16364 lines
599 KiB
JavaScript
16364 lines
599 KiB
JavaScript
/*!
|
|
* FormCreate商业版可视化表单设计器-让表单设计更简单
|
|
* fc-designer-pro v5.7.0
|
|
* (c) 2018-2025 FormCreate Team https://form-create.com/
|
|
* license 仅限于被授权主体（个人、企业或组织）使用
|
|
*/
|
|
(function(){"use strict";try{if(typeof document!="undefined"){var e=document.createElement("style");e.appendChild(document.createTextNode('._fc-step-form{width:100%}._fc-step-form .van-step{line-height:1.4;text-align:left}._fc-popup.van-popup{display:flex;height:100%;padding-bottom:110px;padding-top:50px}._fc-popup-title{color:#333;font-size:16px;left:0;position:absolute;text-align:center;top:16px;width:100%}._fc-popup-content{display:flex;flex:1;overflow:auto}._fc-popup-footer{bottom:0;left:0;padding:10px;position:absolute;right:0}._fc-data-table{width:100%}._fc-data-table .el-table{--el-table-header-bg-color:#e8eefc}._fc-data-table .el-pagination{display:flex;margin-top:10px}._fc-data-table .el-pagination.left{justify-content:flex-start}._fc-data-table .el-pagination.center{justify-content:center}._fc-data-table .el-pagination.right{justify-content:flex-end}._fc-data-table ._fc-data-table-img-list .el-image{height:60px;max-width:150px}._fc-table{overflow:auto}._fc-table>table{border-bottom:1px solid #ebeef5;border-right:1px solid #ebeef5;border-color:#ebeef5 currentcolor currentcolor #ebeef5;border-style:solid none none solid;border-width:1px 0 0 1px;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fc-table td,._fc-table tr{min-height:50px}._fc-table td{border-bottom:0;border-right:0;border-color:currentcolor #ebeef5 #ebeef5 currentcolor;border-style:none solid solid none;border-width:0 1px 1px 0;box-sizing:border-box;min-width:80px;overflow:hidden;overflow-wrap:break-word;padding:5px;position:relative}._fc-table.is-mini td{min-height:12px;padding:0}._fc-table.is-mini .el-form-item{margin:0;padding:0}._fc-table-form{color:var(--fc-text-color-2);overflow:auto}._fc-table-form .form-create td .el-form-item{margin-bottom:1px}._fc-table-form .form-create td .el-form-item.is-error{margin-bottom:22px}._fc-table-form .el-form-item__label,._fc-table-form .van-field__label{display:none!important}._fc-table-form .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fc-tf-head-idx,._fc-tf-idx{font-weight:500;min-width:40px;text-align:center;width:40px}._fc-tf-btn,._fc-tf-edit{min-width:70px;text-align:center;width:70px}._fc-tf-btn .fc-icon{cursor:pointer}._fc-table-form._fc-disabled ._fc-tf-btn .fc-icon,._fc-table-form._fc-disabled>.el-button{cursor:not-allowed}._fc-tf-table{border:1px solid #ebeef5;border-bottom:0;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fc-table-form ._fc-tf-table>thead>tr>th{border:0;border-bottom:1px solid #ebeef5;font-weight:500;height:40px}._fc-table-form ._fc-tf-table>thead>tr>th+th{border-left:1px solid #ebeef5}._fc-table-form tr{min-height:50px}._fc-table-form ._fc-read-view{text-align:center;width:100%}._fc-table-form td{border:0;border-bottom:1px solid #ebeef5;box-sizing:border-box;min-height:50px;min-width:80px;overflow:hidden;overflow-wrap:break-word;padding:5px;position:relative}._fc-table-form td+td{border-left:1px solid #ebeef5}._fc-tf-table .el-cascader,._fc-tf-table .el-date-editor,._fc-tf-table .el-input-number,._fc-tf-table .el-select,._fc-tf-table .el-slider{width:100%}._fc-tf-head-required:before{color:#f56c6c;content:"*";margin-right:4px}._fc-table-form-v2{color:var(--fc-text-color-2);overflow:auto;width:100%}._fc-table-form-v2 .is-required:before{color:#f56c6c;content:"*";margin-right:4px}._fc-table-form-v2 .form-create td .el-form-item{margin-bottom:1px}._fc-table-form-v2 .form-create td .el-form-item.is-error{margin-bottom:22px}._fc-table-form-v2 .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fc-table-form-v2 .el-form-item__label{display:none!important}._fc-tf-pro-handle{align-items:center;display:flex;flex-direction:row;justify-content:space-between;margin-top:12px}._fc-table-form-v2 .el-cascader,._fc-table-form-v2 .el-date-editor,._fc-table-form-v2 .el-input-number,._fc-table-form-v2 .el-select,._fc-table-form-v2 .el-slider{width:100%}._fc-infinite-table-form{color:var(--fc-text-color-2);overflow:auto}._fc-infinite-table-form .form-create .el-form-item{margin-bottom:1px}._fc-infinite-table-form .form-create .el-form-item.is-error{margin-bottom:22px}._fc-infinite-table-form .el-form-item__label,._fc-infinite-table-form .van-field__label{display:none!important}._fc-infinite-table-form .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fc-itf-table ._fc-itf-head-idx,._fc-itf-table ._fc-itf-idx{font-weight:500;min-width:40px;padding:0;text-align:center;width:40px}._fc-itf-idx div{border:1px solid #bfbfbf;border-radius:6px;cursor:pointer;display:inline-flex;height:18px;justify-content:center;line-height:16px;width:18px}._fc-itf-sub-idx{width:30px}._fc-itf-btn,._fc-itf-edit{min-width:70px;text-align:center;width:70px}._fc-itf-btn .fc-icon{cursor:pointer}._fc-infinite-table-form._fc-disabled ._fc-itf-btn .fc-icon,._fc-infinite-table-form._fc-disabled>.el-button{cursor:not-allowed}._fc-itf-table{border:1px solid #ebeef5;border-bottom:0;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fc-itf-table>thead>tr>th{border:0;border-bottom:1px solid #ebeef5;font-weight:500;height:40px}._fc-itf-table ._fc-itf-table>thead{display:none}._fc-itf-table ._fc-itf-table{border-right:0}._fc-itf-table>thead>tr>th+th{border-left:1px solid #ebeef5}._fc-itf-table tr{min-height:50px}._fc-itf-table ._fc-read-view{text-align:center;width:100%}._fc-itf-table td{border:0;border-bottom:1px solid #ebeef5;box-sizing:border-box;min-height:50px;min-width:80px;overflow:hidden;overflow-wrap:break-word;padding:10px;position:relative}._fc-itf-table td+td{border-left:1px solid #ebeef5}._fc-itf-table .el-cascader,._fc-itf-table .el-date-editor,._fc-itf-table .el-input-number,._fc-itf-table .el-select,._fc-itf-table .el-slider{width:100%}._fc-infinite-table-form ._fc-itf-sub{padding:5px 0 5px 10px}._fc-itf-sub ._fc-table-form{background-color:var(--fc-bg-color-1)}._fc-itf-sub ._fc-tf-table{border:0}._fc-itf-idx+._fc-itf-idx,._fc-itf-sub-idx+._fc-itf-head-idx{border-left:0}._fc-itf-head-required:before{color:#f56c6c;content:"*";margin-right:4px}._fc-nested-table-form{color:var(--fc-text-color-2);overflow:auto}._fc-nested-table-form .form-create .el-form-item{margin-bottom:1px}._fc-nested-table-form .form-create .el-form-item.is-error{margin-bottom:22px}._fc-nested-table-form .el-form-item__label,._fc-nested-table-form .van-field__label{display:none!important}._fc-nested-table-form .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fc-ntf-table ._fc-ntf-head-idx,._fc-ntf-table ._fc-ntf-idx{font-weight:500;min-width:40px;padding:0;text-align:center;width:40px}._fc-ntf-idx div{border:1px solid #bfbfbf;border-radius:6px;cursor:pointer;display:inline-flex;height:18px;justify-content:center;line-height:16px;width:18px}._fc-ntf-sub-idx{width:30px}._fc-ntf-btn,._fc-ntf-edit{min-width:70px;text-align:center;width:70px}._fc-ntf-btn .fc-icon{cursor:pointer}._fc-nested-table-form._fc-disabled ._fc-ntf-btn .fc-icon,._fc-nested-table-form._fc-disabled>.el-button{cursor:not-allowed}._fc-ntf-table{border:1px solid #ebeef5;border-bottom:0;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fc-ntf-table>thead>tr>th{border:0;border-bottom:1px solid #ebeef5;font-weight:500;height:40px}._fc-ntf-table>thead>tr>th+th{border-left:1px solid #ebeef5}._fc-ntf-table tr{min-height:50px}._fc-ntf-table ._fc-read-view{text-align:center;width:100%}._fc-ntf-table td{border:0;border-bottom:1px solid #ebeef5;box-sizing:border-box;min-height:50px;min-width:80px;overflow:hidden;overflow-wrap:break-word;padding:10px;position:relative}._fc-ntf-table td+td{border-left:1px solid #ebeef5}._fc-ntf-table .el-cascader,._fc-ntf-table .el-date-editor,._fc-ntf-table .el-input-number,._fc-ntf-table .el-select,._fc-ntf-table .el-slider{width:100%}._fc-nested-table-form ._fc-ntf-sub{background-color:#fafafa}._fc-ntf-sub ._fc-table-form{background-color:var(--fc-bg-color-1)}._fc-ntf-sub ._fc-tf-table{border:0}._fc-ntf-idx+._fc-ntf-idx,._fc-ntf-sub-idx+._fc-ntf-head-idx{border-left:0}._fc-ntf-head-required:before{color:#f56c6c;content:"*";margin-right:4px}._fc-cell{display:inline-block}._fc-cell .el-cascader,._fc-cell .el-date-editor,._fc-cell .el-input-number,._fc-cell .el-select,._fc-cell .el-slider,._fc-city-m{width:100%}._fc-city-m .van-cell{padding:0}._fc-line-form{align-items:flex-start;display:flex;flex-flow:wrap;width:100%}.form-create-m ._fc-line-form{display:flex;flex-wrap:wrap}.form-create ._fc-line-form ._fc-line-form,.form-create ._fc-line-form ._fd-drag-item,.form-create ._fc-line-form ._fd-drag-tool,.form-create ._fc-line-form .el-col-24{display:inline-flex;flex:initial;flex:unset!important;flex-wrap:wrap;max-width:100%;width:auto!important}._fc-m-con .form-create ._fc-line-form>.el-col-24{width:100%!important}._fc-line-form .el-form-item{display:inline-flex;vertical-align:middle}._fc-line-form .el-select,._fc-line-form .el-slider{width:220px}._fc-echarts{height:300px;width:100%}._fc-m-signature{width:100%}._fc-m-signature-btn,._fc-m-signature-preview{background:#fff;border:1px dashed #d4d7e0;border-radius:4px;box-sizing:border-box;color:#c9ccd8;font-size:14px;height:88px;line-height:88px;min-width:160px;position:relative;text-align:center;width:100%}._fc-m-signature-btn{cursor:pointer}._fc-m-signature-preview>img{display:inline-block;height:88px}._fc-m-signature-preview .icon-delete2{cursor:pointer;display:inline-block;font-size:14px;line-height:14px;position:absolute;right:9px;top:9px}._fc-m-signature-btn i{font-size:14px}._fc-m-signature-dialog .van-dialog__header{padding:15px 0;position:relative}._fc-m-signature-dialog .icon-add2{color:var(--fc-text-color-3);display:inline-block;position:absolute;right:18px;transform:rotate(45deg)}._fc-m-signature-pad{background-image:linear-gradient(#fff 14px,transparent 0),linear-gradient(90deg,#fff 14px,#d4d7e0 0);background-size:15px 15px;border:1px dashed #d4d7e0;border-radius:4px;box-sizing:border-box;width:100%}._fc-title{font-size:16px;font-weight:600;margin-bottom:16px;margin-top:1em;width:100%}._fc-title.h1,._fc-title.h2{border-bottom:1px solid #eee;padding-bottom:.3em}._fc-title.h1{font-size:32px;line-height:1.2}._fc-title.h2{font-size:24px;line-height:1.225}._fc-title.h3{font-size:20px;line-height:1.43}._fc-title.h4{font-size:16px}._fc-title.h5{font-size:14px}._fc-title.h6{font-size:12px}._fc-markdown{-ms-text-size-adjust:100%;-webkit-text-size-adjust:100%;word-wrap:break-word;color-scheme:light;font-size:16px;line-height:1.5;margin:0;width:100%}._fc-markdown details,._fc-markdown figcaption,._fc-markdown figure{display:block}._fc-markdown summary{display:list-item}._fc-markdown [hidden]{display:none!important}._fc-markdown a{background-color:transparent;color:#0969da;text-decoration:none}._fc-markdown abbr[title]{border-bottom:none;-webkit-text-decoration:underline dotted;text-decoration:underline dotted}._fc-markdown b,._fc-markdown strong{font-weight:600}._fc-markdown dfn{font-style:italic}._fc-markdown h1{border-bottom:1px solid #d1d9e0b3;font-size:2em;font-weight:600;margin:.67em 0;padding-bottom:.3em}._fc-markdown mark{background-color:#fff8c5;color:#1f2328}._fc-markdown small{font-size:90%}._fc-markdown sub,._fc-markdown sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}._fc-markdown sub{bottom:-.25em}._fc-markdown sup{top:-.5em}._fc-markdown img{border-style:none;box-sizing:content-box;max-width:100%}._fc-markdown code,._fc-markdown kbd,._fc-markdown pre,._fc-markdown samp{font-family:monospace;font-size:1em}._fc-markdown figure{margin:1em 2.5rem}._fc-markdown hr{background:transparent;background-color:#d1d9e0;border:0;box-sizing:content-box;height:.25em;margin:1.5rem 0;overflow:hidden;padding:0}._fc-markdown input{font:inherit;font-family:inherit;font-size:inherit;line-height:inherit;margin:0;overflow:visible}._fc-markdown [type=button],._fc-markdown [type=reset],._fc-markdown [type=submit]{-webkit-appearance:button;appearance:button}._fc-markdown [type=checkbox],._fc-markdown [type=radio]{box-sizing:border-box;padding:0}._fc-markdown [type=number]::-webkit-inner-spin-button,._fc-markdown [type=number]::-webkit-outer-spin-button{height:auto}._fc-markdown [type=search]::-webkit-search-cancel-button,._fc-markdown [type=search]::-webkit-search-decoration{-webkit-appearance:none;appearance:none}._fc-markdown ::-webkit-input-placeholder{color:inherit;opacity:.54}._fc-markdown ::-webkit-file-upload-button{-webkit-appearance:button;appearance:button;font:inherit}._fc-markdown a:hover{text-decoration:underline}._fc-markdown ::placeholder{color:#59636e;opacity:1}._fc-markdown hr:after,._fc-markdown hr:before{content:"";display:table}._fc-markdown hr:after{clear:both}._fc-markdown table{border-collapse:collapse;border-spacing:0;display:block;font-variant:tabular-nums;max-width:100%;overflow:auto;width:max-content}._fc-markdown td,._fc-markdown th{padding:0}._fc-markdown details summary{cursor:pointer}._fc-markdown [role=button]:focus,._fc-markdown a:focus,._fc-markdown input[type=checkbox]:focus,._fc-markdown input[type=radio]:focus{box-shadow:none;outline:2px solid #0969da;outline-offset:-2px}._fc-markdown [role=button]:focus:not(:focus-visible),._fc-markdown a:focus:not(:focus-visible),._fc-markdown input[type=checkbox]:focus:not(:focus-visible),._fc-markdown input[type=radio]:focus:not(:focus-visible){outline:1px solid transparent}._fc-markdown [role=button]:focus-visible,._fc-markdown a:focus-visible,._fc-markdown input[type=checkbox]:focus-visible,._fc-markdown input[type=radio]:focus-visible{box-shadow:none;outline:2px solid #0969da;outline-offset:-2px}._fc-markdown a:not([class]):focus,._fc-markdown a:not([class]):focus-visible,._fc-markdown input[type=checkbox]:focus,._fc-markdown input[type=checkbox]:focus-visible,._fc-markdown input[type=radio]:focus,._fc-markdown input[type=radio]:focus-visible{outline-offset:0}._fc-markdown kbd{background-color:#f6f8fa;border:1px solid #d1d9e0b3;border-radius:6px;box-shadow:inset 0 -1px #d1d9e0b3;color:#1f2328;display:inline-block;font:11px ui-monospace,SFMono-Regular,SF Mono,Menlo,Consolas,Liberation Mono,monospace;line-height:10px;padding:.25rem;vertical-align:middle}._fc-markdown h1,._fc-markdown h2,._fc-markdown h3,._fc-markdown h4,._fc-markdown h5,._fc-markdown h6{font-weight:600;line-height:1.25;margin-bottom:1rem;margin-top:1.5rem}._fc-markdown h2{border-bottom:1px solid #d1d9e0b3;font-size:1.5em;font-weight:600;padding-bottom:.3em}._fc-markdown h3{font-size:1.25em;font-weight:600}._fc-markdown h4{font-size:1em;font-weight:600}._fc-markdown h5{font-size:.875em;font-weight:600}._fc-markdown h6{color:#59636e;font-size:.85em;font-weight:600}._fc-markdown p{margin-bottom:10px;margin-top:0}._fc-markdown blockquote{border-left:.25em solid #d1d9e0;color:#59636e;margin:0;padding:0 1em}._fc-markdown ol,._fc-markdown ul{margin-bottom:0;margin-top:0;padding-left:2em}._fc-markdown ol ol,._fc-markdown ul ol{list-style-type:lower-roman}._fc-markdown ol ol ol,._fc-markdown ol ul ol,._fc-markdown ul ol ol,._fc-markdown ul ul ol{list-style-type:lower-alpha}._fc-markdown dd{margin-left:0}._fc-markdown code,._fc-markdown pre,._fc-markdown samp,._fc-markdown tt{font-family:ui-monospace,SFMono-Regular,SF Mono,Menlo,Consolas,Liberation Mono,monospace;font-size:12px}._fc-markdown pre{word-wrap:normal;margin-bottom:0;margin-top:0}._fc-markdown input::-webkit-inner-spin-button,._fc-markdown input::-webkit-outer-spin-button{appearance:none;margin:0}._fc-markdown:after,._fc-markdown:before{content:"";display:table}._fc-markdown:after{clear:both}._fc-markdown>:first-child{margin-top:0!important}._fc-markdown>:last-child{margin-bottom:0!important}._fc-markdown a:not([href]){color:inherit;text-decoration:none}._fc-markdown blockquote,._fc-markdown details,._fc-markdown dl,._fc-markdown ol,._fc-markdown p,._fc-markdown pre,._fc-markdown table,._fc-markdown ul{margin-bottom:1rem;margin-top:0}._fc-markdown blockquote>:first-child{margin-top:0}._fc-markdown blockquote>:last-child{margin-bottom:0}._fc-markdown h1:hover .anchor,._fc-markdown h2:hover .anchor,._fc-markdown h3:hover .anchor,._fc-markdown h4:hover .anchor,._fc-markdown h5:hover .anchor,._fc-markdown h6:hover .anchor{text-decoration:none}._fc-markdown h1 code,._fc-markdown h1 tt,._fc-markdown h2 code,._fc-markdown h2 tt,._fc-markdown h3 code,._fc-markdown h3 tt,._fc-markdown h4 code,._fc-markdown h4 tt,._fc-markdown h5 code,._fc-markdown h5 tt,._fc-markdown h6 code,._fc-markdown h6 tt{font-size:inherit;padding:0 .2em}._fc-markdown summary h1,._fc-markdown summary h2,._fc-markdown summary h3,._fc-markdown summary h4,._fc-markdown summary h5,._fc-markdown summary h6{display:inline-block}._fc-markdown summary h1,._fc-markdown summary h2{border-bottom:0;padding-bottom:0}._fc-markdown ol.no-list,._fc-markdown ul.no-list{list-style-type:none;padding:0}._fc-markdown ol[type="a s"]{list-style-type:lower-alpha}._fc-markdown ol[type="A s"]{list-style-type:upper-alpha}._fc-markdown ol[type="i s"]{list-style-type:lower-roman}._fc-markdown ol[type="I s"]{list-style-type:upper-roman}._fc-markdown div>ol:not([type]),._fc-markdown ol[type="1"]{list-style-type:decimal}._fc-markdown ol ol,._fc-markdown ol ul,._fc-markdown ul ol,._fc-markdown ul ul{margin-bottom:0;margin-top:0}._fc-markdown li>p{margin-top:1rem}._fc-markdown li+li{margin-top:.25em}._fc-markdown dl{padding:0}._fc-markdown dl dt{font-size:1em;font-style:italic;font-weight:600;margin-top:1rem;padding:0}._fc-markdown dl dd{margin-bottom:1rem;padding:0 1rem}._fc-markdown table th{font-weight:600}._fc-markdown table td,._fc-markdown table th{border:1px solid #d1d9e0;padding:6px 13px}._fc-markdown table td>:last-child{margin-bottom:0}._fc-markdown table tr{background-color:#fff;border-top:1px solid #d1d9e0b3}._fc-markdown table tr:nth-child(2n){background-color:#f6f8fa}._fc-markdown table img{background-color:transparent}._fc-markdown img[align=right]{padding-left:20px}._fc-markdown img[align=left]{padding-right:20px}._fc-markdown .emoji{background-color:transparent;max-width:none;vertical-align:text-top}._fc-markdown span.frame{display:block;overflow:hidden}._fc-markdown span.frame>span{border:1px solid #d1d9e0;display:block;float:left;margin:13px 0 0;overflow:hidden;padding:7px;width:auto}._fc-markdown span.frame span img{display:block;float:left}._fc-markdown span.frame span span{clear:both;color:#1f2328;display:block;padding:5px 0 0}._fc-markdown span.align-center{clear:both;display:block;overflow:hidden}._fc-markdown span.align-center>span{display:block;margin:13px auto 0;overflow:hidden;text-align:center}._fc-markdown span.align-center span img{margin:0 auto;text-align:center}._fc-markdown span.align-right{clear:both;display:block;overflow:hidden}._fc-markdown span.align-right>span{display:block;margin:13px 0 0;overflow:hidden;text-align:right}._fc-markdown span.align-right span img{margin:0;text-align:right}._fc-markdown span.float-left{display:block;float:left;margin-right:13px;overflow:hidden}._fc-markdown span.float-left span{margin:13px 0 0}._fc-markdown span.float-right{display:block;float:right;margin-left:13px;overflow:hidden}._fc-markdown span.float-right>span{display:block;margin:13px auto 0;overflow:hidden;text-align:right}._fc-markdown code,._fc-markdown tt{background-color:#818b981f;border-radius:6px;font-size:85%;margin:0;padding:.2em .4em;white-space:break-spaces}._fc-markdown code br,._fc-markdown tt br{display:none}._fc-markdown del code{text-decoration:inherit}._fc-markdown samp{font-size:85%}._fc-markdown pre code{font-size:100%}._fc-markdown pre>code{background:transparent;border:0;margin:0;padding:0;white-space:pre;word-break:normal}._fc-markdown .highlight{margin-bottom:1rem}._fc-markdown .highlight pre{margin-bottom:0;word-break:normal}._fc-markdown .highlight pre,._fc-markdown pre{background-color:#f6f8fa;border-radius:6px;color:#1f2328;font-size:85%;line-height:1.45;overflow:auto;padding:1rem}._fc-markdown pre code,._fc-markdown pre tt{word-wrap:normal;background-color:transparent;border:0;display:inline;line-height:inherit;margin:0;max-width:auto;overflow:visible;padding:0}._fc-markdown [data-footnote-ref]:before{content:"["}._fc-markdown [data-footnote-ref]:after{content:"]"}._fc-markdown [role=button]:focus:not(:focus-visible),._fc-markdown [role=tabpanel][tabindex="0"]:focus:not(:focus-visible),._fc-markdown a:focus:not(:focus-visible),._fc-markdown button:focus:not(:focus-visible),._fc-markdown summary:focus:not(:focus-visible){box-shadow:none;outline:none}._fc-markdown [tabindex="0"]:focus:not(:focus-visible),._fc-markdown details-dialog:focus:not(:focus-visible){outline:none}._fc-markdown g-emoji{display:inline-block;font-family:Apple Color Emoji,Segoe UI Emoji,Segoe UI Symbol;font-size:1em;font-style:normal!important;font-weight:400;line-height:1;min-width:1ch;vertical-align:-.075em}._fc-markdown g-emoji img{height:1em;width:1em}._fc-markdown .task-list-item{list-style-type:none}._fc-markdown .task-list-item label{font-weight:400}._fc-markdown .task-list-item.enabled label{cursor:pointer}._fc-markdown .task-list-item+.task-list-item{margin-top:.25rem}._fc-markdown .task-list-item .handle{display:none}._fc-markdown .task-list-item-checkbox{margin:0 .2em .25em -1.4em;vertical-align:middle}._fc-markdown ul:dir(rtl) .task-list-item-checkbox{margin:0 -1.6em .25em .2em}._fc-markdown ol:dir(rtl) .task-list-item-checkbox{margin:0 -1.6em .25em .2em}._fc-dialog .el-dialog__headerbtn{align-items:center;color:var(--el-color-info);display:flex;justify-content:center}._fc-dialog .el-dialog__headerbtn:hover .fc-icon{color:var(--el-color-primary)}._fc-data-select-pop{display:none!important}._fc-data-select,._fc-iframe-box,._fc-video-box{width:100%}.form-create-m .van-checkbox--horizontal,.form-create-m .van-radio--horizontal{margin-bottom:5px}.form-create-m .el-input__wrapper,.form-create-m .el-select__wrapper{border-radius:0;box-shadow:none;padding-right:0}.form-create-m .el-input__wrapper:before,.form-create-m .el-select__wrapper:before{border-bottom:1px solid var(--van-cell-border-color);bottom:0;box-sizing:border-box;content:" ";left:var(--van-padding-md);pointer-events:none;position:absolute;right:var(--van-padding-md);transform:scaleY(.5)}.form-create-m .el-select__suffix{display:none}.form-create-m .el-input__wrapper:after,.form-create-m .el-select__wrapper:after{color:var(--van-cell-right-icon-color);content:"\\e660";font:normal normal normal 14px/1 var(--van-icon-font-family,"vant-icon")}.form-create-m .el-date-editor.el-input,.form-create-m .el-date-editor.el-input__wrapper,.form-create-m .el-tree{width:100%}.form-create-m .el-upload--picture-card,.form-create-m .el-upload-list{--el-upload-list-picture-card-size:64px;--el-upload-picture-card-size:64px}.form-create-m.is-preview ._fc-upload .el-icon--close,.form-create-m.is-preview ._fc-upload .el-icon--close-tip,.form-create-m.is-preview ._fc-upload .el-upload{display:none!important}@font-face{font-family:fc-icon;src:url(data:font/woff;base64,d09GRgABAAAAAFEEAAsAAAAAoPAAAQAAAAAAAAAAAAAAAAAAAAAAAAAAAABHU1VCAAABCAAAADsAAABUIIslek9TLzIAAAFEAAAARAAAAGA8FUuIY21hcAAAAYgAAAP7AAAKGJ2RrB1nbHlmAAAFhAAAQ/kAAIgow5ZWYGhlYWQAAEmAAAAALwAAADYrnfY1aGhlYQAASbAAAAAeAAAAJAfeBJ5obXR4AABJ0AAAAF0AAAJ4jxAAAGxvY2EAAEowAAABPgAAAT5fhjx4bWF4cAAAS3AAAAAfAAAAIAHCAPxuYW1lAABLkAAAAUUAAAJb1Yvg7HBvc3QAAEzYAAAELAAABq340wMHeJxjYGRgYOBiMGCwY2BycfMJYeDLSSzJY5BiYGGAAJA8MpsxJzM9kYEDxgPKsYBpDiBmg4gCACY7BUgAeJxjYGFRZZzAwMrAwNTJdIaBgaEfQjO+ZjBi5ACKMrAyM2AFAWmuKQwHnjG8mMzc8L+BgYH5DgOQZGBEUcQEAICVDRp4nO3WZXOVVxiF4fsAhUpq1N3d3agBJQ3u7u7u7u7BIfVSo+7u7u58XMO/oGtndforemauTN53MnNmdp61ng0cAjS0y60RNNhHxb9R2eu3lfr3DTm8/n2jymw/V3EoDWgk1FLV2n+g9uBB8FNztVJNnv77VPzXVRxD00qz+m8Zx3gmMJFJTGaKv3kq05jODGYyi9nMYS7zmM8CFrKIxSxhKctYzgpWsorVnMsazmMt61jPBjayic3Ucg7ncwFb2MqFnM02LmI7O9jJLnazhzqu5Cqu5hrO4Fqu42Ku5wZu5CZu5hZu5RJuoxm3cwd3chd3cynNaUFL7qEV1dxLDa1pQ1va0Z4OdKQTl9GZLj6VrnSjOz3oSS9604e+9KM/AxjIIAYzhKEMYzgjGMkVjGI0YxjLWZzJyZzCqZzG6ZzECZxIE47jeJ/pYT7lxhzh8zqSozjap3YsTctJl/9CpTH/f6rKjyZj/32qK1MXZX7VPDxjqEV42jyl4blDrcITiKrDs4hqwlOJWofnE7WJkhG1Dc8saheeXtQ+PMeoQ3iiUcfwbKNO4SlHncPzjrqEJx91DWcAdQunAXUP5wL1CCcE9QxnBfUKpwb1DucH9QknCfUNZwr1C6cL9Q/nDA0IJw4NDGcPDQqnEA0O5xENCScTDQ1nFA0LpxUND+cWjQgnGI0MZxmNCqcajQ7nG40JJx2NDWcejQunH40P9wCaEG4ENDHcDWhSuCXQ5HBfoCnh5kBTwx2CpoXbBE0P9wqaEW4YNDPcNWhWuHXQ7HD/oDnhJkJzw52E5kX9DM8P9xRaEG4stDDcXWhRuMXQ4nCfoSXhZkNLwx2HloXbDi0P9x5aEW5AtDLchWhVuBXR6nA/ojXhpkRrw52J1oXbE60P9yjaEG5UtDHcrWhTuGXR5nDfotpw86It4Q5GW8NtjLYFJd/bg5LvHUHJ985wa6NdQcn67qBkfU+401FdUHJ/X1Byf39Qcv9AUHL/YFBy/1BQcv9wUHL/SFBy/2hQcr83vDfQY0HpgMeD0gFPRNnBejIoffBUUPpgX1D64Omg9MEzQemDZ4PSB88FpQ+eD0ofvBCUPngxKH3wUlD64OWg9MErQemDV4PSB68FpQ9eD0ofvBGUPngzKH3wVlD64O2g9ME7QemDd8MbE70XlG54Pyjd8EFQuuHDoHTDR+Ediz4Ob1v0SXjvok/DGxh9Ft7F6PPwVkZfhPcz+jK8qdFX4Z2Nvg5vb/RNeI+jb8MbHX0X3u3o+/CWRz+E9z36Mcr9Sj+F7wDo5/BtAP0SZfvp1/ANAf0Wviug38O3BvRH+P6A/gzfJNBf4TsF+jt8u0D7o9z9DtQGlX8AZj1A2gB4nL29CWAbxdkwvDOr1UoraXWuVrJ1ryXZli1bt287sU3iXE6AhBzk5ko4c5T7PgqlXC2EQikBCg3QchYCoQVajtK3tNCWu/SjLUc52r6F9oWWt402/zOzK1ly4tjt1/+zR3PP7M75nDPLGBj4Y6/ATzNuRmF6mHGGQdkQkpweESnRWBoVnPkBlOOiMSPEeXPRbBFiElwYDaKc7OSVZMGOlA4kgc9Zime9QYj22pEx1oESxV5UyBfx35tHm8GoLs1Ff1ZdSiajoD+DrY7whx/Kt5tMnXyBb4Zfp8mEzhVdPmRgi4jDRcyyXjd+qnmkWd0FFhi0EqyhjKLuorWsVDJLuSef5EzqsybTHWcaDGfeAVX0mZBb/AixhmGMh7HxI9HNMDaG2fcpewVrZTxME3MIM4c5jDmcWcesZ05kTmLOZM5iLp3Uenzg1iezIRxESiGfUPSUXiQpenacc/eirJTxpFCskMkXagOlXIYElAwJ9KKpAmxLQ7qxMd2gDnuaAnbwoyfUYbvHY0dPiB7P7SRyyGNXhyEgZrPueKPD0Rh3Px75KELMLcRcF41EokdG4G8V8eHToBZ1GCySEz0BlVdrQE/YPa+S6GyWBMmThuyBJg96gtRc/jmp5DJi3Rmp+YNpY6j2J8vwjIWxM4w7KtF/5FTo/3bWt/dD8sPrL7jrAryUWOu1GNZHpp4AdbzJXs4mmCRTYIrMIMzAiVGhoxFE8I4pVMhli/1I63KI0rscQRSMkAyDUYTh8ZJhiSLF480W84mYUc56YXiMUCYBY1OEkXRG4zAiUAGMCJSVagNsJJgJBDJBRXFIkqP8Q2IrihZ37EjYi67xhkfUq9CufKgtHG4L2b3hsFc9hdjoAojfqj7je8NXNXh1IBP4EH4jXvuHdi+1RvSowZdJqZefUf8MLlR2NFT0LK2ozxseVd97w8f5wBylOQxjrva1zMSZDqaT6WP6mTFmHrMMekmCPuHpBJWi1WkIfYfJTMZK1Enarc1dvnY+SlMGMKO+bnNj6PkW9fXKDMOHVnzqLrRSfR81wIT5TeS4yCSD3h1y2tSXRM8sOttayIRFLcRfvo/UwPpmlTfDix0qeq4mc+kbVYvOqTfYU9lmxspITB7WKINiIvKEUHYA5dOIjyXyxazXY2RjIpY8shf+S8Xa/0I+jdlEEv4LMDPIavbwRt6Ig6mxVGpsGbFSsHEcAnvH6Lnr8yuGjskl7C4p0BgNKYGI3GCz59efN5LPzGktzDnrq2fOLbbM7cQnpeYeMdbaOnbE3NT/ZEezYNC9hXXnjV520erFLV6z1e6RAyElnkplssUSVFso80p6ZGztuvnnzpt37vx1a8dG0kxDdQztsNt6mAiMYh5m/SxmCbMUxnEDs5E5mTmFOZs5h/kSczlzPfM15nbmDuYB5kHmCbIW6ueyrEi5ZO30jU+XYfoayBRw0ingzPfiiYRaP19boq64uzZQWwR92xMMetS9UjAoffb++9cLeQEMXkrC6l6SBrE7hJwARv30QHlRRGgTwFxbcdoFMNcKPxTAXCv8QABTn8ZaK3UjgxScVanoKweMVX9XeSQyeIJDlXf5iqDeKwjoMEF7gGa+qtX/Ve1p6ntCSagaxlgdYwJPm2CEe5iRGcJUAhycFAQ481EoQLc9p6w4c9rcPyggLZdD8IesxZVFMNdcs3RpfCgeH2KtdQXAmgWQs1rskpD6AJRaHCqsOmFVAV3Rp/4pPrhgMF6z35B2JJlmfabOZhbNsDWwFc0Q3B28XWfiN8rNK+PwdxaxzibWNK26b2hPvOaPqYNVpD1dMx0TXjZ6w4hPJHkRJ9N4AHll3hgCt1RMI+NBX/znJSEZx/Z8pNeS7gslslzz3AUNN3Bmfyzm44yN+fQ0jdguJkYsqCS2vRVsEU1C36LhsCM42xnzm81+Z0NabKCwU2uTBDAhwWSZHMDPIWYB7CRbD4TJ4P3ah6ZEVeoCiCI8dD5CVRWQW4HDGlzG1wFSQbGMCpAgWEsFwfCoX4h8GCFmJzVriMFOkhWKPUcgRGN743PPiZIkPgeFJiMsdTgPqVB9iOA1Z0Wi0chZBHKgNpLxOaiE4C7PQcFZHrFSHVPTV5V1mQH4OQDw8whm1b+xPukErgRkSIGugAB0hOz1EPQ3kR9ExSyXk5Rplm0wFAp+GAoGQ7cTX9ZkGjT5nMRSL7333pku34q7I/h4KPR40GTym4ZMTp950OzpY3QcnyULwQpQB9wSNIqsvygd3WI2jLweHhnhxdMY3rtkRnwJbYngX0ci5XgE/dOq2C6xWtWzzdZbBY/diPxYQLer17jPQCePkd7HP7dav2hTrOo5JjaKjaLbcpdoRiPqdRf40Unk8Rz0/1/ZL7M2Jga9vhB2kSMAWyTwqFQM4xJAo1JOg07wDh2INyaSBEShCSgP63AyiK8B8Mkqyvd1m/tOUTT880WHlbO5BdPHDsc/fiyGWDf6QmpJf9TrUQJNjQGvHGiIBxS3HB1Y3FZqGUqNLZ+XGmrpmpcaaGsbSKF33Tb1kZWANly/CVmsLuwS1bfNdu4Mk/n6E0x2J4fOt7lRa6x/SapUSKdiEdltt7vlSKytvVCCx8TU1kR2/LD2BW1tC9oPG89+P5wiFWv9oM1DMhYKrNgFk0dDR9sOtmy5ASR7s6UBFMKA2sSSsBfxIkqjTyLod5GICuPRra8sDeHSkLfyfWTxEKzLU/6v3qtGs6uKBrvDZsTcnBtGYl35AC9LxgJZUfh1iuQNQwUTlMAsjTbQqJC/bkQb5o4ZeWy2O4zr12fCoU6L0eYDOkCjJ9/T4UYKcNUcU5rpCnMq7km/g6+e/z311JsXLz4tkxnPZtPz5uH3CJ24WacTryd0Yjambqb5r49l16jb0RX1v/1hQxLed8YQjpM8XlgveSB2Dw4NyisJzYMGfJZbBOEWi2+6hT3r/NdsNtPxRp/xeJNNXz9vsruATvLA+s0yvcxc8pZkXVD0NkYQ3jxZHLKOLhN/nsTyGioB7YBWyDGjtlDYoldW0gjoBmUAYWbbhrVdPT1daze8X/FsW3vHmjV3/ODQxR2dnR2LD12XIvjvMmKlkl1di7q6ksc+2rskd/n1l+eW9D7KJuoKU8/omjuevGMNKfxDUktXamwpwb7BGiqNl8Cov0brDu/q6+s6fB0ZB0znTj9+gq4Nxk1WhZOuCmf+2Z2ob+dO9dmd+HFikxAdt3fwMWyIIfSRwHihRyYov9rdGgfGUn0pMA2kMfjVEPGnnu9U/Z2d6INOKI9o/66F/m2g/Yq8Iu5AsB0RVJmsLVwsoSJmZAdqsaNQyvELoNp+IQQCHt4kAG3DJpzq645UCNl/Wb6Z0HF44y8FE+8JBCDVqdX/Eh0/OruATvUYAZgCMdML61ZkAafAJaBhByGNF1lANVivDGF2HVmzvyHW5bmrbvzi4VLnCVd//YLFvNPGiRIyrfn69+67qN931G177hmU2ISWNeDp6bYsPP9r156Ydx164ULW6kHIa1+98xhf34UPPnrTOnH4kCsAKLK0v2/H/8WYoL8d8F5srhSVc6zCunNu5Mw50UX/3NaL3L3b/nFm27GGY5F4Av5xeesd38LXqCeisPo2+mp5K76K0cYL6tqGf0T9NsYP/ZigaykPGMks2PEZdy1x4axDL/6NlCs7juwAo2xXwCDv1CH8ow51bTqNbusoP67AHx45eJghPTFNWxYxKwFrOPZgbfrPplzZkYa/DmVUAfOTNIQ60gcMpDsgqAX+1Ybv1xGmKfuhvt3R2kAdRhmtb8MHHWCgfuqqa5V9Chh0m+ZOvG79a2hjYtjvXer3B2ctCL2yA1/W0VE+vUPBtypKed1+XVGZr1vxrw8+X6sUrLOOjv43Uq7ObMxmN2Y0G4nZDdmqgVAlAWz8Zua3GTDqlZqLth08TGEDtOUd/AiFX+2A1x4xQwgmIl4qlqScU2cdkB1J4wwAXMgBcqUBFx5204JCiB6AG0sTsxJgyjsSs+LxWQl8fHkHbKchfDzY5Q8dCW+yIY3u80WjvrflaFT+QrIDNSNvSnJYvK02P7rrNNM8m68d74ay6n1aHehQcIdTIfU+UhM6NJQ62iEb2y3yO6ihKyqr75OKUIMcnZdrCQbdzS6LIwAIiuLKiA2DLfrc+EBv/2LmyJliG4BqSp4chPIKAYu5bEk2KjECSCmLSYkVSBB24azMA0Tx6BxIduVBukAdSrgRNjlCJ+XnLip1SLFcd6Rfzm68eMlQRGoINjSlB6wtdj9q8Phc03TCt441WVhLOnTMrJOGHI2Nspy++MiFx4yG/K2BppLPEXSnkk6D6KS0+pPsn9hhoANbmFFmKbOa2cKczZzHfFnnDUpV3qDeF9Fq/2QKWm8omSRpcwq2fc3VYJNTIW6O1SAW4RxBDxDOEZ8r5eRcSZFyxdIALuQTScqj0NENmDIpVEjKSimb04JJpYC/oS6nbbtLXa71ID5eazuJ9RIOaVMTsW+wS5K9tZXY42QiqY+TCbA2eUjCPuZoXjV3ICbYJKvbYRUtTsEh++0mwWR0x3b4Mz9xc2bBarbZfHi33pfDlb6t9PWw1ru/kMJSWQQLDP4rWOoHUflteJz8jhxd9Ehr6yOPIITsXpvdb+Akn9uK8bGc1WlFqLNveBxZHOBDLRUe9n+zV7NuphHoygHA6I9iToIROAv6/2oK7WVAE+UoXWMiTkaNFK8vUhKasG2BCEElIleIQgcCEs4rRJxSAFOKhhGvdCDFjpTkIIpmKbpnR4Qa0tZmCkEuwsjzErookeTpmGQp7ueeNGoEY0V3ukMstCLX2k1Q+/IdhLLuaXnxRasLovFRFjd2WNUfxjJshOP6uHb4cajHsJDLGGxjNq6DW8ghQ8olWFgDNhgNBrNgD9idGzhufabTYrZK/y21/CTVaRGMJusVTll2qq8RGzWqnyIr6w5Il8IDulvV0ylPGJFXwOtaemY7reVvWNwsgl69EnKwWeUZLsHdy4FJcOwbvKGlxcC/wfrtraKBRayB48QWp8/Icm9wF3Ugg9FpM/cNHZHgDF5IflB2rnX4fI61Trk0i+71gNs9BbjX/ryscYDjJ/7HOVp1EqD4AIJBpCjkIAJSrcTGKCs6Vf4LxalT2F7+S7xQiGM72OVx1rz37+uak8nmi5PNzcmLiG88cl44fF5E/YO5QbjhBt5pt7C8cdUqs4FjE6m5qfInYIHBDrBG8/HyJ/F8Po4d8fxjo8+SSio/9eRwJBJeJrCmM8/iWN7mtBvHxnivhSF0Ww0NNMyMwD66BPaRmcIRSlx4ZQoziE1JjkRSAbqDzMka4CzVBg4uG9xqDkckKRI2z+XlBpmfWx+8I4LWAbF7a6TiTkNTvWi3mhpjDWab3WqzWe02c0Os0WS1W0TRchLhYVyui7V0vPhb+CMmwHRT+QppU4UhS1sU1aipHCxc2BplnVurRKdPVLTEXgRUl+oMmcdNdrPZbho3h2IhU/kDLYT9ptArrqAZ5bWw+jNzUAkRRzSDgejQr6EsjmjJ5d+R0uY5WmiOOYQ/ctrNdviJLpdIPXYgT5x2k90FP2fVo75RTa4W0ObCm+wL+62X/8AqYZX0ovb2RWnVmF6YBoPU8r7m7u5mjMAuH8aye8vrqrN+5nOb0fnud+uySBNQyRITJTiiU0HkNyW++tVMBv8+my3fq2FfqE3DyVirLre8KKNuz2TQFZmKS+nUff9gf4g/h/lBOBtkMw4hEScmCEad/ycjuvMOaGLMaKHiI1wu7OYspsuNHGdzuvhxT0AaF4Ie4XLBrl4keswOl8OMnzE73HYBKD38OcL85bwLvJxxsXopZYKesVjwBIUvWVCZ9dghqxnMbbdp7jM2IPn0uQz9skvnNwUmYc0cFQ/Gk1wWQLjz6uvQyuuuU3ddx8rh0lhSPQWhr0jNYSdr3QGRkLjjOXV7cqwURiuQM9wsoSu0vniT/SHMlQ5thtRzJAoEh9DwCcrDo+w7KpyD+QCIBU8glAydhzoQleUWccPWjRoTYePvN6zr6vaIJ5PWzjcX84ce/v1FC1rbjJmO8SVrREkyip4dNqvQYLvLInomMSC2UTJ4zYJ5zS3WfHbxoY+PL2pPe4Keb3vE3xU5f6OV62fdls8Ja5j20ZvsL6ENPiYGex/j1tCl3CR8yY+SVPYM45igCFF1T5DIsPej6tqGZj/f1Ywsn6kGbb6jf8Bk3wVzvQs/3d0rerYLZJiE7fCO27UR2+5BH6lXx/OjlblO5v7HaOvn+fjKlfG8utkjbiezQthOugPKwwTZTl9fn/tP6GNMaJkgmftTz/l4ZVU4dHLkbG3yq/5sFr8PC+K0yZN+h7YatPH+jH2WRfCULMPEc0XC/krE7MhJuC6SMwm2B5ATbtLML2q4CK9gr9HCXy54AsK4FPAsFgJk0qtftXsEu5vMeegSh437CzZdTpLG0emEh69eNk5KXC7s9YjPaH13662EF/mM1UPZRu4q/LIxMpMGLGyQmQ+Y2HJmBXM0czHzFeZmZifzbeY7zKPMHuZZghdTyTgVZ7QgDT8rFtiKoENPqTBfiaCD7HAE/edqAVgdhVuqCgFgA2Q1EiKZINxsoDQ0RDpLNosk2RpiJJZsHNB9OvkxCKsgEZ+ZgJ69YkKejl8vb3ba8DLRE5uG7XurH630+9VdfvSEf6MfzEa/z+dvCieSIZffaUeszcL7XOFEIuzy2Z1Gg9Pml0yikectAB1s1tstViv18Tb1Xv+9Pt+9/lobDX1UeexHH1HtAby7Tiqjs5ErYpkTfX7yeL8v69/o8230q+c297XYLTaErbzB3tzfDMCJM4hmR1pgjZyJNyO7R7R5bYLNYhDm++FvPik9j1gwBywaP4uNMyEmzKSYNqYL4PcocxvzFvM+83FFm2R/vR19kdejKVP2fLxIkG/Cf4e5P0CHkBKSgCOEkCzB7ieJECPCpIJ8ZOhhCsCORwdc2+hg/BPETRYS+VJhAJF6iL5USeYlL2wmfIYniyhDZRsSVXAgG2umVCA7ailTIhznDLw3lE5m9M1WJhOOTLIqjxd/u4VwwBV1G8GBdu/WMCNnBC0EfOmhSOSX1KwlBm2xBgVA6C02i9GAhaC1WbRyCLts2C5hlsWSHdtcGHFWsdkWtCCOs9qsQBhYgrYEyWh0OScyOl1GknG4yZAIIIxRIGGIIiMvJ2WeVwzxIIkLxg2K0SQlvTxfDLe19be1hQRRlESRbWoeafnxj5UsvLZDycwiqNwn0Iz7ibjvAYKiUetynoXXNZhMBgM2s0aZD9kxZ7R5MJZE1hmFt/FghCQbZ8T2EC/zBnhnkptDgoH3ktyOINBv8LYOxQGvDv6gnbWHTCEPslgDKQOy+mzI0Bq0WpAbGTmnk+PdlRS/FUigAEkxcnY7ZxxtGyDinawo2e2SSPZjij9+UI+LIH3XjdZOszq+FYq//DKSXn5ZPUzBL8Vi5bRScfE3y4/jkfLjMUWJ4S8psZjCVHhiL+EfMWZdnwSeQYhMBYjLeNWH6h6xabMUfjmM2jZ5wVGDMdYUi+39PIYTYa96NdriDe8EsvgT7JDC8DT4q8LHH+qyh9JM5Q5UrFginBRdHTBfD9tLPT2ldUTMsHbthJhBfU4ICFvfJqjQPwSy4c9AsKA+LAhb3yHI0P8KUCJQkelo70xwWCKFmhn2ylK2hgWBDWSaBoWrGOgE7plX7753vOXJlvF7t85h50yDqJ6v9m3dip5V//Dcc5RX8An7IDtEZfYtTCtThB4dZtYypzHnz0xmTzBsd63EOVobYOs5d7AL5QoKRbvyiZwGZoqlnERBk+KlzK8EX9k5WJdOmX4c6Wn3+dp7IthZ/jiRh63EqdGmlr2fPU+mH0qTqfhxpht2sVAp4LFG8g67/Zc3CJl2Z6j0fHtfvl1OWnE8nDa3W5fnBnoKjbFodzTKWqB6VQHC19fWG0ZvhXvb/KOFuKoQAhi9FS+cN4oGlM2x2GZFs9WLB3PxREPOZ/XGXc4Wb4s/EnZFF+V6V3Z73FxbX9thq8dGFyeaepVYb5zyYmDCnssK+/F15xJJax13Wp5ZAFGaFnkJPWvRN/ASUXTEC0OfhsOfhgZDu8Ph3aE5oZPC4ZNCszXdQHWnAWgsFrk5syxzf/+nwWMxWM3cyehM9Yv4mVA4HNpNFHYervrwoSZBMJWXWmWzYMHHlm8UBIw5GTaZ/up8/r4+n49mrpyh/gpdqSImoAKwDIqI8FKOcqQAJ2cJoCJMO0Kwy2Q2DCKegCUijid6AEV3lsrdwU+WMVQmeaFcBachRA5BcGDmBDRexgF5Gm83yRKLjKID6EvBZrVYsZErWBzYaR0Z4tsDBqVgYq2yxPM2p0k09A1bYFe2LrGzbq+v0+yENpnsRpvbnO4wY+S2GR3meJOZxmTaTBi5pll+A43+pMkuIJNosvq8nhZekpBo4awudW8wgTCbjlklo0WyeByWzxASBc7qRN3CrEBEfcVsamuzsQi5Gs3FksliFF2s2Nmpx/TkaAzDuHT9iui08qLjmO06BXZA/JGdEjLUrfe6SVyqW/x1eEptypYoOheA/oVRvCpyXjR6XmRfBJ0bjaoXRirubwlYLf8IkiDDrSRwa/SuSOSuKKJqxPjZiuav+pluE0WBrZE9ETDqjSTuyGoAko6MPhqJPBrV5+4n7E2shXHoekp07hKZdA30INsV1fSogSB1rCJx857jj9/z2uqV+WIxv3L1CasWLmhrb29bsHB3xaO+F0Wz4dWehG3m+D2v7tlcLKxY/caRKwvFWe1t8xftXji/LZ1um79w96L5be3qK+QtJ3SQydqqjF+8Rj+IqXuLOhwxXrP6uChh5NJ1h6pyZxiBXG0AHRVDwVhMfTf2WYzlAfD+bwy/A/NVfYbM3Lzq7IiZUD9Qe+8R0HslsdgE2WivIl5U/q0+x6OjapOSY/NxtJVUVqmUuEyFf/O9uvZkKXU+o5bI2haibSA5GqDat1RfbIOCAoqivqd8pmgNUPC7ZEd/Fpb934AgC3o85+mknOfAr36/R1TfpQyMIFU3f1ejf0lI13N4g71Lf/cA4E3dk6WNk0VVChFUA3EZrXC7YWsj2AbZs3YUfloAg+8hIvnnifX973y7/BbGl/FmM18+3cp9zWD4msHEJgrqsfk8urEAaNCxUjgsoRuJHval6Izyuyw7TzDGefM8nmNPZC3sCSzWZaNP4if20yebGZ4xSdH2gH42PBWfGCBy+cF8Af7yL9c5+PFWfTDARX3gjgBwfZYC1754YbCgfl4oIFNhskt55J/iP1IeAtGlIPhkEOgowv3LUH2TGt0KrupjZxiH1s5r60+l+tvQFfPABv/n00bgp0KUMAhrjnor0aFKpcKaA0GNbNAcpooP147JDOWANRyx6foc/Rr6LD7jftbh9kswnx2A7Y0xmyj2rInEiN5Wnu59xsrmBwutWNn+0ojoa1cyFkqUqV6bpyhPk45T2zas27Jl3Ybfb1y7devajVsXXlFolj0eublwxU3g9UqSF7yoKHr0TAhLja6adI84dRKbaPAfcdwR/gbdGW2QXZIrBD+5ocarPuUR81quPGdzYk9gIkfQ8+HBEjWdoH2fwt5shZ40E14rkO9I5pMlfMYDatsD+Nj7l9+/nPhT38XHPHDE/UdU6ZW7YJW2AuZP6BXCYFRyysS496MBTKZGQaqfG3E54+WRMZlJlFARvWlzIZcNPUeIUfSJkkGERW4iQgZHC1Exa8HHyLKsEktGN3nxp8jd4NLo1ozyY5PdZHaY8I91eQQhYkU9O6CTN8k6rrob/+GAeEM9nuCcMlBHTpZqoc3NEfw6gPSWSNVFCwA6PhxBv4ggHnz/G3mWAvE/UNB/IqGw0VgFzF8cUT+HEqbIpL0uxaSpjvFSgsvMZH0hhVeAnFIAZ+SUQk4TYfIwV3kqFqbCygJMeIWQKCmgV7KcJnYvUXaZrBBuMVkiHooa5IwHXaOq/zBHdklxST4QCCH7cSe3Oi0Wo8XpEuyNdld3l91kt1usPrNfzHbZkaMhme2KBFLdjXbUyZptfquXt0cyNp7rME6zxNUX0u++u2zFimXv+uwtVmhKY7PDx7FH9RtMkpM3pIwhc+5032BXbySYkLyixW4RpIUJp8kVp/PzdXY77AkpoPyWUwkC+R+k5zM0hQtArpOUT96BnITH5CUrmmgUEwQeUlnKgyLrnHfSjCzsAYS9RNhRGnspYeRxyKW0DcxpirvMFsSJzoY1D7OiuHud3ykaEbKanNHmQwY641ajw2TpnjM014IsYfOhN3710LQdWeYOzelpXmawcrIBGU4zWA0vgevlrAY24mzyK1YeIYtJPdXg9gVDJ8/DBsP8k0NBn8eArjAJCCHeqjQ0W43LhEzAZ0Tqd0MJ4cjhgWWdLQiNI84fyKhfOBYqdEPFV3HI8AdwoaxB08WD+bYHzwEYxLjTsFS9shlpyq4INrsLzEbO6ZVNaDlabvJ6HUajSb3cpljRP01e2WHkTepdkGA0OrxekmDTeeRQ5/dxGLAjASAbgWoLCUzjFXfOrc1NZ+3cFFHd5DzI3IxVJyaynSLNPmHu8aPxRBId+6VrSz4R6B1ZtplDTkleMN9t9XgsVmvMNTzfjTbHCrPmp5p6FigeNGgUnCPNrbNcZn7AhJoHUFp9aetpp21F6Yi76LTwpnjea/cYDJcs5oSAbOZ6+BbL8K3hw8fGU/FsICBZ3aVjcl6rnNFh4Jv4d4yPaWd66PmpLAUKHmOFX6NBHYpzi9gT0lSJ8YTyxoSuaM3BK5w/bMlYf/fwSPfA2OI7Fo8NdI8Md/ePLTlscHb/sX39x/XNPntW/3H9fcf2zx6ksr0jF6bbF6UbyUHGIrHw75oiXYWzjj2z2BVVlGhX8cxjzyp0RZpGGxuWHbXsqCMaAoGGI8CzrKFxKy1NrVG9NFh6234E+3oAMJIxbeUQNqtGu0KTZGihojURSNgw0hIJxwPyUUYvtFzrDsnDJ4kiOSKbC3jjxaysSfGSgDuieHZkGTRn1kBXbymb6Zk9d+zQxWP9PSNrf5VxSdAoX6vY6RuOty9qD3/p8MXz+npmpzON0BGzh1ye3k51rxAQ8Bm6cK98mYCvyLadUUhthFbKUiKbbgg2RaEzcoM7Du8UW31QoeTKBMLQcYnhv9N+yvfP7Uwn20h34B6bTxDKlxpdLhvH8fh0IajLqL9PxzkJ8OJgo0xU6Kvn52oHGEv6mPb0w5gumQtjOrunb97iw2MDHQ3aGCxqr4xgw5Qj+GhDx0AsfYABq667K3Bax+e1M29MnZ6cMqEOqysXSTl0oLibMsdlwFxJjm8dRw5rrZg3D68inuNIFAm1Zz7PgAl6PicxYA29iRpqQ1U94wfws4yd6hFqQkrYT7UDpFwVdt3gd33ssi5nWbTM5d/7kd+Fn3L50d9ud/lty7Hf1aeoVzkbGpxoK0NgJOAppx7gfMnMcdADix7qaOC3NbxDHdBV3J9WB6h6w9OAoqilCJoPUH13JPJ8NPo8wG4/EPYfTKcWcTJBAR7UGOsaQVzR5f1tdcyisJekYTeZxyxi1jAbJulGRg8wVu4ptSJnOtpXdqxPp9d3oDvcjY3uDcQ6/JBDvgoxEK/+Kb0hDeZiEr3e09joOeyQQ3CBeNbrOdExmpppwP0hifnQHej/GTLrKqhnaC6Nphn6foZMtSEdb/8O5beFofW9Bx5HFKUs1SihcpJUiterL7RSJYWGWJtG/qphzUUnqK9QGrgNaOaNbxDvG5QOPl+9hcavp6H9OVvlnxESO+h53BOQqAwYPJq2QIWP8QwboXMwV6PFcyJzzkz5hZMHov6QF1c7Nes0lOPTlGSbDoK0nRDt6IjujKbT0Z07TTabaafZZlMjynKlatBbkY6OyE6aj6SaST42Qnrkb3r3CDrj72+U8SfE81vS0QIpVYime6zmAqm4YLZaiQKw+jmx59A0mqtHSyO5dPrhJZ3XOjyznmMlgtvS00lOGHByXl1SKFOL8k9ybG6CQUr6oY5B+sh/2z1WE2cwS2478Zo5lpfd0/A1y09brTxnMSmoVXFbbIC0WnhFfU1xVc6LfMo+q991QE6KH0rbgWfEMZbSiHCGAYZAEwpFrzyA47oWU52AkU2Ee9p9U8lItg4P9Ha0XHnzOYHIvKal6ebk/Bv6/evPV99vaPP72xqSXV1Jm9vd4HazVn9bT0RNaD2D3gSLyAQSFNd+M1541+9rO2F4jrhu3hFdgaB1jivaMXx013UNbbk2f9eirkFSR4NbPyPztRq+V3BaLYihws4CGDSuuWp8dBQ/ni9/ks9jR77ibt77MMNUzuDsqK9/ak34JNT/UJ5Um0dvatVfMWXt2n5zDdRNZHky00jovwqni0gNNW5XRXPjrzsJL2snenwn8agS1LsTfpeFvepKb5iMQtiLdnnDO/c+zC4g9RM6+j32QdgbgnQvowx/Po2pSDpENBPlyikXimiTaMCNSjQJ8FESk0QdypEblgYyzr45Iw3bQl6pd/Hi4KqOVaktpywNBlvQttZt2w4PRVq312TbHpSk3vHx0KoO9JoSNWebO8PNZtm/Pbh4cY8khY7sOLI1GDp8y5ZWtC0VCR++bVvL9rps44t7PR7IVoXb30ffrDkfVIGMJzfjvc3NZUMzuo0qhLlof/6cjpWNEaE/A1TaVmK6mFHmEHrHxHqAZOS8PeyNbqWKIQHSyx0khP5/yPnSuBRvjUvUQrvqAou9TakmL7XK3/xPZsOvS3q0pJvJXvW6//scOv73C/SLunH4F/r75albUxs4f9o3qeBot9I7NJphT1zIHMOcxnyZuUnbGYneD5444NyL+EkgTInXHoOu3jxSn2n/mvCBa0LT1nQj0ZEmejP36cej70f3Ec2Z+ymG8E39bpj7tGPX991H1KGIpS6qK0c89QX1ApPLsVaiq3N/tYx2hJqWuV+/yuN+eAnyHvVJ6k6av6L6Q2uoLamXgOeR8jUpjHYnz5tA0xHdAoXpoOcal9J1eTbzJRiZO5mHptA3cPPaoWCqhpNM2JGuFg8Z4oRDokUnS4qkJ0ChuCLp4kySS9FiaYpb06qXpRykcCSQK1ApJ/nxUk4vE9VYMjE9NwD8JF+tfrDqQi4crh6p/H1F6aFkQaLHLWKbR7IjS++llnjUxHX2OFjJimys1WNw9HRyfKzpxR+wPCvmOqzcoKWsPmkd4GzpnAhxCD2JMMfa5syxsRx+yNqREw1G9gfIMqheDxHoScxjSHyeG7BCRqPBWuxEC8kzbaz2TI/bk0ze7+jOGOAxAmuVfmSANEtTjIf3OJCqRfk8xBYTigHFE10GZPKzNpeBi3s4U2vabE63mjhPwmBw2V5w5bJOg7PRxI8fZTQeNc6bGiGYzbncrc1uJJgxuEgmkb72di+/cXwWSXCk223YbJ7HL9po8qbbZdYVrHkYi/jTOE+cg+pZ8ihTImvWH6/pPL7JngzzpnKXCqFR9rsjhdx7g6ZknbIlcq6k/BGxMbjwezCHo7lc+be5issmIEcTzfF/5GhXuYn15LLZXNmfzeWy2nvcyi5g1/1fvYfdryh+NUJs9Ds1gn5Xfq+I/lQsqp5ixWXXKf69e0gOdq5f6du7h724CH977yF2BX94muKsccBZ11dlrLp2KnmNQaSf6qHqmOQFeYWSXiUd5lcUAzDFDotxgstXTi4ABkIE/b2Y4sJG9DVNbvcWECJEQ9lEtpG3NOXNvf8rep7mnYRbYXzmXqoIuI+zOSVWIvGaFvPT90A88tghweFhE1TT+S26PzHkuOreh4HIoeF9EMZoxCPe+zTPcTaXy/g0OfvqwR4rYkTPs3UJViNN2MeQzYWcuX2W/RXbT3F4b04mqgtSjnKGqFISUdmVclk9VLmxjJc8mp6eJkIMwk4AbSdYEG5C6GzOyC//o4273mC4nrP9cTlmsYE92yAYIMG0/I8YsWbDDo7bYbT94QiTkTubFdhudL3R+sflPIS0fFABIvm0Ov6ESCUsYidSoXoW6brVT1M+8RiVYsCA1Usx8mTgpKRci9PjHEcuc6gZywlFXFTMot+LLo8NvVwhvgToeTNCFdKMqOXgbwmCevrEwFFxLrpMCLAJJDW6UYUKeVmAkmanGb9cwf4JOSAIQSjtoGPktu3TtHXvgeKMxtvdp7IP4X8ABGYqqGaU7u+EfKTEI1AdUZkqVZIhKSVKKA9j4oD+PRmduWzenNY2X8Q3eOIs9fITBGxmrVHLfTaMbfhPJo6zSxJ/clvrnHnL3iHnjt6ZdeLg8ULIwlks0By3TeObGRi8G/BsG+PUV2q0skaJbhW7ya/s/VTx4+vKJ+Dr9r7G/nDvEN6t+Mt7sQFWntrV2qfJmFT22yxmQgC1hrQzIgRpqODsIgB9QKCVqpRaGzaiWSQ7ISFKsziLJXIShIpJbmk+RPbNSX6bSJsejOSsg9Zc5Lsk8J3vCHar2fCd7naIQfd9m4/kLS35hziz1c7ipnC4Kd9U/mtTHidCoQTON2GxKT9gt5T/arZjBYchDlLKb0dYbDdj0WLX94onYV65AB9LT2j0SUoxjcmLD2BOIuQrjIamo1HIeeitNzkRxwuE0IXRwvI2osQ3ig45++ZvnNc0P3LaTeqntz7gDaFvbSWa+yOHnLXzG+c2LYB4ZIH4sAZfti255qiEsn5s/PRZy+4aCXn3lAUCG7dCdDy2Ye74abOX3TUa9u6h+ry6Xj5PNdqJvlw7k2EKTDdgb7MYpkReEl6HiJW0q0FyhOrWJCg8grSS/ovrv+ik3/ODmxtQ36bTtqxf1z9gY0dZ5Jw798StF6r7Rskfu2C0vGETioHZrNmnrxgtbNo5ypYKq448ZdMm8bzNx/YNsOiIzZv3bNr02KZNhc2bx0erfxWa5S38EuMleC9ZhXIIi5gn+n3QoQPYTZTnK1rzWaJNn8SGgZMXO3tW5w3d63vUYHZ5ty02N8MvOutVS8hyRqsQlizDlrBwrcWCf5k7ss846+jtG3rZ9OKjVg/b5mybrf7YArks3hDkslwrhC1Vmej3KZ4VZAanwqkSFcIeMBwpR6UcXqlyBphsnZULWBLYs40McncXlQ4Tz9qNJzl9vpjfZ5rX0lz0+vNtacngLok2VLRZvG2WhkUHRDC+i+QmUgzdlm4dywZjnc1Bv9GdCQfCDkfA63YnbUq6f+7EOYendJ5GETDFMcAVZ8TV2F8XNU6cyjkdCgLqeFtsjGhATilkHIY9bu1ackDhNCFgOU1ALUKARARJRBB+alm5Kha7SpmOtaEeJZBynoBwmkU4XQg8XB/s11Vw9TPeV7FRqjda0qUfOl8KH+SuSk7T2/NorSZtlclMo9JU/eaSWBJ2W0A4qV7jAJLx5y0jzXJLKaQ6QqUWuXmkBX2iOnQheDarniwIc+YI7kbzWjOYxs/qg0cBQMdF7G2gto2NEH61I1RsleXWYoiKwYcqMnJS3+tCgzB3rrnRLawRaB2TwsciLNnUC2wO1mtD50HdOp/zeZ0/V+G1LwGc5wvMJXV3Rk5JW8lTCs1nUnpG1Ntt2r2R3wsQJ/C975GDzd9zSNIVMTRXUdQ9sQ/J2KpnT5EN3R/sDIL5nu5oCWCxCRLUs4N3VHJUCq0lmrl3xNRHYzE0FlNn6Tn0/CNaxST3yJQpE+cftT0rrcG2/XYtIhu0A6wIkWOObBp1AJrB7q/wPdVGNie/qsfIdXYUbWMZ9Nvk7ASrDCYyovvkp4Ww0HqGJeSlG9fwgTe4sczSfNZmO3T9EG6evWikjeM6hg9Tn7JYoKRE98VhS0ij999kX6U8NQLrvUwDQOsYk4AWOaMAKaJOpcDKfFKBXxx+uQJYTvi5ndqVmewr5dWjuOG4L5/R8s1NJ7V8Dd1wc8uO6N0t5+9s+QJbXo3Xlt/HDfic8up7jsUNI6r59JbbTmy5PgOZ/gSZkA2yofmQ7/bR8vuV/etGdjalFWQmzCSJXrqbSB61PkvSJcqjEirJdpbcsZt0k0NC4Mq6+4Ej5cBH2O3HONrs5bsdji+P46HF5R9t6Tyl2LVpU1fu5E1/jA0OxkLDg3/2tbX5pI421monOdugCCnZZk8tLv9gMTrrlMwpV27q7j5uw2A3XjsYiw32JmIb2mRfW0ujT5fBfxWfS05WucnA1gjg4S23WJus/4PurIjfe62KTf3Yih63Wj9Fd5o5jsree2025LSSowoUlv8PeyvLVO+K1bicYf2WKDIitMuTRLmn5gfj04G0X7KSh71l76f4BXL1zOn3xO7J7YrdGd0ZuyVxi7Lzyjtjd155S+yWL96p7MKZ8jU4o4roryyz91PWOljeegdk/8Eu5c5f7lRueQGyqY0QaAJPBFy8CvKfMqiK5H2ddecH9j8zfiRzHLMJ9ptTmQtnfi52aq39OpVeogNY8fNTJZTqoFX0YFpri8mJ8ueJLiZqp3vO5bF5MTDfP5DzPWVMAYP/QrRf4rq06te69kucYP3o11RLvz9G9PN1o46R6snv3DqPvga/s18/LvtP9BpLT45Wzlv3InpxB2s9iCZ6eYnWF0QltY28p/cok8HstqgPadRsuVXwBP/Vti8+mve6LYhK4VKAEzBVHdzvQrtl/Ra0UZg1WyawlQmYvf8JD3e0ALO8EEWZEj0XVoMgyrmsvH8sISoOlLfIesLaQY6wGq/40K+rbcnnz9j7ESuTX/n1Pg6xLGc3dnRyDoHr43iDkZthHJsgFZc/qTxCIwTrpFWqOqJ+bwSV+g02zsBxnZ2cxc71G1C5PoIr93FWI2s0dnQYLXYjPAvpeh+34tNh1wgzbUQjGFXO1OtH7aEHqa5KRd4an1qP5a7hrbNnbx1WXx/eMgyG3G+cOTwDBrVkiat+a4QkXEpTacpGYuHTZm/9IikJ1lDm8KNIHFhDB4ytvWs8pZ9CPIQ5lDmMWcusY05gtjPnMpcR7aP6caeXXO83PXpZp9YUQkjWnUyZ+oxiXQCRm1+I2E67AYb0SNWHbn6uejpU/Kh6fHPi/OhzF0VM5GIA98rIiZEDGvV2FFV/S6hr4mp3EFR9+KceceIA6qz6urX7pMs3QwHIjGeL7gs1zcOKdRFVSZwz5G50XTSL3k9wwZDJ7hLNNfcoegGekztXlk1w8Q92epevWSdpJGKvtlC4Ax8Hbjn4edo7NvDYyJr9poULjXaHxWAwbuAtnAWhA53N1fjrU52F/ekG3ms2mKAmjjNY7Q5ugwmhPZPP0066x3SE2cgcxZwC+8o5MKMun+GeOunouqghsUqVNeimJIN+o4FOItGtlWJ3pZlNuoPf7LFGdGW1mZKlswtQP7eYca8xmxXFaDDYHE6johAaQFEIZQF2w4bI7ZFJZhrNlsUuMUM1diuPcjW6M6JLfUEgNRqdDivHGSce4Abb/Csy7d4g1qn0OpCJ+5wdTBRwR+1U8YHOr0y+dbHuJsIqyMLM5j2bN+95dfUKcoplxerjV9y4YsWNDy2cT06wzF+4MhNsDoJxkoez1s17Xnl0M8n22uoVheKs5V//7o0rSLaHSf5bpWCwJRjcql37X5X5P1l3Z/PMoWwdPhE5yNHH8jhr2vv5hbGHY2AItE0R8pZqyVLyNp+okLeJ/FWj6rv0tKrGf/ipjgcUZ6iNQqTUPD0/TbVAw4htP8iLnWIOStisviFEhS8asdHuchpPmEaHYqeAXQGLeqcVWe/l3U4LNpq+rNOXB8b91szszYmc3j3D3ZleGCwinZD0HhSXUzeNjp4feyY2yaj/6Dca+zmbhecttmmanNr7IV5AEKCdVQsd0290GfsNLGcxnskLHK7wi3ZDHwSBAtxUoap1prISj5EhKZaIajLRqSRnhlhRkxGkEcE+9O02hYxJJUZVhw7y+YaoTlBjgIDoiUBH4O14iS01q2fYxBtcNpsruAi2nmarpREZ7bzg4rpMfpHfgbbxbje/D7M44EPnExq4fDWxYzGNtMVbgp0BRzAp/QYvgl336a7kl1J9Jtsd7lzeHWQb0Y+T3ewokCn/xbMmvmBixSh/i998gdmPUPOvzdI6r/3PhCr+M6GXO4N/1gj1P0vJoGNk0j3vlXtuZ7zayH9c/0bGDO6NpTfRtMzaM2uaHe8fQ+cO/UYdJhdvoyf0u18q94NPfrspcM8SRUAUciNctDDNnd5frF4LPO113a9qFwqTq4Nn6WfuqF7oT2Zy9mHKKyXrAnXyte1R/Fo0Wm6NRi+JRC6JopbIFyNgwL2ERJXvq6Tjn9DTjK/XfttEfYPgHTrt8qIuYySjXGJ6mfnaN3Imy/dgBz1AHNrvsJqU2/+bJJDvXXLmTKUfBUFB9X+Q7W4a0UMjHlFXol2ojfgvIdapxxyjfXrkbXpSzbEPyHW0IQRhmj3sDY3sY3mS7g2FSDg8ug+N1IfPr89OhkOk7f2BTrPUU7xHMquZzczxzOkzo2Dq9VmnDLB1qh7yQUJsJNLT5vO19UTKf6n46ig7dWsMuRRF/XNssrupIPqCPpFahSn8MyBg7iBw7JaJPbNBJGUDflH03yMSe7JXl1GTO38leg5pEHrycIaJV88c9aOcVMFM2bq7SagP9g6iVQhTppCDn0ysXEHhciXiU/gkTSkRf4HdVdn0R7XXXTGx75MrhcRl+fyyvK+70H0nauhPsNlV4dCqLPveVSt3BDVIEQySlgbxVyb8JEV9cenSt1avfiv13e+m3nrkkbe++c23Hkm+1foQzBe5Zg+MA40zcd/OMcxWZhtzHnM+cwVzzQHu3tFuhKqinkQyHdWUZyWCNRE40YFQlp65KGgTgMAMgCo18mvtGq147Xwq1J1pndm3DYiaXrIO+akNZGqRN3KV2QTLpoGQPEdTqgQwSbyEBt2NbgiU7z9I2tWVS9orLurfH7V9c9asjsiaaHRNJBf5UYSYiG6zVqjnaI1kusTqwogESf00sPfDg6U+Sio4vnrZ3XFVy6u+rtCvKBiJDnikecIwzKRvgdTqth/+b2i3c1NiQhN07sFB4scR1AAd934ENWu7u2avorj+dBerk/Y9R3uA0pay+pzWWain8p0EfA20swZ7rnx9im5F4OMVDdfXMRhNVaxOS//ssXPmzTtnbP78rrVdYOZvmF9aXwIzf76esKNyEg9fM3bOdeeMDXWtO2Vd15Du0KhPtNsIzTUwXNPB72XmwEpbWcHJaN9rX8fSWQh83YWv+gYdrQOidQGZ6JTKJbmULCX5kiIn+TCuDcmVz5Ft3Eig+cbn1NcpVK/5MFQFvGpmdGhI/WnQ7Q4Gmq1NxiZOsTafWB/EdwM+pu7SvkKGVgJOQLCIXZUPj610xwP28hXalwjIMGXLC1CHpChSkI85k0lnjA/WhSr6L49V78efSsI53e34tZwi14SEs+LZuobcVvPkYdptNYetm3vGnDlnXE2sOfmVhcLKTcSawZU1K+accQ0pBdZoftVxq/L5lZtX5pnabxEQGWczUJsz+iIdwSXjOi6ZTJIFQARu+5HdVw6h7MQngZJeIpDbb4kM7f0D60WEJ1g9C7IL/1U/U1Cis28V5WNtAoxg27/Ac5h0wEM6QNz+pwik3MR5cnnijLnpYHfzXEPQnMcIcvPQffdRh1j33X03WlAbuk7/jNtDBfIFtrawxvddqdOyu3S+70pKy+6KF0ph72aCb232hnvWnhz2biLVbCKBG2sDqKR90c2rOfoZ5l+xf2dT+plDel1kuKJlHdY+NUAYUtrHVzRql94JRn52qopP9GEwIbdwMlEcxMk0SuLDHKZ1nGR7zS6bectNZhOOY4svJP7A0mB9Ugz5LBA2CV+38GbZ/ppVMq4ztxqWiJ2h3Rd53CwKf9Nf9JtvD3N2F3/RI41pkY3wzqesdhzG7mDQcr3Zb3vFHnBh/igeDFDJ9ldsfvP1lmDQDVns1qc84uo7GhWu4Xx3vtG8e6kNWwxLdzcWPPz5DYawr8IDf4f9gG0B7OcIOl+2MmcxFzMMF0sqiWT1v0RuFq9840Xy0mPBCV4kbQZfzlsiBzDJ2s3J3hJducmCXpQe05S1+9hkLwtrt5jGxpLHCysYpgl4YC2TmVProTMIm+ISm8k0xwM+JzvbbEo2XX7EmtXHrTyk0+/C/tH28VQy6BU4TkCmptsM24JGk+AMDwCIcge8ja5Ot83b2j9/2aJFc7eEFKOx2+7xhqLNtwdTgMW1hnpCLSEwN8APhVLBuzU3tDTcEgy2BkMGY6M35g94jEedsH7V0nMDYbtzrGtpe87IXjOagrnNea0Bi6/dvmjMPSxAzXl3M4dZxJudnSehZHJ+Z69obfAdMzx/yeoVbtkTcMmoF5oeaoXfF4H2hmcEBz2hEDiziRMK3QwOPLtC1z+p8zZm+l0WyvrTlbU0ye7BOUTvC0Hh8cd1Tb9XIPCqMA1X4l1BeOIJcl7S5eRfEQQoU9ENJvgzkdoqNV89XAN45Y3MN5mHK++v0asHutNv5pc2szLRdCEbTyknSyEqxydHsmVeSepXNNJ5RrUpIYtXO3RKJie9308/W+qh4CZfmjglUwojkl/i9e+kFkp0+6q2P66Lms4kfLUj629+vs4o2BcHjHEOGb2c8SuRNOISRski2q2uqNfqTi1McwkOG0ySzSQarVYpZPU2f5CSQyF5GbFSnoaGFr//Sm42F+e4ZsMIcehQEBqTPLxCIGiny0afrrsu+gLu4gZHQ6vCcZxBEi22SzguFuU4URDsvMHECfaueFPEyFmMZsxZedbIGniTPRxoQr7A8UGfL3h8wNcW6YuASbDbtnDckxw+dRtxavj3Fcp6huesOGfOKUuKE4gecuLKSWgggHxAGPGEOCocHHX8eddr1/687wj4odMe2A5/06CLx6g59ELmevVva2LXI2FNrEtt6rsX9Z/Vx1T5rbfVwOrJN45MAa3NSEYsks0YHKt+otMVLLV6yZHOSR+/e6S9PH8heiCtjiMrcRZPB77L2/DudHk+mo8ehNzqp+iBdnUxpe0n5CW1d1MdxWxnvsBcwFzIXDUzCcoM7z91V3h6/1ZV00leprjJNKtzoGZcShPK7KBCGXB1htYOUgKsw7XrSaFeLTegrO2NOypV7yBoam3uynWmMDc8M+rvq5mbmG8wdzF3M7v/3/f9lJoFtTWh2s8oOf+DI6Tuqhw0QSsJ5q/RAR51p/86P5jf+Ef9YMZJd5bvJffjhfYQ858crxWV8WrWHoaYkPr7YBA1gkM+yFfROdT0Fzw131icKW1R913Aic5GWWyYlra4nvCbPozdrii3x2ZAURwd+zwG5nNdYZDbj2bv+TdodXlmFLnaXaHIX6AXy8MWRXY0jRRBf4Ydrm6HuoCQdN01hDcz+fsDFR7DwhneMFPHA6rjCdNrDqEgPcUYmuYTqh9H0DnQjIsiEXJ1XQTzVtMSo2DAhiUGq4WfBlSo+wjFfjYhWtWrl5isvMUK5bBBoDTdX9kXWcLlJndpDdS2KsmTowYEYUnWtY3eSFAi6uEHaCO7NFqKgvnJoD3lmP1cpBjFka4oXlne5Q2GpJ+7xJ4Bi934shQKqSaq9KO+HGNt0a6o2gwWGrCz4qxwPoJ+C6FDwpLaLIVt/f0WHJbQG96QqmoXzE7gX+FJfJ9TmXOZS5lrmPv1lvjRfwQB03At7bofj3ZJh363lYZteQEH1e/2KMkaJrX/pceQQnEtySPn4FVkiV6l049I7ty/gnp9pSnNGjoNiOWdomABJDq13GuxGDIGZDB5LWYjsqQija2vGiCP4ZFMZ+eGTCbjpicO7zb4Oc6PELKZOYPcZBMkg0HSP9XxMTIj036I1+ejzzTX/KlnBJsMBqPRZBKMZj4oB5vc5gaRM1g4E+JYCy+Y/HJjstfwdwOYnv7DensP68805hvBHGnoMMQMR/Iw85oM5DpL9wkQ7jBU7+J4FWj5ijxjUPtS1P4X6h04rubYjEafU04sSyhXom8EYCVXkfoVYMaeRqhlSobffeONuJt4HiNREFJ/yaIBjAcwf4OB5w03sBsggNBEGP8lLJUvpR/SO0MKj5TvxDdPjpAhuwH3syzbZDREDLyCWfUBGjeA9ThjE2Y1nspv2ZfZKOzhaco/Y8yoOltlRK/ERcV8nDLKyF2v9KSN9qUPRKbfAXhEOaomf4/6fHtGLZcWetxAuJcaO92ITZZ53u2xIVb0mFFR4HlBLZs9jR6z+rzA/0rpicV6RokVsxOwZPfFYuhZVEwuLKllKK8+n4S62MTJ+2weNyn7vFa2TCpCRbNHfFcvD9aIozHcaI91xvSx/QL+DFZtA9DbROPoMIZxT1BtifyEbi7Aq+qFStqp75r7lRL5OCIZNX9dwldONzqdNpiZpwuNHtxLbAEst7n8IrpOS+LVE3UP8tbEQSb1MxQiBdS3zQE3ug6FeKeTaGCo75DKtpwO1J/V6TKebnY3lt84XXA3QtWeRgGquZY3GGxOp1E9wah7PqqJg/xWFCZZoSZ3AF2LwrQqJ0/DjI773q5/d71WjreYyrUIH+vUuq8yTuZH1X1BSZ5hXD3qNPWl3xFyN81Gep3N+DheRb9+vp1+ofxC9TIEfUAiXqcRYfWPSNovoryJ4keoH7b7Z6ou+f75Rr3qvvEv1wZ2BqUN5Hlg9S7eqT8cknvH8VBI5QAF+ic4BAVCLaTmKh70fI0+Y+WrrtPKAglfMgo/pGs1sqnK5dLlv1TlbUSUR1gBVMlh+yiaM4LmaHcXsAtmIJwbreRVHyNqhpru99vsW6ynTr7cQ/Q36mTLdUoaztoROxDiIVPJXMzIS7qsSqYbHtk/Cvqul1zRhbPd3eUXuy7M7clm9+TIaVH8lXAuDEa9P5wPhfLhuxzycXYvlh3Hue2cs+L3iKyHoIKql5wtRX/IqXIuhz7K7WNqiqIlEDhmv5JGrUadD/7Tmjsq6ttbdzftedVLE14gUA/dRWAPOpfEkBRG511+wt5A7+5tP6Dek9YjNbK7XEVul8CWzY9t3vwYVV4iV/GeILouIF8kOt/d6L6ACKUucE++qPdnJLLRfX5NNl0u8xTeR9vkYXyTv5hcc2n7F5pg62/aW25CW17fmPtjfsPrV68wLJ8fb2qK44fLL1x5Jc6pu/72N32/vAFggqMer/+X7yWuOz1SaTFpSrGw8sgTVi7S7hxe9PAiTcVrkfr7iHZJceRtKs6LbH7slcc2k8y0A4bqMhNPWn2ZZLyNFCFF9Xf/BD9SN7frbzqJ132Ts663El1busCgZs1VQ01sbzy+90dNeH2Xel9XFzq06/Au1Qief3SpnwCKFGeY/w8acz5TAAAAeJxjYGRgYADifx656fH8Nl8ZuFkYQOCJfaQMgv6/gIWBOQHI5WBgAokCABA7CQsAeJxjYGRgYG7438AQw1LPAAQsDAyMDKhgHgBUCwOGAAB4nGNhYGBgwYYdcIgTwjB99gTUOCCpdcAijgtjMwNdHF2NPQ47bNDU2BBwHyE3GhPpB3si1GBzBwgb4PAXrvBFjwd7PHGDbFY9FrvtcahFdy8DA6Y/0dQBAAt/GYkAAAAAAAAAAHYBHgFAAdQCSAK2A6gEDAR0BN4FdAXyBjQGuAcoB4IH1AhGCF4IhAi0CP4JJAmKCg4KVAp8CuILYgviDKINcg4EDooPCg9kD5oP8BAgEIIQ4hEYEWQSZhOqE94UEhRsFLgVaBXUFqIXMheCF+oYSBicGQQZZhmwGlAaahq+GxIbuhxKHHQc6B1WHdweMB56HqQfCh+MH+YgiiDsIWYhliHEIfQiViJsIzAjdiRAJVwloCXkJm4mzic4J3gnnCf6KE4osCj0KVYp1CpaKworbiu2LAwsNCyMLTAtrC5SLqwvXC/YMJAw5jE0MYoyDDKcMu4zPDOONAY0rjUeNhI2hjbQN2Q3yDgQOLI5Ljn4Ok47PDueO/Q8rD2QPew+RD6yPw4/9kByQORBckIUQmxC6EMQQ1JDfEPaRBQAAHicY2BkYGCYx/CBQYoBBJiAmAsIGRj+g/kMADK6Ar8AeJxdkc1OwkAUhc/IjxESF5q4cDVuiImhBZbsDAnsWeC6lCk/aTvNdCBh5dP4BD6BT+AT6Ev4Ah7K1QTazJ3vnLn3zk0L4AbfUDg+t1xHVrikOvIF+V64Rn4QrpMfhRtoIxRu0h8Kt/CEZ+E2O6bsoOpXVB28Citc4034gvwuXCN/CNfJn8IN3OFLuEn/R7iFmVLCbXTUy8iZyJuFnu/1OrZ5YnOfxN0DTs1ym0ZOlGwz48q1zXU/6IkzMblxfy3K3XLgfaITZzM9Zi+TplYXzm5M7IOV98UwDBPxg9hmGMHBIIJnXEBjjj3jGjEsciRV9NxjdP/dKXOX2PJDRaw+PTtVM2Y6lNQHpdFHgN5ZzoQ5eZV3PkWJHe8Z0D1MoLkcKzLSWOYynCElaxTV2YZOTD/Aqqoq+JNDvslZflDdnf0CPF1o6QAAAHicbVSHlts2ELw5kRQlnc9xzum9Vyax7PTee+89ELGi4AMJGgClU3rvvVfnV7OgpOT8XvSeCAK7AGZnZ7i2vrb49df+/3cU6+ggQowEXaTooY8BNrAHm9iL47APx2ML+3ECTsRJOBmn4FSchtNxBs7EWTgb5+BcnIfzcQEuxEW4GJfgUlyGy5HhClyJq3AAQxzEIVyNa3AtrsP1uAE34ibcjFtwK27D7bgDd+Iu3I17cC/uw/14AA/iITyMR/AoHsPjeAJP4ik8jWfwLJ7D83gBL+IlvIxX8Cpeg8AIOSQIYxSYQOEwtqFRooJBjSOwcPBoMMUMO5jjdbyBN/EW3sY7eBfv4X18gA/xET7GJ/gUn+FzfIEv8RW+xjf4Ft/he/yAH/ETfsYv+BW/4Xf8gT/xF47i77W0FHZbmlk1kMKLzJGm3PcKq2SmVUVxbVXlo1z5eapNLrwyVXLE5kZSqqq68ZmSiRpbUVIsGqlMf2xsmZUc17FXXlPkVFF1hZSWnOs5z0c4r/LuSLSnxFMlySRiyrfbrmtcTZXszoStVFVEjieppTHvnQzXhermRjdldXA5HlqOw+V4INFibhrfc1SUVHmS3TAw5t4CrBdFx4vRRm6qsSoymnKUMVGdBdiJ0wzGJlIJbYqtww0DHc8zV4uchDVNJZOm1kbIKDf1vO9VSZkVVUGpF2474xr3H7NnRH5GVCWqrI31A75YU3vRwcESwEg4Ol5oZkh5Kl3mvCWfT3YvjTXtMAtxPqF8OxKNN2kuNK8IuyrD+bmmvcuJkFNR5SRXwdqa2m1yO8hTliubaxruOWaaLGb7pbLceyYrs2ZmmRvraEMqVzOpLYxIWlHsWa2MWA/bUVBNTFL5YRSeodEZN2NrlaWqIKM2d4VwytXxNoqC7DaPTezQnHr8z3JtHHVrhqFoNgi3ZxWjEnUyNpqbNGh1tiig14ZDMAqrvTYU2IsUXxmrUhS0b9WZkMsqtH5ztZIHpdi9/7Zu0YOY4WwP41JVjYtZRc0wKo2lKLymmrve8KmdWsikNCOlKa15npVih9Omq5mqUi4hCwpbr/MoLHaXck6skKpxAyemLAqlNcn0SEOudZjLrdE6DKr2XUfet27g1MRNBPOWToVVQU+dObmNxRpTyJmhI9QPj6U2uRta1I53zhTXxR4bBYIGXCYt/R5zSxo2sCbLXhdWpq3aRmaHteZyEUwxarw3Vb/9SrRKjgu2RN2VKjjYRoHXDUkLyFyDiya+1EkQhbFxa78oUMrMODczVsaBANNhrSWL3keWQccM19hkgSs67JiMqilHZOPWUv3/TLTLT8MoeDHijCr1tMPdJdH1xmiv6shp41PPXLgxWXZ/0ZvxPTZ896LAQdye02uFO1FaRvw27PBja5cLg1EDxn6b1qpu367wQkJra/8AhSEfTQ==) format("woff")}.fc-icon{-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;font-family:fc-icon!important;font-size:16px;font-style:normal}.icon-data-select:before{content:"\\e6dd"}.icon-markdown:before{content:"\\e893"}.icon-grid-line:before{content:"\\e600"}.icon-print:before{content:"\\e6de"}.icon-city:before{content:"\\e64b"}.icon-location:before{content:"\\e6d4"}.icon-qrcode:before{content:"\\e6ce"}.icon-input-id:before{content:"\\e6d1"}.icon-iframe:before{content:"\\e6d2"}.icon-audio:before{content:"\\e6d3"}.icon-form-model:before{content:"\\e6d5"}.icon-title:before{content:"\\e6d6"}.icon-sign:before{content:"\\e6d7"}.icon-address:before{content:"\\e6d8"}.icon-statistic:before{content:"\\e6d9"}.icon-barcode:before{content:"\\e6da"}.icon-video:before{content:"\\e6db"}.icon-avatar:before{content:"\\e6dc"}.icon-suspend:before{content:"\\e6cf"}.icon-warning:before{content:"\\e6d0"}.icon-send:before{content:"\\e6cc"}.icon-refresh2:before{content:"\\e6cd"}.icon-ai:before{content:"\\e6cb"}.icon-ai.bright{-webkit-text-fill-color:transparent;background:linear-gradient(90deg,#328ff7,#62e3a3);-webkit-background-clip:text}.icon-column4:before{content:"\\e6c7"}.icon-column3:before{content:"\\e6c6"}.icon-column2:before{content:"\\e6c8"}.icon-column1:before{content:"\\e6c9"}.icon-layout:before{content:"\\e6ca"}.icon-segmented:before{content:"\\e682"}.icon-mention:before{content:"\\e6c5"}.icon-input-tag:before{content:"\\e6c4"}.icon-up:before{content:"\\e697";display:inline-block;transform:rotate(180deg)}.icon-alignitems-flexstart:before{content:"\\e67f";display:inline-block;transform:rotate(180deg)}.icon-align-center:before{content:"\\e6a5";display:inline-block;transform:rotate(90deg)}.icon-align-flexstart:before{content:"\\e6a4";display:inline-block;transform:rotate(90deg)}.icon-align-spacearound:before{content:"\\e670";display:inline-block;transform:rotate(-90deg)}.icon-align-spacebetween:before{content:"\\e695";display:inline-block;transform:rotate(-90deg)}.icon-align-stretch:before{content:"\\e6a7";display:inline-block;transform:rotate(-90deg)}.icon-align-flexend:before{content:"\\e6a4";display:inline-block;transform:rotate(-90deg)}.icon-justify-flexend:before{content:"\\e6a4";display:inline-block;transform:rotate(180deg)}.icon-direction-row:before{content:"\\e68b";display:inline-block;transform:rotate(180deg)}.icon-direction-column:before{content:"\\e68b";display:inline-block;transform:rotate(-90deg)}.icon-direction-columnreverse:before{content:"\\e68b";display:inline-block;transform:rotate(90deg)}.icon-arrow:before{content:"\\e697";display:inline-block;transform:rotate(180deg)}.icon-cell:before{content:"\\e654"}.icon-table:before{content:"\\eb0a"}.icon-next-step:before{content:"\\e6b4";display:inline-block;transform:rotateY(180deg)}.icon-grid:before{content:"\\e65c";display:inline-block;transform:rotate(90deg)}.icon-alignitems-stretch:before{content:"\\e67e"}.icon-alignitems-flexend:before{content:"\\e67f"}.icon-check:before{content:"\\e680"}.icon-auto:before{content:"\\e681"}.icon-config-event:before{content:"\\e66e"}.icon-calendar:before{content:"\\e683"}.icon-config-style:before{content:"\\e684"}.icon-copy:before{content:"\\e676"}.icon-config-advanced:before{content:"\\e686"}.icon-config-props:before{content:"\\e687"}.icon-delete-circle2:before{content:"\\e688"}.icon-delete-circle:before,.icon-delete2:before{content:"\\e689"}.icon-delete:before{content:"\\e68a"}.icon-direction-rowreverse:before{content:"\\e68b"}.icon-display-flex:before{content:"\\e68c"}.icon-dialog:before{content:"\\e66f"}.icon-drag:before{content:"\\e68e"}.icon-display-block:before{content:"\\e68f"}.icon-data:before{content:"\\e690"}.icon-edit2:before{content:"\\e691"}.icon-edit:before{content:"\\e692"}.icon-add-col:before{content:"\\e693"}.icon-display-inlineblock:before{content:"\\e694"}.icon-config-base:before{content:"\\e6bf"}.icon-config-validate:before{content:"\\e696"}.icon-down:before{content:"\\e697"}.icon-display-inline:before{content:"\\e698"}.icon-eye:before{content:"\\e699"}.icon-eye-close:before{content:"\\e69a"}.icon-import:before{content:"\\e6a6"}.icon-preview:before{content:"\\e69b"}.icon-flex-nowrap:before{content:"\\e69c"}.icon-folder:before{content:"\\e69d"}.icon-form-circle:before{content:"\\e69e"}.icon-flex-wrap:before{content:"\\e69f"}.icon-form:before{content:"\\e6a0"}.icon-form-item:before{content:"\\e6a1"}.icon-icon:before{content:"\\e6a2"}.icon-image:before{content:"\\e6a3"}.icon-justify-flexstart:before{content:"\\e6a4"}.icon-justify-center:before{content:"\\e6a5"}.icon-justify-spacearound:before{content:"\\e670"}.icon-justify-stretch:before{content:"\\e6a7"}.icon-link2:before{content:"\\e6a8"}.icon-justify-spacebetween:before{content:"\\e695"}.icon-minus:before{content:"\\e6aa"}.icon-menu2:before{content:"\\e6ab"}.icon-more:before{content:"\\e6ac"}.icon-menu:before{content:"\\e6ad"}.icon-language:before{content:"\\e6ae"}.icon-pad:before{content:"\\e6af"}.icon-mobile:before{content:"\\e6b0"}.icon-page-max:before{content:"\\e6b1"}.icon-move:before{content:"\\e6b2"}.icon-page-min:before{content:"\\e6b3"}.icon-pre-step:before{content:"\\e6b4"}.icon-pc:before{content:"\\e6b5"}.icon-page:before{content:"\\e6b6"}.icon-refresh:before{content:"\\e6b7"}.icon-radius:before{content:"\\e6b8"}.icon-save-filled:before{content:"\\e6b9"}.icon-question:before{content:"\\e6ba"}.icon-scroll:before{content:"\\e6bb"}.icon-script:before{content:"\\e6bc"}.icon-setting:before{content:"\\e6bd"}.icon-save-online:before,.icon-save:before{content:"\\e6be"}.icon-task-add:before{content:"\\e68d"}.icon-shadow:before{content:"\\e6c0"}.icon-variable:before{content:"\\e6c1"}.icon-yes:before{content:"\\e6c2"}.icon-shadow-inset:before{content:"\\e6c3"}.icon-date:before{content:"\\e642"}.icon-date-range:before{content:"\\e643"}.icon-collapse:before{content:"\\e644"}.icon-slider:before{content:"\\e665"}.icon-switch:before{content:"\\e646"}.icon-subform:before{content:"\\e647"}.icon-time-range:before{content:"\\e685"}.icon-tree-select:before{content:"\\e649"}.icon-value:before{content:"\\e64a"}.icon-table-form3:before{content:"\\e6a9"}.icon-alert:before{content:"\\e64c"}.icon-card:before{content:"\\e64d"}.icon-checkbox:before{content:"\\e64e"}.icon-cascader:before{content:"\\e64f"}.icon-button:before{content:"\\e650"}.icon-data-table:before{content:"\\e651"}.icon-group:before{content:"\\e652"}.icon-divider:before{content:"\\e653"}.icon-flex:before{content:"\\e654"}.icon-descriptions:before{content:"\\e655"}.icon-html:before{content:"\\e656"}.icon-editor:before{content:"\\e657"}.icon-input:before{content:"\\e658"}.icon-link:before{content:"\\e659"}.icon-password:before{content:"\\e65a"}.icon-radio:before{content:"\\e65b"}.icon-row:before{content:"\\e65c"}.icon-inline:before{content:"\\e65d"}.icon-rate:before{content:"\\e65e"}.icon-color:before{content:"\\e65f"}.icon-select:before{content:"\\e660"}.icon-json:before{content:"\\e661"}.icon-number:before{content:"\\e662"}.icon-space:before{content:"\\e664"}.icon-step-form:before{content:"\\e663"}.icon-table-form:before{content:"\\e666"}.icon-table-form2:before{content:"\\e667"}.icon-time:before{content:"\\e668"}.icon-span:before{content:"\\e669"}.icon-textarea:before{content:"\\e66a"}.icon-tooltip:before{content:"\\e66b"}.icon-slot:before{content:"\\e66c"}.icon-transfer:before{content:"\\e66d"}.icon-upload:before{content:"\\e673"}.icon-tag:before{content:"\\e671"}.icon-watermark:before{content:"\\e672"}.icon-tab:before{content:"\\e674"}.icon-tree:before{content:"\\e675"}.icon-table:before{content:"\\e677"}.icon-add-child:before{content:"\\e678"}.icon-add2:before{content:"\\e679"}.icon-add:before{content:"\\e67a"}.icon-alignitems-baseline:before{content:"\\e67b"}.icon-add-circle:before{content:"\\e67c"}.icon-alignitems-center:before{content:"\\e67d"}')),document.head.appendChild(e)}}catch(o){console.error("vite-plugin-css-injected-by-js",o)}})();
|
|
var zo = Object.defineProperty;
|
|
var Uo = (n, e, t) => e in n ? zo(n, e, { enumerable: !0, configurable: !0, writable: !0, value: t }) : n[e] = t;
|
|
var $e = (n, e, t) => (Uo(n, typeof e != "symbol" ? e + "" : e, t), t);
|
|
import { defineComponent as he, reactive as Be, markRaw as Te, nextTick as je, createVNode as H, ref as Ot, toRef as De, watch as ze, computed as at, Fragment as Ke, resolveComponent as K, mergeProps as Pe, isVNode as Ir, getCurrentInstance as vr, provide as qo, inject as Go, toRefs as Ai, onBeforeMount as Ho, watchEffect as Wo, onMounted as Yo, onBeforeUnmount as Xo, onUpdated as Jo, withDirectives as $a, createApp as Ko, h as qe, openBlock as ee, createElementBlock as me, resolveDirective as Sa, createElementVNode as Me, withCtx as Ce, renderList as un, createBlock as Re, createTextVNode as He, toDisplayString as Ve, resolveDynamicComponent as Ft, createCommentVNode as dt, onUnmounted as Oa, normalizeClass as Yt, normalizeStyle as Ea, renderSlot as Tn, createSlots as xa, shallowRef as Di } from "vue";
|
|
import { showNotify as Ca, Field as Ri } from "vant";
|
|
import { ElMessage as ka } from "element-plus";
|
|
/*!
|
|
* @form-create/vant v3.2.22
|
|
* (c) 2018-2025 xaboy
|
|
* Github https://github.com/xaboy/form-create
|
|
* Released under the MIT License.
|
|
*/
|
|
var Zo = "fcSubForm", Qo = he({
|
|
name: Zo,
|
|
props: {
|
|
rule: Array,
|
|
options: {
|
|
type: Object,
|
|
default: function() {
|
|
return Be({
|
|
submitBtn: !1,
|
|
resetBtn: !1
|
|
});
|
|
}
|
|
},
|
|
modelValue: {
|
|
type: Object,
|
|
default: function() {
|
|
return {};
|
|
}
|
|
},
|
|
disabled: {
|
|
type: Boolean,
|
|
default: !1
|
|
},
|
|
syncDisabled: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
formCreateInject: Object
|
|
},
|
|
data: function() {
|
|
return {
|
|
cacheValue: {},
|
|
subApi: {},
|
|
form: Te(this.formCreateInject.form.$form())
|
|
};
|
|
},
|
|
emits: ["fc:subform", "update:modelValue", "change", "itemMounted"],
|
|
watch: {
|
|
modelValue: function(e) {
|
|
this.setValue(e);
|
|
}
|
|
},
|
|
methods: {
|
|
formData: function(e) {
|
|
this.cacheValue = JSON.stringify(e), this.$emit("update:modelValue", e), this.$emit("change", e);
|
|
},
|
|
setValue: function(e) {
|
|
var t = JSON.stringify(e);
|
|
this.cacheValue !== t && (this.cacheValue = t, this.subApi.coverValue(e || {}));
|
|
},
|
|
add$f: function(e) {
|
|
var t = this;
|
|
this.subApi = e, je(function() {
|
|
t.$emit("itemMounted", e);
|
|
});
|
|
}
|
|
},
|
|
render: function() {
|
|
var e = this.form;
|
|
return H(e, {
|
|
disabled: this.disabled,
|
|
"onUpdate:modelValue": this.formData,
|
|
modelValue: this.modelValue,
|
|
"onEmit-event": this.$emit,
|
|
"onUpdate:api": this.add$f,
|
|
rule: this.rule,
|
|
option: this.options,
|
|
extendOption: !0
|
|
}, null);
|
|
}
|
|
});
|
|
function Pi(n, e) {
|
|
var t = Object.keys(n);
|
|
if (Object.getOwnPropertySymbols) {
|
|
var r = Object.getOwnPropertySymbols(n);
|
|
e && (r = r.filter(function(i) {
|
|
return Object.getOwnPropertyDescriptor(n, i).enumerable;
|
|
})), t.push.apply(t, r);
|
|
}
|
|
return t;
|
|
}
|
|
function W(n) {
|
|
for (var e = 1; e < arguments.length; e++) {
|
|
var t = arguments[e] != null ? arguments[e] : {};
|
|
e % 2 ? Pi(Object(t), !0).forEach(function(r) {
|
|
Le(n, r, t[r]);
|
|
}) : Object.getOwnPropertyDescriptors ? Object.defineProperties(n, Object.getOwnPropertyDescriptors(t)) : Pi(Object(t)).forEach(function(r) {
|
|
Object.defineProperty(n, r, Object.getOwnPropertyDescriptor(t, r));
|
|
});
|
|
}
|
|
return n;
|
|
}
|
|
function pe(n) {
|
|
return typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? pe = function(e) {
|
|
return typeof e;
|
|
} : pe = function(e) {
|
|
return e && typeof Symbol == "function" && e.constructor === Symbol && e !== Symbol.prototype ? "symbol" : typeof e;
|
|
}, pe(n);
|
|
}
|
|
function es(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function Le(n, e, t) {
|
|
return e in n ? Object.defineProperty(n, e, {
|
|
value: t,
|
|
enumerable: !0,
|
|
configurable: !0,
|
|
writable: !0
|
|
}) : n[e] = t, n;
|
|
}
|
|
function ts(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function");
|
|
n.prototype = Object.create(e && e.prototype, {
|
|
constructor: {
|
|
value: n,
|
|
writable: !0,
|
|
configurable: !0
|
|
}
|
|
}), e && yr(n, e);
|
|
}
|
|
function jn(n) {
|
|
return jn = Object.setPrototypeOf ? Object.getPrototypeOf : function(t) {
|
|
return t.__proto__ || Object.getPrototypeOf(t);
|
|
}, jn(n);
|
|
}
|
|
function yr(n, e) {
|
|
return yr = Object.setPrototypeOf || function(r, i) {
|
|
return r.__proto__ = i, r;
|
|
}, yr(n, e);
|
|
}
|
|
function ns() {
|
|
if (typeof Reflect > "u" || !Reflect.construct || Reflect.construct.sham)
|
|
return !1;
|
|
if (typeof Proxy == "function")
|
|
return !0;
|
|
try {
|
|
return Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function() {
|
|
})), !0;
|
|
} catch {
|
|
return !1;
|
|
}
|
|
}
|
|
function rs(n) {
|
|
if (n === void 0)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return n;
|
|
}
|
|
function is(n, e) {
|
|
if (e && (typeof e == "object" || typeof e == "function"))
|
|
return e;
|
|
if (e !== void 0)
|
|
throw new TypeError("Derived constructors may only return object or undefined");
|
|
return rs(n);
|
|
}
|
|
function as(n) {
|
|
var e = ns();
|
|
return function() {
|
|
var r = jn(n), i;
|
|
if (e) {
|
|
var a = jn(this).constructor;
|
|
i = Reflect.construct(r, arguments, a);
|
|
} else
|
|
i = r.apply(this, arguments);
|
|
return is(this, i);
|
|
};
|
|
}
|
|
function os(n, e) {
|
|
return us(n) || cs(n, e) || Aa(n, e) || ds();
|
|
}
|
|
function le(n) {
|
|
return ss(n) || ls(n) || Aa(n) || fs();
|
|
}
|
|
function ss(n) {
|
|
if (Array.isArray(n))
|
|
return _r(n);
|
|
}
|
|
function us(n) {
|
|
if (Array.isArray(n))
|
|
return n;
|
|
}
|
|
function ls(n) {
|
|
if (typeof Symbol < "u" && n[Symbol.iterator] != null || n["@@iterator"] != null)
|
|
return Array.from(n);
|
|
}
|
|
function cs(n, e) {
|
|
var t = n == null ? null : typeof Symbol < "u" && n[Symbol.iterator] || n["@@iterator"];
|
|
if (t != null) {
|
|
var r = [], i = !0, a = !1, o, s;
|
|
try {
|
|
for (t = t.call(n); !(i = (o = t.next()).done) && (r.push(o.value), !(e && r.length === e)); i = !0)
|
|
;
|
|
} catch (u) {
|
|
a = !0, s = u;
|
|
} finally {
|
|
try {
|
|
!i && t.return != null && t.return();
|
|
} finally {
|
|
if (a)
|
|
throw s;
|
|
}
|
|
}
|
|
return r;
|
|
}
|
|
}
|
|
function Aa(n, e) {
|
|
if (!!n) {
|
|
if (typeof n == "string")
|
|
return _r(n, e);
|
|
var t = Object.prototype.toString.call(n).slice(8, -1);
|
|
if (t === "Object" && n.constructor && (t = n.constructor.name), t === "Map" || t === "Set")
|
|
return Array.from(n);
|
|
if (t === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(t))
|
|
return _r(n, e);
|
|
}
|
|
}
|
|
function _r(n, e) {
|
|
(e == null || e > n.length) && (e = n.length);
|
|
for (var t = 0, r = new Array(e); t < e; t++)
|
|
r[t] = n[t];
|
|
return r;
|
|
}
|
|
function fs() {
|
|
throw new TypeError(`Invalid attempt to spread non-iterable instance.
|
|
In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`);
|
|
}
|
|
function ds() {
|
|
throw new TypeError(`Invalid attempt to destructure non-iterable instance.
|
|
In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`);
|
|
}
|
|
var F = {
|
|
type: function(e, t) {
|
|
return Object.prototype.toString.call(e) === "[object " + t + "]";
|
|
},
|
|
Undef: function(e) {
|
|
return e == null;
|
|
},
|
|
Element: function(e) {
|
|
return pe(e) === "object" && e !== null && e.nodeType === 1 && !F.Object(e);
|
|
},
|
|
trueArray: function(e) {
|
|
return Array.isArray(e) && e.length > 0;
|
|
},
|
|
Function: function(e) {
|
|
var t = this.getType(e);
|
|
return t === "Function" || t === "AsyncFunction";
|
|
},
|
|
getType: function(e) {
|
|
var t = Object.prototype.toString.call(e);
|
|
return /^\[object (.*)\]$/.exec(t)[1];
|
|
},
|
|
empty: function(e) {
|
|
return e == null || Array.isArray(e) && Array.isArray(e) && !e.length ? !0 : typeof e == "string" && !e;
|
|
}
|
|
};
|
|
["Date", "Object", "String", "Boolean", "Array", "Number"].forEach(function(n) {
|
|
F[n] = function(e) {
|
|
return F.type(e, n);
|
|
};
|
|
});
|
|
function Se(n, e) {
|
|
return {}.hasOwnProperty.call(n, e);
|
|
}
|
|
var hs = typeof globalThis < "u" ? globalThis : typeof window < "u" ? window : typeof global < "u" ? global : typeof self < "u" ? self : {}, Da = { exports: {} };
|
|
(function(n, e) {
|
|
(function(t, r) {
|
|
n.exports = r();
|
|
})(hs, function() {
|
|
var t = 1e3, r = 6e4, i = 36e5, a = "millisecond", o = "second", s = "minute", u = "hour", c = "day", l = "week", h = "month", m = "quarter", w = "year", $ = "date", S = "Invalid Date", T = /^(\d{4})[-/]?(\d{1,2})?[-/]?(\d{0,2})[Tt\s]*(\d{1,2})?:?(\d{1,2})?:?(\d{1,2})?[.:]?(\d+)?$/, U = /\[([^\]]+)]|Y{1,4}|M{1,4}|D{1,2}|d{1,4}|H{1,2}|h{1,2}|a|A|m{1,2}|s{1,2}|Z{1,2}|SSS/g, z = {
|
|
name: "en",
|
|
weekdays: "Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"),
|
|
months: "January_February_March_April_May_June_July_August_September_October_November_December".split("_"),
|
|
ordinal: function(b) {
|
|
var y = ["th", "st", "nd", "rd"], d = b % 100;
|
|
return "[" + b + (y[(d - 20) % 10] || y[d] || y[0]) + "]";
|
|
}
|
|
}, B = function(b, y, d) {
|
|
var f = String(b);
|
|
return !f || f.length >= y ? b : "" + Array(y + 1 - f.length).join(d) + b;
|
|
}, Z = {
|
|
s: B,
|
|
z: function(b) {
|
|
var y = -b.utcOffset(), d = Math.abs(y), f = Math.floor(d / 60), p = d % 60;
|
|
return (y <= 0 ? "+" : "-") + B(f, 2, "0") + ":" + B(p, 2, "0");
|
|
},
|
|
m: function k(b, y) {
|
|
if (b.date() < y.date())
|
|
return -k(y, b);
|
|
var d = 12 * (y.year() - b.year()) + (y.month() - b.month()), f = b.clone().add(d, h), p = y - f < 0, v = b.clone().add(d + (p ? -1 : 1), h);
|
|
return +(-(d + (y - f) / (p ? f - v : v - f)) || 0);
|
|
},
|
|
a: function(b) {
|
|
return b < 0 ? Math.ceil(b) || 0 : Math.floor(b);
|
|
},
|
|
p: function(b) {
|
|
return {
|
|
M: h,
|
|
y: w,
|
|
w: l,
|
|
d: c,
|
|
D: $,
|
|
h: u,
|
|
m: s,
|
|
s: o,
|
|
ms: a,
|
|
Q: m
|
|
}[b] || String(b || "").toLowerCase().replace(/s$/, "");
|
|
},
|
|
u: function(b) {
|
|
return b === void 0;
|
|
}
|
|
}, Q = "en", q = {};
|
|
q[Q] = z;
|
|
var ce = "$isDayjsObject", re = function(b) {
|
|
return b instanceof Oe || !(!b || !b[ce]);
|
|
}, ae = function k(b, y, d) {
|
|
var f;
|
|
if (!b)
|
|
return Q;
|
|
if (typeof b == "string") {
|
|
var p = b.toLowerCase();
|
|
q[p] && (f = p), y && (q[p] = y, f = p);
|
|
var v = b.split("-");
|
|
if (!f && v.length > 1)
|
|
return k(v[0]);
|
|
} else {
|
|
var g = b.name;
|
|
q[g] = b, f = g;
|
|
}
|
|
return !d && f && (Q = f), f || !d && Q;
|
|
}, J = function(b, y) {
|
|
if (re(b))
|
|
return b.clone();
|
|
var d = pe(y) == "object" ? y : {};
|
|
return d.date = b, d.args = arguments, new Oe(d);
|
|
}, G = Z;
|
|
G.l = ae, G.i = re, G.w = function(k, b) {
|
|
return J(k, {
|
|
locale: b.$L,
|
|
utc: b.$u,
|
|
x: b.$x,
|
|
$offset: b.$offset
|
|
});
|
|
};
|
|
var Oe = function() {
|
|
function k(y) {
|
|
this.$L = ae(y.locale, null, !0), this.parse(y), this.$x = this.$x || y.x || {}, this[ce] = !0;
|
|
}
|
|
var b = k.prototype;
|
|
return b.parse = function(y) {
|
|
this.$d = function(d) {
|
|
var f = d.date, p = d.utc;
|
|
if (f === null)
|
|
return new Date(NaN);
|
|
if (G.u(f))
|
|
return new Date();
|
|
if (f instanceof Date)
|
|
return new Date(f);
|
|
if (typeof f == "string" && !/Z$/i.test(f)) {
|
|
var v = f.match(T);
|
|
if (v) {
|
|
var g = v[2] - 1 || 0, x = (v[7] || "0").substring(0, 3);
|
|
return p ? new Date(Date.UTC(v[1], g, v[3] || 1, v[4] || 0, v[5] || 0, v[6] || 0, x)) : new Date(v[1], g, v[3] || 1, v[4] || 0, v[5] || 0, v[6] || 0, x);
|
|
}
|
|
}
|
|
return new Date(f);
|
|
}(y), this.init();
|
|
}, b.init = function() {
|
|
var y = this.$d;
|
|
this.$y = y.getFullYear(), this.$M = y.getMonth(), this.$D = y.getDate(), this.$W = y.getDay(), this.$H = y.getHours(), this.$m = y.getMinutes(), this.$s = y.getSeconds(), this.$ms = y.getMilliseconds();
|
|
}, b.$utils = function() {
|
|
return G;
|
|
}, b.isValid = function() {
|
|
return this.$d.toString() !== S;
|
|
}, b.isSame = function(y, d) {
|
|
var f = J(y);
|
|
return this.startOf(d) <= f && f <= this.endOf(d);
|
|
}, b.isAfter = function(y, d) {
|
|
return J(y) < this.startOf(d);
|
|
}, b.isBefore = function(y, d) {
|
|
return this.endOf(d) < J(y);
|
|
}, b.$g = function(y, d, f) {
|
|
return G.u(y) ? this[d] : this.set(f, y);
|
|
}, b.unix = function() {
|
|
return Math.floor(this.valueOf() / 1e3);
|
|
}, b.valueOf = function() {
|
|
return this.$d.getTime();
|
|
}, b.startOf = function(y, d) {
|
|
var f = this, p = !!G.u(d) || d, v = G.p(y), g = function(C, D) {
|
|
var _ = G.w(f.$u ? Date.UTC(f.$y, D, C) : new Date(f.$y, D, C), f);
|
|
return p ? _ : _.endOf(c);
|
|
}, x = function(C, D) {
|
|
return G.w(f.toDate()[C].apply(f.toDate("s"), (p ? [0, 0, 0, 0] : [23, 59, 59, 999]).slice(D)), f);
|
|
}, M = this.$W, P = this.$M, N = this.$D, I = "set" + (this.$u ? "UTC" : "");
|
|
switch (v) {
|
|
case w:
|
|
return p ? g(1, 0) : g(31, 11);
|
|
case h:
|
|
return p ? g(1, P) : g(0, P + 1);
|
|
case l:
|
|
var V = this.$locale().weekStart || 0, L = (M < V ? M + 7 : M) - V;
|
|
return g(p ? N - L : N + (6 - L), P);
|
|
case c:
|
|
case $:
|
|
return x(I + "Hours", 0);
|
|
case u:
|
|
return x(I + "Minutes", 1);
|
|
case s:
|
|
return x(I + "Seconds", 2);
|
|
case o:
|
|
return x(I + "Milliseconds", 3);
|
|
default:
|
|
return this.clone();
|
|
}
|
|
}, b.endOf = function(y) {
|
|
return this.startOf(y, !1);
|
|
}, b.$set = function(y, d) {
|
|
var f, p = G.p(y), v = "set" + (this.$u ? "UTC" : ""), g = (f = {}, f[c] = v + "Date", f[$] = v + "Date", f[h] = v + "Month", f[w] = v + "FullYear", f[u] = v + "Hours", f[s] = v + "Minutes", f[o] = v + "Seconds", f[a] = v + "Milliseconds", f)[p], x = p === c ? this.$D + (d - this.$W) : d;
|
|
if (p === h || p === w) {
|
|
var M = this.clone().set($, 1);
|
|
M.$d[g](x), M.init(), this.$d = M.set($, Math.min(this.$D, M.daysInMonth())).$d;
|
|
} else
|
|
g && this.$d[g](x);
|
|
return this.init(), this;
|
|
}, b.set = function(y, d) {
|
|
return this.clone().$set(y, d);
|
|
}, b.get = function(y) {
|
|
return this[G.p(y)]();
|
|
}, b.add = function(y, d) {
|
|
var f, p = this;
|
|
y = Number(y);
|
|
var v = G.p(d), g = function(N) {
|
|
var I = J(p);
|
|
return G.w(I.date(I.date() + Math.round(N * y)), p);
|
|
};
|
|
if (v === h)
|
|
return this.set(h, this.$M + y);
|
|
if (v === w)
|
|
return this.set(w, this.$y + y);
|
|
if (v === c)
|
|
return g(1);
|
|
if (v === l)
|
|
return g(7);
|
|
var x = (f = {}, f[s] = r, f[u] = i, f[o] = t, f)[v] || 1, M = this.$d.getTime() + y * x;
|
|
return G.w(M, this);
|
|
}, b.subtract = function(y, d) {
|
|
return this.add(-1 * y, d);
|
|
}, b.format = function(y) {
|
|
var d = this, f = this.$locale();
|
|
if (!this.isValid())
|
|
return f.invalidDate || S;
|
|
var p = y || "YYYY-MM-DDTHH:mm:ssZ", v = G.z(this), g = this.$H, x = this.$m, M = this.$M, P = f.weekdays, N = f.months, I = f.meridiem, V = function(D, _, E, O) {
|
|
return D && (D[_] || D(d, p)) || E[_].slice(0, O);
|
|
}, L = function(D) {
|
|
return G.s(g % 12 || 12, D, "0");
|
|
}, A = I || function(C, D, _) {
|
|
var E = C < 12 ? "AM" : "PM";
|
|
return _ ? E.toLowerCase() : E;
|
|
};
|
|
return p.replace(U, function(C, D) {
|
|
return D || function(_) {
|
|
switch (_) {
|
|
case "YY":
|
|
return String(d.$y).slice(-2);
|
|
case "YYYY":
|
|
return G.s(d.$y, 4, "0");
|
|
case "M":
|
|
return M + 1;
|
|
case "MM":
|
|
return G.s(M + 1, 2, "0");
|
|
case "MMM":
|
|
return V(f.monthsShort, M, N, 3);
|
|
case "MMMM":
|
|
return V(N, M);
|
|
case "D":
|
|
return d.$D;
|
|
case "DD":
|
|
return G.s(d.$D, 2, "0");
|
|
case "d":
|
|
return String(d.$W);
|
|
case "dd":
|
|
return V(f.weekdaysMin, d.$W, P, 2);
|
|
case "ddd":
|
|
return V(f.weekdaysShort, d.$W, P, 3);
|
|
case "dddd":
|
|
return P[d.$W];
|
|
case "H":
|
|
return String(g);
|
|
case "HH":
|
|
return G.s(g, 2, "0");
|
|
case "h":
|
|
return L(1);
|
|
case "hh":
|
|
return L(2);
|
|
case "a":
|
|
return A(g, x, !0);
|
|
case "A":
|
|
return A(g, x, !1);
|
|
case "m":
|
|
return String(x);
|
|
case "mm":
|
|
return G.s(x, 2, "0");
|
|
case "s":
|
|
return String(d.$s);
|
|
case "ss":
|
|
return G.s(d.$s, 2, "0");
|
|
case "SSS":
|
|
return G.s(d.$ms, 3, "0");
|
|
case "Z":
|
|
return v;
|
|
}
|
|
return null;
|
|
}(C) || v.replace(":", "");
|
|
});
|
|
}, b.utcOffset = function() {
|
|
return 15 * -Math.round(this.$d.getTimezoneOffset() / 15);
|
|
}, b.diff = function(y, d, f) {
|
|
var p, v = this, g = G.p(d), x = J(y), M = (x.utcOffset() - this.utcOffset()) * r, P = this - x, N = function() {
|
|
return G.m(v, x);
|
|
};
|
|
switch (g) {
|
|
case w:
|
|
p = N() / 12;
|
|
break;
|
|
case h:
|
|
p = N();
|
|
break;
|
|
case m:
|
|
p = N() / 3;
|
|
break;
|
|
case l:
|
|
p = (P - M) / 6048e5;
|
|
break;
|
|
case c:
|
|
p = (P - M) / 864e5;
|
|
break;
|
|
case u:
|
|
p = P / i;
|
|
break;
|
|
case s:
|
|
p = P / r;
|
|
break;
|
|
case o:
|
|
p = P / t;
|
|
break;
|
|
default:
|
|
p = P;
|
|
}
|
|
return f ? p : G.a(p);
|
|
}, b.daysInMonth = function() {
|
|
return this.endOf(h).$D;
|
|
}, b.$locale = function() {
|
|
return q[this.$L];
|
|
}, b.locale = function(y, d) {
|
|
if (!y)
|
|
return this.$L;
|
|
var f = this.clone(), p = ae(y, d, !0);
|
|
return p && (f.$L = p), f;
|
|
}, b.clone = function() {
|
|
return G.w(this.$d, this);
|
|
}, b.toDate = function() {
|
|
return new Date(this.valueOf());
|
|
}, b.toJSON = function() {
|
|
return this.isValid() ? this.toISOString() : null;
|
|
}, b.toISOString = function() {
|
|
return this.$d.toISOString();
|
|
}, b.toString = function() {
|
|
return this.$d.toUTCString();
|
|
}, k;
|
|
}(), Ye = Oe.prototype;
|
|
return J.prototype = Ye, [["$ms", a], ["$s", o], ["$m", s], ["$H", u], ["$W", c], ["$M", h], ["$y", w], ["$D", $]].forEach(function(k) {
|
|
Ye[k[1]] = function(b) {
|
|
return this.$g(b, k[0], k[1]);
|
|
};
|
|
}), J.extend = function(k, b) {
|
|
return k.$i || (k(b, Oe, J), k.$i = !0), J;
|
|
}, J.locale = ae, J.isDayjs = re, J.unix = function(k) {
|
|
return J(1e3 * k);
|
|
}, J.en = q[Q], J.Ls = q, J.p = {}, J;
|
|
});
|
|
})(Da);
|
|
var Ht = Da.exports, ps = "fcCalendar", ms = he({
|
|
name: ps,
|
|
inheritAttrs: !1,
|
|
props: {
|
|
placeholder: String,
|
|
formCreateInject: Object,
|
|
disabled: Boolean,
|
|
clearable: Boolean,
|
|
type: String,
|
|
modelValue: [String, Array],
|
|
minDate: [String, Date],
|
|
maxDate: [String, Date]
|
|
},
|
|
emits: ["update:modelValue", "change", "fc.el"],
|
|
setup: function(e, t) {
|
|
var r = Ot(!1), i = De(e, "modelValue"), a = De(e, "formCreateInject"), o = Ot(i.value);
|
|
ze(function() {
|
|
return i.value;
|
|
}, function($) {
|
|
o.value = $;
|
|
});
|
|
var s = function(S) {
|
|
return Ht(S).format("YYYY-MM-DD");
|
|
}, u = function(S) {
|
|
return Ht(S).toDate();
|
|
}, c = at(function() {
|
|
var $ = i.value;
|
|
return Array.isArray($) ? $.map(u) : $ ? u($) : null;
|
|
}), l = at(function() {
|
|
return {
|
|
minDate: e.minDate ? Ht(e.minDate).toDate() : void 0,
|
|
maxDate: e.maxDate ? Ht(e.maxDate).toDate() : void 0
|
|
};
|
|
}), h = function(S) {
|
|
Array.isArray(S) ? o.value = S.map(s) : S ? o.value = s(S) : o.value = S;
|
|
}, m = function() {
|
|
t.emit("update:modelValue", o.value), t.emit("change", o.value);
|
|
}, w = {
|
|
range: function() {
|
|
return o.value.length ? o.value.join(" - ") : "";
|
|
},
|
|
multiple: function() {
|
|
return o.value.length ? a.value.t("selectedData", {
|
|
length: o.value.length
|
|
}) || "\u9009\u62E9\u4E86 ".concat(o.value.length, " \u4E2A\u65E5\u671F") : "";
|
|
}
|
|
};
|
|
return {
|
|
show: r,
|
|
inputValue: o,
|
|
defaultDate: c,
|
|
dateRange: l,
|
|
open: function() {
|
|
e.disabled || (r.value = !0);
|
|
},
|
|
confirm: function(S) {
|
|
h(S), r.value = !1, m();
|
|
},
|
|
getStrValue: function() {
|
|
return o.value ? Se(w, e.type) ? w[e.type]() : o.value || "" : "";
|
|
},
|
|
clear: function(S) {
|
|
S.stopPropagation();
|
|
var T = Array.isArray(o.value) ? [] : "";
|
|
h(T), m();
|
|
}
|
|
};
|
|
},
|
|
render: function() {
|
|
var e = this, t = function() {
|
|
return e.$props.clearable && !F.empty(e.inputValue) ? H("i", {
|
|
class: "van-badge__wrapper van-icon van-icon-clear van-field__clear",
|
|
onClick: e.clear
|
|
}, null) : void 0;
|
|
};
|
|
return H(Ke, null, [H(K("van-field"), {
|
|
ref: "el",
|
|
placeholder: this.placeholder,
|
|
readonly: !0,
|
|
disabled: this.$props.disabled,
|
|
onClick: this.open,
|
|
"model-value": this.getStrValue(),
|
|
isLink: !0,
|
|
border: !1
|
|
}, {
|
|
"right-icon": t
|
|
}), H(K("van-calendar"), Pe(W(W({}, this.$attrs), this.dateRange), {
|
|
show: this.show,
|
|
"onUpdate:show": function(i) {
|
|
return e.show = i;
|
|
},
|
|
type: this.type,
|
|
onConfirm: this.confirm,
|
|
defaultDate: this.defaultDate
|
|
}), null)]);
|
|
},
|
|
mounted: function() {
|
|
this.$emit("fc.el", this.$refs.el);
|
|
}
|
|
}), gs = "fcCascader", vs = he({
|
|
name: gs,
|
|
inheritAttrs: !1,
|
|
props: {
|
|
placeholder: String,
|
|
disabled: Boolean,
|
|
clearable: Boolean,
|
|
fieldNames: Object,
|
|
modelValue: [String, Number],
|
|
options: Array,
|
|
minDate: [String, Date],
|
|
maxDate: [String, Date]
|
|
},
|
|
emits: ["update:modelValue", "fc.el", "change"],
|
|
setup: function(e, t) {
|
|
var r = Ot(!1), i = De(e, "modelValue"), a = De(e, "options"), o = De(e, "fieldNames", {}), s = function h(m, w, $) {
|
|
for (var S = 0; S < m.length; S++) {
|
|
if (m[S][o.value.value || "value"] === w)
|
|
return [].concat(le($), [m[S]]);
|
|
if (m[S][o.value.children || "children"]) {
|
|
var T = h(m[S][o.value.children || "children"], w, [].concat(le($), [m[S]]));
|
|
if (T)
|
|
return T;
|
|
}
|
|
}
|
|
}, u = function(m) {
|
|
if (m == null || m === "")
|
|
return "";
|
|
var w = s(a.value, m, []);
|
|
return w ? w.map(function($) {
|
|
return $[o.value.text || "text"];
|
|
}).join(" / ") : m;
|
|
}, c = Ot(u(i.value));
|
|
ze(function() {
|
|
return i.value;
|
|
}, function(h) {
|
|
c.value = u(h);
|
|
}), ze(function() {
|
|
return a.value;
|
|
}, function() {
|
|
i.value != null && i.value !== "" && (c.value = u(i.value));
|
|
}, {
|
|
deep: !0
|
|
});
|
|
var l = function(m) {
|
|
t.emit("update:modelValue", m), t.emit("change", m);
|
|
};
|
|
return {
|
|
show: r,
|
|
inputValue: c,
|
|
options: a,
|
|
open: function() {
|
|
e.disabled || (r.value = !0);
|
|
},
|
|
confirm: function(m) {
|
|
var w = m.selectedOptions, $ = m.value;
|
|
c.value = w.map(function(S) {
|
|
return S[o.value.text || "text"];
|
|
}).join(" / "), r.value = !1, l($);
|
|
},
|
|
clear: function(m) {
|
|
m.stopPropagation(), c.value = "", l("");
|
|
}
|
|
};
|
|
},
|
|
render: function() {
|
|
var e = this, t = function() {
|
|
return e.$props.clearable && e.inputValue ? H("i", {
|
|
class: "van-badge__wrapper van-icon van-icon-clear van-field__clear",
|
|
onClick: e.clear
|
|
}, null) : void 0;
|
|
};
|
|
return H(Ke, null, [H(K("van-field"), {
|
|
ref: "el",
|
|
placeholder: this.placeholder,
|
|
readonly: !0,
|
|
disabled: this.$props.disabled,
|
|
onClick: this.open,
|
|
"model-value": this.inputValue,
|
|
border: !1,
|
|
isLink: !0
|
|
}, {
|
|
"right-icon": t
|
|
}), H(K("van-popup"), {
|
|
show: this.show,
|
|
"onUpdate:show": function(i) {
|
|
return e.show = i;
|
|
},
|
|
round: !0,
|
|
position: "bottom"
|
|
}, {
|
|
default: function() {
|
|
return [H(K("van-cascader"), Pe(e.$attrs, {
|
|
modelValue: e.modelValue,
|
|
fieldNames: e.fieldNames,
|
|
options: e.options,
|
|
onClose: function() {
|
|
return e.show = !1;
|
|
},
|
|
onFinish: e.confirm
|
|
}), null)];
|
|
}
|
|
})]);
|
|
},
|
|
mounted: function() {
|
|
this.$emit("fc.el", this.$refs.el);
|
|
}
|
|
});
|
|
function ys(n) {
|
|
return typeof n == "function" || Object.prototype.toString.call(n) === "[object Object]" && !Ir(n);
|
|
}
|
|
var _s = "fcCheckbox", bs = he({
|
|
name: _s,
|
|
inheritAttrs: !1,
|
|
props: {
|
|
modelValue: Array,
|
|
options: Array
|
|
},
|
|
emits: ["update:modelValue", "change"],
|
|
setup: function(e, t) {
|
|
var r = De(e, "modelValue", []), i = De(e, "options");
|
|
return {
|
|
options: i,
|
|
modelValue: r,
|
|
onInput: function(o) {
|
|
t.emit("update:modelValue", o), t.emit("change", o);
|
|
}
|
|
};
|
|
},
|
|
render: function() {
|
|
var e;
|
|
return H(K("van-checkbox-group"), Pe({
|
|
direction: "horizontal"
|
|
}, this.$attrs, {
|
|
modelValue: Array.isArray(this.modelValue) ? this.modelValue : [],
|
|
"onUpdate:modelValue": this.onInput
|
|
}), ys(e = (this.options || []).map(function(t) {
|
|
var r = W({}, t), i = t.text, a = t.value;
|
|
return delete r.text, delete r.value, H(K("van-checkbox"), Pe({
|
|
name: a,
|
|
shape: "square"
|
|
}, r), {
|
|
default: function() {
|
|
return [i || t.label || a];
|
|
}
|
|
});
|
|
})) ? e : {
|
|
default: function() {
|
|
return [e];
|
|
}
|
|
});
|
|
}
|
|
}), ws = "fcSelect", $s = he({
|
|
name: ws,
|
|
inheritAttrs: !1,
|
|
props: {
|
|
disabled: Boolean,
|
|
placeholder: String,
|
|
columnsFieldNames: Object,
|
|
modelValue: [String, Number],
|
|
options: Array
|
|
},
|
|
emits: ["update:modelValue", "fc.el", "change"],
|
|
setup: function(e, t) {
|
|
var r = Ot(!1), i = De(e, "modelValue"), a = De(e, "options"), o = De(e, "columnsFieldNames", {}), s = at(function() {
|
|
if (i.value == null || i.value === "")
|
|
return "";
|
|
for (var c = 0; c < (a.value || []).length; c++)
|
|
if (a.value[c][o.value.value || "value"] === i.value)
|
|
return a.value[c][o.value.text || "text"];
|
|
return i.value;
|
|
}), u = function(l) {
|
|
t.emit("update:modelValue", l), t.emit("change", l);
|
|
};
|
|
return {
|
|
show: r,
|
|
inputValue: s,
|
|
options: a,
|
|
open: function() {
|
|
e.disabled || (r.value = !0);
|
|
},
|
|
confirm: function(l) {
|
|
var h = l.selectedValues;
|
|
u(h[0]), r.value = !1;
|
|
}
|
|
};
|
|
},
|
|
render: function() {
|
|
var e = this;
|
|
return H(Ke, null, [H(K("van-field"), {
|
|
ref: "el",
|
|
placeholder: this.placeholder,
|
|
readonly: !0,
|
|
disabled: this.$props.disabled,
|
|
onClick: this.open,
|
|
"model-value": this.inputValue,
|
|
isLink: !0
|
|
}, null), H(K("van-popup"), {
|
|
show: this.show,
|
|
"onUpdate:show": function(r) {
|
|
return e.show = r;
|
|
},
|
|
round: !0,
|
|
position: "bottom"
|
|
}, {
|
|
default: function() {
|
|
return [H(K("van-picker"), Pe(e.$attrs, {
|
|
modelValue: [e.modelValue],
|
|
columnsFieldNames: e.columnsFieldNames,
|
|
columns: e.options,
|
|
onCancel: function() {
|
|
return e.show = !1;
|
|
},
|
|
onConfirm: e.confirm
|
|
}), null)];
|
|
}
|
|
})]);
|
|
},
|
|
mounted: function() {
|
|
this.$emit("fc.el", this.$refs.el);
|
|
}
|
|
});
|
|
function Tt(n) {
|
|
return Array.isArray(n) ? n : [null, void 0, ""].indexOf(n) > -1 ? [] : [n];
|
|
}
|
|
var Ss = "fcUploader";
|
|
function Mi(n, e) {
|
|
return pe(n) === "object" ? n : {
|
|
url: n,
|
|
is_string: !0,
|
|
name: Os(n),
|
|
uid: e
|
|
};
|
|
}
|
|
function Ti(n) {
|
|
return W(W({}, n), {}, {
|
|
file: n,
|
|
value: n
|
|
});
|
|
}
|
|
function Os(n) {
|
|
return ("" + n).split("/").pop();
|
|
}
|
|
var Es = he({
|
|
name: Ss,
|
|
inheritAttrs: !1,
|
|
props: {
|
|
formCreateInject: Object,
|
|
modelValue: [Array, String, Object],
|
|
afterRead: Function,
|
|
action: String,
|
|
headers: Object,
|
|
method: String,
|
|
data: Object,
|
|
uploadName: String,
|
|
onSuccess: Function,
|
|
onError: Function,
|
|
maxCount: Number
|
|
},
|
|
emits: ["update:modelValue", "delete"],
|
|
setup: function(e, t) {
|
|
var r = De(e, "afterRead"), i = De(e, "modelValue", []), a = Ot(Tt(i.value).map(Mi).map(Ti));
|
|
ze(function() {
|
|
return i.value;
|
|
}, function(s) {
|
|
a.value = Tt(s).map(Mi).map(Ti);
|
|
});
|
|
var o = function() {
|
|
var u = a.value.map(function(c) {
|
|
return c.is_string ? c.url : c.value || c.url;
|
|
}).filter(function(c) {
|
|
return c !== void 0;
|
|
});
|
|
t.emit("update:modelValue", e.maxCount === 1 ? u[0] || "" : u);
|
|
};
|
|
return {
|
|
fileList: a,
|
|
modelValue: i,
|
|
onDelete: function(u) {
|
|
o(), t.emit("delete", u);
|
|
},
|
|
uploadFile: function(u) {
|
|
var c = this;
|
|
if (u.status = "uploading", r.value)
|
|
return r.value(u);
|
|
var l = e.data || {};
|
|
l[e.uploadName || "file"] = u.file, e.formCreateInject.api.fetch({
|
|
action: e.action,
|
|
dataType: "formData",
|
|
source: "upload",
|
|
headers: e.headers || {},
|
|
method: e.method || "post",
|
|
data: l
|
|
}).then(function(h) {
|
|
u.status = "success", e.onSuccess && e.onSuccess(h, u), o();
|
|
}).catch(function(h) {
|
|
u.status = "failed", u.message = c.formCreateInject.t("uploadFail") || "\u4E0A\u4F20\u5931\u8D25", e.onError && e.onError(h, u);
|
|
});
|
|
}
|
|
};
|
|
},
|
|
render: function() {
|
|
var e = this;
|
|
return H(K("van-uploader"), Pe(this.$attrs, {
|
|
"model-value": this.fileList,
|
|
maxCount: this.maxCount,
|
|
"onUpdate:model-value": function(r) {
|
|
return e.fileList = r;
|
|
},
|
|
afterRead: this.uploadFile,
|
|
onDelete: this.onDelete
|
|
}), null);
|
|
}
|
|
});
|
|
function xs(n) {
|
|
return typeof n == "function" || Object.prototype.toString.call(n) === "[object Object]" && !Ir(n);
|
|
}
|
|
var Cs = "fcRadio", ks = he({
|
|
name: Cs,
|
|
inheritAttrs: !1,
|
|
props: {
|
|
modelValue: [String, Number],
|
|
options: Array
|
|
},
|
|
emits: ["update:modelValue", "change"],
|
|
setup: function(e, t) {
|
|
var r = De(e, "modelValue", []), i = De(e, "options");
|
|
return {
|
|
options: i,
|
|
modelValue: r,
|
|
onInput: function(o) {
|
|
t.emit("update:modelValue", o), t.emit("change", o);
|
|
}
|
|
};
|
|
},
|
|
render: function() {
|
|
var e;
|
|
return H(K("van-radio-group"), Pe({
|
|
direction: "horizontal"
|
|
}, this.$attrs, {
|
|
modelValue: this.modelValue,
|
|
"onUpdate:modelValue": this.onInput
|
|
}), xs(e = (this.options || []).map(function(t) {
|
|
var r = W({}, t), i = t.text, a = t.value;
|
|
return delete r.text, delete r.value, H(K("van-radio"), Pe({
|
|
name: a
|
|
}, r), {
|
|
default: function() {
|
|
return [i || t.label || a];
|
|
}
|
|
});
|
|
})) ? e : {
|
|
default: function() {
|
|
return [e];
|
|
}
|
|
});
|
|
}
|
|
}), As = "fcDatePicker", Ds = he({
|
|
name: As,
|
|
inheritAttrs: !1,
|
|
props: {
|
|
disabled: Boolean,
|
|
clearable: Boolean,
|
|
placeholder: String,
|
|
modelValue: [String, Number],
|
|
minDate: [String, Date],
|
|
maxDate: [String, Date]
|
|
},
|
|
emits: ["update:modelValue", "fc.el", "change"],
|
|
setup: function(e, t) {
|
|
var r = Ot(!1), i = De(e, "modelValue"), a = at(function() {
|
|
return i.value == null || i.value === "" ? [] : i.value.split("-");
|
|
}), o = at(function() {
|
|
return {
|
|
minDate: e.minDate ? Ht(e.minDate).toDate() : void 0,
|
|
maxDate: e.maxDate ? Ht(e.maxDate).toDate() : void 0
|
|
};
|
|
}), s = function(c) {
|
|
t.emit("update:modelValue", c), t.emit("change", c);
|
|
};
|
|
return {
|
|
show: r,
|
|
formValue: a,
|
|
dateRange: o,
|
|
open: function() {
|
|
e.disabled || (r.value = !0);
|
|
},
|
|
confirm: function(c) {
|
|
var l = c.selectedValues;
|
|
s(l.join("-")), r.value = !1;
|
|
},
|
|
clear: function(c) {
|
|
c.stopPropagation(), s("");
|
|
}
|
|
};
|
|
},
|
|
render: function() {
|
|
var e = this, t = function() {
|
|
return e.$props.clearable && e.modelValue ? H("i", {
|
|
class: "van-badge__wrapper van-icon van-icon-clear van-field__clear",
|
|
onClick: e.clear
|
|
}, null) : void 0;
|
|
};
|
|
return H(Ke, null, [H(K("van-field"), {
|
|
ref: "el",
|
|
placeholder: this.placeholder,
|
|
readonly: !0,
|
|
disabled: this.$props.disabled,
|
|
onClick: this.open,
|
|
"model-value": this.modelValue,
|
|
border: !1,
|
|
isLink: !0
|
|
}, {
|
|
"right-icon": t
|
|
}), H(K("van-popup"), {
|
|
show: this.show,
|
|
"onUpdate:show": function(i) {
|
|
return e.show = i;
|
|
},
|
|
round: !0,
|
|
position: "bottom"
|
|
}, {
|
|
default: function() {
|
|
return [H(K("van-date-picker"), Pe({
|
|
columnsType: ["year", "month", "day"]
|
|
}, W(W({}, e.$attrs), e.dateRange), {
|
|
modelValue: e.formValue,
|
|
onConfirm: e.confirm,
|
|
onCancel: function() {
|
|
return e.show = !1;
|
|
}
|
|
}), null)];
|
|
}
|
|
})]);
|
|
},
|
|
mounted: function() {
|
|
this.$emit("fc.el", this.$refs.el);
|
|
}
|
|
}), Rs = "fcTimePicker", Ps = he({
|
|
name: Rs,
|
|
inheritAttrs: !1,
|
|
props: {
|
|
disabled: Boolean,
|
|
clearable: Boolean,
|
|
placeholder: String,
|
|
modelValue: [String, Number]
|
|
},
|
|
emits: ["update:modelValue", "fc.el", "change"],
|
|
setup: function(e, t) {
|
|
var r = Ot(!1), i = De(e, "modelValue"), a = at(function() {
|
|
return i.value == null || i.value === "" ? [] : i.value.split(":");
|
|
}), o = function(u) {
|
|
t.emit("update:modelValue", u), t.emit("change", u);
|
|
};
|
|
return {
|
|
show: r,
|
|
formValue: a,
|
|
open: function() {
|
|
e.disabled || (r.value = !0);
|
|
},
|
|
confirm: function(u) {
|
|
var c = u.selectedValues;
|
|
o(c.join(":")), r.value = !1;
|
|
},
|
|
clear: function(u) {
|
|
u.stopPropagation(), o("");
|
|
}
|
|
};
|
|
},
|
|
render: function() {
|
|
var e = this, t = function() {
|
|
return e.$props.clearable && e.modelValue ? H("i", {
|
|
class: "van-badge__wrapper van-icon van-icon-clear van-field__clear",
|
|
onClick: e.clear
|
|
}, null) : void 0;
|
|
};
|
|
return H(Ke, null, [H(K("van-field"), {
|
|
ref: "el",
|
|
placeholder: this.placeholder,
|
|
readonly: !0,
|
|
disabled: this.$props.disabled,
|
|
onClick: this.open,
|
|
"model-value": this.modelValue,
|
|
border: !1,
|
|
isLink: !0
|
|
}, {
|
|
"right-icon": t
|
|
}), H(K("van-popup"), {
|
|
show: this.show,
|
|
"onUpdate:show": function(i) {
|
|
return e.show = i;
|
|
},
|
|
round: !0,
|
|
position: "bottom"
|
|
}, {
|
|
default: function() {
|
|
return [H(K("van-time-picker"), Pe({
|
|
columnsType: ["hour", "minute"]
|
|
}, e.$attrs, {
|
|
modelValue: e.formValue,
|
|
onConfirm: e.confirm,
|
|
onCancel: function() {
|
|
return e.show = !1;
|
|
}
|
|
}), null)];
|
|
}
|
|
})]);
|
|
},
|
|
mounted: function() {
|
|
this.$emit("fc.el", this.$refs.el);
|
|
}
|
|
});
|
|
function rt(n, e, t) {
|
|
n[e] = t;
|
|
}
|
|
function Dt(n, e) {
|
|
delete n[e];
|
|
}
|
|
function hn(n) {
|
|
var e = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {}, t = arguments.length > 2 ? arguments[2] : void 0, r = !1;
|
|
for (var i in e)
|
|
if (Object.prototype.hasOwnProperty.call(e, i)) {
|
|
var a = e[i];
|
|
if ((r = Array.isArray(a)) || F.Object(a)) {
|
|
var o = n[i] === void 0;
|
|
if (r)
|
|
r = !1, o && rt(n, i, []);
|
|
else if (a._clone && t !== void 0)
|
|
if (t)
|
|
a = a.getRule(), o && rt(n, i, {});
|
|
else {
|
|
rt(n, i, a._clone());
|
|
continue;
|
|
}
|
|
else
|
|
o && rt(n, i, {});
|
|
n[i] = hn(n[i], a, t);
|
|
} else
|
|
rt(n, i, a), F.Undef(a) || (F.Undef(a.__json) || (n[i].__json = a.__json), F.Undef(a.__origin) || (n[i].__origin = a.__origin));
|
|
}
|
|
return t !== void 0 && Array.isArray(n) ? n.filter(function(s) {
|
|
return !s || !s.__ctrl;
|
|
}) : n;
|
|
}
|
|
function ht(n) {
|
|
return hn({}, {
|
|
value: n
|
|
}).value;
|
|
}
|
|
var Ms = Object.assign || function(n) {
|
|
for (var e, t = 1; t < arguments.length; t++)
|
|
for (var r in e = arguments[t], e)
|
|
Object.prototype.hasOwnProperty.call(e, r) && rt(n, r, e[r]);
|
|
return n;
|
|
};
|
|
function ne() {
|
|
return Ms.apply(this, arguments);
|
|
}
|
|
function br(n) {
|
|
return pe(n) !== "object" || n === null ? n : n instanceof Array ? le(n) : W({}, n);
|
|
}
|
|
var Ts = "fcGroup", js = he({
|
|
name: Ts,
|
|
props: {
|
|
field: String,
|
|
rule: Array,
|
|
expand: Number,
|
|
options: Object,
|
|
button: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
max: {
|
|
type: Number,
|
|
default: 0
|
|
},
|
|
min: {
|
|
type: Number,
|
|
default: 0
|
|
},
|
|
modelValue: {
|
|
type: Array,
|
|
default: function() {
|
|
return [];
|
|
}
|
|
},
|
|
defaultValue: Object,
|
|
sortBtn: {
|
|
type: Boolean,
|
|
default: !1
|
|
},
|
|
disabled: {
|
|
type: Boolean,
|
|
default: void 0
|
|
},
|
|
onBeforeRemove: {
|
|
type: Function,
|
|
default: function() {
|
|
}
|
|
},
|
|
onBeforeAdd: {
|
|
type: Function,
|
|
default: function() {
|
|
}
|
|
},
|
|
formCreateInject: Object,
|
|
parse: Function
|
|
},
|
|
data: function() {
|
|
return {
|
|
len: 0,
|
|
cacheRule: {},
|
|
cacheValue: {},
|
|
sort: [],
|
|
form: Te(this.formCreateInject.form.$form())
|
|
};
|
|
},
|
|
emits: ["update:modelValue", "change", "itemMounted", "remove", "add"],
|
|
watch: {
|
|
rule: {
|
|
handler: function(e, t) {
|
|
var r = this;
|
|
Object.keys(this.cacheRule).forEach(function(i) {
|
|
var a = r.cacheRule[i];
|
|
if (a.$f) {
|
|
var o = a.$f.formData();
|
|
if (e === t)
|
|
a.$f.deferSyncValue(function() {
|
|
hn(a.rule, e), a.$f.setValue(o);
|
|
}, !0);
|
|
else {
|
|
var s = a.$f.formData();
|
|
a.$f.once("reloading", function() {
|
|
a.$f.setValue(s);
|
|
}), a.rule = ht(e);
|
|
}
|
|
}
|
|
});
|
|
},
|
|
deep: !0
|
|
},
|
|
expand: function(e) {
|
|
var t = e - this.modelValue.length;
|
|
t > 0 && this.expandRule(t);
|
|
},
|
|
modelValue: {
|
|
handler: function(e) {
|
|
var t = this;
|
|
e = e || [];
|
|
var r = this.sort, i = r.length, a = i - e.length;
|
|
if (a < 0) {
|
|
for (var o = a; o < 0; o++)
|
|
this.addRule(e.length + o, !0);
|
|
for (var s = 0; s < i; s++)
|
|
this.setValue(r[s], e[s]);
|
|
} else {
|
|
if (a > 0)
|
|
for (var u = 0; u < a; u++)
|
|
this.removeRule(r[i - u - 1]);
|
|
e.forEach(function(c, l) {
|
|
t.setValue(r[l], e[l]);
|
|
});
|
|
}
|
|
},
|
|
deep: !0
|
|
}
|
|
},
|
|
methods: {
|
|
_value: function(e) {
|
|
return e && Se(e, this.field) ? e[this.field] : e;
|
|
},
|
|
cache: function(e, t) {
|
|
this.cacheValue[e] = JSON.stringify(t);
|
|
},
|
|
input: function(e) {
|
|
this.$emit("update:modelValue", e), this.$emit("change", e);
|
|
},
|
|
formData: function(e, t) {
|
|
var r = this, i = this.cacheRule, a = this.sort;
|
|
if (a.filter(function(s) {
|
|
return i[s] && i[s].$f;
|
|
}).length === a.length) {
|
|
var o = a.map(function(s) {
|
|
var u = e === s ? t : W({}, r.cacheRule[s].$f.form), c = r.field ? u[r.field] || null : u;
|
|
return r.cache(s, c), c;
|
|
});
|
|
this.input(o);
|
|
}
|
|
},
|
|
setValue: function(e, t) {
|
|
var r = this.field;
|
|
r && (t = Le({}, r, this._value(t))), this.cacheValue[e] !== JSON.stringify(r ? t[r] : t) && (this.cacheRule[e].$f && this.cacheRule[e].$f.coverValue(t), this.cache(e, t));
|
|
},
|
|
addRule: function(e, t) {
|
|
var r = this, i = this.formCreateInject.form.copyRules(this.rule || []), a = this.options ? W({}, this.options) : {
|
|
submitBtn: !1,
|
|
resetBtn: !1
|
|
};
|
|
if (this.defaultValue) {
|
|
a.formData || (a.formData = {});
|
|
var o = ht(this.defaultValue);
|
|
ne(a.formData, this.field ? Le({}, this.field, o) : o);
|
|
}
|
|
this.parse && this.parse({
|
|
rule: i,
|
|
options: a,
|
|
index: this.sort.length
|
|
}), this.cacheRule[++this.len] = {
|
|
rule: i,
|
|
options: a
|
|
}, this.sort = Object.keys(this.cacheRule), t && je(function() {
|
|
return r.$emit("add", i, Object.keys(r.cacheRule).length - 1);
|
|
});
|
|
},
|
|
add$f: function(e, t, r) {
|
|
var i = this;
|
|
this.cacheRule[t].$f = r, je(function() {
|
|
i.$emit("itemMounted", r, Object.keys(i.cacheRule).indexOf(t));
|
|
});
|
|
},
|
|
removeRule: function(e, t) {
|
|
var r = this, i = Object.keys(this.cacheRule).indexOf(e);
|
|
delete this.cacheRule[e], delete this.cacheValue[e], this.sort = Object.keys(this.cacheRule), t && je(function() {
|
|
return r.$emit("remove", i);
|
|
});
|
|
},
|
|
add: function(e) {
|
|
if (!(this.disabled || this.onBeforeAdd(this.modelValue) === !1)) {
|
|
var t = le(this.modelValue);
|
|
t.push(this.defaultValue ? ht(this.defaultValue) : this.field ? null : {}), this.input(t);
|
|
}
|
|
},
|
|
del: function(e, t) {
|
|
if (!(this.disabled || this.onBeforeRemove(this.modelValue, e) === !1)) {
|
|
this.removeRule(t, !0);
|
|
var r = le(this.modelValue);
|
|
r.splice(e, 1), this.input(r);
|
|
}
|
|
},
|
|
addIcon: function(e) {
|
|
return H("div", {
|
|
class: "_fc-m-group-btn _fc-m-group-plus-minus",
|
|
onClick: this.add
|
|
}, null);
|
|
},
|
|
delIcon: function(e, t) {
|
|
var r = this;
|
|
return H("div", {
|
|
class: "_fc-m-group-btn _fc-m-group-plus-minus _fc-m-group-minus",
|
|
onClick: function() {
|
|
return r.del(e, t);
|
|
}
|
|
}, null);
|
|
},
|
|
sortUpIcon: function(e) {
|
|
var t = this;
|
|
return H("div", {
|
|
class: "_fc-m-group-btn _fc-m-group-arrow _fc-m-group-up",
|
|
onClick: function() {
|
|
return t.changeSort(e, -1);
|
|
}
|
|
}, null);
|
|
},
|
|
sortDownIcon: function(e) {
|
|
var t = this;
|
|
return H("div", {
|
|
class: "_fc-m-group-btn _fc-m-group-arrow _fc-m-group-down",
|
|
onClick: function() {
|
|
return t.changeSort(e, 1);
|
|
}
|
|
}, null);
|
|
},
|
|
changeSort: function(e, t) {
|
|
var r = this, i = this.sort[e];
|
|
this.sort[e] = this.sort[e + t], this.sort[e + t] = i, this.formCreateInject.subForm(this.sort.map(function(a) {
|
|
return r.cacheRule[a].$f;
|
|
})), this.formData(0);
|
|
},
|
|
makeIcon: function(e, t, r) {
|
|
var i = this;
|
|
if (this.$slots.button)
|
|
return this.$slots.button({
|
|
total: e,
|
|
index: t,
|
|
vm: this,
|
|
key: r,
|
|
del: function() {
|
|
return i.del(t, r);
|
|
},
|
|
add: this.add
|
|
});
|
|
var a = [];
|
|
return (!this.max || e < this.max) && e === t + 1 && a.push(this.addIcon(r)), e > this.min && a.push(this.delIcon(t, r)), this.sortBtn && t && a.push(this.sortUpIcon(t)), this.sortBtn && t !== e - 1 && a.push(this.sortDownIcon(t)), a;
|
|
},
|
|
emitEvent: function(e, t, r, i) {
|
|
this.$emit.apply(this, [e].concat(le(t), [this.cacheRule[i].$f, r]));
|
|
},
|
|
expandRule: function(e) {
|
|
for (var t = 0; t < e; t++)
|
|
this.addRule(t);
|
|
}
|
|
},
|
|
created: function() {
|
|
for (var e = (this.expand || 0) - this.modelValue.length, t = 0; t < this.modelValue.length; t++)
|
|
this.addRule(t);
|
|
e > 0 && this.expandRule(e);
|
|
},
|
|
render: function() {
|
|
var e = this, t = this.sort, r = this.button, i = this.form, a = this.disabled, o = t.length === 0 ? this.$slots.default ? this.$slots.default({
|
|
vm: this,
|
|
add: this.add
|
|
}) : H("div", {
|
|
key: "a_def",
|
|
class: "_fc-m-group-plus-minus _fc-m-group-add fc-clock",
|
|
onClick: this.add
|
|
}, null) : t.map(function(s, u) {
|
|
var c = e.cacheRule[s], l = c.rule, h = c.options, m = r && !a ? e.makeIcon(t.length, u, s) : [];
|
|
return H("div", {
|
|
class: "_fc-m-group-container",
|
|
key: s
|
|
}, [H(i, Pe({
|
|
key: s
|
|
}, {
|
|
disabled: a,
|
|
"onUpdate:modelValue": function($) {
|
|
return e.formData(s, $);
|
|
},
|
|
"onEmit-event": function($) {
|
|
for (var S = arguments.length, T = new Array(S > 1 ? S - 1 : 0), U = 1; U < S; U++)
|
|
T[U - 1] = arguments[U];
|
|
return e.emitEvent($, T, u, s);
|
|
},
|
|
"onUpdate:api": function($) {
|
|
return e.add$f(u, s, $);
|
|
},
|
|
inFor: !0,
|
|
modelValue: e.field ? Le({}, e.field, e._value(e.modelValue[u])) : e.modelValue[u],
|
|
rule: l,
|
|
option: h,
|
|
extendOption: !0
|
|
}), null), H("div", {
|
|
class: "_fc-m-group-idx"
|
|
}, [u + 1]), m.length ? H("div", {
|
|
class: "_fc-m-group-handle fc-clock"
|
|
}, [m]) : null]);
|
|
});
|
|
return H("div", {
|
|
key: "con",
|
|
class: "_fc-m-group " + (a ? "_fc-m-group-disabled" : "")
|
|
}, [o]);
|
|
}
|
|
}), Ra = {
|
|
name: "IconWarning"
|
|
}, Fs = {
|
|
class: "icon",
|
|
viewBox: "0 0 1024 1024",
|
|
xmlns: "http://www.w3.org/2000/svg"
|
|
}, Is = /* @__PURE__ */ Me("path", {
|
|
fill: "currentColor",
|
|
d: "M512 64a448 448 0 110 896 448 448 0 010-896zm0 832a384 384 0 000-768 384 384 0 000 768zm48-176a48 48 0 11-96 0 48 48 0 0196 0zm-48-464a32 32 0 0132 32v288a32 32 0 01-64 0V288a32 32 0 0132-32z"
|
|
}, null, -1), Vs = [Is];
|
|
function Bs(n, e, t, r, i, a) {
|
|
return ee(), me("svg", Fs, Vs);
|
|
}
|
|
Ra.render = Bs;
|
|
var Ls = [Qo, Ra, ms, vs, bs, ks, $s, Ds, Ps, js, Es];
|
|
function xt(n, e) {
|
|
var t = null;
|
|
return function() {
|
|
for (var r = this, i = arguments.length, a = new Array(i), o = 0; o < i; o++)
|
|
a[o] = arguments[o];
|
|
t !== null && clearTimeout(t), t = setTimeout(function() {
|
|
return n.call.apply(n, [r].concat(a));
|
|
}, e);
|
|
};
|
|
}
|
|
function fn(n) {
|
|
var e = n.replace(/([A-Z])/g, "-$1").toLocaleLowerCase();
|
|
return e.indexOf("-") === 0 && (e = e.substr(1)), e;
|
|
}
|
|
function Ns(n) {
|
|
return n.replace(n[0], n[0].toLocaleUpperCase());
|
|
}
|
|
var Pa = ["props"], Ma = ["class", "style", "directives"], Ta = ["on", "hook"], Rt = function n(e) {
|
|
var t = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {}, r = arguments.length > 2 && arguments[2] !== void 0 ? arguments[2] : {}, i = [].concat(Pa, le(r.normal || [])), a = [].concat(Ma, le(r.array || [])), o = [].concat(Ta, le(r.functional || [])), s = r.props || [];
|
|
return e.reduce(function(u, c) {
|
|
for (var l in c)
|
|
if (u[l])
|
|
if (s.indexOf(l) > -1)
|
|
u[l] = n([c[l]], u[l]);
|
|
else if (i.indexOf(l) > -1)
|
|
u[l] = W(W({}, u[l]), c[l]);
|
|
else if (a.indexOf(l) > -1) {
|
|
var h = u[l] instanceof Array ? u[l] : [u[l]], m = c[l] instanceof Array ? c[l] : [c[l]];
|
|
u[l] = [].concat(le(h), le(m));
|
|
} else if (o.indexOf(l) > -1)
|
|
for (var w in c[l])
|
|
if (u[l][w]) {
|
|
var $ = u[l][w] instanceof Array ? u[l][w] : [u[l][w]], S = c[l][w] instanceof Array ? c[l][w] : [c[l][w]];
|
|
u[l][w] = [].concat(le($), le(S));
|
|
} else
|
|
u[l][w] = c[l][w];
|
|
else if (l === "hook")
|
|
for (var T in c[l])
|
|
u[l][T] ? u[l][T] = zs(u[l][T], c[l][T]) : u[l][T] = c[l][T];
|
|
else
|
|
u[l] = c[l];
|
|
else
|
|
i.indexOf(l) > -1 || o.indexOf(l) > -1 || s.indexOf(l) > -1 ? u[l] = W({}, c[l]) : a.indexOf(l) > -1 ? u[l] = c[l] instanceof Array ? le(c[l]) : pe(c[l]) === "object" ? W({}, c[l]) : c[l] : u[l] = c[l];
|
|
return u;
|
|
}, t);
|
|
}, zs = function(e, t) {
|
|
return function() {
|
|
e && e.apply(this, arguments), t && t.apply(this, arguments);
|
|
};
|
|
}, wr = ["type", "slot", "ignore", "emitPrefix", "value", "name", "native", "hidden", "display", "inject", "options", "emit", "link", "prefix", "suffix", "update", "sync", "optionsTo", "key", "slotUpdate", "computed", "preview", "component", "cache", "modelEmit"], Fn = ["validate", "children", "control"], In = ["effect", "deep", "renderSlots"];
|
|
function ja() {
|
|
return [].concat(wr, le(Pa), le(Ma), le(Ta), Fn, In);
|
|
}
|
|
function Fa(n, e, t) {
|
|
return "[form-create ".concat(n, "]: ").concat(e) + (t ? `
|
|
|
|
rule: ` + JSON.stringify(t.getRule ? t.getRule() : t) : "");
|
|
}
|
|
function Vr(n, e) {
|
|
console.error(Fa("err", n, e));
|
|
}
|
|
function Us(n) {
|
|
Vr(n.toString()), console.error(n);
|
|
}
|
|
function ft(n) {
|
|
var e = n.replace(/(-[a-z])/g, function(t) {
|
|
return t.replace("-", "").toLocaleUpperCase();
|
|
});
|
|
return Ia(e);
|
|
}
|
|
function Ia(n) {
|
|
return n.replace(n[0], n[0].toLowerCase());
|
|
}
|
|
var $r = "[[FORM-CREATE-PREFIX-", Sr = "-FORM-CREATE-SUFFIX]]";
|
|
function dn(n, e) {
|
|
return JSON.stringify(hn(Array.isArray(n) ? [] : {}, n, !0), function(t, r) {
|
|
if (!(r && r._isVue === !0)) {
|
|
if (typeof r != "function")
|
|
return r;
|
|
if (r.__json)
|
|
return r.__json;
|
|
if (r.__origin && (r = r.__origin), !r.__emit)
|
|
return $r + r + Sr;
|
|
}
|
|
}, e);
|
|
}
|
|
function ar(n) {
|
|
return new Function("return " + n)();
|
|
}
|
|
function gt(n, e) {
|
|
if (n && F.String(n) && n.length > 4) {
|
|
var t = n.trim(), r = !1;
|
|
try {
|
|
if (t.indexOf(Sr) > 0 && t.indexOf($r) === 0)
|
|
t = t.replace(Sr, "").replace($r, ""), r = !0;
|
|
else if (t.indexOf("$FN:") === 0)
|
|
t = t.substring(4), r = !0;
|
|
else if (t.indexOf("$EXEC:") === 0)
|
|
t = t.substring(6), r = !0;
|
|
else if (t.indexOf("$GLOBAL:") === 0) {
|
|
var i = t.substring(8);
|
|
return t = function() {
|
|
for (var s = arguments.length, u = new Array(s), c = 0; c < s; c++)
|
|
u[c] = arguments[c];
|
|
var l = u[0].api.getGlobalEvent(i);
|
|
if (l)
|
|
return l.call.apply(l, [this].concat(u));
|
|
}, t.__json = n, t.__inject = !0, t;
|
|
} else {
|
|
if (t.indexOf("$FNX:") === 0)
|
|
return t = ar("function($inject){" + t.substring(5) + "}"), t.__json = n, t.__inject = !0, t;
|
|
(!e && t.indexOf("function ") === 0 && t !== "function " || !e && t.indexOf("function(") === 0 && t !== "function(") && (r = !0);
|
|
}
|
|
if (!r)
|
|
return n;
|
|
var a;
|
|
try {
|
|
a = ar(t);
|
|
} catch {
|
|
a = ar("function " + t);
|
|
}
|
|
return a.__json = n, a;
|
|
} catch (o) {
|
|
Vr("\u89E3\u6790\u5931\u8D25:".concat(t, `
|
|
|
|
err: `).concat(o));
|
|
return;
|
|
}
|
|
}
|
|
return n;
|
|
}
|
|
function Va(n, e) {
|
|
return JSON.parse(n, function(t, r) {
|
|
return F.Undef(r) || !r.indexOf ? r : gt(r, e);
|
|
});
|
|
}
|
|
function Or(n, e) {
|
|
return {
|
|
value: n,
|
|
enumerable: !1,
|
|
configurable: !1,
|
|
writable: !!e
|
|
};
|
|
}
|
|
function Ba(n, e) {
|
|
return La([n], e || !1)[0];
|
|
}
|
|
function La(n, e) {
|
|
return hn([], le(n), e || !1);
|
|
}
|
|
function $t(n, e) {
|
|
return Rt(Array.isArray(e) ? e : [e], n, {
|
|
array: Fn,
|
|
normal: In
|
|
}), n;
|
|
}
|
|
function ji(n) {
|
|
var e = F.Function(n.getRule) ? n.getRule() : n;
|
|
return e.type || (e.type = "input"), e;
|
|
}
|
|
function qs(n, e) {
|
|
return n ? (Object.keys(e || {}).forEach(function(t) {
|
|
e[t] && (n[t] = $t(n[t] || {}, e[t]));
|
|
}), n) : e;
|
|
}
|
|
function Na(n, e) {
|
|
Object.defineProperties(n, Object.keys(e).reduce(function(t, r) {
|
|
return t[r] = {
|
|
get: function() {
|
|
return e[r]();
|
|
}
|
|
}, t;
|
|
}, {}));
|
|
}
|
|
function bt(n) {
|
|
return n.__fc__ || (n.__origin__ ? n.__origin__.__fc__ : null);
|
|
}
|
|
function fe(n, e) {
|
|
try {
|
|
e = n();
|
|
} catch (t) {
|
|
Us(t);
|
|
}
|
|
return e;
|
|
}
|
|
function bn() {
|
|
var n = {}, e = function(r) {
|
|
return r || "default";
|
|
};
|
|
return {
|
|
setSlot: function(r, i) {
|
|
r = e(r), !(!i || Array.isArray(i) && i.length) && (n[r] || (n[r] = []), n[r].push(i));
|
|
},
|
|
getSlot: function(r, i) {
|
|
r = e(r);
|
|
var a = [];
|
|
return (n[r] || []).forEach(function(o) {
|
|
if (Array.isArray(o))
|
|
a.push.apply(a, le(o));
|
|
else if (F.Function(o)) {
|
|
var s = o.apply(void 0, le(i || []));
|
|
Array.isArray(s) ? a.push.apply(a, le(s)) : a.push(s);
|
|
} else
|
|
F.Undef(o) || a.push(o);
|
|
}), a;
|
|
},
|
|
getSlots: function() {
|
|
var r = this, i = {};
|
|
return Object.keys(n).forEach(function(a) {
|
|
i[a] = function() {
|
|
for (var o = arguments.length, s = new Array(o), u = 0; u < o; u++)
|
|
s[u] = arguments[u];
|
|
return r.getSlot(a, s);
|
|
};
|
|
}), i;
|
|
},
|
|
slotLen: function(r) {
|
|
return r = e(r), n[r] ? n[r].length : 0;
|
|
},
|
|
mergeBag: function(r) {
|
|
var i = this;
|
|
if (!r)
|
|
return this;
|
|
var a = F.Function(r.getSlots) ? r.getSlots() : r;
|
|
return Array.isArray(r) || Ir(r) ? this.setSlot(void 0, function() {
|
|
return r;
|
|
}) : Object.keys(a).forEach(function(o) {
|
|
i.setSlot(o, a[o]);
|
|
}), this;
|
|
}
|
|
};
|
|
}
|
|
function Fi(n) {
|
|
var e = W({}, n.props || {});
|
|
return Object.keys(n.on || {}).forEach(function(t) {
|
|
t.indexOf("-") > 0 && (t = ft(t));
|
|
var r = "on".concat(Ns(t));
|
|
Array.isArray(e[r]) ? e[r] = [].concat(le(e[r]), [n.on[t]]) : e[r] ? e[r] = [e[r], n.on[t]] : e[r] = n.on[t];
|
|
}), e.key = n.key, e.ref = n.ref, e.class = n.class, e.id = n.id, e.style = n.style, e.slot && delete e.slot, e;
|
|
}
|
|
function wn(n, e) {
|
|
return Object.setPrototypeOf(n, e), n;
|
|
}
|
|
var Ii = function(e, t) {
|
|
return typeof e == "string" ? String(t) : typeof e == "number" ? Number(t) : t;
|
|
}, Pt = {
|
|
"==": function(e, t) {
|
|
return JSON.stringify(e) === JSON.stringify(Ii(e, t));
|
|
},
|
|
"!=": function(e, t) {
|
|
return !Pt["=="](e, t);
|
|
},
|
|
">": function(e, t) {
|
|
return e > t;
|
|
},
|
|
">=": function(e, t) {
|
|
return e >= t;
|
|
},
|
|
"<": function(e, t) {
|
|
return e < t;
|
|
},
|
|
"<=": function(e, t) {
|
|
return e <= t;
|
|
},
|
|
on: function(e, t) {
|
|
return e && e.indexOf && e.indexOf(Ii(e[0], t)) > -1;
|
|
},
|
|
notOn: function(e, t) {
|
|
return !Pt.on(e, t);
|
|
},
|
|
in: function(e, t) {
|
|
return t && t.indexOf && t.indexOf(e) > -1;
|
|
},
|
|
notIn: function(e, t) {
|
|
return !Pt.in(e, t);
|
|
},
|
|
between: function(e, t) {
|
|
return e > t[0] && e < t[1];
|
|
},
|
|
notBetween: function(e, t) {
|
|
return e < t[0] || e > t[1];
|
|
},
|
|
empty: function(e) {
|
|
return F.empty(e);
|
|
},
|
|
notEmpty: function(e) {
|
|
return !F.empty(e);
|
|
},
|
|
pattern: function(e, t) {
|
|
return new RegExp(t, "g").test(e);
|
|
}
|
|
};
|
|
function Ge(n, e) {
|
|
return (Array.isArray(e) ? e : (e || "").split(".")).forEach(function(t) {
|
|
n != null && (n = n[t]);
|
|
}), n;
|
|
}
|
|
function Gs(n) {
|
|
for (var e = /{{\s*(.*?)\s*}}/g, t, r = {}; (t = e.exec(n)) !== null; )
|
|
t[1] && (r[t[1]] = !0);
|
|
return Object.keys(r);
|
|
}
|
|
function Vi(n) {
|
|
var e = n.split("."), t = [], r = "";
|
|
return e.forEach(function(i, a) {
|
|
a === 0 ? r = i : r += "." + i, t.push(r);
|
|
}), t.join(" && ");
|
|
}
|
|
var Dn = function(e, t) {
|
|
if (!(!e || e === t)) {
|
|
if (e.props.formCreateInject)
|
|
return e.props.formCreateInject;
|
|
if (e.parent)
|
|
return Dn(e.parent, t);
|
|
}
|
|
};
|
|
function Hs(n, e, t) {
|
|
return he({
|
|
name: "FormCreate" + (n.isMobile ? "Mobile" : ""),
|
|
components: e,
|
|
directives: t,
|
|
props: {
|
|
rule: {
|
|
type: Array,
|
|
required: !0,
|
|
default: function() {
|
|
return [];
|
|
}
|
|
},
|
|
option: {
|
|
type: Object,
|
|
default: function() {
|
|
return {};
|
|
}
|
|
},
|
|
extendOption: Boolean,
|
|
driver: [String, Object],
|
|
modelValue: Object,
|
|
disabled: {
|
|
type: Boolean,
|
|
default: void 0
|
|
},
|
|
preview: {
|
|
type: Boolean,
|
|
default: void 0
|
|
},
|
|
index: [String, Number],
|
|
api: Object,
|
|
locale: [String, Object],
|
|
name: String,
|
|
subForm: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
inFor: Boolean
|
|
},
|
|
emits: ["update:api", "update:modelValue", "mounted", "submit", "reset", "change", "emit-event", "control", "remove-rule", "remove-field", "sync", "reload", "repeat-field", "update", "validate-field-fail", "validate-fail", "created"],
|
|
render: function() {
|
|
return this.fc.render();
|
|
},
|
|
setup: function(i) {
|
|
var a = vr();
|
|
qo("parentFC", a);
|
|
var o = Go("parentFC", null), s = o;
|
|
if (o)
|
|
for (; s.setupState.parent; )
|
|
s = s.setupState.parent;
|
|
else
|
|
s = a;
|
|
var u = Ai(i), c = u.rule, l = u.modelValue, h = u.subForm, m = u.inFor, w = Be({
|
|
ctxInject: {},
|
|
destroyed: !1,
|
|
isShow: !0,
|
|
unique: 1,
|
|
renderRule: le(c.value || []),
|
|
updateValue: JSON.stringify(l.value || {})
|
|
}), $ = new n(a), S = $.api(), T = m.value, U = function() {
|
|
if (o) {
|
|
var ae = Dn(a, o);
|
|
if (ae) {
|
|
var J;
|
|
T ? (J = Tt(ae.getSubForm()), J.push(S)) : J = S, ae.subForm(J);
|
|
}
|
|
}
|
|
}, z = function() {
|
|
var ae = Dn(a, o);
|
|
if (ae)
|
|
if (T) {
|
|
var J = Tt(ae.getSubForm()), G = J.indexOf(S);
|
|
G > -1 && J.splice(G, 1);
|
|
} else
|
|
ae.subForm();
|
|
}, B = null;
|
|
Ho(function() {
|
|
Wo(function() {
|
|
var re = "", ae = i.option && i.option.globalClass || {};
|
|
Object.keys(ae).forEach(function(J) {
|
|
var G = "";
|
|
ae[J].style && Object.keys(ae[J].style).forEach(function(Oe) {
|
|
G += fn(Oe) + ":" + ae[J].style[Oe] + ";";
|
|
}), ae[J].content && (G += ae[J].content + ";"), G && (re += ".".concat(J, "{").concat(G, "}"));
|
|
}), i.option && i.option.style && (re += i.option.style), B || (B = document.createElement("style"), B.type = "text/css", document.head.appendChild(B)), B.innerHTML = re || "";
|
|
});
|
|
});
|
|
var Z = xt(function() {
|
|
$.bus.$emit("$loadData.$topForm");
|
|
}, 100), Q = xt(function() {
|
|
$.bus.$emit("$loadData.$scopeForm");
|
|
}, 100), q = xt(function() {
|
|
$.bus.$emit("$loadData.$form");
|
|
}, 100), ce = function(ae) {
|
|
$.bus.$emit("change-$form." + ae);
|
|
};
|
|
return Yo(function() {
|
|
o && (S.top.bus.$on("$loadData.$form", Z), S.top.bus.$on("change", ce)), S !== S.scope && S.scope.bus.$on("$loadData.$scopeForm", Q), $.mounted();
|
|
}), Xo(function() {
|
|
o && (S.top.bus.$off("$loadData.$form", Z), S.top.bus.$off("change", ce)), S !== S.scope && S.scope.bus.$off("$loadData.$scopeForm", Q), B && document.head.removeChild(B), z(), w.destroyed = !0, $.unmount();
|
|
}), Jo(function() {
|
|
$.updated();
|
|
}), U(), ze(function() {
|
|
return i.option;
|
|
}, function() {
|
|
$.initOptions(), S.refresh();
|
|
}, {
|
|
deep: !0
|
|
}), ze(function() {
|
|
return le(c.value);
|
|
}, function(re) {
|
|
$.$handle.isBreakWatch() || re.length === w.renderRule.length && re.every(function(ae) {
|
|
return w.renderRule.indexOf(ae) > -1;
|
|
}) || ($.$handle.updateAppendData(), $.$handle.reloadRule(c.value), a.setupState.renderRule());
|
|
}), ze(function() {
|
|
return [i.disabled, i.preview];
|
|
}, function() {
|
|
S.refresh();
|
|
}), ze(l, function(re) {
|
|
dn(re || {}) !== w.updateValue && (S.config.forceCoverValue ? S.coverValue(re || {}) : S.setValue(re || {}));
|
|
}, {
|
|
deep: !0,
|
|
flush: "post"
|
|
}), ze(function() {
|
|
return i.index;
|
|
}, function() {
|
|
S.coverValue({}), $.$handle.updateAppendData(), je(function() {
|
|
je(function() {
|
|
S.clearValidateState();
|
|
});
|
|
});
|
|
}, {
|
|
flush: "sync"
|
|
}), W(W({
|
|
fc: Te($),
|
|
parent: o && Te(o),
|
|
top: Te(s),
|
|
fapi: Te(S)
|
|
}, Ai(w)), {}, {
|
|
getGroupInject: function() {
|
|
return Dn(a, o);
|
|
},
|
|
refresh: function() {
|
|
++w.unique;
|
|
},
|
|
renderRule: function() {
|
|
w.renderRule = le(c.value || []);
|
|
},
|
|
updateValue: function(ae) {
|
|
if (!w.destroyed) {
|
|
var J = dn(ae);
|
|
w.updateValue !== J && (w.updateValue = J, a.emit("update:modelValue", ae), je(function() {
|
|
q(), o ? h.value || Q() : (Z(), Q());
|
|
}));
|
|
}
|
|
}
|
|
});
|
|
},
|
|
created: function() {
|
|
var i = vr();
|
|
i.emit("update:api", i.setupState.fapi), i.setupState.fc.init();
|
|
}
|
|
});
|
|
}
|
|
function za() {
|
|
return {
|
|
props: {},
|
|
on: {},
|
|
options: [],
|
|
children: [],
|
|
hidden: !1,
|
|
display: !0,
|
|
value: void 0
|
|
};
|
|
}
|
|
function Gn(n, e) {
|
|
return function(t, r, i) {
|
|
var a = arguments.length > 3 && arguments[3] !== void 0 ? arguments[3] : {}, o = new Br(n, t, r, i, a);
|
|
return e && (F.Function(e) ? e(o) : o.props(e)), o;
|
|
};
|
|
}
|
|
function Br(n, e, t, r, i) {
|
|
this._data = ne(za(), {
|
|
type: n,
|
|
title: e,
|
|
field: t,
|
|
value: r,
|
|
props: i || {}
|
|
}), this.event = this.on;
|
|
}
|
|
ne(Br.prototype, {
|
|
getRule: function() {
|
|
return this._data;
|
|
},
|
|
setProp: function(e, t) {
|
|
return rt(this._data, e, t), this;
|
|
},
|
|
modelField: function(e) {
|
|
return this._data.modelField = e, this;
|
|
},
|
|
_clone: function() {
|
|
var e = new this.constructor();
|
|
return e._data = Ba(this._data), e;
|
|
}
|
|
});
|
|
function Ua(n) {
|
|
n.forEach(function(e) {
|
|
Br.prototype[e] = function(t) {
|
|
return $t(this._data, Le({}, e, arguments.length < 2 ? t : Le({}, t, arguments[1]))), this;
|
|
};
|
|
});
|
|
}
|
|
Ua(ja());
|
|
var Ws = Gn("");
|
|
function Ys(n, e, t) {
|
|
var r = Ws("", e);
|
|
return r._data.type = n, r._data.title = t, r;
|
|
}
|
|
function Xs() {
|
|
return {
|
|
create: Ys,
|
|
factory: Gn
|
|
};
|
|
}
|
|
function Js(n, e, t) {
|
|
var r = "fail to ".concat(n, " ").concat(t.status, "'"), i = new Error(r);
|
|
return i.status = t.status, i.url = n, i;
|
|
}
|
|
function Bi(n) {
|
|
var e = n.responseText || n.response;
|
|
if (!e)
|
|
return e;
|
|
try {
|
|
return JSON.parse(e);
|
|
} catch {
|
|
return e;
|
|
}
|
|
}
|
|
function qa(n) {
|
|
if (!(typeof XMLHttpRequest > "u")) {
|
|
var e = new XMLHttpRequest(), t = n.action || "";
|
|
if (e.upload && n.onProgress && e.upload.addEventListener("progress", function(o) {
|
|
o.percent = o.total > 0 ? o.loaded / o.total * 100 : 0, n.onProgress(o);
|
|
}), n.query) {
|
|
var r = new URLSearchParams(n.query).toString();
|
|
r && (t.includes("?") ? t += "&".concat(r) : t += "?".concat(r));
|
|
}
|
|
e.onerror = function(s) {
|
|
n.onError(s);
|
|
}, e.onload = function() {
|
|
if (e.status < 200 || e.status >= 300)
|
|
return n.onError(Js(t, n, e), Bi(e));
|
|
n.onSuccess(Bi(e));
|
|
}, e.open(n.method || "get", t, !0);
|
|
var i;
|
|
(n.data || n.file) && (n.file || (n.dataType || "").toLowerCase() !== "json" ? (i = new FormData(), Object.keys(n.data || {}).map(function(o) {
|
|
i.append(o, n.data[o]);
|
|
})) : (i = JSON.stringify(n.data || {}), e.setRequestHeader("content-type", "application/json"))), n.file && i.append(n.filename, n.file, n.file.name), n.withCredentials && "withCredentials" in e && (e.withCredentials = !0);
|
|
var a = n.headers || {};
|
|
Object.keys(a).forEach(function(o) {
|
|
a[o] != null && e.setRequestHeader(o, a[o]);
|
|
}), e.send(i);
|
|
}
|
|
}
|
|
function Li(n, e, t) {
|
|
return new Promise(function(r, i) {
|
|
(e || qa)(W(W({}, n), {}, {
|
|
onSuccess: function(o) {
|
|
var s = function(l) {
|
|
return l;
|
|
}, u = gt(n.parse);
|
|
F.Function(u) ? s = u : u && F.String(u) && (s = function(l) {
|
|
return Ge(l, u);
|
|
}), r(s(o, void 0, t));
|
|
},
|
|
onError: function(o) {
|
|
i(o);
|
|
}
|
|
}));
|
|
});
|
|
}
|
|
function en(n) {
|
|
return ht(n);
|
|
}
|
|
function Ks(n) {
|
|
function e(a) {
|
|
return F.Undef(a) ? a = n.fields() : Array.isArray(a) || (a = [a]), a;
|
|
}
|
|
function t(a, o, s) {
|
|
F.Undef(a) ? a = Object.keys(W(W({}, n.fieldCtx), n.nameCtx)) : Array.isArray(a) || (a = [a]), a.forEach(function(u) {
|
|
var c = n.fieldCtx[u] || n.nameCtx[u];
|
|
c && c.forEach(function(l) {
|
|
rt(l.rule, o, s), n.$render.clearCache(l);
|
|
});
|
|
});
|
|
}
|
|
function r() {
|
|
var a = n.subForm;
|
|
return Object.keys(a).reduce(function(o, s) {
|
|
var u = a[s];
|
|
return u && (Array.isArray(u) ? o.push.apply(o, le(u)) : o.push(u)), o;
|
|
}, []);
|
|
}
|
|
var i = {
|
|
get isScope() {
|
|
return n.vm.props.subForm === !1;
|
|
},
|
|
get isPreview() {
|
|
return n.preview;
|
|
},
|
|
get config() {
|
|
return n.options;
|
|
},
|
|
set config(a) {
|
|
n.fc.options.value = a;
|
|
},
|
|
get options() {
|
|
return n.options;
|
|
},
|
|
set options(a) {
|
|
n.fc.options.value = a;
|
|
},
|
|
get form() {
|
|
return n.form;
|
|
},
|
|
get rule() {
|
|
return n.rules;
|
|
},
|
|
get parent() {
|
|
return n.vm.setupState.parent && n.vm.setupState.parent.setupState.fapi;
|
|
},
|
|
get top() {
|
|
return i.parent ? i.parent.top : i;
|
|
},
|
|
get scope() {
|
|
for (var a = n.vm; a && a.setupState.fapi; )
|
|
if (a.props.subForm)
|
|
a = a.setupState.parent;
|
|
else
|
|
return a.setupState.fapi;
|
|
return i.top;
|
|
},
|
|
get children() {
|
|
return r();
|
|
},
|
|
get siblings() {
|
|
var a = n.vm.setupState.getGroupInject();
|
|
if (a) {
|
|
var o = a.getSubForm();
|
|
if (Array.isArray(o))
|
|
return le(o);
|
|
}
|
|
},
|
|
get index() {
|
|
var a = i.siblings;
|
|
if (a) {
|
|
var o = a.indexOf(i);
|
|
return o > -1 ? o : void 0;
|
|
}
|
|
},
|
|
get formulas() {
|
|
return W({}, n.fc.formulas);
|
|
},
|
|
formData: function(o) {
|
|
if (o == null || typeof o == "boolean") {
|
|
var s = {};
|
|
return Object.keys(n.form).forEach(function(u) {
|
|
(o === !0 || n.ignoreFields.indexOf(u) === -1) && (s[u] = en(n.form[u]));
|
|
}), s;
|
|
} else
|
|
return e(o).reduce(function(u, c) {
|
|
return u[c] = i.getValue(c), u;
|
|
}, {});
|
|
},
|
|
getValue: function(o) {
|
|
var s = n.getFieldCtx(o);
|
|
return s ? en(s.rule.value) : n.options.appendValue !== !1 && Se(n.appendData, o) ? en(n.appendData[o]) : void 0;
|
|
},
|
|
coverValue: function(o) {
|
|
var s = W({}, o || {});
|
|
n.deferSyncValue(function() {
|
|
n.appendData = {}, i.fields().forEach(function(u) {
|
|
var c = n.fieldCtx[u];
|
|
if (c) {
|
|
var l = Se(o, u);
|
|
c.forEach(function(h) {
|
|
h.rule.value = l ? o[u] : void 0;
|
|
}), delete s[u];
|
|
}
|
|
}), ne(n.appendData, s);
|
|
}, !0);
|
|
},
|
|
setValue: function(o) {
|
|
var s = o;
|
|
arguments.length >= 2 && (s = Le({}, o, arguments[1])), n.deferSyncValue(function() {
|
|
Object.keys(s).forEach(function(u) {
|
|
var c = n.fieldCtx[u];
|
|
if (!c)
|
|
return n.appendData[u] = s[u];
|
|
c.forEach(function(l) {
|
|
l.rule.value = s[u];
|
|
});
|
|
});
|
|
}, !0);
|
|
},
|
|
removeField: function(o) {
|
|
var s = n.getCtx(o);
|
|
return n.deferSyncValue(function() {
|
|
n.getCtxs(o).forEach(function(u) {
|
|
u.rm();
|
|
});
|
|
}, !0), s ? s.origin : void 0;
|
|
},
|
|
removeRule: function(o) {
|
|
var s = o && bt(o);
|
|
if (!!s)
|
|
return s.rm(), s.origin;
|
|
},
|
|
fields: function() {
|
|
return n.fields();
|
|
},
|
|
append: function(o, s, u) {
|
|
var c = n.sort.length - 1, l, h = n.getCtx(s);
|
|
if (h)
|
|
if (u) {
|
|
if (l = h.getPending("children", h.rule.children), !Array.isArray(l))
|
|
return;
|
|
c = h.rule.children.length - 1;
|
|
} else
|
|
c = h.root.indexOf(h.origin), l = h.root;
|
|
else
|
|
l = n.rules;
|
|
l.splice(c + 1, 0, o);
|
|
},
|
|
prepend: function(o, s, u) {
|
|
var c = 0, l, h = n.getCtx(s);
|
|
if (h)
|
|
if (u) {
|
|
if (l = h.getPending("children", h.rule.children), !Array.isArray(l))
|
|
return;
|
|
} else
|
|
c = h.root.indexOf(h.origin), l = h.root;
|
|
else
|
|
l = n.rules;
|
|
l.splice(c, 0, o);
|
|
},
|
|
hidden: function(o, s) {
|
|
t(s, "hidden", !!o), n.refresh();
|
|
},
|
|
hiddenStatus: function(o) {
|
|
var s = n.getCtx(o);
|
|
if (!!s)
|
|
return !!s.rule.hidden;
|
|
},
|
|
display: function(o, s) {
|
|
t(s, "display", !!o), n.refresh();
|
|
},
|
|
displayStatus: function(o) {
|
|
var s = n.getCtx(o);
|
|
if (!!s)
|
|
return !!s.rule.display;
|
|
},
|
|
disabled: function(o, s) {
|
|
e(s).forEach(function(u) {
|
|
n.getCtxs(u).forEach(function(c) {
|
|
rt(c.rule.props, "disabled", !!o);
|
|
});
|
|
}), n.refresh();
|
|
},
|
|
all: function(o) {
|
|
return Object.keys(n.ctxs).map(function(s) {
|
|
var u = n.ctxs[s];
|
|
return o ? u.origin : u.rule;
|
|
});
|
|
},
|
|
model: function(o) {
|
|
return n.fields().reduce(function(s, u) {
|
|
var c = n.fieldCtx[u][0];
|
|
return s[u] = o ? c.origin : c.rule, s;
|
|
}, {});
|
|
},
|
|
component: function(o) {
|
|
return Object.keys(n.nameCtx).reduce(function(s, u) {
|
|
var c = n.nameCtx[u].map(function(l) {
|
|
return o ? l.origin : l.rule;
|
|
});
|
|
return s[u] = c.length === 1 ? c[0] : c, s;
|
|
}, {});
|
|
},
|
|
bind: function() {
|
|
return i.form;
|
|
},
|
|
reload: function(o) {
|
|
n.reloadRule(o);
|
|
},
|
|
updateOptions: function(o) {
|
|
n.fc.updateOptions(o), i.refresh();
|
|
},
|
|
onSubmit: function(o) {
|
|
i.updateOptions({
|
|
onSubmit: o
|
|
});
|
|
},
|
|
sync: function(o) {
|
|
if (Array.isArray(o)) {
|
|
o.forEach(function(u) {
|
|
return i.sync(u);
|
|
});
|
|
return;
|
|
}
|
|
var s = F.Object(o) ? bt(o) : n.getCtxs(o);
|
|
!s || (s = Array.isArray(s) ? s : [s], s.forEach(function(u) {
|
|
if (!u.deleted) {
|
|
var c = n.subForm[u.id];
|
|
c && (Array.isArray(c) ? c.forEach(function(l) {
|
|
l.refresh();
|
|
}) : c && c.refresh()), n.$render.clearCache(u);
|
|
}
|
|
}), n.refresh());
|
|
},
|
|
refresh: function() {
|
|
r().forEach(function(o) {
|
|
o.refresh();
|
|
}), n.$render.clearCacheAll(), n.refresh();
|
|
},
|
|
refreshOptions: function() {
|
|
n.$manager.updateOptions(n.options), i.refresh();
|
|
},
|
|
hideForm: function(o) {
|
|
n.vm.setupState.isShow = !o;
|
|
},
|
|
changeStatus: function() {
|
|
return n.changeStatus;
|
|
},
|
|
clearChangeStatus: function() {
|
|
n.changeStatus = !1;
|
|
},
|
|
updateRule: function(o, s) {
|
|
n.getCtxs(o).forEach(function(u) {
|
|
ne(u.rule, s);
|
|
});
|
|
},
|
|
updateRules: function(o) {
|
|
Object.keys(o).forEach(function(s) {
|
|
i.updateRule(s, o[s]);
|
|
});
|
|
},
|
|
mergeRule: function(o, s) {
|
|
n.getCtxs(o).forEach(function(u) {
|
|
$t(u.rule, s);
|
|
});
|
|
},
|
|
mergeRules: function(o) {
|
|
Object.keys(o).forEach(function(s) {
|
|
i.mergeRule(s, o[s]);
|
|
});
|
|
},
|
|
getRule: function(o, s) {
|
|
var u = n.getCtx(o);
|
|
if (u)
|
|
return s ? u.origin : u.rule;
|
|
},
|
|
getRenderRule: function(o) {
|
|
var s = n.getCtx(o);
|
|
if (s)
|
|
return s.prop;
|
|
},
|
|
getRefRule: function(o) {
|
|
var s = n.getCtxs(o);
|
|
if (s) {
|
|
var u = s.map(function(c) {
|
|
return c.rule;
|
|
});
|
|
return u.length === 1 ? u[0] : u;
|
|
}
|
|
},
|
|
setEffect: function(o, s, u) {
|
|
var c = n.getCtx(o);
|
|
c && s && (s[0] === "$" && (s = s.substr(1)), Se(c.rule, "$" + s) && rt(c.rule, "$" + s, u), Se(c.rule, "effect") || (c.rule.effect = {}), rt(c.rule.effect, s, u));
|
|
},
|
|
clearEffectData: function(o, s) {
|
|
var u = n.getCtx(o);
|
|
u && (s && s[0] === "$" && (s = s.substr(1)), u.clearEffectData(s), i.sync(o));
|
|
},
|
|
updateValidate: function(o, s, u) {
|
|
u ? i.mergeRule(o, {
|
|
validate: s
|
|
}) : t(o, "validate", s);
|
|
},
|
|
updateValidates: function(o, s) {
|
|
Object.keys(o).forEach(function(u) {
|
|
i.updateValidate(u, o[u], s);
|
|
});
|
|
},
|
|
refreshValidate: function() {
|
|
i.refresh();
|
|
},
|
|
resetFields: function(o) {
|
|
e(o).forEach(function(s) {
|
|
n.getCtxs(s).forEach(function(u) {
|
|
n.$render.clearCache(u), u.rule.value = en(u.defaultValue);
|
|
});
|
|
}), je(function() {
|
|
je(function() {
|
|
je(function() {
|
|
i.clearValidateState(o);
|
|
});
|
|
});
|
|
}), o == null && (F.Function(n.options.onReset) && fe(function() {
|
|
return n.options.onReset(i);
|
|
}), n.vm.emit("reset", i));
|
|
},
|
|
method: function(o, s) {
|
|
var u = i.el(o);
|
|
if (!u || !u[s])
|
|
throw new Error(Fa("err", "".concat(s, " \u65B9\u6CD5\u4E0D\u5B58\u5728")));
|
|
return function() {
|
|
return u[s].apply(u, arguments);
|
|
};
|
|
},
|
|
exec: function(o, s) {
|
|
for (var u = arguments.length, c = new Array(u > 2 ? u - 2 : 0), l = 2; l < u; l++)
|
|
c[l - 2] = arguments[l];
|
|
return fe(function() {
|
|
return i.method(o, s).apply(void 0, c);
|
|
});
|
|
},
|
|
toJson: function(o) {
|
|
return dn(i.rule, o);
|
|
},
|
|
trigger: function(o, s) {
|
|
for (var u = i.el(o), c = arguments.length, l = new Array(c > 2 ? c - 2 : 0), h = 2; h < c; h++)
|
|
l[h - 2] = arguments[h];
|
|
u && u.$emit.apply(u, [s].concat(l));
|
|
},
|
|
el: function(o) {
|
|
var s = n.getCtx(o);
|
|
if (s)
|
|
return s.el || n.vm.refs[s.ref];
|
|
},
|
|
closeModal: function(o) {
|
|
n.bus.$emit("fc:closeModal:" + o);
|
|
},
|
|
getSubForm: function(o) {
|
|
var s = n.getCtx(o);
|
|
return s ? n.subForm[s.id] : void 0;
|
|
},
|
|
getChildrenRuleList: function(o) {
|
|
var s = pe(o) === "object", u = s ? bt(o) : n.getCtx(o), c = u ? u.rule : s ? o : i.getRule(o);
|
|
if (!c)
|
|
return [];
|
|
var l = [], h = function(w) {
|
|
w && w.forEach(function($) {
|
|
pe($) === "object" && ($.field && l.push($), l.push.apply(l, le(i.getChildrenRuleList($))));
|
|
});
|
|
};
|
|
return h(u ? u.loadChildrenPending() : c.children), l;
|
|
},
|
|
getParentRule: function(o) {
|
|
var s = pe(o) === "object", u = s ? bt(o) : n.getCtx(o);
|
|
return u.parent.rule;
|
|
},
|
|
getParentSubRule: function(o) {
|
|
var s = pe(o) === "object", u = s ? bt(o) : n.getCtx(o);
|
|
if (u) {
|
|
var c = u.getParentGroup();
|
|
if (c)
|
|
return c.rule;
|
|
}
|
|
},
|
|
getChildrenFormData: function(o, s) {
|
|
var u = i.getChildrenRuleList(o);
|
|
return u.reduce(function(c, l) {
|
|
return (l.ignore !== !0 || s === !0) && (c[l.field] = en(l.value)), c;
|
|
}, {});
|
|
},
|
|
setChildrenFormData: function(o, s, u) {
|
|
var c = i.getChildrenRuleList(o);
|
|
n.deferSyncValue(function() {
|
|
c.forEach(function(l) {
|
|
Se(s, l.field) ? l.value = s[l.field] : u && (l.value = void 0);
|
|
});
|
|
});
|
|
},
|
|
getGlobalEvent: function(o) {
|
|
var s = i.options.globalEvent[o];
|
|
if (s)
|
|
return pe(s) === "object" && (s = s.handle), gt(s);
|
|
},
|
|
getGlobalData: function(o) {
|
|
return new Promise(function(s, u) {
|
|
var c = i.options.globalData[o];
|
|
c || s(n.fc.loadData[o]), c.type === "fetch" ? i.fetch(c).then(function(l) {
|
|
s(l);
|
|
}).catch(u) : s(c.data);
|
|
});
|
|
},
|
|
renderRule: function(o, s, u) {
|
|
var c = pe(o) === "object", l = c ? bt(o) : n.getCtx(o);
|
|
return l ? n.$render.createRuleVnode(l, s, u) : void 0;
|
|
},
|
|
renderChildren: function(o, s, u) {
|
|
var c = pe(o) === "object", l = c ? bt(o) : n.getCtx(o);
|
|
return l ? n.$render.createChildrenVnodes(l, s, u) : void 0;
|
|
},
|
|
nextTick: function(o) {
|
|
n.bus.$once("next-tick", o), n.refresh();
|
|
},
|
|
nextRefresh: function(o) {
|
|
n.nextRefresh(), o && fe(o);
|
|
},
|
|
deferSyncValue: function(o, s) {
|
|
n.deferSyncValue(o, s);
|
|
},
|
|
emit: function(o) {
|
|
for (var s, u = arguments.length, c = new Array(u > 1 ? u - 1 : 0), l = 1; l < u; l++)
|
|
c[l - 1] = arguments[l];
|
|
(s = n.vm).emit.apply(s, [o].concat(c));
|
|
},
|
|
bus: n.bus,
|
|
fetch: function(o) {
|
|
return new Promise(function(s, u) {
|
|
o = ht(o), o = n.loadFetchVar(o), n.beforeFetch(o).then(function() {
|
|
return Li(o, n.fc.create.fetch, i).then(function(c) {
|
|
fe(function() {
|
|
return o.onSuccess && o.onSuccess(c);
|
|
}), s(c);
|
|
}).catch(function(c) {
|
|
fe(function() {
|
|
return o.onError && o.onError(c);
|
|
}), u(c);
|
|
});
|
|
}).catch(function(c) {
|
|
});
|
|
});
|
|
},
|
|
watchFetch: function(o, s, u, c) {
|
|
return n.fc.watchLoadData(function(l, h) {
|
|
var m = ht(o);
|
|
m = n.loadFetchVar(m, l), !(c && c(m, h) === !1) && n.beforeFetch(m).then(function() {
|
|
return Li(m, n.fc.create.fetch, i).then(function(w) {
|
|
fe(function() {
|
|
return m.onSuccess && m.onSuccess(w);
|
|
}), s && s(w, h);
|
|
}).catch(function(w) {
|
|
fe(function() {
|
|
return m.onError && m.onError(w);
|
|
}), u && u(w);
|
|
});
|
|
}).catch(function(w) {
|
|
});
|
|
}, o.wait == null ? 1e3 : o.wait);
|
|
},
|
|
getData: function(o, s) {
|
|
return n.fc.get ? n.fc.get(o, s) : n.fc.getLoadData(o, s);
|
|
},
|
|
watchData: function(o) {
|
|
return n.fc.watchLoadData(function(s, u) {
|
|
fe(function() {
|
|
return o(s, u);
|
|
});
|
|
});
|
|
},
|
|
setData: function(o, s, u) {
|
|
return n.fc.setData(o, s, u);
|
|
},
|
|
refreshData: function(o) {
|
|
return n.fc.refreshData(o);
|
|
},
|
|
t: function(o, s) {
|
|
return n.fc.t(o, s);
|
|
},
|
|
getLocale: function() {
|
|
return n.fc.getLocale();
|
|
},
|
|
helper: {
|
|
tidyFields: e,
|
|
props: t
|
|
}
|
|
};
|
|
return ["on", "once", "off"].forEach(function(a) {
|
|
i[a] = function() {
|
|
var o;
|
|
(o = n.bus)["$".concat(a)].apply(o, arguments);
|
|
};
|
|
}), i.changeValue = i.changeField = i.setValue, i;
|
|
}
|
|
function Zs(n) {
|
|
ne(n.prototype, {
|
|
initCache: function() {
|
|
this.clearCacheAll();
|
|
},
|
|
clearCache: function(t) {
|
|
if (!t.rule.cache) {
|
|
if (!this.cache[t.id]) {
|
|
t.parent && this.clearCache(t.parent);
|
|
return;
|
|
}
|
|
(this.cache[t.id].use === !0 || this.cache[t.id].parent) && this.$handle.refresh(), this.cache[t.id].parent && this.clearCache(this.cache[t.id].parent), this.cache[t.id] = null;
|
|
}
|
|
},
|
|
clearCacheAll: function() {
|
|
this.cache = {};
|
|
},
|
|
setCache: function(t, r, i) {
|
|
this.cache[t.id] = {
|
|
vnode: r,
|
|
use: !1,
|
|
parent: i,
|
|
slot: t.rule.slot
|
|
};
|
|
},
|
|
getCache: function(t) {
|
|
var r = this.cache[t.id];
|
|
if (r)
|
|
return r.use = !0, r.vnode;
|
|
}
|
|
});
|
|
}
|
|
function Qs(n) {
|
|
return n == null ? "" : pe(n) === "object" ? JSON.stringify(n, null, 2) : String(n);
|
|
}
|
|
var eu = 0;
|
|
function Hn() {
|
|
var n = 370 + ++eu;
|
|
return "F" + Math.random().toString(36).substr(3, 3) + Number("".concat(Date.now())).toString(36) + n.toString(36) + "c";
|
|
}
|
|
function kt(n, e, t) {
|
|
var r = n, i;
|
|
return (e || "").split(".").forEach(function(a) {
|
|
i && ((!r[i] || pe(r[i]) != "object") && (r[i] = {}), r = r[i]), i = a;
|
|
}), r[i] = t, r;
|
|
}
|
|
function tu(n) {
|
|
ne(n.prototype, {
|
|
initRender: function() {
|
|
this.cacheConfig = {};
|
|
},
|
|
getTypeSlot: function(t) {
|
|
var r = function i(a) {
|
|
if (a) {
|
|
var o = void 0;
|
|
return t.rule.field && (o = a.slots["field-" + fn(t.rule.field)] || a.slots["field-" + t.rule.field]), o || (o = a.slots["type-" + fn(t.type)] || a.slots["type-" + t.type]), o || i(a.setupState.parent);
|
|
}
|
|
};
|
|
return r(this.vm);
|
|
},
|
|
render: function() {
|
|
var t = this;
|
|
if (!!this.vm.setupState.isShow) {
|
|
this.$manager.beforeRender();
|
|
var r = bn();
|
|
return this.sort.forEach(function(i) {
|
|
t.renderSlot(r, t.$handle.ctxs[i]);
|
|
}), this.$manager.render(r);
|
|
}
|
|
},
|
|
renderSlot: function(t, r, i) {
|
|
if (this.isFragment(r)) {
|
|
r.initProp(), this.mergeGlobal(r), r.initNone();
|
|
var a = this.renderChildren(r.loadChildrenPending(), r), o = a.default;
|
|
o && t.setSlot(r.rule.slot, function() {
|
|
return o();
|
|
}), delete a.default, t.mergeBag(a);
|
|
} else
|
|
t.setSlot(r.rule.slot, this.renderCtx(r, i));
|
|
},
|
|
mergeGlobal: function(t) {
|
|
var r = this, i = this.$handle.options.global;
|
|
!i || (this.cacheConfig[t.trueType] || (this.cacheConfig[t.trueType] = at(function() {
|
|
var a = r.$handle.options.global;
|
|
return $t({}, [a["*"] || a.default || {}, a[t.originType] || a[t.type] || a[t.type] || {}]);
|
|
})), t.prop = $t({}, [this.cacheConfig[t.trueType].value, t.prop]));
|
|
},
|
|
setOptions: function(t) {
|
|
var r = t.loadPending({
|
|
key: "options",
|
|
origin: t.prop.options,
|
|
def: []
|
|
});
|
|
t.prop.options = r, t.prop.optionsTo && r && kt(t.prop, t.prop.optionsTo, r);
|
|
},
|
|
deepSet: function(t) {
|
|
var r = t.rule.deep;
|
|
r && Object.keys(r).sort(function(i, a) {
|
|
return i.length < a.length ? -1 : 1;
|
|
}).forEach(function(i) {
|
|
kt(t.prop, i, r[i]);
|
|
});
|
|
},
|
|
parseSide: function(t, r) {
|
|
return F.Object(t) ? $t({
|
|
props: {
|
|
formCreateInject: r.prop.props.formCreateInject
|
|
}
|
|
}, t) : t;
|
|
},
|
|
renderSides: function(t, r, i) {
|
|
var a = r[i ? "rule" : "prop"];
|
|
return [this.renderRule(this.parseSide(a.prefix, r)), t, this.renderRule(this.parseSide(a.suffix, r))];
|
|
},
|
|
renderId: function(t, r) {
|
|
var i = this, a = this.$handle[r === "field" ? "fieldCtx" : "nameCtx"][t];
|
|
return a ? a.map(function(o) {
|
|
return i.renderCtx(o, o.parent);
|
|
}) : void 0;
|
|
},
|
|
renderCtx: function(t, r) {
|
|
var i = this;
|
|
try {
|
|
if (t.type === "hidden")
|
|
return;
|
|
var a = t.rule;
|
|
if (this.force || !this.cache[t.id] || this.cache[t.id].slot !== a.slot) {
|
|
var o;
|
|
t.initProp(), this.mergeGlobal(t), t.initNone(), this.$manager.tidyRule(t), this.deepSet(t), this.setOptions(t), this.ctxProp(t);
|
|
var s = t.prop;
|
|
s.preview = !!(s.preview != null ? s.preview : this.$handle.preview), s.props.formCreateInject = this.injectProp(t);
|
|
var u = s.cache !== !1, c = s.preview;
|
|
if (s.hidden) {
|
|
this.setCache(t, void 0, r);
|
|
return;
|
|
}
|
|
o = function() {
|
|
for (var h = arguments.length, m = new Array(h), w = 0; w < h; w++)
|
|
m[w] = arguments[w];
|
|
var $ = {
|
|
rule: a,
|
|
prop: s,
|
|
preview: c,
|
|
api: i.$handle.api,
|
|
model: s.model || {},
|
|
slotValue: m
|
|
};
|
|
m.length && a.slotUpdate && fe(function() {
|
|
return a.slotUpdate($);
|
|
});
|
|
var S = {}, T = t.loadChildrenPending();
|
|
t.parser.renderChildren ? S = t.parser.renderChildren(T, t) : t.parser.loadChildren !== !1 && (S = i.renderChildren(T, t)), Object.keys(s.renderSlots || {}).forEach(function(B) {
|
|
S[B] = function() {
|
|
for (var Z = arguments.length, Q = new Array(Z), q = 0; q < Z; q++)
|
|
Q[q] = arguments[q];
|
|
if (F.Function(s.renderSlots[B]))
|
|
return fe(function() {
|
|
var re;
|
|
return (re = s.renderSlots)[B].apply(re, Q);
|
|
});
|
|
var ce = i.parseSide(s.renderSlots[B], t);
|
|
return i.renderRule(ce);
|
|
};
|
|
});
|
|
var U = i.getTypeSlot(t), z;
|
|
return U ? ($.children = S, z = U($)) : z = c ? t.parser.preview(br(S), t) : t.parser.render(br(S), t), z = i.renderSides(z, t), !(!t.input && F.Undef(s.native)) && s.native !== !0 && (i.fc.targetFormDriver("updateWrap", t), z = i.$manager.makeWrap(t, z)), t.none && (Array.isArray(z) ? z = z.map(function(B) {
|
|
return !B || !B.__v_isVNode ? B : i.none(B);
|
|
}) : z = i.none(z)), u && i.setCache(t, function() {
|
|
return i.stable(z);
|
|
}, r), z;
|
|
}, this.setCache(t, o, r);
|
|
}
|
|
return function() {
|
|
var l = i.getCache(t);
|
|
if (l)
|
|
return l.apply(void 0, arguments);
|
|
if (i.cache[t.id])
|
|
return;
|
|
var h = i.renderCtx(t, t.parent);
|
|
if (h)
|
|
return h();
|
|
};
|
|
} catch (l) {
|
|
console.error(l);
|
|
return;
|
|
}
|
|
},
|
|
none: function(t) {
|
|
if (t)
|
|
return t.props.class = this.mergeClass(t.props.class, "fc-none"), t;
|
|
},
|
|
mergeClass: function(t, r) {
|
|
if (Array.isArray(t))
|
|
t.push(r);
|
|
else
|
|
return t ? [t, r] : r;
|
|
return t;
|
|
},
|
|
stable: function(t) {
|
|
var r = this, i = Array.isArray(t) ? t : [t];
|
|
return i.forEach(function(a) {
|
|
a && a.__v_isVNode && a.children && pe(a.children) === "object" && (a.children.$stable = !0, r.stable(a.children));
|
|
}), t;
|
|
},
|
|
getModelField: function(t) {
|
|
return t.prop.modelField || t.parser.modelField || this.fc.modelFields[this.vNode.aliasMap[t.type]] || this.fc.modelFields[t.type] || this.fc.modelFields[t.originType] || "modelValue";
|
|
},
|
|
isFragment: function(t) {
|
|
return t.type === "fragment" || t.type === "template";
|
|
},
|
|
injectProp: function(t) {
|
|
var r = this, i = this.vm.setupState;
|
|
i.ctxInject[t.id] || (i.ctxInject[t.id] = {
|
|
api: this.$handle.api,
|
|
form: this.fc.create,
|
|
subForm: function(s) {
|
|
r.$handle.addSubForm(t, s);
|
|
},
|
|
getSubForm: function() {
|
|
return r.$handle.subForm[t.id];
|
|
},
|
|
slots: function() {
|
|
return r.vm.setupState.top.slots;
|
|
},
|
|
options: [],
|
|
children: [],
|
|
preview: !1,
|
|
id: t.id,
|
|
field: t.field,
|
|
rule: t.rule,
|
|
input: t.input,
|
|
t: function() {
|
|
var s;
|
|
return (s = r.$handle.api).t.apply(s, arguments);
|
|
},
|
|
updateValue: function(s) {
|
|
r.$handle.onUpdateValue(t, s);
|
|
}
|
|
});
|
|
var a = i.ctxInject[t.id];
|
|
return ne(a, {
|
|
preview: t.prop.preview,
|
|
options: t.prop.options,
|
|
children: t.loadChildrenPending()
|
|
}), a;
|
|
},
|
|
ctxProp: function(t) {
|
|
var r = this, i = t.ref, a = t.key, o = t.rule;
|
|
this.$manager.mergeProp(t), t.parser.mergeProp(t);
|
|
var s = [{
|
|
ref: i,
|
|
key: o.key || "".concat(a, "fc"),
|
|
slot: void 0,
|
|
on: {
|
|
vnodeMounted: function(m) {
|
|
m.el.__rule__ = t.rule, r.onMounted(t, m.el);
|
|
},
|
|
"fc.updateValue": function(m) {
|
|
r.$handle.onUpdateValue(t, m);
|
|
},
|
|
"fc.el": function(m) {
|
|
t.exportEl = m, m && ((m.$el || m).__rule__ = t.rule);
|
|
}
|
|
}
|
|
}];
|
|
if (t.input) {
|
|
var u = this.tmpInput;
|
|
this.vm.props.disabled === !0 && (t.prop.props.disabled = !0);
|
|
var c = this.getModelField(t), l = {
|
|
callback: function(m) {
|
|
u && u(t.field, m, t.rule), r.onInput(t, m);
|
|
},
|
|
modelField: c,
|
|
value: this.$handle.getFormData(t)
|
|
};
|
|
s.push({
|
|
on: W(Le({}, "update:".concat(c), l.callback), t.prop.modelEmit ? Le({}, t.prop.modelEmit, function() {
|
|
return r.onEmitInput(t);
|
|
}) : {}),
|
|
props: Le({}, c, l.value)
|
|
}), t.prop.model = l;
|
|
}
|
|
return Rt(s, t.prop), t.prop;
|
|
},
|
|
onMounted: function(t, r) {
|
|
t.el = this.vm.refs[t.ref] || r, t.parser.mounted(t), this.$handle.effect(t, "mounted"), this.$handle.targetHook(t, "mounted");
|
|
},
|
|
onInput: function(t, r) {
|
|
if (t.prop.modelEmit) {
|
|
this.$handle.onBaseInput(t, r);
|
|
return;
|
|
}
|
|
this.$handle.onInput(t, r);
|
|
},
|
|
onEmitInput: function(t) {
|
|
this.$handle.setValue(t, t.parser.toValue(t.modelValue, t), t.modelValue);
|
|
},
|
|
renderChildren: function(t, r) {
|
|
var i = this;
|
|
if (!F.trueArray(t))
|
|
return {};
|
|
var a = bn();
|
|
return t.map(function(o) {
|
|
if (!!o) {
|
|
if (F.String(o))
|
|
return a.setSlot(null, o);
|
|
if (o.__fc__)
|
|
return i.renderSlot(a, o.__fc__, r);
|
|
o.type && je(function() {
|
|
i.$handle.loadChildren(t, r), i.$handle.refresh();
|
|
});
|
|
}
|
|
}), a.getSlots();
|
|
},
|
|
defaultRender: function(t, r) {
|
|
var i = t.prop;
|
|
return i.component ? typeof i.component == "string" ? this.vNode.make(i.component, i, r) : this.vNode.makeComponent(i.component, i, r) : this.vNode[t.type] ? this.vNode[t.type](i, r) : this.vNode[t.originType] ? this.vNode[t.originType](i, r) : this.vNode.make(Ia(i.type), i, r);
|
|
},
|
|
createChildrenVnodes: function(t, r, i) {
|
|
this.force = i !== !1, this.tmpInput = r;
|
|
var a = this.renderChildren(t.rule.children, t);
|
|
return this.force = !1, this.tmpInput = null, a;
|
|
},
|
|
createRuleVnode: function(t, r, i) {
|
|
this.force = i !== !1, this.tmpInput = r;
|
|
var a = bn();
|
|
return this.renderSlot(a, t, t.parent), this.force = !1, this.tmpInput = null, a.getSlots();
|
|
},
|
|
renderRule: function(t, r, i) {
|
|
var a = this;
|
|
if (!!t) {
|
|
if (F.String(t))
|
|
return t;
|
|
var o;
|
|
if (i)
|
|
o = t.type;
|
|
else if (o = t.is, t.type) {
|
|
o = ft(t.type);
|
|
var s = this.vNode.aliasMap[o];
|
|
s && (o = ft(s));
|
|
}
|
|
if (!!o) {
|
|
var u = bn();
|
|
F.trueArray(t.children) && t.children.forEach(function(l) {
|
|
l && u.setSlot(l == null ? void 0 : l.slot, function() {
|
|
return a.renderRule(l);
|
|
});
|
|
});
|
|
var c = W({}, t);
|
|
return delete c.type, delete c.is, this.vNode.make(o, c, u.mergeBag(r).getSlots());
|
|
}
|
|
}
|
|
}
|
|
});
|
|
}
|
|
var nu = 1;
|
|
function Lr(n) {
|
|
ne(this, {
|
|
$handle: n,
|
|
fc: n.fc,
|
|
vm: n.vm,
|
|
$manager: n.$manager,
|
|
vNode: new n.fc.CreateNode(n.vm),
|
|
force: !1,
|
|
tmpInput: null,
|
|
id: nu++
|
|
}), Na(this, {
|
|
options: function() {
|
|
return n.options;
|
|
},
|
|
sort: function() {
|
|
return n.sort;
|
|
}
|
|
}), this.initCache(), this.initRender();
|
|
}
|
|
Zs(Lr);
|
|
tu(Lr);
|
|
function ru(n) {
|
|
ne(n.prototype, {
|
|
parseInjectEvent: function(t, r) {
|
|
var i = t.inject || this.options.injectEvent;
|
|
return this.parseEventLst(t, r, i);
|
|
},
|
|
parseEventLst: function(t, r, i, a) {
|
|
var o = this;
|
|
return Object.keys(r).forEach(function(s) {
|
|
var u = o.parseEvent(t, r[s], i, a);
|
|
u && (r[s] = u);
|
|
}), r;
|
|
},
|
|
parseEvent: function(t, r, i, a) {
|
|
if (F.Function(r) && (i !== !1 && !F.Undef(i) || r.__inject))
|
|
return this.inject(t, r, i);
|
|
if (!a && Array.isArray(r) && r[0] && (F.String(r[0]) || F.Function(r[0])))
|
|
return this.parseEventLst(t, r, i, !0);
|
|
if (F.String(r)) {
|
|
var o = gt(r);
|
|
if (o && r !== o)
|
|
return o.__inject ? this.parseEvent(t, o, i, !0) : o;
|
|
}
|
|
},
|
|
parseEmit: function(t) {
|
|
var r = this, i = {}, a = t.rule, o = a.emitPrefix, s = a.field, u = a.name, c = a.inject, l = a.emit || [];
|
|
return F.trueArray(l) && l.forEach(function(h) {
|
|
if (!!h) {
|
|
var m, w = o || s || u;
|
|
if (F.Object(h) && (m = h.inject, h = h.name, w = h.prefix || w), w) {
|
|
var $ = fn("".concat(w, "-").concat(h)), S = function() {
|
|
var z, B, Z;
|
|
r.vm.emitsOptions && (r.vm.emitsOptions[$] = null);
|
|
for (var Q = arguments.length, q = new Array(Q), ce = 0; ce < Q; ce++)
|
|
q[ce] = arguments[ce];
|
|
(z = r.vm).emit.apply(z, [$].concat(q)), (B = r.vm).emit.apply(B, ["emit-event", $].concat(q)), (Z = r.bus).$emit.apply(Z, [$].concat(q));
|
|
};
|
|
if (S.__emit = !0, !m && c === !1)
|
|
i[h] = S;
|
|
else {
|
|
var T = m || c || r.options.injectEvent;
|
|
i[h] = F.Undef(T) ? S : r.inject(a, S, T);
|
|
}
|
|
}
|
|
}
|
|
}), t.computed.on = i, i;
|
|
},
|
|
getInjectData: function(t, r) {
|
|
var i = t.__fc__ && t.__fc__.$api, a = t.__fc__ && t.__fc__.$handle.vm || this.vm, o = a.props, s = o.option, u = o.rule;
|
|
return {
|
|
$f: i || this.api,
|
|
api: i || this.api,
|
|
rule: u,
|
|
self: t.__origin__,
|
|
option: s,
|
|
inject: r
|
|
};
|
|
},
|
|
inject: function(t, r, i) {
|
|
if (r.__origin) {
|
|
if (this.watching && !this.loading)
|
|
return r;
|
|
r = r.__origin;
|
|
}
|
|
var a = this, o = function() {
|
|
for (var u = a.getInjectData(t, i), c = arguments.length, l = new Array(c), h = 0; h < c; h++)
|
|
l[h] = arguments[h];
|
|
return u.args = [].concat(l), l.unshift(u), r.apply(this, l);
|
|
};
|
|
return o.__origin = r, o.__json = r.__json, o;
|
|
},
|
|
loadStrVar: function(t, r, i) {
|
|
var a = this;
|
|
if (t && typeof t == "string" && t.indexOf("{{") > -1 && t.indexOf("}}") > -1) {
|
|
var o = t, s = Gs(t), u;
|
|
if (s.forEach(function(c) {
|
|
var l = c.split("||"), h = l[0].trim();
|
|
if (h) {
|
|
var m = (l[1] || "").trim(), w, $ = !1;
|
|
if (i && h.indexOf("$form.") === 0) {
|
|
var S = h.split(".");
|
|
S.shift(), Se(i.value, S[0]) && ($ = !0, w = r ? r({
|
|
id: "$form." + S[0] + "_" + i.rule.__fc__.id,
|
|
getValue: function() {
|
|
return Ge(i.value, S);
|
|
}
|
|
}) : Ge(i.value, S));
|
|
}
|
|
$ || (w = r ? r(h, m) : a.fc.getLoadData(h, m)), u = w, t = t.replaceAll("{{".concat(c, "}}"), w == null ? "" : w);
|
|
}
|
|
}), s.length === 1 && o === "{{".concat(s[0], "}}"))
|
|
return u;
|
|
}
|
|
return t;
|
|
},
|
|
loadFetchVar: function(t, r, i) {
|
|
var a = this, o;
|
|
i && i.__fc__ && (o = i.__fc__.getParentGroup());
|
|
var s = function(c) {
|
|
return a.loadStrVar(c, r, o ? {
|
|
rule: i,
|
|
value: a.subRuleData[o.id] || {}
|
|
} : null);
|
|
};
|
|
return t.action = s(t.action || ""), ["headers", "data", "query"].forEach(function(u) {
|
|
if (t[u]) {
|
|
var c = {};
|
|
Object.keys(t[u]).forEach(function(l) {
|
|
c[s(l)] = s(t[u][l]);
|
|
}), t[u] = c;
|
|
}
|
|
}), t;
|
|
}
|
|
});
|
|
}
|
|
var Ni = ["hook:updated", "hook:mounted"];
|
|
function iu(n) {
|
|
ne(n.prototype, {
|
|
usePage: function() {
|
|
var t = this, r = this.options.page;
|
|
if (!!r) {
|
|
var i = 25, a = au(this.rules);
|
|
F.Object(r) && (r.first && (i = parseInt(r.first, 10) || i), r.limit && (a = parseInt(r.limit, 10) || a)), ne(this, {
|
|
first: i,
|
|
limit: a,
|
|
pageEnd: this.rules.length <= i
|
|
}), this.bus.$on("page-end", function() {
|
|
return t.vm.emit("page-end", t.api);
|
|
}), this.pageLoad();
|
|
}
|
|
},
|
|
pageLoad: function() {
|
|
var t = this, r = function i() {
|
|
t.pageEnd ? (t.bus.$off(Ni, i), t.bus.$emit("page-end")) : (t.first += t.limit, t.pageEnd = t.rules.length <= t.first, t.loadRule(), t.refresh());
|
|
};
|
|
this.bus.$on(Ni, r);
|
|
}
|
|
});
|
|
}
|
|
function au(n) {
|
|
return n.length < 31 ? 31 : Math.ceil(n.length / 3);
|
|
}
|
|
function ou(n) {
|
|
ne(n.prototype, {
|
|
clearNextTick: function() {
|
|
this.nextTick && clearTimeout(this.nextTick), this.nextTick = null;
|
|
},
|
|
bindNextTick: function(t) {
|
|
var r = this;
|
|
this.clearNextTick(), this.nextTick = setTimeout(function() {
|
|
t(), r.nextTick = null;
|
|
}, 10);
|
|
},
|
|
render: function() {
|
|
return ++this.loadedId, this.vm.setupState.unique > 0 ? this.$render.render() : (this.vm.setupState.unique = 1, []);
|
|
}
|
|
});
|
|
}
|
|
function su(n) {
|
|
Object.defineProperties(n.origin, {
|
|
__fc__: Or(Te(n), !0)
|
|
}), n.rule !== n.origin && Object.defineProperties(n.rule, {
|
|
__fc__: Or(Te(n), !0)
|
|
});
|
|
}
|
|
function Ga(n, e, t) {
|
|
var r = Hn(), i = !!e.field;
|
|
ne(this, {
|
|
id: r,
|
|
ref: r,
|
|
wrapRef: r + "fi",
|
|
rule: e,
|
|
origin: e.__origin__ || e,
|
|
name: e.name,
|
|
pending: {},
|
|
none: !1,
|
|
watch: [],
|
|
linkOn: [],
|
|
root: [],
|
|
ctrlRule: [],
|
|
children: [],
|
|
parent: null,
|
|
group: e.subRule ? this : null,
|
|
cacheConfig: null,
|
|
prop: W({}, e),
|
|
computed: {},
|
|
payload: {},
|
|
refRule: {},
|
|
input: i,
|
|
el: void 0,
|
|
exportEl: void 0,
|
|
defaultValue: i ? ht(t) : void 0,
|
|
field: e.field || void 0
|
|
}), this.updateKey(), su(this), this.update(n, !0);
|
|
}
|
|
ne(Ga.prototype, {
|
|
getParentGroup: function() {
|
|
for (var e = this.parent; e; ) {
|
|
if (e.group)
|
|
return e;
|
|
e = e.parent;
|
|
}
|
|
},
|
|
loadChildrenPending: function() {
|
|
var e = this, t = this.rule.children || [];
|
|
return Array.isArray(t) ? t : this.loadPending({
|
|
key: "children",
|
|
origin: t,
|
|
def: [],
|
|
onLoad: function(i) {
|
|
e.$handle && e.$handle.loadChildren(i, e);
|
|
},
|
|
onUpdate: function(i, a) {
|
|
e.$handle && (i === a ? e.$handle.loadChildren(i, e) : e.$handle.updateChildren(e, i, a));
|
|
},
|
|
onReload: function(i) {
|
|
e.$handle ? e.$handle.updateChildren(e, [], i) : delete e.pending.children;
|
|
}
|
|
});
|
|
},
|
|
loadPending: function(e) {
|
|
var t = this, r = e.key, i = e.origin, a = e.def, o = e.onLoad, s = e.onReload, u = e.onUpdate;
|
|
if (this.pending[r] && this.pending[r].origin === i)
|
|
return this.getPending(r, a);
|
|
delete this.pending[r];
|
|
var c = i;
|
|
if (F.Function(i)) {
|
|
var l = fe(function() {
|
|
return i({
|
|
rule: t.rule,
|
|
api: t.$api,
|
|
update: function(m) {
|
|
var w = m || a, $ = t.getPending(r, a);
|
|
t.setPending(r, i, w), u && u(w, $);
|
|
},
|
|
reload: function() {
|
|
var m = t.getPending(r, a);
|
|
delete t.pending[r], s && s(m), t.$api && t.$api.sync(t.rule);
|
|
}
|
|
});
|
|
});
|
|
l && F.Function(l.then) ? (l.then(function(h) {
|
|
var m = h || a;
|
|
t.setPending(r, i, m), o && o(m), t.$api && t.$api.sync(t.rule);
|
|
}).catch(function(h) {
|
|
console.error(h);
|
|
}), c = a, this.setPending(r, i, c)) : (c = l || a, this.setPending(r, i, c), o && o(c));
|
|
}
|
|
return c;
|
|
},
|
|
getPending: function(e, t) {
|
|
return this.pending[e] && this.pending[e].value || t;
|
|
},
|
|
setPending: function(e, t, r) {
|
|
this.pending[e] = {
|
|
origin: t,
|
|
value: Be(r)
|
|
};
|
|
},
|
|
effectData: function(e) {
|
|
return this.payload[e] || (this.payload[e] = {}), this.payload[e];
|
|
},
|
|
clearEffectData: function(e) {
|
|
e === void 0 ? this.payload = {} : delete this.payload[e];
|
|
},
|
|
updateKey: function(e) {
|
|
this.key = Hn(), e && this.parent && this.parent.updateKey(e);
|
|
},
|
|
updateType: function() {
|
|
this.originType = this.rule.type, this.type = ft(this.rule.type), this.trueType = this.$handle.getType(this.originType);
|
|
},
|
|
setParser: function(e) {
|
|
this.parser = e, e.init(this);
|
|
},
|
|
initProp: function() {
|
|
var e = this, t, r, i = W({}, this.rule);
|
|
delete i.children, delete i.validate, this.prop = $t({}, [i].concat(le(Object.keys(this.payload).map(function(a) {
|
|
return e.payload[a];
|
|
})), [this.computed])), this.prop.validate = [].concat(le(((t = this.refRule) === null || t === void 0 || (r = t.__$validate) === null || r === void 0 ? void 0 : r.value) || []), le(this.prop.validate || []));
|
|
},
|
|
initNone: function() {
|
|
this.none = !(F.Undef(this.prop.display) || !!this.prop.display);
|
|
},
|
|
injectValidate: function() {
|
|
return this.prop.validate;
|
|
},
|
|
check: function(e) {
|
|
return this.vm === e.vm;
|
|
},
|
|
unwatch: function() {
|
|
this.watch.forEach(function(e) {
|
|
return e();
|
|
}), this.watch = [], this.refRule = {};
|
|
},
|
|
unlink: function() {
|
|
this.linkOn.forEach(function(e) {
|
|
return e();
|
|
}), this.linkOn = [];
|
|
},
|
|
link: function() {
|
|
this.unlink(), this.$handle.appendLink(this);
|
|
},
|
|
watchTo: function() {
|
|
this.$handle.watchCtx(this);
|
|
},
|
|
delete: function() {
|
|
this.unwatch(), this.unlink(), this.rmCtrl(), this.parent && this.parent.children.splice(this.parent.children.indexOf(this) >>> 0, 1), ne(this, {
|
|
deleted: !0,
|
|
computed: {},
|
|
parent: null,
|
|
children: [],
|
|
cacheConfig: null,
|
|
none: !1
|
|
});
|
|
},
|
|
rmCtrl: function() {
|
|
this.ctrlRule.forEach(function(e) {
|
|
return e.__fc__ && e.__fc__.rm();
|
|
}), this.ctrlRule = [];
|
|
},
|
|
rm: function() {
|
|
var e = this, t = function() {
|
|
var i = e.root.indexOf(e.origin);
|
|
i > -1 && (e.root.splice(i, 1), e.$handle && e.$handle.refresh());
|
|
};
|
|
if (this.deleted) {
|
|
t();
|
|
return;
|
|
}
|
|
this.$handle.noWatch(function() {
|
|
e.$handle.deferSyncValue(function() {
|
|
e.rmCtrl(), t(), e.$handle.rmCtx(e), ne(e, {
|
|
root: []
|
|
});
|
|
}, e.input);
|
|
});
|
|
},
|
|
update: function(e, t) {
|
|
ne(this, {
|
|
deleted: !1,
|
|
$handle: e,
|
|
$render: e.$render,
|
|
$api: e.api,
|
|
vm: e.vm,
|
|
vNode: e.$render.vNode,
|
|
updated: !1,
|
|
cacheValue: this.rule.value
|
|
}), !t && this.unwatch(), this.watchTo(), this.link(), this.updateType();
|
|
}
|
|
});
|
|
function uu(n) {
|
|
ne(n.prototype, {
|
|
nextRefresh: function(t) {
|
|
var r = this, i = this.loadedId;
|
|
je(function() {
|
|
i === r.loadedId && (t ? t() : r.refresh());
|
|
});
|
|
},
|
|
parseRule: function(t) {
|
|
var r = this, i = ji(t);
|
|
return Object.defineProperties(i, {
|
|
__origin__: Or(t, !0)
|
|
}), lu(i), this.appendValue(i), [i, i.prefix, i.suffix].forEach(function(a) {
|
|
!a || r.loadFn(a, i);
|
|
}), this.loadCtrl(i), i.update && (i.update = gt(i.update)), i;
|
|
},
|
|
loadFn: function(t, r) {
|
|
var i = this;
|
|
["on", "props", "deep"].forEach(function(a) {
|
|
t[a] && i.parseInjectEvent(r, t[a]);
|
|
});
|
|
},
|
|
loadCtrl: function(t) {
|
|
t.control && t.control.forEach(function(r) {
|
|
r.handle && (r.handle = gt(r.handle));
|
|
});
|
|
},
|
|
syncProp: function(t) {
|
|
var r = this, i = t.rule;
|
|
F.trueArray(i.sync) && Rt([{
|
|
on: i.sync.reduce(function(a, o) {
|
|
return a[pe(o) === "object" && o.event || "update:".concat(o)] = function(s) {
|
|
i.props[pe(o) === "object" && o.prop || o] = s, r.vm.emit("sync", o, s, i, r.fapi);
|
|
}, a;
|
|
}, {})
|
|
}], t.computed);
|
|
},
|
|
loadRule: function() {
|
|
var t = this;
|
|
this.cycleLoad = !1, this.loading = !0, this.pageEnd && this.bus.$emit("load-start"), this.deferSyncValue(function() {
|
|
if (t._loadRule(t.rules), t.loading = !1, t.cycleLoad && t.pageEnd)
|
|
return t.loadRule();
|
|
t.syncForm(), t.pageEnd && t.bus.$emit("load-end"), t.vm.setupState.renderRule();
|
|
});
|
|
},
|
|
loadChildren: function(t, r) {
|
|
if (this.cycleLoad = !1, this.loading = !0, this.bus.$emit("load-start"), this._loadRule(t, r), this.loading = !1, this.cycleLoad)
|
|
return this.loadRule();
|
|
this.syncForm(), this.bus.$emit("load-end"), this.$render.clearCache(r);
|
|
},
|
|
_loadRule: function(t, r) {
|
|
var i = this, a = function u(c) {
|
|
var l = t[c - 1];
|
|
if (!l || !l.__fc__)
|
|
return c > 0 ? u(c - 1) : -1;
|
|
var h = i.sort.indexOf(l.__fc__.id);
|
|
return h > -1 ? h : u(c - 1);
|
|
}, o = function(c, l) {
|
|
F.trueArray(c) && i._loadRule(c, l);
|
|
}, s = t.map(function(u, c) {
|
|
if (!(r && !F.Object(u)) && !(!i.pageEnd && !r && c >= i.first)) {
|
|
if (u.__fc__ && u.__fc__.root === t && i.ctxs[u.__fc__.id])
|
|
return o(u.__fc__.loadChildrenPending(), u.__fc__), u.__fc__;
|
|
var l = ji(u), h = function() {
|
|
return !!(l.field && i.fieldCtx[l.field] && i.fieldCtx[l.field][0] !== u.__fc__);
|
|
};
|
|
i.fc.targetFormDriver("loadRule", {
|
|
rule: l,
|
|
api: i.api
|
|
}, i.fc), i.ruleEffect(l, "init", {
|
|
repeat: h()
|
|
}), h() && i.vm.emit("repeat-field", u, i.api);
|
|
var m, w = !1, $ = !!u.__fc__, S = l.value;
|
|
if ($) {
|
|
if (m = u.__fc__, S = m.defaultValue, m.deleted) {
|
|
if (zi(m))
|
|
return;
|
|
m.update(i);
|
|
} else if (!m.check(i)) {
|
|
if (zi(m))
|
|
return;
|
|
t[c] = u = u._clone ? u._clone() : Va(dn(u)), m = null, w = !0;
|
|
}
|
|
}
|
|
if (m)
|
|
m.originType !== m.rule.type && m.updateType(), i.bindParser(m), i.appendValue(m.rule), m.parent && m.parent !== r && i.rmSubRuleData(m);
|
|
else {
|
|
var T = i.parseRule(u);
|
|
m = new Ga(i, T, S), i.bindParser(m);
|
|
}
|
|
i.parseEmit(m), i.syncProp(m), m.parent = r || null, m.root = t, i.setCtx(m), !w && !$ && (i.effect(m, "load"), i.targetHook(m, "load")), i.effect(m, "created");
|
|
var U = m.loadChildrenPending();
|
|
if (m.parser.loadChildren === !1 || o(U, m), !r) {
|
|
var z = a(c);
|
|
z > -1 || !c ? i.sort.splice(z + 1, 0, m.id) : i.sort.push(m.id);
|
|
}
|
|
var B = m.rule;
|
|
return m.updated || (m.updated = !0, F.Function(B.update) && i.bus.$once("load-end", function() {
|
|
i.refreshUpdate(m, B.value, "init");
|
|
}), i.effect(m, "loaded")), i.refreshControl(m) && (i.cycleLoad = !0), m;
|
|
}
|
|
}).filter(function(u) {
|
|
return !!u;
|
|
});
|
|
r && (r.children = s);
|
|
},
|
|
refreshControl: function(t) {
|
|
return t.input && t.rule.control && this.useCtrl(t);
|
|
},
|
|
useCtrl: function(t) {
|
|
var r = this, i = cu(t), a = [], o = this.api;
|
|
if (!i.length)
|
|
return !1;
|
|
for (var s = function(w) {
|
|
var $ = i[w], S = $.handle || function(U) {
|
|
return (Pt[$.condition || "=="] || Pt["=="])(U, $.value);
|
|
};
|
|
if (!F.trueArray($.rule))
|
|
return "continue";
|
|
var T = W(W({}, $), {}, {
|
|
valid: fe(function() {
|
|
return S(t.rule.value, o);
|
|
}),
|
|
ctrl: fu(t, $.rule),
|
|
isHidden: F.String($.rule[0])
|
|
});
|
|
if (T.valid && T.ctrl || !T.valid && !T.ctrl && !T.isHidden)
|
|
return "continue";
|
|
a.push(T);
|
|
}, u = 0; u < i.length; u++)
|
|
var c = s(u);
|
|
if (!a.length)
|
|
return !1;
|
|
var l = [], h = !1;
|
|
return this.deferSyncValue(function() {
|
|
a.reverse().forEach(function(m) {
|
|
var w = m.isHidden, $ = m.valid, S = m.rule, T = m.prepend, U = m.append, z = m.child, B = m.ctrl, Z = m.method;
|
|
if (w) {
|
|
$ ? t.ctrlRule.push({
|
|
__ctrl: !0,
|
|
children: S,
|
|
valid: $
|
|
}) : B && t.ctrlRule.splice(t.ctrlRule.indexOf(B) >>> 0, 1), l[$ ? "push" : "unshift"](function() {
|
|
Z === "disabled" || Z === "enabled" ? r.api.disabled(!$, S) : Z === "display" || Z === "show" ? r.api.display($, S) : Z === "required" ? (S.forEach(function(ce) {
|
|
r.api.setEffect(ce, "required", $);
|
|
}), $ || r.api.clearValidateState(S)) : r.api.hidden(!$, S);
|
|
});
|
|
return;
|
|
}
|
|
if ($) {
|
|
h = !0;
|
|
var Q = {
|
|
type: "fragment",
|
|
native: !0,
|
|
__ctrl: !0,
|
|
children: S
|
|
};
|
|
t.ctrlRule.push(Q), r.bus.$once("load-start", function() {
|
|
T ? o.prepend(Q, T, z) : U || z ? o.append(Q, U || t.id, z) : t.root.splice(t.root.indexOf(t.origin) + 1, 0, Q);
|
|
});
|
|
} else {
|
|
t.ctrlRule.splice(t.ctrlRule.indexOf(B), 1);
|
|
var q = bt(B);
|
|
q && q.rm();
|
|
}
|
|
});
|
|
}), l.length && (this.loading ? l.length && this.bus.$once("load-end", function() {
|
|
l.forEach(function(m) {
|
|
return m();
|
|
});
|
|
}) : l.length && je(function() {
|
|
l.forEach(function(m) {
|
|
return m();
|
|
});
|
|
})), this.vm.emit("control", t.origin, this.api), this.effect(t, "control"), h;
|
|
},
|
|
reloadRule: function(t) {
|
|
return this._reloadRule(t);
|
|
},
|
|
_reloadRule: function(t) {
|
|
var r = this;
|
|
t || (t = this.rules);
|
|
var i = W({}, this.ctxs);
|
|
this.clearNextTick(), this.initData(t), this.fc.rules = t, this.deferSyncValue(function() {
|
|
r.bus.$once("load-end", function() {
|
|
Object.keys(i).filter(function(a) {
|
|
return r.ctxs[a] === void 0;
|
|
}).forEach(function(a) {
|
|
return r.rmCtx(i[a]);
|
|
}), r.$render.clearCacheAll();
|
|
}), r.reloading = !0, r.loadRule(), r.reloading = !1, r.refresh(), r.bus.$emit("reloading", r.api);
|
|
}), this.bus.$off("next-tick", this.nextReload), this.bus.$once("next-tick", this.nextReload), this.bus.$emit("update", this.api);
|
|
},
|
|
refresh: function() {
|
|
this.vm.setupState.refresh();
|
|
}
|
|
});
|
|
}
|
|
function lu(n) {
|
|
var e = za();
|
|
return Object.keys(e).forEach(function(t) {
|
|
Se(n, t) || (n[t] = e[t]);
|
|
}), n;
|
|
}
|
|
function cu(n) {
|
|
var e = n.rule.control || [];
|
|
return F.Object(e) ? [e] : e;
|
|
}
|
|
function fu(n, e) {
|
|
for (var t = 0; t < n.ctrlRule.length; t++) {
|
|
var r = n.ctrlRule[t];
|
|
if (r.children === e)
|
|
return r;
|
|
}
|
|
}
|
|
function zi(n) {
|
|
return !!n.rule.__ctrl;
|
|
}
|
|
function du(n) {
|
|
ne(n.prototype, {
|
|
setValue: function(t, r, i, a) {
|
|
var o = this;
|
|
t.deleted || (t.rule.value = r, this.changeStatus = !0, this.nextRefresh(), this.$render.clearCache(t), this.setFormData(t, i), this.syncValue(), this.valueChange(t, r), this.vm.emit("change", t.field, r, t.origin, this.api, a || !1), this.effect(t, "value"), this.targetHook(t, "value", {
|
|
value: r
|
|
}), this.emitEvent("change", t.field, r, {
|
|
rule: t.origin,
|
|
api: this.api,
|
|
setFlag: a || !1
|
|
}), a && je(function() {
|
|
je(function() {
|
|
je(function() {
|
|
o.api.clearValidateState(t.id);
|
|
});
|
|
});
|
|
}));
|
|
},
|
|
onInput: function(t, r) {
|
|
var i;
|
|
t.input && (this.isQuote(t, i = t.parser.toValue(r, t)) || this.isChange(t, r)) && this.setValue(t, i, r);
|
|
},
|
|
onUpdateValue: function(t, r) {
|
|
var i = this;
|
|
this.deferSyncValue(function() {
|
|
var a = t.getParentGroup(), o = a ? i.subRuleData[a.id] : null, s = {};
|
|
Object.keys(r || {}).forEach(function(u) {
|
|
o && Se(o, u) ? s[u] = r[u] : Se(i.api.form, u) ? i.api.form[u] = r[u] : i.api.top !== i.api && Se(i.api.top.form, u) && (i.api.top.form[u] = r[u]);
|
|
}), Object.keys(s).length && i.api.setChildrenFormData(a.rule, s);
|
|
});
|
|
},
|
|
onBaseInput: function(t, r) {
|
|
this.setFormData(t, r), t.modelValue = r, this.nextRefresh(), this.$render.clearCache(t);
|
|
},
|
|
setFormData: function(t, r) {
|
|
t.modelValue = r;
|
|
var i = t.getParentGroup();
|
|
i && (this.subRuleData[i.id] || (this.subRuleData[i.id] = {}), this.subRuleData[i.id][t.field] = t.rule.value), rt(this.formData, t.id, r);
|
|
},
|
|
rmSubRuleData: function(t) {
|
|
var r = t.getParentGroup();
|
|
r && this.subRuleData[r.id] && delete this.subRuleData[r.id][t.field];
|
|
},
|
|
getFormData: function(t) {
|
|
return this.formData[t.id];
|
|
},
|
|
syncForm: function() {
|
|
var t = this, r = Be({}), i = this.fields(), a = [];
|
|
this.options.appendValue !== !1 && Object.keys(this.appendData).reduce(function(o, s) {
|
|
return i.indexOf(s) === -1 && (o[s] = De(t.appendData, s)), o;
|
|
}, r), i.reduce(function(o, s) {
|
|
var u = (t.fieldCtx[s] || []).filter(function(c) {
|
|
return !t.isIgnore(c.rule);
|
|
})[0] || t.fieldCtx[s][0];
|
|
return t.isIgnore(u.rule) && a.push(s), o[s] = De(u.rule, "value"), o;
|
|
}, r), this.form = r, this.ignoreFields = a, this.syncValue();
|
|
},
|
|
isIgnore: function(t) {
|
|
return t.ignore === !0 || t.ignore === "hidden" && t.hidden || this.options.ignoreHiddenFields && t.hidden;
|
|
},
|
|
appendValue: function(t) {
|
|
(!t.field || !Se(this.appendData, t.field)) && !this.options.forceCoverValue || (t.value = this.appendData[t.field], delete this.appendData[t.field]);
|
|
},
|
|
addSubForm: function(t, r) {
|
|
this.subForm[t.id] = r;
|
|
},
|
|
deferSyncValue: function(t, r) {
|
|
this.deferSyncFn || (this.deferSyncFn = t), this.deferSyncFn.sync || (this.deferSyncFn.sync = r), fe(t), this.deferSyncFn === t && (this.deferSyncFn = null, t.sync && this.syncForm());
|
|
},
|
|
syncValue: function() {
|
|
var t = this;
|
|
if (this.deferSyncFn)
|
|
return this.deferSyncFn.sync = !0;
|
|
var r = {};
|
|
Object.keys(this.form).forEach(function(i) {
|
|
t.ignoreFields.indexOf(i) === -1 && (r[i] = t.form[i]);
|
|
}), this.vm.setupState.updateValue(r);
|
|
},
|
|
isChange: function(t, r) {
|
|
return JSON.stringify(this.getFormData(t), Ui) !== JSON.stringify(r, Ui);
|
|
},
|
|
isQuote: function(t, r) {
|
|
return (r instanceof Function || F.Object(r) || Array.isArray(r)) && r === t.rule.value;
|
|
},
|
|
refreshUpdate: function(t, r, i, a) {
|
|
var o = this;
|
|
if (F.Function(t.rule.update)) {
|
|
var s = fe(function() {
|
|
return t.rule.update(r, t.origin, o.api, {
|
|
origin: i || "change",
|
|
linkField: a
|
|
});
|
|
});
|
|
if (s === void 0)
|
|
return;
|
|
t.rule.hidden = s === !0;
|
|
}
|
|
},
|
|
valueChange: function(t, r) {
|
|
this.refreshRule(t, r), this.bus.$emit("change-" + t.field, r);
|
|
},
|
|
refreshRule: function(t, r, i, a) {
|
|
this.refreshControl(t) && (this.$render.clearCacheAll(), this.loadRule(), this.bus.$emit("update", this.api), this.refresh()), this.refreshUpdate(t, r, i, a);
|
|
},
|
|
appendLink: function(t) {
|
|
var r = this, i = t.rule.link;
|
|
F.trueArray(i) && i.forEach(function(a) {
|
|
var o = function() {
|
|
return r.refreshRule(t, t.rule.value, "link", a);
|
|
};
|
|
r.bus.$on("change-" + a, o), t.linkOn.push(function() {
|
|
return r.bus.$off("change-" + a, o);
|
|
});
|
|
});
|
|
},
|
|
fields: function() {
|
|
return Object.keys(this.fieldCtx);
|
|
}
|
|
});
|
|
}
|
|
function Ui(n, e) {
|
|
return typeof e == "function" ? "" + e : e;
|
|
}
|
|
var Rn = {
|
|
init: function(e) {
|
|
},
|
|
toFormValue: function(e, t) {
|
|
return e;
|
|
},
|
|
toValue: function(e, t) {
|
|
return e;
|
|
},
|
|
mounted: function(e) {
|
|
},
|
|
render: function(e, t) {
|
|
return t.$handle.fc.renderDriver && t.$handle.fc.renderDriver.defaultRender ? t.$handle.fc.renderDriver.defaultRender(t, e) : t.$render.defaultRender(t, e);
|
|
},
|
|
preview: function(e, t) {
|
|
return t.$handle.fc.renderDriver && t.$handle.fc.renderDriver.defaultPreview ? t.$handle.fc.renderDriver.defaultPreview(t, e) : this.render(e, t);
|
|
},
|
|
mergeProp: function(e) {
|
|
}
|
|
}, hu = ["field", "value", "vm", "template", "name", "config", "control", "inject", "sync", "payload", "optionsTo", "update", "slotUpdate", "computed", "component", "cache"], qi = Symbol("oldValue");
|
|
function pu(n) {
|
|
ne(n.prototype, {
|
|
getCtx: function(t) {
|
|
return this.getFieldCtx(t) || this.getNameCtx(t)[0] || this.ctxs[t];
|
|
},
|
|
getCtxs: function(t) {
|
|
return this.fieldCtx[t] || this.nameCtx[t] || (this.ctxs[t] ? [this.ctxs[t]] : []);
|
|
},
|
|
setIdCtx: function(t, r, i) {
|
|
var a = "".concat(i, "Ctx");
|
|
this[a][r] ? this[a][r].push(t) : this[a][r] = [t];
|
|
},
|
|
rmIdCtx: function(t, r, i) {
|
|
var a = "".concat(i, "Ctx"), o = this[a][r];
|
|
if (!o)
|
|
return !1;
|
|
var s = o.splice(o.indexOf(t) >>> 0, 1).length > 0;
|
|
return o.length || delete this[a][r], s;
|
|
},
|
|
getFieldCtx: function(t) {
|
|
return (this.fieldCtx[t] || [])[0];
|
|
},
|
|
getNameCtx: function(t) {
|
|
return this.nameCtx[t] || [];
|
|
},
|
|
setCtx: function(t) {
|
|
var r = t.id, i = t.field, a = t.name, o = t.rule;
|
|
this.ctxs[r] = t, a && this.setIdCtx(t, a, "name"), t.input && (this.setIdCtx(t, i, "field"), this.setFormData(t, t.parser.toFormValue(o.value, t)), this.isMounted && !this.reloading && this.vm.emit("change", t.field, o.value, t.origin, this.api));
|
|
},
|
|
getParser: function(t) {
|
|
var r = this.fc.parsers, i = this.fc.renderDriver;
|
|
if (i) {
|
|
var a = i.parsers || {}, o = a[t.originType] || a[ft(t.type)] || a[t.trueType];
|
|
if (o)
|
|
return o;
|
|
}
|
|
return r[t.originType] || r[ft(t.type)] || r[t.trueType] || Rn;
|
|
},
|
|
bindParser: function(t) {
|
|
t.setParser(this.getParser(t));
|
|
},
|
|
getType: function(t) {
|
|
var r = this.fc.CreateNode.aliasMap, i = r[t] || r[ft(t)] || t;
|
|
return ft(i);
|
|
},
|
|
noWatch: function(t) {
|
|
this.noWatchFn || (this.noWatchFn = t), fe(t), this.noWatchFn === t && (this.noWatchFn = null);
|
|
},
|
|
watchCtx: function(t) {
|
|
var r = this, i = ja();
|
|
if (i.filter(function(o) {
|
|
return o[0] !== "_" && o[0] !== "$" && hu.indexOf(o) === -1;
|
|
}).forEach(function(o) {
|
|
var s = De(t.rule, o), u = o === "children";
|
|
t.refRule[o] = s, t.watch.push(ze(u ? function() {
|
|
return F.Function(s.value) ? s.value : le(s.value || []);
|
|
} : function() {
|
|
return s.value;
|
|
}, function(c, l) {
|
|
var h = s.value;
|
|
if (!r.isBreakWatch()) {
|
|
if (u && t.parser.loadChildren === !1) {
|
|
r.$render.clearCache(t), r.nextRefresh();
|
|
return;
|
|
}
|
|
if (r.watching = !0, je(function() {
|
|
r.targetHook(t, "watch", {
|
|
key: o,
|
|
oldValue: l,
|
|
newValue: h
|
|
});
|
|
}), o === "hidden" && Boolean(h) !== Boolean(l) && (r.$render.clearCacheAll(), je(function() {
|
|
r.targetHook(t, "hidden", {
|
|
value: h
|
|
});
|
|
})), o === "ignore" && t.input || o === "hidden" && t.input && (t.rule.ignore === "hidden" || r.options.ignoreHiddenFields))
|
|
r.syncForm();
|
|
else if (o === "link") {
|
|
t.link();
|
|
return;
|
|
} else
|
|
["props", "on", "deep"].indexOf(o) > -1 ? (r.parseInjectEvent(t.rule, h || {}), o === "props" && t.input && r.setFormData(t, t.parser.toFormValue(t.rule.value, t))) : o === "emit" ? r.parseEmit(t) : ["prefix", "suffix"].indexOf(o) > -1 ? h && r.loadFn(h, t.rule) : o === "type" ? (t.updateType(), r.bindParser(t)) : u && (F.Function(l) && (l = t.getPending("children", [])), F.Function(h) && (h = t.loadChildrenPending()), r.updateChildren(t, h, l));
|
|
r.$render.clearCache(t), r.refresh(), r.watching = !1;
|
|
}
|
|
}, {
|
|
deep: !u,
|
|
sync: u
|
|
}));
|
|
}), t.refRule.__$title = at(function() {
|
|
var o = (pe(t.rule.title) === "object" ? t.rule.title.title : t.rule.title) || "";
|
|
if (o) {
|
|
var s = o.match(/^\{\{\s*\$t\.(.+)\s*\}\}$/);
|
|
s && (o = r.api.t(s[1]));
|
|
}
|
|
return o;
|
|
}), t.refRule.__$info = at(function() {
|
|
var o = (pe(t.rule.info) === "object" ? t.rule.info.info : t.rule.info) || "";
|
|
if (o) {
|
|
var s = o.match(/^\{\{\s*\$t\.(.+)\s*\}\}$/);
|
|
s && (o = r.api.t(s[1]));
|
|
}
|
|
return o;
|
|
}), t.refRule.__$validate = at(function() {
|
|
var o = function(u) {
|
|
var c = u.match(/^\{\{\s*\$t\.(.+)\s*\}\}$/);
|
|
if (c) {
|
|
var l, h;
|
|
return r.api.t(c[1], {
|
|
title: (l = t.refRule) === null || l === void 0 || (h = l.__$title) === null || h === void 0 ? void 0 : h.value
|
|
});
|
|
}
|
|
return u;
|
|
};
|
|
return Tt(t.rule.validate).map(function(s) {
|
|
var u = W({}, s);
|
|
if (u.message && (u.message = o(u.message)), F.Function(u.validator)) {
|
|
var c = t;
|
|
u.validator = function() {
|
|
for (var h, m = arguments.length, w = new Array(m), $ = 0; $ < m; $++)
|
|
w[$] = arguments[$];
|
|
return (h = s.validator).call.apply(h, [{
|
|
that: this,
|
|
id: c.id,
|
|
field: c.field,
|
|
rule: c.rule,
|
|
api: c.$handle.api
|
|
}].concat(w));
|
|
};
|
|
}
|
|
if (u.adapter) {
|
|
if (pe(u.error) === "object") {
|
|
var l = W({}, u.error);
|
|
Object.keys(l).forEach(function(h) {
|
|
l[h] = o(l[h]);
|
|
}), u.error = l;
|
|
}
|
|
return r.adapterValidate(u, t);
|
|
}
|
|
return u;
|
|
});
|
|
}), t.input) {
|
|
var a = De(t.rule, "value");
|
|
t.watch.push(ze(function() {
|
|
return a.value;
|
|
}, function() {
|
|
var o = t.parser.toFormValue(a.value, t);
|
|
r.isChange(t, o) && r.setValue(t, a.value, o, !0);
|
|
}));
|
|
}
|
|
this.bus.$once("load-end", function() {
|
|
var o = t.rule.computed;
|
|
!o || (pe(o) !== "object" && (o = {
|
|
value: o
|
|
}), Object.keys(o).forEach(function(s) {
|
|
var u = void 0, c = at(function() {
|
|
var h = o[s];
|
|
if (!!h) {
|
|
var m = r.compute(t, h);
|
|
return h.linkage && m === qi ? u : m;
|
|
}
|
|
}), l = function(m) {
|
|
s === "value" ? r.onInput(t, m) : s[0] === "$" ? r.api.setEffect(t.id, s, m) : kt(t.rule, s, m);
|
|
};
|
|
(s === "value" ? [void 0, null, ""].indexOf(t.rule.value) > -1 : c.value !== Ge(t.rule, s)) && l(c.value), t.watch.push(ze(c, function(h) {
|
|
u = h, setTimeout(function() {
|
|
l(h);
|
|
});
|
|
}));
|
|
}));
|
|
}), this.watchEffect(t);
|
|
},
|
|
adapterValidate: function(t, r) {
|
|
var i = this, a = function(s, u) {
|
|
var c = t.beforeValidate && fe(function() {
|
|
return t.beforeValidate({
|
|
value: s,
|
|
api: i.api,
|
|
validate: t,
|
|
rule: r.rule
|
|
});
|
|
});
|
|
if (c === !1)
|
|
u();
|
|
else {
|
|
var l = i.validator(s, t);
|
|
if (l) {
|
|
var m = "";
|
|
pe(t.error) === "object" && (m = t.error[l] || t.error.default), !m && typeof t.message == "string" && (m = t.message), m || (m = i.getValidateMessage(r, {
|
|
key: l,
|
|
rule: t[l]
|
|
})), u(m);
|
|
} else if (t.validator) {
|
|
var h = t.validator && fe(function() {
|
|
return t.validator(s, u);
|
|
});
|
|
h && F.Function(h.then) && h.then(function() {
|
|
return u();
|
|
}).catch(function(w) {
|
|
return u(w);
|
|
});
|
|
} else
|
|
u();
|
|
}
|
|
};
|
|
return this.$manager.adapterValidate({
|
|
required: t.required,
|
|
message: t.message,
|
|
target: t.trigger
|
|
}, a);
|
|
},
|
|
getValidateMessage: function(t, r) {
|
|
var i, a, o, s = Array.isArray(r.rule) ? r.rule.join(",") : "" + r.rule;
|
|
return this.api.t(r.key === "required" ? r.key : "validate." + r.key, (o = {}, Le(o, r.key, s), Le(o, "title", (i = t.refRule) === null || i === void 0 || (a = i.__$title) === null || a === void 0 ? void 0 : a.value), o));
|
|
},
|
|
validator: function(t, r) {
|
|
var i = F.empty(t);
|
|
if (i)
|
|
return r.required ? "required" : void 0;
|
|
for (var a = function() {
|
|
var l = os(s[o], 2), h = l[0], m = l[1];
|
|
switch (h) {
|
|
case "len":
|
|
case "maxLen":
|
|
case "minLen":
|
|
var w = function(Q) {
|
|
return h === "len" ? Q === m : h === "maxLen" ? Q <= m : Q >= m;
|
|
};
|
|
if (Array.isArray(t)) {
|
|
if (!w(t.length))
|
|
return {
|
|
v: h
|
|
};
|
|
} else {
|
|
if (pe(t) === "object")
|
|
return {
|
|
v: h
|
|
};
|
|
if (!w(("" + t).length))
|
|
return {
|
|
v: h
|
|
};
|
|
}
|
|
break;
|
|
case "pattern":
|
|
var $ = typeof m == "string" ? new RegExp(m) : m;
|
|
if (!$.test("" + t))
|
|
return {
|
|
v: h
|
|
};
|
|
break;
|
|
case "uppercase":
|
|
if (m && (typeof t != "string" || !/^[A-Z]*$/.test(t)))
|
|
return {
|
|
v: h
|
|
};
|
|
break;
|
|
case "lowercase":
|
|
if (m && (typeof t != "string" || !/^[a-z]*$/.test(t)))
|
|
return {
|
|
v: h
|
|
};
|
|
break;
|
|
case "min":
|
|
case "max":
|
|
case "positive":
|
|
case "negative":
|
|
case "integer":
|
|
case "number":
|
|
var S = Number(t);
|
|
if (Number.isNaN(S))
|
|
return {
|
|
v: h
|
|
};
|
|
if (h === "min" && S < m)
|
|
return {
|
|
v: h
|
|
};
|
|
if (h === "max" && S > m)
|
|
return {
|
|
v: h
|
|
};
|
|
if (h === "positive" && S <= 0)
|
|
return {
|
|
v: h
|
|
};
|
|
if (h === "negative" && S >= 0)
|
|
return {
|
|
v: h
|
|
};
|
|
if (h === "integer" && !Number.isInteger(S))
|
|
return {
|
|
v: h
|
|
};
|
|
break;
|
|
case "equal":
|
|
if (t !== m)
|
|
return {
|
|
v: h
|
|
};
|
|
break;
|
|
case "enum":
|
|
if (Array.isArray(m) && !m.includes(t))
|
|
return {
|
|
v: h
|
|
};
|
|
break;
|
|
case "hasKeys":
|
|
if (pe(t) !== "object" || Array.isArray(m) && m.some(function(Z) {
|
|
return !(Z in t);
|
|
}))
|
|
return {
|
|
v: h
|
|
};
|
|
break;
|
|
case "email":
|
|
var T = /^(([^<>()\[\]\\.,;:\s@"]+(\.[^<>()\[\]\\.,;:\s@"]+)*)|(".+"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\])|(([a-zA-Z\-0-9]+\.)+[a-zA-Z]{2,}))$/;
|
|
if (!T.test("" + t))
|
|
return {
|
|
v: h
|
|
};
|
|
break;
|
|
case "url":
|
|
var U = new RegExp("^(?!mailto:)(?:(?:http|https|ftp)://)(?:\\S+(?::\\S*)?@)?(?:(?:(?:[1-9]\\d?|1\\d\\d|2[01]\\d|22[0-3])(?:\\.(?:1?\\d{1,2}|2[0-4]\\d|25[0-5])){2}(?:\\.(?:[0-9]\\d?|1\\d\\d|2[0-4]\\d|25[0-4]))|(?:(?:[a-z\\u00a1-\\uffff0-9]+-?)*[a-z\\u00a1-\\uffff0-9]+)(?:\\.(?:[a-z\\u00a1-\\uffff0-9]+-?)*[a-z\\u00a1-\\uffff0-9]+)*(?:\\.(?:[a-z\\u00a1-\\uffff]{2,})))|localhost)(?::\\d{2,5})?(?:(/|\\?|#)[^\\s]*)?$", "i");
|
|
if (!U.test("" + t))
|
|
return {
|
|
v: h
|
|
};
|
|
break;
|
|
case "ip":
|
|
var z = /^(2(5[0-5]{1}|[0-4]\d{1})|[0-1]?\d{1,2})(\.(2(5[0-5]{1}|[0-4]\d{1})|[0-1]?\d{1,2})){3}$/;
|
|
if (!z.test("" + t))
|
|
return {
|
|
v: h
|
|
};
|
|
break;
|
|
case "phone":
|
|
var B = /^(?:(?:\+|00)86)?1[3-9]\d{9}$/;
|
|
if (!B.test("" + t))
|
|
return {
|
|
v: h
|
|
};
|
|
break;
|
|
}
|
|
}, o = 0, s = Object.entries(r); o < s.length; o++) {
|
|
var u = a();
|
|
if (pe(u) === "object")
|
|
return u.v;
|
|
}
|
|
},
|
|
compute: function(t, r) {
|
|
var i = this, a;
|
|
if (pe(r) === "object") {
|
|
var o = t.getParentGroup(), s = function l(h) {
|
|
if (h = Array.isArray(h) ? {
|
|
mode: "AND",
|
|
group: h
|
|
} : h, !F.trueArray(h.group))
|
|
return !0;
|
|
for (var m = h.mode === "OR", w = !0, $ = function(z) {
|
|
var B = h.group[z], Z = void 0, Q = null;
|
|
if (B.variable)
|
|
Q = JSON.stringify(i.fc.getLoadData(B.variable) || "");
|
|
else if (B.field)
|
|
Q = Vi(B.field || "");
|
|
else if (!B.mode)
|
|
return {
|
|
v: !0
|
|
};
|
|
var q = B.compare;
|
|
if (q && (q = Vi(q || "")), B.mode ? Z = l(B) : Pt[B.condition] ? F.Function(B.handler) ? Z = fe(function() {
|
|
return B.handler(i.api, t.rule);
|
|
}) : Z = fe(function() {
|
|
return new Function("$condition", "$val", "$form", "$scope", "$group", "$rule", "with($form){with($scope){with(this){with($group){ return $condition['".concat(B.condition, "'](").concat(Q, ", ").concat(q || "$val", "); }}}}")).call(i.api.form, Pt, B.value, i.api.top.form, i.api.top === i.api.scope ? {} : i.api.scope.form, o ? i.subRuleData[o.id] || {} : {}, t.rule);
|
|
}) : Z = !1, m && Z)
|
|
return {
|
|
v: !0
|
|
};
|
|
m || (w = w && Z);
|
|
}, S = 0; S < h.group.length; S++) {
|
|
var T = $(S);
|
|
if (pe(T) === "object")
|
|
return T.v;
|
|
}
|
|
return m ? !1 : w;
|
|
}, u = s(r);
|
|
return u = r.invert === !0 ? !u : u, r.linkage ? u ? fe(function() {
|
|
return i.computeValue(r.linkage, t, o);
|
|
}, void 0) : qi : u;
|
|
} else if (F.Function(r))
|
|
a = function() {
|
|
return r(i.api.form, i.api);
|
|
};
|
|
else {
|
|
var c = t.getParentGroup();
|
|
a = function() {
|
|
return i.computeValue(r, t, c);
|
|
};
|
|
}
|
|
return fe(a, void 0);
|
|
},
|
|
computeValue: function(t, r, i) {
|
|
var a = this, o = this, s = Object.keys(this.fc.formulas).reduce(function(u, c) {
|
|
return u[c] = function() {
|
|
for (var l, h = arguments.length, m = new Array(h), w = 0; w < h; w++)
|
|
m[w] = arguments[w];
|
|
return (l = o.fc.formulas[c]).call.apply(l, [{
|
|
that: this,
|
|
rule: r.rule,
|
|
api: o.api,
|
|
fc: o.fc
|
|
}].concat(m));
|
|
}, u;
|
|
}, {});
|
|
return fe(function() {
|
|
return new Function("$formulas", "$form", "$scope", "$group", "$rule", "$api", "with($form){with($scope){with(this){with($group){with($formulas){ return ".concat(t, " }}}}}")).call(a.api.form, s, a.api.top.form, a.api.top === a.api.scope ? {} : a.api.scope.form, i ? a.subRuleData[i.id] || {} : {}, r.rule, a.api);
|
|
}, void 0);
|
|
},
|
|
updateChildren: function(t, r, i) {
|
|
var a = this;
|
|
this.deferSyncValue(function() {
|
|
i && i.forEach(function(o) {
|
|
(r || []).indexOf(o) === -1 && o && !F.String(o) && o.__fc__ && o.__fc__.parent === t && a.rmCtx(o.__fc__);
|
|
}), F.trueArray(r) && (a.loadChildren(r, t), a.bus.$emit("update", a.api));
|
|
});
|
|
},
|
|
rmSub: function(t) {
|
|
var r = this;
|
|
F.trueArray(t) && t.forEach(function(i) {
|
|
i && i.__fc__ && r.rmCtx(i.__fc__);
|
|
});
|
|
},
|
|
rmCtx: function(t) {
|
|
var r = this;
|
|
if (!t.deleted) {
|
|
var i = t.id, a = t.field, o = t.input, s = t.name;
|
|
Dt(this.ctxs, i), Dt(this.formData, i), Dt(this.subForm, i), Dt(this.vm.setupState.ctxInject, i);
|
|
var u = t.getParentGroup();
|
|
u && this.subRuleData[u.id] && Dt(this.subRuleData[u.id], a), t.group && Dt(this.subRuleData, i), o && this.rmIdCtx(t, a, "field"), s && this.rmIdCtx(t, s, "name"), o && !Se(this.fieldCtx, a) && Dt(this.form, a), this.deferSyncValue(function() {
|
|
if (!r.reloading) {
|
|
if (t.parser.loadChildren !== !1) {
|
|
var l = t.getPending("children", t.rule.children);
|
|
F.trueArray(l) && l.forEach(function(h) {
|
|
return h.__fc__ && r.rmCtx(h.__fc__);
|
|
});
|
|
}
|
|
t.root === r.rules && r.vm.setupState.renderRule();
|
|
}
|
|
}, o);
|
|
var c = this.sort.indexOf(i);
|
|
return c > -1 && this.sort.splice(c, 1), this.$render.clearCache(t), t.delete(), this.effect(t, "deleted"), this.targetHook(t, "deleted"), o && !this.fieldCtx[a] && this.vm.emit("remove-field", a, t.rule, this.api), t.rule.__ctrl || this.vm.emit("remove-rule", t.rule, this.api), t;
|
|
}
|
|
}
|
|
});
|
|
}
|
|
function mu(n) {
|
|
ne(n.prototype, {
|
|
mounted: function() {
|
|
var t = this, r = function() {
|
|
t.isMounted = !0, t.lifecycle("mounted");
|
|
};
|
|
this.pageEnd ? r() : this.bus.$once("page-end", r);
|
|
},
|
|
lifecycle: function(t) {
|
|
this.fc.targetFormDriver(t, this.api, this.fc), this.vm.emit(t, this.api), this.emitEvent(t, this.api);
|
|
},
|
|
emitEvent: function(t) {
|
|
for (var r, i = arguments.length, a = new Array(i > 1 ? i - 1 : 0), o = 1; o < i; o++)
|
|
a[o - 1] = arguments[o];
|
|
var s = this.options[t] || this.options[ft("on-" + t)];
|
|
if (s) {
|
|
var u = gt(s);
|
|
F.Function(u) && fe(function() {
|
|
return u.apply(void 0, a);
|
|
});
|
|
}
|
|
(r = this.bus).$emit.apply(r, [t].concat(a));
|
|
},
|
|
targetHook: function(t, r, i) {
|
|
var a, o, s = this, u = (a = t.prop) === null || a === void 0 || (o = a.hook) === null || o === void 0 ? void 0 : o[r];
|
|
u && (u = Array.isArray(u) ? u : [u], u.forEach(function(c) {
|
|
fe(function() {
|
|
return c(W(W({}, i || {}), {}, {
|
|
self: t.rule,
|
|
rule: t.rule,
|
|
$f: s.api,
|
|
api: s.api,
|
|
option: s.vm.props.option
|
|
}));
|
|
});
|
|
}));
|
|
}
|
|
});
|
|
}
|
|
function gu(n) {
|
|
ne(n.prototype, {
|
|
useProvider: function() {
|
|
var t = this, r = this.fc.providers;
|
|
Object.keys(r).forEach(function(i) {
|
|
var a = r[i];
|
|
F.Function(a) && (a = a(t.fc)), a._c = yu(a), t.onEffect(a), t.providers[i] = a;
|
|
});
|
|
},
|
|
onEffect: function(t) {
|
|
var r = this, i = [];
|
|
(t._c || ["*"]).forEach(function(a) {
|
|
var o = a === "*" ? "*" : r.getType(a);
|
|
i.indexOf(o) > -1 || (i.push(o), r.bus.$on("p:".concat(t.name, ":").concat(o, ":").concat(t.input ? 1 : 0), function(s, u) {
|
|
t[s] && t[s].apply(t, le(u));
|
|
}));
|
|
}), t._used = i;
|
|
},
|
|
watchEffect: function(t) {
|
|
var r = this, i = {
|
|
required: function() {
|
|
var o, s;
|
|
return (Se(t.rule, "$required") ? t.rule.$required : (o = t.rule) === null || o === void 0 || (s = o.effect) === null || s === void 0 ? void 0 : s.required) || !1;
|
|
}
|
|
};
|
|
Object.keys(t.rule.effect || {}).forEach(function(a) {
|
|
i[a] = function() {
|
|
return t.rule.effect[a];
|
|
};
|
|
}), Object.keys(t.rule).forEach(function(a) {
|
|
a[0] === "$" && (i[a.substr(1)] = function() {
|
|
return t.rule[a];
|
|
});
|
|
}), Object.keys(i).forEach(function(a) {
|
|
t.watch.push(ze(i[a], function(o) {
|
|
r.effect(t, "watch", Le({}, a, o));
|
|
}, {
|
|
deep: !0
|
|
}));
|
|
});
|
|
},
|
|
ruleEffect: function(t, r, i) {
|
|
this.emitEffect({
|
|
rule: t,
|
|
input: !!t.field,
|
|
type: this.getType(t.type)
|
|
}, r, i);
|
|
},
|
|
effect: function(t, r, i) {
|
|
this.emitEffect({
|
|
rule: t.rule,
|
|
input: t.input,
|
|
type: t.trueType,
|
|
ctx: t,
|
|
custom: i
|
|
}, r);
|
|
},
|
|
getEffect: function(t, r) {
|
|
if (Se(t, "$" + r))
|
|
return t["$" + r];
|
|
if (Se(t, "effect") && Se(t.effect, r))
|
|
return t.effect[r];
|
|
},
|
|
emitEffect: function(t, r, i) {
|
|
var a = this, o = t.ctx, s = t.rule, u = t.input, c = t.type, l = t.custom;
|
|
if (!(!c || ["fcFragment", "fragment"].indexOf(c) > -1)) {
|
|
var h = l || Object.keys(s).reduce(function(m, w) {
|
|
return w[0] === "$" && (m[w.substr(1)] = s[w]), m;
|
|
}, W({}, s.effect || {}));
|
|
Object.keys(h).forEach(function(m) {
|
|
var w = a.providers[m];
|
|
if (!(!w || w.input && !u)) {
|
|
var $;
|
|
if (!w._c)
|
|
$ = "*";
|
|
else if (w._used.indexOf(c) > -1)
|
|
$ = c;
|
|
else
|
|
return;
|
|
var S = W({
|
|
value: h[m],
|
|
getValue: function() {
|
|
return a.getEffect(s, m);
|
|
}
|
|
}, i || {});
|
|
o && (S.getProp = function() {
|
|
return o.effectData(m);
|
|
}, S.clearProp = function() {
|
|
return o.clearEffectData(m);
|
|
}, S.mergeProp = function(T) {
|
|
return $t(S.getProp(), [T]);
|
|
}, S.id = o.id), a.bus.$emit("p:".concat(m, ":").concat($, ":").concat(w.input ? 1 : 0), r, [S, s, a.api]);
|
|
}
|
|
});
|
|
}
|
|
}
|
|
});
|
|
}
|
|
function vu(n) {
|
|
return n.filter(function(e, t, r) {
|
|
return r.indexOf(e, 0) === t;
|
|
});
|
|
}
|
|
function yu(n) {
|
|
var e = n.components;
|
|
if (Array.isArray(e)) {
|
|
var t = vu(e.filter(function(r) {
|
|
return r !== "*";
|
|
}));
|
|
return t.length ? t : !1;
|
|
} else
|
|
return F.String(e) ? [e] : !1;
|
|
}
|
|
function yt(n) {
|
|
var e = this;
|
|
Na(this, {
|
|
options: function() {
|
|
return n.options.value || {};
|
|
},
|
|
bus: function() {
|
|
return n.bus;
|
|
},
|
|
preview: function() {
|
|
return n.vm.props.preview != null ? n.vm.props.preview : n.vm.setupState.parent && n.vm.setupState.parent.props.preview != null ? n.vm.setupState.parent.props.preview : n.options.value.preview || !1;
|
|
}
|
|
}), ne(this, {
|
|
fc: n,
|
|
vm: n.vm,
|
|
watching: !1,
|
|
loading: !1,
|
|
reloading: !1,
|
|
noWatchFn: null,
|
|
deferSyncFn: null,
|
|
isMounted: !1,
|
|
formData: Be({}),
|
|
subRuleData: Be({}),
|
|
subForm: {},
|
|
form: Be({}),
|
|
appendData: {},
|
|
ignoreFields: [],
|
|
providers: {},
|
|
cycleLoad: null,
|
|
loadedId: 1,
|
|
nextTick: null,
|
|
changeStatus: !1,
|
|
pageEnd: !0,
|
|
nextReload: function() {
|
|
e.lifecycle("reload");
|
|
}
|
|
}), this.initData(n.rules), this.$manager = new n.manager(this), this.$render = new Lr(this), this.api = n.extendApiFn.reduce(function(t, r) {
|
|
var i = fe(function() {
|
|
return r(t, e);
|
|
});
|
|
return i && i !== t && ne(t, i), t;
|
|
}, Ks(this));
|
|
}
|
|
ne(yt.prototype, {
|
|
initData: function(e) {
|
|
ne(this, {
|
|
ctxs: {},
|
|
fieldCtx: {},
|
|
nameCtx: {},
|
|
sort: [],
|
|
rules: e
|
|
});
|
|
},
|
|
init: function() {
|
|
this.updateAppendData(), this.useProvider(), this.usePage(), this.loadRule(), this.$manager.__init(), this.lifecycle("created");
|
|
},
|
|
updateAppendData: function() {
|
|
this.appendData = W(W(W({}, this.options.formData || {}), this.fc.vm.props.modelValue || {}), this.appendData);
|
|
},
|
|
isBreakWatch: function() {
|
|
return this.loading || this.noWatchFn || this.reloading;
|
|
},
|
|
globalBeforeFetch: function(e) {
|
|
var t = this;
|
|
return new Promise(function(r, i) {
|
|
var a = t.options.beforeFetch && fe(function() {
|
|
return t.options.beforeFetch(e, {
|
|
api: t.api
|
|
});
|
|
});
|
|
a && F.Function(a.then) ? a.then(r).catch(i) : r();
|
|
});
|
|
},
|
|
beforeFetch: function(e) {
|
|
var t = this;
|
|
return new Promise(function(r, i) {
|
|
var a = e && e.beforeFetch && fe(function() {
|
|
return e.beforeFetch(e, {
|
|
api: t.api
|
|
});
|
|
});
|
|
a && F.Function(a.then) ? a.then(r).catch(i) : a === !1 ? i() : r();
|
|
}).then(function() {
|
|
return t.globalBeforeFetch(e);
|
|
});
|
|
},
|
|
beforeSubmit: function(e) {
|
|
var t = this;
|
|
return new Promise(function(r, i) {
|
|
var a = t.options.beforeSubmit && fe(function() {
|
|
return t.options.beforeSubmit(e, {
|
|
api: t.api
|
|
});
|
|
});
|
|
a && F.Function(a.then) ? a.then(r).catch(i) : a === !1 ? i() : r();
|
|
});
|
|
}
|
|
});
|
|
ru(yt);
|
|
iu(yt);
|
|
ou(yt);
|
|
uu(yt);
|
|
du(yt);
|
|
pu(yt);
|
|
mu(yt);
|
|
gu(yt);
|
|
var _u = "fcFragment", or = he({
|
|
name: _u,
|
|
inheritAttrs: !1,
|
|
props: ["vnode"],
|
|
render: function() {
|
|
return this.vnode;
|
|
}
|
|
});
|
|
function bu(n) {
|
|
return Object.keys(n).map(function(e) {
|
|
var t = n[e], r = Sa(e);
|
|
if (!!r)
|
|
return [r, t.value, t.arg, t.modifiers];
|
|
}).filter(function(e) {
|
|
return !!e;
|
|
});
|
|
}
|
|
function Gi(n, e) {
|
|
var t = n.directives;
|
|
return t ? (Array.isArray(t) || (t = [t]), $a(e, t.reduce(function(r, i) {
|
|
return r.concat(bu(i));
|
|
}, []))) : e;
|
|
}
|
|
function wu() {
|
|
var n = {};
|
|
function e() {
|
|
}
|
|
return ne(e.prototype, {
|
|
make: function(r, i, a) {
|
|
return Gi(i, this.h(r, Fi(i), a));
|
|
},
|
|
makeComponent: function(r, i, a) {
|
|
try {
|
|
return Gi(i, H(r, Fi(i), a));
|
|
} catch (o) {
|
|
return console.error(o), H("");
|
|
}
|
|
},
|
|
h: function(r, i, a) {
|
|
var o = vr().appContext.config.isNativeTag(r);
|
|
o && delete i.formCreateInject;
|
|
try {
|
|
return H(o ? r : K(r), i, a);
|
|
} catch (s) {
|
|
return console.error(s), H("");
|
|
}
|
|
},
|
|
aliasMap: n
|
|
}), ne(e, {
|
|
aliasMap: n,
|
|
alias: function(r, i) {
|
|
n[r] = i;
|
|
},
|
|
use: function(r) {
|
|
Object.keys(r).forEach(function(i) {
|
|
var a = fn(i), o = Qs(i).toLocaleLowerCase(), s = r[i];
|
|
[i, a, o].forEach(function(u) {
|
|
e.alias(i, s), e.prototype[u] = function(c, l) {
|
|
return this.make(s, c, l);
|
|
};
|
|
});
|
|
});
|
|
}
|
|
}), e;
|
|
}
|
|
function $u(n) {
|
|
var e = /* @__PURE__ */ function(t) {
|
|
ts(i, t);
|
|
var r = as(i);
|
|
function i() {
|
|
return es(this, i), r.apply(this, arguments);
|
|
}
|
|
return i;
|
|
}(Ha);
|
|
return Object.assign(e.prototype, n), e;
|
|
}
|
|
function Ha(n) {
|
|
ne(this, {
|
|
$handle: n,
|
|
vm: n.vm,
|
|
options: {},
|
|
ref: "fcForm",
|
|
mergeOptionsRule: {
|
|
normal: ["form", "row", "info", "submitBtn", "resetBtn"]
|
|
}
|
|
}), this.updateKey(), this.init();
|
|
}
|
|
ne(Ha.prototype, {
|
|
__init: function() {
|
|
var e = this;
|
|
this.$render = this.$handle.$render, this.$r = function() {
|
|
var t;
|
|
return (t = e.$render).renderRule.apply(t, arguments);
|
|
};
|
|
},
|
|
updateKey: function() {
|
|
this.key = Hn();
|
|
},
|
|
init: function() {
|
|
},
|
|
update: function() {
|
|
},
|
|
beforeRender: function() {
|
|
},
|
|
form: function() {
|
|
return this.vm.refs[this.ref];
|
|
},
|
|
adapterValidate: function(e, t) {
|
|
return e.validator = function(r, i, a) {
|
|
return t(i, a);
|
|
}, e;
|
|
},
|
|
getSlot: function(e) {
|
|
var t = function r(i) {
|
|
if (i) {
|
|
var a = i.slots[e];
|
|
return a || r(i.setupState.parent);
|
|
}
|
|
};
|
|
return t(this.vm);
|
|
},
|
|
mergeOptions: function(e, t) {
|
|
var r = this;
|
|
return Rt(e.map(function(i) {
|
|
return r.tidyOptions(i);
|
|
}), t, this.mergeOptionsRule);
|
|
},
|
|
updateOptions: function(e) {
|
|
this.$handle.fc.targetFormDriver("updateOptions", e, {
|
|
handle: this.$handle,
|
|
api: this.$handle.api
|
|
}), this.options = this.mergeOptions([e], this.getDefaultOptions()), this.update();
|
|
},
|
|
tidyOptions: function(e) {
|
|
return e;
|
|
},
|
|
tidyRule: function(e) {
|
|
},
|
|
mergeProp: function(e) {
|
|
},
|
|
getDefaultOptions: function() {
|
|
return {};
|
|
},
|
|
render: function(e) {
|
|
}
|
|
});
|
|
var Su = function(e) {
|
|
var t = {
|
|
name: "loadData",
|
|
_fn: [],
|
|
loaded: function(i, a, o) {
|
|
var s = this;
|
|
this.deleted(i), je(function() {
|
|
var u = Tt(i.getValue()), c = [];
|
|
u.forEach(function(l) {
|
|
if (l && (l.attr || l.template)) {
|
|
var h = function(S) {
|
|
var T;
|
|
l.template ? T = e.$handle.loadStrVar(l.template, S) : l.handler && F.Function(l.handler) ? T = l.handler(S, a, o) : T = S(l.attr, l.default), l.copy !== !1 && (T = ht(T));
|
|
var U = l.modify ? a : i.getProp();
|
|
l.to === "child" ? U.children ? U.children[0] = T : U.children = [T] : kt(U, l.to || "options", T), o.sync(a);
|
|
}, m = function(S) {
|
|
return h(S);
|
|
}, w = e.watchLoadData(m);
|
|
h = xt(h, l.wait || 300), l.watch !== !1 ? c.push(w) : w();
|
|
}
|
|
}), s._fn[i.id] = c;
|
|
});
|
|
},
|
|
deleted: function(i) {
|
|
this._fn[i.id] && (this._fn[i.id].forEach(function(a) {
|
|
a();
|
|
}), delete this._fn[i.id]), i.clearProp();
|
|
}
|
|
};
|
|
return t.watch = t.loaded, t;
|
|
}, Ou = function(e) {
|
|
var t = {
|
|
name: "t",
|
|
_fn: [],
|
|
loaded: function(i, a, o) {
|
|
this.deleted(i);
|
|
var s = i.getValue() || {}, u = [];
|
|
Object.keys(s).forEach(function(c) {
|
|
var l = s[c];
|
|
if (l) {
|
|
var h = pe(l) === "object", m = function(T) {
|
|
var U = e.t(h ? l.attr : l, h ? l.params : null, T), z = h && l.modify ? a : i.getProp();
|
|
c === "child" ? z.children ? z.children[0] = U : z.children = [U] : kt(z, c, U), o.sync(a);
|
|
}, w = function(T) {
|
|
return m(T);
|
|
}, $ = e.watchLoadData(w);
|
|
m = xt(m, l.wait || 300), l.watch !== !1 ? u.push($) : $();
|
|
}
|
|
}), this._fn[i.id] = u;
|
|
},
|
|
deleted: function(i) {
|
|
this._fn[i.id] && (this._fn[i.id].forEach(function(a) {
|
|
a();
|
|
}), delete this._fn[i.id]), i.clearProp();
|
|
}
|
|
};
|
|
return t.watch = t.loaded, t;
|
|
}, Er = {
|
|
name: "componentValidate",
|
|
load: function(e, t, r) {
|
|
var i = e.getValue();
|
|
if (!i || i.method === !1)
|
|
e.clearProp(), r.clearValidateState([t.field]);
|
|
else {
|
|
F.Object(i) || (i = {
|
|
method: i
|
|
});
|
|
var a = i.method;
|
|
delete i.method, e.getProp().validate = [W(W({}, i), {}, {
|
|
validator: function() {
|
|
var s = bt(t);
|
|
if (s) {
|
|
for (var u = arguments.length, c = new Array(u), l = 0; l < u; l++)
|
|
c[l] = arguments[l];
|
|
return r.exec.apply(r, [s.id, F.String(a) ? a : "formCreateValidate"].concat(c, [{
|
|
attr: e,
|
|
rule: t,
|
|
api: r
|
|
}]));
|
|
}
|
|
}
|
|
})];
|
|
}
|
|
},
|
|
watch: function() {
|
|
Er.load.apply(Er, arguments);
|
|
}
|
|
}, Eu = function(e) {
|
|
function t(a) {
|
|
return F.String(a) && (a = {
|
|
action: a,
|
|
to: "options"
|
|
}), a;
|
|
}
|
|
function r(a, o, s) {
|
|
var u = a.value;
|
|
i.deleted(a), F.Function(u) && (u = u(o, s)), u = t(u);
|
|
var c = function($) {
|
|
$ === void 0 ? a.clearProp() : kt(a.getProp(), u.to || "options", $), $ != null && u && u.key && e.$handle.options.globalData[u.key] && e.fetchCache.set(e.$handle.options.globalData[u.key], {
|
|
status: !0,
|
|
data: $
|
|
}), s.sync(o);
|
|
};
|
|
if (!u || !u.action && !u.key) {
|
|
c(void 0);
|
|
return;
|
|
}
|
|
if (u = ht(u), u.to || (u.to = "options"), u.key) {
|
|
var l = e.$handle.options.globalData[u.key];
|
|
if (!l) {
|
|
c(void 0);
|
|
return;
|
|
}
|
|
if (l.type === "static") {
|
|
c(l.data);
|
|
return;
|
|
} else
|
|
u = W(W({}, u), l);
|
|
}
|
|
var h = u.onError, m = function() {
|
|
if (!a.getValue())
|
|
return a.clearProp(), s.sync(o), !0;
|
|
};
|
|
i._fn[a.id] = e.watchLoadData(xt(function(w, $) {
|
|
if ($ && u.watch === !1)
|
|
return i._fn[a.id]();
|
|
var S = e.$handle.loadFetchVar(ht(u), w, o), T = W(W({
|
|
headers: {}
|
|
}, S), {}, {
|
|
onSuccess: function(z, B) {
|
|
if (!m()) {
|
|
var Z = function(ce) {
|
|
return B ? ce : Se(ce, "data") ? ce.data : ce;
|
|
}, Q = gt(S.parse);
|
|
F.Function(Q) ? Z = Q : Q && F.String(Q) && (Z = function(ce) {
|
|
return Ge(ce, Q);
|
|
}), c(Z(z, o, s));
|
|
}
|
|
},
|
|
onError: function(z) {
|
|
c(void 0), !m() && (h || function(B) {
|
|
return Vr(B.message || "fetch fail " + S.action);
|
|
})(z, o, s);
|
|
}
|
|
});
|
|
e.$handle.beforeFetch(T, {
|
|
rule: o,
|
|
api: s
|
|
}).then(function() {
|
|
if (F.Function(S.action)) {
|
|
S.action(o, s).then(function(U) {
|
|
T.onSuccess(U, !0);
|
|
}).catch(function(U) {
|
|
T.onError(U);
|
|
});
|
|
return;
|
|
}
|
|
fe(function() {
|
|
return e.create.fetch(T, {
|
|
inject: a,
|
|
rule: o,
|
|
api: s
|
|
});
|
|
});
|
|
}).catch(function(U) {
|
|
});
|
|
}, u.wait || 600));
|
|
}
|
|
var i = {
|
|
name: "fetch",
|
|
_fn: [],
|
|
loaded: function() {
|
|
r.apply(void 0, arguments);
|
|
},
|
|
watch: function() {
|
|
r.apply(void 0, arguments);
|
|
},
|
|
deleted: function(o) {
|
|
this._fn[o.id] && (this._fn[o.id](), delete this._fn[o.id]), o.clearProp();
|
|
}
|
|
};
|
|
return i;
|
|
}, xu = {
|
|
fetch: Eu,
|
|
loadData: Su,
|
|
t: Ou,
|
|
componentValidate: Er
|
|
};
|
|
function Cu(n) {
|
|
n = n || /* @__PURE__ */ new Map();
|
|
var e = {
|
|
$on: function(r, i) {
|
|
var a = n.get(r), o = a && a.push(i);
|
|
o || n.set(r, [i]);
|
|
},
|
|
$once: function(r, i) {
|
|
i._once = !0, e.$on(r, i);
|
|
},
|
|
$off: function(r, i) {
|
|
var a = n.get(r);
|
|
a && a.splice(a.indexOf(i) >>> 0, 1);
|
|
},
|
|
$emit: function(r) {
|
|
for (var i = arguments.length, a = new Array(i > 1 ? i - 1 : 0), o = 1; o < i; o++)
|
|
a[o - 1] = arguments[o];
|
|
(n.get(r) || []).slice().map(function(s) {
|
|
s._once && (e.$off(r, s), delete s._once), s.apply(void 0, a);
|
|
}), (n.get("*") || []).slice().map(function(s) {
|
|
s(r, a);
|
|
});
|
|
}
|
|
};
|
|
return e;
|
|
}
|
|
var ku = "html", Au = {
|
|
name: ku,
|
|
loadChildren: !1,
|
|
render: function(e, t) {
|
|
return t.prop.props.innerHTML = e.default(), t.vNode.make(t.prop.props.tag || "div", t.prop);
|
|
},
|
|
renderChildren: function(e) {
|
|
return {
|
|
default: function() {
|
|
return e.filter(function(r) {
|
|
return F.String(r);
|
|
}).join("");
|
|
}
|
|
};
|
|
}
|
|
};
|
|
function Du(n) {
|
|
n = n + "=";
|
|
for (var e = decodeURIComponent(document.cookie), t = e.split(";"), r = 0; r < t.length; r++) {
|
|
for (var i = t[r]; i.charAt(0) === " "; )
|
|
i = i.substring(1);
|
|
if (i.indexOf(n) === 0) {
|
|
i = i.substring(n.length, i.length);
|
|
try {
|
|
return JSON.parse(i);
|
|
} catch {
|
|
return i;
|
|
}
|
|
}
|
|
}
|
|
return null;
|
|
}
|
|
function Ru(n) {
|
|
var e = localStorage.getItem(n);
|
|
if (e)
|
|
try {
|
|
return JSON.parse(e);
|
|
} catch {
|
|
return e;
|
|
}
|
|
return null;
|
|
}
|
|
function Pu(n) {
|
|
var e = sessionStorage.getItem(n);
|
|
if (e)
|
|
try {
|
|
return JSON.parse(e);
|
|
} catch {
|
|
return e;
|
|
}
|
|
return null;
|
|
}
|
|
function Nr(n, e) {
|
|
if (!e)
|
|
return null;
|
|
var t = e.split("."), r = n(t.shift());
|
|
return t.length ? r == null ? null : Ge(r, t) : r;
|
|
}
|
|
function Mu(n) {
|
|
return Nr(Du, n);
|
|
}
|
|
function Tu(n) {
|
|
return Nr(Ru, n);
|
|
}
|
|
function ju(n) {
|
|
return Nr(Pu, n);
|
|
}
|
|
var Fu = {
|
|
en: {
|
|
required: "{title} is required",
|
|
validate: {
|
|
url: "{title} is not a valid url",
|
|
email: "{title} is not a valid email",
|
|
ip: "{title} {title} is not a valid ip",
|
|
phone: "{title} {title} is not a valid phone",
|
|
pattern: "{title} does not match pattern {pattern}",
|
|
uppercase: "{title} must be all uppercase",
|
|
lowercase: "{title} must be all lowercased",
|
|
positive: "{title} is not a positive number",
|
|
negative: "{title} is not a negative number",
|
|
equal: "{title} is not equal to {equal}",
|
|
min: "{title} cannot be less than {min}",
|
|
max: "{title} cannot be greater than {max}",
|
|
enum: "{title} must be one of {enum}",
|
|
hasKeys: "{title} does not contain required fields {hasKeys}",
|
|
minLen: "{title} must be at least {minLen}",
|
|
maxLen: "{title} cannot be longer than {maxLen}",
|
|
len: "{title} must be exactly {len}",
|
|
integer: "{title} is not an integer",
|
|
number: "{title} is not an number"
|
|
}
|
|
},
|
|
"zh-cn": {
|
|
required: "{title}\u4E0D\u80FD\u4E3A\u7A7A",
|
|
validate: {
|
|
url: "{title}\u4E0D\u662F\u6709\u6548\u7684 url \u5730\u5740",
|
|
email: "{title}\u4E0D\u662F\u6709\u6548\u7684\u90AE\u7BB1\u5730\u5740",
|
|
ip: "{title}\u4E0D\u662F\u6709\u6548\u7684 IP \u5730\u5740",
|
|
phone: "{title}\u4E0D\u662F\u6B63\u786E\u7684\u624B\u673A\u53F7",
|
|
pattern: "{title}\u5FC5\u987B\u5339\u914D {pattern}",
|
|
uppercase: "{title}\u5FC5\u987B\u5168\u5927\u5199",
|
|
lowercase: "{title}\u5FC5\u987B\u5168\u5C0F\u5199",
|
|
positive: "{title}\u4E0D\u662F\u6B63\u6570",
|
|
negative: "{title}\u4E0D\u662F\u8D1F\u6570",
|
|
equal: "{title}\u5FC5\u987B\u7B49\u4E8E {equal}",
|
|
min: "{title}\u5FC5\u987B\u5927\u4E8E\u7B49\u4E8E {min}",
|
|
max: "{title}\u5FC5\u987B\u5C0F\u4E8E\u7B49\u4E8E {max}",
|
|
enum: "{title}\u5FC5\u987B\u662F {enum} \u4E4B\u4E00",
|
|
hasKeys: "{title}\u5FC5\u987B\u5305\u542B {hasKeys} \u5B57\u6BB5",
|
|
minLen: "{title}\u957F\u5EA6\u5FC5\u987B\u5927\u4E8E {minLen}",
|
|
maxLen: "{title}\u957F\u5EA6\u5FC5\u987B\u5C0F\u4E8E {maxLen}",
|
|
len: "{title}\u957F\u5EA6\u5FC5\u987B\u4E3A {len}",
|
|
integer: "{title}\u5FC5\u987B\u4E3A\u6574\u6570",
|
|
number: "{title}\u5FC5\u987B\u4E3A\u6570\u5B57"
|
|
}
|
|
}
|
|
};
|
|
function Iu(n, e) {
|
|
var t;
|
|
return arguments.length === 2 ? (t = arguments[1], e = t[n]) : t = arguments[2], {
|
|
id: e,
|
|
prop: t
|
|
};
|
|
}
|
|
function sr() {
|
|
return Iu.apply(void 0, ["name"].concat(Array.prototype.slice.call(arguments)));
|
|
}
|
|
function Vu(n) {
|
|
var e = n.key || [], t = n.array || [], r = n.normal || [];
|
|
wr.push.apply(wr, le(e)), Fn.push.apply(Fn, le(t)), In.push.apply(In, le(r)), Ua([].concat(le(e), le(t), le(r)));
|
|
}
|
|
var Bu = 1, nt = {}, $n = Symbol("defValue");
|
|
function Wa(n) {
|
|
var e = Le({}, or.name, or), t = {}, r = {}, i = {}, a = {}, o = [], s = [], u = [n.extendApi], c = W({}, xu), l = Xs(), h = {
|
|
global: {}
|
|
}, m = n.isMobile === !0, w = Be({
|
|
$mobile: m
|
|
}), $ = wu(), S = {}, T = {};
|
|
Vu(n.attrs || {});
|
|
function U(A) {
|
|
var C = nt[A];
|
|
if (Array.isArray(C))
|
|
return C.map(function(D) {
|
|
return D.api();
|
|
});
|
|
if (C)
|
|
return C.api();
|
|
}
|
|
function z(A) {
|
|
o.push(A);
|
|
}
|
|
function B() {
|
|
var A = sr.apply(void 0, arguments);
|
|
A.id && A.prop && (r[A.id] = A.prop);
|
|
}
|
|
function Z() {
|
|
var A = sr.apply(void 0, arguments);
|
|
A.id && A.prop && (c[A.id] = F.Function(A.prop) ? A.prop : W(W({}, A.prop), {}, {
|
|
name: A.id
|
|
}));
|
|
}
|
|
function Q(A) {
|
|
$.use(A);
|
|
}
|
|
function q() {
|
|
var A = sr.apply(void 0, arguments);
|
|
if (!A.id || !A.prop)
|
|
return Rn;
|
|
var C = ft(A.id), D = A.prop, _ = D.merge === !0 ? t[C] : void 0;
|
|
t[C] = wn(D, _ || Rn), l[C] = Gn(C), D.maker && ne(l, D.maker);
|
|
}
|
|
function ce(A, C) {
|
|
var D;
|
|
if (F.String(A)) {
|
|
if (D = A, C === void 0)
|
|
return e[D];
|
|
} else
|
|
D = A.displayName || A.name, C = A;
|
|
if (!(!D || !C)) {
|
|
var _ = ft(D);
|
|
e[D] = C, e[_] = C, delete $.aliasMap[D], delete $.aliasMap[_], delete t[D], delete t[_], C.formCreateParser && q(D, C.formCreateParser);
|
|
}
|
|
}
|
|
function re() {
|
|
return Hs(P, e, r);
|
|
}
|
|
function ae(A, C) {
|
|
var D = re();
|
|
return Ko({
|
|
data: function() {
|
|
return Be({
|
|
rule: A,
|
|
option: C
|
|
});
|
|
},
|
|
render: function() {
|
|
return qe(D, W({
|
|
ref: "fc"
|
|
}, this.$data));
|
|
}
|
|
});
|
|
}
|
|
function J() {
|
|
return or;
|
|
}
|
|
function G(A, C) {
|
|
return F.Function(A.install) ? A.install(Oe, C) : F.Function(A) && A(Oe, C), this;
|
|
}
|
|
function Oe(A, C) {
|
|
var D = ae(A, C || {});
|
|
o.forEach(function(O) {
|
|
fe(function() {
|
|
return O(Oe, D);
|
|
});
|
|
});
|
|
var _ = document.createElement("div");
|
|
((C == null ? void 0 : C.el) || document.body).appendChild(_);
|
|
var E = D.mount(_);
|
|
return E.$refs.fc.fapi;
|
|
}
|
|
wn(Oe, T);
|
|
function Ye(A) {
|
|
var C = W({}, n);
|
|
return A ? C.inherit = {
|
|
components: e,
|
|
parsers: t,
|
|
directives: r,
|
|
modelFields: i,
|
|
providers: c,
|
|
useApps: o,
|
|
maker: l,
|
|
formulas: S,
|
|
loadData: w
|
|
} : delete C.inherit, Wa(C);
|
|
}
|
|
function k(A, C) {
|
|
i[A] = C;
|
|
}
|
|
function b(A, C) {
|
|
S[A] = C;
|
|
}
|
|
function y(A, C) {
|
|
var D = a[A] || {}, _ = D.parsers || {};
|
|
C.parsers && Object.keys(C.parsers).forEach(function(E) {
|
|
_[E] = wn(C.parsers[E], Rn);
|
|
}), C.name = A, a[A] = W(W(W({}, D), C), {}, {
|
|
parsers: _
|
|
});
|
|
}
|
|
function d(A) {
|
|
A && Object.keys(nt).forEach(function(C) {
|
|
var D = Array.isArray(nt[C]) ? nt[C] : [nt[C]];
|
|
D.forEach(function(_) {
|
|
_.bus.$emit("$loadData." + A);
|
|
});
|
|
});
|
|
}
|
|
function f(A, C) {
|
|
kt(w, A, C), d(A);
|
|
}
|
|
function p(A, C) {
|
|
var D = function() {
|
|
for (var E = arguments.length, O = new Array(E), R = 0; R < E; R++)
|
|
O[R] = arguments[R];
|
|
return fe(function() {
|
|
return C.apply(void 0, O);
|
|
});
|
|
};
|
|
D._driver = !0, f(A, D);
|
|
}
|
|
function v(A, C) {
|
|
var D = (A || "").split(".");
|
|
A = D.shift();
|
|
var _ = D.join(".");
|
|
if (Se(w, A) || (w[A] = $n), w[A] !== $n) {
|
|
var E = w[A];
|
|
return E && E._driver ? E = E(_) : D.length && (E = Ge(E, D)), E == null || E === "" ? C : E;
|
|
} else
|
|
return C;
|
|
}
|
|
function g(A) {
|
|
u.push(A);
|
|
}
|
|
function x(A) {
|
|
delete w[A], d(A);
|
|
}
|
|
function M(A, C) {
|
|
s.push({
|
|
name: A,
|
|
callback: C
|
|
});
|
|
}
|
|
function P(A) {
|
|
var C = this;
|
|
ne(this, {
|
|
id: Bu++,
|
|
create: Oe,
|
|
vm: A,
|
|
manager: $u(n.manager),
|
|
parsers: t,
|
|
providers: c,
|
|
modelFields: i,
|
|
formulas: S,
|
|
isMobile: m,
|
|
rules: A.props.rule,
|
|
name: A.props.name || Hn(),
|
|
inFor: A.props.inFor,
|
|
prop: {
|
|
components: e,
|
|
directives: r
|
|
},
|
|
get: null,
|
|
drivers: a,
|
|
renderDriver: null,
|
|
refreshData: d,
|
|
loadData: w,
|
|
CreateNode: $,
|
|
bus: new Cu(),
|
|
unwatch: [],
|
|
options: Ot({}),
|
|
extendApiFn: u,
|
|
fetchCache: /* @__PURE__ */ new WeakMap(),
|
|
tmpData: Be({})
|
|
}), s.forEach(function(D) {
|
|
C.bus.$on(D.name, D.callback);
|
|
}), je(function() {
|
|
ze(C.options, function() {
|
|
C.$handle.$manager.updateOptions(C.options.value), C.api().refresh();
|
|
}, {
|
|
deep: !0
|
|
});
|
|
}), ne(A.appContext.components, e), ne(A.appContext.directives, r), this.$handle = new yt(this), this.name && (this.inFor ? (nt[this.name] || (nt[this.name] = []), nt[this.name].push(this)) : nt[this.name] = this);
|
|
}
|
|
P.isMobile = m, ne(P.prototype, {
|
|
init: function() {
|
|
var C = this;
|
|
this.isSub() && this.unwatch.push(ze(function() {
|
|
return C.vm.setupState.parent.setupState.fc.options.value;
|
|
}, function() {
|
|
C.initOptions(), C.$handle.api.refresh();
|
|
}, {
|
|
deep: !0
|
|
})), this.vm.props.driver && (this.renderDriver = pe(this.vm.props.driver) === "object" ? this.vm.props.driver : this.drivers[this.vm.props.driver]), !this.renderDriver && this.vm.setupState.parent && (this.renderDriver = this.vm.setupState.parent.setupState.fc.renderDriver), this.renderDriver || (this.renderDriver = this.drivers.default), this.initOptions(), this.$handle.init();
|
|
},
|
|
targetFormDriver: function(C) {
|
|
for (var D = this, _ = arguments.length, E = new Array(_ > 1 ? _ - 1 : 0), O = 1; O < _; O++)
|
|
E[O - 1] = arguments[O];
|
|
if (this.renderDriver && this.renderDriver[C])
|
|
return fe(function() {
|
|
var R;
|
|
return (R = D.renderDriver)[C].apply(R, E);
|
|
});
|
|
},
|
|
t: function(C, D, _) {
|
|
var E = _ ? _("$t." + C) : this.globalLanguageDriver(C);
|
|
return E == null && (E = ""), E && D && Object.keys(D).forEach(function(O) {
|
|
var R = new RegExp("{".concat(O, "}"), "g");
|
|
E = E.replace(R, D[O]);
|
|
}), E;
|
|
},
|
|
globalDataDriver: function(C) {
|
|
var D = this, _ = C.split("."), E = _.shift(), O = this.options.value.globalData && this.options.value.globalData[E];
|
|
if (O) {
|
|
if (O.type === "static")
|
|
return Ge(O.data, _);
|
|
var R, j = this.fetchCache.get(O);
|
|
if (j) {
|
|
if (j.status && (R = Ge(j.data, _)), !j.loading)
|
|
return R;
|
|
j.loading = !1, this.fetchCache.set(O, j);
|
|
} else
|
|
this.fetchCache.set(O, {
|
|
status: !1
|
|
});
|
|
var Y = xt(function() {
|
|
se();
|
|
var ue = D.fetchCache.get(O);
|
|
D.options.value.globalData && Object.values(D.options.value.globalData).indexOf(O) !== -1 ? (ue && (ue.loading = !0, D.fetchCache.set(O, ue)), D.bus.$emit("$loadData.$globalData." + E)) : D.fetchCache.delete(O);
|
|
}, O.wait || 600), X = function(ge) {
|
|
D.fetchCache.set(O, {
|
|
status: !0,
|
|
data: ge
|
|
}), D.bus.$emit("$loadData.$globalData." + E);
|
|
}, ie = function(ge, Ee) {
|
|
if (Ee && O.watch === !1)
|
|
return se();
|
|
if (Ee) {
|
|
Y();
|
|
return;
|
|
}
|
|
var be = D.$handle.loadFetchVar(br(O), ge);
|
|
D.$handle.api.fetch(be).then(function(de) {
|
|
X(de);
|
|
}).catch(function(de) {
|
|
X(null);
|
|
});
|
|
}, se = this.watchLoadData(ie);
|
|
return this.unwatch.push(se), R;
|
|
}
|
|
},
|
|
getLocale: function() {
|
|
var C = this.vm.setupState.top.props.locale;
|
|
return C && pe(C) === "object" ? C.name : typeof C == "string" ? C : "zh-cn";
|
|
},
|
|
globalLanguageDriver: function(C) {
|
|
var D = this.vm.setupState.top.props.locale, _ = void 0;
|
|
if (D && pe(D) === "object" && (_ = Ge(D, C)), _ == null) {
|
|
var E = this.options.value.language || {}, O = this.getLocale();
|
|
_ = Ge(E[O] || {}, C), _ == null && (_ = Ge(Fu[O] || {}, C));
|
|
}
|
|
return _;
|
|
},
|
|
globalVarDriver: function(C) {
|
|
var D = this, _ = C.split("."), E = _.shift(), O = this.options.value.globalVariable && this.options.value.globalVariable[E];
|
|
if (O) {
|
|
var R = F.Function(O) ? O : gt(O.handle);
|
|
if (R) {
|
|
var j, Y = this.watchLoadData(function(X, ie) {
|
|
ie ? (D.bus.$emit("$loadData.$var." + E), Y()) : j = R(X, D.$handle.api);
|
|
});
|
|
return this.unwatch.push(Y), Ge(j, _);
|
|
}
|
|
}
|
|
},
|
|
setData: function(C, D, _) {
|
|
_ ? f(C, D) : (kt(this.vm.setupState.top.setupState.fc.tmpData, C, D), this.bus.$emit("$loadData." + C));
|
|
},
|
|
getLoadData: function(C, D) {
|
|
var _ = null;
|
|
if (C != null) {
|
|
var E = C.split("."), O = E.shift();
|
|
if (O === "$topForm")
|
|
_ = this.$handle.api.top.formData(!0);
|
|
else if (O === "$scopeForm")
|
|
_ = this.$handle.api.scope.formData(!0);
|
|
else if (O === "$form")
|
|
_ = this.$handle.api.formData(!0);
|
|
else if (O === "$options")
|
|
_ = this.options.value;
|
|
else if (O === "$globalData")
|
|
_ = this.globalDataDriver(E.join(".")), E = [];
|
|
else if (O === "$var")
|
|
_ = this.globalVarDriver(E.join(".")), E = [];
|
|
else if (O === "$locale")
|
|
_ = this.getLocale(), E = [];
|
|
else if (O === "$t")
|
|
_ = this.globalLanguageDriver(E.join(".")), E = [];
|
|
else {
|
|
if (O === "$preview")
|
|
return this.$handle.preview;
|
|
var R = this.vm.setupState.top.setupState.fc.tmpData;
|
|
Se(R, O) || (R[O] = $n), _ = R[O] !== $n ? Ge(R, C) : v(C), E = [];
|
|
}
|
|
_ && E.length && (_ = Ge(_, E));
|
|
}
|
|
return _ == null || _ === "" ? D : _;
|
|
},
|
|
watchLoadData: function(C, D) {
|
|
var _ = this, E = {}, O = function(X) {
|
|
_.get || (_.get = R), fe(function() {
|
|
C(R, X);
|
|
}), _.get === R && (_.get = void 0);
|
|
}, R = function(X, ie) {
|
|
var se;
|
|
if (pe(X) === "object" && (se = X.getValue, X = X.id), E[X])
|
|
return E[X].val;
|
|
var ue = at(function() {
|
|
return se ? se() : _.getLoadData(X, ie);
|
|
}), ge = X.split("."), Ee = ge.shift(), be = ge.shift() || "", de = xt(function() {
|
|
var te = se ? se() : _.getLoadData(X, ie);
|
|
if (E[X])
|
|
JSON.stringify(te) !== JSON.stringify(E[X].val) && (E[X].val = te, O(!0));
|
|
else
|
|
return;
|
|
}, D || 0), ve = ze(ue, function(te) {
|
|
de();
|
|
});
|
|
return _.bus.$on("$loadData." + Ee, de), be && _.bus.$on("$loadData." + Ee + "." + be, de), E[X] = {
|
|
fn: function() {
|
|
_.bus.$off("$loadData." + Ee, de), be && _.bus.$off("$loadData." + Ee + "." + be, de), ve();
|
|
},
|
|
val: ue.value
|
|
}, ue.value;
|
|
};
|
|
O(!1);
|
|
var j = function() {
|
|
Object.keys(E).forEach(function(X) {
|
|
return E[X].fn();
|
|
}), E = {};
|
|
};
|
|
return this.unwatch.push(j), j;
|
|
},
|
|
isSub: function() {
|
|
return this.vm.setupState.parent && this.vm.props.extendOption;
|
|
},
|
|
initOptions: function() {
|
|
this.options.value = {};
|
|
var C = W({
|
|
formData: {},
|
|
submitBtn: {},
|
|
resetBtn: {},
|
|
globalEvent: {},
|
|
globalData: {}
|
|
}, ht(h));
|
|
this.isSub() && (C = this.mergeOptions(C, this.vm.setupState.parent.setupState.fc.options.value || {}, !0)), C = this.mergeOptions(C, this.vm.props.option), this.updateOptions(C);
|
|
},
|
|
mergeOptions: function(C, D, _) {
|
|
return D = W({}, D || {}), _ && ["page", "onSubmit", "onReset", "onCreated", "onChange", "onMounted", "mounted", "onReload", "reload", "formData", "el", "globalClass", "style"].forEach(function(E) {
|
|
delete D[E];
|
|
}), D.global && (C.global = qs(C.global, D.global), delete D.global), this.$handle.$manager.mergeOptions([D], C), C;
|
|
},
|
|
updateOptions: function(C) {
|
|
this.options.value = this.mergeOptions(this.options.value, C), this.$handle.$manager.updateOptions(this.options.value), this.bus.$emit("$loadData.$options");
|
|
},
|
|
api: function() {
|
|
return this.$handle.api;
|
|
},
|
|
render: function() {
|
|
return this.$handle.render();
|
|
},
|
|
mounted: function() {
|
|
this.$handle.mounted();
|
|
},
|
|
unmount: function() {
|
|
var C = this;
|
|
if (this.name)
|
|
if (this.inFor) {
|
|
var D = nt[this.name].indexOf(this);
|
|
nt[this.name].splice(D, 1);
|
|
} else
|
|
delete nt[this.name];
|
|
s.forEach(function(_) {
|
|
C.bus.$off(_.name, _.callback);
|
|
}), this.tmpData = {}, this.unwatch.forEach(function(_) {
|
|
return _();
|
|
}), this.unwatch = [], this.$handle.reloadRule([]);
|
|
},
|
|
updated: function() {
|
|
var C = this;
|
|
this.$handle.bindNextTick(function() {
|
|
return C.bus.$emit("next-tick", C.$handle.api);
|
|
});
|
|
}
|
|
});
|
|
function N(A) {
|
|
ne(A, {
|
|
version: n.version,
|
|
ui: n.ui,
|
|
isMobile: m,
|
|
extendApi: g,
|
|
getData: v,
|
|
setDataDriver: p,
|
|
setData: f,
|
|
removeData: x,
|
|
refreshData: d,
|
|
maker: l,
|
|
component: ce,
|
|
directive: B,
|
|
setModelField: k,
|
|
setFormula: b,
|
|
setDriver: y,
|
|
register: Z,
|
|
$vnode: J,
|
|
parser: q,
|
|
use: G,
|
|
factory: Ye,
|
|
componentAlias: Q,
|
|
copyRule: Ba,
|
|
copyRules: La,
|
|
mergeRule: $t,
|
|
fetch: qa,
|
|
$form: re,
|
|
parseFn: gt,
|
|
parseJson: Va,
|
|
toJson: dn,
|
|
useApp: z,
|
|
getApi: U,
|
|
on: M
|
|
});
|
|
}
|
|
function I(A) {
|
|
ne(A, {
|
|
create: Oe,
|
|
install: function(D, _) {
|
|
h = W(W({}, h), _ || {});
|
|
var E = "_installedFormCreate_" + n.ui;
|
|
if (D[E] !== !0) {
|
|
D[E] = !0;
|
|
var O = function(Y) {
|
|
var X = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {};
|
|
return Oe(Y, X);
|
|
};
|
|
N(O), D.config.globalProperties.$formCreate = O;
|
|
var R = re();
|
|
D.component(R.name, R), o.forEach(function(j) {
|
|
fe(function() {
|
|
return j(A, D);
|
|
});
|
|
});
|
|
}
|
|
}
|
|
});
|
|
}
|
|
if (N(T), I(T), p("$cookie", Mu), p("$localStorage", Tu), p("$sessionStorage", ju), $.use({
|
|
fragment: "fcFragment"
|
|
}), n.install && Oe.use(n), z(function(A, C) {
|
|
C.mixin({
|
|
props: ["formCreateInject"]
|
|
});
|
|
}), q(Au), n.inherit) {
|
|
var V = n.inherit;
|
|
V.components && ne(e, V.components), V.parsers && ne(t, V.parsers), V.directives && ne(r, V.directives), V.modelFields && ne(i, V.modelFields), V.providers && ne(c, V.providers), V.useApps && ne(o, V.useApps), V.maker && ne(l, V.maker), V.loadData && ne(w, V.loadData), V.formulas && ne(S, V.formulas);
|
|
}
|
|
var L = re();
|
|
return wn(L, T), Object.defineProperties(L, {
|
|
fetch: {
|
|
get: function() {
|
|
return T.fetch;
|
|
},
|
|
set: function(C) {
|
|
T.fetch = C;
|
|
}
|
|
}
|
|
}), L.util = T, L;
|
|
}
|
|
var ur = "hidden", Lu = {
|
|
name: ur,
|
|
maker: Le({}, ur, function(n, e) {
|
|
return Gn(ur)("", n, e);
|
|
}),
|
|
render: function() {
|
|
return [];
|
|
}
|
|
}, Nu = {
|
|
name: "FcRow",
|
|
render: function(e, t) {
|
|
return t.vNode.col({
|
|
props: {
|
|
span: 24
|
|
}
|
|
}, {
|
|
default: function() {
|
|
return [t.vNode.row(t.prop, e)];
|
|
}
|
|
});
|
|
}
|
|
}, zu = {
|
|
name: "checkbox",
|
|
mergeProp: function(e) {
|
|
var t = e.prop.props;
|
|
Se(t, "options") || (t.options = e.prop.options || []);
|
|
}
|
|
}, Uu = {
|
|
name: "radio",
|
|
mergeProp: function(e) {
|
|
var t = e.prop.props;
|
|
Se(t, "options") || (t.options = e.prop.options || []);
|
|
}
|
|
}, qu = {
|
|
name: "select",
|
|
mergeProp: function(e) {
|
|
var t = e.prop.props;
|
|
Se(t, "options") || (t.options = e.prop.options || []);
|
|
}
|
|
}, Gu = {
|
|
name: "cascader",
|
|
mergeProp: function(e) {
|
|
var t = e.prop.props;
|
|
Se(t, "options") || (t.options = e.prop.options || []);
|
|
}
|
|
}, Hu = [Lu, Nu, Gu, zu, Uu, qu], Qe = "van", Wu = {
|
|
button: Qe + "-button",
|
|
icon: Qe + "-icon",
|
|
slider: Qe + "-slider",
|
|
stepper: Qe + "-stepper",
|
|
rate: Qe + "-rate",
|
|
uploader: "fc-uploader",
|
|
cell: Qe + "-cell",
|
|
timePicker: "fc-time-picker",
|
|
datePicker: "fc-date-picker",
|
|
switch: Qe + "-switch",
|
|
select: "fc-select",
|
|
cascader: "fc-cascader",
|
|
calendar: "fc-calendar",
|
|
checkbox: "fc-checkbox",
|
|
radio: "fc-radio",
|
|
input: Qe + "-field",
|
|
field: Qe + "-field",
|
|
formItem: Qe + "-field",
|
|
form: Qe + "-form",
|
|
col: Qe + "-col",
|
|
row: Qe + "-row",
|
|
group: "fc-group",
|
|
array: "fc-group",
|
|
object: "fc-sub-form",
|
|
subForm: "fc-sub-form"
|
|
};
|
|
function Yu() {
|
|
return {
|
|
form: {
|
|
required: "auto",
|
|
labelAlign: "right",
|
|
inputAlign: "right"
|
|
},
|
|
row: {
|
|
show: !0,
|
|
gutter: 0
|
|
},
|
|
submitBtn: {
|
|
type: "primary",
|
|
loading: !1,
|
|
disabled: !1,
|
|
block: !0,
|
|
innerText: "",
|
|
size: "small",
|
|
show: !0,
|
|
col: void 0,
|
|
click: void 0
|
|
},
|
|
resetBtn: {
|
|
type: "default",
|
|
loading: !1,
|
|
disabled: !1,
|
|
block: !0,
|
|
innerText: "",
|
|
size: "small",
|
|
show: !1,
|
|
col: void 0,
|
|
click: void 0
|
|
}
|
|
};
|
|
}
|
|
function Hi(n, e) {
|
|
if (!!Se(n, e) && F.String(n[e])) {
|
|
var t;
|
|
n[e] = (t = {}, Le(t, e, n[e]), Le(t, "show", !0), t);
|
|
}
|
|
}
|
|
function _t(n) {
|
|
return n === !1;
|
|
}
|
|
function Xu(n, e) {
|
|
Se(n, e) && !F.Object(n[e]) && (n[e] = {
|
|
show: !!n[e]
|
|
});
|
|
}
|
|
function Wi(n) {
|
|
var e = W({}, n);
|
|
return delete e.children, e;
|
|
}
|
|
var Ju = {
|
|
validate: function() {
|
|
var e = this.form();
|
|
return e ? e.validate() : new Promise(function(t) {
|
|
return t();
|
|
});
|
|
},
|
|
validateField: function(e) {
|
|
var t = this;
|
|
return new Promise(function(r, i) {
|
|
var a = t.form();
|
|
a ? a.validate(e).then(r).catch(i) : r();
|
|
});
|
|
},
|
|
clearValidateState: function(e) {
|
|
var t = this.form();
|
|
if (t)
|
|
return t.resetValidation(e.id);
|
|
},
|
|
tidyOptions: function(e) {
|
|
return ["submitBtn", "resetBtn", "row", "info", "wrap", "col", "title"].forEach(function(t) {
|
|
Xu(e, t);
|
|
}), e;
|
|
},
|
|
tidyRule: function(e) {
|
|
var t = e.prop;
|
|
return Hi(t, "title"), Hi(t, "info"), t.validate && t.validate.forEach(function(r) {
|
|
F.String(r.pattern) && (r.pattern = new RegExp(r.pattern));
|
|
}), t;
|
|
},
|
|
mergeProp: function(e) {
|
|
var t = this, r = {
|
|
info: {
|
|
icon: !0
|
|
},
|
|
title: {},
|
|
col: {
|
|
span: 24
|
|
},
|
|
wrap: {}
|
|
};
|
|
["info", "wrap", "col", "title"].forEach(function(i) {
|
|
e.prop[i] = Rt([t.options[i] || {}, e.prop[i] || {}], r[i]);
|
|
});
|
|
},
|
|
getDefaultOptions: function() {
|
|
return Yu();
|
|
},
|
|
adapterValidate: function(e, t) {
|
|
return e.trigger === "change" ? e.trigger = "onChange" : e.trigger === "blur" && (e.trigger = "onBlur"), e.validator = function(r) {
|
|
return new Promise(function(i) {
|
|
var a = function(s) {
|
|
e.message = s, s ? i(!1) : i();
|
|
};
|
|
return t(r, a);
|
|
});
|
|
}, e;
|
|
},
|
|
update: function() {
|
|
var e = this.options.form;
|
|
this.rule = {
|
|
props: W({}, e),
|
|
on: {
|
|
submit: function(r) {
|
|
r.preventDefault();
|
|
}
|
|
},
|
|
style: e.style,
|
|
type: "form"
|
|
};
|
|
},
|
|
beforeRender: function() {
|
|
var e = this.key, t = this.ref, r = this.options.form;
|
|
ne(this.rule, {
|
|
key: e,
|
|
ref: t,
|
|
class: [r.className, r.class, "form-create-m", this.$handle.preview ? "is-preview" : ""]
|
|
});
|
|
},
|
|
render: function(e) {
|
|
var t = this;
|
|
return e.slotLen() && !this.$handle.preview && e.setSlot(void 0, function() {
|
|
return t.makeFormBtn();
|
|
}), this.$r(this.rule, _t(this.options.row.show) ? e.getSlots() : [this.makeRow(e)]);
|
|
},
|
|
makeWrap: function(e, t) {
|
|
var r = this, i = e.prop, a = "".concat(this.key).concat(e.key), o = i.col, s = this.isTitle(i) && i.wrap.title !== !1, u = this.rule.props.col;
|
|
delete i.wrap.title;
|
|
var c = _t(i.wrap.show) ? t : this.$r(Rt([i.wrap, {
|
|
props: W(W({
|
|
modelValue: e.rule.value,
|
|
label: s ? i.title.title : void 0
|
|
}, Wi(i.wrap || {})), {}, {
|
|
name: e.id,
|
|
rules: e.injectValidate()
|
|
}),
|
|
class: this.$render.mergeClass(i.className, "fc-form-item"),
|
|
key: "".concat(a, "fi"),
|
|
ref: e.wrapRef,
|
|
type: "formItem"
|
|
}]), W({
|
|
input: function() {
|
|
return t;
|
|
}
|
|
}, s ? {
|
|
label: function() {
|
|
return r.makeInfo(i, a, e);
|
|
}
|
|
} : {}));
|
|
return _t(u) || _t(o.show) ? c : this.makeCol(i, a, [c]);
|
|
},
|
|
isTitle: function(e) {
|
|
if (this.options.form.title === !1)
|
|
return !1;
|
|
var t = e.title;
|
|
return !(!t.title && !t.native || _t(t.show));
|
|
},
|
|
makeInfo: function(e, t, r) {
|
|
var i, a, o, s, u = W({}, e.title), c = W({}, e.info), l = this.getSlot("title"), h = [l ? l({
|
|
title: (i = r.refRule) === null || i === void 0 || (a = i.__$title) === null || a === void 0 ? void 0 : a.value,
|
|
rule: r.rule,
|
|
options: this.options
|
|
}) : (o = r.refRule) === null || o === void 0 || (s = o.__$title) === null || s === void 0 ? void 0 : s.value], m = !_t(c.show) && (c.info || c.native) && !_t(c.icon);
|
|
m && h[c.align !== "left" ? "unshift" : "push"](this.$r({
|
|
type: c.icon === !0 ? "icon-warning" : c.icon,
|
|
style: "width:1em;"
|
|
}));
|
|
var w = Rt([u, {
|
|
props: Wi(u),
|
|
key: "".concat(t, "tit"),
|
|
class: "fc-form-title",
|
|
type: u.type || "span"
|
|
}]);
|
|
return m && c.info && !w.props.onClick && (w.props.onClick = function() {
|
|
var $, S;
|
|
Ca({
|
|
type: "warning",
|
|
message: ($ = r.refRule) === null || $ === void 0 || (S = $.__$info) === null || S === void 0 ? void 0 : S.value,
|
|
duration: 1e3
|
|
});
|
|
}), delete w.props.show, delete w.props.title, delete w.props.native, this.$r(w, h);
|
|
},
|
|
makeCol: function(e, t, r) {
|
|
var i = e.col;
|
|
return this.$r({
|
|
class: this.$render.mergeClass(i.class, "fc-form-col"),
|
|
type: "col",
|
|
props: i || {
|
|
span: 24
|
|
},
|
|
key: "".concat(t, "col")
|
|
}, r);
|
|
},
|
|
makeRow: function(e) {
|
|
var t = this.options.row || {};
|
|
return this.$r({
|
|
type: "row",
|
|
props: t,
|
|
class: this.$render.mergeClass(t.class, "fc-form-row"),
|
|
key: "".concat(this.key, "row")
|
|
}, e);
|
|
},
|
|
makeFormBtn: function() {
|
|
var e = [];
|
|
if (_t(this.options.submitBtn.show) || e.push(this.makeSubmitBtn()), _t(this.options.resetBtn.show) || e.push(this.makeResetBtn()), !!e.length)
|
|
return this.$r({
|
|
type: "cell",
|
|
class: "fc-form-cell fc-form-footer",
|
|
key: "".concat(this.key, "fb")
|
|
}, e);
|
|
},
|
|
makeResetBtn: function() {
|
|
var e = this, t = W({}, this.options.resetBtn), r = t.innerText || this.$handle.api.t("reset") || "\u91CD\u7F6E";
|
|
return delete t.innerText, delete t.click, delete t.col, delete t.show, this.$r({
|
|
type: "button",
|
|
props: t,
|
|
class: "fc-reset-btn",
|
|
style: {
|
|
width: t.width
|
|
},
|
|
on: {
|
|
click: function() {
|
|
var a = e.$handle.api;
|
|
e.options.resetBtn.click ? e.options.resetBtn.click(a) : a.resetFields();
|
|
}
|
|
},
|
|
key: "".concat(this.key, "b2")
|
|
}, [r]);
|
|
},
|
|
makeSubmitBtn: function() {
|
|
var e = this, t = W({}, this.options.submitBtn), r = t.innerText || this.$handle.api.t("submit") || "\u63D0\u4EA4";
|
|
return delete t.innerText, delete t.click, delete t.col, delete t.show, this.$r({
|
|
type: "button",
|
|
props: t,
|
|
class: "fc-submit-btn",
|
|
style: {
|
|
width: t.width
|
|
},
|
|
on: {
|
|
click: function() {
|
|
var a = e.$handle.api;
|
|
e.options.submitBtn.click ? e.options.submitBtn.click(a) : a.submit().catch(function() {
|
|
});
|
|
}
|
|
},
|
|
key: "".concat(this.key, "b1")
|
|
}, [r]);
|
|
}
|
|
};
|
|
function Ku(n, e) {
|
|
e === void 0 && (e = {});
|
|
var t = e.insertAt;
|
|
if (!(!n || typeof document > "u")) {
|
|
var r = document.head || document.getElementsByTagName("head")[0], i = document.createElement("style");
|
|
i.type = "text/css", t === "top" && r.firstChild ? r.insertBefore(i, r.firstChild) : r.appendChild(i), i.styleSheet ? i.styleSheet.cssText = n : i.appendChild(document.createTextNode(n));
|
|
}
|
|
}
|
|
var Zu = '.form-create-m{width:100%}.form-create-m .fc-none,.form-create-m.is-preview .fc-clock{display:none!important}.form-create-m .van-field:has(.van-field__value>.van-field__body>.van-field__control>.van-field):after{display:none}.form-create-m .van-field>.van-field__value>.van-field__body>.van-field__control>*>.van-field:after,.form-create-m .van-field>.van-field__value>.van-field__body>.van-field__control>.van-field:after{display:block;left:0;right:0}.form-create-m .fc-form-item>.van-field__value>.van-field__body>.van-field__control>.van-cell{padding:0}.form-create-m .fc-form-item .fc-form-item{--van-padding-md:0;padding-left:0;padding-right:0}.form-create-m>.van-row>.van-col--24:last-of-type>.van-cell:last-of-type:after{display:none}.form-create-m .fc-reset-btn{margin-top:12px}.form-create-m .fc-form-title{align-items:center;display:inline-flex}.form-create-m.is-preview .van-field__label--required:before{display:none}._fc-m-group{align-items:flex-end;display:flex;flex-direction:column;justify-content:center;min-height:38px;width:100%}._fc-m-group-disabled ._fc-m-group-add,._fc-m-group-disabled ._fc-m-group-btn{cursor:not-allowed}._fc-m-group-handle{background-color:#fff;border:1px dashed #d9d9d9;border-radius:15px;bottom:-15px;display:flex;flex-direction:row;padding:3px 8px;position:absolute;right:30px;transform:scale(1.1)}._fc-m-group-btn{cursor:pointer}._fc-m-group-idx{align-items:center;background:#eee;border-radius:15px;bottom:-15px;display:flex;font-weight:700;height:30px;justify-content:center;left:10px;position:absolute;width:30px}._fc-m-group-handle ._fc-m-group-btn+._fc-m-group-btn{margin-left:7px}._fc-m-group-container{border:1px dashed #d9d9d9;border-radius:5px;box-sizing:border-box;display:flex;flex-direction:column;margin-bottom:25px;padding:5px 5px 25px;position:relative;width:100%}._fc-m-group-arrow{height:20px;position:relative;width:20px}._fc-m-group-arrow:before{border-left:2px solid #999;border-top:2px solid #999;content:"";height:9px;left:5px;position:absolute;top:8px;transform:rotate(45deg);width:9px}._fc-m-group-arrow._fc-m-group-down{transform:rotate(180deg)}._fc-m-group-plus-minus{cursor:pointer;height:20px;position:relative;width:20px}._fc-m-group-plus-minus:after,._fc-m-group-plus-minus:before{background-color:#409eff;content:"";height:2px;left:50%;position:absolute;top:50%;transform:translate(-50%,-50%);width:60%}._fc-m-group-plus-minus:before{transform:translate(-50%,-50%) rotate(90deg)}._fc-m-group-plus-minus._fc-m-group-minus:before{display:none}._fc-m-group-plus-minus._fc-m-group-minus:after{background-color:#f56c6c}._fc-m-group-add{border:1px solid rgba(64,158,255,.5);border-radius:15px;cursor:pointer;height:25px;transform:scale(1.1);width:25px}._fc-m-group-add._fc-m-group-plus-minus:after,._fc-m-group-add._fc-m-group-plus-minus:before{width:50%}';
|
|
Ku(Zu);
|
|
function Yi(n, e) {
|
|
return F.Boolean(n) ? n = {
|
|
show: n
|
|
} : !F.Undef(n) && !F.Object(n) && (n = {
|
|
show: e
|
|
}), n;
|
|
}
|
|
function Qu(n, e) {
|
|
return {
|
|
formEl: function() {
|
|
return e.$manager.form();
|
|
},
|
|
wrapEl: function(r) {
|
|
var i = e.getFieldCtx(r);
|
|
if (!!i)
|
|
return e.vm.refs[i.wrapRef];
|
|
},
|
|
validate: function(r) {
|
|
return new Promise(function(i, a) {
|
|
var o = n.children, s = [e.$manager.validate()];
|
|
o.filter(function(u) {
|
|
return !u.isScope;
|
|
}).forEach(function(u) {
|
|
s.push(u.validate());
|
|
}), Promise.all(s).then(function() {
|
|
i(!0), r && r(!0);
|
|
}).catch(function(u) {
|
|
a(u), r && r(u), e.vm.emit("validate-fail", u, {
|
|
api: n
|
|
});
|
|
});
|
|
});
|
|
},
|
|
validateField: function(r, i) {
|
|
return new Promise(function(a, o) {
|
|
var s = e.getFieldCtx(r);
|
|
if (!!s) {
|
|
var u = e.subForm[s.id], c = [e.$manager.validateField(s.id)];
|
|
Tt(u).filter(function(l) {
|
|
return !l.isScope;
|
|
}).forEach(function(l) {
|
|
c.push(l.validate());
|
|
}), Promise.all(c).then(function() {
|
|
a(null), i && i(null);
|
|
}).catch(function(l) {
|
|
o(l), i && i(l), e.vm.emit("validate-field-fail", l, {
|
|
field: r,
|
|
api: n
|
|
});
|
|
});
|
|
}
|
|
});
|
|
},
|
|
clearValidateState: function(r) {
|
|
var i = this, a = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : !0;
|
|
n.helper.tidyFields(r).forEach(function(o) {
|
|
a && i.clearSubValidateState(o), e.getCtxs(o).forEach(function(s) {
|
|
e.$manager.clearValidateState(s);
|
|
});
|
|
});
|
|
},
|
|
clearSubValidateState: function(r) {
|
|
n.helper.tidyFields(r).forEach(function(i) {
|
|
e.getCtxs(i).forEach(function(a) {
|
|
var o = e.subForm[a.id];
|
|
!o || (Array.isArray(o) ? o.forEach(function(s) {
|
|
s.clearValidateState();
|
|
}) : o && o.clearValidateState());
|
|
});
|
|
});
|
|
},
|
|
btn: {
|
|
loading: function() {
|
|
var r = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : !0;
|
|
n.submitBtnProps({
|
|
loading: !!r
|
|
});
|
|
},
|
|
disabled: function() {
|
|
var r = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : !0;
|
|
n.submitBtnProps({
|
|
disabled: !!r
|
|
});
|
|
},
|
|
show: function() {
|
|
var r = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : !0;
|
|
n.submitBtnProps({
|
|
show: !!r
|
|
});
|
|
}
|
|
},
|
|
resetBtn: {
|
|
loading: function() {
|
|
var r = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : !0;
|
|
n.resetBtnProps({
|
|
loading: !!r
|
|
});
|
|
},
|
|
disabled: function() {
|
|
var r = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : !0;
|
|
n.resetBtnProps({
|
|
disabled: !!r
|
|
});
|
|
},
|
|
show: function() {
|
|
var r = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : !0;
|
|
n.resetBtnProps({
|
|
show: !!r
|
|
});
|
|
}
|
|
},
|
|
submitBtnProps: function() {
|
|
var r = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {}, i = Yi(e.options.submitBtn, !0);
|
|
ne(i, r), e.options.submitBtn = i, n.refreshOptions();
|
|
},
|
|
resetBtnProps: function() {
|
|
var r = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {}, i = Yi(e.options.resetBtn, !1);
|
|
ne(i, r), e.options.resetBtn = i, n.refreshOptions();
|
|
},
|
|
submit: function(r, i) {
|
|
return new Promise(function(a, o) {
|
|
var s = e.options.validateOnSubmit === !1 ? Promise.resolve() : n.validate();
|
|
s.then(function() {
|
|
var u = n.formData();
|
|
e.beforeSubmit(u).then(function() {
|
|
F.Function(r) && fe(function() {
|
|
return r(u, n);
|
|
}), F.Function(e.options.onSubmit) && fe(function() {
|
|
return e.options.onSubmit(u, n);
|
|
}), e.vm.emit("submit", u, n), a(u);
|
|
}).catch(function(c) {
|
|
});
|
|
}).catch(function() {
|
|
for (var u = arguments.length, c = new Array(u), l = 0; l < u; l++)
|
|
c[l] = arguments[l];
|
|
F.Function(i) && fe(function() {
|
|
return i.apply(void 0, [n].concat(c));
|
|
}), o.apply(void 0, c);
|
|
});
|
|
});
|
|
}
|
|
};
|
|
}
|
|
var xr = {
|
|
name: "required",
|
|
load: function(e, t, r) {
|
|
var i = el(e.getValue());
|
|
if (i.required === !1)
|
|
e.clearProp(), r.clearValidateState([t.field]);
|
|
else {
|
|
var a, o, s = W({
|
|
required: !0,
|
|
validator: function(h) {
|
|
return !F.empty(h);
|
|
},
|
|
trigger: ["onChange", "onSubmit"]
|
|
}, i), u = (a = t.__fc__.refRule) === null || a === void 0 || (o = a.__$title) === null || o === void 0 ? void 0 : o.value;
|
|
if (!s.message)
|
|
s.message = r.t("required", {
|
|
title: u
|
|
}) || u + (r.getLocale() === "en" ? " is required" : "\u4E0D\u80FD\u4E3A\u7A7A");
|
|
else {
|
|
var c = s.message.match(/^\{\{\s*\$t\.(.+)\s*\}\}$/);
|
|
c && (s.message = r.t(c[1], {
|
|
title: u
|
|
}));
|
|
}
|
|
e.getProp().validate = [s];
|
|
}
|
|
r.sync(t);
|
|
},
|
|
watch: function() {
|
|
xr.load.apply(xr, arguments);
|
|
}
|
|
};
|
|
function el(n) {
|
|
return F.Boolean(n) ? {
|
|
required: n
|
|
} : F.String(n) ? {
|
|
message: n
|
|
} : F.Undef(n) ? {
|
|
required: !1
|
|
} : F.Function(n) ? {
|
|
validator: n
|
|
} : F.Object(n) ? n : {};
|
|
}
|
|
function tl(n) {
|
|
n.componentAlias(Wu), Ls.forEach(function(e) {
|
|
n.component(e.name, e);
|
|
}), n.register(xr), Hu.forEach(function(e) {
|
|
n.parser(e);
|
|
}), Ri.props && (Ri.props.modelValue = {
|
|
type: [String, Number, Array, Object, Boolean],
|
|
default: ""
|
|
});
|
|
}
|
|
function nl() {
|
|
return Wa({
|
|
ui: "vant",
|
|
version: "3.2.22",
|
|
manager: Ju,
|
|
extendApi: Qu,
|
|
install: tl,
|
|
isMobile: !0,
|
|
attrs: {
|
|
normal: ["col", "wrap"],
|
|
key: ["title", "info"]
|
|
}
|
|
});
|
|
}
|
|
var _e = nl();
|
|
typeof window < "u" && (window.formCreateMobile = _e);
|
|
_e.maker;
|
|
/*!
|
|
* @form-create/component-elm-select v3.2.18
|
|
* (c) 2018-2025 xaboy
|
|
* Github https://github.com/xaboy/form-create with select
|
|
* Released under the MIT License.
|
|
*/
|
|
function Xi(n, e) {
|
|
var t = Object.keys(n);
|
|
if (Object.getOwnPropertySymbols) {
|
|
var r = Object.getOwnPropertySymbols(n);
|
|
e && (r = r.filter(function(i) {
|
|
return Object.getOwnPropertyDescriptor(n, i).enumerable;
|
|
})), t.push.apply(t, r);
|
|
}
|
|
return t;
|
|
}
|
|
function rl(n) {
|
|
for (var e = 1; e < arguments.length; e++) {
|
|
var t = arguments[e] != null ? arguments[e] : {};
|
|
e % 2 ? Xi(Object(t), !0).forEach(function(r) {
|
|
il(n, r, t[r]);
|
|
}) : Object.getOwnPropertyDescriptors ? Object.defineProperties(n, Object.getOwnPropertyDescriptors(t)) : Xi(Object(t)).forEach(function(r) {
|
|
Object.defineProperty(n, r, Object.getOwnPropertyDescriptor(t, r));
|
|
});
|
|
}
|
|
return n;
|
|
}
|
|
function Pn(n) {
|
|
return typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? Pn = function(e) {
|
|
return typeof e;
|
|
} : Pn = function(e) {
|
|
return e && typeof Symbol == "function" && e.constructor === Symbol && e !== Symbol.prototype ? "symbol" : typeof e;
|
|
}, Pn(n);
|
|
}
|
|
function il(n, e, t) {
|
|
return e in n ? Object.defineProperty(n, e, {
|
|
value: t,
|
|
enumerable: !0,
|
|
configurable: !0,
|
|
writable: !0
|
|
}) : n[e] = t, n;
|
|
}
|
|
function al(n, e) {
|
|
return Object.keys(n).reduce(function(t, r) {
|
|
return (!e || e.indexOf(r) === -1) && (t[r] = n[r]), t;
|
|
}, {});
|
|
}
|
|
var Vn = {
|
|
type: function(e, t) {
|
|
return Object.prototype.toString.call(e) === "[object " + t + "]";
|
|
},
|
|
Undef: function(e) {
|
|
return e == null;
|
|
},
|
|
Element: function(e) {
|
|
return Pn(e) === "object" && e !== null && e.nodeType === 1 && !Vn.Object(e);
|
|
},
|
|
trueArray: function(e) {
|
|
return Array.isArray(e) && e.length > 0;
|
|
},
|
|
Function: function(e) {
|
|
var t = this.getType(e);
|
|
return t === "Function" || t === "AsyncFunction";
|
|
},
|
|
getType: function(e) {
|
|
var t = Object.prototype.toString.call(e);
|
|
return /^\[object (.*)\]$/.exec(t)[1];
|
|
},
|
|
empty: function(e) {
|
|
return e == null || Array.isArray(e) && Array.isArray(e) && !e.length ? !0 : typeof e == "string" && !e;
|
|
}
|
|
};
|
|
["Date", "Object", "String", "Boolean", "Array", "Number"].forEach(function(n) {
|
|
Vn[n] = function(e) {
|
|
return Vn.type(e, n);
|
|
};
|
|
});
|
|
function ol(n, e) {
|
|
return {}.hasOwnProperty.call(n, e);
|
|
}
|
|
var sl = "fcSelect", ul = he({
|
|
name: sl,
|
|
inheritAttrs: !1,
|
|
props: {
|
|
formCreateInject: Object,
|
|
modelValue: {
|
|
type: [Array, String, Number, Boolean, Object],
|
|
default: void 0
|
|
},
|
|
type: String
|
|
},
|
|
emits: ["update:modelValue", "fc.el"],
|
|
setup: function(e) {
|
|
var t = De(e.formCreateInject, "options", []), r = De(e, "modelValue"), i = function() {
|
|
return Array.isArray(t.value) ? t.value : [];
|
|
};
|
|
return {
|
|
options: i,
|
|
value: r
|
|
};
|
|
},
|
|
render: function() {
|
|
var e = this, t, r, i = function(u, c) {
|
|
return H(K("ElOption"), Pe(u, {
|
|
key: "" + c + "-" + u.value
|
|
}), null);
|
|
}, a = function(u, c) {
|
|
return H(K("ElOptionGroup"), {
|
|
label: u.label,
|
|
key: "" + c + "-" + u.label
|
|
}, {
|
|
default: function() {
|
|
return [Vn.trueArray(u.options) && u.options.map(function(h, m) {
|
|
return i(h, m);
|
|
})];
|
|
}
|
|
});
|
|
}, o = this.options();
|
|
return H(K("ElSelect"), Pe(this.$attrs, {
|
|
modelValue: this.value,
|
|
"onUpdate:modelValue": function(u) {
|
|
return e.$emit("update:modelValue", u);
|
|
},
|
|
ref: "el"
|
|
}), rl({
|
|
default: function() {
|
|
return [o.map(function(u, c) {
|
|
return ol(u || "", "options") ? a(u, c) : i(u, c);
|
|
}), (t = (r = e.$slots).default) === null || t === void 0 ? void 0 : t.call(r)];
|
|
}
|
|
}, al(this.$slots, ["default"])));
|
|
},
|
|
mounted: function() {
|
|
this.$emit("fc.el", this.$refs.el);
|
|
}
|
|
});
|
|
/*!
|
|
* @form-create/component-elm-tree v3.2.18
|
|
* (c) 2018-2025 xaboy
|
|
* Github https://github.com/xaboy/form-create with tree
|
|
* Released under the MIT License.
|
|
*/
|
|
function ll(n) {
|
|
return Array.isArray(n) ? n : [null, void 0, ""].indexOf(n) > -1 ? [] : [n];
|
|
}
|
|
var cl = "fcTree", fl = he({
|
|
name: cl,
|
|
inheritAttrs: !1,
|
|
formCreateParser: {
|
|
mergeProp: function(e) {
|
|
var t = e.prop.props;
|
|
t.nodeKey || (t.nodeKey = "id"), t.props || (t.props = {
|
|
label: "title"
|
|
});
|
|
}
|
|
},
|
|
props: {
|
|
type: String,
|
|
modelValue: {
|
|
type: [Array, String, Number],
|
|
default: function() {
|
|
return [];
|
|
}
|
|
}
|
|
},
|
|
emits: ["update:modelValue", "fc.el"],
|
|
watch: {
|
|
modelValue: function() {
|
|
this.setValue();
|
|
}
|
|
},
|
|
methods: {
|
|
updateValue: function() {
|
|
if (!!this.$refs.tree) {
|
|
var e;
|
|
this.type === "selected" ? e = this.$refs.tree.getCurrentKey() : e = this.$refs.tree.getCheckedKeys(), this.$emit("update:modelValue", e);
|
|
}
|
|
},
|
|
setValue: function() {
|
|
if (!!this.$refs.tree) {
|
|
var e = this.type;
|
|
e === "selected" ? this.$refs.tree.setCurrentKey(this.modelValue) : this.$refs.tree.setCheckedKeys(ll(this.modelValue));
|
|
}
|
|
}
|
|
},
|
|
render: function() {
|
|
return H(K("ElTree"), Pe(this.$attrs, {
|
|
ref: "tree",
|
|
onCheck: this.updateValue,
|
|
onNodeClick: this.updateValue
|
|
}), this.$slots);
|
|
},
|
|
mounted: function() {
|
|
this.setValue(), this.$emit("fc.el", this.$refs.tree);
|
|
}
|
|
});
|
|
/*!
|
|
* @form-create/component-elm-upload v3.2.18
|
|
* (c) 2018-2025 xaboy
|
|
* Github https://github.com/xaboy/form-create with upload
|
|
* Released under the MIT License.
|
|
*/
|
|
function Ji(n, e) {
|
|
var t = Object.keys(n);
|
|
if (Object.getOwnPropertySymbols) {
|
|
var r = Object.getOwnPropertySymbols(n);
|
|
e && (r = r.filter(function(i) {
|
|
return Object.getOwnPropertyDescriptor(n, i).enumerable;
|
|
})), t.push.apply(t, r);
|
|
}
|
|
return t;
|
|
}
|
|
function Cr(n) {
|
|
for (var e = 1; e < arguments.length; e++) {
|
|
var t = arguments[e] != null ? arguments[e] : {};
|
|
e % 2 ? Ji(Object(t), !0).forEach(function(r) {
|
|
dl(n, r, t[r]);
|
|
}) : Object.getOwnPropertyDescriptors ? Object.defineProperties(n, Object.getOwnPropertyDescriptors(t)) : Ji(Object(t)).forEach(function(r) {
|
|
Object.defineProperty(n, r, Object.getOwnPropertyDescriptor(t, r));
|
|
});
|
|
}
|
|
return n;
|
|
}
|
|
function Mn(n) {
|
|
return typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? Mn = function(e) {
|
|
return typeof e;
|
|
} : Mn = function(e) {
|
|
return e && typeof Symbol == "function" && e.constructor === Symbol && e !== Symbol.prototype ? "symbol" : typeof e;
|
|
}, Mn(n);
|
|
}
|
|
function dl(n, e, t) {
|
|
return e in n ? Object.defineProperty(n, e, {
|
|
value: t,
|
|
enumerable: !0,
|
|
configurable: !0,
|
|
writable: !0
|
|
}) : n[e] = t, n;
|
|
}
|
|
function Sn(n) {
|
|
return Array.isArray(n) ? n : [null, void 0, ""].indexOf(n) > -1 ? [] : [n];
|
|
}
|
|
function hl(n, e) {
|
|
return Object.keys(n).reduce(function(t, r) {
|
|
return (!e || e.indexOf(r) === -1) && (t[r] = n[r]), t;
|
|
}, {});
|
|
}
|
|
function pl(n, e) {
|
|
e === void 0 && (e = {});
|
|
var t = e.insertAt;
|
|
if (!(!n || typeof document > "u")) {
|
|
var r = document.head || document.getElementsByTagName("head")[0], i = document.createElement("style");
|
|
i.type = "text/css", t === "top" && r.firstChild ? r.insertBefore(i, r.firstChild) : r.appendChild(i), i.styleSheet ? i.styleSheet.cssText = n : i.appendChild(document.createTextNode(n));
|
|
}
|
|
}
|
|
var ml = "._fc-upload{width:100%}._fc-exceed .el-upload{display:none}.el-upload-list.is-disabled .el-upload{cursor:not-allowed!important}";
|
|
pl(ml);
|
|
var Ya = {
|
|
name: "IconUpload"
|
|
}, gl = {
|
|
class: "icon",
|
|
viewBox: "0 0 1024 1024",
|
|
xmlns: "http://www.w3.org/2000/svg"
|
|
}, vl = /* @__PURE__ */ Me("path", {
|
|
fill: "currentColor",
|
|
d: "M160 832h704a32 32 0 110 64H160a32 32 0 110-64zm384-578.304V704h-64V247.296L237.248 490.048 192 444.8 508.8 128l316.8 316.8-45.312 45.248L544 253.696z"
|
|
}, null, -1), yl = [vl];
|
|
function _l(n, e, t, r, i, a) {
|
|
return ee(), me("svg", gl, yl);
|
|
}
|
|
Ya.render = _l;
|
|
function Ki(n, e) {
|
|
return Mn(n) === "object" ? n : {
|
|
url: n,
|
|
is_string: !0,
|
|
name: bl(n),
|
|
uid: e
|
|
};
|
|
}
|
|
function Zi(n) {
|
|
return Cr(Cr({}, n), {}, {
|
|
file: n,
|
|
value: n
|
|
});
|
|
}
|
|
function bl(n) {
|
|
return ("" + n).split("/").pop();
|
|
}
|
|
var wl = "fcUpload", $l = he({
|
|
name: wl,
|
|
inheritAttrs: !1,
|
|
formCreateParser: {
|
|
toFormValue: function(e) {
|
|
return Sn(e);
|
|
},
|
|
toValue: function(e, t) {
|
|
return t.prop.props.limit === 1 ? e[0] || "" : e;
|
|
}
|
|
},
|
|
props: {
|
|
previewMask: void 0,
|
|
onPreview: Function,
|
|
httpRequest: Function,
|
|
modalTitle: String,
|
|
listType: String,
|
|
formCreateInject: Object,
|
|
modelValue: [Array, String, Object]
|
|
},
|
|
emits: ["update:modelValue", "change", "remove", "fc.el"],
|
|
data: function() {
|
|
return {
|
|
previewVisible: !1,
|
|
previewImage: "",
|
|
fileList: []
|
|
};
|
|
},
|
|
created: function() {
|
|
this.fileList = Sn(this.modelValue).map(Ki).map(Zi);
|
|
},
|
|
watch: {
|
|
modelValue: function(e) {
|
|
this.fileList = Sn(e).map(Ki).map(Zi);
|
|
}
|
|
},
|
|
methods: {
|
|
handlePreview: function(e) {
|
|
this.onPreview ? this.onPreview.apply(this, arguments) : this.listType === "text" ? window.open(e.url) : (this.previewImage = e.url, this.previewVisible = !0);
|
|
},
|
|
update: function(e) {
|
|
var t = e.map(function(r) {
|
|
return r.is_string ? r.url : r.value || r.url;
|
|
}).filter(function(r) {
|
|
return r !== void 0;
|
|
});
|
|
this.$emit("update:modelValue", t);
|
|
},
|
|
handleCancel: function() {
|
|
this.previewVisible = !1;
|
|
},
|
|
handleChange: function(e, t) {
|
|
this.$emit.apply(this, ["change"].concat(Array.prototype.slice.call(arguments))), e.status === "success" && this.update(t);
|
|
},
|
|
handleRemove: function(e, t) {
|
|
this.$emit.apply(this, ["remove"].concat(Array.prototype.slice.call(arguments))), this.update(t);
|
|
},
|
|
doHttpRequest: function(e) {
|
|
if (this.httpRequest)
|
|
return this.httpRequest(e);
|
|
e.source = "upload", this.formCreateInject.api.fetch(e);
|
|
}
|
|
},
|
|
render: function() {
|
|
var e, t, r = this, i = Sn(this.modelValue).length;
|
|
return H("div", {
|
|
class: "_fc-upload"
|
|
}, [H(K("ElUpload"), Pe({
|
|
key: i
|
|
}, this.$attrs, {
|
|
listType: this.listType || "picture-card",
|
|
class: {
|
|
"_fc-exceed": this.$attrs.limit ? this.$attrs.limit <= i : !1
|
|
},
|
|
onPreview: this.handlePreview,
|
|
onChange: this.handleChange,
|
|
onRemove: this.handleRemove,
|
|
httpRequest: this.doHttpRequest,
|
|
fileList: this.fileList,
|
|
ref: "upload"
|
|
}), Cr({
|
|
default: function() {
|
|
return [((e = (t = r.$slots).default) === null || e === void 0 ? void 0 : e.call(t)) || (["text", "picture"].indexOf(r.listType) === -1 ? H(K("ElIcon"), null, {
|
|
default: function() {
|
|
return [H(Ya, null, null)];
|
|
}
|
|
}) : H(K("ElButton"), {
|
|
type: "primary"
|
|
}, {
|
|
default: function() {
|
|
return [r.formCreateInject.t("clickToUpload") || "\u70B9\u51FB\u4E0A\u4F20"];
|
|
}
|
|
}))];
|
|
}
|
|
}, hl(this.$slots, ["default"]))), H(K("ElDialog"), {
|
|
appendToBody: !0,
|
|
modal: this.previewMask,
|
|
title: this.modalTitle,
|
|
modelValue: this.previewVisible,
|
|
onClose: this.handleCancel
|
|
}, {
|
|
default: function() {
|
|
return [H("img", {
|
|
style: "width: 100%",
|
|
src: r.previewImage
|
|
}, null)];
|
|
}
|
|
})]);
|
|
},
|
|
mounted: function() {
|
|
this.$emit("fc.el", this.$refs.upload);
|
|
}
|
|
});
|
|
const ot = {
|
|
type(n, e) {
|
|
return Object.prototype.toString.call(n) === "[object " + e + "]";
|
|
},
|
|
Undef(n) {
|
|
return n == null;
|
|
},
|
|
Element(n) {
|
|
return typeof n == "object" && n !== null && n.nodeType === 1 && !ot.Object(n);
|
|
},
|
|
trueArray(n) {
|
|
return Array.isArray(n) && n.length > 0;
|
|
},
|
|
Function(n) {
|
|
const e = this.getType(n);
|
|
return e === "Function" || e === "AsyncFunction";
|
|
},
|
|
getType(n) {
|
|
const e = Object.prototype.toString.call(n);
|
|
return /^\[object (.*)\]$/.exec(e)[1];
|
|
},
|
|
empty(n) {
|
|
return n == null || Array.isArray(n) && Array.isArray(n) && !n.length ? !0 : typeof n == "string" && !n;
|
|
}
|
|
};
|
|
["Date", "Object", "String", "Boolean", "Array", "Number"].forEach((n) => {
|
|
ot[n] = function(e) {
|
|
return ot.type(e, n);
|
|
};
|
|
});
|
|
function Xa(n, e) {
|
|
return {}.hasOwnProperty.call(n, e);
|
|
}
|
|
var Ja = typeof globalThis < "u" ? globalThis : typeof window < "u" ? window : typeof global < "u" ? global : typeof self < "u" ? self : {};
|
|
function Sl(n) {
|
|
return n && n.__esModule && Object.prototype.hasOwnProperty.call(n, "default") ? n.default : n;
|
|
}
|
|
var Ka = { exports: {} };
|
|
(function(n, e) {
|
|
(function(t, r) {
|
|
n.exports = r();
|
|
})(Ja, function() {
|
|
var t = 1e3, r = 6e4, i = 36e5, a = "millisecond", o = "second", s = "minute", u = "hour", c = "day", l = "week", h = "month", m = "quarter", w = "year", $ = "date", S = "Invalid Date", T = /^(\d{4})[-/]?(\d{1,2})?[-/]?(\d{0,2})[Tt\s]*(\d{1,2})?:?(\d{1,2})?:?(\d{1,2})?[.:]?(\d+)?$/, U = /\[([^\]]+)]|Y{1,4}|M{1,4}|D{1,2}|d{1,4}|H{1,2}|h{1,2}|a|A|m{1,2}|s{1,2}|Z{1,2}|SSS/g, z = { name: "en", weekdays: "Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"), months: "January_February_March_April_May_June_July_August_September_October_November_December".split("_"), ordinal: function(k) {
|
|
var b = ["th", "st", "nd", "rd"], y = k % 100;
|
|
return "[" + k + (b[(y - 20) % 10] || b[y] || b[0]) + "]";
|
|
} }, B = function(k, b, y) {
|
|
var d = String(k);
|
|
return !d || d.length >= b ? k : "" + Array(b + 1 - d.length).join(y) + k;
|
|
}, Z = { s: B, z: function(k) {
|
|
var b = -k.utcOffset(), y = Math.abs(b), d = Math.floor(y / 60), f = y % 60;
|
|
return (b <= 0 ? "+" : "-") + B(d, 2, "0") + ":" + B(f, 2, "0");
|
|
}, m: function k(b, y) {
|
|
if (b.date() < y.date())
|
|
return -k(y, b);
|
|
var d = 12 * (y.year() - b.year()) + (y.month() - b.month()), f = b.clone().add(d, h), p = y - f < 0, v = b.clone().add(d + (p ? -1 : 1), h);
|
|
return +(-(d + (y - f) / (p ? f - v : v - f)) || 0);
|
|
}, a: function(k) {
|
|
return k < 0 ? Math.ceil(k) || 0 : Math.floor(k);
|
|
}, p: function(k) {
|
|
return { M: h, y: w, w: l, d: c, D: $, h: u, m: s, s: o, ms: a, Q: m }[k] || String(k || "").toLowerCase().replace(/s$/, "");
|
|
}, u: function(k) {
|
|
return k === void 0;
|
|
} }, Q = "en", q = {};
|
|
q[Q] = z;
|
|
var ce = "$isDayjsObject", re = function(k) {
|
|
return k instanceof Oe || !(!k || !k[ce]);
|
|
}, ae = function k(b, y, d) {
|
|
var f;
|
|
if (!b)
|
|
return Q;
|
|
if (typeof b == "string") {
|
|
var p = b.toLowerCase();
|
|
q[p] && (f = p), y && (q[p] = y, f = p);
|
|
var v = b.split("-");
|
|
if (!f && v.length > 1)
|
|
return k(v[0]);
|
|
} else {
|
|
var g = b.name;
|
|
q[g] = b, f = g;
|
|
}
|
|
return !d && f && (Q = f), f || !d && Q;
|
|
}, J = function(k, b) {
|
|
if (re(k))
|
|
return k.clone();
|
|
var y = typeof b == "object" ? b : {};
|
|
return y.date = k, y.args = arguments, new Oe(y);
|
|
}, G = Z;
|
|
G.l = ae, G.i = re, G.w = function(k, b) {
|
|
return J(k, { locale: b.$L, utc: b.$u, x: b.$x, $offset: b.$offset });
|
|
};
|
|
var Oe = function() {
|
|
function k(y) {
|
|
this.$L = ae(y.locale, null, !0), this.parse(y), this.$x = this.$x || y.x || {}, this[ce] = !0;
|
|
}
|
|
var b = k.prototype;
|
|
return b.parse = function(y) {
|
|
this.$d = function(d) {
|
|
var f = d.date, p = d.utc;
|
|
if (f === null)
|
|
return new Date(NaN);
|
|
if (G.u(f))
|
|
return new Date();
|
|
if (f instanceof Date)
|
|
return new Date(f);
|
|
if (typeof f == "string" && !/Z$/i.test(f)) {
|
|
var v = f.match(T);
|
|
if (v) {
|
|
var g = v[2] - 1 || 0, x = (v[7] || "0").substring(0, 3);
|
|
return p ? new Date(Date.UTC(v[1], g, v[3] || 1, v[4] || 0, v[5] || 0, v[6] || 0, x)) : new Date(v[1], g, v[3] || 1, v[4] || 0, v[5] || 0, v[6] || 0, x);
|
|
}
|
|
}
|
|
return new Date(f);
|
|
}(y), this.init();
|
|
}, b.init = function() {
|
|
var y = this.$d;
|
|
this.$y = y.getFullYear(), this.$M = y.getMonth(), this.$D = y.getDate(), this.$W = y.getDay(), this.$H = y.getHours(), this.$m = y.getMinutes(), this.$s = y.getSeconds(), this.$ms = y.getMilliseconds();
|
|
}, b.$utils = function() {
|
|
return G;
|
|
}, b.isValid = function() {
|
|
return this.$d.toString() !== S;
|
|
}, b.isSame = function(y, d) {
|
|
var f = J(y);
|
|
return this.startOf(d) <= f && f <= this.endOf(d);
|
|
}, b.isAfter = function(y, d) {
|
|
return J(y) < this.startOf(d);
|
|
}, b.isBefore = function(y, d) {
|
|
return this.endOf(d) < J(y);
|
|
}, b.$g = function(y, d, f) {
|
|
return G.u(y) ? this[d] : this.set(f, y);
|
|
}, b.unix = function() {
|
|
return Math.floor(this.valueOf() / 1e3);
|
|
}, b.valueOf = function() {
|
|
return this.$d.getTime();
|
|
}, b.startOf = function(y, d) {
|
|
var f = this, p = !!G.u(d) || d, v = G.p(y), g = function(A, C) {
|
|
var D = G.w(f.$u ? Date.UTC(f.$y, C, A) : new Date(f.$y, C, A), f);
|
|
return p ? D : D.endOf(c);
|
|
}, x = function(A, C) {
|
|
return G.w(f.toDate()[A].apply(f.toDate("s"), (p ? [0, 0, 0, 0] : [23, 59, 59, 999]).slice(C)), f);
|
|
}, M = this.$W, P = this.$M, N = this.$D, I = "set" + (this.$u ? "UTC" : "");
|
|
switch (v) {
|
|
case w:
|
|
return p ? g(1, 0) : g(31, 11);
|
|
case h:
|
|
return p ? g(1, P) : g(0, P + 1);
|
|
case l:
|
|
var V = this.$locale().weekStart || 0, L = (M < V ? M + 7 : M) - V;
|
|
return g(p ? N - L : N + (6 - L), P);
|
|
case c:
|
|
case $:
|
|
return x(I + "Hours", 0);
|
|
case u:
|
|
return x(I + "Minutes", 1);
|
|
case s:
|
|
return x(I + "Seconds", 2);
|
|
case o:
|
|
return x(I + "Milliseconds", 3);
|
|
default:
|
|
return this.clone();
|
|
}
|
|
}, b.endOf = function(y) {
|
|
return this.startOf(y, !1);
|
|
}, b.$set = function(y, d) {
|
|
var f, p = G.p(y), v = "set" + (this.$u ? "UTC" : ""), g = (f = {}, f[c] = v + "Date", f[$] = v + "Date", f[h] = v + "Month", f[w] = v + "FullYear", f[u] = v + "Hours", f[s] = v + "Minutes", f[o] = v + "Seconds", f[a] = v + "Milliseconds", f)[p], x = p === c ? this.$D + (d - this.$W) : d;
|
|
if (p === h || p === w) {
|
|
var M = this.clone().set($, 1);
|
|
M.$d[g](x), M.init(), this.$d = M.set($, Math.min(this.$D, M.daysInMonth())).$d;
|
|
} else
|
|
g && this.$d[g](x);
|
|
return this.init(), this;
|
|
}, b.set = function(y, d) {
|
|
return this.clone().$set(y, d);
|
|
}, b.get = function(y) {
|
|
return this[G.p(y)]();
|
|
}, b.add = function(y, d) {
|
|
var f, p = this;
|
|
y = Number(y);
|
|
var v = G.p(d), g = function(P) {
|
|
var N = J(p);
|
|
return G.w(N.date(N.date() + Math.round(P * y)), p);
|
|
};
|
|
if (v === h)
|
|
return this.set(h, this.$M + y);
|
|
if (v === w)
|
|
return this.set(w, this.$y + y);
|
|
if (v === c)
|
|
return g(1);
|
|
if (v === l)
|
|
return g(7);
|
|
var x = (f = {}, f[s] = r, f[u] = i, f[o] = t, f)[v] || 1, M = this.$d.getTime() + y * x;
|
|
return G.w(M, this);
|
|
}, b.subtract = function(y, d) {
|
|
return this.add(-1 * y, d);
|
|
}, b.format = function(y) {
|
|
var d = this, f = this.$locale();
|
|
if (!this.isValid())
|
|
return f.invalidDate || S;
|
|
var p = y || "YYYY-MM-DDTHH:mm:ssZ", v = G.z(this), g = this.$H, x = this.$m, M = this.$M, P = f.weekdays, N = f.months, I = f.meridiem, V = function(C, D, _, E) {
|
|
return C && (C[D] || C(d, p)) || _[D].slice(0, E);
|
|
}, L = function(C) {
|
|
return G.s(g % 12 || 12, C, "0");
|
|
}, A = I || function(C, D, _) {
|
|
var E = C < 12 ? "AM" : "PM";
|
|
return _ ? E.toLowerCase() : E;
|
|
};
|
|
return p.replace(U, function(C, D) {
|
|
return D || function(_) {
|
|
switch (_) {
|
|
case "YY":
|
|
return String(d.$y).slice(-2);
|
|
case "YYYY":
|
|
return G.s(d.$y, 4, "0");
|
|
case "M":
|
|
return M + 1;
|
|
case "MM":
|
|
return G.s(M + 1, 2, "0");
|
|
case "MMM":
|
|
return V(f.monthsShort, M, N, 3);
|
|
case "MMMM":
|
|
return V(N, M);
|
|
case "D":
|
|
return d.$D;
|
|
case "DD":
|
|
return G.s(d.$D, 2, "0");
|
|
case "d":
|
|
return String(d.$W);
|
|
case "dd":
|
|
return V(f.weekdaysMin, d.$W, P, 2);
|
|
case "ddd":
|
|
return V(f.weekdaysShort, d.$W, P, 3);
|
|
case "dddd":
|
|
return P[d.$W];
|
|
case "H":
|
|
return String(g);
|
|
case "HH":
|
|
return G.s(g, 2, "0");
|
|
case "h":
|
|
return L(1);
|
|
case "hh":
|
|
return L(2);
|
|
case "a":
|
|
return A(g, x, !0);
|
|
case "A":
|
|
return A(g, x, !1);
|
|
case "m":
|
|
return String(x);
|
|
case "mm":
|
|
return G.s(x, 2, "0");
|
|
case "s":
|
|
return String(d.$s);
|
|
case "ss":
|
|
return G.s(d.$s, 2, "0");
|
|
case "SSS":
|
|
return G.s(d.$ms, 3, "0");
|
|
case "Z":
|
|
return v;
|
|
}
|
|
return null;
|
|
}(C) || v.replace(":", "");
|
|
});
|
|
}, b.utcOffset = function() {
|
|
return 15 * -Math.round(this.$d.getTimezoneOffset() / 15);
|
|
}, b.diff = function(y, d, f) {
|
|
var p, v = this, g = G.p(d), x = J(y), M = (x.utcOffset() - this.utcOffset()) * r, P = this - x, N = function() {
|
|
return G.m(v, x);
|
|
};
|
|
switch (g) {
|
|
case w:
|
|
p = N() / 12;
|
|
break;
|
|
case h:
|
|
p = N();
|
|
break;
|
|
case m:
|
|
p = N() / 3;
|
|
break;
|
|
case l:
|
|
p = (P - M) / 6048e5;
|
|
break;
|
|
case c:
|
|
p = (P - M) / 864e5;
|
|
break;
|
|
case u:
|
|
p = P / i;
|
|
break;
|
|
case s:
|
|
p = P / r;
|
|
break;
|
|
case o:
|
|
p = P / t;
|
|
break;
|
|
default:
|
|
p = P;
|
|
}
|
|
return f ? p : G.a(p);
|
|
}, b.daysInMonth = function() {
|
|
return this.endOf(h).$D;
|
|
}, b.$locale = function() {
|
|
return q[this.$L];
|
|
}, b.locale = function(y, d) {
|
|
if (!y)
|
|
return this.$L;
|
|
var f = this.clone(), p = ae(y, d, !0);
|
|
return p && (f.$L = p), f;
|
|
}, b.clone = function() {
|
|
return G.w(this.$d, this);
|
|
}, b.toDate = function() {
|
|
return new Date(this.valueOf());
|
|
}, b.toJSON = function() {
|
|
return this.isValid() ? this.toISOString() : null;
|
|
}, b.toISOString = function() {
|
|
return this.$d.toISOString();
|
|
}, b.toString = function() {
|
|
return this.$d.toUTCString();
|
|
}, k;
|
|
}(), Ye = Oe.prototype;
|
|
return J.prototype = Ye, [["$ms", a], ["$s", o], ["$m", s], ["$H", u], ["$W", c], ["$M", h], ["$y", w], ["$D", $]].forEach(function(k) {
|
|
Ye[k[1]] = function(b) {
|
|
return this.$g(b, k[0], k[1]);
|
|
};
|
|
}), J.extend = function(k, b) {
|
|
return k.$i || (k(b, Oe, J), k.$i = !0), J;
|
|
}, J.locale = ae, J.isDayjs = re, J.unix = function(k) {
|
|
return J(1e3 * k);
|
|
}, J.en = q[Q], J.Ls = q, J.p = {}, J;
|
|
});
|
|
})(Ka);
|
|
const Ol = Ka.exports, Nt = {
|
|
Add: (n, e) => {
|
|
let t, r, i;
|
|
try {
|
|
t = n.toString().split(".")[1].length;
|
|
} catch {
|
|
t = 0;
|
|
}
|
|
try {
|
|
r = e.toString().split(".")[1].length;
|
|
} catch {
|
|
r = 0;
|
|
}
|
|
return i = Math.pow(10, Math.max(t, r)), (n * i + e * i) / i;
|
|
},
|
|
Sub: (n, e) => {
|
|
let t, r, i;
|
|
try {
|
|
t = n.toString().split(".")[1].length;
|
|
} catch {
|
|
t = 0;
|
|
}
|
|
try {
|
|
r = e.toString().split(".")[1].length;
|
|
} catch {
|
|
r = 0;
|
|
}
|
|
i = Math.pow(10, Math.max(t, r));
|
|
let a = t >= r ? t : r;
|
|
return Number(((n * i - e * i) / i).toFixed(a));
|
|
},
|
|
Mul: (n, e) => {
|
|
let t = 0, r = n.toString(), i = e.toString();
|
|
try {
|
|
t += r.split(".")[1].length;
|
|
} catch {
|
|
}
|
|
try {
|
|
t += i.split(".")[1].length;
|
|
} catch {
|
|
}
|
|
return Number(r.replace(".", "")) * Number(i.replace(".", "")) / Math.pow(10, t);
|
|
},
|
|
Div: (n, e) => {
|
|
let t = 0, r = 0;
|
|
try {
|
|
t = n.toString().split(".")[1].length;
|
|
} catch {
|
|
}
|
|
try {
|
|
r = e.toString().split(".")[1].length;
|
|
} catch {
|
|
}
|
|
let i = Number(n.toString().replace(".", "")), a = Number(e.toString().replace(".", ""));
|
|
return i / a * Math.pow(10, r - t);
|
|
}
|
|
}, El = "YYYY-MM-DD HH:mm:ss", Et = (n, e) => n == null ? e : n, Ie = {
|
|
ADD: function(n, e) {
|
|
return Nt.Add(Et(n, "0"), Et(e, "0"));
|
|
},
|
|
SUB: function(n, e) {
|
|
return Nt.Sub(Et(n, "0"), Et(e, "0"));
|
|
},
|
|
MUL: function(n, e) {
|
|
return Nt.Mul(Et(n, "0"), Et(e, "0"));
|
|
},
|
|
DIV: function(n, e) {
|
|
return Nt.Div(Et(n, "0"), Et(e, "0"));
|
|
},
|
|
SUM: function(...n) {
|
|
return (n || []).reduce((e, t) => Nt.Add(e, Array.isArray(t) ? Ie.SUM(...t) : t || 0), 0);
|
|
},
|
|
MAX: function(...n) {
|
|
const e = Array.isArray(n[0]) ? n[0] : n;
|
|
return Math.max(...e.map((t) => parseFloat(t)).filter((t) => !isNaN(t)));
|
|
},
|
|
MIN: function(...n) {
|
|
const e = Array.isArray(n[0]) ? n[0] : n;
|
|
return Math.min(...e.map((t) => parseFloat(t)).filter((t) => !isNaN(t)));
|
|
},
|
|
ABS: function(n) {
|
|
return parseFloat(Math.abs(n)) || 0;
|
|
},
|
|
AVG: function(...n) {
|
|
const e = Array.isArray(n[0]) ? n[0] : n;
|
|
return e.length ? Nt.Div(Ie.SUM(e), e.length) : 0;
|
|
},
|
|
POWER: function(n, e) {
|
|
return Math.pow(parseFloat(n), parseFloat(e));
|
|
},
|
|
RAND: function() {
|
|
return Math.random();
|
|
},
|
|
CEIL: function(n) {
|
|
return Math.ceil(parseFloat(n)) || 0;
|
|
},
|
|
FLOOR: function(n) {
|
|
return Math.floor(parseFloat(n) || 0);
|
|
},
|
|
FIXED: function(n, e) {
|
|
const t = Math.pow(10, e || 0);
|
|
return (Math.floor(parseFloat(n) * t) / t).toFixed(e || 0);
|
|
},
|
|
ISNUMBER: function(n) {
|
|
return n === "" || n === null ? !1 : !isNaN(Number(n));
|
|
},
|
|
PI: function() {
|
|
return Number(Math.PI);
|
|
},
|
|
ROUND: function(n, e) {
|
|
return n = parseFloat(n), isNaN(n) ? 0 : parseFloat(n.toFixed(parseFloat(e) || 0));
|
|
},
|
|
SQRT: function(n) {
|
|
return Math.sqrt(parseFloat(n)) || 0;
|
|
},
|
|
TONUMBER: function(n) {
|
|
return parseFloat(n) || 0;
|
|
},
|
|
MODIFYDATE: function(n, e, t, r) {
|
|
if (!n)
|
|
return null;
|
|
let i = Ol(n);
|
|
return e > 0 ? i = i.add(e, t) : e < 0 && (i = i.subtract(-1 * e, t)), i.format(r || El);
|
|
},
|
|
ADDYEAR: function(n, e, t) {
|
|
return Ie.MODIFYDATE(n, Math.max(e, 0), "y", t);
|
|
},
|
|
ADDMONTH: function(n, e, t) {
|
|
return Ie.MODIFYDATE(n, Math.max(e, 0), "M", t);
|
|
},
|
|
ADDDAY: function(n, e, t) {
|
|
return Ie.MODIFYDATE(n, Math.max(e, 0), "d", t);
|
|
},
|
|
ADDHOUR: function(n, e, t) {
|
|
return Ie.MODIFYDATE(n, Math.max(e, 0), "h", t);
|
|
},
|
|
ADDMINUTE: function(n, e, t) {
|
|
return Ie.MODIFYDATE(n, Math.max(e, 0), "m", t);
|
|
},
|
|
ADDSECOND: function(n, e, t) {
|
|
return Ie.MODIFYDATE(n, Math.max(e, 0), "s", t);
|
|
},
|
|
ADDWEEK: function(n, e, t) {
|
|
return Ie.MODIFYDATE(n, Math.max(e, 0), "w", t);
|
|
},
|
|
SUBYEAR: function(n, e, t) {
|
|
return e = Math.max(e, 0), Ie.MODIFYDATE(n, e > 0 ? -1 * e : 0, "y", t);
|
|
},
|
|
SUBMONTH: function(n, e, t) {
|
|
return e = Math.max(e, 0), Ie.MODIFYDATE(n, e > 0 ? -1 * e : 0, "M", t);
|
|
},
|
|
SUBDAY: function(n, e, t) {
|
|
return e = Math.max(e, 0), Ie.MODIFYDATE(n, e > 0 ? -1 * e : 0, "d", t);
|
|
},
|
|
SUBHOUR: function(n, e, t) {
|
|
return e = Math.max(e, 0), Ie.MODIFYDATE(n, e > 0 ? -1 * e : 0, "h", t);
|
|
},
|
|
SUBMINUTE: function(n, e, t) {
|
|
return e = Math.max(e, 0), Ie.MODIFYDATE(n, e > 0 ? -1 * e : 0, "m", t);
|
|
},
|
|
SUBSECOND: function(n, e, t) {
|
|
return e = Math.max(e, 0), Ie.MODIFYDATE(n, e > 0 ? -1 * e : 0, "s", t);
|
|
},
|
|
SUBWEEK: function(n, e, t) {
|
|
return e = Math.max(e, 0), Ie.MODIFYDATE(n, e > 0 ? -1 * e : 0, "w", t);
|
|
},
|
|
NOW: function() {
|
|
const n = new Date(), e = n.getFullYear(), t = ("0" + (n.getMonth() + 1)).slice(-2), r = ("0" + n.getDate()).slice(-2), i = ("0" + n.getHours()).slice(-2), a = ("0" + n.getMinutes()).slice(-2), o = ("0" + n.getSeconds()).slice(-2);
|
|
return e + "-" + t + "-" + r + " " + i + ":" + a + ":" + o;
|
|
},
|
|
TODAY: function() {
|
|
const n = new Date(), e = n.getFullYear(), t = ("0" + (n.getMonth() + 1)).slice(-2), r = ("0" + n.getDate()).slice(-2);
|
|
return e + "-" + t + "-" + r;
|
|
},
|
|
YEAR: function(n) {
|
|
return n ? new Date(n).getFullYear() : null;
|
|
},
|
|
MONTH: function(n) {
|
|
return n ? new Date(n).getMonth() + 1 : null;
|
|
},
|
|
DAY: function(n) {
|
|
return n ? new Date(n).getDate() : null;
|
|
},
|
|
HOUR: function(n) {
|
|
return n ? new Date(n).getHours() : null;
|
|
},
|
|
MINUTE: function(n) {
|
|
return n ? new Date(n).getMinutes() : null;
|
|
},
|
|
SECOND: function(n) {
|
|
return n ? new Date(n).getSeconds() : null;
|
|
},
|
|
DIFFDAYS: function(n, e) {
|
|
const t = new Date(n), r = new Date(e);
|
|
return parseInt(Math.ceil(Math.abs(r.getTime() - t.getTime()) / (1e3 * 60 * 60 * 24)));
|
|
},
|
|
DIFFHOURS: function(n, e) {
|
|
const t = new Date(n), r = new Date(e);
|
|
return parseFloat(Math.abs(r.getTime() - t.getTime()) / (1e3 * 60 * 60)).toFixed(2);
|
|
},
|
|
DIFFMINUTES: function(n, e) {
|
|
const t = new Date(n), r = new Date(e);
|
|
return parseInt(Math.ceil(Math.abs(r.getTime() - t.getTime()) / (1e3 * 60)));
|
|
},
|
|
TIMESTAMP: function(n) {
|
|
return Date.parse(n);
|
|
},
|
|
STARTSWITH: function(n, e) {
|
|
return ("" + n).substring(0, ("" + e).length) === e;
|
|
},
|
|
EMPTY: function(n) {
|
|
return ot.empty(n);
|
|
},
|
|
NOTEMPTY: function(n) {
|
|
return !ot.empty(n);
|
|
},
|
|
LEN: function(n) {
|
|
return Array.isArray(n) ? n.length : 0;
|
|
},
|
|
MOD: function(n, e) {
|
|
return n = parseFloat(n), e = parseFloat(e), !n || !e || isNaN(n) || isNaN(e) ? 0 : n % e;
|
|
},
|
|
SLICELEFT: function(n, e) {
|
|
return ("" + n).slice(0, Number(e) || 0);
|
|
},
|
|
SLICERIGHT: function(n, e) {
|
|
return ("" + n).slice(Number(e) * -1);
|
|
},
|
|
TOLOWER: function(n) {
|
|
return ("" + n).toLowerCase();
|
|
},
|
|
TOUPPER: function(n) {
|
|
return ("" + n).toUpperCase();
|
|
},
|
|
INCLUDES: function(n, e) {
|
|
return (n || "").indexOf(e || "");
|
|
},
|
|
REPLACE: function(n, e, t) {
|
|
return (n || "").replace(e || "", t || "");
|
|
},
|
|
REPLACEALL: function(n, e, t) {
|
|
return (n || "").replaceAll(e || "", t || "");
|
|
},
|
|
TRIM: function(n) {
|
|
return (n || "").trim();
|
|
},
|
|
TOCHINSESAMOUNT: function(n) {
|
|
let e = ["\u96F6", "\u58F9", "\u8D30", "\u53C1", "\u8086", "\u4F0D", "\u9646", "\u67D2", "\u634C", "\u7396"], t = ["", "\u4E07", "\u4EBF", "\u4E07\u4EBF", "\u4EBF\u4EBF"], r = ["", "\u62FE", "\u4F70", "\u4EDF"], i = ["\u89D2", "\u5206"];
|
|
function a(m) {
|
|
let w = "", $ = "", S = 0, T = !0;
|
|
for (; m > 0; ) {
|
|
let U = m % 10;
|
|
U === 0 ? T || (T = !0, $ = e[U] + $) : (T = !1, w = e[U], w += r[S], $ = w + $), S++, m = Math.floor(m / 10);
|
|
}
|
|
return $;
|
|
}
|
|
let o = 0, s = "", u = "", c = !1;
|
|
if (n === 0)
|
|
return e[0];
|
|
let l = Math.floor(n), h = Math.round((n - l) * 100);
|
|
for (; l > 0; ) {
|
|
let m = l % 1e4;
|
|
c && (u = e[0] + u), s = a(m), s += m !== 0 ? t[o] : t[0], u = s + u, c = m < 1e3 && m > 0, l = Math.floor(l / 1e4), o++;
|
|
}
|
|
return u && (u += "\u5143"), h > 0 ? (u += e[Math.floor(h / 10)] + i[0], h % 10 !== 0 && (u += e[h % 10] + i[1])) : u && (u += "\u6574"), u;
|
|
},
|
|
UNION: function(...n) {
|
|
return (Array.isArray(n[0]) ? n[0] : n).filter((t, r, i) => i.indexOf(t) === r);
|
|
},
|
|
AND: function(...n) {
|
|
return !!n.reduce((e, t) => e && t, !0);
|
|
},
|
|
OR: function(...n) {
|
|
return !!n.reduce((e, t) => e || t, !1);
|
|
},
|
|
IF: function(n, e = !0, t = !1) {
|
|
return n ? e : t;
|
|
},
|
|
DEFAULT: function(n, e) {
|
|
return ot.Undef(n) ? e : n;
|
|
},
|
|
CASE: function(...n) {
|
|
for (let e = 0; e < n.length - 1; e += 2)
|
|
if (n[e])
|
|
return n[e + 1];
|
|
return null;
|
|
},
|
|
COLUMN: function(n, e) {
|
|
const t = [];
|
|
return Array.isArray(n) && n.forEach(function(r) {
|
|
Array.isArray(r) ? t.push(...Ie.COLUMN(r, e)) : r && t.push(r[e]);
|
|
}), t;
|
|
},
|
|
VALUE: function(n, e, t) {
|
|
const r = ("" + e).split(".");
|
|
let i = n;
|
|
for (let a = 0; a < r.length; a++)
|
|
if (Xa(i, r[a]))
|
|
i = i[r[a]];
|
|
else
|
|
return t;
|
|
return i;
|
|
},
|
|
CONCAT: function(...n) {
|
|
return "".concat(...n);
|
|
},
|
|
INTERSECTIONSET: function(n, e) {
|
|
const t = [];
|
|
for (let r = 0; r < n.length; r++) {
|
|
const i = n[r];
|
|
e.indexOf(i) !== -1 && t.indexOf(i) === -1 && t.push(i);
|
|
}
|
|
return t;
|
|
},
|
|
LIST: function(...n) {
|
|
return n;
|
|
},
|
|
IN: function(n, e) {
|
|
return (n || []).indexOf(e) > -1;
|
|
},
|
|
FALSE: function() {
|
|
return !1;
|
|
},
|
|
TRUE: function() {
|
|
return !0;
|
|
},
|
|
NOT: function(n) {
|
|
return !n;
|
|
},
|
|
EQ: function(n, e) {
|
|
return n === e;
|
|
},
|
|
GE: function(n, e) {
|
|
return n >= e;
|
|
},
|
|
GT: function(n, e) {
|
|
return n > e;
|
|
},
|
|
LE: function(n, e) {
|
|
return n <= e;
|
|
},
|
|
LT: function(n, e) {
|
|
return n < e;
|
|
},
|
|
NE: function(n, e) {
|
|
return n !== e;
|
|
}
|
|
};
|
|
const Ae = (n, e) => {
|
|
const t = n.__vccOpts || n;
|
|
for (const [r, i] of e)
|
|
t[r] = i;
|
|
return t;
|
|
}, Za = (n) => {
|
|
const e = [];
|
|
return n.forEach((t) => {
|
|
t.field && e.push(t.field), t.children && e.push(...Za(t.children));
|
|
}), e;
|
|
}, xl = he({
|
|
name: "StepForm",
|
|
props: {
|
|
stepsProps: Object,
|
|
modelValue: Object,
|
|
formCreateInject: Object,
|
|
autoValidate: Boolean,
|
|
submitBtn: Boolean,
|
|
steps: {
|
|
type: Array,
|
|
required: !0,
|
|
default: () => []
|
|
},
|
|
options: {
|
|
type: Object,
|
|
default: () => Be({
|
|
submitBtn: !1,
|
|
resetBtn: !1
|
|
})
|
|
}
|
|
},
|
|
emits: ["update:modelValue", "change", "itemMounted", "submit", "next"],
|
|
data() {
|
|
return {
|
|
active: 0,
|
|
cacheRule: [],
|
|
cacheValue: {},
|
|
subApi: {},
|
|
Form: Te(this.formCreateInject.form.$form())
|
|
};
|
|
},
|
|
watch: {
|
|
active() {
|
|
this.init();
|
|
},
|
|
modelValue(n) {
|
|
this.setValue(n);
|
|
}
|
|
},
|
|
methods: {
|
|
init() {
|
|
this.steps.forEach((n, e) => {
|
|
this.cacheRule[e] ? this.cacheRule[e].display = e === this.active : this.cacheRule[e] = {
|
|
type: "FcRow",
|
|
native: !0,
|
|
display: e === this.active,
|
|
children: n.rule
|
|
};
|
|
});
|
|
},
|
|
onPrev() {
|
|
this.active--;
|
|
},
|
|
validate() {
|
|
return new Promise((n, e) => {
|
|
const t = Za(this.cacheRule[this.active].children);
|
|
t.length > 0 ? Promise.all(t.map((r) => this.subApi.validateField(r))).then(() => {
|
|
n();
|
|
}).catch((r) => {
|
|
e(r);
|
|
}) : n();
|
|
});
|
|
},
|
|
onNext() {
|
|
this.autoValidate ? this.validate().then(() => {
|
|
this.active++;
|
|
}).catch((n) => {
|
|
}) : this.active++, this.$emit("next", { active: this.active, api: this.subApi });
|
|
},
|
|
submit() {
|
|
const n = () => {
|
|
this.$emit("submit", this.subApi.formData(), this.subApi);
|
|
};
|
|
this.autoValidate ? this.validate().then(() => {
|
|
n();
|
|
}).catch((e) => {
|
|
}) : n();
|
|
},
|
|
addSubApi(n) {
|
|
this.subApi = n, this.$emit("itemMounted", n);
|
|
},
|
|
formData(n) {
|
|
this.cacheValue = JSON.stringify(n), this.$emit("update:modelValue", n), this.$emit("change", n);
|
|
},
|
|
setValue(n) {
|
|
const e = JSON.stringify(n);
|
|
this.cacheValue !== e && (this.cacheValue = e, this.subApi.coverValue(n || {}));
|
|
}
|
|
},
|
|
created() {
|
|
this.init();
|
|
}
|
|
}), Cl = { class: "_fc-step-form" };
|
|
function kl(n, e, t, r, i, a) {
|
|
const o = K("van-step"), s = K("van-steps"), u = K("van-button"), c = K("van-col"), l = K("van-row");
|
|
return ee(), me("div", Cl, [
|
|
H(s, Pe({ active: n.active }, n.stepsProps), {
|
|
default: Ce(() => [
|
|
(ee(!0), me(Ke, null, un(n.steps, (h) => (ee(), Re(o, Pe({ ref_for: !0 }, h.props), {
|
|
default: Ce(() => [
|
|
He(Ve(h.props.title), 1)
|
|
]),
|
|
_: 2
|
|
}, 1040))), 256))
|
|
]),
|
|
_: 1
|
|
}, 16, ["active"]),
|
|
(ee(), Re(Ft(n.Form), {
|
|
option: n.options,
|
|
rule: n.cacheRule,
|
|
extendOption: !0,
|
|
modelValue: n.modelValue,
|
|
"onUpdate:api": n.addSubApi,
|
|
onEmitEvent: n.$emit,
|
|
"onUpdate:modelValue": n.formData
|
|
}, null, 40, ["option", "rule", "modelValue", "onUpdate:api", "onEmitEvent", "onUpdate:modelValue"])),
|
|
H(l, null, {
|
|
default: Ce(() => [
|
|
H(c, {
|
|
span: 24,
|
|
style: { "margin-top": "15px" }
|
|
}, {
|
|
default: Ce(() => [
|
|
n.active > 0 ? (ee(), Re(u, {
|
|
key: 0,
|
|
block: "",
|
|
size: "small",
|
|
onClick: n.onPrev
|
|
}, {
|
|
default: Ce(() => [
|
|
He(Ve(n.formCreateInject.t("prevStep") || "\u4E0A\u4E00\u6B65"), 1)
|
|
]),
|
|
_: 1
|
|
}, 8, ["onClick"])) : dt("", !0),
|
|
n.active < n.cacheRule.length - 1 ? (ee(), Re(u, {
|
|
key: 1,
|
|
block: "",
|
|
size: "small",
|
|
type: "primary",
|
|
onClick: n.onNext
|
|
}, {
|
|
default: Ce(() => [
|
|
He(Ve(n.formCreateInject.t("nextStep") || "\u4E0B\u4E00\u6B65"), 1)
|
|
]),
|
|
_: 1
|
|
}, 8, ["onClick"])) : dt("", !0),
|
|
n.submitBtn !== !1 && n.active === n.cacheRule.length - 1 ? (ee(), Re(u, {
|
|
key: 2,
|
|
block: "",
|
|
size: "small",
|
|
class: "fc-clock",
|
|
type: "primary",
|
|
onClick: n.submit,
|
|
style: { "margin-top": "10px" }
|
|
}, {
|
|
default: Ce(() => [
|
|
He(Ve(n.formCreateInject.t("submit") || "\u63D0\u4EA4"), 1)
|
|
]),
|
|
_: 1
|
|
}, 8, ["onClick"])) : dt("", !0)
|
|
]),
|
|
_: 1
|
|
})
|
|
]),
|
|
_: 1
|
|
})
|
|
]);
|
|
}
|
|
const Al = /* @__PURE__ */ Ae(xl, [["render", kl]]);
|
|
function Gt(n, e, t) {
|
|
n[e] = t;
|
|
}
|
|
function Qa(n, e = {}, t) {
|
|
let r = !1;
|
|
for (let i in e)
|
|
if (Object.prototype.hasOwnProperty.call(e, i)) {
|
|
let a = e[i];
|
|
if ((r = Array.isArray(a)) || ot.Object(a)) {
|
|
let o = n[i] === void 0;
|
|
if (r)
|
|
r = !1, o && Gt(n, i, []);
|
|
else if (a._clone && t !== void 0)
|
|
if (t)
|
|
a = a.getRule(), o && Gt(n, i, {});
|
|
else {
|
|
Gt(n, i, a._clone());
|
|
continue;
|
|
}
|
|
else
|
|
o && Gt(n, i, {});
|
|
n[i] = Qa(n[i], a, t);
|
|
} else
|
|
Gt(n, i, a), ot.Undef(a) || (ot.Undef(a.__json) || (n[i].__json = a.__json), ot.Undef(a.__origin) || (n[i].__origin = a.__origin));
|
|
}
|
|
return t !== void 0 && Array.isArray(n) ? n.filter((i) => !i || !i.__ctrl) : n;
|
|
}
|
|
function vt(n) {
|
|
return Qa({}, { value: n }).value;
|
|
}
|
|
const Dl = he({
|
|
name: "FcPopup",
|
|
emits: ["confirm", "submit", "validateFail", "update:modelValue"],
|
|
props: {
|
|
formData: Object,
|
|
options: {
|
|
type: Object,
|
|
default: () => Be({
|
|
submitBtn: !1,
|
|
resetBtn: !1
|
|
})
|
|
},
|
|
rule: Array,
|
|
autoClose: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
footer: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
preview: Boolean,
|
|
modelValue: Object,
|
|
formCreateInject: Object,
|
|
title: String
|
|
},
|
|
computed: {
|
|
formOptions() {
|
|
const n = { ...this.options };
|
|
return this.preview && (n.preview = this.preview), n;
|
|
}
|
|
},
|
|
data() {
|
|
return {
|
|
visible: !1,
|
|
fapi: {},
|
|
value: {},
|
|
formRule: [],
|
|
Form: Te(this.formCreateInject.form.$form())
|
|
};
|
|
},
|
|
methods: {
|
|
formChange() {
|
|
this.$emit("update:modelValue", this.fapi.formData());
|
|
},
|
|
open(n) {
|
|
this.$nextTick(() => {
|
|
this.visible = !0, this.value = vt(n || this.modelValue || this.formData || {}), this.formRule = vt(this.rule || []);
|
|
});
|
|
},
|
|
close() {
|
|
this.visible = !1;
|
|
},
|
|
handleConfirm() {
|
|
this.$emit("confirm", this.fapi), this.fapi.submit().then((n) => {
|
|
this.$emit("submit", n, this.fapi, this.close), this.autoClose && this.close();
|
|
}).catch((n) => {
|
|
this.$emit("validateFail", n, this.fapi);
|
|
});
|
|
}
|
|
},
|
|
mounted() {
|
|
this.formCreateInject.api.top.bus.$on("fc.closeDialog", this.close), Oa(() => {
|
|
this.formCreateInject.api.top.bus.$off("fc.closeDialog", this.close);
|
|
});
|
|
}
|
|
}), Rl = { class: "_fc-popup-title" }, Pl = { class: "_fc-popup-content" }, Ml = { class: "_fc-popup-footer" };
|
|
function Tl(n, e, t, r, i, a) {
|
|
const o = K("van-button"), s = K("van-popup");
|
|
return ee(), Re(s, Pe({
|
|
class: "_fc-popup",
|
|
closeable: ""
|
|
}, n.$attrs, {
|
|
show: n.visible,
|
|
"onUpdate:show": e[1] || (e[1] = (u) => n.visible = u)
|
|
}), {
|
|
default: Ce(() => [
|
|
Me("div", Rl, Ve(n.title), 1),
|
|
Me("div", Pl, [
|
|
(ee(), Re(Ft(n.Form), {
|
|
option: n.formOptions,
|
|
rule: n.formRule,
|
|
extendOption: !0,
|
|
api: n.fapi,
|
|
"onUpdate:api": e[0] || (e[0] = (u) => n.fapi = u),
|
|
"model-value": n.value,
|
|
subForm: !1,
|
|
onChange: n.formChange,
|
|
onEmitEvent: n.$emit
|
|
}, null, 40, ["option", "rule", "api", "model-value", "onChange", "onEmitEvent"]))
|
|
]),
|
|
Me("div", Ml, [
|
|
n.footer !== !1 ? (ee(), me(Ke, { key: 0 }, [
|
|
H(o, {
|
|
block: "",
|
|
size: "small",
|
|
type: "primary",
|
|
class: "fc-clock",
|
|
onClick: n.handleConfirm
|
|
}, {
|
|
default: Ce(() => [
|
|
He(Ve(n.formCreateInject.t("ok") || "\u786E\u5B9A"), 1)
|
|
]),
|
|
_: 1
|
|
}, 8, ["onClick"]),
|
|
H(o, {
|
|
block: "",
|
|
size: "small",
|
|
class: "fc-clock",
|
|
style: { "margin-top": "10px" },
|
|
onClick: n.close
|
|
}, {
|
|
default: Ce(() => [
|
|
He(Ve(n.formCreateInject.t("close") || "\u5173\u95ED"), 1)
|
|
]),
|
|
_: 1
|
|
}, 8, ["onClick"])
|
|
], 64)) : dt("", !0)
|
|
])
|
|
]),
|
|
_: 1
|
|
}, 16, ["show"]);
|
|
}
|
|
const jl = /* @__PURE__ */ Ae(Dl, [["render", Tl]]);
|
|
function Fl(n, e, t) {
|
|
return `[form-create ${n}]: ${e}` + (t ? `
|
|
|
|
rule: ` + JSON.stringify(t.getRule ? t.getRule() : t) : "");
|
|
}
|
|
function Il(n, e) {
|
|
console.error(Fl("err", n, e));
|
|
}
|
|
const Qi = "[[FORM-CREATE-PREFIX-", ea = "-FORM-CREATE-SUFFIX]]";
|
|
function lr(n) {
|
|
return new Function("return " + n)();
|
|
}
|
|
function Bn(n, e) {
|
|
if (n && ot.String(n) && n.length > 4) {
|
|
let t = n.trim(), r = !1;
|
|
try {
|
|
if (t.indexOf(ea) > 0 && t.indexOf(Qi) === 0)
|
|
t = t.replace(ea, "").replace(Qi, ""), r = !0;
|
|
else if (t.indexOf("$FN:") === 0)
|
|
t = t.substring(4), r = !0;
|
|
else if (t.indexOf("$EXEC:") === 0)
|
|
t = t.substring(6), r = !0;
|
|
else if (t.indexOf("$GLOBAL:") === 0) {
|
|
const a = t.substring(8);
|
|
return t = function(...o) {
|
|
const s = o[0].api.getGlobalEvent(a);
|
|
if (s)
|
|
return s.call(this, ...o);
|
|
}, t.__json = n, t.__inject = !0, t;
|
|
} else {
|
|
if (t.indexOf("$FNX:") === 0)
|
|
return t = lr("function($inject){" + t.substring(5) + "}"), t.__json = n, t.__inject = !0, t;
|
|
(!e && t.indexOf("function ") === 0 && t !== "function " || !e && t.indexOf("function(") === 0 && t !== "function(") && (r = !0);
|
|
}
|
|
if (!r)
|
|
return n;
|
|
let i;
|
|
try {
|
|
i = lr(t);
|
|
} catch {
|
|
i = lr("function " + t);
|
|
}
|
|
return i.__json = n, i;
|
|
} catch (i) {
|
|
Il(`\u89E3\u6790\u5931\u8D25:${t}
|
|
|
|
err: ${i}`);
|
|
return;
|
|
}
|
|
}
|
|
return n;
|
|
}
|
|
const Vl = he({
|
|
name: "DataTable",
|
|
emits: ["sortChange", "handleClick"],
|
|
props: {
|
|
column: {
|
|
type: Array,
|
|
default: () => []
|
|
},
|
|
globalDataKey: [String, Object],
|
|
fetch: Object,
|
|
data: {
|
|
type: Array,
|
|
default: () => []
|
|
},
|
|
button: Object,
|
|
index: Boolean,
|
|
selection: Boolean,
|
|
page: Object,
|
|
formCreateInject: Object
|
|
},
|
|
data() {
|
|
return {
|
|
total: 0,
|
|
loading: !1,
|
|
unwatch: null,
|
|
list: [],
|
|
currentPage: 1,
|
|
id: 1,
|
|
order: "",
|
|
orderBy: ""
|
|
};
|
|
},
|
|
watch: {
|
|
globalDataKey() {
|
|
this.initPage();
|
|
},
|
|
fetch() {
|
|
this.globalDataKey || this.initPage();
|
|
},
|
|
data() {
|
|
!this.globalDataKey && !this.fetch && this.initPage();
|
|
},
|
|
selection() {
|
|
this.id++;
|
|
},
|
|
index() {
|
|
this.id++;
|
|
},
|
|
page: {
|
|
handler() {
|
|
this.initPage(), this.id++;
|
|
},
|
|
deep: !0
|
|
},
|
|
button: {
|
|
handler() {
|
|
this.id++;
|
|
},
|
|
deep: !0
|
|
}
|
|
},
|
|
computed: {
|
|
filterList() {
|
|
let n = this.list || [];
|
|
const e = [];
|
|
return this.column.forEach((t) => {
|
|
t.prop && Array.isArray(t.filter) && t.filter.length > 0 && e.push((r) => t.filter.indexOf(r[t.prop]) > -1);
|
|
}), e.forEach((t) => {
|
|
n = n.filter(t);
|
|
}), n;
|
|
}
|
|
},
|
|
render() {
|
|
return $a(qe("div", {
|
|
class: "_fc-data-table"
|
|
}, [
|
|
qe(K("el-table"), {
|
|
data: this.filterList,
|
|
...this.$attrs,
|
|
key: this.id,
|
|
ref: "table",
|
|
onSortChange: (n) => {
|
|
this.$emit("sortChange", n), n.order ? (this.orderBy = n.order === "descending" ? "DESC" : "ASC", this.order = n.prop) : (this.orderBy = "", this.order = ""), this.initPage();
|
|
}
|
|
}, () => {
|
|
const n = this.column.filter((t) => t.hidden !== !0).map((t) => this.makeColumn(t));
|
|
this.selection && n.unshift(qe(K("el-table-column"), {
|
|
type: "selection",
|
|
width: "50px"
|
|
}));
|
|
const e = this.makeButtonCol();
|
|
return e && n.push(e), this.index && n.unshift(qe(K("el-table-column"), {
|
|
type: "index",
|
|
width: "50px"
|
|
})), n;
|
|
}),
|
|
this.makePage()
|
|
]), [
|
|
[Sa("loading"), this.loading]
|
|
]);
|
|
},
|
|
methods: {
|
|
getEl() {
|
|
return this.$refs.table;
|
|
},
|
|
deepGet(n, e, t) {
|
|
e = (e || "").split(".");
|
|
let r = 0, i = e.length;
|
|
for (; n != null && r < i; )
|
|
n = n[e[r++]];
|
|
return r && r === i && n != null ? n : t;
|
|
},
|
|
initPage() {
|
|
this.loading = !1, this.page && this.page.open ? (this.currentPage = 1, this.nextList()) : this.globalDataKey || this.fetch ? this.fetchData().then(({ list: n }) => {
|
|
this.list = n;
|
|
}) : this.list = this.data;
|
|
},
|
|
btnProps(n, e) {
|
|
const t = n.prop || [], r = {
|
|
type: n.type,
|
|
size: n.size,
|
|
round: t.indexOf("round") > -1,
|
|
link: t.indexOf("link") > -1,
|
|
plain: t.indexOf("plain") > -1,
|
|
disabled: t.indexOf("disabled") > -1,
|
|
onClick: (a) => {
|
|
a.stopPropagation();
|
|
const o = Bn(n.click);
|
|
try {
|
|
o && o(e, this.formCreateInject.api);
|
|
} catch (s) {
|
|
console.error(s);
|
|
}
|
|
this.$emit("handleClick", { name: n.name, key: n.key, scope: e, column: e.row });
|
|
}
|
|
}, i = Bn(n.handle);
|
|
try {
|
|
const a = i && i(r, e, this.formCreateInject.api);
|
|
typeof a == "boolean" && (r.disabled = a);
|
|
} catch (a) {
|
|
console.error(a);
|
|
}
|
|
return r;
|
|
},
|
|
getLimit() {
|
|
return this.page.props && this.page.props.pageSize || 20;
|
|
},
|
|
nextList() {
|
|
if (this.globalDataKey || this.fetch)
|
|
this.fetchData(!0).then(({ list: n, total: e }) => {
|
|
this.list = n, this.total = e;
|
|
});
|
|
else {
|
|
const n = this.data, e = this.getLimit(), t = this.currentPage * e;
|
|
this.list = n.slice(t - e, t), this.total = n.length;
|
|
}
|
|
},
|
|
fetchData(n) {
|
|
return this.unwatch && this.unwatch(), new Promise((e) => {
|
|
let t = this.fetch;
|
|
if (this.globalDataKey) {
|
|
const r = typeof this.globalDataKey == "string" ? this.globalDataKey : this.globalDataKey.key;
|
|
t = this.formCreateInject.api.options.globalData[r];
|
|
}
|
|
if (t)
|
|
if (t.type === "fetch" || !this.globalDataKey) {
|
|
t = { ...t };
|
|
let r = {};
|
|
if (n) {
|
|
const a = this.page.props && this.page.props.pageSize || 20, o = this.page.pageField || "page", s = this.page.pageSizeField || "limit";
|
|
r = {
|
|
[o]: this.currentPage,
|
|
[s]: a
|
|
};
|
|
}
|
|
if (this.order) {
|
|
const a = this.page.orderField || "order", o = this.page.orderByField || "orderBy";
|
|
r[a] = this.order, r[o] = this.orderBy;
|
|
}
|
|
const i = Object.keys(r).map((a) => encodeURIComponent(a) + "=" + encodeURIComponent(r[a]), "").join("&");
|
|
i && (t.action += (t.action.indexOf("?") !== -1 ? "&" : "?") + i), this.loading = !0, t.wait = 1e3, this.unwatch = this.formCreateInject.api.watchFetch(t, (a, o) => {
|
|
this.loading = !1;
|
|
const s = this.page.totalField, u = this.page.dataField, c = u ? this.deepGet(a, u, []) : a;
|
|
let l = s ? this.deepGet(a, s) : 0;
|
|
l || (l = c.length || 0), e({ list: c, total: l });
|
|
}, (a) => {
|
|
console.error(a), this.loading = !1;
|
|
}, (a, o) => {
|
|
if (o)
|
|
return this.unwatch && this.unwatch(), this.unwatch = null, setTimeout(() => {
|
|
this.changePage(1);
|
|
}), !1;
|
|
});
|
|
} else {
|
|
let r = t.data || [], i = t.data.length;
|
|
if (n) {
|
|
const a = this.getLimit(), o = this.currentPage * a;
|
|
r = r.slice(o - a, o), i = r.length;
|
|
}
|
|
e({ list: r, total: i });
|
|
}
|
|
else
|
|
e({ list: [], total: 0 });
|
|
});
|
|
},
|
|
changePage(n) {
|
|
this.currentPage = n, this.nextList();
|
|
},
|
|
makePage() {
|
|
if (this.page && this.page.open === !0)
|
|
return qe(K("el-pagination"), {
|
|
layout: "prev, pager, next",
|
|
total: this.total,
|
|
currentPage: this.currentPage,
|
|
"onUpdate:currentPage": (n) => {
|
|
this.currentPage !== n && this.changePage(n);
|
|
},
|
|
class: this.page.position || "right",
|
|
...this.page.props || {},
|
|
pageSize: this.page.props && this.page.props.pageSize || 20
|
|
});
|
|
},
|
|
makeButtonCol() {
|
|
if (this.button && this.button.open === !0 && this.button.column)
|
|
return qe(K("el-table-column"), {
|
|
label: this.button.label || this.formCreateInject.t("operation") || "\u64CD\u4F5C",
|
|
fixed: this.button.fixed === void 0 ? "right" : this.button.fixed,
|
|
width: this.button.width || "100px"
|
|
}, {
|
|
default: (n) => this.button.column.filter((e) => e.hidden !== !0).map((e) => qe(K("el-button"), this.btnProps(e, n), () => [e.name]))
|
|
});
|
|
},
|
|
makeColumn(n) {
|
|
return qe(K("el-table-column"), {
|
|
label: n.label,
|
|
prop: n.prop,
|
|
width: n.width,
|
|
align: n.align,
|
|
className: n.className,
|
|
fixed: n.fixed,
|
|
sortable: n.sortable
|
|
}, {
|
|
default: (e) => {
|
|
if (n.children && n.children.length > 0)
|
|
return n.children.map((t) => this.makeColumn(t));
|
|
if (!(!n.format || n.format === "default"))
|
|
return this.makeTd(n, e);
|
|
}
|
|
});
|
|
},
|
|
makeTd(n, e) {
|
|
return n.format === "custom" && n.render ? n.render(e, qe, K, this.formCreateInject.api) : n.format === "tag" ? qe(K("el-tag"), { disableTransitions: !0 }, () => [this.deepGet(e.row, n.prop, "")]) : n.format === "image" ? qe("div", {
|
|
class: "_fc-data-table-img-list"
|
|
}, (() => {
|
|
let t = this.deepGet(e.row, n.prop, "");
|
|
return t = (Array.isArray(t) ? t : [t]).filter((r) => !!r), t.map((r, i) => qe(K("el-image"), {
|
|
src: r,
|
|
previewSrcList: t,
|
|
previewTeleported: !0,
|
|
initialIndex: i,
|
|
fit: "cover"
|
|
}));
|
|
})()) : "" + this.deepGet(e.row, n.prop, "");
|
|
}
|
|
},
|
|
created() {
|
|
this.initPage(), this.$watch(() => this.data && this.data.length, () => {
|
|
!this.globalDataKey && !this.fetch && this.initPage();
|
|
});
|
|
}
|
|
});
|
|
const Bl = {
|
|
name: "FcTable",
|
|
props: {
|
|
mini: Boolean,
|
|
label: String,
|
|
width: [Number, String],
|
|
border: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
borderWidth: String,
|
|
borderColor: String,
|
|
rule: {
|
|
type: Object,
|
|
default: () => ({ row: 1, col: 1 })
|
|
}
|
|
},
|
|
watch: {
|
|
rule: {
|
|
handler() {
|
|
this.initRule(), this.loadRule(), this.tdStyle = this.rule.style || {}, this.tdClass = this.rule.class || {};
|
|
},
|
|
immediate: !0,
|
|
deep: !0
|
|
}
|
|
},
|
|
data() {
|
|
return {
|
|
tdStyle: {},
|
|
tdClass: {},
|
|
lattice: {}
|
|
};
|
|
},
|
|
computed: {
|
|
tableColor() {
|
|
const n = {};
|
|
return this.border === !1 ? n.border = "0 none" : (this.borderColor && (n.borderColor = this.borderColor), this.borderWidth && (n.borderWidth = this.borderWidth)), n;
|
|
}
|
|
},
|
|
methods: {
|
|
initRule() {
|
|
const n = this.rule;
|
|
n.style || (n.style = {}), n.layout || (n.layout = []), n.row || (n.row = 1), n.col || (n.col = 1);
|
|
},
|
|
loadRule() {
|
|
const n = [], e = this.rule || { row: 1, col: 1 };
|
|
for (let r = 0; r < e.row; r++) {
|
|
const i = [];
|
|
n.push(i);
|
|
for (let a = 0; a < e.col; a++)
|
|
i.push({ rowspan: 1, colspan: 1, slot: [], show: !0 });
|
|
}
|
|
[...e.layout || []].forEach((r, i) => {
|
|
if ((!r.row || r.row <= 0) && (!r.col || r.col <= 0) || !n[r.top] || !n[r.top][r.left] || !n[r.top][r.left].show) {
|
|
e.layout.splice(i, 1);
|
|
return;
|
|
}
|
|
const a = n[r.top][r.left];
|
|
a.layout = r;
|
|
let o = 1, s = 1;
|
|
if (r.col && (o = r.col + r.left > e.col ? e.col - r.left : r.col, a.colspan = o), r.row && (s = r.row + r.top > e.row ? e.row - r.top : r.row, a.rowspan = s), s && o)
|
|
for (let u = 0; u < s; u++) {
|
|
const c = n[r.top + u];
|
|
if (c)
|
|
for (let l = 0; l < o; l++)
|
|
!l && !u || (c[r.left + l] && (c[r.left + l].show = !1), a.slot.push(`${r.top + u}:${r.left + l}`));
|
|
}
|
|
});
|
|
const t = (r) => !!(!r || r.layout || !r.show);
|
|
n.forEach((r, i) => {
|
|
r.forEach((a, o) => {
|
|
let s = !1, u = !1;
|
|
if (a.layout) {
|
|
const c = a.layout.col || 1, l = a.layout.row || 1;
|
|
for (let h = 0; h < c; h++)
|
|
if (!n[i + l] || t(n[i + l][o + h])) {
|
|
u = !0;
|
|
continue;
|
|
}
|
|
for (let h = 0; h < l; h++)
|
|
if (!n[i + h] || t(n[i + h][o + c])) {
|
|
s = !0;
|
|
continue;
|
|
}
|
|
} else
|
|
s = t(r[o + 1]), u = n[i + 1] ? t(n[i + 1][o]) : !0;
|
|
a.right = s, a.bottom = u;
|
|
});
|
|
}), this.lattice = n;
|
|
}
|
|
}
|
|
};
|
|
function Ll(n, e, t, r, i, a) {
|
|
const o = K("el-col");
|
|
return ee(), Re(o, { span: 24 }, {
|
|
default: Ce(() => [
|
|
Me("div", {
|
|
class: Yt(["_fc-table", { "is-mini": t.mini }])
|
|
}, [
|
|
Me("table", {
|
|
border: "1",
|
|
cellspacing: "0",
|
|
cellpadding: "0",
|
|
style: Ea(a.tableColor)
|
|
}, [
|
|
(ee(!0), me(Ke, null, un(t.rule.row, (s, u) => (ee(), me("tr", { key: u }, [
|
|
(ee(!0), me(Ke, null, un(t.rule.col, (c, l) => (ee(), me(Ke, {
|
|
key: `${u}${l}`
|
|
}, [
|
|
i.lattice[u][l].show ? (ee(), me("td", Pe({
|
|
key: 0,
|
|
ref_for: !0
|
|
}, i.lattice[u][l] ? { colspan: i.lattice[u][l].colspan, rowspan: i.lattice[u][l].rowspan } : {}, {
|
|
valign: "top",
|
|
class: i.tdClass && i.tdClass[`${u}:${l}`] || "",
|
|
style: [a.tableColor, i.tdStyle && i.tdStyle[`${u}:${l}`] || {}]
|
|
}), [
|
|
Tn(n.$slots, `${u}:${l}`),
|
|
(ee(!0), me(Ke, null, un(i.lattice[u][l].slot, (h) => Tn(n.$slots, `${h}`)), 256))
|
|
], 16)) : dt("", !0)
|
|
], 64))), 128))
|
|
]))), 128))
|
|
], 4)
|
|
], 2)
|
|
]),
|
|
_: 3
|
|
});
|
|
}
|
|
const Nl = /* @__PURE__ */ Ae(Bl, [["render", Ll]]);
|
|
const zl = {
|
|
name: "TableForm",
|
|
emits: ["change", "add", "delete", "update:modelValue"],
|
|
props: {
|
|
formCreateInject: Object,
|
|
modelValue: {
|
|
type: Array,
|
|
default: () => []
|
|
},
|
|
columns: {
|
|
type: Array,
|
|
required: !0,
|
|
default: () => []
|
|
},
|
|
filterEmptyColumn: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
deletable: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
addable: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
options: {
|
|
type: Object,
|
|
default: () => Be({
|
|
submitBtn: !1,
|
|
resetBtn: !1
|
|
})
|
|
},
|
|
max: Number,
|
|
min: Number,
|
|
disabled: Boolean
|
|
},
|
|
watch: {
|
|
modelValue: {
|
|
handler() {
|
|
this.updateTable();
|
|
},
|
|
deep: !0
|
|
},
|
|
"formCreateInject.preview": function(n) {
|
|
this.emptyRule.children[0].props.colspan = this.columns.length + (n ? 1 : 2);
|
|
}
|
|
},
|
|
data() {
|
|
return {
|
|
rule: [],
|
|
trs: [],
|
|
fapi: {},
|
|
Form: Te(this.formCreateInject.form.$form()),
|
|
copyTrs: "",
|
|
oldValue: "",
|
|
emptyRule: {
|
|
type: "tr",
|
|
_isEmpty: !0,
|
|
native: !0,
|
|
subRule: !0,
|
|
children: [
|
|
{
|
|
type: "td",
|
|
style: {
|
|
textAlign: "center"
|
|
},
|
|
native: !0,
|
|
subRule: !0,
|
|
props: {
|
|
colspan: this.columns.length + (this.formCreateInject.preview ? 1 : 2)
|
|
},
|
|
children: [this.formCreateInject.t("dataEmpty") || "\u6682\u65E0\u6570\u636E"]
|
|
}
|
|
]
|
|
}
|
|
};
|
|
},
|
|
methods: {
|
|
formChange() {
|
|
this.updateValue();
|
|
},
|
|
updateValue() {
|
|
const n = this.trs.map((t, r) => ({
|
|
...this.modelValue[r] || {},
|
|
...this.fapi.getChildrenFormData(t)
|
|
})).filter((t) => {
|
|
if (!this.filterEmptyColumn)
|
|
return !0;
|
|
if (t == null)
|
|
return !1;
|
|
let r = !1;
|
|
return Object.keys(t).forEach((i) => {
|
|
r = r || t[i] !== void 0 && t[i] !== "" && t[i] !== null;
|
|
}), r;
|
|
}), e = JSON.stringify(n);
|
|
e !== this.oldValue && (this.oldValue = e, this.$emit("update:modelValue", n), this.$emit("change", n));
|
|
},
|
|
setRawData(n, e) {
|
|
const t = this.trs[n];
|
|
this.fapi.setChildrenFormData(t, e, !0);
|
|
},
|
|
updateTable() {
|
|
const n = JSON.stringify(this.modelValue);
|
|
this.oldValue !== n && (this.oldValue = n, this.trs = this.trs.splice(0, this.modelValue.length), this.modelValue.length ? this.clearEmpty() : this.addEmpty(), this.modelValue.forEach((e, t) => {
|
|
this.trs[t] || this.addRaw(), this.setRawData(t, e || {});
|
|
}), this.rule[0].children[1].children = this.trs);
|
|
},
|
|
addEmpty() {
|
|
this.trs.length && this.trs.splice(0, this.trs.length), this.trs.push(this.emptyRule);
|
|
},
|
|
clearEmpty() {
|
|
this.trs[0] && this.trs[0]._isEmpty && this.trs.splice(0, 1);
|
|
},
|
|
delRaw(n) {
|
|
this.disabled || !this.deletable || this.min > 0 && this.trs.length <= this.min || (this.trs.splice(n, 1), this.updateValue(), this.trs.length ? this.trs.forEach((e) => this.updateRaw(e)) : this.addEmpty(), this.$emit("delete", n));
|
|
},
|
|
addRaw(n) {
|
|
if (n && this.disabled)
|
|
return;
|
|
const e = this.formCreateInject.form.parseJson(this.copyTrs)[0];
|
|
this.trs.length === 1 && this.trs[0]._isEmpty && this.trs.splice(0, 1), this.trs.push(e), this.updateRaw(e), n && (this.$emit("add", this.trs.length), this.updateValue());
|
|
},
|
|
updateRaw(n) {
|
|
const e = this.trs.indexOf(n);
|
|
n.children[0].props.innerText = e + 1, n.children[n.children.length - 1].children[0].props.onClick = () => {
|
|
this.delRaw(e);
|
|
};
|
|
},
|
|
loadRule() {
|
|
const n = [{
|
|
type: "th",
|
|
native: !0,
|
|
class: "_fc-tf-head-idx",
|
|
props: {
|
|
innerText: "#"
|
|
}
|
|
}];
|
|
let e = [{
|
|
type: "td",
|
|
class: "_fc-tf-idx",
|
|
native: !0,
|
|
props: {
|
|
innerText: "0"
|
|
}
|
|
}];
|
|
this.columns.forEach((t) => {
|
|
n.push({
|
|
type: "th",
|
|
native: !0,
|
|
style: t.style,
|
|
class: t.required ? "_fc-tf-head-required" : "",
|
|
props: {
|
|
innerText: t.label || ""
|
|
}
|
|
}), e.push({
|
|
type: "td",
|
|
native: !0,
|
|
children: [...t.rule || []]
|
|
});
|
|
}), n.push({
|
|
type: "th",
|
|
native: !0,
|
|
class: "_fc-tf-edit fc-clock",
|
|
props: {
|
|
innerText: this.formCreateInject.t("operation") || "\u64CD\u4F5C"
|
|
}
|
|
}), e.push({
|
|
type: "td",
|
|
native: !0,
|
|
class: "_fc-tf-btn fc-clock",
|
|
children: [
|
|
{
|
|
type: "i",
|
|
native: !0,
|
|
class: "fc-icon icon-delete",
|
|
props: {}
|
|
}
|
|
]
|
|
}), this.copyTrs = this.formCreateInject.form.toJson([
|
|
{
|
|
type: "tr",
|
|
native: !0,
|
|
subRule: !0,
|
|
children: e
|
|
}
|
|
]), this.rule = [
|
|
{
|
|
type: "table",
|
|
native: !0,
|
|
class: "_fc-tf-table",
|
|
props: {
|
|
border: "1",
|
|
cellspacing: "0",
|
|
cellpadding: "0"
|
|
},
|
|
children: [
|
|
{
|
|
type: "thead",
|
|
native: !0,
|
|
children: [
|
|
{
|
|
type: "tr",
|
|
native: !0,
|
|
children: n
|
|
}
|
|
]
|
|
},
|
|
{
|
|
type: "tbody",
|
|
native: !0,
|
|
children: this.trs
|
|
}
|
|
]
|
|
}
|
|
];
|
|
}
|
|
},
|
|
created() {
|
|
this.loadRule();
|
|
},
|
|
mounted() {
|
|
this.updateTable();
|
|
}
|
|
};
|
|
function Ul(n, e, t, r, i, a) {
|
|
const o = K("el-button");
|
|
return ee(), me("div", {
|
|
class: Yt(["_fc-table-form", { "_fc-disabled": t.disabled }])
|
|
}, [
|
|
(ee(), Re(Ft(i.Form), {
|
|
option: t.options,
|
|
rule: i.rule,
|
|
extendOption: !0,
|
|
disabled: t.disabled,
|
|
onChange: a.formChange,
|
|
api: i.fapi,
|
|
"onUpdate:api": e[0] || (e[0] = (s) => i.fapi = s),
|
|
onEmitEvent: n.$emit
|
|
}, null, 40, ["option", "rule", "disabled", "onChange", "api", "onEmitEvent"])),
|
|
t.addable && (!t.max || t.max > this.trs.length) ? (ee(), Re(o, {
|
|
key: 0,
|
|
link: "",
|
|
type: "primary",
|
|
class: "fc-clock",
|
|
onClick: e[1] || (e[1] = (s) => a.addRaw(!0))
|
|
}, {
|
|
default: Ce(() => [
|
|
e[2] || (e[2] = Me("i", {
|
|
class: "fc-icon icon-add-circle",
|
|
style: { "font-weight": "700" }
|
|
}, null, -1)),
|
|
He(" " + Ve(t.formCreateInject.t("add") || "\u6DFB\u52A0"), 1)
|
|
]),
|
|
_: 1
|
|
})) : dt("", !0)
|
|
], 2);
|
|
}
|
|
const ql = /* @__PURE__ */ Ae(zl, [["render", Ul]]), Gl = Object.assign || function(n) {
|
|
for (let e, t = 1; t < arguments.length; t++)
|
|
for (let r in e = arguments[t], e)
|
|
Object.prototype.hasOwnProperty.call(e, r) && Gt(n, r, e[r]);
|
|
return n;
|
|
};
|
|
function eo() {
|
|
return Gl.apply(this, arguments);
|
|
}
|
|
let Hl = 0;
|
|
function kr() {
|
|
const n = 370 + ++Hl;
|
|
return "F" + Math.random().toString(36).substr(3, 3) + Number(`${Date.now()}`).toString(36) + n.toString(36) + "c";
|
|
}
|
|
const Wl = {
|
|
name: "TableFormPro",
|
|
emits: ["change", "add", "delete", "update:modelValue", "handleClick"],
|
|
props: {
|
|
formCreateInject: Object,
|
|
height: [String, Number],
|
|
modelValue: {
|
|
type: Array,
|
|
default: () => []
|
|
},
|
|
columns: {
|
|
type: Array,
|
|
required: !0,
|
|
default: () => []
|
|
},
|
|
button: Object,
|
|
page: Object,
|
|
size: String,
|
|
filterEmptyColumn: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
newColumn: Boolean,
|
|
deletable: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
addable: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
options: {
|
|
type: Object,
|
|
default: () => Be({
|
|
submitBtn: !1,
|
|
resetBtn: !1
|
|
})
|
|
},
|
|
showIndex: Boolean,
|
|
max: Number,
|
|
min: Number,
|
|
disabled: Boolean
|
|
},
|
|
watch: {
|
|
modelValue: {
|
|
handler() {
|
|
const n = JSON.stringify(this.modelValue || []);
|
|
this.oldValue !== n && (this.chunk = [[]], this.nowPage = 1, this.updateTable(), this.oldValue = n);
|
|
}
|
|
}
|
|
},
|
|
computed: {
|
|
total() {
|
|
return this.chunk.reduce((n, e) => (n += e.length, n), 0);
|
|
},
|
|
limit() {
|
|
return !this.page || this.page.open !== !0 ? 1e6 : this.page.props && this.page.props.pageSize || 20;
|
|
},
|
|
pageData() {
|
|
return this.chunk[this.nowPage - 1];
|
|
}
|
|
},
|
|
data() {
|
|
return {
|
|
chunk: [[]],
|
|
data: [],
|
|
rule: [],
|
|
trs: [],
|
|
fapi: {},
|
|
Form: Te(this.formCreateInject.form.$form()),
|
|
copyTrs: "",
|
|
oldValue: "",
|
|
nowPage: 1,
|
|
indexRule: {
|
|
type: "el-table-column",
|
|
props: {
|
|
label: "#",
|
|
type: "index",
|
|
fixed: "left"
|
|
}
|
|
}
|
|
};
|
|
},
|
|
methods: {
|
|
paginateArray() {
|
|
const n = this.modelValue || [], e = this.limit, t = [];
|
|
for (let r = 0; r < n.length; r += e) {
|
|
const i = n.slice(r, r + e);
|
|
t.push(i);
|
|
}
|
|
t.length && t.forEach((r, i) => {
|
|
this.chunk[i] = [...this.chunk[i] || [], ...r];
|
|
}), this.nowPage > this.chunk.length && (this.nowPage = this.chunk.length);
|
|
},
|
|
formChange() {
|
|
this.updateValue();
|
|
},
|
|
updateValue() {
|
|
this.trs.forEach((t, r) => {
|
|
eo(this.pageData[r], this.fapi.getChildrenFormData(t));
|
|
});
|
|
const n = vt(this.chunk.reduce((t, r) => [...t, ...r], []).filter((t) => {
|
|
if (!this.filterEmptyColumn)
|
|
return !0;
|
|
if (t == null)
|
|
return !1;
|
|
let r = !1;
|
|
return Object.keys(t).forEach((i) => {
|
|
r = r || t[i] !== void 0 && t[i] !== "" && t[i] !== null;
|
|
}), r;
|
|
})), e = JSON.stringify(n);
|
|
e !== this.oldValue && (this.oldValue = e, this.$emit("update:modelValue", n), this.$emit("change", n));
|
|
},
|
|
setRawData(n, e) {
|
|
const t = this.trs[n];
|
|
this.fapi.setChildrenFormData(t, e, !0);
|
|
},
|
|
changePage(n) {
|
|
n !== this.nowPage && (this.chunk[this.nowPage - 1] = this.pageData, this.nowPage = n, this.rule[1].props.data = this.pageData, this.trs.splice(0, this.trs.length), this.pageData.forEach((e, t) => {
|
|
this.trs[t] || this.addRaw(), this.setRawData(t, e || {});
|
|
}), this.rule[0].children = this.trs);
|
|
},
|
|
updateTable() {
|
|
this.paginateArray(), this.rule[1].props.data = this.pageData, this.trs.splice(0, this.trs.length), this.pageData.forEach((n, e) => {
|
|
this.trs[e] || this.addRaw(), this.setRawData(e, n || {});
|
|
}), this.rule[0].children = this.trs;
|
|
},
|
|
delRaw(n) {
|
|
this.disabled || this.deletable === !1 || this.min > 0 && this.total <= this.min || (this.trs.splice(n, 1), this.rule[1].props.data.splice(n, 1), this.updateValue(), this.$emit("delete", n), this.oldValue = "");
|
|
},
|
|
addRaw(n) {
|
|
if (!(n && (this.disabled || this.addable === !1))) {
|
|
if (!n) {
|
|
const e = this.formCreateInject.form.parseJson(this.copy);
|
|
this.trs.push(e);
|
|
return;
|
|
}
|
|
if (this.chunk[this.chunk.length - 1].length >= this.limit)
|
|
this.chunk.push([{}]);
|
|
else if (n && this.chunk[this.chunk.length - 1].push({}), n && this.nowPage === this.chunk.length) {
|
|
const e = this.formCreateInject.form.parseJson(this.copy);
|
|
this.trs.push(e);
|
|
}
|
|
n && (this.$emit("add", this.total), this.updateValue());
|
|
}
|
|
},
|
|
btnProps(n, e) {
|
|
const t = { ...e };
|
|
t.row = this.modelValue[e.$index] || {};
|
|
const r = n.prop || [], i = {
|
|
type: n.type,
|
|
size: n.size,
|
|
round: r.indexOf("round") > -1,
|
|
link: r.indexOf("link") > -1,
|
|
plain: r.indexOf("plain") > -1,
|
|
disabled: r.indexOf("disabled") > -1 || this.disabled || n.key === "delete" && this.deletable === !1,
|
|
onClick: (a) => {
|
|
if (t.row = this.modelValue[e.$index] || {}, a.stopPropagation(), n.key === "delete") {
|
|
this.delRaw(e.$index);
|
|
return;
|
|
}
|
|
const o = Bn(n.click);
|
|
try {
|
|
o && o(t, this.formCreateInject.api);
|
|
} catch (s) {
|
|
console.error(s);
|
|
}
|
|
this.$emit("handleClick", { name: n.name, key: n.key, _scope: t, column: t.row });
|
|
}
|
|
};
|
|
try {
|
|
if (!this.disabled) {
|
|
const a = Bn(n.handle), o = a && a(i, t, this.formCreateInject.api);
|
|
typeof o == "boolean" && (i.disabled = o);
|
|
}
|
|
} catch (a) {
|
|
console.error(a);
|
|
}
|
|
return i;
|
|
},
|
|
processRule(n) {
|
|
let e = [];
|
|
return n.forEach((t) => {
|
|
t.children ? e.push(...this.processRule(t.children)) : (t._renderId = kr(), e.push({
|
|
type: "template",
|
|
name: t._renderId,
|
|
children: [...t.rule || []]
|
|
}));
|
|
}), e;
|
|
},
|
|
processColumns(n) {
|
|
return n.map((e, t) => {
|
|
var i;
|
|
const r = {
|
|
type: "el-table-column",
|
|
hidden: e.hidden === !0,
|
|
props: {
|
|
fixed: e.fixed || !1,
|
|
width: ((i = e == null ? void 0 : e.style) == null ? void 0 : i.width) || "auto",
|
|
minWidth: 120
|
|
},
|
|
renderSlots: {
|
|
header() {
|
|
var a;
|
|
return qe("span", {
|
|
class: e.required ? "is-required" : "",
|
|
style: { color: (a = e == null ? void 0 : e.style) == null ? void 0 : a.color }
|
|
}, e.label);
|
|
}
|
|
}
|
|
};
|
|
return e.children ? r.children = this.processColumns(e.children) : r.renderSlots.default = ({ $index: a }) => {
|
|
var o, s, u, c, l, h, m, w;
|
|
for (let $ = 0; $ < ((s = (o = this.rule[0]) == null ? void 0 : o.children[a]) == null ? void 0 : s.children.length); $++)
|
|
if (((c = (u = this.rule[0]) == null ? void 0 : u.children[a]) == null ? void 0 : c.children[$].name) === e._renderId)
|
|
return (w = (m = this.fapi.renderRule((h = (l = this.rule[0]) == null ? void 0 : l.children[a]) == null ? void 0 : h.children[$], void 0, !0)) == null ? void 0 : m.default) == null ? void 0 : w.call(m);
|
|
}, r;
|
|
});
|
|
},
|
|
loadRule() {
|
|
this.copy = this.formCreateInject.form.toJson({
|
|
type: "template",
|
|
name: "template",
|
|
subRule: !0,
|
|
children: this.processRule(this.columns)
|
|
}), this.rule = [
|
|
{
|
|
type: "hidden",
|
|
children: this.trs
|
|
},
|
|
{
|
|
type: "elTable",
|
|
style: {
|
|
width: "100%"
|
|
},
|
|
key: 1,
|
|
props: {
|
|
...this.$attrs,
|
|
height: this.height,
|
|
size: this.size,
|
|
data: []
|
|
},
|
|
children: []
|
|
}
|
|
];
|
|
}
|
|
},
|
|
created() {
|
|
this.loadRule();
|
|
},
|
|
mounted() {
|
|
const n = this.fapi.sync;
|
|
this.fapi.sync = (e) => {
|
|
e.tableRenderUni = kr(), n(e);
|
|
}, this.updateTable(), this.newColumn && (!this.modelValue || !this.modelValue.length) && this.addRaw(!0), this.$watch(() => [...this.columns], (e) => {
|
|
this.rule[1].children.splice(this.rule[1].children.indexOf(this.indexRule) > -1 ? 1 : 0, 0, ...this.processColumns(e)), this.rule[1].key++;
|
|
}, { immediate: !0 }), this.$watch(() => this.showIndex, (e) => {
|
|
e === !1 && this.rule[1].children.indexOf(this.indexRule) > -1 ? this.rule[1].children.splice(0, 1) : e !== !1 && this.rule[1].children.indexOf(this.indexRule) === -1 && this.rule[1].children.unshift(this.indexRule);
|
|
}, { immediate: !0 }), this.$watch(() => this.formCreateInject.preview && this.button && this.button.column && [{ ...this.button }, ...this.button.column], (e) => {
|
|
this.rule[1].children.forEach((t, r) => {
|
|
t._tableHandle && this.rule[1].children.splice(r, 1);
|
|
}), !this.formCreateInject.preview && this.button.open !== !1 && this.rule[1].children.push({
|
|
type: "el-table-column",
|
|
_tableHandle: !0,
|
|
props: {
|
|
label: this.button.label || this.formCreateInject.t("operation") || "\u64CD\u4F5C",
|
|
fixed: this.button.fixed === void 0 ? "right" : this.button.fixed,
|
|
width: this.button.width || "100px"
|
|
},
|
|
renderSlots: {
|
|
default: (t) => this.button.column.filter((r) => r.hidden !== !0).map((r) => qe(K("el-button"), this.btnProps(r, t), () => [r.key === "delete" && this.formCreateInject.t("delete") || r.name]))
|
|
}
|
|
});
|
|
}, { immediate: !0 });
|
|
}
|
|
}, Yl = { class: "_fc-tf-pro-handle" };
|
|
function Xl(n, e, t, r, i, a) {
|
|
const o = K("el-button"), s = K("el-pagination");
|
|
return ee(), me("div", {
|
|
class: Yt(["_fc-table-form-v2", { "_fc-disabled": t.disabled }])
|
|
}, [
|
|
(ee(), Re(Ft(i.Form), {
|
|
option: t.options,
|
|
rule: i.rule,
|
|
extendOption: !0,
|
|
disabled: t.disabled,
|
|
onChange: a.formChange,
|
|
api: i.fapi,
|
|
"onUpdate:api": e[0] || (e[0] = (u) => i.fapi = u),
|
|
onEmitEvent: n.$emit
|
|
}, null, 40, ["option", "rule", "disabled", "onChange", "api", "onEmitEvent"])),
|
|
Me("div", Yl, [
|
|
Me("div", null, [
|
|
(!t.max || t.max > a.total) && t.addable !== !1 && t.disabled !== !0 ? (ee(), Re(o, {
|
|
key: 0,
|
|
link: "",
|
|
type: "primary",
|
|
class: "fc-clock",
|
|
onClick: e[1] || (e[1] = (u) => a.addRaw(!0))
|
|
}, {
|
|
default: Ce(() => [
|
|
e[2] || (e[2] = Me("i", {
|
|
class: "fc-icon icon-add-circle",
|
|
style: { "font-weight": "700" }
|
|
}, null, -1)),
|
|
He(" " + Ve(t.formCreateInject.t("add") || "\u6DFB\u52A0"), 1)
|
|
]),
|
|
_: 1
|
|
})) : dt("", !0)
|
|
]),
|
|
t.page && t.page.open === !0 && i.chunk.length > 1 ? (ee(), Re(s, Pe({ key: 0 }, t.page.props || {}, {
|
|
layout: "prev, pager, next",
|
|
currentPage: i.nowPage,
|
|
"onUpdate:currentPage": a.changePage,
|
|
total: a.total,
|
|
pageSize: a.limit
|
|
}), null, 16, ["currentPage", "onUpdate:currentPage", "total", "pageSize"])) : dt("", !0)
|
|
])
|
|
], 2);
|
|
}
|
|
const Jl = /* @__PURE__ */ Ae(Wl, [["render", Xl]]);
|
|
const Kl = {
|
|
name: "InfiniteTableForm",
|
|
emits: ["change", "add", "delete", "update:modelValue"],
|
|
props: {
|
|
formCreateInject: Object,
|
|
modelValue: {
|
|
type: Array,
|
|
default: () => []
|
|
},
|
|
columns: {
|
|
type: Array,
|
|
required: !0,
|
|
default: () => []
|
|
},
|
|
options: {
|
|
type: Object,
|
|
default: () => Be({
|
|
submitBtn: !1,
|
|
resetBtn: !1
|
|
})
|
|
},
|
|
max: Number,
|
|
layerMax: {
|
|
type: Number,
|
|
default: 0
|
|
},
|
|
childrenField: String,
|
|
disabled: Boolean
|
|
},
|
|
computed: {
|
|
preview() {
|
|
return this.formCreateInject.preview;
|
|
},
|
|
subField() {
|
|
return this.childrenField || "children";
|
|
}
|
|
},
|
|
watch: {
|
|
modelValue() {
|
|
this.updateTable();
|
|
},
|
|
"formCreateInject.preview"(n) {
|
|
this.trs.forEach((e, t) => {
|
|
e.children[1] && (e.children[1].children[0].props.colspan = this.rule[0].children[0].children[0].children.length - (n ? 1 : 0)), e.children[0].children[0].children[0].hidden = this.layerMax === 1 || n && !(this.modelValue && this.modelValue[t] && Array.isArray(this.modelValue[t][this.subField]) && this.modelValue[t][this.subField].length > 0);
|
|
});
|
|
}
|
|
},
|
|
data() {
|
|
return {
|
|
rule: [],
|
|
trs: [],
|
|
fapi: {},
|
|
Form: Te(this.formCreateInject.form.$form()),
|
|
copyTrs: "",
|
|
oldValue: ""
|
|
};
|
|
},
|
|
methods: {
|
|
formChange(n, e, t, r, i) {
|
|
i === !1 && this.updateValue();
|
|
},
|
|
updateValue() {
|
|
const n = this.trs.map((t, r) => {
|
|
const i = {
|
|
...this.modelValue[r] || {},
|
|
...this.fapi.getChildrenFormData(t)
|
|
};
|
|
return !Xa(i, this.subField) && this.modelValue[r] && (i[this.subField] = this.modelValue[r][this.subField]), i[this.subField] == null && delete i[this.subField], i;
|
|
}), e = JSON.stringify(n);
|
|
e !== this.oldValue && (this.oldValue = e, this.$emit("update:modelValue", n), this.$emit("change", n));
|
|
},
|
|
setRawData(n, e) {
|
|
const t = this.trs[n];
|
|
this.fapi.setChildrenFormData(t, e, !0);
|
|
},
|
|
updateTable() {
|
|
const n = JSON.stringify(this.modelValue);
|
|
this.oldValue !== n && (this.oldValue = n, this.trs = this.trs.splice(0, this.modelValue.length), this.modelValue.length || this.addRaw(), this.modelValue.forEach((e, t) => {
|
|
this.trs[t] || this.addRaw(), this.setRawData(t, e || {});
|
|
}), this.rule[0].children[1].children = this.trs);
|
|
},
|
|
delRaw(n) {
|
|
this.disabled || (this.trs.splice(n, 1), this.updateValue(), this.trs.length ? this.trs.forEach((e) => this.updateRaw(e)) : this.addRaw(), this.$emit("delete", n));
|
|
},
|
|
addRaw(n) {
|
|
if (n && this.disabled)
|
|
return;
|
|
const e = this.formCreateInject.form.parseJson(this.copyTrs)[0], t = {
|
|
type: "template",
|
|
subRule: !0,
|
|
children: []
|
|
};
|
|
t.children.push(e), this.trs.push(t), this.trs.forEach((r) => this.updateRaw(r)), n && this.$emit("add", this.trs);
|
|
},
|
|
updateRaw(n) {
|
|
const e = this.trs.indexOf(n), t = n.children[0];
|
|
t.children[0].children[0].hidden = this.layerMax === 1 || this.preview && !(this.modelValue && this.modelValue[e] && Array.isArray(this.modelValue[e][this.subField]) && this.modelValue[e][this.subField].length > 0), t.children[0].children[0].props.onClick = (r) => {
|
|
if (this.trs[e].children.length === 1) {
|
|
if (this.disabled && !(this.modelValue && this.modelValue[e] && Array.isArray(this.modelValue[e][this.subField]) && this.modelValue[e][this.subField].length > 0))
|
|
return;
|
|
this.trs[e].children.push({
|
|
type: "tr",
|
|
native: !0,
|
|
display: !0,
|
|
children: [{
|
|
type: "td",
|
|
native: !0,
|
|
props: {
|
|
colspan: this.rule[0].children[0].children[0].children.length - (this.preview ? 1 : 0)
|
|
},
|
|
class: "_fc-itf-sub",
|
|
children: [{
|
|
type: "infiniteTableForm",
|
|
field: this.subField,
|
|
value: [...this.modelValue[e] && this.modelValue[e][this.subField] || []],
|
|
props: {
|
|
disabled: this.disabled,
|
|
layerMax: this.layerMax === 0 ? 0 : this.layerMax > 1 ? this.layerMax - 1 : 1,
|
|
max: this.max || 0,
|
|
columns: vt(this.columns),
|
|
options: vt(this.options)
|
|
}
|
|
}]
|
|
}]
|
|
});
|
|
}
|
|
const i = r.self.children[0] === "-" ? "+" : "-";
|
|
r.self.children = [i], this.trs[e].children[1].display = i === "-";
|
|
}, t.children[1].props.innerText = e + 1, t.children[t.children.length - 1].children[0].props.onClick = () => {
|
|
this.delRaw(e);
|
|
};
|
|
},
|
|
loadRule() {
|
|
const n = [{
|
|
type: "th",
|
|
native: !0,
|
|
class: "_fc-itf-sub-idx"
|
|
}, {
|
|
type: "th",
|
|
native: !0,
|
|
class: "_fc-itf-head-idx",
|
|
props: {
|
|
innerText: "#"
|
|
}
|
|
}];
|
|
let e = [{
|
|
type: "td",
|
|
class: "_fc-itf-idx",
|
|
native: !0,
|
|
children: [
|
|
{
|
|
type: "div",
|
|
hidden: !1,
|
|
children: ["+"],
|
|
inject: !0,
|
|
props: {}
|
|
}
|
|
]
|
|
}, {
|
|
type: "td",
|
|
class: "_fc-itf-idx",
|
|
native: !0,
|
|
props: {
|
|
innerText: "0"
|
|
}
|
|
}];
|
|
this.columns.forEach((t) => {
|
|
n.push({
|
|
type: "th",
|
|
native: !0,
|
|
class: t.required ? "_fc-itf-head-required" : "",
|
|
style: t.style,
|
|
props: {
|
|
innerText: t.label || ""
|
|
}
|
|
}), e.push({
|
|
type: "td",
|
|
native: !0,
|
|
children: [...t.rule || []]
|
|
});
|
|
}), n.push({
|
|
type: "th",
|
|
native: !0,
|
|
class: "_fc-itf-edit fc-clock",
|
|
props: {
|
|
innerText: this.formCreateInject.t("operation") || "\u64CD\u4F5C"
|
|
}
|
|
}), e.push({
|
|
type: "td",
|
|
native: !0,
|
|
class: "_fc-itf-btn fc-clock",
|
|
children: [
|
|
{
|
|
type: "i",
|
|
native: !0,
|
|
class: "fc-icon icon-delete",
|
|
props: {}
|
|
}
|
|
]
|
|
}), this.copyTrs = this.formCreateInject.form.toJson([
|
|
{
|
|
type: "tr",
|
|
native: !0,
|
|
children: e
|
|
}
|
|
]), this.rule = [
|
|
{
|
|
type: "table",
|
|
native: !0,
|
|
class: "_fc-itf-table",
|
|
props: {
|
|
border: "1",
|
|
cellspacing: "0",
|
|
cellpadding: "0"
|
|
},
|
|
children: [
|
|
{
|
|
type: "thead",
|
|
native: !0,
|
|
children: [
|
|
{
|
|
type: "tr",
|
|
native: !0,
|
|
children: n
|
|
}
|
|
]
|
|
},
|
|
{
|
|
type: "tbody",
|
|
native: !0,
|
|
children: this.trs
|
|
}
|
|
]
|
|
}
|
|
];
|
|
}
|
|
},
|
|
created() {
|
|
this.loadRule();
|
|
},
|
|
mounted() {
|
|
this.updateTable();
|
|
}
|
|
};
|
|
function Zl(n, e, t, r, i, a) {
|
|
const o = K("el-button");
|
|
return ee(), me("div", {
|
|
class: Yt(["_fc-infinite-table-form", { "_fc-disabled": t.disabled }])
|
|
}, [
|
|
(ee(), Re(Ft(i.Form), {
|
|
option: t.options,
|
|
rule: i.rule,
|
|
extendOption: !0,
|
|
onChange: a.formChange,
|
|
disabled: t.disabled,
|
|
api: i.fapi,
|
|
"onUpdate:api": e[0] || (e[0] = (s) => i.fapi = s),
|
|
onEmitEvent: n.$emit
|
|
}, null, 40, ["option", "rule", "onChange", "disabled", "api", "onEmitEvent"])),
|
|
!t.max || t.max > this.trs.length ? (ee(), Re(o, {
|
|
key: 0,
|
|
link: "",
|
|
type: "primary",
|
|
class: "fc-clock",
|
|
onClick: e[1] || (e[1] = (s) => a.addRaw(!0))
|
|
}, {
|
|
default: Ce(() => [
|
|
e[2] || (e[2] = Me("i", {
|
|
class: "fc-icon icon-add-circle",
|
|
style: { "font-weight": "700" }
|
|
}, null, -1)),
|
|
He(" " + Ve(t.formCreateInject.t("add") || "\u6DFB\u52A0"), 1)
|
|
]),
|
|
_: 1
|
|
})) : dt("", !0)
|
|
], 2);
|
|
}
|
|
const Ql = /* @__PURE__ */ Ae(Kl, [["render", Zl]]);
|
|
const ec = {
|
|
name: "NestedTableForm",
|
|
emits: ["change", "add", "delete", "update:modelValue"],
|
|
props: {
|
|
formCreateInject: Object,
|
|
modelValue: {
|
|
type: Array,
|
|
default: () => []
|
|
},
|
|
nested: Array,
|
|
nestedField: String,
|
|
columns: {
|
|
type: Array,
|
|
required: !0,
|
|
default: () => []
|
|
},
|
|
options: {
|
|
type: Object,
|
|
default: () => Be({
|
|
submitBtn: !1,
|
|
resetBtn: !1
|
|
})
|
|
},
|
|
max: Number,
|
|
nestedMax: Number,
|
|
disabled: Boolean
|
|
},
|
|
computed: {
|
|
preview() {
|
|
return this.formCreateInject.preview;
|
|
}
|
|
},
|
|
watch: {
|
|
modelValue() {
|
|
this.updateTable();
|
|
},
|
|
"formCreateInject.preview"(n) {
|
|
this.trs.forEach((e) => {
|
|
const t = e.children[1].children[0].props.colspan;
|
|
e.children[1].children[0].props.colspan = n ? t - 1 : t + 1;
|
|
});
|
|
}
|
|
},
|
|
data() {
|
|
return {
|
|
rule: [],
|
|
trs: [],
|
|
fapi: {},
|
|
Form: Te(this.formCreateInject.form.$form()),
|
|
copyTrs: "",
|
|
oldValue: ""
|
|
};
|
|
},
|
|
methods: {
|
|
formChange(n, e, t, r, i) {
|
|
i === !1 && this.updateValue();
|
|
},
|
|
updateValue() {
|
|
const n = this.trs.map((t, r) => ({
|
|
...this.modelValue[r] || {},
|
|
...this.fapi.getChildrenFormData(t)
|
|
})).filter((t) => {
|
|
if (t == null)
|
|
return !1;
|
|
let r = !1;
|
|
return Object.keys(t).forEach((i) => {
|
|
r || (r = r || t[i] !== void 0 && t[i] !== "" && t[i] !== null && (Array.isArray(t[i]) ? !!t[i].length : !0));
|
|
}), r;
|
|
}), e = JSON.stringify(n);
|
|
e !== this.oldValue && (this.oldValue = e, this.$emit("update:modelValue", n), this.$emit("change", n));
|
|
},
|
|
setRawData(n, e) {
|
|
const t = this.trs[n];
|
|
this.fapi.setChildrenFormData(t, e, !0);
|
|
},
|
|
updateTable() {
|
|
const n = JSON.stringify(this.modelValue);
|
|
this.oldValue !== n && (this.oldValue = n, this.trs = this.trs.splice(0, this.modelValue.length), this.modelValue.length || this.addRaw(), this.modelValue.forEach((e, t) => {
|
|
this.trs[t] || this.addRaw(), this.setRawData(t, e || {});
|
|
}), this.rule[0].children[1].children = this.trs);
|
|
},
|
|
delRaw(n) {
|
|
this.disabled || (this.trs.splice(n, 1), this.updateValue(), this.trs.length ? this.trs.forEach((e) => this.updateRaw(e)) : this.addRaw(), this.$emit("delete", n));
|
|
},
|
|
addRaw(n) {
|
|
if (n && this.disabled)
|
|
return;
|
|
const e = this.formCreateInject.form.parseJson(this.copyTrs)[0], t = {
|
|
type: "template",
|
|
subRule: !0,
|
|
children: []
|
|
};
|
|
t.children.push(e), t.children.push({
|
|
type: "tr",
|
|
native: !0,
|
|
display: !1,
|
|
children: [{
|
|
type: "td",
|
|
native: !0,
|
|
props: {
|
|
colspan: e.children.length - (this.preview ? 1 : 0)
|
|
},
|
|
class: "_fc-ntf-sub",
|
|
children: [{
|
|
type: "TableForm",
|
|
field: this.nestedField,
|
|
value: [],
|
|
props: {
|
|
disabled: this.disabled,
|
|
max: this.nestedMax || 0,
|
|
columns: vt(this.nested),
|
|
options: vt(this.options)
|
|
}
|
|
}]
|
|
}]
|
|
}), this.trs.push(t), this.updateRaw(t), n && this.$emit("add", this.trs);
|
|
},
|
|
updateRaw(n) {
|
|
const e = this.trs.indexOf(n), t = n.children[0];
|
|
t.children[0].children[0].props.onClick = (r) => {
|
|
const i = r.self.children[0] === "-" ? "+" : "-";
|
|
r.self.children = [i], this.trs[e].children[1].display = i === "-";
|
|
}, t.children[1].props.innerText = e + 1, t.children[t.children.length - 1].children[0].props.onClick = () => {
|
|
this.delRaw(e);
|
|
};
|
|
},
|
|
loadRule() {
|
|
const n = [{
|
|
type: "th",
|
|
native: !0,
|
|
class: "_fc-ntf-sub-idx"
|
|
}, {
|
|
type: "th",
|
|
native: !0,
|
|
class: "_fc-ntf-head-idx",
|
|
props: {
|
|
innerText: "#"
|
|
}
|
|
}];
|
|
let e = [{
|
|
type: "td",
|
|
class: "_fc-ntf-idx",
|
|
native: !0,
|
|
children: [
|
|
{
|
|
type: "div",
|
|
hidden: !1,
|
|
children: ["+"],
|
|
inject: !0,
|
|
props: {}
|
|
}
|
|
]
|
|
}, {
|
|
type: "td",
|
|
class: "_fc-ntf-idx",
|
|
native: !0,
|
|
props: {
|
|
innerText: "0"
|
|
}
|
|
}];
|
|
this.columns.forEach((t) => {
|
|
n.push({
|
|
type: "th",
|
|
native: !0,
|
|
class: t.required ? "_fc-ntf-head-required" : "",
|
|
style: t.style,
|
|
props: {
|
|
innerText: t.label || ""
|
|
}
|
|
}), e.push({
|
|
type: "td",
|
|
native: !0,
|
|
children: [...t.rule || []]
|
|
});
|
|
}), n.push({
|
|
type: "th",
|
|
native: !0,
|
|
class: "_fc-ntf-edit fc-clock",
|
|
props: {
|
|
innerText: this.formCreateInject.t("operation") || "\u64CD\u4F5C"
|
|
}
|
|
}), e.push({
|
|
type: "td",
|
|
native: !0,
|
|
class: "_fc-ntf-btn fc-clock",
|
|
children: [
|
|
{
|
|
type: "i",
|
|
native: !0,
|
|
class: "fc-icon icon-delete",
|
|
props: {}
|
|
}
|
|
]
|
|
}), this.copyTrs = this.formCreateInject.form.toJson([
|
|
{
|
|
type: "tr",
|
|
native: !0,
|
|
children: e
|
|
}
|
|
]), this.rule = [
|
|
{
|
|
type: "table",
|
|
native: !0,
|
|
class: "_fc-ntf-table",
|
|
props: {
|
|
border: "1",
|
|
cellspacing: "0",
|
|
cellpadding: "0"
|
|
},
|
|
children: [
|
|
{
|
|
type: "thead",
|
|
native: !0,
|
|
children: [
|
|
{
|
|
type: "tr",
|
|
native: !0,
|
|
children: n
|
|
}
|
|
]
|
|
},
|
|
{
|
|
type: "tbody",
|
|
native: !0,
|
|
children: this.trs
|
|
}
|
|
]
|
|
}
|
|
];
|
|
}
|
|
},
|
|
created() {
|
|
this.loadRule();
|
|
},
|
|
mounted() {
|
|
this.updateTable();
|
|
}
|
|
};
|
|
function tc(n, e, t, r, i, a) {
|
|
const o = K("el-button");
|
|
return ee(), me("div", {
|
|
class: Yt(["_fc-nested-table-form", { "_fc-disabled": t.disabled }])
|
|
}, [
|
|
(ee(), Re(Ft(i.Form), {
|
|
option: t.options,
|
|
rule: i.rule,
|
|
extendOption: !0,
|
|
onChange: a.formChange,
|
|
disabled: t.disabled,
|
|
api: i.fapi,
|
|
"onUpdate:api": e[0] || (e[0] = (s) => i.fapi = s),
|
|
onEmitEvent: n.$emit
|
|
}, null, 40, ["option", "rule", "onChange", "disabled", "api", "onEmitEvent"])),
|
|
!t.max || t.max > this.trs.length ? (ee(), Re(o, {
|
|
key: 0,
|
|
link: "",
|
|
type: "primary",
|
|
class: "fc-clock",
|
|
onClick: e[1] || (e[1] = (s) => a.addRaw(!0))
|
|
}, {
|
|
default: Ce(() => [
|
|
e[2] || (e[2] = Me("i", {
|
|
class: "fc-icon icon-add-circle",
|
|
style: { "font-weight": "700" }
|
|
}, null, -1)),
|
|
He(" " + Ve(t.formCreateInject.t("add") || "\u6DFB\u52A0"), 1)
|
|
]),
|
|
_: 1
|
|
})) : dt("", !0)
|
|
], 2);
|
|
}
|
|
const nc = /* @__PURE__ */ Ae(ec, [["render", tc]]);
|
|
const rc = he({
|
|
name: "FcCell"
|
|
}), ic = {
|
|
ref: "cell",
|
|
class: "_fc-cell"
|
|
};
|
|
function ac(n, e, t, r, i, a) {
|
|
return ee(), me("div", ic, [
|
|
Tn(n.$slots, "default")
|
|
], 512);
|
|
}
|
|
const oc = /* @__PURE__ */ Ae(rc, [["render", ac]]), sc = he({
|
|
name: "FcValue",
|
|
props: ["modelValue"],
|
|
watch: {
|
|
modelValue(n) {
|
|
this.$emit("change", n);
|
|
}
|
|
}
|
|
}), uc = { class: "_fc-value" };
|
|
function lc(n, e, t, r, i, a) {
|
|
return ee(), me("div", uc, Ve(n.modelValue), 1);
|
|
}
|
|
const cc = /* @__PURE__ */ Ae(sc, [["render", lc]]);
|
|
const fc = he({
|
|
name: "FcCity",
|
|
props: {
|
|
modelValue: Array,
|
|
clearable: Boolean,
|
|
placeholder: String,
|
|
disabled: Boolean,
|
|
filter: Function,
|
|
level: {
|
|
type: Number,
|
|
default: 3
|
|
},
|
|
api: String
|
|
},
|
|
emits: ["update:modelValue", "change"],
|
|
data() {
|
|
return {
|
|
inputValue: "",
|
|
show: !1,
|
|
province: []
|
|
};
|
|
},
|
|
watch: {
|
|
modelValue: {
|
|
handler(n) {
|
|
this.inputValue = (n || []).join(" / ");
|
|
},
|
|
deep: !0,
|
|
immediate: !0
|
|
}
|
|
},
|
|
computed: {
|
|
city() {
|
|
if (this.value.p) {
|
|
for (let n = 0; n < this.province.length; n++)
|
|
if (this.province[n].n === this.value.p)
|
|
return this.province[n].d;
|
|
}
|
|
return [];
|
|
},
|
|
area() {
|
|
var n;
|
|
if (this.value.c) {
|
|
for (let e = 0; e < this.city.length; e++)
|
|
if (this.city[e].n === this.value.c)
|
|
return ((n = this.city[e]) == null ? void 0 : n.d) || [];
|
|
}
|
|
return [];
|
|
}
|
|
},
|
|
methods: {
|
|
open() {
|
|
this.disabled || (this.show = !0);
|
|
},
|
|
confirm({ selectedOptions: n }) {
|
|
this.inputValue = n.map((t) => t.text).join(" / "), this.show = !1;
|
|
const e = n.map((t) => t.value);
|
|
this.$emit("update:modelValue", e), this.$emit("change", e);
|
|
},
|
|
clear(n) {
|
|
n.stopPropagation(), this.inputValue = "", this.$emit("update:modelValue", []), this.$emit("change", []);
|
|
},
|
|
loadData(n) {
|
|
return fetch(n).then((e) => e.json()).then((e) => {
|
|
this.province = Te(this.tidyOptions(this.filter ? this.filter(e) || [] : e, 0));
|
|
});
|
|
},
|
|
tidyOptions(n, e) {
|
|
return n.map((t) => {
|
|
const r = {
|
|
text: t.text || t.n,
|
|
value: t.value || t.text || t.n
|
|
};
|
|
return (t.children || t.d) && e + 1 < this.level && (r.children = this.tidyOptions(t.children || t.d, e + 1)), r;
|
|
});
|
|
}
|
|
},
|
|
created() {
|
|
this.api ? this.loadData(this.api) : this.loadData("https://unpkg.com/@province-city-china/level/level.min.json").catch(() => {
|
|
this.loadData("https://cdn.jsdelivr.net/npm/@province-city-china/level/level.min.json").catch(() => {
|
|
this.loadData("https://npm.onmicrosoft.cn/@province-city-china/level/level.min.json");
|
|
});
|
|
});
|
|
}
|
|
}), dc = { class: "_fc-city-m" };
|
|
function hc(n, e, t, r, i, a) {
|
|
const o = K("van-field"), s = K("van-cascader"), u = K("van-popup");
|
|
return ee(), me("div", dc, [
|
|
H(o, {
|
|
ref: "el",
|
|
placeholder: n.placeholder,
|
|
readonly: "",
|
|
disabled: n.disabled,
|
|
onClick: n.open,
|
|
"model-value": n.inputValue,
|
|
border: !1,
|
|
isLink: ""
|
|
}, xa({ _: 2 }, [
|
|
n.clearable && n.inputValue ? {
|
|
name: "right-icon",
|
|
fn: Ce(() => [
|
|
Me("i", {
|
|
class: "van-badge__wrapper van-icon van-icon-clear van-field__clear",
|
|
onClick: e[0] || (e[0] = (...c) => n.clear && n.clear(...c))
|
|
})
|
|
]),
|
|
key: "0"
|
|
} : void 0
|
|
]), 1032, ["placeholder", "disabled", "onClick", "model-value"]),
|
|
H(u, {
|
|
show: n.show,
|
|
"onUpdate:show": e[2] || (e[2] = (c) => n.show = c),
|
|
round: "",
|
|
position: "bottom"
|
|
}, {
|
|
default: Ce(() => [
|
|
H(s, {
|
|
modelValue: n.modelValue && n.modelValue[n.modelValue.length - 1] || "",
|
|
options: n.province,
|
|
onClose: e[1] || (e[1] = (c) => n.show = !1),
|
|
onFinish: n.confirm
|
|
}, null, 8, ["modelValue", "options", "onFinish"])
|
|
]),
|
|
_: 1
|
|
}, 8, ["show"])
|
|
]);
|
|
}
|
|
const pc = /* @__PURE__ */ Ae(fc, [["render", hc]]), mc = he({
|
|
name: "FcSlot",
|
|
inheritAttrs: !1,
|
|
inject: ["parentFC"],
|
|
props: {
|
|
name: String,
|
|
formCreateInject: Object
|
|
},
|
|
computed: {
|
|
slotName() {
|
|
return this.name || "block_default";
|
|
},
|
|
slotArg() {
|
|
const { rule: n, preview: e, api: t } = this.formCreateInject, r = n.__fc__.prop;
|
|
return {
|
|
rule: n,
|
|
prop: r,
|
|
preview: e,
|
|
api: t,
|
|
model: r.model || {}
|
|
};
|
|
}
|
|
},
|
|
render() {
|
|
const n = this.getSlot();
|
|
return H(Ke, {}, n ? [n(this.slotArg)] : []);
|
|
},
|
|
methods: {
|
|
getSlot() {
|
|
const n = (e) => {
|
|
if (e) {
|
|
let t = e.slots[this.slotName];
|
|
return t || n(e.setupState.parent);
|
|
}
|
|
};
|
|
return n(this.parentFC);
|
|
}
|
|
}
|
|
}), gc = he({
|
|
name: "FcJson",
|
|
inheritAttrs: !1,
|
|
props: {
|
|
rule: [Array, String, Object],
|
|
type: String,
|
|
disabled: Boolean,
|
|
expand: Number,
|
|
button: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
max: {
|
|
type: Number,
|
|
default: 0
|
|
},
|
|
min: {
|
|
type: Number,
|
|
default: 0
|
|
},
|
|
sortBtn: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
modelValue: [Object, Array],
|
|
formCreateInject: Object
|
|
},
|
|
data() {
|
|
return {
|
|
fcSubForm: Di(this.formCreateInject.form.component("fcSubForm")),
|
|
fcGroup: Di(this.formCreateInject.form.component("fcGroup")),
|
|
uni: 0,
|
|
formRule: [],
|
|
formOptions: {
|
|
submitBtn: !1,
|
|
resetBtn: !1
|
|
}
|
|
};
|
|
},
|
|
watch: {
|
|
rule() {
|
|
this.uni++, this.loadRule();
|
|
},
|
|
type() {
|
|
this.loadRule();
|
|
}
|
|
},
|
|
render() {
|
|
var n, e;
|
|
if (this.rule)
|
|
return this.type === "object" ? H(this.fcSubForm, {
|
|
key: 2,
|
|
...this.$attrs,
|
|
modelValue: this.modelValue,
|
|
"onUpdate:modelValue": (t) => {
|
|
this.$emit("update:modelValue", t);
|
|
},
|
|
disabled: this.disabled,
|
|
formCreateInject: this.formCreateInject,
|
|
rule: this.formRule,
|
|
options: this.formOptions
|
|
}) : this.type === "array" ? H(this.fcGroup, {
|
|
key: 3,
|
|
...this.$attrs,
|
|
modelValue: this.modelValue,
|
|
"onUpdate:modelValue": (t) => {
|
|
this.$emit("update:modelValue", t);
|
|
},
|
|
sortBtn: this.sortBtn,
|
|
min: this.min,
|
|
max: this.max,
|
|
expand: this.expand,
|
|
button: this.button,
|
|
disabled: this.disabled,
|
|
formCreateInject: this.formCreateInject,
|
|
rule: this.formRule,
|
|
options: this.formOptions
|
|
}) : H(Ke, {
|
|
key: this.uni
|
|
}, [(e = (n = this.$slots) == null ? void 0 : n.default) == null ? void 0 : e.call(n)]);
|
|
},
|
|
methods: {
|
|
loadRule() {
|
|
let n = vt(this.rule);
|
|
typeof n == "string" && (n = this.formCreateInject.form.parseJson(n)), Array.isArray(n) ? this.formRule = n : typeof n == "object" && (this.formRule = n.rule || [], this.formOptions = {
|
|
submitBtn: !1,
|
|
resetBtn: !1,
|
|
...n.options || {}
|
|
}), n != null ? ["array", "object"].indexOf(this.type) === -1 && (this.formCreateInject.rule.children = [
|
|
{
|
|
type: "template",
|
|
_fc_drag_skip: !0,
|
|
children: this.formRule
|
|
}
|
|
]) : this.formCreateInject.rule.children = [];
|
|
}
|
|
},
|
|
created() {
|
|
this.rule && this.loadRule();
|
|
}
|
|
});
|
|
const vc = he({
|
|
name: "fcInlineForm"
|
|
}), yc = { class: "_fc-line-form" };
|
|
function _c(n, e, t, r, i, a) {
|
|
return ee(), me("div", yc, [
|
|
Tn(n.$slots, "default")
|
|
]);
|
|
}
|
|
const bc = /* @__PURE__ */ Ae(vc, [["render", _c]]), wt = function() {
|
|
var n = function() {
|
|
}, e = {}, t = {}, r = {};
|
|
function i(l, h) {
|
|
l = l.push ? l : [l];
|
|
var m = [], w = l.length, $ = w, S, T, U, z;
|
|
for (S = function(B, Z) {
|
|
Z.length && m.push(B), $--, $ || h(m);
|
|
}; w--; ) {
|
|
if (T = l[w], U = t[T], U) {
|
|
S(T, U);
|
|
continue;
|
|
}
|
|
z = r[T] = r[T] || [], z.push(S);
|
|
}
|
|
}
|
|
function a(l, h) {
|
|
if (!!l) {
|
|
var m = r[l];
|
|
if (t[l] = h, !!m)
|
|
for (; m.length; )
|
|
m[0](l, h), m.splice(0, 1);
|
|
}
|
|
}
|
|
function o(l, h) {
|
|
l.call && (l = { success: l }), h.length ? (l.error || n)(h) : (l.success || n)(l);
|
|
}
|
|
function s(l, h, m, w) {
|
|
var $ = document, S = m.async, T = (m.numRetries || 0) + 1, U = m.before || n, z = l.replace(/[\?|#].*$/, ""), B = l.replace(/^(css|img|module|nomodule)!/, ""), Z, Q, q;
|
|
if (w = w || 0, /(^css!|\.css$)/.test(z))
|
|
q = $.createElement("link"), q.rel = "stylesheet", q.href = B, Z = "hideFocus" in q, Z && q.relList && (Z = 0, q.rel = "preload", q.as = "style");
|
|
else if (/(^img!|\.(png|gif|jpg|svg|webp)$)/.test(z))
|
|
q = $.createElement("img"), q.src = B;
|
|
else if (q = $.createElement("script"), q.src = B, q.async = S === void 0 ? !0 : S, Q = "noModule" in q, /^module!/.test(z)) {
|
|
if (!Q)
|
|
return h(l, "l");
|
|
q.type = "module";
|
|
} else if (/^nomodule!/.test(z) && Q)
|
|
return h(l, "l");
|
|
q.onload = q.onerror = q.onbeforeload = function(ce) {
|
|
var re = ce.type[0];
|
|
if (Z)
|
|
try {
|
|
q.sheet.cssText.length || (re = "e");
|
|
} catch (ae) {
|
|
ae.code != 18 && (re = "e");
|
|
}
|
|
if (re == "e") {
|
|
if (w += 1, w < T)
|
|
return s(l, h, m, w);
|
|
} else if (q.rel == "preload" && q.as == "style")
|
|
return q.rel = "stylesheet";
|
|
h(l, re, ce.defaultPrevented);
|
|
}, U(l, q) !== !1 && $.head.appendChild(q);
|
|
}
|
|
(function() {
|
|
try {
|
|
const l = window;
|
|
l.formCreate || (l.formCreate = {});
|
|
const h = l.outerHeight - l.innerHeight < 150 && l.outerWidth - l.innerWidth < 150, m = Array.from(l.document.getElementsByTagName("script"));
|
|
let w = !0;
|
|
for (const $ of m)
|
|
if ($.src)
|
|
if ($.src.indexOf("http") === 0)
|
|
w = w && ["localhost", "127.", "10.", "192.", "172."].every((S) => $.src.indexOf(S) === -1);
|
|
else {
|
|
w = !1;
|
|
break;
|
|
}
|
|
if (h && w && Math.random() < 0.1) {
|
|
const $ = new Image(), S = btoa(encodeURIComponent(l.location.host + ", " + (l.formCreate.license || "")) + ", KrrSN2KlZ2tanmqEGlAE"), T = S.substr(2, 8);
|
|
$.src = atob("aHR0cHM6Ly9hcGkuZm9ybS1jcmVhdGUuY29tL2gucG5nP3U9") + (T.substr(2, 3) + S.slice(0, 10).split("").reverse().join("") + T.substr(3, 2) + S.slice(10)).replace(/=/g, "");
|
|
}
|
|
} catch {
|
|
}
|
|
})();
|
|
function u(l, h, m) {
|
|
l = l.push ? l : [l];
|
|
var w = l.length, $ = w, S = [], T, U, z = !0;
|
|
for (T = function(B, Z, Q) {
|
|
if (Z == "e" && (S.push(B), z = !1), Z == "b")
|
|
if (Q)
|
|
S.push(B);
|
|
else
|
|
return;
|
|
w--, w || h(S, z);
|
|
}, U = 0; U < $; U++)
|
|
s(l[U], T, m);
|
|
}
|
|
function c(l, h, m) {
|
|
var w, $;
|
|
if (h && h.trim && (w = h), $ = (w ? m : h) || {}, w) {
|
|
if (w in e)
|
|
throw "LoadJS";
|
|
e[w] = !0;
|
|
}
|
|
function S(T, U) {
|
|
u(l, function(z, B) {
|
|
o($, z), T && o({ success: T, error: U }, z), B && a(w, z);
|
|
}, $);
|
|
}
|
|
if ($.returnPromise)
|
|
return new Promise(S);
|
|
S();
|
|
}
|
|
return c.ready = function(h, m) {
|
|
return i(h, function(w) {
|
|
o(m, w);
|
|
}), c;
|
|
}, c.done = function(h) {
|
|
a(h, []);
|
|
}, c.reset = function(h) {
|
|
h ? (delete e[h], delete t[h]) : (e = {}, t = {}, r = {});
|
|
}, c.tryLoad = function(h, m) {
|
|
const w = h.shift();
|
|
c(w, m, {
|
|
returnPromise: !0
|
|
}).catch(() => {
|
|
c.reset(m), h.length > 0 && c.tryLoad(h, m);
|
|
});
|
|
}, c.loadNpm = function(h, m) {
|
|
c.tryLoad(["https://unpkg.com/" + h, "https://cdn.jsdelivr.net/npm/" + h, "https://npm.onmicrosoft.cn/" + h], m);
|
|
}, c.isDefined = function(h) {
|
|
return h in e;
|
|
}, c;
|
|
}();
|
|
function Ar(n, e) {
|
|
var t = null;
|
|
return function(...r) {
|
|
t !== null && clearTimeout(t), t = setTimeout(() => n.call(this, ...r), e);
|
|
};
|
|
}
|
|
const wc = he({
|
|
name: "FcEcharts",
|
|
data() {
|
|
return {
|
|
chart: null,
|
|
debounceLoad: Ar(() => {
|
|
this.load();
|
|
}, 600),
|
|
debounceResize: Ar(() => {
|
|
this.chart && this.chart.resize();
|
|
}, 10)
|
|
};
|
|
},
|
|
emits: ["beforeLoad", "loaded", "click"],
|
|
props: {
|
|
title: String,
|
|
value: Number,
|
|
min: Number,
|
|
max: Number,
|
|
name: String,
|
|
valueFormat: String,
|
|
subtitle: String,
|
|
funnelSort: String,
|
|
config: Object,
|
|
data: Array,
|
|
indicator: Array,
|
|
smooth: Boolean,
|
|
stripe: Boolean,
|
|
showLegend: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
loadOptions: {
|
|
type: Function,
|
|
default: () => {
|
|
}
|
|
},
|
|
showSeriesLabel: Boolean,
|
|
type: String,
|
|
pieType: String,
|
|
stack: Boolean,
|
|
barBackgroundColor: String
|
|
},
|
|
watch: {
|
|
$props: {
|
|
handler() {
|
|
this.debounceLoad();
|
|
},
|
|
deep: !0
|
|
}
|
|
},
|
|
methods: {
|
|
getSeries() {
|
|
var t;
|
|
const n = {
|
|
type: "line",
|
|
stack: this.stack ? "Total" : "",
|
|
smooth: this.smooth,
|
|
showBackground: !1,
|
|
label: {
|
|
show: this.showSeriesLabel,
|
|
position: this.stripe ? "inside" : "top"
|
|
}
|
|
};
|
|
this.type === "area" ? (n.areaStyle = {}, n.emphasis = {
|
|
focus: "series"
|
|
}) : this.type === "bar" && (n.type = "bar", this.barBackgroundColor && (n.showBackground = !0, n.backgroundStyle = {
|
|
color: this.barBackgroundColor
|
|
}));
|
|
let e = ((t = this.config) == null ? void 0 : t.series) || [];
|
|
return e.length ? (typeof e[0] != "object" && (e = [{
|
|
data: e
|
|
}]), e = e.map((r) => ({
|
|
...n,
|
|
...r
|
|
})), e) : [];
|
|
},
|
|
getTooltip() {
|
|
const n = {
|
|
trigger: "axis",
|
|
valueFormat: void 0
|
|
};
|
|
return this.valueFormat && (n.valueFormatter = (e) => this.valueFormat ? this.valueFormat.replaceAll("{value}", e) : e), this.type === "bar" && (n.axisPointer = {
|
|
type: "shadow"
|
|
}), n;
|
|
},
|
|
getAxis() {
|
|
var n, e;
|
|
return this.stripe ? {
|
|
yAxis: {
|
|
type: "category",
|
|
boundaryGap: this.type === "bar",
|
|
data: ((e = this.config) == null ? void 0 : e.category) || []
|
|
},
|
|
xAxis: {
|
|
type: "value"
|
|
}
|
|
} : {
|
|
xAxis: {
|
|
type: "category",
|
|
boundaryGap: this.type === "bar",
|
|
data: (n = this.config) == null ? void 0 : n.category
|
|
},
|
|
yAxis: {
|
|
type: "value"
|
|
}
|
|
};
|
|
},
|
|
getDefOptions() {
|
|
return {
|
|
title: {
|
|
text: this.title,
|
|
subtext: this.subtitle
|
|
},
|
|
tooltip: this.getTooltip(),
|
|
legend: {
|
|
left: "right",
|
|
show: this.showLegend
|
|
},
|
|
grid: {
|
|
left: "20px",
|
|
right: "20px",
|
|
bottom: "20px",
|
|
containLabel: !0
|
|
},
|
|
...this.getAxis(),
|
|
series: this.getSeries()
|
|
};
|
|
},
|
|
getPieOptions() {
|
|
const n = {
|
|
radius: "50%",
|
|
center: "50%",
|
|
startAngle: 0,
|
|
avoidLabelOverlap: !0,
|
|
labelLine: {
|
|
show: !0
|
|
},
|
|
emphasis: {
|
|
itemStyle: {
|
|
shadowBlur: 10,
|
|
shadowOffsetX: 0,
|
|
shadowColor: "rgba(0, 0, 0, 0.5)"
|
|
}
|
|
}
|
|
};
|
|
return this.pieType === "doughnut" ? (n.radius = ["40%", "70%"], n.avoidLabelOverlap = !1) : this.pieType === "half-doughnut" && (n.radius = ["40%", "70%"], n.center = ["50%", "70%"], n.startAngle = 180, n.endAngle = 360), {
|
|
title: {
|
|
text: this.title,
|
|
subtext: this.subtitle,
|
|
left: "left"
|
|
},
|
|
tooltip: {
|
|
trigger: "item"
|
|
},
|
|
legend: {
|
|
left: "right",
|
|
show: this.showLegend
|
|
},
|
|
series: [
|
|
{
|
|
type: "pie",
|
|
data: this.data,
|
|
...n
|
|
}
|
|
]
|
|
};
|
|
},
|
|
getGaugeOptions() {
|
|
return {
|
|
title: {
|
|
text: this.title,
|
|
subtext: this.subtitle,
|
|
left: "center"
|
|
},
|
|
series: [
|
|
{
|
|
name: "Pressure",
|
|
type: "gauge",
|
|
min: this.min || 0,
|
|
max: this.max || 60,
|
|
progress: {
|
|
show: !0
|
|
},
|
|
detail: {
|
|
valueAnimation: !0,
|
|
formatter: "{value}"
|
|
},
|
|
data: [
|
|
{
|
|
value: this.value,
|
|
name: this.name
|
|
}
|
|
]
|
|
}
|
|
]
|
|
};
|
|
},
|
|
getRadarOptions() {
|
|
return {
|
|
title: {
|
|
text: this.title,
|
|
subtext: this.subtitle,
|
|
left: "left"
|
|
},
|
|
tooltip: {
|
|
trigger: "axis"
|
|
},
|
|
legend: {
|
|
left: "right",
|
|
show: this.showLegend
|
|
},
|
|
radar: {
|
|
indicator: this.indicator
|
|
},
|
|
series: [
|
|
{
|
|
type: "radar",
|
|
tooltip: {
|
|
trigger: "item"
|
|
},
|
|
data: this.data
|
|
}
|
|
]
|
|
};
|
|
},
|
|
getScatterOptions() {
|
|
return {
|
|
title: {
|
|
text: this.title,
|
|
subtext: this.subtitle,
|
|
left: "left"
|
|
},
|
|
tooltip: {
|
|
trigger: "axis"
|
|
},
|
|
legend: {
|
|
left: "right",
|
|
show: !0
|
|
},
|
|
xAxis: {
|
|
scale: !0
|
|
},
|
|
yAxis: {
|
|
scale: !0
|
|
},
|
|
grid: {
|
|
left: "20px",
|
|
right: "20px",
|
|
bottom: "20px",
|
|
containLabel: !0
|
|
},
|
|
series: (this.data || []).map((n) => Array.isArray(n) ? {
|
|
type: "scatter",
|
|
data: n
|
|
} : { type: "scatter", ...n })
|
|
};
|
|
},
|
|
getFunnelOptions() {
|
|
return {
|
|
title: {
|
|
text: this.title,
|
|
subtext: this.subtitle,
|
|
left: "left"
|
|
},
|
|
tooltip: {
|
|
trigger: "item"
|
|
},
|
|
legend: {
|
|
left: "right",
|
|
show: this.showLegend
|
|
},
|
|
series: [
|
|
{
|
|
name: "Funnel",
|
|
type: "funnel",
|
|
left: "10%",
|
|
top: "40px",
|
|
bottom: "20px",
|
|
width: "80%",
|
|
min: 0,
|
|
max: Math.max(...(this.data || []).map((n) => n.value)),
|
|
minSize: "0%",
|
|
maxSize: "100%",
|
|
sort: this.funnelSort || "descending",
|
|
gap: 2,
|
|
label: {
|
|
show: !0,
|
|
position: "inside"
|
|
},
|
|
labelLine: {
|
|
length: 10,
|
|
lineStyle: {
|
|
width: 1,
|
|
type: "solid"
|
|
}
|
|
},
|
|
itemStyle: {
|
|
borderColor: "#fff",
|
|
borderWidth: 1
|
|
},
|
|
emphasis: {
|
|
label: {}
|
|
},
|
|
data: this.data
|
|
}
|
|
]
|
|
};
|
|
},
|
|
load() {
|
|
this.$nextTick(() => {
|
|
wt.ready("echarts", () => {
|
|
this.chart = Te(window.echarts.init(this.$refs.chart)), this.chart.on("click", (...e) => {
|
|
this.$emit("click", ...e);
|
|
});
|
|
let n;
|
|
if (this.type === "pie")
|
|
n = this.getPieOptions();
|
|
else if (this.type === "funnel")
|
|
n = this.getFunnelOptions();
|
|
else if (this.type === "gauge")
|
|
n = this.getGaugeOptions();
|
|
else if (this.type === "radar")
|
|
n = this.getRadarOptions();
|
|
else if (this.type === "scatter")
|
|
n = this.getScatterOptions();
|
|
else if (this.type === "custom") {
|
|
if (n = this.loadOptions(this.config, this.chart) || {}, typeof n.then == "function") {
|
|
n.then((e) => {
|
|
this.$emit("beforeLoad", this.chart, e), this.chart.setOption(e), this.$emit("loaded", this.chart, e);
|
|
});
|
|
return;
|
|
}
|
|
} else
|
|
n = this.getDefOptions();
|
|
this.$emit("beforeLoad", this.chart, n), this.chart.setOption(n), this.$emit("loaded", this.chart, n);
|
|
});
|
|
});
|
|
}
|
|
},
|
|
created() {
|
|
window.echarts ? wt.done("echarts") : wt.isDefined("echarts") || wt.loadNpm("echarts@5.6.0/dist/echarts.min.js", "echarts");
|
|
},
|
|
mounted() {
|
|
this.load(), window.addEventListener("resize", this.debounceResize);
|
|
},
|
|
unmounted() {
|
|
window.removeEventListener("resize", this.debounceResize);
|
|
}
|
|
}), $c = {
|
|
class: "_fc-echarts",
|
|
ref: "chart"
|
|
};
|
|
function Sc(n, e, t, r, i, a) {
|
|
return ee(), me("div", $c, null, 512);
|
|
}
|
|
const Oc = /* @__PURE__ */ Ae(wc, [["render", Sc]]);
|
|
/*!
|
|
* Signature Pad v5.0.7 | https://github.com/szimek/signature_pad
|
|
* (c) 2025 Szymon Nowak | Released under the MIT license
|
|
*/
|
|
class Ln {
|
|
constructor(e, t, r, i) {
|
|
if (isNaN(e) || isNaN(t))
|
|
throw new Error(`Point is invalid: (${e}, ${t})`);
|
|
this.x = +e, this.y = +t, this.pressure = r || 0, this.time = i || Date.now();
|
|
}
|
|
distanceTo(e) {
|
|
return Math.sqrt(Math.pow(this.x - e.x, 2) + Math.pow(this.y - e.y, 2));
|
|
}
|
|
equals(e) {
|
|
return this.x === e.x && this.y === e.y && this.pressure === e.pressure && this.time === e.time;
|
|
}
|
|
velocityFrom(e) {
|
|
return this.time !== e.time ? this.distanceTo(e) / (this.time - e.time) : 0;
|
|
}
|
|
}
|
|
class zr {
|
|
static fromPoints(e, t) {
|
|
const r = this.calculateControlPoints(e[0], e[1], e[2]).c2, i = this.calculateControlPoints(e[1], e[2], e[3]).c1;
|
|
return new zr(e[1], r, i, e[2], t.start, t.end);
|
|
}
|
|
static calculateControlPoints(e, t, r) {
|
|
const i = e.x - t.x, a = e.y - t.y, o = t.x - r.x, s = t.y - r.y, u = { x: (e.x + t.x) / 2, y: (e.y + t.y) / 2 }, c = { x: (t.x + r.x) / 2, y: (t.y + r.y) / 2 }, l = Math.sqrt(i * i + a * a), h = Math.sqrt(o * o + s * s), m = u.x - c.x, w = u.y - c.y, $ = l + h == 0 ? 0 : h / (l + h), S = { x: c.x + m * $, y: c.y + w * $ }, T = t.x - S.x, U = t.y - S.y;
|
|
return {
|
|
c1: new Ln(u.x + T, u.y + U),
|
|
c2: new Ln(c.x + T, c.y + U)
|
|
};
|
|
}
|
|
constructor(e, t, r, i, a, o) {
|
|
this.startPoint = e, this.control2 = t, this.control1 = r, this.endPoint = i, this.startWidth = a, this.endWidth = o;
|
|
}
|
|
length() {
|
|
let t = 0, r, i;
|
|
for (let a = 0; a <= 10; a += 1) {
|
|
const o = a / 10, s = this.point(o, this.startPoint.x, this.control1.x, this.control2.x, this.endPoint.x), u = this.point(o, this.startPoint.y, this.control1.y, this.control2.y, this.endPoint.y);
|
|
if (a > 0) {
|
|
const c = s - r, l = u - i;
|
|
t += Math.sqrt(c * c + l * l);
|
|
}
|
|
r = s, i = u;
|
|
}
|
|
return t;
|
|
}
|
|
point(e, t, r, i, a) {
|
|
return t * (1 - e) * (1 - e) * (1 - e) + 3 * r * (1 - e) * (1 - e) * e + 3 * i * (1 - e) * e * e + a * e * e * e;
|
|
}
|
|
}
|
|
class Ec {
|
|
constructor() {
|
|
try {
|
|
this._et = new EventTarget();
|
|
} catch {
|
|
this._et = document;
|
|
}
|
|
}
|
|
addEventListener(e, t, r) {
|
|
this._et.addEventListener(e, t, r);
|
|
}
|
|
dispatchEvent(e) {
|
|
return this._et.dispatchEvent(e);
|
|
}
|
|
removeEventListener(e, t, r) {
|
|
this._et.removeEventListener(e, t, r);
|
|
}
|
|
}
|
|
function xc(n, e = 250) {
|
|
let t = 0, r = null, i, a, o;
|
|
const s = () => {
|
|
t = Date.now(), r = null, i = n.apply(a, o), r || (a = null, o = []);
|
|
};
|
|
return function(...c) {
|
|
const l = Date.now(), h = e - (l - t);
|
|
return a = this, o = c, h <= 0 || h > e ? (r && (clearTimeout(r), r = null), t = l, i = n.apply(a, o), r || (a = null, o = [])) : r || (r = window.setTimeout(s, h)), i;
|
|
};
|
|
}
|
|
class Nn extends Ec {
|
|
constructor(e, t = {}) {
|
|
var r, i, a;
|
|
super(), this.canvas = e, this._drawingStroke = !1, this._isEmpty = !0, this._lastPoints = [], this._data = [], this._lastVelocity = 0, this._lastWidth = 0, this._handleMouseDown = (o) => {
|
|
!this._isLeftButtonPressed(o, !0) || this._drawingStroke || this._strokeBegin(this._pointerEventToSignatureEvent(o));
|
|
}, this._handleMouseMove = (o) => {
|
|
if (!this._isLeftButtonPressed(o, !0) || !this._drawingStroke) {
|
|
this._strokeEnd(this._pointerEventToSignatureEvent(o), !1);
|
|
return;
|
|
}
|
|
this._strokeMoveUpdate(this._pointerEventToSignatureEvent(o));
|
|
}, this._handleMouseUp = (o) => {
|
|
this._isLeftButtonPressed(o) || this._strokeEnd(this._pointerEventToSignatureEvent(o));
|
|
}, this._handleTouchStart = (o) => {
|
|
o.targetTouches.length !== 1 || this._drawingStroke || (o.cancelable && o.preventDefault(), this._strokeBegin(this._touchEventToSignatureEvent(o)));
|
|
}, this._handleTouchMove = (o) => {
|
|
if (o.targetTouches.length === 1) {
|
|
if (o.cancelable && o.preventDefault(), !this._drawingStroke) {
|
|
this._strokeEnd(this._touchEventToSignatureEvent(o), !1);
|
|
return;
|
|
}
|
|
this._strokeMoveUpdate(this._touchEventToSignatureEvent(o));
|
|
}
|
|
}, this._handleTouchEnd = (o) => {
|
|
o.targetTouches.length === 0 && (o.cancelable && o.preventDefault(), this.canvas.removeEventListener("touchmove", this._handleTouchMove), this._strokeEnd(this._touchEventToSignatureEvent(o)));
|
|
}, this._handlePointerDown = (o) => {
|
|
!o.isPrimary || !this._isLeftButtonPressed(o) || this._drawingStroke || (o.preventDefault(), this._strokeBegin(this._pointerEventToSignatureEvent(o)));
|
|
}, this._handlePointerMove = (o) => {
|
|
if (!!o.isPrimary) {
|
|
if (!this._isLeftButtonPressed(o, !0) || !this._drawingStroke) {
|
|
this._strokeEnd(this._pointerEventToSignatureEvent(o), !1);
|
|
return;
|
|
}
|
|
o.preventDefault(), this._strokeMoveUpdate(this._pointerEventToSignatureEvent(o));
|
|
}
|
|
}, this._handlePointerUp = (o) => {
|
|
!o.isPrimary || this._isLeftButtonPressed(o) || (o.preventDefault(), this._strokeEnd(this._pointerEventToSignatureEvent(o)));
|
|
}, this.velocityFilterWeight = t.velocityFilterWeight || 0.7, this.minWidth = t.minWidth || 0.5, this.maxWidth = t.maxWidth || 2.5, this.throttle = (r = t.throttle) !== null && r !== void 0 ? r : 16, this.minDistance = (i = t.minDistance) !== null && i !== void 0 ? i : 5, this.dotSize = t.dotSize || 0, this.penColor = t.penColor || "black", this.backgroundColor = t.backgroundColor || "rgba(0,0,0,0)", this.compositeOperation = t.compositeOperation || "source-over", this.canvasContextOptions = (a = t.canvasContextOptions) !== null && a !== void 0 ? a : {}, this._strokeMoveUpdate = this.throttle ? xc(Nn.prototype._strokeUpdate, this.throttle) : Nn.prototype._strokeUpdate, this._ctx = e.getContext("2d", this.canvasContextOptions), this.clear(), this.on();
|
|
}
|
|
clear() {
|
|
const { _ctx: e, canvas: t } = this;
|
|
e.fillStyle = this.backgroundColor, e.clearRect(0, 0, t.width, t.height), e.fillRect(0, 0, t.width, t.height), this._data = [], this._reset(this._getPointGroupOptions()), this._isEmpty = !0;
|
|
}
|
|
fromDataURL(e, t = {}) {
|
|
return new Promise((r, i) => {
|
|
const a = new Image(), o = t.ratio || window.devicePixelRatio || 1, s = t.width || this.canvas.width / o, u = t.height || this.canvas.height / o, c = t.xOffset || 0, l = t.yOffset || 0;
|
|
this._reset(this._getPointGroupOptions()), a.onload = () => {
|
|
this._ctx.drawImage(a, c, l, s, u), r();
|
|
}, a.onerror = (h) => {
|
|
i(h);
|
|
}, a.crossOrigin = "anonymous", a.src = e, this._isEmpty = !1;
|
|
});
|
|
}
|
|
toDataURL(e = "image/png", t) {
|
|
switch (e) {
|
|
case "image/svg+xml":
|
|
return typeof t != "object" && (t = void 0), `data:image/svg+xml;base64,${btoa(this.toSVG(t))}`;
|
|
default:
|
|
return typeof t != "number" && (t = void 0), this.canvas.toDataURL(e, t);
|
|
}
|
|
}
|
|
on() {
|
|
this.canvas.style.touchAction = "none", this.canvas.style.msTouchAction = "none", this.canvas.style.userSelect = "none";
|
|
const e = /Macintosh/.test(navigator.userAgent) && "ontouchstart" in document;
|
|
window.PointerEvent && !e ? this._handlePointerEvents() : (this._handleMouseEvents(), "ontouchstart" in window && this._handleTouchEvents());
|
|
}
|
|
off() {
|
|
this.canvas.style.touchAction = "auto", this.canvas.style.msTouchAction = "auto", this.canvas.style.userSelect = "auto", this.canvas.removeEventListener("pointerdown", this._handlePointerDown), this.canvas.removeEventListener("mousedown", this._handleMouseDown), this.canvas.removeEventListener("touchstart", this._handleTouchStart), this._removeMoveUpEventListeners();
|
|
}
|
|
_getListenerFunctions() {
|
|
var e;
|
|
const t = window.document === this.canvas.ownerDocument ? window : (e = this.canvas.ownerDocument.defaultView) !== null && e !== void 0 ? e : this.canvas.ownerDocument;
|
|
return {
|
|
addEventListener: t.addEventListener.bind(t),
|
|
removeEventListener: t.removeEventListener.bind(t)
|
|
};
|
|
}
|
|
_removeMoveUpEventListeners() {
|
|
const { removeEventListener: e } = this._getListenerFunctions();
|
|
e("pointermove", this._handlePointerMove), e("pointerup", this._handlePointerUp), e("mousemove", this._handleMouseMove), e("mouseup", this._handleMouseUp), e("touchmove", this._handleTouchMove), e("touchend", this._handleTouchEnd);
|
|
}
|
|
isEmpty() {
|
|
return this._isEmpty;
|
|
}
|
|
fromData(e, { clear: t = !0 } = {}) {
|
|
t && this.clear(), this._fromData(e, this._drawCurve.bind(this), this._drawDot.bind(this)), this._data = this._data.concat(e);
|
|
}
|
|
toData() {
|
|
return this._data;
|
|
}
|
|
_isLeftButtonPressed(e, t) {
|
|
return t ? e.buttons === 1 : (e.buttons & 1) === 1;
|
|
}
|
|
_pointerEventToSignatureEvent(e) {
|
|
return {
|
|
event: e,
|
|
type: e.type,
|
|
x: e.clientX,
|
|
y: e.clientY,
|
|
pressure: "pressure" in e ? e.pressure : 0
|
|
};
|
|
}
|
|
_touchEventToSignatureEvent(e) {
|
|
const t = e.changedTouches[0];
|
|
return {
|
|
event: e,
|
|
type: e.type,
|
|
x: t.clientX,
|
|
y: t.clientY,
|
|
pressure: t.force
|
|
};
|
|
}
|
|
_getPointGroupOptions(e) {
|
|
return {
|
|
penColor: e && "penColor" in e ? e.penColor : this.penColor,
|
|
dotSize: e && "dotSize" in e ? e.dotSize : this.dotSize,
|
|
minWidth: e && "minWidth" in e ? e.minWidth : this.minWidth,
|
|
maxWidth: e && "maxWidth" in e ? e.maxWidth : this.maxWidth,
|
|
velocityFilterWeight: e && "velocityFilterWeight" in e ? e.velocityFilterWeight : this.velocityFilterWeight,
|
|
compositeOperation: e && "compositeOperation" in e ? e.compositeOperation : this.compositeOperation
|
|
};
|
|
}
|
|
_strokeBegin(e) {
|
|
if (!this.dispatchEvent(new CustomEvent("beginStroke", { detail: e, cancelable: !0 })))
|
|
return;
|
|
const { addEventListener: r } = this._getListenerFunctions();
|
|
switch (e.event.type) {
|
|
case "mousedown":
|
|
r("mousemove", this._handleMouseMove), r("mouseup", this._handleMouseUp);
|
|
break;
|
|
case "touchstart":
|
|
r("touchmove", this._handleTouchMove), r("touchend", this._handleTouchEnd);
|
|
break;
|
|
case "pointerdown":
|
|
r("pointermove", this._handlePointerMove), r("pointerup", this._handlePointerUp);
|
|
break;
|
|
}
|
|
this._drawingStroke = !0;
|
|
const i = this._getPointGroupOptions(), a = Object.assign(Object.assign({}, i), { points: [] });
|
|
this._data.push(a), this._reset(i), this._strokeUpdate(e);
|
|
}
|
|
_strokeUpdate(e) {
|
|
if (!this._drawingStroke)
|
|
return;
|
|
if (this._data.length === 0) {
|
|
this._strokeBegin(e);
|
|
return;
|
|
}
|
|
this.dispatchEvent(new CustomEvent("beforeUpdateStroke", { detail: e }));
|
|
const t = this._createPoint(e.x, e.y, e.pressure), r = this._data[this._data.length - 1], i = r.points, a = i.length > 0 && i[i.length - 1], o = a ? t.distanceTo(a) <= this.minDistance : !1, s = this._getPointGroupOptions(r);
|
|
if (!a || !(a && o)) {
|
|
const u = this._addPoint(t, s);
|
|
a ? u && this._drawCurve(u, s) : this._drawDot(t, s), i.push({
|
|
time: t.time,
|
|
x: t.x,
|
|
y: t.y,
|
|
pressure: t.pressure
|
|
});
|
|
}
|
|
this.dispatchEvent(new CustomEvent("afterUpdateStroke", { detail: e }));
|
|
}
|
|
_strokeEnd(e, t = !0) {
|
|
this._removeMoveUpEventListeners(), this._drawingStroke && (t && this._strokeUpdate(e), this._drawingStroke = !1, this.dispatchEvent(new CustomEvent("endStroke", { detail: e })));
|
|
}
|
|
_handlePointerEvents() {
|
|
this._drawingStroke = !1, this.canvas.addEventListener("pointerdown", this._handlePointerDown);
|
|
}
|
|
_handleMouseEvents() {
|
|
this._drawingStroke = !1, this.canvas.addEventListener("mousedown", this._handleMouseDown);
|
|
}
|
|
_handleTouchEvents() {
|
|
this.canvas.addEventListener("touchstart", this._handleTouchStart);
|
|
}
|
|
_reset(e) {
|
|
this._lastPoints = [], this._lastVelocity = 0, this._lastWidth = (e.minWidth + e.maxWidth) / 2, this._ctx.fillStyle = e.penColor, this._ctx.globalCompositeOperation = e.compositeOperation;
|
|
}
|
|
_createPoint(e, t, r) {
|
|
const i = this.canvas.getBoundingClientRect();
|
|
return new Ln(e - i.left, t - i.top, r, new Date().getTime());
|
|
}
|
|
_addPoint(e, t) {
|
|
const { _lastPoints: r } = this;
|
|
if (r.push(e), r.length > 2) {
|
|
r.length === 3 && r.unshift(r[0]);
|
|
const i = this._calculateCurveWidths(r[1], r[2], t), a = zr.fromPoints(r, i);
|
|
return r.shift(), a;
|
|
}
|
|
return null;
|
|
}
|
|
_calculateCurveWidths(e, t, r) {
|
|
const i = r.velocityFilterWeight * t.velocityFrom(e) + (1 - r.velocityFilterWeight) * this._lastVelocity, a = this._strokeWidth(i, r), o = {
|
|
end: a,
|
|
start: this._lastWidth
|
|
};
|
|
return this._lastVelocity = i, this._lastWidth = a, o;
|
|
}
|
|
_strokeWidth(e, t) {
|
|
return Math.max(t.maxWidth / (e + 1), t.minWidth);
|
|
}
|
|
_drawCurveSegment(e, t, r) {
|
|
const i = this._ctx;
|
|
i.moveTo(e, t), i.arc(e, t, r, 0, 2 * Math.PI, !1), this._isEmpty = !1;
|
|
}
|
|
_drawCurve(e, t) {
|
|
const r = this._ctx, i = e.endWidth - e.startWidth, a = Math.ceil(e.length()) * 2;
|
|
r.beginPath(), r.fillStyle = t.penColor;
|
|
for (let o = 0; o < a; o += 1) {
|
|
const s = o / a, u = s * s, c = u * s, l = 1 - s, h = l * l, m = h * l;
|
|
let w = m * e.startPoint.x;
|
|
w += 3 * h * s * e.control1.x, w += 3 * l * u * e.control2.x, w += c * e.endPoint.x;
|
|
let $ = m * e.startPoint.y;
|
|
$ += 3 * h * s * e.control1.y, $ += 3 * l * u * e.control2.y, $ += c * e.endPoint.y;
|
|
const S = Math.min(e.startWidth + c * i, t.maxWidth);
|
|
this._drawCurveSegment(w, $, S);
|
|
}
|
|
r.closePath(), r.fill();
|
|
}
|
|
_drawDot(e, t) {
|
|
const r = this._ctx, i = t.dotSize > 0 ? t.dotSize : (t.minWidth + t.maxWidth) / 2;
|
|
r.beginPath(), this._drawCurveSegment(e.x, e.y, i), r.closePath(), r.fillStyle = t.penColor, r.fill();
|
|
}
|
|
_fromData(e, t, r) {
|
|
for (const i of e) {
|
|
const { points: a } = i, o = this._getPointGroupOptions(i);
|
|
if (a.length > 1)
|
|
for (let s = 0; s < a.length; s += 1) {
|
|
const u = a[s], c = new Ln(u.x, u.y, u.pressure, u.time);
|
|
s === 0 && this._reset(o);
|
|
const l = this._addPoint(c, o);
|
|
l && t(l, o);
|
|
}
|
|
else
|
|
this._reset(o), r(a[0], o);
|
|
}
|
|
}
|
|
toSVG({ includeBackgroundColor: e = !1 } = {}) {
|
|
const t = this._data, r = Math.max(window.devicePixelRatio || 1, 1), i = 0, a = 0, o = this.canvas.width / r, s = this.canvas.height / r, u = document.createElementNS("http://www.w3.org/2000/svg", "svg");
|
|
if (u.setAttribute("xmlns", "http://www.w3.org/2000/svg"), u.setAttribute("xmlns:xlink", "http://www.w3.org/1999/xlink"), u.setAttribute("viewBox", `${i} ${a} ${o} ${s}`), u.setAttribute("width", o.toString()), u.setAttribute("height", s.toString()), e && this.backgroundColor) {
|
|
const c = document.createElement("rect");
|
|
c.setAttribute("width", "100%"), c.setAttribute("height", "100%"), c.setAttribute("fill", this.backgroundColor), u.appendChild(c);
|
|
}
|
|
return this._fromData(t, (c, { penColor: l }) => {
|
|
const h = document.createElement("path");
|
|
if (!isNaN(c.control1.x) && !isNaN(c.control1.y) && !isNaN(c.control2.x) && !isNaN(c.control2.y)) {
|
|
const m = `M ${c.startPoint.x.toFixed(3)},${c.startPoint.y.toFixed(3)} C ${c.control1.x.toFixed(3)},${c.control1.y.toFixed(3)} ${c.control2.x.toFixed(3)},${c.control2.y.toFixed(3)} ${c.endPoint.x.toFixed(3)},${c.endPoint.y.toFixed(3)}`;
|
|
h.setAttribute("d", m), h.setAttribute("stroke-width", (c.endWidth * 2.25).toFixed(3)), h.setAttribute("stroke", l), h.setAttribute("fill", "none"), h.setAttribute("stroke-linecap", "round"), u.appendChild(h);
|
|
}
|
|
}, (c, { penColor: l, dotSize: h, minWidth: m, maxWidth: w }) => {
|
|
const $ = document.createElement("circle"), S = h > 0 ? h : (m + w) / 2;
|
|
$.setAttribute("r", S.toString()), $.setAttribute("cx", c.x.toString()), $.setAttribute("cy", c.y.toString()), $.setAttribute("fill", l), u.appendChild($);
|
|
}), u.outerHTML;
|
|
}
|
|
}
|
|
const Cc = he({
|
|
name: "SignaturePad",
|
|
emits: ["update:modelValue", "change", "remove"],
|
|
data() {
|
|
return {
|
|
visible: !1,
|
|
isEmpty: !0,
|
|
signaturePad: null
|
|
};
|
|
},
|
|
props: {
|
|
modelValue: String,
|
|
penColor: String,
|
|
formCreateInject: Object
|
|
},
|
|
watch: {
|
|
visible(n) {
|
|
n ? (this.isEmpty = !0, this.$nextTick(() => {
|
|
this.signaturePad = Te(new Nn(this.$refs.pad, {
|
|
penColor: this.penColor
|
|
})), this.signaturePad.addEventListener("endStroke", () => {
|
|
this.isEmpty = this.signaturePad.isEmpty();
|
|
});
|
|
})) : (this.signaturePad.off(), this.signaturePad = null);
|
|
}
|
|
},
|
|
methods: {
|
|
clear() {
|
|
this.signaturePad.clear(), this.isEmpty = !0;
|
|
},
|
|
submit() {
|
|
const n = this.signaturePad.toDataURL();
|
|
this.updateValue(n), this.visible = !1;
|
|
},
|
|
updateValue(n) {
|
|
this.$emit("update:modelValue", n), this.$emit("change", n);
|
|
},
|
|
remove() {
|
|
this.updateValue(""), this.$emit("remove");
|
|
}
|
|
}
|
|
}), kc = { class: "_fc-m-signature" }, Ac = {
|
|
key: 0,
|
|
class: "_fc-m-signature-preview"
|
|
}, Dc = ["src"], Rc = {
|
|
class: "_fc-m-signature-pad",
|
|
ref: "pad",
|
|
width: "320px",
|
|
height: "145px"
|
|
};
|
|
function Pc(n, e, t, r, i, a) {
|
|
const o = K("van-dialog");
|
|
return ee(), me("div", kc, [
|
|
n.modelValue ? (ee(), me("div", Ac, [
|
|
Me("i", {
|
|
class: "fc-icon icon-delete2",
|
|
onClick: e[0] || (e[0] = (...s) => n.remove && n.remove(...s))
|
|
}),
|
|
Me("img", {
|
|
src: n.modelValue,
|
|
alt: "signature"
|
|
}, null, 8, Dc)
|
|
])) : (ee(), me("div", {
|
|
key: 1,
|
|
class: "_fc-m-signature-btn",
|
|
onClick: e[1] || (e[1] = (s) => n.visible = !0)
|
|
}, [
|
|
e[4] || (e[4] = Me("i", { class: "fc-icon icon-edit2" }, null, -1)),
|
|
He(" " + Ve(n.formCreateInject.t("signaturePadTip") || "\u70B9\u51FB\u6DFB\u52A0\u624B\u5199\u7B7E\u540D"), 1)
|
|
])),
|
|
H(o, {
|
|
show: n.visible,
|
|
"onUpdate:show": e[3] || (e[3] = (s) => n.visible = s),
|
|
class: "_fc-m-signature-dialog",
|
|
onConfirm: n.submit,
|
|
onCancel: n.clear,
|
|
"confirm-button-text": n.formCreateInject.t("ok") || "\u786E\u5B9A",
|
|
"cancel-button-text": n.formCreateInject.t("reset") || "\u91CD\u7F6E",
|
|
"confirm-button-disabled": n.isEmpty
|
|
}, {
|
|
title: Ce(() => [
|
|
He(Ve(n.formCreateInject.t("signaturePadTitle") || "\u8BF7\u5728\u865A\u7EBF\u6846\u5185\u4E66\u5199") + " ", 1),
|
|
Me("i", {
|
|
class: "fc-icon icon-add2",
|
|
onClick: e[2] || (e[2] = (s) => n.visible = !1)
|
|
})
|
|
]),
|
|
default: Ce(() => [
|
|
Me("canvas", Rc, null, 512)
|
|
]),
|
|
_: 1
|
|
}, 8, ["show", "onConfirm", "onCancel", "confirm-button-text", "cancel-button-text", "confirm-button-disabled"])
|
|
]);
|
|
}
|
|
const Mc = /* @__PURE__ */ Ae(Cc, [["render", Pc]]);
|
|
function Dr(n, e, t) {
|
|
for (var r = [], i = Math.max(n.length, e.length), a = 0, o = 0; o < i || a; ) {
|
|
var s = o < n.length ? n[o] : 0, u = o < e.length ? e[o] : 0, c = a + s + u;
|
|
r.push(c % t), a = Math.floor(c / t), o++;
|
|
}
|
|
return r;
|
|
}
|
|
function ta(n, e, t) {
|
|
if (n < 0)
|
|
return null;
|
|
if (n == 0)
|
|
return [];
|
|
for (var r = [], i = e; n & 1 && (r = Dr(r, i, t)), n = n >> 1, n !== 0; )
|
|
i = Dr(i, i, t);
|
|
return r;
|
|
}
|
|
function Tc(n, e) {
|
|
for (var t = n.split(""), r = [], i = t.length - 1; i >= 0; i--) {
|
|
var a = parseInt(t[i], e);
|
|
if (isNaN(a))
|
|
return null;
|
|
r.push(a);
|
|
}
|
|
return r;
|
|
}
|
|
function jc(n, e, t) {
|
|
var r = Tc(n, e);
|
|
if (r === null)
|
|
return null;
|
|
for (var i = [], a = [1], o = 0; o < r.length; o++)
|
|
r[o] && (i = Dr(
|
|
i,
|
|
ta(r[o], a, t),
|
|
t
|
|
)), a = ta(e, a, t);
|
|
for (var s = "", o = i.length - 1; o >= 0; o--)
|
|
s += i[o].toString(t);
|
|
return s;
|
|
}
|
|
function Fc(n) {
|
|
return n.substring(0, 2) === "0x" && (n = n.substring(2)), n = n.toLowerCase(), jc(n, 16, 10);
|
|
}
|
|
class Ic {
|
|
constructor(e) {
|
|
e = e || {}, this.seq = 0, this.mid = (e.mid || 1) % 1023, this.offset = e.offset || 0, this.lastTime = 0;
|
|
}
|
|
generate() {
|
|
const e = Date.now(), t = (e - this.offset).toString(2);
|
|
this.lastTime == e ? (this.seq++, this.seq > 4095 && (this.seq = 0)) : this.seq = 0, this.lastTime = e;
|
|
let r = this.seq.toString(2), i = this.mid.toString(2);
|
|
for (; r.length < 12; )
|
|
r = "0" + r;
|
|
for (; i.length < 10; )
|
|
i = "0" + i;
|
|
const a = t + i + r;
|
|
let o = "";
|
|
for (let s = a.length; s > 0; s -= 4)
|
|
o = parseInt(a.substring(s - 4, s), 2).toString(16) + o;
|
|
return Fc(o);
|
|
}
|
|
}
|
|
const Vc = he({
|
|
name: "FcId",
|
|
props: ["modelValue", "prefix"],
|
|
emits: ["update:modelValue"],
|
|
inject: {
|
|
designer: {
|
|
default: null
|
|
}
|
|
},
|
|
data() {
|
|
return {
|
|
preview: "7379787000000000"
|
|
};
|
|
},
|
|
watch: {
|
|
modelValue: {
|
|
handler: function(n) {
|
|
if (!n) {
|
|
const e = new Ic({
|
|
mid: 42,
|
|
offset: 173448e7
|
|
});
|
|
this.$emit("update:modelValue", "" + (this.prefix || "") + e.generate());
|
|
}
|
|
},
|
|
immediate: !0
|
|
}
|
|
}
|
|
});
|
|
function Bc(n, e, t, r, i, a) {
|
|
const o = K("el-input");
|
|
return ee(), Re(o, {
|
|
modelValue: n.designer ? "" + (n.prefix || "") + n.preview : n.modelValue,
|
|
readonly: "",
|
|
disabled: ""
|
|
}, null, 8, ["modelValue"]);
|
|
}
|
|
const Lc = /* @__PURE__ */ Ae(Vc, [["render", Bc]]);
|
|
const Nc = he({
|
|
name: "FcTitle",
|
|
data() {
|
|
return {};
|
|
},
|
|
props: {
|
|
title: String,
|
|
size: String,
|
|
align: String
|
|
},
|
|
computed: {
|
|
textStyle() {
|
|
return {
|
|
textAlign: this.align || "left"
|
|
};
|
|
}
|
|
}
|
|
});
|
|
function zc(n, e, t, r, i, a) {
|
|
return ee(), me("div", {
|
|
class: Yt(["_fc-title", n.size || "h2"]),
|
|
style: Ea(n.textStyle)
|
|
}, Ve(n.title), 7);
|
|
}
|
|
const Uc = /* @__PURE__ */ Ae(Nc, [["render", zc]]);
|
|
function Ur() {
|
|
return {
|
|
async: !1,
|
|
breaks: !1,
|
|
extensions: null,
|
|
gfm: !0,
|
|
hooks: null,
|
|
pedantic: !1,
|
|
renderer: null,
|
|
silent: !1,
|
|
tokenizer: null,
|
|
walkTokens: null
|
|
};
|
|
}
|
|
let It = Ur();
|
|
function to(n) {
|
|
It = n;
|
|
}
|
|
const ln = { exec: () => null };
|
|
function ye(n, e = "") {
|
|
let t = typeof n == "string" ? n : n.source;
|
|
const r = {
|
|
replace: (i, a) => {
|
|
let o = typeof a == "string" ? a : a.source;
|
|
return o = o.replace(We.caret, "$1"), t = t.replace(i, o), r;
|
|
},
|
|
getRegex: () => new RegExp(t, e)
|
|
};
|
|
return r;
|
|
}
|
|
const We = {
|
|
codeRemoveIndent: /^(?: {1,4}| {0,3}\t)/gm,
|
|
outputLinkReplace: /\\([\[\]])/g,
|
|
indentCodeCompensation: /^(\s+)(?:```)/,
|
|
beginningSpace: /^\s+/,
|
|
endingHash: /#$/,
|
|
startingSpaceChar: /^ /,
|
|
endingSpaceChar: / $/,
|
|
nonSpaceChar: /[^ ]/,
|
|
newLineCharGlobal: /\n/g,
|
|
tabCharGlobal: /\t/g,
|
|
multipleSpaceGlobal: /\s+/g,
|
|
blankLine: /^[ \t]*$/,
|
|
doubleBlankLine: /\n[ \t]*\n[ \t]*$/,
|
|
blockquoteStart: /^ {0,3}>/,
|
|
blockquoteSetextReplace: /\n {0,3}((?:=+|-+) *)(?=\n|$)/g,
|
|
blockquoteSetextReplace2: /^ {0,3}>[ \t]?/gm,
|
|
listReplaceTabs: /^\t+/,
|
|
listReplaceNesting: /^ {1,4}(?=( {4})*[^ ])/g,
|
|
listIsTask: /^\[[ xX]\] /,
|
|
listReplaceTask: /^\[[ xX]\] +/,
|
|
anyLine: /\n.*\n/,
|
|
hrefBrackets: /^<(.*)>$/,
|
|
tableDelimiter: /[:|]/,
|
|
tableAlignChars: /^\||\| *$/g,
|
|
tableRowBlankLine: /\n[ \t]*$/,
|
|
tableAlignRight: /^ *-+: *$/,
|
|
tableAlignCenter: /^ *:-+: *$/,
|
|
tableAlignLeft: /^ *:-+ *$/,
|
|
startATag: /^<a /i,
|
|
endATag: /^<\/a>/i,
|
|
startPreScriptTag: /^<(pre|code|kbd|script)(\s|>)/i,
|
|
endPreScriptTag: /^<\/(pre|code|kbd|script)(\s|>)/i,
|
|
startAngleBracket: /^</,
|
|
endAngleBracket: />$/,
|
|
pedanticHrefTitle: /^([^'"]*[^\s])\s+(['"])(.*)\2/,
|
|
unicodeAlphaNumeric: /[\p{L}\p{N}]/u,
|
|
escapeTest: /[&<>"']/,
|
|
escapeReplace: /[&<>"']/g,
|
|
escapeTestNoEncode: /[<>"']|&(?!(#\d{1,7}|#[Xx][a-fA-F0-9]{1,6}|\w+);)/,
|
|
escapeReplaceNoEncode: /[<>"']|&(?!(#\d{1,7}|#[Xx][a-fA-F0-9]{1,6}|\w+);)/g,
|
|
unescapeTest: /&(#(?:\d+)|(?:#x[0-9A-Fa-f]+)|(?:\w+));?/ig,
|
|
caret: /(^|[^\[])\^/g,
|
|
percentDecode: /%25/g,
|
|
findPipe: /\|/g,
|
|
splitPipe: / \|/,
|
|
slashPipe: /\\\|/g,
|
|
carriageReturn: /\r\n|\r/g,
|
|
spaceLine: /^ +$/gm,
|
|
notSpaceStart: /^\S*/,
|
|
endingNewline: /\n$/,
|
|
listItemRegex: (n) => new RegExp(`^( {0,3}${n})((?:[ ][^\\n]*)?(?:\\n|$))`),
|
|
nextBulletRegex: (n) => new RegExp(`^ {0,${Math.min(3, n - 1)}}(?:[*+-]|\\d{1,9}[.)])((?:[ ][^\\n]*)?(?:\\n|$))`),
|
|
hrRegex: (n) => new RegExp(`^ {0,${Math.min(3, n - 1)}}((?:- *){3,}|(?:_ *){3,}|(?:\\* *){3,})(?:\\n+|$)`),
|
|
fencesBeginRegex: (n) => new RegExp(`^ {0,${Math.min(3, n - 1)}}(?:\`\`\`|~~~)`),
|
|
headingBeginRegex: (n) => new RegExp(`^ {0,${Math.min(3, n - 1)}}#`),
|
|
htmlBeginRegex: (n) => new RegExp(`^ {0,${Math.min(3, n - 1)}}<(?:[a-z].*>|!--)`, "i")
|
|
}, qc = /^(?:[ \t]*(?:\n|$))+/, Gc = /^((?: {4}| {0,3}\t)[^\n]+(?:\n(?:[ \t]*(?:\n|$))*)?)+/, Hc = /^ {0,3}(`{3,}(?=[^`\n]*(?:\n|$))|~{3,})([^\n]*)(?:\n|$)(?:|([\s\S]*?)(?:\n|$))(?: {0,3}\1[~`]* *(?=\n|$)|$)/, pn = /^ {0,3}((?:-[\t ]*){3,}|(?:_[ \t]*){3,}|(?:\*[ \t]*){3,})(?:\n+|$)/, Wc = /^ {0,3}(#{1,6})(?=\s|$)(.*)(?:\n+|$)/, qr = /(?:[*+-]|\d{1,9}[.)])/, no = /^(?!bull |blockCode|fences|blockquote|heading|html|table)((?:.|\n(?!\s*?\n|bull |blockCode|fences|blockquote|heading|html|table))+?)\n {0,3}(=+|-+) *(?:\n+|$)/, ro = ye(no).replace(/bull/g, qr).replace(/blockCode/g, /(?: {4}| {0,3}\t)/).replace(/fences/g, / {0,3}(?:`{3,}|~{3,})/).replace(/blockquote/g, / {0,3}>/).replace(/heading/g, / {0,3}#{1,6}/).replace(/html/g, / {0,3}<[^\n>]+>\n/).replace(/\|table/g, "").getRegex(), Yc = ye(no).replace(/bull/g, qr).replace(/blockCode/g, /(?: {4}| {0,3}\t)/).replace(/fences/g, / {0,3}(?:`{3,}|~{3,})/).replace(/blockquote/g, / {0,3}>/).replace(/heading/g, / {0,3}#{1,6}/).replace(/html/g, / {0,3}<[^\n>]+>\n/).replace(/table/g, / {0,3}\|?(?:[:\- ]*\|)+[\:\- ]*\n/).getRegex(), Gr = /^([^\n]+(?:\n(?!hr|heading|lheading|blockquote|fences|list|html|table| +\n)[^\n]+)*)/, Xc = /^[^\n]+/, Hr = /(?!\s*\])(?:\\.|[^\[\]\\])+/, Jc = ye(/^ {0,3}\[(label)\]: *(?:\n[ \t]*)?([^<\s][^\s]*|<.*?>)(?:(?: +(?:\n[ \t]*)?| *\n[ \t]*)(title))? *(?:\n+|$)/).replace("label", Hr).replace("title", /(?:"(?:\\"?|[^"\\])*"|'[^'\n]*(?:\n[^'\n]+)*\n?'|\([^()]*\))/).getRegex(), Kc = ye(/^( {0,3}bull)([ \t][^\n]+?)?(?:\n|$)/).replace(/bull/g, qr).getRegex(), Wn = "address|article|aside|base|basefont|blockquote|body|caption|center|col|colgroup|dd|details|dialog|dir|div|dl|dt|fieldset|figcaption|figure|footer|form|frame|frameset|h[1-6]|head|header|hr|html|iframe|legend|li|link|main|menu|menuitem|meta|nav|noframes|ol|optgroup|option|p|param|search|section|summary|table|tbody|td|tfoot|th|thead|title|tr|track|ul", Wr = /<!--(?:-?>|[\s\S]*?(?:-->|$))/, Zc = ye("^ {0,3}(?:<(script|pre|style|textarea)[\\s>][\\s\\S]*?(?:</\\1>[^\\n]*\\n+|$)|comment[^\\n]*(\\n+|$)|<\\?[\\s\\S]*?(?:\\?>\\n*|$)|<![A-Z][\\s\\S]*?(?:>\\n*|$)|<!\\[CDATA\\[[\\s\\S]*?(?:\\]\\]>\\n*|$)|</?(tag)(?: +|\\n|/?>)[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$)|<(?!script|pre|style|textarea)([a-z][\\w-]*)(?:attribute)*? */?>(?=[ \\t]*(?:\\n|$))[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$)|</(?!script|pre|style|textarea)[a-z][\\w-]*\\s*>(?=[ \\t]*(?:\\n|$))[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$))", "i").replace("comment", Wr).replace("tag", Wn).replace("attribute", / +[a-zA-Z:_][\w.:-]*(?: *= *"[^"\n]*"| *= *'[^'\n]*'| *= *[^\s"'=<>`]+)?/).getRegex(), io = ye(Gr).replace("hr", pn).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("|lheading", "").replace("|table", "").replace("blockquote", " {0,3}>").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", "</?(?:tag)(?: +|\\n|/?>)|<(?:script|pre|style|textarea|!--)").replace("tag", Wn).getRegex(), Qc = ye(/^( {0,3}> ?(paragraph|[^\n]*)(?:\n|$))+/).replace("paragraph", io).getRegex(), Yr = {
|
|
blockquote: Qc,
|
|
code: Gc,
|
|
def: Jc,
|
|
fences: Hc,
|
|
heading: Wc,
|
|
hr: pn,
|
|
html: Zc,
|
|
lheading: ro,
|
|
list: Kc,
|
|
newline: qc,
|
|
paragraph: io,
|
|
table: ln,
|
|
text: Xc
|
|
}, na = ye("^ *([^\\n ].*)\\n {0,3}((?:\\| *)?:?-+:? *(?:\\| *:?-+:? *)*(?:\\| *)?)(?:\\n((?:(?! *\\n|hr|heading|blockquote|code|fences|list|html).*(?:\\n|$))*)\\n*|$)").replace("hr", pn).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("blockquote", " {0,3}>").replace("code", "(?: {4}| {0,3} )[^\\n]").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", "</?(?:tag)(?: +|\\n|/?>)|<(?:script|pre|style|textarea|!--)").replace("tag", Wn).getRegex(), ef = {
|
|
...Yr,
|
|
lheading: Yc,
|
|
table: na,
|
|
paragraph: ye(Gr).replace("hr", pn).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("|lheading", "").replace("table", na).replace("blockquote", " {0,3}>").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", "</?(?:tag)(?: +|\\n|/?>)|<(?:script|pre|style|textarea|!--)").replace("tag", Wn).getRegex()
|
|
}, tf = {
|
|
...Yr,
|
|
html: ye(`^ *(?:comment *(?:\\n|\\s*$)|<(tag)[\\s\\S]+?</\\1> *(?:\\n{2,}|\\s*$)|<tag(?:"[^"]*"|'[^']*'|\\s[^'"/>\\s]*)*?/?> *(?:\\n{2,}|\\s*$))`).replace("comment", Wr).replace(/tag/g, "(?!(?:a|em|strong|small|s|cite|q|dfn|abbr|data|time|code|var|samp|kbd|sub|sup|i|b|u|mark|ruby|rt|rp|bdi|bdo|span|br|wbr|ins|del|img)\\b)\\w+(?!:|[^\\w\\s@]*@)\\b").getRegex(),
|
|
def: /^ *\[([^\]]+)\]: *<?([^\s>]+)>?(?: +(["(][^\n]+[")]))? *(?:\n+|$)/,
|
|
heading: /^(#{1,6})(.*)(?:\n+|$)/,
|
|
fences: ln,
|
|
lheading: /^(.+?)\n {0,3}(=+|-+) *(?:\n+|$)/,
|
|
paragraph: ye(Gr).replace("hr", pn).replace("heading", ` *#{1,6} *[^
|
|
]`).replace("lheading", ro).replace("|table", "").replace("blockquote", " {0,3}>").replace("|fences", "").replace("|list", "").replace("|html", "").replace("|tag", "").getRegex()
|
|
}, nf = /^\\([!"#$%&'()*+,\-./:;<=>?@\[\]\\^_`{|}~])/, rf = /^(`+)([^`]|[^`][\s\S]*?[^`])\1(?!`)/, ao = /^( {2,}|\\)\n(?!\s*$)/, af = /^(`+|[^`])(?:(?= {2,}\n)|[\s\S]*?(?:(?=[\\<!\[`*_]|\b_|$)|[^ ](?= {2,}\n)))/, Yn = /[\p{P}\p{S}]/u, Xr = /[\s\p{P}\p{S}]/u, oo = /[^\s\p{P}\p{S}]/u, of = ye(/^((?![*_])punctSpace)/, "u").replace(/punctSpace/g, Xr).getRegex(), so = /(?!~)[\p{P}\p{S}]/u, sf = /(?!~)[\s\p{P}\p{S}]/u, uf = /(?:[^\s\p{P}\p{S}]|~)/u, lf = /\[[^[\]]*?\]\((?:\\.|[^\\\(\)]|\((?:\\.|[^\\\(\)])*\))*\)|`[^`]*?`|<[^<>]*?>/g, uo = /^(?:\*+(?:((?!\*)punct)|[^\s*]))|^_+(?:((?!_)punct)|([^\s_]))/, cf = ye(uo, "u").replace(/punct/g, Yn).getRegex(), ff = ye(uo, "u").replace(/punct/g, so).getRegex(), lo = "^[^_*]*?__[^_*]*?\\*[^_*]*?(?=__)|[^*]+(?=[^*])|(?!\\*)punct(\\*+)(?=[\\s]|$)|notPunctSpace(\\*+)(?!\\*)(?=punctSpace|$)|(?!\\*)punctSpace(\\*+)(?=notPunctSpace)|[\\s](\\*+)(?!\\*)(?=punct)|(?!\\*)punct(\\*+)(?!\\*)(?=punct)|notPunctSpace(\\*+)(?=notPunctSpace)", df = ye(lo, "gu").replace(/notPunctSpace/g, oo).replace(/punctSpace/g, Xr).replace(/punct/g, Yn).getRegex(), hf = ye(lo, "gu").replace(/notPunctSpace/g, uf).replace(/punctSpace/g, sf).replace(/punct/g, so).getRegex(), pf = ye("^[^_*]*?\\*\\*[^_*]*?_[^_*]*?(?=\\*\\*)|[^_]+(?=[^_])|(?!_)punct(_+)(?=[\\s]|$)|notPunctSpace(_+)(?!_)(?=punctSpace|$)|(?!_)punctSpace(_+)(?=notPunctSpace)|[\\s](_+)(?!_)(?=punct)|(?!_)punct(_+)(?!_)(?=punct)", "gu").replace(/notPunctSpace/g, oo).replace(/punctSpace/g, Xr).replace(/punct/g, Yn).getRegex(), mf = ye(/\\(punct)/, "gu").replace(/punct/g, Yn).getRegex(), gf = ye(/^<(scheme:[^\s\x00-\x1f<>]*|email)>/).replace("scheme", /[a-zA-Z][a-zA-Z0-9+.-]{1,31}/).replace("email", /[a-zA-Z0-9.!#$%&'*+/=?^_`{|}~-]+(@)[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)+(?![-_])/).getRegex(), vf = ye(Wr).replace("(?:-->|$)", "-->").getRegex(), yf = ye("^comment|^</[a-zA-Z][\\w:-]*\\s*>|^<[a-zA-Z][\\w-]*(?:attribute)*?\\s*/?>|^<\\?[\\s\\S]*?\\?>|^<![a-zA-Z]+\\s[\\s\\S]*?>|^<!\\[CDATA\\[[\\s\\S]*?\\]\\]>").replace("comment", vf).replace("attribute", /\s+[a-zA-Z:_][\w.:-]*(?:\s*=\s*"[^"]*"|\s*=\s*'[^']*'|\s*=\s*[^\s"'=<>`]+)?/).getRegex(), zn = /(?:\[(?:\\.|[^\[\]\\])*\]|\\.|`[^`]*`|[^\[\]\\`])*?/, _f = ye(/^!?\[(label)\]\(\s*(href)(?:(?:[ \t]*(?:\n[ \t]*)?)(title))?\s*\)/).replace("label", zn).replace("href", /<(?:\\.|[^\n<>\\])+>|[^ \t\n\x00-\x1f]*/).replace("title", /"(?:\\"?|[^"\\])*"|'(?:\\'?|[^'\\])*'|\((?:\\\)?|[^)\\])*\)/).getRegex(), co = ye(/^!?\[(label)\]\[(ref)\]/).replace("label", zn).replace("ref", Hr).getRegex(), fo = ye(/^!?\[(ref)\](?:\[\])?/).replace("ref", Hr).getRegex(), bf = ye("reflink|nolink(?!\\()", "g").replace("reflink", co).replace("nolink", fo).getRegex(), Jr = {
|
|
_backpedal: ln,
|
|
anyPunctuation: mf,
|
|
autolink: gf,
|
|
blockSkip: lf,
|
|
br: ao,
|
|
code: rf,
|
|
del: ln,
|
|
emStrongLDelim: cf,
|
|
emStrongRDelimAst: df,
|
|
emStrongRDelimUnd: pf,
|
|
escape: nf,
|
|
link: _f,
|
|
nolink: fo,
|
|
punctuation: of,
|
|
reflink: co,
|
|
reflinkSearch: bf,
|
|
tag: yf,
|
|
text: af,
|
|
url: ln
|
|
}, wf = {
|
|
...Jr,
|
|
link: ye(/^!?\[(label)\]\((.*?)\)/).replace("label", zn).getRegex(),
|
|
reflink: ye(/^!?\[(label)\]\s*\[([^\]]*)\]/).replace("label", zn).getRegex()
|
|
}, Rr = {
|
|
...Jr,
|
|
emStrongRDelimAst: hf,
|
|
emStrongLDelim: ff,
|
|
url: ye(/^((?:ftp|https?):\/\/|www\.)(?:[a-zA-Z0-9\-]+\.?)+[^\s<]*|^email/, "i").replace("email", /[A-Za-z0-9._+-]+(@)[a-zA-Z0-9-_]+(?:\.[a-zA-Z0-9-_]*[a-zA-Z0-9])+(?![-_])/).getRegex(),
|
|
_backpedal: /(?:[^?!.,:;*_'"~()&]+|\([^)]*\)|&(?![a-zA-Z0-9]+;$)|[?!.,:;*_'"~)]+(?!$))+/,
|
|
del: /^(~~?)(?=[^\s~])((?:\\.|[^\\])*?(?:\\.|[^\s~\\]))\1(?=[^~]|$)/,
|
|
text: /^([`~]+|[^`~])(?:(?= {2,}\n)|(?=[a-zA-Z0-9.!#$%&'*+\/=?_`{\|}~-]+@)|[\s\S]*?(?:(?=[\\<!\[`*~_]|\b_|https?:\/\/|ftp:\/\/|www\.|$)|[^ ](?= {2,}\n)|[^a-zA-Z0-9.!#$%&'*+\/=?_`{\|}~-](?=[a-zA-Z0-9.!#$%&'*+\/=?_`{\|}~-]+@)))/
|
|
}, $f = {
|
|
...Rr,
|
|
br: ye(ao).replace("{2,}", "*").getRegex(),
|
|
text: ye(Rr.text).replace("\\b_", "\\b_| {2,}\\n").replace(/\{2,\}/g, "*").getRegex()
|
|
}, On = {
|
|
normal: Yr,
|
|
gfm: ef,
|
|
pedantic: tf
|
|
}, tn = {
|
|
normal: Jr,
|
|
gfm: Rr,
|
|
breaks: $f,
|
|
pedantic: wf
|
|
}, Sf = {
|
|
"&": "&",
|
|
"<": "<",
|
|
">": ">",
|
|
'"': """,
|
|
"'": "'"
|
|
}, ra = (n) => Sf[n];
|
|
function pt(n, e) {
|
|
if (e) {
|
|
if (We.escapeTest.test(n))
|
|
return n.replace(We.escapeReplace, ra);
|
|
} else if (We.escapeTestNoEncode.test(n))
|
|
return n.replace(We.escapeReplaceNoEncode, ra);
|
|
return n;
|
|
}
|
|
function ia(n) {
|
|
try {
|
|
n = encodeURI(n).replace(We.percentDecode, "%");
|
|
} catch {
|
|
return null;
|
|
}
|
|
return n;
|
|
}
|
|
function aa(n, e) {
|
|
var a;
|
|
const t = n.replace(We.findPipe, (o, s, u) => {
|
|
let c = !1, l = s;
|
|
for (; --l >= 0 && u[l] === "\\"; )
|
|
c = !c;
|
|
return c ? "|" : " |";
|
|
}), r = t.split(We.splitPipe);
|
|
let i = 0;
|
|
if (r[0].trim() || r.shift(), r.length > 0 && !((a = r.at(-1)) != null && a.trim()) && r.pop(), e)
|
|
if (r.length > e)
|
|
r.splice(e);
|
|
else
|
|
for (; r.length < e; )
|
|
r.push("");
|
|
for (; i < r.length; i++)
|
|
r[i] = r[i].trim().replace(We.slashPipe, "|");
|
|
return r;
|
|
}
|
|
function nn(n, e, t) {
|
|
const r = n.length;
|
|
if (r === 0)
|
|
return "";
|
|
let i = 0;
|
|
for (; i < r && n.charAt(r - i - 1) === e; )
|
|
i++;
|
|
return n.slice(0, r - i);
|
|
}
|
|
function Of(n, e) {
|
|
if (n.indexOf(e[1]) === -1)
|
|
return -1;
|
|
let t = 0;
|
|
for (let r = 0; r < n.length; r++)
|
|
if (n[r] === "\\")
|
|
r++;
|
|
else if (n[r] === e[0])
|
|
t++;
|
|
else if (n[r] === e[1] && (t--, t < 0))
|
|
return r;
|
|
return t > 0 ? -2 : -1;
|
|
}
|
|
function oa(n, e, t, r, i) {
|
|
const a = e.href, o = e.title || null, s = n[1].replace(i.other.outputLinkReplace, "$1");
|
|
r.state.inLink = !0;
|
|
const u = {
|
|
type: n[0].charAt(0) === "!" ? "image" : "link",
|
|
raw: t,
|
|
href: a,
|
|
title: o,
|
|
text: s,
|
|
tokens: r.inlineTokens(s)
|
|
};
|
|
return r.state.inLink = !1, u;
|
|
}
|
|
function Ef(n, e, t) {
|
|
const r = n.match(t.other.indentCodeCompensation);
|
|
if (r === null)
|
|
return e;
|
|
const i = r[1];
|
|
return e.split(`
|
|
`).map((a) => {
|
|
const o = a.match(t.other.beginningSpace);
|
|
if (o === null)
|
|
return a;
|
|
const [s] = o;
|
|
return s.length >= i.length ? a.slice(i.length) : a;
|
|
}).join(`
|
|
`);
|
|
}
|
|
class Un {
|
|
constructor(e) {
|
|
$e(this, "options");
|
|
$e(this, "rules");
|
|
$e(this, "lexer");
|
|
this.options = e || It;
|
|
}
|
|
space(e) {
|
|
const t = this.rules.block.newline.exec(e);
|
|
if (t && t[0].length > 0)
|
|
return {
|
|
type: "space",
|
|
raw: t[0]
|
|
};
|
|
}
|
|
code(e) {
|
|
const t = this.rules.block.code.exec(e);
|
|
if (t) {
|
|
const r = t[0].replace(this.rules.other.codeRemoveIndent, "");
|
|
return {
|
|
type: "code",
|
|
raw: t[0],
|
|
codeBlockStyle: "indented",
|
|
text: this.options.pedantic ? r : nn(r, `
|
|
`)
|
|
};
|
|
}
|
|
}
|
|
fences(e) {
|
|
const t = this.rules.block.fences.exec(e);
|
|
if (t) {
|
|
const r = t[0], i = Ef(r, t[3] || "", this.rules);
|
|
return {
|
|
type: "code",
|
|
raw: r,
|
|
lang: t[2] ? t[2].trim().replace(this.rules.inline.anyPunctuation, "$1") : t[2],
|
|
text: i
|
|
};
|
|
}
|
|
}
|
|
heading(e) {
|
|
const t = this.rules.block.heading.exec(e);
|
|
if (t) {
|
|
let r = t[2].trim();
|
|
if (this.rules.other.endingHash.test(r)) {
|
|
const i = nn(r, "#");
|
|
(this.options.pedantic || !i || this.rules.other.endingSpaceChar.test(i)) && (r = i.trim());
|
|
}
|
|
return {
|
|
type: "heading",
|
|
raw: t[0],
|
|
depth: t[1].length,
|
|
text: r,
|
|
tokens: this.lexer.inline(r)
|
|
};
|
|
}
|
|
}
|
|
hr(e) {
|
|
const t = this.rules.block.hr.exec(e);
|
|
if (t)
|
|
return {
|
|
type: "hr",
|
|
raw: nn(t[0], `
|
|
`)
|
|
};
|
|
}
|
|
blockquote(e) {
|
|
const t = this.rules.block.blockquote.exec(e);
|
|
if (t) {
|
|
let r = nn(t[0], `
|
|
`).split(`
|
|
`), i = "", a = "";
|
|
const o = [];
|
|
for (; r.length > 0; ) {
|
|
let s = !1;
|
|
const u = [];
|
|
let c;
|
|
for (c = 0; c < r.length; c++)
|
|
if (this.rules.other.blockquoteStart.test(r[c]))
|
|
u.push(r[c]), s = !0;
|
|
else if (!s)
|
|
u.push(r[c]);
|
|
else
|
|
break;
|
|
r = r.slice(c);
|
|
const l = u.join(`
|
|
`), h = l.replace(this.rules.other.blockquoteSetextReplace, `
|
|
$1`).replace(this.rules.other.blockquoteSetextReplace2, "");
|
|
i = i ? `${i}
|
|
${l}` : l, a = a ? `${a}
|
|
${h}` : h;
|
|
const m = this.lexer.state.top;
|
|
if (this.lexer.state.top = !0, this.lexer.blockTokens(h, o, !0), this.lexer.state.top = m, r.length === 0)
|
|
break;
|
|
const w = o.at(-1);
|
|
if ((w == null ? void 0 : w.type) === "code")
|
|
break;
|
|
if ((w == null ? void 0 : w.type) === "blockquote") {
|
|
const $ = w, S = $.raw + `
|
|
` + r.join(`
|
|
`), T = this.blockquote(S);
|
|
o[o.length - 1] = T, i = i.substring(0, i.length - $.raw.length) + T.raw, a = a.substring(0, a.length - $.text.length) + T.text;
|
|
break;
|
|
} else if ((w == null ? void 0 : w.type) === "list") {
|
|
const $ = w, S = $.raw + `
|
|
` + r.join(`
|
|
`), T = this.list(S);
|
|
o[o.length - 1] = T, i = i.substring(0, i.length - w.raw.length) + T.raw, a = a.substring(0, a.length - $.raw.length) + T.raw, r = S.substring(o.at(-1).raw.length).split(`
|
|
`);
|
|
continue;
|
|
}
|
|
}
|
|
return {
|
|
type: "blockquote",
|
|
raw: i,
|
|
tokens: o,
|
|
text: a
|
|
};
|
|
}
|
|
}
|
|
list(e) {
|
|
let t = this.rules.block.list.exec(e);
|
|
if (t) {
|
|
let r = t[1].trim();
|
|
const i = r.length > 1, a = {
|
|
type: "list",
|
|
raw: "",
|
|
ordered: i,
|
|
start: i ? +r.slice(0, -1) : "",
|
|
loose: !1,
|
|
items: []
|
|
};
|
|
r = i ? `\\d{1,9}\\${r.slice(-1)}` : `\\${r}`, this.options.pedantic && (r = i ? r : "[*+-]");
|
|
const o = this.rules.other.listItemRegex(r);
|
|
let s = !1;
|
|
for (; e; ) {
|
|
let c = !1, l = "", h = "";
|
|
if (!(t = o.exec(e)) || this.rules.block.hr.test(e))
|
|
break;
|
|
l = t[0], e = e.substring(l.length);
|
|
let m = t[2].split(`
|
|
`, 1)[0].replace(this.rules.other.listReplaceTabs, (z) => " ".repeat(3 * z.length)), w = e.split(`
|
|
`, 1)[0], $ = !m.trim(), S = 0;
|
|
if (this.options.pedantic ? (S = 2, h = m.trimStart()) : $ ? S = t[1].length + 1 : (S = t[2].search(this.rules.other.nonSpaceChar), S = S > 4 ? 1 : S, h = m.slice(S), S += t[1].length), $ && this.rules.other.blankLine.test(w) && (l += w + `
|
|
`, e = e.substring(w.length + 1), c = !0), !c) {
|
|
const z = this.rules.other.nextBulletRegex(S), B = this.rules.other.hrRegex(S), Z = this.rules.other.fencesBeginRegex(S), Q = this.rules.other.headingBeginRegex(S), q = this.rules.other.htmlBeginRegex(S);
|
|
for (; e; ) {
|
|
const ce = e.split(`
|
|
`, 1)[0];
|
|
let re;
|
|
if (w = ce, this.options.pedantic ? (w = w.replace(this.rules.other.listReplaceNesting, " "), re = w) : re = w.replace(this.rules.other.tabCharGlobal, " "), Z.test(w) || Q.test(w) || q.test(w) || z.test(w) || B.test(w))
|
|
break;
|
|
if (re.search(this.rules.other.nonSpaceChar) >= S || !w.trim())
|
|
h += `
|
|
` + re.slice(S);
|
|
else {
|
|
if ($ || m.replace(this.rules.other.tabCharGlobal, " ").search(this.rules.other.nonSpaceChar) >= 4 || Z.test(m) || Q.test(m) || B.test(m))
|
|
break;
|
|
h += `
|
|
` + w;
|
|
}
|
|
!$ && !w.trim() && ($ = !0), l += ce + `
|
|
`, e = e.substring(ce.length + 1), m = re.slice(S);
|
|
}
|
|
}
|
|
a.loose || (s ? a.loose = !0 : this.rules.other.doubleBlankLine.test(l) && (s = !0));
|
|
let T = null, U;
|
|
this.options.gfm && (T = this.rules.other.listIsTask.exec(h), T && (U = T[0] !== "[ ] ", h = h.replace(this.rules.other.listReplaceTask, ""))), a.items.push({
|
|
type: "list_item",
|
|
raw: l,
|
|
task: !!T,
|
|
checked: U,
|
|
loose: !1,
|
|
text: h,
|
|
tokens: []
|
|
}), a.raw += l;
|
|
}
|
|
const u = a.items.at(-1);
|
|
if (u)
|
|
u.raw = u.raw.trimEnd(), u.text = u.text.trimEnd();
|
|
else
|
|
return;
|
|
a.raw = a.raw.trimEnd();
|
|
for (let c = 0; c < a.items.length; c++)
|
|
if (this.lexer.state.top = !1, a.items[c].tokens = this.lexer.blockTokens(a.items[c].text, []), !a.loose) {
|
|
const l = a.items[c].tokens.filter((m) => m.type === "space"), h = l.length > 0 && l.some((m) => this.rules.other.anyLine.test(m.raw));
|
|
a.loose = h;
|
|
}
|
|
if (a.loose)
|
|
for (let c = 0; c < a.items.length; c++)
|
|
a.items[c].loose = !0;
|
|
return a;
|
|
}
|
|
}
|
|
html(e) {
|
|
const t = this.rules.block.html.exec(e);
|
|
if (t)
|
|
return {
|
|
type: "html",
|
|
block: !0,
|
|
raw: t[0],
|
|
pre: t[1] === "pre" || t[1] === "script" || t[1] === "style",
|
|
text: t[0]
|
|
};
|
|
}
|
|
def(e) {
|
|
const t = this.rules.block.def.exec(e);
|
|
if (t) {
|
|
const r = t[1].toLowerCase().replace(this.rules.other.multipleSpaceGlobal, " "), i = t[2] ? t[2].replace(this.rules.other.hrefBrackets, "$1").replace(this.rules.inline.anyPunctuation, "$1") : "", a = t[3] ? t[3].substring(1, t[3].length - 1).replace(this.rules.inline.anyPunctuation, "$1") : t[3];
|
|
return {
|
|
type: "def",
|
|
tag: r,
|
|
raw: t[0],
|
|
href: i,
|
|
title: a
|
|
};
|
|
}
|
|
}
|
|
table(e) {
|
|
var s;
|
|
const t = this.rules.block.table.exec(e);
|
|
if (!t || !this.rules.other.tableDelimiter.test(t[2]))
|
|
return;
|
|
const r = aa(t[1]), i = t[2].replace(this.rules.other.tableAlignChars, "").split("|"), a = (s = t[3]) != null && s.trim() ? t[3].replace(this.rules.other.tableRowBlankLine, "").split(`
|
|
`) : [], o = {
|
|
type: "table",
|
|
raw: t[0],
|
|
header: [],
|
|
align: [],
|
|
rows: []
|
|
};
|
|
if (r.length === i.length) {
|
|
for (const u of i)
|
|
this.rules.other.tableAlignRight.test(u) ? o.align.push("right") : this.rules.other.tableAlignCenter.test(u) ? o.align.push("center") : this.rules.other.tableAlignLeft.test(u) ? o.align.push("left") : o.align.push(null);
|
|
for (let u = 0; u < r.length; u++)
|
|
o.header.push({
|
|
text: r[u],
|
|
tokens: this.lexer.inline(r[u]),
|
|
header: !0,
|
|
align: o.align[u]
|
|
});
|
|
for (const u of a)
|
|
o.rows.push(aa(u, o.header.length).map((c, l) => ({
|
|
text: c,
|
|
tokens: this.lexer.inline(c),
|
|
header: !1,
|
|
align: o.align[l]
|
|
})));
|
|
return o;
|
|
}
|
|
}
|
|
lheading(e) {
|
|
const t = this.rules.block.lheading.exec(e);
|
|
if (t)
|
|
return {
|
|
type: "heading",
|
|
raw: t[0],
|
|
depth: t[2].charAt(0) === "=" ? 1 : 2,
|
|
text: t[1],
|
|
tokens: this.lexer.inline(t[1])
|
|
};
|
|
}
|
|
paragraph(e) {
|
|
const t = this.rules.block.paragraph.exec(e);
|
|
if (t) {
|
|
const r = t[1].charAt(t[1].length - 1) === `
|
|
` ? t[1].slice(0, -1) : t[1];
|
|
return {
|
|
type: "paragraph",
|
|
raw: t[0],
|
|
text: r,
|
|
tokens: this.lexer.inline(r)
|
|
};
|
|
}
|
|
}
|
|
text(e) {
|
|
const t = this.rules.block.text.exec(e);
|
|
if (t)
|
|
return {
|
|
type: "text",
|
|
raw: t[0],
|
|
text: t[0],
|
|
tokens: this.lexer.inline(t[0])
|
|
};
|
|
}
|
|
escape(e) {
|
|
const t = this.rules.inline.escape.exec(e);
|
|
if (t)
|
|
return {
|
|
type: "escape",
|
|
raw: t[0],
|
|
text: t[1]
|
|
};
|
|
}
|
|
tag(e) {
|
|
const t = this.rules.inline.tag.exec(e);
|
|
if (t)
|
|
return !this.lexer.state.inLink && this.rules.other.startATag.test(t[0]) ? this.lexer.state.inLink = !0 : this.lexer.state.inLink && this.rules.other.endATag.test(t[0]) && (this.lexer.state.inLink = !1), !this.lexer.state.inRawBlock && this.rules.other.startPreScriptTag.test(t[0]) ? this.lexer.state.inRawBlock = !0 : this.lexer.state.inRawBlock && this.rules.other.endPreScriptTag.test(t[0]) && (this.lexer.state.inRawBlock = !1), {
|
|
type: "html",
|
|
raw: t[0],
|
|
inLink: this.lexer.state.inLink,
|
|
inRawBlock: this.lexer.state.inRawBlock,
|
|
block: !1,
|
|
text: t[0]
|
|
};
|
|
}
|
|
link(e) {
|
|
const t = this.rules.inline.link.exec(e);
|
|
if (t) {
|
|
const r = t[2].trim();
|
|
if (!this.options.pedantic && this.rules.other.startAngleBracket.test(r)) {
|
|
if (!this.rules.other.endAngleBracket.test(r))
|
|
return;
|
|
const o = nn(r.slice(0, -1), "\\");
|
|
if ((r.length - o.length) % 2 === 0)
|
|
return;
|
|
} else {
|
|
const o = Of(t[2], "()");
|
|
if (o === -2)
|
|
return;
|
|
if (o > -1) {
|
|
const u = (t[0].indexOf("!") === 0 ? 5 : 4) + t[1].length + o;
|
|
t[2] = t[2].substring(0, o), t[0] = t[0].substring(0, u).trim(), t[3] = "";
|
|
}
|
|
}
|
|
let i = t[2], a = "";
|
|
if (this.options.pedantic) {
|
|
const o = this.rules.other.pedanticHrefTitle.exec(i);
|
|
o && (i = o[1], a = o[3]);
|
|
} else
|
|
a = t[3] ? t[3].slice(1, -1) : "";
|
|
return i = i.trim(), this.rules.other.startAngleBracket.test(i) && (this.options.pedantic && !this.rules.other.endAngleBracket.test(r) ? i = i.slice(1) : i = i.slice(1, -1)), oa(t, {
|
|
href: i && i.replace(this.rules.inline.anyPunctuation, "$1"),
|
|
title: a && a.replace(this.rules.inline.anyPunctuation, "$1")
|
|
}, t[0], this.lexer, this.rules);
|
|
}
|
|
}
|
|
reflink(e, t) {
|
|
let r;
|
|
if ((r = this.rules.inline.reflink.exec(e)) || (r = this.rules.inline.nolink.exec(e))) {
|
|
const i = (r[2] || r[1]).replace(this.rules.other.multipleSpaceGlobal, " "), a = t[i.toLowerCase()];
|
|
if (!a) {
|
|
const o = r[0].charAt(0);
|
|
return {
|
|
type: "text",
|
|
raw: o,
|
|
text: o
|
|
};
|
|
}
|
|
return oa(r, a, r[0], this.lexer, this.rules);
|
|
}
|
|
}
|
|
emStrong(e, t, r = "") {
|
|
let i = this.rules.inline.emStrongLDelim.exec(e);
|
|
if (!i || i[3] && r.match(this.rules.other.unicodeAlphaNumeric))
|
|
return;
|
|
if (!(i[1] || i[2] || "") || !r || this.rules.inline.punctuation.exec(r)) {
|
|
const o = [...i[0]].length - 1;
|
|
let s, u, c = o, l = 0;
|
|
const h = i[0][0] === "*" ? this.rules.inline.emStrongRDelimAst : this.rules.inline.emStrongRDelimUnd;
|
|
for (h.lastIndex = 0, t = t.slice(-1 * e.length + o); (i = h.exec(t)) != null; ) {
|
|
if (s = i[1] || i[2] || i[3] || i[4] || i[5] || i[6], !s)
|
|
continue;
|
|
if (u = [...s].length, i[3] || i[4]) {
|
|
c += u;
|
|
continue;
|
|
} else if ((i[5] || i[6]) && o % 3 && !((o + u) % 3)) {
|
|
l += u;
|
|
continue;
|
|
}
|
|
if (c -= u, c > 0)
|
|
continue;
|
|
u = Math.min(u, u + c + l);
|
|
const m = [...i[0]][0].length, w = e.slice(0, o + i.index + m + u);
|
|
if (Math.min(o, u) % 2) {
|
|
const S = w.slice(1, -1);
|
|
return {
|
|
type: "em",
|
|
raw: w,
|
|
text: S,
|
|
tokens: this.lexer.inlineTokens(S)
|
|
};
|
|
}
|
|
const $ = w.slice(2, -2);
|
|
return {
|
|
type: "strong",
|
|
raw: w,
|
|
text: $,
|
|
tokens: this.lexer.inlineTokens($)
|
|
};
|
|
}
|
|
}
|
|
}
|
|
codespan(e) {
|
|
const t = this.rules.inline.code.exec(e);
|
|
if (t) {
|
|
let r = t[2].replace(this.rules.other.newLineCharGlobal, " ");
|
|
const i = this.rules.other.nonSpaceChar.test(r), a = this.rules.other.startingSpaceChar.test(r) && this.rules.other.endingSpaceChar.test(r);
|
|
return i && a && (r = r.substring(1, r.length - 1)), {
|
|
type: "codespan",
|
|
raw: t[0],
|
|
text: r
|
|
};
|
|
}
|
|
}
|
|
br(e) {
|
|
const t = this.rules.inline.br.exec(e);
|
|
if (t)
|
|
return {
|
|
type: "br",
|
|
raw: t[0]
|
|
};
|
|
}
|
|
del(e) {
|
|
const t = this.rules.inline.del.exec(e);
|
|
if (t)
|
|
return {
|
|
type: "del",
|
|
raw: t[0],
|
|
text: t[2],
|
|
tokens: this.lexer.inlineTokens(t[2])
|
|
};
|
|
}
|
|
autolink(e) {
|
|
const t = this.rules.inline.autolink.exec(e);
|
|
if (t) {
|
|
let r, i;
|
|
return t[2] === "@" ? (r = t[1], i = "mailto:" + r) : (r = t[1], i = r), {
|
|
type: "link",
|
|
raw: t[0],
|
|
text: r,
|
|
href: i,
|
|
tokens: [
|
|
{
|
|
type: "text",
|
|
raw: r,
|
|
text: r
|
|
}
|
|
]
|
|
};
|
|
}
|
|
}
|
|
url(e) {
|
|
var r, i;
|
|
let t;
|
|
if (t = this.rules.inline.url.exec(e)) {
|
|
let a, o;
|
|
if (t[2] === "@")
|
|
a = t[0], o = "mailto:" + a;
|
|
else {
|
|
let s;
|
|
do
|
|
s = t[0], t[0] = (i = (r = this.rules.inline._backpedal.exec(t[0])) == null ? void 0 : r[0]) != null ? i : "";
|
|
while (s !== t[0]);
|
|
a = t[0], t[1] === "www." ? o = "http://" + t[0] : o = t[0];
|
|
}
|
|
return {
|
|
type: "link",
|
|
raw: t[0],
|
|
text: a,
|
|
href: o,
|
|
tokens: [
|
|
{
|
|
type: "text",
|
|
raw: a,
|
|
text: a
|
|
}
|
|
]
|
|
};
|
|
}
|
|
}
|
|
inlineText(e) {
|
|
const t = this.rules.inline.text.exec(e);
|
|
if (t) {
|
|
const r = this.lexer.state.inRawBlock;
|
|
return {
|
|
type: "text",
|
|
raw: t[0],
|
|
text: t[0],
|
|
escaped: r
|
|
};
|
|
}
|
|
}
|
|
}
|
|
class st {
|
|
constructor(e) {
|
|
$e(this, "tokens");
|
|
$e(this, "options");
|
|
$e(this, "state");
|
|
$e(this, "tokenizer");
|
|
$e(this, "inlineQueue");
|
|
this.tokens = [], this.tokens.links = /* @__PURE__ */ Object.create(null), this.options = e || It, this.options.tokenizer = this.options.tokenizer || new Un(), this.tokenizer = this.options.tokenizer, this.tokenizer.options = this.options, this.tokenizer.lexer = this, this.inlineQueue = [], this.state = {
|
|
inLink: !1,
|
|
inRawBlock: !1,
|
|
top: !0
|
|
};
|
|
const t = {
|
|
other: We,
|
|
block: On.normal,
|
|
inline: tn.normal
|
|
};
|
|
this.options.pedantic ? (t.block = On.pedantic, t.inline = tn.pedantic) : this.options.gfm && (t.block = On.gfm, this.options.breaks ? t.inline = tn.breaks : t.inline = tn.gfm), this.tokenizer.rules = t;
|
|
}
|
|
static get rules() {
|
|
return {
|
|
block: On,
|
|
inline: tn
|
|
};
|
|
}
|
|
static lex(e, t) {
|
|
return new st(t).lex(e);
|
|
}
|
|
static lexInline(e, t) {
|
|
return new st(t).inlineTokens(e);
|
|
}
|
|
lex(e) {
|
|
e = e.replace(We.carriageReturn, `
|
|
`), this.blockTokens(e, this.tokens);
|
|
for (let t = 0; t < this.inlineQueue.length; t++) {
|
|
const r = this.inlineQueue[t];
|
|
this.inlineTokens(r.src, r.tokens);
|
|
}
|
|
return this.inlineQueue = [], this.tokens;
|
|
}
|
|
blockTokens(e, t = [], r = !1) {
|
|
var i, a, o;
|
|
for (this.options.pedantic && (e = e.replace(We.tabCharGlobal, " ").replace(We.spaceLine, "")); e; ) {
|
|
let s;
|
|
if ((a = (i = this.options.extensions) == null ? void 0 : i.block) != null && a.some((c) => (s = c.call({ lexer: this }, e, t)) ? (e = e.substring(s.raw.length), t.push(s), !0) : !1))
|
|
continue;
|
|
if (s = this.tokenizer.space(e)) {
|
|
e = e.substring(s.raw.length);
|
|
const c = t.at(-1);
|
|
s.raw.length === 1 && c !== void 0 ? c.raw += `
|
|
` : t.push(s);
|
|
continue;
|
|
}
|
|
if (s = this.tokenizer.code(e)) {
|
|
e = e.substring(s.raw.length);
|
|
const c = t.at(-1);
|
|
(c == null ? void 0 : c.type) === "paragraph" || (c == null ? void 0 : c.type) === "text" ? (c.raw += `
|
|
` + s.raw, c.text += `
|
|
` + s.text, this.inlineQueue.at(-1).src = c.text) : t.push(s);
|
|
continue;
|
|
}
|
|
if (s = this.tokenizer.fences(e)) {
|
|
e = e.substring(s.raw.length), t.push(s);
|
|
continue;
|
|
}
|
|
if (s = this.tokenizer.heading(e)) {
|
|
e = e.substring(s.raw.length), t.push(s);
|
|
continue;
|
|
}
|
|
if (s = this.tokenizer.hr(e)) {
|
|
e = e.substring(s.raw.length), t.push(s);
|
|
continue;
|
|
}
|
|
if (s = this.tokenizer.blockquote(e)) {
|
|
e = e.substring(s.raw.length), t.push(s);
|
|
continue;
|
|
}
|
|
if (s = this.tokenizer.list(e)) {
|
|
e = e.substring(s.raw.length), t.push(s);
|
|
continue;
|
|
}
|
|
if (s = this.tokenizer.html(e)) {
|
|
e = e.substring(s.raw.length), t.push(s);
|
|
continue;
|
|
}
|
|
if (s = this.tokenizer.def(e)) {
|
|
e = e.substring(s.raw.length);
|
|
const c = t.at(-1);
|
|
(c == null ? void 0 : c.type) === "paragraph" || (c == null ? void 0 : c.type) === "text" ? (c.raw += `
|
|
` + s.raw, c.text += `
|
|
` + s.raw, this.inlineQueue.at(-1).src = c.text) : this.tokens.links[s.tag] || (this.tokens.links[s.tag] = {
|
|
href: s.href,
|
|
title: s.title
|
|
});
|
|
continue;
|
|
}
|
|
if (s = this.tokenizer.table(e)) {
|
|
e = e.substring(s.raw.length), t.push(s);
|
|
continue;
|
|
}
|
|
if (s = this.tokenizer.lheading(e)) {
|
|
e = e.substring(s.raw.length), t.push(s);
|
|
continue;
|
|
}
|
|
let u = e;
|
|
if ((o = this.options.extensions) != null && o.startBlock) {
|
|
let c = 1 / 0;
|
|
const l = e.slice(1);
|
|
let h;
|
|
this.options.extensions.startBlock.forEach((m) => {
|
|
h = m.call({ lexer: this }, l), typeof h == "number" && h >= 0 && (c = Math.min(c, h));
|
|
}), c < 1 / 0 && c >= 0 && (u = e.substring(0, c + 1));
|
|
}
|
|
if (this.state.top && (s = this.tokenizer.paragraph(u))) {
|
|
const c = t.at(-1);
|
|
r && (c == null ? void 0 : c.type) === "paragraph" ? (c.raw += `
|
|
` + s.raw, c.text += `
|
|
` + s.text, this.inlineQueue.pop(), this.inlineQueue.at(-1).src = c.text) : t.push(s), r = u.length !== e.length, e = e.substring(s.raw.length);
|
|
continue;
|
|
}
|
|
if (s = this.tokenizer.text(e)) {
|
|
e = e.substring(s.raw.length);
|
|
const c = t.at(-1);
|
|
(c == null ? void 0 : c.type) === "text" ? (c.raw += `
|
|
` + s.raw, c.text += `
|
|
` + s.text, this.inlineQueue.pop(), this.inlineQueue.at(-1).src = c.text) : t.push(s);
|
|
continue;
|
|
}
|
|
if (e) {
|
|
const c = "Infinite loop on byte: " + e.charCodeAt(0);
|
|
if (this.options.silent) {
|
|
console.error(c);
|
|
break;
|
|
} else
|
|
throw new Error(c);
|
|
}
|
|
}
|
|
return this.state.top = !0, t;
|
|
}
|
|
inline(e, t = []) {
|
|
return this.inlineQueue.push({ src: e, tokens: t }), t;
|
|
}
|
|
inlineTokens(e, t = []) {
|
|
var s, u, c;
|
|
let r = e, i = null;
|
|
if (this.tokens.links) {
|
|
const l = Object.keys(this.tokens.links);
|
|
if (l.length > 0)
|
|
for (; (i = this.tokenizer.rules.inline.reflinkSearch.exec(r)) != null; )
|
|
l.includes(i[0].slice(i[0].lastIndexOf("[") + 1, -1)) && (r = r.slice(0, i.index) + "[" + "a".repeat(i[0].length - 2) + "]" + r.slice(this.tokenizer.rules.inline.reflinkSearch.lastIndex));
|
|
}
|
|
for (; (i = this.tokenizer.rules.inline.anyPunctuation.exec(r)) != null; )
|
|
r = r.slice(0, i.index) + "++" + r.slice(this.tokenizer.rules.inline.anyPunctuation.lastIndex);
|
|
for (; (i = this.tokenizer.rules.inline.blockSkip.exec(r)) != null; )
|
|
r = r.slice(0, i.index) + "[" + "a".repeat(i[0].length - 2) + "]" + r.slice(this.tokenizer.rules.inline.blockSkip.lastIndex);
|
|
let a = !1, o = "";
|
|
for (; e; ) {
|
|
a || (o = ""), a = !1;
|
|
let l;
|
|
if ((u = (s = this.options.extensions) == null ? void 0 : s.inline) != null && u.some((m) => (l = m.call({ lexer: this }, e, t)) ? (e = e.substring(l.raw.length), t.push(l), !0) : !1))
|
|
continue;
|
|
if (l = this.tokenizer.escape(e)) {
|
|
e = e.substring(l.raw.length), t.push(l);
|
|
continue;
|
|
}
|
|
if (l = this.tokenizer.tag(e)) {
|
|
e = e.substring(l.raw.length), t.push(l);
|
|
continue;
|
|
}
|
|
if (l = this.tokenizer.link(e)) {
|
|
e = e.substring(l.raw.length), t.push(l);
|
|
continue;
|
|
}
|
|
if (l = this.tokenizer.reflink(e, this.tokens.links)) {
|
|
e = e.substring(l.raw.length);
|
|
const m = t.at(-1);
|
|
l.type === "text" && (m == null ? void 0 : m.type) === "text" ? (m.raw += l.raw, m.text += l.text) : t.push(l);
|
|
continue;
|
|
}
|
|
if (l = this.tokenizer.emStrong(e, r, o)) {
|
|
e = e.substring(l.raw.length), t.push(l);
|
|
continue;
|
|
}
|
|
if (l = this.tokenizer.codespan(e)) {
|
|
e = e.substring(l.raw.length), t.push(l);
|
|
continue;
|
|
}
|
|
if (l = this.tokenizer.br(e)) {
|
|
e = e.substring(l.raw.length), t.push(l);
|
|
continue;
|
|
}
|
|
if (l = this.tokenizer.del(e)) {
|
|
e = e.substring(l.raw.length), t.push(l);
|
|
continue;
|
|
}
|
|
if (l = this.tokenizer.autolink(e)) {
|
|
e = e.substring(l.raw.length), t.push(l);
|
|
continue;
|
|
}
|
|
if (!this.state.inLink && (l = this.tokenizer.url(e))) {
|
|
e = e.substring(l.raw.length), t.push(l);
|
|
continue;
|
|
}
|
|
let h = e;
|
|
if ((c = this.options.extensions) != null && c.startInline) {
|
|
let m = 1 / 0;
|
|
const w = e.slice(1);
|
|
let $;
|
|
this.options.extensions.startInline.forEach((S) => {
|
|
$ = S.call({ lexer: this }, w), typeof $ == "number" && $ >= 0 && (m = Math.min(m, $));
|
|
}), m < 1 / 0 && m >= 0 && (h = e.substring(0, m + 1));
|
|
}
|
|
if (l = this.tokenizer.inlineText(h)) {
|
|
e = e.substring(l.raw.length), l.raw.slice(-1) !== "_" && (o = l.raw.slice(-1)), a = !0;
|
|
const m = t.at(-1);
|
|
(m == null ? void 0 : m.type) === "text" ? (m.raw += l.raw, m.text += l.text) : t.push(l);
|
|
continue;
|
|
}
|
|
if (e) {
|
|
const m = "Infinite loop on byte: " + e.charCodeAt(0);
|
|
if (this.options.silent) {
|
|
console.error(m);
|
|
break;
|
|
} else
|
|
throw new Error(m);
|
|
}
|
|
}
|
|
return t;
|
|
}
|
|
}
|
|
class qn {
|
|
constructor(e) {
|
|
$e(this, "options");
|
|
$e(this, "parser");
|
|
this.options = e || It;
|
|
}
|
|
space(e) {
|
|
return "";
|
|
}
|
|
code({ text: e, lang: t, escaped: r }) {
|
|
var o;
|
|
const i = (o = (t || "").match(We.notSpaceStart)) == null ? void 0 : o[0], a = e.replace(We.endingNewline, "") + `
|
|
`;
|
|
return i ? '<pre><code class="language-' + pt(i) + '">' + (r ? a : pt(a, !0)) + `</code></pre>
|
|
` : "<pre><code>" + (r ? a : pt(a, !0)) + `</code></pre>
|
|
`;
|
|
}
|
|
blockquote({ tokens: e }) {
|
|
return `<blockquote>
|
|
${this.parser.parse(e)}</blockquote>
|
|
`;
|
|
}
|
|
html({ text: e }) {
|
|
return e;
|
|
}
|
|
heading({ tokens: e, depth: t }) {
|
|
return `<h${t}>${this.parser.parseInline(e)}</h${t}>
|
|
`;
|
|
}
|
|
hr(e) {
|
|
return `<hr>
|
|
`;
|
|
}
|
|
list(e) {
|
|
const t = e.ordered, r = e.start;
|
|
let i = "";
|
|
for (let s = 0; s < e.items.length; s++) {
|
|
const u = e.items[s];
|
|
i += this.listitem(u);
|
|
}
|
|
const a = t ? "ol" : "ul", o = t && r !== 1 ? ' start="' + r + '"' : "";
|
|
return "<" + a + o + `>
|
|
` + i + "</" + a + `>
|
|
`;
|
|
}
|
|
listitem(e) {
|
|
var r;
|
|
let t = "";
|
|
if (e.task) {
|
|
const i = this.checkbox({ checked: !!e.checked });
|
|
e.loose ? ((r = e.tokens[0]) == null ? void 0 : r.type) === "paragraph" ? (e.tokens[0].text = i + " " + e.tokens[0].text, e.tokens[0].tokens && e.tokens[0].tokens.length > 0 && e.tokens[0].tokens[0].type === "text" && (e.tokens[0].tokens[0].text = i + " " + pt(e.tokens[0].tokens[0].text), e.tokens[0].tokens[0].escaped = !0)) : e.tokens.unshift({
|
|
type: "text",
|
|
raw: i + " ",
|
|
text: i + " ",
|
|
escaped: !0
|
|
}) : t += i + " ";
|
|
}
|
|
return t += this.parser.parse(e.tokens, !!e.loose), `<li>${t}</li>
|
|
`;
|
|
}
|
|
checkbox({ checked: e }) {
|
|
return "<input " + (e ? 'checked="" ' : "") + 'disabled="" type="checkbox">';
|
|
}
|
|
paragraph({ tokens: e }) {
|
|
return `<p>${this.parser.parseInline(e)}</p>
|
|
`;
|
|
}
|
|
table(e) {
|
|
let t = "", r = "";
|
|
for (let a = 0; a < e.header.length; a++)
|
|
r += this.tablecell(e.header[a]);
|
|
t += this.tablerow({ text: r });
|
|
let i = "";
|
|
for (let a = 0; a < e.rows.length; a++) {
|
|
const o = e.rows[a];
|
|
r = "";
|
|
for (let s = 0; s < o.length; s++)
|
|
r += this.tablecell(o[s]);
|
|
i += this.tablerow({ text: r });
|
|
}
|
|
return i && (i = `<tbody>${i}</tbody>`), `<table>
|
|
<thead>
|
|
` + t + `</thead>
|
|
` + i + `</table>
|
|
`;
|
|
}
|
|
tablerow({ text: e }) {
|
|
return `<tr>
|
|
${e}</tr>
|
|
`;
|
|
}
|
|
tablecell(e) {
|
|
const t = this.parser.parseInline(e.tokens), r = e.header ? "th" : "td";
|
|
return (e.align ? `<${r} align="${e.align}">` : `<${r}>`) + t + `</${r}>
|
|
`;
|
|
}
|
|
strong({ tokens: e }) {
|
|
return `<strong>${this.parser.parseInline(e)}</strong>`;
|
|
}
|
|
em({ tokens: e }) {
|
|
return `<em>${this.parser.parseInline(e)}</em>`;
|
|
}
|
|
codespan({ text: e }) {
|
|
return `<code>${pt(e, !0)}</code>`;
|
|
}
|
|
br(e) {
|
|
return "<br>";
|
|
}
|
|
del({ tokens: e }) {
|
|
return `<del>${this.parser.parseInline(e)}</del>`;
|
|
}
|
|
link({ href: e, title: t, tokens: r }) {
|
|
const i = this.parser.parseInline(r), a = ia(e);
|
|
if (a === null)
|
|
return i;
|
|
e = a;
|
|
let o = '<a href="' + e + '"';
|
|
return t && (o += ' title="' + pt(t) + '"'), o += ">" + i + "</a>", o;
|
|
}
|
|
image({ href: e, title: t, text: r, tokens: i }) {
|
|
i && (r = this.parser.parseInline(i, this.parser.textRenderer));
|
|
const a = ia(e);
|
|
if (a === null)
|
|
return pt(r);
|
|
e = a;
|
|
let o = `<img src="${e}" alt="${r}"`;
|
|
return t && (o += ` title="${pt(t)}"`), o += ">", o;
|
|
}
|
|
text(e) {
|
|
return "tokens" in e && e.tokens ? this.parser.parseInline(e.tokens) : "escaped" in e && e.escaped ? e.text : pt(e.text);
|
|
}
|
|
}
|
|
class Kr {
|
|
strong({ text: e }) {
|
|
return e;
|
|
}
|
|
em({ text: e }) {
|
|
return e;
|
|
}
|
|
codespan({ text: e }) {
|
|
return e;
|
|
}
|
|
del({ text: e }) {
|
|
return e;
|
|
}
|
|
html({ text: e }) {
|
|
return e;
|
|
}
|
|
text({ text: e }) {
|
|
return e;
|
|
}
|
|
link({ text: e }) {
|
|
return "" + e;
|
|
}
|
|
image({ text: e }) {
|
|
return "" + e;
|
|
}
|
|
br() {
|
|
return "";
|
|
}
|
|
}
|
|
class ut {
|
|
constructor(e) {
|
|
$e(this, "options");
|
|
$e(this, "renderer");
|
|
$e(this, "textRenderer");
|
|
this.options = e || It, this.options.renderer = this.options.renderer || new qn(), this.renderer = this.options.renderer, this.renderer.options = this.options, this.renderer.parser = this, this.textRenderer = new Kr();
|
|
}
|
|
static parse(e, t) {
|
|
return new ut(t).parse(e);
|
|
}
|
|
static parseInline(e, t) {
|
|
return new ut(t).parseInline(e);
|
|
}
|
|
parse(e, t = !0) {
|
|
var i, a;
|
|
let r = "";
|
|
for (let o = 0; o < e.length; o++) {
|
|
const s = e[o];
|
|
if ((a = (i = this.options.extensions) == null ? void 0 : i.renderers) != null && a[s.type]) {
|
|
const c = s, l = this.options.extensions.renderers[c.type].call({ parser: this }, c);
|
|
if (l !== !1 || !["space", "hr", "heading", "code", "table", "blockquote", "list", "html", "paragraph", "text"].includes(c.type)) {
|
|
r += l || "";
|
|
continue;
|
|
}
|
|
}
|
|
const u = s;
|
|
switch (u.type) {
|
|
case "space": {
|
|
r += this.renderer.space(u);
|
|
continue;
|
|
}
|
|
case "hr": {
|
|
r += this.renderer.hr(u);
|
|
continue;
|
|
}
|
|
case "heading": {
|
|
r += this.renderer.heading(u);
|
|
continue;
|
|
}
|
|
case "code": {
|
|
r += this.renderer.code(u);
|
|
continue;
|
|
}
|
|
case "table": {
|
|
r += this.renderer.table(u);
|
|
continue;
|
|
}
|
|
case "blockquote": {
|
|
r += this.renderer.blockquote(u);
|
|
continue;
|
|
}
|
|
case "list": {
|
|
r += this.renderer.list(u);
|
|
continue;
|
|
}
|
|
case "html": {
|
|
r += this.renderer.html(u);
|
|
continue;
|
|
}
|
|
case "paragraph": {
|
|
r += this.renderer.paragraph(u);
|
|
continue;
|
|
}
|
|
case "text": {
|
|
let c = u, l = this.renderer.text(c);
|
|
for (; o + 1 < e.length && e[o + 1].type === "text"; )
|
|
c = e[++o], l += `
|
|
` + this.renderer.text(c);
|
|
t ? r += this.renderer.paragraph({
|
|
type: "paragraph",
|
|
raw: l,
|
|
text: l,
|
|
tokens: [{ type: "text", raw: l, text: l, escaped: !0 }]
|
|
}) : r += l;
|
|
continue;
|
|
}
|
|
default: {
|
|
const c = 'Token with "' + u.type + '" type was not found.';
|
|
if (this.options.silent)
|
|
return console.error(c), "";
|
|
throw new Error(c);
|
|
}
|
|
}
|
|
}
|
|
return r;
|
|
}
|
|
parseInline(e, t = this.renderer) {
|
|
var i, a;
|
|
let r = "";
|
|
for (let o = 0; o < e.length; o++) {
|
|
const s = e[o];
|
|
if ((a = (i = this.options.extensions) == null ? void 0 : i.renderers) != null && a[s.type]) {
|
|
const c = this.options.extensions.renderers[s.type].call({ parser: this }, s);
|
|
if (c !== !1 || !["escape", "html", "link", "image", "strong", "em", "codespan", "br", "del", "text"].includes(s.type)) {
|
|
r += c || "";
|
|
continue;
|
|
}
|
|
}
|
|
const u = s;
|
|
switch (u.type) {
|
|
case "escape": {
|
|
r += t.text(u);
|
|
break;
|
|
}
|
|
case "html": {
|
|
r += t.html(u);
|
|
break;
|
|
}
|
|
case "link": {
|
|
r += t.link(u);
|
|
break;
|
|
}
|
|
case "image": {
|
|
r += t.image(u);
|
|
break;
|
|
}
|
|
case "strong": {
|
|
r += t.strong(u);
|
|
break;
|
|
}
|
|
case "em": {
|
|
r += t.em(u);
|
|
break;
|
|
}
|
|
case "codespan": {
|
|
r += t.codespan(u);
|
|
break;
|
|
}
|
|
case "br": {
|
|
r += t.br(u);
|
|
break;
|
|
}
|
|
case "del": {
|
|
r += t.del(u);
|
|
break;
|
|
}
|
|
case "text": {
|
|
r += t.text(u);
|
|
break;
|
|
}
|
|
default: {
|
|
const c = 'Token with "' + u.type + '" type was not found.';
|
|
if (this.options.silent)
|
|
return console.error(c), "";
|
|
throw new Error(c);
|
|
}
|
|
}
|
|
}
|
|
return r;
|
|
}
|
|
}
|
|
class cn {
|
|
constructor(e) {
|
|
$e(this, "options");
|
|
$e(this, "block");
|
|
this.options = e || It;
|
|
}
|
|
preprocess(e) {
|
|
return e;
|
|
}
|
|
postprocess(e) {
|
|
return e;
|
|
}
|
|
processAllTokens(e) {
|
|
return e;
|
|
}
|
|
provideLexer() {
|
|
return this.block ? st.lex : st.lexInline;
|
|
}
|
|
provideParser() {
|
|
return this.block ? ut.parse : ut.parseInline;
|
|
}
|
|
}
|
|
$e(cn, "passThroughHooks", /* @__PURE__ */ new Set([
|
|
"preprocess",
|
|
"postprocess",
|
|
"processAllTokens"
|
|
]));
|
|
class ho {
|
|
constructor(...e) {
|
|
$e(this, "defaults", Ur());
|
|
$e(this, "options", this.setOptions);
|
|
$e(this, "parse", this.parseMarkdown(!0));
|
|
$e(this, "parseInline", this.parseMarkdown(!1));
|
|
$e(this, "Parser", ut);
|
|
$e(this, "Renderer", qn);
|
|
$e(this, "TextRenderer", Kr);
|
|
$e(this, "Lexer", st);
|
|
$e(this, "Tokenizer", Un);
|
|
$e(this, "Hooks", cn);
|
|
this.use(...e);
|
|
}
|
|
walkTokens(e, t) {
|
|
var i, a;
|
|
let r = [];
|
|
for (const o of e)
|
|
switch (r = r.concat(t.call(this, o)), o.type) {
|
|
case "table": {
|
|
const s = o;
|
|
for (const u of s.header)
|
|
r = r.concat(this.walkTokens(u.tokens, t));
|
|
for (const u of s.rows)
|
|
for (const c of u)
|
|
r = r.concat(this.walkTokens(c.tokens, t));
|
|
break;
|
|
}
|
|
case "list": {
|
|
const s = o;
|
|
r = r.concat(this.walkTokens(s.items, t));
|
|
break;
|
|
}
|
|
default: {
|
|
const s = o;
|
|
(a = (i = this.defaults.extensions) == null ? void 0 : i.childTokens) != null && a[s.type] ? this.defaults.extensions.childTokens[s.type].forEach((u) => {
|
|
const c = s[u].flat(1 / 0);
|
|
r = r.concat(this.walkTokens(c, t));
|
|
}) : s.tokens && (r = r.concat(this.walkTokens(s.tokens, t)));
|
|
}
|
|
}
|
|
return r;
|
|
}
|
|
use(...e) {
|
|
const t = this.defaults.extensions || { renderers: {}, childTokens: {} };
|
|
return e.forEach((r) => {
|
|
const i = { ...r };
|
|
if (i.async = this.defaults.async || i.async || !1, r.extensions && (r.extensions.forEach((a) => {
|
|
if (!a.name)
|
|
throw new Error("extension name required");
|
|
if ("renderer" in a) {
|
|
const o = t.renderers[a.name];
|
|
o ? t.renderers[a.name] = function(...s) {
|
|
let u = a.renderer.apply(this, s);
|
|
return u === !1 && (u = o.apply(this, s)), u;
|
|
} : t.renderers[a.name] = a.renderer;
|
|
}
|
|
if ("tokenizer" in a) {
|
|
if (!a.level || a.level !== "block" && a.level !== "inline")
|
|
throw new Error("extension level must be 'block' or 'inline'");
|
|
const o = t[a.level];
|
|
o ? o.unshift(a.tokenizer) : t[a.level] = [a.tokenizer], a.start && (a.level === "block" ? t.startBlock ? t.startBlock.push(a.start) : t.startBlock = [a.start] : a.level === "inline" && (t.startInline ? t.startInline.push(a.start) : t.startInline = [a.start]));
|
|
}
|
|
"childTokens" in a && a.childTokens && (t.childTokens[a.name] = a.childTokens);
|
|
}), i.extensions = t), r.renderer) {
|
|
const a = this.defaults.renderer || new qn(this.defaults);
|
|
for (const o in r.renderer) {
|
|
if (!(o in a))
|
|
throw new Error(`renderer '${o}' does not exist`);
|
|
if (["options", "parser"].includes(o))
|
|
continue;
|
|
const s = o, u = r.renderer[s], c = a[s];
|
|
a[s] = (...l) => {
|
|
let h = u.apply(a, l);
|
|
return h === !1 && (h = c.apply(a, l)), h || "";
|
|
};
|
|
}
|
|
i.renderer = a;
|
|
}
|
|
if (r.tokenizer) {
|
|
const a = this.defaults.tokenizer || new Un(this.defaults);
|
|
for (const o in r.tokenizer) {
|
|
if (!(o in a))
|
|
throw new Error(`tokenizer '${o}' does not exist`);
|
|
if (["options", "rules", "lexer"].includes(o))
|
|
continue;
|
|
const s = o, u = r.tokenizer[s], c = a[s];
|
|
a[s] = (...l) => {
|
|
let h = u.apply(a, l);
|
|
return h === !1 && (h = c.apply(a, l)), h;
|
|
};
|
|
}
|
|
i.tokenizer = a;
|
|
}
|
|
if (r.hooks) {
|
|
const a = this.defaults.hooks || new cn();
|
|
for (const o in r.hooks) {
|
|
if (!(o in a))
|
|
throw new Error(`hook '${o}' does not exist`);
|
|
if (["options", "block"].includes(o))
|
|
continue;
|
|
const s = o, u = r.hooks[s], c = a[s];
|
|
cn.passThroughHooks.has(o) ? a[s] = (l) => {
|
|
if (this.defaults.async)
|
|
return Promise.resolve(u.call(a, l)).then((m) => c.call(a, m));
|
|
const h = u.call(a, l);
|
|
return c.call(a, h);
|
|
} : a[s] = (...l) => {
|
|
let h = u.apply(a, l);
|
|
return h === !1 && (h = c.apply(a, l)), h;
|
|
};
|
|
}
|
|
i.hooks = a;
|
|
}
|
|
if (r.walkTokens) {
|
|
const a = this.defaults.walkTokens, o = r.walkTokens;
|
|
i.walkTokens = function(s) {
|
|
let u = [];
|
|
return u.push(o.call(this, s)), a && (u = u.concat(a.call(this, s))), u;
|
|
};
|
|
}
|
|
this.defaults = { ...this.defaults, ...i };
|
|
}), this;
|
|
}
|
|
setOptions(e) {
|
|
return this.defaults = { ...this.defaults, ...e }, this;
|
|
}
|
|
lexer(e, t) {
|
|
return st.lex(e, t != null ? t : this.defaults);
|
|
}
|
|
parser(e, t) {
|
|
return ut.parse(e, t != null ? t : this.defaults);
|
|
}
|
|
parseMarkdown(e) {
|
|
return (r, i) => {
|
|
const a = { ...i }, o = { ...this.defaults, ...a }, s = this.onError(!!o.silent, !!o.async);
|
|
if (this.defaults.async === !0 && a.async === !1)
|
|
return s(new Error("marked(): The async option was set to true by an extension. Remove async: false from the parse options object to return a Promise."));
|
|
if (typeof r > "u" || r === null)
|
|
return s(new Error("marked(): input parameter is undefined or null"));
|
|
if (typeof r != "string")
|
|
return s(new Error("marked(): input parameter is of type " + Object.prototype.toString.call(r) + ", string expected"));
|
|
o.hooks && (o.hooks.options = o, o.hooks.block = e);
|
|
const u = o.hooks ? o.hooks.provideLexer() : e ? st.lex : st.lexInline, c = o.hooks ? o.hooks.provideParser() : e ? ut.parse : ut.parseInline;
|
|
if (o.async)
|
|
return Promise.resolve(o.hooks ? o.hooks.preprocess(r) : r).then((l) => u(l, o)).then((l) => o.hooks ? o.hooks.processAllTokens(l) : l).then((l) => o.walkTokens ? Promise.all(this.walkTokens(l, o.walkTokens)).then(() => l) : l).then((l) => c(l, o)).then((l) => o.hooks ? o.hooks.postprocess(l) : l).catch(s);
|
|
try {
|
|
o.hooks && (r = o.hooks.preprocess(r));
|
|
let l = u(r, o);
|
|
o.hooks && (l = o.hooks.processAllTokens(l)), o.walkTokens && this.walkTokens(l, o.walkTokens);
|
|
let h = c(l, o);
|
|
return o.hooks && (h = o.hooks.postprocess(h)), h;
|
|
} catch (l) {
|
|
return s(l);
|
|
}
|
|
};
|
|
}
|
|
onError(e, t) {
|
|
return (r) => {
|
|
if (r.message += `
|
|
Please report this to https://github.com/markedjs/marked.`, e) {
|
|
const i = "<p>An error occurred:</p><pre>" + pt(r.message + "", !0) + "</pre>";
|
|
return t ? Promise.resolve(i) : i;
|
|
}
|
|
if (t)
|
|
return Promise.reject(r);
|
|
throw r;
|
|
};
|
|
}
|
|
}
|
|
const jt = new ho();
|
|
function we(n, e) {
|
|
return jt.parse(n, e);
|
|
}
|
|
we.options = we.setOptions = function(n) {
|
|
return jt.setOptions(n), we.defaults = jt.defaults, to(we.defaults), we;
|
|
};
|
|
we.getDefaults = Ur;
|
|
we.defaults = It;
|
|
we.use = function(...n) {
|
|
return jt.use(...n), we.defaults = jt.defaults, to(we.defaults), we;
|
|
};
|
|
we.walkTokens = function(n, e) {
|
|
return jt.walkTokens(n, e);
|
|
};
|
|
we.parseInline = jt.parseInline;
|
|
we.Parser = ut;
|
|
we.parser = ut.parse;
|
|
we.Renderer = qn;
|
|
we.TextRenderer = Kr;
|
|
we.Lexer = st;
|
|
we.lexer = st.lex;
|
|
we.Tokenizer = Un;
|
|
we.Hooks = cn;
|
|
we.parse = we;
|
|
we.options;
|
|
we.setOptions;
|
|
we.use;
|
|
we.walkTokens;
|
|
we.parseInline;
|
|
ut.parse;
|
|
st.lex;
|
|
const xf = he({
|
|
name: "FcMarkdown",
|
|
data() {
|
|
return {
|
|
marked: Te(new ho()),
|
|
html: ""
|
|
};
|
|
},
|
|
props: {
|
|
content: String
|
|
},
|
|
watch: {
|
|
content: {
|
|
handler() {
|
|
this.html = this.marked.parse(this.content || "");
|
|
},
|
|
immediate: !0
|
|
}
|
|
}
|
|
}), Cf = ["innerHTML"];
|
|
function kf(n, e, t, r, i, a) {
|
|
return ee(), me("div", {
|
|
class: "_fc-markdown",
|
|
innerHTML: n.html
|
|
}, null, 8, Cf);
|
|
}
|
|
const Af = /* @__PURE__ */ Ae(xf, [["render", kf]]);
|
|
const Df = he({
|
|
name: "FcDialog",
|
|
emits: ["confirm", "submit", "validateFail", "update:modelValue"],
|
|
props: {
|
|
formData: Object,
|
|
options: {
|
|
type: Object,
|
|
default: () => Be({
|
|
submitBtn: !1,
|
|
resetBtn: !1
|
|
})
|
|
},
|
|
rule: Array,
|
|
autoClose: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
footer: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
preview: Boolean,
|
|
modelValue: Object,
|
|
formCreateInject: Object
|
|
},
|
|
computed: {
|
|
formOptions() {
|
|
const n = { ...this.options };
|
|
return this.preview && (n.preview = this.preview), n;
|
|
}
|
|
},
|
|
data() {
|
|
return {
|
|
visible: !1,
|
|
max: this.$attrs.fullscreen || !1,
|
|
fapi: {},
|
|
value: {},
|
|
formRule: [],
|
|
Form: Te(this.formCreateInject.form.$form())
|
|
};
|
|
},
|
|
methods: {
|
|
formChange() {
|
|
this.$emit("update:modelValue", this.fapi.formData());
|
|
},
|
|
open(n) {
|
|
this.$nextTick(() => {
|
|
this.visible = !0, this.value = vt(n || this.modelValue || this.formData || {}), this.formRule = vt(this.rule || []);
|
|
});
|
|
},
|
|
close() {
|
|
this.visible = !1;
|
|
},
|
|
handleConfirm() {
|
|
this.$emit("confirm", this.fapi), this.fapi.submit().then((n) => {
|
|
this.$emit("submit", n, this.fapi, this.close), this.autoClose && this.close();
|
|
}).catch((n) => {
|
|
this.$emit("validateFail", n, this.fapi);
|
|
});
|
|
}
|
|
},
|
|
mounted() {
|
|
this.formCreateInject.api.top.bus.$on("fc.closeDialog", this.close), Oa(() => {
|
|
this.formCreateInject.api.top.bus.$off("fc.closeDialog", this.close);
|
|
});
|
|
}
|
|
}), Rf = {
|
|
key: 0,
|
|
class: "el-dialog__headerbtn",
|
|
type: "button",
|
|
style: { right: "36px" }
|
|
};
|
|
function Pf(n, e, t, r, i, a) {
|
|
const o = K("el-button"), s = K("el-dialog");
|
|
return ee(), Re(s, Pe({ class: "_fc-dialog" }, n.$attrs, {
|
|
fullscreen: n.max,
|
|
modelValue: n.visible,
|
|
"onUpdate:modelValue": e[3] || (e[3] = (u) => n.visible = u),
|
|
destroyOnClose: ""
|
|
}), xa({
|
|
default: Ce(() => [
|
|
n.$attrs.fullscreen ? dt("", !0) : (ee(), me("button", Rf, [
|
|
n.max ? (ee(), me("i", {
|
|
key: 0,
|
|
class: "fc-icon icon-page-min",
|
|
onClick: e[0] || (e[0] = (u) => n.max = !1)
|
|
})) : (ee(), me("i", {
|
|
key: 1,
|
|
class: "fc-icon icon-page-max",
|
|
onClick: e[1] || (e[1] = (u) => n.max = !0)
|
|
}))
|
|
])),
|
|
(ee(), Re(Ft(n.Form), {
|
|
option: n.formOptions,
|
|
rule: n.formRule,
|
|
extendOption: !0,
|
|
api: n.fapi,
|
|
"onUpdate:api": e[2] || (e[2] = (u) => n.fapi = u),
|
|
"model-value": n.value,
|
|
subForm: !1,
|
|
onChange: n.formChange,
|
|
onEmitEvent: n.$emit
|
|
}, null, 40, ["option", "rule", "api", "model-value", "onChange", "onEmitEvent"]))
|
|
]),
|
|
_: 2
|
|
}, [
|
|
n.footer !== !1 ? {
|
|
name: "footer",
|
|
fn: Ce(() => [
|
|
H(o, { onClick: n.close }, {
|
|
default: Ce(() => [
|
|
He(Ve(n.formCreateInject.t("close") || "\u5173\u95ED"), 1)
|
|
]),
|
|
_: 1
|
|
}, 8, ["onClick"]),
|
|
H(o, {
|
|
type: "primary",
|
|
onClick: n.handleConfirm
|
|
}, {
|
|
default: Ce(() => [
|
|
He(Ve(n.formCreateInject.t("ok") || "\u786E\u5B9A"), 1)
|
|
]),
|
|
_: 1
|
|
}, 8, ["onClick"])
|
|
]),
|
|
key: "0"
|
|
} : void 0
|
|
]), 1040, ["fullscreen", "modelValue"]);
|
|
}
|
|
const Mf = /* @__PURE__ */ Ae(Df, [["render", Pf]]), Tf = (n) => n !== null && typeof n == "object", jf = (n) => n != null;
|
|
function Pr(n) {
|
|
if (!jf(n))
|
|
return n;
|
|
if (Array.isArray(n))
|
|
return n.map((e) => Pr(e));
|
|
if (Tf(n)) {
|
|
const e = {};
|
|
return Object.keys(n).forEach((t) => {
|
|
e[t] = Pr(n[t]);
|
|
}), e;
|
|
}
|
|
return n;
|
|
}
|
|
const Ff = (n, e) => ka({
|
|
message: n,
|
|
type: e || "info",
|
|
customClass: "_fc-message-tip"
|
|
});
|
|
function If(n) {
|
|
const e = document.createElement("textarea");
|
|
e.style.position = "fixed", e.style.top = 0, e.style.left = "-9999px", e.value = n, document.body.appendChild(e), e.focus(), e.select();
|
|
try {
|
|
document.execCommand("copy");
|
|
} catch {
|
|
console.log("Oops, unable to copy");
|
|
}
|
|
Ff("\u5DF2\u590D\u5236!", "success"), document.body.removeChild(e);
|
|
}
|
|
function Vf(n) {
|
|
return n.filter((e, t) => n.indexOf(e) === t);
|
|
}
|
|
const Bf = he({
|
|
name: "FcDataSelect",
|
|
components: { FcDialog: Mf },
|
|
emits: ["update:modelValue", "change", "clear"],
|
|
props: {
|
|
title: String,
|
|
formCreateInject: Object,
|
|
placeholder: String,
|
|
multiple: Boolean,
|
|
disabled: Boolean,
|
|
multipleLimit: Number,
|
|
valueKey: String,
|
|
labelKey: String,
|
|
clearable: Boolean,
|
|
searchRule: Object,
|
|
tableRule: Object,
|
|
autoLoad: Boolean,
|
|
modelValue: [Object, Array]
|
|
},
|
|
computed: {
|
|
options() {
|
|
return this.list.map((n) => ({
|
|
label: n[this.labelKey || "label"],
|
|
value: n[this.valueKey || "value"]
|
|
}));
|
|
},
|
|
selectValue() {
|
|
const n = this.options.map((e) => e.value);
|
|
return this.multiple === !0 ? n : n[0];
|
|
},
|
|
fapi() {
|
|
var n, e;
|
|
return (e = (n = this.$refs) == null ? void 0 : n.dialog) == null ? void 0 : e.fapi;
|
|
}
|
|
},
|
|
data() {
|
|
return {
|
|
list: [],
|
|
visible: !1,
|
|
formRule: [],
|
|
load: Ar(() => {
|
|
this.$refs.dialog.fapi.el(this.formRule[1].name).initPage();
|
|
}, 500)
|
|
};
|
|
},
|
|
watch: {
|
|
modelValue: {
|
|
handler(n) {
|
|
n ? this.list = Array.isArray(n) ? n : [n] : this.list = [];
|
|
},
|
|
immediate: !0
|
|
}
|
|
},
|
|
methods: {
|
|
getTableEl() {
|
|
return this.$refs.dialog.fapi.el(this.formRule[1].name);
|
|
},
|
|
getDialogEl() {
|
|
return this.$refs.dialog;
|
|
},
|
|
formChange() {
|
|
this.autoLoad && this.load();
|
|
},
|
|
changeSelectValue(n) {
|
|
n == null ? this.list = [] : this.list = this.list.filter((e) => n.indexOf(e[this.valueKey || "value"]) !== -1), this.updateValue();
|
|
},
|
|
confirm() {
|
|
const n = Vf([...this.list, ...this.$refs.dialog.fapi.el(this.formRule[1].name).getEl().getSelectionRows()]), e = n.map((t) => t[this.valueKey || "value"]);
|
|
this.list = n.filter((t, r) => e.indexOf(t[this.valueKey || "value"]) === r), this.$refs.dialog.close(), this.updateValue();
|
|
},
|
|
tableRowClick(n) {
|
|
this.multiple ? this.$refs.dialog.fapi.el(this.formRule[1].name).getEl().toggleRowSelection(n) : (this.list = [n], this.updateValue(), this.$refs.dialog.close());
|
|
},
|
|
updateValue() {
|
|
this.multipleLimit > 0 && this.list.length > this.multipleLimit && (this.list = this.list.splice(0, this.multipleLimit));
|
|
const n = this.list.map((e) => ({
|
|
[this.valueKey || "value"]: e[this.valueKey || "value"],
|
|
[this.labelKey || "label"]: e[this.labelKey || "label"]
|
|
}));
|
|
this.$emit("update:modelValue", this.multiple ? n : n[0]), this.$emit("change", this.multiple ? n : n[0]);
|
|
},
|
|
getFormRule() {
|
|
const n = Pr([
|
|
this.searchRule,
|
|
this.tableRule
|
|
]);
|
|
return n[1].on || (n[1].on = {}), n[1].props || (n[1].props = {}), this.multiple && (n[1].props.rowKey || (n[1].props.rowKey = this.valueKey || "value"), n[1].name || (n[1].name = kr())), n[1].props.selection = !0, n[1].on.rowClick ? n[1].on.rowClick = [(...e) => this.tableRowClick(...e), n[1].on.rowClick] : n[1].on.rowClick = (...e) => this.tableRowClick(...e), n[1].on.selectionChange ? n[1].on.selectionChange = [(...e) => this.selectionChange(...e), n[1].on.selectionChange] : n[1].on.selectionChange = (...e) => this.selectionChange(...e), n;
|
|
},
|
|
selectionChange(n) {
|
|
this.multiple || this.tableRowClick(n[0]);
|
|
},
|
|
handleClear(...n) {
|
|
this.$emit("clear", ...n);
|
|
},
|
|
handleClick(n) {
|
|
this.disabled || !n || (this.visible = !0, this.formRule = this.getFormRule(), this.$refs.dialog.open());
|
|
}
|
|
}
|
|
}), Lf = { class: "_fc-data-select" };
|
|
function Nf(n, e, t, r, i, a) {
|
|
const o = K("el-option"), s = K("el-select"), u = K("FcDialog");
|
|
return ee(), me("div", Lf, [
|
|
H(s, {
|
|
disabled: n.disabled,
|
|
placeholder: n.placeholder,
|
|
multiple: n.multiple,
|
|
multipleLimit: n.multipleLimit,
|
|
clearable: n.clearable,
|
|
"model-value": n.selectValue,
|
|
"onUpdate:modelValue": n.changeSelectValue,
|
|
"popper-class": "_fc-data-select-pop",
|
|
onVisibleChange: n.handleClick,
|
|
onClear: n.handleClear
|
|
}, {
|
|
default: Ce(() => [
|
|
(ee(!0), me(Ke, null, un(n.options, (c) => (ee(), Re(o, {
|
|
key: c.value,
|
|
label: c.label,
|
|
value: c.value
|
|
}, null, 8, ["label", "value"]))), 128))
|
|
]),
|
|
_: 1
|
|
}, 8, ["disabled", "placeholder", "multiple", "multipleLimit", "clearable", "model-value", "onUpdate:modelValue", "onVisibleChange", "onClear"]),
|
|
H(u, {
|
|
ref: "dialog",
|
|
formCreateInject: n.formCreateInject,
|
|
rule: n.formRule,
|
|
"onUpdate:modelValue": n.formChange,
|
|
footer: n.multiple,
|
|
title: n.title,
|
|
width: "900px",
|
|
onConfirm: n.confirm
|
|
}, null, 8, ["formCreateInject", "rule", "onUpdate:modelValue", "footer", "title", "onConfirm"])
|
|
]);
|
|
}
|
|
const zf = /* @__PURE__ */ Ae(Bf, [["render", Nf]]), Uf = he({
|
|
name: "AudioBox",
|
|
emits: ["pause", "play", "ended"],
|
|
data() {
|
|
return {};
|
|
},
|
|
props: {
|
|
src: String,
|
|
type: String,
|
|
controls: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
autoplay: Boolean,
|
|
loop: Boolean,
|
|
preload: {
|
|
type: String,
|
|
default: "auto"
|
|
},
|
|
muted: Boolean
|
|
}
|
|
}), qf = ["controls", "autoplay", "loop", "preload", "muted"], Gf = ["src", "type"];
|
|
function Hf(n, e, t, r, i, a) {
|
|
return ee(), me("audio", {
|
|
key: n.src,
|
|
controls: n.controls,
|
|
autoplay: n.autoplay,
|
|
loop: n.loop,
|
|
preload: n.preload,
|
|
muted: n.muted,
|
|
onPause: e[0] || (e[0] = (o) => n.$emit("pause", o)),
|
|
onPlay: e[1] || (e[1] = (o) => n.$emit("play", o)),
|
|
onEnded: e[2] || (e[2] = (o) => n.$emit("ended", o))
|
|
}, [
|
|
Me("source", {
|
|
src: n.src,
|
|
type: n.type
|
|
}, null, 8, Gf),
|
|
e[3] || (e[3] = He(" Your browser does not support the audio element. "))
|
|
], 40, qf);
|
|
}
|
|
const Wf = /* @__PURE__ */ Ae(Uf, [["render", Hf]]);
|
|
const Yf = he({
|
|
name: "IframeBox",
|
|
emits: ["load"],
|
|
data() {
|
|
return {};
|
|
},
|
|
props: {
|
|
src: String,
|
|
loading: String
|
|
}
|
|
}), Xf = ["src"];
|
|
function Jf(n, e, t, r, i, a) {
|
|
return ee(), me("iframe", {
|
|
class: "_fc-iframe-box",
|
|
src: n.src,
|
|
frameborder: "0",
|
|
onLoad: e[0] || (e[0] = (o) => n.$emit("load", o))
|
|
}, null, 40, Xf);
|
|
}
|
|
const Kf = /* @__PURE__ */ Ae(Yf, [["render", Jf]]);
|
|
var Zr = {}, Xn = {}, Ze = {};
|
|
Object.defineProperty(Ze, "__esModule", {
|
|
value: !0
|
|
});
|
|
function Zf(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
var Qf = function n(e, t) {
|
|
Zf(this, n), this.data = e, this.text = t.text || e, this.options = t;
|
|
};
|
|
Ze.default = Qf;
|
|
Object.defineProperty(Xn, "__esModule", {
|
|
value: !0
|
|
});
|
|
Xn.CODE39 = void 0;
|
|
var ed = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), td = Ze, nd = rd(td);
|
|
function rd(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function id(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function ad(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function od(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var sd = function(n) {
|
|
od(e, n);
|
|
function e(t, r) {
|
|
return id(this, e), t = t.toUpperCase(), r.mod43 && (t += cd(fd(t))), ad(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t, r));
|
|
}
|
|
return ed(e, [{
|
|
key: "encode",
|
|
value: function() {
|
|
for (var r = cr("*"), i = 0; i < this.data.length; i++)
|
|
r += cr(this.data[i]) + "0";
|
|
return r += cr("*"), {
|
|
data: r,
|
|
text: this.text
|
|
};
|
|
}
|
|
}, {
|
|
key: "valid",
|
|
value: function() {
|
|
return this.data.search(/^[0-9A-Z\-\.\ \$\/\+\%]+$/) !== -1;
|
|
}
|
|
}]), e;
|
|
}(nd.default), po = ["0", "1", "2", "3", "4", "5", "6", "7", "8", "9", "A", "B", "C", "D", "E", "F", "G", "H", "I", "J", "K", "L", "M", "N", "O", "P", "Q", "R", "S", "T", "U", "V", "W", "X", "Y", "Z", "-", ".", " ", "$", "/", "+", "%", "*"], ud = [20957, 29783, 23639, 30485, 20951, 29813, 23669, 20855, 29789, 23645, 29975, 23831, 30533, 22295, 30149, 24005, 21623, 29981, 23837, 22301, 30023, 23879, 30545, 22343, 30161, 24017, 21959, 30065, 23921, 22385, 29015, 18263, 29141, 17879, 29045, 18293, 17783, 29021, 18269, 17477, 17489, 17681, 20753, 35770];
|
|
function cr(n) {
|
|
return ld(mo(n));
|
|
}
|
|
function ld(n) {
|
|
return ud[n].toString(2);
|
|
}
|
|
function cd(n) {
|
|
return po[n];
|
|
}
|
|
function mo(n) {
|
|
return po.indexOf(n);
|
|
}
|
|
function fd(n) {
|
|
for (var e = 0, t = 0; t < n.length; t++)
|
|
e += mo(n[t]);
|
|
return e = e % 43, e;
|
|
}
|
|
Xn.CODE39 = sd;
|
|
var mt = {}, Qr = {}, Xt = {}, xe = {};
|
|
Object.defineProperty(xe, "__esModule", {
|
|
value: !0
|
|
});
|
|
var rn;
|
|
function fr(n, e, t) {
|
|
return e in n ? Object.defineProperty(n, e, { value: t, enumerable: !0, configurable: !0, writable: !0 }) : n[e] = t, n;
|
|
}
|
|
var go = xe.SET_A = 0, vo = xe.SET_B = 1, yo = xe.SET_C = 2;
|
|
xe.SHIFT = 98;
|
|
var dd = xe.START_A = 103, hd = xe.START_B = 104, pd = xe.START_C = 105;
|
|
xe.MODULO = 103;
|
|
xe.STOP = 106;
|
|
xe.FNC1 = 207;
|
|
xe.SET_BY_CODE = (rn = {}, fr(rn, dd, go), fr(rn, hd, vo), fr(rn, pd, yo), rn);
|
|
xe.SWAP = {
|
|
101: go,
|
|
100: vo,
|
|
99: yo
|
|
};
|
|
xe.A_START_CHAR = String.fromCharCode(208);
|
|
xe.B_START_CHAR = String.fromCharCode(209);
|
|
xe.C_START_CHAR = String.fromCharCode(210);
|
|
xe.A_CHARS = "[\0-_\xC8-\xCF]";
|
|
xe.B_CHARS = "[ -\x7F\xC8-\xCF]";
|
|
xe.C_CHARS = "(\xCF*[0-9]{2}\xCF*)";
|
|
xe.BARS = [11011001100, 11001101100, 11001100110, 10010011e3, 10010001100, 10001001100, 10011001e3, 10011000100, 10001100100, 11001001e3, 11001000100, 11000100100, 10110011100, 10011011100, 10011001110, 10111001100, 10011101100, 10011100110, 11001110010, 11001011100, 11001001110, 11011100100, 11001110100, 11101101110, 11101001100, 11100101100, 11100100110, 11101100100, 11100110100, 11100110010, 11011011e3, 11011000110, 11000110110, 10100011e3, 10001011e3, 10001000110, 10110001e3, 10001101e3, 10001100010, 11010001e3, 11000101e3, 11000100010, 10110111e3, 10110001110, 10001101110, 10111011e3, 10111000110, 10001110110, 11101110110, 11010001110, 11000101110, 11011101e3, 11011100010, 11011101110, 11101011e3, 11101000110, 11100010110, 11101101e3, 11101100010, 11100011010, 11101111010, 11001000010, 11110001010, 1010011e4, 10100001100, 1001011e4, 10010000110, 10000101100, 10000100110, 1011001e4, 10110000100, 1001101e4, 10011000010, 10000110100, 10000110010, 11000010010, 1100101e4, 11110111010, 11000010100, 10001111010, 10100111100, 10010111100, 10010011110, 10111100100, 10011110100, 10011110010, 11110100100, 11110010100, 11110010010, 11011011110, 11011110110, 11110110110, 10101111e3, 10100011110, 10001011110, 10111101e3, 10111100010, 11110101e3, 11110100010, 10111011110, 10111101110, 11101011110, 11110101110, 11010000100, 1101001e4, 11010011100, 1100011101011];
|
|
Object.defineProperty(Xt, "__esModule", {
|
|
value: !0
|
|
});
|
|
var md = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), gd = Ze, vd = yd(gd), et = xe;
|
|
function yd(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function _d(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function bd(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function wd(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var $d = function(n) {
|
|
wd(e, n);
|
|
function e(t, r) {
|
|
_d(this, e);
|
|
var i = bd(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t.substring(1), r));
|
|
return i.bytes = t.split("").map(function(a) {
|
|
return a.charCodeAt(0);
|
|
}), i;
|
|
}
|
|
return md(e, [{
|
|
key: "valid",
|
|
value: function() {
|
|
return /^[\x00-\x7F\xC8-\xD3]+$/.test(this.data);
|
|
}
|
|
}, {
|
|
key: "encode",
|
|
value: function() {
|
|
var r = this.bytes, i = r.shift() - 105, a = et.SET_BY_CODE[i];
|
|
if (a === void 0)
|
|
throw new RangeError("The encoding does not start with a start character.");
|
|
this.shouldEncodeAsEan128() === !0 && r.unshift(et.FNC1);
|
|
var o = e.next(r, 1, a);
|
|
return {
|
|
text: this.text === this.data ? this.text.replace(/[^\x20-\x7E]/g, "") : this.text,
|
|
data: e.getBar(i) + o.result + e.getBar((o.checksum + i) % et.MODULO) + e.getBar(et.STOP)
|
|
};
|
|
}
|
|
}, {
|
|
key: "shouldEncodeAsEan128",
|
|
value: function() {
|
|
var r = this.options.ean128 || !1;
|
|
return typeof r == "string" && (r = r.toLowerCase() === "true"), r;
|
|
}
|
|
}], [{
|
|
key: "getBar",
|
|
value: function(r) {
|
|
return et.BARS[r] ? et.BARS[r].toString() : "";
|
|
}
|
|
}, {
|
|
key: "correctIndex",
|
|
value: function(r, i) {
|
|
if (i === et.SET_A) {
|
|
var a = r.shift();
|
|
return a < 32 ? a + 64 : a - 32;
|
|
} else
|
|
return i === et.SET_B ? r.shift() - 32 : (r.shift() - 48) * 10 + r.shift() - 48;
|
|
}
|
|
}, {
|
|
key: "next",
|
|
value: function(r, i, a) {
|
|
if (!r.length)
|
|
return { result: "", checksum: 0 };
|
|
var o = void 0, s = void 0;
|
|
if (r[0] >= 200) {
|
|
s = r.shift() - 105;
|
|
var u = et.SWAP[s];
|
|
u !== void 0 ? o = e.next(r, i + 1, u) : ((a === et.SET_A || a === et.SET_B) && s === et.SHIFT && (r[0] = a === et.SET_A ? r[0] > 95 ? r[0] - 96 : r[0] : r[0] < 32 ? r[0] + 96 : r[0]), o = e.next(r, i + 1, a));
|
|
} else
|
|
s = e.correctIndex(r, a), o = e.next(r, i + 1, a);
|
|
var c = e.getBar(s), l = s * i;
|
|
return {
|
|
result: c + o.result,
|
|
checksum: l + o.checksum
|
|
};
|
|
}
|
|
}]), e;
|
|
}(vd.default);
|
|
Xt.default = $d;
|
|
var ei = {};
|
|
Object.defineProperty(ei, "__esModule", {
|
|
value: !0
|
|
});
|
|
var Ct = xe, _o = function(e) {
|
|
return e.match(new RegExp("^" + Ct.A_CHARS + "*"))[0].length;
|
|
}, bo = function(e) {
|
|
return e.match(new RegExp("^" + Ct.B_CHARS + "*"))[0].length;
|
|
}, wo = function(e) {
|
|
return e.match(new RegExp("^" + Ct.C_CHARS + "*"))[0];
|
|
};
|
|
function ti(n, e) {
|
|
var t = e ? Ct.A_CHARS : Ct.B_CHARS, r = n.match(new RegExp("^(" + t + "+?)(([0-9]{2}){2,})([^0-9]|$)"));
|
|
if (r)
|
|
return r[1] + String.fromCharCode(204) + $o(n.substring(r[1].length));
|
|
var i = n.match(new RegExp("^" + t + "+"))[0];
|
|
return i.length === n.length ? n : i + String.fromCharCode(e ? 205 : 206) + ti(n.substring(i.length), !e);
|
|
}
|
|
function $o(n) {
|
|
var e = wo(n), t = e.length;
|
|
if (t === n.length)
|
|
return n;
|
|
n = n.substring(t);
|
|
var r = _o(n) >= bo(n);
|
|
return e + String.fromCharCode(r ? 206 : 205) + ti(n, r);
|
|
}
|
|
ei.default = function(n) {
|
|
var e = void 0, t = wo(n).length;
|
|
if (t >= 2)
|
|
e = Ct.C_START_CHAR + $o(n);
|
|
else {
|
|
var r = _o(n) > bo(n);
|
|
e = (r ? Ct.A_START_CHAR : Ct.B_START_CHAR) + ti(n, r);
|
|
}
|
|
return e.replace(
|
|
/[\xCD\xCE]([^])[\xCD\xCE]/,
|
|
function(i, a) {
|
|
return String.fromCharCode(203) + a;
|
|
}
|
|
);
|
|
};
|
|
Object.defineProperty(Qr, "__esModule", {
|
|
value: !0
|
|
});
|
|
var Sd = Xt, Od = So(Sd), Ed = ei, xd = So(Ed);
|
|
function So(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function Cd(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function dr(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function kd(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var Ad = function(n) {
|
|
kd(e, n);
|
|
function e(t, r) {
|
|
if (Cd(this, e), /^[\x00-\x7F\xC8-\xD3]+$/.test(t))
|
|
var i = dr(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, (0, xd.default)(t), r));
|
|
else
|
|
var i = dr(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t, r));
|
|
return dr(i);
|
|
}
|
|
return e;
|
|
}(Od.default);
|
|
Qr.default = Ad;
|
|
var ni = {};
|
|
Object.defineProperty(ni, "__esModule", {
|
|
value: !0
|
|
});
|
|
var Dd = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), Rd = Xt, Pd = Md(Rd), sa = xe;
|
|
function Md(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function Td(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function jd(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function Fd(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var Id = function(n) {
|
|
Fd(e, n);
|
|
function e(t, r) {
|
|
return Td(this, e), jd(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, sa.A_START_CHAR + t, r));
|
|
}
|
|
return Dd(e, [{
|
|
key: "valid",
|
|
value: function() {
|
|
return new RegExp("^" + sa.A_CHARS + "+$").test(this.data);
|
|
}
|
|
}]), e;
|
|
}(Pd.default);
|
|
ni.default = Id;
|
|
var ri = {};
|
|
Object.defineProperty(ri, "__esModule", {
|
|
value: !0
|
|
});
|
|
var Vd = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), Bd = Xt, Ld = Nd(Bd), ua = xe;
|
|
function Nd(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function zd(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function Ud(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function qd(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var Gd = function(n) {
|
|
qd(e, n);
|
|
function e(t, r) {
|
|
return zd(this, e), Ud(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, ua.B_START_CHAR + t, r));
|
|
}
|
|
return Vd(e, [{
|
|
key: "valid",
|
|
value: function() {
|
|
return new RegExp("^" + ua.B_CHARS + "+$").test(this.data);
|
|
}
|
|
}]), e;
|
|
}(Ld.default);
|
|
ri.default = Gd;
|
|
var ii = {};
|
|
Object.defineProperty(ii, "__esModule", {
|
|
value: !0
|
|
});
|
|
var Hd = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), Wd = Xt, Yd = Xd(Wd), la = xe;
|
|
function Xd(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function Jd(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function Kd(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function Zd(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var Qd = function(n) {
|
|
Zd(e, n);
|
|
function e(t, r) {
|
|
return Jd(this, e), Kd(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, la.C_START_CHAR + t, r));
|
|
}
|
|
return Hd(e, [{
|
|
key: "valid",
|
|
value: function() {
|
|
return new RegExp("^" + la.C_CHARS + "+$").test(this.data);
|
|
}
|
|
}]), e;
|
|
}(Yd.default);
|
|
ii.default = Qd;
|
|
Object.defineProperty(mt, "__esModule", {
|
|
value: !0
|
|
});
|
|
mt.CODE128C = mt.CODE128B = mt.CODE128A = mt.CODE128 = void 0;
|
|
var eh = Qr, th = Jn(eh), nh = ni, rh = Jn(nh), ih = ri, ah = Jn(ih), oh = ii, sh = Jn(oh);
|
|
function Jn(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
mt.CODE128 = th.default;
|
|
mt.CODE128A = rh.default;
|
|
mt.CODE128B = ah.default;
|
|
mt.CODE128C = sh.default;
|
|
var Je = {}, ai = {}, lt = {};
|
|
Object.defineProperty(lt, "__esModule", {
|
|
value: !0
|
|
});
|
|
lt.SIDE_BIN = "101";
|
|
lt.MIDDLE_BIN = "01010";
|
|
lt.BINARIES = {
|
|
L: [
|
|
"0001101",
|
|
"0011001",
|
|
"0010011",
|
|
"0111101",
|
|
"0100011",
|
|
"0110001",
|
|
"0101111",
|
|
"0111011",
|
|
"0110111",
|
|
"0001011"
|
|
],
|
|
G: [
|
|
"0100111",
|
|
"0110011",
|
|
"0011011",
|
|
"0100001",
|
|
"0011101",
|
|
"0111001",
|
|
"0000101",
|
|
"0010001",
|
|
"0001001",
|
|
"0010111"
|
|
],
|
|
R: [
|
|
"1110010",
|
|
"1100110",
|
|
"1101100",
|
|
"1000010",
|
|
"1011100",
|
|
"1001110",
|
|
"1010000",
|
|
"1000100",
|
|
"1001000",
|
|
"1110100"
|
|
],
|
|
O: [
|
|
"0001101",
|
|
"0011001",
|
|
"0010011",
|
|
"0111101",
|
|
"0100011",
|
|
"0110001",
|
|
"0101111",
|
|
"0111011",
|
|
"0110111",
|
|
"0001011"
|
|
],
|
|
E: [
|
|
"0100111",
|
|
"0110011",
|
|
"0011011",
|
|
"0100001",
|
|
"0011101",
|
|
"0111001",
|
|
"0000101",
|
|
"0010001",
|
|
"0001001",
|
|
"0010111"
|
|
]
|
|
};
|
|
lt.EAN2_STRUCTURE = ["LL", "LG", "GL", "GG"];
|
|
lt.EAN5_STRUCTURE = ["GGLLL", "GLGLL", "GLLGL", "GLLLG", "LGGLL", "LLGGL", "LLLGG", "LGLGL", "LGLLG", "LLGLG"];
|
|
lt.EAN13_STRUCTURE = ["LLLLLL", "LLGLGG", "LLGGLG", "LLGGGL", "LGLLGG", "LGGLLG", "LGGGLL", "LGLGLG", "LGLGGL", "LGGLGL"];
|
|
var Kn = {}, Vt = {};
|
|
Object.defineProperty(Vt, "__esModule", {
|
|
value: !0
|
|
});
|
|
var uh = lt, lh = function(e, t, r) {
|
|
var i = e.split("").map(function(o, s) {
|
|
return uh.BINARIES[t[s]];
|
|
}).map(function(o, s) {
|
|
return o ? o[e[s]] : "";
|
|
});
|
|
if (r) {
|
|
var a = e.length - 1;
|
|
i = i.map(function(o, s) {
|
|
return s < a ? o + r : o;
|
|
});
|
|
}
|
|
return i.join("");
|
|
};
|
|
Vt.default = lh;
|
|
Object.defineProperty(Kn, "__esModule", {
|
|
value: !0
|
|
});
|
|
var ch = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), zt = lt, fh = Vt, ca = Oo(fh), dh = Ze, hh = Oo(dh);
|
|
function Oo(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function ph(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function mh(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function gh(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var vh = function(n) {
|
|
gh(e, n);
|
|
function e(t, r) {
|
|
ph(this, e);
|
|
var i = mh(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t, r));
|
|
return i.fontSize = !r.flat && r.fontSize > r.width * 10 ? r.width * 10 : r.fontSize, i.guardHeight = r.height + i.fontSize / 2 + r.textMargin, i;
|
|
}
|
|
return ch(e, [{
|
|
key: "encode",
|
|
value: function() {
|
|
return this.options.flat ? this.encodeFlat() : this.encodeGuarded();
|
|
}
|
|
}, {
|
|
key: "leftText",
|
|
value: function(r, i) {
|
|
return this.text.substr(r, i);
|
|
}
|
|
}, {
|
|
key: "leftEncode",
|
|
value: function(r, i) {
|
|
return (0, ca.default)(r, i);
|
|
}
|
|
}, {
|
|
key: "rightText",
|
|
value: function(r, i) {
|
|
return this.text.substr(r, i);
|
|
}
|
|
}, {
|
|
key: "rightEncode",
|
|
value: function(r, i) {
|
|
return (0, ca.default)(r, i);
|
|
}
|
|
}, {
|
|
key: "encodeGuarded",
|
|
value: function() {
|
|
var r = { fontSize: this.fontSize }, i = { height: this.guardHeight };
|
|
return [{ data: zt.SIDE_BIN, options: i }, { data: this.leftEncode(), text: this.leftText(), options: r }, { data: zt.MIDDLE_BIN, options: i }, { data: this.rightEncode(), text: this.rightText(), options: r }, { data: zt.SIDE_BIN, options: i }];
|
|
}
|
|
}, {
|
|
key: "encodeFlat",
|
|
value: function() {
|
|
var r = [zt.SIDE_BIN, this.leftEncode(), zt.MIDDLE_BIN, this.rightEncode(), zt.SIDE_BIN];
|
|
return {
|
|
data: r.join(""),
|
|
text: this.text
|
|
};
|
|
}
|
|
}]), e;
|
|
}(hh.default);
|
|
Kn.default = vh;
|
|
Object.defineProperty(ai, "__esModule", {
|
|
value: !0
|
|
});
|
|
var yh = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), an = function n(e, t, r) {
|
|
e === null && (e = Function.prototype);
|
|
var i = Object.getOwnPropertyDescriptor(e, t);
|
|
if (i === void 0) {
|
|
var a = Object.getPrototypeOf(e);
|
|
return a === null ? void 0 : n(a, t, r);
|
|
} else {
|
|
if ("value" in i)
|
|
return i.value;
|
|
var o = i.get;
|
|
return o === void 0 ? void 0 : o.call(r);
|
|
}
|
|
}, _h = lt, bh = Kn, wh = $h(bh);
|
|
function $h(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function Sh(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function Oh(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function Eh(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var fa = function(e) {
|
|
var t = e.substr(0, 12).split("").map(function(r) {
|
|
return +r;
|
|
}).reduce(function(r, i, a) {
|
|
return a % 2 ? r + i * 3 : r + i;
|
|
}, 0);
|
|
return (10 - t % 10) % 10;
|
|
}, xh = function(n) {
|
|
Eh(e, n);
|
|
function e(t, r) {
|
|
Sh(this, e), t.search(/^[0-9]{12}$/) !== -1 && (t += fa(t));
|
|
var i = Oh(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t, r));
|
|
return i.lastChar = r.lastChar, i;
|
|
}
|
|
return yh(e, [{
|
|
key: "valid",
|
|
value: function() {
|
|
return this.data.search(/^[0-9]{13}$/) !== -1 && +this.data[12] === fa(this.data);
|
|
}
|
|
}, {
|
|
key: "leftText",
|
|
value: function() {
|
|
return an(e.prototype.__proto__ || Object.getPrototypeOf(e.prototype), "leftText", this).call(this, 1, 6);
|
|
}
|
|
}, {
|
|
key: "leftEncode",
|
|
value: function() {
|
|
var r = this.data.substr(1, 6), i = _h.EAN13_STRUCTURE[this.data[0]];
|
|
return an(e.prototype.__proto__ || Object.getPrototypeOf(e.prototype), "leftEncode", this).call(this, r, i);
|
|
}
|
|
}, {
|
|
key: "rightText",
|
|
value: function() {
|
|
return an(e.prototype.__proto__ || Object.getPrototypeOf(e.prototype), "rightText", this).call(this, 7, 6);
|
|
}
|
|
}, {
|
|
key: "rightEncode",
|
|
value: function() {
|
|
var r = this.data.substr(7, 6);
|
|
return an(e.prototype.__proto__ || Object.getPrototypeOf(e.prototype), "rightEncode", this).call(this, r, "RRRRRR");
|
|
}
|
|
}, {
|
|
key: "encodeGuarded",
|
|
value: function() {
|
|
var r = an(e.prototype.__proto__ || Object.getPrototypeOf(e.prototype), "encodeGuarded", this).call(this);
|
|
return this.options.displayValue && (r.unshift({
|
|
data: "000000000000",
|
|
text: this.text.substr(0, 1),
|
|
options: { textAlign: "left", fontSize: this.fontSize }
|
|
}), this.options.lastChar && (r.push({
|
|
data: "00"
|
|
}), r.push({
|
|
data: "00000",
|
|
text: this.options.lastChar,
|
|
options: { fontSize: this.fontSize }
|
|
}))), r;
|
|
}
|
|
}]), e;
|
|
}(wh.default);
|
|
ai.default = xh;
|
|
var oi = {};
|
|
Object.defineProperty(oi, "__esModule", {
|
|
value: !0
|
|
});
|
|
var Ch = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), En = function n(e, t, r) {
|
|
e === null && (e = Function.prototype);
|
|
var i = Object.getOwnPropertyDescriptor(e, t);
|
|
if (i === void 0) {
|
|
var a = Object.getPrototypeOf(e);
|
|
return a === null ? void 0 : n(a, t, r);
|
|
} else {
|
|
if ("value" in i)
|
|
return i.value;
|
|
var o = i.get;
|
|
return o === void 0 ? void 0 : o.call(r);
|
|
}
|
|
}, kh = Kn, Ah = Dh(kh);
|
|
function Dh(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function Rh(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function Ph(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function Mh(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var da = function(e) {
|
|
var t = e.substr(0, 7).split("").map(function(r) {
|
|
return +r;
|
|
}).reduce(function(r, i, a) {
|
|
return a % 2 ? r + i : r + i * 3;
|
|
}, 0);
|
|
return (10 - t % 10) % 10;
|
|
}, Th = function(n) {
|
|
Mh(e, n);
|
|
function e(t, r) {
|
|
return Rh(this, e), t.search(/^[0-9]{7}$/) !== -1 && (t += da(t)), Ph(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t, r));
|
|
}
|
|
return Ch(e, [{
|
|
key: "valid",
|
|
value: function() {
|
|
return this.data.search(/^[0-9]{8}$/) !== -1 && +this.data[7] === da(this.data);
|
|
}
|
|
}, {
|
|
key: "leftText",
|
|
value: function() {
|
|
return En(e.prototype.__proto__ || Object.getPrototypeOf(e.prototype), "leftText", this).call(this, 0, 4);
|
|
}
|
|
}, {
|
|
key: "leftEncode",
|
|
value: function() {
|
|
var r = this.data.substr(0, 4);
|
|
return En(e.prototype.__proto__ || Object.getPrototypeOf(e.prototype), "leftEncode", this).call(this, r, "LLLL");
|
|
}
|
|
}, {
|
|
key: "rightText",
|
|
value: function() {
|
|
return En(e.prototype.__proto__ || Object.getPrototypeOf(e.prototype), "rightText", this).call(this, 4, 4);
|
|
}
|
|
}, {
|
|
key: "rightEncode",
|
|
value: function() {
|
|
var r = this.data.substr(4, 4);
|
|
return En(e.prototype.__proto__ || Object.getPrototypeOf(e.prototype), "rightEncode", this).call(this, r, "RRRR");
|
|
}
|
|
}]), e;
|
|
}(Ah.default);
|
|
oi.default = Th;
|
|
var si = {};
|
|
Object.defineProperty(si, "__esModule", {
|
|
value: !0
|
|
});
|
|
var jh = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), Fh = lt, Ih = Vt, Vh = Eo(Ih), Bh = Ze, Lh = Eo(Bh);
|
|
function Eo(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function Nh(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function zh(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function Uh(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var qh = function(e) {
|
|
var t = e.split("").map(function(r) {
|
|
return +r;
|
|
}).reduce(function(r, i, a) {
|
|
return a % 2 ? r + i * 9 : r + i * 3;
|
|
}, 0);
|
|
return t % 10;
|
|
}, Gh = function(n) {
|
|
Uh(e, n);
|
|
function e(t, r) {
|
|
return Nh(this, e), zh(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t, r));
|
|
}
|
|
return jh(e, [{
|
|
key: "valid",
|
|
value: function() {
|
|
return this.data.search(/^[0-9]{5}$/) !== -1;
|
|
}
|
|
}, {
|
|
key: "encode",
|
|
value: function() {
|
|
var r = Fh.EAN5_STRUCTURE[qh(this.data)];
|
|
return {
|
|
data: "1011" + (0, Vh.default)(this.data, r, "01"),
|
|
text: this.text
|
|
};
|
|
}
|
|
}]), e;
|
|
}(Lh.default);
|
|
si.default = Gh;
|
|
var ui = {};
|
|
Object.defineProperty(ui, "__esModule", {
|
|
value: !0
|
|
});
|
|
var Hh = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), Wh = lt, Yh = Vt, Xh = xo(Yh), Jh = Ze, Kh = xo(Jh);
|
|
function xo(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function Zh(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function Qh(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function ep(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var tp = function(n) {
|
|
ep(e, n);
|
|
function e(t, r) {
|
|
return Zh(this, e), Qh(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t, r));
|
|
}
|
|
return Hh(e, [{
|
|
key: "valid",
|
|
value: function() {
|
|
return this.data.search(/^[0-9]{2}$/) !== -1;
|
|
}
|
|
}, {
|
|
key: "encode",
|
|
value: function() {
|
|
var r = Wh.EAN2_STRUCTURE[parseInt(this.data) % 4];
|
|
return {
|
|
data: "1011" + (0, Xh.default)(this.data, r, "01"),
|
|
text: this.text
|
|
};
|
|
}
|
|
}]), e;
|
|
}(Kh.default);
|
|
ui.default = tp;
|
|
var mn = {};
|
|
Object.defineProperty(mn, "__esModule", {
|
|
value: !0
|
|
});
|
|
var np = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}();
|
|
mn.checksum = Mr;
|
|
var rp = Vt, Ut = Co(rp), ip = Ze, ap = Co(ip);
|
|
function Co(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function op(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function sp(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function up(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var lp = function(n) {
|
|
up(e, n);
|
|
function e(t, r) {
|
|
op(this, e), t.search(/^[0-9]{11}$/) !== -1 && (t += Mr(t));
|
|
var i = sp(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t, r));
|
|
return i.displayValue = r.displayValue, r.fontSize > r.width * 10 ? i.fontSize = r.width * 10 : i.fontSize = r.fontSize, i.guardHeight = r.height + i.fontSize / 2 + r.textMargin, i;
|
|
}
|
|
return np(e, [{
|
|
key: "valid",
|
|
value: function() {
|
|
return this.data.search(/^[0-9]{12}$/) !== -1 && this.data[11] == Mr(this.data);
|
|
}
|
|
}, {
|
|
key: "encode",
|
|
value: function() {
|
|
return this.options.flat ? this.flatEncoding() : this.guardedEncoding();
|
|
}
|
|
}, {
|
|
key: "flatEncoding",
|
|
value: function() {
|
|
var r = "";
|
|
return r += "101", r += (0, Ut.default)(this.data.substr(0, 6), "LLLLLL"), r += "01010", r += (0, Ut.default)(this.data.substr(6, 6), "RRRRRR"), r += "101", {
|
|
data: r,
|
|
text: this.text
|
|
};
|
|
}
|
|
}, {
|
|
key: "guardedEncoding",
|
|
value: function() {
|
|
var r = [];
|
|
return this.displayValue && r.push({
|
|
data: "00000000",
|
|
text: this.text.substr(0, 1),
|
|
options: { textAlign: "left", fontSize: this.fontSize }
|
|
}), r.push({
|
|
data: "101" + (0, Ut.default)(this.data[0], "L"),
|
|
options: { height: this.guardHeight }
|
|
}), r.push({
|
|
data: (0, Ut.default)(this.data.substr(1, 5), "LLLLL"),
|
|
text: this.text.substr(1, 5),
|
|
options: { fontSize: this.fontSize }
|
|
}), r.push({
|
|
data: "01010",
|
|
options: { height: this.guardHeight }
|
|
}), r.push({
|
|
data: (0, Ut.default)(this.data.substr(6, 5), "RRRRR"),
|
|
text: this.text.substr(6, 5),
|
|
options: { fontSize: this.fontSize }
|
|
}), r.push({
|
|
data: (0, Ut.default)(this.data[11], "R") + "101",
|
|
options: { height: this.guardHeight }
|
|
}), this.displayValue && r.push({
|
|
data: "00000000",
|
|
text: this.text.substr(11, 1),
|
|
options: { textAlign: "right", fontSize: this.fontSize }
|
|
}), r;
|
|
}
|
|
}]), e;
|
|
}(ap.default);
|
|
function Mr(n) {
|
|
var e = 0, t;
|
|
for (t = 1; t < 11; t += 2)
|
|
e += parseInt(n[t]);
|
|
for (t = 0; t < 11; t += 2)
|
|
e += parseInt(n[t]) * 3;
|
|
return (10 - e % 10) % 10;
|
|
}
|
|
mn.default = lp;
|
|
var li = {};
|
|
Object.defineProperty(li, "__esModule", {
|
|
value: !0
|
|
});
|
|
var cp = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), fp = Vt, dp = ko(fp), hp = Ze, pp = ko(hp), mp = mn;
|
|
function ko(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function gp(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function hr(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function vp(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var yp = ["XX00000XXX", "XX10000XXX", "XX20000XXX", "XXX00000XX", "XXXX00000X", "XXXXX00005", "XXXXX00006", "XXXXX00007", "XXXXX00008", "XXXXX00009"], _p = [["EEEOOO", "OOOEEE"], ["EEOEOO", "OOEOEE"], ["EEOOEO", "OOEEOE"], ["EEOOOE", "OOEEEO"], ["EOEEOO", "OEOOEE"], ["EOOEEO", "OEEOOE"], ["EOOOEE", "OEEEOO"], ["EOEOEO", "OEOEOE"], ["EOEOOE", "OEOEEO"], ["EOOEOE", "OEEOEO"]], bp = function(n) {
|
|
vp(e, n);
|
|
function e(t, r) {
|
|
gp(this, e);
|
|
var i = hr(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t, r));
|
|
if (i.isValid = !1, t.search(/^[0-9]{6}$/) !== -1)
|
|
i.middleDigits = t, i.upcA = ha(t, "0"), i.text = r.text || "" + i.upcA[0] + t + i.upcA[i.upcA.length - 1], i.isValid = !0;
|
|
else if (t.search(/^[01][0-9]{7}$/) !== -1)
|
|
if (i.middleDigits = t.substring(1, t.length - 1), i.upcA = ha(i.middleDigits, t[0]), i.upcA[i.upcA.length - 1] === t[t.length - 1])
|
|
i.isValid = !0;
|
|
else
|
|
return hr(i);
|
|
else
|
|
return hr(i);
|
|
return i.displayValue = r.displayValue, r.fontSize > r.width * 10 ? i.fontSize = r.width * 10 : i.fontSize = r.fontSize, i.guardHeight = r.height + i.fontSize / 2 + r.textMargin, i;
|
|
}
|
|
return cp(e, [{
|
|
key: "valid",
|
|
value: function() {
|
|
return this.isValid;
|
|
}
|
|
}, {
|
|
key: "encode",
|
|
value: function() {
|
|
return this.options.flat ? this.flatEncoding() : this.guardedEncoding();
|
|
}
|
|
}, {
|
|
key: "flatEncoding",
|
|
value: function() {
|
|
var r = "";
|
|
return r += "101", r += this.encodeMiddleDigits(), r += "010101", {
|
|
data: r,
|
|
text: this.text
|
|
};
|
|
}
|
|
}, {
|
|
key: "guardedEncoding",
|
|
value: function() {
|
|
var r = [];
|
|
return this.displayValue && r.push({
|
|
data: "00000000",
|
|
text: this.text[0],
|
|
options: { textAlign: "left", fontSize: this.fontSize }
|
|
}), r.push({
|
|
data: "101",
|
|
options: { height: this.guardHeight }
|
|
}), r.push({
|
|
data: this.encodeMiddleDigits(),
|
|
text: this.text.substring(1, 7),
|
|
options: { fontSize: this.fontSize }
|
|
}), r.push({
|
|
data: "010101",
|
|
options: { height: this.guardHeight }
|
|
}), this.displayValue && r.push({
|
|
data: "00000000",
|
|
text: this.text[7],
|
|
options: { textAlign: "right", fontSize: this.fontSize }
|
|
}), r;
|
|
}
|
|
}, {
|
|
key: "encodeMiddleDigits",
|
|
value: function() {
|
|
var r = this.upcA[0], i = this.upcA[this.upcA.length - 1], a = _p[parseInt(i)][parseInt(r)];
|
|
return (0, dp.default)(this.middleDigits, a);
|
|
}
|
|
}]), e;
|
|
}(pp.default);
|
|
function ha(n, e) {
|
|
for (var t = parseInt(n[n.length - 1]), r = yp[t], i = "", a = 0, o = 0; o < r.length; o++) {
|
|
var s = r[o];
|
|
s === "X" ? i += n[a++] : i += s;
|
|
}
|
|
return i = "" + e + i, "" + i + (0, mp.checksum)(i);
|
|
}
|
|
li.default = bp;
|
|
Object.defineProperty(Je, "__esModule", {
|
|
value: !0
|
|
});
|
|
Je.UPCE = Je.UPC = Je.EAN2 = Je.EAN5 = Je.EAN8 = Je.EAN13 = void 0;
|
|
var wp = ai, $p = Jt(wp), Sp = oi, Op = Jt(Sp), Ep = si, xp = Jt(Ep), Cp = ui, kp = Jt(Cp), Ap = mn, Dp = Jt(Ap), Rp = li, Pp = Jt(Rp);
|
|
function Jt(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
Je.EAN13 = $p.default;
|
|
Je.EAN8 = Op.default;
|
|
Je.EAN5 = xp.default;
|
|
Je.EAN2 = kp.default;
|
|
Je.UPC = Dp.default;
|
|
Je.UPCE = Pp.default;
|
|
var Wt = {}, Zn = {}, gn = {};
|
|
Object.defineProperty(gn, "__esModule", {
|
|
value: !0
|
|
});
|
|
gn.START_BIN = "1010";
|
|
gn.END_BIN = "11101";
|
|
gn.BINARIES = ["00110", "10001", "01001", "11000", "00101", "10100", "01100", "00011", "10010", "01010"];
|
|
Object.defineProperty(Zn, "__esModule", {
|
|
value: !0
|
|
});
|
|
var Mp = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), xn = gn, Tp = Ze, jp = Fp(Tp);
|
|
function Fp(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function Ip(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function Vp(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function Bp(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var Lp = function(n) {
|
|
Bp(e, n);
|
|
function e() {
|
|
return Ip(this, e), Vp(this, (e.__proto__ || Object.getPrototypeOf(e)).apply(this, arguments));
|
|
}
|
|
return Mp(e, [{
|
|
key: "valid",
|
|
value: function() {
|
|
return this.data.search(/^([0-9]{2})+$/) !== -1;
|
|
}
|
|
}, {
|
|
key: "encode",
|
|
value: function() {
|
|
var r = this, i = this.data.match(/.{2}/g).map(function(a) {
|
|
return r.encodePair(a);
|
|
}).join("");
|
|
return {
|
|
data: xn.START_BIN + i + xn.END_BIN,
|
|
text: this.text
|
|
};
|
|
}
|
|
}, {
|
|
key: "encodePair",
|
|
value: function(r) {
|
|
var i = xn.BINARIES[r[1]];
|
|
return xn.BINARIES[r[0]].split("").map(function(a, o) {
|
|
return (a === "1" ? "111" : "1") + (i[o] === "1" ? "000" : "0");
|
|
}).join("");
|
|
}
|
|
}]), e;
|
|
}(jp.default);
|
|
Zn.default = Lp;
|
|
var ci = {};
|
|
Object.defineProperty(ci, "__esModule", {
|
|
value: !0
|
|
});
|
|
var Np = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), zp = Zn, Up = qp(zp);
|
|
function qp(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function Gp(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function Hp(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function Wp(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var pa = function(e) {
|
|
var t = e.substr(0, 13).split("").map(function(r) {
|
|
return parseInt(r, 10);
|
|
}).reduce(function(r, i, a) {
|
|
return r + i * (3 - a % 2 * 2);
|
|
}, 0);
|
|
return Math.ceil(t / 10) * 10 - t;
|
|
}, Yp = function(n) {
|
|
Wp(e, n);
|
|
function e(t, r) {
|
|
return Gp(this, e), t.search(/^[0-9]{13}$/) !== -1 && (t += pa(t)), Hp(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t, r));
|
|
}
|
|
return Np(e, [{
|
|
key: "valid",
|
|
value: function() {
|
|
return this.data.search(/^[0-9]{14}$/) !== -1 && +this.data[13] === pa(this.data);
|
|
}
|
|
}]), e;
|
|
}(Up.default);
|
|
ci.default = Yp;
|
|
Object.defineProperty(Wt, "__esModule", {
|
|
value: !0
|
|
});
|
|
Wt.ITF14 = Wt.ITF = void 0;
|
|
var Xp = Zn, Jp = Ao(Xp), Kp = ci, Zp = Ao(Kp);
|
|
function Ao(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
Wt.ITF = Jp.default;
|
|
Wt.ITF14 = Zp.default;
|
|
var it = {}, Bt = {};
|
|
Object.defineProperty(Bt, "__esModule", {
|
|
value: !0
|
|
});
|
|
var Qp = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), em = Ze, tm = nm(em);
|
|
function nm(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function rm(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function im(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function am(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var om = function(n) {
|
|
am(e, n);
|
|
function e(t, r) {
|
|
return rm(this, e), im(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t, r));
|
|
}
|
|
return Qp(e, [{
|
|
key: "encode",
|
|
value: function() {
|
|
for (var r = "110", i = 0; i < this.data.length; i++) {
|
|
var a = parseInt(this.data[i]), o = a.toString(2);
|
|
o = sm(o, 4 - o.length);
|
|
for (var s = 0; s < o.length; s++)
|
|
r += o[s] == "0" ? "100" : "110";
|
|
}
|
|
return r += "1001", {
|
|
data: r,
|
|
text: this.text
|
|
};
|
|
}
|
|
}, {
|
|
key: "valid",
|
|
value: function() {
|
|
return this.data.search(/^[0-9]+$/) !== -1;
|
|
}
|
|
}]), e;
|
|
}(tm.default);
|
|
function sm(n, e) {
|
|
for (var t = 0; t < e; t++)
|
|
n = "0" + n;
|
|
return n;
|
|
}
|
|
Bt.default = om;
|
|
var fi = {}, Lt = {};
|
|
Object.defineProperty(Lt, "__esModule", {
|
|
value: !0
|
|
});
|
|
Lt.mod10 = um;
|
|
Lt.mod11 = lm;
|
|
function um(n) {
|
|
for (var e = 0, t = 0; t < n.length; t++) {
|
|
var r = parseInt(n[t]);
|
|
(t + n.length) % 2 === 0 ? e += r : e += r * 2 % 10 + Math.floor(r * 2 / 10);
|
|
}
|
|
return (10 - e % 10) % 10;
|
|
}
|
|
function lm(n) {
|
|
for (var e = 0, t = [2, 3, 4, 5, 6, 7], r = 0; r < n.length; r++) {
|
|
var i = parseInt(n[n.length - 1 - r]);
|
|
e += t[r % t.length] * i;
|
|
}
|
|
return (11 - e % 11) % 11;
|
|
}
|
|
Object.defineProperty(fi, "__esModule", {
|
|
value: !0
|
|
});
|
|
var cm = Bt, fm = hm(cm), dm = Lt;
|
|
function hm(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function pm(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function mm(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function gm(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var vm = function(n) {
|
|
gm(e, n);
|
|
function e(t, r) {
|
|
return pm(this, e), mm(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t + (0, dm.mod10)(t), r));
|
|
}
|
|
return e;
|
|
}(fm.default);
|
|
fi.default = vm;
|
|
var di = {};
|
|
Object.defineProperty(di, "__esModule", {
|
|
value: !0
|
|
});
|
|
var ym = Bt, _m = wm(ym), bm = Lt;
|
|
function wm(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function $m(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function Sm(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function Om(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var Em = function(n) {
|
|
Om(e, n);
|
|
function e(t, r) {
|
|
return $m(this, e), Sm(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t + (0, bm.mod11)(t), r));
|
|
}
|
|
return e;
|
|
}(_m.default);
|
|
di.default = Em;
|
|
var hi = {};
|
|
Object.defineProperty(hi, "__esModule", {
|
|
value: !0
|
|
});
|
|
var xm = Bt, Cm = km(xm), ma = Lt;
|
|
function km(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function Am(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function Dm(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function Rm(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var Pm = function(n) {
|
|
Rm(e, n);
|
|
function e(t, r) {
|
|
return Am(this, e), t += (0, ma.mod10)(t), t += (0, ma.mod10)(t), Dm(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t, r));
|
|
}
|
|
return e;
|
|
}(Cm.default);
|
|
hi.default = Pm;
|
|
var pi = {};
|
|
Object.defineProperty(pi, "__esModule", {
|
|
value: !0
|
|
});
|
|
var Mm = Bt, Tm = jm(Mm), ga = Lt;
|
|
function jm(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function Fm(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function Im(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function Vm(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var Bm = function(n) {
|
|
Vm(e, n);
|
|
function e(t, r) {
|
|
return Fm(this, e), t += (0, ga.mod11)(t), t += (0, ga.mod10)(t), Im(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t, r));
|
|
}
|
|
return e;
|
|
}(Tm.default);
|
|
pi.default = Bm;
|
|
Object.defineProperty(it, "__esModule", {
|
|
value: !0
|
|
});
|
|
it.MSI1110 = it.MSI1010 = it.MSI11 = it.MSI10 = it.MSI = void 0;
|
|
var Lm = Bt, Nm = vn(Lm), zm = fi, Um = vn(zm), qm = di, Gm = vn(qm), Hm = hi, Wm = vn(Hm), Ym = pi, Xm = vn(Ym);
|
|
function vn(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
it.MSI = Nm.default;
|
|
it.MSI10 = Um.default;
|
|
it.MSI11 = Gm.default;
|
|
it.MSI1010 = Wm.default;
|
|
it.MSI1110 = Xm.default;
|
|
var Qn = {};
|
|
Object.defineProperty(Qn, "__esModule", {
|
|
value: !0
|
|
});
|
|
Qn.pharmacode = void 0;
|
|
var Jm = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), Km = Ze, Zm = Qm(Km);
|
|
function Qm(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function eg(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function tg(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function ng(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var rg = function(n) {
|
|
ng(e, n);
|
|
function e(t, r) {
|
|
eg(this, e);
|
|
var i = tg(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t, r));
|
|
return i.number = parseInt(t, 10), i;
|
|
}
|
|
return Jm(e, [{
|
|
key: "encode",
|
|
value: function() {
|
|
for (var r = this.number, i = ""; !isNaN(r) && r != 0; )
|
|
r % 2 === 0 ? (i = "11100" + i, r = (r - 2) / 2) : (i = "100" + i, r = (r - 1) / 2);
|
|
return i = i.slice(0, -2), {
|
|
data: i,
|
|
text: this.text
|
|
};
|
|
}
|
|
}, {
|
|
key: "valid",
|
|
value: function() {
|
|
return this.number >= 3 && this.number <= 131070;
|
|
}
|
|
}]), e;
|
|
}(Zm.default);
|
|
Qn.pharmacode = rg;
|
|
var er = {};
|
|
Object.defineProperty(er, "__esModule", {
|
|
value: !0
|
|
});
|
|
er.codabar = void 0;
|
|
var ig = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), ag = Ze, og = sg(ag);
|
|
function sg(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function ug(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function lg(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function cg(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var fg = function(n) {
|
|
cg(e, n);
|
|
function e(t, r) {
|
|
ug(this, e), t.search(/^[0-9\-\$\:\.\+\/]+$/) === 0 && (t = "A" + t + "A");
|
|
var i = lg(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t.toUpperCase(), r));
|
|
return i.text = i.options.text || i.text.replace(/[A-D]/g, ""), i;
|
|
}
|
|
return ig(e, [{
|
|
key: "valid",
|
|
value: function() {
|
|
return this.data.search(/^[A-D][0-9\-\$\:\.\+\/]+[A-D]$/) !== -1;
|
|
}
|
|
}, {
|
|
key: "encode",
|
|
value: function() {
|
|
for (var r = [], i = this.getEncodings(), a = 0; a < this.data.length; a++)
|
|
r.push(i[this.data.charAt(a)]), a !== this.data.length - 1 && r.push("0");
|
|
return {
|
|
text: this.text,
|
|
data: r.join("")
|
|
};
|
|
}
|
|
}, {
|
|
key: "getEncodings",
|
|
value: function() {
|
|
return {
|
|
0: "101010011",
|
|
1: "101011001",
|
|
2: "101001011",
|
|
3: "110010101",
|
|
4: "101101001",
|
|
5: "110101001",
|
|
6: "100101011",
|
|
7: "100101101",
|
|
8: "100110101",
|
|
9: "110100101",
|
|
"-": "101001101",
|
|
$: "101100101",
|
|
":": "1101011011",
|
|
"/": "1101101011",
|
|
".": "1101101101",
|
|
"+": "1011011011",
|
|
A: "1011001001",
|
|
B: "1001001011",
|
|
C: "1010010011",
|
|
D: "1010011001"
|
|
};
|
|
}
|
|
}]), e;
|
|
}(og.default);
|
|
er.codabar = fg;
|
|
var tr = {};
|
|
Object.defineProperty(tr, "__esModule", {
|
|
value: !0
|
|
});
|
|
tr.GenericBarcode = void 0;
|
|
var dg = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), hg = Ze, pg = mg(hg);
|
|
function mg(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function gg(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function vg(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function yg(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var _g = function(n) {
|
|
yg(e, n);
|
|
function e(t, r) {
|
|
return gg(this, e), vg(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this, t, r));
|
|
}
|
|
return dg(e, [{
|
|
key: "encode",
|
|
value: function() {
|
|
return {
|
|
data: "10101010101010101010101010101010101010101",
|
|
text: this.text
|
|
};
|
|
}
|
|
}, {
|
|
key: "valid",
|
|
value: function() {
|
|
return !0;
|
|
}
|
|
}]), e;
|
|
}(pg.default);
|
|
tr.GenericBarcode = _g;
|
|
Object.defineProperty(Zr, "__esModule", {
|
|
value: !0
|
|
});
|
|
var bg = Xn, Cn = mt, qt = Je, va = Wt, on = it, wg = Qn, $g = er, Sg = tr;
|
|
Zr.default = {
|
|
CODE39: bg.CODE39,
|
|
CODE128: Cn.CODE128,
|
|
CODE128A: Cn.CODE128A,
|
|
CODE128B: Cn.CODE128B,
|
|
CODE128C: Cn.CODE128C,
|
|
EAN13: qt.EAN13,
|
|
EAN8: qt.EAN8,
|
|
EAN5: qt.EAN5,
|
|
EAN2: qt.EAN2,
|
|
UPC: qt.UPC,
|
|
UPCE: qt.UPCE,
|
|
ITF14: va.ITF14,
|
|
ITF: va.ITF,
|
|
MSI: on.MSI,
|
|
MSI10: on.MSI10,
|
|
MSI11: on.MSI11,
|
|
MSI1010: on.MSI1010,
|
|
MSI1110: on.MSI1110,
|
|
pharmacode: wg.pharmacode,
|
|
codabar: $g.codabar,
|
|
GenericBarcode: Sg.GenericBarcode
|
|
};
|
|
var Kt = {};
|
|
Object.defineProperty(Kt, "__esModule", {
|
|
value: !0
|
|
});
|
|
var Og = Object.assign || function(n) {
|
|
for (var e = 1; e < arguments.length; e++) {
|
|
var t = arguments[e];
|
|
for (var r in t)
|
|
Object.prototype.hasOwnProperty.call(t, r) && (n[r] = t[r]);
|
|
}
|
|
return n;
|
|
};
|
|
Kt.default = function(n, e) {
|
|
return Og({}, n, e);
|
|
};
|
|
var mi = {};
|
|
Object.defineProperty(mi, "__esModule", {
|
|
value: !0
|
|
});
|
|
mi.default = Eg;
|
|
function Eg(n) {
|
|
var e = [];
|
|
function t(r) {
|
|
if (Array.isArray(r))
|
|
for (var i = 0; i < r.length; i++)
|
|
t(r[i]);
|
|
else
|
|
r.text = r.text || "", r.data = r.data || "", e.push(r);
|
|
}
|
|
return t(n), e;
|
|
}
|
|
var gi = {};
|
|
Object.defineProperty(gi, "__esModule", {
|
|
value: !0
|
|
});
|
|
gi.default = xg;
|
|
function xg(n) {
|
|
return n.marginTop = n.marginTop || n.margin, n.marginBottom = n.marginBottom || n.margin, n.marginRight = n.marginRight || n.margin, n.marginLeft = n.marginLeft || n.margin, n;
|
|
}
|
|
var vi = {}, yi = {}, nr = {};
|
|
Object.defineProperty(nr, "__esModule", {
|
|
value: !0
|
|
});
|
|
nr.default = Cg;
|
|
function Cg(n) {
|
|
var e = ["width", "height", "textMargin", "fontSize", "margin", "marginTop", "marginBottom", "marginLeft", "marginRight"];
|
|
for (var t in e)
|
|
e.hasOwnProperty(t) && (t = e[t], typeof n[t] == "string" && (n[t] = parseInt(n[t], 10)));
|
|
return typeof n.displayValue == "string" && (n.displayValue = n.displayValue != "false"), n;
|
|
}
|
|
var rr = {};
|
|
Object.defineProperty(rr, "__esModule", {
|
|
value: !0
|
|
});
|
|
var kg = {
|
|
width: 2,
|
|
height: 100,
|
|
format: "auto",
|
|
displayValue: !0,
|
|
fontOptions: "",
|
|
font: "monospace",
|
|
text: void 0,
|
|
textAlign: "center",
|
|
textPosition: "bottom",
|
|
textMargin: 2,
|
|
fontSize: 20,
|
|
background: "#ffffff",
|
|
lineColor: "#000000",
|
|
margin: 10,
|
|
marginTop: void 0,
|
|
marginBottom: void 0,
|
|
marginLeft: void 0,
|
|
marginRight: void 0,
|
|
valid: function() {
|
|
}
|
|
};
|
|
rr.default = kg;
|
|
Object.defineProperty(yi, "__esModule", {
|
|
value: !0
|
|
});
|
|
var Ag = nr, Dg = Do(Ag), Rg = rr, ya = Do(Rg);
|
|
function Do(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function Pg(n) {
|
|
var e = {};
|
|
for (var t in ya.default)
|
|
ya.default.hasOwnProperty(t) && (n.hasAttribute("jsbarcode-" + t.toLowerCase()) && (e[t] = n.getAttribute("jsbarcode-" + t.toLowerCase())), n.hasAttribute("data-" + t.toLowerCase()) && (e[t] = n.getAttribute("data-" + t.toLowerCase())));
|
|
return e.value = n.getAttribute("jsbarcode-value") || n.getAttribute("data-value"), e = (0, Dg.default)(e), e;
|
|
}
|
|
yi.default = Pg;
|
|
var _i = {}, bi = {}, tt = {};
|
|
Object.defineProperty(tt, "__esModule", {
|
|
value: !0
|
|
});
|
|
tt.getTotalWidthOfEncodings = tt.calculateEncodingAttributes = tt.getBarcodePadding = tt.getEncodingHeight = tt.getMaximumHeightOfEncodings = void 0;
|
|
var Mg = Kt, Tg = jg(Mg);
|
|
function jg(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function Ro(n, e) {
|
|
return e.height + (e.displayValue && n.text.length > 0 ? e.fontSize + e.textMargin : 0) + e.marginTop + e.marginBottom;
|
|
}
|
|
function Po(n, e, t) {
|
|
if (t.displayValue && e < n) {
|
|
if (t.textAlign == "center")
|
|
return Math.floor((n - e) / 2);
|
|
if (t.textAlign == "left")
|
|
return 0;
|
|
if (t.textAlign == "right")
|
|
return Math.floor(n - e);
|
|
}
|
|
return 0;
|
|
}
|
|
function Fg(n, e, t) {
|
|
for (var r = 0; r < n.length; r++) {
|
|
var i = n[r], a = (0, Tg.default)(e, i.options), o;
|
|
a.displayValue ? o = Bg(i.text, a, t) : o = 0;
|
|
var s = i.data.length * a.width;
|
|
i.width = Math.ceil(Math.max(o, s)), i.height = Ro(i, a), i.barcodePadding = Po(o, s, a);
|
|
}
|
|
}
|
|
function Ig(n) {
|
|
for (var e = 0, t = 0; t < n.length; t++)
|
|
e += n[t].width;
|
|
return e;
|
|
}
|
|
function Vg(n) {
|
|
for (var e = 0, t = 0; t < n.length; t++)
|
|
n[t].height > e && (e = n[t].height);
|
|
return e;
|
|
}
|
|
function Bg(n, e, t) {
|
|
var r;
|
|
if (t)
|
|
r = t;
|
|
else if (typeof document < "u")
|
|
r = document.createElement("canvas").getContext("2d");
|
|
else
|
|
return 0;
|
|
r.font = e.fontOptions + " " + e.fontSize + "px " + e.font;
|
|
var i = r.measureText(n);
|
|
if (!i)
|
|
return 0;
|
|
var a = i.width;
|
|
return a;
|
|
}
|
|
tt.getMaximumHeightOfEncodings = Vg;
|
|
tt.getEncodingHeight = Ro;
|
|
tt.getBarcodePadding = Po;
|
|
tt.calculateEncodingAttributes = Fg;
|
|
tt.getTotalWidthOfEncodings = Ig;
|
|
Object.defineProperty(bi, "__esModule", {
|
|
value: !0
|
|
});
|
|
var Lg = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), Ng = Kt, zg = Ug(Ng), pr = tt;
|
|
function Ug(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function qg(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
var Gg = function() {
|
|
function n(e, t, r) {
|
|
qg(this, n), this.canvas = e, this.encodings = t, this.options = r;
|
|
}
|
|
return Lg(n, [{
|
|
key: "render",
|
|
value: function() {
|
|
if (!this.canvas.getContext)
|
|
throw new Error("The browser does not support canvas.");
|
|
this.prepareCanvas();
|
|
for (var t = 0; t < this.encodings.length; t++) {
|
|
var r = (0, zg.default)(this.options, this.encodings[t].options);
|
|
this.drawCanvasBarcode(r, this.encodings[t]), this.drawCanvasText(r, this.encodings[t]), this.moveCanvasDrawing(this.encodings[t]);
|
|
}
|
|
this.restoreCanvas();
|
|
}
|
|
}, {
|
|
key: "prepareCanvas",
|
|
value: function() {
|
|
var t = this.canvas.getContext("2d");
|
|
t.save(), (0, pr.calculateEncodingAttributes)(this.encodings, this.options, t);
|
|
var r = (0, pr.getTotalWidthOfEncodings)(this.encodings), i = (0, pr.getMaximumHeightOfEncodings)(this.encodings);
|
|
this.canvas.width = r + this.options.marginLeft + this.options.marginRight, this.canvas.height = i, t.clearRect(0, 0, this.canvas.width, this.canvas.height), this.options.background && (t.fillStyle = this.options.background, t.fillRect(0, 0, this.canvas.width, this.canvas.height)), t.translate(this.options.marginLeft, 0);
|
|
}
|
|
}, {
|
|
key: "drawCanvasBarcode",
|
|
value: function(t, r) {
|
|
var i = this.canvas.getContext("2d"), a = r.data, o;
|
|
t.textPosition == "top" ? o = t.marginTop + t.fontSize + t.textMargin : o = t.marginTop, i.fillStyle = t.lineColor;
|
|
for (var s = 0; s < a.length; s++) {
|
|
var u = s * t.width + r.barcodePadding;
|
|
a[s] === "1" ? i.fillRect(u, o, t.width, t.height) : a[s] && i.fillRect(u, o, t.width, t.height * a[s]);
|
|
}
|
|
}
|
|
}, {
|
|
key: "drawCanvasText",
|
|
value: function(t, r) {
|
|
var i = this.canvas.getContext("2d"), a = t.fontOptions + " " + t.fontSize + "px " + t.font;
|
|
if (t.displayValue) {
|
|
var o, s;
|
|
t.textPosition == "top" ? s = t.marginTop + t.fontSize - t.textMargin : s = t.height + t.textMargin + t.marginTop + t.fontSize, i.font = a, t.textAlign == "left" || r.barcodePadding > 0 ? (o = 0, i.textAlign = "left") : t.textAlign == "right" ? (o = r.width - 1, i.textAlign = "right") : (o = r.width / 2, i.textAlign = "center"), i.fillText(r.text, o, s);
|
|
}
|
|
}
|
|
}, {
|
|
key: "moveCanvasDrawing",
|
|
value: function(t) {
|
|
var r = this.canvas.getContext("2d");
|
|
r.translate(t.width, 0);
|
|
}
|
|
}, {
|
|
key: "restoreCanvas",
|
|
value: function() {
|
|
var t = this.canvas.getContext("2d");
|
|
t.restore();
|
|
}
|
|
}]), n;
|
|
}();
|
|
bi.default = Gg;
|
|
var wi = {};
|
|
Object.defineProperty(wi, "__esModule", {
|
|
value: !0
|
|
});
|
|
var Hg = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}(), Wg = Kt, Yg = Xg(Wg), mr = tt;
|
|
function Xg(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function Jg(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
var kn = "http://www.w3.org/2000/svg", Kg = function() {
|
|
function n(e, t, r) {
|
|
Jg(this, n), this.svg = e, this.encodings = t, this.options = r, this.document = r.xmlDocument || document;
|
|
}
|
|
return Hg(n, [{
|
|
key: "render",
|
|
value: function() {
|
|
var t = this.options.marginLeft;
|
|
this.prepareSVG();
|
|
for (var r = 0; r < this.encodings.length; r++) {
|
|
var i = this.encodings[r], a = (0, Yg.default)(this.options, i.options), o = this.createGroup(t, a.marginTop, this.svg);
|
|
this.setGroupOptions(o, a), this.drawSvgBarcode(o, a, i), this.drawSVGText(o, a, i), t += i.width;
|
|
}
|
|
}
|
|
}, {
|
|
key: "prepareSVG",
|
|
value: function() {
|
|
for (; this.svg.firstChild; )
|
|
this.svg.removeChild(this.svg.firstChild);
|
|
(0, mr.calculateEncodingAttributes)(this.encodings, this.options);
|
|
var t = (0, mr.getTotalWidthOfEncodings)(this.encodings), r = (0, mr.getMaximumHeightOfEncodings)(this.encodings), i = t + this.options.marginLeft + this.options.marginRight;
|
|
this.setSvgAttributes(i, r), this.options.background && this.drawRect(0, 0, i, r, this.svg).setAttribute("style", "fill:" + this.options.background + ";");
|
|
}
|
|
}, {
|
|
key: "drawSvgBarcode",
|
|
value: function(t, r, i) {
|
|
var a = i.data, o;
|
|
r.textPosition == "top" ? o = r.fontSize + r.textMargin : o = 0;
|
|
for (var s = 0, u = 0, c = 0; c < a.length; c++)
|
|
u = c * r.width + i.barcodePadding, a[c] === "1" ? s++ : s > 0 && (this.drawRect(u - r.width * s, o, r.width * s, r.height, t), s = 0);
|
|
s > 0 && this.drawRect(u - r.width * (s - 1), o, r.width * s, r.height, t);
|
|
}
|
|
}, {
|
|
key: "drawSVGText",
|
|
value: function(t, r, i) {
|
|
var a = this.document.createElementNS(kn, "text");
|
|
if (r.displayValue) {
|
|
var o, s;
|
|
a.setAttribute("style", "font:" + r.fontOptions + " " + r.fontSize + "px " + r.font), r.textPosition == "top" ? s = r.fontSize - r.textMargin : s = r.height + r.textMargin + r.fontSize, r.textAlign == "left" || i.barcodePadding > 0 ? (o = 0, a.setAttribute("text-anchor", "start")) : r.textAlign == "right" ? (o = i.width - 1, a.setAttribute("text-anchor", "end")) : (o = i.width / 2, a.setAttribute("text-anchor", "middle")), a.setAttribute("x", o), a.setAttribute("y", s), a.appendChild(this.document.createTextNode(i.text)), t.appendChild(a);
|
|
}
|
|
}
|
|
}, {
|
|
key: "setSvgAttributes",
|
|
value: function(t, r) {
|
|
var i = this.svg;
|
|
i.setAttribute("width", t + "px"), i.setAttribute("height", r + "px"), i.setAttribute("x", "0px"), i.setAttribute("y", "0px"), i.setAttribute("viewBox", "0 0 " + t + " " + r), i.setAttribute("xmlns", kn), i.setAttribute("version", "1.1"), i.setAttribute("style", "transform: translate(0,0)");
|
|
}
|
|
}, {
|
|
key: "createGroup",
|
|
value: function(t, r, i) {
|
|
var a = this.document.createElementNS(kn, "g");
|
|
return a.setAttribute("transform", "translate(" + t + ", " + r + ")"), i.appendChild(a), a;
|
|
}
|
|
}, {
|
|
key: "setGroupOptions",
|
|
value: function(t, r) {
|
|
t.setAttribute("style", "fill:" + r.lineColor + ";");
|
|
}
|
|
}, {
|
|
key: "drawRect",
|
|
value: function(t, r, i, a, o) {
|
|
var s = this.document.createElementNS(kn, "rect");
|
|
return s.setAttribute("x", t), s.setAttribute("y", r), s.setAttribute("width", i), s.setAttribute("height", a), o.appendChild(s), s;
|
|
}
|
|
}]), n;
|
|
}();
|
|
wi.default = Kg;
|
|
var $i = {};
|
|
Object.defineProperty($i, "__esModule", {
|
|
value: !0
|
|
});
|
|
var Zg = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}();
|
|
function Qg(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
var e0 = function() {
|
|
function n(e, t, r) {
|
|
Qg(this, n), this.object = e, this.encodings = t, this.options = r;
|
|
}
|
|
return Zg(n, [{
|
|
key: "render",
|
|
value: function() {
|
|
this.object.encodings = this.encodings;
|
|
}
|
|
}]), n;
|
|
}();
|
|
$i.default = e0;
|
|
Object.defineProperty(_i, "__esModule", {
|
|
value: !0
|
|
});
|
|
var t0 = bi, n0 = Si(t0), r0 = wi, i0 = Si(r0), a0 = $i, o0 = Si(a0);
|
|
function Si(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
_i.default = { CanvasRenderer: n0.default, SVGRenderer: i0.default, ObjectRenderer: o0.default };
|
|
var Zt = {};
|
|
Object.defineProperty(Zt, "__esModule", {
|
|
value: !0
|
|
});
|
|
function Oi(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
function Ei(n, e) {
|
|
if (!n)
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
return e && (typeof e == "object" || typeof e == "function") ? e : n;
|
|
}
|
|
function xi(n, e) {
|
|
if (typeof e != "function" && e !== null)
|
|
throw new TypeError("Super expression must either be null or a function, not " + typeof e);
|
|
n.prototype = Object.create(e && e.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } }), e && (Object.setPrototypeOf ? Object.setPrototypeOf(n, e) : n.__proto__ = e);
|
|
}
|
|
var s0 = function(n) {
|
|
xi(e, n);
|
|
function e(t, r) {
|
|
Oi(this, e);
|
|
var i = Ei(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this));
|
|
return i.name = "InvalidInputException", i.symbology = t, i.input = r, i.message = '"' + i.input + '" is not a valid input for ' + i.symbology, i;
|
|
}
|
|
return e;
|
|
}(Error), u0 = function(n) {
|
|
xi(e, n);
|
|
function e() {
|
|
Oi(this, e);
|
|
var t = Ei(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this));
|
|
return t.name = "InvalidElementException", t.message = "Not supported type to render on", t;
|
|
}
|
|
return e;
|
|
}(Error), l0 = function(n) {
|
|
xi(e, n);
|
|
function e() {
|
|
Oi(this, e);
|
|
var t = Ei(this, (e.__proto__ || Object.getPrototypeOf(e)).call(this));
|
|
return t.name = "NoElementException", t.message = "No element to render on.", t;
|
|
}
|
|
return e;
|
|
}(Error);
|
|
Zt.InvalidInputException = s0;
|
|
Zt.InvalidElementException = u0;
|
|
Zt.NoElementException = l0;
|
|
Object.defineProperty(vi, "__esModule", {
|
|
value: !0
|
|
});
|
|
var c0 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(n) {
|
|
return typeof n;
|
|
} : function(n) {
|
|
return n && typeof Symbol == "function" && n.constructor === Symbol && n !== Symbol.prototype ? "symbol" : typeof n;
|
|
}, f0 = yi, Tr = Mo(f0), d0 = _i, sn = Mo(d0), h0 = Zt;
|
|
function Mo(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
function Ci(n) {
|
|
if (typeof n == "string")
|
|
return p0(n);
|
|
if (Array.isArray(n)) {
|
|
for (var e = [], t = 0; t < n.length; t++)
|
|
e.push(Ci(n[t]));
|
|
return e;
|
|
} else {
|
|
if (typeof HTMLCanvasElement < "u" && n instanceof HTMLImageElement)
|
|
return m0(n);
|
|
if (n && n.nodeName && n.nodeName.toLowerCase() === "svg" || typeof SVGElement < "u" && n instanceof SVGElement)
|
|
return {
|
|
element: n,
|
|
options: (0, Tr.default)(n),
|
|
renderer: sn.default.SVGRenderer
|
|
};
|
|
if (typeof HTMLCanvasElement < "u" && n instanceof HTMLCanvasElement)
|
|
return {
|
|
element: n,
|
|
options: (0, Tr.default)(n),
|
|
renderer: sn.default.CanvasRenderer
|
|
};
|
|
if (n && n.getContext)
|
|
return {
|
|
element: n,
|
|
renderer: sn.default.CanvasRenderer
|
|
};
|
|
if (n && (typeof n > "u" ? "undefined" : c0(n)) === "object" && !n.nodeName)
|
|
return {
|
|
element: n,
|
|
renderer: sn.default.ObjectRenderer
|
|
};
|
|
throw new h0.InvalidElementException();
|
|
}
|
|
}
|
|
function p0(n) {
|
|
var e = document.querySelectorAll(n);
|
|
if (e.length !== 0) {
|
|
for (var t = [], r = 0; r < e.length; r++)
|
|
t.push(Ci(e[r]));
|
|
return t;
|
|
}
|
|
}
|
|
function m0(n) {
|
|
var e = document.createElement("canvas");
|
|
return {
|
|
element: e,
|
|
options: (0, Tr.default)(n),
|
|
renderer: sn.default.CanvasRenderer,
|
|
afterRender: function() {
|
|
n.setAttribute("src", e.toDataURL());
|
|
}
|
|
};
|
|
}
|
|
vi.default = Ci;
|
|
var ki = {};
|
|
Object.defineProperty(ki, "__esModule", {
|
|
value: !0
|
|
});
|
|
var g0 = function() {
|
|
function n(e, t) {
|
|
for (var r = 0; r < t.length; r++) {
|
|
var i = t[r];
|
|
i.enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(e, i.key, i);
|
|
}
|
|
}
|
|
return function(e, t, r) {
|
|
return t && n(e.prototype, t), r && n(e, r), e;
|
|
};
|
|
}();
|
|
function v0(n, e) {
|
|
if (!(n instanceof e))
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
var y0 = function() {
|
|
function n(e) {
|
|
v0(this, n), this.api = e;
|
|
}
|
|
return g0(n, [{
|
|
key: "handleCatch",
|
|
value: function(t) {
|
|
if (t.name === "InvalidInputException")
|
|
if (this.api._options.valid !== this.api._defaults.valid)
|
|
this.api._options.valid(!1);
|
|
else
|
|
throw t.message;
|
|
else
|
|
throw t;
|
|
this.api.render = function() {
|
|
};
|
|
}
|
|
}, {
|
|
key: "wrapBarcodeCall",
|
|
value: function(t) {
|
|
try {
|
|
var r = t.apply(void 0, arguments);
|
|
return this.api._options.valid(!0), r;
|
|
} catch (i) {
|
|
return this.handleCatch(i), this.api;
|
|
}
|
|
}
|
|
}]), n;
|
|
}();
|
|
ki.default = y0;
|
|
var _0 = Zr, Mt = At(_0), b0 = Kt, yn = At(b0), w0 = mi, To = At(w0), $0 = gi, _a = At($0), S0 = vi, O0 = At(S0), E0 = nr, x0 = At(E0), C0 = ki, k0 = At(C0), jo = Zt, A0 = rr, Fo = At(A0);
|
|
function At(n) {
|
|
return n && n.__esModule ? n : { default: n };
|
|
}
|
|
var St = function() {
|
|
}, ir = function(e, t, r) {
|
|
var i = new St();
|
|
if (typeof e > "u")
|
|
throw Error("No element to render on was provided.");
|
|
return i._renderProperties = (0, O0.default)(e), i._encodings = [], i._options = Fo.default, i._errorHandler = new k0.default(i), typeof t < "u" && (r = r || {}, r.format || (r.format = Vo()), i.options(r)[r.format](t, r).render()), i;
|
|
};
|
|
ir.getModule = function(n) {
|
|
return Mt.default[n];
|
|
};
|
|
for (var ba in Mt.default)
|
|
Mt.default.hasOwnProperty(ba) && D0(Mt.default, ba);
|
|
function D0(n, e) {
|
|
St.prototype[e] = St.prototype[e.toUpperCase()] = St.prototype[e.toLowerCase()] = function(t, r) {
|
|
var i = this;
|
|
return i._errorHandler.wrapBarcodeCall(function() {
|
|
r.text = typeof r.text > "u" ? void 0 : "" + r.text;
|
|
var a = (0, yn.default)(i._options, r);
|
|
a = (0, x0.default)(a);
|
|
var o = n[e], s = Io(t, o, a);
|
|
return i._encodings.push(s), i;
|
|
});
|
|
};
|
|
}
|
|
function Io(n, e, t) {
|
|
n = "" + n;
|
|
var r = new e(n, t);
|
|
if (!r.valid())
|
|
throw new jo.InvalidInputException(r.constructor.name, n);
|
|
var i = r.encode();
|
|
i = (0, To.default)(i);
|
|
for (var a = 0; a < i.length; a++)
|
|
i[a].options = (0, yn.default)(t, i[a].options);
|
|
return i;
|
|
}
|
|
function Vo() {
|
|
return Mt.default.CODE128 ? "CODE128" : Object.keys(Mt.default)[0];
|
|
}
|
|
St.prototype.options = function(n) {
|
|
return this._options = (0, yn.default)(this._options, n), this;
|
|
};
|
|
St.prototype.blank = function(n) {
|
|
var e = new Array(n + 1).join("0");
|
|
return this._encodings.push({ data: e }), this;
|
|
};
|
|
St.prototype.init = function() {
|
|
if (!!this._renderProperties) {
|
|
Array.isArray(this._renderProperties) || (this._renderProperties = [this._renderProperties]);
|
|
var n;
|
|
for (var e in this._renderProperties) {
|
|
n = this._renderProperties[e];
|
|
var t = (0, yn.default)(this._options, n.options);
|
|
t.format == "auto" && (t.format = Vo()), this._errorHandler.wrapBarcodeCall(function() {
|
|
var r = t.value, i = Mt.default[t.format.toUpperCase()], a = Io(r, i, t);
|
|
jr(n, a, t);
|
|
});
|
|
}
|
|
}
|
|
};
|
|
St.prototype.render = function() {
|
|
if (!this._renderProperties)
|
|
throw new jo.NoElementException();
|
|
if (Array.isArray(this._renderProperties))
|
|
for (var n = 0; n < this._renderProperties.length; n++)
|
|
jr(this._renderProperties[n], this._encodings, this._options);
|
|
else
|
|
jr(this._renderProperties, this._encodings, this._options);
|
|
return this;
|
|
};
|
|
St.prototype._defaults = Fo.default;
|
|
function jr(n, e, t) {
|
|
e = (0, To.default)(e);
|
|
for (var r = 0; r < e.length; r++)
|
|
e[r].options = (0, yn.default)(t, e[r].options), (0, _a.default)(e[r].options);
|
|
(0, _a.default)(t);
|
|
var i = n.renderer, a = new i(n.element, e, t);
|
|
a.render(), n.afterRender && n.afterRender();
|
|
}
|
|
typeof window < "u" && (window.JsBarcode = ir);
|
|
typeof jQuery < "u" && (jQuery.fn.JsBarcode = function(n, e) {
|
|
var t = [];
|
|
return jQuery(this).each(function() {
|
|
t.push(this);
|
|
}), ir(t, n, e);
|
|
});
|
|
var R0 = ir;
|
|
const P0 = he({
|
|
name: "BarCodeBox",
|
|
data() {
|
|
return {};
|
|
},
|
|
props: {
|
|
value: String,
|
|
format: String,
|
|
displayValue: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
fontSize: Number,
|
|
textPosition: String,
|
|
textAlign: String,
|
|
textMargin: Number,
|
|
width: {
|
|
type: Number,
|
|
default: 2
|
|
},
|
|
height: {
|
|
type: Number,
|
|
default: 50
|
|
},
|
|
background: String,
|
|
lineColor: String
|
|
},
|
|
methods: {},
|
|
computed: {},
|
|
components: {},
|
|
watch: {
|
|
$props: {
|
|
handler() {
|
|
const n = this.value, e = {};
|
|
Object.keys(this.$props).forEach((t) => {
|
|
this.$props[t] != null && this.$props[t] !== "" && (e[t] = this.$props[t]);
|
|
}), delete e.value, delete e.formCreateInject, this.$nextTick(() => {
|
|
R0(this.$refs.bar, n || "", e);
|
|
});
|
|
},
|
|
deep: !0,
|
|
immediate: !0
|
|
}
|
|
}
|
|
}), M0 = {
|
|
class: "_fc-barcode",
|
|
ref: "bar"
|
|
};
|
|
function T0(n, e, t, r, i, a) {
|
|
return ee(), me("img", M0, null, 512);
|
|
}
|
|
const j0 = /* @__PURE__ */ Ae(P0, [["render", T0]]);
|
|
const F0 = he({
|
|
name: "VideoBox",
|
|
emits: ["pause", "play", "ended", "error"],
|
|
data() {
|
|
return {
|
|
player: null
|
|
};
|
|
},
|
|
props: {
|
|
src: String,
|
|
type: String,
|
|
controls: {
|
|
type: Boolean,
|
|
default: !0
|
|
},
|
|
autoplay: Boolean,
|
|
isLive: Boolean,
|
|
withCredentials: Boolean,
|
|
loop: Boolean
|
|
},
|
|
watch: {
|
|
src: {
|
|
handler: function() {
|
|
this.$nextTick(() => {
|
|
wt.ready("mpegts", () => {
|
|
const n = this.$refs.video, e = window.mpegts.createPlayer({
|
|
isLive: this.isLive,
|
|
type: this.type,
|
|
url: this.src
|
|
});
|
|
e.attachMediaElement(n), e.on("error", (t) => {
|
|
this.$emit("error", t);
|
|
}), e.load(), this.autoplay && e.play().catch((t) => {
|
|
this.$emit("error", t);
|
|
}), this.player = e;
|
|
});
|
|
});
|
|
},
|
|
immediate: !0
|
|
}
|
|
},
|
|
created() {
|
|
window.mpegts ? wt.done("mpegts") : wt.isDefined("mpegts") || wt.loadNpm("mpegts.js@1.8.0/dist/mpegts.js", "mpegts");
|
|
}
|
|
}), I0 = ["controls", "loop"];
|
|
function V0(n, e, t, r, i, a) {
|
|
return ee(), me("video", {
|
|
ref: "video",
|
|
class: "_fc-video-box",
|
|
controls: n.controls,
|
|
loop: n.loop,
|
|
onPause: e[0] || (e[0] = (o) => n.$emit("pause", o)),
|
|
onPlay: e[1] || (e[1] = (o) => n.$emit("play", o)),
|
|
onEnded: e[2] || (e[2] = (o) => n.$emit("ended", o))
|
|
}, null, 40, I0);
|
|
}
|
|
const B0 = /* @__PURE__ */ Ae(F0, [["render", V0]]);
|
|
var Bo = { exports: {} };
|
|
(function(n, e) {
|
|
(function(t, r) {
|
|
n.exports = r();
|
|
})(Ja, () => (() => {
|
|
var t = { 873: (o, s) => {
|
|
var u, c, l = function() {
|
|
var h = function(k, b) {
|
|
var y = k, d = U[b], f = null, p = 0, v = null, g = [], x = {}, M = function(_, E) {
|
|
f = function(O) {
|
|
for (var R = new Array(O), j = 0; j < O; j += 1) {
|
|
R[j] = new Array(O);
|
|
for (var Y = 0; Y < O; Y += 1)
|
|
R[j][Y] = null;
|
|
}
|
|
return R;
|
|
}(p = 4 * y + 17), P(0, 0), P(p - 7, 0), P(0, p - 7), I(), N(), L(_, E), y >= 7 && V(_), v == null && (v = C(y, d, g)), A(v, E);
|
|
}, P = function(_, E) {
|
|
for (var O = -1; O <= 7; O += 1)
|
|
if (!(_ + O <= -1 || p <= _ + O))
|
|
for (var R = -1; R <= 7; R += 1)
|
|
E + R <= -1 || p <= E + R || (f[_ + O][E + R] = 0 <= O && O <= 6 && (R == 0 || R == 6) || 0 <= R && R <= 6 && (O == 0 || O == 6) || 2 <= O && O <= 4 && 2 <= R && R <= 4);
|
|
}, N = function() {
|
|
for (var _ = 8; _ < p - 8; _ += 1)
|
|
f[_][6] == null && (f[_][6] = _ % 2 == 0);
|
|
for (var E = 8; E < p - 8; E += 1)
|
|
f[6][E] == null && (f[6][E] = E % 2 == 0);
|
|
}, I = function() {
|
|
for (var _ = z.getPatternPosition(y), E = 0; E < _.length; E += 1)
|
|
for (var O = 0; O < _.length; O += 1) {
|
|
var R = _[E], j = _[O];
|
|
if (f[R][j] == null)
|
|
for (var Y = -2; Y <= 2; Y += 1)
|
|
for (var X = -2; X <= 2; X += 1)
|
|
f[R + Y][j + X] = Y == -2 || Y == 2 || X == -2 || X == 2 || Y == 0 && X == 0;
|
|
}
|
|
}, V = function(_) {
|
|
for (var E = z.getBCHTypeNumber(y), O = 0; O < 18; O += 1) {
|
|
var R = !_ && (E >> O & 1) == 1;
|
|
f[Math.floor(O / 3)][O % 3 + p - 8 - 3] = R;
|
|
}
|
|
for (O = 0; O < 18; O += 1)
|
|
R = !_ && (E >> O & 1) == 1, f[O % 3 + p - 8 - 3][Math.floor(O / 3)] = R;
|
|
}, L = function(_, E) {
|
|
for (var O = d << 3 | E, R = z.getBCHTypeInfo(O), j = 0; j < 15; j += 1) {
|
|
var Y = !_ && (R >> j & 1) == 1;
|
|
j < 6 ? f[j][8] = Y : j < 8 ? f[j + 1][8] = Y : f[p - 15 + j][8] = Y;
|
|
}
|
|
for (j = 0; j < 15; j += 1)
|
|
Y = !_ && (R >> j & 1) == 1, j < 8 ? f[8][p - j - 1] = Y : j < 9 ? f[8][15 - j - 1 + 1] = Y : f[8][15 - j - 1] = Y;
|
|
f[p - 8][8] = !_;
|
|
}, A = function(_, E) {
|
|
for (var O = -1, R = p - 1, j = 7, Y = 0, X = z.getMaskFunction(E), ie = p - 1; ie > 0; ie -= 2)
|
|
for (ie == 6 && (ie -= 1); ; ) {
|
|
for (var se = 0; se < 2; se += 1)
|
|
if (f[R][ie - se] == null) {
|
|
var ue = !1;
|
|
Y < _.length && (ue = (_[Y] >>> j & 1) == 1), X(R, ie - se) && (ue = !ue), f[R][ie - se] = ue, (j -= 1) == -1 && (Y += 1, j = 7);
|
|
}
|
|
if ((R += O) < 0 || p <= R) {
|
|
R -= O, O = -O;
|
|
break;
|
|
}
|
|
}
|
|
}, C = function(_, E, O) {
|
|
for (var R = Q.getRSBlocks(_, E), j = q(), Y = 0; Y < O.length; Y += 1) {
|
|
var X = O[Y];
|
|
j.put(X.getMode(), 4), j.put(X.getLength(), z.getLengthInBits(X.getMode(), _)), X.write(j);
|
|
}
|
|
var ie = 0;
|
|
for (Y = 0; Y < R.length; Y += 1)
|
|
ie += R[Y].dataCount;
|
|
if (j.getLengthInBits() > 8 * ie)
|
|
throw "code length overflow. (" + j.getLengthInBits() + ">" + 8 * ie + ")";
|
|
for (j.getLengthInBits() + 4 <= 8 * ie && j.put(0, 4); j.getLengthInBits() % 8 != 0; )
|
|
j.putBit(!1);
|
|
for (; !(j.getLengthInBits() >= 8 * ie || (j.put(236, 8), j.getLengthInBits() >= 8 * ie)); )
|
|
j.put(17, 8);
|
|
return function(se, ue) {
|
|
for (var ge = 0, Ee = 0, be = 0, de = new Array(ue.length), ve = new Array(ue.length), te = 0; te < ue.length; te += 1) {
|
|
var ke = ue[te].dataCount, Fe = ue[te].totalCount - ke;
|
|
Ee = Math.max(Ee, ke), be = Math.max(be, Fe), de[te] = new Array(ke);
|
|
for (var oe = 0; oe < de[te].length; oe += 1)
|
|
de[te][oe] = 255 & se.getBuffer()[oe + ge];
|
|
ge += ke;
|
|
var Xe = z.getErrorCorrectPolynomial(Fe), Ue = Z(de[te], Xe.getLength() - 1).mod(Xe);
|
|
for (ve[te] = new Array(Xe.getLength() - 1), oe = 0; oe < ve[te].length; oe += 1) {
|
|
var Ne = oe + Ue.getLength() - ve[te].length;
|
|
ve[te][oe] = Ne >= 0 ? Ue.getAt(Ne) : 0;
|
|
}
|
|
}
|
|
var _n = 0;
|
|
for (oe = 0; oe < ue.length; oe += 1)
|
|
_n += ue[oe].totalCount;
|
|
var Qt = new Array(_n), ct = 0;
|
|
for (oe = 0; oe < Ee; oe += 1)
|
|
for (te = 0; te < ue.length; te += 1)
|
|
oe < de[te].length && (Qt[ct] = de[te][oe], ct += 1);
|
|
for (oe = 0; oe < be; oe += 1)
|
|
for (te = 0; te < ue.length; te += 1)
|
|
oe < ve[te].length && (Qt[ct] = ve[te][oe], ct += 1);
|
|
return Qt;
|
|
}(j, R);
|
|
};
|
|
x.addData = function(_, E) {
|
|
var O = null;
|
|
switch (E = E || "Byte") {
|
|
case "Numeric":
|
|
O = ce(_);
|
|
break;
|
|
case "Alphanumeric":
|
|
O = re(_);
|
|
break;
|
|
case "Byte":
|
|
O = ae(_);
|
|
break;
|
|
case "Kanji":
|
|
O = J(_);
|
|
break;
|
|
default:
|
|
throw "mode:" + E;
|
|
}
|
|
g.push(O), v = null;
|
|
}, x.isDark = function(_, E) {
|
|
if (_ < 0 || p <= _ || E < 0 || p <= E)
|
|
throw _ + "," + E;
|
|
return f[_][E];
|
|
}, x.getModuleCount = function() {
|
|
return p;
|
|
}, x.make = function() {
|
|
if (y < 1) {
|
|
for (var _ = 1; _ < 40; _++) {
|
|
for (var E = Q.getRSBlocks(_, d), O = q(), R = 0; R < g.length; R++) {
|
|
var j = g[R];
|
|
O.put(j.getMode(), 4), O.put(j.getLength(), z.getLengthInBits(j.getMode(), _)), j.write(O);
|
|
}
|
|
var Y = 0;
|
|
for (R = 0; R < E.length; R++)
|
|
Y += E[R].dataCount;
|
|
if (O.getLengthInBits() <= 8 * Y)
|
|
break;
|
|
}
|
|
y = _;
|
|
}
|
|
M(!1, function() {
|
|
for (var X = 0, ie = 0, se = 0; se < 8; se += 1) {
|
|
M(!0, se);
|
|
var ue = z.getLostPoint(x);
|
|
(se == 0 || X > ue) && (X = ue, ie = se);
|
|
}
|
|
return ie;
|
|
}());
|
|
}, x.createTableTag = function(_, E) {
|
|
_ = _ || 2;
|
|
var O = "";
|
|
O += '<table style="', O += " border-width: 0px; border-style: none;", O += " border-collapse: collapse;", O += " padding: 0px; margin: " + (E = E === void 0 ? 4 * _ : E) + "px;", O += '">', O += "<tbody>";
|
|
for (var R = 0; R < x.getModuleCount(); R += 1) {
|
|
O += "<tr>";
|
|
for (var j = 0; j < x.getModuleCount(); j += 1)
|
|
O += '<td style="', O += " border-width: 0px; border-style: none;", O += " border-collapse: collapse;", O += " padding: 0px; margin: 0px;", O += " width: " + _ + "px;", O += " height: " + _ + "px;", O += " background-color: ", O += x.isDark(R, j) ? "#000000" : "#ffffff", O += ";", O += '"/>';
|
|
O += "</tr>";
|
|
}
|
|
return (O += "</tbody>") + "</table>";
|
|
}, x.createSvgTag = function(_, E, O, R) {
|
|
var j = {};
|
|
typeof arguments[0] == "object" && (_ = (j = arguments[0]).cellSize, E = j.margin, O = j.alt, R = j.title), _ = _ || 2, E = E === void 0 ? 4 * _ : E, (O = typeof O == "string" ? { text: O } : O || {}).text = O.text || null, O.id = O.text ? O.id || "qrcode-description" : null, (R = typeof R == "string" ? { text: R } : R || {}).text = R.text || null, R.id = R.text ? R.id || "qrcode-title" : null;
|
|
var Y, X, ie, se, ue = x.getModuleCount() * _ + 2 * E, ge = "";
|
|
for (se = "l" + _ + ",0 0," + _ + " -" + _ + ",0 0,-" + _ + "z ", ge += '<svg version="1.1" xmlns="http://www.w3.org/2000/svg"', ge += j.scalable ? "" : ' width="' + ue + 'px" height="' + ue + 'px"', ge += ' viewBox="0 0 ' + ue + " " + ue + '" ', ge += ' preserveAspectRatio="xMinYMin meet"', ge += R.text || O.text ? ' role="img" aria-labelledby="' + D([R.id, O.id].join(" ").trim()) + '"' : "", ge += ">", ge += R.text ? '<title id="' + D(R.id) + '">' + D(R.text) + "</title>" : "", ge += O.text ? '<description id="' + D(O.id) + '">' + D(O.text) + "</description>" : "", ge += '<rect width="100%" height="100%" fill="white" cx="0" cy="0"/>', ge += '<path d="', X = 0; X < x.getModuleCount(); X += 1)
|
|
for (ie = X * _ + E, Y = 0; Y < x.getModuleCount(); Y += 1)
|
|
x.isDark(X, Y) && (ge += "M" + (Y * _ + E) + "," + ie + se);
|
|
return (ge += '" stroke="transparent" fill="black"/>') + "</svg>";
|
|
}, x.createDataURL = function(_, E) {
|
|
_ = _ || 2, E = E === void 0 ? 4 * _ : E;
|
|
var O = x.getModuleCount() * _ + 2 * E, R = E, j = O - E;
|
|
return Ye(O, O, function(Y, X) {
|
|
if (R <= Y && Y < j && R <= X && X < j) {
|
|
var ie = Math.floor((Y - R) / _), se = Math.floor((X - R) / _);
|
|
return x.isDark(se, ie) ? 0 : 1;
|
|
}
|
|
return 1;
|
|
});
|
|
}, x.createImgTag = function(_, E, O) {
|
|
_ = _ || 2, E = E === void 0 ? 4 * _ : E;
|
|
var R = x.getModuleCount() * _ + 2 * E, j = "";
|
|
return j += "<img", j += ' src="', j += x.createDataURL(_, E), j += '"', j += ' width="', j += R, j += '"', j += ' height="', j += R, j += '"', O && (j += ' alt="', j += D(O), j += '"'), j + "/>";
|
|
};
|
|
var D = function(_) {
|
|
for (var E = "", O = 0; O < _.length; O += 1) {
|
|
var R = _.charAt(O);
|
|
switch (R) {
|
|
case "<":
|
|
E += "<";
|
|
break;
|
|
case ">":
|
|
E += ">";
|
|
break;
|
|
case "&":
|
|
E += "&";
|
|
break;
|
|
case '"':
|
|
E += """;
|
|
break;
|
|
default:
|
|
E += R;
|
|
}
|
|
}
|
|
return E;
|
|
};
|
|
return x.createASCII = function(_, E) {
|
|
if ((_ = _ || 1) < 2)
|
|
return function(de) {
|
|
de = de === void 0 ? 2 : de;
|
|
var ve, te, ke, Fe, oe, Xe = 1 * x.getModuleCount() + 2 * de, Ue = de, Ne = Xe - de, _n = { "\u2588\u2588": "\u2588", "\u2588 ": "\u2580", " \u2588": "\u2584", " ": " " }, Qt = { "\u2588\u2588": "\u2580", "\u2588 ": "\u2580", " \u2588": " ", " ": " " }, ct = "";
|
|
for (ve = 0; ve < Xe; ve += 2) {
|
|
for (ke = Math.floor((ve - Ue) / 1), Fe = Math.floor((ve + 1 - Ue) / 1), te = 0; te < Xe; te += 1)
|
|
oe = "\u2588", Ue <= te && te < Ne && Ue <= ve && ve < Ne && x.isDark(ke, Math.floor((te - Ue) / 1)) && (oe = " "), Ue <= te && te < Ne && Ue <= ve + 1 && ve + 1 < Ne && x.isDark(Fe, Math.floor((te - Ue) / 1)) ? oe += " " : oe += "\u2588", ct += de < 1 && ve + 1 >= Ne ? Qt[oe] : _n[oe];
|
|
ct += `
|
|
`;
|
|
}
|
|
return Xe % 2 && de > 0 ? ct.substring(0, ct.length - Xe - 1) + Array(Xe + 1).join("\u2580") : ct.substring(0, ct.length - 1);
|
|
}(E);
|
|
_ -= 1, E = E === void 0 ? 2 * _ : E;
|
|
var O, R, j, Y, X = x.getModuleCount() * _ + 2 * E, ie = E, se = X - E, ue = Array(_ + 1).join("\u2588\u2588"), ge = Array(_ + 1).join(" "), Ee = "", be = "";
|
|
for (O = 0; O < X; O += 1) {
|
|
for (j = Math.floor((O - ie) / _), be = "", R = 0; R < X; R += 1)
|
|
Y = 1, ie <= R && R < se && ie <= O && O < se && x.isDark(j, Math.floor((R - ie) / _)) && (Y = 0), be += Y ? ue : ge;
|
|
for (j = 0; j < _; j += 1)
|
|
Ee += be + `
|
|
`;
|
|
}
|
|
return Ee.substring(0, Ee.length - 1);
|
|
}, x.renderTo2dContext = function(_, E) {
|
|
E = E || 2;
|
|
for (var O = x.getModuleCount(), R = 0; R < O; R++)
|
|
for (var j = 0; j < O; j++)
|
|
_.fillStyle = x.isDark(R, j) ? "black" : "white", _.fillRect(R * E, j * E, E, E);
|
|
}, x;
|
|
};
|
|
h.stringToBytes = (h.stringToBytesFuncs = { default: function(k) {
|
|
for (var b = [], y = 0; y < k.length; y += 1) {
|
|
var d = k.charCodeAt(y);
|
|
b.push(255 & d);
|
|
}
|
|
return b;
|
|
} }).default, h.createStringToBytes = function(k, b) {
|
|
var y = function() {
|
|
for (var f = Oe(k), p = function() {
|
|
var N = f.read();
|
|
if (N == -1)
|
|
throw "eof";
|
|
return N;
|
|
}, v = 0, g = {}; ; ) {
|
|
var x = f.read();
|
|
if (x == -1)
|
|
break;
|
|
var M = p(), P = p() << 8 | p();
|
|
g[String.fromCharCode(x << 8 | M)] = P, v += 1;
|
|
}
|
|
if (v != b)
|
|
throw v + " != " + b;
|
|
return g;
|
|
}(), d = "?".charCodeAt(0);
|
|
return function(f) {
|
|
for (var p = [], v = 0; v < f.length; v += 1) {
|
|
var g = f.charCodeAt(v);
|
|
if (g < 128)
|
|
p.push(g);
|
|
else {
|
|
var x = y[f.charAt(v)];
|
|
typeof x == "number" ? (255 & x) == x ? p.push(x) : (p.push(x >>> 8), p.push(255 & x)) : p.push(d);
|
|
}
|
|
}
|
|
return p;
|
|
};
|
|
};
|
|
var m, w, $, S, T, U = { L: 1, M: 0, Q: 3, H: 2 }, z = (m = [[], [6, 18], [6, 22], [6, 26], [6, 30], [6, 34], [6, 22, 38], [6, 24, 42], [6, 26, 46], [6, 28, 50], [6, 30, 54], [6, 32, 58], [6, 34, 62], [6, 26, 46, 66], [6, 26, 48, 70], [6, 26, 50, 74], [6, 30, 54, 78], [6, 30, 56, 82], [6, 30, 58, 86], [6, 34, 62, 90], [6, 28, 50, 72, 94], [6, 26, 50, 74, 98], [6, 30, 54, 78, 102], [6, 28, 54, 80, 106], [6, 32, 58, 84, 110], [6, 30, 58, 86, 114], [6, 34, 62, 90, 118], [6, 26, 50, 74, 98, 122], [6, 30, 54, 78, 102, 126], [6, 26, 52, 78, 104, 130], [6, 30, 56, 82, 108, 134], [6, 34, 60, 86, 112, 138], [6, 30, 58, 86, 114, 142], [6, 34, 62, 90, 118, 146], [6, 30, 54, 78, 102, 126, 150], [6, 24, 50, 76, 102, 128, 154], [6, 28, 54, 80, 106, 132, 158], [6, 32, 58, 84, 110, 136, 162], [6, 26, 54, 82, 110, 138, 166], [6, 30, 58, 86, 114, 142, 170]], w = 1335, $ = 7973, T = function(k) {
|
|
for (var b = 0; k != 0; )
|
|
b += 1, k >>>= 1;
|
|
return b;
|
|
}, (S = {}).getBCHTypeInfo = function(k) {
|
|
for (var b = k << 10; T(b) - T(w) >= 0; )
|
|
b ^= w << T(b) - T(w);
|
|
return 21522 ^ (k << 10 | b);
|
|
}, S.getBCHTypeNumber = function(k) {
|
|
for (var b = k << 12; T(b) - T($) >= 0; )
|
|
b ^= $ << T(b) - T($);
|
|
return k << 12 | b;
|
|
}, S.getPatternPosition = function(k) {
|
|
return m[k - 1];
|
|
}, S.getMaskFunction = function(k) {
|
|
switch (k) {
|
|
case 0:
|
|
return function(b, y) {
|
|
return (b + y) % 2 == 0;
|
|
};
|
|
case 1:
|
|
return function(b, y) {
|
|
return b % 2 == 0;
|
|
};
|
|
case 2:
|
|
return function(b, y) {
|
|
return y % 3 == 0;
|
|
};
|
|
case 3:
|
|
return function(b, y) {
|
|
return (b + y) % 3 == 0;
|
|
};
|
|
case 4:
|
|
return function(b, y) {
|
|
return (Math.floor(b / 2) + Math.floor(y / 3)) % 2 == 0;
|
|
};
|
|
case 5:
|
|
return function(b, y) {
|
|
return b * y % 2 + b * y % 3 == 0;
|
|
};
|
|
case 6:
|
|
return function(b, y) {
|
|
return (b * y % 2 + b * y % 3) % 2 == 0;
|
|
};
|
|
case 7:
|
|
return function(b, y) {
|
|
return (b * y % 3 + (b + y) % 2) % 2 == 0;
|
|
};
|
|
default:
|
|
throw "bad maskPattern:" + k;
|
|
}
|
|
}, S.getErrorCorrectPolynomial = function(k) {
|
|
for (var b = Z([1], 0), y = 0; y < k; y += 1)
|
|
b = b.multiply(Z([1, B.gexp(y)], 0));
|
|
return b;
|
|
}, S.getLengthInBits = function(k, b) {
|
|
if (1 <= b && b < 10)
|
|
switch (k) {
|
|
case 1:
|
|
return 10;
|
|
case 2:
|
|
return 9;
|
|
case 4:
|
|
case 8:
|
|
return 8;
|
|
default:
|
|
throw "mode:" + k;
|
|
}
|
|
else if (b < 27)
|
|
switch (k) {
|
|
case 1:
|
|
return 12;
|
|
case 2:
|
|
return 11;
|
|
case 4:
|
|
return 16;
|
|
case 8:
|
|
return 10;
|
|
default:
|
|
throw "mode:" + k;
|
|
}
|
|
else {
|
|
if (!(b < 41))
|
|
throw "type:" + b;
|
|
switch (k) {
|
|
case 1:
|
|
return 14;
|
|
case 2:
|
|
return 13;
|
|
case 4:
|
|
return 16;
|
|
case 8:
|
|
return 12;
|
|
default:
|
|
throw "mode:" + k;
|
|
}
|
|
}
|
|
}, S.getLostPoint = function(k) {
|
|
for (var b = k.getModuleCount(), y = 0, d = 0; d < b; d += 1)
|
|
for (var f = 0; f < b; f += 1) {
|
|
for (var p = 0, v = k.isDark(d, f), g = -1; g <= 1; g += 1)
|
|
if (!(d + g < 0 || b <= d + g))
|
|
for (var x = -1; x <= 1; x += 1)
|
|
f + x < 0 || b <= f + x || g == 0 && x == 0 || v == k.isDark(d + g, f + x) && (p += 1);
|
|
p > 5 && (y += 3 + p - 5);
|
|
}
|
|
for (d = 0; d < b - 1; d += 1)
|
|
for (f = 0; f < b - 1; f += 1) {
|
|
var M = 0;
|
|
k.isDark(d, f) && (M += 1), k.isDark(d + 1, f) && (M += 1), k.isDark(d, f + 1) && (M += 1), k.isDark(d + 1, f + 1) && (M += 1), M != 0 && M != 4 || (y += 3);
|
|
}
|
|
for (d = 0; d < b; d += 1)
|
|
for (f = 0; f < b - 6; f += 1)
|
|
k.isDark(d, f) && !k.isDark(d, f + 1) && k.isDark(d, f + 2) && k.isDark(d, f + 3) && k.isDark(d, f + 4) && !k.isDark(d, f + 5) && k.isDark(d, f + 6) && (y += 40);
|
|
for (f = 0; f < b; f += 1)
|
|
for (d = 0; d < b - 6; d += 1)
|
|
k.isDark(d, f) && !k.isDark(d + 1, f) && k.isDark(d + 2, f) && k.isDark(d + 3, f) && k.isDark(d + 4, f) && !k.isDark(d + 5, f) && k.isDark(d + 6, f) && (y += 40);
|
|
var P = 0;
|
|
for (f = 0; f < b; f += 1)
|
|
for (d = 0; d < b; d += 1)
|
|
k.isDark(d, f) && (P += 1);
|
|
return y + Math.abs(100 * P / b / b - 50) / 5 * 10;
|
|
}, S), B = function() {
|
|
for (var k = new Array(256), b = new Array(256), y = 0; y < 8; y += 1)
|
|
k[y] = 1 << y;
|
|
for (y = 8; y < 256; y += 1)
|
|
k[y] = k[y - 4] ^ k[y - 5] ^ k[y - 6] ^ k[y - 8];
|
|
for (y = 0; y < 255; y += 1)
|
|
b[k[y]] = y;
|
|
return { glog: function(d) {
|
|
if (d < 1)
|
|
throw "glog(" + d + ")";
|
|
return b[d];
|
|
}, gexp: function(d) {
|
|
for (; d < 0; )
|
|
d += 255;
|
|
for (; d >= 256; )
|
|
d -= 255;
|
|
return k[d];
|
|
} };
|
|
}();
|
|
function Z(k, b) {
|
|
if (k.length === void 0)
|
|
throw k.length + "/" + b;
|
|
var y = function() {
|
|
for (var f = 0; f < k.length && k[f] == 0; )
|
|
f += 1;
|
|
for (var p = new Array(k.length - f + b), v = 0; v < k.length - f; v += 1)
|
|
p[v] = k[v + f];
|
|
return p;
|
|
}(), d = { getAt: function(f) {
|
|
return y[f];
|
|
}, getLength: function() {
|
|
return y.length;
|
|
}, multiply: function(f) {
|
|
for (var p = new Array(d.getLength() + f.getLength() - 1), v = 0; v < d.getLength(); v += 1)
|
|
for (var g = 0; g < f.getLength(); g += 1)
|
|
p[v + g] ^= B.gexp(B.glog(d.getAt(v)) + B.glog(f.getAt(g)));
|
|
return Z(p, 0);
|
|
}, mod: function(f) {
|
|
if (d.getLength() - f.getLength() < 0)
|
|
return d;
|
|
for (var p = B.glog(d.getAt(0)) - B.glog(f.getAt(0)), v = new Array(d.getLength()), g = 0; g < d.getLength(); g += 1)
|
|
v[g] = d.getAt(g);
|
|
for (g = 0; g < f.getLength(); g += 1)
|
|
v[g] ^= B.gexp(B.glog(f.getAt(g)) + p);
|
|
return Z(v, 0).mod(f);
|
|
} };
|
|
return d;
|
|
}
|
|
var Q = function() {
|
|
var k = [[1, 26, 19], [1, 26, 16], [1, 26, 13], [1, 26, 9], [1, 44, 34], [1, 44, 28], [1, 44, 22], [1, 44, 16], [1, 70, 55], [1, 70, 44], [2, 35, 17], [2, 35, 13], [1, 100, 80], [2, 50, 32], [2, 50, 24], [4, 25, 9], [1, 134, 108], [2, 67, 43], [2, 33, 15, 2, 34, 16], [2, 33, 11, 2, 34, 12], [2, 86, 68], [4, 43, 27], [4, 43, 19], [4, 43, 15], [2, 98, 78], [4, 49, 31], [2, 32, 14, 4, 33, 15], [4, 39, 13, 1, 40, 14], [2, 121, 97], [2, 60, 38, 2, 61, 39], [4, 40, 18, 2, 41, 19], [4, 40, 14, 2, 41, 15], [2, 146, 116], [3, 58, 36, 2, 59, 37], [4, 36, 16, 4, 37, 17], [4, 36, 12, 4, 37, 13], [2, 86, 68, 2, 87, 69], [4, 69, 43, 1, 70, 44], [6, 43, 19, 2, 44, 20], [6, 43, 15, 2, 44, 16], [4, 101, 81], [1, 80, 50, 4, 81, 51], [4, 50, 22, 4, 51, 23], [3, 36, 12, 8, 37, 13], [2, 116, 92, 2, 117, 93], [6, 58, 36, 2, 59, 37], [4, 46, 20, 6, 47, 21], [7, 42, 14, 4, 43, 15], [4, 133, 107], [8, 59, 37, 1, 60, 38], [8, 44, 20, 4, 45, 21], [12, 33, 11, 4, 34, 12], [3, 145, 115, 1, 146, 116], [4, 64, 40, 5, 65, 41], [11, 36, 16, 5, 37, 17], [11, 36, 12, 5, 37, 13], [5, 109, 87, 1, 110, 88], [5, 65, 41, 5, 66, 42], [5, 54, 24, 7, 55, 25], [11, 36, 12, 7, 37, 13], [5, 122, 98, 1, 123, 99], [7, 73, 45, 3, 74, 46], [15, 43, 19, 2, 44, 20], [3, 45, 15, 13, 46, 16], [1, 135, 107, 5, 136, 108], [10, 74, 46, 1, 75, 47], [1, 50, 22, 15, 51, 23], [2, 42, 14, 17, 43, 15], [5, 150, 120, 1, 151, 121], [9, 69, 43, 4, 70, 44], [17, 50, 22, 1, 51, 23], [2, 42, 14, 19, 43, 15], [3, 141, 113, 4, 142, 114], [3, 70, 44, 11, 71, 45], [17, 47, 21, 4, 48, 22], [9, 39, 13, 16, 40, 14], [3, 135, 107, 5, 136, 108], [3, 67, 41, 13, 68, 42], [15, 54, 24, 5, 55, 25], [15, 43, 15, 10, 44, 16], [4, 144, 116, 4, 145, 117], [17, 68, 42], [17, 50, 22, 6, 51, 23], [19, 46, 16, 6, 47, 17], [2, 139, 111, 7, 140, 112], [17, 74, 46], [7, 54, 24, 16, 55, 25], [34, 37, 13], [4, 151, 121, 5, 152, 122], [4, 75, 47, 14, 76, 48], [11, 54, 24, 14, 55, 25], [16, 45, 15, 14, 46, 16], [6, 147, 117, 4, 148, 118], [6, 73, 45, 14, 74, 46], [11, 54, 24, 16, 55, 25], [30, 46, 16, 2, 47, 17], [8, 132, 106, 4, 133, 107], [8, 75, 47, 13, 76, 48], [7, 54, 24, 22, 55, 25], [22, 45, 15, 13, 46, 16], [10, 142, 114, 2, 143, 115], [19, 74, 46, 4, 75, 47], [28, 50, 22, 6, 51, 23], [33, 46, 16, 4, 47, 17], [8, 152, 122, 4, 153, 123], [22, 73, 45, 3, 74, 46], [8, 53, 23, 26, 54, 24], [12, 45, 15, 28, 46, 16], [3, 147, 117, 10, 148, 118], [3, 73, 45, 23, 74, 46], [4, 54, 24, 31, 55, 25], [11, 45, 15, 31, 46, 16], [7, 146, 116, 7, 147, 117], [21, 73, 45, 7, 74, 46], [1, 53, 23, 37, 54, 24], [19, 45, 15, 26, 46, 16], [5, 145, 115, 10, 146, 116], [19, 75, 47, 10, 76, 48], [15, 54, 24, 25, 55, 25], [23, 45, 15, 25, 46, 16], [13, 145, 115, 3, 146, 116], [2, 74, 46, 29, 75, 47], [42, 54, 24, 1, 55, 25], [23, 45, 15, 28, 46, 16], [17, 145, 115], [10, 74, 46, 23, 75, 47], [10, 54, 24, 35, 55, 25], [19, 45, 15, 35, 46, 16], [17, 145, 115, 1, 146, 116], [14, 74, 46, 21, 75, 47], [29, 54, 24, 19, 55, 25], [11, 45, 15, 46, 46, 16], [13, 145, 115, 6, 146, 116], [14, 74, 46, 23, 75, 47], [44, 54, 24, 7, 55, 25], [59, 46, 16, 1, 47, 17], [12, 151, 121, 7, 152, 122], [12, 75, 47, 26, 76, 48], [39, 54, 24, 14, 55, 25], [22, 45, 15, 41, 46, 16], [6, 151, 121, 14, 152, 122], [6, 75, 47, 34, 76, 48], [46, 54, 24, 10, 55, 25], [2, 45, 15, 64, 46, 16], [17, 152, 122, 4, 153, 123], [29, 74, 46, 14, 75, 47], [49, 54, 24, 10, 55, 25], [24, 45, 15, 46, 46, 16], [4, 152, 122, 18, 153, 123], [13, 74, 46, 32, 75, 47], [48, 54, 24, 14, 55, 25], [42, 45, 15, 32, 46, 16], [20, 147, 117, 4, 148, 118], [40, 75, 47, 7, 76, 48], [43, 54, 24, 22, 55, 25], [10, 45, 15, 67, 46, 16], [19, 148, 118, 6, 149, 119], [18, 75, 47, 31, 76, 48], [34, 54, 24, 34, 55, 25], [20, 45, 15, 61, 46, 16]], b = function(d, f) {
|
|
var p = {};
|
|
return p.totalCount = d, p.dataCount = f, p;
|
|
}, y = { getRSBlocks: function(d, f) {
|
|
var p = function(V, L) {
|
|
switch (L) {
|
|
case U.L:
|
|
return k[4 * (V - 1) + 0];
|
|
case U.M:
|
|
return k[4 * (V - 1) + 1];
|
|
case U.Q:
|
|
return k[4 * (V - 1) + 2];
|
|
case U.H:
|
|
return k[4 * (V - 1) + 3];
|
|
default:
|
|
return;
|
|
}
|
|
}(d, f);
|
|
if (p === void 0)
|
|
throw "bad rs block @ typeNumber:" + d + "/errorCorrectionLevel:" + f;
|
|
for (var v = p.length / 3, g = [], x = 0; x < v; x += 1)
|
|
for (var M = p[3 * x + 0], P = p[3 * x + 1], N = p[3 * x + 2], I = 0; I < M; I += 1)
|
|
g.push(b(P, N));
|
|
return g;
|
|
} };
|
|
return y;
|
|
}(), q = function() {
|
|
var k = [], b = 0, y = { getBuffer: function() {
|
|
return k;
|
|
}, getAt: function(d) {
|
|
var f = Math.floor(d / 8);
|
|
return (k[f] >>> 7 - d % 8 & 1) == 1;
|
|
}, put: function(d, f) {
|
|
for (var p = 0; p < f; p += 1)
|
|
y.putBit((d >>> f - p - 1 & 1) == 1);
|
|
}, getLengthInBits: function() {
|
|
return b;
|
|
}, putBit: function(d) {
|
|
var f = Math.floor(b / 8);
|
|
k.length <= f && k.push(0), d && (k[f] |= 128 >>> b % 8), b += 1;
|
|
} };
|
|
return y;
|
|
}, ce = function(k) {
|
|
var b = k, y = { getMode: function() {
|
|
return 1;
|
|
}, getLength: function(p) {
|
|
return b.length;
|
|
}, write: function(p) {
|
|
for (var v = b, g = 0; g + 2 < v.length; )
|
|
p.put(d(v.substring(g, g + 3)), 10), g += 3;
|
|
g < v.length && (v.length - g == 1 ? p.put(d(v.substring(g, g + 1)), 4) : v.length - g == 2 && p.put(d(v.substring(g, g + 2)), 7));
|
|
} }, d = function(p) {
|
|
for (var v = 0, g = 0; g < p.length; g += 1)
|
|
v = 10 * v + f(p.charAt(g));
|
|
return v;
|
|
}, f = function(p) {
|
|
if ("0" <= p && p <= "9")
|
|
return p.charCodeAt(0) - "0".charCodeAt(0);
|
|
throw "illegal char :" + p;
|
|
};
|
|
return y;
|
|
}, re = function(k) {
|
|
var b = k, y = { getMode: function() {
|
|
return 2;
|
|
}, getLength: function(f) {
|
|
return b.length;
|
|
}, write: function(f) {
|
|
for (var p = b, v = 0; v + 1 < p.length; )
|
|
f.put(45 * d(p.charAt(v)) + d(p.charAt(v + 1)), 11), v += 2;
|
|
v < p.length && f.put(d(p.charAt(v)), 6);
|
|
} }, d = function(f) {
|
|
if ("0" <= f && f <= "9")
|
|
return f.charCodeAt(0) - "0".charCodeAt(0);
|
|
if ("A" <= f && f <= "Z")
|
|
return f.charCodeAt(0) - "A".charCodeAt(0) + 10;
|
|
switch (f) {
|
|
case " ":
|
|
return 36;
|
|
case "$":
|
|
return 37;
|
|
case "%":
|
|
return 38;
|
|
case "*":
|
|
return 39;
|
|
case "+":
|
|
return 40;
|
|
case "-":
|
|
return 41;
|
|
case ".":
|
|
return 42;
|
|
case "/":
|
|
return 43;
|
|
case ":":
|
|
return 44;
|
|
default:
|
|
throw "illegal char :" + f;
|
|
}
|
|
};
|
|
return y;
|
|
}, ae = function(k) {
|
|
var b = h.stringToBytes(k);
|
|
return { getMode: function() {
|
|
return 4;
|
|
}, getLength: function(y) {
|
|
return b.length;
|
|
}, write: function(y) {
|
|
for (var d = 0; d < b.length; d += 1)
|
|
y.put(b[d], 8);
|
|
} };
|
|
}, J = function(k) {
|
|
var b = h.stringToBytesFuncs.SJIS;
|
|
if (!b)
|
|
throw "sjis not supported.";
|
|
(function() {
|
|
var f = b("\u53CB");
|
|
if (f.length != 2 || (f[0] << 8 | f[1]) != 38726)
|
|
throw "sjis not supported.";
|
|
})();
|
|
var y = b(k), d = { getMode: function() {
|
|
return 8;
|
|
}, getLength: function(f) {
|
|
return ~~(y.length / 2);
|
|
}, write: function(f) {
|
|
for (var p = y, v = 0; v + 1 < p.length; ) {
|
|
var g = (255 & p[v]) << 8 | 255 & p[v + 1];
|
|
if (33088 <= g && g <= 40956)
|
|
g -= 33088;
|
|
else {
|
|
if (!(57408 <= g && g <= 60351))
|
|
throw "illegal char at " + (v + 1) + "/" + g;
|
|
g -= 49472;
|
|
}
|
|
g = 192 * (g >>> 8 & 255) + (255 & g), f.put(g, 13), v += 2;
|
|
}
|
|
if (v < p.length)
|
|
throw "illegal char at " + (v + 1);
|
|
} };
|
|
return d;
|
|
}, G = function() {
|
|
var k = [], b = { writeByte: function(y) {
|
|
k.push(255 & y);
|
|
}, writeShort: function(y) {
|
|
b.writeByte(y), b.writeByte(y >>> 8);
|
|
}, writeBytes: function(y, d, f) {
|
|
d = d || 0, f = f || y.length;
|
|
for (var p = 0; p < f; p += 1)
|
|
b.writeByte(y[p + d]);
|
|
}, writeString: function(y) {
|
|
for (var d = 0; d < y.length; d += 1)
|
|
b.writeByte(y.charCodeAt(d));
|
|
}, toByteArray: function() {
|
|
return k;
|
|
}, toString: function() {
|
|
var y = "";
|
|
y += "[";
|
|
for (var d = 0; d < k.length; d += 1)
|
|
d > 0 && (y += ","), y += k[d];
|
|
return y + "]";
|
|
} };
|
|
return b;
|
|
}, Oe = function(k) {
|
|
var b = k, y = 0, d = 0, f = 0, p = { read: function() {
|
|
for (; f < 8; ) {
|
|
if (y >= b.length) {
|
|
if (f == 0)
|
|
return -1;
|
|
throw "unexpected end of file./" + f;
|
|
}
|
|
var g = b.charAt(y);
|
|
if (y += 1, g == "=")
|
|
return f = 0, -1;
|
|
g.match(/^\s$/) || (d = d << 6 | v(g.charCodeAt(0)), f += 6);
|
|
}
|
|
var x = d >>> f - 8 & 255;
|
|
return f -= 8, x;
|
|
} }, v = function(g) {
|
|
if (65 <= g && g <= 90)
|
|
return g - 65;
|
|
if (97 <= g && g <= 122)
|
|
return g - 97 + 26;
|
|
if (48 <= g && g <= 57)
|
|
return g - 48 + 52;
|
|
if (g == 43)
|
|
return 62;
|
|
if (g == 47)
|
|
return 63;
|
|
throw "c:" + g;
|
|
};
|
|
return p;
|
|
}, Ye = function(k, b, y) {
|
|
for (var d = function(P, N) {
|
|
var I = P, V = N, L = new Array(P * N), A = { setPixel: function(_, E, O) {
|
|
L[E * I + _] = O;
|
|
}, write: function(_) {
|
|
_.writeString("GIF87a"), _.writeShort(I), _.writeShort(V), _.writeByte(128), _.writeByte(0), _.writeByte(0), _.writeByte(0), _.writeByte(0), _.writeByte(0), _.writeByte(255), _.writeByte(255), _.writeByte(255), _.writeString(","), _.writeShort(0), _.writeShort(0), _.writeShort(I), _.writeShort(V), _.writeByte(0);
|
|
var E = C(2);
|
|
_.writeByte(2);
|
|
for (var O = 0; E.length - O > 255; )
|
|
_.writeByte(255), _.writeBytes(E, O, 255), O += 255;
|
|
_.writeByte(E.length - O), _.writeBytes(E, O, E.length - O), _.writeByte(0), _.writeString(";");
|
|
} }, C = function(_) {
|
|
for (var E = 1 << _, O = 1 + (1 << _), R = _ + 1, j = D(), Y = 0; Y < E; Y += 1)
|
|
j.add(String.fromCharCode(Y));
|
|
j.add(String.fromCharCode(E)), j.add(String.fromCharCode(O));
|
|
var X, ie, se, ue = G(), ge = (X = ue, ie = 0, se = 0, { write: function(ve, te) {
|
|
if (ve >>> te != 0)
|
|
throw "length over";
|
|
for (; ie + te >= 8; )
|
|
X.writeByte(255 & (ve << ie | se)), te -= 8 - ie, ve >>>= 8 - ie, se = 0, ie = 0;
|
|
se |= ve << ie, ie += te;
|
|
}, flush: function() {
|
|
ie > 0 && X.writeByte(se);
|
|
} });
|
|
ge.write(E, R);
|
|
var Ee = 0, be = String.fromCharCode(L[Ee]);
|
|
for (Ee += 1; Ee < L.length; ) {
|
|
var de = String.fromCharCode(L[Ee]);
|
|
Ee += 1, j.contains(be + de) ? be += de : (ge.write(j.indexOf(be), R), j.size() < 4095 && (j.size() == 1 << R && (R += 1), j.add(be + de)), be = de);
|
|
}
|
|
return ge.write(j.indexOf(be), R), ge.write(O, R), ge.flush(), ue.toByteArray();
|
|
}, D = function() {
|
|
var _ = {}, E = 0, O = { add: function(R) {
|
|
if (O.contains(R))
|
|
throw "dup key:" + R;
|
|
_[R] = E, E += 1;
|
|
}, size: function() {
|
|
return E;
|
|
}, indexOf: function(R) {
|
|
return _[R];
|
|
}, contains: function(R) {
|
|
return _[R] !== void 0;
|
|
} };
|
|
return O;
|
|
};
|
|
return A;
|
|
}(k, b), f = 0; f < b; f += 1)
|
|
for (var p = 0; p < k; p += 1)
|
|
d.setPixel(p, f, y(p, f));
|
|
var v = G();
|
|
d.write(v);
|
|
for (var g = function() {
|
|
var P = 0, N = 0, I = 0, V = "", L = {}, A = function(D) {
|
|
V += String.fromCharCode(C(63 & D));
|
|
}, C = function(D) {
|
|
if (!(D < 0)) {
|
|
if (D < 26)
|
|
return 65 + D;
|
|
if (D < 52)
|
|
return D - 26 + 97;
|
|
if (D < 62)
|
|
return D - 52 + 48;
|
|
if (D == 62)
|
|
return 43;
|
|
if (D == 63)
|
|
return 47;
|
|
}
|
|
throw "n:" + D;
|
|
};
|
|
return L.writeByte = function(D) {
|
|
for (P = P << 8 | 255 & D, N += 8, I += 1; N >= 6; )
|
|
A(P >>> N - 6), N -= 6;
|
|
}, L.flush = function() {
|
|
if (N > 0 && (A(P << 6 - N), P = 0, N = 0), I % 3 != 0)
|
|
for (var D = 3 - I % 3, _ = 0; _ < D; _ += 1)
|
|
V += "=";
|
|
}, L.toString = function() {
|
|
return V;
|
|
}, L;
|
|
}(), x = v.toByteArray(), M = 0; M < x.length; M += 1)
|
|
g.writeByte(x[M]);
|
|
return g.flush(), "data:image/gif;base64," + g;
|
|
};
|
|
return h;
|
|
}();
|
|
l.stringToBytesFuncs["UTF-8"] = function(h) {
|
|
return function(m) {
|
|
for (var w = [], $ = 0; $ < m.length; $++) {
|
|
var S = m.charCodeAt($);
|
|
S < 128 ? w.push(S) : S < 2048 ? w.push(192 | S >> 6, 128 | 63 & S) : S < 55296 || S >= 57344 ? w.push(224 | S >> 12, 128 | S >> 6 & 63, 128 | 63 & S) : ($++, S = 65536 + ((1023 & S) << 10 | 1023 & m.charCodeAt($)), w.push(240 | S >> 18, 128 | S >> 12 & 63, 128 | S >> 6 & 63, 128 | 63 & S));
|
|
}
|
|
return w;
|
|
}(h);
|
|
}, (c = typeof (u = function() {
|
|
return l;
|
|
}) == "function" ? u.apply(s, []) : u) === void 0 || (o.exports = c);
|
|
} }, r = {};
|
|
function i(o) {
|
|
var s = r[o];
|
|
if (s !== void 0)
|
|
return s.exports;
|
|
var u = r[o] = { exports: {} };
|
|
return t[o](u, u.exports, i), u.exports;
|
|
}
|
|
i.n = (o) => {
|
|
var s = o && o.__esModule ? () => o.default : () => o;
|
|
return i.d(s, { a: s }), s;
|
|
}, i.d = (o, s) => {
|
|
for (var u in s)
|
|
i.o(s, u) && !i.o(o, u) && Object.defineProperty(o, u, { enumerable: !0, get: s[u] });
|
|
}, i.o = (o, s) => Object.prototype.hasOwnProperty.call(o, s);
|
|
var a = {};
|
|
return (() => {
|
|
i.d(a, { default: () => b });
|
|
const o = (y) => !!y && typeof y == "object" && !Array.isArray(y);
|
|
function s(y, ...d) {
|
|
if (!d.length)
|
|
return y;
|
|
const f = d.shift();
|
|
return f !== void 0 && o(y) && o(f) ? (y = Object.assign({}, y), Object.keys(f).forEach((p) => {
|
|
const v = y[p], g = f[p];
|
|
Array.isArray(v) && Array.isArray(g) ? y[p] = g : o(v) && o(g) ? y[p] = s(Object.assign({}, v), g) : y[p] = g;
|
|
}), s(y, ...d)) : y;
|
|
}
|
|
function u(y, d) {
|
|
const f = document.createElement("a");
|
|
f.download = d, f.href = y, document.body.appendChild(f), f.click(), document.body.removeChild(f);
|
|
}
|
|
const c = { L: 0.07, M: 0.15, Q: 0.25, H: 0.3 };
|
|
class l {
|
|
constructor({ svg: d, type: f, window: p }) {
|
|
this._svg = d, this._type = f, this._window = p;
|
|
}
|
|
draw(d, f, p, v) {
|
|
let g;
|
|
switch (this._type) {
|
|
case "dots":
|
|
g = this._drawDot;
|
|
break;
|
|
case "classy":
|
|
g = this._drawClassy;
|
|
break;
|
|
case "classy-rounded":
|
|
g = this._drawClassyRounded;
|
|
break;
|
|
case "rounded":
|
|
g = this._drawRounded;
|
|
break;
|
|
case "extra-rounded":
|
|
g = this._drawExtraRounded;
|
|
break;
|
|
default:
|
|
g = this._drawSquare;
|
|
}
|
|
g.call(this, { x: d, y: f, size: p, getNeighbor: v });
|
|
}
|
|
_rotateFigure({ x: d, y: f, size: p, rotation: v = 0, draw: g }) {
|
|
var x;
|
|
const M = d + p / 2, P = f + p / 2;
|
|
g(), (x = this._element) === null || x === void 0 || x.setAttribute("transform", `rotate(${180 * v / Math.PI},${M},${P})`);
|
|
}
|
|
_basicDot(d) {
|
|
const { size: f, x: p, y: v } = d;
|
|
this._rotateFigure(Object.assign(Object.assign({}, d), { draw: () => {
|
|
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "circle"), this._element.setAttribute("cx", String(p + f / 2)), this._element.setAttribute("cy", String(v + f / 2)), this._element.setAttribute("r", String(f / 2));
|
|
} }));
|
|
}
|
|
_basicSquare(d) {
|
|
const { size: f, x: p, y: v } = d;
|
|
this._rotateFigure(Object.assign(Object.assign({}, d), { draw: () => {
|
|
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "rect"), this._element.setAttribute("x", String(p)), this._element.setAttribute("y", String(v)), this._element.setAttribute("width", String(f)), this._element.setAttribute("height", String(f));
|
|
} }));
|
|
}
|
|
_basicSideRounded(d) {
|
|
const { size: f, x: p, y: v } = d;
|
|
this._rotateFigure(Object.assign(Object.assign({}, d), { draw: () => {
|
|
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "path"), this._element.setAttribute("d", `M ${p} ${v}v ${f}h ` + f / 2 + `a ${f / 2} ${f / 2}, 0, 0, 0, 0 ${-f}`);
|
|
} }));
|
|
}
|
|
_basicCornerRounded(d) {
|
|
const { size: f, x: p, y: v } = d;
|
|
this._rotateFigure(Object.assign(Object.assign({}, d), { draw: () => {
|
|
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "path"), this._element.setAttribute("d", `M ${p} ${v}v ${f}h ${f}v ` + -f / 2 + `a ${f / 2} ${f / 2}, 0, 0, 0, ${-f / 2} ${-f / 2}`);
|
|
} }));
|
|
}
|
|
_basicCornerExtraRounded(d) {
|
|
const { size: f, x: p, y: v } = d;
|
|
this._rotateFigure(Object.assign(Object.assign({}, d), { draw: () => {
|
|
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "path"), this._element.setAttribute("d", `M ${p} ${v}v ${f}h ${f}a ${f} ${f}, 0, 0, 0, ${-f} ${-f}`);
|
|
} }));
|
|
}
|
|
_basicCornersRounded(d) {
|
|
const { size: f, x: p, y: v } = d;
|
|
this._rotateFigure(Object.assign(Object.assign({}, d), { draw: () => {
|
|
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "path"), this._element.setAttribute("d", `M ${p} ${v}v ` + f / 2 + `a ${f / 2} ${f / 2}, 0, 0, 0, ${f / 2} ${f / 2}h ` + f / 2 + "v " + -f / 2 + `a ${f / 2} ${f / 2}, 0, 0, 0, ${-f / 2} ${-f / 2}`);
|
|
} }));
|
|
}
|
|
_drawDot({ x: d, y: f, size: p }) {
|
|
this._basicDot({ x: d, y: f, size: p, rotation: 0 });
|
|
}
|
|
_drawSquare({ x: d, y: f, size: p }) {
|
|
this._basicSquare({ x: d, y: f, size: p, rotation: 0 });
|
|
}
|
|
_drawRounded({ x: d, y: f, size: p, getNeighbor: v }) {
|
|
const g = v ? +v(-1, 0) : 0, x = v ? +v(1, 0) : 0, M = v ? +v(0, -1) : 0, P = v ? +v(0, 1) : 0, N = g + x + M + P;
|
|
if (N !== 0)
|
|
if (N > 2 || g && x || M && P)
|
|
this._basicSquare({ x: d, y: f, size: p, rotation: 0 });
|
|
else {
|
|
if (N === 2) {
|
|
let I = 0;
|
|
return g && M ? I = Math.PI / 2 : M && x ? I = Math.PI : x && P && (I = -Math.PI / 2), void this._basicCornerRounded({ x: d, y: f, size: p, rotation: I });
|
|
}
|
|
if (N === 1) {
|
|
let I = 0;
|
|
return M ? I = Math.PI / 2 : x ? I = Math.PI : P && (I = -Math.PI / 2), void this._basicSideRounded({ x: d, y: f, size: p, rotation: I });
|
|
}
|
|
}
|
|
else
|
|
this._basicDot({ x: d, y: f, size: p, rotation: 0 });
|
|
}
|
|
_drawExtraRounded({ x: d, y: f, size: p, getNeighbor: v }) {
|
|
const g = v ? +v(-1, 0) : 0, x = v ? +v(1, 0) : 0, M = v ? +v(0, -1) : 0, P = v ? +v(0, 1) : 0, N = g + x + M + P;
|
|
if (N !== 0)
|
|
if (N > 2 || g && x || M && P)
|
|
this._basicSquare({ x: d, y: f, size: p, rotation: 0 });
|
|
else {
|
|
if (N === 2) {
|
|
let I = 0;
|
|
return g && M ? I = Math.PI / 2 : M && x ? I = Math.PI : x && P && (I = -Math.PI / 2), void this._basicCornerExtraRounded({ x: d, y: f, size: p, rotation: I });
|
|
}
|
|
if (N === 1) {
|
|
let I = 0;
|
|
return M ? I = Math.PI / 2 : x ? I = Math.PI : P && (I = -Math.PI / 2), void this._basicSideRounded({ x: d, y: f, size: p, rotation: I });
|
|
}
|
|
}
|
|
else
|
|
this._basicDot({ x: d, y: f, size: p, rotation: 0 });
|
|
}
|
|
_drawClassy({ x: d, y: f, size: p, getNeighbor: v }) {
|
|
const g = v ? +v(-1, 0) : 0, x = v ? +v(1, 0) : 0, M = v ? +v(0, -1) : 0, P = v ? +v(0, 1) : 0;
|
|
g + x + M + P !== 0 ? g || M ? x || P ? this._basicSquare({ x: d, y: f, size: p, rotation: 0 }) : this._basicCornerRounded({ x: d, y: f, size: p, rotation: Math.PI / 2 }) : this._basicCornerRounded({ x: d, y: f, size: p, rotation: -Math.PI / 2 }) : this._basicCornersRounded({ x: d, y: f, size: p, rotation: Math.PI / 2 });
|
|
}
|
|
_drawClassyRounded({ x: d, y: f, size: p, getNeighbor: v }) {
|
|
const g = v ? +v(-1, 0) : 0, x = v ? +v(1, 0) : 0, M = v ? +v(0, -1) : 0, P = v ? +v(0, 1) : 0;
|
|
g + x + M + P !== 0 ? g || M ? x || P ? this._basicSquare({ x: d, y: f, size: p, rotation: 0 }) : this._basicCornerExtraRounded({ x: d, y: f, size: p, rotation: Math.PI / 2 }) : this._basicCornerExtraRounded({ x: d, y: f, size: p, rotation: -Math.PI / 2 }) : this._basicCornersRounded({ x: d, y: f, size: p, rotation: Math.PI / 2 });
|
|
}
|
|
}
|
|
const h = { dot: "dot", square: "square", extraRounded: "extra-rounded" }, m = Object.values(h);
|
|
class w {
|
|
constructor({ svg: d, type: f, window: p }) {
|
|
this._svg = d, this._type = f, this._window = p;
|
|
}
|
|
draw(d, f, p, v) {
|
|
let g;
|
|
switch (this._type) {
|
|
case h.square:
|
|
g = this._drawSquare;
|
|
break;
|
|
case h.extraRounded:
|
|
g = this._drawExtraRounded;
|
|
break;
|
|
default:
|
|
g = this._drawDot;
|
|
}
|
|
g.call(this, { x: d, y: f, size: p, rotation: v });
|
|
}
|
|
_rotateFigure({ x: d, y: f, size: p, rotation: v = 0, draw: g }) {
|
|
var x;
|
|
const M = d + p / 2, P = f + p / 2;
|
|
g(), (x = this._element) === null || x === void 0 || x.setAttribute("transform", `rotate(${180 * v / Math.PI},${M},${P})`);
|
|
}
|
|
_basicDot(d) {
|
|
const { size: f, x: p, y: v } = d, g = f / 7;
|
|
this._rotateFigure(Object.assign(Object.assign({}, d), { draw: () => {
|
|
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "path"), this._element.setAttribute("clip-rule", "evenodd"), this._element.setAttribute("d", `M ${p + f / 2} ${v}a ${f / 2} ${f / 2} 0 1 0 0.1 0zm 0 ${g}a ${f / 2 - g} ${f / 2 - g} 0 1 1 -0.1 0Z`);
|
|
} }));
|
|
}
|
|
_basicSquare(d) {
|
|
const { size: f, x: p, y: v } = d, g = f / 7;
|
|
this._rotateFigure(Object.assign(Object.assign({}, d), { draw: () => {
|
|
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "path"), this._element.setAttribute("clip-rule", "evenodd"), this._element.setAttribute("d", `M ${p} ${v}v ${f}h ${f}v ` + -f + `zM ${p + g} ${v + g}h ` + (f - 2 * g) + "v " + (f - 2 * g) + "h " + (2 * g - f) + "z");
|
|
} }));
|
|
}
|
|
_basicExtraRounded(d) {
|
|
const { size: f, x: p, y: v } = d, g = f / 7;
|
|
this._rotateFigure(Object.assign(Object.assign({}, d), { draw: () => {
|
|
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "path"), this._element.setAttribute("clip-rule", "evenodd"), this._element.setAttribute("d", `M ${p} ${v + 2.5 * g}v ` + 2 * g + `a ${2.5 * g} ${2.5 * g}, 0, 0, 0, ${2.5 * g} ${2.5 * g}h ` + 2 * g + `a ${2.5 * g} ${2.5 * g}, 0, 0, 0, ${2.5 * g} ${2.5 * -g}v ` + -2 * g + `a ${2.5 * g} ${2.5 * g}, 0, 0, 0, ${2.5 * -g} ${2.5 * -g}h ` + -2 * g + `a ${2.5 * g} ${2.5 * g}, 0, 0, 0, ${2.5 * -g} ${2.5 * g}M ${p + 2.5 * g} ${v + g}h ` + 2 * g + `a ${1.5 * g} ${1.5 * g}, 0, 0, 1, ${1.5 * g} ${1.5 * g}v ` + 2 * g + `a ${1.5 * g} ${1.5 * g}, 0, 0, 1, ${1.5 * -g} ${1.5 * g}h ` + -2 * g + `a ${1.5 * g} ${1.5 * g}, 0, 0, 1, ${1.5 * -g} ${1.5 * -g}v ` + -2 * g + `a ${1.5 * g} ${1.5 * g}, 0, 0, 1, ${1.5 * g} ${1.5 * -g}`);
|
|
} }));
|
|
}
|
|
_drawDot({ x: d, y: f, size: p, rotation: v }) {
|
|
this._basicDot({ x: d, y: f, size: p, rotation: v });
|
|
}
|
|
_drawSquare({ x: d, y: f, size: p, rotation: v }) {
|
|
this._basicSquare({ x: d, y: f, size: p, rotation: v });
|
|
}
|
|
_drawExtraRounded({ x: d, y: f, size: p, rotation: v }) {
|
|
this._basicExtraRounded({ x: d, y: f, size: p, rotation: v });
|
|
}
|
|
}
|
|
const $ = { dot: "dot", square: "square" }, S = Object.values($);
|
|
class T {
|
|
constructor({ svg: d, type: f, window: p }) {
|
|
this._svg = d, this._type = f, this._window = p;
|
|
}
|
|
draw(d, f, p, v) {
|
|
let g;
|
|
g = this._type === $.square ? this._drawSquare : this._drawDot, g.call(this, { x: d, y: f, size: p, rotation: v });
|
|
}
|
|
_rotateFigure({ x: d, y: f, size: p, rotation: v = 0, draw: g }) {
|
|
var x;
|
|
const M = d + p / 2, P = f + p / 2;
|
|
g(), (x = this._element) === null || x === void 0 || x.setAttribute("transform", `rotate(${180 * v / Math.PI},${M},${P})`);
|
|
}
|
|
_basicDot(d) {
|
|
const { size: f, x: p, y: v } = d;
|
|
this._rotateFigure(Object.assign(Object.assign({}, d), { draw: () => {
|
|
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "circle"), this._element.setAttribute("cx", String(p + f / 2)), this._element.setAttribute("cy", String(v + f / 2)), this._element.setAttribute("r", String(f / 2));
|
|
} }));
|
|
}
|
|
_basicSquare(d) {
|
|
const { size: f, x: p, y: v } = d;
|
|
this._rotateFigure(Object.assign(Object.assign({}, d), { draw: () => {
|
|
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "rect"), this._element.setAttribute("x", String(p)), this._element.setAttribute("y", String(v)), this._element.setAttribute("width", String(f)), this._element.setAttribute("height", String(f));
|
|
} }));
|
|
}
|
|
_drawDot({ x: d, y: f, size: p, rotation: v }) {
|
|
this._basicDot({ x: d, y: f, size: p, rotation: v });
|
|
}
|
|
_drawSquare({ x: d, y: f, size: p, rotation: v }) {
|
|
this._basicSquare({ x: d, y: f, size: p, rotation: v });
|
|
}
|
|
}
|
|
const U = "circle", z = [[1, 1, 1, 1, 1, 1, 1], [1, 0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 0, 1], [1, 1, 1, 1, 1, 1, 1]], B = [[0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0], [0, 0, 1, 1, 1, 0, 0], [0, 0, 1, 1, 1, 0, 0], [0, 0, 1, 1, 1, 0, 0], [0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0]];
|
|
class Z {
|
|
constructor(d, f) {
|
|
this._roundSize = (p) => this._options.dotsOptions.roundSize ? Math.floor(p) : p, this._window = f, this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "svg"), this._element.setAttribute("width", String(d.width)), this._element.setAttribute("height", String(d.height)), this._element.setAttribute("xmlns:xlink", "http://www.w3.org/1999/xlink"), d.dotsOptions.roundSize || this._element.setAttribute("shape-rendering", "crispEdges"), this._element.setAttribute("viewBox", `0 0 ${d.width} ${d.height}`), this._defs = this._window.document.createElementNS("http://www.w3.org/2000/svg", "defs"), this._element.appendChild(this._defs), this._imageUri = d.image, this._instanceId = Z.instanceCount++, this._options = d;
|
|
}
|
|
get width() {
|
|
return this._options.width;
|
|
}
|
|
get height() {
|
|
return this._options.height;
|
|
}
|
|
getElement() {
|
|
return this._element;
|
|
}
|
|
async drawQR(d) {
|
|
const f = d.getModuleCount(), p = Math.min(this._options.width, this._options.height) - 2 * this._options.margin, v = this._options.shape === U ? p / Math.sqrt(2) : p, g = this._roundSize(v / f);
|
|
let x = { hideXDots: 0, hideYDots: 0, width: 0, height: 0 };
|
|
if (this._qr = d, this._options.image) {
|
|
if (await this.loadImage(), !this._image)
|
|
return;
|
|
const { imageOptions: M, qrOptions: P } = this._options, N = M.imageSize * c[P.errorCorrectionLevel], I = Math.floor(N * f * f);
|
|
x = function({ originalHeight: V, originalWidth: L, maxHiddenDots: A, maxHiddenAxisDots: C, dotSize: D }) {
|
|
const _ = { x: 0, y: 0 }, E = { x: 0, y: 0 };
|
|
if (V <= 0 || L <= 0 || A <= 0 || D <= 0)
|
|
return { height: 0, width: 0, hideYDots: 0, hideXDots: 0 };
|
|
const O = V / L;
|
|
return _.x = Math.floor(Math.sqrt(A / O)), _.x <= 0 && (_.x = 1), C && C < _.x && (_.x = C), _.x % 2 == 0 && _.x--, E.x = _.x * D, _.y = 1 + 2 * Math.ceil((_.x * O - 1) / 2), E.y = Math.round(E.x * O), (_.y * _.x > A || C && C < _.y) && (C && C < _.y ? (_.y = C, _.y % 2 == 0 && _.x--) : _.y -= 2, E.y = _.y * D, _.x = 1 + 2 * Math.ceil((_.y / O - 1) / 2), E.x = Math.round(E.y / O)), { height: E.y, width: E.x, hideYDots: _.y, hideXDots: _.x };
|
|
}({ originalWidth: this._image.width, originalHeight: this._image.height, maxHiddenDots: I, maxHiddenAxisDots: f - 14, dotSize: g });
|
|
}
|
|
this.drawBackground(), this.drawDots((M, P) => {
|
|
var N, I, V, L, A, C;
|
|
return !(this._options.imageOptions.hideBackgroundDots && M >= (f - x.hideYDots) / 2 && M < (f + x.hideYDots) / 2 && P >= (f - x.hideXDots) / 2 && P < (f + x.hideXDots) / 2 || ((N = z[M]) === null || N === void 0 ? void 0 : N[P]) || ((I = z[M - f + 7]) === null || I === void 0 ? void 0 : I[P]) || ((V = z[M]) === null || V === void 0 ? void 0 : V[P - f + 7]) || ((L = B[M]) === null || L === void 0 ? void 0 : L[P]) || ((A = B[M - f + 7]) === null || A === void 0 ? void 0 : A[P]) || ((C = B[M]) === null || C === void 0 ? void 0 : C[P - f + 7]));
|
|
}), this.drawCorners(), this._options.image && await this.drawImage({ width: x.width, height: x.height, count: f, dotSize: g });
|
|
}
|
|
drawBackground() {
|
|
var d, f, p;
|
|
const v = this._element, g = this._options;
|
|
if (v) {
|
|
const x = (d = g.backgroundOptions) === null || d === void 0 ? void 0 : d.gradient, M = (f = g.backgroundOptions) === null || f === void 0 ? void 0 : f.color;
|
|
let P = g.height, N = g.width;
|
|
if (x || M) {
|
|
const I = this._window.document.createElementNS("http://www.w3.org/2000/svg", "rect");
|
|
this._backgroundClipPath = this._window.document.createElementNS("http://www.w3.org/2000/svg", "clipPath"), this._backgroundClipPath.setAttribute("id", `clip-path-background-color-${this._instanceId}`), this._defs.appendChild(this._backgroundClipPath), !((p = g.backgroundOptions) === null || p === void 0) && p.round && (P = N = Math.min(g.width, g.height), I.setAttribute("rx", String(P / 2 * g.backgroundOptions.round))), I.setAttribute("x", String(this._roundSize((g.width - N) / 2))), I.setAttribute("y", String(this._roundSize((g.height - P) / 2))), I.setAttribute("width", String(N)), I.setAttribute("height", String(P)), this._backgroundClipPath.appendChild(I), this._createColor({ options: x, color: M, additionalRotation: 0, x: 0, y: 0, height: g.height, width: g.width, name: `background-color-${this._instanceId}` });
|
|
}
|
|
}
|
|
}
|
|
drawDots(d) {
|
|
var f, p;
|
|
if (!this._qr)
|
|
throw "QR code is not defined";
|
|
const v = this._options, g = this._qr.getModuleCount();
|
|
if (g > v.width || g > v.height)
|
|
throw "The canvas is too small.";
|
|
const x = Math.min(v.width, v.height) - 2 * v.margin, M = v.shape === U ? x / Math.sqrt(2) : x, P = this._roundSize(M / g), N = this._roundSize((v.width - g * P) / 2), I = this._roundSize((v.height - g * P) / 2), V = new l({ svg: this._element, type: v.dotsOptions.type, window: this._window });
|
|
this._dotsClipPath = this._window.document.createElementNS("http://www.w3.org/2000/svg", "clipPath"), this._dotsClipPath.setAttribute("id", `clip-path-dot-color-${this._instanceId}`), this._defs.appendChild(this._dotsClipPath), this._createColor({ options: (f = v.dotsOptions) === null || f === void 0 ? void 0 : f.gradient, color: v.dotsOptions.color, additionalRotation: 0, x: 0, y: 0, height: v.height, width: v.width, name: `dot-color-${this._instanceId}` });
|
|
for (let L = 0; L < g; L++)
|
|
for (let A = 0; A < g; A++)
|
|
d && !d(L, A) || !((p = this._qr) === null || p === void 0) && p.isDark(L, A) && (V.draw(N + A * P, I + L * P, P, (C, D) => !(A + C < 0 || L + D < 0 || A + C >= g || L + D >= g) && !(d && !d(L + D, A + C)) && !!this._qr && this._qr.isDark(L + D, A + C)), V._element && this._dotsClipPath && this._dotsClipPath.appendChild(V._element));
|
|
if (v.shape === U) {
|
|
const L = this._roundSize((x / P - g) / 2), A = g + 2 * L, C = N - L * P, D = I - L * P, _ = [], E = this._roundSize(A / 2);
|
|
for (let O = 0; O < A; O++) {
|
|
_[O] = [];
|
|
for (let R = 0; R < A; R++)
|
|
O >= L - 1 && O <= A - L && R >= L - 1 && R <= A - L || Math.sqrt((O - E) * (O - E) + (R - E) * (R - E)) > E ? _[O][R] = 0 : _[O][R] = this._qr.isDark(R - 2 * L < 0 ? R : R >= g ? R - 2 * L : R - L, O - 2 * L < 0 ? O : O >= g ? O - 2 * L : O - L) ? 1 : 0;
|
|
}
|
|
for (let O = 0; O < A; O++)
|
|
for (let R = 0; R < A; R++)
|
|
_[O][R] && (V.draw(C + R * P, D + O * P, P, (j, Y) => {
|
|
var X;
|
|
return !!(!((X = _[O + Y]) === null || X === void 0) && X[R + j]);
|
|
}), V._element && this._dotsClipPath && this._dotsClipPath.appendChild(V._element));
|
|
}
|
|
}
|
|
drawCorners() {
|
|
if (!this._qr)
|
|
throw "QR code is not defined";
|
|
const d = this._element, f = this._options;
|
|
if (!d)
|
|
throw "Element code is not defined";
|
|
const p = this._qr.getModuleCount(), v = Math.min(f.width, f.height) - 2 * f.margin, g = f.shape === U ? v / Math.sqrt(2) : v, x = this._roundSize(g / p), M = 7 * x, P = 3 * x, N = this._roundSize((f.width - p * x) / 2), I = this._roundSize((f.height - p * x) / 2);
|
|
[[0, 0, 0], [1, 0, Math.PI / 2], [0, 1, -Math.PI / 2]].forEach(([V, L, A]) => {
|
|
var C, D, _, E, O, R, j, Y, X, ie, se, ue, ge, Ee;
|
|
const be = N + V * x * (p - 7), de = I + L * x * (p - 7);
|
|
let ve = this._dotsClipPath, te = this._dotsClipPath;
|
|
if ((((C = f.cornersSquareOptions) === null || C === void 0 ? void 0 : C.gradient) || ((D = f.cornersSquareOptions) === null || D === void 0 ? void 0 : D.color)) && (ve = this._window.document.createElementNS("http://www.w3.org/2000/svg", "clipPath"), ve.setAttribute("id", `clip-path-corners-square-color-${V}-${L}-${this._instanceId}`), this._defs.appendChild(ve), this._cornersSquareClipPath = this._cornersDotClipPath = te = ve, this._createColor({ options: (_ = f.cornersSquareOptions) === null || _ === void 0 ? void 0 : _.gradient, color: (E = f.cornersSquareOptions) === null || E === void 0 ? void 0 : E.color, additionalRotation: A, x: be, y: de, height: M, width: M, name: `corners-square-color-${V}-${L}-${this._instanceId}` })), ((O = f.cornersSquareOptions) === null || O === void 0 ? void 0 : O.type) && m.includes(f.cornersSquareOptions.type)) {
|
|
const ke = new w({ svg: this._element, type: f.cornersSquareOptions.type, window: this._window });
|
|
ke.draw(be, de, M, A), ke._element && ve && ve.appendChild(ke._element);
|
|
} else {
|
|
const ke = new l({ svg: this._element, type: ((R = f.cornersSquareOptions) === null || R === void 0 ? void 0 : R.type) || f.dotsOptions.type, window: this._window });
|
|
for (let Fe = 0; Fe < z.length; Fe++)
|
|
for (let oe = 0; oe < z[Fe].length; oe++)
|
|
!((j = z[Fe]) === null || j === void 0) && j[oe] && (ke.draw(be + oe * x, de + Fe * x, x, (Xe, Ue) => {
|
|
var Ne;
|
|
return !!(!((Ne = z[Fe + Ue]) === null || Ne === void 0) && Ne[oe + Xe]);
|
|
}), ke._element && ve && ve.appendChild(ke._element));
|
|
}
|
|
if ((((Y = f.cornersDotOptions) === null || Y === void 0 ? void 0 : Y.gradient) || ((X = f.cornersDotOptions) === null || X === void 0 ? void 0 : X.color)) && (te = this._window.document.createElementNS("http://www.w3.org/2000/svg", "clipPath"), te.setAttribute("id", `clip-path-corners-dot-color-${V}-${L}-${this._instanceId}`), this._defs.appendChild(te), this._cornersDotClipPath = te, this._createColor({ options: (ie = f.cornersDotOptions) === null || ie === void 0 ? void 0 : ie.gradient, color: (se = f.cornersDotOptions) === null || se === void 0 ? void 0 : se.color, additionalRotation: A, x: be + 2 * x, y: de + 2 * x, height: P, width: P, name: `corners-dot-color-${V}-${L}-${this._instanceId}` })), ((ue = f.cornersDotOptions) === null || ue === void 0 ? void 0 : ue.type) && S.includes(f.cornersDotOptions.type)) {
|
|
const ke = new T({ svg: this._element, type: f.cornersDotOptions.type, window: this._window });
|
|
ke.draw(be + 2 * x, de + 2 * x, P, A), ke._element && te && te.appendChild(ke._element);
|
|
} else {
|
|
const ke = new l({ svg: this._element, type: ((ge = f.cornersDotOptions) === null || ge === void 0 ? void 0 : ge.type) || f.dotsOptions.type, window: this._window });
|
|
for (let Fe = 0; Fe < B.length; Fe++)
|
|
for (let oe = 0; oe < B[Fe].length; oe++)
|
|
!((Ee = B[Fe]) === null || Ee === void 0) && Ee[oe] && (ke.draw(be + oe * x, de + Fe * x, x, (Xe, Ue) => {
|
|
var Ne;
|
|
return !!(!((Ne = B[Fe + Ue]) === null || Ne === void 0) && Ne[oe + Xe]);
|
|
}), ke._element && te && te.appendChild(ke._element));
|
|
}
|
|
});
|
|
}
|
|
loadImage() {
|
|
return new Promise((d, f) => {
|
|
var p;
|
|
const v = this._options;
|
|
if (!v.image)
|
|
return f("Image is not defined");
|
|
if (!((p = v.nodeCanvas) === null || p === void 0) && p.loadImage)
|
|
v.nodeCanvas.loadImage(v.image).then((g) => {
|
|
var x, M;
|
|
if (this._image = g, this._options.imageOptions.saveAsBlob) {
|
|
const P = (x = v.nodeCanvas) === null || x === void 0 ? void 0 : x.createCanvas(this._image.width, this._image.height);
|
|
(M = P == null ? void 0 : P.getContext("2d")) === null || M === void 0 || M.drawImage(g, 0, 0), this._imageUri = P == null ? void 0 : P.toDataURL();
|
|
}
|
|
d();
|
|
}).catch(f);
|
|
else {
|
|
const g = new this._window.Image();
|
|
typeof v.imageOptions.crossOrigin == "string" && (g.crossOrigin = v.imageOptions.crossOrigin), this._image = g, g.onload = async () => {
|
|
this._options.imageOptions.saveAsBlob && (this._imageUri = await async function(x, M) {
|
|
return new Promise((P) => {
|
|
const N = new M.XMLHttpRequest();
|
|
N.onload = function() {
|
|
const I = new M.FileReader();
|
|
I.onloadend = function() {
|
|
P(I.result);
|
|
}, I.readAsDataURL(N.response);
|
|
}, N.open("GET", x), N.responseType = "blob", N.send();
|
|
});
|
|
}(v.image || "", this._window)), d();
|
|
}, g.src = v.image;
|
|
}
|
|
});
|
|
}
|
|
async drawImage({ width: d, height: f, count: p, dotSize: v }) {
|
|
const g = this._options, x = this._roundSize((g.width - p * v) / 2), M = this._roundSize((g.height - p * v) / 2), P = x + this._roundSize(g.imageOptions.margin + (p * v - d) / 2), N = M + this._roundSize(g.imageOptions.margin + (p * v - f) / 2), I = d - 2 * g.imageOptions.margin, V = f - 2 * g.imageOptions.margin, L = this._window.document.createElementNS("http://www.w3.org/2000/svg", "image");
|
|
L.setAttribute("href", this._imageUri || ""), L.setAttribute("xlink:href", this._imageUri || ""), L.setAttribute("x", String(P)), L.setAttribute("y", String(N)), L.setAttribute("width", `${I}px`), L.setAttribute("height", `${V}px`), this._element.appendChild(L);
|
|
}
|
|
_createColor({ options: d, color: f, additionalRotation: p, x: v, y: g, height: x, width: M, name: P }) {
|
|
const N = M > x ? M : x, I = this._window.document.createElementNS("http://www.w3.org/2000/svg", "rect");
|
|
if (I.setAttribute("x", String(v)), I.setAttribute("y", String(g)), I.setAttribute("height", String(x)), I.setAttribute("width", String(M)), I.setAttribute("clip-path", `url('#clip-path-${P}')`), d) {
|
|
let V;
|
|
if (d.type === "radial")
|
|
V = this._window.document.createElementNS("http://www.w3.org/2000/svg", "radialGradient"), V.setAttribute("id", P), V.setAttribute("gradientUnits", "userSpaceOnUse"), V.setAttribute("fx", String(v + M / 2)), V.setAttribute("fy", String(g + x / 2)), V.setAttribute("cx", String(v + M / 2)), V.setAttribute("cy", String(g + x / 2)), V.setAttribute("r", String(N / 2));
|
|
else {
|
|
const L = ((d.rotation || 0) + p) % (2 * Math.PI), A = (L + 2 * Math.PI) % (2 * Math.PI);
|
|
let C = v + M / 2, D = g + x / 2, _ = v + M / 2, E = g + x / 2;
|
|
A >= 0 && A <= 0.25 * Math.PI || A > 1.75 * Math.PI && A <= 2 * Math.PI ? (C -= M / 2, D -= x / 2 * Math.tan(L), _ += M / 2, E += x / 2 * Math.tan(L)) : A > 0.25 * Math.PI && A <= 0.75 * Math.PI ? (D -= x / 2, C -= M / 2 / Math.tan(L), E += x / 2, _ += M / 2 / Math.tan(L)) : A > 0.75 * Math.PI && A <= 1.25 * Math.PI ? (C += M / 2, D += x / 2 * Math.tan(L), _ -= M / 2, E -= x / 2 * Math.tan(L)) : A > 1.25 * Math.PI && A <= 1.75 * Math.PI && (D += x / 2, C += M / 2 / Math.tan(L), E -= x / 2, _ -= M / 2 / Math.tan(L)), V = this._window.document.createElementNS("http://www.w3.org/2000/svg", "linearGradient"), V.setAttribute("id", P), V.setAttribute("gradientUnits", "userSpaceOnUse"), V.setAttribute("x1", String(Math.round(C))), V.setAttribute("y1", String(Math.round(D))), V.setAttribute("x2", String(Math.round(_))), V.setAttribute("y2", String(Math.round(E)));
|
|
}
|
|
d.colorStops.forEach(({ offset: L, color: A }) => {
|
|
const C = this._window.document.createElementNS("http://www.w3.org/2000/svg", "stop");
|
|
C.setAttribute("offset", 100 * L + "%"), C.setAttribute("stop-color", A), V.appendChild(C);
|
|
}), I.setAttribute("fill", `url('#${P}')`), this._defs.appendChild(V);
|
|
} else
|
|
f && I.setAttribute("fill", f);
|
|
this._element.appendChild(I);
|
|
}
|
|
}
|
|
Z.instanceCount = 0;
|
|
const Q = Z, q = "canvas", ce = {};
|
|
for (let y = 0; y <= 40; y++)
|
|
ce[y] = y;
|
|
const re = { type: q, shape: "square", width: 300, height: 300, data: "", margin: 0, qrOptions: { typeNumber: ce[0], mode: void 0, errorCorrectionLevel: "Q" }, imageOptions: { saveAsBlob: !0, hideBackgroundDots: !0, imageSize: 0.4, crossOrigin: void 0, margin: 0 }, dotsOptions: { type: "square", color: "#000", roundSize: !0 }, backgroundOptions: { round: 0, color: "#fff" } };
|
|
function ae(y) {
|
|
const d = Object.assign({}, y);
|
|
if (!d.colorStops || !d.colorStops.length)
|
|
throw "Field 'colorStops' is required in gradient";
|
|
return d.rotation ? d.rotation = Number(d.rotation) : d.rotation = 0, d.colorStops = d.colorStops.map((f) => Object.assign(Object.assign({}, f), { offset: Number(f.offset) })), d;
|
|
}
|
|
function J(y) {
|
|
const d = Object.assign({}, y);
|
|
return d.width = Number(d.width), d.height = Number(d.height), d.margin = Number(d.margin), d.imageOptions = Object.assign(Object.assign({}, d.imageOptions), { hideBackgroundDots: Boolean(d.imageOptions.hideBackgroundDots), imageSize: Number(d.imageOptions.imageSize), margin: Number(d.imageOptions.margin) }), d.margin > Math.min(d.width, d.height) && (d.margin = Math.min(d.width, d.height)), d.dotsOptions = Object.assign({}, d.dotsOptions), d.dotsOptions.gradient && (d.dotsOptions.gradient = ae(d.dotsOptions.gradient)), d.cornersSquareOptions && (d.cornersSquareOptions = Object.assign({}, d.cornersSquareOptions), d.cornersSquareOptions.gradient && (d.cornersSquareOptions.gradient = ae(d.cornersSquareOptions.gradient))), d.cornersDotOptions && (d.cornersDotOptions = Object.assign({}, d.cornersDotOptions), d.cornersDotOptions.gradient && (d.cornersDotOptions.gradient = ae(d.cornersDotOptions.gradient))), d.backgroundOptions && (d.backgroundOptions = Object.assign({}, d.backgroundOptions), d.backgroundOptions.gradient && (d.backgroundOptions.gradient = ae(d.backgroundOptions.gradient))), d;
|
|
}
|
|
var G = i(873), Oe = i.n(G);
|
|
function Ye(y) {
|
|
if (!y)
|
|
throw new Error("Extension must be defined");
|
|
y[0] === "." && (y = y.substring(1));
|
|
const d = { bmp: "image/bmp", gif: "image/gif", ico: "image/vnd.microsoft.icon", jpeg: "image/jpeg", jpg: "image/jpeg", png: "image/png", svg: "image/svg+xml", tif: "image/tiff", tiff: "image/tiff", webp: "image/webp", pdf: "application/pdf" }[y.toLowerCase()];
|
|
if (!d)
|
|
throw new Error(`Extension "${y}" is not supported`);
|
|
return d;
|
|
}
|
|
class k {
|
|
constructor(d) {
|
|
d != null && d.jsdom ? this._window = new d.jsdom("", { resources: "usable" }).window : this._window = window, this._options = d ? J(s(re, d)) : re, this.update();
|
|
}
|
|
static _clearContainer(d) {
|
|
d && (d.innerHTML = "");
|
|
}
|
|
_setupSvg() {
|
|
if (!this._qr)
|
|
return;
|
|
const d = new Q(this._options, this._window);
|
|
this._svg = d.getElement(), this._svgDrawingPromise = d.drawQR(this._qr).then(() => {
|
|
var f;
|
|
this._svg && ((f = this._extension) === null || f === void 0 || f.call(this, d.getElement(), this._options));
|
|
});
|
|
}
|
|
_setupCanvas() {
|
|
var d, f;
|
|
this._qr && (!((d = this._options.nodeCanvas) === null || d === void 0) && d.createCanvas ? (this._nodeCanvas = this._options.nodeCanvas.createCanvas(this._options.width, this._options.height), this._nodeCanvas.width = this._options.width, this._nodeCanvas.height = this._options.height) : (this._domCanvas = document.createElement("canvas"), this._domCanvas.width = this._options.width, this._domCanvas.height = this._options.height), this._setupSvg(), this._canvasDrawingPromise = (f = this._svgDrawingPromise) === null || f === void 0 ? void 0 : f.then(() => {
|
|
var p;
|
|
if (!this._svg)
|
|
return;
|
|
const v = this._svg, g = new this._window.XMLSerializer().serializeToString(v), x = btoa(g), M = `data:${Ye("svg")};base64,${x}`;
|
|
if (!((p = this._options.nodeCanvas) === null || p === void 0) && p.loadImage)
|
|
return this._options.nodeCanvas.loadImage(M).then((P) => {
|
|
var N, I;
|
|
P.width = this._options.width, P.height = this._options.height, (I = (N = this._nodeCanvas) === null || N === void 0 ? void 0 : N.getContext("2d")) === null || I === void 0 || I.drawImage(P, 0, 0);
|
|
});
|
|
{
|
|
const P = new this._window.Image();
|
|
return new Promise((N) => {
|
|
P.onload = () => {
|
|
var I, V;
|
|
(V = (I = this._domCanvas) === null || I === void 0 ? void 0 : I.getContext("2d")) === null || V === void 0 || V.drawImage(P, 0, 0), N();
|
|
}, P.src = M;
|
|
});
|
|
}
|
|
}));
|
|
}
|
|
async _getElement(d = "png") {
|
|
if (!this._qr)
|
|
throw "QR code is empty";
|
|
return d.toLowerCase() === "svg" ? (this._svg && this._svgDrawingPromise || this._setupSvg(), await this._svgDrawingPromise, this._svg) : ((this._domCanvas || this._nodeCanvas) && this._canvasDrawingPromise || this._setupCanvas(), await this._canvasDrawingPromise, this._domCanvas || this._nodeCanvas);
|
|
}
|
|
update(d) {
|
|
k._clearContainer(this._container), this._options = d ? J(s(this._options, d)) : this._options, this._options.data && (this._qr = Oe()(this._options.qrOptions.typeNumber, this._options.qrOptions.errorCorrectionLevel), this._qr.addData(this._options.data, this._options.qrOptions.mode || function(f) {
|
|
switch (!0) {
|
|
case /^[0-9]*$/.test(f):
|
|
return "Numeric";
|
|
case /^[0-9A-Z $%*+\-./:]*$/.test(f):
|
|
return "Alphanumeric";
|
|
default:
|
|
return "Byte";
|
|
}
|
|
}(this._options.data)), this._qr.make(), this._options.type === q ? this._setupCanvas() : this._setupSvg(), this.append(this._container));
|
|
}
|
|
append(d) {
|
|
if (d) {
|
|
if (typeof d.appendChild != "function")
|
|
throw "Container should be a single DOM node";
|
|
this._options.type === q ? this._domCanvas && d.appendChild(this._domCanvas) : this._svg && d.appendChild(this._svg), this._container = d;
|
|
}
|
|
}
|
|
applyExtension(d) {
|
|
if (!d)
|
|
throw "Extension function should be defined.";
|
|
this._extension = d, this.update();
|
|
}
|
|
deleteExtension() {
|
|
this._extension = void 0, this.update();
|
|
}
|
|
async getRawData(d = "png") {
|
|
if (!this._qr)
|
|
throw "QR code is empty";
|
|
const f = await this._getElement(d), p = Ye(d);
|
|
if (!f)
|
|
return null;
|
|
if (d.toLowerCase() === "svg") {
|
|
const v = `<?xml version="1.0" standalone="no"?>\r
|
|
${new this._window.XMLSerializer().serializeToString(f)}`;
|
|
return typeof Blob > "u" || this._options.jsdom ? Buffer.from(v) : new Blob([v], { type: p });
|
|
}
|
|
return new Promise((v) => {
|
|
const g = f;
|
|
if ("toBuffer" in g)
|
|
if (p === "image/png")
|
|
v(g.toBuffer(p));
|
|
else if (p === "image/jpeg")
|
|
v(g.toBuffer(p));
|
|
else {
|
|
if (p !== "application/pdf")
|
|
throw Error("Unsupported extension");
|
|
v(g.toBuffer(p));
|
|
}
|
|
else
|
|
"toBlob" in g && g.toBlob(v, p, 1);
|
|
});
|
|
}
|
|
async download(d) {
|
|
if (!this._qr)
|
|
throw "QR code is empty";
|
|
if (typeof Blob > "u")
|
|
throw "Cannot download in Node.js, call getRawData instead.";
|
|
let f = "png", p = "qr";
|
|
typeof d == "string" ? (f = d, console.warn("Extension is deprecated as argument for 'download' method, please pass object { name: '...', extension: '...' } as argument")) : typeof d == "object" && d !== null && (d.name && (p = d.name), d.extension && (f = d.extension));
|
|
const v = await this._getElement(f);
|
|
if (v)
|
|
if (f.toLowerCase() === "svg") {
|
|
let g = new XMLSerializer().serializeToString(v);
|
|
g = `<?xml version="1.0" standalone="no"?>\r
|
|
` + g, u(`data:${Ye(f)};charset=utf-8,${encodeURIComponent(g)}`, `${p}.svg`);
|
|
} else
|
|
u(v.toDataURL(Ye(f)), `${p}.${f}`);
|
|
}
|
|
}
|
|
const b = k;
|
|
})(), a.default;
|
|
})());
|
|
})(Bo);
|
|
const L0 = /* @__PURE__ */ Sl(Bo.exports), N0 = he({
|
|
name: "QrCodeBox",
|
|
data() {
|
|
return {
|
|
qrcode: null
|
|
};
|
|
},
|
|
props: {
|
|
data: String,
|
|
image: String,
|
|
width: Number,
|
|
height: Number,
|
|
circleType: String,
|
|
circleColor: String
|
|
},
|
|
methods: {},
|
|
computed: {},
|
|
components: {},
|
|
watch: {
|
|
$props: {
|
|
handler() {
|
|
const n = {
|
|
dotsOptions: {}
|
|
};
|
|
Object.keys(this.$props).forEach((e) => {
|
|
this.$props[e] != null && this.$props[e] !== "" && (n[e] = this.$props[e]);
|
|
}), delete n.formCreateInject, n.circleType && (n.dotsOptions.type = n.circleType), n.circleColor && (n.dotsOptions.color = n.circleColor), delete n.circleColor, delete n.circleType, this.$nextTick(() => {
|
|
this.qrcode ? this.qrcode.update(n) : (this.qrcode = Te(new L0(n)), this.qrcode.append(this.$refs.qr));
|
|
});
|
|
},
|
|
deep: !0,
|
|
immediate: !0
|
|
}
|
|
}
|
|
}), z0 = {
|
|
class: "_fc-qrcode",
|
|
ref: "qr"
|
|
};
|
|
function U0(n, e, t, r, i, a) {
|
|
return ee(), me("div", z0, null, 512);
|
|
}
|
|
const q0 = /* @__PURE__ */ Ae(N0, [["render", U0]]);
|
|
const G0 = (n, e) => {
|
|
let t = [n];
|
|
const r = e.split(".");
|
|
let i = 1;
|
|
for (; r[i]; ) {
|
|
let a = [];
|
|
t.forEach((o) => {
|
|
Object.values(o.ctxs).forEach((s) => {
|
|
if (s.rule._fc_id === r[i - 1]) {
|
|
const u = o.subForm[s.id];
|
|
a.push(...Array.isArray(u) ? u : [u]);
|
|
}
|
|
});
|
|
}), t = a.map((o) => o.rule[0].__fc__.$handle), i++;
|
|
}
|
|
return [t, r[i - 1]];
|
|
}, An = (n, e, t) => {
|
|
const r = n.vm.setupState.top.setupState.fc.$handle;
|
|
let i = [n.$handle];
|
|
n.$handle !== r && i.push(r);
|
|
let a = e;
|
|
e.indexOf(".") > -1 && ([i, a] = G0(r, e)), i.forEach((o) => {
|
|
Object.values(o.ctxs).forEach((s) => {
|
|
s.rule._fc_id === a && t(s.rule, o.api);
|
|
});
|
|
});
|
|
}, Lo = {
|
|
openModel(n, e) {
|
|
e.api.open(n.model);
|
|
},
|
|
closeModel(n, e) {
|
|
e.api.close(n.model);
|
|
},
|
|
hidden(n, e, t) {
|
|
const r = typeof n.id == "string" ? [n.id] : n.id || [];
|
|
let i = !!n.status;
|
|
n.compute && (i = !!t.$handle.compute(e.self.__fc__, n.formula)), r.forEach((a) => {
|
|
An(t, a, (o) => {
|
|
o.hidden = i;
|
|
});
|
|
});
|
|
},
|
|
disabled(n, e, t) {
|
|
const r = typeof n.id == "string" ? [n.id] : n.id || [];
|
|
let i = !!n.status;
|
|
n.compute && (i = !!t.$handle.compute(e.self.__fc__, n.formula)), r.forEach((a) => {
|
|
An(t, a, (o) => {
|
|
o.props || (o.props = {}), o.props.disabled = i;
|
|
});
|
|
});
|
|
},
|
|
resetFields(n, e) {
|
|
e.api.top.resetFields();
|
|
},
|
|
clearFields(n, e) {
|
|
e.api.top.coverValue({});
|
|
},
|
|
validate(n, e) {
|
|
return e.api.top.validate();
|
|
},
|
|
validateFields(n, e, t) {
|
|
const r = typeof n.id == "string" ? [n.id] : n.id || [], i = [];
|
|
return r.forEach((a) => {
|
|
An(t, a, (o, s) => {
|
|
o.field && i.push(s.validateField(o.field));
|
|
});
|
|
}), i.length ? Promise.all(i) : void 0;
|
|
},
|
|
submit(n, e) {
|
|
return e.api.top.submit();
|
|
},
|
|
setValue(n, e, t) {
|
|
(n.formData || []).forEach((r) => {
|
|
let i = r.value;
|
|
r.compute && (i = t.$handle.compute(e.self.__fc__, r.formula)), An(t, r.id, (a) => {
|
|
a.value = i;
|
|
});
|
|
});
|
|
},
|
|
fetch(n, e) {
|
|
const { append: t, response: r, fetch: i } = n;
|
|
return t && (i.data = { ...e.api.formData(), ...i.data || {} }), new Promise((a, o) => {
|
|
e.api.fetch(n.fetch).then((s) => {
|
|
r && e.api.setData(r, s), a(s);
|
|
}).catch((s) => {
|
|
o(s);
|
|
});
|
|
});
|
|
},
|
|
copy(n, e, t) {
|
|
let r = n.content || "";
|
|
n.compute && (r = t.$handle.compute(e.self.__fc__, n.formula)), If(r);
|
|
},
|
|
callback(n, e) {
|
|
return n.callback && n.callback(e);
|
|
},
|
|
message(n) {
|
|
ka(n || {});
|
|
}
|
|
};
|
|
function H0(n, e) {
|
|
return n.reduce((t, r) => t.then(() => r(e)), Promise.resolve());
|
|
}
|
|
const W0 = function(n) {
|
|
return {
|
|
name: "behavior",
|
|
load(e, t) {
|
|
const r = e.getValue(), i = {}, a = {};
|
|
r && Object.keys(r).forEach((o) => {
|
|
if (Array.isArray(r[o])) {
|
|
const s = [];
|
|
if (r[o].forEach((u) => {
|
|
const { method: c, config: l, expression: h, stopPropagation: m, ignoreError: w } = u;
|
|
s.push(($) => new Promise((S) => {
|
|
if (h && n.$handle.compute(t.__fc__, h) === !1) {
|
|
S();
|
|
return;
|
|
}
|
|
const T = (...z) => {
|
|
(!m || n.$handle.compute(t.__fc__, m) !== !0) && S(...z);
|
|
};
|
|
let U;
|
|
try {
|
|
U = Lo[c](l || {}, $, n);
|
|
} catch (z) {
|
|
console.error(z), w !== !1 && T();
|
|
return;
|
|
}
|
|
U && U.then ? U.then(T).catch(() => {
|
|
w !== !1 && T();
|
|
}) : T(U);
|
|
}));
|
|
}), s.length) {
|
|
const u = n.$handle.inject(t, function(c) {
|
|
H0(s, c);
|
|
}, t.inject || n.$handle.options.injectEvent);
|
|
o.indexOf("hook_") > -1 ? a[o.replace("hook_", "")] = u : i[o] = u;
|
|
}
|
|
}
|
|
}), e.getProp().on = i, e.getProp().hook = a;
|
|
}
|
|
};
|
|
};
|
|
function Y0(n) {
|
|
n.__proto__.setBehavior = (e) => {
|
|
eo(Lo, e);
|
|
}, n.extendApi((e) => ({
|
|
open(t, ...r) {
|
|
(e.el(t) || e.top.el(t)).open(...r);
|
|
},
|
|
close(t) {
|
|
t ? (e.el(t) || e.top.el(t)).close() : (e.top.bus.$emit("fc.closeDialog"), e !== e.top && e.bus.$emit("fc.closeDialog"));
|
|
}
|
|
}));
|
|
}
|
|
const Fr = {
|
|
name: "easySlots",
|
|
load(n) {
|
|
const e = n.getValue(), t = {};
|
|
e && Object.keys(e).forEach((r) => {
|
|
t[r] = e[r].type === "icon" ? {
|
|
type: "i",
|
|
class: "fc-icon iconfont " + e[r].value
|
|
} : {
|
|
type: "div",
|
|
children: ["" + (e[r].value || "")]
|
|
};
|
|
}), n.getProp().renderSlots = t;
|
|
}
|
|
};
|
|
Fr.watch = Fr.load;
|
|
const wa = {
|
|
date: "YYYY-MM-DD",
|
|
month: "YYYY-MM",
|
|
datetime: "YYYY-MM-DD HH:mm:ss",
|
|
timerange: "HH:mm:ss",
|
|
daterange: "YYYY-MM-DD",
|
|
monthrange: "YYYY-MM",
|
|
datetimerange: "YYYY-MM-DD HH:mm:ss",
|
|
year: "YYYY"
|
|
};
|
|
function X0(n) {
|
|
return n / 20 + "em";
|
|
}
|
|
function J0(n) {
|
|
var e;
|
|
!((e = n.wrap) != null && e.class) || (n.wrap.class === "fc-wrap-top" ? (n.wrap.labelAlign = "top", delete n.wrap.class) : n.wrap.class === "fc-wrap-left" ? (n.wrap.labelAlign = "left", delete n.wrap.class) : n.wrap.class === "fc-wrap-right" && (n.wrap.labelAlign = "right", delete n.wrap.class));
|
|
}
|
|
const No = function(n, e, t, r) {
|
|
const i = r || {};
|
|
return e.forEach((a) => {
|
|
n.indexOf(a[t || "id"]) > -1 && n.splice(n.indexOf(a[t || "id"]), 1, a[i.label || "label"] || a.text), ot.trueArray(a[i.children || "children"]) && No(n, a[i.children || "children"], t, r);
|
|
}), n;
|
|
}, K0 = function(n, e) {
|
|
return e.forEach((t) => {
|
|
n.indexOf(t.value) > -1 && (n[n.indexOf(t.value)] = t.label || t.text);
|
|
}), n;
|
|
};
|
|
function gr(n) {
|
|
if (n) {
|
|
if (!Array.isArray(n))
|
|
return [n];
|
|
} else
|
|
return [];
|
|
return n;
|
|
}
|
|
function Z0(n) {
|
|
Object.keys(Ie).forEach((e) => {
|
|
n.setFormula(e, Ie[e]);
|
|
}), Y0(n), n.register("behavior", W0), n.register("easySlots", Fr), n.extendApi((e) => ({
|
|
message(t) {
|
|
Ca({
|
|
type: "warning",
|
|
...t || {}
|
|
});
|
|
}
|
|
})), n.setDriver("elm", {
|
|
defaultPreview(e, t) {
|
|
let r = e.rule.value;
|
|
const i = e.$render.vNode.h, a = e.type, o = e.$handle.subForm[e.id], s = e.prop.readMode;
|
|
if (s === !1 || s === "custom" || !e.input || e.rule.subForm || (Array.isArray(o) ? o.length : o) || ["fcGroup", "fcSubForm", "tableForm", "stepForm", "nestedTableForm", "infiniteTableForm", "upload", "fcDialog", "fcDrawer", "fcPopup"].indexOf(e.trueType) > -1)
|
|
return e.parser.render(t, e);
|
|
if (["radio", "select", "checkbox"].indexOf(a) > -1)
|
|
r = K0([...gr(r)], e.prop.props.options || e.prop.props.formCreateInject.options || []).join(", ");
|
|
else if (["timePicker", "datePicker", "slider"].indexOf(a) > -1)
|
|
r = Array.isArray(r) ? r.join(" - ") : r;
|
|
else if (a === "cascader")
|
|
r = [...gr(r)], Array.isArray(r[0]) || (r = [r]), r = r.map((u) => No(u, e.prop.props.options || e.prop.props.formCreateInject.options || [], "value").join("/")).join(", ");
|
|
else {
|
|
if (a === "fcEditor" || s === "html")
|
|
return i("div", { innerHTML: r });
|
|
if (a === "uploader" || s === "image")
|
|
return r = gr(r), i("div", { class: "_fc-upload" }, r.map(function(u) {
|
|
return i("div", { class: "_fc-upload-preview" }, [
|
|
i("van-image", { src: u, fit: "cover" })
|
|
]);
|
|
}));
|
|
if (a === "signaturePad" && r)
|
|
return i("van-image", { src: r, fit: "cover", style: { height: "90px" } });
|
|
(typeof r == "boolean" || a === "switch") && (r = r ? "\u662F" : "\u5426");
|
|
}
|
|
return i("span", { class: "_fc-read-view" }, ["" + (r == null ? "" : r)]);
|
|
},
|
|
updateWrap(e) {
|
|
var r, i;
|
|
let t = (i = (r = e.prop) == null ? void 0 : r.wrap) == null ? void 0 : i.style;
|
|
e.prop.col && e.prop.col.span && (e.prop.col.span = 24), t && (t = Array.isArray(t) ? t : [t], t.forEach((a) => {
|
|
delete a.marginBottom;
|
|
})), J0(e.prop);
|
|
},
|
|
updateOptions(e) {
|
|
var t, r, i;
|
|
((t = e.form) == null ? void 0 : t.labelWidth) && e.form.labelWidth.indexOf("px") > -1 && (e.form.labelWidth = X0(parseInt(e.form.labelWidth))), (r = e.form) != null && r.labelPosition && (e.form.labelAlign = e.form.labelPosition, delete e.form.labelPosition), (i = e.form) != null && i.hideRequiredAsterisk && (e.form.colon = e.form.hideRequiredAsterisk, delete e.form.hideRequiredAsterisk);
|
|
},
|
|
parsers: {
|
|
inputNumber: {
|
|
mergeProp(e) {
|
|
e.prop.component = "vanStepper";
|
|
const t = e.prop.props;
|
|
t.decimalLength = t.precision, t.integer = t.precision === 0, delete t.precision;
|
|
}
|
|
},
|
|
radio: {
|
|
mergeProp(e) {
|
|
e.prop.options && (e.prop.props.options = e.prop.options);
|
|
}
|
|
},
|
|
checkbox: {
|
|
mergeProp(e) {
|
|
e.prop.options && (e.prop.props.options = e.prop.options);
|
|
}
|
|
},
|
|
select: {
|
|
mergeProp(e) {
|
|
e.prop.props.multiple === !0 ? e.prop.component = ul : (e.prop.options && (e.prop.props.options = e.prop.options), e.prop.props.options = (e.prop.props.options || []).map((t) => ({
|
|
text: t.label,
|
|
value: t.value
|
|
})));
|
|
}
|
|
},
|
|
rate: {
|
|
mergeProp(e) {
|
|
e.prop.props.count = e.prop.props.max, delete e.prop.props.max;
|
|
}
|
|
},
|
|
timePicker: {
|
|
mergeProp(e) {
|
|
e.prop.component = "elTimePicker";
|
|
const t = e.prop.props;
|
|
t.valueFormat || (t.valueFormat = "HH:mm:ss");
|
|
}
|
|
},
|
|
datePicker: {
|
|
mergeProp(e) {
|
|
e.prop.component = "elDatePicker";
|
|
const t = e.prop.props;
|
|
t.valueFormat || (t.valueFormat = wa[t.type] || wa.date);
|
|
}
|
|
},
|
|
colorPicker: {
|
|
mergeProp(e) {
|
|
e.prop.component = "elColorPicker";
|
|
}
|
|
},
|
|
cascader: {
|
|
mergeProp(e) {
|
|
e.prop.component = "elCascader";
|
|
}
|
|
},
|
|
elDivider: {
|
|
mergeProp(e) {
|
|
e.prop.component = "vanDivider";
|
|
}
|
|
},
|
|
upload: {
|
|
mergeProp(e) {
|
|
e.prop.component = $l;
|
|
}
|
|
},
|
|
tree: {
|
|
mergeProp(e) {
|
|
e.prop.component = fl;
|
|
}
|
|
},
|
|
row: {
|
|
mergeProp(e) {
|
|
e.prop.component = "vanRow";
|
|
}
|
|
},
|
|
col: {
|
|
mergeProp(e) {
|
|
e.prop.component = "vanCol", e.prop.props.xs && (e.prop.props = { ...e.prop.props, ...e.prop.props.xs });
|
|
}
|
|
},
|
|
fcDialog: {
|
|
mergeProp(e) {
|
|
e.prop.component = "FcPopup";
|
|
}
|
|
},
|
|
fcDrawer: {
|
|
mergeProp(e) {
|
|
e.prop.component = "FcPopup";
|
|
}
|
|
}
|
|
}
|
|
});
|
|
}
|
|
Z0(_e);
|
|
_e.component("FcSlot", mc);
|
|
_e.component("FcJson", gc);
|
|
_e.component("StepForm", Al);
|
|
_e.component("FcPopup", jl);
|
|
_e.component("FcTable", Nl);
|
|
_e.component("FcCell", oc);
|
|
_e.component("FcInlineForm", bc);
|
|
_e.component("TableForm", ql);
|
|
_e.component("TableFormPro", Jl);
|
|
_e.component("NestedTableForm", nc);
|
|
_e.component("InfiniteTableForm", Ql);
|
|
_e.component("DataTable", Vl);
|
|
_e.component("FcValue", cc);
|
|
_e.component("FcCity", pc);
|
|
_e.component("AudioBox", Wf);
|
|
_e.component("VideoBox", B0);
|
|
_e.component("BarCodeBox", j0);
|
|
_e.component("IframeBox", Kf);
|
|
_e.component("QrCodeBox", q0);
|
|
_e.component("SignaturePad", Mc);
|
|
_e.component("FcEcharts", Oc);
|
|
_e.component("FcTitle", Uc);
|
|
_e.component("FcDataSelect", zf);
|
|
_e.component("FcMarkdown", Af);
|
|
_e.component("FcId", Lc);
|
|
_e.loadjs = wt;
|
|
export {
|
|
_e as default,
|
|
Z0 as useAdvanced
|
|
};
|