zhengsl/stdproject
1
0
Fork 0
Code Issues Pull Requests Actions Packages Projects Releases Wiki Activity
559c08a557
stdproject/frontend/src/fcDesignerPro/pc/index.es.js
limengnan 1dbfcfd0f2 添加formcreat
2025-05-30 16:20:02 +08:00

59687 lines
2.3 MiB
Raw Blame History

This file contains invisible Unicode characters

This file contains invisible Unicode characters that are indistinguishable to humans but may be processed differently by a computer. If you think that this is intentional, you can safely ignore this warning. Use the Escape button to reveal them.

/*!
* FormCreate商业版可视化表单设计器-让表单设计更简单
* fc-designer-pro v5.7.0
* (c) 2018-2025 FormCreate Team https://form-create.com/
* license 仅限于被授权主体（个人、企业或组织）使用
*/
(function(){"use strict";try{if(typeof document!="undefined"){var e=document.createElement("style");e.appendChild(document.createTextNode('.CodeMirror{color:#000;direction:ltr;font-family:monospace;height:300px}.CodeMirror-lines{padding:4px 0}.CodeMirror pre.CodeMirror-line,.CodeMirror pre.CodeMirror-line-like{padding:0 4px}.CodeMirror-gutter-filler,.CodeMirror-scrollbar-filler{background-color:#fff}.CodeMirror-gutters{background-color:#f7f7f7;border-right:1px solid #ddd;white-space:nowrap}.CodeMirror-linenumber{color:#999;min-width:20px;padding:0 3px 0 5px;text-align:right;white-space:nowrap}.CodeMirror-guttermarker{color:#000}.CodeMirror-guttermarker-subtle{color:#999}.CodeMirror-cursor{border-left:1px solid #000;border-right:none;width:0}.CodeMirror div.CodeMirror-secondarycursor{border-left:1px solid silver}.cm-fat-cursor .CodeMirror-cursor{background:#7e7;border:0!important;width:auto}.cm-fat-cursor div.CodeMirror-cursors{z-index:1}.cm-fat-cursor .CodeMirror-line::selection,.cm-fat-cursor .CodeMirror-line>span::selection,.cm-fat-cursor .CodeMirror-line>span>span::selection{background:transparent}.cm-fat-cursor .CodeMirror-line::-moz-selection,.cm-fat-cursor .CodeMirror-line>span::-moz-selection,.cm-fat-cursor .CodeMirror-line>span>span::-moz-selection{background:transparent}.cm-fat-cursor{caret-color:transparent}.cm-tab{display:inline-block;text-decoration:inherit}.CodeMirror-rulers{bottom:0;left:0;overflow:hidden;position:absolute;right:0;top:-50px}.CodeMirror-ruler{border-left:1px solid #ccc;bottom:0;position:absolute;top:0}.cm-s-default .cm-header{color:#00f}.cm-s-default .cm-quote{color:#090}.cm-negative{color:#d44}.cm-positive{color:#292}.cm-header,.cm-strong{font-weight:700}.cm-em{font-style:italic}.cm-link{text-decoration:underline}.cm-strikethrough{text-decoration:line-through}.cm-s-default .cm-keyword{color:#708}.cm-s-default .cm-atom{color:#219}.cm-s-default .cm-number{color:#164}.cm-s-default .cm-def{color:#00f}.cm-s-default .cm-variable-2{color:#05a}.cm-s-default .cm-type,.cm-s-default .cm-variable-3{color:#085}.cm-s-default .cm-comment{color:#a50}.cm-s-default .cm-string{color:#a11}.cm-s-default .cm-string-2{color:#f50}.cm-s-default .cm-meta,.cm-s-default .cm-qualifier{color:#555}.cm-s-default .cm-builtin{color:#30a}.cm-s-default .cm-bracket{color:#997}.cm-s-default .cm-tag{color:#170}.cm-s-default .cm-attribute{color:#00c}.cm-s-default .cm-hr{color:#999}.cm-s-default .cm-link{color:#00c}.cm-invalidchar,.cm-s-default .cm-error{color:red}.CodeMirror-composing{border-bottom:2px solid}div.CodeMirror span.CodeMirror-matchingbracket{color:#0b0}div.CodeMirror span.CodeMirror-nonmatchingbracket{color:#a22}.CodeMirror-matchingtag{background:rgba(255,150,0,.3)}.CodeMirror-activeline-background{background:#e8f2ff}.CodeMirror{background:#fff;overflow:hidden;position:relative}.CodeMirror-scroll{height:100%;margin-bottom:-50px;margin-right:-50px;outline:none;overflow:scroll!important;padding-bottom:50px;position:relative;z-index:0}.CodeMirror-sizer{border-right:50px solid transparent;position:relative}.CodeMirror-gutter-filler,.CodeMirror-hscrollbar,.CodeMirror-scrollbar-filler,.CodeMirror-vscrollbar{display:none;outline:none;position:absolute;z-index:5}.CodeMirror-vscrollbar{overflow-x:hidden;overflow-y:scroll;right:0;top:0}.CodeMirror-hscrollbar{bottom:0;left:0;overflow-x:scroll;overflow-y:hidden}.CodeMirror-scrollbar-filler{bottom:0;right:0}.CodeMirror-gutter-filler{bottom:0;left:0}.CodeMirror-gutters{left:0;min-height:100%;position:absolute;top:0;z-index:3}.CodeMirror-gutter{display:inline-block;height:100%;margin-bottom:-50px;vertical-align:top;white-space:normal}.CodeMirror-gutter-wrapper{background:none!important;border:none!important;position:absolute;z-index:4}.CodeMirror-gutter-background{bottom:0;position:absolute;top:0;z-index:4}.CodeMirror-gutter-elt{cursor:default;position:absolute;z-index:4}.CodeMirror-gutter-wrapper ::selection{background-color:transparent}.CodeMirror-gutter-wrapper ::-moz-selection{background-color:transparent}.CodeMirror-lines{cursor:text;min-height:1px}.CodeMirror pre.CodeMirror-line,.CodeMirror pre.CodeMirror-line-like{word-wrap:normal;-webkit-tap-highlight-color:transparent;background:transparent;border-radius:0;border-width:0;color:inherit;font-family:inherit;font-size:inherit;font-variant-ligatures:contextual;line-height:inherit;margin:0;overflow:visible;position:relative;white-space:pre;z-index:2}.CodeMirror-wrap pre.CodeMirror-line,.CodeMirror-wrap pre.CodeMirror-line-like{word-wrap:break-word;white-space:pre-wrap;word-break:normal}.CodeMirror-linebackground{bottom:0;left:0;position:absolute;right:0;top:0;z-index:0}.CodeMirror-linewidget{padding:.1px;position:relative;z-index:2}.CodeMirror-rtl pre{direction:rtl}.CodeMirror-code{outline:none}.CodeMirror-gutter,.CodeMirror-gutters,.CodeMirror-linenumber,.CodeMirror-scroll,.CodeMirror-sizer{box-sizing:content-box}.CodeMirror-measure{height:0;overflow:hidden;position:absolute;visibility:hidden;width:100%}.CodeMirror-cursor{pointer-events:none;position:absolute}.CodeMirror-measure pre{position:static}div.CodeMirror-cursors{position:relative;visibility:hidden;z-index:3}.CodeMirror-focused div.CodeMirror-cursors,div.CodeMirror-dragcursors{visibility:visible}.CodeMirror-selected{background:#d9d9d9}.CodeMirror-focused .CodeMirror-selected{background:#d7d4f0}.CodeMirror-crosshair{cursor:crosshair}.CodeMirror-line::selection,.CodeMirror-line>span::selection,.CodeMirror-line>span>span::selection{background:#d7d4f0}.CodeMirror-line::-moz-selection,.CodeMirror-line>span::-moz-selection,.CodeMirror-line>span>span::-moz-selection{background:#d7d4f0}.cm-searching{background-color:#ffa;background-color:#ff06}.cm-force-border{padding-right:.1px}@media print{.CodeMirror div.CodeMirror-cursors{visibility:hidden}}.cm-tab-wrap-hack:after{content:""}span.CodeMirror-selectedtext{background:none}.CodeMirror-hints{background:#fff;border:1px solid silver;border-radius:3px;box-shadow:2px 3px 5px #0003;font-family:monospace;font-size:90%;list-style:none;margin:0;max-height:20em;overflow:hidden;overflow-y:auto;padding:2px;position:absolute;z-index:1}.CodeMirror-hint{border-radius:2px;color:#000;cursor:pointer;margin:0;padding:0 4px;white-space:pre}li.CodeMirror-hint-active{background:#08f;color:#fff}._fd-fn{display:flex;flex-direction:column;height:100%;position:relative;width:100%}._fd-fn .el-button{bottom:3px;box-shadow:0 6px 16px #00000014,0 3px 6px -4px #0000001f,0 9px 28px 8px #0000000d;position:absolute;right:5px}._fd-fn-editor{display:flex;flex:1;overflow:auto;width:100%}._fd-fn-editor .CodeMirror{height:100%;width:100%}._fd-fn-tip{background:var(--fc-bg-color-2);color:var(--fc-text-color-1);direction:ltr;font-family:monospace}._fd-fn-tip .cm-keyword{color:#708;line-height:24px;overflow-x:auto;white-space:nowrap}._fd-fn-tip .cm-keyword::-webkit-scrollbar{background-color:transparent;height:0;width:0}._fd-fn-ind{background-color:var(--fc-bg-color-3);border-right:1px solid var(--fc-line-color-2);display:inline-block;float:left;height:24px;margin-right:4px;width:29px}._fd-fn-arg{cursor:pointer;text-decoration:underline}._fd-fn-arg i{color:var(--fc-style-color-1);font-size:12px}._fd-cdi-input>div{width:100%}._fd-pattern-input{width:100%}._fd-pattern-input .el-input-group__append{padding:0 10px}._fd-pattern-input .fc-icon{cursor:pointer}._fd-pattern-popper .el-dropdown__list{height:350px;overflow:auto}.el-tree._fd-rule-select{min-width:200px}._fd-rule-select .el-tree-node:has(._fd-rule-select-node){border-bottom-style:solid;border-bottom:1px dashed var(--fc-line-color-3);padding-bottom:5px}._fd-rule-select .el-tree-node:has(._fd-rule-select-node)>.el-tree-node__content>.el-checkbox{display:none}._fd-rule-select .el-tree-node:has(._fd-rule-select-node)>.el-tree-node__content>.el-select-dropdown__item{padding-right:20px}._fd-rule-select-node{display:flex;justify-content:space-between}._fd-rule-select-node>div{color:#61affe}._fd-rule-select-node>span{font-size:12px}._fd-value-input .el-input__validateIcon{display:none}._fd-value-input .el-select,._fd-value-input .el-select__wrapper{height:100%}._fd-warning-pop{max-width:400px}._fd-warning-text{cursor:help;text-decoration:underline;text-decoration-style:dashed}._fd-variable-btn{align-items:center;background:var(--fc-style-bg-color-1);border-radius:5px;color:var(--fc-style-color-1);cursor:pointer;display:flex;font-size:12px;margin-left:6px;padding:2px 6px}._fd-variable-con .el-main{padding:0}._fd-variable-l,._fd-variable-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-variable-r{margin-left:10px}._fd-variable-l .el-header,._fd-variable-r .el-header{align-items:center;background:var(--fc-bg-color-3);color:var(--fc-text-color-1);display:flex;font-size:13px;height:40px}._fd-variable-r .el-header .fc-icon{color:var(--fc-style-color-1);cursor:pointer;font-size:13px;margin-left:2px}._fd-variable-r .el-main{padding:10px}._fd-variable-info{background:hsla(0,0%,67%,.1);border-radius:6px;color:var(--fc-text-color-2);display:flex;font-size:12px;line-height:18px;margin-bottom:6px;padding:8px 13px;position:relative}._fd-variable-node{align-items:center;color:var(--fc-text-color-1);display:flex;font-size:13px;height:26px;justify-content:space-between;line-height:26px;padding-right:5px;width:100%}._fd-variable-node>span{color:var(--fc-text-color-3);font-size:12px}._fd-variable-item{align-items:center;border-bottom:1px solid var(--fc-line-color-3);display:flex;min-height:40px;padding:0 20px}._fd-variable-top ._fd-variable-item-label{color:#fca130}._fd-variable-item-label{font-size:13px;margin-right:18px;width:198px}._fd-variable-item .el-input{display:flex;flex:1;font-size:13px;margin-top:4px}._fd-variable-item.active,._fd-variable-item.active ._fd-variable-item-label,._fd-variable-item.active input{color:var(--fc-style-color-1)}._fd-variable-item.active .el-input{--el-input-icon-color:var(--fc-style-color-1)}._fd-variable-item input{text-align:center}._fd-variable-item .el-input .el-input__wrapper{box-shadow:none}._fd-variable-pop.el-popover.el-popper{height:400px;padding:0}._fd-variable-pop-header .fc-icon{color:var(--fc-style-color-1);cursor:pointer;margin-left:4px}._fd-variable-pop .el-header{align-items:center;background-color:var(--fc-bg-color-2);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:0 10px}._fd-variable-pop .el-main{padding:10px}._fd-variable-pop .el-tree-node__content>.el-tree-node__expand-icon{padding:3px}._fd-variable-pop .el-input-group__append{background:var(--fc-style-color-1);color:#fff;cursor:pointer;padding:0;width:60px}._fd-variable-pop .el-input-group__append div{text-align:center;width:100%}._fd-variable-pop-node{align-items:center;display:flex;font-size:13px;height:26px;justify-content:space-between;line-height:26px;padding-right:5px;width:100%}._fd-variable-pop-node>span{color:var(--fc-text-color-3);font-size:12px}._fd-cdg-input{display:flex;flex-direction:column}._fd-cdg-btns{margin-left:30px;margin-top:10px}._fd-cdg-btns .el-button{color:var(--fc-text-color-2)}._fd-cdg-item{display:flex}._fd-cdg-item .el-select{background-color:var(--fc-bg-color-2)}._fd-cdg-and{display:flex;flex-shrink:0;position:relative;width:100px}._fd-cdg-and>.el-select{left:-5px;margin-top:-16px;position:absolute;top:50%;width:80px;z-index:1}._fd-cdg-and:before{background-color:var(--fc-line-color-2);bottom:1px;content:"";left:30px;margin-bottom:16px;margin-top:14px;position:absolute;top:1px;width:1px}._fd-cdg-options{display:flex;flex-direction:column}._fd-cdg-option{align-items:center;display:flex;position:relative}._fd-cdg-field{width:208px}._fd-cdg-variable{height:32px;width:208px}._fd-cdg-term{width:104px}._fd-cdg-option>._fd-cfg-value{align-items:center;display:flex;width:208px}._fd-cdg-option>.fc-icon{color:var(--fc-text-color-2);cursor:pointer;margin-left:10px}._fd-cdg-option>.fc-icon.disabled{cursor:not-allowed}._fd-cdg-option>._fd-cfg-value>div{width:100%}._fd-cdg-option>.el-input+.el-select,._fd-cdg-option>.el-select+.el-input,._fd-cdg-option>.el-select+.el-select,._fd-cfg-value,._fd-cfg-value .el-checkbox{margin-left:10px}._fd-cdg-option:before{background-color:var(--fc-line-color-2);content:"";height:1px;left:-70px;margin-top:-1px;position:absolute;top:50%;width:105px}._fd-cdg-option.is-group{border:1px dashed #ccd3db;padding:14px}._fd-cdg-option.is-group>.fc-icon{font-size:18px;position:absolute;right:-10px;top:-10px;transform:rotate(45deg);z-index:1}._fd-cdg-option.is-group:before{margin-top:-17px}._fd-cdg-option+._fd-cdg-option{margin-top:16px}._fd-computed,._fd-computed .el-badge{width:100%}._fd-computed .el-button{font-weight:400;width:100%}._fd-comp-con,._fd-comp-condition{height:500px}._fd-comp-condition .el-main{padding:20px 5px}._fd-comp-con .el-tree>.el-tree-node{color:var(--fc-text-color-1);font-size:13px;font-weight:500;margin:1px;padding:14px}._fd-comp-con .el-tree>.el-tree-node+.el-tree-node{border-top:1px solid var(--fc-line-color-3)}._fd-comp-con .el-tree-node{font-weight:400}._fd-comp-con .el-tree-node__content{margin-top:5px}._fd-comp-dialog .el-dialog__body{padding:0 10px}._fd-comp-dialog .el-tabs__header{margin-bottom:0}._fd-comp-con .el-main{padding:0}._fd-comp-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-comp-head{align-items:center;border-bottom:1px solid var(--fc-line-color-3);color:var(--fc-text-color-1);display:flex;font-size:13px;font-weight:500;height:38px;padding:5px 15px}._fd-comp-r>.el-main,._fd-comp-script{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-comp-script{width:100%}._fd-comp-r>.el-main{flex-direction:column}._fd-comp-info{background:var(--fc-bg-color-2);border-radius:6px;color:var(--fc-text-color-2);height:90px;line-height:20px;margin:10px;padding:15px}._fd-comp-con .CodeMirror{height:100%;width:100%}._fd-comp-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-comp-node{align-items:center;display:flex;font-size:13px;height:26px;justify-content:space-between;line-height:26px;padding-right:5px;width:100%}._fd-comp-node ._group{color:#61affe;font-weight:700;margin-right:5px}._fd-comp-node ._subform{color:#fca130;font-weight:700;margin-right:5px}._fd-comp-node.disabled{color:var(--fc-text-color-3);cursor:not-allowed}._fd-comp-node.disabled ._fd-comp-id{background-color:#999}._fd-comp-id{background-color:var(--fc-style-color-1);border-radius:5px;color:#fff;font-weight:500;height:20px;line-height:20px;text-align:center;width:20px}._fd-comp-dialog .el-aside{border:1px solid var(--fc-line-color-3);border-right:0;width:300px}._fd-comp-title{color:var(--fc-text-color-1);font-weight:500;margin-bottom:15px;padding-left:5px;position:relative}._fd-comp-title:before{background-color:var(--fc-style-color-1);content:" ";display:inline-block;height:1em;left:-5px;position:absolute;top:3px;width:3px}._fd-comp-script .CodeMirror pre.CodeMirror-line{line-height:26px}._fd-comp-linkage{align-items:center;display:flex;font-size:12px}._fd-comp-linkage>._fd-rule-select{display:inline-block;margin:0 6px;width:120px}._fd-event .el-button{font-weight:400;width:100%}._fd-event .el-badge,._fd-menu{width:100%}._fd-menu{box-sizing:border-box;display:flex;flex-direction:column}._fd-menu-item{border:1px solid transparent;border-bottom:1px dashed var(--fc-line-color-3);padding:0 15px}._fd-menu-item.is-active{border:1px solid var(--fc-style-color-1)}._fd-menu-item.is-active ._fd-event-title i{color:var(--fc-style-color-1)}._fd-event-dialog .el-tabs__header{margin:0}._fd-event-select{align-items:center;display:flex;margin-left:15px;margin-top:15px}._fd-event-select .el-select{width:240px}._fd-event-con .el-main{padding:0}._fd-event-l,._fd-event-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-event-dropdown .el-dropdown-menu{max-height:500px;overflow:auto}._fd-event-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-event-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-event-r{border-left:0}._fd-event-r ._fd-event-head{justify-content:flex-end}._fd-event-l>.el-main,._fd-event-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-event-r>.el-main{flex-direction:column}._fd-event-r>.el-main.is-behavior{flex-direction:unset}._fd-event-item{display:flex;flex-direction:column;font-size:14px;justify-content:center;max-width:250px;overflow:hidden;white-space:pre-wrap}._fd-event-item ._fd-label{color:var(--fc-text-color-3);font-size:12px}._fd-event-l .el-menu-item.is-active ._fd-event-title i{color:var(--fc-style-color-1)}._fd-event-method{color:#9d238c;display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;overflow:hidden;white-space:pre-wrap;width:225px}._fd-event-method ._fd-label{color:var(--fc-text-color-3);font-size:12px;margin-top:4px}._fd-event-method>span:first-child,._fd-fn-list-method>span:first-child{color:#9d238c}._fd-event-method>span:first-child>span,._fd-fn-list-method>span:first-child>span{color:var(--fc-text-color-1);margin-left:10px}._fd-event-title{align-items:center;cursor:pointer;display:flex;justify-content:space-between;padding:12px 0;width:100%}._fd-event-title .fc-icon{color:var(--fc-text-color-2);font-size:18px;margin-right:6px}._fd-event-title .el-input{width:200px}._fd-event-title .el-input__wrapper{box-shadow:none}._fd-event-con .CodeMirror{height:100%;width:100%}._fd-event-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-event-behaviors{width:100%}._fd-event-behavior{background:var(--fc-bg-color-3);border-radius:5px;box-sizing:border-box;cursor:pointer;font-size:12px;margin-bottom:12px;padding:12px;width:100%}._fd-event-behavior.is-active{background:var(--fc-style-color-1)}._fd-event-behavior.is-active ._fd-event-behavior-info,._fd-event-behavior.is-active ._fd-event-behavior-label{color:#fff}._fd-event-behavior-label{color:var(--fc-text-color-2);display:flex;justify-content:space-between}._fd-event-behavior-label>div{display:flex}._fd-event-behavior-info{color:var(--fc-text-color-3);margin-left:16px}._fd-event-behavior-list{border-right:1px solid var(--fc-line-color-3);height:100%;padding:15px}._fd-event-behavior-list .el-menu-item,._fd-event-behavior-list .el-sub-menu__title{height:30px}._fd-event-behavior-list .el-menu{border-right:0}._fd-event-behavior-list .el-menu-item.is-active{background:var(--fc-style-color-1);color:#fff}._fd-event-behavior-list .el-menu-item,._fd-event-behavior-list .el-sub-menu__title{border-radius:6px!important;margin-bottom:4px}._fd-event-con ._fd-event-behavior-con{padding:15px}._fd-event-con .form-create .form-create .el-form-item{margin-bottom:18px}._fd-event-con .el-form ._fd-form-item-warning{color:var(--fc-text-color-3);font-size:12px;font-weight:400;line-height:17px;margin-top:6px}._fd-event-behavior-title{color:var(--fc-text-color-1);font-size:13px;font-weight:500;margin-bottom:12px}._fd-event-behavior-title>div{color:var(--fc-text-color-3);font-size:12px;font-weight:400}._fd-config-item{color:var(--fc-text-color-2);display:flex;flex-direction:column;font-size:12px;margin-bottom:10px;width:100%}._fd-ci-head{justify-content:space-between}._fd-ci-head,._fd-ci-label{align-items:center;display:flex}._fd-ci-label{color:var(--fc-text-color-1);font-size:12px}._fd-ci-con{align-items:center;display:flex;justify-content:flex-end;min-width:150px}._fd-ci-label.is-arrow{cursor:pointer}._fd-ci-append{background:var(--fc-bg-color-2);display:flex;flex-direction:column;margin:5px 3px 3px;padding:4px}._fd-ci-label i{font-size:12px;font-weight:600}._fd-ci-label i.down{transform:rotate(-180deg)}._fd-ci-info{font-size:12px;padding-right:5px}._fd-page-item{align-items:center;border-bottom:1px solid var(--fc-line-color-3);box-sizing:content-box;cursor:pointer;display:flex;flex-direction:row;font-size:12px;height:30px;justify-content:space-between;margin:0 12px;padding:12px 0}._fd-page-item.active ._fd-page-label{color:var(--fc-style-color-1)}._fd-page-btns{display:flex}._fd-page-label{color:var(--fc-text-color-1);font-weight:600}._fd-page-label .fc-icon{font-size:12px;margin-left:5px}._fd-page-id{align-items:center;color:var(--fc-text-color-3);display:flex;font-weight:400}._fd-page-id .fc-icon{margin-left:5px}._fd-page-id .fc-icon:hover,._fd-page-input .el-button{color:var(--fc-style-color-1)}._fd-page-input .el-button{font-size:12px;font-weight:400;margin-left:12px;margin-top:12px}._fd-page-input .el-button .fc-icon{font-size:12px;margin-left:5px}._fd-page-del{align-items:center;background-color:var(--fc-style-bg-color-3);border-radius:25px;display:flex;height:24px;justify-content:center;margin-left:4px;width:24px}._fd-page-del .fc-icon{color:var(--fc-style-color-3);font-size:14px}._fd-page-copy{align-items:center;background-color:var(--fc-style-bg-color-1);border-radius:25px;display:flex;height:24px;justify-content:center;width:24px}._fd-page-copy .fc-icon{color:var(--fc-style-color-1);font-size:14px}._fc-sublist ._fc-r-title{align-items:center;display:flex;justify-content:space-between}._fc-sublist .fc-icon{cursor:pointer}._fc-sublist ._fd-config-item+._fd-config-item{margin-top:8px}._fc-r-tools-bar{height:30px}._fc-r-tools-close{color:var(--fc-text-color-2);position:absolute;right:5px;transform:rotate(45deg)}._fc-r-tools{border-top:1px solid var(--fc-line-color-3);left:0;padding:0 10px;position:absolute;right:0}._fc-r-tool,._fc-r-tools{align-items:center;display:flex}._fc-r-tool{cursor:pointer;height:28px;justify-content:center;width:28px}._fc-r-tool:hover{color:var(--fc-style-color-1)}._fc-r-tool .fc-icon{font-size:22px}._fc-r-tools-close .fc-icon{font-size:18px}._fd-config-title{align-items:center;display:flex;font-size:14px;margin:26px 0 16px;padding-left:10px;position:relative}._fd-config-title:before{background-color:var(--fc-style-color-1);content:" ";display:block;height:20px;left:0;position:absolute;width:2px}._fd-type-select{cursor:pointer}._fd-type-select.is-disabled{cursor:default}._fd-type-select .fc-icon{font-size:14px}._fd-type-select-pop{max-height:500px;overflow:auto}._fd-type-select-pop .fc-icon{font-size:14px}._fc-field-tree .el-tree-node__content{color:var(--fc-text-color-1);display:flex;flex:1}._fc-field-tree .el-tree-node__content:hover{background-color:var(--fc-style-bg-color-1);color:var(--fc-style-color-1)}._fc-field-tree ._fc-field-drag{display:flex;flex:1;flex-direction:column}._fc-field-tree .fc-icon{font-size:18px;margin-right:5px}._fc-field-tree .icon-folder{color:var(--fc-style-color-1)}._fc-field-node-label{align-items:center;display:flex;user-select:none}._fc-l ._fc-form-tree .el-tree-node__content{color:var(--fc-text-color-1);display:flex;flex:1;height:auto;padding:5px 0}._fc-form-tree .el-tree-node__content:hover{background-color:var(--fc-style-bg-color-1);color:var(--fc-style-color-1)}._fc-form-tree .fc-icon{color:var(--fc-style-color-1);font-size:18px;margin-right:5px}._fc-form-tree .icon-folder{color:#ffba00}._fc-form-node{display:flex;flex-direction:row;justify-content:space-between;padding-right:12px;width:100%}._fc-form-node-label{align-items:flex-start;display:flex;user-select:none;white-space:normal}._fc-form-node-info{color:var(--fc-text-color-2);font-size:12px}._fd-gec,._fd-gec .el-badge{width:100%}._fd-gec .el-button{font-weight:400;width:100%}._fd-gec-con .el-main{padding:0}._fd-gec-l,._fd-gec-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-gec-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-gec-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-gec-r{border-left:0}._fd-gec-r ._fd-gec-head{justify-content:flex-end}._fd-gec-l>.el-main,._fd-gec-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-gec-r>.el-main{flex-direction:column}._fd-gec-l .el-menu{border-right:0;border-top:0;overflow:auto;padding:0 10px 5px;width:100%}._fd-gec-l .el-menu-item.is-active{background:var(--fc-bg-color-3);color:var(--fc-text-color-2)}._fd-gec-l .el-menu-item{border:1px solid var(--fc-line-color-3);border-radius:5px;height:auto;line-height:1em;margin-top:5px;padding:0}._fd-gec-method{color:#9d238c;display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;overflow:hidden;white-space:pre-wrap;width:225px}._fd-gec-method ._fd-label{color:var(--fc-text-color-3);font-size:12px;margin-top:4px}._fd-gec-title{align-items:center;display:flex;justify-content:space-between;padding:10px 0;width:100%}._fd-gec-title .el-input{width:200px}._fd-gec-title .fc-icon{color:var(--fc-text-color-2);font-size:18px;margin-right:6px}._fd-gec-title .el-input__wrapper{box-shadow:none}._fd-gec-con .el-menu-item.is-active i{color:var(--fc-text-color-2)}._fd-gec-con .CodeMirror{height:100%;width:100%}._fd-gec-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-struct-editor{flex:1;width:100%}._fd-struct-editor>div{height:100%}._fd-gfc,._fd-gfc .el-badge{width:100%}._fd-gfc .el-button{font-weight:400;width:100%}._fd-gfc-dialog .el-tabs__header{margin-bottom:0}._fd-gfc-dialog .form-create{margin-top:15px}._fd-gfc-dialog ._fc-tabs{display:flex;height:100%}._fd-gfc-dialog ._fc-tabs .el-tabs__content{display:flex;flex:1;overflow:auto}._fd-gfc-info{background:hsla(0,0%,67%,.1);border-radius:6px;color:var(--fc-text-color-2);display:flex;font-size:12px;line-height:18px;margin-left:15px;margin-top:8px;padding:8px 13px;position:relative}._fd-gfc-con .el-main{padding:0}._fd-gfc-l,._fd-gfc-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-gfc-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-gfc-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-gfc-r{border-left:0}._fd-gfc-r ._fd-gfc-head{justify-content:flex-end}._fd-gfc-l>.el-main,._fd-gfc-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-gfc-r>.el-main{flex-direction:column}._fd-gfc-l .el-menu{border-right:0;border-top:0;overflow:auto;padding:0 10px 5px;width:100%}._fd-gfc-l .el-menu-item.is-active{background:var(--fc-bg-color-3);color:var(--fc-text-color-2)}._fd-gfc-l .el-menu-item{border:1px solid var(--fc-line-color-3);border-radius:5px;height:auto;line-height:1em;margin-top:5px;padding:0}._fd-gfc-method{color:#702c71;display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;overflow:hidden;white-space:pre-wrap;width:100%}._fd-gfc-method ._fd-label{color:var(--fc-text-color-3);font-size:12px;margin-top:4px}._fd-gfc-title{align-items:center;display:flex;justify-content:space-between;padding:10px 0;width:100%}._fd-gfc-title .el-input{width:200px}._fd-gfc-title .fc-icon{color:var(--fc-text-color-2);font-size:18px;margin-right:6px}._fd-gfc-title .el-input__wrapper{box-shadow:none}._fd-gfc-title .el-menu-item.is-active i{color:var(--fc-text-color-2)}._fd-gfc-con .CodeMirror{height:100%;width:100%}._fd-gfc-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-size-input{align-items:center;display:flex}._fd-size-input .el-input-number--small{width:122px}._fd-size-input .el-button{font-size:12px;margin-left:3px;padding:5px;width:25px}._fd-box-size-input .el-form{grid-column-gap:10px;display:grid;grid-template-columns:repeat(2,1fr);width:100%}._fd-box-size-input .el-radio-group{width:100%}._fd-box-size-input .el-radio-button__inner{padding:4px;width:100%}._fd-box-size-input .el-radio-button{flex:1}._fd-box-size-input ._fd-size-input .el-input-number--small{width:100%}._fd-color-input{width:150px}._fd-color-input .el-input .el-color-picker{margin:0}._fd-color-input .el-input .el-input-group__append{padding:0;width:24px}._fd-color-input .el-input .el-color-picker__trigger{border-left:0;border-radius:0 3px 3px 0}._fd-border-input{display:flex;height:110px;justify-content:center;width:100%}._fd-border-input ._fd-bi-left{align-items:center;display:flex;flex-direction:column;height:115px;justify-content:center;width:115px}._fd-border-input ._fd-bi-right{display:flex;flex-direction:column;justify-content:space-around;padding:5px;width:140px}._fd-border-input ._fd-bi-right ._fd-color-input{width:140px}._fd-bi-opt{align-items:center;display:flex;height:100%;width:100%}._fd-bi-opt ._line{width:100%}._fd-bi-opt .solid{border:1px solid #000}._fd-bi-opt .dashed{border:1px dashed #000}._fd-bi-opt .dotted{border:1px dotted #000}._fd-bi-opt .double{border:1px double #000}._fd-border-input ._fd-bil-row{display:flex;height:38px;justify-content:center}._fd-border-input ._fd-bil-col{align-items:center;cursor:pointer;display:flex;font-size:16px;height:22px;justify-content:center;margin:8px;width:22px}._fd-border-input ._fd-bil-col.active{color:var(--fc-style-color-1);outline:1px dashed var(--fc-style-color-1)}.line-box{box-sizing:border-box;height:20px;padding:1px;width:150px}.line-box-con{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABAAAAAQCAYAAAAf8/9hAAAAAXNSR0IArs4c6QAAAD5JREFUOE9jZGBg+M+AChjR+HjlQYqHgQFoXibNS+gBBjKMpDAZHAaQ5GQGBgYUV4+mA7QAgaYokgJ14NMBAK1TIAlUJpxYAAAAAElFTkSuQmCC);height:100%;opacity:.3;width:100%}._fd-radius-input{display:flex;flex-direction:column;width:100%}._fd-radius-con{display:flex;flex-wrap:wrap}._fd-radius-item{box-sizing:border-box;padding:5px 0;width:50%}._fd-radius-item,._fd-radius-item ._fd-radius-icon{align-items:center;display:flex;justify-content:center}._fd-radius-item ._fd-radius-icon{height:24px;width:24px}._fd-radius-item ._fd-size-input .el-input-number--small{width:70px}._fd-font-input{display:flex;justify-content:center;padding:0 5px}._fd-fi-box{overflow:hidden;width:150px}._fd-font-input .el-form{grid-column-gap:10px;display:grid;grid-template-columns:repeat(2,1fr);width:100%}._fd-font-input .el-form--inline .el-form-item{margin:0;padding:0}._fd-font-input ._fd-size-input .el-input-number--small{width:100%}._fd-display-input{display:flex;flex-direction:column}._fd-display-input .el-radio-button__inner{padding:4px;width:100%}._fd-display-input .el-radio-button{flex:1}._fd-display-input .is-active i{color:#fff}._fd-display-input .el-radio-button__inner{color:var(--fc-text-color-1)}._fd-display-con{display:flex;flex-wrap:wrap}._fd-display-con.rotate-flag .rotate{display:inline-block;transform:rotate(-90deg)}._fd-display-con.column .icon-justify-flexstart:before{display:inline-block;transform:rotate(180deg)}._fd-display-con.column .icon-justify-flexend:before{display:inline-block;transform:rotate(0)}._fd-display-con.row-reverse .icon-justify-flexstart:before{display:inline-block;transform:rotate(180deg)}._fd-display-con.column-reverse .icon-justify-flexstart:before,._fd-display-con.row-reverse .icon-justify-flexend:before{display:inline-block;transform:rotate(0)}._fd-display-con.column-reverse .icon-justify-flexend:before{display:inline-block;transform:rotate(180deg)}._fd-display-raw{display:flex;flex-direction:column;margin-bottom:5px;width:100%}._fd-shadow-content{align-items:center;display:flex;flex-direction:column;justify-content:space-between;padding:0 5px}._fd-sc-form .fc-icon{font-size:12px}._fd-shadow-content .el-form{grid-column-gap:10px;display:grid;grid-template-columns:repeat(2,1fr);width:100%}._fd-shadow-content .el-form-item{display:grid!important;margin:0!important}._fd-shadow-content .el-input__wrapper{flex:1}._fd-shadow-content ._fd-sc-box{border:1px solid #ccc;border-radius:5px;cursor:pointer;height:250px;overflow:hidden;position:relative;width:250px}._fd-shadow-content ._fd-sc-box .spot{border-radius:100%;height:0;position:absolute;width:0}._fd-shadow-content ._fd-sc-box .spot-id{background:#1989fa;border-radius:100%;height:10px;left:-5px;position:absolute;top:-5px;width:10px;z-index:1}._fd-shadow-content ._fd-sc-box.down .spot-id{box-shadow:1px 1px 10px 2px #1989fa}._fd-shadow-content ._fd-sc-box .center-spot{background:#1989fa;border-radius:100%;height:0;left:125px;position:absolute;top:125px;width:0}._fd-shadow-content ._fd-sc-box .x-hr{background:#ccc;height:1px;position:absolute;top:125px;width:100%}._fd-shadow-content ._fd-sc-box .y-hr{background:#ccc;height:100%;left:125px;position:absolute;width:1px}._fd-shadow-content .el-select__placeholder{text-align:center}._fd-shadow-content .el-input-group__append{padding:0;width:55px}._fd-shadow-content ._fd-color-input,._fd-shadow-content .el-input{width:100%}._fd-shadow-content ._fd-sc-right{margin-top:10px}._fd-shadow-content ._fd-sc-radio{width:100%}._fd-shadow-content ._fd-sc-radio .el-radio-button{display:flex;flex:1}._fd-shadow-content ._fd-sc-radio .el-radio-button__inner{width:100%}._fd-shadow-input ._fd-ci-con{width:150px}._fd-shadow-input :focus-visible{outline:0 none}._fd-si-input .el-input-group__append{display:inline-flex;padding:0;width:24px}._fd-si-input .el-input__wrapper{flex:1}._fd-shadow-input ._fd-ci-con .fc-icon{cursor:pointer}._td-table-opt{width:100%}._td-table-opt .icon-delete{cursor:pointer}._td-table-opt .el-table{z-index:1}._td-table-opt-handle{align-items:center;display:flex;justify-content:space-between;padding-right:5px}._fd-box-space-input{color:#000}._fd-box-space-input ._margin,._fd-box-space-input ._padding{background-color:#f2cea5;box-sizing:border-box;height:180px;padding:40px 55px;position:relative;width:100%}._fd-box-space-input ._margin,html.dark ._fd-box-space-input ._padding{background-color:#a9855c}._fd-box-space-input ._margin{background-color:#c6cf92;height:100px;width:100%}._fd-box-space-input ._fd-input{background-color:unset;border:0;display:inline-block;font-size:12px;height:20px;margin:0;max-width:40px;outline:0 none;padding:0;text-align:center;text-decoration:underline;width:30%}._fd-box-space-input ._fd-input:focus,._fd-box-space-input ._fd-input:hover{background-color:var(--fc-bg-color-3);color:var(--fc-text-color-1);opacity:.9}._fd-box-space-input ._fd-left,._fd-box-space-input ._fd-right{left:7px;margin-top:-10px;position:absolute;top:50%}._fd-box-space-input ._fd-bottom,._fd-box-space-input ._fd-top{left:50%;margin-left:-20px;position:absolute;top:5px}._fd-box-space-input ._fd-bottom{bottom:15px;top:unset}._fd-box-space-input ._fd-right{left:unset;right:2px}._fd-box-space-input ._box{align-items:center;background-color:#94b5c0;display:flex;height:100%;justify-content:center;width:100%}._fd-box-space-input ._margin-title,._fd-box-space-input ._padding-title{left:4px;position:absolute;top:2px}._fd-box-space-input ._fd-help{align-items:center;color:var(--fc-text-color-3);display:flex;position:absolute;right:5px;top:5px}._fd-box-space-input ._padding .fc-icon{color:var(--fc-text-color-1);cursor:pointer;font-size:12px}._fd-box-space-input ._padding .fc-icon+.fc-icon{margin-left:2px}._fd-box-space-input .fc-icon.active{color:var(--fc-style-color-1)}._fd-box-space-input ._fd-x{margin:0 5px}._fd-style-config{display:flex;flex-direction:column;width:100%}._fd-opacity-input ._fd-ci-con{align-items:center;display:flex;justify-content:space-between;width:150px}._fd-opacity-input ._fd-ci-con>span{width:32px}._fd-opacity-input .el-slider{flex:1;margin-right:15px}._fd-style-editor{flex:1;width:100%}._fd-style-editor .CodeMirror,._fd-style-editor>div{height:100%}._fd-gcc,._fd-gcc .el-badge{width:100%}._fd-gcc .el-button{font-weight:400;width:100%}._fd-gcc-con .el-main{padding:0}._fd-gcc-l,._fd-gcc-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-gcc-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-gcc-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-gcc-r{border-left:0}._fd-gcc-r ._fd-gcc-head{justify-content:flex-end}._fd-gcc-l>.el-main,._fd-gcc-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-gcc-r>.el-main{flex-direction:column;padding:20px}._fd-gcc-r>.el-main._fd-gcc-style{padding:0}._fd-gcc-r .el-form-item{margin-bottom:10px!important}._fd-gcc-l .el-menu{border-right:0;border-top:0;overflow:auto;padding:0 10px 5px;width:100%}._fd-gcc-l .el-menu-item.is-active{background:var(--fc-bg-color-3);color:var(--fc-style-color-1)}._fd-gcc-l .el-menu-item{border:1px solid var(--fc-line-color-3);border-radius:5px;height:auto;line-height:1em;margin-top:5px;padding:0}._fd-gcc-default.is-active ._fd-label{color:var(--fc-style-color-1);margin-top:0}._fd-gcc-method{color:#923b76;display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;overflow:hidden;white-space:pre-wrap;width:175px}._fd-gcc-method ._fd-label{color:var(--fc-text-color-3);font-size:12px}._fd-gcc-method span+._fd-label{margin-top:4px}._fd-gcc-title{align-items:center;display:flex;justify-content:space-between;padding:10px 0;width:100%}._fd-gcc-title .el-input{width:160px}._fd-gcc-title .fc-icon{color:var(--fc-text-color-2);font-size:18px;margin-right:6px}._fd-gcc-title .el-input__wrapper{box-shadow:none}._fd-gcc-con .el-menu-item.is-active i{color:var(--fc-text-color-2)}._fd-gvc,._fd-gvc .el-badge{width:100%}._fd-gvc .el-button{font-weight:400;width:100%}._fd-gvc-con .el-main{padding:0}._fd-gvc-l,._fd-gvc-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-gvc-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-gvc-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-gvc-r{border-left:0}._fd-gvc-r ._fd-gvc-head{justify-content:flex-end}._fd-gvc-l>.el-main,._fd-gvc-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-gvc-r>.el-main{flex-direction:column;padding:0}._fd-gvc-l .el-menu{border-right:0;border-top:0;overflow:auto;padding:0 10px 5px;width:100%}._fd-gvc-l .el-menu-item.is-active{background:var(--fc-bg-color-3);color:var(--fc-text-color-2)}._fd-gvc-l .el-menu-item{border:1px solid var(--fc-line-color-3);border-radius:5px;height:auto;line-height:1em;margin-top:5px;padding:0}._fd-gvc-method{color:#923b76;display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;overflow:hidden;white-space:pre-wrap;width:175px}._fd-gvc-method ._fd-label{color:var(--fc-text-color-3);font-size:12px;margin-top:4px}._fd-gvc-title{align-items:center;display:flex;justify-content:space-between;padding:10px 0;width:100%}._fd-gvc-title .el-input{width:160px}._fd-gvc-title .fc-icon{color:var(--fc-text-color-2);font-size:18px;margin-right:6px}._fd-gvc-title .el-input__wrapper{box-shadow:none}._fd-gvc-con .el-menu-item.is-active i{color:var(--fc-text-color-2)}._fc-json-preview{color:var(--fc-text-color-1);display:flex;width:100%}._fc-json-preview .CodeMirror{font-size:12px;height:100%}._fd-struct,._fd-struct .el-badge{width:100%}._fd-struct .el-button{font-weight:400;width:100%}._fd-struct-dialog .CodeMirror{height:500px}._fd-struct-dialog .el-dialog__body{padding:0}._fd-props-input{flex:1;text-align:right}._fd-props-input .fc-icon{cursor:pointer}._fd-lc-body,._fd-lc-header{padding:0 12px}._fd-lc-body{overflow:auto}._fd-lc-header{display:flex;justify-content:flex-end;margin-bottom:12px}._fd-language-config .el-table__cell{height:34px}._fd-lc-handle{align-items:center;cursor:pointer;display:flex;justify-content:space-between}._fd-slots-config .el-input{margin-left:5px;min-width:170px;width:170px}._fd-slots-config .el-select{width:60px}._fd-slots-config .el-select input,._fd-slots-config .fc-icon{cursor:pointer}._fd-slots-config .el-input-group__append{padding:0 5px}._fd-slots-icons{grid-gap:10px;display:grid;grid-template-columns:repeat(13,1fr);width:100%}._fd-slots-icon{color:var(--fc-text-color-1);cursor:pointer;text-align:center}._fd-slots-config-pop{max-height:320px;overflow:auto}._fd-quick-layout-content{grid-column-gap:10px;display:grid;grid-template-columns:repeat(4,1fr);width:100%}._fd-quick-layout-content>div{cursor:pointer;display:flex;flex-direction:column;font-size:12px;text-align:center}._fd-quick-layout-content>div:hover{color:var(--fc-style-color-1)}._fd-quick-layout-content i{font-size:24px}._fd-print .el-button{font-weight:400;width:100%}._fd-print-con .el-main{padding:0}._fd-print-l,._fd-print-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-print-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-print-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-print-r{border-left:0}._fd-print-r ._fd-print-head{justify-content:flex-end}._fd-print-l>.el-main,._fd-print-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:column;min-width:0;padding:10px;width:100%}._fd-print-l .el-form .el-radio-button__inner,._fd-print-l .el-form .el-radio-group{width:100%}._fd-print-l .el-form .el-radio-button{flex:1}._fd-print-r>.el-main{flex-direction:column;padding:20px;position:relative}._fd-print-form{box-sizing:border-box;padding:2px}._fd-print-form .el-input__wrapper,._fd-print-form .el-select__wrapper,._fd-print-form .el-textarea__inner{border:1px solid var(--el-input-border-color,var(--el-border-color));box-shadow:none!important}._fd-print-form .el-select__placeholder{position:unset!important;top:unset!important;transform:unset!important}._fd-print-form .is-disabled .el-input__wrapper{background-color:unset!important}._fd-print-form .is-disabled .el-input__inner{color:unset!important}._fd-print-form-word .el-input__wrapper,._fd-print-form-word .el-select__wrapper,._fd-print-form-word .el-textarea__inner{border:none!important;border-color:inherit!important;border-radius:0!important}._fd-print-form-word .el-input-number__decrease,._fd-print-form-word .el-input-number__increase{display:none!important}._fd-print-form-word ._fc-read-view{border-bottom:1px solid var(--el-input-border-color,var(--el-border-color))!important;border-color:inherit!important;display:block;height:1.5em;line-height:1.5em;padding:0 4px;width:100%}._fd-print-page-line{border-bottom:1px dashed var(--fc-line-color-3);box-sizing:border-box;color:var(--fc-text-color-3);font-size:12px;height:1px;left:0;line-height:2em;padding-left:4px;position:absolute;right:0;z-index:1}._fd-ai-chat{box-sizing:border-box;display:flex;flex-direction:column;font-size:12px;height:100%;padding:12px}._fd-ai-chat-header{border:1px solid var(--fc-line-color-3);border-radius:6px}._fd-ai-chat-prompt{display:flex;justify-content:space-between;padding:8px 12px 10px}._fd-ai-chat-prompt .fc-icon{font-size:12px;margin-right:2px}._fd-ai-chat-refresh{color:var(--fc-style-color-1);cursor:pointer}._fd-ai-chat-question{align-items:center;background:var(--fc-bg-color-2);border-radius:6px;color:var(--fc-text-color-2);cursor:pointer;display:flex;justify-content:space-between;margin:0 12px 12px;padding:7px 10px}._fd-ai-chat-question+._fd-ai-chat-question{margin-top:6px}._fd-ai-chat-question .fc-icon{margin-left:12px}._fd-ai-chat-question .icon-down:before{display:inline-block;transform:rotate(-90deg)}._fd-ai-chat-history{display:flex;flex:1;flex-direction:column;margin-top:12px;overflow:auto}._fd-ai-chat-history-chat{align-items:flex-end;display:flex;flex-direction:column;margin-bottom:10px}._fd-ai-chat-history-chat>div{background:var(--fc-style-bg-color-1);border-radius:6px 0 6px 6px;color:var(--fc-style-color-1);max-width:70%;padding:10px;white-space:pre-wrap}._fd-ai-chat-history-status{align-items:flex-start;display:flex;flex-direction:column;margin-bottom:10px}._fd-ai-chat-history-status>div{background:var(--fc-bg-color-2);border-radius:0 6px 6px;color:var(--fc-text-color-2);max-width:70%;overflow:hidden;padding:10px;position:relative}._fd-ai-chat-history-status>div>div{align-items:center;display:flex;position:relative;z-index:1}._fd-ai-chat-history-status.loading>div:after{animation:b 3s linear infinite;background:linear-gradient(0deg,var(--fc-style-color-1) 0,var(--fc-style-color-4) 100%);bottom:-2px;content:"";filter:blur(5px);left:-2px;padding:1px;position:absolute;right:-2px;top:-2px}._fd-ai-chat-history-status.loading>div{border-radius:0 6px 6px;padding:1px}._fd-ai-chat-history-status.loading>div>div{background-color:var(--fc-bg-color-1);border-radius:0 6px 6px;padding:7px 10px}._fd-ai-chat-history-status.success>div{background:var(--fc-style-bg-color-2);color:var(--fc-style-color-2)}._fd-ai-chat-history-status .fc-icon{background:var(--fc-style-color-2);border-radius:15px;color:#fff;font-size:14px;height:15px;margin-right:5px;text-align:center;width:15px}._fd-ai-chat-history-status.fail>div{background:var(--fc-style-bg-color-3);color:var(--fc-style-color-3)}._fd-ai-chat-history-status.fail .fc-icon{background:var(--fc-style-color-3)}._fd-ai-chat-input{border-radius:6px;margin-top:12px;position:relative;width:100%}._fd-ai-chat-clear{margin-bottom:6px;text-align:right}._fd-ai-chat-clear .el-button{margin-right:2px;padding:0}._fd-ai-chat-clear .fc-icon{font-size:13px}._fd-ai-chat-input .el-textarea{box-sizing:border-box;height:120px;padding:1px;position:relative}._fd-ai-chat-input .el-textarea:before{background:linear-gradient(135deg,var(--fc-style-color-1),var(--fc-style-color-4));border-radius:6px;bottom:0;content:"";left:0;position:absolute;right:0;top:0}._fd-ai-chat-input .el-textarea__inner{background:var(--fc-bg-color-1);border-radius:6px;box-shadow:none;height:100%;resize:none}._fd-ai-chat-input>.fc-icon{align-items:center;background:var(--fc-style-color-1);border-radius:15px;bottom:12px;color:#fff;cursor:pointer;display:flex;font-size:14px;height:20px;justify-content:center;position:absolute;right:12px;text-align:center;width:20px}._fd-ai-chat-input .icon-suspend{background:linear-gradient(90deg,var(--fc-style-color-1) 0,var(--fc-style-color-4) 100%)}._fd-ai-chat-input .disabled{background:var(--fc-text-color-3)}@keyframes b{0%{transform:rotate(0)}to{transform:rotate(1turn)}}.m-title{align-items:center;color:#1f2329;flex-direction:row;font-weight:500;height:28px;justify-content:space-between;padding-top:8px;width:100%}.m-title,.tree-row-item{display:flex;font-size:12px;font-style:normal;line-height:20px}.tree-row-item{font-weight:400;overflow-x:hidden;padding-right:11px;text-overflow:ellipsis;white-space:nowrap;word-break:break-all}._fd-drag-tool{word-wrap:break-word;box-sizing:border-box;display:block;min-height:20px;min-width:0;outline:1px dashed var(--fc-tool-border-color);overflow:hidden;padding:2px;position:relative;word-break:break-all;z-index:0}._fd-drag-tool ._fd-drag-tool{margin:2px;max-height:calc(100% - 7px);max-width:calc(100% - 4px)}._fd-drag-tool.is-inline{display:inline-block}._fd-drag-tool.is-inside{height:inherit;width:inherit}._fd-drag-tool:hover{outline-color:var(--fc-style-color-1);outline-style:solid;z-index:1}._fd-drag-tool:has(._fd-drag-tool:hover){outline-style:dashed}._fd-drag-tool:not(.active):hover>div>._fd-drag-btn{display:flex!important;opacity:.7}._fd-drag-tool:has(._fd-drag-tool:not(.active):hover,._fd-drag-tool.active:hover)>div>._fd-drag-btn{display:none!important}._fd-drag-tool:has(._fd-drag-tool){padding:2px}._fd-drag-tool+._fd-drag-tool{margin-top:5px}._fd-drag-tool.active{min-height:36px;min-width:80px;outline:2px solid var(--fc-style-color-1)!important;z-index:2}._fd-drag-tool.active>div>._fd-drag-btn{display:flex}._fd-drag-tool._fd-drop-hover ._fd-drag-box{padding-bottom:15px!important;padding-top:15px!important}._fd-drag-tool._fd-drop-hover:hover{outline:1px dashed var(--fc-tool-border-color)}._fd-drag-tool ._fd-drag-btn{display:none}._fd-drag-r{padding:0 2px 2px 0;right:0;top:calc(100% - 20px)}._fd-drag-l,._fd-drag-r{position:absolute;z-index:4}._fd-drag-l{left:0;top:0}._fd-drag-btn{align-items:center;background-color:var(--fc-style-color-1);color:#fff;cursor:pointer;float:left;height:18px;justify-content:center;line-height:20px;padding-bottom:1px;width:18px}._fd-drag-btn .el-dropdown{color:#fff}._fd-drag-btn+._fd-drag-btn{margin-left:2px}._fd-drag-danger{background-color:var(--fc-style-color-3)}._fd-drag-btn i{font-size:14px}._fd-drag-hidden,._fd-drag-mask{bottom:0;left:0;position:absolute;right:0;top:0;z-index:3}._fd-drag-hidden{align-items:center;background:rgba(51,51,51,.7);color:#fff;display:flex;font-size:14px;justify-content:center}._fd-drag-tool.active ._fd-drag-hidden,._fd-drag-tool:has(._fd-drag-tool.active) ._fd-drag-hidden,._fd-drag-tool:hover ._fd-drag-hidden{display:none}._fd-drag-hidden .fc-icon{margin-right:5px}._fd-html-editor{width:100%}._fd-html-editor>.el-button{font-weight:400;width:100%}._fd-html-editor-con .CodeMirror{height:450px}._fd-html-editor-con .CodeMirror-line{font-size:13px!important;line-height:16px!important}._fd-html-editor-con .CodeMirror-lint-tooltip{z-index:1!important}._fd-html-editor-con .el-dialog__body{padding:0 20px}._fd-field-input{position:relative;width:100%}._fd-field-input>.fc-icon{color:#a8abb2;cursor:pointer;height:24px;position:absolute;right:28px;text-align:center;top:1px;width:24px;z-index:1}._fd-field-input .el-input-group__append{color:var(--fc-text-color-3);cursor:pointer;margin:0;padding:0;width:25px}._fd-field-popper .el-tree-node__content{color:#333;padding:2px 0}._fd-field-popper .el-select-dropdown__list>.el-select-dropdown__item{border-bottom:1px solid var(--fc-line-color-3);box-sizing:border-box;height:26px;padding-left:15px}._fd-list-input{width:100%}._fd-list-input .el-input-group__append{padding:0 10px}._fd-list-input .fc-icon{cursor:pointer}._fd-fetch-config,._fd-fetch-config .el-badge{width:100%}._fd-fetch-config .el-button{font-weight:400;width:100%}._fd-fetch-dialog .el-tabs__header{margin-bottom:0}._fd-fetch-dialog .form-create{margin-top:15px}._fd-fetch-dialog ._fc-tabs{display:flex}._fd-fetch-dialog ._fc-tabs .el-tabs__content{display:flex;flex:1;overflow:auto}._fd-fetch-info{background:hsla(0,0%,67%,.1);border-radius:6px;color:var(--fc-text-color-2);display:flex;font-size:12px;line-height:18px;margin-left:15px;margin-top:8px;padding:8px 13px;position:relative}._fd-fetch-con .el-main{padding:0}._fd-fetch-con .CodeMirror{height:100%;width:100%}._fd-fetch-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-table-column-config,._fd-table-column-config .el-badge{width:100%}._fd-table-column-config .el-button{font-weight:400;width:100%}._fd-tcc-dialog .flex{display:flex;width:100%}._fd-tcc-dialog .el-dialog__body{height:500px;overflow:auto}._fd-tcc-dialog ._fd-fn{height:100%}._fd-tcc-table .fc-icon{cursor:pointer}._fd-tcc-table .fc-icon+.fc-icon{margin-left:4px}._fd-tcc-table .cell{align-items:center;display:flex;flex-direction:row}._fd-tcc-table .el-table__indent{padding-left:8px!important}.TableColumnConfigTree .el-tree-node__content{height:35px}._fd-table-button-config,._fd-table-button-config .el-badge{width:100%}._fd-table-button-config .el-button{font-weight:400;width:100%}._fd-tcb-dialog .el-dialog__body{height:500px;overflow:auto}._fd-tcb-btn{cursor:pointer;display:flex}._fc-data-table{width:100%}._fc-data-table .el-table{--el-table-header-bg-color:#e8eefc}._fc-data-table .el-pagination{display:flex;margin-top:10px}._fc-data-table .el-pagination.left{justify-content:flex-start}._fc-data-table .el-pagination.center{justify-content:center}._fc-data-table .el-pagination.right{justify-content:flex-end}._fc-data-table ._fc-data-table-img-list .el-image{height:60px;max-width:150px}._fd-fn-list,._fd-fn-list .el-badge{width:100%}._fd-fn-list .el-button{font-weight:400;width:100%}._fd-fn-list-con .el-main{padding:0}._fd-fn-list-l,._fd-fn-list-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-fn-list-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-fn-list-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-fn-list-r{border-left:0}._fd-fn-list-r ._fd-fn-list-head{justify-content:flex-end}._fd-fn-list-l>.el-main,._fd-fn-list-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-fn-list-r>.el-main{flex-direction:column}._fd-fn-list-l .el-menu{border-right:0;border-top:0;overflow:auto;padding:0 10px 5px;width:100%}._fd-fn-list-l .el-menu-item.is-active{background:var(--fc-bg-color-3);color:var(--fc-text-color-2)}._fd-fn-list-l .el-menu-item{border:1px solid var(--fc-line-color-3);border-radius:5px;height:auto;line-height:1em;margin-top:5px;padding:0}._fd-fn-list-method{display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;line-height:1em;overflow:hidden;padding:10px 20px 10px 0;position:relative;white-space:pre-wrap;width:100%}._fd-fn-list-method ._fd-label{color:var(--fc-text-color-3);font-size:12px;margin-top:4px}._fd-fn-list-method ._fd-dot{background:#00c050;border-radius:15px;display:block;height:6px;margin-top:-3px;position:absolute;right:16px;top:50%;width:6px}._fd-fn-list-method-info>span:first-child,._fd-fn-list-method>span:first-child{color:#9d238c}._fd-fn-list-method-info>span:first-child>span,._fd-fn-list-method>span:first-child>span{color:var(--fc-text-color-1);margin-left:10px}._fd-fn-list-con .CodeMirror{height:100%;width:100%}._fd-fn-list-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-fn-input,._fd-fn-input .el-badge{width:100%}._fd-fn-input .el-button{font-weight:400;width:100%}._fd-fn-input-dialog .CodeMirror-lint-tooltip{z-index:1!important}._fd-fn-input-dialog .el-dialog__body{height:500px;padding:0}._fd-gfs{align-items:center;display:flex;width:100%}._fd-gfs .el-select{width:190px}._fd-gfs-handle{display:inline-flex;height:14px;line-height:14px}._fd-gfs-handle .fc-icon{color:var(--fc-style-color-1);cursor:pointer;margin-left:4px}._fd-gfs-handle .icon-refresh.disabled{color:#a9abb2;cursor:not-allowed}._fd-gfs-handle ._fc-manage-text{border-left:1px solid var(--fc-line-color-3);padding-left:4px}._fd-gcs{align-items:center;display:flex;width:100%}._fd-gcs .el-select{width:190px}._fd-gcs-handle{display:inline-flex;height:14px;line-height:14px}._fd-gcs-handle ._fc-manage-text{border-left:1px solid var(--fc-line-color-3);padding-left:4px}._fd-fetch-table{width:100%}._fd-fetch-table .el-button>span{font-size:12px;font-weight:400}._fd-fetch-table-con{border:1px solid var(--fc-line-color-3);border-bottom:0;display:flex;flex:1;flex-direction:column;height:100%}._fd-fetch-table-con .el-header{align-items:center;background:var(--fc-bg-color-3);color:var(--fc-text-color-1);display:flex;height:30px;padding-left:12px}._fd-fetch-table-row{align-items:center;border-bottom:1px solid var(--fc-line-color-3);display:flex;min-height:34px;padding:0 10px 4px}._fd-fetch-table-row>.fc-icon{align-items:center;color:var(--fc-text-color-2);cursor:pointer;display:flex;font-size:18px;height:24px;justify-content:center;margin-left:12px;margin-top:4px;width:24px}._fd-fetch-table-row .el-input{display:flex;flex:1;font-size:13px;margin-top:4px}._fd-fetch-table-key{margin-right:15px;width:calc(40% - 20px)}._fd-table-view{overflow:auto}._fd-table-view-cell{background:var(--fc-bg-color-1);border:1px inset rgba(0,0,0,.1);height:100%;min-height:50px}._fd-table-view-cell>._fd-drag-tool{border:0;height:100%;margin:0;max-height:100%;max-width:100%;min-width:unset;width:100%}._fd-table-view-btn{flex-direction:column;padding:0}._fd-table-view-btn .fc-icon{color:#fff;font-size:16px;width:18px}._fd-table-view-icon{color:#fff;display:flex;height:100%;justify-content:center;margin-top:1px;width:100%}._fd-table-view>table{border-bottom:1px solid #ebeef5;border-right:1px solid #ebeef5;border-color:#ebeef5 currentcolor currentcolor #ebeef5;border-style:solid none none solid;border-width:1px 0 0 1px;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fd-table-view tr{min-height:50px}._fd-table-view td{border-bottom:0;border-right:0;border-color:currentcolor #ebeef5 #ebeef5 currentcolor;border-style:none solid solid none;border-width:0 1px 1px 0;box-sizing:border-box;min-height:50px;min-width:80px;overflow-wrap:break-word;padding:0;position:relative;white-space:nowrap}._fd-tableCell-drag{height:100%}._fd-table-view.is-mini td{min-height:12px;padding:0}._fd-table-view.is-mini .el-form-item{margin:0;padding:0}._fc-table{overflow:auto}._fc-table>table{border-bottom:1px solid #ebeef5;border-right:1px solid #ebeef5;border-color:#ebeef5 currentcolor currentcolor #ebeef5;border-style:solid none none solid;border-width:1px 0 0 1px;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fc-table td,._fc-table tr{min-height:50px}._fc-table td{border-bottom:0;border-right:0;border-color:currentcolor #ebeef5 #ebeef5 currentcolor;border-style:none solid solid none;border-width:0 1px 1px 0;box-sizing:border-box;min-width:80px;overflow:hidden;overflow-wrap:break-word;padding:5px;position:relative}._fc-table.is-mini td{min-height:12px;padding:0}._fc-table.is-mini .el-form-item{margin:0;padding:0}._fd-value{color:var(--fc-text-color-3);white-space:nowrap}._fd-json-container{--fc-json-mask:" ";display:flex;flex:1;flex-direction:column;flex-wrap:wrap;justify-content:center;min-height:20px;position:relative}._fd-json-container ._fd-dialog,._fd-json-container ._fd-drawer,._fd-json-container ._fd-popup{display:none}._fc-line-form{align-items:flex-start;display:flex;flex-flow:wrap;width:100%}.form-create-m ._fc-line-form{display:flex;flex-wrap:wrap}.form-create ._fc-line-form ._fc-line-form,.form-create ._fc-line-form ._fd-drag-item,.form-create ._fc-line-form ._fd-drag-tool,.form-create ._fc-line-form .el-col-24{display:inline-flex;flex:initial;flex:unset!important;flex-wrap:wrap;max-width:100%;width:auto!important}._fc-m-con .form-create ._fc-line-form>.el-col-24{width:100%!important}._fc-line-form .el-form-item{display:inline-flex;vertical-align:middle}._fc-line-form .el-select,._fc-line-form .el-slider{width:220px}._fd-language-list{max-height:320px;overflow:auto;padding-top:70px}._fd-language-input .el-input-group__append{color:var(--fc-text-color-3);cursor:pointer;margin:0;padding:0;width:25px}._fd-language-input.is-variable input{color:var(--fc-style-color-1)}._fd-language-header,._fd-language-item{border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:0 12px}._fd-language-header{background-color:var(--fc-bg-color-1);color:var(--fc-text-color-1);flex-direction:column;font-weight:500;left:0;overflow:auto;padding-top:10px;position:absolute;right:0;top:0}._fd-language-item>div,._fd-language-name>div{flex:1;font-size:12px;min-width:70px;padding:5px}._fd-language-title{margin:6px 0}._fd-language-title .fc-icon{color:var(--fc-style-color-1);cursor:pointer;font-size:14px}._fd-language-name{display:flex}._fd-language-name>div{color:var(--fc-text-color-3);overflow:hidden;text-overflow:ellipsis;white-space:nowrap}._fd-language-item{cursor:pointer}._fd-language-item:hover{background-color:var(--fc-style-bg-color-1);color:var(--fc-style-color-1)}._fd-language-popover{padding:0!important}._fd-validate{display:flex;flex-direction:column;width:100%}._fd-validate-btn{font-weight:400;width:100%}._fd-validate-pop .el-dropdown-menu__item{width:248px}._fd-validate-item{border-bottom:1px dashed var(--fc-line-color-3);margin-bottom:10px}._fd-validate-item .el-col-12:first-child{padding-right:5px}._fd-validate-item .el-col-12+.el-col-12{padding-left:5px}._fd-validate-item .el-input-number{width:100%}._fd-validate-title{display:flex;flex-direction:row;justify-content:space-between;margin-bottom:10px}._fd-validate-title>div{align-items:center;display:flex}._fd-validate-title>div>span{background:var(--fc-bg-color-3);border-radius:15px;font-size:12px;height:16px;line-height:16px;margin-right:5px;text-align:center;width:16px}._fd-validate-title i{cursor:pointer}._fd-validate-title i:hover{color:var(--fc-style-color-3)}._fd-validate .append-msg{cursor:pointer}._fd-validate .el-input-group__append{padding:0 10px}._fd-required{align-items:center;display:flex;width:100%}._fd-required .el-input{margin-left:15px}._fd-required .el-switch{height:28px}._fd-tree-opt ._fd-tree-opt-btn{background-color:var(--fc-style-color-1);color:#fff;cursor:pointer;float:left;height:19px;justify-content:center;line-height:20px;padding-bottom:1px;text-align:center;width:18px}._fd-tree-opt-node{align-items:center;display:flex}._fd-tree-opt-first{margin-right:5px;width:60px}._fd-tree-opt-last{width:165px}._fd-tree-opt-last._label{width:175px}._fd-tree-opt-last._label .el-input-group__append{width:65px}._fd-tree-opt ._fd-tree-opt-danger{background-color:var(--fc-style-color-3);border-radius:0 2px 2px 0}._fd-tree-opt .el-tree-node__content{height:28px;margin-bottom:3px}._fd-tree-opt .el-input__inner{border-right:0}._fd-tree-opt .el-input-group__append{background:var(--fc-bg-color-1);padding-left:1px;padding-right:2px;width:90px}._fc-step-form{width:100%}._fc-step-form>.el-steps{margin-bottom:20px}._fc-step-form .el-step .el-step__head{line-height:1.4}._fd-step-form{width:100%}._fd-step-form .el-step{cursor:pointer}._fd-step-form>.el-steps{margin-bottom:20px}._fd-step-form .el-step .el-step__head{line-height:1.4}._fd-table-form{background:var(--fc-bg-color-1);border:1px solid var(--fc-line-color-3);width:100%}._fc-child-empty,._fd-table-form{min-height:130px}._fd-tf-wrap{display:flex;overflow:auto}._fd-tf-wrap>._fd-drag-tool{display:flex;flex-shrink:0;height:auto;margin:2px;overflow:auto}._fd-ntable-form{background:var(--fc-bg-color-1);border:1px solid var(--fc-line-color-3);min-height:130px;width:100%}._fd-ntable-sub .el-form-item__label,._fd-ntable-sub .van-field__label{display:none}._fd-ntable-form ._fc-child-empty{min-height:130px}._fd-ntf-wrap{display:flex;overflow:auto}._fd-ntf-wrap>._fd-drag-tool{display:flex;flex-shrink:0;height:auto;margin:2px}._fd-ntable-sub ._title{background-color:var(--fc-bg-color-3);border-radius:8px 8px 0 0;color:#65676b;display:inline-block;font-size:12px;height:20px;line-height:1em;margin-left:2px;padding:6px 8px 0;text-align:center}._fd-ntable-sub>._fd-drag-tool{margin-top:0}._fc-nested-table-form{color:var(--fc-text-color-2);overflow:auto}._fc-nested-table-form .form-create .el-form-item{margin-bottom:1px}._fc-nested-table-form .form-create .el-form-item.is-error{margin-bottom:22px}._fc-nested-table-form .el-form-item__label,._fc-nested-table-form .van-field__label{display:none!important}._fc-nested-table-form .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fc-ntf-table ._fc-ntf-head-idx,._fc-ntf-table ._fc-ntf-idx{font-weight:500;min-width:40px;padding:0;text-align:center;width:40px}._fc-ntf-idx div{border:1px solid #bfbfbf;border-radius:6px;cursor:pointer;display:inline-flex;height:18px;justify-content:center;line-height:16px;width:18px}._fc-ntf-sub-idx{width:30px}._fc-ntf-btn,._fc-ntf-edit{min-width:70px;text-align:center;width:70px}._fc-ntf-btn .fc-icon{cursor:pointer}._fc-nested-table-form._fc-disabled ._fc-ntf-btn .fc-icon,._fc-nested-table-form._fc-disabled>.el-button{cursor:not-allowed}._fc-ntf-table{border:1px solid #ebeef5;border-bottom:0;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fc-ntf-table>thead>tr>th{border:0;border-bottom:1px solid #ebeef5;font-weight:500;height:40px}._fc-ntf-table>thead>tr>th+th{border-left:1px solid #ebeef5}._fc-ntf-table tr{min-height:50px}._fc-ntf-table ._fc-read-view{text-align:center;width:100%}._fc-ntf-table td{border:0;border-bottom:1px solid #ebeef5;box-sizing:border-box;min-height:50px;min-width:80px;overflow:hidden;overflow-wrap:break-word;padding:10px;position:relative}._fc-ntf-table td+td{border-left:1px solid #ebeef5}._fc-ntf-table .el-cascader,._fc-ntf-table .el-date-editor,._fc-ntf-table .el-input-number,._fc-ntf-table .el-select,._fc-ntf-table .el-slider{width:100%}._fc-nested-table-form ._fc-ntf-sub{background-color:#fafafa}._fc-ntf-sub ._fc-table-form{background-color:var(--fc-bg-color-1)}._fc-ntf-sub ._fc-tf-table{border:0}._fc-ntf-idx+._fc-ntf-idx,._fc-ntf-sub-idx+._fc-ntf-head-idx{border-left:0}._fc-ntf-head-required:before{color:#f56c6c;content:"*";margin-right:4px}._fd-itable-form{background:var(--fc-bg-color-1);border:1px solid var(--fc-line-color-3);min-height:130px;width:100%}._fd-itable-form ._fc-child-empty{min-height:130px}._fd-itf-wrap{display:flex;overflow:auto}._fd-itf-wrap>._fd-drag-tool{display:flex;flex-shrink:0;height:auto;margin:2px}._fc-infinite-table-form{color:var(--fc-text-color-2);overflow:auto}._fc-infinite-table-form .form-create .el-form-item{margin-bottom:1px}._fc-infinite-table-form .form-create .el-form-item.is-error{margin-bottom:22px}._fc-infinite-table-form .el-form-item__label,._fc-infinite-table-form .van-field__label{display:none!important}._fc-infinite-table-form .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fc-itf-table ._fc-itf-head-idx,._fc-itf-table ._fc-itf-idx{font-weight:500;min-width:40px;padding:0;text-align:center;width:40px}._fc-itf-idx div{border:1px solid #bfbfbf;border-radius:6px;cursor:pointer;display:inline-flex;height:18px;justify-content:center;line-height:16px;width:18px}._fc-itf-sub-idx{width:30px}._fc-itf-btn,._fc-itf-edit{min-width:70px;text-align:center;width:70px}._fc-itf-btn .fc-icon{cursor:pointer}._fc-infinite-table-form._fc-disabled ._fc-itf-btn .fc-icon,._fc-infinite-table-form._fc-disabled>.el-button{cursor:not-allowed}._fc-itf-table{border:1px solid #ebeef5;border-bottom:0;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fc-itf-table>thead>tr>th{border:0;border-bottom:1px solid #ebeef5;font-weight:500;height:40px}._fc-itf-table ._fc-itf-table>thead{display:none}._fc-itf-table ._fc-itf-table{border-right:0}._fc-itf-table>thead>tr>th+th{border-left:1px solid #ebeef5}._fc-itf-table tr{min-height:50px}._fc-itf-table ._fc-read-view{text-align:center;width:100%}._fc-itf-table td{border:0;border-bottom:1px solid #ebeef5;box-sizing:border-box;min-height:50px;min-width:80px;overflow:hidden;overflow-wrap:break-word;padding:10px;position:relative}._fc-itf-table td+td{border-left:1px solid #ebeef5}._fc-itf-table .el-cascader,._fc-itf-table .el-date-editor,._fc-itf-table .el-input-number,._fc-itf-table .el-select,._fc-itf-table .el-slider{width:100%}._fc-infinite-table-form ._fc-itf-sub{padding:5px 0 5px 10px}._fc-itf-sub ._fc-table-form{background-color:var(--fc-bg-color-1)}._fc-itf-sub ._fc-tf-table{border:0}._fc-itf-idx+._fc-itf-idx,._fc-itf-sub-idx+._fc-itf-head-idx{border-left:0}._fc-itf-head-required:before{color:#f56c6c;content:"*";margin-right:4px}._fc-table-form{color:var(--fc-text-color-2);overflow:auto}._fc-table-form .form-create td .el-form-item{margin-bottom:1px}._fc-table-form .form-create td .el-form-item.is-error{margin-bottom:22px}._fc-table-form .el-form-item__label,._fc-table-form .van-field__label{display:none!important}._fc-table-form .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fc-tf-head-idx,._fc-tf-idx{font-weight:500;min-width:40px;text-align:center;width:40px}._fc-tf-btn,._fc-tf-edit{min-width:70px;text-align:center;width:70px}._fc-tf-btn .fc-icon{cursor:pointer}._fc-table-form._fc-disabled ._fc-tf-btn .fc-icon,._fc-table-form._fc-disabled>.el-button{cursor:not-allowed}._fc-tf-table{border:1px solid #ebeef5;border-bottom:0;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fc-table-form ._fc-tf-table>thead>tr>th{border:0;border-bottom:1px solid #ebeef5;font-weight:500;height:40px}._fc-table-form ._fc-tf-table>thead>tr>th+th{border-left:1px solid #ebeef5}._fc-table-form tr{min-height:50px}._fc-table-form ._fc-read-view{text-align:center;width:100%}._fc-table-form td{border:0;border-bottom:1px solid #ebeef5;box-sizing:border-box;min-height:50px;min-width:80px;overflow:hidden;overflow-wrap:break-word;padding:5px;position:relative}._fc-table-form td+td{border-left:1px solid #ebeef5}._fc-tf-table .el-cascader,._fc-tf-table .el-date-editor,._fc-tf-table .el-input-number,._fc-tf-table .el-select,._fc-tf-table .el-slider{width:100%}._fc-tf-head-required:before{color:#f56c6c;content:"*";margin-right:4px}._fc-table-form-v2{color:var(--fc-text-color-2);overflow:auto;width:100%}._fc-table-form-v2 .is-required:before{color:#f56c6c;content:"*";margin-right:4px}._fc-table-form-v2 .form-create td .el-form-item{margin-bottom:1px}._fc-table-form-v2 .form-create td .el-form-item.is-error{margin-bottom:22px}._fc-table-form-v2 .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fc-table-form-v2 .el-form-item__label{display:none!important}._fc-tf-pro-handle{align-items:center;display:flex;flex-direction:row;justify-content:space-between;margin-top:12px}._fc-table-form-v2 .el-cascader,._fc-table-form-v2 .el-date-editor,._fc-table-form-v2 .el-input-number,._fc-table-form-v2 .el-select,._fc-table-form-v2 .el-slider{width:100%}._fd-tf-col ._fd-tf-con .el-form-item{margin-bottom:1px!important}._fd-tf-col{display:flex;flex-direction:column;flex-shrink:0;flex-wrap:wrap;width:180px}._fd-tf-con .el-form-item__label,._fd-tf-con .van-field__label{display:none!important}._fd-tf-con{display:flex;flex:1;width:100%}._fd-tf-con .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fd-tf-title{align-items:center;border-bottom:1px solid #ebeef5;display:flex;height:40px;margin-bottom:0;padding-left:5px}._fd-tf-required{color:#f56c6c;margin-right:4px}._fd-tf-con ._fc-l-item{display:flex;flex-shrink:0;margin-top:4px;width:100%}._fd-tf-con ._fc-l-item>*{display:none!important}._fd-tf-con .el-cascader,._fd-tf-con .el-date-editor,._fd-tf-con .el-input-number,._fd-tf-con .el-select,._fd-tf-con .el-slider{width:100%}._fd-tf-col:has(._fd-tf-col){width:auto!important}._fd-tf-con>._fd-tableFormColumn2-drag:has(._fd-tf-col){display:flex!important;flex-direction:row!important;flex-wrap:nowrap!important}._fd-tf-con>._fd-tableFormColumn2-drag:has(._fd-tf-col)>._fd-drag-item{flex:unset}._fd-step-form-item>._fd-drag-tool{min-height:200px}._fd-dialog.el-dialog{margin:10px;width:calc(100% - 20px)}._fd-dialog .el-dialog__headerbtn{align-items:center;color:var(--el-color-info);display:flex;justify-content:center}._fd-dialog .el-dialog__headerbtn:hover .fc-icon{color:var(--el-color-primary)}._fd-dialog .el-dialog__body>._fd-drag-box{align-content:flex-start;align-items:flex-start;box-sizing:border-box;display:flex;flex-wrap:wrap;height:calc(var(--fc-dialog-height) - 125px);justify-content:flex-start;outline:1px dashed var(--fc-tool-border-color);overflow:auto;position:relative}._fc-dialog .el-dialog__headerbtn{align-items:center;color:var(--el-color-info);display:flex;justify-content:center}._fc-dialog .el-dialog__headerbtn:hover .fc-icon{color:var(--el-color-primary)}._fd-drawer.el-drawer{box-shadow:unset;width:100%}._fd-drawer .el-drawer__header{border-bottom:1px solid var(--fc-line-color-3);color:#333;font-size:15px;font-weight:600;margin-bottom:0;padding:14px 24px 14px 20px}._fd-drawer .el-drawer__body{padding:12px}._fd-drawer .el-drawer__close-btn{color:#909399;font-size:14px}._fd-drawer .el-drawer__footer{box-shadow:0 -2px 4px #0000000d;padding:10px 0;text-align:center}._fd-drawer .el-drawer__body>._fd-drag-box{align-content:flex-start;align-items:flex-start;box-sizing:border-box;display:flex;flex-wrap:wrap;height:calc(var(--fc-drawer-height) - 105px);justify-content:flex-start;outline:1px dashed var(--fc-tool-border-color);overflow:auto;position:relative}._fc-drawer .el-drawer__header{border-bottom:1px solid var(--fc-line-color-3);color:#333;font-size:15px;font-weight:600;margin-bottom:0;padding:14px 24px 14px 20px}._fc-drawer .el-drawer__body{padding:10px 24px 50px}._fc-drawer .el-drawer__close-btn{color:#909399;font-size:14px}._fc-drawer .el-drawer__footer{background:var(--fc-bg-color-1);bottom:0;box-shadow:0 -2px 4px #0000000d;left:0;padding:10px 0;position:absolute;right:0;text-align:center;width:100%;z-index:1}._fc-cell{display:inline-block}._fc-cell .el-cascader,._fc-cell .el-date-editor,._fc-cell .el-input-number,._fc-cell .el-select,._fc-cell .el-slider{width:100%}._fd-cell{display:inline-block}._fd-cell.is-new{width:100%!important}._fd-cell>div{box-sizing:border-box}._fd-cell>div>._fd-drag-tool.is-inline,._fd-cell>div>._fd-drag-tool>._fd-drag-box{align-content:var(--fc-cell-alignContent)!important;align-items:var(--fc-cell-alignItems)!important;display:var(--fc-cell-display)!important;flex-direction:var(--fc-cell-flexDirection)!important;flex-wrap:var(--fc-cell-flexWrap)!important;justify-content:var(--fc-cell-justifyContent)!important}._fd-cell>div>._fd-drag-item:has(>._fd-drag-tool>.el-col-24,>.el-col-24),._fd-cell>div>._fd-drag-tool>._fd-drag-box>._fd-drag-item:has(>._fd-drag-tool>.el-col-24,>.el-col-24){flex:none}._fd-cell .el-cascader,._fd-cell .el-date-editor,._fd-cell .el-input-number,._fd-cell .el-select,._fd-cell .el-slider,._fd-row{width:100%}._fd-hide-config{align-items:center;color:var(--fc-text-color-2);cursor:pointer;display:flex}._fd-hide-config .fc-icon{margin-right:3px}._fd-hide-config.active{color:var(--fc-style-color-1)}._fd-hide-config.disabled{color:var(--fc-text-color-3);cursor:not-allowed}._fd-span-input{width:100%}._fd-span-input .el-radio-button__inner{line-height:16px;padding:4px;width:100%}._fd-span-input .el-radio-button{flex:1}._fc-video-box,._fc-iframe-box{width:100%}._fc-city .el-select{width:150px}.form-create-m ._fc-city,.form-create-m ._fc-city .el-select{width:100%}.form-create ._fc-city .el-select+.el-select{margin-left:12px}._fc-title{font-size:16px;font-weight:600;margin-bottom:16px;margin-top:1em;width:100%}._fc-title.h1,._fc-title.h2{border-bottom:1px solid #eee;padding-bottom:.3em}._fc-title.h1{font-size:32px;line-height:1.2}._fc-title.h2{font-size:24px;line-height:1.225}._fc-title.h3{font-size:20px;line-height:1.43}._fc-title.h4{font-size:16px}._fc-title.h5{font-size:14px}._fc-title.h6{font-size:12px}._fc-markdown{-ms-text-size-adjust:100%;-webkit-text-size-adjust:100%;word-wrap:break-word;color-scheme:light;font-size:16px;line-height:1.5;margin:0;width:100%}._fc-markdown details,._fc-markdown figcaption,._fc-markdown figure{display:block}._fc-markdown summary{display:list-item}._fc-markdown [hidden]{display:none!important}._fc-markdown a{background-color:transparent;color:#0969da;text-decoration:none}._fc-markdown abbr[title]{border-bottom:none;-webkit-text-decoration:underline dotted;text-decoration:underline dotted}._fc-markdown b,._fc-markdown strong{font-weight:600}._fc-markdown dfn{font-style:italic}._fc-markdown h1{border-bottom:1px solid #d1d9e0b3;font-size:2em;font-weight:600;margin:.67em 0;padding-bottom:.3em}._fc-markdown mark{background-color:#fff8c5;color:#1f2328}._fc-markdown small{font-size:90%}._fc-markdown sub,._fc-markdown sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}._fc-markdown sub{bottom:-.25em}._fc-markdown sup{top:-.5em}._fc-markdown img{border-style:none;box-sizing:content-box;max-width:100%}._fc-markdown code,._fc-markdown kbd,._fc-markdown pre,._fc-markdown samp{font-family:monospace;font-size:1em}._fc-markdown figure{margin:1em 2.5rem}._fc-markdown hr{background:transparent;background-color:#d1d9e0;border:0;box-sizing:content-box;height:.25em;margin:1.5rem 0;overflow:hidden;padding:0}._fc-markdown input{font:inherit;font-family:inherit;font-size:inherit;line-height:inherit;margin:0;overflow:visible}._fc-markdown [type=button],._fc-markdown [type=reset],._fc-markdown [type=submit]{-webkit-appearance:button;appearance:button}._fc-markdown [type=checkbox],._fc-markdown [type=radio]{box-sizing:border-box;padding:0}._fc-markdown [type=number]::-webkit-inner-spin-button,._fc-markdown [type=number]::-webkit-outer-spin-button{height:auto}._fc-markdown [type=search]::-webkit-search-cancel-button,._fc-markdown [type=search]::-webkit-search-decoration{-webkit-appearance:none;appearance:none}._fc-markdown ::-webkit-input-placeholder{color:inherit;opacity:.54}._fc-markdown ::-webkit-file-upload-button{-webkit-appearance:button;appearance:button;font:inherit}._fc-markdown a:hover{text-decoration:underline}._fc-markdown ::placeholder{color:#59636e;opacity:1}._fc-markdown hr:after,._fc-markdown hr:before{content:"";display:table}._fc-markdown hr:after{clear:both}._fc-markdown table{border-collapse:collapse;border-spacing:0;display:block;font-variant:tabular-nums;max-width:100%;overflow:auto;width:max-content}._fc-markdown td,._fc-markdown th{padding:0}._fc-markdown details summary{cursor:pointer}._fc-markdown [role=button]:focus,._fc-markdown a:focus,._fc-markdown input[type=checkbox]:focus,._fc-markdown input[type=radio]:focus{box-shadow:none;outline:2px solid #0969da;outline-offset:-2px}._fc-markdown [role=button]:focus:not(:focus-visible),._fc-markdown a:focus:not(:focus-visible),._fc-markdown input[type=checkbox]:focus:not(:focus-visible),._fc-markdown input[type=radio]:focus:not(:focus-visible){outline:1px solid transparent}._fc-markdown [role=button]:focus-visible,._fc-markdown a:focus-visible,._fc-markdown input[type=checkbox]:focus-visible,._fc-markdown input[type=radio]:focus-visible{box-shadow:none;outline:2px solid #0969da;outline-offset:-2px}._fc-markdown a:not([class]):focus,._fc-markdown a:not([class]):focus-visible,._fc-markdown input[type=checkbox]:focus,._fc-markdown input[type=checkbox]:focus-visible,._fc-markdown input[type=radio]:focus,._fc-markdown input[type=radio]:focus-visible{outline-offset:0}._fc-markdown kbd{background-color:#f6f8fa;border:1px solid #d1d9e0b3;border-radius:6px;box-shadow:inset 0 -1px #d1d9e0b3;color:#1f2328;display:inline-block;font:11px ui-monospace,SFMono-Regular,SF Mono,Menlo,Consolas,Liberation Mono,monospace;line-height:10px;padding:.25rem;vertical-align:middle}._fc-markdown h1,._fc-markdown h2,._fc-markdown h3,._fc-markdown h4,._fc-markdown h5,._fc-markdown h6{font-weight:600;line-height:1.25;margin-bottom:1rem;margin-top:1.5rem}._fc-markdown h2{border-bottom:1px solid #d1d9e0b3;font-size:1.5em;font-weight:600;padding-bottom:.3em}._fc-markdown h3{font-size:1.25em;font-weight:600}._fc-markdown h4{font-size:1em;font-weight:600}._fc-markdown h5{font-size:.875em;font-weight:600}._fc-markdown h6{color:#59636e;font-size:.85em;font-weight:600}._fc-markdown p{margin-bottom:10px;margin-top:0}._fc-markdown blockquote{border-left:.25em solid #d1d9e0;color:#59636e;margin:0;padding:0 1em}._fc-markdown ol,._fc-markdown ul{margin-bottom:0;margin-top:0;padding-left:2em}._fc-markdown ol ol,._fc-markdown ul ol{list-style-type:lower-roman}._fc-markdown ol ol ol,._fc-markdown ol ul ol,._fc-markdown ul ol ol,._fc-markdown ul ul ol{list-style-type:lower-alpha}._fc-markdown dd{margin-left:0}._fc-markdown code,._fc-markdown pre,._fc-markdown samp,._fc-markdown tt{font-family:ui-monospace,SFMono-Regular,SF Mono,Menlo,Consolas,Liberation Mono,monospace;font-size:12px}._fc-markdown pre{word-wrap:normal;margin-bottom:0;margin-top:0}._fc-markdown input::-webkit-inner-spin-button,._fc-markdown input::-webkit-outer-spin-button{appearance:none;margin:0}._fc-markdown:after,._fc-markdown:before{content:"";display:table}._fc-markdown:after{clear:both}._fc-markdown>:first-child{margin-top:0!important}._fc-markdown>:last-child{margin-bottom:0!important}._fc-markdown a:not([href]){color:inherit;text-decoration:none}._fc-markdown blockquote,._fc-markdown details,._fc-markdown dl,._fc-markdown ol,._fc-markdown p,._fc-markdown pre,._fc-markdown table,._fc-markdown ul{margin-bottom:1rem;margin-top:0}._fc-markdown blockquote>:first-child{margin-top:0}._fc-markdown blockquote>:last-child{margin-bottom:0}._fc-markdown h1:hover .anchor,._fc-markdown h2:hover .anchor,._fc-markdown h3:hover .anchor,._fc-markdown h4:hover .anchor,._fc-markdown h5:hover .anchor,._fc-markdown h6:hover .anchor{text-decoration:none}._fc-markdown h1 code,._fc-markdown h1 tt,._fc-markdown h2 code,._fc-markdown h2 tt,._fc-markdown h3 code,._fc-markdown h3 tt,._fc-markdown h4 code,._fc-markdown h4 tt,._fc-markdown h5 code,._fc-markdown h5 tt,._fc-markdown h6 code,._fc-markdown h6 tt{font-size:inherit;padding:0 .2em}._fc-markdown summary h1,._fc-markdown summary h2,._fc-markdown summary h3,._fc-markdown summary h4,._fc-markdown summary h5,._fc-markdown summary h6{display:inline-block}._fc-markdown summary h1,._fc-markdown summary h2{border-bottom:0;padding-bottom:0}._fc-markdown ol.no-list,._fc-markdown ul.no-list{list-style-type:none;padding:0}._fc-markdown ol[type="a s"]{list-style-type:lower-alpha}._fc-markdown ol[type="A s"]{list-style-type:upper-alpha}._fc-markdown ol[type="i s"]{list-style-type:lower-roman}._fc-markdown ol[type="I s"]{list-style-type:upper-roman}._fc-markdown div>ol:not([type]),._fc-markdown ol[type="1"]{list-style-type:decimal}._fc-markdown ol ol,._fc-markdown ol ul,._fc-markdown ul ol,._fc-markdown ul ul{margin-bottom:0;margin-top:0}._fc-markdown li>p{margin-top:1rem}._fc-markdown li+li{margin-top:.25em}._fc-markdown dl{padding:0}._fc-markdown dl dt{font-size:1em;font-style:italic;font-weight:600;margin-top:1rem;padding:0}._fc-markdown dl dd{margin-bottom:1rem;padding:0 1rem}._fc-markdown table th{font-weight:600}._fc-markdown table td,._fc-markdown table th{border:1px solid #d1d9e0;padding:6px 13px}._fc-markdown table td>:last-child{margin-bottom:0}._fc-markdown table tr{background-color:#fff;border-top:1px solid #d1d9e0b3}._fc-markdown table tr:nth-child(2n){background-color:#f6f8fa}._fc-markdown table img{background-color:transparent}._fc-markdown img[align=right]{padding-left:20px}._fc-markdown img[align=left]{padding-right:20px}._fc-markdown .emoji{background-color:transparent;max-width:none;vertical-align:text-top}._fc-markdown span.frame{display:block;overflow:hidden}._fc-markdown span.frame>span{border:1px solid #d1d9e0;display:block;float:left;margin:13px 0 0;overflow:hidden;padding:7px;width:auto}._fc-markdown span.frame span img{display:block;float:left}._fc-markdown span.frame span span{clear:both;color:#1f2328;display:block;padding:5px 0 0}._fc-markdown span.align-center{clear:both;display:block;overflow:hidden}._fc-markdown span.align-center>span{display:block;margin:13px auto 0;overflow:hidden;text-align:center}._fc-markdown span.align-center span img{margin:0 auto;text-align:center}._fc-markdown span.align-right{clear:both;display:block;overflow:hidden}._fc-markdown span.align-right>span{display:block;margin:13px 0 0;overflow:hidden;text-align:right}._fc-markdown span.align-right span img{margin:0;text-align:right}._fc-markdown span.float-left{display:block;float:left;margin-right:13px;overflow:hidden}._fc-markdown span.float-left span{margin:13px 0 0}._fc-markdown span.float-right{display:block;float:right;margin-left:13px;overflow:hidden}._fc-markdown span.float-right>span{display:block;margin:13px auto 0;overflow:hidden;text-align:right}._fc-markdown code,._fc-markdown tt{background-color:#818b981f;border-radius:6px;font-size:85%;margin:0;padding:.2em .4em;white-space:break-spaces}._fc-markdown code br,._fc-markdown tt br{display:none}._fc-markdown del code{text-decoration:inherit}._fc-markdown samp{font-size:85%}._fc-markdown pre code{font-size:100%}._fc-markdown pre>code{background:transparent;border:0;margin:0;padding:0;white-space:pre;word-break:normal}._fc-markdown .highlight{margin-bottom:1rem}._fc-markdown .highlight pre{margin-bottom:0;word-break:normal}._fc-markdown .highlight pre,._fc-markdown pre{background-color:#f6f8fa;border-radius:6px;color:#1f2328;font-size:85%;line-height:1.45;overflow:auto;padding:1rem}._fc-markdown pre code,._fc-markdown pre tt{word-wrap:normal;background-color:transparent;border:0;display:inline;line-height:inherit;margin:0;max-width:auto;overflow:visible;padding:0}._fc-markdown [data-footnote-ref]:before{content:"["}._fc-markdown [data-footnote-ref]:after{content:"]"}._fc-markdown [role=button]:focus:not(:focus-visible),._fc-markdown [role=tabpanel][tabindex="0"]:focus:not(:focus-visible),._fc-markdown a:focus:not(:focus-visible),._fc-markdown button:focus:not(:focus-visible),._fc-markdown summary:focus:not(:focus-visible){box-shadow:none;outline:none}._fc-markdown [tabindex="0"]:focus:not(:focus-visible),._fc-markdown details-dialog:focus:not(:focus-visible){outline:none}._fc-markdown g-emoji{display:inline-block;font-family:Apple Color Emoji,Segoe UI Emoji,Segoe UI Symbol;font-size:1em;font-style:normal!important;font-weight:400;line-height:1;min-width:1ch;vertical-align:-.075em}._fc-markdown g-emoji img{height:1em;width:1em}._fc-markdown .task-list-item{list-style-type:none}._fc-markdown .task-list-item label{font-weight:400}._fc-markdown .task-list-item.enabled label{cursor:pointer}._fc-markdown .task-list-item+.task-list-item{margin-top:.25rem}._fc-markdown .task-list-item .handle{display:none}._fc-markdown .task-list-item-checkbox{margin:0 .2em .25em -1.4em;vertical-align:middle}._fc-markdown ul:dir(rtl) .task-list-item-checkbox{margin:0 -1.6em .25em .2em}._fc-markdown ol:dir(rtl) .task-list-item-checkbox{margin:0 -1.6em .25em .2em}._fc-signature{width:100%}._fc-signature-btn,._fc-signature-preview{background:#fff;border:1px dashed #d4d7e0;border-radius:4px;box-sizing:border-box;color:#c9ccd8;font-size:14px;height:88px;line-height:88px;min-width:160px;position:relative;text-align:center;width:100%}._fc-signature-btn{cursor:pointer}._fc-signature-preview>img{display:inline-block;height:88px}._fc-signature-preview .icon-delete2{cursor:pointer;display:inline-block;font-size:14px;line-height:14px;position:absolute;right:9px;top:9px}._fc-signature-btn i{font-size:14px}._fc-signature-dialog .el-dialog__body{text-align:center}._fc-signature-pad{background-image:linear-gradient(#fff 14px,transparent 0),linear-gradient(90deg,#fff 14px,#d4d7e0 0);background-size:15px 15px;border:1px dashed #d4d7e0;border-radius:4px}._fd-data-select{width:100%}._fd-data-select>.el-dialog{margin:10px;width:calc(100% - 20px)}._fc-data-select-pop{display:none!important}._fc-data-select{width:100%}._fc-echarts{height:300px;width:100%}:root{--fc-drag-empty:"\\62d6\\62fd\\5de6\\4fa7\\5217\\8868\\4e2d\\7684\\7ec4\\4ef6\\5230\\6b64\\5904";--fc-child-empty:"\\70b9\\51fb\\53f3\\4e0b\\89d2 \\e789 \\6309\\94ae\\6dfb\\52a0\\4e00\\5217";--fc-text-color-1:#262626;--fc-text-color-2:#666;--fc-text-color-3:#aaa;--fc-bg-color-1:#fff;--fc-bg-color-2:#f5f5f5;--fc-bg-color-3:#ececec;--fc-line-color-1:#ddd;--fc-line-color-2:#d9d9d9;--fc-line-color-3:#ececec;--fc-style-color-1:#2e73ff;--fc-style-bg-color-1:rgba(46,115,255,.05);--fc-style-color-2:#00c050;--fc-style-bg-color-2:rgba(0,192,80,.05);--fc-style-color-3:#ff2e2e;--fc-style-bg-color-3:rgba(255,46,46,.05);--fc-style-color-4:#4efdb7;--fc-style-bg-color-4:rgba(78,253,183,.05);--fc-grid-line-color:rgba(0,0,0,.05)}html.dark{--fc-text-color-1:#e5eaf3;--fc-text-color-2:#cfd3dc;--fc-text-color-3:#6c6e72;--fc-bg-color-1:#0a0a0a;--fc-bg-color-2:#191919;--fc-bg-color-3:#2b2b2c;--fc-line-color-1:#393a3c;--fc-line-color-2:#636466;--fc-line-color-3:#2b2b2c;--fc-grid-line-color:hsla(0,0%,100%,.15)}._fc-designer,._fd-config-dialog{--el-color-primary:#2e73ff;--el-color-primary-light-3:#69f;--el-color-primary-light-5:#9bf;--el-color-primary-light-7:#ccdfff;--el-color-primary-light-8:#e0ebff;--el-color-primary-light-9:#ccdfff;--el-color-primary-dark-2:#265fcc;--el-color-success:#00c050;--el-color-success-light-3:#4ddb82;--el-color-success-light-5:#80e6a3;--el-color-success-light-7:#b3f1c5;--el-color-success-light-8:#ccf6d5;--el-color-success-light-9:#e6fae6;--el-color-success-dark-2:#00a046;--el-color-danger:#ff2e2e;--el-color-danger-light-3:#f66;--el-color-danger-light-5:#f99;--el-color-danger-light-7:#fcc;--el-color-danger-light-8:#ffd9d9;--el-color-danger-light-9:#ffe6e6;--el-color-danger-dark-2:#cc2626;--el-menu-hover-bg-color:var(--el-color-primary-light-9)}._fc-designer .el-button--primary,._fd-config-dialog .el-button--primary{--el-button-bg-color:var(--el-color-primary);--el-button-text-color:var(--el-color-white);--el-button-border-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-color-primary-light-3);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-border-color:var(--el-color-primary-light-3);--el-button-active-bg-color:var(--el-color-primary-dark-2);--el-button-active-border-color:var(--el-color-primary-dark-2)}._fc-designer .el-button--primary.is-plain,._fd-config-dialog .el-button--primary.is-plain{--el-button-bg-color:var(--el-color-primary-light-8);--el-button-text-color:var(--el-color-primary);--el-button-border-color:var(--el-color-primary-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-primary);--el-button-hover-border-color:var(--el-color-primary);--el-button-active-bg-color:var(--el-color-primary-dark-2);--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:var(--el-color-primary-dark-2)}._fc-designer .el-button--primary.is-link,._fd-config-dialog .el-button--primary.is-link{--el-button-text-color:var(--el-color-primary)}._fc-designer .el-button--success,._fd-config-dialog .el-button--success{--el-button-bg-color:var(--el-color-success);--el-button-text-color:var(--el-color-white);--el-button-border-color:var(--el-color-success);--el-button-hover-bg-color:var(--el-color-success-light-3);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-border-color:var(--el-color-success-light-3);--el-button-active-bg-color:var(--el-color-success-dark-2);--el-button-active-border-color:var(--el-color-success-dark-2)}._fc-designer .el-button--success.is-plain,._fd-config-dialog .el-button--success.is-plain{--el-button-bg-color:var(--el-color-success-light-8);--el-button-text-color:var(--el-color-success);--el-button-border-color:var(--el-color-success-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-success);--el-button-hover-border-color:var(--el-color-success);--el-button-active-bg-color:var(--el-color-success-dark-2);--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:var(--el-color-primary-dark-2)}._fc-designer .el-button--success.is-link,._fd-config-dialog .el-button--success.is-link{--el-button-text-color:var(--el-color-success)}._fc-designer .el-button--danger,._fd-config-dialog .el-button--danger{--el-button-bg-color:var(--el-color-danger);--el-button-text-color:var(--el-color-white);--el-button-border-color:var(--el-color-danger);--el-button-hover-bg-color:var(--el-color-danger-light-3);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-border-color:var(--el-color-danger-light-3);--el-button-active-bg-color:var(--el-color-danger-dark-2);--el-button-active-border-color:var(--el-color-danger-dark-2)}._fc-designer .el-button--danger.is-plain,._fd-config-dialog .el-button--danger.is-plain{--el-button-bg-color:var(--el-color-danger-light-8);--el-button-text-color:var(--el-color-danger);--el-button-border-color:var(--el-color-danger-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-danger);--el-button-hover-border-color:var(--el-color-danger);--el-button-active-bg-color:var(--el-color-danger-dark-2);--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:var(--el-color-primary-dark-2)}._fc-designer .el-button--danger.is-link,._fd-config-dialog .el-button--danger.is-link{--el-button-text-color:var(--el-color-danger)}._fd-plain-button{border-color:var(--fc-style-color-1);color:var(--fc-style-color-1)}._fc-designer .CodeMirror-gutters,._fd-config-dialog .CodeMirror-gutters{background-color:var(--fc-bg-color-3);border-right-color:var(--fc-line-color-2)}._fc-designer .CodeMirror-scroll,._fd-config-dialog .CodeMirror-scroll{background-color:var(--fc-bg-color-2);caret-color:var(--fc-text-color-1);color:var(--fc-text-color-1)}._fd-config-dialog .CodeMirror-scroll{background-color:var(--el-bg-color)}._fc-designer{--fc-tool-border-color:var(--fc-line-color-1);background-color:var(--fc-bg-color-1);cursor:default;height:100%;min-height:500px;overflow:hidden;position:relative}._fc-designer>.el-main{bottom:0;left:0;padding:0;position:absolute;right:0;top:0}._fc-l-menu{border-right:1px solid var(--fc-line-color-3);border-top:1px solid var(--fc-line-color-3);flex-direction:column}._fc-l-menu,._fc-l-menu-item{align-items:center;display:flex}._fc-l-menu-item{box-sizing:border-box;cursor:pointer;height:40px;justify-content:center;width:100%}._fc-l-menu-item.active{color:var(--fc-style-color-1)}._fc-l-menu-form{border-bottom:1px solid var(--fc-line-color-3)}._fc-l-menu-item i{font-size:22px}._fc-l-menu-item i:hover{color:var(--fc-style-color-1)}._fc-l-menu-item .el-badge__content{--el-badge-size:15px;--el-badge-padding:4px;background-color:var(--fc-style-color-1)}._fc-l-label{color:var(--fc-text-color-1);font-size:14px;font-weight:500;line-height:17px;margin-top:5px;padding:10px 12px}._fc-l-info{color:var(--fc-text-color-3);font-size:12px;font-style:normal;font-weight:400;line-height:17px;text-align:left}._fc-l-global,._fc-l-info{padding:0 12px}._fc-l-global ._fc-l-label{font-size:12px;font-weight:400;margin-bottom:8px;margin-top:14px;padding:0}._fc-m .form-create>.el-row>._fd-drag-box{align-content:flex-start;align-items:flex-start;box-sizing:border-box;display:flex;flex-wrap:wrap;justify-content:flex-start;position:relative;width:100%}._fc-m .form-create .el-col-24._fd-drag-box{align-content:flex-start;display:flex;flex-direction:row;flex-wrap:wrap}._fc-m .form-create ._fc-field-node,._fc-m .form-create ._fc-l-item,._fc-m .form-create-m ._fc-field-node,._fc-m .form-create-m ._fc-l-item{align-items:center;background:var(--fc-bg-color-2);border:1px dashed #000;border-radius:4px;color:var(--fc-text-color-1);display:flex!important;height:30px;justify-content:center;margin:5px 0;overflow:hidden;padding-bottom:0;transition:all .3s ease;width:calc(100% - 2px)}._fc-m .form-create ._fc-l-item.is-inline,._fc-m .form-create-m ._fc-l-item.is-inline{box-sizing:border-box;display:inline-flex!important;vertical-align:top;width:100px}._fc-m .form-create ._fc-field-node .fc-icon,._fc-m .form-create ._fc-l-item ._fc-l-icon,._fc-m .form-create-m ._fc-field-node .fc-icon,._fc-m .form-create-m ._fc-l-item ._fc-l-icon{display:inline-block!important;font-size:21px;padding:0 4px}._fc-m .form-create ._fc-field-node ._fc-field-node-label>span,._fc-m .form-create ._fc-l-item ._fc-l-name,._fc-m .form-create-m ._fc-field-node ._fc-field-node-label>span,._fc-m .form-create-m ._fc-l-item ._fc-l-name{display:inline-block!important;font-size:12px}._fc-m .form-create ._fc-field-node ._fc-field-node-label,._fc-m .form-create-m ._fc-field-node ._fc-field-node-label{align-items:center;display:flex!important}._fc-l,._fc-m,._fc-r{border-top:1px solid var(--fc-line-color-3);box-sizing:border-box;overflow:unset;position:relative}._fc-l-close,._fc-l-open,._fc-r-close,._fc-r-open{align-items:center;background:var(--fc-bg-color-1);border-radius:0 5px 5px 0;cursor:pointer;display:flex;height:46px;justify-content:center;position:absolute;right:-12px;top:50%;width:12px;z-index:1}._fc-l-open{left:0;right:unset}._fc-r-close{left:-12px;right:unset}._fc-r-close,._fc-r-open{border-radius:5px 0 0 5px}._fc-r-open{right:0}._fc-l-close>i,._fc-r-open>i{display:block;font-size:9px;transform:rotate(-90deg)}._fc-l-open>i,._fc-r-close>i{display:block;font-size:9px;transform:rotate(90deg)}._fc-r-tab-props{padding:0 20px}._fc-r-title{color:var(--fc-text-color-1);font-size:12px;margin:15px 0 5px}._fc-r-config{display:grid;grid-template-areas:"a" "b" "c" "d" "e" "f" "g";grid-template-columns:280px}._fc-r-name-input .el-input-group__append{color:var(--fc-text-color-3);cursor:pointer;margin:0;padding:0;width:25px}._fc-r-name-input .icon-group{cursor:pointer}._fc-r-name-input .icon-group:hover{color:var(--fc-style-color-1)}._fc-r .el-main{padding-bottom:100px}._fc-l>.el-container{height:100%}._fc-l .el-main{padding:0}._fc-l .el-tree-node__label{color:#333;font-weight:400;padding:3px}._fc-l .el-tree-node__content{height:30px;margin:5px 5px 0}._fc-l .el-tree-node__content>.el-tree-node__expand-icon{color:#333}._fc-l .el-tree-node__expand-icon.is-leaf{color:transparent}@keyframes a{0%{transform:rotate(0)}to{transform:rotate(1turn)}}._fc-loading{animation:a 2s linear infinite}._fc-struct-tree{color:var(--fc-text-color-1)}._fc-tree-node{align-items:center;display:flex;height:26px;justify-content:space-between;line-height:26px;padding-right:5px;width:100%}._fc-struct-tree .el-tree-node__content:hover{background-color:var(--fc-style-bg-color-1);color:var(--fc-style-color-1)!important}._fc-tree-node.active,._fc-tree-node.active .icon-more{color:var(--fc-style-color-1)}._fc-tree-label{align-items:center;display:flex}._fc-tree-label>i{font-weight:400;margin-right:2px}._fc-tree-more{align-items:center;display:flex;padding:0 15px}._fc-tree-more .icon-more{font-weight:700}._fc-l-tabs,._fc-r-tabs{border-bottom:1px solid var(--fc-line-color-3);padding:0 10px;position:relative;width:100%}._fc-l-tab,._fc-r-tab{box-sizing:border-box;color:var(--fc-text-color-1);cursor:pointer;display:inline-block;font-size:14px;font-weight:400;height:40px;line-height:40px;list-style:none;margin:0 10px;position:relative;text-align:center}._fc-l ._fc-l-tab.active{border-bottom:2px solid var(--fc-style-color-1);color:var(--fc-style-color-1)}._fc-l-group{border:1px solid var(--fc-line-color-2);margin:12px;padding:0;user-select:none}._fc-l-group ._fc-l-list{align-items:stretch;display:grid;grid-template-columns:repeat(3,1fr)}._fc-l-group.is-template ._fc-l-list{grid-column-gap:5px;align-items:stretch;display:grid;grid-template-columns:repeat(2,1fr);padding:0 7px}._fc-l-group.is-template ._fc-l-item{background:var(--fc-bg-color-2);height:30px;line-height:28px;margin-bottom:5px;overflow:hidden;padding-bottom:0;text-overflow:ellipsis;white-space:nowrap}._fc-l-group.is-template ._fc-l-item:hover{background:var(--fc-style-color-1)}._fc-l-title{align-items:center;cursor:pointer;display:flex;font-weight:600;justify-content:space-between;margin:0;padding:12px}._fc-l-title,._fc-l-title i{font-size:14px}._fc-l-title i.down{transform:rotate(90deg)}._fc-l-item{background:var(--fc-bg-color-1);color:var(--fc-text-color-1);cursor:pointer;display:inline-block;line-height:1;padding-bottom:10px;text-align:center;transition:all .2s ease}._fc-l-item i{display:inline-block;font-size:21px}._fc-l-item ._fc-l-name{font-size:12px}._fc-l-item ._fc-l-icon{padding:10px 5px 12px}._fc-l-item:hover{background:var(--fc-style-color-1);color:#fff}._fc-m-tools{border:1px solid var(--fc-line-color-3);border-top:0;height:40px;justify-content:space-between;padding:0 10px;white-space:nowrap}._fc-m-tools,._fc-m-tools-l,._fc-m-tools-r{align-items:center;display:flex}._fc-m-tools-r{overflow:auto}._fc-m-menus{display:flex;flex-direction:row}._fc-m-menus .fc-icon{cursor:pointer;width:18px}._fc-m-menus .fc-icon.active{color:var(--fc-style-color-1)}._fc-m-menus>*+*{margin-left:5px}._fc-m-tools .line{background:var(--fc-line-color-3);height:24px;margin:0 10px;width:1px}._fc-m-tools .el-button{align-items:center;border-radius:5px;display:flex;padding:5px 10px}._fc-m-tools .el-button>span{align-items:center;display:inline-flex;justify-content:center}._fc-m-tools .el-button+.el-button,._fc-m-tools .el-dropdown{margin-left:10px}._fc-m-tools ._fd-m-extend{background-color:var(--fc-bg-color-3);border-color:var(--fc-line-color-1);border-radius:5px;color:#666;padding:5px}._fc-m-tools ._fd-m-extend .fc-icon{margin-right:0}._fc-m-tools ._fd-input-btn{align-items:center;display:flex;font-size:12px;justify-content:space-between}._fc-m-tools ._fd-input-btn .icon-check{color:#67c23a;font-size:18px}._fc-m-tools-r .fc-icon{font-size:14px;margin-right:2px}._fc-m-tools-l .fc-icon{cursor:pointer;font-size:18px}._fc-m-tools-l .fc-icon+.fc-icon{margin-left:10px}._fc-m-tools-l .fc-icon.disabled{color:var(--fc-text-color-3);cursor:not-allowed}._fc-r .el-tabs__nav-wrap:after{background-color:var(--fc-bg-color-3);height:1px}._fc-r .el-button,._fc-r .el-checkbox,._fc-r .el-radio-button__inner,._fc-r .el-table__cell .cell{font-weight:400}._fc-r ._fc-r-tab.active{border-bottom:2px solid var(--fc-style-color-1);color:var(--fc-style-color-1)}._fc-m-con{background:var(--fc-bg-color-2);padding:20px;position:relative}._fc-m-drag.mobile,._fc-m-drag.pad{border:10px solid #000;border-radius:25px}._fc-m-drag{box-sizing:border-box;margin:0 auto;overflow:auto;padding:2px}._fc-m-drag._fc-grid-line{--van-cell-background:transparent;background-image:linear-gradient(to right,var(--fc-grid-line-color) 1px,transparent 1px),linear-gradient(to bottom,var(--fc-grid-line-color) 1px,transparent 1px);background-repeat:repeat;background-size:16px 16px}._fc-m-input{padding:5px 5px 80px}._fc-m-input-handle{background:var(--fc-bg-color-1);bottom:0;box-shadow:0 2px 10px #0000000d;left:0;margin:20px;padding:12px;position:absolute;right:0;text-align:center;z-index:3}._fc-m-input-handle>.el-button{font-size:13px}._fc-m-drag.mobile{width:400px}._fc-m-drag.pad{width:770px}._fc-m-drag,.draggable-drag{background-color:var(--fc-bg-color-1);height:100%;position:relative}._fc-m-drag>form,._fc-m-drag>form>.el-row,._fc-m-drag>form>.van-row{height:100%}._fc-m-drag>form>.el-row>._fd-drag-tool,._fc-m-drag>form>.van-row>._fd-drag-tool{width:100%}._fd-fcDialog-drag,._fd-fcDrawer-drag{padding:3px}._fc-m-drag>form>.van-row{flex-direction:column}._fc-m-drag .el-tree{width:100%}._fd-drag-box{height:100%;min-height:80px;transition:padding-bottom,padding-top .3s ease;width:100%}._fd-drag-box ._fd-drag-box{outline:1px dashed var(--fc-line-color-1)}._fd-drag-tool>._fd-drag-box{outline:none}._fd-drag-box>div[data-draggable]{margin-bottom:1px}._fc-r ._fc-group-container+._fc-group-container{margin-top:20px}._fc-r ._fc-group-container{margin:0;padding:10px}._fc-r ._fc-group-handle{right:15px}._fc-r .el-form-item{margin-bottom:10px!important}._fc-r .el-form-item__label{color:var(--fc-text-color-1)}.cm-fc-field,.cm-fc-id{background-color:var(--fc-style-color-1);border-radius:5px;color:#fff;display:inline-block;line-height:1.5em;padding:0 8px}.cm-fc-id{background-color:#df2121}.CodeMirror-widget+.CodeMirror-widget{margin-left:5px}._fc-tabs .el-tabs__item{font-weight:400}._fc-tabs .el-tabs__nav-scroll{padding:0 15px}._fc-tabs .el-tab-pane{width:100%}._fc-tabs .el-tabs__nav-wrap:after{height:1px}.form-create .fc-none{display:none}._fc-child-empty,._fd-draggable-drag.drag-holder,._fd-elCard-drag.drag-holder,._fd-elCollapseItem-drag.drag-holder,._fd-elTabPane-drag.drag-holder,._fd-elTooltip-drag.drag-holder,._fd-fcDialog-drag.drag-holder,._fd-fcDrawer-drag.drag-holder,._fd-fcInlineForm-drag.drag-holder,._fd-group-drag.drag-holder,._fd-stepFormItem-drag.drag-holder,._fd-subForm-drag.drag-holder,._fd-tableFormColumn-drag.drag-holder,._fd-tableFormColumn2-drag.drag-holder{background:var(--fc-bg-color-2) url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAOYAAAAMCAMAAABBazFtAAAA1VBMVEX///8uLi5wcHBDQ0P7+/v4+PhaWlpNTU3x8fHR0dH9/f1dXV0jIyPb29ucnJxSUlJLS0s7Ozvm5ubOzs5hYWH19fXIyMh9fX0+Pj5WVlbu7u6vr69ra2s1NTXj4+O8vLx0dHTX19fDw8OOjo6Hh4d5eXlISEg4ODi5ubkyMjLU1NSjo6Ofn5/r6+u0tLSLi4sWFharq6uEhITFxcXAwMCnp6eBgYGxsbFmZmbz8/OXl5eTk5MAAAANDQ23t7ccHBzd3d3Hx8cqKiro6OjKysrf39+QkJAsSMNaAAAFiElEQVRIx+WV17aaUBRFF016BymiiFLECrZrN5ry/58UjrnGkfKSPOQl0+E+e6Asz9SN4Gc+sCCEZOlx+AmX+7WTAFYAuOaJ8JmC38HiRyT2cVQCrNdBTiLl15TZ7HUW+8r7NRXhHr+hI7/TYQVB0DtNkcDbEMZFPJZEXe/Uuq7TIGgaqa9O3fJVfGHHDjBKAZgcCOP82zZ1vfUlCAIPwN4E1yUGu9aDISCrjrVwyvMNoBB/+fLlCMROFc/pbmW9UhrcdrvtBU1JAKzoj48XvI9d9hj51RHDGqzO8xcgXQBYvgGIed5LeF7Hk4+2vTsMI9u27Ip5UInCiSonueddOVfVFmknDH1gEUW+GUVbsBRFVVVTZupUsZDlbQcfD7Td71d0fxVT1PlKNUxs+Va04mRcADikjeGcbF4kjHSgVJ04mH+QwO7v+9rcbCqg25nBr20WrxQAn6PdKYrMIjqAw4C2DLBA8LnrUvW46WZlHJrq4gC4+fRdczr9yNwysu0ndts5LqL2J9g77AMJcMSOA9Q+TVccO1gsUkaWKUBcrfr91coG3CH5NSMO4Zj6FGKoOdiUyjCO75fYAkSF+xZMT7UWwxsFwFGz5rjJIvEIy54O3AfBfIgG7XpSViYsHSjqWmXQ8EohWKpyU/1a5VCwD81jjeBGWfxzTCd9TFIAXPjUVHzmdvXPL03F68qB712hThJPTpJkqg5LPqvp0Yji1G7a/vRGTS4cGenjsSksYNw0bS0Dq+Zb7vjq+9CqajlWJbil0kxld9xo+mFr/UEtgN0SlxnonTRbE1ZEs5Ll41nhKxX1KYHpbr4A3aNzKAyGObxSCAYd5RGTlTbo20PTsBDo8uZ85u+TgSF/yAWo/HZgGAnDXO9MwKqiuKtFZj3DEwp5Mk+bZZAFVZZRfDaQBJ8dp90oZdd0L+wOla0vrmTZP518WR7caJ73/TtPt5GdWnuxuDlApzjw3ax/Zmemo8/nc15sNJ1Ri7nyETayZN05SLKGqR4EMoimovZG29z1wRXnPDkeCwtgMD8w6AzxSiEYg2aamSNtI86IZmgC/EAV+FzgLaALOjcMw22692uzl9EnJzO72eSluZKlgblRACnX0KNcIA7OLY+/Mv4n0XP6ZkzVugi4/Hab74F9r+eUjNPr7Ve6efHC9lCZLMtICq+Wt8Hmra13Oh2DaM6Y1of0zRE5DrsaW5Z10W8DXaLpVrQ5meyyA4ZTqvfRvfYB7qwzE59ovlLkqhIMuk/TO4e3wZVEczgFCrpKnEnWAsnbM9a6hZemtaXqGdfzjBpP7jsB0upCNNcRUz78XQZ0QovpGhh48839YAiw+JGmxXkP4LaZpi09DlvLdNeBt+RDMrS4lAEa2mTclEazlfqtD7PTHE2KIUEbAuhHi4VCNNUWZy7X8ak5laWAN8UXsHIAmETzlUIwBNmetVTaBrRRo7lxAQrmaCmcLkRuE4o+FZJu/vmhOUuZbTE3tsrgdW2OHigA+3lIpSXdiHxUZDmhJ3kbGA4FtThW1lpZQdOaT18PqC+km5YrwHQBjMnQphi39GIjAe0MAN1oRp+44Is+NS3Y58kkjU4keTweJxB1aAvONFdUEOzJlg/FbNMN0w7wmSeaz5Sn5jI3mN7Obm4th2BeNLeWxIAZ1XxQfsD+5IxpqnvgwJ1l96GJQaYy86Vq4jvl4gEFUQmOAthJGSLxenHY71xYrjBtxtlOl9OeRf6mgd5soDadBiSfAIZoJjtcyvUotyFkW+CTB4lnBNg0sBuqGC0Q01stTkYevsHfp5h+5vwsF6GlQGHpjewm3QrAm0Y0XymElvCoSvi5/44mviGP6A3aAdxJbL6x7iIHOwXeNf1+MWf6Cv4M6W/eIuGfIr0vz/Xx+J/4CrqNrFdzXxZoAAAAAElFTkSuQmCC);background-size:0;min-height:90px;position:relative}._fc-child-empty:after,._fd-draggable-drag.drag-holder:after,._fd-elCard-drag.drag-holder:after,._fd-elCollapseItem-drag.drag-holder:after,._fd-elTabPane-drag.drag-holder:after,._fd-elTooltip-drag.drag-holder:after,._fd-fcDialog-drag.drag-holder:after,._fd-fcDrawer-drag.drag-holder:after,._fd-fcInlineForm-drag.drag-holder:after,._fd-group-drag.drag-holder:after,._fd-stepFormItem-drag.drag-holder:after,._fd-subForm-drag.drag-holder:after,._fd-tableFormColumn-drag.drag-holder:after,._fd-tableFormColumn2-drag.drag-holder:after{align-items:center;bottom:0;color:var(--fc-text-color-3);content:var(--fc-drag-empty);display:flex;font-size:12px;justify-content:center;left:0;position:absolute;right:0;top:0}._fc-designer ._fc-m-drag ._fd-draggable-drag{overflow:auto;padding:2px 2px 100px}._fc-m-drag._fd-drop-hover ._fd-draggable-drag{padding-top:20px}._fd-draggable-drag.drag-holder{background-color:var(--fc-bg-color-1)}._fd-draggable-drag.drag-holder:after{font-size:16px}._fd-drag-item{width:100%}._fd-drag-item.is-inline{display:inline;vertical-align:top;width:auto}._fd-drag-item.is-inline>div{vertical-align:top}._fc-child-empty:after{content:var(--fc-child-empty);font-family:fc-icon!important}.fc-configured{color:var(--fc-text-color-3);margin-left:5px}._fc-manage-text{color:var(--fc-style-color-1);cursor:pointer;margin-left:4px}._fc-message-tip{background-color:var(--fc-bg-color-1);border-color:#fff;border-radius:8px;box-shadow:0 6px 16px #00000014,0 3px 6px -4px #0000001f,0 9px 28px 8px #0000000d;padding:9px 13px;top:16px;z-index:4}._fc-message-tip>.el-icon{font-size:18px}._fc-message-tip .el-message__content{color:var(--fc-text-color-1);font-size:14px}._fd-preview-copy{align-items:center;background:var(--fc-style-bg-color-1);border-radius:10px;color:var(--fc-style-color-1);cursor:pointer;display:flex;height:28px;justify-content:center;position:absolute;right:35px;top:65px;width:28px}._fd-preview-dialog{border-radius:6px;min-height:40%;padding-top:0}._fd-preview-dialog>.el-dialog__header{float:right;position:absolute;right:0;top:0;z-index:2}._fd-preview-code{margin-top:0;max-height:510px;overflow:auto}._fd-preview-tabs .el-tabs__nav-wrap:after{background-color:var(--fc-line-color-3);height:1px}._fd-preview-tabs .el-tabs__item{height:46px}._fd-preview-code>code{white-space:pre-wrap}._fd-preview-device{align-items:center;display:flex;position:absolute;right:50px;top:9px}._fd-preview-device>div{align-items:center;border-radius:3px;cursor:pointer;height:28px;margin-right:10px;width:76px}._fd-preview-device>div,._fd-preview-mobile{display:flex;justify-content:center}._fd-preview-mobile>div{border:6px solid #000;border-radius:24px;box-sizing:border-box;height:70vh;overflow:auto;width:350px}._fd-preview-device>div.active{background:var(--fc-style-bg-color-1);color:var(--fc-style-color-1)}._fd-row-line{background:var(--fc-line-color-3);height:1px;margin:10px 0;width:100%}.CodeMirror-hints{z-index:5}.fc-wrap-right .el-form-item__label{justify-content:flex-end}.fc-wrap-left .el-form-item__label{justify-content:flex-start}.fc-wrap-top.el-form-item{display:block}.fc-wrap-top.el-form-item .el-form-item__label{display:block;height:auto;line-height:22px;margin-bottom:8px;text-align:left}.el-form--large .fc-wrap-top.el-form-item .el-form-item__label{line-height:22px;margin-bottom:12px}.el-form--default .fc-wrap-top.el-form-item .el-form-item__label{line-height:22px;margin-bottom:8px}.el-form--small .fc-wrap-top.el-form-item .el-form-item__label{line-height:20px;margin-bottom:4px}._fd-slot-empty{align-items:center;background:var(--fc-bg-color-2);color:var(--fc-text-color-3);display:flex;flex-direction:row;font-size:12px;justify-content:center;min-height:90px;position:relative;width:100%}.form-create-m ._fd-slot-empty{flex-direction:column}._fd-slot-empty>span{color:var(--fc-text-color-2)}._fd-drag-item:has(>._fd-drag-tool>.el-col,>.el-col){transition:all .3s}._fd-drag-item:has(>._fd-drag-tool>.el-col-1,>.el-col-1){flex:0 0 4.1666666667%;max-width:4.1666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-2,>.el-col-2){flex:0 0 8.3333333333%;max-width:8.3333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-3,>.el-col-3){flex:0 0 12.5%;max-width:12.5%}._fd-drag-item:has(>._fd-drag-tool>.el-col-4,>.el-col-4){flex:0 0 16.6666666667%;max-width:16.6666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-5,>.el-col-5){flex:0 0 20.8333333333%;max-width:20.8333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-6,>.el-col-6){flex:0 0 25%;max-width:25%}._fd-drag-item:has(>._fd-drag-tool>.el-col-7,>.el-col-7){flex:0 0 29.1666666667%;max-width:29.1666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-8,>.el-col-8){flex:0 0 33.3333333333%;max-width:33.3333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-9,>.el-col-9){flex:0 0 37.5%;max-width:37.5%}._fd-drag-item:has(>._fd-drag-tool>.el-col-10,>.el-col-10){flex:0 0 41.6666666667%;max-width:41.6666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-11,>.el-col-11){flex:0 0 45.8333333333%;max-width:45.8333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-12,>.el-col-12){flex:0 0 50%;max-width:50%}._fd-drag-item:has(>._fd-drag-tool>.el-col-13,>.el-col-13){flex:0 0 54.1666666667%;max-width:54.1666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-14,>.el-col-14){flex:0 0 58.3333333333%;max-width:58.3333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-15,>.el-col-15){flex:0 0 62.5%;max-width:62.5%}._fd-drag-item:has(>._fd-drag-tool>.el-col-16,>.el-col-16){flex:0 0 66.6666666667%;max-width:66.6666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-17,>.el-col-17){flex:0 0 70.8333333333%;max-width:70.8333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-18,>.el-col-18){flex:0 0 75%;max-width:75%}._fd-drag-item:has(>._fd-drag-tool>.el-col-19,>.el-col-19){flex:0 0 79.1666666667%;max-width:79.1666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-20,>.el-col-20){flex:0 0 83.3333333333%;max-width:83.3333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-21,>.el-col-21){flex:0 0 87.5%;max-width:87.5%}._fd-drag-item:has(>._fd-drag-tool>.el-col-22,>.el-col-22){flex:0 0 91.6666666667%;max-width:91.6666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-23,>.el-col-23){flex:0 0 95.8333333333%;max-width:95.8333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-24,>.el-col-24){flex:0 0 100%;max-width:100%}._fd-drag-item>._fd-drag-tool>.el-col,._fd-drag-item>.el-col{flex:0 0 100%;max-width:100%}.fc-icon[class*=icon-chart-]{background-color:var(--fc-bg-color-2);background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAXAAAABsCAYAAAEEfdn9AAAAAXNSR0IArs4c6QAAAERlWElmTU0AKgAAAAgAAYdpAAQAAAABAAAAGgAAAAAAA6ABAAMAAAABAAEAAKACAAQAAAABAAABcKADAAQAAAABAAAAbAAAAACUwJ3TAAA5qklEQVR4Ae1dB5wURdavnpkNwLLkICAZFpaogpKUoBgQUBARRMCACUVPBfXUO/XzPM/Tk/PEjApyEhRFEeEIShZUQFhWYBElSFxQCcKmmenv/3qmmu6e7p7pCTu7ULW/2a7w6lXVv1+/elVdVc1YOXUS1bvDg3JLJ/Xf9JK0Pdl5XGYV9jM2ThsvSyyPfto4o98s3ciH8nBe/Grks2ng4M3GOJ5v08BBah08nIgYSTLL4mHtdXO/G/Jq/HLpQ/Vz7tBGK5XALftQZmyoNq9ZhXlG4sX9Lr/7aNsF05VgztU3zEn7o97MDnM/abdpwODcdotmtud0WlCo8h3mzslSK05EPJJn4Nf2X8wayP3aK1U2Z8CQVe0/n52lzStJ7F4msVNMZhX9aBXCW5FvO+W14iW7i7Ozlk+cRZVs/8UnXXL6D9rKngMXjWv/+RyKmEVRpqKioVW8hCD/adN+vvBv3VHpHjs7P9+JUNCmUaUprDSCsZHaNDNePD+BIfnZ7zys8NBKgsz+SnEq4pQBxAp/tOYVxRP8ZwzztKbfPrGa/E2+e2Qdj6OrVmy08dxvxY+nm12NPNWKmxFHE0caxyqfXZrTPBGJihVTbbz2AdLGJ8qvIk5yh0Iy8PtDcrFCyNnb2kJRsddxu+42xKkawngrtXSJ8OsQx4N0Mz1Msp+lmxTWB49yG208VZb/gg3XJifUr6u4WUl5PR+6juJRwedlmb2hpSHx0HYK2rRE+1VRoScdaC+hAlFB0ruKy1r+r4+D3ndR+XeD/sBFYg9XPtzxdwpAvy7WpYnAGYaAZGXllQUL0AprqlvIw2nUDvQA8p+REeJ/MMbZhUF/AedFVyNt7lUjX87rfZ/OPCAav8SG0lWrCJSHk5iQWqNEo+PWXIhx5GKroevbmOZ1sXv8/oAdRA8954ky1sMKVCsMnjxJZ+BpDTYiwIP/DC4fqsTwqFqFIilDu7lzJmkJQirME/2sOy8A1y2wc7J5EvqBK6GhWqJAH1mH2spb8dMaVZUPdbqZ8+JXAoisQ+50FeeR2qtRdHglTtXYUpEK45XX5gFEyogKdXZThwZLUUVdy4/z0uVFoOk3j68xxlFYKxVKxXmEttU8oxXzir9mnyIaszycH+ehvVrx09IY/Wb8wiJuZBIuHE8L0K4sABAfB7GoHh9OkXFREVdkz8UqMT87aXY7XR6W6fey4xq2f0GeFaBdHkz7TZOWcK+COFWaHiLI0i1UIsza1rzknP5DVtITbag0JT9Dlfb4WYbXy0Zz+tK6KhXHv1fw5H/GC4U6U40s2eWrDaNLpyKJjhpD1/XXDlpP19J2qqi4XOw9FP4eKunTVsJMawTTb6drhWPNH3Z72EbZq80l/JYIoHMrn1NwVi0q68ahKuJWDYgkHs/pXCMdFJTp5JeR7mwLRwQ4N4sUpWmCUDTgyi72vTpJRwa1xEai733C7WedYX1ruzldiUh3l7jY2GDketTpax2BIcCVtiFaCZpZQJSQM+C6b2TJX9WYJ3N/l5FN1j3yrTGewsDoO/SEmeQnvmR6kp+cVi/rAOeVs6pIIHvofy3zlKKa72QvfPufoVT6GIxAzuMxKHctyuwC/TZtx0V/684nJHk6XflN9wNhNIwmfcZQr4j4CygdcVvBQ5mioDB3OQMGca/u2mDjfV1q7Omti6MAtUXypeW0mz+zq0umYgPOJ7FGuQMGLUK6DkCezsGmsORhjc77bE5nngYBUp0OcDUWHg6i9u5o07X+9vPmPKUNQ3qH8zCAncH92ivxr7H3ssG/NljySc3dVww40mhhHiTe2+HzObqZMp4HDbqX+/k1GLcdT0dD5N2I+BDAqf78ZvF8dMV9U+aCtHHk17YX7ZgP06cWaDu7ZbZbm2bMpw37fWxRYNAakHZtmg5w3IhRkLa6qDzLzO80qiTtaF0ihqE4B/ea5kJNnRWopsTBSF75BhvuUcbn9TfdZTpO5zxsnzrU184BMHXUaEdnTEO7+mmE05isC9vWT0cpAqWKgHIDrebfrGpSmqaXVR3KazyetlAHFdKP6z26QpdVC6WKPYZ30pwThb0eFmId8PQz4RoCuOxjEqb5JlKHRADgeg/00/V2jeU3R0uTM2Do/3jHq40nPwea9B78WygMiyATN/oVl1f/DteYt7yHdZ0m+p5zZTe71tBR0A1IQ0PHmXU+HNSUU7U8rZe8NRt5fyEA2837UDc1aQSKaAhw/JS5XTKd0LsbijbmKv9hHeAKWNQmL2sF4FUzjICGWrn9tFV6uuHc2jgdE2oKadOMfn7DzPgYac+EsA5wapAixW6AZjClYCLpXovH0niSbJ5fC7TZE8TpxFUgEBUCis4sy2bhmVY3PMXClSYCITrcaeGwLsgySdXl82MySmJ/18WJgIJARIBzO9usUwPY7UKwdKFTlMMDzk1Dnh/hFfDX0XaqPE17pfqY1UVLQ37ib4zThu3KOdRidr1DWbOmSX7P4XbzZwzT5rPy8/L4DKXbW2FV2/nTb9PSRwS4NoPRb1dpI602zCuH6xTwuJmHw/HjNz9S0LVlav14AgfTJJ2Z46YqpckubwMe1lpUxny8/tp4n6eghzZMfh3gPFO4RmuZYJXMbIRVlWK1+ESbh8rBk3ExGpxP/mB4IsK6tYDaPBxoY5ydpFM7UL+Qt1HEA/U0XcqkA1diF2H80UrysakUTz8z0Dlu2rpxf07/ofPbz/uwHw/rAOeRTq5Y4x2qUsIw4De0oOr2ChWOtlRtcspWmLkzPf14k0I7FjTtgNHv67hpPn4jrIBH/XT87fgGhef0nLjMvgHY31AeAprfDDselGZ4+aB7e2UJOGdudke1BYZL19Jq/Tn9r1+Kx7Uezy97iqScfsO2uYsqf9524fvjtbTkD4I82SWxMRTG9W6zdRCUpnWcvzbOys+FB5pmMW5mX6KDUeCiNz+QYqXc3KuHT2v7xYyQRXlanj4X+46HuXDxsCXgnCDcFRUaCjAwNg11WHvxNdZP7Dam0GNOYFc61nI83Vh3caVFvtSTl4cDh4PN+dFNgH8yfmOgjixfMvCngOezehqM5ZOqANjKEwLgJiOdygpxBKqFWvnRSBwz4GhoHUiaqUNDO0JSQgCnx5w3btOAQf+IBGzTAgKRiuTZpEedZJROO0YAvBvo1RfaCOe4/KGzrHrAse4bS0j3kLjSCp/UE+fsoUIA2mKAesxsLs9KWpTKAXEzx8GmNKt3mMZ8ThpvzGtbRyNxlGGA+yuyqv0F6mvqdIBjguozrhtaLn9BXUMGwLfh8RVOIFD+EFDktixPEJU/SO1rDPUmXGkiYAk4RljX4HdlaVYGbz/etTCvSrUaiSzMFHCyW9FwN1YdtTDasPGqDPjPw+91zg+d+lRYQt1jsUY4r7J81QGOBtfhAMNieY5XnMfxcLgrwBtOI0crOpJi0NRBeh8aycHcnIZflzMdbMJDBzhMv0P4rQuO4JThtELkYUvpauawGt8N1dNAmwakZ9AwfVvve00HJS4fOw8juM4EMGi3AvwLya/cWGwn0/I60/w6wIOSPEXbSAIfG056W0n5piuGTznUaqZEQ3ySXMqLp6MWDW5aLZ00GZNM3bX8yI8bpGzKIj/Sh2klm+/do7Qz0ekAVxoo6xfXQ/poBGXqTtbaVMnnLrzwUPNZSyCxWIjCniVCv5ut4uBj/kM5C0HLQFEpwZuDgdb32rQz3R8COADeg0YX8IaDYAT5sRD+HR7Hr5UOdzippHnTldkxdLJVKAwem91upq6P5vRmV5q84jOTZulnWpxuaO+B1YBH3Iuf6rD8rCJAL9KqATURHu28COiUGTtI+xCoIeFMENABTmADtAoAeYmWFtbLW9pwzH5MkuExyCc+NEnmKayq+NGBLkaU8tTEXEYZZaADnOqIzrEA/9QNj4moN02Scb7GSTIeL64CAYGAQEAgEA4BdfTtdIY2HGNjOj+vQZRjRMY+LHCzx8cqleMGG1A4gcCZi0CIER5tU2nK0F+sbASi+ccirITRHQJix5dPutjR8DTtLBePi/aKOtbDfMV+u/yYuRuLtV1zMCF0wI4u0jSaVsUgZG+k9FZ0wGw60pQ971Y0dvHxxNGunHik8TOGtPM/Nff0HVh/41jblbpUdtwEvMSL0x2C/QFJNryWq6Di0ehYeEA4cpA/DfM9tJy5GDdbtzaSAPX5AkvVaEoJQk578mdEWyZtw1Q3qGEYD34lmNawXLQaSTmo841OFIOB5ypDOKJgXq8Hh2DdpzIbbJVBkj2H2ix4r7fbmxGxgjPywjT/OtjOlXk87gUth1LX+1D8kYaL5+LHUgqrv5e96J1/cFrj1VrAJXY1bkJdygAgdwNQ3VyWkVEs4dLSJpAt9TiT4Nu8+hDgj0lQIHTjMLM8HvGNgoAeQPt7OW0X5v668+l/aOtU8LzTuOgSNCngOy7Fx972uZntImG78ksLN6xE/AG46GQlpaDWa9X39v64+r4e+ftafdDhRK0NT8rukhay5K2T22/kFqq33dEyZu3CPbgK9+jf6sDQjMgQV5L+2y15fe49kPXVpKmGJCWoq7SWADf+JXpsNE73BGniY/Zqux4js0iPujHmMwsDwEy06VLFRCDVjNNSSDNAwNdi8vkVaq+/hHWHuXXELH9EcRI7HzfpfIUWHqNDWVUgmMcovsSNbcaM5aO3m+Xzspqu1MBJeqjfSmM+q7AddmZ5Uk7WfjX7yzf/Y5ZmjCuqtDdt26XjqLdTXOaBLiPo/HI8uPNQx5fpCB6siy5u9M2jqSk4Hccr4UUpdvLyB+J4vbXTcMr8ARzY3ivIwvZCwm1HUDdveB/TdD/1xebOUsDNyU8fEcTTta96eFxcr/7Ibflw5SoaLwgFDrRajQOtalL9Ed+F54Vwqy63341TsEGnK0XE1E4JSxMYu4j4KDoD//BA8dMUa+PGjoOwMGh7Ml8cvYSgnQu+tBMDiHckLlLhJl5a4ab200OIvqcthLg/pfNF/5KbNcM4ZTVwfBvw/pOWQmOnxQIs/m8qS75z8nrfPzxr6ctRm3hKWehla29XTiCmoOqgMAqxZLmDGmHwaG6nIaUUgzEJj8N6YnPTQtlV0phnIw2YUljt/exF7yq25a6OL3U41nDlhzy9xu7Lrm2w6Z6IhQ4CSrsxwjqig5wfg7kyjRNDONyIuwLhiM3B4Lac8TR45XysrhDMvVZppvF41aqNV3o2+XTvRqYdpYOv2ruj/g9TXPM1T1/3Y7fHlUUFhZX2PoCo8AIu46xuSf9VAOJl51xu1snssA2ep0wIOGkwXiEnV7zj3gNw1deidnk39x/2od9VpDzpmfu6D2+yfvwGosfeqOkl6b+PgqCP4vmxj3UZ9rHeycOJukKgq2gfCAgHubWBi7P/0P6DwuUAf0cDf7tNKeDVXOkM/eyqQLekL50O3rbLr6cOhMBzMHq2VuAX/p7iqF7QZ2O4buvKhIDb1tAmEV0ino3IXLt5M0P7N2TFxr8biQMEfGu7hbPauIpSI+ZpVrJiBpklJDgOqv/LcEVAeOLmwGqH0lZIWTwd2G3D4F7pEbDYsRlmtB5HL9cBZf0Kwf8C15edlGcp4FY3ysqciGVaMOq8cbxhaJd6VLoTAMsKLYRXmbkoK/WJRz2wufcnqLBbIR8BF8X9VvNyHuIqEBAICAQEAuUEAdWCEougnN0xvpjHWS5BXdoICBMlDOKYCnuHT4eFIRXJZRABRwKOgYyyURa70gZTW2h6D/Ovd5fBdoWtEure044IQj0lKNg9MHpXXwTZ5RFpZQ8By1kUbVWxUGgsFgy5zeY7Mf/qweA2MI/tUk4ZWq7NG0d/fwhlE9ThVbyYjWoqT3kdnhLYJkq2WXBQfiNmjNbzeiKOdp1fSGE8/RfioT7GCTmNuJYfBCwFHNqrK25uJ6UpwXVheClxBcItSLyQ/hyE5Cho/qs218/aI6k9hV0pWC1XEm4aPpATi5M8XnyQGzzn0tdxVH7wkBZFOXSE5DzqbvJ6/2lEYcbuvxJNvc139Ki186rD5Ld1EpsJwT0PdSKppsU8ryv0OEIB8dNRBhawsfXwK1t3aQsvfU0RYeHKOQKmAk7nZ0CYW0CgluImp6GNtPbYzFXlb+Jo3tztY+kQlpZYIdcSL3lvQYaIds9iIp9239KXMFUH7xZoUjrg7A3EK7tkKfHcTXfM+bH74xBwqZgLN8ykG/FG06qOJNTDIMChTsbXPOgjEx62DeV1BhidfDI7QVum8aDq3q4q9QvlIGLKOAKmAk4mAASV9tf3pvpDiOmFKOk/S0cCAds84CAtEKiIXgsbV8O1Xvafdml/nFsTPQPnRq/MJ6I+L+A6sMJv2Qxfn9at4bYVbl6l4LqJYFD92goWCsn4U96cRb2AmTMV1zKHgKmAUy1JaCCnihaDsL3JNbVZC0D3tTYeJsd2CE1Ubl/Lme2arJuwHrZ9PxjB/TweNjV4CEVfDcNUjT8mr/EBs3pTG1MhInPSELAUcKoRhHoThLsDXZVX9x7WFsKmaPVgugeatQ6WKz4KDd4NcYEtVDJbSOl2DvmeQnpLK4GC2XEMD0oBzKUC4oPyO9JVOIGAEwTsBVxmKyDctPgln6YDsf5XRw/h9yJtn2KvBmY3vobibhVJBSCwT9nRwT45At6TIxum2nESaWczAjqBNQUiOMCDyULfVrB2QZMENNusiZKXovRAJsVb9SBiUGkCVjmMwn0UTiAgEBAICAQEAgIBgYBAQCAgEChFBNRxo1gu6wx1vlxW4Fa2cRODTGf3R1CXMwSEgJezGyaq6wwBIeDO8BLU5QyB8C96EtwgvAXtibelD0VSDF7WDIyETtAIBDgCcRNwvOmsyJnitf4p7g93xdEAo/HKX1nNF46WNizEdG6gtgBa2x5mzYyybJixVXiwaJ1NzA4HFbXGIrKIT8myKxBrecIeHWyZX2YbMLsw3DK9jCXQ6bz52R/WO5g14yuqmttbcUXb+R/cHkk14yLgtP7E72KnV/u52GdYgLUnkgokhUZifVDn/0DgPsLC7yfM6gABugBCEFhjLrE/42F4zowu0jjgQ0eMdcUBPY3xQC+INF8i6NC2l/DQRu3yet83srjC4av9nqI2kt+d7/Kl59bacc3zdX4csj9qppqMOLPd7fWw5cC8FkW7XfpvyPk8py6hVaDN1vylU8bh809osoZ4k26D42ZHvAxbTteflRfSmggicHO74t4qO3pQ9vUAoJ0xG2goPSDcjBXHQbh7knBTOdhQ0Rw3r6qxTMdhCQIQpcN6f+XMQCfZfZ4/3DkDrl9BglVY+Zcn/J7C87CTJBUHbDbwpfxx5cHWHyylNDpD3AlfE9oeXjc2uwSF2yRdjfqp6zPr1ICFJ+kCDk1yO350wmvYn8fLjlq0I6JoPEm4KWxKkFg5WBIH3M0mjcEZQPhz4e8TDC9BvUIeAE4byRUPy1UQbmUbH6d3ebGTKEYHk/DFGFlEnH1np+cvpDO/6ezvcJnogHyc3PtNODqzdNyLRsDrHbM0q7jcfiPetkqjeFMThWxPPOW3aDI6KlSTr8x4IbitsL58plIhif0IAekPMDcjnBrUGNdgG5J66CN2Mw2D1H/vpAHYnN0FvcKPMM9+pXzK6QM+Vt+UhwR8ZfaeaVpkkdtJKURGGj0VCTed863lIPlSfqx8+Pyn628bsem3+qtq/9Zg6XUlFQ6P5TQ4lroqnRHu9PBNaNtFnEekVzJX7GhNBRyzGgMgEA/zjBgYbYNwrObheF5/7vZkzz+qbTOdRXHJruNt58+4KdbyIHR1sDtIEV7Y1buhUZXzrUk7Q8gDg7XTwu2DIdQGG48BgUPnZxnIdSNmhmizSAGMrwpWHPAAZWCA3QZ1+cGKJlx87lU3vu93+RyZO+2/mBXxTJQ/rdilE25ZKunw+SdtqV5QgkPJ1Kl3dHj1uluHv4yol/N6PnBDYZVd/6fUGztdc66+YQ7KG6SEw/0jLJwjHo6ruQYPmyuOBKeqbR8tu4tNNRFMirg4CNshPKRTIeQ0c3K5linie2GwuUyJk9laPACjTxssWkpnfjxUocIt4ZMwMjvIOeH01D6kPGhfKB62lhiItoG59DFPD3d1FVX+zpeRf284umjTcy+/UZm1UPJjcwsJN2TwbvRQU4HRTorHVx0Ok52LmbP5Wcsn9tvZ+fmfjp+z9gNKw33Npq9EpJ1sUERhOwccHqWNvFau5i+XEm7cdLQiC4mnup0VDkL+dwhRT97Y/e0mNyc/eqYDAPZFpN2mCDcnCF5zrxo+1RAVVRDlDAD/IaiHTqPh4RoLob8HgtMXZlM9J8zrbL9JZzo4yRsJLX2dgdORuUGfLEEbXqdpYD5QVfADEerej0xb+sSJ5EtTP3uS1+shRdg5H8urZD3WwSkNL6acrFHpnG1DTxh/tbcMtZ25cSTgO3o+MoBGyvz3c+dnYp8fll3xUtSW2BkTDrR6r8nhJl98QdNdlIabQwOVVVq6I02/rEHt9KUUdsnr+dB12jQbf4pJmoQHiAS4UTCtPoREOVjIhNZRVI29FzsadLtLMr6ItAD67Ainlfyen8nv94V+vQJCrZxyptCSyedi1dp/MfN6nhdaPLJBumTzOUcoJnzy8Tuzn3IqAi/M5Gpqg5vQKVF+hk5U6yTooxhdpBP2MRajZj/UYna9/JZz/0cRNN11uNGiBbV2X35EJYBnW5977ijK2K+OCxpuunW+Nt3GPwyIdIFAF0KgV8C+LkD4mhB6nJwF4PbCjLHVPiH5TCKsttyZkDqKKqmY349nyDjc8f8wVhkL8+kZCLTqIMyj0MZxiPiEIiEctEn9S3gvpbATB7afAbMHneSJhNaRgEfCsCzTQJhr0nytto77O7y+GgKujgHw8aSlmNtVTAVorj3t533UV0sfkV9m6bhhl9vZlOAzGEIzGaZRIeeJhyE7moEWBK0B52F1RS+11yrNLN4nlbRCXZSp1Lo7BtGpCmu0wo223Yv0cdCgf9e+yQBdQLiDec14m8b52Zvg6UzAYf+HwyvpAk52HQZbjk0daAof7MAPTcEyiTzR8OsqJMyBJOl4h7mfdCYThMKbBg7e2GzNExdrXxykn2rwbNaSV943YRW3KGi8MdBak3BjL8ID0Tlaxhig6ex6Mz7g/4pZvFVch3mzbeuDepPmpi/DTQPvEOd0ilBhIOHziTKO6YvQ4b0ImS62LukCDuHuCJBq2tYyxsSTtTZV+rnjC98G2LgKOsz9WLl5bZa90+aHXrf9gNtUQSvcTTdOuLDynm7HYiw2ouzQ2gmbBYmoAtESyYGlGJAvmhWNi0MvMwa90fcQ8orhGNKkAIQ77PgtjPyHK6Z8pFc63OGk25cOAZeKIdwdea09x6t7M/d3u5GHaV0F2bSlJdy83PJ4hdbuS7941x1Cfh56tJV2fPFE0VTvKjsanpZ0DY4nEe88Eu/wNTVlxsRYEh0Tl3vlqM89voq7Wi1+Y5Ix3UkYbRnthD5etO5S/sJavOptxYc0uZLmYndCNq6BRq+H32ZMqf6DXoy5rTKaxJsKOAr4DF2F6vhbzJbLX/hse88JanzTb59QbFo8ybrDfpB/j0oUziOzzzVFhaNOSHrb/70/PiGMS4kpxiNbSqmo0i0GA0/I1ptqoVEYQ6YCTgxJyFXGGg8JuSaoeo1CriYIj0AgiQgkW3kmsemi6LMBASHgZ8NdFm0UCAgEBAICAYFAuUMAY8OAEyc0cSQiu/KTrSKjFlTJQkDY4MlCXpRbKggIAQ8Ds3a/ZhhSkVwGERACbnNT8Io1jfZr4qXX7TZkIqkMI+BYwPEyqQO1Bxkr4ManluG2xVQ1Em68Gg7sTBEnasWEZTIzOxJwCPQoVPYSXmGsArxTWcPMI8rTlTa5Wjj6oK0q3Pi4MtaYDLAgFdFlHIGIBJy0GTT3OAh0FWN7cJDNpRB8dUWeMb0MhlvSTnqs3/iEjgQz1o96JhzMsykYvw3CHfEudCMvEU4+AmEFHALcEWJwh11VIfg16AFI5IBMecDwKUO7eoRLg2C/jd/nKp1bf2QDCTcOn9lI6VjFtgXCHbrdTM0sPOUBAVsBx0E2o2GC6HZYIDyINCCWLIbkLaEd4hJrEq+GYzX7hVQH4geTYQ/OEVH2RtIGBidlUA9EdUYexbzCTqAH4JdRVzda8S7x0go3Un4AzSCKF658I2C5mpA0pm6/hAuDLhyzxptbLLENEIQPEP6dx9EVwtQf0rIXZ2fM0cbb+aEtb8bevgyUp1uPjUMXH0Lv0Bp5pypLeFEpvs0MIq9sO7Pjy9NUexrb3CDodLaH3+NjC5UZEpl1h6BfhofpVYUewg275fROcc5EXMslApYCDo0W2MMnsdoQiOcgzD2MLYQ2HwHhWAMhXA+N/hP2V67Cp76PO97E5EIOGX9G52c3hBjJKo2cqXrDeGBv/xXtOQ9kj+IhVRxtdwLvUQi+jwhFuOHfDLohOA6pPtqhCjna9YHkZb8Fcor/5QkB3E8TB5sbGrUvDomoAeH4ChQhwq3mkllXCPoFEI75EPQMaO/e+N1Jh8CoNGE80M7vQ8QDGhS0NGglkyJoVuhyu70VVlFE+omGTysJmA1BPRvqiAwBVGQWoh41RJOR8g0eUGV7FMrKgVkyhGjwyfLKWlqlXdoI4S83CJhrcJxD6PMpx2S1gvDuh/A2CtOidMWkwT/uIFSaEI8NvdKhOoWZux7zFFde2GbhlMcUCpk9ySkheA9A606kMBj2bLt4+l34fn0JT4eQHvb4WaHuSAM1MbwHD9cYlDEdJlV5mgkK3zBBoSBgrmU1B0JCuMMe1g7BU45fUDGl8yoicHl97h9VWOXnv2P7UIY37dh1OQOGLKdsEDj1rBDMSX8ZjMvDw/YWtGsuhLKFyl5m+RDu42rYxIMe4RrwVHoEumKc0F1LhgdICLcWkDPIby7gmgbCRFEOf9FEhXghILqToaBqFUENITREFGbsCWjsYDzOwqtLXmjTDtDMT2EvaH+YHzn46WY0MLPyloGVCAoETBEwN1FACuHaBU3XmHJBi+dITH+IO8VbOeQ9YJWmjXd50zcGvhSgjQ34MfORiZmNi/AE/oiYFQaKRYZwVEE6uvlEzRz1Yamxt/fgBhvu+yEqZiJTmUTAUoNDoE8LlYvNQO23W7UApkMBT3M5OFe73fwZwzDdd4rnbbDhwYvI75VZVRwIlIqeoBqFodF/RS9xF7yYncRpVjF+L4d4kvOmnNKdrV3sOa4LB6jE//KMgKUGh2lyjDcM57/S4YqfwNZWjuvi8RDsGnhCNoL2U2j5QJoU2fdfyBaG0GbhCDWavtM5j8SOIv0AhPkEdR9BtxT07XhAXAUCkSBgqcEpMwTYh5ctS8iPgZw6L0xhchDsX/Eq/1zye2Qcig6HI3Yj+sARCTfRWzmkz4ZwL7RKF/ECgUgQsBVwmAlfYw54KwS9CoStvhVDKNnraSYDJyxtxlxyRNODVrxEvEAgnghYmihUCARWWXiElyH14Fc0uVXh/hJQudkyq/RkxuMU0nlYIag6DIJXU6DZ6ifn/dT9aTWen9QF84g+8KQ6TEvuUQPCU64Q0Nx263qTFrdODaTgzWeZdcpreZOTutzeDJ/ZSV3BXmhbmW2QqFjECNiaKBFzEYQCgTKKgBDwMnpjRLUEAgIBgYBAQCAgEBAICAQEAgIBgYBAQCAgEBAICAQEAqWFAFYz6V2iz5jVlxb/kPHMV9Ge+GMcC0dxf2JBL/F5xf1JPMaxlGC8P+ItTyxoirwCAYGAQCCJCAgFnkTwRdECAYGAQCAWBIQCjwU9kVcgIBAQCCQRgYi2OiSxfqVSNPbuvI2CLol3YT43uwj7iI7Gm29Z44czxTK8LvZHWatXWawPtogNxAk/KcmoG86lKMFLr7nJKPtsKvNQi9n1DraePlfye/Jdfs/+lMLqK6sc7PFV3S3Dfok3DmVKgeNstWoQsKHKYSiGluIEoAKcrP8BtjKrh68YSKIOYje1G0cDxN1JhTigtkwhjCb62RXAeSK2zm7Fbzg2mhZH03DAVR35X0DeHiXYp4j79j2GczfhlKiwR6BFU57TPNhw2x6K8hLI0skUL5uBzlQ9B9Apr3jSA7dG2At5bzx5RsoLZb8asmoh0syC7jQCKSxFLmZdoJP6Qm90wfNUB5u306GfOivnR7rwn8mVZVdJZZ+rpJkvY9/Fhc1nPXaoOR3+y/xQ6FOzvnr5Bdore5ppdL6ypV78rA4UtOkX27DhuQKsvFqwIvZE19SzOxcE7WJo2ddx4gG3/triCJDNeKifgLR9FAk6yreMPOw25HsQvHTby8HnPEjj8xjNTEjmkSGQn25oywXoSFjwww0Z6GBux1dBvkLnlfTj+HCY1es4kP5WYFgxEszjSFPgSsH9L4kjxzCsCjN3pu+64MURxRWP9JfdxdlhyHXJki91S+qpmvMarx//QfrxJsnvfPHFGogUfSuhhWKiwFohESPLRXvyhq4R5gFXSfpvt+T2G3kLHQHfetFbd8SiyMuWAjdvcMJjYaVNxY3IxL0w7TyiqoCfrXV7DIftRsUotkywQjtBwCajfRVMOUnsb4gfC8U7GNa47is0nB6y2g5K52X64IUSB6A07heMYO7nylGfpKFKoBf2Dgxu1gedFH3lxtThHvdBQlsYArNxSFvMlo9pIRFEKiMUGVhK7M8RkMeTZJLuOP14ctbwOth6RoP8pp9OgsK2vBcacksvKfyiyvuz83o9+DARQaFvrf3ztffW3Tp8r2WmBCTguegKTf0OWOsMlngU5fMU9IAiz625p++19TeO1Z88H2EBQoEDKCio5bhJyyPELDKyZGgybc3wiS1Yo1OgvPUfYZHZVnQs98OangILoh5lUa4yW4vr26j2ixRH89olHvYsEq800XZeKPsXoYTeI1pikAwHrY1qsqtQfuMIq1DbncLuhqL/FPUvVUWgw8eHT6mlsC2od6lJCXD6LpGFbe854ZqCzB34hEViJg2pQzjU4sMvDzX/0FvhePPHzI7p0mEchwCMn4/w/LRP8F1yHWm4eK67uPpl0cyRO1XgPdAjUW9k6vBAXRvJ2W6mmUVkXBCAYmrhd7NpYEbvE7RuJw6NvIlGBfj2C7neEEz60tazSoj+Sex23N8RUCxuTDuk4Wp0KzCXPEF5MWtgbiSMRxh1uYxb1SjuCJTQNphB2/EtGx86l4GwZus4LQdHHlPNB6HT/gnNUz626pRHrPQ425DOpf02Vj5O8qO9CXGKxd3849n4JItygL9ZIS5/6saMQ+e/0OS7R9aZpRvjdnZ+vtMfdTZM8LuKOxrTcPc8BVV2/BPfOPpz7R3XDUmURQ7ZWATl3Sik/ARFHGk890ko8DFO2TtS4Jisr2HyUKtl4mts1WksW95cbr8Rb/s8py6Jpt4pBTXfyl789r+iyRvvPDRHLXuggKG8Nbz3oVMdgftyAMpb5yCgs3FP50JJTsdtC3xQwDg3i4+IYfrhQShOReFAeSfF4YGqiTr2gBLvgQ4qZqsfo4pmwOQufAB4ZrJWCuX2u3EyhtEXJxJQzLOubDt/umPFEEmdtl8yfnBB1Z+eM6OVZNfRyge6jG2ybsJ6bTo633RgvgFxm3A/h1Ma7ukkTMP1Rfhi6Jf8oKK/gdJ2dnrhghPnrH1Nlvy6L65Qh0EW+fFa6//ccsWL9FGOuDkYDveDWakpb6q4z1MY2llF0CLDIx1BjjORRFJUQnQtc8V/biy6isCAJssOH6RD/qdgqdyF8AJY27vxcFg6WOz0qaMhENquIKLRFalH6Gz2BuJfwUvjGMCxLDbhCaj7ecCA2nQclvpshENehCE+xeVlI9HAfZgVTwFO9K1jar/qELcVHZ3tcfgqsUNPxd+z3j9Ra2NCFXjFoy2mOaxWROR5ve+9ubDyvj+bEacfb/Rk1rJ/z+RpkKUH0VkOALADMYI7gXuhe6GJ0cG93DAE3lVAT0bFx4j/T7ADuCiv15+GFWbufprz5FfqQFCXzKylk6bwuJivMrtaGac5ZCSnwHDCx93r5A3dh5/tR2scsrYkT6gCP9xkQa0D2VPfxIA8ZKgr+VL2NFv719sq/pqtflfNspYiwTkCMnsjOFWiy7u/3eTmRxotmOYqqbS67cL3x/NEKKk18GfD0q2OB+w3nRbjRJqrP63Yta37uHtKMvLHItrlKc78pM3/ppo+0JpsCfXi4ac5/Svwq6QpqCqUxxi0Kw9KYrEm/rTXF3g5C6VRqq7pmidX5PS/frfs8ibE2oNd8kvTr59eHu9G5Tf+rA6U96NmfDP3dxnZZN0j3wYNgim4Jy/BCHgJ2L+EUY+lw4vouli9dBD34Bjkryd+9HLqHoTvQ0c7kjqEnZ2e//l4vbUhHRLVBXVaUHvXNYcsC3CQgLrXUMp3kIdIMT23KBrF73Zj+SEUv8PiFPKEKvDfG37VTXYXtTGrGOJrHmz2yXlNf81WPpBjRlNacRV/bzn1j2rbMlGeo1UoLtl1vMqBznNKq56xlHOw1fSG+S3m/FeWvEpn6ks7MWDTgEFXZe7vPrLJ+vE0pFUcBPc37je77rzwH51P1Fk3EUPYWtp0b+rxwTlXD81qu+S/Q1xFqTCi4uJugvJtgYd7F6aBdqNTOQjGejUrsYqo8+UorYFdiaDJwsOVhY5qMXjk2dGWZlr6icav4hPftyWizPQT505JBN/8Vh9PAN8QHUfTiaS8qcygQZBluFuh1ZHZMEzjPYWPfg2Csj6oI/Ar69Zf5cYE8d7S9/a3SiocuUNHh+KoTlDgqkFiSHcUhMxtQl26O8oULbHMdkervKnIhCrwaNtU2vmCVsry0i63NMrLbzq37sHs9/8ru3znhpSHF0LH66+ekVt3/frWSyeNdJ+qYWoknWj4dZXdbV59wZdyqmcID8aK0o81fjZr+cRZJmmxRkEPYO5bxk9inUhzc60BPwwlNRhxOcjUF7wupuWEyJT0XbLB1RSfRdyAMkDodxe0N6tGtf09PqZ44DsWneRgbGwZjM7X1LKE0r4dyn28cgdl9iUU5lYznrjPtGGM+H4AOZhMZeQ3+9SowJnfUxh4h2PGxGEc3iX9Ddb/AofZoiOX2TPOpfh0UUKBn8bijPIdabys+v62r0FxlzTTNoxeLlU83vxvJ6v8+Ax0YAVK87kLL8i9bMyWSr+3HN985fOfc/q8PveOLqy072EIWIicuL2VFjbZ8MBjlQ5ekJQt9NEob94uKI50KJmboBwOQHF8Cl7ajisFSr4N5l/PAz1NxazFLyFz4Gp9gh4ovXHGuGjCqDttOEmYa//FRzTisXTA9DVg+hqUd4gDtmMQOUFrmWOT1SvoUE0dWPwG2t488ZwfRu/CL6Hzy5CNn/ES6FbstHyXl5uIK+TvL7D2V8bCO+TBjIVZuc2LFyyYZ2tcmvXHjdsFwVSVZbzKPlHn28ydnV6cIrtL9FNXsuuP6vsuvuXcDX/KCZb1+ZbLb328JP33Ubzsk9W2v5jTfwjewEsy5mUb8nh+xdkO+6vt736/hgdPKpdXKIdz8LDejQ5qL+5FXTRCeR4QL1ziEKAXy6edjfV9mqj0fXg+V6MD6oZ5+dlQtMp+iXjVAvxOoJO9HiOKnbHyFAocCMIqcGktglhBjSQ/lYkbGFd3su76jF3nT3xLr7ylwsxDnW5v8s1jytyktsDsRe8+ixfNbx1o+84cPqcdMtWChLSCuhOzlk2cLHnT4lxjbW2S6Jft58+TWLMzrmjI/G203BUrf2rgTcnvviTuig0HLl6+/goasv5boaN/HcIfkyLHyOQ4+NyHToEWDMTFCQUeFxjLBhOazmg3f8awgqrbK/zU9emX8XJ2etO1Ty6zq12tnVcdxq9HXp/7R+Fl2uOc1u2r8HXdrbeNr/nzpSTEyXEyjiKQlIcoOeVTqVQH4eKKAC13xYvJI1De5cJhRLYNctCbRmYYqXeHEn4Icqkf4Vq1BC8pYc1PhPJeoIzs4mwCOVLg6D0P2pWPN8mHtOkpRVUPFlg1DPHpBXX1y37oSFKLuTBigzkp23SbomyTMAe30SezNNwYyFXiHW6mj8q0mveLtQYVjrYsaLvgg5AXPXZ8cTra+1D8Hx1s+UnbJt8++p0dbWmlQeAfKu2RUWm1zaycRM9dm5Up4pwhQFMryLHaiVzieU+Yc6TAUelv8FBZvkAw1rPJ2se/Qc0t6Y2tovMpwN/6BUyCdgHSZhc8PLud3BRj3Z2EqSc2W6PthEciaEnxlxXlnYj2CZ4CgTMNgXIyiDnTYBftEQgIBAQCsSMgFHjsGAoOAgGBgEAgKQgIBZ4U2EWhAgGBgEBAICAQEAgIBAQCAgGBgEBAICAQEAiULwRoQYTOdXhQbqmLKGeBTS9J27VVFu3RopF8v/H+JL9GogYCgfKLgJgDL7/3TtRcICAQOMsREAr8LBeAWJuPnWlpOBbgHexMc7RxKNZyRX6BgEBA+Z5v6cCATToVeUl0FgL3i2v5RIAUN06QeRe7Y+lwrB7YxPUQFHkerteVzxaJWgsEyh8CznZiOmwfPeT42sSlPj9rxlLYPpePfUIsEJeOTZVjXG521FfEFtCHdh2yFuRJQoC+aejzsNdx7EA3wxbhPHTLo3Hcwu9JqpooViBw1iGQEAWOc0U6ujysG05ZdkN5Wzp8gqiq5GHDiQQKYSsOIlkGpZ+gDfOW1TgrEqgzhbVMX1IZid8+dKLXOvkSiPIxWg97w+tRvjOpxWwbvnM4WvkwsPEsBS2V8AsEBAJxRyBuChzWWB2cpnwlpkcyoYwZro4c8reG5m6NQ57oI7tf4aCnHx0xKCPEfpfyPb3LYYlWxJTCKkwdJffzXRIbCb06AfckTQNRfZ+PfQeL+QXUc7ImPsSLlyQVfBJ7E4r7Im0i7tdWv4fdTIo7WV+q19ZH+AUCZyMCMSlwsuqgcC/Dtakyq22ntGV2MQ5I9+Ms3E/tgMaXMFKRfmXwl+/BMYxWn2Wy45OsNCjEC6HcapIxCuXXEx3Zdjo+szTrgxFNTyjs51BmDZNyixFHGJObgE5mFGp3LTpN3bcwFcXN2FtQ3hcGSAP/0ZAtGCndjOsxfNFdOIGAQCCJCESlwGmKxBOcIoHytnYu1hIKrRcIUoMqrB8UxvN47tcgnIv4IuvMSkptL+ZVMVcuY7j/PTTiGnQANpMyYbiFSaYXrbKHNYHSPQIFqD/q1iyvxJai+coh7zhmsj+NGtDewLm/RE/YpBVJ23o9cHdRxYO3IaKy5Evdji93/6Xx9w9sNGMZQ1xLYPsS8rcIeUMss3UYGUzANwr3E38A+CDad2ewrDrofNfA/wrqO4kUNzrMt9EXdw6mBy4y+wHvKm6maRe7W67LIwICAYFAQhGISoHjuyw7MLddDKV1LpTGuVBcyrcVlZpKrAGU2GVQChlBpR3SACiYrkjvirzFUJqLoBB2hRAFIzBvewxz6b+A10Go+xR0BeGUvhUr23jUoxYOmB+mdA+kAXFeN+JW2mWCpX0dPs7azy2zDVZTPpuvGP2x7C5SD3+X3cUtj527YlZe1V1PZS19eYYdf0dpEisBfQM1j8z2ANfxUMibKA7KW3WIe0nysWnorD6l0QIlgHYc7sk4k0FULvLeQqMgKG/mKmEVij266RiFL3gWQB4Scm/UiguPQEAgoEMgYgUO68vtL8aaXxc75aUPK8hsCzhtgbImZZeF8L/ga6FwDzEBldiQf8ibCqXRXyGX2VoogL9Cgfyis7KDigdTNfQZDwlpmVIKO+nz6j5EG8LbaQTadTjFB8vTzRrCWv0VytvqSzQtUede+KVguudrKLf/EgRWzlOS8V2JRoEH6XwZv2dtsMoTVTy+rwccO0LRdgZGygcZ7G4DtRedVXe0YyzKw3cw9Q5t2uzBh10VxR1khLhW3hTWF7fC1AG3z/AZqj2miSJSICAQiDsCEStwUphQoD1hsTXX1sLtYi5Mo9yFZ9zqudaSW/sl1gV8JkKJvwelURMdQkYIMSZfoeB/lLzsfyFpcYiA8i4Em+1QQiEOyqkhlPp8UtxKIrQZ6nofKW+MJEYgz7qQTIjIXjT5OVye29vh1dbFFY7UqXyga26t3Zfrlk2Cx3X41UMnlQulutSMT6RxXHlHSo9O9DUo8xm4zkEdzsF93ASYb8M02QncB+EEAgKBMoxAxAqc2gALdWWxS6/AMZVC6m4JFNvlsbYT87L7ocQbW/GhuXCphK2AwomLkz1F0g+XjXnFl/pH31CG0okqe3vc3njDg99TGpR3Z1V5G4jRqXVHlKLAQUfz6I8h7noN2cF6G+95DAp/mSZO9UJPfqzoSpOOQyWKwAMFfC4w/Ds6lGpGcijow4h/EPULWacdjOuF3pE+Kud0AZGxKBEWCAgESgkBR6qQpk6QQVFohvpth3KIabkclI8fVt8OA19dEDTroLxP6SJjCGy+4qaF5sqbmMqVjzVYOXPHxY/0oxApWfx7GF7tPC+pvBcxB/5ykKY5vrb9vUF5U1JdzOW/C4z+Q4GEORc7HxhdiNFLC+MP8d2gmbPtyi7t1TJ2dRFpAgGBQHgEHFngxA5zvmtgpbWFpRyYSgiWgSmEJVBQDRE8/UIzmBbJBRYiKW+Td2iB3FCAhXhR+K1iqUbCMAyNN/M3j+z2nROGjHnTTjTiNLBUP4P/M3ofgJpWpGkGKErVYcqhsRow9zQxj05e7N7zJmUXpxwNsdjTCmvn18+5o1yuxU8emqJkgUDpIuBYgWOlhg9b4r/GnHBPbVUx+pfxNw9DeO3UgZbE1g/lb/+lZ6wIgfUf4yTD6Sp4jlf3Zu7rNvp4/dUfINZ0JOL2pa9uteS113kuUtyYMhpT4lXXUeOtKtsTVOwMndASjBCeBg5P8jya615MQQ3HKKbMuO09J1xTUGXHP80qdAKRRen5tzb99onVZukiTiAgEEg+Ao4VOFUZyjsH89EdaCs8bwJewPl9xezf2EL/BMVhuC7JKWwErOZsvBTLhKFaBdMNmZheqAIrmvwVeV5cj+Hl2z/oRSHmiQeCr9HQzkfENg19LN4e6CyegJKd2mT9+Bls/fjWh7I+rH+03srLvanHW0uy+1TaH/VXNv72kWVub4ZuRFDiwxy8rEyh8I0wVNECbWWgzKcjTD8Gi9yFdqmdTllS3to6C79AQCBQPhGISoFTU2Fpr8BlYNBf4C9k09zBNdpQ4plQXjdCeadAwR2ABjtAdFCapy9BP0VAaf+sXLEEDfleQx5alVFXIaZ/MspCZDwcRhA/Q8kuwuqZjaif4urkDd2H33vh+AeV8RRdVVT1HJpbq7xDU0WMQEAgIBCIDYGoFbjsZbtp+gD2ZSqOn5rtCu61hD7rgA0flzipFubTm0KJ01LEGVB6x5D3Iyjw5rhehXj6wk6gA3DC1IIWc/j7kfQSV94WZCJaICAQEAiUeQSiVuDUMijqebBkceZgYMoE18GIVraWO2158KXoKMwhfwMl+y2mindgzvm1khLmgRIXLgIEgNMp4GjpMHWkW8Hj9qXqwsaMLm9FXTo6vRLztwXBnD6ki3tlhFGEBQIJQyAmBa4o72DVgkvQAuuZY6muZkqCNg9BKenmoWNhfabnxXuHxdCfWVbtRD+rc81WPbsYEZb0OmIE8J7jJ1xeMcarYaG8VSiERyBQGgiUoTURpdFcUYZAQCAgEDhzEBAK/My5l6IlAgGBwFmGgFDgZ9kNF80VCAgEBAICAYGAQEAgIBAQCAgEBAICAYGAQCAaBP4f7gEVmIzBYlQAAAAASUVORK5CYII=);background-repeat:no-repeat;background-size:164px;border-radius:3px;display:inline-block;height:21px;width:21px}.fc-icon.icon-chart-bar{background-position:-2px -2px}.fc-icon.icon-chart-stripe{background-position:-25px -2px}.fc-icon.icon-chart-line{background-position:-48px -2px}.fc-icon.icon-chart-area{background-position:-71px -2px}.fc-icon.icon-chart-funnel{background-position:-95px -2px}.fc-icon.icon-chart-gauge{background-position:-118px -2px}.fc-icon.icon-chart-pie{background-position:-141px -2px}.fc-icon.icon-chart-radar{background-position:-2px -25px}.fc-icon.icon-chart-scatter{background-position:-25px -25px}.fc-icon.icon-chart-custom{background-position:-48px -25px}.fd-theme-purple,.fd-theme-purple ._fc-designer,.fd-theme-purple ._fd-config-dialog{--fc-style-color-1:#884cff;--fc-style-bg-color-1:rgba(136,76,255,.05);--el-color-primary:#884cff;--el-color-primary-light-3:#a47fff;--el-color-primary-light-5:#b599ff;--el-color-primary-light-7:#c6b3ff;--el-color-primary-light-8:#d1c2ff;--el-color-primary-light-9:#e1d6ff;--el-color-primary-dark-2:#6e3acc;--fc-style-color-4:#e000ff;--fc-style-bg-color-4:rgba(224,0,255,.05)}.fd-theme-orange,.fd-theme-orange ._fc-designer,.fd-theme-orange ._fd-config-dialog{--fc-style-color-1:#f27024;--fc-style-bg-color-1:rgba(242,112,36,.05);--el-color-primary:#f27024;--el-color-primary-light-3:#ff9a59;--el-color-primary-light-5:#ffb380;--el-color-primary-light-7:#fc9;--el-color-primary-light-8:#ffd6b3;--el-color-primary-light-9:#ffe6cc;--el-color-primary-dark-2:#c25a1d;--fc-style-color-4:#ffb600;--fc-style-bg-color-4:rgba(255,182,0,.05)}.fd-theme-pink,.fd-theme-pink ._fc-designer,.fd-theme-pink ._fd-config-dialog{--fc-style-color-1:#fe679a;--fc-style-bg-color-1:rgba(254,103,154,.05);--el-color-primary:#fe679a;--el-color-primary-light-3:#ff96b3;--el-color-primary-light-5:#ffb3c8;--el-color-primary-light-7:#ffd1dc;--el-color-primary-light-8:#ffdce5;--el-color-primary-light-9:#ffe6ed;--el-color-primary-dark-2:#cb517a;--fc-style-color-4:#bd2bff;--fc-style-bg-color-4:rgba(189,43,255,.05)}.fd-theme-green,.fd-theme-green ._fc-designer,.fd-theme-green ._fd-config-dialog{--fc-style-color-1:#18bf82;--fc-style-bg-color-1:rgba(24,191,130,.05);--el-color-primary:#18bf82;--el-color-primary-light-3:#4fd8a1;--el-color-primary-light-5:#80e6bb;--el-color-primary-light-7:#b3f1d6;--el-color-primary-light-8:#c6f5e0;--el-color-primary-light-9:#d9f9eb;--el-color-primary-dark-2:#149566;--fc-style-color-4:#e2ff00;--fc-style-bg-color-4:rgba(226,255,0,.05)}.fd-theme-green ._fc-designer .el-button--success.is-plain,.fd-theme-green ._fd-config-dialog .el-button--success.is-plain{--el-button-bg-color:#fef1e9;--el-button-text-color:#f27024;--el-button-border-color:#f9b892;--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:#f27024;--el-button-hover-border-color:#f27024;--el-button-active-bg-color:#c65e21;--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:#c65e21}._fc-upload-preview{border-radius:5px;display:inline-block;height:120px;overflow:hidden;width:120px}.form-create.is-preview ._fc-upload .el-icon--close,.form-create.is-preview ._fc-upload .el-icon--close-tip,.form-create.is-preview ._fc-upload .el-upload{display:none!important}@font-face{font-family:fc-icon;src:url(data:font/woff;base64,d09GRgABAAAAAFEEAAsAAAAAoPAAAQAAAAAAAAAAAAAAAAAAAAAAAAAAAABHU1VCAAABCAAAADsAAABUIIslek9TLzIAAAFEAAAARAAAAGA8FUuIY21hcAAAAYgAAAP7AAAKGJ2RrB1nbHlmAAAFhAAAQ/kAAIgow5ZWYGhlYWQAAEmAAAAALwAAADYrnfY1aGhlYQAASbAAAAAeAAAAJAfeBJ5obXR4AABJ0AAAAF0AAAJ4jxAAAGxvY2EAAEowAAABPgAAAT5fhjx4bWF4cAAAS3AAAAAfAAAAIAHCAPxuYW1lAABLkAAAAUUAAAJb1Yvg7HBvc3QAAEzYAAAELAAABq340wMHeJxjYGRgYOBiMGCwY2BycfMJYeDLSSzJY5BiYGGAAJA8MpsxJzM9kYEDxgPKsYBpDiBmg4gCACY7BUgAeJxjYGFRZZzAwMrAwNTJdIaBgaEfQjO+ZjBi5ACKMrAyM2AFAWmuKQwHnjG8mMzc8L+BgYH5DgOQZGBEUcQEAICVDRp4nO3WZXOVVxiF4fsAhUpq1N3d3agBJQ3u7u7u7u7BIfVSo+7u7u58XMO/oGtndforemauTN53MnNmdp61ng0cAjS0y60RNNhHxb9R2eu3lfr3DTm8/n2jymw/V3EoDWgk1FLV2n+g9uBB8FNztVJNnv77VPzXVRxD00qz+m8Zx3gmMJFJTGaKv3kq05jODGYyi9nMYS7zmM8CFrKIxSxhKctYzgpWsorVnMsazmMt61jPBjayic3Ucg7ncwFb2MqFnM02LmI7O9jJLnazhzqu5Cqu5hrO4Fqu42Ku5wZu5CZu5hZu5RJuoxm3cwd3chd3cynNaUFL7qEV1dxLDa1pQ1va0Z4OdKQTl9GZLj6VrnSjOz3oSS9604e+9KM/AxjIIAYzhKEMYzgjGMkVjGI0YxjLWZzJyZzCqZzG6ZzECZxIE47jeJ/pYT7lxhzh8zqSozjap3YsTctJl/9CpTH/f6rKjyZj/32qK1MXZX7VPDxjqEV42jyl4blDrcITiKrDs4hqwlOJWofnE7WJkhG1Dc8saheeXtQ+PMeoQ3iiUcfwbKNO4SlHncPzjrqEJx91DWcAdQunAXUP5wL1CCcE9QxnBfUKpwb1DucH9QknCfUNZwr1C6cL9Q/nDA0IJw4NDGcPDQqnEA0O5xENCScTDQ1nFA0LpxUND+cWjQgnGI0MZxmNCqcajQ7nG40JJx2NDWcejQunH40P9wCaEG4ENDHcDWhSuCXQ5HBfoCnh5kBTwx2CpoXbBE0P9wqaEW4YNDPcNWhWuHXQ7HD/oDnhJkJzw52E5kX9DM8P9xRaEG4stDDcXWhRuMXQ4nCfoSXhZkNLwx2HloXbDi0P9x5aEW5AtDLchWhVuBXR6nA/ojXhpkRrw52J1oXbE60P9yjaEG5UtDHcrWhTuGXR5nDfotpw86It4Q5GW8NtjLYFJd/bg5LvHUHJ985wa6NdQcn67qBkfU+401FdUHJ/X1Byf39Qcv9AUHL/YFBy/1BQcv9wUHL/SFBy/2hQcr83vDfQY0HpgMeD0gFPRNnBejIoffBUUPpgX1D64Omg9MEzQemDZ4PSB88FpQ+eD0ofvBCUPngxKH3wUlD64OWg9MErQemDV4PSB68FpQ9eD0ofvBGUPngzKH3wVlD64O2g9ME7QemDd8MbE70XlG54Pyjd8EFQuuHDoHTDR+Ediz4Ob1v0SXjvok/DGxh9Ft7F6PPwVkZfhPcz+jK8qdFX4Z2Nvg5vb/RNeI+jb8MbHX0X3u3o+/CWRz+E9z36Mcr9Sj+F7wDo5/BtAP0SZfvp1/ANAf0Wviug38O3BvRH+P6A/gzfJNBf4TsF+jt8u0D7o9z9DtQGlX8AZj1A2gB4nL29CWAbxdkwvDOr1UoraXWuVrJ1ryXZli1bt287sU3iXE6AhBzk5ko4c5T7PgqlXC2EQikBCg3QchYCoQVajtK3tNCWu/SjLUc52r6F9oWWt402/zOzK1ly4tjt1/+zR3PP7M75nDPLGBj4Y6/ATzNuRmF6mHGGQdkQkpweESnRWBoVnPkBlOOiMSPEeXPRbBFiElwYDaKc7OSVZMGOlA4kgc9Zime9QYj22pEx1oESxV5UyBfx35tHm8GoLs1Ff1ZdSiajoD+DrY7whx/Kt5tMnXyBb4Zfp8mEzhVdPmRgi4jDRcyyXjd+qnmkWd0FFhi0EqyhjKLuorWsVDJLuSef5EzqsybTHWcaDGfeAVX0mZBb/AixhmGMh7HxI9HNMDaG2fcpewVrZTxME3MIM4c5jDmcWcesZ05kTmLOZM5iLp3Uenzg1iezIRxESiGfUPSUXiQpenacc/eirJTxpFCskMkXagOlXIYElAwJ9KKpAmxLQ7qxMd2gDnuaAnbwoyfUYbvHY0dPiB7P7SRyyGNXhyEgZrPueKPD0Rh3Px75KELMLcRcF41EokdG4G8V8eHToBZ1GCySEz0BlVdrQE/YPa+S6GyWBMmThuyBJg96gtRc/jmp5DJi3Rmp+YNpY6j2J8vwjIWxM4w7KtF/5FTo/3bWt/dD8sPrL7jrAryUWOu1GNZHpp4AdbzJXs4mmCRTYIrMIMzAiVGhoxFE8I4pVMhli/1I63KI0rscQRSMkAyDUYTh8ZJhiSLF480W84mYUc56YXiMUCYBY1OEkXRG4zAiUAGMCJSVagNsJJgJBDJBRXFIkqP8Q2IrihZ37EjYi67xhkfUq9CufKgtHG4L2b3hsFc9hdjoAojfqj7je8NXNXh1IBP4EH4jXvuHdi+1RvSowZdJqZefUf8MLlR2NFT0LK2ozxseVd97w8f5wBylOQxjrva1zMSZDqaT6WP6mTFmHrMMekmCPuHpBJWi1WkIfYfJTMZK1Enarc1dvnY+SlMGMKO+bnNj6PkW9fXKDMOHVnzqLrRSfR81wIT5TeS4yCSD3h1y2tSXRM8sOttayIRFLcRfvo/UwPpmlTfDix0qeq4mc+kbVYvOqTfYU9lmxspITB7WKINiIvKEUHYA5dOIjyXyxazXY2RjIpY8shf+S8Xa/0I+jdlEEv4LMDPIavbwRt6Ig6mxVGpsGbFSsHEcAnvH6Lnr8yuGjskl7C4p0BgNKYGI3GCz59efN5LPzGktzDnrq2fOLbbM7cQnpeYeMdbaOnbE3NT/ZEezYNC9hXXnjV520erFLV6z1e6RAyElnkplssUSVFso80p6ZGztuvnnzpt37vx1a8dG0kxDdQztsNt6mAiMYh5m/SxmCbMUxnEDs5E5mTmFOZs5h/kSczlzPfM15nbmDuYB5kHmCbIW6ueyrEi5ZO30jU+XYfoayBRw0ingzPfiiYRaP19boq64uzZQWwR92xMMetS9UjAoffb++9cLeQEMXkrC6l6SBrE7hJwARv30QHlRRGgTwFxbcdoFMNcKPxTAXCv8QABTn8ZaK3UjgxScVanoKweMVX9XeSQyeIJDlXf5iqDeKwjoMEF7gGa+qtX/Ve1p6ntCSagaxlgdYwJPm2CEe5iRGcJUAhycFAQ481EoQLc9p6w4c9rcPyggLZdD8IesxZVFMNdcs3RpfCgeH2KtdQXAmgWQs1rskpD6AJRaHCqsOmFVAV3Rp/4pPrhgMF6z35B2JJlmfabOZhbNsDWwFc0Q3B28XWfiN8rNK+PwdxaxzibWNK26b2hPvOaPqYNVpD1dMx0TXjZ6w4hPJHkRJ9N4AHll3hgCt1RMI+NBX/znJSEZx/Z8pNeS7gslslzz3AUNN3Bmfyzm44yN+fQ0jdguJkYsqCS2vRVsEU1C36LhsCM42xnzm81+Z0NabKCwU2uTBDAhwWSZHMDPIWYB7CRbD4TJ4P3ah6ZEVeoCiCI8dD5CVRWQW4HDGlzG1wFSQbGMCpAgWEsFwfCoX4h8GCFmJzVriMFOkhWKPUcgRGN743PPiZIkPgeFJiMsdTgPqVB9iOA1Z0Wi0chZBHKgNpLxOaiE4C7PQcFZHrFSHVPTV5V1mQH4OQDw8whm1b+xPukErgRkSIGugAB0hOz1EPQ3kR9ExSyXk5Rplm0wFAp+GAoGQ7cTX9ZkGjT5nMRSL7333pku34q7I/h4KPR40GTym4ZMTp950OzpY3QcnyULwQpQB9wSNIqsvygd3WI2jLweHhnhxdMY3rtkRnwJbYngX0ci5XgE/dOq2C6xWtWzzdZbBY/diPxYQLer17jPQCePkd7HP7dav2hTrOo5JjaKjaLbcpdoRiPqdRf40Unk8Rz0/1/ZL7M2Jga9vhB2kSMAWyTwqFQM4xJAo1JOg07wDh2INyaSBEShCSgP63AyiK8B8Mkqyvd1m/tOUTT880WHlbO5BdPHDsc/fiyGWDf6QmpJf9TrUQJNjQGvHGiIBxS3HB1Y3FZqGUqNLZ+XGmrpmpcaaGsbSKF33Tb1kZWANly/CVmsLuwS1bfNdu4Mk/n6E0x2J4fOt7lRa6x/SapUSKdiEdltt7vlSKytvVCCx8TU1kR2/LD2BW1tC9oPG89+P5wiFWv9oM1DMhYKrNgFk0dDR9sOtmy5ASR7s6UBFMKA2sSSsBfxIkqjTyLod5GICuPRra8sDeHSkLfyfWTxEKzLU/6v3qtGs6uKBrvDZsTcnBtGYl35AC9LxgJZUfh1iuQNQwUTlMAsjTbQqJC/bkQb5o4ZeWy2O4zr12fCoU6L0eYDOkCjJ9/T4UYKcNUcU5rpCnMq7km/g6+e/z311JsXLz4tkxnPZtPz5uH3CJ24WacTryd0Yjambqb5r49l16jb0RX1v/1hQxLed8YQjpM8XlgveSB2Dw4NyisJzYMGfJZbBOEWi2+6hT3r/NdsNtPxRp/xeJNNXz9vsruATvLA+s0yvcxc8pZkXVD0NkYQ3jxZHLKOLhN/nsTyGioB7YBWyDGjtlDYoldW0gjoBmUAYWbbhrVdPT1daze8X/FsW3vHmjV3/ODQxR2dnR2LD12XIvjvMmKlkl1di7q6ksc+2rskd/n1l+eW9D7KJuoKU8/omjuevGMNKfxDUktXamwpwb7BGiqNl8Cov0brDu/q6+s6fB0ZB0znTj9+gq4Nxk1WhZOuCmf+2Z2ob+dO9dmd+HFikxAdt3fwMWyIIfSRwHihRyYov9rdGgfGUn0pMA2kMfjVEPGnnu9U/Z2d6INOKI9o/66F/m2g/Yq8Iu5AsB0RVJmsLVwsoSJmZAdqsaNQyvELoNp+IQQCHt4kAG3DJpzq645UCNl/Wb6Z0HF44y8FE+8JBCDVqdX/Eh0/OruATvUYAZgCMdML61ZkAafAJaBhByGNF1lANVivDGF2HVmzvyHW5bmrbvzi4VLnCVd//YLFvNPGiRIyrfn69+67qN931G177hmU2ISWNeDp6bYsPP9r156Ydx164ULW6kHIa1+98xhf34UPPnrTOnH4kCsAKLK0v2/H/8WYoL8d8F5srhSVc6zCunNu5Mw50UX/3NaL3L3b/nFm27GGY5F4Av5xeesd38LXqCeisPo2+mp5K76K0cYL6tqGf0T9NsYP/ZigaykPGMks2PEZdy1x4axDL/6NlCs7juwAo2xXwCDv1CH8ow51bTqNbusoP67AHx45eJghPTFNWxYxKwFrOPZgbfrPplzZkYa/DmVUAfOTNIQ60gcMpDsgqAX+1Ybv1xGmKfuhvt3R2kAdRhmtb8MHHWCgfuqqa5V9Chh0m+ZOvG79a2hjYtjvXer3B2ctCL2yA1/W0VE+vUPBtypKed1+XVGZr1vxrw8+X6sUrLOOjv43Uq7ObMxmN2Y0G4nZDdmqgVAlAWz8Zua3GTDqlZqLth08TGEDtOUd/AiFX+2A1x4xQwgmIl4qlqScU2cdkB1J4wwAXMgBcqUBFx5204JCiB6AG0sTsxJgyjsSs+LxWQl8fHkHbKchfDzY5Q8dCW+yIY3u80WjvrflaFT+QrIDNSNvSnJYvK02P7rrNNM8m68d74ay6n1aHehQcIdTIfU+UhM6NJQ62iEb2y3yO6ihKyqr75OKUIMcnZdrCQbdzS6LIwAIiuLKiA2DLfrc+EBv/2LmyJliG4BqSp4chPIKAYu5bEk2KjECSCmLSYkVSBB24azMA0Tx6BxIduVBukAdSrgRNjlCJ+XnLip1SLFcd6Rfzm68eMlQRGoINjSlB6wtdj9q8Phc03TCt441WVhLOnTMrJOGHI2Nspy++MiFx4yG/K2BppLPEXSnkk6D6KS0+pPsn9hhoANbmFFmKbOa2cKczZzHfFnnDUpV3qDeF9Fq/2QKWm8omSRpcwq2fc3VYJNTIW6O1SAW4RxBDxDOEZ8r5eRcSZFyxdIALuQTScqj0NENmDIpVEjKSimb04JJpYC/oS6nbbtLXa71ID5eazuJ9RIOaVMTsW+wS5K9tZXY42QiqY+TCbA2eUjCPuZoXjV3ICbYJKvbYRUtTsEh++0mwWR0x3b4Mz9xc2bBarbZfHi33pfDlb6t9PWw1ru/kMJSWQQLDP4rWOoHUflteJz8jhxd9Ehr6yOPIITsXpvdb+Akn9uK8bGc1WlFqLNveBxZHOBDLRUe9n+zV7NuphHoygHA6I9iToIROAv6/2oK7WVAE+UoXWMiTkaNFK8vUhKasG2BCEElIleIQgcCEs4rRJxSAFOKhhGvdCDFjpTkIIpmKbpnR4Qa0tZmCkEuwsjzErookeTpmGQp7ueeNGoEY0V3ukMstCLX2k1Q+/IdhLLuaXnxRasLovFRFjd2WNUfxjJshOP6uHb4cajHsJDLGGxjNq6DW8ghQ8olWFgDNhgNBrNgD9idGzhufabTYrZK/y21/CTVaRGMJusVTll2qq8RGzWqnyIr6w5Il8IDulvV0ylPGJFXwOtaemY7reVvWNwsgl69EnKwWeUZLsHdy4FJcOwbvKGlxcC/wfrtraKBRayB48QWp8/Icm9wF3Ugg9FpM/cNHZHgDF5IflB2rnX4fI61Trk0i+71gNs9BbjX/ryscYDjJ/7HOVp1EqD4AIJBpCjkIAJSrcTGKCs6Vf4LxalT2F7+S7xQiGM72OVx1rz37+uak8nmi5PNzcmLiG88cl44fF5E/YO5QbjhBt5pt7C8cdUqs4FjE6m5qfInYIHBDrBG8/HyJ/F8Po4d8fxjo8+SSio/9eRwJBJeJrCmM8/iWN7mtBvHxnivhSF0Ww0NNMyMwD66BPaRmcIRSlx4ZQoziE1JjkRSAbqDzMka4CzVBg4uG9xqDkckKRI2z+XlBpmfWx+8I4LWAbF7a6TiTkNTvWi3mhpjDWab3WqzWe02c0Os0WS1W0TRchLhYVyui7V0vPhb+CMmwHRT+QppU4UhS1sU1aipHCxc2BplnVurRKdPVLTEXgRUl+oMmcdNdrPZbho3h2IhU/kDLYT9ptArrqAZ5bWw+jNzUAkRRzSDgejQr6EsjmjJ5d+R0uY5WmiOOYQ/ctrNdviJLpdIPXYgT5x2k90FP2fVo75RTa4W0ObCm+wL+62X/8AqYZX0ovb2RWnVmF6YBoPU8r7m7u5mjMAuH8aye8vrqrN+5nOb0fnud+uySBNQyRITJTiiU0HkNyW++tVMBv8+my3fq2FfqE3DyVirLre8KKNuz2TQFZmKS+nUff9gf4g/h/lBOBtkMw4hEScmCEad/ycjuvMOaGLMaKHiI1wu7OYspsuNHGdzuvhxT0AaF4Ie4XLBrl4keswOl8OMnzE73HYBKD38OcL85bwLvJxxsXopZYKesVjwBIUvWVCZ9dghqxnMbbdp7jM2IPn0uQz9skvnNwUmYc0cFQ/Gk1wWQLjz6uvQyuuuU3ddx8rh0lhSPQWhr0jNYSdr3QGRkLjjOXV7cqwURiuQM9wsoSu0vniT/SHMlQ5thtRzJAoEh9DwCcrDo+w7KpyD+QCIBU8glAydhzoQleUWccPWjRoTYePvN6zr6vaIJ5PWzjcX84ce/v1FC1rbjJmO8SVrREkyip4dNqvQYLvLInomMSC2UTJ4zYJ5zS3WfHbxoY+PL2pPe4Keb3vE3xU5f6OV62fdls8Ja5j20ZvsL6ENPiYGex/j1tCl3CR8yY+SVPYM45igCFF1T5DIsPej6tqGZj/f1Ywsn6kGbb6jf8Bk3wVzvQs/3d0rerYLZJiE7fCO27UR2+5BH6lXx/OjlblO5v7HaOvn+fjKlfG8utkjbiezQthOugPKwwTZTl9fn/tP6GNMaJkgmftTz/l4ZVU4dHLkbG3yq/5sFr8PC+K0yZN+h7YatPH+jH2WRfCULMPEc0XC/krE7MhJuC6SMwm2B5ATbtLML2q4CK9gr9HCXy54AsK4FPAsFgJk0qtftXsEu5vMeegSh437CzZdTpLG0emEh69eNk5KXC7s9YjPaH13662EF/mM1UPZRu4q/LIxMpMGLGyQmQ+Y2HJmBXM0czHzFeZmZifzbeY7zKPMHuZZghdTyTgVZ7QgDT8rFtiKoENPqTBfiaCD7HAE/edqAVgdhVuqCgFgA2Q1EiKZINxsoDQ0RDpLNosk2RpiJJZsHNB9OvkxCKsgEZ+ZgJ69YkKejl8vb3ba8DLRE5uG7XurH630+9VdfvSEf6MfzEa/z+dvCieSIZffaUeszcL7XOFEIuzy2Z1Gg9Pml0yikectAB1s1tstViv18Tb1Xv+9Pt+9/lobDX1UeexHH1HtAby7Tiqjs5ErYpkTfX7yeL8v69/o8230q+c297XYLTaErbzB3tzfDMCJM4hmR1pgjZyJNyO7R7R5bYLNYhDm++FvPik9j1gwBywaP4uNMyEmzKSYNqYL4PcocxvzFvM+83FFm2R/vR19kdejKVP2fLxIkG/Cf4e5P0CHkBKSgCOEkCzB7ieJECPCpIJ8ZOhhCsCORwdc2+hg/BPETRYS+VJhAJF6iL5USeYlL2wmfIYniyhDZRsSVXAgG2umVCA7ailTIhznDLw3lE5m9M1WJhOOTLIqjxd/u4VwwBV1G8GBdu/WMCNnBC0EfOmhSOSX1KwlBm2xBgVA6C02i9GAhaC1WbRyCLts2C5hlsWSHdtcGHFWsdkWtCCOs9qsQBhYgrYEyWh0OScyOl1GknG4yZAIIIxRIGGIIiMvJ2WeVwzxIIkLxg2K0SQlvTxfDLe19be1hQRRlESRbWoeafnxj5UsvLZDycwiqNwn0Iz7ibjvAYKiUetynoXXNZhMBgM2s0aZD9kxZ7R5MJZE1hmFt/FghCQbZ8T2EC/zBnhnkptDgoH3ktyOINBv8LYOxQGvDv6gnbWHTCEPslgDKQOy+mzI0Bq0WpAbGTmnk+PdlRS/FUigAEkxcnY7ZxxtGyDinawo2e2SSPZjij9+UI+LIH3XjdZOszq+FYq//DKSXn5ZPUzBL8Vi5bRScfE3y4/jkfLjMUWJ4S8psZjCVHhiL+EfMWZdnwSeQYhMBYjLeNWH6h6xabMUfjmM2jZ5wVGDMdYUi+39PIYTYa96NdriDe8EsvgT7JDC8DT4q8LHH+qyh9JM5Q5UrFginBRdHTBfD9tLPT2ldUTMsHbthJhBfU4ICFvfJqjQPwSy4c9AsKA+LAhb3yHI0P8KUCJQkelo70xwWCKFmhn2ylK2hgWBDWSaBoWrGOgE7plX7753vOXJlvF7t85h50yDqJ6v9m3dip5V//Dcc5RX8An7IDtEZfYtTCtThB4dZtYypzHnz0xmTzBsd63EOVobYOs5d7AL5QoKRbvyiZwGZoqlnERBk+KlzK8EX9k5WJdOmX4c6Wn3+dp7IthZ/jiRh63EqdGmlr2fPU+mH0qTqfhxpht2sVAp4LFG8g67/Zc3CJl2Z6j0fHtfvl1OWnE8nDa3W5fnBnoKjbFodzTKWqB6VQHC19fWG0ZvhXvb/KOFuKoQAhi9FS+cN4oGlM2x2GZFs9WLB3PxREPOZ/XGXc4Wb4s/EnZFF+V6V3Z73FxbX9thq8dGFyeaepVYb5zyYmDCnssK+/F15xJJax13Wp5ZAFGaFnkJPWvRN/ASUXTEC0OfhsOfhgZDu8Ph3aE5oZPC4ZNCszXdQHWnAWgsFrk5syxzf/+nwWMxWM3cyehM9Yv4mVA4HNpNFHYervrwoSZBMJWXWmWzYMHHlm8UBIw5GTaZ/up8/r4+n49mrpyh/gpdqSImoAKwDIqI8FKOcqQAJ2cJoCJMO0Kwy2Q2DCKegCUijid6AEV3lsrdwU+WMVQmeaFcBachRA5BcGDmBDRexgF5Gm83yRKLjKID6EvBZrVYsZErWBzYaR0Z4tsDBqVgYq2yxPM2p0k09A1bYFe2LrGzbq+v0+yENpnsRpvbnO4wY+S2GR3meJOZxmTaTBi5pll+A43+pMkuIJNosvq8nhZekpBo4awudW8wgTCbjlklo0WyeByWzxASBc7qRN3CrEBEfcVsamuzsQi5Gs3FksliFF2s2Nmpx/TkaAzDuHT9iui08qLjmO06BXZA/JGdEjLUrfe6SVyqW/x1eEptypYoOheA/oVRvCpyXjR6XmRfBJ0bjaoXRirubwlYLf8IkiDDrSRwa/SuSOSuKKJqxPjZiuav+pluE0WBrZE9ETDqjSTuyGoAko6MPhqJPBrV5+4n7E2shXHoekp07hKZdA30INsV1fSogSB1rCJx857jj9/z2uqV+WIxv3L1CasWLmhrb29bsHB3xaO+F0Wz4dWehG3m+D2v7tlcLKxY/caRKwvFWe1t8xftXji/LZ1um79w96L5be3qK+QtJ3SQydqqjF+8Rj+IqXuLOhwxXrP6uChh5NJ1h6pyZxiBXG0AHRVDwVhMfTf2WYzlAfD+bwy/A/NVfYbM3Lzq7IiZUD9Qe+8R0HslsdgE2WivIl5U/q0+x6OjapOSY/NxtJVUVqmUuEyFf/O9uvZkKXU+o5bI2haibSA5GqDat1RfbIOCAoqivqd8pmgNUPC7ZEd/Fpb934AgC3o85+mknOfAr36/R1TfpQyMIFU3f1ejf0lI13N4g71Lf/cA4E3dk6WNk0VVChFUA3EZrXC7YWsj2AbZs3YUfloAg+8hIvnnifX973y7/BbGl/FmM18+3cp9zWD4msHEJgrqsfk8urEAaNCxUjgsoRuJHval6Izyuyw7TzDGefM8nmNPZC3sCSzWZaNP4if20yebGZ4xSdH2gH42PBWfGCBy+cF8Af7yL9c5+PFWfTDARX3gjgBwfZYC1754YbCgfl4oIFNhskt55J/iP1IeAtGlIPhkEOgowv3LUH2TGt0KrupjZxiH1s5r60+l+tvQFfPABv/n00bgp0KUMAhrjnor0aFKpcKaA0GNbNAcpooP147JDOWANRyx6foc/Rr6LD7jftbh9kswnx2A7Y0xmyj2rInEiN5Wnu59xsrmBwutWNn+0ojoa1cyFkqUqV6bpyhPk45T2zas27Jl3Ybfb1y7devajVsXXlFolj0eublwxU3g9UqSF7yoKHr0TAhLja6adI84dRKbaPAfcdwR/gbdGW2QXZIrBD+5ocarPuUR81quPGdzYk9gIkfQ8+HBEjWdoH2fwt5shZ40E14rkO9I5pMlfMYDatsD+Nj7l9+/nPhT38XHPHDE/UdU6ZW7YJW2AuZP6BXCYFRyysS496MBTKZGQaqfG3E54+WRMZlJlFARvWlzIZcNPUeIUfSJkkGERW4iQgZHC1Exa8HHyLKsEktGN3nxp8jd4NLo1ozyY5PdZHaY8I91eQQhYkU9O6CTN8k6rrob/+GAeEM9nuCcMlBHTpZqoc3NEfw6gPSWSNVFCwA6PhxBv4ggHnz/G3mWAvE/UNB/IqGw0VgFzF8cUT+HEqbIpL0uxaSpjvFSgsvMZH0hhVeAnFIAZ+SUQk4TYfIwV3kqFqbCygJMeIWQKCmgV7KcJnYvUXaZrBBuMVkiHooa5IwHXaOq/zBHdklxST4QCCH7cSe3Oi0Wo8XpEuyNdld3l91kt1usPrNfzHbZkaMhme2KBFLdjXbUyZptfquXt0cyNp7rME6zxNUX0u++u2zFimXv+uwtVmhKY7PDx7FH9RtMkpM3pIwhc+5032BXbySYkLyixW4RpIUJp8kVp/PzdXY77AkpoPyWUwkC+R+k5zM0hQtArpOUT96BnITH5CUrmmgUEwQeUlnKgyLrnHfSjCzsAYS9RNhRGnspYeRxyKW0DcxpirvMFsSJzoY1D7OiuHud3ykaEbKanNHmQwY641ajw2TpnjM014IsYfOhN3710LQdWeYOzelpXmawcrIBGU4zWA0vgevlrAY24mzyK1YeIYtJPdXg9gVDJ8/DBsP8k0NBn8eArjAJCCHeqjQ0W43LhEzAZ0Tqd0MJ4cjhgWWdLQiNI84fyKhfOBYqdEPFV3HI8AdwoaxB08WD+bYHzwEYxLjTsFS9shlpyq4INrsLzEbO6ZVNaDlabvJ6HUajSb3cpljRP01e2WHkTepdkGA0OrxekmDTeeRQ5/dxGLAjASAbgWoLCUzjFXfOrc1NZ+3cFFHd5DzI3IxVJyaynSLNPmHu8aPxRBId+6VrSz4R6B1ZtplDTkleMN9t9XgsVmvMNTzfjTbHCrPmp5p6FigeNGgUnCPNrbNcZn7AhJoHUFp9aetpp21F6Yi76LTwpnjea/cYDJcs5oSAbOZ6+BbL8K3hw8fGU/FsICBZ3aVjcl6rnNFh4Jv4d4yPaWd66PmpLAUKHmOFX6NBHYpzi9gT0lSJ8YTyxoSuaM3BK5w/bMlYf/fwSPfA2OI7Fo8NdI8Md/ePLTlscHb/sX39x/XNPntW/3H9fcf2zx6ksr0jF6bbF6UbyUHGIrHw75oiXYWzjj2z2BVVlGhX8cxjzyp0RZpGGxuWHbXsqCMaAoGGI8CzrKFxKy1NrVG9NFh6234E+3oAMJIxbeUQNqtGu0KTZGihojURSNgw0hIJxwPyUUYvtFzrDsnDJ4kiOSKbC3jjxaysSfGSgDuieHZkGTRn1kBXbymb6Zk9d+zQxWP9PSNrf5VxSdAoX6vY6RuOty9qD3/p8MXz+npmpzON0BGzh1ye3k51rxAQ8Bm6cK98mYCvyLadUUhthFbKUiKbbgg2RaEzcoM7Du8UW31QoeTKBMLQcYnhv9N+yvfP7Uwn20h34B6bTxDKlxpdLhvH8fh0IajLqL9PxzkJ8OJgo0xU6Kvn52oHGEv6mPb0w5gumQtjOrunb97iw2MDHQ3aGCxqr4xgw5Qj+GhDx0AsfYABq667K3Bax+e1M29MnZ6cMqEOqysXSTl0oLibMsdlwFxJjm8dRw5rrZg3D68inuNIFAm1Zz7PgAl6PicxYA29iRpqQ1U94wfws4yd6hFqQkrYT7UDpFwVdt3gd33ssi5nWbTM5d/7kd+Fn3L50d9ud/lty7Hf1aeoVzkbGpxoK0NgJOAppx7gfMnMcdADix7qaOC3NbxDHdBV3J9WB6h6w9OAoqilCJoPUH13JPJ8NPo8wG4/EPYfTKcWcTJBAR7UGOsaQVzR5f1tdcyisJekYTeZxyxi1jAbJulGRg8wVu4ptSJnOtpXdqxPp9d3oDvcjY3uDcQ6/JBDvgoxEK/+Kb0hDeZiEr3e09joOeyQQ3CBeNbrOdExmpppwP0hifnQHej/GTLrKqhnaC6Nphn6foZMtSEdb/8O5beFofW9Bx5HFKUs1SihcpJUiterL7RSJYWGWJtG/qphzUUnqK9QGrgNaOaNbxDvG5QOPl+9hcavp6H9OVvlnxESO+h53BOQqAwYPJq2QIWP8QwboXMwV6PFcyJzzkz5hZMHov6QF1c7Nes0lOPTlGSbDoK0nRDt6IjujKbT0Z07TTabaafZZlMjynKlatBbkY6OyE6aj6SaST42Qnrkb3r3CDrj72+U8SfE81vS0QIpVYime6zmAqm4YLZaiQKw+jmx59A0mqtHSyO5dPrhJZ3XOjyznmMlgtvS00lOGHByXl1SKFOL8k9ybG6CQUr6oY5B+sh/2z1WE2cwS2478Zo5lpfd0/A1y09brTxnMSmoVXFbbIC0WnhFfU1xVc6LfMo+q991QE6KH0rbgWfEMZbSiHCGAYZAEwpFrzyA47oWU52AkU2Ee9p9U8lItg4P9Ha0XHnzOYHIvKal6ebk/Bv6/evPV99vaPP72xqSXV1Jm9vd4HazVn9bT0RNaD2D3gSLyAQSFNd+M1541+9rO2F4jrhu3hFdgaB1jivaMXx013UNbbk2f9eirkFSR4NbPyPztRq+V3BaLYihws4CGDSuuWp8dBQ/ni9/ks9jR77ibt77MMNUzuDsqK9/ak34JNT/UJ5Um0dvatVfMWXt2n5zDdRNZHky00jovwqni0gNNW5XRXPjrzsJL2snenwn8agS1LsTfpeFvepKb5iMQtiLdnnDO/c+zC4g9RM6+j32QdgbgnQvowx/Po2pSDpENBPlyikXimiTaMCNSjQJ8FESk0QdypEblgYyzr45Iw3bQl6pd/Hi4KqOVaktpywNBlvQttZt2w4PRVq312TbHpSk3vHx0KoO9JoSNWebO8PNZtm/Pbh4cY8khY7sOLI1GDp8y5ZWtC0VCR++bVvL9rps44t7PR7IVoXb30ffrDkfVIGMJzfjvc3NZUMzuo0qhLlof/6cjpWNEaE/A1TaVmK6mFHmEHrHxHqAZOS8PeyNbqWKIQHSyx0khP5/yPnSuBRvjUvUQrvqAou9TakmL7XK3/xPZsOvS3q0pJvJXvW6//scOv73C/SLunH4F/r75albUxs4f9o3qeBot9I7NJphT1zIHMOcxnyZuUnbGYneD5444NyL+EkgTInXHoOu3jxSn2n/mvCBa0LT1nQj0ZEmejP36cej70f3Ec2Z+ymG8E39bpj7tGPX991H1KGIpS6qK0c89QX1ApPLsVaiq3N/tYx2hJqWuV+/yuN+eAnyHvVJ6k6av6L6Q2uoLamXgOeR8jUpjHYnz5tA0xHdAoXpoOcal9J1eTbzJRiZO5mHptA3cPPaoWCqhpNM2JGuFg8Z4oRDokUnS4qkJ0ChuCLp4kySS9FiaYpb06qXpRykcCSQK1ApJ/nxUk4vE9VYMjE9NwD8JF+tfrDqQi4crh6p/H1F6aFkQaLHLWKbR7IjS++llnjUxHX2OFjJimys1WNw9HRyfKzpxR+wPCvmOqzcoKWsPmkd4GzpnAhxCD2JMMfa5syxsRx+yNqREw1G9gfIMqheDxHoScxjSHyeG7BCRqPBWuxEC8kzbaz2TI/bk0ze7+jOGOAxAmuVfmSANEtTjIf3OJCqRfk8xBYTigHFE10GZPKzNpeBi3s4U2vabE63mjhPwmBw2V5w5bJOg7PRxI8fZTQeNc6bGiGYzbncrc1uJJgxuEgmkb72di+/cXwWSXCk223YbJ7HL9po8qbbZdYVrHkYi/jTOE+cg+pZ8ihTImvWH6/pPL7JngzzpnKXCqFR9rsjhdx7g6ZknbIlcq6k/BGxMbjwezCHo7lc+be5issmIEcTzfF/5GhXuYn15LLZXNmfzeWy2nvcyi5g1/1fvYfdryh+NUJs9Ds1gn5Xfq+I/lQsqp5ixWXXKf69e0gOdq5f6du7h724CH977yF2BX94muKsccBZ11dlrLp2KnmNQaSf6qHqmOQFeYWSXiUd5lcUAzDFDotxgstXTi4ABkIE/b2Y4sJG9DVNbvcWECJEQ9lEtpG3NOXNvf8rep7mnYRbYXzmXqoIuI+zOSVWIvGaFvPT90A88tghweFhE1TT+S26PzHkuOreh4HIoeF9EMZoxCPe+zTPcTaXy/g0OfvqwR4rYkTPs3UJViNN2MeQzYWcuX2W/RXbT3F4b04mqgtSjnKGqFISUdmVclk9VLmxjJc8mp6eJkIMwk4AbSdYEG5C6GzOyC//o4273mC4nrP9cTlmsYE92yAYIMG0/I8YsWbDDo7bYbT94QiTkTubFdhudL3R+sflPIS0fFABIvm0Ov6ESCUsYidSoXoW6brVT1M+8RiVYsCA1Usx8mTgpKRci9PjHEcuc6gZywlFXFTMot+LLo8NvVwhvgToeTNCFdKMqOXgbwmCevrEwFFxLrpMCLAJJDW6UYUKeVmAkmanGb9cwf4JOSAIQSjtoGPktu3TtHXvgeKMxtvdp7IP4X8ABGYqqGaU7u+EfKTEI1AdUZkqVZIhKSVKKA9j4oD+PRmduWzenNY2X8Q3eOIs9fITBGxmrVHLfTaMbfhPJo6zSxJ/clvrnHnL3iHnjt6ZdeLg8ULIwlks0By3TeObGRi8G/BsG+PUV2q0skaJbhW7ya/s/VTx4+vKJ+Dr9r7G/nDvEN6t+Mt7sQFWntrV2qfJmFT22yxmQgC1hrQzIgRpqODsIgB9QKCVqpRaGzaiWSQ7ISFKsziLJXIShIpJbmk+RPbNSX6bSJsejOSsg9Zc5Lsk8J3vCHar2fCd7naIQfd9m4/kLS35hziz1c7ipnC4Kd9U/mtTHidCoQTON2GxKT9gt5T/arZjBYchDlLKb0dYbDdj0WLX94onYV65AB9LT2j0SUoxjcmLD2BOIuQrjIamo1HIeeitNzkRxwuE0IXRwvI2osQ3ig45++ZvnNc0P3LaTeqntz7gDaFvbSWa+yOHnLXzG+c2LYB4ZIH4sAZfti255qiEsn5s/PRZy+4aCXn3lAUCG7dCdDy2Ye74abOX3TUa9u6h+ry6Xj5PNdqJvlw7k2EKTDdgb7MYpkReEl6HiJW0q0FyhOrWJCg8grSS/ovrv+ik3/ODmxtQ36bTtqxf1z9gY0dZ5Jw798StF6r7Rskfu2C0vGETioHZrNmnrxgtbNo5ypYKq448ZdMm8bzNx/YNsOiIzZv3bNr02KZNhc2bx0erfxWa5S38EuMleC9ZhXIIi5gn+n3QoQPYTZTnK1rzWaJNn8SGgZMXO3tW5w3d63vUYHZ5ty02N8MvOutVS8hyRqsQlizDlrBwrcWCf5k7ss846+jtG3rZ9OKjVg/b5mybrf7YArks3hDkslwrhC1Vmej3KZ4VZAanwqkSFcIeMBwpR6UcXqlyBphsnZULWBLYs40McncXlQ4Tz9qNJzl9vpjfZ5rX0lz0+vNtacngLok2VLRZvG2WhkUHRDC+i+QmUgzdlm4dywZjnc1Bv9GdCQfCDkfA63YnbUq6f+7EOYendJ5GETDFMcAVZ8TV2F8XNU6cyjkdCgLqeFtsjGhATilkHIY9bu1ackDhNCFgOU1ALUKARARJRBB+alm5Kha7SpmOtaEeJZBynoBwmkU4XQg8XB/s11Vw9TPeV7FRqjda0qUfOl8KH+SuSk7T2/NorSZtlclMo9JU/eaSWBJ2W0A4qV7jAJLx5y0jzXJLKaQ6QqUWuXmkBX2iOnQheDarniwIc+YI7kbzWjOYxs/qg0cBQMdF7G2gto2NEH61I1RsleXWYoiKwYcqMnJS3+tCgzB3rrnRLawRaB2TwsciLNnUC2wO1mtD50HdOp/zeZ0/V+G1LwGc5wvMJXV3Rk5JW8lTCs1nUnpG1Ntt2r2R3wsQJ/C975GDzd9zSNIVMTRXUdQ9sQ/J2KpnT5EN3R/sDIL5nu5oCWCxCRLUs4N3VHJUCq0lmrl3xNRHYzE0FlNn6Tn0/CNaxST3yJQpE+cftT0rrcG2/XYtIhu0A6wIkWOObBp1AJrB7q/wPdVGNie/qsfIdXYUbWMZ9Nvk7ASrDCYyovvkp4Ww0HqGJeSlG9fwgTe4sczSfNZmO3T9EG6evWikjeM6hg9Tn7JYoKRE98VhS0ij999kX6U8NQLrvUwDQOsYk4AWOaMAKaJOpcDKfFKBXxx+uQJYTvi5ndqVmewr5dWjuOG4L5/R8s1NJ7V8Dd1wc8uO6N0t5+9s+QJbXo3Xlt/HDfic8up7jsUNI6r59JbbTmy5PgOZ/gSZkA2yofmQ7/bR8vuV/etGdjalFWQmzCSJXrqbSB61PkvSJcqjEirJdpbcsZt0k0NC4Mq6+4Ej5cBH2O3HONrs5bsdji+P46HF5R9t6Tyl2LVpU1fu5E1/jA0OxkLDg3/2tbX5pI421monOdugCCnZZk8tLv9gMTrrlMwpV27q7j5uw2A3XjsYiw32JmIb2mRfW0ujT5fBfxWfS05WucnA1gjg4S23WJus/4PurIjfe62KTf3Yih63Wj9Fd5o5jsree2025LSSowoUlv8PeyvLVO+K1bicYf2WKDIitMuTRLmn5gfj04G0X7KSh71l76f4BXL1zOn3xO7J7YrdGd0ZuyVxi7Lzyjtjd155S+yWL96p7MKZ8jU4o4roryyz91PWOljeegdk/8Eu5c5f7lRueQGyqY0QaAJPBFy8CvKfMqiK5H2ddecH9j8zfiRzHLMJ9ptTmQtnfi52aq39OpVeogNY8fNTJZTqoFX0YFpri8mJ8ueJLiZqp3vO5bF5MTDfP5DzPWVMAYP/QrRf4rq06te69kucYP3o11RLvz9G9PN1o46R6snv3DqPvga/s18/LvtP9BpLT45Wzlv3InpxB2s9iCZ6eYnWF0QltY28p/cok8HstqgPadRsuVXwBP/Vti8+mve6LYhK4VKAEzBVHdzvQrtl/Ra0UZg1WyawlQmYvf8JD3e0ALO8EEWZEj0XVoMgyrmsvH8sISoOlLfIesLaQY6wGq/40K+rbcnnz9j7ESuTX/n1Pg6xLGc3dnRyDoHr43iDkZthHJsgFZc/qTxCIwTrpFWqOqJ+bwSV+g02zsBxnZ2cxc71G1C5PoIr93FWI2s0dnQYLXYjPAvpeh+34tNh1wgzbUQjGFXO1OtH7aEHqa5KRd4an1qP5a7hrbNnbx1WXx/eMgyG3G+cOTwDBrVkiat+a4QkXEpTacpGYuHTZm/9IikJ1lDm8KNIHFhDB4ytvWs8pZ9CPIQ5lDmMWcusY05gtjPnMpcR7aP6caeXXO83PXpZp9YUQkjWnUyZ+oxiXQCRm1+I2E67AYb0SNWHbn6uejpU/Kh6fHPi/OhzF0VM5GIA98rIiZEDGvV2FFV/S6hr4mp3EFR9+KceceIA6qz6urX7pMs3QwHIjGeL7gs1zcOKdRFVSZwz5G50XTSL3k9wwZDJ7hLNNfcoegGekztXlk1w8Q92epevWSdpJGKvtlC4Ax8Hbjn4edo7NvDYyJr9poULjXaHxWAwbuAtnAWhA53N1fjrU52F/ekG3ms2mKAmjjNY7Q5ugwmhPZPP0066x3SE2cgcxZwC+8o5MKMun+GeOunouqghsUqVNeimJIN+o4FOItGtlWJ3pZlNuoPf7LFGdGW1mZKlswtQP7eYca8xmxXFaDDYHE6johAaQFEIZQF2w4bI7ZFJZhrNlsUuMUM1diuPcjW6M6JLfUEgNRqdDivHGSce4Abb/Csy7d4g1qn0OpCJ+5wdTBRwR+1U8YHOr0y+dbHuJsIqyMLM5j2bN+95dfUKcoplxerjV9y4YsWNDy2cT06wzF+4MhNsDoJxkoez1s17Xnl0M8n22uoVheKs5V//7o0rSLaHSf5bpWCwJRjcql37X5X5P1l3Z/PMoWwdPhE5yNHH8jhr2vv5hbGHY2AItE0R8pZqyVLyNp+okLeJ/FWj6rv0tKrGf/ipjgcUZ6iNQqTUPD0/TbVAw4htP8iLnWIOStisviFEhS8asdHuchpPmEaHYqeAXQGLeqcVWe/l3U4LNpq+rNOXB8b91szszYmc3j3D3ZleGCwinZD0HhSXUzeNjp4feyY2yaj/6Dca+zmbhecttmmanNr7IV5AEKCdVQsd0290GfsNLGcxnskLHK7wi3ZDHwSBAtxUoap1prISj5EhKZaIajLRqSRnhlhRkxGkEcE+9O02hYxJJUZVhw7y+YaoTlBjgIDoiUBH4O14iS01q2fYxBtcNpsruAi2nmarpREZ7bzg4rpMfpHfgbbxbje/D7M44EPnExq4fDWxYzGNtMVbgp0BRzAp/QYvgl336a7kl1J9Jtsd7lzeHWQb0Y+T3ewokCn/xbMmvmBixSh/i998gdmPUPOvzdI6r/3PhCr+M6GXO4N/1gj1P0vJoGNk0j3vlXtuZ7zayH9c/0bGDO6NpTfRtMzaM2uaHe8fQ+cO/UYdJhdvoyf0u18q94NPfrspcM8SRUAUciNctDDNnd5frF4LPO113a9qFwqTq4Nn6WfuqF7oT2Zy9mHKKyXrAnXyte1R/Fo0Wm6NRi+JRC6JopbIFyNgwL2ERJXvq6Tjn9DTjK/XfttEfYPgHTrt8qIuYySjXGJ6mfnaN3Imy/dgBz1AHNrvsJqU2/+bJJDvXXLmTKUfBUFB9X+Q7W4a0UMjHlFXol2ojfgvIdapxxyjfXrkbXpSzbEPyHW0IQRhmj3sDY3sY3mS7g2FSDg8ug+N1IfPr89OhkOk7f2BTrPUU7xHMquZzczxzOkzo2Dq9VmnDLB1qh7yQUJsJNLT5vO19UTKf6n46ig7dWsMuRRF/XNssrupIPqCPpFahSn8MyBg7iBw7JaJPbNBJGUDflH03yMSe7JXl1GTO38leg5pEHrycIaJV88c9aOcVMFM2bq7SagP9g6iVQhTppCDn0ysXEHhciXiU/gkTSkRf4HdVdn0R7XXXTGx75MrhcRl+fyyvK+70H0nauhPsNlV4dCqLPveVSt3BDVIEQySlgbxVyb8JEV9cenSt1avfiv13e+m3nrkkbe++c23Hkm+1foQzBe5Zg+MA40zcd/OMcxWZhtzHnM+cwVzzQHu3tFuhKqinkQyHdWUZyWCNRE40YFQlp65KGgTgMAMgCo18mvtGq147Xwq1J1pndm3DYiaXrIO+akNZGqRN3KV2QTLpoGQPEdTqgQwSbyEBt2NbgiU7z9I2tWVS9orLurfH7V9c9asjsiaaHRNJBf5UYSYiG6zVqjnaI1kusTqwogESf00sPfDg6U+Sio4vnrZ3XFVy6u+rtCvKBiJDnikecIwzKRvgdTqth/+b2i3c1NiQhN07sFB4scR1AAd934ENWu7u2avorj+dBerk/Y9R3uA0pay+pzWWain8p0EfA20swZ7rnx9im5F4OMVDdfXMRhNVaxOS//ssXPmzTtnbP78rrVdYOZvmF9aXwIzf76esKNyEg9fM3bOdeeMDXWtO2Vd15Du0KhPtNsIzTUwXNPB72XmwEpbWcHJaN9rX8fSWQh83YWv+gYdrQOidQGZ6JTKJbmULCX5kiIn+TCuDcmVz5Ft3Eig+cbn1NcpVK/5MFQFvGpmdGhI/WnQ7Q4Gmq1NxiZOsTafWB/EdwM+pu7SvkKGVgJOQLCIXZUPj610xwP28hXalwjIMGXLC1CHpChSkI85k0lnjA/WhSr6L49V78efSsI53e34tZwi14SEs+LZuobcVvPkYdptNYetm3vGnDlnXE2sOfmVhcLKTcSawZU1K+accQ0pBdZoftVxq/L5lZtX5pnabxEQGWczUJsz+iIdwSXjOi6ZTJIFQARu+5HdVw6h7MQngZJeIpDbb4kM7f0D60WEJ1g9C7IL/1U/U1Cis28V5WNtAoxg27/Ac5h0wEM6QNz+pwik3MR5cnnijLnpYHfzXEPQnMcIcvPQffdRh1j33X03WlAbuk7/jNtDBfIFtrawxvddqdOyu3S+70pKy+6KF0ph72aCb232hnvWnhz2biLVbCKBG2sDqKR90c2rOfoZ5l+xf2dT+plDel1kuKJlHdY+NUAYUtrHVzRql94JRn52qopP9GEwIbdwMlEcxMk0SuLDHKZ1nGR7zS6bectNZhOOY4svJP7A0mB9Ugz5LBA2CV+38GbZ/ppVMq4ztxqWiJ2h3Rd53CwKf9Nf9JtvD3N2F3/RI41pkY3wzqesdhzG7mDQcr3Zb3vFHnBh/igeDFDJ9ldsfvP1lmDQDVns1qc84uo7GhWu4Xx3vtG8e6kNWwxLdzcWPPz5DYawr8IDf4f9gG0B7OcIOl+2MmcxFzMMF0sqiWT1v0RuFq9840Xy0mPBCV4kbQZfzlsiBzDJ2s3J3hJducmCXpQe05S1+9hkLwtrt5jGxpLHCysYpgl4YC2TmVProTMIm+ISm8k0xwM+JzvbbEo2XX7EmtXHrTyk0+/C/tH28VQy6BU4TkCmptsM24JGk+AMDwCIcge8ja5Ot83b2j9/2aJFc7eEFKOx2+7xhqLNtwdTgMW1hnpCLSEwN8APhVLBuzU3tDTcEgy2BkMGY6M35g94jEedsH7V0nMDYbtzrGtpe87IXjOagrnNea0Bi6/dvmjMPSxAzXl3M4dZxJudnSehZHJ+Z69obfAdMzx/yeoVbtkTcMmoF5oeaoXfF4H2hmcEBz2hEDiziRMK3QwOPLtC1z+p8zZm+l0WyvrTlbU0ye7BOUTvC0Hh8cd1Tb9XIPCqMA1X4l1BeOIJcl7S5eRfEQQoU9ENJvgzkdoqNV89XAN45Y3MN5mHK++v0asHutNv5pc2szLRdCEbTyknSyEqxydHsmVeSepXNNJ5RrUpIYtXO3RKJie9308/W+qh4CZfmjglUwojkl/i9e+kFkp0+6q2P66Lms4kfLUj629+vs4o2BcHjHEOGb2c8SuRNOISRski2q2uqNfqTi1McwkOG0ySzSQarVYpZPU2f5CSQyF5GbFSnoaGFr//Sm42F+e4ZsMIcehQEBqTPLxCIGiny0afrrsu+gLu4gZHQ6vCcZxBEi22SzguFuU4URDsvMHECfaueFPEyFmMZsxZedbIGniTPRxoQr7A8UGfL3h8wNcW6YuASbDbtnDckxw+dRtxavj3Fcp6huesOGfOKUuKE4gecuLKSWgggHxAGPGEOCocHHX8eddr1/687wj4odMe2A5/06CLx6g59ELmevVva2LXI2FNrEtt6rsX9Z/Vx1T5rbfVwOrJN45MAa3NSEYsks0YHKt+otMVLLV6yZHOSR+/e6S9PH8heiCtjiMrcRZPB77L2/DudHk+mo8ehNzqp+iBdnUxpe0n5CW1d1MdxWxnvsBcwFzIXDUzCcoM7z91V3h6/1ZV00leprjJNKtzoGZcShPK7KBCGXB1htYOUgKsw7XrSaFeLTegrO2NOypV7yBoam3uynWmMDc8M+rvq5mbmG8wdzF3M7v/3/f9lJoFtTWh2s8oOf+DI6Tuqhw0QSsJ5q/RAR51p/86P5jf+Ef9YMZJd5bvJffjhfYQ858crxWV8WrWHoaYkPr7YBA1gkM+yFfROdT0Fzw131icKW1R913Aic5GWWyYlra4nvCbPozdrii3x2ZAURwd+zwG5nNdYZDbj2bv+TdodXlmFLnaXaHIX6AXy8MWRXY0jRRBf4Ydrm6HuoCQdN01hDcz+fsDFR7DwhneMFPHA6rjCdNrDqEgPcUYmuYTqh9H0DnQjIsiEXJ1XQTzVtMSo2DAhiUGq4WfBlSo+wjFfjYhWtWrl5isvMUK5bBBoDTdX9kXWcLlJndpDdS2KsmTowYEYUnWtY3eSFAi6uEHaCO7NFqKgvnJoD3lmP1cpBjFka4oXlne5Q2GpJ+7xJ4Bi934shQKqSaq9KO+HGNt0a6o2gwWGrCz4qxwPoJ+C6FDwpLaLIVt/f0WHJbQG96QqmoXzE7gX+FJfJ9TmXOZS5lrmPv1lvjRfwQB03At7bofj3ZJh363lYZteQEH1e/2KMkaJrX/pceQQnEtySPn4FVkiV6l049I7ty/gnp9pSnNGjoNiOWdomABJDq13GuxGDIGZDB5LWYjsqQija2vGiCP4ZFMZ+eGTCbjpicO7zb4Oc6PELKZOYPcZBMkg0HSP9XxMTIj036I1+ejzzTX/KlnBJsMBqPRZBKMZj4oB5vc5gaRM1g4E+JYCy+Y/HJjstfwdwOYnv7DensP68805hvBHGnoMMQMR/Iw85oM5DpL9wkQ7jBU7+J4FWj5ijxjUPtS1P4X6h04rubYjEafU04sSyhXom8EYCVXkfoVYMaeRqhlSobffeONuJt4HiNREFJ/yaIBjAcwf4OB5w03sBsggNBEGP8lLJUvpR/SO0MKj5TvxDdPjpAhuwH3syzbZDREDLyCWfUBGjeA9ThjE2Y1nspv2ZfZKOzhaco/Y8yoOltlRK/ERcV8nDLKyF2v9KSN9qUPRKbfAXhEOaomf4/6fHtGLZcWetxAuJcaO92ITZZ53u2xIVb0mFFR4HlBLZs9jR6z+rzA/0rpicV6RokVsxOwZPfFYuhZVEwuLKllKK8+n4S62MTJ+2weNyn7vFa2TCpCRbNHfFcvD9aIozHcaI91xvSx/QL+DFZtA9DbROPoMIZxT1BtifyEbi7Aq+qFStqp75r7lRL5OCIZNX9dwldONzqdNpiZpwuNHtxLbAEst7n8IrpOS+LVE3UP8tbEQSb1MxQiBdS3zQE3ug6FeKeTaGCo75DKtpwO1J/V6TKebnY3lt84XXA3QtWeRgGquZY3GGxOp1E9wah7PqqJg/xWFCZZoSZ3AF2LwrQqJ0/DjI773q5/d71WjreYyrUIH+vUuq8yTuZH1X1BSZ5hXD3qNPWl3xFyN81Gep3N+DheRb9+vp1+ofxC9TIEfUAiXqcRYfWPSNovoryJ4keoH7b7Z6ou+f75Rr3qvvEv1wZ2BqUN5Hlg9S7eqT8cknvH8VBI5QAF+ic4BAVCLaTmKh70fI0+Y+WrrtPKAglfMgo/pGs1sqnK5dLlv1TlbUSUR1gBVMlh+yiaM4LmaHcXsAtmIJwbreRVHyNqhpru99vsW6ynTr7cQ/Q36mTLdUoaztoROxDiIVPJXMzIS7qsSqYbHtk/Cvqul1zRhbPd3eUXuy7M7clm9+TIaVH8lXAuDEa9P5wPhfLhuxzycXYvlh3Hue2cs+L3iKyHoIKql5wtRX/IqXIuhz7K7WNqiqIlEDhmv5JGrUadD/7Tmjsq6ttbdzftedVLE14gUA/dRWAPOpfEkBRG511+wt5A7+5tP6Dek9YjNbK7XEVul8CWzY9t3vwYVV4iV/GeILouIF8kOt/d6L6ACKUucE++qPdnJLLRfX5NNl0u8xTeR9vkYXyTv5hcc2n7F5pg62/aW25CW17fmPtjfsPrV68wLJ8fb2qK44fLL1x5Jc6pu/72N32/vAFggqMer/+X7yWuOz1SaTFpSrGw8sgTVi7S7hxe9PAiTcVrkfr7iHZJceRtKs6LbH7slcc2k8y0A4bqMhNPWn2ZZLyNFCFF9Xf/BD9SN7frbzqJ132Ts663El1busCgZs1VQ01sbzy+90dNeH2Xel9XFzq06/Au1Qief3SpnwCKFGeY/w8acz5TAAAAeJxjYGRgYADifx656fH8Nl8ZuFkYQOCJfaQMgv6/gIWBOQHI5WBgAokCABA7CQsAeJxjYGRgYG7438AQw1LPAAQsDAyMDKhgHgBUCwOGAAB4nGNhYGBgwYYdcIgTwjB99gTUOCCpdcAijgtjMwNdHF2NPQ47bNDU2BBwHyE3GhPpB3si1GBzBwgb4PAXrvBFjwd7PHGDbFY9FrvtcahFdy8DA6Y/0dQBAAt/GYkAAAAAAAAAAHYBHgFAAdQCSAK2A6gEDAR0BN4FdAXyBjQGuAcoB4IH1AhGCF4IhAi0CP4JJAmKCg4KVAp8CuILYgviDKINcg4EDooPCg9kD5oP8BAgEIIQ4hEYEWQSZhOqE94UEhRsFLgVaBXUFqIXMheCF+oYSBicGQQZZhmwGlAaahq+GxIbuhxKHHQc6B1WHdweMB56HqQfCh+MH+YgiiDsIWYhliHEIfQiViJsIzAjdiRAJVwloCXkJm4mzic4J3gnnCf6KE4osCj0KVYp1CpaKworbiu2LAwsNCyMLTAtrC5SLqwvXC/YMJAw5jE0MYoyDDKcMu4zPDOONAY0rjUeNhI2hjbQN2Q3yDgQOLI5Ljn4Ok47PDueO/Q8rD2QPew+RD6yPw4/9kByQORBckIUQmxC6EMQQ1JDfEPaRBQAAHicY2BkYGCYx/CBQYoBBJiAmAsIGRj+g/kMADK6Ar8AeJxdkc1OwkAUhc/IjxESF5q4cDVuiImhBZbsDAnsWeC6lCk/aTvNdCBh5dP4BD6BT+AT6Ev4Ah7K1QTazJ3vnLn3zk0L4AbfUDg+t1xHVrikOvIF+V64Rn4QrpMfhRtoIxRu0h8Kt/CEZ+E2O6bsoOpXVB28Citc4034gvwuXCN/CNfJn8IN3OFLuEn/R7iFmVLCbXTUy8iZyJuFnu/1OrZ5YnOfxN0DTs1ym0ZOlGwz48q1zXU/6IkzMblxfy3K3XLgfaITZzM9Zi+TplYXzm5M7IOV98UwDBPxg9hmGMHBIIJnXEBjjj3jGjEsciRV9NxjdP/dKXOX2PJDRaw+PTtVM2Y6lNQHpdFHgN5ZzoQ5eZV3PkWJHe8Z0D1MoLkcKzLSWOYynCElaxTV2YZOTD/Aqqoq+JNDvslZflDdnf0CPF1o6QAAAHicbVSHlts2ELw5kRQlnc9xzum9Vyax7PTee+89ELGi4AMJGgClU3rvvVfnV7OgpOT8XvSeCAK7AGZnZ7i2vrb49df+/3cU6+ggQowEXaTooY8BNrAHm9iL47APx2ML+3ECTsRJOBmn4FSchtNxBs7EWTgb5+BcnIfzcQEuxEW4GJfgUlyGy5HhClyJq3AAQxzEIVyNa3AtrsP1uAE34ibcjFtwK27D7bgDd+Iu3I17cC/uw/14AA/iITyMR/AoHsPjeAJP4ik8jWfwLJ7D83gBL+IlvIxX8Cpeg8AIOSQIYxSYQOEwtqFRooJBjSOwcPBoMMUMO5jjdbyBN/EW3sY7eBfv4X18gA/xET7GJ/gUn+FzfIEv8RW+xjf4Ft/he/yAH/ETfsYv+BW/4Xf8gT/xF47i77W0FHZbmlk1kMKLzJGm3PcKq2SmVUVxbVXlo1z5eapNLrwyVXLE5kZSqqq68ZmSiRpbUVIsGqlMf2xsmZUc17FXXlPkVFF1hZSWnOs5z0c4r/LuSLSnxFMlySRiyrfbrmtcTZXszoStVFVEjieppTHvnQzXhermRjdldXA5HlqOw+V4INFibhrfc1SUVHmS3TAw5t4CrBdFx4vRRm6qsSoymnKUMVGdBdiJ0wzGJlIJbYqtww0DHc8zV4uchDVNJZOm1kbIKDf1vO9VSZkVVUGpF2474xr3H7NnRH5GVCWqrI31A75YU3vRwcESwEg4Ol5oZkh5Kl3mvCWfT3YvjTXtMAtxPqF8OxKNN2kuNK8IuyrD+bmmvcuJkFNR5SRXwdqa2m1yO8hTliubaxruOWaaLGb7pbLceyYrs2ZmmRvraEMqVzOpLYxIWlHsWa2MWA/bUVBNTFL5YRSeodEZN2NrlaWqIKM2d4VwytXxNoqC7DaPTezQnHr8z3JtHHVrhqFoNgi3ZxWjEnUyNpqbNGh1tiig14ZDMAqrvTYU2IsUXxmrUhS0b9WZkMsqtH5ztZIHpdi9/7Zu0YOY4WwP41JVjYtZRc0wKo2lKLymmrve8KmdWsikNCOlKa15npVih9Omq5mqUi4hCwpbr/MoLHaXck6skKpxAyemLAqlNcn0SEOudZjLrdE6DKr2XUfet27g1MRNBPOWToVVQU+dObmNxRpTyJmhI9QPj6U2uRta1I53zhTXxR4bBYIGXCYt/R5zSxo2sCbLXhdWpq3aRmaHteZyEUwxarw3Vb/9SrRKjgu2RN2VKjjYRoHXDUkLyFyDiya+1EkQhbFxa78oUMrMODczVsaBANNhrSWL3keWQccM19hkgSs67JiMqilHZOPWUv3/TLTLT8MoeDHijCr1tMPdJdH1xmiv6shp41PPXLgxWXZ/0ZvxPTZ896LAQdye02uFO1FaRvw27PBja5cLg1EDxn6b1qpu367wQkJra/8AhSEfTQ==) format("woff")}.fc-icon{-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;font-family:fc-icon!important;font-size:16px;font-style:normal}.icon-data-select:before{content:"\\e6dd"}.icon-markdown:before{content:"\\e893"}.icon-grid-line:before{content:"\\e600"}.icon-print:before{content:"\\e6de"}.icon-city:before{content:"\\e64b"}.icon-location:before{content:"\\e6d4"}.icon-qrcode:before{content:"\\e6ce"}.icon-input-id:before{content:"\\e6d1"}.icon-iframe:before{content:"\\e6d2"}.icon-audio:before{content:"\\e6d3"}.icon-form-model:before{content:"\\e6d5"}.icon-title:before{content:"\\e6d6"}.icon-sign:before{content:"\\e6d7"}.icon-address:before{content:"\\e6d8"}.icon-statistic:before{content:"\\e6d9"}.icon-barcode:before{content:"\\e6da"}.icon-video:before{content:"\\e6db"}.icon-avatar:before{content:"\\e6dc"}.icon-suspend:before{content:"\\e6cf"}.icon-warning:before{content:"\\e6d0"}.icon-send:before{content:"\\e6cc"}.icon-refresh2:before{content:"\\e6cd"}.icon-ai:before{content:"\\e6cb"}.icon-ai.bright{-webkit-text-fill-color:transparent;background:linear-gradient(90deg,#328ff7,#62e3a3);-webkit-background-clip:text}.icon-column4:before{content:"\\e6c7"}.icon-column3:before{content:"\\e6c6"}.icon-column2:before{content:"\\e6c8"}.icon-column1:before{content:"\\e6c9"}.icon-layout:before{content:"\\e6ca"}.icon-segmented:before{content:"\\e682"}.icon-mention:before{content:"\\e6c5"}.icon-input-tag:before{content:"\\e6c4"}.icon-up:before{content:"\\e697";display:inline-block;transform:rotate(180deg)}.icon-alignitems-flexstart:before{content:"\\e67f";display:inline-block;transform:rotate(180deg)}.icon-align-center:before{content:"\\e6a5";display:inline-block;transform:rotate(90deg)}.icon-align-flexstart:before{content:"\\e6a4";display:inline-block;transform:rotate(90deg)}.icon-align-spacearound:before{content:"\\e670";display:inline-block;transform:rotate(-90deg)}.icon-align-spacebetween:before{content:"\\e695";display:inline-block;transform:rotate(-90deg)}.icon-align-stretch:before{content:"\\e6a7";display:inline-block;transform:rotate(-90deg)}.icon-align-flexend:before{content:"\\e6a4";display:inline-block;transform:rotate(-90deg)}.icon-justify-flexend:before{content:"\\e6a4";display:inline-block;transform:rotate(180deg)}.icon-direction-row:before{content:"\\e68b";display:inline-block;transform:rotate(180deg)}.icon-direction-column:before{content:"\\e68b";display:inline-block;transform:rotate(-90deg)}.icon-direction-columnreverse:before{content:"\\e68b";display:inline-block;transform:rotate(90deg)}.icon-arrow:before{content:"\\e697";display:inline-block;transform:rotate(180deg)}.icon-cell:before{content:"\\e654"}.icon-table:before{content:"\\eb0a"}.icon-next-step:before{content:"\\e6b4";display:inline-block;transform:rotateY(180deg)}.icon-grid:before{content:"\\e65c";display:inline-block;transform:rotate(90deg)}.icon-alignitems-stretch:before{content:"\\e67e"}.icon-alignitems-flexend:before{content:"\\e67f"}.icon-check:before{content:"\\e680"}.icon-auto:before{content:"\\e681"}.icon-config-event:before{content:"\\e66e"}.icon-calendar:before{content:"\\e683"}.icon-config-style:before{content:"\\e684"}.icon-copy:before{content:"\\e676"}.icon-config-advanced:before{content:"\\e686"}.icon-config-props:before{content:"\\e687"}.icon-delete-circle2:before{content:"\\e688"}.icon-delete-circle:before,.icon-delete2:before{content:"\\e689"}.icon-delete:before{content:"\\e68a"}.icon-direction-rowreverse:before{content:"\\e68b"}.icon-display-flex:before{content:"\\e68c"}.icon-dialog:before{content:"\\e66f"}.icon-drag:before{content:"\\e68e"}.icon-display-block:before{content:"\\e68f"}.icon-data:before{content:"\\e690"}.icon-edit2:before{content:"\\e691"}.icon-edit:before{content:"\\e692"}.icon-add-col:before{content:"\\e693"}.icon-display-inlineblock:before{content:"\\e694"}.icon-config-base:before{content:"\\e6bf"}.icon-config-validate:before{content:"\\e696"}.icon-down:before{content:"\\e697"}.icon-display-inline:before{content:"\\e698"}.icon-eye:before{content:"\\e699"}.icon-eye-close:before{content:"\\e69a"}.icon-import:before{content:"\\e6a6"}.icon-preview:before{content:"\\e69b"}.icon-flex-nowrap:before{content:"\\e69c"}.icon-folder:before{content:"\\e69d"}.icon-form-circle:before{content:"\\e69e"}.icon-flex-wrap:before{content:"\\e69f"}.icon-form:before{content:"\\e6a0"}.icon-form-item:before{content:"\\e6a1"}.icon-icon:before{content:"\\e6a2"}.icon-image:before{content:"\\e6a3"}.icon-justify-flexstart:before{content:"\\e6a4"}.icon-justify-center:before{content:"\\e6a5"}.icon-justify-spacearound:before{content:"\\e670"}.icon-justify-stretch:before{content:"\\e6a7"}.icon-link2:before{content:"\\e6a8"}.icon-justify-spacebetween:before{content:"\\e695"}.icon-minus:before{content:"\\e6aa"}.icon-menu2:before{content:"\\e6ab"}.icon-more:before{content:"\\e6ac"}.icon-menu:before{content:"\\e6ad"}.icon-language:before{content:"\\e6ae"}.icon-pad:before{content:"\\e6af"}.icon-mobile:before{content:"\\e6b0"}.icon-page-max:before{content:"\\e6b1"}.icon-move:before{content:"\\e6b2"}.icon-page-min:before{content:"\\e6b3"}.icon-pre-step:before{content:"\\e6b4"}.icon-pc:before{content:"\\e6b5"}.icon-page:before{content:"\\e6b6"}.icon-refresh:before{content:"\\e6b7"}.icon-radius:before{content:"\\e6b8"}.icon-save-filled:before{content:"\\e6b9"}.icon-question:before{content:"\\e6ba"}.icon-scroll:before{content:"\\e6bb"}.icon-script:before{content:"\\e6bc"}.icon-setting:before{content:"\\e6bd"}.icon-save-online:before,.icon-save:before{content:"\\e6be"}.icon-task-add:before{content:"\\e68d"}.icon-shadow:before{content:"\\e6c0"}.icon-variable:before{content:"\\e6c1"}.icon-yes:before{content:"\\e6c2"}.icon-shadow-inset:before{content:"\\e6c3"}.icon-date:before{content:"\\e642"}.icon-date-range:before{content:"\\e643"}.icon-collapse:before{content:"\\e644"}.icon-slider:before{content:"\\e665"}.icon-switch:before{content:"\\e646"}.icon-subform:before{content:"\\e647"}.icon-time-range:before{content:"\\e685"}.icon-tree-select:before{content:"\\e649"}.icon-value:before{content:"\\e64a"}.icon-table-form3:before{content:"\\e6a9"}.icon-alert:before{content:"\\e64c"}.icon-card:before{content:"\\e64d"}.icon-checkbox:before{content:"\\e64e"}.icon-cascader:before{content:"\\e64f"}.icon-button:before{content:"\\e650"}.icon-data-table:before{content:"\\e651"}.icon-group:before{content:"\\e652"}.icon-divider:before{content:"\\e653"}.icon-flex:before{content:"\\e654"}.icon-descriptions:before{content:"\\e655"}.icon-html:before{content:"\\e656"}.icon-editor:before{content:"\\e657"}.icon-input:before{content:"\\e658"}.icon-link:before{content:"\\e659"}.icon-password:before{content:"\\e65a"}.icon-radio:before{content:"\\e65b"}.icon-row:before{content:"\\e65c"}.icon-inline:before{content:"\\e65d"}.icon-rate:before{content:"\\e65e"}.icon-color:before{content:"\\e65f"}.icon-select:before{content:"\\e660"}.icon-json:before{content:"\\e661"}.icon-number:before{content:"\\e662"}.icon-space:before{content:"\\e664"}.icon-step-form:before{content:"\\e663"}.icon-table-form:before{content:"\\e666"}.icon-table-form2:before{content:"\\e667"}.icon-time:before{content:"\\e668"}.icon-span:before{content:"\\e669"}.icon-textarea:before{content:"\\e66a"}.icon-tooltip:before{content:"\\e66b"}.icon-slot:before{content:"\\e66c"}.icon-transfer:before{content:"\\e66d"}.icon-upload:before{content:"\\e673"}.icon-tag:before{content:"\\e671"}.icon-watermark:before{content:"\\e672"}.icon-tab:before{content:"\\e674"}.icon-tree:before{content:"\\e675"}.icon-table:before{content:"\\e677"}.icon-add-child:before{content:"\\e678"}.icon-add2:before{content:"\\e679"}.icon-add:before{content:"\\e67a"}.icon-alignitems-baseline:before{content:"\\e67b"}.icon-add-circle:before{content:"\\e67c"}.icon-alignitems-center:before{content:"\\e67d"}pre code.hljs{display:block;overflow-x:auto;padding:1em}code.hljs{padding:3px 5px}.hljs{background:#fff;color:#000}.hljs-subst,.hljs-title{color:#000;font-weight:400}.hljs-title.function_{color:#7a7a43}.hljs-code,.hljs-comment,.hljs-quote{color:#8c8c8c;font-style:italic}.hljs-meta{color:#9e880d}.hljs-section{color:#871094}.hljs-built_in,.hljs-keyword,.hljs-literal,.hljs-meta .hljs-keyword,.hljs-name,.hljs-selector-attr,.hljs-selector-class,.hljs-selector-id,.hljs-selector-pseudo,.hljs-selector-tag,.hljs-symbol,.hljs-template-tag,.hljs-type,.hljs-variable.language_{color:#0033b3}.hljs-attr,.hljs-property{color:#871094}.hljs-attribute{color:#174ad4}.hljs-number{color:#1750eb}.hljs-regexp{color:#264eff}.hljs-link{color:#006dcc;text-decoration:underline}.hljs-meta .hljs-string,.hljs-string{color:#067d17}.hljs-char.escape_{color:#0037a6}.hljs-doctag{text-decoration:underline}.hljs-template-variable{color:#248f8f}.hljs-addition{background:#bee6be}.hljs-deletion{background:#d6d6d6}.hljs-emphasis{font-style:italic}.hljs-strong{font-weight:700}')),document.head.appendChild(e)}}catch(o){console.error("vite-plugin-css-injected-by-js",o)}})();
var b_ = Object.defineProperty;
var __ = (e, t, i) => t in e ? b_(e, t, { enumerable: !0, configurable: !0, writable: !0, value: i }) : e[t] = i;
var zt = (e, t, i) => (__(e, typeof t != "symbol" ? t + "" : t, i), i);
import { computed as _n, isRef as jg, unref as Ug, ref as $s, resolveComponent as ie, TransitionGroup as w_, defineComponent as Ve, h as tn, nextTick as Kn, markRaw as Xt, openBlock as W, createElementBlock as ae, createElementVNode as Z, createTextVNode as _e, toDisplayString as le, Fragment as Pe, renderList as Ge, createBlock as ye, withCtx as N, createVNode as G, createCommentVNode as Oe, mergeProps as dn, createSlots as ii, renderSlot as kt, normalizeClass as qe, withModifiers as vt, withKeys as nl, normalizeStyle as An, normalizeProps as Ar, guardReactiveProps as Cr, toRefs as Im, getCurrentInstance as A_, reactive as Vi, provide as Fm, toRef as qi, watch as So, withDirectives as wn, vShow as xn, onUnmounted as wc, resolveDirective as C_, shallowRef as Is, resolveDynamicComponent as Yr } from "vue";
import { ElMessage as Ac, ElLoading as S_ } from "element-plus";
import qs from "@form-create/element-ui";
const St = {
type(e, t) {
return Object.prototype.toString.call(e) === "[object " + t + "]";
},
Undef(e) {
return e == null;
},
Element(e) {
return typeof e == "object" && e !== null && e.nodeType === 1 && !St.Object(e);
},
trueArray(e) {
return Array.isArray(e) && e.length > 0;
},
Function(e) {
const t = this.getType(e);
return t === "Function" || t === "AsyncFunction";
},
getType(e) {
const t = Object.prototype.toString.call(e);
return /^\[object (.*)\]$/.exec(t)[1];
},
empty(e) {
return e == null || Array.isArray(e) && Array.isArray(e) && !e.length ? !0 : typeof e == "string" && !e;
}
};
["Date", "Object", "String", "Boolean", "Array", "Number"].forEach((e) => {
St[e] = function(t) {
return St.type(t, e);
};
});
function Li(e, t) {
return {}.hasOwnProperty.call(e, t);
}
function Fo(e, t, i) {
e[t] = i;
}
function Cc(e, t = {}, i) {
let r = !1;
for (let n in t)
if (Object.prototype.hasOwnProperty.call(t, n)) {
let a = t[n];
if ((r = Array.isArray(a)) || St.Object(a)) {
let s = e[n] === void 0;
if (r)
r = !1, s && Fo(e, n, []);
else if (a._clone && i !== void 0)
if (i)
a = a.getRule(), s && Fo(e, n, {});
else {
Fo(e, n, a._clone());
continue;
}
else
s && Fo(e, n, {});
e[n] = Cc(e[n], a, i);
} else
Fo(e, n, a), St.Undef(a) || (St.Undef(a.__json) || (e[n].__json = a.__json), St.Undef(a.__origin) || (e[n].__origin = a.__origin));
}
return i !== void 0 && Array.isArray(e) ? e.filter((n) => !n || !n.__ctrl) : e;
}
function At(e) {
return Cc({}, { value: e }).value;
}
function E_(e, t, i) {
return `[form-create ${e}]: ${t}` + (i ? `
rule: ` + JSON.stringify(i.getRule ? i.getRule() : i) : "");
}
function x_(e, t) {
console.error(E_("err", e, t));
}
const Mm = "[[FORM-CREATE-PREFIX-", Pm = "-FORM-CREATE-SUFFIX]]";
function bd(e) {
return new Function("return " + e)();
}
function jo(e, t) {
if (e && St.String(e) && e.length > 4) {
let i = e.trim(), r = !1;
try {
if (i.indexOf(Pm) > 0 && i.indexOf(Mm) === 0)
i = i.replace(Pm, "").replace(Mm, ""), r = !0;
else if (i.indexOf("$FN:") === 0)
i = i.substring(4), r = !0;
else if (i.indexOf("$EXEC:") === 0)
i = i.substring(6), r = !0;
else if (i.indexOf("$GLOBAL:") === 0) {
const a = i.substring(8);
return i = function(...s) {
const u = s[0].api.getGlobalEvent(a);
if (u)
return u.call(this, ...s);
}, i.__json = e, i.__inject = !0, i;
} else {
if (i.indexOf("$FNX:") === 0)
return i = bd("function($inject){" + i.substring(5) + "}"), i.__json = e, i.__inject = !0, i;
(!t && i.indexOf("function ") === 0 && i !== "function " || !t && i.indexOf("function(") === 0 && i !== "function(") && (r = !0);
}
if (!r)
return e;
let n;
try {
n = bd(i);
} catch {
n = bd("function " + i);
}
return n.__json = e, n;
} catch (n) {
x_(`\u89E3\u6790\u5931\u8D25:${i}
err: ${n}`);
return;
}
}
return e;
}
function Sc(e) {
const t = e.replace(/(-[a-z])/g, function(i) {
return i.replace("-", "").toLocaleUpperCase();
});
return Fs(t);
}
function Fs(e) {
return e.replace(e[0], e[0].toLowerCase());
}
const zg = {
name: "zh-cn",
form: {
field: "\u5B57\u6BB5 ID",
title: "\u5B57\u6BB5\u540D\u79F0",
iskey: "\u662F\u5426\u4E3B\u952E",
fieldtype: "\u5B57\u6BB5\u7C7B\u578B",
info: "\u63D0\u793A\u4FE1\u606F",
ignore: "\u5FFD\u7565\u5B57\u6BB5",
native: "\u662F\u5426\u663E\u793A\u6807\u9898",
control: "\u7EC4\u4EF6\u8054\u52A8",
labelShow: "\u662F\u5426\u663E\u793A",
labelPosition: "\u6807\u7B7E\u7684\u4F4D\u7F6E",
tableName: "\u81EA\u5B9A\u4E49\u540D\u79F0",
labelStyle: "\u6807\u7B7E\u7684\u6837\u5F0F",
labelSuffix: "\u6807\u7B7E\u7684\u540E\u7F00",
formItem: "\u914D\u7F6E\u8868\u5355\u9879",
formItemSpan: "\u7EC4\u4EF6\u5BBD\u5EA6",
row: "\u6574\u884C",
globalEvent: "\u5168\u5C40\u4E8B\u4EF6",
globalFetch: "\u5168\u5C40\u6570\u636E\u6E90",
globalClass: "\u5168\u5C40\u6837\u5F0F",
globalConfig: "\u5168\u5C40\u914D\u7F6E",
size: "\u8868\u5355\u7684\u5C3A\u5BF8",
event: "\u8868\u5355\u4E8B\u4EF6",
labelWidth: "\u6807\u7B7E\u7684\u5BBD\u5EA6",
hideRequiredAsterisk: "\u9690\u85CF\u5FC5\u586B\u5B57\u6BB5\u7684\u6807\u7B7E\u65C1\u8FB9\u7684\u7EA2\u8272\u661F\u53F7",
formItemMarginBottom: "\u8868\u5355\u9879\u7684\u4E0B\u8FB9\u8DDD",
showMessage: "\u663E\u793A\u6821\u9A8C\u9519\u8BEF\u4FE1\u606F",
inlineMessage: "\u4EE5\u884C\u5185\u5F62\u5F0F\u5C55\u793A\u6821\u9A8C\u4FE1\u606F",
submitBtn: "\u662F\u5426\u663E\u793A\u8868\u5355\u63D0\u4EA4\u6309\u94AE",
resetBtn: "\u662F\u5426\u663E\u793A\u8868\u5355\u91CD\u7F6E\u6309\u94AE",
appendChild: "\u6DFB\u52A0\u5B50\u7EA7",
formMode: "\u8868\u5355\u6A21\u5F0F",
formName: "\u8868\u5355\u540D\u79F0",
ignoreHiddenFields: "\u63D0\u4EA4\u8868\u5355\u65F6\u5FFD\u7565\u88AB\u9690\u85CF\u7684\u5B57\u6BB5",
previewMode: "\u9605\u8BFB\u6A21\u5F0F",
componentMode: "\u751F\u6210\u7EC4\u4EF6",
sfcMode: "\u751F\u6210SFC",
document: "\u5E2E\u52A9\u6587\u6863",
controlDocument: "\u9700\u8981\u66F4\u8BE6\u7EC6\u7684\u914D\u7F6E\u65B9\u6CD5\uFF1F\u8BF7\u67E5\u770B{doc}",
onSubmit: "\u8868\u5355\u63D0\u4EA4\u65F6\u89E6\u53D1",
onReset: "\u8868\u5355\u91CD\u7F6E\u540E\u89E6\u53D1",
onCreated: "\u8868\u5355\u7EC4\u4EF6\u521D\u59CB\u5316\u5B8C\u6BD5\u540E\u89E6\u53D1",
onMounted: "\u8868\u5355\u7EC4\u4EF6\u6E32\u67D3\u5B8C\u6BD5\u540E\u89E6\u53D1",
onReload: "\u8868\u5355\u6E32\u67D3\u89C4\u5219\u91CD\u8F7D\u540E\u89E6\u53D1",
onChange: "\u8868\u5355\u7EC4\u4EF6\u7684\u503C\u53D1\u751F\u53D8\u5316\u65F6\u89E6\u53D1",
beforeSubmit: "\u8868\u5355\u9A8C\u8BC1\u901A\u8FC7\u65F6\u89E6\u53D1",
beforeFetch: "\u8FDC\u7A0B\u6570\u636E\u8BF7\u6C42\u53D1\u9001\u524D\u89E6\u53D1"
},
ai: {
name: "\u667A\u80FD\u8868\u5355\u52A9\u7406",
info: "\u60A8\u597D\uFF0C\u6211\u662F\u60A8\u7684\u667A\u80FD\u8868\u5355\u52A9\u624B\uFF01\u6211\u53EF\u4EE5\u5E2E\u52A9\u60A8\u5FEB\u901F\u751F\u6210\u548C\u4FEE\u6539\u8868\u5355\uFF0C\u5E2E\u52A9\u60A8\u8F7B\u677E\u9AD8\u6548\u5730\u5B8C\u6210\u8868\u5355\u8BBE\u8BA1\u3002",
try: "\u4F60\u53EF\u4EE5\u8BD5\u7740\u95EE\u6211",
change: "\u6362\u4E00\u6362",
loading: "\u6B63\u5728\u6839\u636E\u60A8\u7684\u9700\u6C42\u5236\u4F5C\u8868\u5355\uFF0C\u8BF7\u7A0D\u5019...",
fail: "\u5236\u4F5C\u8868\u5355\u65F6\u9047\u5230\u95EE\u9898\uFF0C\u8BF7\u5C1D\u8BD5\u8C03\u6574\u5185\u5BB9\u3002",
success: "\u5DF2\u5904\u7406\u5B8C\u6BD5\uFF01",
placeholder: "\u8BF7\u63CF\u8FF0\u60A8\u7684\u9700\u6C42"
},
warning: {
name: "\u7EC4\u4EF6\u7684\u552F\u4E00\u6807\u8BC6\uFF0C\u7528\u4E8E\u83B7\u53D6\u548C\u4FEE\u6539\u8BE5\u7EC4\u4EF6\u7684\u914D\u7F6E\u89C4\u5219\u3002\u901A\u8FC7\u8BE5\u6807\u8BC6\u53EF\u4EE5\u7CBE\u786E\u5B9A\u4F4D\u7EC4\u4EF6\uFF0C\u5B9E\u73B0\u5BF9\u7EC4\u4EF6\u5C5E\u6027\u548C\u884C\u4E3A\u7684\u63A7\u5236\u3002",
field: "\u7EC4\u4EF6\u5BF9\u5E94\u7684\u5B57\u6BB5\u540D\u7528\u4E8E\u4E0E\u7EC4\u4EF6\u7684\u6570\u636E\u8FDB\u884C\u7ED1\u5B9A\u3002\u5B57\u6BB5\u540D\u9700\u4EE5\u5B57\u6BCD\u5F00\u5934\uFF0C\u4EE5\u786E\u4FDD\u80FD\u591F\u6B63\u786E\u8BC6\u522B\u3002",
formList: "\u7528\u4E8E\u7BA1\u7406\u548C\u5207\u6362\u8868\u5355\u6A21\u677F\uFF0C\u65B9\u4FBF\u5728\u4E0D\u540C\u4E1A\u52A1\u573A\u666F\u4E2D\u5FEB\u901F\u5207\u6362\u548C\u914D\u7F6E\u8868\u5355\u3002",
fetch: "\u8FDC\u7A0B\u6570\u636E\u901A\u8FC7\u8FDC\u7A0B\u8BF7\u6C42\u52A0\u8F7D\u7EC4\u4EF6\u7684\u914D\u7F6E\u9879\u3002\u914D\u7F6E\u8BF7\u6C42\u53C2\u6570\u540E\uFF0C\u7EC4\u4EF6\u4F1A\u81EA\u52A8\u53D1\u8D77\u8BF7\u6C42\uFF0C\u83B7\u53D6\u8FDC\u7A0B\u6570\u636E\u5E76\u6839\u636E\u8FD4\u56DE\u7684\u7ED3\u679C\u66F4\u65B0\u7EC4\u4EF6\u3002",
fetchQuery: "\u5B9A\u4E49\u8BF7\u6C42\u7684 GET \u53C2\u6570\uFF0C\u901A\u8FC7 URL \u4F20\u9012\u6570\u636E\u3002",
fetchData: "\u5B9A\u4E49\u8BF7\u6C42\u7684 POST \u53C2\u6570\uFF0C\u901A\u8FC7\u8BF7\u6C42\u4F53\u4F20\u9012\u6570\u636E\u3002",
fetchDataType: "\u9009\u62E9\u8BF7\u6C42\u4F53\u7684\u6570\u636E\u7C7B\u578B\uFF0C\u786E\u4FDD\u6570\u636E\u683C\u5F0F\u6B63\u786E\u3002",
beforeFetch: "\u5728\u8BF7\u6C42\u53D1\u9001\u524D\uFF0C\u53EF\u901A\u8FC7\u5904\u7406\u51FD\u6570\u4FEE\u6539\u8BF7\u6C42\u53C2\u6570\uFF1B\u82E5\u9700\u7EC8\u6B62\u8BF7\u6C42\uFF0C\u76F4\u63A5\u8FD4\u56DE false \u6216\u4E00\u4E2A\u62D2\u7EDD\u7684 Promise\u3002",
fetchParse: "\u8BF7\u6C42\u8FD4\u56DE\u540E\uFF0C\u53EF\u4EE5\u901A\u8FC7\u5904\u7406\u51FD\u6570\u5BF9\u8FD4\u56DE\u7684\u7ED3\u679C\u8FDB\u884C\u5904\u7406\uFF0C\u5C06\u7ED3\u679C\u8F6C\u6362\u4E3A\u7EC4\u4EF6\u6240\u9700\u7684\u6570\u636E\u548C\u7ED3\u6784\u3002",
language: "\u7BA1\u7406\u9875\u9762\u7684\u591A\u8BED\u8A00\u6570\u636E\uFF0C\u5728\u7EC4\u4EF6\u4E2D\u914D\u7F6E\u4E0D\u540C\u8BED\u8A00\u7684\u6587\u672C\uFF0C\u652F\u6301\u4E00\u952E\u5207\u6362\u8BED\u8A00\u4F53\u7CFB\uFF0C\u4FBF\u4E8E\u5728\u591A\u8BED\u8A00\u73AF\u5883\u4E0B\u4F7F\u7528\u548C\u5C55\u793A\u5185\u5BB9\u3002",
variable: "\u4ECE\u53D8\u91CF\u8BFB\u53D6\u914D\u7F6E\u9879\u7684\u503C\uFF0C\u652F\u6301\u901A\u8FC7\u53D8\u91CF\uFF08\u5982 Cookie\u3001localStorage\u3001\u5168\u5C40\u53D8\u91CF\u548C\u5916\u90E8\u6570\u636E\u6E90\u7B49\uFF09\u8BBE\u7F6E\u914D\u7F6E\u9879\u3002\u5F53\u5173\u8054\u7684\u53D8\u91CF\u53D8\u5316\u65F6\uFF0C\u914D\u7F6E\u9879\u4F1A\u540C\u6B65\u66F4\u65B0\u3002",
variableInfo: "\u8BF7\u5728\u53D8\u91CF\u5217\u8868\u4E2D\u9009\u62E9\u53D8\u91CF\u3002\u5982\u679C\u53D8\u91CF\u7684\u503C\u662F\u5BF9\u8C61\uFF0C\u60A8\u53EF\u4EE5\u901A\u8FC7 {{variableName.attributeName}} \u683C\u5F0F\u8BBF\u95EE\u5BF9\u8C61\u4E2D\u7684\u5C5E\u6027\u503C\u3002",
pageManage: "\u8BBE\u8BA1\u8868\u5355\u4E2D\u7684\u5B50\u5F39\u7A97\uFF0C\u901A\u8FC7\u4E8B\u4EF6\u89E6\u53D1\u5F39\u7A97\u663E\u793A\uFF0C\u4FBF\u4E8E\u5728\u8868\u5355\u4E2D\u52A8\u6001\u5C55\u793A\u4FE1\u606F\u6216\u8FDB\u884C\u4EA4\u4E92\u64CD\u4F5C\u3002",
globalConfig: "\u7BA1\u7406\u5168\u5C40\u4E8B\u4EF6\u3001\u6837\u5F0F\u3001\u6570\u636E\u548C\u53D8\u91CF\uFF0C\u7528\u4E8E\u5728\u4E0D\u540C\u7EC4\u4EF6\u95F4\u8FDB\u884C\u6570\u636E\u5171\u4EAB\u548C\u4E8B\u4EF6\u5904\u7406\u3002",
globalClass: "\u63D0\u4F9B\u5B9A\u4E49\u5168\u5C40\u6837\u5F0F\u548C Class \u7684\u529F\u80FD\uFF0C\u7528\u6237\u53EF\u4EE5\u5728\u7EC4\u4EF6\u914D\u7F6E\u4E2D\u9009\u62E9\u5E76\u5E94\u7528\u8FD9\u4E9B\u9884\u5B9A\u4E49\u7684 Class\uFF0C\u4EE5\u5B9E\u73B0\u7EDF\u4E00\u7684\u6837\u5F0F\u7BA1\u7406\u3002",
globalEvent: "\u5168\u5C40\u4E8B\u4EF6\u7528\u4E8E\u5B9A\u4E49\u7EC4\u4EF6\u4E8B\u4EF6\uFF0C\u4F9B\u7EC4\u4EF6\u8FDB\u884C\u914D\u7F6E\u548C\u9009\u62E9\uFF0C\u65B9\u4FBF\u5728\u4E0D\u540C\u7EC4\u4EF6\u4E2D\u7EDF\u4E00\u4F7F\u7528\u9884\u8BBE\u4E8B\u4EF6\uFF0C\u7B80\u5316\u4E8B\u4EF6\u7684\u7BA1\u7406\u548C\u5206\u53D1\u3002",
globalFetch: "\u5168\u5C40\u6570\u636E\u6E90\u7528\u4E8E\u5B9A\u4E49\u5E38\u7528\u7684\u6570\u636E\u6E90\uFF0C\u652F\u6301\u9759\u6001\u6570\u636E\u548C\u8FDC\u7A0B\u6570\u636E\u3002\u8BE5\u6570\u636E\u6E90\u53EF\u5728\u5404\u79CD\u7EC4\u4EF6\u914D\u7F6E\u4E2D\u4F7F\u7528\uFF0C\u65B9\u4FBF\u7EDF\u4E00\u7BA1\u7406\u548C\u8C03\u7528\u6570\u636E\u3002",
globalVariable: "\u5168\u5C40\u53D8\u91CF\u4E2D\u53EF\u4EE5\u5B9A\u4E49\u8BA1\u7B97\u5C5E\u6027\uFF0C\u901A\u8FC7\u8868\u5355\u6570\u636E\u548C\u5916\u90E8\u6570\u636E\u8FD4\u56DE\u7EC4\u4EF6\u6240\u9700\u7684\u6570\u636E\u3002\u5173\u8054\u6570\u636E\u53D8\u5316\u65F6\uFF0C\u8BA1\u7B97\u5C5E\u6027\u4F1A\u81EA\u52A8\u66F4\u65B0\uFF0C\u53EF\u4EE5\u5728\u7ED1\u5B9A\u53D8\u91CF\u6A21\u5757\u548C\u4E8B\u4EF6\u4E2D\u4F7F\u7528\u3002",
ignore: "\u5F00\u542F\u540E\uFF0C\u8868\u5355\u63D0\u4EA4\u65F6\u4F1A\u81EA\u52A8\u6392\u9664\u8BE5\u7EC4\u4EF6\u7684\u5B57\u6BB5\uFF0C\u4E0D\u4F1A\u5C06\u5176\u5305\u542B\u5728\u63D0\u4EA4\u7684\u6570\u636E\u4E2D\u3002",
ignoreHiddenFields: "\u5F00\u542F\u540E\uFF0C\u8868\u5355\u63D0\u4EA4\u65F6\u4F1A\u81EA\u52A8\u8FC7\u6EE4\u6389\u88AB\u9690\u85CF\u7684\u7EC4\u4EF6\u5B57\u6BB5\uFF0C\u786E\u4FDD\u4EC5\u63D0\u4EA4\u53EF\u89C1\u7684\u5B57\u6BB5\u6570\u636E\u3002",
behaviorIgnoreError: "\u5982\u679C\u52A8\u4F5C\u6267\u884C\u8FC7\u7A0B\u4E2D\u53D1\u751F\u9519\u8BEF\uFF0C\u662F\u5426\u7EE7\u7EED\u6267\u884C\u540E\u7EED\u7684\u52A8\u4F5C\u3002",
behaviorExpression: "\u5F53\u6761\u4EF6\u8FBE\u6210\u65F6\uFF0C\u52A8\u4F5C\u624D\u4F1A\u88AB\u6267\u884C\u3002",
behaviorStopPropagation: "\u5F53\u6761\u4EF6\u8FBE\u6210\u65F6\uFF0C\u4F1A\u963B\u6B62\u540E\u7EED\u52A8\u4F5C\u7684\u6267\u884C\u3002",
computedCondition: "\u901A\u8FC7\u5B9A\u4E49\u6761\u4EF6\uFF0C\u7EC4\u4EF6\u7684\u72B6\u6001\u548C\u6570\u636E\u503C\u4F1A\u6839\u636E\u6761\u4EF6\u662F\u5426\u6210\u7ACB\u81EA\u52A8\u8C03\u6574\u3002",
computedFormula: "\u901A\u8FC7\u516C\u5F0F\u548C\u8868\u5355\u6570\u636E\uFF0C\u52A8\u6001\u8BA1\u7B97\u7EC4\u4EF6\u7684\u72B6\u6001\u548C\u6570\u636E\u503C\u3002"
},
computed: {
value: {
title: "\u6570\u636E\u8054\u52A8",
btn: "\u8BBE\u7F6E\u6570\u636E\u8054\u52A8",
name: "\u8BBE\u7F6E\u7EC4\u4EF6\u7684\u503C"
},
hidden: {
title: "\u9690\u85CF\u6761\u4EF6",
btn: "\u8BBE\u7F6E\u9690\u85CF\u6761\u4EF6",
name: "\u8BBE\u7F6E\u7EC4\u4EF6\u7684\u9690\u85CF\u6761\u4EF6"
},
required: {
title: "\u5FC5\u586B\u6761\u4EF6",
btn: "\u8BBE\u7F6E\u5FC5\u586B\u6761\u4EF6",
name: "\u8BBE\u7F6E\u7EC4\u4EF6\u7684\u5FC5\u586B\u6761\u4EF6"
},
disabled: {
title: "\u7981\u7528\u6761\u4EF6",
btn: "\u8BBE\u7F6E\u7981\u7528\u6761\u4EF6",
name: "\u8BBE\u7F6E\u7EC4\u4EF6\u7684\u7981\u7528\u6761\u4EF6"
},
formulas: {
"==": "\u7B49\u4E8E",
"!=": "\u4E0D\u7B49\u4E8E",
on: "\u5305\u542B",
notOn: "\u4E0D\u5305\u542B",
empty: "\u4E3A\u7A7A",
notEmpty: "\u4E0D\u4E3A\u7A7A",
pattern: "\u6B63\u5219\u8868\u8FBE\u5F0F",
">": "\u5927\u4E8E",
">=": "\u5927\u4E8E\u7B49\u4E8E",
"<": "\u5C0F\u4E8E",
"<=": "\u5C0F\u4E8E\u7B49\u4E8E"
},
variable: {
attr: "\u5C5E\u6027\u5217\u8868",
bind: "\u7ED1\u5B9A\u53D8\u91CF",
list: "\u53D8\u91CF\u5217\u8868",
btn: "\u8BBE\u7F6E\u53D8\u91CF",
title: "\u5168\u5C40\u53D8\u91CF",
create: "\u521B\u5EFA\u53D8\u91CF",
placeholder: "\u8BF7\u8F93\u5165\u53D8\u91CF\u7684\u63CF\u8FF0\u4FE1\u606F"
},
linkage: {
trigger: "\u89E6\u53D1\u4EE5\u4E0B\u8054\u52A8",
info: [
"\u5F53\u524D\u7EC4\u4EF6\u8054\u52A8\u663E\u793A",
"\u7684\u503C"
]
},
name: "\u8BA1\u7B97\u516C\u5F0F",
setting: "\u8BBE\u7F6E\u6761\u4EF6",
invert: "\u6761\u4EF6\u6210\u7ACB\u540E\u7EC4\u4EF6\u72B6\u6001",
condition: "\u903B\u8F91\u6761\u4EF6",
addCondition: "\u6DFB\u52A0\u6761\u4EF6",
addGroup: "\u6DFB\u52A0\u6761\u4EF6\u7EC4",
form: "\u5F53\u524D\u8868\u5355",
subform: "\u5B50\u8868\u5355",
formula: "\u51FD\u6570\u516C\u5F0F",
formulaInfo: "\u51FD\u6570\u8BF4\u660E",
formulaExample: "\u51FD\u6570\u793A\u4F8B",
fieldUsed: "\u3010{label}\u3011\u5728\u8BA1\u7B97\u516C\u5F0F\u4E2D\u88AB\u4F7F\u7528\uFF0C\u8BF7\u5148\u4FEE\u6539\u5BF9\u5E94\u516C\u5F0F",
fieldExist: "\u3010{label}\u3011\u5B57\u6BB5\u5DF2\u5B58\u5728",
fieldEmpty: "\u5B57\u6BB5\u540D\u79F0\u4E0D\u80FD\u4E3A\u7A7A",
fieldChar: "\u5B57\u6BB5\u540D\u79F0\u5FC5\u987B\u4EE5\u5B57\u6BCD\u5F00\u5934"
},
validate: {
type: "\u5B57\u6BB5\u7C7B\u578B",
typePlaceholder: "\u8BF7\u9009\u62E9",
trigger: "\u89E6\u53D1\u65B9\u5F0F",
mode: "\u9A8C\u8BC1\u65B9\u5F0F",
modes: {
required: "\u5FC5\u586B",
notRequired: "\u975E\u5FC5\u586B",
pattern: "\u6B63\u5219\u8868\u8FBE\u5F0F",
validator: "\u81EA\u5B9A\u4E49\u9A8C\u8BC1",
min: "\u6700\u5C0F\u503C",
max: "\u6700\u5927\u503C",
len: "\u957F\u5EA6"
},
types: {
string: "\u6587\u672C",
boolean: "\u5E03\u5C14",
array: "\u591A\u9009",
number: "\u6570\u5B57",
integer: "\u6574\u6570",
float: "\u5C0F\u6570",
object: "\u5408\u96C6",
date: "\u65E5\u671F",
url: "URL\u94FE\u63A5",
email: "\u90AE\u7BB1\u5730\u5740"
},
message: "\u9519\u8BEF\u4FE1\u606F",
auto: "\u81EA\u52A8\u83B7\u53D6",
autoRequired: "\u8BF7\u8F93\u5165{title}",
autoMode: "\u8BF7\u8F93\u5165\u6B63\u786E\u7684{title}",
requiredPlaceholder: "\u8BF7\u8F93\u5165\u63D0\u793A\u8BED",
required: "\u662F\u5426\u5FC5\u586B",
rule: "\u9A8C\u8BC1\u89C4\u5219"
},
tableOptions: {
handle: "\u64CD\u4F5C",
add: "\u6DFB\u52A0",
empty1: "\u70B9\u51FB\u53F3\u4E0B\u89D2",
empty2: "\u6309\u94AE\u6DFB\u52A0\u4E00\u5217",
rmCol: "\u5220\u9664\u5F53\u524D\u5217",
rmRow: "\u5220\u9664\u5F53\u524D\u884C",
splitRow: "\u62C6\u5206\u6210\u884C",
splitCol: "\u62C6\u5206\u6210\u5217",
mergeBottom: "\u5411\u4E0B\u5408\u5E76",
mergeRight: "\u5411\u53F3\u5408\u5E76",
addTop: "\u6DFB\u52A0\u4E0A\u5217",
addBottom: "\u6DFB\u52A0\u4E0B\u5217",
addLeft: "\u6DFB\u52A0\u5DE6\u5217",
addRight: "\u6DFB\u52A0\u53F3\u5217",
keyValue: "\u952E\u503C\u5BF9"
},
struct: {
title: "\u7F16\u8F91\u6570\u636E",
only: "\u3010{label}\u3011\u53EA\u5141\u8BB8\u6DFB\u52A0\u4E00\u4E2A",
errorMsg: "\u8F93\u5165\u7684\u5185\u5BB9\u8BED\u6CD5\u9519\u8BEF",
configured: "\u5DF2\u914D\u7F6E",
configuredData: "\u5DF2\u914D\u7F6E {num} \u4E2A\u6570\u636E\u6E90",
configuredEvent: "\u5DF2\u914D\u7F6E {num} \u4E2A\u4E8B\u4EF6"
},
class: {
title: "\u8BBE\u7F6E\u6837\u5F0F",
create: "\u521B\u5EFA\u6837\u5F0F",
placeholder: "\u8BF7\u8F93\u5165\u6837\u5F0F\u7684\u63CF\u8FF0\u4FE1\u606F",
saveMsg: "\u8BF7\u5148\u4FDD\u5B58\u5F53\u524D\u6B63\u5728\u7F16\u8F91\u7684\u6837\u5F0F",
configured: "\u5DF2\u914D\u7F6E {num} \u4E2A\u6837\u5F0F"
},
event: {
title: "\u8BBE\u7F6E\u4E8B\u4EF6",
create: "\u521B\u5EFA\u4E8B\u4EF6",
list: "\u4E8B\u4EF6\u5217\u8868",
placeholder: "\u8BF7\u8F93\u5165\u4E8B\u4EF6\u7684\u540D\u79F0",
saveMsg: "\u8BF7\u5148\u4FDD\u5B58\u5F53\u524D\u6B63\u5728\u7F16\u8F91\u7684\u4E8B\u4EF6",
type: "\u7C7B\u578B",
info: "\u8BF4\u660E",
action: "\u7F16\u8F91\u884C\u4E3A",
inject: {
api: "\u5F53\u524D\u8868\u5355\u7684api",
rule: "\u5F53\u524D\u8868\u5355\u7684\u751F\u6210\u89C4\u5219",
self: "\u7EC4\u4EF6\u7684\u751F\u6210\u89C4\u5219",
option: "\u8868\u5355\u7684\u914D\u7F6E",
args: "\u4E8B\u4EF6\u7684\u539F\u59CB\u53C2\u6570"
}
},
eventInfo: {
blur: "\u5931\u53BB\u7126\u70B9\u65F6\u89E6\u53D1",
focus: "\u83B7\u5F97\u7126\u70B9\u65F6\u89E6\u53D1",
change: "\u5F53\u7ED1\u5B9A\u503C\u53D8\u5316\u65F6\u89E6\u53D1",
input: "\u5728\u503C\u6539\u53D8\u65F6\u89E6\u53D1",
clear: "\u5728\u70B9\u51FB\u6E05\u7A7A\u6309\u94AE\u65F6\u89E6\u53D1",
close: "\u5173\u95ED\u7EC4\u4EF6\u65F6\u89E6\u53D1",
click: "\u70B9\u51FB\u7EC4\u4EF6\u65F6\u89E6\u53D1",
add: "\u589E\u52A0\u65F6\u89E6\u53D1",
delete: "\u5220\u9664\u65F6\u89E6\u53D1",
remove: "\u5220\u9664\u65F6\u89E6\u53D1",
visibleChange: "\u4E0B\u62C9\u6846\u51FA\u73B0/\u9690\u85CF\u65F6\u89E6\u53D1",
calendarChange: "\u5728\u65E5\u5386\u6240\u9009\u65E5\u671F\u66F4\u6539\u65F6\u89E6\u53D1",
panelChange: "\u5F53\u65E5\u671F\u9762\u677F\u6539\u53D8\u65F6\u89E6\u53D1",
open: "\u6253\u5F00\u7684\u56DE\u8C03",
opened: "\u6253\u5F00\u52A8\u753B\u7ED3\u675F\u65F6\u7684\u56DE\u8C03",
closed: "\u5173\u95ED\u52A8\u753B\u7ED3\u675F\u65F6\u7684\u56DE\u8C03",
openAutoFocus: "\u8F93\u5165\u7126\u70B9\u805A\u7126\u5728\u5185\u5BB9\u65F6\u7684\u56DE\u8C03",
closeAutoFocus: "\u8F93\u5165\u7126\u70B9\u4ECE\u5185\u5BB9\u5931\u7126\u65F6\u7684\u56DE\u8C03",
submit: "\u8868\u5355\u63D0\u4EA4\u65F6\u89E6\u53D1",
confirm: "\u70B9\u51FB\u786E\u8BA4\u6309\u94AE\u65F6\u89E6\u53D1",
validateFail: "\u8868\u5355\u9A8C\u8BC1\u5931\u8D25\u65F6\u89E6\u53D1",
beforeLoad: "\u521D\u59CB\u5316\u4E4B\u524D\u89E6\u53D1",
loaded: "\u521D\u59CB\u5316\u5B8C\u6210\u4E4B\u540E\u89E6\u53D1",
hook_load: "\u7EC4\u4EF6\u89C4\u5219\u52A0\u8F7D\u540E\u89E6\u53D1",
hook_mounted: "\u7EC4\u4EF6\u6302\u8F7D\u540E\u89E6\u53D1",
hook_deleted: "\u7EC4\u4EF6\u89C4\u5219\u88AB\u79FB\u9664\u540E\u89E6\u53D1",
hook_watch: "\u7EC4\u4EF6\u89C4\u5219\u53D1\u751F\u53D8\u5316\u540E\u89E6\u53D1",
hook_value: "\u7EC4\u4EF6\u7684\u503C\u53D1\u751F\u53D8\u5316\u540E\u89E6\u53D1",
hook_hidden: "\u7EC4\u4EF6\u663E\u793A\u72B6\u6001\u53D1\u751F\u53D8\u5316\u540E\u89E6\u53D1"
},
fetch: {
info: "\u5B9A\u4E49\u8BF7\u6C42\u65F6\uFF0C\u652F\u6301\u901A\u8FC7\u53CC\u5927\u62EC\u53F7\u8BED\u6CD5\uFF08\u5982 {{token}}\uFF09\u4F7F\u7528\u53D8\u91CF\u3002\u5728\u63A5\u53E3\u8BF7\u6C42\u65F6\u4F1A\u81EA\u52A8\u8BFB\u53D6\u8FD9\u4E9B\u53D8\u91CF\u3002\u5982\u679C\u53D8\u91CF\u7684\u503C\u662F\u5BF9\u8C61\uFF0C\u53EF\u4EE5\u901A\u8FC7 {{variableName.attributeName}} \u8BBF\u95EE\u5BF9\u8C61\u7684\u5C5E\u6027\u503C\u3002",
title: "\u8BBE\u7F6E\u6570\u636E\u6E90",
create: "\u521B\u5EFA\u6570\u636E\u6E90",
config: "\u8BF7\u6C42\u914D\u7F6E",
action: "\u8BF7\u6C42\u94FE\u63A5",
actionRequired: "\u8BF7\u8F93\u5165\u6B63\u786E\u7684\u94FE\u63A5",
placeholder: "\u8BF7\u8F93\u5165\u6570\u636E\u6E90\u7684\u63CF\u8FF0\u4FE1\u606F",
method: "\u8BF7\u6C42\u65B9\u5F0F",
data: "\u9644\u5E26\u6570\u636E",
dataType: "\u6570\u636E\u7C7B\u578B",
headers: "\u8BF7\u6C42\u5934\u90E8",
query: "\u8BF7\u6C42\u53C2\u6570",
parse: "\u6570\u636E\u5904\u7406",
response: "\u63A5\u53E3\u8FD4\u56DE\u7684\u6570\u636E",
onError: "\u9519\u8BEF\u5904\u7406",
beforeFetch: "\u524D\u7F6E\u5904\u7406",
remote: "\u8FDC\u7A0B\u6570\u636E",
static: "\u9759\u6001\u6570\u636E",
optionsType: {
fetch: "\u8FDC\u7A0B\u6570\u636E",
global: "\u5168\u5C40\u6570\u636E\u6E90",
struct: "\u9759\u6001\u6570\u636E"
}
},
style: {
width: "\u5BBD\u5EA6",
height: "\u9AD8\u5EA6",
minWidth: "\u6700\u5C0F\u5BBD",
minHeight: "\u6700\u5C0F\u9AD8",
maxWidth: "\u6700\u5927\u5BBD",
maxHeight: "\u6700\u5927\u9AD8",
color: "\u989C\u8272",
backgroundColor: "\u80CC\u666F\u8272",
margin: "\u5916\u8FB9\u8DDD",
padding: "\u5185\u8FB9\u8DDD",
borderRadius: "\u5706\u89D2",
border: "\u8FB9\u6846",
solid: "\u5B9E\u7EBF",
dashed: "\u865A\u7EBF",
dotted: "\u70B9\u72B6\u865A\u7EBF",
double: "\u53CC\u5B9E\u7EBF",
opacity: "\u900F\u660E\u5EA6",
scale: "\u7F29\u653E",
overflow: {
name: "\u6EA2\u51FA",
visible: "\u53EF\u89C1",
hidden: "\u9690\u85CF",
scroll: "\u6EDA\u52A8",
auto: "\u6EA2\u51FA\u540E\u81EA\u52A8\u6EDA\u52A8"
},
shadow: {
name: "\u9634\u5F71",
x: "x\u8F74\u504F\u79FB\u91CF",
y: "y\u8F74\u504F\u79FB\u91CF",
vague: "\u6A21\u7CCA\u534A\u5F84",
extend: "\u6269\u6563\u534A\u5F84",
inset: "\u5411\u5185",
external: "\u5411\u5916",
mode: "\u6A21\u5F0F",
classic: "\u7ECF\u5178",
flat: "\u6241\u5E73",
solid: "\u7ACB\u4F53"
},
display: {
name: "\u5E03\u5C40",
block: "\u533A\u5757",
"inline-block": "\u884C\u5185\u533A\u5757",
inline: "\u884C\u5185\u6587\u672C",
flex: "\u5F39\u6027\u76D2\u5B50"
},
flexDirection: {
name: "\u4E3B\u8F74\u7684\u65B9\u5411",
row: "\u4E3B\u8F74\u4E3A\u6C34\u5E73\u65B9\u5411\uFF0C\u8D77\u70B9\u5728\u5DE6\u7AEF",
"row-reverse": "\u4E3B\u8F74\u4E3A\u6C34\u5E73\u65B9\u5411\uFF0C\u8D77\u70B9\u5728\u53F3\u7AEF",
column: "\u4E3B\u8F74\u4E3A\u5782\u76F4\u65B9\u5411\uFF0C\u8D77\u70B9\u5728\u4E0A\u6CBF",
"column-reverse": "\u4E3B\u8F74\u4E3A\u5782\u76F4\u65B9\u5411\uFF0C\u8D77\u70B9\u5728\u4E0B\u6CBF"
},
flexWrap: {
name: "\u662F\u5426\u6362\u884C",
nowrap: "\u4E0D\u6362\u884C",
wrap: "\u6362\u884C"
},
justifyContent: {
name: "\u4E3B\u8F74\u4E0A\u7684\u5BF9\u9F50\u65B9\u5F0F",
"flex-start": "\u5DE6\u5BF9\u9F50",
"flex-end": "\u53F3\u5BF9\u9F50",
center: "\u5C45\u4E2D",
"space-between": "\u4E24\u7AEF\u5BF9\u9F50",
"space-around": "\u5B50\u5143\u7D20\u4E24\u4FA7\u7684\u95F4\u9694\u76F8\u7B49",
"space-evenly": "\u5B50\u5143\u7D20\u5E73\u5747\u5206\u5E03\u5728\u4E3B\u8F74\u4E0A"
},
alignItems: {
name: "\u5B50\u5143\u7D20\u4EA4\u53C9\u8F74\u4E0A\u7684\u5BF9\u9F50\u65B9\u5F0F",
"flex-start": "\u4EA4\u53C9\u8F74\u7684\u8D77\u70B9\u5BF9\u9F50",
"flex-end": "\u4EA4\u53C9\u8F74\u7684\u7EC8\u70B9\u5BF9\u9F50",
center: "\u4EA4\u53C9\u8F74\u7684\u4E2D\u70B9\u5BF9\u9F50",
baseline: "\u6CBF\u7B2C\u4E00\u884C\u6587\u5B57\u7684\u57FA\u7EBF\u5BF9\u9F50",
stretch: "\u6EE1\u6574\u4E2A\u5BB9\u5668\u7684\u9AD8\u5EA6"
},
alignContent: {
name: "\u591A\u884C\u5B50\u5143\u7D20\u5728\u4EA4\u53C9\u8F74\u4E0A\u7684\u5BF9\u9F50\u65B9\u5F0F",
"flex-start": "\u4E0E\u4EA4\u53C9\u8F74\u7684\u8D77\u70B9\u5BF9\u9F50",
"flex-end": "\u4E0E\u4EA4\u53C9\u8F74\u7684\u7EC8\u70B9\u5BF9\u9F50",
center: "\u4E0E\u4EA4\u53C9\u8F74\u7684\u4E2D\u70B9\u5BF9\u9F50",
"space-between": "\u4E0E\u4EA4\u53C9\u8F74\u4E24\u7AEF\u5BF9\u9F50",
"space-around": "\u591A\u884C\u5B50\u5143\u7D20\u5E73\u5747\u5206\u5E03\u5728\u4EA4\u53C9\u8F74",
stretch: "\u8F74\u7EBF\u5360\u6EE1\u6574\u4E2A\u4EA4\u53C9\u8F74"
},
font: {
name: "\u5B57\u4F53",
size: "\u5927\u5C0F",
align: "\u5BF9\u9F50\u65B9\u5F0F",
height: "\u884C\u9AD8",
spacing: "\u5B57\u95F4\u8DDD",
preview: "\u6837\u5F0F\u9884\u89C8"
},
decoration: {
name: "\u4FEE\u9970",
underline: "\u4E0B\u5212\u7EBF",
"line-through": "\u5220\u9664\u7EBF",
overline: "\u4E0A\u5212\u7EBF"
},
weight: {
name: "\u7C97\u7EC6",
300: "\u7EC6\u4F53",
400: "\u5E38\u89C4\u4F53",
500: "\u4E2D\u9ED1\u4F53",
700: "\u4E2D\u7C97\u4F53"
}
},
designer: {
component: "\u7EC4\u4EF6\u914D\u7F6E",
id: "\u552F\u4E00\u503C",
name: "\u7F16\u53F7",
type: "\u7EC4\u4EF6\u7C7B\u578B",
form: "\u8868\u5355\u914D\u7F6E",
json: "\u6E32\u67D3\u89C4\u5219",
style: "\u6837\u5F0F\u914D\u7F6E",
rule: "\u57FA\u7840\u914D\u7F6E",
advanced: "\u9AD8\u7EA7\u914D\u7F6E",
props: "\u5C5E\u6027\u914D\u7F6E",
slots: "\u63D2\u69FD\u914D\u7F6E",
customProps: "\u81EA\u5B9A\u4E49\u5C5E\u6027\u914D\u7F6E",
validate: "\u9A8C\u8BC1\u914D\u7F6E",
event: "\u4E8B\u4EF6\u914D\u7F6E",
clearWarn: "\u6E05\u7A7A\u540E\u5C06\u4E0D\u80FD\u6062\u590D\uFF0C\u786E\u5B9A\u8981\u6E05\u7A7A\u5417\uFF1F",
childEmpty: "\u70B9\u51FB\u53F3\u4E0B\u89D2 \\e789 \u6309\u94AE\u6DFB\u52A0\u4E00\u5217",
dragEmpty: "\u62D6\u62FD\u5DE6\u4FA7\u5217\u8868\u4E2D\u7684\u7EC4\u4EF6\u5230\u6B64\u5904",
unload: "\u786E\u5B9A\u79BB\u5F00\u5F53\u524D\u9875\u9762\u5417?",
sublist: "\u5B50\u8282\u70B9\u5217\u8868",
formList: "\u8868\u5355\u5217\u8868",
comList: "\u7EC4\u4EF6\u5217\u8868",
addPage: "\u6DFB\u52A0\u6A21\u5757",
pageManage: "\u6A21\u5757\u7BA1\u7406",
gridLine: "\u8F85\u52A9\u7EBF",
main: "\u4E3B\u4F53",
layout: "\u5FEB\u901F\u5E03\u5C40",
col1: "\u4E00\u5217",
col2: "\u4E24\u5217",
col3: "\u4E09\u5217",
col4: "\u56DB\u5217",
print: {
title: "\u6253\u5370\u8868\u5355",
config: "\u8BBE\u7F6E\u6253\u5370",
left: "\u5DE6\u8FB9\u8DDD",
right: "\u53F3\u8FB9\u8DDD",
top: "\u4E0A\u8FB9\u8DDD",
bottom: "\u4E0B\u8FB9\u8DDD",
defaultStyle: "\u9ED8\u8BA4\u6837\u5F0F",
wordStyle: "\u6587\u6863\u6837\u5F0F",
export: "\u5BFC\u51FA PDF"
}
},
menu: {
template: "\u6A21\u677F",
main: "\u57FA\u7840\u7EC4\u4EF6",
aide: "\u8F85\u52A9\u7EC4\u4EF6",
layout: "\u5E03\u5C40\u7EC4\u4EF6",
component: "\u7EC4\u4EF6",
subform: "\u5B50\u8868\u5355\u7EC4\u4EF6",
container: "\u5BB9\u5668\u7EC4\u4EF6",
chart: "\u56FE\u8868\u7EC4\u4EF6",
tree: "\u5927\u7EB2"
},
formula: {
math: "\u6570\u5B57\u5904\u7406",
string: "\u6587\u672C\u5904\u7406",
date: "\u65F6\u95F4\u5904\u7406",
collection: "\u5408\u96C6\u5904\u7406",
condition: "\u903B\u8F91\u5904\u7406",
ADD: "\u83B7\u53D6\u4E24\u4E2A\u6570\u5B57\u76F8\u52A0\u7684\u503C",
SUB: "\u83B7\u53D6\u4E24\u4E2A\u6570\u5B57\u76F8\u51CF\u7684\u503C",
MUL: "\u83B7\u53D6\u4E24\u4E2A\u6570\u5B57\u76F8\u4E58\u7684\u503C",
DIV: "\u83B7\u53D6\u4E24\u4E2A\u6570\u5B57\u76F8\u9664\u7684\u503C",
SUM: "\u83B7\u53D6\u5408\u96C6\u4E2D\u6570\u503C\u7684\u603B\u548C",
MAX: "\u83B7\u53D6\u53C2\u6570\u5217\u8868\u4E2D\u7684\u6700\u5927\u503C",
MIN: "\u83B7\u53D6\u53C2\u6570\u5217\u8868\u4E2D\u7684\u6700\u5C0F\u503C",
ABS: "\u83B7\u53D6\u6570\u5B57\u7684\u7EDD\u5BF9\u503C",
AVG: "\u83B7\u53D6\u53C2\u6570\u5217\u8868\u7684\u5E73\u5747\u503C",
POWER: "\u83B7\u53D6\u6307\u5B9A\u6570\u5B57\u7684\u4E58\u5E42",
RAND: "\u83B7\u53D6\u4E00\u4E2A\u5927\u4E8E\u7B49\u4E8E0\u4E14\u5C0F\u4E8E1\u7684\u968F\u673A\u6570",
PI: "\u83B7\u53D6\u5706\u5468\u7387",
ROUND: "\u5C06\u4E00\u4E2A\u5C0F\u6570\u56DB\u820D\u4E94\u5165\u5230\u6307\u5B9A\u7684\u4F4D\u6570",
SQRT: "\u83B7\u53D6\u4E00\u4E2A\u6570\u5B57\u7684\u6B63\u5E73\u65B9\u6839",
NOW: "\u83B7\u53D6\u5F53\u524D\u7684\u65F6\u95F4",
TODAY: "\u83B7\u53D6\u4ECA\u5929\u7684\u65E5\u671F",
YEAR: "\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u5E74\u4EFD",
MONTH: "\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u6708\u4EFD",
DAY: "\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u5929\u6570",
HOUR: "\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u5C0F\u65F6\u6570",
MINUTE: "\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u5206\u949F\u6570",
SECOND: "\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u79D2\u6570",
DIFFDAYS: "\u83B7\u53D6\u4E24\u4E2A\u65E5\u671F\u4E4B\u95F4\u7684\u5929\u6570",
DIFFHOURS: "\u83B7\u53D6\u4E24\u4E2A\u65F6\u95F4\u4E4B\u95F4\u7684\u5C0F\u65F6\u6570,\u4FDD\u7559\u4E24\u4F4D\u5C0F\u6570",
DIFFMINUTES: "\u83B7\u53D6\u4E24\u4E2A\u65F6\u95F4\u4E4B\u95F4\u7684\u5206\u949F\u6570",
ADDYEAR: "\u589E\u52A0\u6307\u5B9A\u65E5\u671F\u7684\u5E74\u4EFD",
ADDMONTH: "\u589E\u52A0\u6307\u5B9A\u65E5\u671F\u7684\u6708\u4EFD",
ADDDAY: "\u589E\u52A0\u6307\u5B9A\u65E5\u671F\u7684\u5929\u6570",
ADDWEEK: "\u589E\u52A0\u6307\u5B9A\u65E5\u671F\u7684\u5468\u6570",
ADDHOUR: "\u589E\u52A0\u6307\u5B9A\u65F6\u95F4\u7684\u5C0F\u65F6\u6570",
ADDMINUTE: "\u589E\u52A0\u6307\u5B9A\u65F6\u95F4\u7684\u5206\u949F\u6570",
ADDSECOND: "\u589E\u52A0\u6307\u5B9A\u65F6\u95F4\u7684\u79D2\u6570",
SUBYEAR: "\u51CF\u5C11\u6307\u5B9A\u65E5\u671F\u7684\u5E74\u4EFD",
SUBMONTH: "\u51CF\u5C11\u6307\u5B9A\u65E5\u671F\u7684\u6708\u4EFD",
SUBDAY: "\u51CF\u5C11\u6307\u5B9A\u65E5\u671F\u7684\u5929\u6570",
SUBWEEK: "\u51CF\u5C11\u6307\u5B9A\u65E5\u671F\u7684\u5468\u6570",
SUBHOUR: "\u51CF\u5C11\u6307\u5B9A\u65F6\u95F4\u7684\u5C0F\u65F6\u6570",
SUBMINUTE: "\u51CF\u5C11\u6307\u5B9A\u65F6\u95F4\u7684\u5206\u949F\u6570",
SUBSECOND: "\u51CF\u5C11\u6307\u5B9A\u65F6\u95F4\u7684\u79D2\u6570",
TIMESTAMP: "\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u65F6\u95F4\u6233",
STARTSWITH: "\u68C0\u67E5\u5B57\u7B26\u4E32\u662F\u5426\u4EE5\u6307\u5B9A\u5B57\u7B26\u4E32\u5F00\u5934",
EMPTY: "\u68C0\u67E5\u53C2\u6570\u662F\u5426\u4E3A\u7A7A",
NOTEMPTY: "\u68C0\u67E5\u53C2\u6570\u662F\u5426\u4E0D\u4E3A\u7A7A",
LEN: "\u83B7\u53D6\u6307\u5B9A\u5408\u96C6\u7684\u957F\u5EA6",
MOD: "\u83B7\u53D6\u4E24\u4E2A\u6570\u5B57\u7684\u4F59\u6570",
FLOOR: "\u83B7\u53D6\u6307\u5B9A\u6570\u5B57\u5411\u4E0B\u53D6\u6574\u7684\u503C",
CEIL: "\u83B7\u53D6\u6307\u5B9A\u6570\u5B57\u5411\u4E0A\u53D6\u6574\u7684\u503C",
FIXED: "\u5C06\u4E00\u4E2A\u5C0F\u6570\u4FDD\u7559\u6307\u5B9A\u4F4D\u6570\u7684\u5C0F\u6570",
ISNUMBER: "\u68C0\u67E5\u53C2\u6570\u662F\u5426\u4E3A\u6570\u5B57",
TONUMBER: "\u5C06\u53C2\u6570\u8F6C\u6362\u4E3A\u6570\u5B57",
SLICELEFT: "\u83B7\u53D6\u4E00\u4E2A\u5B57\u7B26\u4E32\u4ECE\u5F00\u5934\u5F00\u59CB\u6307\u5B9A\u957F\u5EA6\u7684\u5B57\u7B26\u4E32",
SLICERIGHT: "\u83B7\u53D6\u4E00\u4E2A\u5B57\u7B26\u4E32\u4ECE\u7ED3\u5C3E\u5F00\u59CB\u6307\u5B9A\u957F\u5EA6\u7684\u5B57\u7B26\u4E32",
TOLOWER: "\u5C06\u5B57\u7B26\u4E32\u4E2D\u6240\u6709\u5927\u5199\u5B57\u6BCD\u8F6C\u6362\u4E3A\u5C0F\u5199\u5B57\u6BCD",
TOUPPER: "\u5C06\u5B57\u7B26\u4E32\u4E2D\u6240\u6709\u5C0F\u5199\u5B57\u6BCD\u8F6C\u6362\u4E3A\u5927\u5199\u5B57\u6BCD",
INCLUDES: "\u68C0\u67E5\u5B57\u7B26\u4E32\u4E2D\u662F\u5426\u5305\u542B\u6307\u5B9A\u5B57\u7B26\u4E32",
REPLACE: "\u5C06\u5B57\u7B26\u4E32\u4E2D\u7684\u90E8\u5206\u6587\u672C\u66FF\u6362\u4E3A\u4E0D\u540C\u7684\u6587\u672C,\u53EA\u66FF\u6362\u5339\u914D\u5230\u7684\u7B2C\u4E00\u4E2A",
REPLACEALL: "\u5C06\u5B57\u7B26\u4E32\u4E2D\u7684\u90E8\u5206\u6587\u672C\u66FF\u6362\u4E3A\u4E0D\u540C\u7684\u6587\u672C,\u66FF\u6362\u6240\u6709\u5339\u914D\u5230\u7684",
TRIM: "\u5C06\u5B57\u7B26\u4E32\u524D\u540E\u7684\u7A7A\u683C\u5220\u9664",
TOCHINSESAMOUNT: "\u83B7\u53D6\u6307\u5B9A\u6570\u5B57\u7684\u4E2D\u6587\u5927\u5199\u91D1\u989D",
UNION: "\u5C06\u5408\u96C6/\u53C2\u6570\u4E2D\u7684\u503C\u53BB\u91CD,\u8FD4\u56DE\u53BB\u91CD\u540E\u7684\u5408\u96C6",
INTERSECTIONSET: "\u83B7\u53D6\u4E24\u4E2A\u96C6\u5408\u7684\u4EA4\u96C6",
LIST: "\u83B7\u53D6\u6240\u6709\u53C2\u6570\u7EC4\u6210\u7684\u96C6\u5408",
AND: '\u5C06\u8868\u8FBE\u5F0F\u7528"\u5E76\u4E14"\u94FE\u63A5,\u5F53\u6240\u6709\u8868\u8FBE\u5F0F\u5747\u4E3Atrue\u65F6\u8FD4\u56DEtrue\uFF0C\u5426\u5219\u8FD4\u56DEfalse',
OR: '\u5C06\u8868\u8FBE\u5F0F\u7528"\u6216"\u94FE\u63A5,\u5F53\u6709\u4E00\u4E2A\u8868\u8FBE\u5F0F\u4E3Atrue\u65F6\u8FD4\u56DEtrue\uFF0C\u5426\u5219\u8FD4\u56DEfalse',
IF: "\u68C0\u67E5\u4E00\u4E2A\u6761\u4EF6\u80FD\u5426\u6EE1\u8DB3,\u5982\u679C\u6EE1\u8DB3\u8FD4\u56DE\u7B2C\u4E8C\u4E2A\u53C2\u6570\uFF0C\u5426\u5219\u8FD4\u56DE\u7B2C\u4E09\u4E2A\u53C2\u6570",
IN: "\u68C0\u67E5\u7B2C\u4E8C\u4E2A\u53C2\u6570\u662F\u5426\u5728\u5408\u96C6\u4E2D",
DEFAULT: "\u68C0\u67E5\u7B2C\u4E00\u4E2A\u53C2\u6570,\u5982\u679C\u4E3A\u7A7A\u8FD4\u56DE\u7B2C\u4E8C\u4E2A\u53C2\u6570,\u5426\u5219\u8FD4\u56DE\u7B2C\u4E00\u4E2A\u53C2\u6570",
CASE: "\u68C0\u67E5\u662F\u5426\u6EE1\u8DB3\u4E00\u4E2A\u6216\u591A\u4E2A\u6761\u4EF6\uFF0C\u8FD4\u56DE\u7B2C\u4E00\u4E2A\u6EE1\u8DB3\u6761\u4EF6\u7684\u503C",
COLUMN: "\u83B7\u53D6\u5B50\u8868\u5355\u4E2D\u6307\u5B9A\u5B57\u6BB5\u5E76\u8FD4\u56DE\u5408\u96C6",
VALUE: "\u83B7\u53D6\u5206\u7EC4\u8868\u5355\u4E2D\u6307\u5B9A\u5B57\u6BB5",
CONCAT: "\u5C06\u6240\u6709\u53C2\u6570\u62FC\u63A5,\u8FD4\u56DE\u62FC\u63A5\u540E\u7684\u5B57\u7B26\u4E32",
FALSE: "\u8FD4\u56DE\u903B\u8F91\u503C false",
TRUE: "\u8FD4\u56DE\u903B\u8F91\u503C true",
NOT: "\u83B7\u53D6\u67D0\u4E2A\u903B\u8F91\u503C\u7684\u76F8\u53CD\u503C",
EQ: "\u68C0\u67E5\u4E24\u4E2A\u503C\u662F\u5426\u76F8\u7B49",
NE: "\u68C0\u67E5\u4E24\u4E2A\u503C\u662F\u5426\u4E0D\u76F8\u7B49",
GE: "\u68C0\u67E5\u7B2C\u4E00\u4E2A\u503C\u662F\u5426\u5927\u4E8E\u7B49\u4E8E\u53E6\u4E00\u4E2A\u503C",
GT: "\u68C0\u67E5\u7B2C\u4E00\u4E2A\u503C\u662F\u5426\u5927\u4E8E\u53E6\u4E00\u4E2A\u503C",
LE: "\u68C0\u67E5\u7B2C\u4E00\u4E2A\u503C\u662F\u5426\u5C0F\u4E8E\u7B49\u4E8E\u53E6\u4E00\u4E2A\u503C",
LT: "\u68C0\u67E5\u7B2C\u4E00\u4E2A\u503C\u662F\u5426\u5C0F\u4E8E\u53E6\u4E00\u4E2A\u503C"
},
language: {
name: "\u56FD\u9645\u5316\u914D\u7F6E",
add: "\u65B0\u589E\u8BCD\u6761",
batchRemove: "\u6279\u91CF\u5220\u9664",
select: "\u9009\u62E9\u591A\u8BED\u8A00"
},
props: {
circle: "\u5706\u5F62",
square: "\u6B63\u65B9\u5F62",
image: "\u56FE\u7247",
video: "\u89C6\u9891",
audio: "\u97F3\u9891",
document: "\u6587\u6863",
size: "\u5C3A\u5BF8",
info: "\u63D0\u793A",
success: "\u6210\u529F",
error: "\u5931\u8D25",
warning: "\u8B66\u544A",
primary: "\u91CD\u8981",
danger: "\u5371\u9669",
form: "\u8868\u5355",
subform: "\u5B50\u8868\u5355",
other: "\u5176\u4ED6",
model: "\u5F39\u7A97",
field: "\u6570\u636E\u96C6",
variable: "\u53D8\u91CF",
disabled: "\u7981\u7528",
enable: "\u542F\u7528",
time: "\u65F6\u95F4",
email: "\u90AE\u7BB1",
number: "\u6570\u5B57",
globalData: "\u5168\u5C40\u6570\u636E",
mobile: "\u79FB\u52A8\u7AEF",
reactive: "\u54CD\u5E94\u5F0F",
pc: "\u7535\u8111\u7AEF",
title: "\u6807\u9898",
content: "\u5185\u5BB9",
collection: "\u5408\u96C6",
group: "\u5206\u7EC4",
custom: "\u81EA\u5B9A\u4E49",
change: "\u6539\u53D8",
blur: "\u5931\u53BB\u7126\u70B9",
preview: "\u9884\u89C8",
clear: "\u6E05\u7A7A",
cancel: "\u53D6\u6D88",
close: "\u5173\u95ED",
ok: "\u786E\u5B9A",
save: "\u4FDD\u5B58",
refresh: "\u5237\u65B0",
submit: "\u63D0\u4EA4",
reset: "\u91CD\u7F6E",
copy: "\u590D\u5236",
delete: "\u5220\u9664",
hide: "\u9690\u85CF",
show: "\u663E\u793A",
position: "\u4F4D\u7F6E",
render: "\u6E32\u67D3",
large: "\u5927",
default: "\u9ED8\u8BA4",
small: "\u5C0F",
always: "\u5E38\u663E",
never: "\u4E0D\u663E\u793A",
hover: "\u60AC\u6D6E",
click: "\u70B9\u51FB",
button: "\u6309\u94AE",
year: "\u5E74\u4EFD",
month: "\u6708\u4EFD",
date: "\u65E5\u671F",
dates: "\u65E5\u671F\u591A\u9009",
week: "\u4E00\u5468",
datetime: "\u65E5\u671F\u65F6\u95F4",
"datetime-local": "\u65E5\u671F\u65F6\u95F4",
datetimerange: "\u65E5\u671F\u65F6\u95F4\u533A\u95F4",
daterange: "\u65E5\u671F\u533A\u95F4",
monthrange: "\u6708\u4EFD\u533A\u95F4",
left: "\u5DE6\u5BF9\u9F50",
right: "\u53F3\u5BF9\u9F50",
top: "\u9876\u90E8",
bottom: "\u5E95\u90E8",
text: "\u6587\u5B57",
icon: "\u56FE\u6807",
picture: "\u56FE\u7247",
"picture-card": "\u5361\u7247",
center: "\u5C45\u4E2D",
vertical: "\u7AD6\u5411",
horizontal: "\u6A2A\u5411",
manage: "\u7BA1\u7406",
key: "\u952E\u540D",
name: "\u540D\u79F0",
value: "\u503C",
inputData: "\u9ED8\u8BA4\u503C",
append: "\u63D2\u5165",
options: "\u9009\u9879\u6570\u636E",
option: "\u9009\u9879",
callback: "\u56DE\u8C03",
mode: "\u6A21\u5F0F",
style: "\u6837\u5F0F",
print: "\u6253\u5370",
_self: "\u5F53\u524D\u7A97\u53E3",
_blank: "\u65B0\u7684\u7A97\u53E3",
_parent: "\u7236\u7EA7\u7A97\u53E3",
_top: "\u9876\u7EA7\u7A97\u53E3"
},
slots: {
prefix: "\u5934\u90E8\u5185\u5BB9",
suffix: "\u5C3E\u90E8\u5185\u5BB9",
prepend: "\u524D\u7F6E\u5185\u5BB9",
append: "\u540E\u7F6E\u5185\u5BB9"
},
behavior: {
add: "\u6DFB\u52A0\u52A8\u4F5C",
props: {
id: "\u9009\u62E9\u7EC4\u4EF6",
status: "\u72B6\u6001",
compute: "\u6761\u4EF6",
static: "\u9759\u6001",
formula: "\u8868\u8FBE\u5F0F",
setFormula: "\u914D\u7F6E\u8868\u8FBE\u5F0F",
continue: "\u7EE7\u7EED\u6267\u884C\u52A8\u4F5C",
stop: "\u4E2D\u65AD\u6267\u884C\u52A8\u4F5C",
break: "\u8DF3\u8FC7\u5F53\u524D\u52A8\u4F5C",
model: "\u9009\u62E9\u5F39\u7A97",
fetch: "\u914D\u7F6E\u8BF7\u6C42",
response: "\u8BF7\u6C42\u7ED3\u679C",
callback: "\u81EA\u5B9A\u4E49JS",
ignoreError: "\u6267\u884C\u5F02\u5E38",
expression: "\u6267\u884C\u6761\u4EF6",
stopPropagation: "\u963B\u65AD\u6761\u4EF6",
execute: "\u6267\u884C\u52A8\u4F5C",
info: "\u52A8\u4F5C\u8BF4\u660E"
},
openModel: {
name: "\u6253\u5F00\u5F39\u7A97",
info: "\u6253\u5F00\u6240\u9009\u7684\u5F39\u7A97"
},
closeModel: {
name: "\u5173\u95ED\u5F39\u7A97",
info: "\u5173\u95ED\u5F53\u524D\u5F39\u7A97"
},
hidden: {
name: "\u7EC4\u4EF6\u53EF\u89C1\u6027",
info: "\u63A7\u5236\u6240\u9009\u7684\u7EC4\u4EF6\u7684\u663E\u793A/\u9690\u85CF"
},
disabled: {
name: "\u7EC4\u4EF6\u53EF\u7528\u6027",
info: "\u63A7\u5236\u6240\u9009\u7684\u7EC4\u4EF6\u7684\u542F\u7528/\u7981\u7528"
},
resetFields: {
name: "\u91CD\u7F6E\u8868\u5355",
info: "\u91CD\u7F6E\u8868\u5355\u6570\u636E"
},
clearFields: {
name: "\u6E05\u7A7A\u8868\u5355",
info: "\u6E05\u7A7A\u8868\u5355\u6570\u636E"
},
validate: {
name: "\u6821\u9A8C\u8868\u5355",
info: "\u5BF9\u6574\u4E2A\u8868\u5355\u7684\u5185\u5BB9\u8FDB\u884C\u6821\u9A8C"
},
validateFields: {
name: "\u6821\u9A8C\u8868\u5355\u9879",
info: "\u6821\u9A8C\u6240\u9009\u7684\u7684\u8868\u5355\u9879"
},
setValue: {
name: "\u8868\u5355\u8D4B\u503C",
info: "\u4FEE\u6539\u8868\u5355\u7684\u6570\u636E"
},
fetch: {
name: "\u53D1\u9001\u8BF7\u6C42",
info: "\u914D\u7F6E\u5E76\u53D1\u9001API\u8BF7\u6C42",
props: {
append: "\u8FFD\u52A0\u8868\u5355\u6570\u636E"
},
warning: {
append: "\u5F00\u542F\u540E\uFF0C\u8FDC\u7A0B\u8BF7\u6C42\u8FD4\u56DE\u7684\u6570\u636E\u5C06\u81EA\u52A8\u8FFD\u52A0\u5230\u8868\u5355\u7684\u6570\u636E\u4E2D\u3002",
response: "\u8FDC\u7A0B\u8BF7\u6C42\u8FD4\u56DE\u7684\u6570\u636E\u5C06\u6682\u5B58\u5230\u6307\u5B9A\u7684\u53D8\u91CF\u4E2D\u3002"
}
},
copy: {
name: "\u590D\u5236\u5185\u5BB9",
info: "\u590D\u5236\u6587\u672C\u5185\u5BB9\u81F3\u7C98\u8D34\u677F"
},
callback: {
name: "\u81EA\u5B9A\u4E49\u64CD\u4F5C",
info: "\u901A\u8FC7JavaScript\u81EA\u5B9A\u4E49\u52A8\u4F5C\u903B\u8F91"
},
message: {
name: "\u6D88\u606F\u63D0\u9192",
info: "\u5F39\u51FA\u6D88\u606F\u63D0\u9192",
props: {
type: "\u7C7B\u578B",
message: "\u63D0\u793A\u4FE1\u606F",
duration: "\u6301\u7EED\u65F6\u95F4(ms)",
showClose: "\u663E\u793A\u5173\u95ED\u6309\u94AE"
}
},
submit: {
name: "\u63D0\u4EA4\u8868\u5355",
info: "\u624B\u52A8\u63D0\u4EA4\u8868\u5355\u5E76\u89E6\u53D1\u8868\u5355\u63D0\u4EA4\u4E8B\u4EF6"
}
},
com: {
cascader: {
name: "\u7EA7\u8054\u9009\u62E9\u5668",
event: {
expandChange: "\u5F53\u5C55\u5F00\u8282\u70B9\u53D1\u751F\u53D8\u5316\u65F6\u89E6\u53D1",
removeTag: "\u5728\u591A\u9009\u6A21\u5F0F\u4E0B\uFF0C\u79FB\u9664Tag\u65F6\u89E6\u53D1"
},
props: {
props: "\u914D\u7F6E\u9009\u9879",
placeholder: "\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C",
disabled: "\u662F\u5426\u7981\u7528",
clearable: "\u662F\u5426\u652F\u6301\u6E05\u7A7A\u9009\u9879",
showAllLevels: "\u8F93\u5165\u6846\u4E2D\u662F\u5426\u663E\u793A\u9009\u4E2D\u503C\u7684\u5B8C\u6574\u8DEF\u5F84",
collapseTags: "\u591A\u9009\u6A21\u5F0F\u4E0B\u662F\u5426\u6298\u53E0Tag",
collapseTagsTooltip: "\u5F53\u9F20\u6807\u60AC\u505C\u4E8E\u6298\u53E0\u6807\u7B7E\u7684\u6587\u672C\u65F6\uFF0C\u662F\u5426\u663E\u793A\u6240\u6709\u9009\u4E2D\u7684\u6807\u7B7E",
separator: "\u9009\u9879\u5206\u9694\u7B26",
filterable: "\u8BE5\u9009\u9879\u662F\u5426\u53EF\u4EE5\u88AB\u641C\u7D22",
tagType: "\u6807\u7B7E\u7C7B\u578B"
},
propsOpt: {
multiple: "\u662F\u5426\u591A\u9009",
expandTrigger: "\u6B21\u7EA7\u83DC\u5355\u7684\u5C55\u5F00\u65B9\u5F0F",
checkStrictly: "\u662F\u5426\u4E25\u683C\u7684\u9075\u5B88\u7236\u5B50\u8282\u70B9\u4E0D\u4E92\u76F8\u5173\u8054",
emitPath: "\u5728\u9009\u4E2D\u8282\u70B9\u6539\u53D8\u65F6\uFF0C\u662F\u5426\u8FD4\u56DE\u7531\u8BE5\u8282\u70B9\u6240\u5728\u7684\u5404\u7EA7\u83DC\u5355\u7684\u503C\u6240\u7EC4\u6210\u7684\u6570\u7EC4",
value: "\u6307\u5B9A\u9009\u9879\u7684\u503C\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",
label: "\u6307\u5B9A\u9009\u9879\u6807\u7B7E\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",
children: "\u6307\u5B9A\u9009\u9879\u7684\u5B50\u9009\u9879\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",
disabled: "\u6307\u5B9A\u9009\u9879\u7684\u7981\u7528\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",
leaf: "\u6307\u5B9A\u9009\u9879\u7684\u53F6\u5B50\u8282\u70B9\u7684\u6807\u5FD7\u4F4D\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C"
}
},
checkbox: {
name: "\u591A\u9009\u6846",
props: {
input: "\u662F\u5426\u53EF\u4EE5\u586B\u5199",
type: "\u6309\u94AE\u7C7B\u578B",
disabled: "\u662F\u5426\u7981\u7528",
min: "\u53EF\u88AB\u52FE\u9009\u7684\u6700\u5C0F\u6570\u91CF",
max: "\u53EF\u88AB\u52FE\u9009\u7684\u6700\u5927\u6570\u91CF",
textColor: "\u5F53\u6309\u94AE\u4E3A\u6D3B\u8DC3\u72B6\u6001\u65F6\u7684\u5B57\u4F53\u989C\u8272",
fill: "\u5F53\u6309\u94AE\u4E3A\u6D3B\u8DC3\u72B6\u6001\u65F6\u7684\u8FB9\u6846\u548C\u80CC\u666F\u989C\u8272"
}
},
col: {
name: "\u5E03\u5C40\u683C\u5B50",
info: "\u901A\u8FC7\u54CD\u5E94\u5F0F\u914D\u7F6E\u591A\u7AEF\u5E03\u5C40\uFF0C\u79FB\u52A8\u7AEF\u4F1A\u81EA\u52A8\u5E94\u7528\u7B2C\u4E00\u4E2A",
props: {
span: "\u6805\u683C\u5360\u636E\u7684\u5217\u6570",
offset: "\u6805\u683C\u5DE6\u4FA7\u7684\u95F4\u9694\u683C\u6570",
push: "\u6805\u683C\u5411\u53F3\u79FB\u52A8\u683C\u6570",
pull: "\u6805\u683C\u5411\u5DE6\u79FB\u52A8\u683C\u6570"
}
},
colorPicker: {
name: "\u989C\u8272\u9009\u62E9\u5668",
event: {
activeChange: "\u9762\u677F\u4E2D\u5F53\u524D\u663E\u793A\u7684\u989C\u8272\u53D1\u751F\u6539\u53D8\u65F6\u89E6\u53D1"
},
props: {
disabled: "\u662F\u5426\u7981\u7528",
showAlpha: "\u662F\u5426\u652F\u6301\u900F\u660E\u5EA6\u9009\u62E9",
colorFormat: "\u989C\u8272\u7684\u683C\u5F0F",
predefine: "\u9884\u5B9A\u4E49\u989C\u8272"
}
},
datePicker: {
name: "\u65E5\u671F",
props: {
pickerOptions: "\u5F53\u524D\u65F6\u95F4\u65E5\u671F\u9009\u62E9\u5668\u7279\u6709\u7684\u9009\u9879",
readonly: "\u5B8C\u5168\u53EA\u8BFB",
disabled: "\u7981\u7528",
type: "\u663E\u793A\u7C7B\u578B",
editable: "\u6587\u672C\u6846\u53EF\u8F93\u5165",
clearable: "\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE",
placeholder: "\u975E\u8303\u56F4\u9009\u62E9\u65F6\u7684\u5360\u4F4D\u5185\u5BB9",
startPlaceholder: "\u8303\u56F4\u9009\u62E9\u65F6\u5F00\u59CB\u65E5\u671F\u7684\u5360\u4F4D\u5185\u5BB9",
endPlaceholder: "\u8303\u56F4\u9009\u62E9\u65F6\u7ED3\u675F\u65E5\u671F\u7684\u5360\u4F4D\u5185\u5BB9",
format: "\u663E\u793A\u5728\u8F93\u5165\u6846\u4E2D\u7684\u683C\u5F0F",
align: "\u5BF9\u9F50\u65B9\u5F0F",
rangeSeparator: "\u9009\u62E9\u8303\u56F4\u65F6\u7684\u5206\u9694\u7B26",
unlinkPanels: "\u5728\u8303\u56F4\u9009\u62E9\u5668\u91CC\u53D6\u6D88\u4E24\u4E2A\u65E5\u671F\u9762\u677F\u4E4B\u95F4\u7684\u8054\u52A8"
}
},
dateRange: {
name: "\u65E5\u671F\u533A\u95F4"
},
timeRange: {
name: "\u65F6\u95F4\u533A\u95F4"
},
elAlert: {
name: "\u63D0\u793A",
description: "\u8BF4\u660E\u6587\u5B57",
props: {
title: "\u6807\u9898",
type: "\u4E3B\u9898",
description: "\u8F85\u52A9\u6027\u6587\u5B57",
closable: "\u662F\u5426\u53EF\u5173\u95ED",
center: "\u6587\u5B57\u662F\u5426\u5C45\u4E2D",
closeText: "\u5173\u95ED\u6309\u94AE\u81EA\u5B9A\u4E49\u6587\u672C",
showIcon: "\u662F\u5426\u663E\u793A\u56FE\u6807",
effect: "\u9009\u62E9\u63D0\u4F9B\u7684\u4E3B\u9898"
}
},
elButton: {
name: "\u6309\u94AE",
props: {
formCreateChild: "\u5185\u5BB9",
size: "\u5C3A\u5BF8",
type: "\u7C7B\u578B",
plain: "\u662F\u5426\u6734\u7D20\u6309\u94AE",
round: "\u662F\u5426\u5706\u89D2\u6309\u94AE",
circle: "\u662F\u5426\u5706\u5F62\u6309\u94AE",
loading: "\u662F\u5426\u52A0\u8F7D\u4E2D\u72B6\u6001",
disabled: "\u662F\u5426\u7981\u7528\u72B6\u6001"
}
},
elCard: {
name: "\u5361\u7247",
props: {
header: "\u6807\u9898",
shadow: "\u9634\u5F71\u663E\u793A\u65F6\u673A"
}
},
elCollapse: {
name: "\u6298\u53E0\u9762\u677F",
event: {
change: "\u5207\u6362\u5F53\u524D\u6D3B\u52A8\u9762\u677F\uFF0C\u5728\u624B\u98CE\u7434\u6A21\u5F0F\u4E0B\u5176\u7C7B\u578B\u662Fstring\uFF0C\u5728\u5176\u4ED6\u6A21\u5F0F\u4E0B\u662Farray"
},
props: {
accordion: "\u662F\u5426\u624B\u98CE\u7434\u6A21\u5F0F"
}
},
elCollapseItem: {
name: "\u9762\u677F",
props: {
title: "\u9762\u677F\u6807\u9898",
name: "\u552F\u4E00\u6807\u5FD7\u7B26",
disabled: "\u662F\u5426\u7981\u7528"
}
},
elDescriptions: {
name: "\u63CF\u8FF0\u5217\u8868",
props: {
title: "\u6807\u9898\u6587\u672C\uFF0C\u663E\u793A\u5728\u5DE6\u4E0A\u65B9",
extra: "\u64CD\u4F5C\u533A\u6587\u672C\uFF0C\u663E\u793A\u5728\u53F3\u4E0A\u65B9",
column: "\u4E00\u884C\u4E2D\u8868\u683C\u7684\u6570\u91CF",
border: "\u662F\u5426\u5E26\u6709\u8FB9\u6846",
direction: "\u6392\u5217\u7684\u65B9\u5411",
size: "\u5217\u8868\u7684\u5C3A\u5BF8"
}
},
elDescriptionsItem: {
name: "\u63CF\u8FF0\u683C\u5B50",
props: {
label: "\u6807\u7B7E\u6587\u672C",
__child: "\u5185\u5BB9",
span: "\u5217\u7684\u6570\u91CF",
width: "\u5217\u7684\u5BBD\u5EA6\uFF0C\u4E0D\u540C\u884C\u76F8\u540C\u5217\u7684\u5BBD\u5EA6\u6309\u6700\u5927\u503C\u8BBE\u5B9A\uFF08\u5982\u65E0 border \uFF0C\u5BBD\u5EA6\u5305\u542B\u6807\u7B7E\u4E0E\u5185\u5BB9",
minWidth: "\u5217\u7684\u6700\u5C0F\u5BBD\u5EA6",
align: "\u5217\u7684\u5185\u5BB9\u5BF9\u9F50\u65B9\u5F0F\uFF08\u5982\u65E0 border\uFF0C\u5BF9\u6807\u7B7E\u548C\u5185\u5BB9\u5747\u751F\u6548\uFF09",
labelAlign: "\u5217\u7684\u6807\u7B7E\u5BF9\u9F50\u65B9\u5F0F\uFF0C\u82E5\u4E0D\u8BBE\u7F6E\u8BE5\u9879\uFF0C\u5219\u4F7F\u7528\u5185\u5BB9\u7684\u5BF9\u9F50\u65B9\u5F0F\uFF08\u5982\u65E0 border\uFF0C\u8BF7\u4F7F\u7528 align \u53C2\u6570\uFF09",
className: "\u5217\u7684\u5185\u5BB9\u81EA\u5B9A\u4E49\u7C7B\u540D"
}
},
elDivider: {
name: "\u5206\u5272\u7EBF",
props: {
direction: "\u8BBE\u7F6E\u5206\u5272\u7EBF\u65B9\u5411",
formCreateChild: "\u8BBE\u7F6E\u5206\u5272\u7EBF\u6587\u6848",
contentPosition: "\u8BBE\u7F6E\u5206\u5272\u7EBF\u6587\u6848\u7684\u4F4D\u7F6E"
}
},
elTabPane: {
name: "\u9009\u9879\u5361",
props: {
label: "\u9009\u9879\u5361\u6807\u9898",
disabled: "\u662F\u5426\u7981\u7528",
name: "\u9009\u9879\u5361\u7684\u6807\u8BC6\u7B26",
lazy: "\u6807\u7B7E\u662F\u5426\u5EF6\u8FDF\u6E32\u67D3"
}
},
elTabs: {
name: "\u6807\u7B7E\u9875",
event: {
tabClick: "tab \u88AB\u9009\u4E2D\u65F6\u89E6\u53D1",
tabChange: "activeName \u6539\u53D8\u65F6\u89E6\u53D1",
tabRemove: "\u70B9\u51FB tab \u79FB\u9664\u6309\u94AE\u65F6\u89E6\u53D1",
tabAdd: "\u70B9\u51FB tab \u65B0\u589E\u6309\u94AE\u65F6\u89E6\u53D1",
edit: "\u70B9\u51FB tab \u7684\u65B0\u589E\u6216\u79FB\u9664\u6309\u94AE\u540E\u89E6\u53D1"
},
props: {
type: "\u98CE\u683C\u7C7B\u578B",
closable: "\u6807\u7B7E\u662F\u5426\u53EF\u5173\u95ED",
tabPosition: "\u9009\u9879\u5361\u6240\u5728\u4F4D\u7F6E",
stretch: "\u6807\u7B7E\u7684\u5BBD\u5EA6\u662F\u5426\u81EA\u6491\u5F00"
}
},
elTag: {
name: "\u6807\u7B7E",
props: {
formCreateChild: "\u6807\u7B7E\u5185\u5BB9",
type: "\u6807\u7B7E\u7684\u7C7B\u578B",
size: "\u6807\u7B7E\u7684\u5C3A\u5BF8",
effect: "\u6807\u7B7E\u7684\u4E3B\u9898",
closable: "\u662F\u5426\u53EF\u5173\u95ED",
disableTransitions: "\u662F\u5426\u7981\u7528\u6E10\u53D8\u52A8\u753B",
hit: "\u662F\u5426\u6709\u8FB9\u6846\u63CF\u8FB9",
round: "\u662F\u5426\u4E3A\u5706\u5F62",
color: "\u80CC\u666F\u8272"
}
},
elTransfer: {
name: "\u7A7F\u68AD\u6846",
event: {
leftCheckChange: "\u5DE6\u4FA7\u5217\u8868\u5143\u7D20\u88AB\u7528\u6237\u9009\u4E2D / \u53D6\u6D88\u9009\u4E2D\u65F6\u89E6\u53D1",
rightCheckChange: "\u53F3\u4FA7\u5217\u8868\u5143\u7D20\u88AB\u7528\u6237\u9009\u4E2D / \u53D6\u6D88\u9009\u4E2D\u65F6\u89E6\u53D1"
},
props: {
filterable: "\u662F\u5426\u53EF\u641C\u7D22",
filterPlaceholder: "\u641C\u7D22\u6846\u5360\u4F4D\u7B26",
targetOrder: "\u53F3\u4FA7\u5217\u8868\u5143\u7D20\u7684\u6392\u5E8F\u7B56\u7565",
targetOrderInfo: "\u82E5\u4E3A original\uFF0C\u5219\u4FDD\u6301\u4E0E\u6570\u636E\u76F8\u540C\u7684\u987A\u5E8F\uFF1B\u82E5\u4E3A push\uFF0C\u5219\u65B0\u52A0\u5165\u7684\u5143\u7D20\u6392\u5728\u6700\u540E\uFF1B\u82E5\u4E3A unshift\uFF0C\u5219\u65B0\u52A0\u5165\u7684\u5143\u7D20\u6392\u5728\u6700\u524D",
titles: "\u81EA\u5B9A\u4E49\u5217\u8868\u6807\u9898",
buttonTexts: "\u81EA\u5B9A\u4E49\u6309\u94AE\u6587\u6848",
props: "\u6570\u636E\u6E90\u7684\u5B57\u6BB5\u522B\u540D"
}
},
elTreeSelect: {
name: "\u6811\u5F62\u9009\u62E9",
event: {
removeTag: "\u591A\u9009\u6A21\u5F0F\u4E0B\u79FB\u9664tag\u65F6\u89E6\u53D1"
},
props: {
multiple: "\u662F\u5426\u591A\u9009",
disabled: "\u662F\u5426\u7981\u7528",
clearable: "\u662F\u5426\u53EF\u4EE5\u6E05\u7A7A\u9009\u9879",
collapseTags: "\u591A\u9009\u65F6\u662F\u5426\u5C06\u9009\u4E2D\u503C\u6309\u6587\u5B57\u7684\u5F62\u5F0F\u5C55\u793A",
multipleLimit: "\u591A\u9009\u65F6\u7528\u6237\u6700\u591A\u53EF\u4EE5\u9009\u62E9\u7684\u9879\u76EE\u6570\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236",
placeholder: "\u5360\u4F4D\u7B26",
props: "\u914D\u7F6E\u9009\u9879",
checkStrictly: "\u5728\u663E\u793A\u590D\u9009\u6846\u7684\u60C5\u51B5\u4E0B\uFF0C\u662F\u5426\u4E25\u683C\u7684\u9075\u5FAA\u7236\u5B50\u4E0D\u4E92\u76F8\u5173\u8054\u7684\u505A\u6CD5",
renderAfterExpand: "\u662F\u5426\u5728\u7B2C\u4E00\u6B21\u5C55\u5F00\u67D0\u4E2A\u6811\u8282\u70B9\u540E\u624D\u6E32\u67D3\u5176\u5B50\u8282\u70B9",
defaultExpandAll: "\u662F\u5426\u9ED8\u8BA4\u5C55\u5F00\u6240\u6709\u8282\u70B9",
expandOnClickNode: "\u662F\u5426\u5728\u70B9\u51FB\u8282\u70B9\u7684\u65F6\u5019\u5C55\u5F00\u6216\u8005\u6536\u7F29\u8282\u70B9",
checkOnClickNode: "\u662F\u5426\u5728\u70B9\u51FB\u8282\u70B9\u7684\u65F6\u5019\u9009\u4E2D\u8282\u70B9",
nodeKey: "\u6BCF\u4E2A\u6811\u8282\u70B9\u7528\u6765\u4F5C\u4E3A\u552F\u4E00\u6807\u8BC6\u7684\u5C5E\u6027\uFF0C\u6574\u68F5\u6811\u5E94\u8BE5\u662F\u552F\u4E00\u7684"
}
},
elLink: {
name: "\u94FE\u63A5",
props: {
formCreateChild: "\u5185\u5BB9",
href: "\u8DF3\u8F6C\u94FE\u63A5",
type: "\u7C7B\u578B",
underline: "\u662F\u5426\u663E\u793A\u4E0B\u5212\u7EBF",
disabled: "\u662F\u5426\u7981\u7528",
target: "\u6253\u5F00\u65B9\u5F0F"
}
},
elWatermark: {
name: "\u6C34\u5370",
props: {
content: "\u6C34\u5370\u6587\u672C\u5185\u5BB9",
image: "\u6C34\u5370\u56FE\u7247\uFF0C\u5EFA\u8BAE\u4F7F\u7528 2x \u6216 3x \u56FE\u50CF",
width: "\u6C34\u5370\u7684\u5BBD\u5EA6\uFF0C content \u7684\u9ED8\u8BA4\u503C\u662F\u5B83\u81EA\u5DF1\u7684\u5BBD\u5EA6",
height: "\u6C34\u5370\u7684\u9AD8\u5EA6\uFF0C content \u7684\u9ED8\u8BA4\u503C\u662F\u5B83\u81EA\u5DF1\u7684\u9AD8\u5EA6",
rotate: "\u6C34\u5370\u7684\u65CB\u8F6C\u89D2\u5EA6, \u5355\u4F4D \xB0",
zIndex: "\u6C34\u5370\u5143\u7D20\u7684z-index\u503C",
gap: "\u6C34\u5370\u4E4B\u95F4\u7684\u95F4\u8DDD"
}
},
elTooltip: {
name: "\u6587\u5B57\u63D0\u793A",
props: {
content: "\u663E\u793A\u7684\u5185\u5BB9",
disabled: "\u662F\u5426\u7981\u7528",
rawContent: "\u5185\u5BB9\u662F\u5426\u4F5C\u4E3A HTML \u5B57\u7B26\u4E32\u5904\u7406",
enterable: "\u9F20\u6807\u662F\u5426\u53EF\u8FDB\u5165\u5230 Tooltip \u4E2D",
effect: "\u4E3B\u9898",
placement: "Tooltip \u7EC4\u4EF6\u51FA\u73B0\u7684\u4F4D\u7F6E",
trigger: "\u5982\u4F55\u89E6\u53D1 Tooltip",
offset: "\u51FA\u73B0\u4F4D\u7F6E\u7684\u504F\u79FB\u91CF",
showAfter: "\u5728\u89E6\u53D1\u540E\u591A\u4E45\u663E\u793A\u5185\u5BB9\uFF0C\u5355\u4F4D\u6BEB\u79D2",
hideAfter: "\u5EF6\u8FDF\u5173\u95ED\uFF0C\u5355\u4F4D\u6BEB\u79D2",
autoClose: "\u51FA\u73B0\u540E\u81EA\u52A8\u9690\u85CF\u5EF6\u65F6\uFF0C\u5355\u4F4D\u6BEB\u79D2"
}
},
elImage: {
name: "\u56FE\u7247",
props: {
src: "\u56FE\u7247\u94FE\u63A5",
previewSrcList: "\u9884\u89C8\u56FE\u7247\u5217\u8868"
}
},
elAvatar: {
name: "\u5934\u50CF\u6846",
props: {
src: "\u56FE\u7247\u94FE\u63A5",
shape: "\u5F62\u72B6",
size: "\u5C3A\u5BF8"
}
},
elMention: {
name: "\u63D0\u53CA",
event: {
search: "\u6309\u4E0B\u89E6\u53D1\u5B57\u6BB5\u65F6\u89E6\u53D1",
select: "\u5F53\u7528\u6237\u9009\u62E9\u9009\u9879\u65F6\u89E6\u53D1"
},
props: {
type: "\u7C7B\u578B",
placeholder: "\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C",
clearable: "\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE",
disabled: "\u662F\u5426\u7981\u7528",
whole: "\u5F53\u9000\u683C\u952E\u88AB\u6309\u4E0B\u505A\u5220\u9664\u64CD\u4F5C\u65F6\uFF0C\u662F\u5426\u5C06\u63D0\u53CA\u90E8\u5206\u4F5C\u4E3A\u6574\u4F53\u5220\u9664",
checkIsWhole: "\u5F53\u9000\u683C\u952E\u88AB\u6309\u4E0B\u505A\u5220\u9664\u64CD\u4F5C\u65F6\uFF0C\u68C0\u67E5\u662F\u5426\u5C06\u63D0\u53CA\u90E8\u5206\u4F5C\u4E3A\u6574\u4F53\u5220\u9664",
filterOption: "\u7B5B\u9009\u5668\u9009\u9879\u903B\u8F91"
}
},
elSegmented: {
name: "\u5206\u6BB5\u63A7\u5236\u5668",
props: {
size: "\u5C3A\u5BF8",
block: "\u6491\u6EE1\u7236\u5143\u7D20\u5BBD\u5EA6",
disabled: "\u662F\u5426\u7981\u7528"
}
},
elFormItem: {
name: "\u8868\u5355\u9879",
props: {
label: "\u6807\u7B7E\u6587\u672C",
labelWidth: "\u6807\u7B7E\u5BBD\u5EA6",
size: "\u5C3A\u5BF8"
}
},
elStatistic: {
name: "\u7EDF\u8BA1\u680F",
props: {
value: "\u6570\u503C",
title: "\u6807\u9898",
prefix: "\u6570\u503C\u7684\u524D\u7F00",
suffix: "\u6570\u503C\u7684\u540E\u7F00"
}
},
fcTitle: {
name: "\u6807\u9898",
props: {
title: "\u6807\u9898",
size: "\u5C3A\u5BF8",
align: "\u5BF9\u9F50\u65B9\u5F0F"
}
},
fcId: {
name: "\u552F\u4E00\u503C",
props: {
prefix: "\u524D\u7F00"
}
},
fcCity: {
name: "\u7701\u5E02\u533A\u9009\u62E9\u5668",
props: {
api: "\u6570\u636E\u94FE\u63A5 URI",
level: "\u7C7B\u578B",
clearable: "\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE",
disabled: "\u662F\u5426\u7981\u7528",
filter: "\u6570\u636E\u8FC7\u6EE4,\u8FD4\u56DE\u53EF\u9009\u62E9\u6570\u636E"
}
},
fcCell: {
name: "\u683C\u5B50"
},
fcEditor: {
name: "\u5BCC\u6587\u672C\u6846",
props: {
disabled: "\u662F\u5426\u7981\u7528"
}
},
fcFlex: {
name: "\u76D2\u5B50\u5E03\u5C40"
},
fcFlex2: {
name: "\u76D2\u5B50\u5E03\u5C40",
horizontal: "\u6C34\u5E73\u5C45\u4E2D",
vertical: "\u5782\u76F4\u5C45\u4E2D",
left: "\u5DE6\u5BF9\u9F50",
right: "\u53F3\u5BF9\u9F50",
reset: "\u91CD\u7F6E\u5E03\u5C40"
},
fcRow: {
name: "\u6805\u683C\u5E03\u5C40",
props: {
gutter: "\u6805\u683C\u95F4\u9694",
type: "flex\u5E03\u5C40\u6A21\u5F0F",
justify: "flex\u5E03\u5C40\u4E0B\u7684\u6C34\u5E73\u6392\u5217\u65B9\u5F0F",
align: "flex\u5E03\u5C40\u4E0B\u7684\u5782\u76F4\u6392\u5217\u65B9\u5F0F"
}
},
fcDialog: {
name: "\u5F39\u51FA\u6846",
props: {
title: "\u6807\u9898",
width: "\u5BF9\u8BDD\u6846\u7684\u5BBD\u5EA6",
fullscreen: "\u662F\u5426\u4E3A\u5168\u5C4F",
modal: "\u662F\u5426\u9700\u8981\u906E\u7F69\u5C42",
autoClose: "\u63D0\u4EA4\u8868\u5355\u540E\u81EA\u52A8\u5173\u95ED\u5F39\u51FA\u6846",
footer: "\u662F\u5426\u663E\u793A\u64CD\u4F5C\u6309\u94AE",
beforeClose: "\u5173\u95ED\u524D\u7684\u56DE\u8C03"
}
},
fcDrawer: {
name: "\u62BD\u5C49",
props: {
title: "\u6807\u9898",
size: "\u5BF9\u8BDD\u6846\u7684\u5BBD\u5EA6",
direction: "\u6253\u5F00\u7684\u65B9\u5411",
modal: "\u662F\u5426\u9700\u8981\u906E\u7F69\u5C42",
autoClose: "\u63D0\u4EA4\u8868\u5355\u540E\u81EA\u52A8\u5173\u95ED\u5F39\u51FA\u6846",
footer: "\u662F\u5426\u663E\u793A\u64CD\u4F5C\u6309\u94AE",
beforeClose: "\u5173\u95ED\u524D\u7684\u56DE\u8C03"
},
directionType: {
ltr: "\u5DE6\u4FA7",
rtl: "\u53F3\u4FA7"
}
},
fcTable: {
name: "\u8868\u683C\u5E03\u5C40",
props: {
mini: "\u7D27\u51D1\u6A21\u5F0F",
border: "\u662F\u5426\u663E\u793A\u8FB9\u6846",
borderColor: "\u8FB9\u6846\u989C\u8272",
borderWidth: "\u8FB9\u6846\u5BBD\u5EA6"
}
},
fcTableGrid: {
name: "\u683C\u5B50"
},
fcValue: {
name: "\u8BA1\u7B97\u516C\u5F0F",
empty: "\u5728\u53F3\u4FA7\u914D\u7F6E\u4E2D\u8BBE\u7F6E\u8BA1\u7B97\u516C\u5F0F"
},
fcSlot: {
name: "\u63D2\u69FD\u533A\u57DF",
empty: "\u901A\u8FC7\u5B9A\u4E49\u63D2\u69FD&nbsp;{tag}&nbsp;\u586B\u5145\u533A\u57DF",
props: {
name: "\u63D2\u69FD\u540D\u79F0"
}
},
fcJson: {
name: "\u52A8\u6001\u533A\u57DF",
empty: "\u901A\u8FC7\u52A0\u8F7D&nbsp;{tag}&nbsp;\u89C4\u5219\u586B\u5145\u533A\u57DF",
props: {
_loadType: "JSON \u89C4\u5219",
type: "\u7C7B\u578B"
}
},
lineChart: {
name: "\u6298\u7EBF\u56FE",
data: "\u56FE\u8868\u6570\u636E",
pieTypeOpt: {
pie: "\u5706\u5F62",
doughnut: "\u73AF\u5F62",
"half-doughnut": "\u534A\u73AF\u5F62"
},
funnelSortOpt: {
descending: "\u5012\u5E8F",
ascending: "\u6B63\u5E8F"
},
props: {
title: "\u56FE\u8868\u7684\u540D\u79F0",
subtitle: "\u56FE\u8868\u7684\u7B80\u4ECB",
valueFormat: "\u683C\u5F0F\u5316\u6570\u503C\u663E\u793A",
stack: "\u591A\u5217\u6570\u636E\u65F6\u662F\u5426\u5806\u53E0",
smooth: "\u7EBF\u6761\u662F\u5426\u5E73\u6ED1\u8FC7\u6E21",
showLegend: "\u662F\u5426\u663E\u793A\u6807\u8BB0",
showSeriesLabel: "\u662F\u5426\u663E\u793A\u6570\u503C",
barBackgroundColor: "\u67F1\u72B6\u7684\u80CC\u666F\u8272",
funnelSort: "\u6392\u5E8F\u65B9\u5F0F",
pieType: "\u5F62\u72B6",
min: "\u6700\u5C0F\u503C",
max: "\u6700\u5927\u503C",
value: "\u6570\u503C",
indicator: "\u6307\u793A\u5668",
loadOptions: "\u521D\u59CB\u5316"
}
},
areaChart: {
name: "\u4F53\u79EF\u56FE"
},
barChart: {
name: "\u67F1\u72B6\u56FE"
},
customChart: {
name: "\u81EA\u5B9A\u4E49\u56FE\u8868"
},
funnelChart: {
name: "\u6F0F\u6597\u56FE"
},
gaugeChart: {
name: "\u4EEA\u8868\u76D8"
},
pieChart: {
name: "\u997C\u56FE"
},
radarChart: {
name: "\u96F7\u8FBE\u56FE"
},
scatterChart: {
name: "\u6563\u70B9\u56FE"
},
stripeChart: {
name: "\u6761\u5F62\u56FE"
},
fcInlineForm: {
name: "\u884C\u5185\u5E03\u5C40"
},
group: {
name: "\u5B50\u8868\u5355",
props: {
disabled: "\u662F\u5426\u7981\u7528",
syncDisabled: "\u662F\u5426\u4E0E\u5B50\u8868\u5355\u5F3A\u5236\u540C\u6B65\u7981\u7528\u72B6\u6001",
expand: "\u8BBE\u7F6E\u9ED8\u8BA4\u5C55\u5F00\u51E0\u9879",
button: "\u662F\u5426\u663E\u793A\u64CD\u4F5C\u6309\u94AE",
sortBtn: "\u662F\u5426\u663E\u793A\u6392\u5E8F\u6309\u94AE",
min: "\u8BBE\u7F6E\u6700\u5C0F\u6DFB\u52A0\u51E0\u9879",
max: "\u8BBE\u7F6E\u6700\u591A\u6DFB\u52A0\u51E0\u9879"
}
},
html: {
name: "HTML",
props: {
formCreateChild: "\u5185\u5BB9"
}
},
input: {
name: "\u8F93\u5165\u6846",
event: {
change: "\u5F53\u503C\u6539\u53D8\u65F6\uFF0C\u5F53\u7EC4\u4EF6\u5931\u53BB\u7126\u70B9\u6216\u7528\u6237\u6309Enter\u65F6\u89E6\u53D1"
},
props: {
type: "\u7C7B\u578B",
maxlength: "\u6700\u5927\u8F93\u5165\u957F\u5EA6",
minlength: "\u6700\u5C0F\u8F93\u5165\u957F\u5EA6",
placeholder: "\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C",
clearable: "\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE",
disabled: "\u662F\u5426\u7981\u7528",
readonly: "\u662F\u5426\u53EA\u8BFB"
}
},
inputNumber: {
name: "\u6570\u5B57\u8F93\u5165\u6846",
props: {
precision: "\u6570\u503C\u7CBE\u5EA6",
min: "\u8BBE\u7F6E\u8BA1\u6570\u5668\u5141\u8BB8\u7684\u6700\u5C0F\u503C",
max: "\u8BBE\u7F6E\u8BA1\u6570\u5668\u5141\u8BB8\u7684\u6700\u5927\u503C",
step: "\u8BA1\u6570\u5668\u6B65\u957F",
stepStrictly: "\u662F\u5426\u53EA\u80FD\u8F93\u5165 step \u7684\u500D\u6570",
disabled: "\u662F\u5426\u7981\u7528\u8BA1\u6570\u5668",
controls: "\u662F\u5426\u4F7F\u7528\u63A7\u5236\u6309\u94AE",
controlsPosition: "\u63A7\u5236\u6309\u94AE\u4F4D\u7F6E",
placeholder: "\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C"
}
},
password: {
name: "\u5BC6\u7801\u8F93\u5165\u6846",
event: {
change: "\u5F53\u503C\u6539\u53D8\u65F6\uFF0C\u5F53\u7EC4\u4EF6\u5931\u53BB\u7126\u70B9\u6216\u7528\u6237\u6309Enter\u65F6\u89E6\u53D1"
},
props: {
disabled: "\u662F\u5426\u7981\u7528",
readonly: "\u662F\u5426\u53EA\u8BFB",
maxlength: "\u6700\u5927\u8F93\u5165\u957F\u5EA6",
minlength: "\u6700\u5C0F\u8F93\u5165\u957F\u5EA6",
placeholder: "\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C",
clearable: "\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE"
}
},
radio: {
name: "\u5355\u9009\u6846",
props: {
input: "\u662F\u5426\u53EF\u4EE5\u586B\u5199",
disabled: "\u662F\u5426\u7981\u7528",
type: "\u6309\u94AE\u5F62\u5F0F",
textColor: "\u6309\u94AE\u5F62\u5F0F\u6FC0\u6D3B\u65F6\u7684\u6587\u672C\u989C\u8272",
fill: "\u6309\u94AE\u5F62\u5F0F\u6FC0\u6D3B\u65F6\u7684\u586B\u5145\u8272\u548C\u8FB9\u6846\u8272"
}
},
rate: {
name: "\u8BC4\u5206",
props: {
max: "\u6700\u5927\u5206\u503C",
disabled: "\u662F\u5426\u7981\u7528",
allowHalf: "\u662F\u5426\u5141\u8BB8\u534A\u9009",
voidColor: "\u672A\u9009\u4E2D\u65F6\u56FE\u6807\u7684\u989C\u8272",
disabledVoidColor: "\u53EA\u8BFB\u65F6\u672A\u9009\u4E2D\u65F6\u56FE\u6807\u7684\u989C\u8272",
voidIconClass: "\u672A\u9009\u4E2D\u65F6\u56FE\u6807\u7684\u7C7B\u540D",
disabledVoidIconClass: "\u53EA\u8BFB\u65F6\u672A\u9009\u4E2D\u65F6\u56FE\u6807\u7684\u7C7B\u540D",
showScore: "\u662F\u5426\u663E\u793A\u5F53\u524D\u5206\u6570",
textColor: "\u8F85\u52A9\u6587\u5B57\u7684\u989C\u8272",
scoreTemplate: "\u5206\u6570\u663E\u793A\u6A21\u677F"
}
},
fcDataSelect: {
name: "\u5B50\u8868\u5355\u9009\u62E9\u5668"
},
select: {
name: "\u9009\u62E9\u5668",
title: "\u8BF7\u9009\u62E9",
emptyText: "\u62D6\u62FD\u7EC4\u4EF6\u914D\u7F6E\u641C\u7D22\u6761\u4EF6",
event: {
removeTag: "\u591A\u9009\u6A21\u5F0F\u4E0B\u79FB\u9664tag\u65F6\u89E6\u53D1"
},
props: {
title: "\u6807\u9898",
valueKey: "\u6307\u5B9A\u9009\u9879\u7684\u503C\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",
labelKey: "\u6307\u5B9A\u9009\u9879\u6807\u7B7E\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",
autoLoad: "\u81EA\u52A8\u89E6\u53D1\u641C\u7D22",
multiple: "\u662F\u5426\u591A\u9009",
disabled: "\u662F\u5426\u7981\u7528",
clearable: "\u662F\u5426\u53EF\u4EE5\u6E05\u7A7A\u9009\u9879",
collapseTags: "\u591A\u9009\u65F6\u662F\u5426\u5C06\u9009\u4E2D\u503C\u6309\u6587\u5B57\u7684\u5F62\u5F0F\u5C55\u793A",
multipleLimit: "\u591A\u9009\u65F6\u7528\u6237\u6700\u591A\u53EF\u4EE5\u9009\u62E9\u7684\u9879\u76EE\u6570\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236",
placeholder: "\u5360\u4F4D\u7B26",
filterable: "\u662F\u5426\u53EF\u641C\u7D22",
allowCreate: "\u662F\u5426\u5141\u8BB8\u7528\u6237\u521B\u5EFA\u65B0\u6761\u76EE",
noMatchText: "\u641C\u7D22\u6761\u4EF6\u65E0\u5339\u914D\u65F6\u663E\u793A\u7684\u6587\u5B57",
noDataText: "\u9009\u9879\u4E3A\u7A7A\u65F6\u663E\u793A\u7684\u6587\u5B57",
reserveKeyword: "\u591A\u9009\u4E14\u53EF\u641C\u7D22\u65F6\uFF0C\u662F\u5426\u5728\u9009\u4E2D\u4E00\u4E2A\u9009\u9879\u540E\u4FDD\u7559\u5F53\u524D\u7684\u641C\u7D22\u5173\u952E\u8BCD",
defaultFirstOption: "\u5728\u8F93\u5165\u6846\u6309\u4E0B\u56DE\u8F66\uFF0C\u9009\u62E9\u7B2C\u4E00\u4E2A\u5339\u914D\u9879",
remote: "\u5176\u4E2D\u7684\u9009\u9879\u662F\u5426\u4ECE\u670D\u52A1\u5668\u8FDC\u7A0B\u52A0\u8F7D",
remoteMethod: "\u81EA\u5B9A\u4E49\u8FDC\u7A0B\u641C\u7D22\u65B9\u6CD5"
}
},
slider: {
name: "\u6ED1\u5757",
props: {
min: "\u6700\u5C0F\u503C",
max: "\u6700\u5927\u503C",
disabled: "\u662F\u5426\u7981\u7528",
step: "\u6B65\u957F",
showInput: "\u662F\u5426\u663E\u793A\u8F93\u5165\u6846\uFF0C\u4EC5\u5728\u975E\u8303\u56F4\u9009\u62E9\u65F6\u6709\u6548",
showInputControls: "\u5728\u663E\u793A\u8F93\u5165\u6846\u7684\u60C5\u51B5\u4E0B\uFF0C\u662F\u5426\u663E\u793A\u8F93\u5165\u6846\u7684\u63A7\u5236\u6309\u94AE",
showStops: "\u662F\u5426\u663E\u793A\u95F4\u65AD\u70B9",
range: "\u662F\u5426\u4E3A\u8303\u56F4\u9009\u62E9",
vertical: "\u662F\u5426\u7AD6\u5411\u6A21\u5F0F",
height: "Slider \u9AD8\u5EA6\uFF0C\u7AD6\u5411\u6A21\u5F0F\u65F6\u5FC5\u586B"
}
},
space: {
name: "\u95F4\u8DDD"
},
stepForm: {
name: "\u5206\u6B65\u8868\u5355",
event: {
next: "\u70B9\u51FB\u4E0B\u4E00\u6B65\u6309\u94AE\u65F6\u89E6\u53D1"
},
props: {
submitBtn: "\u663E\u793A\u63D0\u4EA4\u6309\u94AE",
autoValidate: "\u8FDB\u5165\u4E0B\u4E00\u6B65\u524D\u81EA\u52A8\u9A8C\u8BC1\u8868\u5355",
"stepsProps>alignCenter": "\u8FDB\u884C\u5C45\u4E2D\u5BF9\u9F50",
"stepsProps>simple": "\u662F\u5426\u5E94\u7528\u7B80\u6D01\u98CE\u683C"
}
},
stepFormItem: {
name: "\u6B65\u9AA4\u6761",
props: {
title: "\u6807\u9898",
description: "\u63CF\u8FF0\u6587\u6848"
}
},
subForm: {
name: "\u5206\u7EC4",
props: {
disabled: "\u662F\u5426\u7981\u7528",
syncDisabled: "\u662F\u5426\u4E0E\u5B50\u8868\u5355\u5F3A\u5236\u540C\u6B65\u7981\u7528\u72B6\u6001"
}
},
switch: {
name: "\u5F00\u5173",
slots: {
"active-action": "\u6253\u5F00\u65F6\u7684\u5185\u5BB9",
"inactive-action": "\u5173\u95ED\u65F6\u7684\u5185\u5BB9"
},
props: {
disabled: "\u662F\u5426\u7981\u7528",
width: "\u5BBD\u5EA6\uFF08px\uFF09",
activeText: "\u6253\u5F00\u65F6\u7684\u6587\u5B57\u63CF\u8FF0",
inactiveText: "\u5173\u95ED\u65F6\u7684\u6587\u5B57\u63CF\u8FF0",
activeValue: "\u6253\u5F00\u65F6\u7684\u503C",
inactiveValue: "\u5173\u95ED\u65F6\u7684\u503C",
activeColor: "\u6253\u5F00\u65F6\u7684\u80CC\u666F\u8272",
inactiveColor: "\u5173\u95ED\u65F6\u7684\u80CC\u666F\u8272"
}
},
tableForm: {
name: "\u8868\u683C\u8868\u5355",
props: {
disabled: "\u662F\u5426\u7981\u7528",
filterEmptyColumn: "\u662F\u5426\u8FC7\u6EE4\u7A7A\u884C\u7684\u6570\u636E",
max: "\u6700\u591A\u6DFB\u52A0\u51E0\u884C\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236",
min: "\u6700\u5C11\u6DFB\u52A0\u51E0\u884C",
size: "\u5C3A\u5BF8",
emptyText: "\u7A7A\u6570\u636E\u65F6\u663E\u793A\u7684\u6587\u672C\u5185\u5BB9",
height: "\u9AD8\u5EA6",
showIndex: "\u663E\u793A\u884C\u53F7",
stripe: "\u663E\u793A\u6591\u9A6C\u7EB9",
border: "\u8FB9\u6846",
button: "\u64CD\u4F5C\u6309\u94AE",
page: "\u5206\u9875",
addable: "\u5141\u8BB8\u65B0\u589E",
deletable: "\u5141\u8BB8\u5220\u9664",
newColumn: "\u9ED8\u8BA4\u663E\u793A\u65B0\u884C",
"button>column": "\u6309\u94AE\u7BA1\u7406",
"button>label": "\u64CD\u4F5C",
"button>fixed": "\u4F4D\u7F6E",
"button>width": "\u5217\u7684\u5BBD\u5EA6",
"page>props>pageSize": "\u6BCF\u9875\u663E\u793A\u6761\u76EE\u4E2A\u6570",
"page>props>small": "\u4F7F\u7528\u5C0F\u578B\u5206\u9875\u6837\u5F0F",
"page>props>background": "\u4E3A\u5206\u9875\u6309\u94AE\u6DFB\u52A0\u80CC\u666F\u8272"
}
},
tableFormPro: {
name: "\u8868\u683C\u8868\u5355Pro",
event: {
handleClick: "\u70B9\u51FB\u64CD\u4F5C\u6309\u94AE\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6"
}
},
nestedTableForm: {
name: "\u5D4C\u5957\u8868\u5355",
props: {
disabled: "\u662F\u5426\u7981\u7528",
max: "\u6700\u591A\u6DFB\u52A0\u51E0\u884C\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236",
nestedMax: "\u5B50\u8868\u5355\u6700\u591A\u6DFB\u52A0\u51E0\u884C\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236"
}
},
infiniteTableForm: {
name: "\u65E0\u9650\u7EA7\u8868\u5355",
props: {
disabled: "\u662F\u5426\u7981\u7528",
childrenField: "\u8BBE\u7F6E\u5B50\u7EA7\u7684\u5B57\u6BB5\u540D",
max: "\u6700\u591A\u6DFB\u52A0\u51E0\u884C\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236",
layerMax: "\u6700\u591A\u6DFB\u52A0\u51E0\u5C42\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236"
}
},
nestedSubTableForm: {
name: "\u5B50\u8868\u683C\u8868\u5355"
},
tableFormColumn: {
name: "\u8868\u683C\u683C\u5B50",
label: "\u81EA\u5B9A\u4E49\u540D\u79F0",
props: {
label: "\u6807\u9898",
header: "\u8868\u5934",
fixed: "\u4F4D\u7F6E",
width: "\u5BBD\u5EA6",
color: "\u989C\u8272",
hidden: "\u662F\u5426\u9690\u85CF",
required: "\u662F\u5426\u663E\u793A\u5FC5\u586B\u661F\u53F7"
}
},
tableFormColumn2: {
name: "\u8868\u683C\u683C\u5B50",
header: "\u914D\u7F6E\u5F53\u524D\u5217\u7684\u8868\u5934\u540D\u79F0\uFF0C\u91CD\u590D\u7684\u8868\u5934\u5C06\u81EA\u52A8\u5408\u5E76\u3002"
},
dataTable: {
name: "\u6570\u636E\u8868\u683C",
handle: "\u7981\u7528\u903B\u8F91",
click: "\u70B9\u51FB\u4E8B\u4EF6",
filter: "\u7B5B\u9009",
header: "\u8868\u5934",
event: {
cellMouseEnter: "\u5F53\u5355\u5143\u683C hover \u8FDB\u5165\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",
cellMouseLeave: "\u5F53\u5355\u5143\u683C hover \u9000\u51FA\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",
handleClick: "\u70B9\u51FB\u64CD\u4F5C\u6309\u94AE\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",
rowClick: "\u5F53\u67D0\u4E00\u884C\u88AB\u70B9\u51FB\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",
rowDblclick: "\u5F53\u67D0\u4E00\u884C\u88AB\u53CC\u51FB\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",
headerClick: "\u5F53\u67D0\u4E00\u5217\u7684\u8868\u5934\u88AB\u70B9\u51FB\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",
filterChange: "\u7B5B\u9009\u6761\u4EF6\u53D8\u5316\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",
expandChange: "\u5F53\u7528\u6237\u5BF9\u67D0\u4E00\u884C\u5C55\u5F00\u6216\u8005\u5173\u95ED\u7684\u65F6\u5019\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",
sortChange: "\u5F53\u8868\u683C\u7684\u6392\u5E8F\u6761\u4EF6\u53D1\u751F\u53D8\u5316\u7684\u65F6\u5019\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",
selectionChange: "\u5F53\u9009\u62E9\u9879\u53D1\u751F\u53D8\u5316\u65F6\u89E6\u53D1"
},
button: {
title: "\u64CD\u4F5C\u6309\u94AE",
btn: "\u914D\u7F6E\u64CD\u4F5C\u6309\u94AE",
link: "\u6587\u5B57",
round: "\u5706\u89D2",
plain: "\u6734\u7D20",
disabled: "\u7981\u7528"
},
column: {
title: "\u5217\u8868\u7BA1\u7406",
btn: "\u914D\u7F6E\u8868\u683C\u5217\u8868",
prop: "\u5B57\u6BB5\u540D\u79F0",
sort: "\u6392\u5E8F"
},
format: {
default: "\u5E38\u89C4",
tag: "\u6807\u7B7E",
image: "\u56FE\u7247",
custom: "\u81EA\u5B9A\u4E49"
},
fixed: {
default: "\u5E38\u89C4",
left: "\u5DE6\u60AC\u6D6E",
right: "\u53F3\u60AC\u6D6E"
},
sortable: {
disabled: "\u4E0D\u6392\u5E8F",
default: "\u5E38\u89C4\u6392\u5E8F",
custom: "\u63A5\u53E3\u6392\u5E8F"
},
props: {
_optionType: "\u8868\u683C\u6570\u636E",
"page>totalField": "\u63A5\u53E3\u54CD\u5E94\u6570\u636E\u4E2D\u603B\u6761\u76EE\u6570\u7684\u5B57\u6BB5\u540D\u79F0",
"page>dataField": "\u63A5\u53E3\u54CD\u5E94\u6570\u636E\u4E2D\u5217\u8868\u6570\u636E\u7684\u5B57\u6BB5\u540D\u79F0",
"page>orderField": "\u8BF7\u6C42\u63A5\u53E3\u65F6\u6392\u5E8F\u7684\u53C2\u6570\u540D\u79F0",
"page>orderByField": "\u8BF7\u6C42\u63A5\u53E3\u65F6\u6392\u5E8F\u65B9\u5F0F\u7684\u53C2\u6570\u540D\u79F0",
"page>pageField": "\u8BF7\u6C42\u63A5\u53E3\u65F6\u9875\u7801\u7684\u53C2\u6570\u540D\u79F0(\u5206\u9875)",
"page>pageSizeField": "\u8BF7\u6C42\u63A5\u53E3\u65F6\u6761\u76EE\u6570\u7684\u53C2\u6570\u540D\u79F0(\u5206\u9875)",
column: "\u8868\u683C\u7BA1\u7406",
showSummary: "\u662F\u5426\u5728\u8868\u5C3E\u663E\u793A\u5408\u8BA1\u884C",
selection: "\u662F\u5426\u663E\u793A\u591A\u9009\u6846",
size: "\u5C3A\u5BF8",
rowKey: "\u884C\u6570\u636E\u7684Key",
emptyText: "\u7A7A\u6570\u636E\u65F6\u663E\u793A\u7684\u6587\u672C\u5185\u5BB9",
height: "\u9AD8\u5EA6",
index: "\u663E\u793A\u884C\u53F7",
stripe: "\u663E\u793A\u6591\u9A6C\u7EB9",
border: "\u8FB9\u6846",
defaultExpandAll: "\u9ED8\u8BA4\u5C55\u5F00\u6240\u6709\u884C",
button: "\u64CD\u4F5C\u6309\u94AE",
page: "\u5206\u9875",
"button>column": "\u6309\u94AE\u7BA1\u7406",
"button>label": "\u64CD\u4F5C",
"button>fixed": "\u4F4D\u7F6E",
"button>width": "\u5217\u7684\u5BBD\u5EA6",
"page>position": "\u4F4D\u7F6E",
"page>props>pageSize": "\u6BCF\u9875\u663E\u793A\u6761\u76EE\u4E2A\u6570",
"page>props>small": "\u4F7F\u7528\u5C0F\u578B\u5206\u9875\u6837\u5F0F",
"page>props>background": "\u4E3A\u5206\u9875\u6309\u94AE\u6DFB\u52A0\u80CC\u666F\u8272"
},
requiredName: "\u8BF7\u8F93\u5165\u6309\u94AE\u540D\u79F0",
requiredKey: "\u8BF7\u8F93\u5165\u6309\u94AE\u6807\u8BC6",
requiredLabel: "\u8BF7\u8F93\u5165\u6807\u9898",
requiredRender: "\u8BF7\u8F93\u5165\u6E32\u67D3\u51FD\u6570"
},
text: {
name: "\u6587\u5B57",
props: {
formCreateChild: "\u5185\u5BB9"
}
},
textarea: {
name: "\u591A\u884C\u8F93\u5165\u6846",
event: {
change: "\u5F53\u503C\u6539\u53D8\u65F6\uFF0C\u5F53\u7EC4\u4EF6\u5931\u53BB\u7126\u70B9\u6216\u7528\u6237\u6309Enter\u65F6\u89E6\u53D1"
},
props: {
disabled: "\u662F\u5426\u7981\u7528",
readonly: "\u662F\u5426\u53EA\u8BFB",
maxlength: "\u6700\u5927\u8F93\u5165\u957F\u5EA6",
minlength: "\u6700\u5C0F\u8F93\u5165\u957F\u5EA6",
showWordLimit: "\u662F\u5426\u663E\u793A\u7EDF\u8BA1\u5B57\u6570",
placeholder: "\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C",
rows: "\u8F93\u5165\u6846\u884C\u6570",
autosize: "\u9AD8\u5EA6\u662F\u5426\u81EA\u9002\u5E94"
}
},
timePicker: {
name: "\u65F6\u95F4",
"HH:mm:ss": "\u65F6:\u5206:\u79D2",
"HH:mm": "\u65F6:\u5206",
props: {
__format: "\u8F93\u5165\u6846\u4E2D\u7684\u683C\u5F0F",
pickerOptions: "\u5F53\u524D\u65F6\u95F4\u65E5\u671F\u9009\u62E9\u5668\u7279\u6709\u7684\u9009\u9879",
readonly: "\u5B8C\u5168\u53EA\u8BFB",
disabled: "\u7981\u7528",
editable: "\u6587\u672C\u6846\u53EF\u8F93\u5165",
clearable: "\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE",
placeholder: "\u975E\u8303\u56F4\u9009\u62E9\u65F6\u7684\u5360\u4F4D\u5185\u5BB9",
startPlaceholder: "\u8303\u56F4\u9009\u62E9\u65F6\u5F00\u59CB\u65E5\u671F\u7684\u5360\u4F4D\u5185\u5BB9",
endPlaceholder: "\u8303\u56F4\u9009\u62E9\u65F6\u7ED3\u675F\u65E5\u671F\u7684\u5360\u4F4D\u5185\u5BB9",
isRange: "\u662F\u5426\u4E3A\u65F6\u95F4\u8303\u56F4\u9009\u62E9",
arrowControl: "\u662F\u5426\u4F7F\u7528\u7BAD\u5934\u8FDB\u884C\u65F6\u95F4\u9009\u62E9",
align: "\u5BF9\u9F50\u65B9\u5F0F"
}
},
tree: {
name: "\u6811\u5F62\u63A7\u4EF6",
event: {
nodeClick: "\u5F53\u8282\u70B9\u88AB\u70B9\u51FB\u7684\u65F6\u5019\u89E6\u53D1",
nodeContextmenu: "\u5F53\u67D0\u4E00\u8282\u70B9\u88AB\u9F20\u6807\u53F3\u952E\u70B9\u51FB\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",
checkChange: "\u5F53\u590D\u9009\u6846\u88AB\u70B9\u51FB\u7684\u65F6\u5019\u89E6\u53D1",
check: "\u70B9\u51FB\u8282\u70B9\u590D\u9009\u6846\u4E4B\u540E\u89E6\u53D1",
currentChange: "\u5F53\u524D\u9009\u4E2D\u8282\u70B9\u53D8\u5316\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",
nodeExpand: "\u8282\u70B9\u88AB\u5C55\u5F00\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",
nodeCollapse: "\u8282\u70B9\u88AB\u5173\u95ED\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",
nodeDragStart: "\u8282\u70B9\u5F00\u59CB\u62D6\u62FD\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",
nodeDragEnter: "\u62D6\u62FD\u8FDB\u5165\u5176\u4ED6\u8282\u70B9\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",
nodeDragLeave: "\u62D6\u62FD\u79BB\u5F00\u67D0\u4E2A\u8282\u70B9\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",
nodeDragOver: "\u5728\u62D6\u62FD\u8282\u70B9\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6\uFF08\u7C7B\u4F3C\u6D4F\u89C8\u5668\u7684 mouseover \u4E8B\u4EF6\uFF09",
nodeDragEnd: "\u62D6\u62FD\u7ED3\u675F\u65F6\uFF08\u53EF\u80FD\u672A\u6210\u529F\uFF09\u89E6\u53D1\u7684\u4E8B\u4EF6",
nodeDrop: "\u62D6\u62FD\u6210\u529F\u5B8C\u6210\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6"
},
props: {
emptyText: "\u5185\u5BB9\u4E3A\u7A7A\u7684\u65F6\u5019\u5C55\u793A\u7684\u6587\u672C",
props: "\u914D\u7F6E\u9009\u9879",
renderAfterExpand: "\u662F\u5426\u5728\u7B2C\u4E00\u6B21\u5C55\u5F00\u67D0\u4E2A\u6811\u8282\u70B9\u540E\u624D\u6E32\u67D3\u5176\u5B50\u8282\u70B9",
defaultExpandAll: "\u662F\u5426\u9ED8\u8BA4\u5C55\u5F00\u6240\u6709\u8282\u70B9",
expandOnClickNode: "\u662F\u5426\u5728\u70B9\u51FB\u8282\u70B9\u7684\u65F6\u5019\u5C55\u5F00\u6216\u8005\u6536\u7F29\u8282\u70B9\uFF0C\u5982\u679C\u4E3A false\uFF0C\u5219\u53EA\u6709\u70B9\u7BAD\u5934\u56FE\u6807\u7684\u65F6\u5019\u624D\u4F1A\u5C55\u5F00\u6216\u8005\u6536\u7F29\u8282\u70B9\u3002",
checkOnClickNode: "\u662F\u5426\u5728\u70B9\u51FB\u8282\u70B9\u7684\u65F6\u5019\u9009\u4E2D\u8282\u70B9",
autoExpandParent: "\u5C55\u5F00\u5B50\u8282\u70B9\u7684\u65F6\u5019\u662F\u5426\u81EA\u52A8\u5C55\u5F00\u7236\u8282\u70B9",
checkStrictly: "\u5728\u663E\u793A\u590D\u9009\u6846\u7684\u60C5\u51B5\u4E0B\uFF0C\u662F\u5426\u4E25\u683C\u7684\u9075\u5FAA\u7236\u5B50\u4E0D\u4E92\u76F8\u5173\u8054\u7684\u505A\u6CD5",
accordion: "\u662F\u5426\u6BCF\u6B21\u53EA\u6253\u5F00\u4E00\u4E2A\u540C\u7EA7\u6811\u8282\u70B9\u5C55\u5F00",
indent: "\u76F8\u90BB\u7EA7\u8282\u70B9\u95F4\u7684\u6C34\u5E73\u7F29\u8FDB(px)",
nodeKey: "\u6BCF\u4E2A\u6811\u8282\u70B9\u7528\u6765\u4F5C\u4E3A\u552F\u4E00\u6807\u8BC6\u7684\u5C5E\u6027\uFF0C\u6574\u68F5\u6811\u5E94\u8BE5\u662F\u552F\u4E00\u7684"
}
},
upload: {
name: "\u4E0A\u4F20",
info: "\u4E0A\u4F20\u6210\u529F\u540E\uFF0C\u5C06\u63A5\u53E3\u8FD4\u56DE\u7684 URL \u8D4B\u503C\u7ED9 file.url\uFF0C\u6216\u5C06\u8FD4\u56DE\u7ED3\u679C\u8D4B\u503C\u7ED9 file.value\uFF0C\u4EE5\u4FBF\u5728\u540E\u7EED\u7684\u8868\u5355\u63D0\u4EA4\u65F6\u83B7\u53D6\u8FD9\u4E9B\u6570\u636E\u3002",
event: {
remove: "\u6587\u4EF6\u5217\u8868\u79FB\u9664\u6587\u4EF6\u65F6\u89E6\u53D1",
preview: "\u70B9\u51FB\u6587\u4EF6\u5217\u8868\u4E2D\u5DF2\u4E0A\u4F20\u7684\u6587\u4EF6\u65F6\u89E6\u53D1",
error: "\u6587\u4EF6\u4E0A\u4F20\u5931\u8D25\u65F6\u89E6\u53D1",
progress: "\u6587\u4EF6\u4E0A\u4F20\u65F6\u89E6\u53D1",
exceed: "\u5F53\u8D85\u51FA\u9650\u5236\u65F6\u89E6\u53D1"
},
slots: {
tip: "\u8BF4\u660E"
},
props: {
listType: "\u4E0A\u4F20\u7C7B\u578B",
multiple: "\u662F\u5426\u652F\u6301\u591A\u9009\u6587\u4EF6",
action: "\u4E0A\u4F20\u7684\u5730\u5740(\u5FC5\u586B)",
beforeUpload: "\u4E0A\u4F20\u6587\u4EF6\u4E4B\u524D\u89E6\u53D1",
onSuccess: "\u4E0A\u4F20\u6210\u529F\u65F6\u89E6\u53D1",
beforeRemove: "\u5220\u9664\u6587\u4EF6\u4E4B\u524D\u89E6\u53D1",
headers: "\u8BBE\u7F6E\u4E0A\u4F20\u7684\u8BF7\u6C42\u5934\u90E8",
data: "\u4E0A\u4F20\u65F6\u9644\u5E26\u7684\u989D\u5916\u53C2\u6570",
name: "\u4E0A\u4F20\u7684\u6587\u4EF6\u5B57\u6BB5\u540D",
withCredentials: "\u652F\u6301\u53D1\u9001 cookie \u51ED\u8BC1\u4FE1\u606F",
accept: "\u63A5\u53D7\u4E0A\u4F20\u7684\u6587\u4EF6\u7C7B\u578B",
autoUpload: "\u662F\u5426\u5728\u9009\u53D6\u6587\u4EF6\u540E\u7ACB\u5373\u8FDB\u884C\u4E0A\u4F20",
disabled: "\u662F\u5426\u7981\u7528",
limit: "\u6700\u5927\u5141\u8BB8\u4E0A\u4F20\u4E2A\u6570"
}
},
audioBox: {
name: "\u97F3\u9891\u64AD\u653E\u5668",
preloadOpt: {
auto: "\u81EA\u52A8",
metadata: "\u5143\u6570\u636E",
none: "\u7981\u6B62"
},
event: {
pause: "\u97F3\u9891\u64AD\u653E\u6682\u505C\u65F6\u89E6\u53D1",
play: "\u97F3\u9891\u5F00\u59CB\u64AD\u653E\u65F6\u89E6\u53D1",
ended: "\u97F3\u9891\u64AD\u653E\u7ED3\u675F\u540E\u89E6\u53D1"
},
props: {
src: "\u97F3\u9891\u5730\u5740",
type: "\u97F3\u9891\u7C7B\u578B",
autoplay: "\u662F\u5426\u81EA\u52A8\u64AD\u653E",
loop: "\u662F\u5426\u5FAA\u73AF\u64AD\u653E",
muted: "\u662F\u5426\u9759\u97F3",
controls: "\u662F\u5426\u663E\u793A\u63A7\u5236\u6761",
preload: "\u9884\u52A0\u8F7D"
}
},
barCodeBox: {
name: "\u6761\u5F62\u7801",
props: {
value: "\u5185\u5BB9",
format: "\u6761\u5F62\u7801\u7684\u7C7B\u578B",
width: "\u5355\u4E2A\u6761\u5F62\u7684\u5BBD\u5EA6",
height: "\u6761\u5F62\u7801\u7684\u9AD8\u5EA6",
displayValue: "\u662F\u5426\u663E\u793A\u5185\u5BB9",
fontSize: "\u8BBE\u7F6E\u6587\u5B57\u7684\u5927\u5C0F",
textPosition: "\u8BBE\u7F6E\u6587\u5B57\u7684\u4F4D\u7F6E",
textAlign: "\u8BBE\u7F6E\u6587\u5B57\u7684\u5BF9\u9F50\u65B9\u5F0F",
textMargin: "\u8BBE\u7F6E\u6587\u5B57\u7684\u8FB9\u8DDD",
background: "\u6761\u5F62\u7801\u7684\u80CC\u666F\u8272",
lineColor: "\u7EBF\u6761\u7684\u989C\u8272"
}
},
iframeBox: {
name: "\u5185\u5D4C\u9875\u9762",
event: {
load: "\u9875\u9762\u52A0\u8F7D\u5B8C\u6210\u540E\u89E6\u53D1"
},
loadingOpt: {
eager: "\u7ACB\u5373\u52A0\u8F7D",
lazy: "\u5EF6\u8FDF\u52A0\u8F7D"
},
props: {
src: "\u9875\u9762\u94FE\u63A5",
loading: "\u52A0\u8F7D\u65B9\u5F0F"
}
},
qrCodeBox: {
name: "\u4E8C\u7EF4\u7801",
circleTypeOpt: {
square: "\u6B63\u65B9\u5F62",
dots: "\u70B9\u72B6",
rounded: "\u5706\u5F62",
classy: "\u7ECF\u5178"
},
props: {
data: "\u5185\u5BB9",
image: "\u4E2D\u5FC3\u7684\u56FE\u7247\u94FE\u63A5",
width: "\u4E8C\u7EF4\u7801\u7684\u5BBD\u5EA6",
height: "\u4E8C\u7EF4\u7801\u7684\u9AD8\u5EA6",
circleType: "\u70B9\u7684\u7C7B\u578B",
circleColor: "\u70B9\u7684\u989C\u8272"
}
},
signaturePad: {
name: "\u624B\u5199\u7B7E\u540D",
props: {
penColor: "\u7EBF\u6761\u7684\u989C\u8272"
}
},
videoBox: {
name: "\u89C6\u9891\u64AD\u653E\u5668",
event: {
error: "\u89C6\u9891\u52A0\u8F7D\u5931\u8D25\u65F6\u89E6\u53D1",
pause: "\u89C6\u9891\u64AD\u653E\u6682\u505C\u65F6\u89E6\u53D1",
play: "\u89C6\u9891\u5F00\u59CB\u64AD\u653E\u65F6\u89E6\u53D1",
ended: "\u89C6\u9891\u64AD\u653E\u7ED3\u675F\u540E\u89E6\u53D1"
},
props: {
src: "\u89C6\u9891\u5730\u5740",
type: "\u89C6\u9891\u7C7B\u578B",
autoplay: "\u662F\u5426\u81EA\u52A8\u64AD\u653E",
loop: "\u662F\u5426\u5FAA\u73AF\u64AD\u653E",
isLive: "\u662F\u5426\u662F\u76F4\u64AD",
controls: "\u662F\u5426\u663E\u793A\u63A7\u5236\u6761",
withCredentials: "\u662F\u5426\u643A\u5E26\u51ED\u8BC1"
}
}
},
tmp: {
duration: "\u65F6\u957F",
chineseAmount: "\u91D1\u989D",
col3: "\u4E09\u5217\u6805\u683C",
col4: "\u56DB\u5217\u6805\u683C",
table43: "4x3\u8868\u683C"
}
}, Ec = (e, t) => Ac({
message: e,
type: t || "info",
customClass: "_fc-message-tip"
}), $n = (e) => Ec(e, "error"), ws = function(e, t, i, r) {
const n = r || {};
return t.forEach((a) => {
e.indexOf(a[i || "id"]) > -1 && e.splice(e.indexOf(a[i || "id"]), 1, a[n.label || "label"]), St.trueArray(a[n.children || "children"]) && ws(e, a[n.children || "children"], i, r);
}), e;
}, T_ = function(e, t) {
return t.forEach((i) => {
e.indexOf(i.value) > -1 && (e[e.indexOf(i.value)] = i.label);
}), e;
};
function Eo(e) {
if (e) {
if (!Array.isArray(e))
return [e];
} else
return [];
return e;
}
function k_(e, t) {
let i = t.rule.value;
const r = t.$render.vNode.h, n = t.type, a = t.$handle.subForm[t.id], s = t.prop.readMode;
if (t.prop.title.title && t.prop.title.title.trim() && (t.prop.title.title += "\uFF1A"), s === !1 || s === "custom" || !t.input || t.rule.subForm || (Array.isArray(a) ? a.length : a) || ["fcGroup", "fcSubForm", "tableForm", "tableFormPro", "fcJson", "stepForm", "nestedTableForm", "infiniteTableForm", "fcUpload", "fcDialog", "fcDrawer", "fcPopup"].indexOf(t.trueType) > -1)
return t.trueType === "fcUpload" && (t.prop.props.disabled = !0), t.parser.render(e, t);
if (["radio", "select", "checkbox"].indexOf(n) > -1)
i = T_([...Eo(i)], t.prop.props.options || t.prop.props.formCreateInject.options || []).join(", ");
else if (["timePicker", "datePicker", "slider"].indexOf(n) > -1)
i = Array.isArray(i) ? i.join(" - ") : i;
else if (n === "cascader")
i = [...Eo(i)], Array.isArray(i[0]) || (i = [i]), i = i.map((u) => ws(u, t.prop.props.options || t.prop.props.formCreateInject.options || [], "value", t.prop.props.props).join("/")).join(", ");
else if (n === "elTransfer") {
const u = [...Eo(i)];
i = ws(u, t.prop.props.data || t.prop.props.formCreateInject.options || [], "key").join(", ");
} else if (n === "fcDataSelect")
i = [...Eo(i)].map((d) => d[t.prop.props.labelKey || "label"]).join(", ");
else if (["tree", "elTreeSelect"].indexOf(n) > -1) {
const u = t.prop.props.data || t.prop.props.formCreateInject.options || [];
i = ws([...Eo(i)], u, n === "elTreeSelect" ? "value" : "id").join(", ");
} else {
if (n === "fcEditor" || s === "html")
return r("div", { innerHTML: i });
if (s === "image")
return i = Eo(i), r("div", { class: "_fc-upload" }, i.map(function(u) {
return r("div", { class: "_fc-upload-preview" }, [
r("el-image", { src: (u == null ? void 0 : u.url) || u, previewSrcList: i.map((d) => (d == null ? void 0 : d.url) || d), previewTeleported: !0, fit: "cover" })
]);
}));
if ((n === "switch" || n === "el-switch") && (t.prop.props.activeValue != null || t.prop.props.inactiveValue != null))
i = t.prop.props.activeValue === i ? "\u662F" : "\u5426";
else {
if (n === "signaturePad" && i)
return r("el-image", { src: i, previewTeleported: !0, fit: "cover", style: { height: "90px" } });
typeof i == "boolean" && (i = i ? "\u662F" : "\u5426");
}
}
return r("span", { class: "_fc-read-view" }, ["" + (i == null ? "" : i)]);
}
function O_(e, t) {
return `<template>
<form-create
v-model="formData"
v-model:api="fapi"
:rule="rule"
:option="option"
@submit="onSubmit"
></form-create>
</template>
<script>
import formCreate from "@form-create/element-ui";
export default {
components: {
formCreate: formCreate.$form()
},
data () {
const option = formCreate.parseJson('${t.replaceAll("\\", "\\\\").replaceAll("'", "\\'")}');
//\u5F00\u542F\u9605\u8BFB\u6A21\u5F0F
//option.preview = true;
return {
formData: {},
fapi: null,
rule: formCreate.parseJson('${e.replaceAll("\\", "\\\\").replaceAll("'", "\\'")}'),
option: option
}
},
methods: {
onSubmit (formData) {
//todo \u63D0\u4EA4\u8868\u5355
}
}
}
<\/script>`;
}
function R_(e, t) {
return `<template>
<form-create
v-model="formData"
v-model:api="fapi"
:rule="rule"
:option="option"
@submit="onSubmit"
></form-create>
</template>
<script setup>
import {ref} from "vue";
import formCreate from "@form-create/element-ui";
const option = ref(formCreate.parseJson('${t.replaceAll("\\", "\\\\").replaceAll("'", "\\'")}'));
const rule = ref(formCreate.parseJson('${e.replaceAll("\\", "\\\\").replaceAll("'", "\\'")}'));
const fapi = ref(null);
const formData = ref({});
const onSubmit = (formData) => {
//todo \u63D0\u4EA4\u8868\u5355
}
<\/script>`;
}
function D_(e, t) {
return `<template>
<form-create-mobile
driver="elm"
v-model="formData"
v-model:api="fapi"
:rule="rule"
:option="option"
@submit="onSubmit"
></form-create-mobile>
</template>
<script>
import formCreate from "@form-create/vant";
export default {
components: {
formCreateMobile: formCreate.$form()
},
data () {
const option = formCreate.parseJson('${t.replaceAll("\\", "\\\\").replaceAll("'", "\\'")}');
//\u5F00\u542F\u9605\u8BFB\u6A21\u5F0F
//option.preview = true;
return {
formData: {},
fapi: null,
rule: formCreate.parseJson('${e.replaceAll("\\", "\\\\").replaceAll("'", "\\'")}'),
option: option
}
},
methods: {
onSubmit (formData) {
//todo \u63D0\u4EA4\u8868\u5355
}
}
}
<\/script>`;
}
function $_(e, t) {
return `<template>
<form-create-mobile
driver="elm"
v-model="formData"
v-model:api="fapi"
:rule="rule"
:option="option"
@submit="onSubmit"
></form-create-mobile>
</template>
<script setup>
import {ref} from "vue";
import formCreateMobile from "@form-create/vant";
const option = ref(formCreateMobile.parseJson('${t.replaceAll("\\", "\\\\").replaceAll("'", "\\'")}'));
const rule = ref(formCreateMobile.parseJson('${e.replaceAll("\\", "\\\\").replaceAll("'", "\\'")}'));
const fapi = ref(null);
const formData = ref({});
const onSubmit = (formData) => {
//todo \u63D0\u4EA4\u8868\u5355
}
<\/script>`;
}
function Hg() {
return {
type: "Required",
field: "formCreate$required",
title: "\u662F\u5426\u5FC5\u586B"
};
}
function zi(e, t, i, r = []) {
t.id || (t.id = 1), i && i--;
for (let n = 0; n < 3; n++) {
const a = {
[t.label]: e + i * 10 + (n + 1),
[t.value]: "" + t.id++
};
i && zi(e + (n + 1) + "-", t, i, a.children = []), r.push(a);
}
return r;
}
function Wg(e) {
return [
{
type: "ConfigItem",
col: { show: !0 },
name: "labelConfig",
style: "margin-bottom: 10px",
props: {
label: e("form.formItem")
},
children: [{
type: "HideConfig",
field: "formCreateNative",
_fc_important_prop: !1,
col: { show: !1 },
wrap: { show: !1 },
value: !1,
props: {
activeValue: !1,
inactiveValue: !0
}
}, {
type: "input",
field: "formCreateTitle",
title: e("form.title"),
_fc_license: "KrrSN2KlZ2tanmqEGlAE",
_fc_important_prop: !1,
col: { show: !1 },
slot: "append"
}, {
type: "select",
field: "formCreateWrap>class",
title: e("form.labelPosition"),
_fc_important_prop: !1,
col: { show: !1 },
slot: "append",
options: gt(e, [
{ value: "fc-wrap-top", label: "top" },
{ value: "fc-wrap-left", label: "left" },
{ value: "fc-wrap-right", label: "right" }
])
}, {
type: "SizeInput",
field: "formCreateWrap>labelWidth",
_fc_important_prop: !1,
col: { show: !1 },
value: "",
slot: "append",
title: e("form.labelWidth")
}, {
type: "SizeInput",
field: "formCreateWrap>style>marginBottom",
_fc_important_prop: !1,
col: { show: !1 },
value: "",
slot: "append",
title: e("form.formItemMarginBottom")
}]
}
];
}
function Qr(e, t, i, r) {
const n = [
{ label: e("fetch.optionsType.struct"), value: 2 },
{ label: e("fetch.optionsType.fetch"), value: 3 },
{ label: e("fetch.optionsType.global"), value: 1 }
], a = [
{
value: 1,
rule: [
{
type: "GlobalFetchSelect",
field: "formCreateEffect>fetch",
props: {
to: t
}
}
]
},
{
value: 3,
rule: [
{
type: "FetchConfig",
field: "formCreateEffect>fetch",
props: {
to: t
}
}
]
},
{
value: 2,
rule: [
{
type: "TableOptions",
field: "formCreate" + Uo(t).replace(".", ">"),
title: e("props.options"),
_fc_important_prop: !0,
wrap: { show: !1 },
props: {
column: [{ label: "label", key: i || "label" }, { value: !0, label: "value", key: r || "value" }],
keyValue: i || "label"
}
}
]
}
];
return {
type: "radio",
title: e("props.options"),
field: "_optionType",
value: 2,
options: n,
props: {
type: "button"
},
control: a
};
}
function Si(e, t, i) {
const r = [
{ label: e("fetch.optionsType.struct"), value: 2 },
{ label: e("fetch.optionsType.fetch"), value: 3 },
{ label: e("fetch.optionsType.global"), value: 1 }
], n = [
{
value: 1,
rule: [
{
type: "GlobalFetchSelect",
field: "formCreateEffect>fetch",
props: {
to: t
}
}
]
},
{
value: 3,
rule: [
{
type: "FetchConfig",
field: "formCreateEffect>fetch",
props: {
to: t
}
}
]
},
{
value: 2,
rule: [
{
type: "Struct",
field: "formCreate" + Uo(t).replace(".", ">"),
title: i || e("props.options"),
_fc_important_prop: !0,
wrap: { show: !1 }
}
]
}
];
return {
type: "radio",
title: i || e("props.options"),
field: "_optionType",
value: 2,
options: r,
props: {
type: "button"
},
control: n
};
}
function il(e, t, i, r) {
const n = [
{ label: e("fetch.optionsType.struct"), value: 2 },
{ label: e("fetch.optionsType.fetch"), value: 3 },
{ label: e("fetch.optionsType.global"), value: 1 }
], a = [
{
value: 1,
rule: [
{
type: "GlobalFetchSelect",
field: "formCreateEffect>fetch",
props: {
to: t
}
}
]
},
{
value: 3,
rule: [
{
type: "FetchConfig",
field: "formCreateEffect>fetch",
props: {
to: t
}
}
]
},
{
value: 2,
rule: [
{
type: "TreeOptions",
field: "formCreate" + Uo(t).replace(".", ">"),
title: e("props.options"),
_fc_important_prop: !0,
wrap: { show: !1 },
props: {
columns: {
label: i,
value: r
},
keyValue: i
}
}
]
}
];
return {
type: "radio",
title: e("props.options"),
field: "_optionType",
value: 2,
options: n,
props: {
type: "button"
},
control: a
};
}
function Uo(e) {
return e.replace(e[0], e[0].toLocaleUpperCase());
}
const ai = function(e) {
const t = /object ([a-zA-Z]*)/.exec(Object.prototype.toString.call(e));
return t && Lm[t[1].toLowerCase()] ? Lm[t[1].toLowerCase()](e) : e;
}, Lm = {
object: function(e) {
var t = [];
for (var i in e)
!Li(e, i) || t.push(
ai(i) + ": " + (e[i] != null ? ai(e[i]) : "null")
);
return `{
` + t.join(`,
`) + `
}`;
},
function: function(e) {
e = "" + e;
var t = /^ *([\w]+) *\(/.exec(e);
return t && t[1] !== "function" ? "function " + e : e;
},
array: function(e) {
for (var t = 0, i = []; t < e.length; t++)
i[t] = e[t] != null ? ai(e[t]) : "null";
return "[" + i.join(", ") + "]";
},
string: function(e) {
for (var t = e.split(""), i = 0; i < t.length; i++) {
var r = t[i];
r >= " " ? r === "\\" ? t[i] = "\\\\" : r === '"' && (t[i] = '\\"') : t[i] = r === `
` ? "\\n" : r === "\r" ? "\\r" : r === " " ? "\\t" : r === "\b" ? "\\b" : r === "\f" ? "\\f" : (r = r.charCodeAt(), "\\u00" + (r > 15 ? 1 : 0) + r % 16);
}
return '"' + t.join("") + '"';
}
}, Gg = function(e) {
if (e && typeof e == "object") {
for (let t in e)
if (Object.prototype.hasOwnProperty.call(e, t)) {
let i = e[t];
(Array.isArray(i) || St.Object(i)) && Gg(i), St.String(i) && (e[t] = jo(i));
}
}
return e;
};
function zo(e, t, i) {
t = (t || "").split(".");
let r = 0, n = t.length;
for (; e != null && r < n; )
e = e[t[r++]];
return r && r === n && e !== void 0 ? e : i;
}
const I_ = (e) => (t, i) => F_(t, i, Ug(e)), F_ = (e, t, i) => zo(i, e, "").replace(
/\{(\w+)\}/g,
(r, n) => {
var a;
return `${(a = t == null ? void 0 : t[n]) != null ? a : `{${n}}`}`;
}
), M_ = (e) => {
const t = _n(() => Ug(e).name), i = _n(() => Uo(Sc(t.value || ""))), r = jg(e) ? e : $s(e);
return {
lang: t,
name: i,
locale: r,
t: I_(e)
};
}, Zf = (e) => M_(_n(() => (jg(e) ? e.value : e) || zg)), gt = (e, t, i) => t.map((r) => (r.label = e((i || "props") + "." + (r.label || r.value)) || r.label, r)), Ke = (e, t, i) => i.map((r) => (r.field === "formCreate$required" ? r.title = e("validate.required") || r.title : r.field && r.field !== "_optionType" && (r.title = e("com." + t + "." + r.field) || r.title), r.type === "template" && St.trueArray(r.children) && (r.children = Ke(e, t, r.children)), r)), qf = (e) => {
const t = [];
return e && e.forEach((i) => {
if (!i._fc_drag_skip)
if (i._fc_drag_tag) {
const r = {
id: i.__fc__.id,
rule: i,
children: qf(i.children)
};
r.children.length || delete r.children, t.push(r);
} else
t.push(...qf(i.children));
}), t;
}, Nm = (e) => {
const t = (i) => {
const r = [];
return i && i.forEach((n) => {
n._fc_drag_skip || (n.field ? (n.children = t(n.children || []), n.children.length || delete n.children, r.push(n)) : r.push(...t(n.children || [])));
}), r;
};
return t(e);
}, Bm = (e) => {
const t = (i) => {
const r = [];
return i && i.forEach((n) => {
if (typeof n == "object")
if (n._fc_drag_tag) {
const a = {
_fc_id: n._fc_id,
_fc_drag_tag: n._fc_drag_tag === "_" ? void 0 : n._fc_drag_tag,
type: n.type,
field: n.field,
title: n.title,
name: n.name,
slot: n.slot,
props: { ...n.props || {} },
children: t(n.children || [])
};
n.children && typeof n.children[0] == "string" && (a.content = n.children[0]), a.children.length || delete a.children, r.push(a);
} else
r.push(...t(n.children));
}), r;
};
return t(e);
};
function In(e) {
return {
name: "$inject",
columns: [
{ label: "$inject.api", info: e("event.inject.api"), type: "Api" },
{ label: "$inject.rule", info: e("event.inject.rule"), type: "Rule[]" },
{ label: "$inject.self", info: e("event.inject.self"), type: "Rule" },
{ label: "$inject.option", info: e("event.inject.option"), type: "Object" },
{ label: "$inject.args", info: e("event.inject.args"), type: "Array" }
]
};
}
function Ni(e) {
return ["", null, void 0].indexOf(e) !== -1;
}
function Kg(e) {
return e.replace(/[\ .*+?^${}()|[\]\\]/g, "\\$&");
}
function P_(e, t) {
const i = e.split("."), r = t.split("."), n = Math.min(i.length, r.length);
for (var a = 0; a < n; a++) {
var s = parseInt(i[a], 10) - parseInt(r[a], 10);
if (s > 0)
return 1;
if (s < 0)
return -1;
}
return i.length === r.length ? 0 : i.length < r.length ? -1 : 1;
}
function er(e) {
const t = document.createElement("textarea");
t.style.position = "fixed", t.style.top = 0, t.style.left = "-9999px", t.value = e, document.body.appendChild(t), t.focus(), t.select();
try {
document.execCommand("copy");
} catch {
console.log("Oops, unable to copy");
}
Ec("\u5DF2\u590D\u5236!", "success"), document.body.removeChild(t);
}
function Ms(e) {
return e.filter((t, i) => e.indexOf(t) === i);
}
let L_ = 0;
function rt() {
const e = 370 + ++L_;
return "F" + Math.random().toString(36).substr(3, 3) + Number(`${Date.now()}`).toString(36) + e.toString(36) + "c";
}
function N_(e, t) {
return function(i, r, n) {
const a = { ...i || {} };
Object.keys(a).forEach((s) => {
Ni(a[s]) && delete a[s];
}), n.getRule(e).props.info = Object.keys(a).length > 0 ? t("struct.configured") : "";
};
}
function Vm({ t: e }) {
const t = rt();
return [
{
type: "input",
field: ">formName",
value: "",
title: e("form.formName")
},
{
type: "radio",
field: "labelPosition",
value: "left",
title: e("form.labelPosition"),
options: gt(e, [
{ value: "left", label: "left" },
{ value: "right", label: "right" },
{ value: "top", label: "top" }
])
},
{
type: "input",
field: ">tableName",
value: "",
title: e("form.tableName")
},
{
type: "radio",
field: "size",
value: "small",
title: e("form.size"),
options: gt(e, [
{ value: "large", label: "large" },
{ value: "default", label: "default" },
{ value: "small", label: "small" }
])
},
{
type: "input",
field: "labelSuffix",
value: "",
title: e("form.labelSuffix"),
style: {
width: "150px"
}
},
{
type: "SizeInput",
field: "labelWidth",
value: "125px",
title: e("form.labelWidth")
},
{
type: "SizeInput",
field: "wrap>style>marginBottom",
value: "",
title: e("form.formItemMarginBottom")
},
{
type: "switch",
field: "hideRequiredAsterisk",
value: !1,
title: e("form.hideRequiredAsterisk")
},
{
type: "switch",
field: "showMessage",
value: !0,
title: e("form.showMessage")
},
{
type: "switch",
field: "inlineMessage",
value: !1,
title: e("form.inlineMessage")
},
{
type: "switch",
field: "_submitBtn>show",
value: !0,
title: e("form.submitBtn")
},
{
type: "switch",
field: "_resetBtn>show",
value: !1,
title: e("form.resetBtn")
},
{
type: "switch",
field: ">ignoreHiddenFields",
value: !1,
title: e("form.ignoreHiddenFields"),
warning: e("warning.ignoreHiddenFields")
},
{
type: "ConfigItem",
col: { show: !0 },
name: t,
style: "margin-bottom: 10px",
props: {
label: e("form.labelStyle"),
info: ""
},
children: [{
type: "StyleConfig",
field: "title>style",
wrap: { show: !1 },
value: {},
slot: "append",
update: N_(t, e)
}]
},
{
type: "FnConfig",
field: ">_event",
value: {},
col: { show: !0 },
props: {
eventConfig: [
{
name: "onSubmit",
info: e("form.onSubmit"),
args: ["formData", "api"]
},
{
name: "onReset",
info: e("form.onReset"),
args: ["api"]
},
{
name: "onCreated",
info: e("form.onCreated"),
args: ["api"]
},
{
name: "onMounted",
info: e("form.onMounted"),
args: ["api"]
},
{
name: "onReload",
info: e("form.onReload"),
args: ["api"]
},
{
name: "onChange",
info: e("form.onChange"),
args: ["field", "value", "options"]
},
{
name: "beforeSubmit",
info: e("form.beforeSubmit"),
args: ["formData", "data"]
},
{
name: "beforeFetch",
info: e("form.beforeFetch"),
args: ["config", "data"]
}
]
},
title: e("form.event")
}
];
}
function $a({ t: e }) {
return [
{
type: "ConfigItem",
col: { show: !0 },
style: "margin-bottom: 10px",
name: "iskey",
props: {
label: e("form.iskey"),
warning: e("warning.iskey")
},
children: [{
type: "switch",
field: "iskey",
value: !1,
wrap: { show: !1 },
col: { show: !1 }
}]
},
{
type: "FieldInput",
field: "field",
value: "",
title: e("form.field"),
warning: e("warning.field")
},
{
type: "LanguageInput",
field: "title",
value: "",
title: e("form.title")
},
{
type: "Input",
field: "fieldtype",
value: "",
title: e("form.fieldtype")
},
{
type: "LanguageInput",
field: "info",
value: "",
title: e("form.info")
},
{
type: "SpanInput",
field: "formCreateCol>span",
title: e("form.formItemSpan")
},
{
type: "ConfigItem",
col: { show: !0 },
style: "margin-bottom: 10px",
name: "ignoreConfig",
props: {
label: e("form.ignore"),
warning: e("warning.ignore")
},
children: [{
type: "switch",
field: "ignore",
value: !1,
wrap: { show: !1 },
col: { show: !1 }
}]
},
{
type: "ConfigItem",
col: { show: !0 },
name: "labelConfig",
style: "margin-bottom: 10px",
props: {
label: e("form.formItem")
},
children: [
{
type: "HideConfig",
field: "formCreateWrap>title",
col: { show: !1 },
wrap: { show: !1 },
value: !0
},
{
type: "select",
field: "formCreateWrap>class",
title: e("form.labelPosition"),
col: { show: !1 },
slot: "append",
options: gt(e, [
{ value: "fc-wrap-top", label: "top" },
{ value: "fc-wrap-left", label: "left" },
{ value: "fc-wrap-right", label: "right" }
])
},
{
type: "SizeInput",
field: "formCreateWrap>labelWidth",
col: { show: !1 },
value: "",
slot: "append",
title: e("form.labelWidth")
},
{
type: "SizeInput",
field: "formCreateWrap>style>marginBottom",
col: { show: !1 },
value: "",
slot: "append",
title: e("form.formItemMarginBottom")
}
]
},
{
type: "Struct",
field: "_control",
name: "control",
value: [],
title: e("form.control"),
warning: e("form.controlDocument", { doc: '<a target="_blank" href="https://pro.form-create.com/doc/control" style="color: inherit;text-decoration: underline;">' + e("form.document") + "</a>" }),
props: {
defaultValue: [],
validate(t) {
return Array.isArray(t) ? t.length ? !t.some(({ rule: i }) => !Array.isArray(i)) : !0 : !1;
}
}
}
];
}
function jm({ t: e }) {
return [
{
type: "input",
title: "ID",
field: "id",
wrap: {
labelWidth: "45px"
}
},
{
type: "GlobalClassSelect",
title: "Class",
field: "class",
wrap: {
labelWidth: "45px"
}
},
{
type: "StyleConfig",
field: "style",
title: "",
value: {}
}
];
}
function Um({ t: e }) {
return [
{
type: "ComputedConfig",
field: "value",
value: "",
props: {
type: "linkage",
btn: e("computed.value.btn"),
title: e("computed.value.title"),
name: e("computed.value.name")
},
title: e("computed.value.title")
},
{
type: "ComputedConfig",
field: "hidden",
value: "",
props: {
btn: e("computed.hidden.btn"),
title: e("computed.hidden.title"),
name: e("computed.hidden.name"),
invertLabel: e("props.show"),
validLabel: e("props.hide")
},
title: e("computed.hidden.title")
},
{
type: "ComputedConfig",
field: "$required",
value: "",
props: {
btn: e("computed.required.btn"),
title: e("computed.required.title"),
name: e("computed.required.name"),
invertLabel: e("validate.modes.notRequired"),
validLabel: e("validate.modes.required")
},
title: e("computed.required.title")
},
{
type: "ComputedConfig",
field: "props.disabled",
value: "",
props: {
btn: e("computed.disabled.btn"),
title: e("computed.disabled.title"),
name: e("computed.disabled.name"),
invertLabel: e("props.enable"),
validLabel: e("props.disabled")
},
title: e("computed.disabled.title")
}
];
}
function zm({ t: e }) {
return [
{
type: "Required",
field: "$required",
title: e("validate.required")
},
{
type: "validate",
field: "validate",
title: e("validate.rule"),
value: []
}
];
}
function B_(e) {
e = e || /* @__PURE__ */ new Map();
const t = {
$on(i, r) {
const n = e.get(i);
n && n.push(r) || e.set(i, [r]);
},
$once(i, r) {
r._once = !0, t.$on(i, r);
},
$off(i, r) {
const n = e.get(i);
n && n.splice(n.indexOf(r) >>> 0, 1);
},
$emit(i, ...r) {
(e.get(i) || []).slice().map((n) => {
n._once && (t.$off(i, n), delete n._once), n(...r);
}), (e.get("*") || []).slice().map((n) => {
n(i, r);
});
}
};
return t;
}
const V_ = "\u5355\u9009\u6846", _d = "radio", j_ = {
menu: "main",
icon: "icon-radio",
label: V_,
name: _d,
input: !0,
event: ["change"],
validate: ["string", "number"],
condition: {
type: "select",
options: "options"
},
sfc(e) {
e.type = "elRadioGroup", e.children = (e.options || []).map((t) => ({
type: e.props.type === "button" ? "elRadioButton" : "elRadio",
props: {
label: t.value,
value: t.value
},
_sfc: {
content: t.label
}
})), delete e.props.type;
},
rule({ t: e }) {
return {
type: _d,
field: rt(),
title: e("com.radio.name"),
info: "",
effect: {
fetch: ""
},
$required: !1,
props: {},
options: zi(e("props.option"), { label: "label", value: "value" }, 1)
};
},
props(e, { t }) {
return Ke(t, _d + ".props", [
Qr(t, "options"),
{ type: "switch", field: "disabled" },
{ type: "switch", field: "input" },
{
type: "switch",
field: "type",
props: { activeValue: "button", inactiveValue: "default" }
},
{ type: "ColorInput", field: "textColor" },
{
type: "ColorInput",
field: "fill"
}
]);
}
}, U_ = "\u591A\u9009\u6846", wd = "checkbox", z_ = {
menu: "main",
icon: "icon-checkbox",
label: U_,
name: wd,
input: !0,
event: ["change"],
validate: ["array"],
condition: {
type: "select",
options: "options"
},
sfc(e) {
e.type = "elCheckboxGroup", e.children = (e.options || []).map((t) => ({
type: e.props.type === "button" ? "elCheckboxButton" : "elCheckbox",
props: {
label: t.value,
value: t.value
},
_sfc: {
content: t.label
}
})), delete e.props.type;
},
rule({ t: e }) {
return {
type: wd,
field: rt(),
title: e("com.checkbox.name"),
info: "",
effect: {
fetch: ""
},
$required: !1,
props: {},
options: zi(e("props.option"), { label: "label", value: "value" }, 1)
};
},
props(e, { t }) {
return Ke(t, wd + ".props", [
Qr(t, "options"),
{
type: "switch",
field: "disabled"
},
{ type: "switch", field: "input" },
{
type: "switch",
field: "type",
props: { activeValue: "button", inactiveValue: "default" }
},
{
field: "min",
type: "inputNumber",
props: {
min: 0
}
},
{
field: "max",
type: "inputNumber",
props: {
min: 0
}
},
{
type: "ColorInput",
field: "textColor"
},
{
type: "ColorInput",
field: "fill"
}
]);
}
}, H_ = "\u8F93\u5165\u6846", Ad = "input", W_ = {
menu: "main",
icon: "icon-input",
label: H_,
name: Ad,
input: !0,
easySlots: ["prefix", "suffix", "prepend", "append"],
event: ["blur", "focus", "change", "input", "clear"],
validate: ["string", "url", "email"],
rule({ t: e }) {
return {
type: Ad,
field: rt(),
title: e("com.input.name"),
info: "",
$required: !1,
props: {}
};
},
props(e, { t }) {
return Ke(t, Ad + ".props", [
{
type: "switch",
field: "disabled"
},
{
type: "switch",
field: "readonly"
},
{
type: "select",
field: "type",
options: gt(t, [
{ label: "text", value: "text" },
{ label: "number", value: "number" },
{ label: "time", value: "time" },
{ label: "date", value: "date" },
{ label: "month", value: "month" },
{ label: "datetime-local", value: "datetime-local" }
])
},
{
type: "inputNumber",
field: "maxlength",
props: { min: 0 }
},
{
type: "input",
field: "placeholder"
},
{
type: "switch",
field: "clearable"
}
]);
}
}, G_ = "\u591A\u884C\u8F93\u5165\u6846", Hm = "textarea", K_ = {
menu: "main",
icon: "icon-textarea",
label: G_,
name: Hm,
input: !0,
event: ["blur", "focus", "change", "input"],
validate: ["string"],
rule({ t: e }) {
return {
type: "input",
field: rt(),
title: e("com.textarea.name"),
info: "",
$required: !1,
props: {
type: "textarea"
}
};
},
props(e, { t }) {
return Ke(t, Hm + ".props", [
{
type: "switch",
field: "disabled"
},
{
type: "switch",
field: "readonly"
},
{
type: "inputNumber",
field: "maxlength",
props: { min: 0 }
},
{
type: "switch",
field: "showWordLimit"
},
{
type: "input",
field: "placeholder"
},
{
type: "inputNumber",
field: "rows",
props: {
min: 0
}
},
{
type: "switch",
field: "autosize"
}
]);
}
}, Y_ = "\u5BC6\u7801\u8F93\u5165\u6846", Wm = "password", Q_ = {
menu: "main",
icon: "icon-password",
label: Y_,
name: Wm,
input: !0,
easySlots: ["prefix", "suffix", "prepend", "append"],
event: ["blur", "focus", "change", "input", "clear"],
validate: ["string"],
rule({ t: e }) {
return {
type: "input",
field: rt(),
title: e("com.password.name"),
info: "",
$required: !1,
props: {
type: "password"
}
};
},
props(e, { t }) {
return Ke(t, Wm + ".props", [
{
type: "switch",
field: "disabled"
},
{
type: "switch",
field: "readonly"
},
{
type: "inputNumber",
field: "maxlength",
props: { min: 0 }
},
{
type: "input",
field: "placeholder"
},
{
type: "switch",
field: "clearable"
}
]);
}
}, J_ = "\u8BA1\u6570\u5668", Cd = "inputNumber", X_ = {
menu: "main",
icon: "icon-number",
label: J_,
name: Cd,
input: !0,
easySlots: ["prefix", "suffix"],
event: ["blur", "focus", "change"],
validate: ["number", "integer", "float"],
condition: "number",
rule({ t: e }) {
return {
type: Cd,
field: rt(),
title: e("com.inputNumber.name"),
info: "",
$required: !1,
props: {}
};
},
props(e, { t }) {
return Ke(t, Cd + ".props", [{ type: "switch", field: "disabled" }, {
type: "inputNumber",
field: "min"
}, {
type: "inputNumber",
field: "max"
}, {
type: "inputNumber",
title: "precision",
field: "precision"
}, { type: "inputNumber", field: "step", props: { min: 0 } }, {
type: "switch",
field: "stepStrictly"
}, {
type: "switch",
field: "controls",
value: !0
}, {
type: "select",
field: "controlsPosition",
options: gt(t, [{ label: "default", value: "" }, { label: "right", value: "right" }])
}, { type: "input", field: "placeholder" }]);
}
}, Z_ = "\u9009\u62E9\u5668", Sd = "select", q_ = {
menu: "main",
icon: "icon-select",
label: Z_,
name: Sd,
input: !0,
event: ["change", "visibleChange", "removeTag", "clear", "blur", "focus"],
validate: ["string", "number", "array"],
condition: {
type: "select",
options: "options"
},
sfc(e) {
e.type = "elSelect", e.children = (e.options || []).map((t) => ({
type: "elOption",
props: {
label: t.label,
value: t.value
}
}));
},
rule({ t: e }) {
return {
type: Sd,
field: rt(),
title: e("com.select.name"),
info: "",
effect: {
fetch: ""
},
$required: !1,
props: {},
options: zi(e("props.option"), { label: "label", value: "value" }, 1)
};
},
watch: {
multiple({ rule: e }) {
e.key = rt();
}
},
props(e, { t }) {
return Ke(t, Sd + ".props", [
Qr(t, "options"),
{ type: "switch", field: "multiple" },
{
type: "switch",
field: "disabled"
},
{ type: "switch", field: "clearable" },
{
type: "switch",
field: "collapseTags"
},
{
type: "inputNumber",
field: "multipleLimit",
props: { min: 0 }
},
{ type: "input", field: "placeholder" },
{
type: "switch",
field: "filterable"
},
{
type: "switch",
field: "remote"
},
{
type: "FnInput",
field: "remoteMethod",
props: {
body: !0,
button: !0,
fnx: !0,
name: "remoteMethod",
args: [In(t)]
}
},
{ type: "switch", field: "allowCreate" },
{
type: "input",
field: "noMatchText"
},
{ type: "input", field: "noDataText" },
{
type: "switch",
field: "reserveKeyword"
},
{ type: "switch", field: "defaultFirstOption" }
]);
}
}, ew = "\u5F00\u5173", Ed = "switch", tw = {
menu: "main",
icon: "icon-switch",
label: ew,
name: Ed,
input: !0,
easySlots: ["active-action", "inactive-action"],
event: ["change"],
condition: function(e) {
return {
type: "switch",
props: {
activeValue: e.props.activeValue,
inactiveValue: e.props.inactiveValue,
activeText: e.props.activeText,
inactiveText: e.props.inactiveText
}
};
},
rule({ t: e }) {
return {
type: Ed,
field: rt(),
title: e("com.switch.name"),
info: "",
$required: !1,
props: {
activeValue: !0,
inactiveValue: !1
}
};
},
props(e, { t }) {
return Ke(t, Ed + ".props", [{
type: "switch",
field: "disabled"
}, {
type: "inputNumber",
field: "width",
props: { min: 0 }
}, { type: "input", field: "activeText" }, {
type: "input",
field: "inactiveText"
}, { type: "ValueInput", field: "activeValue" }, {
type: "ValueInput",
field: "inactiveValue"
}, { type: "ColorInput", field: "activeColor" }, {
type: "ColorInput",
field: "inactiveColor"
}]);
}
}, nw = "\u6ED1\u5757", xd = "slider", iw = {
menu: "main",
icon: "icon-slider",
label: nw,
name: xd,
input: !0,
event: ["change", "input"],
validate: ["number", "array"],
condition: "number",
rule({ t: e }) {
return {
type: xd,
field: rt(),
title: e("com.slider.name"),
info: "",
$required: !1,
props: {}
};
},
props(e, { t }) {
return Ke(t, xd + ".props", [{ type: "switch", field: "disabled" }, {
type: "switch",
field: "range"
}, {
type: "inputNumber",
field: "min",
props: { min: 0 }
}, {
type: "inputNumber",
field: "max",
props: { min: 0 }
}, {
type: "inputNumber",
field: "step",
props: { min: 0 }
}, { type: "switch", field: "showInput" }, {
type: "switch",
field: "showInputControls",
value: !0
}, { type: "switch", field: "showStops" }, {
type: "switch",
field: "vertical"
}, {
type: "input",
field: "height"
}]);
}
}, rw = "\u65F6\u95F4", Ia = "timePicker", Yg = {
menu: "main",
icon: "icon-time",
label: rw,
name: Ia,
input: !0,
event: ["change", "blur", "focus", "visibleChange"],
sfc(e) {
e.props.valueFormat || (e.props.valueFormat = "HH:mm:ss");
},
rule({ t: e }) {
return {
type: Ia,
field: rt(),
title: e("com.timePicker.name"),
info: "",
$required: !1,
props: {}
};
},
watch: {
isRange({ rule: e }) {
e.key = rt();
},
__format({ value: e, rule: t }) {
t.props.format = e, t.props.valueFormat = e;
}
},
attrs: {
format({ rule: e }) {
return e.props.format || "";
}
},
props(e, { t }) {
return Ke(t, Ia + ".props", [{ type: "switch", field: "readonly" }, {
type: "switch",
field: "disabled"
}, {
type: "switch",
field: "isRange"
}, {
type: "switch",
field: "clearable",
value: !0
}, {
type: "select",
field: "__format",
options: [
{
label: t("com." + Ia + ".HH:mm:ss"),
value: "HH:mm:ss"
},
{
label: t("com." + Ia + ".HH:mm"),
value: "HH:mm"
}
]
}, {
type: "Struct",
field: "pickerOptions",
props: { defaultValue: {} }
}, { type: "switch", field: "editable", value: !0 }, {
type: "input",
field: "placeholder"
}, {
type: "input",
field: "startPlaceholder"
}, { type: "input", field: "endPlaceholder" }, {
type: "switch",
field: "arrowControl"
}, {
type: "select",
field: "align",
options: gt(t, [{ label: "left", value: "left" }, { label: "center", value: "center" }, {
label: "right",
value: "right"
}])
}]);
}
}, ow = "\u65F6\u95F4\u533A\u95F4", aw = "timeRange", lw = {
menu: "main",
icon: "icon-time-range",
label: ow,
name: aw,
input: !0,
event: ["change", "blur", "focus", "visibleChange"],
sfc: Yg.sfc,
rule({ t: e }) {
return {
type: "timePicker",
field: rt(),
title: e("com.timeRange.name"),
info: "",
$required: !1,
props: {
isRange: !0
}
};
},
watch: {
__format({ value: e, rule: t }) {
t.props.format = e, t.props.valueFormat = e;
}
},
attrs: {
format({ rule: e }) {
return e.props.format || "";
}
},
props(e, { t }) {
return Ke(t, "timePicker.props", [{ type: "switch", field: "readonly" }, {
type: "switch",
field: "disabled"
}, {
type: "switch",
field: "clearable",
value: !0
}, {
type: "select",
field: "__format",
options: [
{
label: t("com.timePicker.HH:mm:ss"),
value: "HH:mm:ss"
},
{
label: t("com.timePicker.HH:mm"),
value: "HH:mm"
}
]
}, {
type: "Struct",
field: "pickerOptions",
props: { defaultValue: {} }
}, { type: "switch", field: "editable", value: !0 }, {
type: "input",
field: "startPlaceholder"
}, { type: "input", field: "endPlaceholder" }, {
type: "switch",
field: "arrowControl"
}, {
type: "select",
field: "align",
options: gt(t, [{ label: "left", value: "left" }, { label: "center", value: "center" }, {
label: "right",
value: "right"
}])
}]);
}
}, sw = "\u65E5\u671F", Td = "datePicker", Gm = {
date: "YYYY-MM-DD",
month: "YYYY-MM",
datetime: "YYYY-MM-DD HH:mm:ss",
timerange: "HH:mm:ss",
daterange: "YYYY-MM-DD",
monthrange: "YYYY-MM",
datetimerange: "YYYY-MM-DD HH:mm:ss",
year: "YYYY"
}, Qg = {
menu: "main",
icon: "icon-date",
label: sw,
name: Td,
input: !0,
event: ["change", "blur", "focus", "calendarChange", "panelChange", "visibleChange"],
sfc(e) {
e.props.valueFormat || (e.props.valueFormat = Gm[e.props.type] || Gm.date);
},
rule({ t: e }) {
return {
type: Td,
field: rt(),
title: e("com.datePicker.name"),
info: "",
$required: !1,
props: {}
};
},
props(e, { t }) {
return Ke(t, Td + ".props", [{ type: "switch", field: "readonly" }, {
type: "switch",
field: "disabled"
}, {
type: "select",
field: "type",
options: gt(t, [{ label: "year", value: "year" }, { label: "month", value: "month" }, {
label: "date",
value: "date"
}, { label: "dates", value: "dates" }, { label: "week", value: "week" }, {
label: "datetime",
value: "datetime"
}, { label: "datetimerange", value: "datetimerange" }, {
label: "daterange",
value: "daterange"
}, { label: "monthrange", value: "monthrange" }])
}, {
type: "switch",
field: "clearable",
value: !0
}, {
type: "Struct",
field: "pickerOptions",
props: { defaultValue: {} }
}, { type: "switch", field: "editable", value: !0 }, {
type: "input",
field: "placeholder"
}, {
type: "input",
field: "startPlaceholder"
}, { type: "input", field: "endPlaceholder" }, {
type: "input",
field: "format"
}, {
type: "select",
field: "align",
options: gt(t, [{ label: "left", value: "left" }, { label: "center", value: "center" }, {
label: "right",
value: "right"
}])
}, { type: "input", field: "rangeSeparator" }, {
type: "switch",
field: "unlinkPanels"
}]);
}
}, uw = "\u65E5\u671F\u533A\u95F4", dw = "dateRange", fw = {
menu: "main",
icon: "icon-date-range",
label: uw,
name: dw,
input: !0,
event: ["change", "blur", "focus", "calendarChange", "panelChange", "visibleChange"],
sfc: Qg.sfc,
rule({ t: e }) {
return {
type: "datePicker",
field: rt(),
title: e("com.dateRange.name"),
info: "",
$required: !1,
props: {
type: "datetimerange"
}
};
},
props(e, { t }) {
return Ke(t, "datePicker.props", [{ type: "switch", field: "readonly" }, {
type: "switch",
field: "disabled"
}, {
type: "select",
field: "type",
options: gt(t, [
{ label: "datetimerange", value: "datetimerange" },
{ label: "daterange", value: "daterange" },
{ label: "monthrange", value: "monthrange" }
])
}, {
type: "switch",
field: "clearable",
value: !0
}, {
type: "Struct",
field: "pickerOptions",
props: { defaultValue: {} }
}, { type: "switch", field: "editable", value: !0 }, {
type: "input",
field: "startPlaceholder"
}, { type: "input", field: "endPlaceholder" }, {
type: "input",
field: "format"
}, {
type: "select",
field: "align",
options: gt(t, [{ label: "left", value: "left" }, { label: "center", value: "center" }, {
label: "right",
value: "right"
}])
}, { type: "input", field: "rangeSeparator" }, {
type: "switch",
field: "unlinkPanels"
}]);
}
}, cw = "\u8BC4\u5206", kd = "rate", pw = {
menu: "main",
icon: "icon-rate",
label: cw,
name: kd,
input: !0,
event: ["change"],
validate: ["number"],
condition: "number",
rule({ t: e }) {
return {
type: kd,
field: rt(),
title: e("com.rate.name"),
info: "",
$required: !1,
props: {}
};
},
props(e, { t }) {
return Ke(t, kd + ".props", [
{ type: "inputNumber", field: "max", props: { min: 0 } },
{
type: "switch",
field: "disabled"
},
{ type: "switch", field: "allowHalf" },
{
type: "ColorInput",
field: "voidColor"
},
{ type: "ColorInput", field: "disabledVoidColor" },
{
type: "input",
field: "voidIconClass"
},
{ type: "input", field: "disabledVoidIconClass" },
{
type: "switch",
field: "showScore"
},
{ type: "ColorInput", field: "textColor" },
{
type: "input",
field: "scoreTemplate"
}
]);
}
}, hw = "\u989C\u8272\u9009\u62E9\u5668", Od = "colorPicker", mw = {
menu: "main",
icon: "icon-color",
label: hw,
name: Od,
input: !0,
event: ["change", "activeChange", "focus", "blur"],
validate: ["string"],
condition: "color",
rule({ t: e }) {
return {
type: Od,
field: rt(),
title: e("com.colorPicker.name"),
info: "",
$required: !1,
props: {
predefine: [
"#c9e6fc",
"#c3f2f2",
"#c2f1d2",
"#fef6c6",
"#ffe5c2",
"#fdcac2",
"#fadcce",
"#dec2fa",
"#ccd2f1",
"#2196f3",
"#08c9c9",
"#00c344",
"#fad714",
"#ff9300",
"#f52222",
"#eb2f96",
"#800080",
"#7500ea",
"#2d46c4",
"#000000",
"#333333",
"#5a5a5a",
"#757575",
"#9e9e9e",
"#bdbdbd",
"#dddddd",
"#f5f5f5",
"#ffffff"
]
}
};
},
props(e, { t }) {
return Ke(t, Od + ".props", [
{
type: "switch",
field: "disabled"
},
{
type: "switch",
field: "showAlpha"
},
{
type: "select",
field: "colorFormat",
options: [{ label: "hsl", value: "hsl" }, { label: "hsv", value: "hsv" }, {
label: "hex",
value: "hex"
}, { label: "rgb", value: "rgb" }]
},
{
type: "tableOptions",
field: "predefine",
props: {
column: [{ label: t("props.value"), key: "value" }],
valueType: "string"
}
}
]);
}
}, vw = "\u6805\u683C\u5E03\u5C40", Rd = "fcRow", gw = {
menu: "layout",
icon: "icon-row",
label: vw,
name: Rd,
mask: !1,
children: "col",
childrenLen: 2,
subRender({ t: e, h: t, resolveComponent: i, subRule: r }) {
return [
{
label: e("style.width"),
vnode: t(i("el-slider"), {
size: "small",
min: 0,
max: 24,
modelValue: r.props.span,
"onUpdate:modelValue": (n) => {
r.props.span = n;
}
})
}
];
},
sfc(e) {
e.type = "elRow";
},
rule() {
return {
type: Rd,
props: {},
children: []
};
},
props(e, { t }) {
return Ke(t, Rd + ".props", [{
type: "inputNumber",
field: "gutter",
props: { min: 0 }
}, {
type: "switch",
field: "type",
props: { activeValue: "flex", inactiveValue: "default" }
}, {
type: "select",
field: "justify",
options: [{ label: "start", value: "start" }, { label: "end", value: "end" }, {
label: "center",
value: "center"
}, { label: "space-around", value: "space-around" }, { label: "space-between", value: "space-between" }]
}, {
type: "select",
field: "align",
options: [{ label: "top", value: "top" }, { label: "middle", value: "middle" }, {
label: "bottom",
value: "bottom"
}]
}]);
}
}, Dd = "col", Km = {
xs: "<768px",
sm: "\u2265768px",
md: "\u2265992px",
lg: "\u22651200px",
xl: "\u22651920px"
}, yw = {
name: Dd,
label: "\u683C\u5B50",
drag: !0,
dragBtn: !1,
inside: !0,
mask: !1,
rule() {
return {
type: Dd,
props: { span: 12 },
children: []
};
},
props(e, { t }) {
return Ke(t, Dd + ".props", [
{ type: "slider", field: "span", value: 12, props: { min: 0, max: 24 } },
{ type: "slider", field: "offset", props: { min: 0, max: 24 } },
{ type: "slider", field: "push", props: { min: 0, max: 24 } },
{ type: "slider", field: "pull", props: { min: 0, max: 24 } },
{
type: "ConfigItem",
props: {
label: t("props.reactive"),
warning: t("com.col.info")
},
children: [
{
type: "elTabs",
style: {
width: "100%"
},
slot: "append",
children: Object.keys(Km).map((i) => ({
type: "elTabPane",
props: {
label: Km[i]
},
style: "padding:0 10px;",
children: [
{
type: "slider",
field: i + ">span",
title: t("com.col.props.span"),
value: 12,
props: { min: 0, max: 24 }
},
{
type: "slider",
field: i + ">offset",
title: t("com.col.props.offset"),
props: { min: 0, max: 24 }
},
{
type: "slider",
field: i + ">push",
title: t("com.col.props.push"),
props: { min: 0, max: 24 }
},
{
type: "slider",
field: i + ">pull",
title: t("com.col.props.pull"),
props: { min: 0, max: 24 }
}
]
}))
}
]
}
]);
}
}, bw = "\u9009\u9879\u5361", $d = "elTabPane", _w = {
label: bw,
name: $d,
inside: !0,
drag: !0,
dragBtn: !1,
mask: !1,
rule({ t: e }) {
return {
type: $d,
props: {
label: e("com.elTabPane.name")
},
children: []
};
},
props(e, { t }) {
return Ke(t, $d + ".props", [{ type: "input", field: "label" }, {
type: "switch",
field: "disabled"
}, { type: "input", field: "name" }, {
type: "switch",
field: "lazy"
}]);
}
}, ww = "\u5206\u5272\u7EBF", Id = "elDivider", Aw = {
menu: "aide",
icon: "icon-divider",
label: ww,
name: Id,
rule({ t: e }) {
return {
type: Id,
props: {},
children: [e("com.elDivider.name")]
};
},
props(e, { t }) {
return Ke(t, Id + ".props", [{
type: "select",
field: "direction",
options: gt(t, [{ label: "horizontal", value: "horizontal" }, { label: "vertical", value: "vertical" }])
}, {
type: "input",
field: "formCreateChild"
}, {
type: "select",
field: "contentPosition",
options: gt(t, [{ label: "left", value: "left" }, { label: "right", value: "right" }, {
label: "center",
value: "center"
}])
}]);
}
}, Cw = "\u7EA7\u8054\u9009\u62E9\u5668", Yl = "cascader", Sw = {
menu: "main",
icon: "icon-cascader",
label: Cw,
name: Yl,
input: !0,
event: ["change", "expandChange", "blur", "focus", "visibleChange", "removeTag"],
validate: ["string", "number", "array"],
condition(e) {
return {
type: "cascader",
options: "props.options",
props: {
props: e.props && e.props.props || {}
}
};
},
rule({ t: e }) {
return {
type: Yl,
field: rt(),
title: e("com.cascader.name"),
info: "",
effect: {
fetch: ""
},
$required: !1,
props: {
options: zi(e("props.option"), { label: "label", value: "value" }, 3)
}
};
},
props(e, { t }) {
return Ke(t, Yl + ".props", [
il(t, "props.options"),
{
type: "switch",
field: "disabled"
},
{
type: "switch",
field: "clearable"
},
{
type: "input",
field: "placeholder"
},
{
type: "Object",
field: "props",
props: {
rule: Ke(t, Yl + ".propsOpt", [{
type: "switch",
field: "multiple"
}, {
type: "select",
field: "expandTrigger",
options: gt(t, [{ label: "click", value: "click" }, {
label: "hover",
value: "hover"
}])
}, {
type: "switch",
field: "checkStrictly"
}, {
type: "switch",
field: "emitPath",
value: !0
}, {
type: "input",
field: "value",
value: "value"
}, {
type: "input",
field: "label",
value: "label"
}, {
type: "input",
field: "children",
value: "children"
}, {
type: "input",
field: "disabled",
value: "disabled"
}, { type: "input", field: "leaf" }])
}
},
{
type: "switch",
field: "showAllLevels",
value: !0
},
{
type: "switch",
field: "collapseTags"
},
{
type: "switch",
field: "collapseTagsTooltip"
},
{
type: "input",
field: "separator"
},
{
type: "switch",
field: "filterable"
},
{
type: "select",
field: "tagType",
options: [
{ label: "success", value: "success" },
{ label: "info", value: "info" },
{ label: "warning", value: "warning" },
{ label: "danger", value: "danger" }
]
}
]);
}
}, Ew = "\u4E0A\u4F20", Fd = "upload", xw = {
menu: "main",
icon: "icon-upload",
label: Ew,
name: Fd,
input: !0,
easySlots: [{ value: "tip", type: "text" }],
event: ["change", "remove", "preview", "error", "progress", "exceed"],
languageKey: ["clickToUpload"],
validate: ["array"],
sfc(e) {
e.type = "elUpload", e.props.listType || (e.props.listType = "picture-card"), e._sfc.modelField = "fileList";
},
rule({ t: e }) {
return {
type: Fd,
field: rt(),
title: e("com.upload.name"),
info: "",
$required: !1,
props: {
action: "/",
onSuccess: `$FNX:const res = $inject.args[0];
const file = $inject.args[1];
file.url = res.data.url;`
}
};
},
props(e, { t }) {
return Ke(t, Fd + ".props", [
{
type: "switch",
field: "disabled"
},
{
type: "select",
field: "listType",
options: gt(t, [{ label: "text", value: "text" }, {
label: "picture",
value: "picture"
}, {
label: "picture-card",
value: "picture-card"
}])
},
{ type: "switch", field: "multiple" },
{ type: "input", field: "name" },
{
type: "PromptInput",
field: "accept",
props: {
options: [
{
label: t("props.image"),
value: "image/*"
},
{
label: t("props.document"),
value: ".pdf,.doc,.docx,.xml,application/msword,application/vnd.openxmlformats-officedocument.wordprocessingml.document"
},
{
label: t("props.video"),
value: "video/*"
},
{
label: t("props.audio"),
value: "audio/*"
}
]
}
},
{
type: "input",
field: "action"
},
{
type: "FnInput",
field: "beforeUpload",
props: {
body: !0,
button: !0,
fnx: !0,
args: [In(t)],
name: "beforeUpload"
}
},
{
type: "FnInput",
field: "beforeRemove",
props: {
body: !0,
button: !0,
fnx: !0,
args: [In(t)],
name: "beforeRemove"
}
},
{
type: "FnInput",
field: "onSuccess",
warning: t("com.upload.info"),
props: {
body: !0,
button: !0,
fnx: !0,
args: [In(t)],
name: "onSuccess"
}
},
{
type: "TableOptions",
field: "headers",
props: {
column: [{ label: t("props.key"), key: "label" }, { label: t("props.value"), key: "value" }],
valueType: "object"
}
},
{
type: "TableOptions",
field: "data",
props: {
column: [{ label: t("props.key"), key: "label" }, { label: t("props.value"), key: "value" }],
valueType: "object"
}
},
{
type: "switch",
field: "withCredentials"
},
{
type: "switch",
field: "autoUpload",
value: !0
},
{
type: "inputNumber",
field: "limit",
props: { min: 0 }
}
]);
}
}, Tw = "\u7A7F\u68AD\u6846", Md = "elTransfer", kw = {
menu: "main",
icon: "icon-transfer",
label: Tw,
name: Md,
input: !0,
event: ["change", "leftCheckChange", "rightCheckChange"],
validate: ["array"],
condition: function(e) {
return {
type: "select",
options: e.props.data ? e.props.data.map((t) => ({
label: t.label,
value: t.key
})) : []
};
},
rule({ t: e }) {
return {
type: Md,
field: rt(),
title: e("com.elTransfer.name"),
info: "",
$required: !1,
props: {
data: zi(e("props.option"), { label: "label", value: "key" }, 1)
}
};
},
props(e, { t }) {
return Ke(t, Md + ".props", [
Qr(t, "props.data", "label", "key"),
{ type: "switch", field: "filterable" },
{
type: "input",
field: "filterPlaceholder"
},
{
type: "select",
field: "targetOrder",
warning: t("com.elTransfer.props.targetOrderInfo"),
options: [{ label: "original", value: "original" }, {
label: "push",
value: "push"
}, { label: "unshift", value: "unshift" }]
},
{
type: "TableOptions",
field: "titles",
props: {
column: [{ label: t("props.value"), key: "value" }],
valueType: "string",
max: 2
}
},
{
type: "TableOptions",
field: "buttonTexts",
props: {
column: [{ label: t("props.value"), key: "value" }],
valueType: "string",
max: 2
}
}
]);
}
}, Ow = "\u6811\u5F62\u63A7\u4EF6", Pd = "tree", Rw = {
menu: "main",
icon: "icon-tree",
label: Ow,
name: Pd,
input: !0,
event: ["nodeClick", "nodeContextmenu", "checkChange", "check", "currentChange", "nodeExpand", "nodeCollapse", "nodeDragStart", "nodeDragEnter", "nodeDragLeave", "nodeDragOver", "nodeDragEnd", "nodeDrop"],
validate: ["string", "number", "array"],
condition: function(e) {
return {
type: "cascader",
options: e.props.data || [],
props: {
props: {
checkStrictly: !0,
emitPath: !1,
value: "id"
}
}
};
},
sfc(e) {
e.type = "elTree", e._sfc.modelField = "defaultCheckedKeys";
},
rule({ t: e }) {
return {
type: Pd,
field: rt(),
title: e("com.tree.name"),
info: "",
effect: {
fetch: ""
},
$required: !1,
props: {
props: {
label: "label"
},
showCheckbox: !0,
nodeKey: "id",
data: zi(e("props.option"), { label: "label", value: "id" }, 3)
}
};
},
props(e, { t }) {
return Ke(t, Pd + ".props", [
il(t, "props.data", "label", "id"),
{ type: "input", field: "emptyText" },
{
type: "TableOptions",
field: "props",
props: {
column: [{ label: t("props.key"), key: "label" }, { label: t("props.value"), key: "value" }],
valueType: "object"
}
},
{
type: "switch",
field: "renderAfterExpand",
value: !0
},
{
type: "switch",
field: "defaultExpandAll"
},
{
type: "switch",
field: "expandOnClickNode",
value: !0
},
{
type: "switch",
field: "checkOnClickNode"
},
{ type: "switch", field: "autoExpandParent", value: !0 },
{
type: "switch",
field: "checkStrictly"
},
{ type: "switch", field: "accordion" },
{
type: "inputNumber",
field: "indent"
},
{
type: "input",
field: "nodeKey"
}
]);
}
}, Dw = "\u63D0\u793A", Ld = "elAlert", $w = {
menu: "aide",
icon: "icon-alert",
label: Dw,
name: Ld,
event: ["close"],
rule({ t: e }) {
return {
type: Ld,
props: {
title: e("com.elAlert.name"),
description: e("com.elAlert.description"),
type: "success",
effect: "dark"
},
children: []
};
},
props(e, { t }) {
return Ke(t, Ld + ".props", [{ type: "input", field: "title" }, {
type: "select",
field: "type",
options: [{ label: "success", value: "success" }, { label: "warning", value: "warning" }, {
label: "info",
value: "info"
}, { label: "error", value: "error" }]
}, { type: "input", field: "description" }, {
type: "switch",
field: "closable",
value: !0
}, { type: "switch", field: "center", value: !0 }, {
type: "input",
field: "closeText"
}, { type: "switch", field: "showIcon" }, {
type: "select",
field: "effect",
options: [{ label: "light", value: "light" }, { label: "dark", value: "dark" }]
}]);
}
}, Iw = "\u6587\u5B57", Ym = "text", Fw = {
menu: "aide",
icon: "icon-span",
label: Iw,
name: Ym,
inline: !0,
rule({ t: e }) {
return {
type: "div",
title: "",
style: {
whiteSpace: "pre-line"
},
children: [e("com.text.name")]
};
},
props(e, { t }) {
return Ke(t, Ym + ".props", [
{
type: "input",
field: "formCreateChild",
props: {
type: "textarea"
}
}
]);
}
}, Mw = "\u95F4\u8DDD", Pw = "space", Lw = {
menu: "layout",
icon: "icon-space",
label: Mw,
name: Pw,
rule() {
return {
type: "div",
wrap: {
show: !1
},
native: !0,
style: {
width: "100%",
height: "20px"
},
children: []
};
},
props() {
return [];
}
}, Nw = "\u6807\u7B7E\u9875", Nd = "elTabs", Bw = {
menu: "layout",
icon: "icon-tab",
label: Nw,
name: Nd,
mask: !1,
event: ["tabClick", "tabChange", "tabRemove", "tabAdd", "edit"],
children: "elTabPane",
subRender({ t: e, h: t, resolveComponent: i, subRule: r }) {
return [
{
label: e("props.title"),
vnode: t(i("el-input"), {
size: "small",
modelValue: r.props.label,
"onUpdate:modelValue": (n) => {
r.props.label = n;
}
})
}
];
},
rule() {
return {
type: Nd,
style: { width: "100%" },
props: {
modelValue: "0"
},
sync: ["modelValue"],
children: []
};
},
props(e, { t }) {
return Ke(t, Nd + ".props", [{
type: "select",
field: "type",
options: [{
label: "card",
value: "card"
}, { label: "border-card", value: "border-card" }]
}, { type: "switch", field: "closable" }, {
type: "select",
field: "tabPosition",
options: gt(t, [{ label: "top", value: "top" }, { label: "right", value: "right" }, {
label: "left",
value: "left"
}])
}, { type: "switch", field: "stretch" }]);
}
}, Vw = "\u6309\u94AE", Bd = "elButton", jw = {
menu: "aide",
icon: "icon-button",
label: Vw,
name: Bd,
mask: !0,
inline: !0,
easySlots: [{ value: "icon", type: "icon" }],
event: ["click"],
rule({ t: e }) {
return {
type: Bd,
props: {},
children: [e("com.elButton.name")]
};
},
props(e, { t }) {
return Ke(t, Bd + ".props", [{
type: "input",
field: "formCreateChild"
}, {
type: "select",
field: "size",
options: gt(t, [{ label: "large", value: "large" }, { label: "default", value: "default" }, {
label: "small",
value: "small"
}])
}, {
type: "select",
field: "type",
options: gt(t, [{ label: "primary", value: "primary" }, {
label: "success",
value: "success"
}, { label: "warning", value: "warning" }, { label: "danger", value: "danger" }, {
label: "info",
value: "info"
}])
}, { type: "switch", field: "plain" }, {
type: "switch",
field: "round"
}, { type: "switch", field: "circle" }, {
type: "switch",
field: "loading"
}, { type: "switch", field: "disabled" }]);
}
}, Uw = "\u5BCC\u6587\u672C\u6846", Vd = "fcEditor", zw = {
menu: "main",
icon: "icon-editor",
label: Uw,
name: Vd,
input: !0,
event: ["change"],
validate: ["string"],
rule({ t: e }) {
return {
type: Vd,
field: rt(),
title: e("com.fcEditor.name"),
info: "",
$required: !1,
props: {}
};
},
props(e, { t }) {
return Ke(t, Vd + ".props", [{
type: "switch",
field: "disabled"
}]);
}
}, Hw = "\u5B50\u8868\u5355", Qm = "group", Ww = {
menu: "subform",
icon: "icon-subform",
label: Hw,
name: Qm,
input: !0,
inside: !1,
drag: !0,
dragBtn: !0,
mask: !1,
event: ["change"],
subForm: "array",
loadRule(e) {
e.children = e.props.rule || [], e.type = "FcRow", delete e.props.rule;
},
parseRule(e) {
e.props.rule = e.children, e.type = "group", delete e.children, delete e.props.mode;
},
sfc: !1,
rule({ t: e }) {
return {
type: "fcRow",
field: rt(),
title: e("com.group.name"),
info: "",
$required: !1,
props: {},
children: []
};
},
props(e, { t }) {
return Ke(t, Qm + ".props", [
{
type: "switch",
field: "disabled"
},
{ type: "switch", field: "button", value: !0 },
{ type: "switch", field: "sortBtn", value: !0 },
{ type: "inputNumber", field: "expand" },
{ type: "inputNumber", field: "min" },
{ type: "inputNumber", field: "max" }
]);
}
}, Gw = "\u5206\u7EC4", Jm = "subForm", Kw = {
menu: "subform",
icon: "icon-group",
label: Gw,
name: Jm,
input: !0,
inside: !1,
drag: !0,
dragBtn: !0,
mask: !1,
subForm: "object",
event: ["change"],
loadRule(e) {
e.children = e.props.rule || [], e.type = "FcRow", delete e.props.rule;
},
parseRule(e) {
e.props.rule = e.children, e.type = "subForm", delete e.children;
},
sfc(e, { getParentFieldStr: t }) {
return {
type: "elFormItem",
props: {
prop: t() + e.field,
label: e.title,
required: e.$required === !0 ? !0 : void 0
},
col: { show: !0 },
_sfc: {
parentField: e.field
},
_fc_id: e._fc_id,
children: [
{
type: "elRow",
class: e.class,
style: e.style,
children: e.children
}
]
};
},
rule({ t: e }) {
return {
type: "fcRow",
field: rt(),
title: e("com.subForm.name"),
info: "",
$required: !1,
props: {},
children: []
};
},
props(e, { t }) {
return Ke(t, Jm + ".props", [
{
type: "switch",
field: "disabled"
}
]);
}
}, Yw = "\u5361\u7247", jd = "elCard", Qw = {
menu: "layout",
icon: "icon-card",
label: Yw,
name: jd,
drag: !0,
inside: !1,
mask: !1,
rule({ t: e }) {
return {
type: jd,
props: {
header: e("com.elCard.props.header")
},
style: {
width: "100%"
},
children: []
};
},
props(e, { t }) {
return Ke(t, jd + ".props", [{
type: "input",
field: "header"
}, {
type: "select",
field: "shadow",
value: "always",
options: gt(t, [{ label: "always", value: "always" }, { label: "never", value: "never" }, {
label: "hover",
value: "hover"
}])
}]);
}
}, Jw = "\u6298\u53E0\u9762\u677F", Ud = "elCollapse", Xw = {
menu: "layout",
icon: "icon-collapse",
label: Jw,
name: Ud,
mask: !1,
children: "elCollapseItem",
subRender({ t: e, h: t, resolveComponent: i, subRule: r }) {
return [
{
label: e("props.title"),
vnode: t(i("el-input"), {
size: "small",
modelValue: r.props.title,
"onUpdate:modelValue": (n) => {
r.props.title = n;
}
})
}
];
},
event: ["change"],
rule() {
return {
type: Ud,
props: {
modelValue: []
},
sync: ["modelValue"],
style: {
width: "100%"
},
children: []
};
},
props(e, { t }) {
return Ke(t, Ud + ".props", [{
type: "switch",
field: "accordion"
}]);
}
}, Zw = "\u9762\u677F", zd = "elCollapseItem", qw = {
icon: "icon-cell",
label: Zw,
name: zd,
drag: !0,
dragBtn: !1,
inside: !0,
mask: !1,
easySlots: [{ value: "icon", type: "icon" }],
rule({ t: e }) {
return {
type: zd,
props: {
title: e("com.elCollapseItem.name"),
name: rt()
},
style: {},
children: []
};
},
props(e, { t }) {
return Ke(t, zd + ".props", [{
type: "input",
field: "title"
}, {
type: "input",
field: "name"
}, {
type: "switch",
field: "disabled"
}]);
}
}, eA = "\u6811\u5F62\u9009\u62E9", Hd = "elTreeSelect", tA = {
menu: "main",
icon: "icon-tree-select",
label: eA,
name: Hd,
input: !0,
event: ["change", "visibleChange", "removeTag", "clear", "blur", "focus"],
validate: ["string", "number", "array"],
condition: function(e) {
return {
type: "cascader",
options: e.props.data || [],
props: {
props: {
checkStrictly: !0,
emitPath: !1
}
}
};
},
rule({ t: e }) {
return {
type: Hd,
field: rt(),
title: e("com.elTreeSelect.name"),
info: "",
effect: {
fetch: ""
},
$required: !1,
props: {
nodeKey: "value",
showCheckbox: !0,
data: zi(e("props.option"), { label: "label", value: "value" }, 3)
}
};
},
watch: {
multiple({ rule: e }) {
e.key = rt();
}
},
props(e, { t }) {
return Ke(t, Hd + ".props", [
il(t, "props.data", "label", "value"),
{ type: "switch", field: "multiple" },
{
type: "switch",
field: "disabled"
},
{ type: "switch", field: "clearable" },
{
type: "switch",
field: "collapseTags"
},
{
type: "inputNumber",
field: "multipleLimit",
props: { min: 0 }
},
{ type: "input", field: "placeholder" },
{
type: "TableOptions",
field: "props",
props: {
column: [{ label: t("props.key"), key: "label" }, { label: t("props.value"), key: "value" }],
valueType: "object"
}
},
{
type: "switch",
field: "renderAfterExpand",
value: !0
},
{
type: "switch",
field: "defaultExpandAll"
},
{
type: "switch",
field: "expandOnClickNode",
value: !0
},
{
type: "switch",
field: "checkOnClickNode"
},
{ type: "switch", field: "checkStrictly" },
{
type: "input",
field: "nodeKey"
}
]);
}
}, nA = "\u6807\u7B7E", Wd = "elTag", iA = {
menu: "aide",
icon: "icon-tag",
label: nA,
name: Wd,
mask: !0,
inline: !0,
event: ["click", "close"],
rule({ t: e }) {
return {
type: Wd,
title: "",
children: [e("com.elTag.name")]
};
},
props(e, { t }) {
return Ke(t, Wd + ".props", [
{
type: "input",
field: "formCreateChild"
},
{
type: "select",
field: "type",
options: gt(t, [{ label: "primary", value: "primary" }, {
label: "success",
value: "success"
}, { label: "warning", value: "warning" }, { label: "danger", value: "danger" }, {
label: "info",
value: "info"
}])
},
{
type: "select",
field: "size",
options: gt(t, [{ label: "large", value: "large" }, {
label: "default",
value: "default"
}, { label: "small", value: "small" }])
},
{
type: "select",
field: "effect",
options: [{ label: "dark", value: "dark" }, {
label: "light",
value: "light"
}, { label: "plain", value: "plain" }]
},
{
type: "switch",
field: "closable"
},
{
type: "switch",
field: "disableTransitions"
},
{
type: "switch",
field: "hit"
},
{
type: "switch",
field: "round"
},
{
type: "ColorInput",
field: "color"
}
]);
}
}, rA = "\u63CF\u8FF0\u683C\u5B50", Gd = "elDescriptionsItem", oA = {
icon: "icon-cell",
label: rA,
name: Gd,
dragBtn: !1,
inside: !0,
mask: !1,
rule({ t: e }) {
return {
type: Gd,
props: {
label: e("props.title")
},
children: [e("props.content")]
};
},
watch: {
__child({ value: e, rule: t }) {
t.children[0].children[0] = e;
}
},
attrs: {
child({ rule: e }) {
return e.children[0].children[0] || "";
}
},
props(e, { t }) {
return Ke(t, Gd + ".props", [
{ type: "input", field: "label" },
{
type: "input",
field: "__child",
_fc_important_prop: "formCreateChild"
},
{
type: "inputNumber",
field: "span"
},
{
type: "input",
field: "width"
},
{
type: "input",
field: "minWidth"
},
{
type: "select",
field: "align",
options: gt(t, [{ label: "left", value: "left" }, { label: "center", value: "center" }, {
label: "right",
value: "right"
}])
},
{
type: "select",
field: "labelAlign",
options: gt(t, [{ label: "left", value: "left" }, { label: "center", value: "center" }, {
label: "right",
value: "right"
}])
},
{ type: "input", field: "className" }
]);
}
}, aA = "\u63CF\u8FF0\u5217\u8868", Kd = "elDescriptions", lA = {
menu: "layout",
icon: "icon-descriptions",
label: aA,
name: Kd,
mask: !1,
rule() {
return {
type: Kd,
props: {
border: !0
},
style: {
width: "100%"
},
children: []
};
},
children: "elDescriptionsItem",
childrenLen: 2,
subRender({ t: e, h: t, resolveComponent: i, subRule: r }) {
return [
{
label: e("props.title"),
vnode: t(i("el-input"), {
size: "small",
modelValue: r.props.label,
"onUpdate:modelValue": (n) => {
r.props.label = n;
}
})
}
];
},
props(e, { t }) {
return Ke(t, Kd + ".props", [{
type: "input",
field: "title",
value: ""
}, {
type: "input",
field: "extra",
value: ""
}, {
type: "inputNumber",
field: "column",
value: 3,
props: { min: 0 }
}, {
type: "switch",
field: "border"
}, {
type: "select",
field: "direction",
options: gt(t, [{ label: "vertical", value: "vertical" }, {
label: "horizontal",
value: "horizontal"
}])
}, {
type: "select",
field: "size",
options: gt(t, [{ label: "large", value: "large" }, { label: "default", value: "default" }, {
label: "small",
value: "small"
}])
}]);
}
}, sA = "\u5206\u6B65\u8868\u5355", Yd = "stepForm", uA = {
menu: "subform",
icon: "icon-step-form",
label: sA,
name: Yd,
input: !0,
mask: !1,
languageKey: ["prevStep", "nextStep", "submit"],
event: ["change", "submit", "next"],
subForm: "object",
children: "stepFormItem",
childrenLen: 2,
subRender({ t: e, h: t, resolveComponent: i, subRule: r }) {
return [
{
label: e("props.title"),
vnode: t(i("el-input"), {
size: "small",
modelValue: r.props.title,
"onUpdate:modelValue": (n) => {
r.props.title = n;
}
})
}
];
},
loadRule(e) {
e.props || (e.props = {});
const t = e.props.steps || {};
e.children = t.map((i) => ({
type: "stepFormItem",
_fc_drag_tag: "stepFormItem",
props: {
title: i.props.title,
description: i.props.description
},
children: i.rule
})), delete e.props.steps;
},
parseRule(e) {
const t = e.children || [];
e.props.steps = t.map((i) => ({
props: i.props,
rule: i.children
})), e.children = [];
},
sfc: !1,
rule() {
return {
type: Yd,
field: rt(),
title: "",
info: "",
$required: !1,
props: {},
children: []
};
},
props(e, { t }) {
return Ke(t, Yd + ".props", [
{ type: "switch", field: "submitBtn", value: !0 },
{ type: "switch", field: "autoValidate" },
{ type: "switch", field: "stepsProps>alignCenter" },
{
type: "switch",
field: "stepsProps>simple"
}
]);
}
}, dA = "\u6B65\u9AA4\u6761", Qd = "stepFormItem", fA = {
icon: "icon-cell",
label: dA,
name: Qd,
aide: !0,
drag: !0,
dragBtn: !1,
inside: !0,
mask: !1,
style: !1,
advanced: !1,
variable: !1,
rule({ t: e }) {
return {
type: Qd,
props: {
title: e("com.stepFormItem.props.title"),
description: ""
},
children: []
};
},
props(e, { t }) {
return Ke(t, Qd + ".props", [
{
type: "input",
field: "title",
value: ""
},
{
type: "input",
field: "description",
value: ""
}
]);
}
}, cA = "HTML", Jd = "html", pA = {
menu: "aide",
icon: "icon-html",
label: cA,
name: Jd,
sfc(e) {
e.type = "div";
},
rule() {
return {
type: Jd,
title: "",
style: {
display: "block",
width: "100%"
},
children: ['<div style="color:#2E73FF;display:flex;align-items:center;"><img style="width:20px;height:20px;display:inline-block;"src="https://static.form-create.com/example.png"data="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABkAAAAZCAIAAABLixI0AAAAAXNSR0IArs4c6QAAAERlWElmTU0AKgAAAAgAAYdpAAQAAAABAAAAGgAAAAAAA6ABAAMAAAABAAEAAKACAAQAAAABAAAAGaADAAQAAAABAAAAGQAAAABY85deAAABuElEQVQ4Ee2UTYtBYRTH595BIu8hoYSNfAFJVrKxsFA+gg9laycLG7KQHUo+gRAhRaHI+8v8ZOYu7jTNTM1iauZZnOc8/+c8/3PP/5yu0G63n35oiT/Ec6f55/qemL9VL8VkMimVSo9iUqlUuVze7Xay2mw222w2A4zFYl6v93ELUiwW8YPBoNForNfrCqfTSUS1Wk0mkxaLRalUxuNxu92ey+XC4bDb7a7Van6/fzQardfrbrcrcS0WC4PBQEAoFBIE4XA4KCA2m81YvV6PjUQiEOE8lkqlikajxN1uN2yr1TqdTuTj9nK54Oh0OlG8iw6JXHuXy/VK87ZpNBqTycSJHGq1ejgc4q9WKz7qLeR1F7PZbD6fl6EfHSmw3+9zi8rvs4qZTCadTn/0WIb7fD6EOx6PlCy74iiv8X2EhFyvV6vVqtVqm82mw+GQcMm5c223WywSSCgIGi+XSwQGPJ/P4/G41+vhUOZ8Pqfj+/2e6aG55CBms9k8JxKJx3x1Oh2Px4PS0+m0UCgQgUMC6qpUKoPBgIHiZSAQoH0Iz9CQD5D+gjcaDeH/Xyh14yvON2biU7q/wPUCZDXIe9hWJkQAAAAASUVORK5CYII="/><span style="font-size:16px;">HTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTML</span></div>']
};
},
props(e, { t }) {
return Ke(t, Jd + ".props", [
{
type: "HtmlEditor",
field: "formCreateChild"
}
]);
}
}, hA = "\u8868\u683C\u5E03\u5C40", Xd = "fcTable", mA = {
menu: "layout",
icon: "icon-table",
label: hA,
name: Xd,
inside: !1,
mask: !1,
sfc: {
style: `._fc-table {
overflow: auto;
}
._fc-table > table {
width: 100%;
height: 100%;
overflow: hidden;
table-layout: fixed;
border: 1px solid #EBEEF5;
border-bottom: 0 none;
border-right: 0 none;
}
._fc-table tr {
min-height: 50px;
}
._fc-table td {
padding: 5px;
min-height: 50px;
min-width: 80px;
position: relative;
box-sizing: border-box;
overflow-wrap: break-word;
overflow: hidden;
border: 0 none;
border-right: 1px solid #EBEEF5;
border-bottom: 1px solid #EBEEF5;
}`,
handle(e) {
const t = (e.children || []).reduce((p, g) => (p[g.slot] || (p[g.slot] = []), p[g.slot].push(g), delete g.slot, p), {}), { row: i, col: r, style: n, class: a, layout: s } = e.props.rule, u = {}, d = [];
s.forEach((p) => {
const g = p.row || 1, _ = p.col || 1, S = `${p.top}:${p.left}`;
u[S] = {
row: g,
col: _
};
for (let b = 0; b < g; b++)
for (let A = 0; A < _; A++) {
if (b === 0 && b === A)
continue;
const w = `${p.top + b}:${p.left + A}`;
t[w] && (t[S] = (t[S] || []).concat(t[w]), delete t[w]), d.push(w);
}
});
const h = [];
for (let p = 0; p < i; p++) {
const g = [];
for (let _ = 0; _ < r; _++) {
const S = `${p}:${_}`;
if (d.indexOf(S) > -1)
continue;
const b = t[S];
g.push({
type: "td",
props: {
rowspan: "" + (u[S] ? u[S].row : 1),
colspan: "" + (u[S] ? u[S].col : 1)
},
style: n[S],
class: a[S],
children: b
});
}
h.push({
type: "tr",
children: g
});
}
return {
type: "elCol",
props: {
span: 24
},
style: e.style,
class: e.class,
children: [{
type: "div",
class: "_fc-table",
children: [{
type: "table",
props: {
border: "1",
cellspacing: "0",
cellpadding: "0"
},
children: h
}]
}]
};
}
},
rule() {
return {
type: Xd,
props: {
rule: {
row: 3,
col: 4,
style: {},
class: {},
layout: []
}
},
children: []
};
},
props(e, { t }) {
return Ke(t, Xd + ".props", [
{ type: "switch", field: "border", value: !0 },
{ type: "switch", field: "mini" },
{ type: "ColorInput", field: "borderColor" },
{ type: "input", field: "borderWidth" }
]);
}
}, vA = "\u8868\u683C\u8868\u5355", Zd = "tableForm", gA = {
menu: "subform",
icon: "icon-table-form",
label: vA,
name: Zd,
input: !0,
mask: !1,
subForm: "array",
languageKey: ["add", "operation", "dataEmpty"],
event: ["change", "add", "delete"],
children: "tableFormColumn",
subRender({ t: e, h: t, resolveComponent: i, subRule: r }) {
return [
{
label: e("props.title"),
vnode: t(i("el-input"), {
size: "small",
modelValue: r.props.label,
"onUpdate:modelValue": (n) => {
r.props.label = n;
}
})
}
];
},
loadRule(e) {
e.props || (e.props = {});
const t = e.props.columns || [];
e.children = t.map((i) => ({
type: "tableFormColumn",
_fc_drag_tag: "tableFormColumn",
props: {
label: i.label,
required: i.required || !1,
width: i.style.width || "",
color: i.style.color || ""
},
children: i.rule || []
})), delete e.props.columns;
},
parseRule(e) {
const t = e.children || [];
e.props.columns = t.map((i) => ({
label: i.props.label,
required: i.props.required,
style: {
width: i.props.width,
color: i.props.color
},
rule: i.children || []
})), e.children = [];
},
sfc: !1,
rule({ t: e }) {
return {
type: Zd,
field: rt(),
title: e("com.tableForm.name"),
info: "",
props: {},
children: []
};
},
props(e, { t }) {
return Ke(t, Zd + ".props", [
{
type: "switch",
field: "disabled"
},
{
type: "switch",
field: "addable",
value: !0
},
{
type: "switch",
field: "deletable",
value: !0
},
{
type: "switch",
field: "filterEmptyColumn",
value: !0
},
{
type: "inputNumber",
field: "min",
props: { min: 0 }
},
{
type: "inputNumber",
field: "max",
props: { min: 0 }
}
]);
}
}, yA = "\u8868\u683C\u8868\u5355Pro", bA = "tableFormPro", Jg = (e) => e.map((t) => {
let i = t.children || [];
const r = i.filter((n) => n._fc_drag_tag === "tableFormColumn2");
return r.length > 0 && (i = Jg(r)), {
header: t.props.header,
label: t.props.label,
fixed: t.props.fixed,
required: t.props.required,
hidden: t.props.hidden,
style: {
width: t.props.width,
color: t.props.color
},
[r.length ? "children" : "rule"]: i
};
}), Xg = (e) => e.map((t) => ({
type: "tableFormColumn",
_fc_drag_tag: "tableFormColumn2",
props: {
header: t.header,
label: t.label,
fixed: t.fixed,
required: t.required || !1,
hidden: t.hidden || !1,
width: t.style.width || "",
color: t.style.color || ""
},
children: t.children ? Xg(t.children) : t.rule || []
})), _A = {
menu: "subform",
icon: "icon-table-form",
label: yA,
name: bA,
input: !0,
mask: !1,
subForm: "array",
languageKey: ["add", "delete", "operation", "dataEmpty"],
event: ["change", "add", "delete", "handleClick"],
children: "tableFormColumn2",
subRender({ t: e, h: t, resolveComponent: i, subRule: r }) {
return [
{
label: e("props.title"),
vnode: t(i("el-input"), {
size: "small",
modelValue: r.props.label,
"onUpdate:modelValue": (n) => {
r.props.label = n;
}
})
}
];
},
loadRule(e) {
e.props || (e.props = {}), e.children = Xg(e.props.columns || []), delete e.props.columns;
},
parseRule(e) {
e.props.columns = Jg(e.children || []), e.children = [];
},
sfc: !1,
rule({ t: e }) {
return {
type: "tableFormPro",
field: rt(),
title: e("com.tableFormPro.name"),
info: "",
props: {
button: {
open: !0,
column: [
{
key: "delete",
name: "\u5220\u9664",
type: "danger",
size: "small",
prop: ["link"]
}
]
}
},
children: []
};
},
props(e, { t }) {
const i = function(r) {
return Ke(t, "tableForm.props", r);
};
return Ke(t, "tableForm.props", [
{
type: "ConfigItem",
props: {
label: t("com.dataTable.props.button")
},
col: {
show: !0
},
children: [{
type: "HideConfig",
title: t("com.dataTable.props.button"),
wrap: { show: !1 },
col: { show: !1 },
field: "button>open"
}, {
type: "template",
slot: "append",
children: i([{
type: "TableButtonConfig",
col: { show: !1 },
field: "button>column"
}, {
type: "input",
col: { show: !1 },
field: "button>label",
value: "\u64CD\u4F5C"
}, {
type: "select",
col: { show: !1 },
field: "button>fixed",
options: [
{ label: t("com.dataTable.fixed.default"), value: !1 },
{ label: t("com.dataTable.fixed.left"), value: "left" },
{ label: t("com.dataTable.fixed.right"), value: "right" }
],
value: "right"
}, {
type: "SizeInput",
col: { show: !1 },
field: "button>width",
value: "100px"
}])
}]
},
{
type: "ConfigItem",
props: {
label: t("com.dataTable.props.page")
},
col: {
show: !0
},
children: [{
type: "HideConfig",
wrap: {
show: !1
},
col: {
show: !1
},
title: t("com.dataTable.props.page"),
field: "page>open"
}, {
type: "template",
slot: "append",
children: i([{
type: "inputNumber",
col: {
show: !1
},
field: "page>props>pageSize",
value: 20
}, {
type: "switch",
col: {
show: !1
},
field: "page>props>small"
}, {
type: "switch",
col: {
show: !1
},
field: "page>props>background"
}])
}]
},
{
type: "switch",
field: "disabled"
},
{
type: "select",
field: "size",
options: gt(t, [
{ label: "large", value: "large" },
{ label: "default", value: "default" },
{ label: "small", value: "small" }
])
},
{
type: "input",
field: "emptyText"
},
{
type: "switch",
field: "stripe"
},
{
type: "switch",
field: "border"
},
{
type: "switch",
field: "showIndex"
},
{
type: "switch",
field: "addable",
value: !0
},
{
type: "switch",
field: "deletable",
value: !0
},
{
type: "switch",
field: "newColumn"
},
{
type: "switch",
field: "filterEmptyColumn",
value: !0
},
{
type: "SizeInput",
field: "height"
},
{
type: "inputNumber",
field: "min",
props: { min: 0 }
},
{
type: "inputNumber",
field: "max",
props: { min: 0 }
}
]);
}
}, wA = "\u65E0\u9650\u7EA7\u8868\u5355", Ql = "infiniteTableForm", AA = {
menu: "subform",
icon: "icon-table-form3",
label: wA,
name: Ql,
input: !0,
mask: !1,
subForm: "array",
languageKey: ["add", "operation"],
event: ["change", "add", "delete"],
children: "tableFormColumn",
subRender({ t: e, h: t, resolveComponent: i, subRule: r }) {
return [
{
label: e("props.title"),
vnode: t(i("el-input"), {
size: "small",
modelValue: r.props.label,
"onUpdate:modelValue": (n) => {
r.props.label = n;
}
})
}
];
},
loadRule(e) {
e.props || (e.props = {});
const t = e.props.columns || [];
e.children = t.map((i) => ({
type: "tableFormColumn",
_fc_drag_tag: "tableFormColumn",
props: {
label: i.label,
required: i.required || !1,
width: i.style.width || "",
color: i.style.color || ""
},
children: i.rule || []
})), delete e.props.columns;
},
parseRule(e) {
const t = e.children || [];
e.props.columns = t.map((i) => ({
label: i.props.label,
required: i.props.required,
style: {
width: i.props.width,
color: i.props.color
},
rule: i.children || []
})), e.children = [];
},
sfc: !1,
rule({ t: e }) {
return {
type: Ql,
field: rt(),
title: e("com." + Ql + ".name"),
info: "",
props: {},
children: []
};
},
props(e, { t }) {
return Ke(t, Ql + ".props", [
{
type: "switch",
field: "disabled"
},
{
type: "input",
field: "childrenField",
value: "children"
},
{
type: "inputNumber",
field: "max",
props: { min: 0 }
},
{
type: "inputNumber",
field: "layerMax",
props: { min: 0 }
}
]);
}
}, CA = "\u5D4C\u5957\u8868\u5355", Jl = "nestedTableForm", SA = (e) => e.map((t) => ({
type: "tableFormColumn",
_fc_drag_tag: "tableFormColumn",
props: {
label: t.label,
required: t.required || !1,
width: t.style.width || "",
color: t.style.color || ""
},
children: t.rule || []
})), EA = {
menu: "subform",
icon: "icon-table-form2",
label: CA,
name: Jl,
input: !0,
mask: !1,
subForm: "array",
languageKey: ["add", "operation"],
event: ["change", "add", "delete"],
slot: ["default", {
name: "nested",
type: "nestedSubTableForm"
}],
children: "tableFormColumn",
subRender({ t: e, h: t, resolveComponent: i, subRule: r }) {
return [
{
label: e("props.title"),
vnode: t(i("el-input"), {
size: "small",
modelValue: r.props.label,
"onUpdate:modelValue": (n) => {
r.props.label = n;
}
})
}
];
},
loadRule(e) {
e.props || (e.props = {});
const t = e.props.columns || [], i = e.props.nested || [];
e.children = SA(t), e.children.push({
type: "TableForm",
_fc_drag_tag: "nestedSubTableForm",
field: e.props.nestedField,
props: {
columns: i
},
slot: "nested"
}), delete e.props.nestedField, delete e.props.columns, delete e.props.nested;
},
parseRule(e) {
const t = e.children || [];
e.props.columns = [], t.forEach((i) => {
if (i.slot === "nested") {
e.props.nested = i.props.columns, e.props.nestedField = i.field;
return;
}
e.props.columns.push({
label: i.props.label,
required: i.props.required,
style: {
width: i.props.width,
color: i.props.color
},
rule: i.children || []
});
}), e.children = [];
},
sfc: !1,
rule({ t: e }) {
return {
type: Jl,
field: rt(),
title: e("com." + Jl + ".name"),
info: "",
props: {},
children: []
};
},
props(e, { t }) {
return Ke(t, Jl + ".props", [
{
type: "switch",
field: "disabled"
},
{
type: "inputNumber",
field: "max",
props: { min: 0 }
},
{
type: "inputNumber",
field: "nestedMax",
props: { min: 0 }
}
]);
}
}, xA = "\u5B50\u8868\u683C\u8868\u5355", TA = "nestedSubTableForm", kA = {
icon: "icon-table-form",
label: xA,
name: TA,
aide: !0,
mask: !1,
validate: !1,
style: !1,
advanced: !1,
variable: !1,
subForm: "array",
hiddenBaseField: ["title", "info", "labelConfig", "formCreate_computed>hidden", "formCreate_computed>value", "_control"],
children: "tableFormColumn",
subRender({ t: e, h: t, resolveComponent: i, subRule: r }) {
return [
{
label: e("props.title"),
vnode: t(i("el-input"), {
size: "small",
modelValue: r.props.label,
"onUpdate:modelValue": (n) => {
r.props.label = n;
}
})
}
];
},
loadRule(e) {
e.props || (e.props = {});
const t = e.props.columns || [];
e.children = t.map((i) => ({
type: "tableFormColumn",
_fc_drag_tag: "tableFormColumn",
props: {
label: i.label,
required: i.required || !1,
width: i.style.width || "",
color: i.style.color || ""
},
children: i.rule || []
})), delete e.props.columns;
},
parseRule(e) {
const t = e.children || [];
e.props.columns = t.map((i) => ({
label: i.props.label,
required: i.props.required,
style: {
width: i.props.width,
color: i.props.color
},
rule: i.children || []
})), e.children = [];
},
rule() {
return {
type: "TableForm",
field: rt(),
title: "",
info: "",
props: {},
children: []
};
},
props() {
return [];
}
}, qd = "tableFormColumn", OA = {
icon: "icon-cell",
name: qd,
aide: !0,
drag: !0,
dragBtn: !1,
mask: !1,
style: !1,
advanced: !1,
variable: !1,
rule({ t: e }) {
return {
type: qd,
props: {
label: e("com.tableFormColumn.label"),
width: "auto"
},
children: []
};
},
props(e, { t }) {
return Ke(t, qd + ".props", [
{
type: "input",
field: "label"
},
{
type: "switch",
field: "required"
},
{
type: "input",
field: "width"
},
{
type: "ColorInput",
field: "color"
}
]);
}
}, Xm = "tableFormColumn2", RA = {
icon: "icon-cell",
name: Xm,
aide: !0,
drag: !0,
dragBtn: !1,
mask: !1,
style: !1,
advanced: !1,
variable: !1,
children: "tableFormColumn2",
childrenLen: 0,
checkDrag({ toRule: e }) {
return !(e.children[0].children.length > 0 && e.children[0].children.some((t) => t._config.name === "tableFormColumn2"));
},
rule({ t: e }) {
return {
type: Xm,
props: {
label: e("com.tableFormColumn.label"),
width: "auto"
},
children: []
};
},
props(e, { t }) {
return Ke(t, "tableFormColumn.props", [
{
type: "input",
field: "label"
},
{
type: "select",
field: "fixed",
options: [!1, "left", "right"].map((i) => ({ label: t("com.dataTable.fixed." + (i || "default")), value: i }))
},
{
type: "switch",
field: "required"
},
{
type: "switch",
field: "hidden"
},
{
type: "input",
field: "width"
},
{
type: "ColorInput",
field: "color"
}
]);
}
}, DA = "\u76D2\u5B50\u5E03\u5C40", $A = "fcFlex", IA = {
icon: "icon-flex",
label: DA,
name: $A,
mask: !1,
children: "fcCell",
childrenLen: 2,
subRender({ t: e, h: t, resolveComponent: i, subRule: r }) {
return [
{
label: e("style.width"),
vnode: t(i("SizeInput"), {
size: "small",
modelValue: r.style && r.style.width || "",
"onUpdate:modelValue": (n) => {
r.style || (r.style = {}), r.style.width = n;
}
})
},
{
label: e("style.height"),
vnode: t(i("SizeInput"), {
size: "small",
modelValue: r.style && r.style.height || "auto",
"onUpdate:modelValue": (n) => {
r.style || (r.style = {}), r.style.height = n;
}
})
}
];
},
sfc(e) {
e.type = "elRow";
},
rule() {
return {
type: "fcRow",
props: {},
children: []
};
},
props() {
return [];
}
}, Zm = "fcCell", FA = {
name: Zm,
label: "\u683C\u5B50",
drag: !0,
dragBtn: !1,
inside: !0,
inline: !0,
mask: !1,
sfc(e) {
e.type = "div";
},
rule() {
return {
type: Zm,
style: {
display: "block",
width: "50%",
height: "100px"
},
children: []
};
},
props(e, { t }) {
return [{
type: "SizeInput",
field: "formCreateStyle>width",
title: t("style.width")
}];
}
}, MA = "\u8BA1\u7B97\u516C\u5F0F", qm = "fcValue", PA = {
menu: "main",
icon: "icon-value",
label: MA,
name: qm,
input: !0,
event: ["change"],
validate: !1,
sfc(e, { getParentFieldStr: t }) {
e.type = "div", e._sfc.content = `{{formData.${t()}${e.field}}}`, e._sfc.vModel = !1;
},
rule({ t: e }) {
return {
type: qm,
field: rt(),
title: e("com.fcValue.name"),
info: "",
props: {}
};
},
props() {
return [];
}
}, LA = "\u94FE\u63A5", ef = "elLink", NA = {
menu: "aide",
icon: "icon-link",
label: LA,
name: ef,
inline: !0,
easySlots: [{ value: "icon", type: "icon" }],
rule({ t: e }) {
return {
type: ef,
title: "",
children: [e("com.elLink.name")]
};
},
props(e, { t }) {
return Ke(t, ef + ".props", [
{
type: "input",
field: "href"
},
{
type: "input",
field: "formCreateChild"
},
{
type: "select",
field: "target",
options: gt(t, [
{ label: "_self", value: "_self" },
{ label: "_blank", value: "_blank" },
{ label: "_parent", value: "_parent" },
{ label: "_top", value: "_top" }
])
},
{
type: "switch",
field: "underline",
value: !0
},
{
type: "switch",
field: "disabled"
},
{
type: "select",
field: "type",
options: gt(t, [
{ label: "primary", value: "primary" },
{ label: "success", value: "success" },
{ label: "warning", value: "warning" },
{ label: "danger", value: "danger" },
{ label: "info", value: "info" },
{ label: "default", value: "default" }
])
}
]);
}
}, BA = "\u6587\u5B57\u63D0\u793A", Xl = "elTooltip", VA = {
menu: "aide",
icon: "icon-tooltip",
label: BA,
name: Xl,
drag: !0,
dragBtn: !0,
inside: !1,
mask: !1,
rule({ t: e }) {
return {
type: Xl,
props: {
content: e("com." + Xl + ".name")
},
children: []
};
},
props(e, { t }) {
return Ke(t, Xl + ".props", [
{
type: "input",
field: "content",
props: { type: "textarea" }
},
{
type: "switch",
field: "disabled"
},
{
type: "switch",
field: "rawContent"
},
{
type: "switch",
field: "enterable",
value: !0
},
{
type: "select",
field: "effect",
value: "dark",
options: [{ label: "dark", value: "dark" }, { label: "light", value: "light" }]
},
{
type: "select",
field: "placement",
value: "bottom",
options: [
{ label: "top", value: "top" },
{ label: "top-start", value: "top-start" },
{ label: "top-end", value: "top-end" },
{ label: "bottom", value: "bottom" },
{ label: "bottom-start", value: "bottom-start" },
{ label: "bottom-end", value: "bottom-end" },
{ label: "left", value: "left" },
{ label: "left-start", value: "left-start" },
{ label: "left-end", value: "left-end" },
{ label: "right", value: "right" },
{ label: "right-start", value: "right-start" },
{ label: "right-end", value: "right-end" }
]
},
{
type: "select",
field: "trigger",
value: "hover",
options: [
{ label: "hover", value: "hover" },
{ label: "click", value: "click" },
{ label: "focus", value: "focus" },
{ label: "contextmenu", value: "contextmenu" }
]
},
{
type: "inputNumber",
field: "offset"
},
{
type: "inputNumber",
field: "showAfter",
props: {
min: 0
}
},
{
type: "inputNumber",
field: "hideAfter",
props: {
min: 0
}
},
{
type: "inputNumber",
field: "autoClose",
props: {
min: 0
}
}
]);
}
}, jA = "\u6C34\u5370", Zl = "elWatermark", UA = {
menu: "aide",
icon: "icon-watermark",
label: jA,
name: Zl,
drag: !0,
dragBtn: !0,
inside: !1,
mask: !1,
rule({ t: e }) {
return {
type: Zl,
style: {
width: "100%"
},
props: {
content: e("com." + Zl + ".name")
},
children: []
};
},
props(e, { t }) {
return Ke(t, Zl + ".props", [
{
type: "input",
field: "content"
},
{
type: "input",
field: "image"
},
{
type: "inputNumber",
field: "width",
props: {
min: 0
},
value: 120
},
{
type: "inputNumber",
field: "height",
props: {
min: 0
},
value: 64
},
{
type: "inputNumber",
field: "rotate",
value: -22
},
{
type: "inputNumber",
field: "zIndex",
props: {
min: 0
}
},
{
type: "TableOptions",
field: "gap",
props: {
column: [{ label: t("props.value"), key: "value" }],
valueType: "string",
max: 2
},
value: [100, 100]
}
]);
}
}, zA = "\u91D1\u989D", HA = {
menu: "template",
name: "chineseAmount",
label: zA,
autoField: !0,
template: [
{
type: "inputNumber",
field: "Fgtxlugfgbdvb5c",
title: "\u91D1\u989D",
info: "",
$required: !1,
display: !0,
hidden: !1,
_fc_drag_tag: "inputNumber"
},
{
type: "fcValue",
field: "Fvr1lugfgd3yb7c",
title: " ",
info: "",
display: !0,
hidden: !1,
_fc_drag_tag: "fcValue",
style: {
color: "#999999"
},
computed: {
value: '"\u5927\u5199: " + TOCHINSESAMOUNT(Fgtxlugfgbdvb5c || 0)'
}
}
]
}, WA = "\u65F6\u957F", GA = {
menu: "template",
name: "duration",
label: WA,
autoField: !0,
template: [
{
type: "fcInlineForm",
_fc_id: "id_Founm50iu5kocac",
name: "ref_Fqrpm50iu5kocbc",
display: !0,
hidden: !1,
_fc_drag_tag: "fcInlineForm",
children: [
{
type: "datePicker",
field: "Fz0um50itwf6bbc",
title: "\u5F00\u59CB\u65F6\u95F4",
$required: !1,
_fc_drag_tag: "datePicker",
validate: [
{
type: "validator",
trigger: "change",
validator: `[[FORM-CREATE-PREFIX-function validator(rule, value, callback){this.api.validateField('Fv92m50itwf6bdc');
callback();}-FORM-CREATE-SUFFIX]]`,
mode: "validator",
message: ""
}
],
_fc_template: "duration",
_fc_id: "id_Fhqtm50itwf6bgc",
name: "ref_Fzsym50itwf6bhc",
display: !0,
hidden: !1
},
{
type: "select",
field: "F730m50itwf6bcc",
title: "\u5F00\u59CB\u65F6\u95F4\u6BB5",
effect: {
fetch: ""
},
$required: !1,
options: [
{
label: "\u4E0A\u5348",
value: "1"
},
{
label: "\u4E0B\u5348",
value: "1.5"
}
],
_fc_drag_tag: "select",
_fc_template: "duration",
_fc_id: "id_Fnj8m50itwf6bkc",
name: "ref_Fyjym50itwf6blc",
display: !0,
hidden: !1,
wrap: {
title: !1
},
style: {
marginLeft: "10px",
width: "150px"
}
}
]
},
{
type: "fcInlineForm",
_fc_id: "id_Fxbnm50iw4ttccc",
name: "ref_Fhwmm50iw4ttcdc",
display: !0,
hidden: !1,
_fc_drag_tag: "fcInlineForm",
children: [
{
type: "datePicker",
field: "Fv92m50itwf6bdc",
title: "\u7ED3\u675F\u65F6\u95F4",
$required: !1,
_fc_drag_tag: "datePicker",
validate: [
{
type: "validator",
trigger: "change",
validator: `[[FORM-CREATE-PREFIX-function validator(rule, value, callback){let startTime = this.api.getValue('Fz0um50itwf6bbc');
if(startTime && value && Date.parse(startTime) > Date.parse(value)) {
callback(false);
return;
}
callback()}-FORM-CREATE-SUFFIX]]`,
mode: "min",
message: "\u5F00\u59CB\u65F6\u95F4\u4E0D\u80FD\u5927\u4E8E\u7ED3\u675F\u65F6\u95F4"
}
],
_fc_template: "duration",
_fc_id: "id_Fu8im50itwf6bqc",
name: "ref_Fy17m50itwf6brc",
display: !0,
hidden: !1
},
{
type: "select",
field: "Fx9gm50itwf6bec",
title: "\u7ED3\u675F\u65F6\u95F4\u6BB5",
effect: {
fetch: ""
},
$required: !1,
options: [
{
label: "\u4E0A\u5348",
value: "1"
},
{
label: "\u4E0B\u5348",
value: "1.5"
}
],
_fc_drag_tag: "select",
_fc_template: "duration",
_fc_id: "id_Fxrxm50itwf6buc",
name: "ref_Fehcm50itwf6bvc",
display: !0,
hidden: !1,
wrap: {
title: !1
},
style: {
marginLeft: "10px",
width: "150px"
}
}
]
},
{
type: "fcInlineForm",
_fc_id: "id_Ffb0m50j0g8vcec",
name: "ref_Ftpym50j0g8vcfc",
display: !0,
hidden: !1,
_fc_drag_tag: "fcInlineForm",
children: [
{
type: "inputNumber",
field: "F5q8m50itwf6bfc",
title: "\u65F6\u957F",
$required: !1,
props: {
controls: !1
},
_fc_drag_tag: "inputNumber",
_fc_template: "duration",
_fc_id: "id_Fo5cm50itwf7c0c",
name: "ref_Fnnvm50itwf7c1c",
display: !0,
hidden: !1,
computed: {
value: "MAX(IF(Fz0um50itwf6bbc && Fv92m50itwf6bdc && TIMESTAMP(Fv92m50itwf6bdc) > TIMESTAMP(Fz0um50itwf6bbc), DIFFDAYS(Fz0um50itwf6bbc, Fv92m50itwf6bdc), 0) + IF(Fx9gm50itwf6bec && F730m50itwf6bcc, Fx9gm50itwf6bec - F730m50itwf6bcc + 0.5, 0), 0);"
}
},
{
type: "div",
native: !0,
children: [
"\u5929"
],
_fc_drag_tag: "text",
_fc_template: "duration",
_fc_id: "id_Fatsm50itwf7c4c",
name: "ref_Fh2rm50itwf7c5c",
display: !0,
hidden: !1,
style: {
marginTop: "5px",
marginLeft: "10px"
}
}
],
style: {
alignItems: "flex-start"
}
}
]
}, KA = "\u4E09\u5217\u6805\u683C", YA = {
menu: "template",
name: "col3",
label: KA,
autoField: !1,
template: [
{
type: "fcRow",
children: [
{
type: "col",
props: {
span: 8
},
display: !0,
hidden: !1,
_fc_drag_tag: "col"
},
{
type: "col",
props: {
span: 8
},
display: !0,
hidden: !1,
_fc_drag_tag: "col"
},
{
type: "col",
props: {
span: 8
},
display: !0,
hidden: !1,
_fc_drag_tag: "col"
}
],
display: !0,
hidden: !1,
_fc_drag_tag: "fcRow"
}
]
}, QA = "\u56DB\u5217\u6805\u683C", JA = {
menu: "template",
name: "col4",
label: QA,
autoField: !1,
template: [
{
type: "fcRow",
children: [
{
type: "col",
props: {
span: 6
},
display: !0,
hidden: !1,
_fc_drag_tag: "col"
},
{
type: "col",
props: {
span: 6
},
display: !0,
hidden: !1,
_fc_drag_tag: "col"
},
{
type: "col",
props: {
span: 6
},
display: !0,
hidden: !1,
_fc_drag_tag: "col"
},
{
type: "col",
props: {
span: 6
},
display: !0,
hidden: !1,
_fc_drag_tag: "col"
}
],
display: !0,
hidden: !1,
_fc_drag_tag: "fcRow"
}
]
}, XA = "\u56DB\u884C\u4E09\u5217\u8868\u683C", ZA = {
menu: "template",
name: "table43",
label: XA,
autoField: !1,
template: [
{
type: "fcTable",
props: {
rule: {
row: 4,
col: 3,
style: {},
class: {},
layout: []
}
},
display: !0,
hidden: !1,
_fc_drag_tag: "fcTable"
}
]
}, qA = "\u6570\u636E\u8868\u683C", ql = "dataTable", eC = () => [], tC = (e) => {
if (e.format === "tag")
return {
type: "elTag",
props: {
disableTransitions: !0
},
_sfc: {
content: `{{scope.row.${e.prop}}}`
}
};
if (e.format === "image")
return {
type: "div",
class: "_fc-data-table-img-list",
children: [
{
type: "template",
children: [
{
type: "el-image",
props: {
previewTeleported: !0,
fit: "cover"
},
_sfc: {
attr: {
":initialIndex": "i",
":src": "src",
":previewSrcList": `Array.isArray(scope.row.${e.prop}) ? scope.row.${e.prop} : [scope.row.${e.prop}]`
}
}
}
],
_sfc: {
attr: {
"v-for": `(src, i) in Array.isArray(scope.row.${e.prop}) ? scope.row.${e.prop} : [scope.row.${e.prop}]`
}
}
}
]
};
}, nC = {
menu: "main",
icon: "icon-data-table",
label: qA,
name: ql,
languageKey: ["operation"],
event: ["cellMouseEnter", "cellMouseLeave", "handleClick", "rowClick", "rowDblclick", "headerClick", "filterChange", "expandChange", "sortChange", "selectionChange"],
sfc: {
style: `._fc-data-table {
width: 100%;
}
._fc-data-table .el-table {
--el-table-header-bg-color: #e8eefc;
}
._fc-data-table .el-pagination {
display: flex;
margin-top: 10px;
}
._fc-data-table .el-pagination.left {
justify-content: flex-start;
}
._fc-data-table .el-pagination.left {
justify-content: center;
}
._fc-data-table .el-pagination.right {
justify-content: flex-end;
}
._fc-data-table ._fc-data-table-img-list .el-image {
max-width: 150px;
height: 60px;
}`,
handle(e) {
const { column: t, button: i, page: r, index: n, selection: a, data: s } = e.props, u = [];
["column", "button", "index", "globalDataKey", "fetch", "page"].forEach((h) => {
delete e.props[h];
}), t.forEach((h) => {
const p = tC(h), g = {
type: "elTableColumn",
props: {
label: h.label,
prop: h.prop,
width: h.width,
align: h.align,
className: h.className,
fixed: h.fixed,
sortable: h.sortable
},
_sfc: {
attr: {
"#default": "scope"
}
}
};
p && (g.children = [p]), u.push(g);
}), i && i.open === !0 && i.column && u.push({
type: "elTableColumn",
props: {
label: i.label || "\u64CD\u4F5C",
fixed: i.fixed === void 0 ? "right" : i.fixed,
width: i.width || "100px"
},
_sfc: {
attr: {
"#default": "scope"
}
},
children: i.column.map((h) => {
const p = h.prop || [], g = {
type: "elButton",
props: {
type: h.type,
size: h.size
},
_sfc: {
content: h.name
}
};
return p.forEach((_) => {
g.props[_] = !0;
}), g;
})
}), a && u.unshift({
type: "elTableColumn",
props: {
type: "selection",
width: "50px"
}
}), n && u.unshift({
type: "elTableColumn",
props: {
type: "index",
width: "50px"
}
});
const d = [
{
type: "elTable",
props: {
data: [],
...e.props
},
_fc_id: e._fc_id,
children: u
}
];
if (r && r.open === !0) {
const h = r.props && r.props.pageSize || 20;
r.props && delete r.props.pageSize, d.push({
type: "elPagination",
class: r.position || "right",
_fc_id: e._fc_id,
props: {
layout: "prev, pager, next",
...r.props || {}
},
_sfc: {
prop: {
total: (s || []).length,
currentPage: 1,
pageSize: h
}
}
});
}
return {
type: "div",
class: "_fc-data-table",
children: d
};
}
},
rule() {
return {
type: ql,
native: !0,
props: {
height: "500px",
button: {},
data: eC(),
column: []
}
};
},
props(e, { t }) {
const i = function(n) {
return Ke(t, ql + ".props", n);
}, r = i([{
type: "input",
field: "page>totalField",
value: "count"
}, {
type: "input",
field: "page>dataField",
value: "list"
}, {
type: "input",
field: "page>orderField",
value: "order"
}, {
type: "input",
field: "page>orderByField",
value: "orderBy"
}, {
type: "input",
field: "page>pageField",
value: "page"
}, {
type: "input",
field: "page>pageSizeField",
value: "limit"
}]);
return Ke(t, ql + ".props", [{
type: "radio",
field: "_optionType",
value: 0,
options: [
{ label: t("fetch.optionsType.struct"), value: 0 },
{ label: t("fetch.optionsType.fetch"), value: 2 },
{ label: t("fetch.optionsType.global"), value: 1 }
],
props: {
type: "button"
},
control: [{
value: 1,
rule: [{
type: "GlobalFetchSelect",
field: "globalDataKey"
}, ...r]
}, {
value: 2,
rule: [{
type: "FetchConfig",
field: "fetch"
}, ...r]
}, {
value: 0,
rule: [{
type: "Struct",
title: t("com.dataTable.props._optionType"),
field: "data",
_fc_important_prop: !0,
props: {
validate(n) {
return !n || Array.isArray(n);
}
}
}]
}]
}, {
type: "TableColumnConfig",
field: "column",
_fc_important_prop: !0
}, {
type: "select",
field: "size",
options: gt(t, [
{ label: "large", value: "large" },
{ label: "default", value: "default" },
{ label: "small", value: "small" }
])
}, {
type: "ConfigItem",
props: {
label: t("com.dataTable.props.button")
},
col: {
show: !0
},
children: [{
type: "HideConfig",
title: t("com.dataTable.props.button"),
wrap: { show: !1 },
col: { show: !1 },
field: "button>open"
}, {
type: "template",
slot: "append",
children: i([{
type: "TableButtonConfig",
col: { show: !1 },
field: "button>column"
}, {
type: "input",
col: { show: !1 },
field: "button>label",
value: "\u64CD\u4F5C"
}, {
type: "select",
col: { show: !1 },
field: "button>fixed",
options: [
{ label: t("com.dataTable.fixed.default"), value: !1 },
{ label: t("com.dataTable.fixed.left"), value: "left" },
{ label: t("com.dataTable.fixed.right"), value: "right" }
],
value: "right"
}, {
type: "SizeInput",
col: { show: !1 },
field: "button>width",
value: "100px"
}])
}]
}, {
type: "ConfigItem",
props: {
label: t("com.dataTable.props.page")
},
col: {
show: !0
},
children: [{
type: "HideConfig",
wrap: {
show: !1
},
col: {
show: !1
},
title: t("com.dataTable.props.page"),
field: "page>open"
}, {
type: "template",
slot: "append",
children: i([{
type: "select",
field: "page>position",
value: "right",
col: {
show: !1
},
options: gt(t, [
{
label: "left",
value: "left"
},
{
label: "center",
value: "center"
},
{
label: "right",
value: "right"
}
])
}, {
type: "inputNumber",
col: {
show: !1
},
field: "page>props>pageSize",
value: 20
}, {
type: "switch",
col: {
show: !1
},
field: "page>props>small"
}, {
type: "switch",
col: {
show: !1
},
field: "page>props>background"
}])
}]
}, {
type: "input",
field: "rowKey"
}, {
type: "input",
field: "emptyText"
}, {
type: "SizeInput",
field: "height"
}, {
type: "switch",
field: "showSummary"
}, {
type: "switch",
field: "selection"
}, {
type: "switch",
field: "index"
}, {
type: "switch",
field: "stripe"
}, {
type: "switch",
field: "border"
}, {
type: "switch",
field: "defaultExpandAll"
}]);
}
}, es = "fcDialog", iC = {
name: es,
icon: "icon-dialog",
label: "\u5F39\u51FA\u6846",
drag: !0,
dragBtn: !1,
handleBtn: !1,
inside: !1,
mask: !1,
style: !1,
advanced: !1,
input: !0,
subForm: "object",
hiddenBaseField: ["title", "info", "formCreateCol>span", "labelConfig", "_control"],
languageKey: ["close", "ok"],
event: ["confirm", "submit", "validateFail", "open", "opened", "close", "closed", "openAutoFocus", "closeAutoFocus"],
container: {
formDataField: "value",
labelField: "props.title"
},
loadRule(e) {
e.children = e.props.rule || [], e.native == null && (e.native = !0), e.ignore == null && (e.ignore = !0), delete e.props.rule;
},
parseRule(e) {
e.props.rule = e.children || [], e.children = [];
},
rule({ t: e }) {
return {
type: es,
props: {
title: e("com." + es + ".name")
},
native: !0,
ignore: !0,
children: []
};
},
props(e, { t }) {
return Ke(t, es + ".props", [
{
type: "input",
field: "formCreateProps>title",
title: "\u6807\u9898"
},
{
type: "SizeInput",
field: "width",
value: "50%"
},
{
type: "switch",
field: "fullscreen"
},
{
type: "switch",
field: "preview",
title: t("form.previewMode")
},
{
type: "switch",
field: "modal",
value: !0
},
{
type: "switch",
field: "footer",
value: !0
},
{
type: "switch",
field: "autoClose",
value: !0
},
{
type: "FnInput",
field: "beforeClose",
props: {
body: !0,
button: !0,
fnx: !0,
name: "beforeClose",
args: [In(t)]
}
}
]);
}
}, ts = "fcDrawer", rC = {
name: ts,
icon: "icon-dialog",
label: "\u62BD\u5C49",
drag: !0,
dragBtn: !1,
handleBtn: !1,
inside: !1,
mask: !1,
style: !1,
advanced: !1,
input: !0,
subForm: "object",
hiddenBaseField: ["title", "info", "formCreateCol>span", "labelConfig", "_control"],
languageKey: ["close", "ok"],
event: ["confirm", "submit", "validateFail", "open", "opened", "close", "closed", "openAutoFocus", "closeAutoFocus"],
container: {
formDataField: "value",
labelField: "props.title"
},
loadRule(e) {
e.children = e.props.rule || [], e.native == null && (e.native = !0), e.ignore == null && (e.ignore = !0), delete e.props.rule;
},
parseRule(e) {
e.props.rule = e.children || [], e.children = [];
},
rule({ t: e }) {
return {
type: ts,
props: {
title: e("com." + ts + ".name")
},
native: !0,
ignore: !0,
children: []
};
},
props(e, { t }) {
return Ke(t, ts + ".props", [
{
type: "input",
field: "formCreateProps>title",
title: "\u6807\u9898"
},
{
type: "SizeInput",
field: "size",
value: "30%"
},
{
type: "select",
field: "direction",
options: gt(t, [
{ label: "ltr", value: "ltr" },
{ label: "rtl", value: "rtl" }
], "com.fcDrawer.directionType"),
value: "rtl"
},
{
type: "switch",
field: "preview",
title: t("form.previewMode")
},
{
type: "switch",
field: "modal",
value: !0
},
{
type: "switch",
field: "footer",
value: !0
},
{
type: "switch",
field: "autoClose",
value: !0
},
{
type: "FnInput",
field: "beforeClose",
props: {
body: !0,
button: !0,
fnx: !0,
name: "beforeClose",
args: [In(t)]
}
}
]);
}
}, oC = "\u63D2\u69FD\u533A\u57DF", tf = "fcSlot", aC = {
menu: "container",
icon: "icon-slot",
label: oC,
name: tf,
input: !0,
mask: !0,
style: !1,
sfc: !1,
rule() {
return {
type: tf,
field: rt(),
title: "",
native: !1,
$required: !1,
readMode: "custom",
props: {
name: "block_" + rt()
}
};
},
props(e, { t }) {
return Ke(t, tf + ".props", [{ type: "input", field: "name" }]);
}
}, lC = "\u52A8\u6001\u533A\u57DF", nf = "fcJson", sC = {
menu: "container",
icon: "icon-json",
label: lC,
name: nf,
input: !0,
mask: !0,
style: !1,
sfc: !1,
rule() {
return {
type: nf,
field: rt(),
props: {
expand: 1
}
};
},
props(e, { t }) {
return Ke(t, nf + ".props", [{
type: "radio",
field: "_loadType",
value: 2,
props: {
type: "button"
},
options: [
{ label: t("fetch.optionsType.struct"), value: 2 },
{ label: t("fetch.optionsType.fetch"), value: 3 },
{ label: t("fetch.optionsType.global"), value: 1 }
],
control: [{
value: 1,
rule: [
{
type: "GlobalFetchSelect",
field: "formCreateEffect>fetch",
props: {
to: "props.rule"
}
}
]
}, {
value: 2,
rule: [
{
type: "Struct",
field: "rule",
title: t("com.fcJson.props._loadType"),
_fc_important_prop: !0,
wrap: { show: !1 }
}
]
}, {
value: 3,
rule: [
{
type: "FetchConfig",
field: "formCreateEffect>fetch",
props: {
to: "props.rule"
}
}
]
}]
}, {
type: "select",
field: "type",
options: gt(t, [
{ label: t("props.default"), value: "default" },
{ label: t("com.group.name"), value: "array" },
{ label: t("com.subForm.name"), value: "object" }
]),
control: [
{
value: "array",
method: "hidden",
rule: Ke(t, "group.props", [
{
type: "switch",
field: "disabled",
ignore: "hidden"
},
{
type: "switch",
field: "button",
ignore: "hidden",
value: !0
},
{
type: "switch",
field: "sortBtn",
ignore: "hidden",
value: !0
},
{
type: "inputNumber",
field: "expand",
ignore: "hidden"
},
{
type: "inputNumber",
field: "min",
ignore: "hidden"
},
{
type: "inputNumber",
field: "max",
ignore: "hidden"
}
])
},
{
value: "object",
method: "hidden",
rule: Ke(t, "group.props", [{
type: "switch",
field: "disabled",
ignore: "hidden"
}])
}
]
}]);
}
}, uC = "\u5185\u8054\u5E03\u5C40", ev = "fcInlineForm", dC = {
menu: "layout",
icon: "icon-inline",
label: uC,
name: ev,
denyDrag: {
menu: ["subform", "layout"]
},
drag: !0,
inside: !1,
mask: !1,
sfc: {
style: `._fc-line-form .el-form-item {
display: inline-flex;
vertical-align: middle;
}
._fc-line-form .el-select, ._fc-line-form .el-slider {
width: 220px;
}`,
handle(e) {
return {
type: "div",
class: "_fc-line-form",
children: e.children
};
}
},
rule() {
return {
type: ev,
props: {}
};
},
props() {
return [];
}
}, fC = "\u56FE\u7247", rf = "elImage", cC = {
menu: "aide",
icon: "icon-image",
label: fC,
name: rf,
inline: !0,
rule() {
return {
type: rf,
title: "",
style: {
width: "100px",
height: "100px"
},
props: {
src: "https://static.form-create.com/example.png"
}
};
},
props(e, { t }) {
return Ke(t, rf + ".props", [
{
type: "input",
field: "src"
},
{
type: "TableOptions",
field: "previewSrcList",
props: {
column: [{ label: t("com.elImage.props.src"), key: "value" }],
valueType: "string"
}
}
]);
}
}, pC = "\u76D2\u5B50\u5E03\u5C40", hC = "fcFlex2", mC = {
menu: "layout",
icon: "icon-flex",
name: hC,
label: pC,
drag: !0,
inside: !0,
inline: !0,
mask: !1,
sfc(e) {
e.type = "div";
},
actions: [
{
label: "com.fcFlex2.horizontal",
handler(e) {
e.style || (e.style = {}), e.style.display !== "flex" ? (e.style.display = "flex", e.style.flexDirection = "row", e.style.justifyContent = "center") : ["column-reverse", "column"].indexOf(e.style.flexDirection) > -1 ? e.style.alignItems = "center" : e.style.justifyContent = "center";
}
},
{
label: "com.fcFlex2.vertical",
handler(e) {
e.style || (e.style = {}), e.style.display !== "flex" ? (e.style.display = "flex", e.style.flexDirection = "row", e.style.alignItems = "center") : ["column-reverse", "column"].indexOf(e.style.flexDirection) > -1 ? e.style.justifyContent = "center" : e.style.alignItems = "center";
}
},
{
label: "com.fcFlex2.left",
handler(e) {
e.style || (e.style = {}), e.style.display !== "flex" ? (e.style.display = "flex", e.style.flexDirection = "row", e.style.justifyContent = "flex-start") : ["column-reverse", "column"].indexOf(e.style.flexDirection) > -1 ? e.style.alignItems = "flex-start" : e.style.justifyContent = "flex-start";
}
},
{
label: "com.fcFlex2.right",
handler(e) {
e.style || (e.style = {}), e.style.display !== "flex" ? (e.style.display = "flex", e.style.flexDirection = "row", e.style.justifyContent = "flex-end") : ["column-reverse", "column"].indexOf(e.style.flexDirection) > -1 ? e.style.alignItems = "flex-end" : e.style.justifyContent = "flex-end";
}
},
{
label: "com.fcFlex2.reset",
handler(e) {
e.style ? (delete e.style.flexDirection, delete e.style.justifyContent, delete e.style.alignContent, delete e.style.flexWrap, delete e.style.alignItems, e.style.display = "flex") : e.style = {};
}
}
],
rule() {
return {
type: "fcCell",
style: {
display: "block",
width: "100%",
height: "100px"
},
children: []
};
},
props(e, { t }) {
return [{
type: "SizeInput",
field: "formCreateStyle>width",
title: t("style.width")
}, {
type: "SizeInput",
field: "formCreateStyle>height",
title: t("style.height")
}];
}
}, vC = "\u8868\u5355\u9879", of = "elFormItem", gC = {
menu: "container",
icon: "icon-form-item",
label: vC,
name: of,
drag: !0,
mask: !1,
event: !1,
rule({ t: e }) {
return {
type: of,
props: {
label: e("com.elFormItem.name")
},
children: []
};
},
props(e, { t }) {
return Ke(t, of + ".props", [
{ type: "input", field: "label" },
{ type: "SizeInput", field: "labelWidth" },
{
type: "select",
field: "formCreateClass",
title: t("form.labelPosition"),
options: gt(t, [
{ value: "fc-wrap-top", label: "top" },
{ value: "fc-wrap-left", label: "left" },
{ value: "fc-wrap-right", label: "right" }
])
},
{
type: "select",
field: "size",
options: gt(t, [
{ label: "large", value: "large" },
{ label: "default", value: "default" },
{ label: "small", value: "small" }
])
}
]);
}
}, yC = "\u97F3\u9891\u64AD\u653E\u5668", af = "audioBox", bC = {
menu: "aide",
icon: "icon-audio",
label: yC,
name: af,
mask: !1,
event: ["pause", "play", "ended"],
rule() {
return {
type: af,
props: {
src: "https://static.form-create.com/res/demo.mp3",
type: "audio/mpeg"
}
};
},
props(e, { t }) {
return Ke(t, af + ".props", [
{
type: "input",
field: "src"
},
{
type: "select",
field: "type",
options: [
{
label: "MP3",
value: "audio/mpeg"
},
{
label: "OGG",
value: "audio/ogg"
},
{
label: "AAC",
value: "audio/aac"
},
{
label: "WAV",
value: "audio/wav"
},
{
label: "WMA",
value: "audio/x-ms-wma"
},
{
label: "WEBA",
value: "audio/webm"
},
{
label: "FLAC",
value: "audio/flac"
},
{
label: "ALAC",
value: "audio/x-alac"
},
{
label: "AMR",
value: "audio/amr"
},
{
label: "MIDI",
value: "audio/midi"
}
]
},
{
type: "switch",
field: "autoplay"
},
{
type: "switch",
field: "loop"
},
{
type: "switch",
field: "muted"
},
{
type: "switch",
field: "controls"
},
{
type: "select",
field: "preload",
options: gt(t, [
{
label: "auto",
value: "auto"
},
{
label: "metadata",
value: "metadata"
},
{
label: "none",
value: "none"
}
], "com.audioBox.preloadOpt")
}
]);
}
}, _C = "\u89C6\u9891\u64AD\u653E\u5668", lf = "videoBox", wC = {
menu: "aide",
icon: "icon-video",
label: _C,
name: lf,
mask: !1,
event: ["pause", "play", "ended", "error"],
rule() {
return {
type: lf,
props: {
src: "",
type: "mp4"
}
};
},
props(e, { t }) {
return Ke(t, lf + ".props", [
{
type: "input",
field: "src"
},
{
type: "select",
field: "type",
options: [
{
label: "mp4",
value: "mp4"
},
{
label: "mpegts",
value: "mpegts"
},
{
label: "m2ts",
value: "m2ts"
},
{
label: "flv",
value: "flv"
},
{
label: "mse",
value: "mse"
}
]
},
{
type: "switch",
field: "autoplay"
},
{
type: "switch",
field: "controls",
value: !0
},
{
type: "switch",
field: "isLive"
},
{
type: "switch",
field: "loop"
},
{
type: "switch",
field: "withCredentials",
value: !0
}
]);
}
}, AC = "\u5934\u50CF\u6846", tv = "elAvatar", CC = {
menu: "aide",
icon: "icon-avatar",
label: AC,
name: tv,
mask: !0,
inline: !0,
event: [],
rule() {
return {
type: tv,
props: {
fit: "cover",
src: "https://static.form-create.com/example.png"
}
};
},
props(e, { t }) {
return Ke(t, "elAvatar.props", [
{
type: "input",
field: "src"
},
{
type: "select",
field: "shape",
options: gt(t, [
{ label: "circle", value: "circle" },
{ label: "square", value: "square" }
])
},
{
type: "select",
field: "size",
options: gt(t, [
{ label: "large", value: "large" },
{ label: "default", value: "default" },
{ label: "small", value: "small" }
])
}
]);
}
}, SC = "\u6761\u5F62\u7801", nv = "barCodeBox", EC = {
menu: "aide",
icon: "icon-barcode",
label: SC,
name: nv,
mask: !0,
inline: !0,
event: [],
rule() {
return {
type: nv,
props: {
value: "12345670",
format: "CODE128"
}
};
},
props(e, { t }) {
return Ke(t, "barCodeBox.props", [
{
type: "input",
field: "value"
},
{
type: "select",
field: "format",
options: [
{ label: "CODE39", value: "CODE39" },
{ label: "CODE128", value: "CODE128" },
{ label: "CODE128A", value: "CODE128A" },
{ label: "CODE128B", value: "CODE128B" },
{ label: "CODE128C", value: "CODE128C" },
{ label: "EAN13", value: "EAN13" },
{ label: "UPC", value: "UPC" },
{ label: "CODABAR", value: "CODABAR" }
]
},
{
type: "inputNumber",
field: "width",
value: 2
},
{
type: "inputNumber",
field: "height",
value: 50
},
{
type: "switch",
field: "displayValue",
value: !0
},
{
type: "inputNumber",
field: "fontSize",
value: 12
},
{
type: "select",
field: "textPosition",
options: gt(t, [
{ label: "top", value: "top" },
{ label: "bottom", value: "bottom" }
])
},
{
type: "select",
field: "textAlign",
options: gt(t, [
{ label: "left", value: "left" },
{ label: "center", value: "center" },
{ label: "right", value: "right" }
])
},
{
type: "inputNumber",
field: "textMargin",
value: 2
},
{
type: "ColorInput",
field: "background"
},
{
type: "ColorInput",
field: "lineColor"
}
]);
}
}, xC = "\u5185\u5D4C\u7F51\u9875", iv = "iframeBox", TC = {
menu: "aide",
icon: "icon-iframe",
label: xC,
name: iv,
mask: !0,
event: ["load"],
rule() {
return {
type: iv,
props: {
src: "https://github.com/xaboy/form-create"
}
};
},
props(e, { t }) {
return Ke(t, "iframeBox.props", [
{
type: "input",
field: "src"
},
{
type: "select",
field: "loading",
value: "eager",
options: gt(t, [
{ label: "eager", value: "eager" },
{ label: "lazy", value: "lazy" }
], "com.iframeBox.loadingOpt")
}
]);
}
}, kC = "\u4E8C\u7EF4\u7801", sf = "qrCodeBox", OC = {
menu: "aide",
icon: "icon-qrcode",
label: kC,
name: sf,
mask: !0,
inline: !0,
rule() {
return {
type: sf,
props: {
data: "1234567890",
width: 150,
height: 150
}
};
},
props(e, { t }) {
return Ke(t, sf + ".props", [
{
type: "input",
field: "data"
},
{
type: "input",
field: "image"
},
{
type: "inputNumber",
field: "width"
},
{
type: "inputNumber",
field: "height"
},
{
type: "select",
field: "circleType",
options: gt(t, [
{ label: "square", value: "square" },
{ label: "dots", value: "dots" },
{ label: "rounded", value: "rounded" },
{ label: "classy", value: "classy" }
], "com.qrCodeBox.circleTypeOpt")
},
{
type: "ColorInput",
field: "circleColor"
}
]);
}
}, RC = "\u624B\u5199\u7B7E\u540D", uf = "signaturePad", DC = {
menu: "main",
icon: "icon-sign",
label: RC,
name: uf,
input: !0,
mask: !0,
languageKey: ["signaturePadTip", "signaturePadTitle", "reset", "ok"],
event: ["change", "remove"],
rule({ t: e }) {
return {
type: uf,
field: rt(),
title: e("com.signaturePad.name"),
info: "",
$required: !1,
props: {}
};
},
props(e, { t }) {
return Ke(t, uf + ".props", [
{
type: "ColorInput",
field: "penColor"
}
]);
}
}, $C = "\u63D0\u53CA", df = "elMention", IC = {
menu: "main",
icon: "icon-mention",
label: $C,
name: df,
input: !0,
event: ["search", "select", "blur", "focus", "change", "input", "clear"],
validate: ["string"],
rule({ t: e }) {
return {
type: df,
field: rt(),
title: e("com.elMention.name"),
info: "",
$required: !1,
props: {
options: [
{
label: "Fuphoenixes",
value: "Fuphoenixes"
},
{
label: "kooriookami",
value: "kooriookami"
},
{
label: "Jeremy",
value: "Jeremy"
},
{
label: "btea",
value: "btea"
}
]
}
};
},
props(e, { t }) {
return Ke(t, df + ".props", [
Qr(t, "props.options"),
{
type: "switch",
field: "disabled"
},
{
type: "switch",
field: "clearable"
},
{
type: "switch",
field: "whole"
},
{
type: "input",
field: "placeholder"
},
{
type: "select",
field: "type",
options: [
{ label: "input", value: "input" },
{ label: "textarea", value: "textarea" }
]
},
{
type: "FnInput",
field: "checkIsWhole",
props: {
body: !0,
button: !0,
fnx: !0,
args: [In(t)],
name: "checkIsWhole"
}
},
{
type: "FnInput",
field: "filterOption",
props: {
body: !0,
button: !0,
fnx: !0,
args: [In(t)],
name: "filterOption"
}
}
]);
}
}, FC = "\u5206\u6BB5\u63A7\u5236\u5668", ff = "elSegmented", MC = {
menu: "main",
icon: "icon-segmented",
label: FC,
name: ff,
input: !0,
event: ["change"],
validate: ["string", "number"],
rule() {
return {
type: ff,
field: rt(),
title: "",
props: {
options: ["Mon", "Tue", "Wed", "Thu", "Fri", "Sat", "Sun"].map((e) => ({ label: e, value: e }))
}
};
},
props(e, { t }) {
return Ke(t, ff + ".props", [
{
type: "TableOptions",
field: "options",
title: t("props.options"),
wrap: { show: !1 },
props: {
column: [{ label: "label", key: "label" }, { value: !0, label: "value", key: "value" }],
keyValue: "label"
}
},
{
type: "switch",
field: "disabled"
},
{
type: "switch",
field: "block"
},
{
type: "select",
field: "size",
options: gt(t, [{ label: "large", value: "large" }, { label: "default", value: "default" }, {
label: "small",
value: "small"
}])
}
]);
}
}, PC = "\u6807\u9898", rv = "fcTitle", LC = {
menu: "aide",
icon: "icon-title",
label: PC,
name: rv,
event: [],
rule({ t: e }) {
return {
type: "fcTitle",
props: {
title: e("props.title")
}
};
},
props(e, { t }) {
return Ke(t, rv + ".props", [{ type: "input", field: "title" }, {
type: "select",
field: "size",
value: "H2",
options: [1, 2, 3, 4, 5, 6].map((i) => ({ label: "H" + i, value: "h" + i }))
}, {
type: "select",
field: "align",
options: gt(t, [{ label: "left", value: "left" }, { label: "center", value: "center" }, {
label: "right",
value: "right"
}])
}]);
}
}, NC = "\u552F\u4E00\u503C", cf = "fcId", BC = {
menu: "main",
icon: "icon-input-id",
label: NC,
name: cf,
input: !0,
validate: !1,
rule({ t: e }) {
return {
type: cf,
field: rt(),
title: e("com.fcId.name"),
info: "",
$required: !1,
props: {}
};
},
props(e, { t }) {
return Ke(t, cf + ".props", [
{
type: "input",
field: "prefix"
}
]);
}
}, VC = "\u7701\u5E02\u533A\u9009\u62E9\u5668", pf = "fcCity", jC = {
menu: "main",
icon: "icon-city",
label: VC,
name: pf,
input: !0,
event: ["change"],
validate: ["array"],
rule({ t: e }) {
return {
type: pf,
field: rt(),
title: e("com.fcCity.name"),
info: "",
$required: !1,
props: {}
};
},
props(e, { t }) {
return Ke(t, pf + ".props", [
{
type: "select",
field: "level",
value: 3,
options: [
{ label: "\u7701\u4F1A", value: 1 },
{ label: "\u7701\u4F1A/\u57CE\u5E02", value: 2 },
{ label: "\u7701\u4F1A/\u57CE\u5E02/\u533A\u57DF", value: 3 }
]
},
{
type: "switch",
field: "disabled"
},
{
type: "switch",
field: "clearable"
},
{
type: "FnInput",
field: "filter",
props: {
body: !0,
button: !0,
fnx: !0,
args: [In(t)],
name: "filter"
}
},
{
type: "input",
field: "api"
}
]);
}
}, UC = "Markdown", zC = "markdown", HC = {
menu: "aide",
icon: "icon-markdown",
label: UC,
name: zC,
rule() {
return {
type: "FcMarkdown",
native: !0,
props: {
content: `### \u6807\u9898
\u4F7F\u7528 # \u53F7\u521B\u5EFA\u6807\u9898
\`\`\`
# \u4E00\u7EA7\u6807\u9898
## \u4E8C\u7EA7\u6807\u9898
### \u4E09\u7EA7\u6807\u9898
\`\`\`
### \u7C97\u4F53
\u4F7F\u7528 ** \u5305\u56F4\u6587\u672C
\`\`\`
**\u7C97\u4F53\u6587\u672C**
\`\`\`
### \u659C\u4F53
\u4F7F\u7528 * \u5305\u56F4\u6587\u672C
\`\`\`
*\u659C\u4F53\u6587\u672C*
\`\`\`
### \u5220\u9664\u7EBF
\u4F7F\u7528 ~~ \u5305\u56F4\u6587\u672C
\`\`\`
~~\u5220\u9664\u7EBF\u6587\u672C~~
\`\`\`
### \u94FE\u63A5
\u4F7F\u7528 [\u6587\u672C](\u94FE\u63A5) \u683C\u5F0F
\`\`\`
[\u94FE\u63A5\u6587\u672C](https://example.com)
\`\`\`
### \u56FE\u7247
\u4F7F\u7528 ![\u63CF\u8FF0|\u5BBD\u5EA6x\u9AD8\u5EA6](\u56FE\u7247\u94FE\u63A5) \u683C\u5F0F
\`\`\`
![\u56FE\u7247\u56FA\u5B9A|400x300](https://example.com/image.jpg)
![\u56FE\u7247](https://example.com/image.jpg)
\`\`\`
### \u4EE3\u7801\u5757
\u4F7F\u7528 \`\`\` \u5305\u56F4\u4EE3\u7801
\`\`\`\`
\`\`\`js
function hello() {
console.log('Hello');
}
\`\`\`
\`\`\`\`
### \u884C\u5185\u4EE3\u7801
\u4F7F\u7528 \` \u5305\u56F4\u4EE3\u7801
\`\`\`
\`\u884C\u5185\u4EE3\u7801\`
\`\`\`
### \u5F15\u7528
\u4F7F\u7528 > \u5F00\u59CB\u5F15\u7528
\`\`\`
> \u8FD9\u662F\u4E00\u6BB5\u5F15\u7528\u6587\u672C
\`\`\`
### \u65E0\u5E8F\u5217\u8868
\u4F7F\u7528 - \u5F00\u59CB\u5217\u8868\u9879
\`\`\`
- \u9879\u76EE1
- \u9879\u76EE2
- \u9879\u76EE3
\`\`\`
### \u6709\u5E8F\u5217\u8868
\u4F7F\u7528 1. \u5F00\u59CB\u5217\u8868\u9879
\`\`\`
1. \u7B2C\u4E00\u9879
2. \u7B2C\u4E8C\u9879
3. \u7B2C\u4E09\u9879
\`\`\`
### \u8868\u683C
\u4F7F\u7528 | \u5206\u9694\u5217
\`\`\`
| \u5DE6\u5BF9\u9F50 | \u5C45\u4E2D\u5BF9\u9F50 | \u53F3\u5BF9\u9F50 |
|:-------|:-------:|-------:|
| \u6570\u636E1 | \u6570\u636E2 | \u6570\u636E3 |
\`\`\`
### \u6C34\u5E73\u5206\u5272\u7EBF
\u4F7F\u7528 --- \u521B\u5EFA\u5206\u5272\u7EBF
\`\`\`
---
\`\`\`
### \u5F3A\u5236\u6362\u884C
\u4F7F\u7528 <br/> \u6807\u7B7E\u5B9E\u73B0\u591A\u6B21\u6362\u884C
\`\`\`
\u7B2C\u4E00\u884C<br/><br/>\u7B2C\u4E09\u884C
\`\`\`
`
}
};
},
props(e, { t }) {
return [
{
type: "HtmlEditor",
field: "content",
title: t("props.content"),
props: {
text: !0
}
}
];
}
}, WC = "\u7EDF\u8BA1\u680F", ns = "elStatistic", GC = {
menu: "aide",
icon: "icon-statistic",
label: WC,
name: ns,
inline: !0,
easySlots: ["prefix", "suffix"],
rule({ t: e }) {
return {
type: ns,
props: {
value: 99e3,
title: e("com." + ns + ".name")
}
};
},
props(e, { t }) {
return Ke(t, ns + ".props", [
{ type: "inputNumber", field: "value" },
{ type: "input", field: "title" },
{ type: "input", field: "prefix" },
{ type: "input", field: "suffix" }
]);
}
}, KC = "\u6298\u7EBF\u56FE", YC = "lineChart", QC = {
menu: "chart",
icon: "icon-chart-line",
label: KC,
name: YC,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
return {
type: "fcEcharts",
props: {
type: "line",
config: {
category: ["Mon", "Tue", "Wed", "Thu", "Fri", "Sat", "Sun"],
series: [
{
name: "Email",
data: [120, 132, 101, 134, 90, 230, 210]
},
{
name: "Union Ads",
data: [220, 182, 191, 234, 290, 330, 310]
},
{
name: "Video Ads",
data: [150, 232, 201, 154, 190, 330, 410]
},
{
name: "Direct",
data: [320, 332, 301, 334, 390, 330, 320]
},
{
name: "Search Engine",
data: [820, 932, 901, 934, 1290, 1330, 1320]
}
]
}
}
};
},
props(e, { t }) {
return Ke(t, "lineChart.props", [
Si(t, "props.config", t("com.lineChart.data")),
{
type: "input",
field: "title"
},
{
type: "input",
field: "subtitle"
},
{
type: "input",
field: "valueFormat",
value: "{value}"
},
{
type: "switch",
field: "stack"
},
{
type: "switch",
field: "smooth"
},
{
type: "switch",
field: "showLegend",
value: !0
},
{
type: "switch",
field: "showSeriesLabel"
}
]);
}
}, JC = "\u4F53\u79EF\u56FE", XC = "areaChart", ZC = {
menu: "chart",
icon: "icon-chart-area",
label: JC,
name: XC,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
return {
type: "fcEcharts",
props: {
type: "area",
config: {
category: ["Mon", "Tue", "Wed", "Thu", "Fri", "Sat", "Sun"],
series: [
{
name: "Email",
data: [120, 132, 101, 134, 90, 230, 210]
},
{
name: "Union Ads",
data: [220, 182, 191, 234, 290, 330, 310]
},
{
name: "Video Ads",
data: [150, 232, 201, 154, 190, 330, 410]
},
{
name: "Direct",
data: [320, 332, 301, 334, 390, 330, 320]
},
{
name: "Search Engine",
data: [820, 932, 901, 934, 1290, 1330, 1320]
}
]
}
}
};
},
props(e, { t }) {
return Ke(t, "lineChart.props", [
Si(t, "props.config", t("com.lineChart.data")),
{
type: "input",
field: "title"
},
{
type: "input",
field: "subtitle"
},
{
type: "input",
field: "valueFormat",
value: "{value}"
},
{
type: "switch",
field: "stack"
},
{
type: "switch",
field: "smooth"
},
{
type: "switch",
field: "showLegend",
value: !0
},
{
type: "switch",
field: "showSeriesLabel"
}
]);
}
}, qC = "\u67F1\u72B6\u56FE", eS = "barChart", tS = {
menu: "chart",
icon: "icon-chart-bar",
label: qC,
name: eS,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
return {
type: "fcEcharts",
props: {
type: "bar",
config: {
category: ["Mon", "Tue", "Wed", "Thu", "Fri", "Sat", "Sun"],
series: [
{
name: "Direct",
data: [320, 332, 301, 334, 390, 330, 320]
}
]
}
}
};
},
props(e, { t }) {
return Ke(t, "lineChart.props", [
Si(t, "props.config", t("com.lineChart.data")),
{
type: "input",
field: "title"
},
{
type: "input",
field: "subtitle"
},
{
type: "input",
field: "valueFormat",
value: "{value}"
},
{
type: "ColorInput",
field: "barBackgroundColor"
},
{
type: "switch",
field: "stack"
},
{
type: "switch",
field: "showLegend",
value: !0
},
{
type: "switch",
field: "showSeriesLabel"
}
]);
}
}, nS = "\u6761\u5F62\u56FE", iS = "stripeChart", rS = {
menu: "chart",
icon: "icon-chart-stripe",
label: nS,
name: iS,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
return {
type: "fcEcharts",
props: {
type: "bar",
stripe: !0,
config: {
category: ["Mon", "Tue", "Wed", "Thu", "Fri", "Sat", "Sun"],
series: [
{
name: "Direct",
data: [320, 332, 301, 334, 390, 330, 320]
},
{
name: "Direct2",
data: [320, 332, 301, 334, 390, 330, 320]
}
]
}
}
};
},
props(e, { t }) {
return Ke(t, "lineChart.props", [
Si(t, "props.config", t("com.lineChart.data")),
{
type: "input",
field: "title"
},
{
type: "input",
field: "subtitle"
},
{
type: "input",
field: "valueFormat",
value: "{value}"
},
{
type: "ColorInput",
field: "barBackgroundColor"
},
{
type: "switch",
field: "stack"
},
{
type: "switch",
field: "showLegend",
value: !0
},
{
type: "switch",
field: "showSeriesLabel"
}
]);
}
}, oS = "\u997C\u56FE", aS = "pieChart", lS = {
menu: "chart",
icon: "icon-chart-pie",
label: oS,
name: aS,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
return {
type: "fcEcharts",
props: {
type: "pie",
data: [
{ value: 1048, name: "Search Engine" },
{ value: 735, name: "Direct" },
{ value: 580, name: "Email" },
{ value: 484, name: "Union Num" },
{ value: 300, name: "Video Num" }
]
}
};
},
props(e, { t }) {
return Ke(t, "lineChart.props", [
Si(t, "props.data", t("com.lineChart.data")),
{
type: "input",
field: "title"
},
{
type: "input",
field: "subtitle"
},
{
type: "select",
field: "pieType",
options: gt(t, [
{ label: "pie", value: "pie" },
{ label: "doughnut", value: "doughnut" },
{ label: "half-doughnut", value: "half-doughnut" }
], "com.lineChart.pieTypeOpt")
},
{
type: "switch",
field: "showLegend",
value: !0
}
]);
}
}, sS = "\u6F0F\u6597\u56FE", uS = "funnelChart", dS = {
menu: "chart",
icon: "icon-chart-funnel",
label: sS,
name: uS,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
return {
type: "fcEcharts",
props: {
type: "funnel",
data: [
{ value: 60, name: "Visit" },
{ value: 40, name: "Inquiry" },
{ value: 20, name: "Order" },
{ value: 80, name: "Click" },
{ value: 100, name: "Show" }
]
}
};
},
props(e, { t }) {
return Ke(t, "lineChart.props", [
Si(t, "props.data", t("com.lineChart.data")),
{
type: "input",
field: "title"
},
{
type: "input",
field: "subtitle"
},
{
type: "select",
field: "funnelSort",
options: gt(t, [
{ label: "descending", value: "descending" },
{ label: "ascending", value: "ascending" }
], "com.lineChart.funnelSortOpt"),
value: "descending"
},
{
type: "switch",
field: "showLegend",
value: !0
}
]);
}
}, fS = "\u4EEA\u8868\u76D8", cS = "gaugeChart", pS = {
menu: "chart",
icon: "icon-chart-gauge",
label: fS,
name: cS,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
return {
type: "fcEcharts",
props: {
type: "gauge",
value: 50
}
};
},
props(e, { t }) {
return Ke(t, "lineChart.props", [
{
type: "inputNumber",
field: "value"
},
{
type: "input",
field: "title"
},
{
type: "input",
field: "subtitle"
},
{
type: "inputNumber",
field: "min"
},
{
type: "inputNumber",
field: "max"
}
]);
}
}, hS = "\u96F7\u8FBE\u56FE", mS = "radarChart", vS = {
menu: "chart",
icon: "icon-chart-radar",
label: hS,
name: mS,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
return {
type: "fcEcharts",
props: {
type: "radar",
indicator: [
{ name: "Sales", max: 6500 },
{ name: "Administration", max: 16e3 },
{ name: "Information Technology", max: 3e4 },
{ name: "Customer Support", max: 38e3 },
{ name: "Development", max: 52e3 },
{ name: "Marketing", max: 25e3 }
],
data: [
{
value: [4200, 3e3, 2e4, 35e3, 5e4, 18e3],
name: "Allocated Budget"
},
{
value: [5e3, 14e3, 28e3, 26e3, 42e3, 21e3],
name: "Actual Spending"
}
]
}
};
},
props(e, { t }) {
return Ke(t, "lineChart.props", [
Si(t, "props.data", t("com.lineChart.data")),
{
type: "TableOptions",
field: "indicator",
props: {
column: [{ label: t("props.name"), key: "name" }, { label: t("com.lineChart.props.max"), key: "max" }]
}
},
{
type: "input",
field: "title"
},
{
type: "input",
field: "subtitle"
},
{
type: "switch",
field: "showLegend",
value: !0
},
{
type: "switch",
field: "showSeriesLabel"
}
]);
}
}, gS = "\u6563\u70B9\u56FE", yS = "scatterChart", bS = {
menu: "chart",
icon: "icon-chart-scatter",
label: gS,
name: yS,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
return {
type: "fcEcharts",
props: {
type: "scatter",
data: [
[
[161.2, 51.6],
[167.5, 59],
[159.5, 49.2],
[157, 63],
[155.8, 53.6],
[170, 59],
[159.1, 47.6],
[166, 69.8],
[176.2, 66.8],
[160.2, 75.2]
],
[
[172.5, 55.2],
[170.9, 54.2],
[172.9, 62.5],
[153.4, 42],
[160, 50],
[147.2, 49.8],
[168.2, 49.2],
[175, 73.2],
[157, 47.8],
[167.6, 68.8]
]
]
}
};
},
props(e, { t }) {
return Ke(t, "lineChart.props", [
Si(t, "props.data", t("com.lineChart.data")),
{
type: "input",
field: "title"
},
{
type: "input",
field: "subtitle"
}
]);
}
}, _S = "\u81EA\u5B9A\u4E49\u56FE\u8868", wS = "customChart", AS = {
menu: "chart",
icon: "icon-chart-custom",
label: _S,
name: wS,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
return {
type: "fcEcharts",
style: {
height: "500px"
},
props: {
type: "custom",
config: {
builderJson: {
all: 10887,
charts: {
map: 3237,
lines: 2164,
bar: 7561,
line: 7778,
pie: 7355,
scatter: 2405,
candlestick: 1842,
radar: 2090,
heatmap: 1762,
treemap: 1593,
graph: 2060,
boxplot: 1537,
parallel: 1908,
gauge: 2107,
funnel: 1692,
sankey: 1568
},
components: {
geo: 2788,
title: 9575,
legend: 9400,
tooltip: 9466,
grid: 9266,
markPoint: 3419,
markLine: 2984,
timeline: 2739,
dataZoom: 2744,
visualMap: 2466,
toolbox: 3034,
polar: 1945
},
ie: 9743
},
downloadJson: {
"echarts.min.js": 17365,
"echarts.simple.min.js": 4079,
"echarts.common.min.js": 6929,
"echarts.js": 14890
},
themeJson: {
"dark.js": 1594,
"infographic.js": 925,
"shine.js": 1608,
"roma.js": 721,
"macarons.js": 2179,
"vintage.js": 1982
}
},
loadOptions: `$FNX:const builderJson = $inject.args[0]?.builderJson;
const downloadJson = $inject.args[0]?.downloadJson;
const themeJson = $inject.args[0]?.themeJson;
const waterMarkText = 'ECHARTS';
const canvas = document.createElement('canvas');
const ctx = canvas.getContext('2d');
canvas.width = canvas.height = 100;
ctx.textAlign = 'center';
ctx.textBaseline = 'middle';
ctx.globalAlpha = 0.08;
ctx.font = '20px';
ctx.translate(50, 50);
ctx.rotate(-Math.PI / 4);
ctx.fillText(waterMarkText, 0, 0);
return {
backgroundColor: {
type: 'pattern',
image: canvas,
repeat: 'repeat'
},
tooltip: {},
title: [
{
text: '\u5728\u7EBF\u6784\u5EFA',
subtext: '\u603B\u8BA1 ' + builderJson.all,
left: '25%',
textAlign: 'center'
},
{
text: '\u5404\u7248\u672C\u4E0B\u8F7D',
subtext:
'\u603B\u8BA1 ' +
Object.keys(downloadJson).reduce(function (all, key) {
return all + downloadJson[key];
}, 0),
left: '75%',
textAlign: 'center'
},
{
text: '\u4E3B\u9898\u4E0B\u8F7D',
subtext:
'\u603B\u8BA1 ' +
Object.keys(themeJson).reduce(function (all, key) {
return all + themeJson[key];
}, 0),
left: '75%',
top: '50%',
textAlign: 'center'
}
],
grid: [
{
top: 50,
width: '50%',
bottom: '45%',
left: 10,
containLabel: true
},
{
top: '55%',
width: '50%',
bottom: 0,
left: 10,
containLabel: true
}
],
xAxis: [
{
type: 'value',
max: builderJson.all,
splitLine: {
show: false
}
},
{
type: 'value',
max: builderJson.all,
gridIndex: 1,
splitLine: {
show: false
}
}
],
yAxis: [
{
type: 'category',
data: Object.keys(builderJson.charts),
axisLabel: {
interval: 0,
rotate: 30
},
splitLine: {
show: false
}
},
{
gridIndex: 1,
type: 'category',
data: Object.keys(builderJson.components),
axisLabel: {
interval: 0,
rotate: 30
},
splitLine: {
show: false
}
}
],
series: [
{
type: 'bar',
stack: 'chart',
z: 3,
label: {
position: 'right',
show: true
},
data: Object.keys(builderJson.charts).map(function (key) {
return builderJson.charts[key];
})
},
{
type: 'bar',
stack: 'chart',
silent: true,
itemStyle: {
color: '#eee'
},
data: Object.keys(builderJson.charts).map(function (key) {
return builderJson.all - builderJson.charts[key];
})
},
{
type: 'bar',
stack: 'component',
xAxisIndex: 1,
yAxisIndex: 1,
z: 3,
label: {
position: 'right',
show: true
},
data: Object.keys(builderJson.components).map(function (key) {
return builderJson.components[key];
})
},
{
type: 'bar',
stack: 'component',
silent: true,
xAxisIndex: 1,
yAxisIndex: 1,
itemStyle: {
color: '#eee'
},
data: Object.keys(builderJson.components).map(function (key) {
return builderJson.all - builderJson.components[key];
})
},
{
type: 'pie',
radius: [0, '30%'],
center: ['75%', '25%'],
data: Object.keys(downloadJson).map(function (key) {
return {
name: key.replace('.js', ''),
value: downloadJson[key]
};
})
},
{
type: 'pie',
radius: [0, '30%'],
center: ['75%', '75%'],
data: Object.keys(themeJson).map(function (key) {
return {
name: key.replace('.js', ''),
value: themeJson[key]
};
})
}
]
};`
}
};
},
props(e, { t }) {
return Ke(t, "lineChart.props", [
Si(t, "props.config", t("com.lineChart.data")),
{
type: "FnInput",
field: "loadOptions",
props: {
body: !0,
button: !0,
fnx: !0,
args: [In(t)],
name: "loadOptions"
}
}
]);
}
}, CS = "\u5B50\u8868\u5355\u9009\u62E9\u5668", SS = "fcDataSelect", ES = {
menu: "main",
icon: "icon-data-select",
label: CS,
name: SS,
drag: !0,
input: !0,
mask: !1,
subForm: "scope",
slot: [
{ name: "search", type: "fcInlineForm" },
{ name: "table", type: "dataTable" }
],
event: ["change", "clear"],
validate: ["object", "array"],
parseRule(e) {
e.children.forEach((t) => {
t.slot === "search" ? (delete t.slot, e.props.searchRule = t) : t.slot === "table" && (delete t.slot, e.props.tableRule = t);
}), delete e.children;
},
loadRule(e) {
e.children = [
e.props.searchRule,
e.props.tableRule
], e.children[0].slot = "search", e.children[1].slot = "table", delete e.props.searchRule, delete e.props.tableRule;
},
rule({ t: e }) {
return {
type: "fcDataSelect",
field: rt(),
title: e("com.fcDataSelect.name"),
info: "",
$required: !1,
props: {
title: e("com.select.title"),
labelKey: "name",
valueKey: "name"
}
};
},
props(e, { t }) {
return Ke(t, "select.props", [
{ type: "input", field: "title" },
{ type: "input", field: "labelKey", value: "label" },
{ type: "input", field: "valueKey", value: "value" },
{ type: "switch", field: "autoLoad" },
{ type: "switch", field: "multiple" },
{
type: "switch",
field: "disabled"
},
{ type: "switch", field: "clearable" },
{
type: "inputNumber",
field: "multipleLimit",
props: { min: 0 }
},
{ type: "input", field: "placeholder" }
]);
}
}, ov = [
W_,
K_,
Q_,
IC,
MC,
X_,
j_,
z_,
q_,
tw,
pw,
Yg,
lw,
iw,
Qg,
fw,
mw,
Sw,
xw,
kw,
Rw,
tA,
jC,
zw,
nC,
BC,
DC,
PA,
ES,
Ww,
Kw,
uA,
gA,
_A,
OA,
RA,
EA,
kA,
AA,
aC,
sC,
gC,
$w,
jw,
iA,
LC,
Fw,
pA,
GC,
Aw,
NA,
VA,
UA,
cC,
bC,
wC,
CC,
EC,
TC,
OC,
HC,
QC,
ZC,
tS,
rS,
lS,
dS,
pS,
vS,
bS,
AS,
gw,
mA,
dC,
mC,
IA,
FA,
Bw,
Lw,
Qw,
Xw,
lA,
iC,
rC,
YA,
JA,
ZA,
HA,
GA,
yw,
_w,
qw,
oA,
fA
];
function xS(e) {
return {
icon: e.field ? "icon-input" : "icon-cell",
label: e.field || e.type,
name: "_",
mask: !0,
handleBtn: ["delete"],
rule() {
return e;
},
props() {
return [];
}
};
}
/**!
* Sortable 1.14.0
* @author RubaXa <trash@rubaxa.org>
* @author owenm <owen23355@gmail.com>
* @license MIT
*/
function av(e, t) {
var i = Object.keys(e);
if (Object.getOwnPropertySymbols) {
var r = Object.getOwnPropertySymbols(e);
t && (r = r.filter(function(n) {
return Object.getOwnPropertyDescriptor(e, n).enumerable;
})), i.push.apply(i, r);
}
return i;
}
function Ui(e) {
for (var t = 1; t < arguments.length; t++) {
var i = arguments[t] != null ? arguments[t] : {};
t % 2 ? av(Object(i), !0).forEach(function(r) {
TS(e, r, i[r]);
}) : Object.getOwnPropertyDescriptors ? Object.defineProperties(e, Object.getOwnPropertyDescriptors(i)) : av(Object(i)).forEach(function(r) {
Object.defineProperty(e, r, Object.getOwnPropertyDescriptor(i, r));
});
}
return e;
}
function As(e) {
return typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? As = function(t) {
return typeof t;
} : As = function(t) {
return t && typeof Symbol == "function" && t.constructor === Symbol && t !== Symbol.prototype ? "symbol" : typeof t;
}, As(e);
}
function TS(e, t, i) {
return t in e ? Object.defineProperty(e, t, {
value: i,
enumerable: !0,
configurable: !0,
writable: !0
}) : e[t] = i, e;
}
function rr() {
return rr = Object.assign || function(e) {
for (var t = 1; t < arguments.length; t++) {
var i = arguments[t];
for (var r in i)
Object.prototype.hasOwnProperty.call(i, r) && (e[r] = i[r]);
}
return e;
}, rr.apply(this, arguments);
}
function kS(e, t) {
if (e == null)
return {};
var i = {}, r = Object.keys(e), n, a;
for (a = 0; a < r.length; a++)
n = r[a], !(t.indexOf(n) >= 0) && (i[n] = e[n]);
return i;
}
function OS(e, t) {
if (e == null)
return {};
var i = kS(e, t), r, n;
if (Object.getOwnPropertySymbols) {
var a = Object.getOwnPropertySymbols(e);
for (n = 0; n < a.length; n++)
r = a[n], !(t.indexOf(r) >= 0) && (!Object.prototype.propertyIsEnumerable.call(e, r) || (i[r] = e[r]));
}
return i;
}
var RS = "1.14.0";
function tr(e) {
if (typeof window < "u" && window.navigator)
return !!/* @__PURE__ */ navigator.userAgent.match(e);
}
var or = tr(/(?:Trident.*rv[ :]?11\.|msie|iemobile|Windows Phone)/i), rl = tr(/Edge/i), lv = tr(/firefox/i), Ga = tr(/safari/i) && !tr(/chrome/i) && !tr(/android/i), Zg = tr(/iP(ad|od|hone)/i), DS = tr(/chrome/i) && tr(/android/i), qg = {
capture: !1,
passive: !1
};
function Pt(e, t, i) {
e.addEventListener(t, i, !or && qg);
}
function $t(e, t, i) {
e.removeEventListener(t, i, !or && qg);
}
function Ps(e, t) {
if (!!t) {
if (t[0] === ">" && (t = t.substring(1)), e)
try {
if (e.matches)
return e.matches(t);
if (e.msMatchesSelector)
return e.msMatchesSelector(t);
if (e.webkitMatchesSelector)
return e.webkitMatchesSelector(t);
} catch {
return !1;
}
return !1;
}
}
function $S(e) {
return e.host && e !== document && e.host.nodeType ? e.host : e.parentNode;
}
function Pi(e, t, i, r) {
if (e) {
i = i || document;
do {
if (t != null && (t[0] === ">" ? e.parentNode === i && Ps(e, t) : Ps(e, t)) || r && e === i)
return e;
if (e === i)
break;
} while (e = $S(e));
}
return null;
}
var sv = /\s+/g;
function ti(e, t, i) {
if (e && t)
if (e.classList)
e.classList[i ? "add" : "remove"](t);
else {
var r = (" " + e.className + " ").replace(sv, " ").replace(" " + t + " ", " ");
e.className = (r + (i ? " " + t : "")).replace(sv, " ");
}
}
function _t(e, t, i) {
var r = e && e.style;
if (r) {
if (i === void 0)
return document.defaultView && document.defaultView.getComputedStyle ? i = document.defaultView.getComputedStyle(e, "") : e.currentStyle && (i = e.currentStyle), t === void 0 ? i : i[t];
!(t in r) && t.indexOf("webkit") === -1 && (t = "-webkit-" + t), r[t] = i + (typeof i == "string" ? "" : "px");
}
}
function No(e, t) {
var i = "";
if (typeof e == "string")
i = e;
else
do {
var r = _t(e, "transform");
r && r !== "none" && (i = r + " " + i);
} while (!t && (e = e.parentNode));
var n = window.DOMMatrix || window.WebKitCSSMatrix || window.CSSMatrix || window.MSCSSMatrix;
return n && new n(i);
}
function e0(e, t, i) {
if (e) {
var r = e.getElementsByTagName(t), n = 0, a = r.length;
if (i)
for (; n < a; n++)
i(r[n], n);
return r;
}
return [];
}
function ji() {
var e = document.scrollingElement;
return e || document.documentElement;
}
function yn(e, t, i, r, n) {
if (!(!e.getBoundingClientRect && e !== window)) {
var a, s, u, d, h, p, g;
if (e !== window && e.parentNode && e !== ji() ? (a = e.getBoundingClientRect(), s = a.top, u = a.left, d = a.bottom, h = a.right, p = a.height, g = a.width) : (s = 0, u = 0, d = window.innerHeight, h = window.innerWidth, p = window.innerHeight, g = window.innerWidth), (t || i) && e !== window && (n = n || e.parentNode, !or))
do
if (n && n.getBoundingClientRect && (_t(n, "transform") !== "none" || i && _t(n, "position") !== "static")) {
var _ = n.getBoundingClientRect();
s -= _.top + parseInt(_t(n, "border-top-width")), u -= _.left + parseInt(_t(n, "border-left-width")), d = s + a.height, h = u + a.width;
break;
}
while (n = n.parentNode);
if (r && e !== window) {
var S = No(n || e), b = S && S.a, A = S && S.d;
S && (s /= A, u /= b, g /= b, p /= A, d = s + p, h = u + g);
}
return {
top: s,
left: u,
bottom: d,
right: h,
width: g,
height: p
};
}
}
function uv(e, t, i) {
for (var r = Tr(e, !0), n = yn(e)[t]; r; ) {
var a = yn(r)[i], s = void 0;
if (i === "top" || i === "left" ? s = n >= a : s = n <= a, !s)
return r;
if (r === ji())
break;
r = Tr(r, !1);
}
return !1;
}
function Ho(e, t, i, r) {
for (var n = 0, a = 0, s = e.children; a < s.length; ) {
if (s[a].style.display !== "none" && s[a] !== wt.ghost && (r || s[a] !== wt.dragged) && Pi(s[a], i.draggable, e, !1)) {
if (n === t)
return s[a];
n++;
}
a++;
}
return null;
}
function xc(e, t) {
for (var i = e.lastElementChild; i && (i === wt.ghost || _t(i, "display") === "none" || t && !Ps(i, t)); )
i = i.previousElementSibling;
return i || null;
}
function fi(e, t) {
var i = 0;
if (!e || !e.parentNode)
return -1;
for (; e = e.previousElementSibling; )
e.nodeName.toUpperCase() !== "TEMPLATE" && e !== wt.clone && (!t || Ps(e, t)) && i++;
return i;
}
function dv(e) {
var t = 0, i = 0, r = ji();
if (e)
do {
var n = No(e), a = n.a, s = n.d;
t += e.scrollLeft * a, i += e.scrollTop * s;
} while (e !== r && (e = e.parentNode));
return [t, i];
}
function IS(e, t) {
for (var i in e)
if (!!e.hasOwnProperty(i)) {
for (var r in t)
if (t.hasOwnProperty(r) && t[r] === e[i][r])
return Number(i);
}
return -1;
}
function Tr(e, t) {
if (!e || !e.getBoundingClientRect)
return ji();
var i = e, r = !1;
do
if (i.clientWidth < i.scrollWidth || i.clientHeight < i.scrollHeight) {
var n = _t(i);
if (i.clientWidth < i.scrollWidth && (n.overflowX == "auto" || n.overflowX == "scroll") || i.clientHeight < i.scrollHeight && (n.overflowY == "auto" || n.overflowY == "scroll")) {
if (!i.getBoundingClientRect || i === document.body)
return ji();
if (r || t)
return i;
r = !0;
}
}
while (i = i.parentNode);
return ji();
}
function FS(e, t) {
if (e && t)
for (var i in t)
t.hasOwnProperty(i) && (e[i] = t[i]);
return e;
}
function hf(e, t) {
return Math.round(e.top) === Math.round(t.top) && Math.round(e.left) === Math.round(t.left) && Math.round(e.height) === Math.round(t.height) && Math.round(e.width) === Math.round(t.width);
}
var Ka;
function t0(e, t) {
return function() {
if (!Ka) {
var i = arguments, r = this;
i.length === 1 ? e.call(r, i[0]) : e.apply(r, i), Ka = setTimeout(function() {
Ka = void 0;
}, t);
}
};
}
function MS() {
clearTimeout(Ka), Ka = void 0;
}
function n0(e, t, i) {
e.scrollLeft += t, e.scrollTop += i;
}
function i0(e) {
var t = window.Polymer, i = window.jQuery || window.Zepto;
return t && t.dom ? t.dom(e).cloneNode(!0) : i ? i(e).clone(!0)[0] : e.cloneNode(!0);
}
var ri = "Sortable" + new Date().getTime();
function PS() {
var e = [], t;
return {
captureAnimationState: function() {
if (e = [], !!this.options.animation) {
var r = [].slice.call(this.el.children);
r.forEach(function(n) {
if (!(_t(n, "display") === "none" || n === wt.ghost)) {
e.push({
target: n,
rect: yn(n)
});
var a = Ui({}, e[e.length - 1].rect);
if (n.thisAnimationDuration) {
var s = No(n, !0);
s && (a.top -= s.f, a.left -= s.e);
}
n.fromRect = a;
}
});
}
},
addAnimationState: function(r) {
e.push(r);
},
removeAnimationState: function(r) {
e.splice(IS(e, {
target: r
}), 1);
},
animateAll: function(r) {
var n = this;
if (!this.options.animation) {
clearTimeout(t), typeof r == "function" && r();
return;
}
var a = !1, s = 0;
e.forEach(function(u) {
var d = 0, h = u.target, p = h.fromRect, g = yn(h), _ = h.prevFromRect, S = h.prevToRect, b = u.rect, A = No(h, !0);
A && (g.top -= A.f, g.left -= A.e), h.toRect = g, h.thisAnimationDuration && hf(_, g) && !hf(p, g) && (b.top - g.top) / (b.left - g.left) === (p.top - g.top) / (p.left - g.left) && (d = NS(b, _, S, n.options)), hf(g, p) || (h.prevFromRect = p, h.prevToRect = g, d || (d = n.options.animation), n.animate(h, b, g, d)), d && (a = !0, s = Math.max(s, d), clearTimeout(h.animationResetTimer), h.animationResetTimer = setTimeout(function() {
h.animationTime = 0, h.prevFromRect = null, h.fromRect = null, h.prevToRect = null, h.thisAnimationDuration = null;
}, d), h.thisAnimationDuration = d);
}), clearTimeout(t), a ? t = setTimeout(function() {
typeof r == "function" && r();
}, s) : typeof r == "function" && r(), e = [];
},
animate: function(r, n, a, s) {
if (s) {
_t(r, "transition", ""), _t(r, "transform", "");
var u = No(this.el), d = u && u.a, h = u && u.d, p = (n.left - a.left) / (d || 1), g = (n.top - a.top) / (h || 1);
r.animatingX = !!p, r.animatingY = !!g, _t(r, "transform", "translate3d(" + p + "px," + g + "px,0)"), this.forRepaintDummy = LS(r), _t(r, "transition", "transform " + s + "ms" + (this.options.easing ? " " + this.options.easing : "")), _t(r, "transform", "translate3d(0,0,0)"), typeof r.animated == "number" && clearTimeout(r.animated), r.animated = setTimeout(function() {
_t(r, "transition", ""), _t(r, "transform", ""), r.animated = !1, r.animatingX = !1, r.animatingY = !1;
}, s);
}
}
};
}
function LS(e) {
return e.offsetWidth;
}
function NS(e, t, i, r) {
return Math.sqrt(Math.pow(t.top - e.top, 2) + Math.pow(t.left - e.left, 2)) / Math.sqrt(Math.pow(t.top - i.top, 2) + Math.pow(t.left - i.left, 2)) * r.animation;
}
var xo = [], mf = {
initializeByDefault: !0
}, ol = {
mount: function(t) {
for (var i in mf)
mf.hasOwnProperty(i) && !(i in t) && (t[i] = mf[i]);
xo.forEach(function(r) {
if (r.pluginName === t.pluginName)
throw "Sortable: Cannot mount plugin ".concat(t.pluginName, " more than once");
}), xo.push(t);
},
pluginEvent: function(t, i, r) {
var n = this;
this.eventCanceled = !1, r.cancel = function() {
n.eventCanceled = !0;
};
var a = t + "Global";
xo.forEach(function(s) {
!i[s.pluginName] || (i[s.pluginName][a] && i[s.pluginName][a](Ui({
sortable: i
}, r)), i.options[s.pluginName] && i[s.pluginName][t] && i[s.pluginName][t](Ui({
sortable: i
}, r)));
});
},
initializePlugins: function(t, i, r, n) {
xo.forEach(function(u) {
var d = u.pluginName;
if (!(!t.options[d] && !u.initializeByDefault)) {
var h = new u(t, i, t.options);
h.sortable = t, h.options = t.options, t[d] = h, rr(r, h.defaults);
}
});
for (var a in t.options)
if (!!t.options.hasOwnProperty(a)) {
var s = this.modifyOption(t, a, t.options[a]);
typeof s < "u" && (t.options[a] = s);
}
},
getEventProperties: function(t, i) {
var r = {};
return xo.forEach(function(n) {
typeof n.eventProperties == "function" && rr(r, n.eventProperties.call(i[n.pluginName], t));
}), r;
},
modifyOption: function(t, i, r) {
var n;
return xo.forEach(function(a) {
!t[a.pluginName] || a.optionListeners && typeof a.optionListeners[i] == "function" && (n = a.optionListeners[i].call(t[a.pluginName], r));
}), n;
}
};
function BS(e) {
var t = e.sortable, i = e.rootEl, r = e.name, n = e.targetEl, a = e.cloneEl, s = e.toEl, u = e.fromEl, d = e.oldIndex, h = e.newIndex, p = e.oldDraggableIndex, g = e.newDraggableIndex, _ = e.originalEvent, S = e.putSortable, b = e.extraEventProperties;
if (t = t || i && i[ri], !!t) {
var A, w = t.options, m = "on" + r.charAt(0).toUpperCase() + r.substr(1);
window.CustomEvent && !or && !rl ? A = new CustomEvent(r, {
bubbles: !0,
cancelable: !0
}) : (A = document.createEvent("Event"), A.initEvent(r, !0, !0)), A.to = s || i, A.from = u || i, A.item = n || i, A.clone = a, A.oldIndex = d, A.newIndex = h, A.oldDraggableIndex = p, A.newDraggableIndex = g, A.originalEvent = _, A.pullMode = S ? S.lastPutMode : void 0;
var y = Ui(Ui({}, b), ol.getEventProperties(r, t));
for (var E in y)
A[E] = y[E];
i && i.dispatchEvent(A), w[m] && w[m].call(t, A);
}
}
var VS = ["evt"], Gn = function(t, i) {
var r = arguments.length > 2 && arguments[2] !== void 0 ? arguments[2] : {}, n = r.evt, a = OS(r, VS);
ol.pluginEvent.bind(wt)(t, i, Ui({
dragEl: et,
parentEl: qt,
ghostEl: xt,
rootEl: Yt,
nextEl: Ur,
lastDownEl: Cs,
cloneEl: en,
cloneHidden: Er,
dragStarted: Ua,
putSortable: En,
activeSortable: wt.active,
originalEvent: n,
oldIndex: Po,
oldDraggableIndex: Ya,
newIndex: ni,
newDraggableIndex: Sr,
hideGhostForTarget: l0,
unhideGhostForTarget: s0,
cloneNowHidden: function() {
Er = !0;
},
cloneNowShown: function() {
Er = !1;
},
dispatchSortableEvent: function(u) {
jn({
sortable: i,
name: u,
originalEvent: n
});
}
}, a));
};
function jn(e) {
BS(Ui({
putSortable: En,
cloneEl: en,
targetEl: et,
rootEl: Yt,
oldIndex: Po,
oldDraggableIndex: Ya,
newIndex: ni,
newDraggableIndex: Sr
}, e));
}
var et, qt, xt, Yt, Ur, Cs, en, Er, Po, ni, Ya, Sr, is, En, Mo = !1, Ls = !1, Ns = [], Vr, Ai, vf, gf, fv, cv, Ua, To, Qa, Ja = !1, rs = !1, Ss, On, yf = [], ec = !1, Bs = [], eu = typeof document < "u", os = Zg, pv = rl || or ? "cssFloat" : "float", jS = eu && !DS && !Zg && "draggable" in document.createElement("div"), r0 = function() {
if (!!eu) {
if (or)
return !1;
var e = document.createElement("x");
return e.style.cssText = "pointer-events:auto", e.style.pointerEvents === "auto";
}
}(), o0 = function(t, i) {
var r = _t(t), n = parseInt(r.width) - parseInt(r.paddingLeft) - parseInt(r.paddingRight) - parseInt(r.borderLeftWidth) - parseInt(r.borderRightWidth), a = Ho(t, 0, i), s = Ho(t, 1, i), u = a && _t(a), d = s && _t(s), h = u && parseInt(u.marginLeft) + parseInt(u.marginRight) + yn(a).width, p = d && parseInt(d.marginLeft) + parseInt(d.marginRight) + yn(s).width;
if (r.display === "flex")
return r.flexDirection === "column" || r.flexDirection === "column-reverse" ? "vertical" : "horizontal";
if (r.display === "grid")
return r.gridTemplateColumns.split(" ").length <= 1 ? "vertical" : "horizontal";
if (a && u.float && u.float !== "none") {
var g = u.float === "left" ? "left" : "right";
return s && (d.clear === "both" || d.clear === g) ? "vertical" : "horizontal";
}
return a && (u.display === "block" || u.display === "flex" || u.display === "table" || u.display === "grid" || h >= n && r[pv] === "none" || s && r[pv] === "none" && h + p > n) ? "vertical" : "horizontal";
}, US = function(t, i, r) {
var n = r ? t.left : t.top, a = r ? t.right : t.bottom, s = r ? t.width : t.height, u = r ? i.left : i.top, d = r ? i.right : i.bottom, h = r ? i.width : i.height;
return n === u || a === d || n + s / 2 === u + h / 2;
}, zS = function(t, i) {
var r;
return Ns.some(function(n) {
var a = n[ri].options.emptyInsertThreshold;
if (!(!a || xc(n))) {
var s = yn(n), u = t >= s.left - a && t <= s.right + a, d = i >= s.top - a && i <= s.bottom + a;
if (u && d)
return r = n;
}
}), r;
}, a0 = function(t) {
function i(a, s) {
return function(u, d, h, p) {
var g = u.options.group.name && d.options.group.name && u.options.group.name === d.options.group.name;
if (a == null && (s || g))
return !0;
if (a == null || a === !1)
return !1;
if (s && a === "clone")
return a;
if (typeof a == "function")
return i(a(u, d, h, p), s)(u, d, h, p);
var _ = (s ? u : d).options.group.name;
return a === !0 || typeof a == "string" && a === _ || a.join && a.indexOf(_) > -1;
};
}
var r = {}, n = t.group;
(!n || As(n) != "object") && (n = {
name: n
}), r.name = n.name, r.checkPull = i(n.pull, !0), r.checkPut = i(n.put), r.revertClone = n.revertClone, t.group = r;
}, l0 = function() {
!r0 && xt && _t(xt, "display", "none");
}, s0 = function() {
!r0 && xt && _t(xt, "display", "");
};
eu && document.addEventListener("click", function(e) {
if (Ls)
return e.preventDefault(), e.stopPropagation && e.stopPropagation(), e.stopImmediatePropagation && e.stopImmediatePropagation(), Ls = !1, !1;
}, !0);
var jr = function(t) {
if (et) {
t = t.touches ? t.touches[0] : t;
var i = zS(t.clientX, t.clientY);
if (i) {
var r = {};
for (var n in t)
t.hasOwnProperty(n) && (r[n] = t[n]);
r.target = r.rootEl = i, r.preventDefault = void 0, r.stopPropagation = void 0, i[ri]._onDragOver(r);
}
}
}, HS = function(t) {
et && et.parentNode[ri]._isOutsideThisEl(t.target);
};
function wt(e, t) {
if (!(e && e.nodeType && e.nodeType === 1))
throw "Sortable: `el` must be an HTMLElement, not ".concat({}.toString.call(e));
this.el = e, this.options = t = rr({}, t), e[ri] = this;
var i = {
group: null,
sort: !0,
disabled: !1,
store: null,
handle: null,
draggable: /^[uo]l$/i.test(e.nodeName) ? ">li" : ">*",
swapThreshold: 1,
invertSwap: !1,
invertedSwapThreshold: null,
removeCloneOnHide: !0,
direction: function() {
return o0(e, this.options);
},
ghostClass: "sortable-ghost",
chosenClass: "sortable-chosen",
dragClass: "sortable-drag",
ignore: "a, img",
filter: null,
preventOnFilter: !0,
animation: 0,
easing: null,
setData: function(s, u) {
s.setData("Text", u.textContent);
},
dropBubble: !1,
dragoverBubble: !1,
dataIdAttr: "data-id",
delay: 0,
delayOnTouchOnly: !1,
touchStartThreshold: (Number.parseInt ? Number : window).parseInt(window.devicePixelRatio, 10) || 1,
forceFallback: !1,
fallbackClass: "sortable-fallback",
fallbackOnBody: !1,
fallbackTolerance: 0,
fallbackOffset: {
x: 0,
y: 0
},
supportPointer: wt.supportPointer !== !1 && "PointerEvent" in window && !Ga,
emptyInsertThreshold: 5
};
ol.initializePlugins(this, e, i);
for (var r in i)
!(r in t) && (t[r] = i[r]);
a0(t);
for (var n in this)
n.charAt(0) === "_" && typeof this[n] == "function" && (this[n] = this[n].bind(this));
this.nativeDraggable = t.forceFallback ? !1 : jS, this.nativeDraggable && (this.options.touchStartThreshold = 1), t.supportPointer ? Pt(e, "pointerdown", this._onTapStart) : (Pt(e, "mousedown", this._onTapStart), Pt(e, "touchstart", this._onTapStart)), this.nativeDraggable && (Pt(e, "dragover", this), Pt(e, "dragenter", this)), Ns.push(this.el), t.store && t.store.get && this.sort(t.store.get(this) || []), rr(this, PS());
}
wt.prototype = {
constructor: wt,
_isOutsideThisEl: function(t) {
!this.el.contains(t) && t !== this.el && (To = null);
},
_getDirection: function(t, i) {
return typeof this.options.direction == "function" ? this.options.direction.call(this, t, i, et) : this.options.direction;
},
_onTapStart: function(t) {
if (!!t.cancelable) {
var i = this, r = this.el, n = this.options, a = n.preventOnFilter, s = t.type, u = t.touches && t.touches[0] || t.pointerType && t.pointerType === "touch" && t, d = (u || t).target, h = t.target.shadowRoot && (t.path && t.path[0] || t.composedPath && t.composedPath()[0]) || d, p = n.filter;
if (ZS(r), !et && !(/mousedown|pointerdown/.test(s) && t.button !== 0 || n.disabled) && !h.isContentEditable && !(!this.nativeDraggable && Ga && d && d.tagName.toUpperCase() === "SELECT") && (d = Pi(d, n.draggable, r, !1), !(d && d.animated) && Cs !== d)) {
if (Po = fi(d), Ya = fi(d, n.draggable), typeof p == "function") {
if (p.call(this, t, d, this)) {
jn({
sortable: i,
rootEl: h,
name: "filter",
targetEl: d,
toEl: r,
fromEl: r
}), Gn("filter", i, {
evt: t
}), a && t.cancelable && t.preventDefault();
return;
}
} else if (p && (p = p.split(",").some(function(g) {
if (g = Pi(h, g.trim(), r, !1), g)
return jn({
sortable: i,
rootEl: g,
name: "filter",
targetEl: d,
fromEl: r,
toEl: r
}), Gn("filter", i, {
evt: t
}), !0;
}), p)) {
a && t.cancelable && t.preventDefault();
return;
}
n.handle && !Pi(h, n.handle, r, !1) || this._prepareDragStart(t, u, d);
}
}
},
_prepareDragStart: function(t, i, r) {
var n = this, a = n.el, s = n.options, u = a.ownerDocument, d;
if (r && !et && r.parentNode === a) {
var h = yn(r);
if (Yt = a, et = r, qt = et.parentNode, Ur = et.nextSibling, Cs = r, is = s.group, wt.dragged = et, Vr = {
target: et,
clientX: (i || t).clientX,
clientY: (i || t).clientY
}, fv = Vr.clientX - h.left, cv = Vr.clientY - h.top, this._lastX = (i || t).clientX, this._lastY = (i || t).clientY, et.style["will-change"] = "all", d = function() {
if (Gn("delayEnded", n, {
evt: t
}), wt.eventCanceled) {
n._onDrop();
return;
}
n._disableDelayedDragEvents(), !lv && n.nativeDraggable && (et.draggable = !0), n._triggerDragStart(t, i), jn({
sortable: n,
name: "choose",
originalEvent: t
}), ti(et, s.chosenClass, !0);
}, s.ignore.split(",").forEach(function(p) {
e0(et, p.trim(), bf);
}), Pt(u, "dragover", jr), Pt(u, "mousemove", jr), Pt(u, "touchmove", jr), Pt(u, "mouseup", n._onDrop), Pt(u, "touchend", n._onDrop), Pt(u, "touchcancel", n._onDrop), lv && this.nativeDraggable && (this.options.touchStartThreshold = 4, et.draggable = !0), Gn("delayStart", this, {
evt: t
}), s.delay && (!s.delayOnTouchOnly || i) && (!this.nativeDraggable || !(rl || or))) {
if (wt.eventCanceled) {
this._onDrop();
return;
}
Pt(u, "mouseup", n._disableDelayedDrag), Pt(u, "touchend", n._disableDelayedDrag), Pt(u, "touchcancel", n._disableDelayedDrag), Pt(u, "mousemove", n._delayedDragTouchMoveHandler), Pt(u, "touchmove", n._delayedDragTouchMoveHandler), s.supportPointer && Pt(u, "pointermove", n._delayedDragTouchMoveHandler), n._dragStartTimer = setTimeout(d, s.delay);
} else
d();
}
},
_delayedDragTouchMoveHandler: function(t) {
var i = t.touches ? t.touches[0] : t;
Math.max(Math.abs(i.clientX - this._lastX), Math.abs(i.clientY - this._lastY)) >= Math.floor(this.options.touchStartThreshold / (this.nativeDraggable && window.devicePixelRatio || 1)) && this._disableDelayedDrag();
},
_disableDelayedDrag: function() {
et && bf(et), clearTimeout(this._dragStartTimer), this._disableDelayedDragEvents();
},
_disableDelayedDragEvents: function() {
var t = this.el.ownerDocument;
$t(t, "mouseup", this._disableDelayedDrag), $t(t, "touchend", this._disableDelayedDrag), $t(t, "touchcancel", this._disableDelayedDrag), $t(t, "mousemove", this._delayedDragTouchMoveHandler), $t(t, "touchmove", this._delayedDragTouchMoveHandler), $t(t, "pointermove", this._delayedDragTouchMoveHandler);
},
_triggerDragStart: function(t, i) {
i = i || t.pointerType == "touch" && t, !this.nativeDraggable || i ? this.options.supportPointer ? Pt(document, "pointermove", this._onTouchMove) : i ? Pt(document, "touchmove", this._onTouchMove) : Pt(document, "mousemove", this._onTouchMove) : (Pt(et, "dragend", this), Pt(Yt, "dragstart", this._onDragStart));
try {
document.selection ? Es(function() {
document.selection.empty();
}) : window.getSelection().removeAllRanges();
} catch {
}
},
_dragStarted: function(t, i) {
if (Mo = !1, Yt && et) {
Gn("dragStarted", this, {
evt: i
}), this.nativeDraggable && Pt(document, "dragover", HS);
var r = this.options;
!t && ti(et, r.dragClass, !1), ti(et, r.ghostClass, !0), wt.active = this, t && this._appendGhost(), jn({
sortable: this,
name: "start",
originalEvent: i
});
} else
this._nulling();
},
_emulateDragOver: function() {
if (Ai) {
this._lastX = Ai.clientX, this._lastY = Ai.clientY, l0();
for (var t = document.elementFromPoint(Ai.clientX, Ai.clientY), i = t; t && t.shadowRoot && (t = t.shadowRoot.elementFromPoint(Ai.clientX, Ai.clientY), t !== i); )
i = t;
if (et.parentNode[ri]._isOutsideThisEl(t), i)
do {
if (i[ri]) {
var r = void 0;
if (r = i[ri]._onDragOver({
clientX: Ai.clientX,
clientY: Ai.clientY,
target: t,
rootEl: i
}), r && !this.options.dragoverBubble)
break;
}
t = i;
} while (i = i.parentNode);
s0();
}
},
_onTouchMove: function(t) {
if (Vr) {
var i = this.options, r = i.fallbackTolerance, n = i.fallbackOffset, a = t.touches ? t.touches[0] : t, s = xt && No(xt, !0), u = xt && s && s.a, d = xt && s && s.d, h = os && On && dv(On), p = (a.clientX - Vr.clientX + n.x) / (u || 1) + (h ? h[0] - yf[0] : 0) / (u || 1), g = (a.clientY - Vr.clientY + n.y) / (d || 1) + (h ? h[1] - yf[1] : 0) / (d || 1);
if (!wt.active && !Mo) {
if (r && Math.max(Math.abs(a.clientX - this._lastX), Math.abs(a.clientY - this._lastY)) < r)
return;
this._onDragStart(t, !0);
}
if (xt) {
s ? (s.e += p - (vf || 0), s.f += g - (gf || 0)) : s = {
a: 1,
b: 0,
c: 0,
d: 1,
e: p,
f: g
};
var _ = "matrix(".concat(s.a, ",").concat(s.b, ",").concat(s.c, ",").concat(s.d, ",").concat(s.e, ",").concat(s.f, ")");
_t(xt, "webkitTransform", _), _t(xt, "mozTransform", _), _t(xt, "msTransform", _), _t(xt, "transform", _), vf = p, gf = g, Ai = a;
}
t.cancelable && t.preventDefault();
}
},
_appendGhost: function() {
if (!xt) {
var t = this.options.fallbackOnBody ? document.body : Yt, i = yn(et, !0, os, !0, t), r = this.options;
if (os) {
for (On = t; _t(On, "position") === "static" && _t(On, "transform") === "none" && On !== document; )
On = On.parentNode;
On !== document.body && On !== document.documentElement ? (On === document && (On = ji()), i.top += On.scrollTop, i.left += On.scrollLeft) : On = ji(), yf = dv(On);
}
xt = et.cloneNode(!0), ti(xt, r.ghostClass, !1), ti(xt, r.fallbackClass, !0), ti(xt, r.dragClass, !0), _t(xt, "transition", ""), _t(xt, "transform", ""), _t(xt, "box-sizing", "border-box"), _t(xt, "margin", 0), _t(xt, "top", i.top), _t(xt, "left", i.left), _t(xt, "width", i.width), _t(xt, "height", i.height), _t(xt, "opacity", "0.8"), _t(xt, "position", os ? "absolute" : "fixed"), _t(xt, "zIndex", "100000"), _t(xt, "pointerEvents", "none"), wt.ghost = xt, t.appendChild(xt), _t(xt, "transform-origin", fv / parseInt(xt.style.width) * 100 + "% " + cv / parseInt(xt.style.height) * 100 + "%");
}
},
_onDragStart: function(t, i) {
var r = this, n = t.dataTransfer, a = r.options;
if (Gn("dragStart", this, {
evt: t
}), wt.eventCanceled) {
this._onDrop();
return;
}
Gn("setupClone", this), wt.eventCanceled || (en = i0(et), en.draggable = !1, en.style["will-change"] = "", this._hideClone(), ti(en, this.options.chosenClass, !1), wt.clone = en), r.cloneId = Es(function() {
Gn("clone", r), !wt.eventCanceled && (r.options.removeCloneOnHide || Yt.insertBefore(en, et), r._hideClone(), jn({
sortable: r,
name: "clone"
}));
}), !i && ti(et, a.dragClass, !0), i ? (Ls = !0, r._loopId = setInterval(r._emulateDragOver, 50)) : ($t(document, "mouseup", r._onDrop), $t(document, "touchend", r._onDrop), $t(document, "touchcancel", r._onDrop), n && (n.effectAllowed = "move", a.setData && a.setData.call(r, n, et)), Pt(document, "drop", r), _t(et, "transform", "translateZ(0)")), Mo = !0, r._dragStartId = Es(r._dragStarted.bind(r, i, t)), Pt(document, "selectstart", r), Ua = !0, Ga && _t(document.body, "user-select", "none");
},
_onDragOver: function(t) {
var i = this.el, r = t.target, n, a, s, u = this.options, d = u.group, h = wt.active, p = is === d, g = u.sort, _ = En || h, S, b = this, A = !1;
if (ec)
return;
function w(C, q) {
Gn(C, b, Ui({
evt: t,
isOwner: p,
axis: S ? "vertical" : "horizontal",
revert: s,
dragRect: n,
targetRect: a,
canSort: g,
fromSortable: _,
target: r,
completed: y,
onMove: function(Y, ue) {
return as(Yt, i, et, n, Y, yn(Y), t, ue);
},
changed: E
}, q));
}
function m() {
w("dragOverAnimationCapture"), b.captureAnimationState(), b !== _ && _.captureAnimationState();
}
function y(C) {
return w("dragOverCompleted", {
insertion: C
}), C && (p ? h._hideClone() : h._showClone(b), b !== _ && (ti(et, En ? En.options.ghostClass : h.options.ghostClass, !1), ti(et, u.ghostClass, !0)), En !== b && b !== wt.active ? En = b : b === wt.active && En && (En = null), _ === b && (b._ignoreWhileAnimating = r), b.animateAll(function() {
w("dragOverAnimationComplete"), b._ignoreWhileAnimating = null;
}), b !== _ && (_.animateAll(), _._ignoreWhileAnimating = null)), (r === et && !et.animated || r === i && !r.animated) && (To = null), !u.dragoverBubble && !t.rootEl && r !== document && (et.parentNode[ri]._isOutsideThisEl(t.target), !C && jr(t)), !u.dragoverBubble && t.stopPropagation && t.stopPropagation(), A = !0;
}
function E() {
ni = fi(et), Sr = fi(et, u.draggable), jn({
sortable: b,
name: "change",
toEl: i,
newIndex: ni,
newDraggableIndex: Sr,
originalEvent: t
});
}
if (t.preventDefault !== void 0 && t.cancelable && t.preventDefault(), r = Pi(r, u.draggable, i, !0), w("dragOver"), wt.eventCanceled)
return A;
if (et.contains(t.target) || r.animated && r.animatingX && r.animatingY || b._ignoreWhileAnimating === r)
return y(!1);
if (Ls = !1, h && !u.disabled && (p ? g || (s = qt !== Yt) : En === this || (this.lastPutMode = is.checkPull(this, h, et, t)) && d.checkPut(this, h, et, t))) {
if (S = this._getDirection(t, r) === "vertical", n = yn(et), w("dragOverValid"), wt.eventCanceled)
return A;
if (s)
return qt = Yt, m(), this._hideClone(), w("revert"), wt.eventCanceled || (Ur ? Yt.insertBefore(et, Ur) : Yt.appendChild(et)), y(!0);
var x = xc(i, u.draggable);
if (!x || YS(t, S, this) && !x.animated) {
if (x === et)
return y(!1);
if (x && i === t.target && (r = x), r && (a = yn(r)), as(Yt, i, et, n, r, a, t, !!r) !== !1)
return m(), i.appendChild(et), qt = i, E(), y(!0);
} else if (x && KS(t, S, this)) {
var k = Ho(i, 0, u, !0);
if (k === et)
return y(!1);
if (r = k, a = yn(r), as(Yt, i, et, n, r, a, t, !1) !== !1)
return m(), i.insertBefore(et, k), qt = i, E(), y(!0);
} else if (r.parentNode === i) {
a = yn(r);
var D = 0, P, M = et.parentNode !== i, B = !US(et.animated && et.toRect || n, r.animated && r.toRect || a, S), T = S ? "top" : "left", $ = uv(r, "top", "top") || uv(et, "top", "top"), V = $ ? $.scrollTop : void 0;
To !== r && (P = a[T], Ja = !1, rs = !B && u.invertSwap || M), D = QS(t, r, a, S, B ? 1 : u.swapThreshold, u.invertedSwapThreshold == null ? u.swapThreshold : u.invertedSwapThreshold, rs, To === r);
var z;
if (D !== 0) {
var H = fi(et);
do
H -= D, z = qt.children[H];
while (z && (_t(z, "display") === "none" || z === xt));
}
if (D === 0 || z === r)
return y(!1);
To = r, Qa = D;
var I = r.nextElementSibling, U = !1;
U = D === 1;
var F = as(Yt, i, et, n, r, a, t, U);
if (F !== !1)
return (F === 1 || F === -1) && (U = F === 1), ec = !0, setTimeout(GS, 30), m(), U && !I ? i.appendChild(et) : r.parentNode.insertBefore(et, U ? I : r), $ && n0($, 0, V - $.scrollTop), qt = et.parentNode, P !== void 0 && !rs && (Ss = Math.abs(P - yn(r)[T])), E(), y(!0);
}
if (i.contains(et))
return y(!1);
}
return !1;
},
_ignoreWhileAnimating: null,
_offMoveEvents: function() {
$t(document, "mousemove", this._onTouchMove), $t(document, "touchmove", this._onTouchMove), $t(document, "pointermove", this._onTouchMove), $t(document, "dragover", jr), $t(document, "mousemove", jr), $t(document, "touchmove", jr);
},
_offUpEvents: function() {
var t = this.el.ownerDocument;
$t(t, "mouseup", this._onDrop), $t(t, "touchend", this._onDrop), $t(t, "pointerup", this._onDrop), $t(t, "touchcancel", this._onDrop), $t(document, "selectstart", this);
},
_onDrop: function(t) {
var i = this.el, r = this.options;
if (ni = fi(et), Sr = fi(et, r.draggable), Gn("drop", this, {
evt: t
}), qt = et && et.parentNode, ni = fi(et), Sr = fi(et, r.draggable), wt.eventCanceled) {
this._nulling();
return;
}
Mo = !1, rs = !1, Ja = !1, clearInterval(this._loopId), clearTimeout(this._dragStartTimer), tc(this.cloneId), tc(this._dragStartId), this.nativeDraggable && ($t(document, "drop", this), $t(i, "dragstart", this._onDragStart)), this._offMoveEvents(), this._offUpEvents(), Ga && _t(document.body, "user-select", ""), _t(et, "transform", ""), t && (Ua && (t.cancelable && t.preventDefault(), !r.dropBubble && t.stopPropagation()), xt && xt.parentNode && xt.parentNode.removeChild(xt), (Yt === qt || En && En.lastPutMode !== "clone") && en && en.parentNode && en.parentNode.removeChild(en), et && (this.nativeDraggable && $t(et, "dragend", this), bf(et), et.style["will-change"] = "", Ua && !Mo && ti(et, En ? En.options.ghostClass : this.options.ghostClass, !1), ti(et, this.options.chosenClass, !1), jn({
sortable: this,
name: "unchoose",
toEl: qt,
newIndex: null,
newDraggableIndex: null,
originalEvent: t
}), Yt !== qt ? (ni >= 0 && (jn({
rootEl: qt,
name: "add",
toEl: qt,
fromEl: Yt,
originalEvent: t
}), jn({
sortable: this,
name: "remove",
toEl: qt,
originalEvent: t
}), jn({
rootEl: qt,
name: "sort",
toEl: qt,
fromEl: Yt,
originalEvent: t
}), jn({
sortable: this,
name: "sort",
toEl: qt,
originalEvent: t
})), En && En.save()) : ni !== Po && ni >= 0 && (jn({
sortable: this,
name: "update",
toEl: qt,
originalEvent: t
}), jn({
sortable: this,
name: "sort",
toEl: qt,
originalEvent: t
})), wt.active && ((ni == null || ni === -1) && (ni = Po, Sr = Ya), jn({
sortable: this,
name: "end",
toEl: qt,
originalEvent: t
}), this.save()))), this._nulling();
},
_nulling: function() {
Gn("nulling", this), Yt = et = qt = xt = Ur = en = Cs = Er = Vr = Ai = Ua = ni = Sr = Po = Ya = To = Qa = En = is = wt.dragged = wt.ghost = wt.clone = wt.active = null, Bs.forEach(function(t) {
t.checked = !0;
}), Bs.length = vf = gf = 0;
},
handleEvent: function(t) {
switch (t.type) {
case "drop":
case "dragend":
this._onDrop(t);
break;
case "dragenter":
case "dragover":
et && (this._onDragOver(t), WS(t));
break;
case "selectstart":
t.preventDefault();
break;
}
},
toArray: function() {
for (var t = [], i, r = this.el.children, n = 0, a = r.length, s = this.options; n < a; n++)
i = r[n], Pi(i, s.draggable, this.el, !1) && t.push(i.getAttribute(s.dataIdAttr) || XS(i));
return t;
},
sort: function(t, i) {
var r = {}, n = this.el;
this.toArray().forEach(function(a, s) {
var u = n.children[s];
Pi(u, this.options.draggable, n, !1) && (r[a] = u);
}, this), i && this.captureAnimationState(), t.forEach(function(a) {
r[a] && (n.removeChild(r[a]), n.appendChild(r[a]));
}), i && this.animateAll();
},
save: function() {
var t = this.options.store;
t && t.set && t.set(this);
},
closest: function(t, i) {
return Pi(t, i || this.options.draggable, this.el, !1);
},
option: function(t, i) {
var r = this.options;
if (i === void 0)
return r[t];
var n = ol.modifyOption(this, t, i);
typeof n < "u" ? r[t] = n : r[t] = i, t === "group" && a0(r);
},
destroy: function() {
Gn("destroy", this);
var t = this.el;
t[ri] = null, $t(t, "mousedown", this._onTapStart), $t(t, "touchstart", this._onTapStart), $t(t, "pointerdown", this._onTapStart), this.nativeDraggable && ($t(t, "dragover", this), $t(t, "dragenter", this)), Array.prototype.forEach.call(t.querySelectorAll("[draggable]"), function(i) {
i.removeAttribute("draggable");
}), this._onDrop(), this._disableDelayedDragEvents(), Ns.splice(Ns.indexOf(this.el), 1), this.el = t = null;
},
_hideClone: function() {
if (!Er) {
if (Gn("hideClone", this), wt.eventCanceled)
return;
_t(en, "display", "none"), this.options.removeCloneOnHide && en.parentNode && en.parentNode.removeChild(en), Er = !0;
}
},
_showClone: function(t) {
if (t.lastPutMode !== "clone") {
this._hideClone();
return;
}
if (Er) {
if (Gn("showClone", this), wt.eventCanceled)
return;
et.parentNode == Yt && !this.options.group.revertClone ? Yt.insertBefore(en, et) : Ur ? Yt.insertBefore(en, Ur) : Yt.appendChild(en), this.options.group.revertClone && this.animate(et, en), _t(en, "display", ""), Er = !1;
}
}
};
function WS(e) {
e.dataTransfer && (e.dataTransfer.dropEffect = "move"), e.cancelable && e.preventDefault();
}
function as(e, t, i, r, n, a, s, u) {
var d, h = e[ri], p = h.options.onMove, g;
return window.CustomEvent && !or && !rl ? d = new CustomEvent("move", {
bubbles: !0,
cancelable: !0
}) : (d = document.createEvent("Event"), d.initEvent("move", !0, !0)), d.to = t, d.from = e, d.dragged = i, d.draggedRect = r, d.related = n || t, d.relatedRect = a || yn(t), d.willInsertAfter = u, d.originalEvent = s, e.dispatchEvent(d), p && (g = p.call(h, d, s)), g;
}
function bf(e) {
e.draggable = !1;
}
function GS() {
ec = !1;
}
function KS(e, t, i) {
var r = yn(Ho(i.el, 0, i.options, !0)), n = 10;
return t ? e.clientX < r.left - n || e.clientY < r.top && e.clientX < r.right : e.clientY < r.top - n || e.clientY < r.bottom && e.clientX < r.left;
}
function YS(e, t, i) {
var r = yn(xc(i.el, i.options.draggable)), n = 10;
return t ? e.clientX > r.right + n || e.clientX <= r.right && e.clientY > r.bottom && e.clientX >= r.left : e.clientX > r.right && e.clientY > r.top || e.clientX <= r.right && e.clientY > r.bottom + n;
}
function QS(e, t, i, r, n, a, s, u) {
var d = r ? e.clientY : e.clientX, h = r ? i.height : i.width, p = r ? i.top : i.left, g = r ? i.bottom : i.right, _ = !1;
if (!s) {
if (u && Ss < h * n) {
if (!Ja && (Qa === 1 ? d > p + h * a / 2 : d < g - h * a / 2) && (Ja = !0), Ja)
_ = !0;
else if (Qa === 1 ? d < p + Ss : d > g - Ss)
return -Qa;
} else if (d > p + h * (1 - n) / 2 && d < g - h * (1 - n) / 2)
return JS(t);
}
return _ = _ || s, _ && (d < p + h * a / 2 || d > g - h * a / 2) ? d > p + h / 2 ? 1 : -1 : 0;
}
function JS(e) {
return fi(et) < fi(e) ? 1 : -1;
}
function XS(e) {
for (var t = e.tagName + e.className + e.src + e.href + e.textContent, i = t.length, r = 0; i--; )
r += t.charCodeAt(i);
return r.toString(36);
}
function ZS(e) {
Bs.length = 0;
for (var t = e.getElementsByTagName("input"), i = t.length; i--; ) {
var r = t[i];
r.checked && Bs.push(r);
}
}
function Es(e) {
return setTimeout(e, 0);
}
function tc(e) {
return clearTimeout(e);
}
eu && Pt(document, "touchmove", function(e) {
(wt.active || Mo) && e.cancelable && e.preventDefault();
});
wt.utils = {
on: Pt,
off: $t,
css: _t,
find: e0,
is: function(t, i) {
return !!Pi(t, i, t, !1);
},
extend: FS,
throttle: t0,
closest: Pi,
toggleClass: ti,
clone: i0,
index: fi,
nextTick: Es,
cancelNextTick: tc,
detectDirection: o0,
getChild: Ho
};
wt.get = function(e) {
return e[ri];
};
wt.mount = function() {
for (var e = arguments.length, t = new Array(e), i = 0; i < e; i++)
t[i] = arguments[i];
t[0].constructor === Array && (t = t[0]), t.forEach(function(r) {
if (!r.prototype || !r.prototype.constructor)
throw "Sortable: Mounted plugin must be a constructor function, not ".concat({}.toString.call(r));
r.utils && (wt.utils = Ui(Ui({}, wt.utils), r.utils)), ol.mount(r);
});
};
wt.create = function(e, t) {
return new wt(e, t);
};
wt.version = RS;
var sn = [], za, nc, ic = !1, _f, wf, Vs, Ha;
function qS() {
function e() {
this.defaults = {
scroll: !0,
forceAutoScrollFallback: !1,
scrollSensitivity: 30,
scrollSpeed: 10,
bubbleScroll: !0
};
for (var t in this)
t.charAt(0) === "_" && typeof this[t] == "function" && (this[t] = this[t].bind(this));
}
return e.prototype = {
dragStarted: function(i) {
var r = i.originalEvent;
this.sortable.nativeDraggable ? Pt(document, "dragover", this._handleAutoScroll) : this.options.supportPointer ? Pt(document, "pointermove", this._handleFallbackAutoScroll) : r.touches ? Pt(document, "touchmove", this._handleFallbackAutoScroll) : Pt(document, "mousemove", this._handleFallbackAutoScroll);
},
dragOverCompleted: function(i) {
var r = i.originalEvent;
!this.options.dragOverBubble && !r.rootEl && this._handleAutoScroll(r);
},
drop: function() {
this.sortable.nativeDraggable ? $t(document, "dragover", this._handleAutoScroll) : ($t(document, "pointermove", this._handleFallbackAutoScroll), $t(document, "touchmove", this._handleFallbackAutoScroll), $t(document, "mousemove", this._handleFallbackAutoScroll)), hv(), xs(), MS();
},
nulling: function() {
Vs = nc = za = ic = Ha = _f = wf = null, sn.length = 0;
},
_handleFallbackAutoScroll: function(i) {
this._handleAutoScroll(i, !0);
},
_handleAutoScroll: function(i, r) {
var n = this, a = (i.touches ? i.touches[0] : i).clientX, s = (i.touches ? i.touches[0] : i).clientY, u = document.elementFromPoint(a, s);
if (Vs = i, r || this.options.forceAutoScrollFallback || rl || or || Ga) {
Af(i, this.options, u, r);
var d = Tr(u, !0);
ic && (!Ha || a !== _f || s !== wf) && (Ha && hv(), Ha = setInterval(function() {
var h = Tr(document.elementFromPoint(a, s), !0);
h !== d && (d = h, xs()), Af(i, n.options, h, r);
}, 10), _f = a, wf = s);
} else {
if (!this.options.bubbleScroll || Tr(u, !0) === ji()) {
xs();
return;
}
Af(i, this.options, Tr(u, !1), !1);
}
}
}, rr(e, {
pluginName: "scroll",
initializeByDefault: !0
});
}
function xs() {
sn.forEach(function(e) {
clearInterval(e.pid);
}), sn = [];
}
function hv() {
clearInterval(Ha);
}
var Af = t0(function(e, t, i, r) {
if (!!t.scroll) {
var n = (e.touches ? e.touches[0] : e).clientX, a = (e.touches ? e.touches[0] : e).clientY, s = t.scrollSensitivity, u = t.scrollSpeed, d = ji(), h = !1, p;
nc !== i && (nc = i, xs(), za = t.scroll, p = t.scrollFn, za === !0 && (za = Tr(i, !0)));
var g = 0, _ = za;
do {
var S = _, b = yn(S), A = b.top, w = b.bottom, m = b.left, y = b.right, E = b.width, x = b.height, k = void 0, D = void 0, P = S.scrollWidth, M = S.scrollHeight, B = _t(S), T = S.scrollLeft, $ = S.scrollTop;
S === d ? (k = E < P && (B.overflowX === "auto" || B.overflowX === "scroll" || B.overflowX === "visible"), D = x < M && (B.overflowY === "auto" || B.overflowY === "scroll" || B.overflowY === "visible")) : (k = E < P && (B.overflowX === "auto" || B.overflowX === "scroll"), D = x < M && (B.overflowY === "auto" || B.overflowY === "scroll"));
var V = k && (Math.abs(y - n) <= s && T + E < P) - (Math.abs(m - n) <= s && !!T), z = D && (Math.abs(w - a) <= s && $ + x < M) - (Math.abs(A - a) <= s && !!$);
if (!sn[g])
for (var H = 0; H <= g; H++)
sn[H] || (sn[H] = {});
(sn[g].vx != V || sn[g].vy != z || sn[g].el !== S) && (sn[g].el = S, sn[g].vx = V, sn[g].vy = z, clearInterval(sn[g].pid), (V != 0 || z != 0) && (h = !0, sn[g].pid = setInterval(function() {
r && this.layer === 0 && wt.active._onTouchMove(Vs);
var I = sn[this.layer].vy ? sn[this.layer].vy * u : 0, U = sn[this.layer].vx ? sn[this.layer].vx * u : 0;
typeof p == "function" && p.call(wt.dragged.parentNode[ri], U, I, e, Vs, sn[this.layer].el) !== "continue" || n0(sn[this.layer].el, U, I);
}.bind({
layer: g
}), 24))), g++;
} while (t.bubbleScroll && _ !== d && (_ = Tr(_, !1)));
ic = h;
}
}, 30), u0 = function(t) {
var i = t.originalEvent, r = t.putSortable, n = t.dragEl, a = t.activeSortable, s = t.dispatchSortableEvent, u = t.hideGhostForTarget, d = t.unhideGhostForTarget;
if (!!i) {
var h = r || a;
u();
var p = i.changedTouches && i.changedTouches.length ? i.changedTouches[0] : i, g = document.elementFromPoint(p.clientX, p.clientY);
d(), h && !h.el.contains(g) && (s("spill"), this.onSpill({
dragEl: n,
putSortable: r
}));
}
};
function Tc() {
}
Tc.prototype = {
startIndex: null,
dragStart: function(t) {
var i = t.oldDraggableIndex;
this.startIndex = i;
},
onSpill: function(t) {
var i = t.dragEl, r = t.putSortable;
this.sortable.captureAnimationState(), r && r.captureAnimationState();
var n = Ho(this.sortable.el, this.startIndex, this.options);
n ? this.sortable.el.insertBefore(i, n) : this.sortable.el.appendChild(i), this.sortable.animateAll(), r && r.animateAll();
},
drop: u0
};
rr(Tc, {
pluginName: "revertOnSpill"
});
function kc() {
}
kc.prototype = {
onSpill: function(t) {
var i = t.dragEl, r = t.putSortable, n = r || this.sortable;
n.captureAnimationState(), i.parentNode && i.parentNode.removeChild(i), n.animateAll();
},
drop: u0
};
rr(kc, {
pluginName: "removeOnSpill"
});
wt.mount(new qS());
wt.mount(kc, Tc);
function Cf(e) {
e.parentElement !== null && e.parentElement.removeChild(e);
}
function mv(e, t, i) {
const r = i === 0 ? e.children[0] : e.children[i - 1].nextSibling;
e.insertBefore(t, r);
}
function eE() {
return typeof window < "u" ? window.console : global.console;
}
const tE = eE();
function nE(e) {
const t = /* @__PURE__ */ Object.create(null);
return function(r) {
return t[r] || (t[r] = e(r));
};
}
const iE = /-(\w)/g, rE = nE((e) => e.replace(iE, (t, i) => i.toUpperCase())), d0 = ["Start", "Add", "Remove", "Update", "End"], f0 = ["Choose", "Unchoose", "Sort", "Filter", "Clone"], c0 = ["Move"], oE = [c0, d0, f0].flatMap((e) => e).map((e) => `on${e}`), rc = {
manage: c0,
manageAndEmit: d0,
emit: f0
};
function aE(e) {
return oE.indexOf(e) !== -1;
}
const lE = [
"a",
"abbr",
"address",
"area",
"article",
"aside",
"audio",
"b",
"base",
"bdi",
"bdo",
"blockquote",
"body",
"br",
"button",
"canvas",
"caption",
"cite",
"code",
"col",
"colgroup",
"data",
"datalist",
"dd",
"del",
"details",
"dfn",
"dialog",
"div",
"dl",
"dt",
"em",
"embed",
"fieldset",
"figcaption",
"figure",
"footer",
"form",
"h1",
"h2",
"h3",
"h4",
"h5",
"h6",
"head",
"header",
"hgroup",
"hr",
"html",
"i",
"iframe",
"img",
"input",
"ins",
"kbd",
"label",
"legend",
"li",
"link",
"main",
"map",
"mark",
"math",
"menu",
"menuitem",
"meta",
"meter",
"nav",
"noscript",
"object",
"ol",
"optgroup",
"option",
"output",
"p",
"param",
"picture",
"pre",
"progress",
"q",
"rb",
"rp",
"rt",
"rtc",
"ruby",
"s",
"samp",
"script",
"section",
"select",
"slot",
"small",
"source",
"span",
"strong",
"style",
"sub",
"summary",
"sup",
"svg",
"table",
"tbody",
"td",
"template",
"textarea",
"tfoot",
"th",
"thead",
"time",
"title",
"tr",
"track",
"u",
"ul",
"var",
"video",
"wbr"
];
function sE(e) {
return lE.includes(e);
}
function uE(e) {
return ["transition-group", "TransitionGroup"].includes(e);
}
function p0(e) {
return ["id", "class", "role", "style"].includes(e) || e.startsWith("data-") || e.startsWith("aria-") || e.startsWith("on");
}
function h0(e) {
return e.reduce((t, [i, r]) => (t[i] = r, t), {});
}
function dE({ $attrs: e, componentData: t = {} }) {
return {
...h0(
Object.entries(e).filter(([r, n]) => p0(r))
),
...t
};
}
function fE({ $attrs: e, callBackBuilder: t }) {
const i = h0(m0(e));
Object.entries(t).forEach(([n, a]) => {
rc[n].forEach((s) => {
i[`on${s}`] = a(s);
});
});
const r = `[data-draggable]${i.draggable || ""}`;
return {
...i,
draggable: r
};
}
function m0(e) {
return Object.entries(e).filter(([t, i]) => !p0(t)).map(([t, i]) => [rE(t), i]).filter(([t, i]) => !aE(t));
}
const vv = ({ el: e }) => e, cE = (e, t) => e.__draggable_context = t, gv = (e) => e.__draggable_context;
class pE {
constructor({
nodes: { header: t, default: i, footer: r },
root: n,
realList: a
}) {
this.defaultNodes = i, this.children = [...t, ...i, ...r], this.externalComponent = n.externalComponent, this.rootTransition = n.transition, this.tag = n.tag, this.realList = a;
}
get _isRootComponent() {
return this.externalComponent || this.rootTransition;
}
render(t, i) {
const { tag: r, children: n, _isRootComponent: a } = this;
return t(r, i, a ? { default: () => n } : n);
}
updated() {
const { defaultNodes: t, realList: i } = this;
t.forEach((r, n) => {
cE(vv(r), {
element: i[n],
index: n
});
});
}
getUnderlyingVm(t) {
return gv(t);
}
getVmIndexFromDomIndex(t, i) {
const { defaultNodes: r } = this, { length: n } = r, a = i.children, s = a.item(t);
if (s === null)
return n;
const u = gv(s);
if (u)
return u.index;
if (n === 0)
return 0;
const d = vv(r[0]), h = [...a].findIndex(
(p) => p === d
);
return t < h ? 0 : n;
}
}
function hE(e, t) {
const i = e[t];
return i ? i() : [];
}
function mE({ $slots: e, realList: t, getKey: i }) {
const r = t || [], [n, a] = ["header", "footer"].map(
(d) => hE(e, d)
), { item: s } = e;
if (!s)
throw new Error("draggable element must have an item slot");
const u = r.flatMap(
(d, h) => s({ element: d, index: h }).map((p) => (p.key = i(d), p.props = { ...p.props || {}, "data-draggable": !0 }, p))
);
if (u.length !== r.length)
throw new Error("Item slot must have only one child");
return {
header: n,
footer: a,
default: u
};
}
function vE(e) {
const t = uE(e), i = !sE(e) && !t;
return {
transition: t,
externalComponent: i,
tag: i ? ie(e) : t ? w_ : e
};
}
function gE({ $slots: e, tag: t, realList: i, getKey: r }) {
const n = mE({ $slots: e, realList: i, getKey: r }), a = vE(t);
return new pE({ nodes: n, root: a, realList: i });
}
function v0(e, t) {
Kn(() => this.$emit(e.toLowerCase(), t));
}
function g0(e) {
return (t, i) => {
if (this.realList !== null)
return this[`onDrag${e}`](t, i);
};
}
function yE(e) {
const t = g0.call(this, e);
return (i, r) => {
t.call(this, i, r), v0.call(this, e, i);
};
}
let Sf = null;
const bE = {
list: {
type: Array,
required: !1,
default: null
},
modelValue: {
type: Array,
required: !1,
default: null
},
itemKey: {
type: [String, Function],
required: !0
},
clone: {
type: Function,
default: (e) => e
},
tag: {
type: String,
default: "div"
},
move: {
type: Function,
default: null
},
componentData: {
type: Object,
required: !1,
default: null
}
}, _E = [
"update:modelValue",
"change",
...[...rc.manageAndEmit, ...rc.emit].map((e) => e.toLowerCase())
], Go = Ve({
name: "draggable",
inheritAttrs: !1,
props: bE,
emits: _E,
data() {
return {
error: !1
};
},
render() {
try {
this.error = !1;
const { $slots: e, $attrs: t, tag: i, componentData: r, realList: n, getKey: a } = this, s = gE({
$slots: e,
tag: i,
realList: n,
getKey: a
});
this.componentStructure = s;
const u = dE({ $attrs: t, componentData: r });
return s.render(tn, u);
} catch (e) {
return this.error = !0, tn("pre", { style: { color: "red" } }, e.stack);
}
},
created() {
this.list !== null && this.modelValue !== null && tE.error(
"modelValue and list props are mutually exclusive! Please set one or another."
);
},
mounted() {
if (this.error)
return;
const { $attrs: e, $el: t, componentStructure: i } = this;
i.updated();
const r = fE({
$attrs: e,
callBackBuilder: {
manageAndEmit: (a) => yE.call(this, a),
emit: (a) => v0.bind(this, a),
manage: (a) => g0.call(this, a)
}
}), n = t.nodeType === 1 ? t : t.parentElement;
this._sortable = new wt(n, r), this.targetDomElement = n, n.__draggable_component__ = this;
},
updated() {
this.componentStructure.updated();
},
beforeUnmount() {
this._sortable !== void 0 && this._sortable.destroy();
},
computed: {
realList() {
const { list: e } = this;
return e || this.modelValue;
},
getKey() {
const { itemKey: e } = this;
return typeof e == "function" ? e : (t) => t[e];
}
},
watch: {
$attrs: {
handler(e) {
const { _sortable: t } = this;
!t || m0(e).forEach(([i, r]) => {
t.option(i, r);
});
},
deep: !0
}
},
methods: {
getUnderlyingVm(e) {
return this.componentStructure.getUnderlyingVm(e) || null;
},
getUnderlyingPotencialDraggableComponent(e) {
return e.__draggable_component__;
},
emitChanges(e) {
Kn(() => this.$emit("change", e));
},
alterList(e) {
if (this.list) {
e(this.list);
return;
}
const t = [...this.modelValue];
e(t), this.$emit("update:modelValue", t);
},
spliceList() {
const e = (t) => t.splice(...arguments);
this.alterList(e);
},
updatePosition(e, t) {
const i = (r) => r.splice(t, 0, r.splice(e, 1)[0]);
this.alterList(i);
},
getRelatedContextFromMoveEvent({ to: e, related: t }) {
const i = this.getUnderlyingPotencialDraggableComponent(e);
if (!i)
return { component: i };
const r = i.realList, n = { list: r, component: i };
return e !== t && r ? { ...i.getUnderlyingVm(t) || {}, ...n } : n;
},
getVmIndexFromDomIndex(e) {
return this.componentStructure.getVmIndexFromDomIndex(
e,
this.targetDomElement
);
},
onDragStart(e) {
this.context = this.getUnderlyingVm(e.item), e.item._underlying_vm_ = this.clone(this.context.element), Sf = e.item;
},
onDragAdd(e) {
const t = e.item._underlying_vm_;
if (t === void 0)
return;
Cf(e.item);
const i = this.getVmIndexFromDomIndex(e.newIndex);
this.spliceList(i, 0, t);
const r = { element: t, newIndex: i };
this.emitChanges({ added: r });
},
onDragRemove(e) {
if (mv(this.$el, e.item, e.oldIndex), e.pullMode === "clone") {
Cf(e.clone);
return;
}
const { index: t, element: i } = this.context;
this.spliceList(t, 1);
const r = { element: i, oldIndex: t };
this.emitChanges({ removed: r });
},
onDragUpdate(e) {
Cf(e.item), mv(e.from, e.item, e.oldIndex);
const t = this.context.index, i = this.getVmIndexFromDomIndex(e.newIndex);
this.updatePosition(t, i);
const r = { element: this.context.element, oldIndex: t, newIndex: i };
this.emitChanges({ moved: r });
},
computeFutureIndex(e, t) {
if (!e.element)
return 0;
const i = [...t.to.children].filter(
(s) => s.style.display !== "none"
), r = i.indexOf(t.related), n = e.component.getVmIndexFromDomIndex(
r
);
return i.indexOf(Sf) !== -1 || !t.willInsertAfter ? n : n + 1;
},
onDragMove(e, t) {
const { move: i, realList: r } = this;
if (!i || !r)
return !0;
const n = this.getRelatedContextFromMoveEvent(e), a = this.computeFutureIndex(n, e), s = {
...this.context,
futureIndex: a
}, u = {
...e,
relatedContext: n,
draggedContext: s
};
return i(u, t);
},
onDragEnd() {
Sf = null;
}
}
});
function wE() {
return [
{
name: "template",
title: "\u6A21\u677F",
list: []
},
{
name: "main",
title: "\u57FA\u7840\u7EC4\u4EF6",
list: []
},
{
name: "subform",
title: "\u5B50\u8868\u5355\u7EC4\u4EF6",
list: []
},
{
name: "container",
title: "\u5BB9\u5668\u7EC4\u4EF6",
list: []
},
{
name: "chart",
title: "\u56FE\u8868\u7EC4\u4EF6",
list: []
},
{
name: "aide",
title: "\u8F85\u52A9\u7EC4\u4EF6",
list: []
},
{
name: "layout",
title: "\u5E03\u5C40\u7EC4\u4EF6",
list: []
}
];
}
var Oc = typeof globalThis < "u" ? globalThis : typeof window < "u" ? window : typeof global < "u" ? global : typeof self < "u" ? self : {};
function AE(e) {
return e && e.__esModule && Object.prototype.hasOwnProperty.call(e, "default") ? e.default : e;
}
var y0 = { exports: {} };
(function(e, t) {
(function(i, r) {
e.exports = r();
})(Oc, function() {
var i = 1e3, r = 6e4, n = 36e5, a = "millisecond", s = "second", u = "minute", d = "hour", h = "day", p = "week", g = "month", _ = "quarter", S = "year", b = "date", A = "Invalid Date", w = /^(\d{4})[-/]?(\d{1,2})?[-/]?(\d{0,2})[Tt\s]*(\d{1,2})?:?(\d{1,2})?:?(\d{1,2})?[.:]?(\d+)?$/, m = /\[([^\]]+)]|Y{1,4}|M{1,4}|D{1,2}|d{1,4}|H{1,2}|h{1,2}|a|A|m{1,2}|s{1,2}|Z{1,2}|SSS/g, y = { name: "en", weekdays: "Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"), months: "January_February_March_April_May_June_July_August_September_October_November_December".split("_"), ordinal: function(H) {
var I = ["th", "st", "nd", "rd"], U = H % 100;
return "[" + H + (I[(U - 20) % 10] || I[U] || I[0]) + "]";
} }, E = function(H, I, U) {
var F = String(H);
return !F || F.length >= I ? H : "" + Array(I + 1 - F.length).join(U) + H;
}, x = { s: E, z: function(H) {
var I = -H.utcOffset(), U = Math.abs(I), F = Math.floor(U / 60), C = U % 60;
return (I <= 0 ? "+" : "-") + E(F, 2, "0") + ":" + E(C, 2, "0");
}, m: function H(I, U) {
if (I.date() < U.date())
return -H(U, I);
var F = 12 * (U.year() - I.year()) + (U.month() - I.month()), C = I.clone().add(F, g), q = U - C < 0, X = I.clone().add(F + (q ? -1 : 1), g);
return +(-(F + (U - C) / (q ? C - X : X - C)) || 0);
}, a: function(H) {
return H < 0 ? Math.ceil(H) || 0 : Math.floor(H);
}, p: function(H) {
return { M: g, y: S, w: p, d: h, D: b, h: d, m: u, s, ms: a, Q: _ }[H] || String(H || "").toLowerCase().replace(/s$/, "");
}, u: function(H) {
return H === void 0;
} }, k = "en", D = {};
D[k] = y;
var P = "$isDayjsObject", M = function(H) {
return H instanceof V || !(!H || !H[P]);
}, B = function H(I, U, F) {
var C;
if (!I)
return k;
if (typeof I == "string") {
var q = I.toLowerCase();
D[q] && (C = q), U && (D[q] = U, C = q);
var X = I.split("-");
if (!C && X.length > 1)
return H(X[0]);
} else {
var Y = I.name;
D[Y] = I, C = Y;
}
return !F && C && (k = C), C || !F && k;
}, T = function(H, I) {
if (M(H))
return H.clone();
var U = typeof I == "object" ? I : {};
return U.date = H, U.args = arguments, new V(U);
}, $ = x;
$.l = B, $.i = M, $.w = function(H, I) {
return T(H, { locale: I.$L, utc: I.$u, x: I.$x, $offset: I.$offset });
};
var V = function() {
function H(U) {
this.$L = B(U.locale, null, !0), this.parse(U), this.$x = this.$x || U.x || {}, this[P] = !0;
}
var I = H.prototype;
return I.parse = function(U) {
this.$d = function(F) {
var C = F.date, q = F.utc;
if (C === null)
return new Date(NaN);
if ($.u(C))
return new Date();
if (C instanceof Date)
return new Date(C);
if (typeof C == "string" && !/Z$/i.test(C)) {
var X = C.match(w);
if (X) {
var Y = X[2] - 1 || 0, ue = (X[7] || "0").substring(0, 3);
return q ? new Date(Date.UTC(X[1], Y, X[3] || 1, X[4] || 0, X[5] || 0, X[6] || 0, ue)) : new Date(X[1], Y, X[3] || 1, X[4] || 0, X[5] || 0, X[6] || 0, ue);
}
}
return new Date(C);
}(U), this.init();
}, I.init = function() {
var U = this.$d;
this.$y = U.getFullYear(), this.$M = U.getMonth(), this.$D = U.getDate(), this.$W = U.getDay(), this.$H = U.getHours(), this.$m = U.getMinutes(), this.$s = U.getSeconds(), this.$ms = U.getMilliseconds();
}, I.$utils = function() {
return $;
}, I.isValid = function() {
return this.$d.toString() !== A;
}, I.isSame = function(U, F) {
var C = T(U);
return this.startOf(F) <= C && C <= this.endOf(F);
}, I.isAfter = function(U, F) {
return T(U) < this.startOf(F);
}, I.isBefore = function(U, F) {
return this.endOf(F) < T(U);
}, I.$g = function(U, F, C) {
return $.u(U) ? this[F] : this.set(C, U);
}, I.unix = function() {
return Math.floor(this.valueOf() / 1e3);
}, I.valueOf = function() {
return this.$d.getTime();
}, I.startOf = function(U, F) {
var C = this, q = !!$.u(F) || F, X = $.p(U), Y = function(he, Se) {
var xe = $.w(C.$u ? Date.UTC(C.$y, Se, he) : new Date(C.$y, Se, he), C);
return q ? xe : xe.endOf(h);
}, ue = function(he, Se) {
return $.w(C.toDate()[he].apply(C.toDate("s"), (q ? [0, 0, 0, 0] : [23, 59, 59, 999]).slice(Se)), C);
}, ee = this.$W, pe = this.$M, Te = this.$D, ve = "set" + (this.$u ? "UTC" : "");
switch (X) {
case S:
return q ? Y(1, 0) : Y(31, 11);
case g:
return q ? Y(1, pe) : Y(0, pe + 1);
case p:
var me = this.$locale().weekStart || 0, we = (ee < me ? ee + 7 : ee) - me;
return Y(q ? Te - we : Te + (6 - we), pe);
case h:
case b:
return ue(ve + "Hours", 0);
case d:
return ue(ve + "Minutes", 1);
case u:
return ue(ve + "Seconds", 2);
case s:
return ue(ve + "Milliseconds", 3);
default:
return this.clone();
}
}, I.endOf = function(U) {
return this.startOf(U, !1);
}, I.$set = function(U, F) {
var C, q = $.p(U), X = "set" + (this.$u ? "UTC" : ""), Y = (C = {}, C[h] = X + "Date", C[b] = X + "Date", C[g] = X + "Month", C[S] = X + "FullYear", C[d] = X + "Hours", C[u] = X + "Minutes", C[s] = X + "Seconds", C[a] = X + "Milliseconds", C)[q], ue = q === h ? this.$D + (F - this.$W) : F;
if (q === g || q === S) {
var ee = this.clone().set(b, 1);
ee.$d[Y](ue), ee.init(), this.$d = ee.set(b, Math.min(this.$D, ee.daysInMonth())).$d;
} else
Y && this.$d[Y](ue);
return this.init(), this;
}, I.set = function(U, F) {
return this.clone().$set(U, F);
}, I.get = function(U) {
return this[$.p(U)]();
}, I.add = function(U, F) {
var C, q = this;
U = Number(U);
var X = $.p(F), Y = function(pe) {
var Te = T(q);
return $.w(Te.date(Te.date() + Math.round(pe * U)), q);
};
if (X === g)
return this.set(g, this.$M + U);
if (X === S)
return this.set(S, this.$y + U);
if (X === h)
return Y(1);
if (X === p)
return Y(7);
var ue = (C = {}, C[u] = r, C[d] = n, C[s] = i, C)[X] || 1, ee = this.$d.getTime() + U * ue;
return $.w(ee, this);
}, I.subtract = function(U, F) {
return this.add(-1 * U, F);
}, I.format = function(U) {
var F = this, C = this.$locale();
if (!this.isValid())
return C.invalidDate || A;
var q = U || "YYYY-MM-DDTHH:mm:ssZ", X = $.z(this), Y = this.$H, ue = this.$m, ee = this.$M, pe = C.weekdays, Te = C.months, ve = C.meridiem, me = function(Se, xe, O, K) {
return Se && (Se[xe] || Se(F, q)) || O[xe].slice(0, K);
}, we = function(Se) {
return $.s(Y % 12 || 12, Se, "0");
}, he = ve || function(Se, xe, O) {
var K = Se < 12 ? "AM" : "PM";
return O ? K.toLowerCase() : K;
};
return q.replace(m, function(Se, xe) {
return xe || function(O) {
switch (O) {
case "YY":
return String(F.$y).slice(-2);
case "YYYY":
return $.s(F.$y, 4, "0");
case "M":
return ee + 1;
case "MM":
return $.s(ee + 1, 2, "0");
case "MMM":
return me(C.monthsShort, ee, Te, 3);
case "MMMM":
return me(Te, ee);
case "D":
return F.$D;
case "DD":
return $.s(F.$D, 2, "0");
case "d":
return String(F.$W);
case "dd":
return me(C.weekdaysMin, F.$W, pe, 2);
case "ddd":
return me(C.weekdaysShort, F.$W, pe, 3);
case "dddd":
return pe[F.$W];
case "H":
return String(Y);
case "HH":
return $.s(Y, 2, "0");
case "h":
return we(1);
case "hh":
return we(2);
case "a":
return he(Y, ue, !0);
case "A":
return he(Y, ue, !1);
case "m":
return String(ue);
case "mm":
return $.s(ue, 2, "0");
case "s":
return String(F.$s);
case "ss":
return $.s(F.$s, 2, "0");
case "SSS":
return $.s(F.$ms, 3, "0");
case "Z":
return X;
}
return null;
}(Se) || X.replace(":", "");
});
}, I.utcOffset = function() {
return 15 * -Math.round(this.$d.getTimezoneOffset() / 15);
}, I.diff = function(U, F, C) {
var q, X = this, Y = $.p(F), ue = T(U), ee = (ue.utcOffset() - this.utcOffset()) * r, pe = this - ue, Te = function() {
return $.m(X, ue);
};
switch (Y) {
case S:
q = Te() / 12;
break;
case g:
q = Te();
break;
case _:
q = Te() / 3;
break;
case p:
q = (pe - ee) / 6048e5;
break;
case h:
q = (pe - ee) / 864e5;
break;
case d:
q = pe / n;
break;
case u:
q = pe / r;
break;
case s:
q = pe / i;
break;
default:
q = pe;
}
return C ? q : $.a(q);
}, I.daysInMonth = function() {
return this.endOf(g).$D;
}, I.$locale = function() {
return D[this.$L];
}, I.locale = function(U, F) {
if (!U)
return this.$L;
var C = this.clone(), q = B(U, F, !0);
return q && (C.$L = q), C;
}, I.clone = function() {
return $.w(this.$d, this);
}, I.toDate = function() {
return new Date(this.valueOf());
}, I.toJSON = function() {
return this.isValid() ? this.toISOString() : null;
}, I.toISOString = function() {
return this.$d.toISOString();
}, I.toString = function() {
return this.$d.toUTCString();
}, H;
}(), z = V.prototype;
return T.prototype = z, [["$ms", a], ["$s", s], ["$m", u], ["$H", d], ["$W", h], ["$M", g], ["$y", S], ["$D", b]].forEach(function(H) {
z[H[1]] = function(I) {
return this.$g(I, H[0], H[1]);
};
}), T.extend = function(H, I) {
return H.$i || (H(I, V, T), H.$i = !0), T;
}, T.locale = B, T.isDayjs = M, T.unix = function(H) {
return T(1e3 * H);
}, T.en = D[k], T.Ls = D, T.p = {}, T;
});
})(y0);
const CE = y0.exports, ko = {
Add: (e, t) => {
let i, r, n;
try {
i = e.toString().split(".")[1].length;
} catch {
i = 0;
}
try {
r = t.toString().split(".")[1].length;
} catch {
r = 0;
}
return n = Math.pow(10, Math.max(i, r)), (e * n + t * n) / n;
},
Sub: (e, t) => {
let i, r, n;
try {
i = e.toString().split(".")[1].length;
} catch {
i = 0;
}
try {
r = t.toString().split(".")[1].length;
} catch {
r = 0;
}
n = Math.pow(10, Math.max(i, r));
let a = i >= r ? i : r;
return Number(((e * n - t * n) / n).toFixed(a));
},
Mul: (e, t) => {
let i = 0, r = e.toString(), n = t.toString();
try {
i += r.split(".")[1].length;
} catch {
}
try {
i += n.split(".")[1].length;
} catch {
}
return Number(r.replace(".", "")) * Number(n.replace(".", "")) / Math.pow(10, i);
},
Div: (e, t) => {
let i = 0, r = 0;
try {
i = e.toString().split(".")[1].length;
} catch {
}
try {
r = t.toString().split(".")[1].length;
} catch {
}
let n = Number(e.toString().replace(".", "")), a = Number(t.toString().replace(".", ""));
return n / a * Math.pow(10, r - i);
}
}, SE = "YYYY-MM-DD HH:mm:ss", wr = (e, t) => e == null ? t : e, un = {
ADD: function(e, t) {
return ko.Add(wr(e, "0"), wr(t, "0"));
},
SUB: function(e, t) {
return ko.Sub(wr(e, "0"), wr(t, "0"));
},
MUL: function(e, t) {
return ko.Mul(wr(e, "0"), wr(t, "0"));
},
DIV: function(e, t) {
return ko.Div(wr(e, "0"), wr(t, "0"));
},
SUM: function(...e) {
return (e || []).reduce((t, i) => ko.Add(t, Array.isArray(i) ? un.SUM(...i) : i || 0), 0);
},
MAX: function(...e) {
const t = Array.isArray(e[0]) ? e[0] : e;
return Math.max(...t.map((i) => parseFloat(i)).filter((i) => !isNaN(i)));
},
MIN: function(...e) {
const t = Array.isArray(e[0]) ? e[0] : e;
return Math.min(...t.map((i) => parseFloat(i)).filter((i) => !isNaN(i)));
},
ABS: function(e) {
return parseFloat(Math.abs(e)) || 0;
},
AVG: function(...e) {
const t = Array.isArray(e[0]) ? e[0] : e;
return t.length ? ko.Div(un.SUM(t), t.length) : 0;
},
POWER: function(e, t) {
return Math.pow(parseFloat(e), parseFloat(t));
},
RAND: function() {
return Math.random();
},
CEIL: function(e) {
return Math.ceil(parseFloat(e)) || 0;
},
FLOOR: function(e) {
return Math.floor(parseFloat(e) || 0);
},
FIXED: function(e, t) {
const i = Math.pow(10, t || 0);
return (Math.floor(parseFloat(e) * i) / i).toFixed(t || 0);
},
ISNUMBER: function(e) {
return e === "" || e === null ? !1 : !isNaN(Number(e));
},
PI: function() {
return Number(Math.PI);
},
ROUND: function(e, t) {
return e = parseFloat(e), isNaN(e) ? 0 : parseFloat(e.toFixed(parseFloat(t) || 0));
},
SQRT: function(e) {
return Math.sqrt(parseFloat(e)) || 0;
},
TONUMBER: function(e) {
return parseFloat(e) || 0;
},
MODIFYDATE: function(e, t, i, r) {
if (!e)
return null;
let n = CE(e);
return t > 0 ? n = n.add(t, i) : t < 0 && (n = n.subtract(-1 * t, i)), n.format(r || SE);
},
ADDYEAR: function(e, t, i) {
return un.MODIFYDATE(e, Math.max(t, 0), "y", i);
},
ADDMONTH: function(e, t, i) {
return un.MODIFYDATE(e, Math.max(t, 0), "M", i);
},
ADDDAY: function(e, t, i) {
return un.MODIFYDATE(e, Math.max(t, 0), "d", i);
},
ADDHOUR: function(e, t, i) {
return un.MODIFYDATE(e, Math.max(t, 0), "h", i);
},
ADDMINUTE: function(e, t, i) {
return un.MODIFYDATE(e, Math.max(t, 0), "m", i);
},
ADDSECOND: function(e, t, i) {
return un.MODIFYDATE(e, Math.max(t, 0), "s", i);
},
ADDWEEK: function(e, t, i) {
return un.MODIFYDATE(e, Math.max(t, 0), "w", i);
},
SUBYEAR: function(e, t, i) {
return t = Math.max(t, 0), un.MODIFYDATE(e, t > 0 ? -1 * t : 0, "y", i);
},
SUBMONTH: function(e, t, i) {
return t = Math.max(t, 0), un.MODIFYDATE(e, t > 0 ? -1 * t : 0, "M", i);
},
SUBDAY: function(e, t, i) {
return t = Math.max(t, 0), un.MODIFYDATE(e, t > 0 ? -1 * t : 0, "d", i);
},
SUBHOUR: function(e, t, i) {
return t = Math.max(t, 0), un.MODIFYDATE(e, t > 0 ? -1 * t : 0, "h", i);
},
SUBMINUTE: function(e, t, i) {
return t = Math.max(t, 0), un.MODIFYDATE(e, t > 0 ? -1 * t : 0, "m", i);
},
SUBSECOND: function(e, t, i) {
return t = Math.max(t, 0), un.MODIFYDATE(e, t > 0 ? -1 * t : 0, "s", i);
},
SUBWEEK: function(e, t, i) {
return t = Math.max(t, 0), un.MODIFYDATE(e, t > 0 ? -1 * t : 0, "w", i);
},
NOW: function() {
const e = new Date(), t = e.getFullYear(), i = ("0" + (e.getMonth() + 1)).slice(-2), r = ("0" + e.getDate()).slice(-2), n = ("0" + e.getHours()).slice(-2), a = ("0" + e.getMinutes()).slice(-2), s = ("0" + e.getSeconds()).slice(-2);
return t + "-" + i + "-" + r + " " + n + ":" + a + ":" + s;
},
TODAY: function() {
const e = new Date(), t = e.getFullYear(), i = ("0" + (e.getMonth() + 1)).slice(-2), r = ("0" + e.getDate()).slice(-2);
return t + "-" + i + "-" + r;
},
YEAR: function(e) {
return e ? new Date(e).getFullYear() : null;
},
MONTH: function(e) {
return e ? new Date(e).getMonth() + 1 : null;
},
DAY: function(e) {
return e ? new Date(e).getDate() : null;
},
HOUR: function(e) {
return e ? new Date(e).getHours() : null;
},
MINUTE: function(e) {
return e ? new Date(e).getMinutes() : null;
},
SECOND: function(e) {
return e ? new Date(e).getSeconds() : null;
},
DIFFDAYS: function(e, t) {
const i = new Date(e), r = new Date(t);
return parseInt(Math.ceil(Math.abs(r.getTime() - i.getTime()) / (1e3 * 60 * 60 * 24)));
},
DIFFHOURS: function(e, t) {
const i = new Date(e), r = new Date(t);
return parseFloat(Math.abs(r.getTime() - i.getTime()) / (1e3 * 60 * 60)).toFixed(2);
},
DIFFMINUTES: function(e, t) {
const i = new Date(e), r = new Date(t);
return parseInt(Math.ceil(Math.abs(r.getTime() - i.getTime()) / (1e3 * 60)));
},
TIMESTAMP: function(e) {
return Date.parse(e);
},
STARTSWITH: function(e, t) {
return ("" + e).substring(0, ("" + t).length) === t;
},
EMPTY: function(e) {
return St.empty(e);
},
NOTEMPTY: function(e) {
return !St.empty(e);
},
LEN: function(e) {
return Array.isArray(e) ? e.length : 0;
},
MOD: function(e, t) {
return e = parseFloat(e), t = parseFloat(t), !e || !t || isNaN(e) || isNaN(t) ? 0 : e % t;
},
SLICELEFT: function(e, t) {
return ("" + e).slice(0, Number(t) || 0);
},
SLICERIGHT: function(e, t) {
return ("" + e).slice(Number(t) * -1);
},
TOLOWER: function(e) {
return ("" + e).toLowerCase();
},
TOUPPER: function(e) {
return ("" + e).toUpperCase();
},
INCLUDES: function(e, t) {
return (e || "").indexOf(t || "");
},
REPLACE: function(e, t, i) {
return (e || "").replace(t || "", i || "");
},
REPLACEALL: function(e, t, i) {
return (e || "").replaceAll(t || "", i || "");
},
TRIM: function(e) {
return (e || "").trim();
},
TOCHINSESAMOUNT: function(e) {
let t = ["\u96F6", "\u58F9", "\u8D30", "\u53C1", "\u8086", "\u4F0D", "\u9646", "\u67D2", "\u634C", "\u7396"], i = ["", "\u4E07", "\u4EBF", "\u4E07\u4EBF", "\u4EBF\u4EBF"], r = ["", "\u62FE", "\u4F70", "\u4EDF"], n = ["\u89D2", "\u5206"];
function a(_) {
let S = "", b = "", A = 0, w = !0;
for (; _ > 0; ) {
let m = _ % 10;
m === 0 ? w || (w = !0, b = t[m] + b) : (w = !1, S = t[m], S += r[A], b = S + b), A++, _ = Math.floor(_ / 10);
}
return b;
}
let s = 0, u = "", d = "", h = !1;
if (e === 0)
return t[0];
let p = Math.floor(e), g = Math.round((e - p) * 100);
for (; p > 0; ) {
let _ = p % 1e4;
h && (d = t[0] + d), u = a(_), u += _ !== 0 ? i[s] : i[0], d = u + d, h = _ < 1e3 && _ > 0, p = Math.floor(p / 1e4), s++;
}
return d && (d += "\u5143"), g > 0 ? (d += t[Math.floor(g / 10)] + n[0], g % 10 !== 0 && (d += t[g % 10] + n[1])) : d && (d += "\u6574"), d;
},
UNION: function(...e) {
return (Array.isArray(e[0]) ? e[0] : e).filter((i, r, n) => n.indexOf(i) === r);
},
AND: function(...e) {
return !!e.reduce((t, i) => t && i, !0);
},
OR: function(...e) {
return !!e.reduce((t, i) => t || i, !1);
},
IF: function(e, t = !0, i = !1) {
return e ? t : i;
},
DEFAULT: function(e, t) {
return St.Undef(e) ? t : e;
},
CASE: function(...e) {
for (let t = 0; t < e.length - 1; t += 2)
if (e[t])
return e[t + 1];
return null;
},
COLUMN: function(e, t) {
const i = [];
return Array.isArray(e) && e.forEach(function(r) {
Array.isArray(r) ? i.push(...un.COLUMN(r, t)) : r && i.push(r[t]);
}), i;
},
VALUE: function(e, t, i) {
const r = ("" + t).split(".");
let n = e;
for (let a = 0; a < r.length; a++)
if (Li(n, r[a]))
n = n[r[a]];
else
return i;
return n;
},
CONCAT: function(...e) {
return "".concat(...e);
},
INTERSECTIONSET: function(e, t) {
const i = [];
for (let r = 0; r < e.length; r++) {
const n = e[r];
t.indexOf(n) !== -1 && i.indexOf(n) === -1 && i.push(n);
}
return i;
},
LIST: function(...e) {
return e;
},
IN: function(e, t) {
return (e || []).indexOf(t) > -1;
},
FALSE: function() {
return !1;
},
TRUE: function() {
return !0;
},
NOT: function(e) {
return !e;
},
EQ: function(e, t) {
return e === t;
},
GE: function(e, t) {
return e >= t;
},
GT: function(e, t) {
return e > t;
},
LE: function(e, t) {
return e <= t;
},
LT: function(e, t) {
return e < t;
},
NE: function(e, t) {
return e !== t;
}
}, oc = {
ADD: "ADD(1, 2) = 3",
SUB: "SUB(10, 1) = 9",
MUL: "MUL(2, 2) = 4",
DIV: "DIV(10, 2) = 5",
SUM: "SUM(1,2,3) = 6, SUM([5, 6, 7]) = 18",
MAX: "MAX(1, 5, 10) = 10",
MIN: "MIN(1, 5, 10) = 1",
ABS: "ABS(-10) = 10, ABS(10) = 10",
AVG: "AVG(2, 4, 6, 8) = 5",
POWER: "POWER(2, 4) = 16",
RAND: "RAND() = 0.75348173001531",
PI: "PI() = 3.141592653589793",
ROUND: "ROUND(3.149, 2) = 3.15, ROUND(3.149) = 3",
SQRT: "SQRT(9) = 3",
NOW: 'NOW() = "2024-03-15 12:08:31"',
TODAY: 'TODAY() = "2024-03-15"',
YEAR: 'YEAR("2024-03-15 12:08:31") = 2024',
MONTH: 'MONTH("2024-03-15 12:08:31") = 3',
DAY: 'DAY("2024-03-15 12:08:31") = 15',
HOUR: 'HOUR("2024-03-15 12:08:31") = 12',
MINUTE: 'MINUTE("2024-03-15 12:08:31") = 8',
SECOND: 'SECOND("2024-03-15 12:08:31") = 31',
TIMESTAMP: 'TIMESTAMP("2024-03-15 12:08:31") = 1710475711000',
ADDYEAR: 'ADDYEAR("2024-03-15 12:08:31", 2) = 2026-03-15 12:08:31, ADDYEAR("2024-03-15 12:08:31", 3, "YYYY-MM-DD") = 2027-03-15',
ADDMONTH: 'ADDMONTH("2024-03-15 12:08:31", 2) = 2024-05-15 12:08:31, ADDMONTH("2024-03-15 12:08:31", 10, "YYYY-MM-DD") = 2025-01-15',
ADDDAY: 'ADDDAY("2024-03-15 12:08:31", 10) = 2024-03-25 12:08:31, ADDDAY("2024-03-15 12:08:31", 20, "YYYY-MM-DD") = 2024-04-04',
ADDHOUR: 'ADDHOUR("2024-03-15 12:08:31", 10) = 2024-03-15 22:08:31, ADDHOUR("2024-03-15 12:08:31", 20, "HH:mm:ss") = 08:08:31',
ADDMINUTE: 'ADDMINUTE("2024-03-15 12:08:31", 30) = 2024-03-15 12:38:31, ADDMINUTE("2024-03-15 12:08:31", 55, "HH:mm:ss") = 13:03:31',
ADDSECOND: 'ADDSECOND("2024-03-15 12:08:31", 20) = 2024-03-15 12:08:51, ADDSECOND("2024-03-15 12:08:31", 40, "HH:mm:ss") = 12:09:11',
ADDWEEK: 'ADDWEEK("2024-03-15 12:08:31", 2) = 2024-03-29 12:08:31, ADDWEEK("2024-03-15 12:08:31", 4, "YYYY-MM-DD") = 2024-04-12',
SUBYEAR: 'SUBYEAR("2024-03-15 12:08:31", 2) = 2022-03-15 12:08:31, SUBYEAR("2024-03-15 12:08:31", 3, "YYYY-MM-DD") = 2021-03-15',
SUBMONTH: 'SUBMONTH("2024-03-15 12:08:31", 2) = 2024-01-15 12:08:31, SUBMONTH("2024-03-15 12:08:31", 10, "YYYY-MM-DD") = 2023-05-15',
SUBDAY: 'SUBDAY("2024-03-15 12:08:31", 10) = 2024-03-05 12:08:31, SUBDAY("2024-03-15 12:08:31", 20, "YYYY-MM-DD") = 2024-02-24',
SUBHOUR: 'SUBHOUR("2024-03-15 12:08:31", 10) = 2024-03-15 02:08:31, SUBHOUR("2024-03-15 12:08:31", 20, "HH:mm:ss") = 16:08:31',
SUBMINUTE: 'SUBMINUTE("2024-03-15 12:08:31", 30) = 2024-03-15 11:38:31, SUBMINUTE("2024-03-15 12:08:31", 55, "HH:mm:ss") = 11:13:31',
SUBSECOND: 'SUBSECOND("2024-03-15 12:08:31", 20) = 2024-03-15 12:08:11, SUBSECOND("2024-03-15 12:08:31", 40, "HH:mm:ss") = 12:07:51',
SUBWEEK: 'SUBWEEK("2024-03-15 12:08:31", 2) = 2024-03-01 12:08:31, SUBWEEK("2024-03-15 12:08:31", 4, "YYYY-MM-DD") = 2024-02-16',
DIFFDAYS: 'DIFFDAYS("2024-01-15","2024-03-15") = 60',
DIFFHOURS: 'DIFFHOURS("2024-01-15 12:00:00", "2024-01-16 15:00:00") = 27, DIFFHOURS("2024-01-15 12:00:00", "2024-01-15 12:30:00") = 0.5',
DIFFMINUTES: 'DIFFMINUTES("2024-01-15 12:00:00", "2024-01-15 12:30:00") = 30',
STARTSWITH: 'STARTSWITH("ABCDEF","ABC") = true, STARTSWITH("ABCDEF","AD") = false',
EMPTY: 'EMPTY("") = true, EMPTY([]) = true, EMPTY("0") = false',
NOTEMPTY: 'NOTEMPTY("") = false, NOTEMPTY([]) = false, NOTEMPTY("0") = true',
LEN: 'LEN(["a", "b", "c"]) = 3',
MOD: "MOD(10, 3) = 1",
FLOOR: "FLOOR(1.93) = 1",
CEIL: "CEIL(1.93) = 2",
FIXED: "FIXED(1.93, 1) = 1.9",
ISNUMBER: 'ISNUMBER("2.34") = true, ISNUMBER("2.4e") = false',
TONUMBER: 'TONUMBER("1.5") = 1.5, TONUMBER("2.4e") = 2.4, TONUMBER("ABC") = 0',
SLICELEFT: 'SLICELEFT("ABCDE", 3) = "ABC"',
SLICERIGHT: 'SLICERIGHT("ABCDE", 3) = "CDE"',
TOLOWER: 'TOUPPER("ABCD") = "abcd"',
TOUPPER: 'TOUPPER("abcd") = "ABCD"',
INCLUDES: 'INCLUDES("ABCD", "BC") = 1, INCLUDES("ABCD", "E") = -1',
REPLACE: 'REPLACE("AbAc","A","1") = "1bAc"',
REPLACEALL: 'REPLACEALL("AbAc","A","1") = "1b1c"',
TRIM: 'TRIM("\\t\\n A BC \\t\\n") = "A BC"',
TOCHINSESAMOUNT: 'TOCHINSESAMOUNT(32.14) = "\u53C1\u62FE\u8D30\u5143\u58F9\u89D2\u8086\u5206"',
UNION: "UNION(1, 3, 5, 1, 4, 3) = [1, 3, 5, 4], UNION([1, 2, 3, 1, 2, 3]) = [1, 2, 3]",
INTERSECTIONSET: "INTERSECTIONSET([1, 3, 5], [1, 4, 3]) = [1, 3]",
LIST: "LIST([1, 3, 5], [1, 4, 3]) = [[1, 3, 5], [1, 4, 3]]",
AND: "AND(true, true) = true, AND(true, false) = false",
OR: "OR(false, false) = false, OR(false, true) = true",
IF: "IF(false, 1, 0) = 0, IF(true, 1, 0) = 1",
IN: "IN([1,2,3,4], 4) = true, IN([1,2,3,4], 5) = false",
DEFAULT: 'DEFAULT("#FF7271", "#000") = "#FF7271", DEFAULT("", "#000") = "", DEFAULT(null, "#000") = "#000"',
CASE: "CASE(IN([1,2,3,4], 5), 1, IN([1,2,3,4], 2), 2) = 2",
COLUMN: 'COLUMN([{key: 1}, {key: 2}, {key: 3}],"key") = [1, 2, 3], COLUMN([[{key: 1}, {key: 2}], [{key: 3}, {key: 4}]], "key") = [1, 2, 3, 4]',
VALUE: 'VALUE({key: 1}, "key", 2) = 1, VALUE({key: 1}, "value", 2) = 2, VALUE({list: {key: 1}}, "list.key") = 1',
CONCAT: 'CONCAT("ABC", "DEF") = "ABCDEF"',
FALSE: "FALSE() = false",
TRUE: "TRUE() = true",
NOT: "NOT(true) = false, NOT(false) = true",
EQ: 'EQ(100, 100) = true, EQ(100, 90) = false, EQ(100, "100") = false',
GE: "GE(100, 90) = true, GE(100, 100) = true, GE(100, 110) = false",
GT: "GT(100, 90) = true, GT(100, 100) = false, GT(100, 110) = false",
LE: "LE(100, 90) = false, LE(100, 100) = true, LE(100, 110) = true",
LT: "LT(100, 90) = false, LT(100, 100) = false, LT(100, 110) = true",
NE: 'NE(100, 90) = true, NE(100, 100) = false, NE(100, "100") = true'
}, b0 = [
{
key: "math",
children: ["TONUMBER", "ADD", "SUB", "MUL", "DIV", "SUM", "MAX", "MIN", "ABS", "AVG", "MOD", "SQRT", "POWER", "RAND", "PI", "ROUND", "FLOOR", "CEIL", "FIXED", "TOCHINSESAMOUNT"]
},
{
key: "string",
children: ["STARTSWITH", "SLICELEFT", "SLICERIGHT", "TOLOWER", "TOUPPER", "INCLUDES", "CONCAT", "REPLACE", "REPLACEALL", "TRIM"]
},
{
key: "date",
children: ["NOW", "TODAY", "YEAR", "MONTH", "DAY", "HOUR", "MINUTE", "SECOND", "ADDYEAR", "SUBYEAR", "ADDMONTH", "SUBMONTH", "ADDWEEK", "SUBWEEK", "ADDDAY", "SUBDAY", "ADDHOUR", "SUBHOUR", "ADDMINUTE", "SUBMINUTE", "ADDSECOND", "SUBSECOND", "DIFFDAYS", "DIFFHOURS", "DIFFMINUTES", "TIMESTAMP"]
},
{
key: "collection",
children: ["IN", "LEN", "UNION", "COLUMN", "VALUE", "INTERSECTIONSET", "LIST"]
},
{
key: "condition",
children: ["IF", "AND", "OR", "CASE", "NOT", "EQ", "NE", "GE", "GT", "LE", "LT", "TRUE", "FALSE", "DEFAULT", "EMPTY", "NOTEMPTY", "ISNUMBER"]
}
], EE = (e, t) => {
let i = [e];
const r = t.split(".");
let n = 1;
for (; r[n]; ) {
let a = [];
i.forEach((s) => {
Object.values(s.ctxs).forEach((u) => {
if (u.rule._fc_id === r[n - 1]) {
const d = s.subForm[u.id];
a.push(...Array.isArray(d) ? d : [d]);
}
});
}), i = a.map((s) => s.rule[0].__fc__.$handle), n++;
}
return [i, r[n - 1]];
}, ls = (e, t, i) => {
const r = e.vm.setupState.top.setupState.fc.$handle;
let n = [e.$handle];
e.$handle !== r && n.push(r);
let a = t;
t.indexOf(".") > -1 && ([n, a] = EE(r, t)), n.forEach((s) => {
Object.values(s.ctxs).forEach((u) => {
u.rule._fc_id === a && i(u.rule, s.api);
});
});
}, Rc = {
openModel(e, t) {
t.api.open(e.model);
},
closeModel(e, t) {
t.api.close(e.model);
},
hidden(e, t, i) {
const r = typeof e.id == "string" ? [e.id] : e.id || [];
let n = !!e.status;
e.compute && (n = !!i.$handle.compute(t.self.__fc__, e.formula)), r.forEach((a) => {
ls(i, a, (s) => {
s.hidden = n;
});
});
},
disabled(e, t, i) {
const r = typeof e.id == "string" ? [e.id] : e.id || [];
let n = !!e.status;
e.compute && (n = !!i.$handle.compute(t.self.__fc__, e.formula)), r.forEach((a) => {
ls(i, a, (s) => {
s.props || (s.props = {}), s.props.disabled = n;
});
});
},
resetFields(e, t) {
t.api.top.resetFields();
},
clearFields(e, t) {
t.api.top.coverValue({});
},
validate(e, t) {
return t.api.top.validate();
},
validateFields(e, t, i) {
const r = typeof e.id == "string" ? [e.id] : e.id || [], n = [];
return r.forEach((a) => {
ls(i, a, (s, u) => {
s.field && n.push(u.validateField(s.field));
});
}), n.length ? Promise.all(n) : void 0;
},
submit(e, t) {
return t.api.top.submit();
},
setValue(e, t, i) {
(e.formData || []).forEach((r) => {
let n = r.value;
r.compute && (n = i.$handle.compute(t.self.__fc__, r.formula)), ls(i, r.id, (a) => {
a.value = n;
});
});
},
fetch(e, t) {
const { append: i, response: r, fetch: n } = e;
return i && (n.data = { ...t.api.formData(), ...n.data || {} }), new Promise((a, s) => {
t.api.fetch(e.fetch).then((u) => {
r && t.api.setData(r, u), a(u);
}).catch((u) => {
s(u);
});
});
},
copy(e, t, i) {
let r = e.content || "";
e.compute && (r = i.$handle.compute(t.self.__fc__, e.formula)), er(r);
},
callback(e, t) {
return e.callback && e.callback(t);
},
message(e) {
Ac(e || {});
}
}, _0 = [
{
key: "model",
children: ["openModel", "closeModel", "message"]
},
{
key: "form",
children: ["hidden", "disabled", "resetFields", "clearFields", "setValue", "validate", "validateFields", "submit"]
},
{
key: "other",
children: ["fetch", "copy", "callback"]
}
], w0 = {
openModel(e) {
return [
{
type: "select",
field: "model",
$required: !0,
options: e.pageData.filter((t) => !t.default).map((t) => {
const i = t.main._menu;
return {
label: zo(t.main, t.config.labelField, "") || e.t("com." + i.name + ".name") || i.label,
value: t.main.name
};
})
}
];
},
message(e) {
return [
{
type: "radio",
field: "type",
value: "info",
props: {
type: "button"
},
options: gt(e.t, ["info", "warning", "success", "error"].map((t) => ({ label: t, value: t })))
},
{
type: "input",
$required: !0,
field: "message"
},
{
type: "inputNumber",
field: "duration",
props: {
precision: 0,
controlsPosition: "right"
}
},
{
type: "switch",
field: "showClose"
}
];
},
hidden(e) {
const t = e.t;
return [
{
type: "RuleSelect",
field: "id",
$required: !0,
props: {
multiple: !0
}
},
{
type: "radio",
field: "compute",
value: !1,
options: [
{ label: t("behavior.props.static"), value: !1 },
{ label: t("behavior.props.formula"), value: !0 }
],
control: [
{
value: !1,
rule: [
{
type: "radio",
field: "status",
value: !0,
options: [
{ label: t("props.show"), value: !1 },
{ label: t("props.hide"), value: !0 }
]
}
]
},
{
value: !0,
rule: [
{
type: "ComputedConfig",
field: "formula",
$required: !0,
props: {
btn: t("behavior.props.setFormula"),
title: t("behavior.props.setFormula"),
name: t("behavior.props.setFormula"),
invertLabel: t("props.show"),
validLabel: t("props.hide")
}
}
]
}
]
}
];
},
disabled(e) {
const t = e.t;
return [
{
type: "RuleSelect",
field: "id",
$required: !0,
props: {
onlyField: !0,
multiple: !0
}
},
{
type: "radio",
field: "compute",
value: !1,
options: [
{ label: t("behavior.props.static"), value: !1 },
{ label: t("behavior.props.formula"), value: !0 }
],
control: [
{
value: !1,
rule: [
{
type: "radio",
field: "status",
value: !0,
options: [
{ label: t("props.enable"), value: !1 },
{ label: t("props.disabled"), value: !0 }
]
}
]
},
{
value: !0,
rule: [
{
type: "ComputedConfig",
field: "formula",
$required: !0,
props: {
title: t("behavior.props.setFormula"),
invertLabel: t("props.enable"),
validLabel: t("props.disabled")
}
}
]
}
]
}
];
},
validateFields() {
return [
{
type: "RuleSelect",
field: "id",
$required: !0,
props: {
onlyField: !0,
multiple: !0
}
}
];
},
setValue(e) {
const t = e.t;
return [
{
type: "group",
field: "formData",
props: {
expand: 1,
rule: [
{
type: "RuleSelect",
field: "id",
title: t("behavior.props.id"),
$required: !0,
props: {
onlyField: !0
}
},
{
type: "radio",
field: "compute",
value: !1,
title: t("behavior.props.compute"),
options: [
{ label: t("behavior.props.static"), value: !1 },
{ label: t("behavior.props.formula"), value: !0 }
],
control: [
{
value: !1,
rule: [
{
type: "ValueInput",
field: "value",
title: t("props.value"),
$required: !0
}
]
},
{
value: !0,
rule: [
{
type: "ComputedConfig",
field: "formula",
title: t("behavior.props.formula"),
$required: !0,
props: {
type: "value",
title: t("behavior.props.setFormula"),
invertLabel: t("props.show"),
validLabel: t("props.hide")
}
}
]
}
]
}
]
}
}
];
},
fetch() {
return [
{
type: "FetchConfig",
field: "fetch",
$required: !0
},
{
type: "switch",
field: "append",
value: !1
},
{
type: "input",
field: "response",
value: "res_" + rt()
}
];
},
copy(e) {
const t = e.t;
return [
{
type: "radio",
field: "compute",
value: !1,
options: [
{ label: t("behavior.props.static"), value: !1 },
{ label: t("behavior.props.formula"), value: !0 }
],
control: [
{
value: !1,
rule: [
{
type: "input",
field: "content",
$required: !0,
props: {
type: "textarea"
},
options: [
{ label: t("props.enable"), value: !1 },
{ label: t("props.disabled"), value: !0 }
]
}
]
},
{
value: !0,
rule: [
{
type: "ComputedConfig",
field: "formula",
$required: !0,
props: {
type: "value",
title: t("behavior.props.setFormula"),
invertLabel: t("props.enable"),
validLabel: t("props.disabled")
}
}
]
}
]
}
];
},
callback(e) {
return [{
type: "FnInput",
field: "callback",
$required: !0,
props: {
name: "callback",
args: [In(e.t)]
}
}];
}
};
function xE(e, t) {
return e.reduce((i, r) => i.then(() => r(t)), Promise.resolve());
}
const TE = function(e) {
return {
name: "behavior",
load(t, i) {
const r = t.getValue(), n = {}, a = {};
r && Object.keys(r).forEach((s) => {
if (Array.isArray(r[s])) {
const u = [];
if (r[s].forEach((d) => {
const { method: h, config: p, expression: g, stopPropagation: _, ignoreError: S } = d;
u.push((b) => new Promise((A) => {
if (g && e.$handle.compute(i.__fc__, g) === !1) {
A();
return;
}
const w = (...y) => {
(!_ || e.$handle.compute(i.__fc__, _) !== !0) && A(...y);
};
let m;
try {
m = Rc[h](p || {}, b, e);
} catch (y) {
console.error(y), S !== !1 && w();
return;
}
m && m.then ? m.then(w).catch(() => {
S !== !1 && w();
}) : w(m);
}));
}), u.length) {
const d = e.$handle.inject(i, function(h) {
xE(u, h);
}, i.inject || e.$handle.options.injectEvent);
s.indexOf("hook_") > -1 ? a[s.replace("hook_", "")] = d : n[s] = d;
}
}
}), t.getProp().on = n, t.getProp().hook = a;
}
};
}, js = {
name: "easySlots",
load(e) {
const t = e.getValue(), i = {};
t && Object.keys(t).forEach((r) => {
i[r] = t[r].type === "icon" ? {
type: "i",
class: "fc-icon iconfont " + t[r].value
} : {
type: "div",
children: ["" + (t[r].value || "")]
};
}), e.getProp().renderSlots = i;
}
};
js.watch = js.load;
const kE = Object.assign || function(e) {
for (let t, i = 1; i < arguments.length; i++)
for (let r in t = arguments[i], t)
Object.prototype.hasOwnProperty.call(t, r) && Fo(e, r, t[r]);
return e;
};
function tu() {
return kE.apply(this, arguments);
}
function OE(e) {
return typeof e != "object" || e === null ? e : e instanceof Array ? [...e] : { ...e };
}
function A0(e) {
e.__proto__.setBehavior = (t) => {
tu(Rc, t);
}, e.extendApi((t) => ({
open(i, ...r) {
(t.el(i) || t.top.el(i)).open(...r);
},
close(i) {
i ? (t.el(i) || t.top.el(i)).close() : (t.top.bus.$emit("fc.closeDialog"), t !== t.top && t.bus.$emit("fc.closeDialog"));
}
}));
}
function C0(e) {
e.extendApi((t) => ({
message(i) {
return Ac(i || {});
}
}));
}
qs.parser().preview = k_;
Object.keys(un).forEach((e) => {
qs.setFormula(e, un[e]);
});
const Qn = qs, tt = qs.factory();
A0(Qn);
C0(Qn);
A0(tt);
C0(tt);
Qn.register("behavior", TE);
Qn.register("easySlots", js);
tt.register("easySlots", js);
let S0 = null, Us = $s(null);
function ac(...e) {
return S0(...e);
}
const E0 = (e) => {
Us.value = e || zg;
const t = Zf(Us);
return S0 = t.t, t;
};
E0();
var Ef = { exports: {} }, yv;
function Ko() {
return yv || (yv = 1, function(e, t) {
(function(i, r) {
e.exports = r();
})(Oc, function() {
var i = navigator.userAgent, r = navigator.platform, n = /gecko\/\d/i.test(i), a = /MSIE \d/.test(i), s = /Trident\/(?:[7-9]|\d{2,})\..*rv:(\d+)/.exec(i), u = /Edge\/(\d+)/.exec(i), d = a || s || u, h = d && (a ? document.documentMode || 6 : +(u || s)[1]), p = !u && /WebKit\//.test(i), g = p && /Qt\/\d+\.\d+/.test(i), _ = !u && /Chrome\/(\d+)/.exec(i), S = _ && +_[1], b = /Opera\//.test(i), A = /Apple Computer/.test(navigator.vendor), w = /Mac OS X 1\d\D([8-9]|\d\d)\D/.test(i), m = /PhantomJS/.test(i), y = A && (/Mobile\/\w+/.test(i) || navigator.maxTouchPoints > 2), E = /Android/.test(i), x = y || E || /webOS|BlackBerry|Opera Mini|Opera Mobi|IEMobile/i.test(i), k = y || /Mac/.test(r), D = /\bCrOS\b/.test(i), P = /win/i.test(r), M = b && i.match(/Version\/(\d*\.\d*)/);
M && (M = Number(M[1])), M && M >= 15 && (b = !1, p = !0);
var B = k && (g || b && (M == null || M < 12.11)), T = n || d && h >= 9;
function $(o) {
return new RegExp("(^|\\s)" + o + "(?:$|\\s)\\s*");
}
var V = function(o, l) {
var c = o.className, f = $(l).exec(c);
if (f) {
var v = c.slice(f.index + f[0].length);
o.className = c.slice(0, f.index) + (v ? f[1] + v : "");
}
};
function z(o) {
for (var l = o.childNodes.length; l > 0; --l)
o.removeChild(o.firstChild);
return o;
}
function H(o, l) {
return z(o).appendChild(l);
}
function I(o, l, c, f) {
var v = document.createElement(o);
if (c && (v.className = c), f && (v.style.cssText = f), typeof l == "string")
v.appendChild(document.createTextNode(l));
else if (l)
for (var R = 0; R < l.length; ++R)
v.appendChild(l[R]);
return v;
}
function U(o, l, c, f) {
var v = I(o, l, c, f);
return v.setAttribute("role", "presentation"), v;
}
var F;
document.createRange ? F = function(o, l, c, f) {
var v = document.createRange();
return v.setEnd(f || o, c), v.setStart(o, l), v;
} : F = function(o, l, c) {
var f = document.body.createTextRange();
try {
f.moveToElementText(o.parentNode);
} catch {
return f;
}
return f.collapse(!0), f.moveEnd("character", c), f.moveStart("character", l), f;
};
function C(o, l) {
if (l.nodeType == 3 && (l = l.parentNode), o.contains)
return o.contains(l);
do
if (l.nodeType == 11 && (l = l.host), l == o)
return !0;
while (l = l.parentNode);
}
function q(o) {
var l;
try {
l = o.activeElement;
} catch {
l = o.body || null;
}
for (; l && l.shadowRoot && l.shadowRoot.activeElement; )
l = l.shadowRoot.activeElement;
return l;
}
function X(o, l) {
var c = o.className;
$(l).test(c) || (o.className += (c ? " " : "") + l);
}
function Y(o, l) {
for (var c = o.split(" "), f = 0; f < c.length; f++)
c[f] && !$(c[f]).test(l) && (l += " " + c[f]);
return l;
}
var ue = function(o) {
o.select();
};
y ? ue = function(o) {
o.selectionStart = 0, o.selectionEnd = o.value.length;
} : d && (ue = function(o) {
try {
o.select();
} catch {
}
});
function ee(o) {
return o.display.wrapper.ownerDocument;
}
function pe(o) {
return ee(o).defaultView;
}
function Te(o) {
var l = Array.prototype.slice.call(arguments, 1);
return function() {
return o.apply(null, l);
};
}
function ve(o, l, c) {
l || (l = {});
for (var f in o)
o.hasOwnProperty(f) && (c !== !1 || !l.hasOwnProperty(f)) && (l[f] = o[f]);
return l;
}
function me(o, l, c, f, v) {
l == null && (l = o.search(/[^\s\u00a0]/), l == -1 && (l = o.length));
for (var R = f || 0, L = v || 0; ; ) {
var j = o.indexOf(" ", R);
if (j < 0 || j >= l)
return L + (l - R);
L += j - R, L += c - L % c, R = j + 1;
}
}
var we = function() {
this.id = null, this.f = null, this.time = 0, this.handler = Te(this.onTimeout, this);
};
we.prototype.onTimeout = function(o) {
o.id = 0, o.time <= +new Date() ? o.f() : setTimeout(o.handler, o.time - +new Date());
}, we.prototype.set = function(o, l) {
this.f = l;
var c = +new Date() + o;
(!this.id || c < this.time) && (clearTimeout(this.id), this.id = setTimeout(this.handler, o), this.time = c);
};
function he(o, l) {
for (var c = 0; c < o.length; ++c)
if (o[c] == l)
return c;
return -1;
}
var Se = 50, xe = { toString: function() {
return "CodeMirror.Pass";
} }, O = { scroll: !1 }, K = { origin: "*mouse" }, J = { origin: "+move" };
function ne(o, l, c) {
for (var f = 0, v = 0; ; ) {
var R = o.indexOf(" ", f);
R == -1 && (R = o.length);
var L = R - f;
if (R == o.length || v + L >= l)
return f + Math.min(L, l - v);
if (v += R - f, v += c - v % c, f = R + 1, v >= l)
return f;
}
}
var re = [""];
function fe(o) {
for (; re.length <= o; )
re.push(Ae(re) + " ");
return re[o];
}
function Ae(o) {
return o[o.length - 1];
}
function Fe(o, l) {
for (var c = [], f = 0; f < o.length; f++)
c[f] = l(o[f], f);
return c;
}
function Xe(o, l, c) {
for (var f = 0, v = c(l); f < o.length && c(o[f]) <= v; )
f++;
o.splice(f, 0, l);
}
function Ze() {
}
function be(o, l) {
var c;
return Object.create ? c = Object.create(o) : (Ze.prototype = o, c = new Ze()), l && ve(l, c), c;
}
var Le = /[\u00df\u0587\u0590-\u05f4\u0600-\u06ff\u3040-\u309f\u30a0-\u30ff\u3400-\u4db5\u4e00-\u9fcc\uac00-\ud7af]/;
function ke(o) {
return /\w/.test(o) || o > "\x80" && (o.toUpperCase() != o.toLowerCase() || Le.test(o));
}
function it(o, l) {
return l ? l.source.indexOf("\\w") > -1 && ke(o) ? !0 : l.test(o) : ke(o);
}
function pt(o) {
for (var l in o)
if (o.hasOwnProperty(l) && o[l])
return !1;
return !0;
}
var De = /[\u0300-\u036f\u0483-\u0489\u0591-\u05bd\u05bf\u05c1\u05c2\u05c4\u05c5\u05c7\u0610-\u061a\u064b-\u065e\u0670\u06d6-\u06dc\u06de-\u06e4\u06e7\u06e8\u06ea-\u06ed\u0711\u0730-\u074a\u07a6-\u07b0\u07eb-\u07f3\u0816-\u0819\u081b-\u0823\u0825-\u0827\u0829-\u082d\u0900-\u0902\u093c\u0941-\u0948\u094d\u0951-\u0955\u0962\u0963\u0981\u09bc\u09be\u09c1-\u09c4\u09cd\u09d7\u09e2\u09e3\u0a01\u0a02\u0a3c\u0a41\u0a42\u0a47\u0a48\u0a4b-\u0a4d\u0a51\u0a70\u0a71\u0a75\u0a81\u0a82\u0abc\u0ac1-\u0ac5\u0ac7\u0ac8\u0acd\u0ae2\u0ae3\u0b01\u0b3c\u0b3e\u0b3f\u0b41-\u0b44\u0b4d\u0b56\u0b57\u0b62\u0b63\u0b82\u0bbe\u0bc0\u0bcd\u0bd7\u0c3e-\u0c40\u0c46-\u0c48\u0c4a-\u0c4d\u0c55\u0c56\u0c62\u0c63\u0cbc\u0cbf\u0cc2\u0cc6\u0ccc\u0ccd\u0cd5\u0cd6\u0ce2\u0ce3\u0d3e\u0d41-\u0d44\u0d4d\u0d57\u0d62\u0d63\u0dca\u0dcf\u0dd2-\u0dd4\u0dd6\u0ddf\u0e31\u0e34-\u0e3a\u0e47-\u0e4e\u0eb1\u0eb4-\u0eb9\u0ebb\u0ebc\u0ec8-\u0ecd\u0f18\u0f19\u0f35\u0f37\u0f39\u0f71-\u0f7e\u0f80-\u0f84\u0f86\u0f87\u0f90-\u0f97\u0f99-\u0fbc\u0fc6\u102d-\u1030\u1032-\u1037\u1039\u103a\u103d\u103e\u1058\u1059\u105e-\u1060\u1071-\u1074\u1082\u1085\u1086\u108d\u109d\u135f\u1712-\u1714\u1732-\u1734\u1752\u1753\u1772\u1773\u17b7-\u17bd\u17c6\u17c9-\u17d3\u17dd\u180b-\u180d\u18a9\u1920-\u1922\u1927\u1928\u1932\u1939-\u193b\u1a17\u1a18\u1a56\u1a58-\u1a5e\u1a60\u1a62\u1a65-\u1a6c\u1a73-\u1a7c\u1a7f\u1b00-\u1b03\u1b34\u1b36-\u1b3a\u1b3c\u1b42\u1b6b-\u1b73\u1b80\u1b81\u1ba2-\u1ba5\u1ba8\u1ba9\u1c2c-\u1c33\u1c36\u1c37\u1cd0-\u1cd2\u1cd4-\u1ce0\u1ce2-\u1ce8\u1ced\u1dc0-\u1de6\u1dfd-\u1dff\u200c\u200d\u20d0-\u20f0\u2cef-\u2cf1\u2de0-\u2dff\u302a-\u302f\u3099\u309a\ua66f-\ua672\ua67c\ua67d\ua6f0\ua6f1\ua802\ua806\ua80b\ua825\ua826\ua8c4\ua8e0-\ua8f1\ua926-\ua92d\ua947-\ua951\ua980-\ua982\ua9b3\ua9b6-\ua9b9\ua9bc\uaa29-\uaa2e\uaa31\uaa32\uaa35\uaa36\uaa43\uaa4c\uaab0\uaab2-\uaab4\uaab7\uaab8\uaabe\uaabf\uaac1\uabe5\uabe8\uabed\udc00-\udfff\ufb1e\ufe00-\ufe0f\ufe20-\ufe26\uff9e\uff9f]/;
function ze(o) {
return o.charCodeAt(0) >= 768 && De.test(o);
}
function at(o, l, c) {
for (; (c < 0 ? l > 0 : l < o.length) && ze(o.charAt(l)); )
l += c;
return l;
}
function He(o, l, c) {
for (var f = l > c ? -1 : 1; ; ) {
if (l == c)
return l;
var v = (l + c) / 2, R = f < 0 ? Math.ceil(v) : Math.floor(v);
if (R == l)
return o(R) ? l : c;
o(R) ? c = R : l = R + f;
}
}
function Rt(o, l, c, f) {
if (!o)
return f(l, c, "ltr", 0);
for (var v = !1, R = 0; R < o.length; ++R) {
var L = o[R];
(L.from < c && L.to > l || l == c && L.to == l) && (f(Math.max(L.from, l), Math.min(L.to, c), L.level == 1 ? "rtl" : "ltr", R), v = !0);
}
v || f(l, c, "ltr");
}
var ft = null;
function Be(o, l, c) {
var f;
ft = null;
for (var v = 0; v < o.length; ++v) {
var R = o[v];
if (R.from < l && R.to > l)
return v;
R.to == l && (R.from != R.to && c == "before" ? f = v : ft = v), R.from == l && (R.from != R.to && c != "before" ? f = v : ft = v);
}
return f != null ? f : ft;
}
var Je = function() {
var o = "bbbbbbbbbtstwsbbbbbbbbbbbbbbssstwNN%%%NNNNNN,N,N1111111111NNNNNNNLLLLLLLLLLLLLLLLLLLLLLLLLLNNNNNNLLLLLLLLLLLLLLLLLLLLLLLLLLNNNNbbbbbbsbbbbbbbbbbbbbbbbbbbbbbbbbb,N%%%%NNNNLNNNNN%%11NLNNN1LNNNNNLLLLLLLLLLLLLLLLLLLLLLLNLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLN", l = "nnnnnnNNr%%r,rNNmmmmmmmmmmmrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrmmmmmmmmmmmmmmmmmmmmmnnnnnnnnnn%nnrrrmrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrmmmmmmmnNmmmmmmrrmmNmmmmrr1111111111";
function c(te) {
return te <= 247 ? o.charAt(te) : 1424 <= te && te <= 1524 ? "R" : 1536 <= te && te <= 1785 ? l.charAt(te - 1536) : 1774 <= te && te <= 2220 ? "r" : 8192 <= te && te <= 8203 ? "w" : te == 8204 ? "b" : "L";
}
var f = /[\u0590-\u05f4\u0600-\u06ff\u0700-\u08ac]/, v = /[stwN]/, R = /[LRr]/, L = /[Lb1n]/, j = /[1n]/;
function Q(te, se, de) {
this.level = te, this.from = se, this.to = de;
}
return function(te, se) {
var de = se == "ltr" ? "L" : "R";
if (te.length == 0 || se == "ltr" && !f.test(te))
return !1;
for (var Ee = te.length, Ce = [], Ie = 0; Ie < Ee; ++Ie)
Ce.push(c(te.charCodeAt(Ie)));
for (var Ne = 0, Ue = de; Ne < Ee; ++Ne) {
var Ye = Ce[Ne];
Ye == "m" ? Ce[Ne] = Ue : Ue = Ye;
}
for (var nt = 0, Qe = de; nt < Ee; ++nt) {
var ot = Ce[nt];
ot == "1" && Qe == "r" ? Ce[nt] = "n" : R.test(ot) && (Qe = ot, ot == "r" && (Ce[nt] = "R"));
}
for (var mt = 1, ct = Ce[0]; mt < Ee - 1; ++mt) {
var Et = Ce[mt];
Et == "+" && ct == "1" && Ce[mt + 1] == "1" ? Ce[mt] = "1" : Et == "," && ct == Ce[mt + 1] && (ct == "1" || ct == "n") && (Ce[mt] = ct), ct = Et;
}
for (var Bt = 0; Bt < Ee; ++Bt) {
var mn = Ce[Bt];
if (mn == ",")
Ce[Bt] = "N";
else if (mn == "%") {
var Kt = void 0;
for (Kt = Bt + 1; Kt < Ee && Ce[Kt] == "%"; ++Kt)
;
for (var Wn = Bt && Ce[Bt - 1] == "!" || Kt < Ee && Ce[Kt] == "1" ? "1" : "N", Nn = Bt; Nn < Kt; ++Nn)
Ce[Nn] = Wn;
Bt = Kt - 1;
}
}
for (var rn = 0, Bn = de; rn < Ee; ++rn) {
var bn = Ce[rn];
Bn == "L" && bn == "1" ? Ce[rn] = "L" : R.test(bn) && (Bn = bn);
}
for (var ln = 0; ln < Ee; ++ln)
if (v.test(Ce[ln])) {
var on = void 0;
for (on = ln + 1; on < Ee && v.test(Ce[on]); ++on)
;
for (var Jt = (ln ? Ce[ln - 1] : de) == "L", Vn = (on < Ee ? Ce[on] : de) == "L", Ao = Jt == Vn ? Jt ? "L" : "R" : de, _r = ln; _r < on; ++_r)
Ce[_r] = Ao;
ln = on - 1;
}
for (var Sn = [], Ii, vn = 0; vn < Ee; )
if (L.test(Ce[vn])) {
var gd = vn;
for (++vn; vn < Ee && L.test(Ce[vn]); ++vn)
;
Sn.push(new Q(0, gd, vn));
} else {
var Zi = vn, Nr = Sn.length, Br = se == "rtl" ? 1 : 0;
for (++vn; vn < Ee && Ce[vn] != "L"; ++vn)
;
for (var kn = Zi; kn < vn; )
if (j.test(Ce[kn])) {
Zi < kn && (Sn.splice(Nr, 0, new Q(1, Zi, kn)), Nr += Br);
var Co = kn;
for (++kn; kn < vn && j.test(Ce[kn]); ++kn)
;
Sn.splice(Nr, 0, new Q(2, Co, kn)), Nr += Br, Zi = kn;
} else
++kn;
Zi < vn && Sn.splice(Nr, 0, new Q(1, Zi, vn));
}
return se == "ltr" && (Sn[0].level == 1 && (Ii = te.match(/^\s+/)) && (Sn[0].from = Ii[0].length, Sn.unshift(new Q(0, 0, Ii[0].length))), Ae(Sn).level == 1 && (Ii = te.match(/\s+$/)) && (Ae(Sn).to -= Ii[0].length, Sn.push(new Q(0, Ee - Ii[0].length, Ee)))), se == "rtl" ? Sn.reverse() : Sn;
};
}();
function ht(o, l) {
var c = o.order;
return c == null && (c = o.order = Je(o.text, l)), c;
}
var We = [], Re = function(o, l, c) {
if (o.addEventListener)
o.addEventListener(l, c, !1);
else if (o.attachEvent)
o.attachEvent("on" + l, c);
else {
var f = o._handlers || (o._handlers = {});
f[l] = (f[l] || We).concat(c);
}
};
function dt(o, l) {
return o._handlers && o._handlers[l] || We;
}
function lt(o, l, c) {
if (o.removeEventListener)
o.removeEventListener(l, c, !1);
else if (o.detachEvent)
o.detachEvent("on" + l, c);
else {
var f = o._handlers, v = f && f[l];
if (v) {
var R = he(v, c);
R > -1 && (f[l] = v.slice(0, R).concat(v.slice(R + 1)));
}
}
}
function st(o, l) {
var c = dt(o, l);
if (!!c.length)
for (var f = Array.prototype.slice.call(arguments, 2), v = 0; v < c.length; ++v)
c[v].apply(null, f);
}
function Ct(o, l, c) {
return typeof l == "string" && (l = { type: l, preventDefault: function() {
this.defaultPrevented = !0;
} }), st(o, c || l.type, o, l), lr(l) || l.codemirrorIgnore;
}
function Fn(o) {
var l = o._handlers && o._handlers.cursorActivity;
if (!!l)
for (var c = o.curOp.cursorActivityHandlers || (o.curOp.cursorActivityHandlers = []), f = 0; f < l.length; ++f)
he(c, l[f]) == -1 && c.push(l[f]);
}
function Gt(o, l) {
return dt(o, l).length > 0;
}
function Ut(o) {
o.prototype.on = function(l, c) {
Re(this, l, c);
}, o.prototype.off = function(l, c) {
lt(this, l, c);
};
}
function It(o) {
o.preventDefault ? o.preventDefault() : o.returnValue = !1;
}
function si(o) {
o.stopPropagation ? o.stopPropagation() : o.cancelBubble = !0;
}
function lr(o) {
return o.defaultPrevented != null ? o.defaultPrevented : o.returnValue == !1;
}
function vi(o) {
It(o), si(o);
}
function Mn(o) {
return o.target || o.srcElement;
}
function na(o) {
var l = o.which;
return l == null && (o.button & 1 ? l = 1 : o.button & 2 ? l = 3 : o.button & 4 && (l = 2)), k && o.ctrlKey && l == 1 && (l = 3), l;
}
var Eu = function() {
if (d && h < 9)
return !1;
var o = I("div");
return "draggable" in o || "dragDrop" in o;
}(), ui;
function xu(o) {
if (ui == null) {
var l = I("span", "\u200B");
H(o, I("span", [l, document.createTextNode("x")])), o.firstChild.offsetHeight != 0 && (ui = l.offsetWidth <= 1 && l.offsetHeight > 2 && !(d && h < 8));
}
var c = ui ? I("span", "\u200B") : I("span", "\xA0", null, "display: inline-block; width: 1px; margin-right: -1px");
return c.setAttribute("cm-text", ""), c;
}
var to;
function hl(o) {
if (to != null)
return to;
var l = H(o, document.createTextNode("A\u062EA")), c = F(l, 0, 1).getBoundingClientRect(), f = F(l, 1, 2).getBoundingClientRect();
return z(o), !c || c.left == c.right ? !1 : to = f.right - c.right < 3;
}
var ia = `
b`.split(/\n/).length != 3 ? function(o) {
for (var l = 0, c = [], f = o.length; l <= f; ) {
var v = o.indexOf(`
`, l);
v == -1 && (v = o.length);
var R = o.slice(l, o.charAt(v - 1) == "\r" ? v - 1 : v), L = R.indexOf("\r");
L != -1 ? (c.push(R.slice(0, L)), l += L + 1) : (c.push(R), l = v + 1);
}
return c;
} : function(o) {
return o.split(/\r\n?|\n/);
}, sr = window.getSelection ? function(o) {
try {
return o.selectionStart != o.selectionEnd;
} catch {
return !1;
}
} : function(o) {
var l;
try {
l = o.ownerDocument.selection.createRange();
} catch {
}
return !l || l.parentElement() != o ? !1 : l.compareEndPoints("StartToEnd", l) != 0;
}, Ti = function() {
var o = I("div");
return "oncopy" in o ? !0 : (o.setAttribute("oncopy", "return;"), typeof o.oncopy == "function");
}(), ki = null;
function ml(o) {
if (ki != null)
return ki;
var l = H(o, I("span", "x")), c = l.getBoundingClientRect(), f = F(l, 0, 1).getBoundingClientRect();
return ki = Math.abs(c.left - f.left) > 1;
}
var gi = {}, ur = {};
function vl(o, l) {
arguments.length > 2 && (l.dependencies = Array.prototype.slice.call(arguments, 2)), gi[o] = l;
}
function no(o, l) {
ur[o] = l;
}
function zn(o) {
if (typeof o == "string" && ur.hasOwnProperty(o))
o = ur[o];
else if (o && typeof o.name == "string" && ur.hasOwnProperty(o.name)) {
var l = ur[o.name];
typeof l == "string" && (l = { name: l }), o = be(l, o), o.name = l.name;
} else {
if (typeof o == "string" && /^[\w\-]+\/[\w\-]+\+xml$/.test(o))
return zn("application/xml");
if (typeof o == "string" && /^[\w\-]+\/[\w\-]+\+json$/.test(o))
return zn("application/json");
}
return typeof o == "string" ? { name: o } : o || { name: "null" };
}
function Hi(o, l) {
l = zn(l);
var c = gi[l.name];
if (!c)
return Hi(o, "text/plain");
var f = c(o, l);
if (dr.hasOwnProperty(l.name)) {
var v = dr[l.name];
for (var R in v)
!v.hasOwnProperty(R) || (f.hasOwnProperty(R) && (f["_" + R] = f[R]), f[R] = v[R]);
}
if (f.name = l.name, l.helperType && (f.helperType = l.helperType), l.modeProps)
for (var L in l.modeProps)
f[L] = l.modeProps[L];
return f;
}
var dr = {};
function gl(o, l) {
var c = dr.hasOwnProperty(o) ? dr[o] : dr[o] = {};
ve(l, c);
}
function Wi(o, l) {
if (l === !0)
return l;
if (o.copyState)
return o.copyState(l);
var c = {};
for (var f in l) {
var v = l[f];
v instanceof Array && (v = v.concat([])), c[f] = v;
}
return c;
}
function fr(o, l) {
for (var c; o.innerMode && (c = o.innerMode(l), !(!c || c.mode == o)); )
l = c.state, o = c.mode;
return c || { mode: o, state: l };
}
function ra(o, l, c) {
return o.startState ? o.startState(l, c) : !0;
}
var Qt = function(o, l, c) {
this.pos = this.start = 0, this.string = o, this.tabSize = l || 8, this.lastColumnPos = this.lastColumnValue = 0, this.lineStart = 0, this.lineOracle = c;
};
Qt.prototype.eol = function() {
return this.pos >= this.string.length;
}, Qt.prototype.sol = function() {
return this.pos == this.lineStart;
}, Qt.prototype.peek = function() {
return this.string.charAt(this.pos) || void 0;
}, Qt.prototype.next = function() {
if (this.pos < this.string.length)
return this.string.charAt(this.pos++);
}, Qt.prototype.eat = function(o) {
var l = this.string.charAt(this.pos), c;
if (typeof o == "string" ? c = l == o : c = l && (o.test ? o.test(l) : o(l)), c)
return ++this.pos, l;
}, Qt.prototype.eatWhile = function(o) {
for (var l = this.pos; this.eat(o); )
;
return this.pos > l;
}, Qt.prototype.eatSpace = function() {
for (var o = this.pos; /[\s\u00a0]/.test(this.string.charAt(this.pos)); )
++this.pos;
return this.pos > o;
}, Qt.prototype.skipToEnd = function() {
this.pos = this.string.length;
}, Qt.prototype.skipTo = function(o) {
var l = this.string.indexOf(o, this.pos);
if (l > -1)
return this.pos = l, !0;
}, Qt.prototype.backUp = function(o) {
this.pos -= o;
}, Qt.prototype.column = function() {
return this.lastColumnPos < this.start && (this.lastColumnValue = me(this.string, this.start, this.tabSize, this.lastColumnPos, this.lastColumnValue), this.lastColumnPos = this.start), this.lastColumnValue - (this.lineStart ? me(this.string, this.lineStart, this.tabSize) : 0);
}, Qt.prototype.indentation = function() {
return me(this.string, null, this.tabSize) - (this.lineStart ? me(this.string, this.lineStart, this.tabSize) : 0);
}, Qt.prototype.match = function(o, l, c) {
if (typeof o == "string") {
var f = function(L) {
return c ? L.toLowerCase() : L;
}, v = this.string.substr(this.pos, o.length);
if (f(v) == f(o))
return l !== !1 && (this.pos += o.length), !0;
} else {
var R = this.string.slice(this.pos).match(o);
return R && R.index > 0 ? null : (R && l !== !1 && (this.pos += R[0].length), R);
}
}, Qt.prototype.current = function() {
return this.string.slice(this.start, this.pos);
}, Qt.prototype.hideFirstChars = function(o, l) {
this.lineStart += o;
try {
return l();
} finally {
this.lineStart -= o;
}
}, Qt.prototype.lookAhead = function(o) {
var l = this.lineOracle;
return l && l.lookAhead(o);
}, Qt.prototype.baseToken = function() {
var o = this.lineOracle;
return o && o.baseToken(this.pos);
};
function ut(o, l) {
if (l -= o.first, l < 0 || l >= o.size)
throw new Error("There is no line " + (l + o.first) + " in the document.");
for (var c = o; !c.lines; )
for (var f = 0; ; ++f) {
var v = c.children[f], R = v.chunkSize();
if (l < R) {
c = v;
break;
}
l -= R;
}
return c.lines[l];
}
function Gi(o, l, c) {
var f = [], v = l.line;
return o.iter(l.line, c.line + 1, function(R) {
var L = R.text;
v == c.line && (L = L.slice(0, c.ch)), v == l.line && (L = L.slice(l.ch)), f.push(L), ++v;
}), f;
}
function io(o, l, c) {
var f = [];
return o.iter(l, c, function(v) {
f.push(v.text);
}), f;
}
function di(o, l) {
var c = l - o.height;
if (c)
for (var f = o; f; f = f.parent)
f.height += c;
}
function Ft(o) {
if (o.parent == null)
return null;
for (var l = o.parent, c = he(l.lines, o), f = l.parent; f; l = f, f = f.parent)
for (var v = 0; f.children[v] != l; ++v)
c += f.children[v].chunkSize();
return c + l.first;
}
function Oi(o, l) {
var c = o.first;
e:
do {
for (var f = 0; f < o.children.length; ++f) {
var v = o.children[f], R = v.height;
if (l < R) {
o = v;
continue e;
}
l -= R, c += v.chunkSize();
}
return c;
} while (!o.lines);
for (var L = 0; L < o.lines.length; ++L) {
var j = o.lines[L], Q = j.height;
if (l < Q)
break;
l -= Q;
}
return c + L;
}
function oe(o, l) {
return l >= o.first && l < o.first + o.size;
}
function ce(o, l) {
return String(o.lineNumberFormatter(l + o.firstLineNumber));
}
function ge(o, l, c) {
if (c === void 0 && (c = null), !(this instanceof ge))
return new ge(o, l, c);
this.line = o, this.ch = l, this.sticky = c;
}
function $e(o, l) {
return o.line - l.line || o.ch - l.ch;
}
function yt(o, l) {
return o.sticky == l.sticky && $e(o, l) == 0;
}
function Ot(o) {
return ge(o.line, o.ch);
}
function Dt(o, l) {
return $e(o, l) < 0 ? l : o;
}
function an(o, l) {
return $e(o, l) < 0 ? o : l;
}
function Zn(o, l) {
return Math.max(o.first, Math.min(l, o.first + o.size - 1));
}
function bt(o, l) {
if (l.line < o.first)
return ge(o.first, 0);
var c = o.first + o.size - 1;
return l.line > c ? ge(c, ut(o, c).text.length) : _b(l, ut(o, l.line).text.length);
}
function _b(o, l) {
var c = o.ch;
return c == null || c > l ? ge(o.line, l) : c < 0 ? ge(o.line, 0) : o;
}
function Fp(o, l) {
for (var c = [], f = 0; f < l.length; f++)
c[f] = bt(o, l[f]);
return c;
}
var yl = function(o, l) {
this.state = o, this.lookAhead = l;
}, Ri = function(o, l, c, f) {
this.state = l, this.doc = o, this.line = c, this.maxLookAhead = f || 0, this.baseTokens = null, this.baseTokenPos = 1;
};
Ri.prototype.lookAhead = function(o) {
var l = this.doc.getLine(this.line + o);
return l != null && o > this.maxLookAhead && (this.maxLookAhead = o), l;
}, Ri.prototype.baseToken = function(o) {
if (!this.baseTokens)
return null;
for (; this.baseTokens[this.baseTokenPos] <= o; )
this.baseTokenPos += 2;
var l = this.baseTokens[this.baseTokenPos + 1];
return {
type: l && l.replace(/( |^)overlay .*/, ""),
size: this.baseTokens[this.baseTokenPos] - o
};
}, Ri.prototype.nextLine = function() {
this.line++, this.maxLookAhead > 0 && this.maxLookAhead--;
}, Ri.fromSaved = function(o, l, c) {
return l instanceof yl ? new Ri(o, Wi(o.mode, l.state), c, l.lookAhead) : new Ri(o, Wi(o.mode, l), c);
}, Ri.prototype.save = function(o) {
var l = o !== !1 ? Wi(this.doc.mode, this.state) : this.state;
return this.maxLookAhead > 0 ? new yl(l, this.maxLookAhead) : l;
};
function Mp(o, l, c, f) {
var v = [o.state.modeGen], R = {};
jp(
o,
l.text,
o.doc.mode,
c,
function(te, se) {
return v.push(te, se);
},
R,
f
);
for (var L = c.state, j = function(te) {
c.baseTokens = v;
var se = o.state.overlays[te], de = 1, Ee = 0;
c.state = !0, jp(o, l.text, se.mode, c, function(Ce, Ie) {
for (var Ne = de; Ee < Ce; ) {
var Ue = v[de];
Ue > Ce && v.splice(de, 1, Ce, v[de + 1], Ue), de += 2, Ee = Math.min(Ce, Ue);
}
if (!!Ie)
if (se.opaque)
v.splice(Ne, de - Ne, Ce, "overlay " + Ie), de = Ne + 2;
else
for (; Ne < de; Ne += 2) {
var Ye = v[Ne + 1];
v[Ne + 1] = (Ye ? Ye + " " : "") + "overlay " + Ie;
}
}, R), c.state = L, c.baseTokens = null, c.baseTokenPos = 1;
}, Q = 0; Q < o.state.overlays.length; ++Q)
j(Q);
return { styles: v, classes: R.bgClass || R.textClass ? R : null };
}
function Pp(o, l, c) {
if (!l.styles || l.styles[0] != o.state.modeGen) {
var f = oa(o, Ft(l)), v = l.text.length > o.options.maxHighlightLength && Wi(o.doc.mode, f.state), R = Mp(o, l, f);
v && (f.state = v), l.stateAfter = f.save(!v), l.styles = R.styles, R.classes ? l.styleClasses = R.classes : l.styleClasses && (l.styleClasses = null), c === o.doc.highlightFrontier && (o.doc.modeFrontier = Math.max(o.doc.modeFrontier, ++o.doc.highlightFrontier));
}
return l.styles;
}
function oa(o, l, c) {
var f = o.doc, v = o.display;
if (!f.mode.startState)
return new Ri(f, !0, l);
var R = wb(o, l, c), L = R > f.first && ut(f, R - 1).stateAfter, j = L ? Ri.fromSaved(f, L, R) : new Ri(f, ra(f.mode), R);
return f.iter(R, l, function(Q) {
Tu(o, Q.text, j);
var te = j.line;
Q.stateAfter = te == l - 1 || te % 5 == 0 || te >= v.viewFrom && te < v.viewTo ? j.save() : null, j.nextLine();
}), c && (f.modeFrontier = j.line), j;
}
function Tu(o, l, c, f) {
var v = o.doc.mode, R = new Qt(l, o.options.tabSize, c);
for (R.start = R.pos = f || 0, l == "" && Lp(v, c.state); !R.eol(); )
ku(v, R, c.state), R.start = R.pos;
}
function Lp(o, l) {
if (o.blankLine)
return o.blankLine(l);
if (!!o.innerMode) {
var c = fr(o, l);
if (c.mode.blankLine)
return c.mode.blankLine(c.state);
}
}
function ku(o, l, c, f) {
for (var v = 0; v < 10; v++) {
f && (f[0] = fr(o, c).mode);
var R = o.token(l, c);
if (l.pos > l.start)
return R;
}
throw new Error("Mode " + o.name + " failed to advance stream.");
}
var Np = function(o, l, c) {
this.start = o.start, this.end = o.pos, this.string = o.current(), this.type = l || null, this.state = c;
};
function Bp(o, l, c, f) {
var v = o.doc, R = v.mode, L;
l = bt(v, l);
var j = ut(v, l.line), Q = oa(o, l.line, c), te = new Qt(j.text, o.options.tabSize, Q), se;
for (f && (se = []); (f || te.pos < l.ch) && !te.eol(); )
te.start = te.pos, L = ku(R, te, Q.state), f && se.push(new Np(te, L, Wi(v.mode, Q.state)));
return f ? se : new Np(te, L, Q.state);
}
function Vp(o, l) {
if (o)
for (; ; ) {
var c = o.match(/(?:^|\s+)line-(background-)?(\S+)/);
if (!c)
break;
o = o.slice(0, c.index) + o.slice(c.index + c[0].length);
var f = c[1] ? "bgClass" : "textClass";
l[f] == null ? l[f] = c[2] : new RegExp("(?:^|\\s)" + c[2] + "(?:$|\\s)").test(l[f]) || (l[f] += " " + c[2]);
}
return o;
}
function jp(o, l, c, f, v, R, L) {
var j = c.flattenSpans;
j == null && (j = o.options.flattenSpans);
var Q = 0, te = null, se = new Qt(l, o.options.tabSize, f), de, Ee = o.options.addModeClass && [null];
for (l == "" && Vp(Lp(c, f.state), R); !se.eol(); ) {
if (se.pos > o.options.maxHighlightLength ? (j = !1, L && Tu(o, l, f, se.pos), se.pos = l.length, de = null) : de = Vp(ku(c, se, f.state, Ee), R), Ee) {
var Ce = Ee[0].name;
Ce && (de = "m-" + (de ? Ce + " " + de : Ce));
}
if (!j || te != de) {
for (; Q < se.start; )
Q = Math.min(se.start, Q + 5e3), v(Q, te);
te = de;
}
se.start = se.pos;
}
for (; Q < se.pos; ) {
var Ie = Math.min(se.pos, Q + 5e3);
v(Ie, te), Q = Ie;
}
}
function wb(o, l, c) {
for (var f, v, R = o.doc, L = c ? -1 : l - (o.doc.mode.innerMode ? 1e3 : 100), j = l; j > L; --j) {
if (j <= R.first)
return R.first;
var Q = ut(R, j - 1), te = Q.stateAfter;
if (te && (!c || j + (te instanceof yl ? te.lookAhead : 0) <= R.modeFrontier))
return j;
var se = me(Q.text, null, o.options.tabSize);
(v == null || f > se) && (v = j - 1, f = se);
}
return v;
}
function Ab(o, l) {
if (o.modeFrontier = Math.min(o.modeFrontier, l), !(o.highlightFrontier < l - 10)) {
for (var c = o.first, f = l - 1; f > c; f--) {
var v = ut(o, f).stateAfter;
if (v && (!(v instanceof yl) || f + v.lookAhead < l)) {
c = f + 1;
break;
}
}
o.highlightFrontier = Math.min(o.highlightFrontier, c);
}
}
var Up = !1, Ki = !1;
function Cb() {
Up = !0;
}
function Sb() {
Ki = !0;
}
function bl(o, l, c) {
this.marker = o, this.from = l, this.to = c;
}
function aa(o, l) {
if (o)
for (var c = 0; c < o.length; ++c) {
var f = o[c];
if (f.marker == l)
return f;
}
}
function Eb(o, l) {
for (var c, f = 0; f < o.length; ++f)
o[f] != l && (c || (c = [])).push(o[f]);
return c;
}
function xb(o, l, c) {
var f = c && window.WeakSet && (c.markedSpans || (c.markedSpans = /* @__PURE__ */ new WeakSet()));
f && o.markedSpans && f.has(o.markedSpans) ? o.markedSpans.push(l) : (o.markedSpans = o.markedSpans ? o.markedSpans.concat([l]) : [l], f && f.add(o.markedSpans)), l.marker.attachLine(o);
}
function Tb(o, l, c) {
var f;
if (o)
for (var v = 0; v < o.length; ++v) {
var R = o[v], L = R.marker, j = R.from == null || (L.inclusiveLeft ? R.from <= l : R.from < l);
if (j || R.from == l && L.type == "bookmark" && (!c || !R.marker.insertLeft)) {
var Q = R.to == null || (L.inclusiveRight ? R.to >= l : R.to > l);
(f || (f = [])).push(new bl(L, R.from, Q ? null : R.to));
}
}
return f;
}
function kb(o, l, c) {
var f;
if (o)
for (var v = 0; v < o.length; ++v) {
var R = o[v], L = R.marker, j = R.to == null || (L.inclusiveRight ? R.to >= l : R.to > l);
if (j || R.from == l && L.type == "bookmark" && (!c || R.marker.insertLeft)) {
var Q = R.from == null || (L.inclusiveLeft ? R.from <= l : R.from < l);
(f || (f = [])).push(new bl(
L,
Q ? null : R.from - l,
R.to == null ? null : R.to - l
));
}
}
return f;
}
function Ou(o, l) {
if (l.full)
return null;
var c = oe(o, l.from.line) && ut(o, l.from.line).markedSpans, f = oe(o, l.to.line) && ut(o, l.to.line).markedSpans;
if (!c && !f)
return null;
var v = l.from.ch, R = l.to.ch, L = $e(l.from, l.to) == 0, j = Tb(c, v, L), Q = kb(f, R, L), te = l.text.length == 1, se = Ae(l.text).length + (te ? v : 0);
if (j)
for (var de = 0; de < j.length; ++de) {
var Ee = j[de];
if (Ee.to == null) {
var Ce = aa(Q, Ee.marker);
Ce ? te && (Ee.to = Ce.to == null ? null : Ce.to + se) : Ee.to = v;
}
}
if (Q)
for (var Ie = 0; Ie < Q.length; ++Ie) {
var Ne = Q[Ie];
if (Ne.to != null && (Ne.to += se), Ne.from == null) {
var Ue = aa(j, Ne.marker);
Ue || (Ne.from = se, te && (j || (j = [])).push(Ne));
} else
Ne.from += se, te && (j || (j = [])).push(Ne);
}
j && (j = zp(j)), Q && Q != j && (Q = zp(Q));
var Ye = [j];
if (!te) {
var nt = l.text.length - 2, Qe;
if (nt > 0 && j)
for (var ot = 0; ot < j.length; ++ot)
j[ot].to == null && (Qe || (Qe = [])).push(new bl(j[ot].marker, null, null));
for (var mt = 0; mt < nt; ++mt)
Ye.push(Qe);
Ye.push(Q);
}
return Ye;
}
function zp(o) {
for (var l = 0; l < o.length; ++l) {
var c = o[l];
c.from != null && c.from == c.to && c.marker.clearWhenEmpty !== !1 && o.splice(l--, 1);
}
return o.length ? o : null;
}
function Ob(o, l, c) {
var f = null;
if (o.iter(l.line, c.line + 1, function(Ce) {
if (Ce.markedSpans)
for (var Ie = 0; Ie < Ce.markedSpans.length; ++Ie) {
var Ne = Ce.markedSpans[Ie].marker;
Ne.readOnly && (!f || he(f, Ne) == -1) && (f || (f = [])).push(Ne);
}
}), !f)
return null;
for (var v = [{ from: l, to: c }], R = 0; R < f.length; ++R)
for (var L = f[R], j = L.find(0), Q = 0; Q < v.length; ++Q) {
var te = v[Q];
if (!($e(te.to, j.from) < 0 || $e(te.from, j.to) > 0)) {
var se = [Q, 1], de = $e(te.from, j.from), Ee = $e(te.to, j.to);
(de < 0 || !L.inclusiveLeft && !de) && se.push({ from: te.from, to: j.from }), (Ee > 0 || !L.inclusiveRight && !Ee) && se.push({ from: j.to, to: te.to }), v.splice.apply(v, se), Q += se.length - 3;
}
}
return v;
}
function Hp(o) {
var l = o.markedSpans;
if (!!l) {
for (var c = 0; c < l.length; ++c)
l[c].marker.detachLine(o);
o.markedSpans = null;
}
}
function Wp(o, l) {
if (!!l) {
for (var c = 0; c < l.length; ++c)
l[c].marker.attachLine(o);
o.markedSpans = l;
}
}
function _l(o) {
return o.inclusiveLeft ? -1 : 0;
}
function wl(o) {
return o.inclusiveRight ? 1 : 0;
}
function Ru(o, l) {
var c = o.lines.length - l.lines.length;
if (c != 0)
return c;
var f = o.find(), v = l.find(), R = $e(f.from, v.from) || _l(o) - _l(l);
if (R)
return -R;
var L = $e(f.to, v.to) || wl(o) - wl(l);
return L || l.id - o.id;
}
function Gp(o, l) {
var c = Ki && o.markedSpans, f;
if (c)
for (var v = void 0, R = 0; R < c.length; ++R)
v = c[R], v.marker.collapsed && (l ? v.from : v.to) == null && (!f || Ru(f, v.marker) < 0) && (f = v.marker);
return f;
}
function Kp(o) {
return Gp(o, !0);
}
function Al(o) {
return Gp(o, !1);
}
function Rb(o, l) {
var c = Ki && o.markedSpans, f;
if (c)
for (var v = 0; v < c.length; ++v) {
var R = c[v];
R.marker.collapsed && (R.from == null || R.from < l) && (R.to == null || R.to > l) && (!f || Ru(f, R.marker) < 0) && (f = R.marker);
}
return f;
}
function Yp(o, l, c, f, v) {
var R = ut(o, l), L = Ki && R.markedSpans;
if (L)
for (var j = 0; j < L.length; ++j) {
var Q = L[j];
if (!!Q.marker.collapsed) {
var te = Q.marker.find(0), se = $e(te.from, c) || _l(Q.marker) - _l(v), de = $e(te.to, f) || wl(Q.marker) - wl(v);
if (!(se >= 0 && de <= 0 || se <= 0 && de >= 0) && (se <= 0 && (Q.marker.inclusiveRight && v.inclusiveLeft ? $e(te.to, c) >= 0 : $e(te.to, c) > 0) || se >= 0 && (Q.marker.inclusiveRight && v.inclusiveLeft ? $e(te.from, f) <= 0 : $e(te.from, f) < 0)))
return !0;
}
}
}
function yi(o) {
for (var l; l = Kp(o); )
o = l.find(-1, !0).line;
return o;
}
function Db(o) {
for (var l; l = Al(o); )
o = l.find(1, !0).line;
return o;
}
function $b(o) {
for (var l, c; l = Al(o); )
o = l.find(1, !0).line, (c || (c = [])).push(o);
return c;
}
function Du(o, l) {
var c = ut(o, l), f = yi(c);
return c == f ? l : Ft(f);
}
function Qp(o, l) {
if (l > o.lastLine())
return l;
var c = ut(o, l), f;
if (!cr(o, c))
return l;
for (; f = Al(c); )
c = f.find(1, !0).line;
return Ft(c) + 1;
}
function cr(o, l) {
var c = Ki && l.markedSpans;
if (c) {
for (var f = void 0, v = 0; v < c.length; ++v)
if (f = c[v], !!f.marker.collapsed) {
if (f.from == null)
return !0;
if (!f.marker.widgetNode && f.from == 0 && f.marker.inclusiveLeft && $u(o, l, f))
return !0;
}
}
}
function $u(o, l, c) {
if (c.to == null) {
var f = c.marker.find(1, !0);
return $u(o, f.line, aa(f.line.markedSpans, c.marker));
}
if (c.marker.inclusiveRight && c.to == l.text.length)
return !0;
for (var v = void 0, R = 0; R < l.markedSpans.length; ++R)
if (v = l.markedSpans[R], v.marker.collapsed && !v.marker.widgetNode && v.from == c.to && (v.to == null || v.to != c.from) && (v.marker.inclusiveLeft || c.marker.inclusiveRight) && $u(o, l, v))
return !0;
}
function Yi(o) {
o = yi(o);
for (var l = 0, c = o.parent, f = 0; f < c.lines.length; ++f) {
var v = c.lines[f];
if (v == o)
break;
l += v.height;
}
for (var R = c.parent; R; c = R, R = c.parent)
for (var L = 0; L < R.children.length; ++L) {
var j = R.children[L];
if (j == c)
break;
l += j.height;
}
return l;
}
function Cl(o) {
if (o.height == 0)
return 0;
for (var l = o.text.length, c, f = o; c = Kp(f); ) {
var v = c.find(0, !0);
f = v.from.line, l += v.from.ch - v.to.ch;
}
for (f = o; c = Al(f); ) {
var R = c.find(0, !0);
l -= f.text.length - R.from.ch, f = R.to.line, l += f.text.length - R.to.ch;
}
return l;
}
function Iu(o) {
var l = o.display, c = o.doc;
l.maxLine = ut(c, c.first), l.maxLineLength = Cl(l.maxLine), l.maxLineChanged = !0, c.iter(function(f) {
var v = Cl(f);
v > l.maxLineLength && (l.maxLineLength = v, l.maxLine = f);
});
}
var ro = function(o, l, c) {
this.text = o, Wp(this, l), this.height = c ? c(this) : 1;
};
ro.prototype.lineNo = function() {
return Ft(this);
}, Ut(ro);
function Ib(o, l, c, f) {
o.text = l, o.stateAfter && (o.stateAfter = null), o.styles && (o.styles = null), o.order != null && (o.order = null), Hp(o), Wp(o, c);
var v = f ? f(o) : 1;
v != o.height && di(o, v);
}
function Fb(o) {
o.parent = null, Hp(o);
}
var Mb = {}, Pb = {};
function Jp(o, l) {
if (!o || /^\s*$/.test(o))
return null;
var c = l.addModeClass ? Pb : Mb;
return c[o] || (c[o] = o.replace(/\S+/g, "cm-$&"));
}
function Xp(o, l) {
var c = U("span", null, null, p ? "padding-right: .1px" : null), f = {
pre: U("pre", [c], "CodeMirror-line"),
content: c,
col: 0,
pos: 0,
cm: o,
trailingSpace: !1,
splitSpaces: o.getOption("lineWrapping")
};
l.measure = {};
for (var v = 0; v <= (l.rest ? l.rest.length : 0); v++) {
var R = v ? l.rest[v - 1] : l.line, L = void 0;
f.pos = 0, f.addToken = Nb, hl(o.display.measure) && (L = ht(R, o.doc.direction)) && (f.addToken = Vb(f.addToken, L)), f.map = [];
var j = l != o.display.externalMeasured && Ft(R);
jb(R, f, Pp(o, R, j)), R.styleClasses && (R.styleClasses.bgClass && (f.bgClass = Y(R.styleClasses.bgClass, f.bgClass || "")), R.styleClasses.textClass && (f.textClass = Y(R.styleClasses.textClass, f.textClass || ""))), f.map.length == 0 && f.map.push(0, 0, f.content.appendChild(xu(o.display.measure))), v == 0 ? (l.measure.map = f.map, l.measure.cache = {}) : ((l.measure.maps || (l.measure.maps = [])).push(f.map), (l.measure.caches || (l.measure.caches = [])).push({}));
}
if (p) {
var Q = f.content.lastChild;
(/\bcm-tab\b/.test(Q.className) || Q.querySelector && Q.querySelector(".cm-tab")) && (f.content.className = "cm-tab-wrap-hack");
}
return st(o, "renderLine", o, l.line, f.pre), f.pre.className && (f.textClass = Y(f.pre.className, f.textClass || "")), f;
}
function Lb(o) {
var l = I("span", "\u2022", "cm-invalidchar");
return l.title = "\\u" + o.charCodeAt(0).toString(16), l.setAttribute("aria-label", l.title), l;
}
function Nb(o, l, c, f, v, R, L) {
if (!!l) {
var j = o.splitSpaces ? Bb(l, o.trailingSpace) : l, Q = o.cm.state.specialChars, te = !1, se;
if (!Q.test(l))
o.col += l.length, se = document.createTextNode(j), o.map.push(o.pos, o.pos + l.length, se), d && h < 9 && (te = !0), o.pos += l.length;
else {
se = document.createDocumentFragment();
for (var de = 0; ; ) {
Q.lastIndex = de;
var Ee = Q.exec(l), Ce = Ee ? Ee.index - de : l.length - de;
if (Ce) {
var Ie = document.createTextNode(j.slice(de, de + Ce));
d && h < 9 ? se.appendChild(I("span", [Ie])) : se.appendChild(Ie), o.map.push(o.pos, o.pos + Ce, Ie), o.col += Ce, o.pos += Ce;
}
if (!Ee)
break;
de += Ce + 1;
var Ne = void 0;
if (Ee[0] == " ") {
var Ue = o.cm.options.tabSize, Ye = Ue - o.col % Ue;
Ne = se.appendChild(I("span", fe(Ye), "cm-tab")), Ne.setAttribute("role", "presentation"), Ne.setAttribute("cm-text", " "), o.col += Ye;
} else
Ee[0] == "\r" || Ee[0] == `
` ? (Ne = se.appendChild(I("span", Ee[0] == "\r" ? "\u240D" : "\u2424", "cm-invalidchar")), Ne.setAttribute("cm-text", Ee[0]), o.col += 1) : (Ne = o.cm.options.specialCharPlaceholder(Ee[0]), Ne.setAttribute("cm-text", Ee[0]), d && h < 9 ? se.appendChild(I("span", [Ne])) : se.appendChild(Ne), o.col += 1);
o.map.push(o.pos, o.pos + 1, Ne), o.pos++;
}
}
if (o.trailingSpace = j.charCodeAt(l.length - 1) == 32, c || f || v || te || R || L) {
var nt = c || "";
f && (nt += f), v && (nt += v);
var Qe = I("span", [se], nt, R);
if (L)
for (var ot in L)
L.hasOwnProperty(ot) && ot != "style" && ot != "class" && Qe.setAttribute(ot, L[ot]);
return o.content.appendChild(Qe);
}
o.content.appendChild(se);
}
}
function Bb(o, l) {
if (o.length > 1 && !/ /.test(o))
return o;
for (var c = l, f = "", v = 0; v < o.length; v++) {
var R = o.charAt(v);
R == " " && c && (v == o.length - 1 || o.charCodeAt(v + 1) == 32) && (R = "\xA0"), f += R, c = R == " ";
}
return f;
}
function Vb(o, l) {
return function(c, f, v, R, L, j, Q) {
v = v ? v + " cm-force-border" : "cm-force-border";
for (var te = c.pos, se = te + f.length; ; ) {
for (var de = void 0, Ee = 0; Ee < l.length && (de = l[Ee], !(de.to > te && de.from <= te)); Ee++)
;
if (de.to >= se)
return o(c, f, v, R, L, j, Q);
o(c, f.slice(0, de.to - te), v, R, null, j, Q), R = null, f = f.slice(de.to - te), te = de.to;
}
};
}
function Zp(o, l, c, f) {
var v = !f && c.widgetNode;
v && o.map.push(o.pos, o.pos + l, v), !f && o.cm.display.input.needsContentAttribute && (v || (v = o.content.appendChild(document.createElement("span"))), v.setAttribute("cm-marker", c.id)), v && (o.cm.display.input.setUneditable(v), o.content.appendChild(v)), o.pos += l, o.trailingSpace = !1;
}
function jb(o, l, c) {
var f = o.markedSpans, v = o.text, R = 0;
if (!f) {
for (var L = 1; L < c.length; L += 2)
l.addToken(l, v.slice(R, R = c[L]), Jp(c[L + 1], l.cm.options));
return;
}
for (var j = v.length, Q = 0, te = 1, se = "", de, Ee, Ce = 0, Ie, Ne, Ue, Ye, nt; ; ) {
if (Ce == Q) {
Ie = Ne = Ue = Ee = "", nt = null, Ye = null, Ce = 1 / 0;
for (var Qe = [], ot = void 0, mt = 0; mt < f.length; ++mt) {
var ct = f[mt], Et = ct.marker;
if (Et.type == "bookmark" && ct.from == Q && Et.widgetNode)
Qe.push(Et);
else if (ct.from <= Q && (ct.to == null || ct.to > Q || Et.collapsed && ct.to == Q && ct.from == Q)) {
if (ct.to != null && ct.to != Q && Ce > ct.to && (Ce = ct.to, Ne = ""), Et.className && (Ie += " " + Et.className), Et.css && (Ee = (Ee ? Ee + ";" : "") + Et.css), Et.startStyle && ct.from == Q && (Ue += " " + Et.startStyle), Et.endStyle && ct.to == Ce && (ot || (ot = [])).push(Et.endStyle, ct.to), Et.title && ((nt || (nt = {})).title = Et.title), Et.attributes)
for (var Bt in Et.attributes)
(nt || (nt = {}))[Bt] = Et.attributes[Bt];
Et.collapsed && (!Ye || Ru(Ye.marker, Et) < 0) && (Ye = ct);
} else
ct.from > Q && Ce > ct.from && (Ce = ct.from);
}
if (ot)
for (var mn = 0; mn < ot.length; mn += 2)
ot[mn + 1] == Ce && (Ne += " " + ot[mn]);
if (!Ye || Ye.from == Q)
for (var Kt = 0; Kt < Qe.length; ++Kt)
Zp(l, 0, Qe[Kt]);
if (Ye && (Ye.from || 0) == Q) {
if (Zp(
l,
(Ye.to == null ? j + 1 : Ye.to) - Q,
Ye.marker,
Ye.from == null
), Ye.to == null)
return;
Ye.to == Q && (Ye = !1);
}
}
if (Q >= j)
break;
for (var Wn = Math.min(j, Ce); ; ) {
if (se) {
var Nn = Q + se.length;
if (!Ye) {
var rn = Nn > Wn ? se.slice(0, Wn - Q) : se;
l.addToken(
l,
rn,
de ? de + Ie : Ie,
Ue,
Q + rn.length == Ce ? Ne : "",
Ee,
nt
);
}
if (Nn >= Wn) {
se = se.slice(Wn - Q), Q = Wn;
break;
}
Q = Nn, Ue = "";
}
se = v.slice(R, R = c[te++]), de = Jp(c[te++], l.cm.options);
}
}
}
function qp(o, l, c) {
this.line = l, this.rest = $b(l), this.size = this.rest ? Ft(Ae(this.rest)) - c + 1 : 1, this.node = this.text = null, this.hidden = cr(o, l);
}
function Sl(o, l, c) {
for (var f = [], v, R = l; R < c; R = v) {
var L = new qp(o.doc, ut(o.doc, R), R);
v = R + L.size, f.push(L);
}
return f;
}
var oo = null;
function Ub(o) {
oo ? oo.ops.push(o) : o.ownsGroup = oo = {
ops: [o],
delayedCallbacks: []
};
}
function zb(o) {
var l = o.delayedCallbacks, c = 0;
do {
for (; c < l.length; c++)
l[c].call(null);
for (var f = 0; f < o.ops.length; f++) {
var v = o.ops[f];
if (v.cursorActivityHandlers)
for (; v.cursorActivityCalled < v.cursorActivityHandlers.length; )
v.cursorActivityHandlers[v.cursorActivityCalled++].call(null, v.cm);
}
} while (c < l.length);
}
function Hb(o, l) {
var c = o.ownsGroup;
if (!!c)
try {
zb(c);
} finally {
oo = null, l(c);
}
}
var la = null;
function cn(o, l) {
var c = dt(o, l);
if (!!c.length) {
var f = Array.prototype.slice.call(arguments, 2), v;
oo ? v = oo.delayedCallbacks : la ? v = la : (v = la = [], setTimeout(Wb, 0));
for (var R = function(j) {
v.push(function() {
return c[j].apply(null, f);
});
}, L = 0; L < c.length; ++L)
R(L);
}
}
function Wb() {
var o = la;
la = null;
for (var l = 0; l < o.length; ++l)
o[l]();
}
function eh(o, l, c, f) {
for (var v = 0; v < l.changes.length; v++) {
var R = l.changes[v];
R == "text" ? Kb(o, l) : R == "gutter" ? nh(o, l, c, f) : R == "class" ? Fu(o, l) : R == "widget" && Yb(o, l, f);
}
l.changes = null;
}
function sa(o) {
return o.node == o.text && (o.node = I("div", null, null, "position: relative"), o.text.parentNode && o.text.parentNode.replaceChild(o.node, o.text), o.node.appendChild(o.text), d && h < 8 && (o.node.style.zIndex = 2)), o.node;
}
function Gb(o, l) {
var c = l.bgClass ? l.bgClass + " " + (l.line.bgClass || "") : l.line.bgClass;
if (c && (c += " CodeMirror-linebackground"), l.background)
c ? l.background.className = c : (l.background.parentNode.removeChild(l.background), l.background = null);
else if (c) {
var f = sa(l);
l.background = f.insertBefore(I("div", null, c), f.firstChild), o.display.input.setUneditable(l.background);
}
}
function th(o, l) {
var c = o.display.externalMeasured;
return c && c.line == l.line ? (o.display.externalMeasured = null, l.measure = c.measure, c.built) : Xp(o, l);
}
function Kb(o, l) {
var c = l.text.className, f = th(o, l);
l.text == l.node && (l.node = f.pre), l.text.parentNode.replaceChild(f.pre, l.text), l.text = f.pre, f.bgClass != l.bgClass || f.textClass != l.textClass ? (l.bgClass = f.bgClass, l.textClass = f.textClass, Fu(o, l)) : c && (l.text.className = c);
}
function Fu(o, l) {
Gb(o, l), l.line.wrapClass ? sa(l).className = l.line.wrapClass : l.node != l.text && (l.node.className = "");
var c = l.textClass ? l.textClass + " " + (l.line.textClass || "") : l.line.textClass;
l.text.className = c || "";
}
function nh(o, l, c, f) {
if (l.gutter && (l.node.removeChild(l.gutter), l.gutter = null), l.gutterBackground && (l.node.removeChild(l.gutterBackground), l.gutterBackground = null), l.line.gutterClass) {
var v = sa(l);
l.gutterBackground = I(
"div",
null,
"CodeMirror-gutter-background " + l.line.gutterClass,
"left: " + (o.options.fixedGutter ? f.fixedPos : -f.gutterTotalWidth) + "px; width: " + f.gutterTotalWidth + "px"
), o.display.input.setUneditable(l.gutterBackground), v.insertBefore(l.gutterBackground, l.text);
}
var R = l.line.gutterMarkers;
if (o.options.lineNumbers || R) {
var L = sa(l), j = l.gutter = I("div", null, "CodeMirror-gutter-wrapper", "left: " + (o.options.fixedGutter ? f.fixedPos : -f.gutterTotalWidth) + "px");
if (j.setAttribute("aria-hidden", "true"), o.display.input.setUneditable(j), L.insertBefore(j, l.text), l.line.gutterClass && (j.className += " " + l.line.gutterClass), o.options.lineNumbers && (!R || !R["CodeMirror-linenumbers"]) && (l.lineNumber = j.appendChild(
I(
"div",
ce(o.options, c),
"CodeMirror-linenumber CodeMirror-gutter-elt",
"left: " + f.gutterLeft["CodeMirror-linenumbers"] + "px; width: " + o.display.lineNumInnerWidth + "px"
)
)), R)
for (var Q = 0; Q < o.display.gutterSpecs.length; ++Q) {
var te = o.display.gutterSpecs[Q].className, se = R.hasOwnProperty(te) && R[te];
se && j.appendChild(I(
"div",
[se],
"CodeMirror-gutter-elt",
"left: " + f.gutterLeft[te] + "px; width: " + f.gutterWidth[te] + "px"
));
}
}
}
function Yb(o, l, c) {
l.alignable && (l.alignable = null);
for (var f = $("CodeMirror-linewidget"), v = l.node.firstChild, R = void 0; v; v = R)
R = v.nextSibling, f.test(v.className) && l.node.removeChild(v);
ih(o, l, c);
}
function Qb(o, l, c, f) {
var v = th(o, l);
return l.text = l.node = v.pre, v.bgClass && (l.bgClass = v.bgClass), v.textClass && (l.textClass = v.textClass), Fu(o, l), nh(o, l, c, f), ih(o, l, f), l.node;
}
function ih(o, l, c) {
if (rh(o, l.line, l, c, !0), l.rest)
for (var f = 0; f < l.rest.length; f++)
rh(o, l.rest[f], l, c, !1);
}
function rh(o, l, c, f, v) {
if (!!l.widgets)
for (var R = sa(c), L = 0, j = l.widgets; L < j.length; ++L) {
var Q = j[L], te = I("div", [Q.node], "CodeMirror-linewidget" + (Q.className ? " " + Q.className : ""));
Q.handleMouseEvents || te.setAttribute("cm-ignore-events", "true"), Jb(Q, te, c, f), o.display.input.setUneditable(te), v && Q.above ? R.insertBefore(te, c.gutter || c.text) : R.appendChild(te), cn(Q, "redraw");
}
}
function Jb(o, l, c, f) {
if (o.noHScroll) {
(c.alignable || (c.alignable = [])).push(l);
var v = f.wrapperWidth;
l.style.left = f.fixedPos + "px", o.coverGutter || (v -= f.gutterTotalWidth, l.style.paddingLeft = f.gutterTotalWidth + "px"), l.style.width = v + "px";
}
o.coverGutter && (l.style.zIndex = 5, l.style.position = "relative", o.noHScroll || (l.style.marginLeft = -f.gutterTotalWidth + "px"));
}
function ua(o) {
if (o.height != null)
return o.height;
var l = o.doc.cm;
if (!l)
return 0;
if (!C(document.body, o.node)) {
var c = "position: relative;";
o.coverGutter && (c += "margin-left: -" + l.display.gutters.offsetWidth + "px;"), o.noHScroll && (c += "width: " + l.display.wrapper.clientWidth + "px;"), H(l.display.measure, I("div", [o.node], null, c));
}
return o.height = o.node.parentNode.offsetHeight;
}
function Qi(o, l) {
for (var c = Mn(l); c != o.wrapper; c = c.parentNode)
if (!c || c.nodeType == 1 && c.getAttribute("cm-ignore-events") == "true" || c.parentNode == o.sizer && c != o.mover)
return !0;
}
function El(o) {
return o.lineSpace.offsetTop;
}
function Mu(o) {
return o.mover.offsetHeight - o.lineSpace.offsetHeight;
}
function oh(o) {
if (o.cachedPaddingH)
return o.cachedPaddingH;
var l = H(o.measure, I("pre", "x", "CodeMirror-line-like")), c = window.getComputedStyle ? window.getComputedStyle(l) : l.currentStyle, f = { left: parseInt(c.paddingLeft), right: parseInt(c.paddingRight) };
return !isNaN(f.left) && !isNaN(f.right) && (o.cachedPaddingH = f), f;
}
function Di(o) {
return Se - o.display.nativeBarWidth;
}
function Rr(o) {
return o.display.scroller.clientWidth - Di(o) - o.display.barWidth;
}
function Pu(o) {
return o.display.scroller.clientHeight - Di(o) - o.display.barHeight;
}
function Xb(o, l, c) {
var f = o.options.lineWrapping, v = f && Rr(o);
if (!l.measure.heights || f && l.measure.width != v) {
var R = l.measure.heights = [];
if (f) {
l.measure.width = v;
for (var L = l.text.firstChild.getClientRects(), j = 0; j < L.length - 1; j++) {
var Q = L[j], te = L[j + 1];
Math.abs(Q.bottom - te.bottom) > 2 && R.push((Q.bottom + te.top) / 2 - c.top);
}
}
R.push(c.bottom - c.top);
}
}
function ah(o, l, c) {
if (o.line == l)
return { map: o.measure.map, cache: o.measure.cache };
if (o.rest) {
for (var f = 0; f < o.rest.length; f++)
if (o.rest[f] == l)
return { map: o.measure.maps[f], cache: o.measure.caches[f] };
for (var v = 0; v < o.rest.length; v++)
if (Ft(o.rest[v]) > c)
return { map: o.measure.maps[v], cache: o.measure.caches[v], before: !0 };
}
}
function Zb(o, l) {
l = yi(l);
var c = Ft(l), f = o.display.externalMeasured = new qp(o.doc, l, c);
f.lineN = c;
var v = f.built = Xp(o, f);
return f.text = v.pre, H(o.display.lineMeasure, v.pre), f;
}
function lh(o, l, c, f) {
return $i(o, ao(o, l), c, f);
}
function Lu(o, l) {
if (l >= o.display.viewFrom && l < o.display.viewTo)
return o.display.view[Ir(o, l)];
var c = o.display.externalMeasured;
if (c && l >= c.lineN && l < c.lineN + c.size)
return c;
}
function ao(o, l) {
var c = Ft(l), f = Lu(o, c);
f && !f.text ? f = null : f && f.changes && (eh(o, f, c, Uu(o)), o.curOp.forceUpdate = !0), f || (f = Zb(o, l));
var v = ah(f, l, c);
return {
line: l,
view: f,
rect: null,
map: v.map,
cache: v.cache,
before: v.before,
hasHeights: !1
};
}
function $i(o, l, c, f, v) {
l.before && (c = -1);
var R = c + (f || ""), L;
return l.cache.hasOwnProperty(R) ? L = l.cache[R] : (l.rect || (l.rect = l.view.text.getBoundingClientRect()), l.hasHeights || (Xb(o, l.view, l.rect), l.hasHeights = !0), L = e1(o, l, c, f), L.bogus || (l.cache[R] = L)), {
left: L.left,
right: L.right,
top: v ? L.rtop : L.top,
bottom: v ? L.rbottom : L.bottom
};
}
var sh = { left: 0, right: 0, top: 0, bottom: 0 };
function uh(o, l, c) {
for (var f, v, R, L, j, Q, te = 0; te < o.length; te += 3)
if (j = o[te], Q = o[te + 1], l < j ? (v = 0, R = 1, L = "left") : l < Q ? (v = l - j, R = v + 1) : (te == o.length - 3 || l == Q && o[te + 3] > l) && (R = Q - j, v = R - 1, l >= Q && (L = "right")), v != null) {
if (f = o[te + 2], j == Q && c == (f.insertLeft ? "left" : "right") && (L = c), c == "left" && v == 0)
for (; te && o[te - 2] == o[te - 3] && o[te - 1].insertLeft; )
f = o[(te -= 3) + 2], L = "left";
if (c == "right" && v == Q - j)
for (; te < o.length - 3 && o[te + 3] == o[te + 4] && !o[te + 5].insertLeft; )
f = o[(te += 3) + 2], L = "right";
break;
}
return { node: f, start: v, end: R, collapse: L, coverStart: j, coverEnd: Q };
}
function qb(o, l) {
var c = sh;
if (l == "left")
for (var f = 0; f < o.length && (c = o[f]).left == c.right; f++)
;
else
for (var v = o.length - 1; v >= 0 && (c = o[v]).left == c.right; v--)
;
return c;
}
function e1(o, l, c, f) {
var v = uh(l.map, c, f), R = v.node, L = v.start, j = v.end, Q = v.collapse, te;
if (R.nodeType == 3) {
for (var se = 0; se < 4; se++) {
for (; L && ze(l.line.text.charAt(v.coverStart + L)); )
--L;
for (; v.coverStart + j < v.coverEnd && ze(l.line.text.charAt(v.coverStart + j)); )
++j;
if (d && h < 9 && L == 0 && j == v.coverEnd - v.coverStart ? te = R.parentNode.getBoundingClientRect() : te = qb(F(R, L, j).getClientRects(), f), te.left || te.right || L == 0)
break;
j = L, L = L - 1, Q = "right";
}
d && h < 11 && (te = t1(o.display.measure, te));
} else {
L > 0 && (Q = f = "right");
var de;
o.options.lineWrapping && (de = R.getClientRects()).length > 1 ? te = de[f == "right" ? de.length - 1 : 0] : te = R.getBoundingClientRect();
}
if (d && h < 9 && !L && (!te || !te.left && !te.right)) {
var Ee = R.parentNode.getClientRects()[0];
Ee ? te = { left: Ee.left, right: Ee.left + so(o.display), top: Ee.top, bottom: Ee.bottom } : te = sh;
}
for (var Ce = te.top - l.rect.top, Ie = te.bottom - l.rect.top, Ne = (Ce + Ie) / 2, Ue = l.view.measure.heights, Ye = 0; Ye < Ue.length - 1 && !(Ne < Ue[Ye]); Ye++)
;
var nt = Ye ? Ue[Ye - 1] : 0, Qe = Ue[Ye], ot = {
left: (Q == "right" ? te.right : te.left) - l.rect.left,
right: (Q == "left" ? te.left : te.right) - l.rect.left,
top: nt,
bottom: Qe
};
return !te.left && !te.right && (ot.bogus = !0), o.options.singleCursorHeightPerLine || (ot.rtop = Ce, ot.rbottom = Ie), ot;
}
function t1(o, l) {
if (!window.screen || screen.logicalXDPI == null || screen.logicalXDPI == screen.deviceXDPI || !ml(o))
return l;
var c = screen.logicalXDPI / screen.deviceXDPI, f = screen.logicalYDPI / screen.deviceYDPI;
return {
left: l.left * c,
right: l.right * c,
top: l.top * f,
bottom: l.bottom * f
};
}
function dh(o) {
if (o.measure && (o.measure.cache = {}, o.measure.heights = null, o.rest))
for (var l = 0; l < o.rest.length; l++)
o.measure.caches[l] = {};
}
function fh(o) {
o.display.externalMeasure = null, z(o.display.lineMeasure);
for (var l = 0; l < o.display.view.length; l++)
dh(o.display.view[l]);
}
function da(o) {
fh(o), o.display.cachedCharWidth = o.display.cachedTextHeight = o.display.cachedPaddingH = null, o.options.lineWrapping || (o.display.maxLineChanged = !0), o.display.lineNumChars = null;
}
function ch(o) {
return _ && E ? -(o.body.getBoundingClientRect().left - parseInt(getComputedStyle(o.body).marginLeft)) : o.defaultView.pageXOffset || (o.documentElement || o.body).scrollLeft;
}
function ph(o) {
return _ && E ? -(o.body.getBoundingClientRect().top - parseInt(getComputedStyle(o.body).marginTop)) : o.defaultView.pageYOffset || (o.documentElement || o.body).scrollTop;
}
function Nu(o) {
var l = yi(o), c = l.widgets, f = 0;
if (c)
for (var v = 0; v < c.length; ++v)
c[v].above && (f += ua(c[v]));
return f;
}
function xl(o, l, c, f, v) {
if (!v) {
var R = Nu(l);
c.top += R, c.bottom += R;
}
if (f == "line")
return c;
f || (f = "local");
var L = Yi(l);
if (f == "local" ? L += El(o.display) : L -= o.display.viewOffset, f == "page" || f == "window") {
var j = o.display.lineSpace.getBoundingClientRect();
L += j.top + (f == "window" ? 0 : ph(ee(o)));
var Q = j.left + (f == "window" ? 0 : ch(ee(o)));
c.left += Q, c.right += Q;
}
return c.top += L, c.bottom += L, c;
}
function hh(o, l, c) {
if (c == "div")
return l;
var f = l.left, v = l.top;
if (c == "page")
f -= ch(ee(o)), v -= ph(ee(o));
else if (c == "local" || !c) {
var R = o.display.sizer.getBoundingClientRect();
f += R.left, v += R.top;
}
var L = o.display.lineSpace.getBoundingClientRect();
return { left: f - L.left, top: v - L.top };
}
function Tl(o, l, c, f, v) {
return f || (f = ut(o.doc, l.line)), xl(o, f, lh(o, f, l.ch, v), c);
}
function bi(o, l, c, f, v, R) {
f = f || ut(o.doc, l.line), v || (v = ao(o, f));
function L(Ie, Ne) {
var Ue = $i(o, v, Ie, Ne ? "right" : "left", R);
return Ne ? Ue.left = Ue.right : Ue.right = Ue.left, xl(o, f, Ue, c);
}
var j = ht(f, o.doc.direction), Q = l.ch, te = l.sticky;
if (Q >= f.text.length ? (Q = f.text.length, te = "before") : Q <= 0 && (Q = 0, te = "after"), !j)
return L(te == "before" ? Q - 1 : Q, te == "before");
function se(Ie, Ne, Ue) {
var Ye = j[Ne], nt = Ye.level == 1;
return L(Ue ? Ie - 1 : Ie, nt != Ue);
}
var de = Be(j, Q, te), Ee = ft, Ce = se(Q, de, te == "before");
return Ee != null && (Ce.other = se(Q, Ee, te != "before")), Ce;
}
function mh(o, l) {
var c = 0;
l = bt(o.doc, l), o.options.lineWrapping || (c = so(o.display) * l.ch);
var f = ut(o.doc, l.line), v = Yi(f) + El(o.display);
return { left: c, right: c, top: v, bottom: v + f.height };
}
function Bu(o, l, c, f, v) {
var R = ge(o, l, c);
return R.xRel = v, f && (R.outside = f), R;
}
function Vu(o, l, c) {
var f = o.doc;
if (c += o.display.viewOffset, c < 0)
return Bu(f.first, 0, null, -1, -1);
var v = Oi(f, c), R = f.first + f.size - 1;
if (v > R)
return Bu(f.first + f.size - 1, ut(f, R).text.length, null, 1, 1);
l < 0 && (l = 0);
for (var L = ut(f, v); ; ) {
var j = n1(o, L, v, l, c), Q = Rb(L, j.ch + (j.xRel > 0 || j.outside > 0 ? 1 : 0));
if (!Q)
return j;
var te = Q.find(1);
if (te.line == v)
return te;
L = ut(f, v = te.line);
}
}
function vh(o, l, c, f) {
f -= Nu(l);
var v = l.text.length, R = He(function(L) {
return $i(o, c, L - 1).bottom <= f;
}, v, 0);
return v = He(function(L) {
return $i(o, c, L).top > f;
}, R, v), { begin: R, end: v };
}
function gh(o, l, c, f) {
c || (c = ao(o, l));
var v = xl(o, l, $i(o, c, f), "line").top;
return vh(o, l, c, v);
}
function ju(o, l, c, f) {
return o.bottom <= c ? !1 : o.top > c ? !0 : (f ? o.left : o.right) > l;
}
function n1(o, l, c, f, v) {
v -= Yi(l);
var R = ao(o, l), L = Nu(l), j = 0, Q = l.text.length, te = !0, se = ht(l, o.doc.direction);
if (se) {
var de = (o.options.lineWrapping ? r1 : i1)(o, l, c, R, se, f, v);
te = de.level != 1, j = te ? de.from : de.to - 1, Q = te ? de.to : de.from - 1;
}
var Ee = null, Ce = null, Ie = He(function(mt) {
var ct = $i(o, R, mt);
return ct.top += L, ct.bottom += L, ju(ct, f, v, !1) ? (ct.top <= v && ct.left <= f && (Ee = mt, Ce = ct), !0) : !1;
}, j, Q), Ne, Ue, Ye = !1;
if (Ce) {
var nt = f - Ce.left < Ce.right - f, Qe = nt == te;
Ie = Ee + (Qe ? 0 : 1), Ue = Qe ? "after" : "before", Ne = nt ? Ce.left : Ce.right;
} else {
!te && (Ie == Q || Ie == j) && Ie++, Ue = Ie == 0 ? "after" : Ie == l.text.length ? "before" : $i(o, R, Ie - (te ? 1 : 0)).bottom + L <= v == te ? "after" : "before";
var ot = bi(o, ge(c, Ie, Ue), "line", l, R);
Ne = ot.left, Ye = v < ot.top ? -1 : v >= ot.bottom ? 1 : 0;
}
return Ie = at(l.text, Ie, 1), Bu(c, Ie, Ue, Ye, f - Ne);
}
function i1(o, l, c, f, v, R, L) {
var j = He(function(de) {
var Ee = v[de], Ce = Ee.level != 1;
return ju(bi(
o,
ge(c, Ce ? Ee.to : Ee.from, Ce ? "before" : "after"),
"line",
l,
f
), R, L, !0);
}, 0, v.length - 1), Q = v[j];
if (j > 0) {
var te = Q.level != 1, se = bi(
o,
ge(c, te ? Q.from : Q.to, te ? "after" : "before"),
"line",
l,
f
);
ju(se, R, L, !0) && se.top > L && (Q = v[j - 1]);
}
return Q;
}
function r1(o, l, c, f, v, R, L) {
var j = vh(o, l, f, L), Q = j.begin, te = j.end;
/\s/.test(l.text.charAt(te - 1)) && te--;
for (var se = null, de = null, Ee = 0; Ee < v.length; Ee++) {
var Ce = v[Ee];
if (!(Ce.from >= te || Ce.to <= Q)) {
var Ie = Ce.level != 1, Ne = $i(o, f, Ie ? Math.min(te, Ce.to) - 1 : Math.max(Q, Ce.from)).right, Ue = Ne < R ? R - Ne + 1e9 : Ne - R;
(!se || de > Ue) && (se = Ce, de = Ue);
}
}
return se || (se = v[v.length - 1]), se.from < Q && (se = { from: Q, to: se.to, level: se.level }), se.to > te && (se = { from: se.from, to: te, level: se.level }), se;
}
var Dr;
function lo(o) {
if (o.cachedTextHeight != null)
return o.cachedTextHeight;
if (Dr == null) {
Dr = I("pre", null, "CodeMirror-line-like");
for (var l = 0; l < 49; ++l)
Dr.appendChild(document.createTextNode("x")), Dr.appendChild(I("br"));
Dr.appendChild(document.createTextNode("x"));
}
H(o.measure, Dr);
var c = Dr.offsetHeight / 50;
return c > 3 && (o.cachedTextHeight = c), z(o.measure), c || 1;
}
function so(o) {
if (o.cachedCharWidth != null)
return o.cachedCharWidth;
var l = I("span", "xxxxxxxxxx"), c = I("pre", [l], "CodeMirror-line-like");
H(o.measure, c);
var f = l.getBoundingClientRect(), v = (f.right - f.left) / 10;
return v > 2 && (o.cachedCharWidth = v), v || 10;
}
function Uu(o) {
for (var l = o.display, c = {}, f = {}, v = l.gutters.clientLeft, R = l.gutters.firstChild, L = 0; R; R = R.nextSibling, ++L) {
var j = o.display.gutterSpecs[L].className;
c[j] = R.offsetLeft + R.clientLeft + v, f[j] = R.clientWidth;
}
return {
fixedPos: zu(l),
gutterTotalWidth: l.gutters.offsetWidth,
gutterLeft: c,
gutterWidth: f,
wrapperWidth: l.wrapper.clientWidth
};
}
function zu(o) {
return o.scroller.getBoundingClientRect().left - o.sizer.getBoundingClientRect().left;
}
function yh(o) {
var l = lo(o.display), c = o.options.lineWrapping, f = c && Math.max(5, o.display.scroller.clientWidth / so(o.display) - 3);
return function(v) {
if (cr(o.doc, v))
return 0;
var R = 0;
if (v.widgets)
for (var L = 0; L < v.widgets.length; L++)
v.widgets[L].height && (R += v.widgets[L].height);
return c ? R + (Math.ceil(v.text.length / f) || 1) * l : R + l;
};
}
function Hu(o) {
var l = o.doc, c = yh(o);
l.iter(function(f) {
var v = c(f);
v != f.height && di(f, v);
});
}
function $r(o, l, c, f) {
var v = o.display;
if (!c && Mn(l).getAttribute("cm-not-content") == "true")
return null;
var R, L, j = v.lineSpace.getBoundingClientRect();
try {
R = l.clientX - j.left, L = l.clientY - j.top;
} catch {
return null;
}
var Q = Vu(o, R, L), te;
if (f && Q.xRel > 0 && (te = ut(o.doc, Q.line).text).length == Q.ch) {
var se = me(te, te.length, o.options.tabSize) - te.length;
Q = ge(Q.line, Math.max(0, Math.round((R - oh(o.display).left) / so(o.display)) - se));
}
return Q;
}
function Ir(o, l) {
if (l >= o.display.viewTo || (l -= o.display.viewFrom, l < 0))
return null;
for (var c = o.display.view, f = 0; f < c.length; f++)
if (l -= c[f].size, l < 0)
return f;
}
function Pn(o, l, c, f) {
l == null && (l = o.doc.first), c == null && (c = o.doc.first + o.doc.size), f || (f = 0);
var v = o.display;
if (f && c < v.viewTo && (v.updateLineNumbers == null || v.updateLineNumbers > l) && (v.updateLineNumbers = l), o.curOp.viewChanged = !0, l >= v.viewTo)
Ki && Du(o.doc, l) < v.viewTo && hr(o);
else if (c <= v.viewFrom)
Ki && Qp(o.doc, c + f) > v.viewFrom ? hr(o) : (v.viewFrom += f, v.viewTo += f);
else if (l <= v.viewFrom && c >= v.viewTo)
hr(o);
else if (l <= v.viewFrom) {
var R = kl(o, c, c + f, 1);
R ? (v.view = v.view.slice(R.index), v.viewFrom = R.lineN, v.viewTo += f) : hr(o);
} else if (c >= v.viewTo) {
var L = kl(o, l, l, -1);
L ? (v.view = v.view.slice(0, L.index), v.viewTo = L.lineN) : hr(o);
} else {
var j = kl(o, l, l, -1), Q = kl(o, c, c + f, 1);
j && Q ? (v.view = v.view.slice(0, j.index).concat(Sl(o, j.lineN, Q.lineN)).concat(v.view.slice(Q.index)), v.viewTo += f) : hr(o);
}
var te = v.externalMeasured;
te && (c < te.lineN ? te.lineN += f : l < te.lineN + te.size && (v.externalMeasured = null));
}
function pr(o, l, c) {
o.curOp.viewChanged = !0;
var f = o.display, v = o.display.externalMeasured;
if (v && l >= v.lineN && l < v.lineN + v.size && (f.externalMeasured = null), !(l < f.viewFrom || l >= f.viewTo)) {
var R = f.view[Ir(o, l)];
if (R.node != null) {
var L = R.changes || (R.changes = []);
he(L, c) == -1 && L.push(c);
}
}
}
function hr(o) {
o.display.viewFrom = o.display.viewTo = o.doc.first, o.display.view = [], o.display.viewOffset = 0;
}
function kl(o, l, c, f) {
var v = Ir(o, l), R, L = o.display.view;
if (!Ki || c == o.doc.first + o.doc.size)
return { index: v, lineN: c };
for (var j = o.display.viewFrom, Q = 0; Q < v; Q++)
j += L[Q].size;
if (j != l) {
if (f > 0) {
if (v == L.length - 1)
return null;
R = j + L[v].size - l, v++;
} else
R = j - l;
l += R, c += R;
}
for (; Du(o.doc, c) != c; ) {
if (v == (f < 0 ? 0 : L.length - 1))
return null;
c += f * L[v - (f < 0 ? 1 : 0)].size, v += f;
}
return { index: v, lineN: c };
}
function o1(o, l, c) {
var f = o.display, v = f.view;
v.length == 0 || l >= f.viewTo || c <= f.viewFrom ? (f.view = Sl(o, l, c), f.viewFrom = l) : (f.viewFrom > l ? f.view = Sl(o, l, f.viewFrom).concat(f.view) : f.viewFrom < l && (f.view = f.view.slice(Ir(o, l))), f.viewFrom = l, f.viewTo < c ? f.view = f.view.concat(Sl(o, f.viewTo, c)) : f.viewTo > c && (f.view = f.view.slice(0, Ir(o, c)))), f.viewTo = c;
}
function bh(o) {
for (var l = o.display.view, c = 0, f = 0; f < l.length; f++) {
var v = l[f];
!v.hidden && (!v.node || v.changes) && ++c;
}
return c;
}
function fa(o) {
o.display.input.showSelection(o.display.input.prepareSelection());
}
function _h(o, l) {
l === void 0 && (l = !0);
var c = o.doc, f = {}, v = f.cursors = document.createDocumentFragment(), R = f.selection = document.createDocumentFragment(), L = o.options.$customCursor;
L && (l = !0);
for (var j = 0; j < c.sel.ranges.length; j++)
if (!(!l && j == c.sel.primIndex)) {
var Q = c.sel.ranges[j];
if (!(Q.from().line >= o.display.viewTo || Q.to().line < o.display.viewFrom)) {
var te = Q.empty();
if (L) {
var se = L(o, Q);
se && Wu(o, se, v);
} else
(te || o.options.showCursorWhenSelecting) && Wu(o, Q.head, v);
te || a1(o, Q, R);
}
}
return f;
}
function Wu(o, l, c) {
var f = bi(o, l, "div", null, null, !o.options.singleCursorHeightPerLine), v = c.appendChild(I("div", "\xA0", "CodeMirror-cursor"));
if (v.style.left = f.left + "px", v.style.top = f.top + "px", v.style.height = Math.max(0, f.bottom - f.top) * o.options.cursorHeight + "px", /\bcm-fat-cursor\b/.test(o.getWrapperElement().className)) {
var R = Tl(o, l, "div", null, null), L = R.right - R.left;
v.style.width = (L > 0 ? L : o.defaultCharWidth()) + "px";
}
if (f.other) {
var j = c.appendChild(I("div", "\xA0", "CodeMirror-cursor CodeMirror-secondarycursor"));
j.style.display = "", j.style.left = f.other.left + "px", j.style.top = f.other.top + "px", j.style.height = (f.other.bottom - f.other.top) * 0.85 + "px";
}
}
function Ol(o, l) {
return o.top - l.top || o.left - l.left;
}
function a1(o, l, c) {
var f = o.display, v = o.doc, R = document.createDocumentFragment(), L = oh(o.display), j = L.left, Q = Math.max(f.sizerWidth, Rr(o) - f.sizer.offsetLeft) - L.right, te = v.direction == "ltr";
function se(Qe, ot, mt, ct) {
ot < 0 && (ot = 0), ot = Math.round(ot), ct = Math.round(ct), R.appendChild(I("div", null, "CodeMirror-selected", "position: absolute; left: " + Qe + `px;
top: ` + ot + "px; width: " + (mt == null ? Q - Qe : mt) + `px;
height: ` + (ct - ot) + "px"));
}
function de(Qe, ot, mt) {
var ct = ut(v, Qe), Et = ct.text.length, Bt, mn;
function Kt(rn, Bn) {
return Tl(o, ge(Qe, rn), "div", ct, Bn);
}
function Wn(rn, Bn, bn) {
var ln = gh(o, ct, null, rn), on = Bn == "ltr" == (bn == "after") ? "left" : "right", Jt = bn == "after" ? ln.begin : ln.end - (/\s/.test(ct.text.charAt(ln.end - 1)) ? 2 : 1);
return Kt(Jt, on)[on];
}
var Nn = ht(ct, v.direction);
return Rt(Nn, ot || 0, mt == null ? Et : mt, function(rn, Bn, bn, ln) {
var on = bn == "ltr", Jt = Kt(rn, on ? "left" : "right"), Vn = Kt(Bn - 1, on ? "right" : "left"), Ao = ot == null && rn == 0, _r = mt == null && Bn == Et, Sn = ln == 0, Ii = !Nn || ln == Nn.length - 1;
if (Vn.top - Jt.top <= 3) {
var vn = (te ? Ao : _r) && Sn, gd = (te ? _r : Ao) && Ii, Zi = vn ? j : (on ? Jt : Vn).left, Nr = gd ? Q : (on ? Vn : Jt).right;
se(Zi, Jt.top, Nr - Zi, Jt.bottom);
} else {
var Br, kn, Co, yd;
on ? (Br = te && Ao && Sn ? j : Jt.left, kn = te ? Q : Wn(rn, bn, "before"), Co = te ? j : Wn(Bn, bn, "after"), yd = te && _r && Ii ? Q : Vn.right) : (Br = te ? Wn(rn, bn, "before") : j, kn = !te && Ao && Sn ? Q : Jt.right, Co = !te && _r && Ii ? j : Vn.left, yd = te ? Wn(Bn, bn, "after") : Q), se(Br, Jt.top, kn - Br, Jt.bottom), Jt.bottom < Vn.top && se(j, Jt.bottom, null, Vn.top), se(Co, Vn.top, yd - Co, Vn.bottom);
}
(!Bt || Ol(Jt, Bt) < 0) && (Bt = Jt), Ol(Vn, Bt) < 0 && (Bt = Vn), (!mn || Ol(Jt, mn) < 0) && (mn = Jt), Ol(Vn, mn) < 0 && (mn = Vn);
}), { start: Bt, end: mn };
}
var Ee = l.from(), Ce = l.to();
if (Ee.line == Ce.line)
de(Ee.line, Ee.ch, Ce.ch);
else {
var Ie = ut(v, Ee.line), Ne = ut(v, Ce.line), Ue = yi(Ie) == yi(Ne), Ye = de(Ee.line, Ee.ch, Ue ? Ie.text.length + 1 : null).end, nt = de(Ce.line, Ue ? 0 : null, Ce.ch).start;
Ue && (Ye.top < nt.top - 2 ? (se(Ye.right, Ye.top, null, Ye.bottom), se(j, nt.top, nt.left, nt.bottom)) : se(Ye.right, Ye.top, nt.left - Ye.right, Ye.bottom)), Ye.bottom < nt.top && se(j, Ye.bottom, null, nt.top);
}
c.appendChild(R);
}
function Gu(o) {
if (!!o.state.focused) {
var l = o.display;
clearInterval(l.blinker);
var c = !0;
l.cursorDiv.style.visibility = "", o.options.cursorBlinkRate > 0 ? l.blinker = setInterval(function() {
o.hasFocus() || uo(o), l.cursorDiv.style.visibility = (c = !c) ? "" : "hidden";
}, o.options.cursorBlinkRate) : o.options.cursorBlinkRate < 0 && (l.cursorDiv.style.visibility = "hidden");
}
}
function wh(o) {
o.hasFocus() || (o.display.input.focus(), o.state.focused || Yu(o));
}
function Ku(o) {
o.state.delayingBlurEvent = !0, setTimeout(function() {
o.state.delayingBlurEvent && (o.state.delayingBlurEvent = !1, o.state.focused && uo(o));
}, 100);
}
function Yu(o, l) {
o.state.delayingBlurEvent && !o.state.draggingText && (o.state.delayingBlurEvent = !1), o.options.readOnly != "nocursor" && (o.state.focused || (st(o, "focus", o, l), o.state.focused = !0, X(o.display.wrapper, "CodeMirror-focused"), !o.curOp && o.display.selForContextMenu != o.doc.sel && (o.display.input.reset(), p && setTimeout(function() {
return o.display.input.reset(!0);
}, 20)), o.display.input.receivedFocus()), Gu(o));
}
function uo(o, l) {
o.state.delayingBlurEvent || (o.state.focused && (st(o, "blur", o, l), o.state.focused = !1, V(o.display.wrapper, "CodeMirror-focused")), clearInterval(o.display.blinker), setTimeout(function() {
o.state.focused || (o.display.shift = !1);
}, 150));
}
function Rl(o) {
for (var l = o.display, c = l.lineDiv.offsetTop, f = Math.max(0, l.scroller.getBoundingClientRect().top), v = l.lineDiv.getBoundingClientRect().top, R = 0, L = 0; L < l.view.length; L++) {
var j = l.view[L], Q = o.options.lineWrapping, te = void 0, se = 0;
if (!j.hidden) {
if (v += j.line.height, d && h < 8) {
var de = j.node.offsetTop + j.node.offsetHeight;
te = de - c, c = de;
} else {
var Ee = j.node.getBoundingClientRect();
te = Ee.bottom - Ee.top, !Q && j.text.firstChild && (se = j.text.firstChild.getBoundingClientRect().right - Ee.left - 1);
}
var Ce = j.line.height - te;
if ((Ce > 5e-3 || Ce < -5e-3) && (v < f && (R -= Ce), di(j.line, te), Ah(j.line), j.rest))
for (var Ie = 0; Ie < j.rest.length; Ie++)
Ah(j.rest[Ie]);
if (se > o.display.sizerWidth) {
var Ne = Math.ceil(se / so(o.display));
Ne > o.display.maxLineLength && (o.display.maxLineLength = Ne, o.display.maxLine = j.line, o.display.maxLineChanged = !0);
}
}
}
Math.abs(R) > 2 && (l.scroller.scrollTop += R);
}
function Ah(o) {
if (o.widgets)
for (var l = 0; l < o.widgets.length; ++l) {
var c = o.widgets[l], f = c.node.parentNode;
f && (c.height = f.offsetHeight);
}
}
function Dl(o, l, c) {
var f = c && c.top != null ? Math.max(0, c.top) : o.scroller.scrollTop;
f = Math.floor(f - El(o));
var v = c && c.bottom != null ? c.bottom : f + o.wrapper.clientHeight, R = Oi(l, f), L = Oi(l, v);
if (c && c.ensure) {
var j = c.ensure.from.line, Q = c.ensure.to.line;
j < R ? (R = j, L = Oi(l, Yi(ut(l, j)) + o.wrapper.clientHeight)) : Math.min(Q, l.lastLine()) >= L && (R = Oi(l, Yi(ut(l, Q)) - o.wrapper.clientHeight), L = Q);
}
return { from: R, to: Math.max(L, R + 1) };
}
function l1(o, l) {
if (!Ct(o, "scrollCursorIntoView")) {
var c = o.display, f = c.sizer.getBoundingClientRect(), v = null, R = c.wrapper.ownerDocument;
if (l.top + f.top < 0 ? v = !0 : l.bottom + f.top > (R.defaultView.innerHeight || R.documentElement.clientHeight) && (v = !1), v != null && !m) {
var L = I("div", "\u200B", null, `position: absolute;
top: ` + (l.top - c.viewOffset - El(o.display)) + `px;
height: ` + (l.bottom - l.top + Di(o) + c.barHeight) + `px;
left: ` + l.left + "px; width: " + Math.max(2, l.right - l.left) + "px;");
o.display.lineSpace.appendChild(L), L.scrollIntoView(v), o.display.lineSpace.removeChild(L);
}
}
}
function s1(o, l, c, f) {
f == null && (f = 0);
var v;
!o.options.lineWrapping && l == c && (c = l.sticky == "before" ? ge(l.line, l.ch + 1, "before") : l, l = l.ch ? ge(l.line, l.sticky == "before" ? l.ch - 1 : l.ch, "after") : l);
for (var R = 0; R < 5; R++) {
var L = !1, j = bi(o, l), Q = !c || c == l ? j : bi(o, c);
v = {
left: Math.min(j.left, Q.left),
top: Math.min(j.top, Q.top) - f,
right: Math.max(j.left, Q.left),
bottom: Math.max(j.bottom, Q.bottom) + f
};
var te = Qu(o, v), se = o.doc.scrollTop, de = o.doc.scrollLeft;
if (te.scrollTop != null && (pa(o, te.scrollTop), Math.abs(o.doc.scrollTop - se) > 1 && (L = !0)), te.scrollLeft != null && (Fr(o, te.scrollLeft), Math.abs(o.doc.scrollLeft - de) > 1 && (L = !0)), !L)
break;
}
return v;
}
function u1(o, l) {
var c = Qu(o, l);
c.scrollTop != null && pa(o, c.scrollTop), c.scrollLeft != null && Fr(o, c.scrollLeft);
}
function Qu(o, l) {
var c = o.display, f = lo(o.display);
l.top < 0 && (l.top = 0);
var v = o.curOp && o.curOp.scrollTop != null ? o.curOp.scrollTop : c.scroller.scrollTop, R = Pu(o), L = {};
l.bottom - l.top > R && (l.bottom = l.top + R);
var j = o.doc.height + Mu(c), Q = l.top < f, te = l.bottom > j - f;
if (l.top < v)
L.scrollTop = Q ? 0 : l.top;
else if (l.bottom > v + R) {
var se = Math.min(l.top, (te ? j : l.bottom) - R);
se != v && (L.scrollTop = se);
}
var de = o.options.fixedGutter ? 0 : c.gutters.offsetWidth, Ee = o.curOp && o.curOp.scrollLeft != null ? o.curOp.scrollLeft : c.scroller.scrollLeft - de, Ce = Rr(o) - c.gutters.offsetWidth, Ie = l.right - l.left > Ce;
return Ie && (l.right = l.left + Ce), l.left < 10 ? L.scrollLeft = 0 : l.left < Ee ? L.scrollLeft = Math.max(0, l.left + de - (Ie ? 0 : 10)) : l.right > Ce + Ee - 3 && (L.scrollLeft = l.right + (Ie ? 0 : 10) - Ce), L;
}
function Ju(o, l) {
l != null && ($l(o), o.curOp.scrollTop = (o.curOp.scrollTop == null ? o.doc.scrollTop : o.curOp.scrollTop) + l);
}
function fo(o) {
$l(o);
var l = o.getCursor();
o.curOp.scrollToPos = { from: l, to: l, margin: o.options.cursorScrollMargin };
}
function ca(o, l, c) {
(l != null || c != null) && $l(o), l != null && (o.curOp.scrollLeft = l), c != null && (o.curOp.scrollTop = c);
}
function d1(o, l) {
$l(o), o.curOp.scrollToPos = l;
}
function $l(o) {
var l = o.curOp.scrollToPos;
if (l) {
o.curOp.scrollToPos = null;
var c = mh(o, l.from), f = mh(o, l.to);
Ch(o, c, f, l.margin);
}
}
function Ch(o, l, c, f) {
var v = Qu(o, {
left: Math.min(l.left, c.left),
top: Math.min(l.top, c.top) - f,
right: Math.max(l.right, c.right),
bottom: Math.max(l.bottom, c.bottom) + f
});
ca(o, v.scrollLeft, v.scrollTop);
}
function pa(o, l) {
Math.abs(o.doc.scrollTop - l) < 2 || (n || Zu(o, { top: l }), Sh(o, l, !0), n && Zu(o), va(o, 100));
}
function Sh(o, l, c) {
l = Math.max(0, Math.min(o.display.scroller.scrollHeight - o.display.scroller.clientHeight, l)), !(o.display.scroller.scrollTop == l && !c) && (o.doc.scrollTop = l, o.display.scrollbars.setScrollTop(l), o.display.scroller.scrollTop != l && (o.display.scroller.scrollTop = l));
}
function Fr(o, l, c, f) {
l = Math.max(0, Math.min(l, o.display.scroller.scrollWidth - o.display.scroller.clientWidth)), !((c ? l == o.doc.scrollLeft : Math.abs(o.doc.scrollLeft - l) < 2) && !f) && (o.doc.scrollLeft = l, Oh(o), o.display.scroller.scrollLeft != l && (o.display.scroller.scrollLeft = l), o.display.scrollbars.setScrollLeft(l));
}
function ha(o) {
var l = o.display, c = l.gutters.offsetWidth, f = Math.round(o.doc.height + Mu(o.display));
return {
clientHeight: l.scroller.clientHeight,
viewHeight: l.wrapper.clientHeight,
scrollWidth: l.scroller.scrollWidth,
clientWidth: l.scroller.clientWidth,
viewWidth: l.wrapper.clientWidth,
barLeft: o.options.fixedGutter ? c : 0,
docHeight: f,
scrollHeight: f + Di(o) + l.barHeight,
nativeBarWidth: l.nativeBarWidth,
gutterWidth: c
};
}
var Mr = function(o, l, c) {
this.cm = c;
var f = this.vert = I("div", [I("div", null, null, "min-width: 1px")], "CodeMirror-vscrollbar"), v = this.horiz = I("div", [I("div", null, null, "height: 100%; min-height: 1px")], "CodeMirror-hscrollbar");
f.tabIndex = v.tabIndex = -1, o(f), o(v), Re(f, "scroll", function() {
f.clientHeight && l(f.scrollTop, "vertical");
}), Re(v, "scroll", function() {
v.clientWidth && l(v.scrollLeft, "horizontal");
}), this.checkedZeroWidth = !1, d && h < 8 && (this.horiz.style.minHeight = this.vert.style.minWidth = "18px");
};
Mr.prototype.update = function(o) {
var l = o.scrollWidth > o.clientWidth + 1, c = o.scrollHeight > o.clientHeight + 1, f = o.nativeBarWidth;
if (c) {
this.vert.style.display = "block", this.vert.style.bottom = l ? f + "px" : "0";
var v = o.viewHeight - (l ? f : 0);
this.vert.firstChild.style.height = Math.max(0, o.scrollHeight - o.clientHeight + v) + "px";
} else
this.vert.scrollTop = 0, this.vert.style.display = "", this.vert.firstChild.style.height = "0";
if (l) {
this.horiz.style.display = "block", this.horiz.style.right = c ? f + "px" : "0", this.horiz.style.left = o.barLeft + "px";
var R = o.viewWidth - o.barLeft - (c ? f : 0);
this.horiz.firstChild.style.width = Math.max(0, o.scrollWidth - o.clientWidth + R) + "px";
} else
this.horiz.style.display = "", this.horiz.firstChild.style.width = "0";
return !this.checkedZeroWidth && o.clientHeight > 0 && (f == 0 && this.zeroWidthHack(), this.checkedZeroWidth = !0), { right: c ? f : 0, bottom: l ? f : 0 };
}, Mr.prototype.setScrollLeft = function(o) {
this.horiz.scrollLeft != o && (this.horiz.scrollLeft = o), this.disableHoriz && this.enableZeroWidthBar(this.horiz, this.disableHoriz, "horiz");
}, Mr.prototype.setScrollTop = function(o) {
this.vert.scrollTop != o && (this.vert.scrollTop = o), this.disableVert && this.enableZeroWidthBar(this.vert, this.disableVert, "vert");
}, Mr.prototype.zeroWidthHack = function() {
var o = k && !w ? "12px" : "18px";
this.horiz.style.height = this.vert.style.width = o, this.horiz.style.visibility = this.vert.style.visibility = "hidden", this.disableHoriz = new we(), this.disableVert = new we();
}, Mr.prototype.enableZeroWidthBar = function(o, l, c) {
o.style.visibility = "";
function f() {
var v = o.getBoundingClientRect(), R = c == "vert" ? document.elementFromPoint(v.right - 1, (v.top + v.bottom) / 2) : document.elementFromPoint((v.right + v.left) / 2, v.bottom - 1);
R != o ? o.style.visibility = "hidden" : l.set(1e3, f);
}
l.set(1e3, f);
}, Mr.prototype.clear = function() {
var o = this.horiz.parentNode;
o.removeChild(this.horiz), o.removeChild(this.vert);
};
var ma = function() {
};
ma.prototype.update = function() {
return { bottom: 0, right: 0 };
}, ma.prototype.setScrollLeft = function() {
}, ma.prototype.setScrollTop = function() {
}, ma.prototype.clear = function() {
};
function co(o, l) {
l || (l = ha(o));
var c = o.display.barWidth, f = o.display.barHeight;
Eh(o, l);
for (var v = 0; v < 4 && c != o.display.barWidth || f != o.display.barHeight; v++)
c != o.display.barWidth && o.options.lineWrapping && Rl(o), Eh(o, ha(o)), c = o.display.barWidth, f = o.display.barHeight;
}
function Eh(o, l) {
var c = o.display, f = c.scrollbars.update(l);
c.sizer.style.paddingRight = (c.barWidth = f.right) + "px", c.sizer.style.paddingBottom = (c.barHeight = f.bottom) + "px", c.heightForcer.style.borderBottom = f.bottom + "px solid transparent", f.right && f.bottom ? (c.scrollbarFiller.style.display = "block", c.scrollbarFiller.style.height = f.bottom + "px", c.scrollbarFiller.style.width = f.right + "px") : c.scrollbarFiller.style.display = "", f.bottom && o.options.coverGutterNextToScrollbar && o.options.fixedGutter ? (c.gutterFiller.style.display = "block", c.gutterFiller.style.height = f.bottom + "px", c.gutterFiller.style.width = l.gutterWidth + "px") : c.gutterFiller.style.display = "";
}
var xh = { native: Mr, null: ma };
function Th(o) {
o.display.scrollbars && (o.display.scrollbars.clear(), o.display.scrollbars.addClass && V(o.display.wrapper, o.display.scrollbars.addClass)), o.display.scrollbars = new xh[o.options.scrollbarStyle](function(l) {
o.display.wrapper.insertBefore(l, o.display.scrollbarFiller), Re(l, "mousedown", function() {
o.state.focused && setTimeout(function() {
return o.display.input.focus();
}, 0);
}), l.setAttribute("cm-not-content", "true");
}, function(l, c) {
c == "horizontal" ? Fr(o, l) : pa(o, l);
}, o), o.display.scrollbars.addClass && X(o.display.wrapper, o.display.scrollbars.addClass);
}
var f1 = 0;
function Pr(o) {
o.curOp = {
cm: o,
viewChanged: !1,
startHeight: o.doc.height,
forceUpdate: !1,
updateInput: 0,
typing: !1,
changeObjs: null,
cursorActivityHandlers: null,
cursorActivityCalled: 0,
selectionChanged: !1,
updateMaxLine: !1,
scrollLeft: null,
scrollTop: null,
scrollToPos: null,
focus: !1,
id: ++f1,
markArrays: null
}, Ub(o.curOp);
}
function Lr(o) {
var l = o.curOp;
l && Hb(l, function(c) {
for (var f = 0; f < c.ops.length; f++)
c.ops[f].cm.curOp = null;
c1(c);
});
}
function c1(o) {
for (var l = o.ops, c = 0; c < l.length; c++)
p1(l[c]);
for (var f = 0; f < l.length; f++)
h1(l[f]);
for (var v = 0; v < l.length; v++)
m1(l[v]);
for (var R = 0; R < l.length; R++)
v1(l[R]);
for (var L = 0; L < l.length; L++)
g1(l[L]);
}
function p1(o) {
var l = o.cm, c = l.display;
b1(l), o.updateMaxLine && Iu(l), o.mustUpdate = o.viewChanged || o.forceUpdate || o.scrollTop != null || o.scrollToPos && (o.scrollToPos.from.line < c.viewFrom || o.scrollToPos.to.line >= c.viewTo) || c.maxLineChanged && l.options.lineWrapping, o.update = o.mustUpdate && new Il(l, o.mustUpdate && { top: o.scrollTop, ensure: o.scrollToPos }, o.forceUpdate);
}
function h1(o) {
o.updatedDisplay = o.mustUpdate && Xu(o.cm, o.update);
}
function m1(o) {
var l = o.cm, c = l.display;
o.updatedDisplay && Rl(l), o.barMeasure = ha(l), c.maxLineChanged && !l.options.lineWrapping && (o.adjustWidthTo = lh(l, c.maxLine, c.maxLine.text.length).left + 3, l.display.sizerWidth = o.adjustWidthTo, o.barMeasure.scrollWidth = Math.max(c.scroller.clientWidth, c.sizer.offsetLeft + o.adjustWidthTo + Di(l) + l.display.barWidth), o.maxScrollLeft = Math.max(0, c.sizer.offsetLeft + o.adjustWidthTo - Rr(l))), (o.updatedDisplay || o.selectionChanged) && (o.preparedSelection = c.input.prepareSelection());
}
function v1(o) {
var l = o.cm;
o.adjustWidthTo != null && (l.display.sizer.style.minWidth = o.adjustWidthTo + "px", o.maxScrollLeft < l.doc.scrollLeft && Fr(l, Math.min(l.display.scroller.scrollLeft, o.maxScrollLeft), !0), l.display.maxLineChanged = !1);
var c = o.focus && o.focus == q(ee(l));
o.preparedSelection && l.display.input.showSelection(o.preparedSelection, c), (o.updatedDisplay || o.startHeight != l.doc.height) && co(l, o.barMeasure), o.updatedDisplay && ed(l, o.barMeasure), o.selectionChanged && Gu(l), l.state.focused && o.updateInput && l.display.input.reset(o.typing), c && wh(o.cm);
}
function g1(o) {
var l = o.cm, c = l.display, f = l.doc;
if (o.updatedDisplay && kh(l, o.update), c.wheelStartX != null && (o.scrollTop != null || o.scrollLeft != null || o.scrollToPos) && (c.wheelStartX = c.wheelStartY = null), o.scrollTop != null && Sh(l, o.scrollTop, o.forceScroll), o.scrollLeft != null && Fr(l, o.scrollLeft, !0, !0), o.scrollToPos) {
var v = s1(
l,
bt(f, o.scrollToPos.from),
bt(f, o.scrollToPos.to),
o.scrollToPos.margin
);
l1(l, v);
}
var R = o.maybeHiddenMarkers, L = o.maybeUnhiddenMarkers;
if (R)
for (var j = 0; j < R.length; ++j)
R[j].lines.length || st(R[j], "hide");
if (L)
for (var Q = 0; Q < L.length; ++Q)
L[Q].lines.length && st(L[Q], "unhide");
c.wrapper.offsetHeight && (f.scrollTop = l.display.scroller.scrollTop), o.changeObjs && st(l, "changes", l, o.changeObjs), o.update && o.update.finish();
}
function Hn(o, l) {
if (o.curOp)
return l();
Pr(o);
try {
return l();
} finally {
Lr(o);
}
}
function pn(o, l) {
return function() {
if (o.curOp)
return l.apply(o, arguments);
Pr(o);
try {
return l.apply(o, arguments);
} finally {
Lr(o);
}
};
}
function Tn(o) {
return function() {
if (this.curOp)
return o.apply(this, arguments);
Pr(this);
try {
return o.apply(this, arguments);
} finally {
Lr(this);
}
};
}
function hn(o) {
return function() {
var l = this.cm;
if (!l || l.curOp)
return o.apply(this, arguments);
Pr(l);
try {
return o.apply(this, arguments);
} finally {
Lr(l);
}
};
}
function va(o, l) {
o.doc.highlightFrontier < o.display.viewTo && o.state.highlight.set(l, Te(y1, o));
}
function y1(o) {
var l = o.doc;
if (!(l.highlightFrontier >= o.display.viewTo)) {
var c = +new Date() + o.options.workTime, f = oa(o, l.highlightFrontier), v = [];
l.iter(f.line, Math.min(l.first + l.size, o.display.viewTo + 500), function(R) {
if (f.line >= o.display.viewFrom) {
var L = R.styles, j = R.text.length > o.options.maxHighlightLength ? Wi(l.mode, f.state) : null, Q = Mp(o, R, f, !0);
j && (f.state = j), R.styles = Q.styles;
var te = R.styleClasses, se = Q.classes;
se ? R.styleClasses = se : te && (R.styleClasses = null);
for (var de = !L || L.length != R.styles.length || te != se && (!te || !se || te.bgClass != se.bgClass || te.textClass != se.textClass), Ee = 0; !de && Ee < L.length; ++Ee)
de = L[Ee] != R.styles[Ee];
de && v.push(f.line), R.stateAfter = f.save(), f.nextLine();
} else
R.text.length <= o.options.maxHighlightLength && Tu(o, R.text, f), R.stateAfter = f.line % 5 == 0 ? f.save() : null, f.nextLine();
if (+new Date() > c)
return va(o, o.options.workDelay), !0;
}), l.highlightFrontier = f.line, l.modeFrontier = Math.max(l.modeFrontier, f.line), v.length && Hn(o, function() {
for (var R = 0; R < v.length; R++)
pr(o, v[R], "text");
});
}
}
var Il = function(o, l, c) {
var f = o.display;
this.viewport = l, this.visible = Dl(f, o.doc, l), this.editorIsHidden = !f.wrapper.offsetWidth, this.wrapperHeight = f.wrapper.clientHeight, this.wrapperWidth = f.wrapper.clientWidth, this.oldDisplayWidth = Rr(o), this.force = c, this.dims = Uu(o), this.events = [];
};
Il.prototype.signal = function(o, l) {
Gt(o, l) && this.events.push(arguments);
}, Il.prototype.finish = function() {
for (var o = 0; o < this.events.length; o++)
st.apply(null, this.events[o]);
};
function b1(o) {
var l = o.display;
!l.scrollbarsClipped && l.scroller.offsetWidth && (l.nativeBarWidth = l.scroller.offsetWidth - l.scroller.clientWidth, l.heightForcer.style.height = Di(o) + "px", l.sizer.style.marginBottom = -l.nativeBarWidth + "px", l.sizer.style.borderRightWidth = Di(o) + "px", l.scrollbarsClipped = !0);
}
function _1(o) {
if (o.hasFocus())
return null;
var l = q(ee(o));
if (!l || !C(o.display.lineDiv, l))
return null;
var c = { activeElt: l };
if (window.getSelection) {
var f = pe(o).getSelection();
f.anchorNode && f.extend && C(o.display.lineDiv, f.anchorNode) && (c.anchorNode = f.anchorNode, c.anchorOffset = f.anchorOffset, c.focusNode = f.focusNode, c.focusOffset = f.focusOffset);
}
return c;
}
function w1(o) {
if (!(!o || !o.activeElt || o.activeElt == q(o.activeElt.ownerDocument)) && (o.activeElt.focus(), !/^(INPUT|TEXTAREA)$/.test(o.activeElt.nodeName) && o.anchorNode && C(document.body, o.anchorNode) && C(document.body, o.focusNode))) {
var l = o.activeElt.ownerDocument, c = l.defaultView.getSelection(), f = l.createRange();
f.setEnd(o.anchorNode, o.anchorOffset), f.collapse(!1), c.removeAllRanges(), c.addRange(f), c.extend(o.focusNode, o.focusOffset);
}
}
function Xu(o, l) {
var c = o.display, f = o.doc;
if (l.editorIsHidden)
return hr(o), !1;
if (!l.force && l.visible.from >= c.viewFrom && l.visible.to <= c.viewTo && (c.updateLineNumbers == null || c.updateLineNumbers >= c.viewTo) && c.renderedView == c.view && bh(o) == 0)
return !1;
Rh(o) && (hr(o), l.dims = Uu(o));
var v = f.first + f.size, R = Math.max(l.visible.from - o.options.viewportMargin, f.first), L = Math.min(v, l.visible.to + o.options.viewportMargin);
c.viewFrom < R && R - c.viewFrom < 20 && (R = Math.max(f.first, c.viewFrom)), c.viewTo > L && c.viewTo - L < 20 && (L = Math.min(v, c.viewTo)), Ki && (R = Du(o.doc, R), L = Qp(o.doc, L));
var j = R != c.viewFrom || L != c.viewTo || c.lastWrapHeight != l.wrapperHeight || c.lastWrapWidth != l.wrapperWidth;
o1(o, R, L), c.viewOffset = Yi(ut(o.doc, c.viewFrom)), o.display.mover.style.top = c.viewOffset + "px";
var Q = bh(o);
if (!j && Q == 0 && !l.force && c.renderedView == c.view && (c.updateLineNumbers == null || c.updateLineNumbers >= c.viewTo))
return !1;
var te = _1(o);
return Q > 4 && (c.lineDiv.style.display = "none"), A1(o, c.updateLineNumbers, l.dims), Q > 4 && (c.lineDiv.style.display = ""), c.renderedView = c.view, w1(te), z(c.cursorDiv), z(c.selectionDiv), c.gutters.style.height = c.sizer.style.minHeight = 0, j && (c.lastWrapHeight = l.wrapperHeight, c.lastWrapWidth = l.wrapperWidth, va(o, 400)), c.updateLineNumbers = null, !0;
}
function kh(o, l) {
for (var c = l.viewport, f = !0; ; f = !1) {
if (!f || !o.options.lineWrapping || l.oldDisplayWidth == Rr(o)) {
if (c && c.top != null && (c = { top: Math.min(o.doc.height + Mu(o.display) - Pu(o), c.top) }), l.visible = Dl(o.display, o.doc, c), l.visible.from >= o.display.viewFrom && l.visible.to <= o.display.viewTo)
break;
} else
f && (l.visible = Dl(o.display, o.doc, c));
if (!Xu(o, l))
break;
Rl(o);
var v = ha(o);
fa(o), co(o, v), ed(o, v), l.force = !1;
}
l.signal(o, "update", o), (o.display.viewFrom != o.display.reportedViewFrom || o.display.viewTo != o.display.reportedViewTo) && (l.signal(o, "viewportChange", o, o.display.viewFrom, o.display.viewTo), o.display.reportedViewFrom = o.display.viewFrom, o.display.reportedViewTo = o.display.viewTo);
}
function Zu(o, l) {
var c = new Il(o, l);
if (Xu(o, c)) {
Rl(o), kh(o, c);
var f = ha(o);
fa(o), co(o, f), ed(o, f), c.finish();
}
}
function A1(o, l, c) {
var f = o.display, v = o.options.lineNumbers, R = f.lineDiv, L = R.firstChild;
function j(Ie) {
var Ne = Ie.nextSibling;
return p && k && o.display.currentWheelTarget == Ie ? Ie.style.display = "none" : Ie.parentNode.removeChild(Ie), Ne;
}
for (var Q = f.view, te = f.viewFrom, se = 0; se < Q.length; se++) {
var de = Q[se];
if (!de.hidden)
if (!de.node || de.node.parentNode != R) {
var Ee = Qb(o, de, te, c);
R.insertBefore(Ee, L);
} else {
for (; L != de.node; )
L = j(L);
var Ce = v && l != null && l <= te && de.lineNumber;
de.changes && (he(de.changes, "gutter") > -1 && (Ce = !1), eh(o, de, te, c)), Ce && (z(de.lineNumber), de.lineNumber.appendChild(document.createTextNode(ce(o.options, te)))), L = de.node.nextSibling;
}
te += de.size;
}
for (; L; )
L = j(L);
}
function qu(o) {
var l = o.gutters.offsetWidth;
o.sizer.style.marginLeft = l + "px", cn(o, "gutterChanged", o);
}
function ed(o, l) {
o.display.sizer.style.minHeight = l.docHeight + "px", o.display.heightForcer.style.top = l.docHeight + "px", o.display.gutters.style.height = l.docHeight + o.display.barHeight + Di(o) + "px";
}
function Oh(o) {
var l = o.display, c = l.view;
if (!(!l.alignWidgets && (!l.gutters.firstChild || !o.options.fixedGutter))) {
for (var f = zu(l) - l.scroller.scrollLeft + o.doc.scrollLeft, v = l.gutters.offsetWidth, R = f + "px", L = 0; L < c.length; L++)
if (!c[L].hidden) {
o.options.fixedGutter && (c[L].gutter && (c[L].gutter.style.left = R), c[L].gutterBackground && (c[L].gutterBackground.style.left = R));
var j = c[L].alignable;
if (j)
for (var Q = 0; Q < j.length; Q++)
j[Q].style.left = R;
}
o.options.fixedGutter && (l.gutters.style.left = f + v + "px");
}
}
function Rh(o) {
if (!o.options.lineNumbers)
return !1;
var l = o.doc, c = ce(o.options, l.first + l.size - 1), f = o.display;
if (c.length != f.lineNumChars) {
var v = f.measure.appendChild(I(
"div",
[I("div", c)],
"CodeMirror-linenumber CodeMirror-gutter-elt"
)), R = v.firstChild.offsetWidth, L = v.offsetWidth - R;
return f.lineGutter.style.width = "", f.lineNumInnerWidth = Math.max(R, f.lineGutter.offsetWidth - L) + 1, f.lineNumWidth = f.lineNumInnerWidth + L, f.lineNumChars = f.lineNumInnerWidth ? c.length : -1, f.lineGutter.style.width = f.lineNumWidth + "px", qu(o.display), !0;
}
return !1;
}
function td(o, l) {
for (var c = [], f = !1, v = 0; v < o.length; v++) {
var R = o[v], L = null;
if (typeof R != "string" && (L = R.style, R = R.className), R == "CodeMirror-linenumbers")
if (l)
f = !0;
else
continue;
c.push({ className: R, style: L });
}
return l && !f && c.push({ className: "CodeMirror-linenumbers", style: null }), c;
}
function Dh(o) {
var l = o.gutters, c = o.gutterSpecs;
z(l), o.lineGutter = null;
for (var f = 0; f < c.length; ++f) {
var v = c[f], R = v.className, L = v.style, j = l.appendChild(I("div", null, "CodeMirror-gutter " + R));
L && (j.style.cssText = L), R == "CodeMirror-linenumbers" && (o.lineGutter = j, j.style.width = (o.lineNumWidth || 1) + "px");
}
l.style.display = c.length ? "" : "none", qu(o);
}
function ga(o) {
Dh(o.display), Pn(o), Oh(o);
}
function C1(o, l, c, f) {
var v = this;
this.input = c, v.scrollbarFiller = I("div", null, "CodeMirror-scrollbar-filler"), v.scrollbarFiller.setAttribute("cm-not-content", "true"), v.gutterFiller = I("div", null, "CodeMirror-gutter-filler"), v.gutterFiller.setAttribute("cm-not-content", "true"), v.lineDiv = U("div", null, "CodeMirror-code"), v.selectionDiv = I("div", null, null, "position: relative; z-index: 1"), v.cursorDiv = I("div", null, "CodeMirror-cursors"), v.measure = I("div", null, "CodeMirror-measure"), v.lineMeasure = I("div", null, "CodeMirror-measure"), v.lineSpace = U(
"div",
[v.measure, v.lineMeasure, v.selectionDiv, v.cursorDiv, v.lineDiv],
null,
"position: relative; outline: none"
);
var R = U("div", [v.lineSpace], "CodeMirror-lines");
v.mover = I("div", [R], null, "position: relative"), v.sizer = I("div", [v.mover], "CodeMirror-sizer"), v.sizerWidth = null, v.heightForcer = I("div", null, null, "position: absolute; height: " + Se + "px; width: 1px;"), v.gutters = I("div", null, "CodeMirror-gutters"), v.lineGutter = null, v.scroller = I("div", [v.sizer, v.heightForcer, v.gutters], "CodeMirror-scroll"), v.scroller.setAttribute("tabIndex", "-1"), v.wrapper = I("div", [v.scrollbarFiller, v.gutterFiller, v.scroller], "CodeMirror"), v.wrapper.setAttribute("translate", "no"), d && h < 8 && (v.gutters.style.zIndex = -1, v.scroller.style.paddingRight = 0), !p && !(n && x) && (v.scroller.draggable = !0), o && (o.appendChild ? o.appendChild(v.wrapper) : o(v.wrapper)), v.viewFrom = v.viewTo = l.first, v.reportedViewFrom = v.reportedViewTo = l.first, v.view = [], v.renderedView = null, v.externalMeasured = null, v.viewOffset = 0, v.lastWrapHeight = v.lastWrapWidth = 0, v.updateLineNumbers = null, v.nativeBarWidth = v.barHeight = v.barWidth = 0, v.scrollbarsClipped = !1, v.lineNumWidth = v.lineNumInnerWidth = v.lineNumChars = null, v.alignWidgets = !1, v.cachedCharWidth = v.cachedTextHeight = v.cachedPaddingH = null, v.maxLine = null, v.maxLineLength = 0, v.maxLineChanged = !1, v.wheelDX = v.wheelDY = v.wheelStartX = v.wheelStartY = null, v.shift = !1, v.selForContextMenu = null, v.activeTouch = null, v.gutterSpecs = td(f.gutters, f.lineNumbers), Dh(v), c.init(v);
}
var Fl = 0, Ji = null;
d ? Ji = -0.53 : n ? Ji = 15 : _ ? Ji = -0.7 : A && (Ji = -1 / 3);
function $h(o) {
var l = o.wheelDeltaX, c = o.wheelDeltaY;
return l == null && o.detail && o.axis == o.HORIZONTAL_AXIS && (l = o.detail), c == null && o.detail && o.axis == o.VERTICAL_AXIS ? c = o.detail : c == null && (c = o.wheelDelta), { x: l, y: c };
}
function S1(o) {
var l = $h(o);
return l.x *= Ji, l.y *= Ji, l;
}
function Ih(o, l) {
_ && S == 102 && (o.display.chromeScrollHack == null ? o.display.sizer.style.pointerEvents = "none" : clearTimeout(o.display.chromeScrollHack), o.display.chromeScrollHack = setTimeout(function() {
o.display.chromeScrollHack = null, o.display.sizer.style.pointerEvents = "";
}, 100));
var c = $h(l), f = c.x, v = c.y, R = Ji;
l.deltaMode === 0 && (f = l.deltaX, v = l.deltaY, R = 1);
var L = o.display, j = L.scroller, Q = j.scrollWidth > j.clientWidth, te = j.scrollHeight > j.clientHeight;
if (!!(f && Q || v && te)) {
if (v && k && p) {
e:
for (var se = l.target, de = L.view; se != j; se = se.parentNode)
for (var Ee = 0; Ee < de.length; Ee++)
if (de[Ee].node == se) {
o.display.currentWheelTarget = se;
break e;
}
}
if (f && !n && !b && R != null) {
v && te && pa(o, Math.max(0, j.scrollTop + v * R)), Fr(o, Math.max(0, j.scrollLeft + f * R)), (!v || v && te) && It(l), L.wheelStartX = null;
return;
}
if (v && R != null) {
var Ce = v * R, Ie = o.doc.scrollTop, Ne = Ie + L.wrapper.clientHeight;
Ce < 0 ? Ie = Math.max(0, Ie + Ce - 50) : Ne = Math.min(o.doc.height, Ne + Ce + 50), Zu(o, { top: Ie, bottom: Ne });
}
Fl < 20 && l.deltaMode !== 0 && (L.wheelStartX == null ? (L.wheelStartX = j.scrollLeft, L.wheelStartY = j.scrollTop, L.wheelDX = f, L.wheelDY = v, setTimeout(function() {
if (L.wheelStartX != null) {
var Ue = j.scrollLeft - L.wheelStartX, Ye = j.scrollTop - L.wheelStartY, nt = Ye && L.wheelDY && Ye / L.wheelDY || Ue && L.wheelDX && Ue / L.wheelDX;
L.wheelStartX = L.wheelStartY = null, nt && (Ji = (Ji * Fl + nt) / (Fl + 1), ++Fl);
}
}, 200)) : (L.wheelDX += f, L.wheelDY += v));
}
}
var qn = function(o, l) {
this.ranges = o, this.primIndex = l;
};
qn.prototype.primary = function() {
return this.ranges[this.primIndex];
}, qn.prototype.equals = function(o) {
if (o == this)
return !0;
if (o.primIndex != this.primIndex || o.ranges.length != this.ranges.length)
return !1;
for (var l = 0; l < this.ranges.length; l++) {
var c = this.ranges[l], f = o.ranges[l];
if (!yt(c.anchor, f.anchor) || !yt(c.head, f.head))
return !1;
}
return !0;
}, qn.prototype.deepCopy = function() {
for (var o = [], l = 0; l < this.ranges.length; l++)
o[l] = new Mt(Ot(this.ranges[l].anchor), Ot(this.ranges[l].head));
return new qn(o, this.primIndex);
}, qn.prototype.somethingSelected = function() {
for (var o = 0; o < this.ranges.length; o++)
if (!this.ranges[o].empty())
return !0;
return !1;
}, qn.prototype.contains = function(o, l) {
l || (l = o);
for (var c = 0; c < this.ranges.length; c++) {
var f = this.ranges[c];
if ($e(l, f.from()) >= 0 && $e(o, f.to()) <= 0)
return c;
}
return -1;
};
var Mt = function(o, l) {
this.anchor = o, this.head = l;
};
Mt.prototype.from = function() {
return an(this.anchor, this.head);
}, Mt.prototype.to = function() {
return Dt(this.anchor, this.head);
}, Mt.prototype.empty = function() {
return this.head.line == this.anchor.line && this.head.ch == this.anchor.ch;
};
function _i(o, l, c) {
var f = o && o.options.selectionsMayTouch, v = l[c];
l.sort(function(Ee, Ce) {
return $e(Ee.from(), Ce.from());
}), c = he(l, v);
for (var R = 1; R < l.length; R++) {
var L = l[R], j = l[R - 1], Q = $e(j.to(), L.from());
if (f && !L.empty() ? Q > 0 : Q >= 0) {
var te = an(j.from(), L.from()), se = Dt(j.to(), L.to()), de = j.empty() ? L.from() == L.head : j.from() == j.head;
R <= c && --c, l.splice(--R, 2, new Mt(de ? se : te, de ? te : se));
}
}
return new qn(l, c);
}
function mr(o, l) {
return new qn([new Mt(o, l || o)], 0);
}
function vr(o) {
return o.text ? ge(
o.from.line + o.text.length - 1,
Ae(o.text).length + (o.text.length == 1 ? o.from.ch : 0)
) : o.to;
}
function Fh(o, l) {
if ($e(o, l.from) < 0)
return o;
if ($e(o, l.to) <= 0)
return vr(l);
var c = o.line + l.text.length - (l.to.line - l.from.line) - 1, f = o.ch;
return o.line == l.to.line && (f += vr(l).ch - l.to.ch), ge(c, f);
}
function nd(o, l) {
for (var c = [], f = 0; f < o.sel.ranges.length; f++) {
var v = o.sel.ranges[f];
c.push(new Mt(
Fh(v.anchor, l),
Fh(v.head, l)
));
}
return _i(o.cm, c, o.sel.primIndex);
}
function Mh(o, l, c) {
return o.line == l.line ? ge(c.line, o.ch - l.ch + c.ch) : ge(c.line + (o.line - l.line), o.ch);
}
function E1(o, l, c) {
for (var f = [], v = ge(o.first, 0), R = v, L = 0; L < l.length; L++) {
var j = l[L], Q = Mh(j.from, v, R), te = Mh(vr(j), v, R);
if (v = j.to, R = te, c == "around") {
var se = o.sel.ranges[L], de = $e(se.head, se.anchor) < 0;
f[L] = new Mt(de ? te : Q, de ? Q : te);
} else
f[L] = new Mt(Q, Q);
}
return new qn(f, o.sel.primIndex);
}
function id(o) {
o.doc.mode = Hi(o.options, o.doc.modeOption), ya(o);
}
function ya(o) {
o.doc.iter(function(l) {
l.stateAfter && (l.stateAfter = null), l.styles && (l.styles = null);
}), o.doc.modeFrontier = o.doc.highlightFrontier = o.doc.first, va(o, 100), o.state.modeGen++, o.curOp && Pn(o);
}
function Ph(o, l) {
return l.from.ch == 0 && l.to.ch == 0 && Ae(l.text) == "" && (!o.cm || o.cm.options.wholeLineUpdateBefore);
}
function rd(o, l, c, f) {
function v(nt) {
return c ? c[nt] : null;
}
function R(nt, Qe, ot) {
Ib(nt, Qe, ot, f), cn(nt, "change", nt, l);
}
function L(nt, Qe) {
for (var ot = [], mt = nt; mt < Qe; ++mt)
ot.push(new ro(te[mt], v(mt), f));
return ot;
}
var j = l.from, Q = l.to, te = l.text, se = ut(o, j.line), de = ut(o, Q.line), Ee = Ae(te), Ce = v(te.length - 1), Ie = Q.line - j.line;
if (l.full)
o.insert(0, L(0, te.length)), o.remove(te.length, o.size - te.length);
else if (Ph(o, l)) {
var Ne = L(0, te.length - 1);
R(de, de.text, Ce), Ie && o.remove(j.line, Ie), Ne.length && o.insert(j.line, Ne);
} else if (se == de)
if (te.length == 1)
R(se, se.text.slice(0, j.ch) + Ee + se.text.slice(Q.ch), Ce);
else {
var Ue = L(1, te.length - 1);
Ue.push(new ro(Ee + se.text.slice(Q.ch), Ce, f)), R(se, se.text.slice(0, j.ch) + te[0], v(0)), o.insert(j.line + 1, Ue);
}
else if (te.length == 1)
R(se, se.text.slice(0, j.ch) + te[0] + de.text.slice(Q.ch), v(0)), o.remove(j.line + 1, Ie);
else {
R(se, se.text.slice(0, j.ch) + te[0], v(0)), R(de, Ee + de.text.slice(Q.ch), Ce);
var Ye = L(1, te.length - 1);
Ie > 1 && o.remove(j.line + 1, Ie - 1), o.insert(j.line + 1, Ye);
}
cn(o, "change", o, l);
}
function gr(o, l, c) {
function f(v, R, L) {
if (v.linked)
for (var j = 0; j < v.linked.length; ++j) {
var Q = v.linked[j];
if (Q.doc != R) {
var te = L && Q.sharedHist;
c && !te || (l(Q.doc, te), f(Q.doc, v, te));
}
}
}
f(o, null, !0);
}
function Lh(o, l) {
if (l.cm)
throw new Error("This document is already in use.");
o.doc = l, l.cm = o, Hu(o), id(o), Nh(o), o.options.direction = l.direction, o.options.lineWrapping || Iu(o), o.options.mode = l.modeOption, Pn(o);
}
function Nh(o) {
(o.doc.direction == "rtl" ? X : V)(o.display.lineDiv, "CodeMirror-rtl");
}
function x1(o) {
Hn(o, function() {
Nh(o), Pn(o);
});
}
function Ml(o) {
this.done = [], this.undone = [], this.undoDepth = o ? o.undoDepth : 1 / 0, this.lastModTime = this.lastSelTime = 0, this.lastOp = this.lastSelOp = null, this.lastOrigin = this.lastSelOrigin = null, this.generation = this.maxGeneration = o ? o.maxGeneration : 1;
}
function od(o, l) {
var c = { from: Ot(l.from), to: vr(l), text: Gi(o, l.from, l.to) };
return jh(o, c, l.from.line, l.to.line + 1), gr(o, function(f) {
return jh(f, c, l.from.line, l.to.line + 1);
}, !0), c;
}
function Bh(o) {
for (; o.length; ) {
var l = Ae(o);
if (l.ranges)
o.pop();
else
break;
}
}
function T1(o, l) {
if (l)
return Bh(o.done), Ae(o.done);
if (o.done.length && !Ae(o.done).ranges)
return Ae(o.done);
if (o.done.length > 1 && !o.done[o.done.length - 2].ranges)
return o.done.pop(), Ae(o.done);
}
function Vh(o, l, c, f) {
var v = o.history;
v.undone.length = 0;
var R = +new Date(), L, j;
if ((v.lastOp == f || v.lastOrigin == l.origin && l.origin && (l.origin.charAt(0) == "+" && v.lastModTime > R - (o.cm ? o.cm.options.historyEventDelay : 500) || l.origin.charAt(0) == "*")) && (L = T1(v, v.lastOp == f)))
j = Ae(L.changes), $e(l.from, l.to) == 0 && $e(l.from, j.to) == 0 ? j.to = vr(l) : L.changes.push(od(o, l));
else {
var Q = Ae(v.done);
for ((!Q || !Q.ranges) && Pl(o.sel, v.done), L = {
changes: [od(o, l)],
generation: v.generation
}, v.done.push(L); v.done.length > v.undoDepth; )
v.done.shift(), v.done[0].ranges || v.done.shift();
}
v.done.push(c), v.generation = ++v.maxGeneration, v.lastModTime = v.lastSelTime = R, v.lastOp = v.lastSelOp = f, v.lastOrigin = v.lastSelOrigin = l.origin, j || st(o, "historyAdded");
}
function k1(o, l, c, f) {
var v = l.charAt(0);
return v == "*" || v == "+" && c.ranges.length == f.ranges.length && c.somethingSelected() == f.somethingSelected() && new Date() - o.history.lastSelTime <= (o.cm ? o.cm.options.historyEventDelay : 500);
}
function O1(o, l, c, f) {
var v = o.history, R = f && f.origin;
c == v.lastSelOp || R && v.lastSelOrigin == R && (v.lastModTime == v.lastSelTime && v.lastOrigin == R || k1(o, R, Ae(v.done), l)) ? v.done[v.done.length - 1] = l : Pl(l, v.done), v.lastSelTime = +new Date(), v.lastSelOrigin = R, v.lastSelOp = c, f && f.clearRedo !== !1 && Bh(v.undone);
}
function Pl(o, l) {
var c = Ae(l);
c && c.ranges && c.equals(o) || l.push(o);
}
function jh(o, l, c, f) {
var v = l["spans_" + o.id], R = 0;
o.iter(Math.max(o.first, c), Math.min(o.first + o.size, f), function(L) {
L.markedSpans && ((v || (v = l["spans_" + o.id] = {}))[R] = L.markedSpans), ++R;
});
}
function R1(o) {
if (!o)
return null;
for (var l, c = 0; c < o.length; ++c)
o[c].marker.explicitlyCleared ? l || (l = o.slice(0, c)) : l && l.push(o[c]);
return l ? l.length ? l : null : o;
}
function D1(o, l) {
var c = l["spans_" + o.id];
if (!c)
return null;
for (var f = [], v = 0; v < l.text.length; ++v)
f.push(R1(c[v]));
return f;
}
function Uh(o, l) {
var c = D1(o, l), f = Ou(o, l);
if (!c)
return f;
if (!f)
return c;
for (var v = 0; v < c.length; ++v) {
var R = c[v], L = f[v];
if (R && L) {
e:
for (var j = 0; j < L.length; ++j) {
for (var Q = L[j], te = 0; te < R.length; ++te)
if (R[te].marker == Q.marker)
continue e;
R.push(Q);
}
} else
L && (c[v] = L);
}
return c;
}
function po(o, l, c) {
for (var f = [], v = 0; v < o.length; ++v) {
var R = o[v];
if (R.ranges) {
f.push(c ? qn.prototype.deepCopy.call(R) : R);
continue;
}
var L = R.changes, j = [];
f.push({ changes: j });
for (var Q = 0; Q < L.length; ++Q) {
var te = L[Q], se = void 0;
if (j.push({ from: te.from, to: te.to, text: te.text }), l)
for (var de in te)
(se = de.match(/^spans_(\d+)$/)) && he(l, Number(se[1])) > -1 && (Ae(j)[de] = te[de], delete te[de]);
}
}
return f;
}
function ad(o, l, c, f) {
if (f) {
var v = o.anchor;
if (c) {
var R = $e(l, v) < 0;
R != $e(c, v) < 0 ? (v = l, l = c) : R != $e(l, c) < 0 && (l = c);
}
return new Mt(v, l);
} else
return new Mt(c || l, l);
}
function Ll(o, l, c, f, v) {
v == null && (v = o.cm && (o.cm.display.shift || o.extend)), Cn(o, new qn([ad(o.sel.primary(), l, c, v)], 0), f);
}
function zh(o, l, c) {
for (var f = [], v = o.cm && (o.cm.display.shift || o.extend), R = 0; R < o.sel.ranges.length; R++)
f[R] = ad(o.sel.ranges[R], l[R], null, v);
var L = _i(o.cm, f, o.sel.primIndex);
Cn(o, L, c);
}
function ld(o, l, c, f) {
var v = o.sel.ranges.slice(0);
v[l] = c, Cn(o, _i(o.cm, v, o.sel.primIndex), f);
}
function Hh(o, l, c, f) {
Cn(o, mr(l, c), f);
}
function $1(o, l, c) {
var f = {
ranges: l.ranges,
update: function(v) {
this.ranges = [];
for (var R = 0; R < v.length; R++)
this.ranges[R] = new Mt(
bt(o, v[R].anchor),
bt(o, v[R].head)
);
},
origin: c && c.origin
};
return st(o, "beforeSelectionChange", o, f), o.cm && st(o.cm, "beforeSelectionChange", o.cm, f), f.ranges != l.ranges ? _i(o.cm, f.ranges, f.ranges.length - 1) : l;
}
function Wh(o, l, c) {
var f = o.history.done, v = Ae(f);
v && v.ranges ? (f[f.length - 1] = l, Nl(o, l, c)) : Cn(o, l, c);
}
function Cn(o, l, c) {
Nl(o, l, c), O1(o, o.sel, o.cm ? o.cm.curOp.id : NaN, c);
}
function Nl(o, l, c) {
(Gt(o, "beforeSelectionChange") || o.cm && Gt(o.cm, "beforeSelectionChange")) && (l = $1(o, l, c));
var f = c && c.bias || ($e(l.primary().head, o.sel.primary().head) < 0 ? -1 : 1);
Gh(o, Yh(o, l, f, !0)), !(c && c.scroll === !1) && o.cm && o.cm.getOption("readOnly") != "nocursor" && fo(o.cm);
}
function Gh(o, l) {
l.equals(o.sel) || (o.sel = l, o.cm && (o.cm.curOp.updateInput = 1, o.cm.curOp.selectionChanged = !0, Fn(o.cm)), cn(o, "cursorActivity", o));
}
function Kh(o) {
Gh(o, Yh(o, o.sel, null, !1));
}
function Yh(o, l, c, f) {
for (var v, R = 0; R < l.ranges.length; R++) {
var L = l.ranges[R], j = l.ranges.length == o.sel.ranges.length && o.sel.ranges[R], Q = Bl(o, L.anchor, j && j.anchor, c, f), te = L.head == L.anchor ? Q : Bl(o, L.head, j && j.head, c, f);
(v || Q != L.anchor || te != L.head) && (v || (v = l.ranges.slice(0, R)), v[R] = new Mt(Q, te));
}
return v ? _i(o.cm, v, l.primIndex) : l;
}
function ho(o, l, c, f, v) {
var R = ut(o, l.line);
if (R.markedSpans)
for (var L = 0; L < R.markedSpans.length; ++L) {
var j = R.markedSpans[L], Q = j.marker, te = "selectLeft" in Q ? !Q.selectLeft : Q.inclusiveLeft, se = "selectRight" in Q ? !Q.selectRight : Q.inclusiveRight;
if ((j.from == null || (te ? j.from <= l.ch : j.from < l.ch)) && (j.to == null || (se ? j.to >= l.ch : j.to > l.ch))) {
if (v && (st(Q, "beforeCursorEnter"), Q.explicitlyCleared))
if (R.markedSpans) {
--L;
continue;
} else
break;
if (!Q.atomic)
continue;
if (c) {
var de = Q.find(f < 0 ? 1 : -1), Ee = void 0;
if ((f < 0 ? se : te) && (de = Qh(o, de, -f, de && de.line == l.line ? R : null)), de && de.line == l.line && (Ee = $e(de, c)) && (f < 0 ? Ee < 0 : Ee > 0))
return ho(o, de, l, f, v);
}
var Ce = Q.find(f < 0 ? -1 : 1);
return (f < 0 ? te : se) && (Ce = Qh(o, Ce, f, Ce.line == l.line ? R : null)), Ce ? ho(o, Ce, l, f, v) : null;
}
}
return l;
}
function Bl(o, l, c, f, v) {
var R = f || 1, L = ho(o, l, c, R, v) || !v && ho(o, l, c, R, !0) || ho(o, l, c, -R, v) || !v && ho(o, l, c, -R, !0);
return L || (o.cantEdit = !0, ge(o.first, 0));
}
function Qh(o, l, c, f) {
return c < 0 && l.ch == 0 ? l.line > o.first ? bt(o, ge(l.line - 1)) : null : c > 0 && l.ch == (f || ut(o, l.line)).text.length ? l.line < o.first + o.size - 1 ? ge(l.line + 1, 0) : null : new ge(l.line, l.ch + c);
}
function Jh(o) {
o.setSelection(ge(o.firstLine(), 0), ge(o.lastLine()), O);
}
function Xh(o, l, c) {
var f = {
canceled: !1,
from: l.from,
to: l.to,
text: l.text,
origin: l.origin,
cancel: function() {
return f.canceled = !0;
}
};
return c && (f.update = function(v, R, L, j) {
v && (f.from = bt(o, v)), R && (f.to = bt(o, R)), L && (f.text = L), j !== void 0 && (f.origin = j);
}), st(o, "beforeChange", o, f), o.cm && st(o.cm, "beforeChange", o.cm, f), f.canceled ? (o.cm && (o.cm.curOp.updateInput = 2), null) : { from: f.from, to: f.to, text: f.text, origin: f.origin };
}
function mo(o, l, c) {
if (o.cm) {
if (!o.cm.curOp)
return pn(o.cm, mo)(o, l, c);
if (o.cm.state.suppressEdits)
return;
}
if (!((Gt(o, "beforeChange") || o.cm && Gt(o.cm, "beforeChange")) && (l = Xh(o, l, !0), !l))) {
var f = Up && !c && Ob(o, l.from, l.to);
if (f)
for (var v = f.length - 1; v >= 0; --v)
Zh(o, { from: f[v].from, to: f[v].to, text: v ? [""] : l.text, origin: l.origin });
else
Zh(o, l);
}
}
function Zh(o, l) {
if (!(l.text.length == 1 && l.text[0] == "" && $e(l.from, l.to) == 0)) {
var c = nd(o, l);
Vh(o, l, c, o.cm ? o.cm.curOp.id : NaN), ba(o, l, c, Ou(o, l));
var f = [];
gr(o, function(v, R) {
!R && he(f, v.history) == -1 && (nm(v.history, l), f.push(v.history)), ba(v, l, null, Ou(v, l));
});
}
}
function Vl(o, l, c) {
var f = o.cm && o.cm.state.suppressEdits;
if (!(f && !c)) {
for (var v = o.history, R, L = o.sel, j = l == "undo" ? v.done : v.undone, Q = l == "undo" ? v.undone : v.done, te = 0; te < j.length && (R = j[te], !(c ? R.ranges && !R.equals(o.sel) : !R.ranges)); te++)
;
if (te != j.length) {
for (v.lastOrigin = v.lastSelOrigin = null; ; )
if (R = j.pop(), R.ranges) {
if (Pl(R, Q), c && !R.equals(o.sel)) {
Cn(o, R, { clearRedo: !1 });
return;
}
L = R;
} else if (f) {
j.push(R);
return;
} else
break;
var se = [];
Pl(L, Q), Q.push({ changes: se, generation: v.generation }), v.generation = R.generation || ++v.maxGeneration;
for (var de = Gt(o, "beforeChange") || o.cm && Gt(o.cm, "beforeChange"), Ee = function(Ne) {
var Ue = R.changes[Ne];
if (Ue.origin = l, de && !Xh(o, Ue, !1))
return j.length = 0, {};
se.push(od(o, Ue));
var Ye = Ne ? nd(o, Ue) : Ae(j);
ba(o, Ue, Ye, Uh(o, Ue)), !Ne && o.cm && o.cm.scrollIntoView({ from: Ue.from, to: vr(Ue) });
var nt = [];
gr(o, function(Qe, ot) {
!ot && he(nt, Qe.history) == -1 && (nm(Qe.history, Ue), nt.push(Qe.history)), ba(Qe, Ue, null, Uh(Qe, Ue));
});
}, Ce = R.changes.length - 1; Ce >= 0; --Ce) {
var Ie = Ee(Ce);
if (Ie)
return Ie.v;
}
}
}
}
function qh(o, l) {
if (l != 0 && (o.first += l, o.sel = new qn(Fe(o.sel.ranges, function(v) {
return new Mt(
ge(v.anchor.line + l, v.anchor.ch),
ge(v.head.line + l, v.head.ch)
);
}), o.sel.primIndex), o.cm)) {
Pn(o.cm, o.first, o.first - l, l);
for (var c = o.cm.display, f = c.viewFrom; f < c.viewTo; f++)
pr(o.cm, f, "gutter");
}
}
function ba(o, l, c, f) {
if (o.cm && !o.cm.curOp)
return pn(o.cm, ba)(o, l, c, f);
if (l.to.line < o.first) {
qh(o, l.text.length - 1 - (l.to.line - l.from.line));
return;
}
if (!(l.from.line > o.lastLine())) {
if (l.from.line < o.first) {
var v = l.text.length - 1 - (o.first - l.from.line);
qh(o, v), l = {
from: ge(o.first, 0),
to: ge(l.to.line + v, l.to.ch),
text: [Ae(l.text)],
origin: l.origin
};
}
var R = o.lastLine();
l.to.line > R && (l = {
from: l.from,
to: ge(R, ut(o, R).text.length),
text: [l.text[0]],
origin: l.origin
}), l.removed = Gi(o, l.from, l.to), c || (c = nd(o, l)), o.cm ? I1(o.cm, l, f) : rd(o, l, f), Nl(o, c, O), o.cantEdit && Bl(o, ge(o.firstLine(), 0)) && (o.cantEdit = !1);
}
}
function I1(o, l, c) {
var f = o.doc, v = o.display, R = l.from, L = l.to, j = !1, Q = R.line;
o.options.lineWrapping || (Q = Ft(yi(ut(f, R.line))), f.iter(Q, L.line + 1, function(Ce) {
if (Ce == v.maxLine)
return j = !0, !0;
})), f.sel.contains(l.from, l.to) > -1 && Fn(o), rd(f, l, c, yh(o)), o.options.lineWrapping || (f.iter(Q, R.line + l.text.length, function(Ce) {
var Ie = Cl(Ce);
Ie > v.maxLineLength && (v.maxLine = Ce, v.maxLineLength = Ie, v.maxLineChanged = !0, j = !1);
}), j && (o.curOp.updateMaxLine = !0)), Ab(f, R.line), va(o, 400);
var te = l.text.length - (L.line - R.line) - 1;
l.full ? Pn(o) : R.line == L.line && l.text.length == 1 && !Ph(o.doc, l) ? pr(o, R.line, "text") : Pn(o, R.line, L.line + 1, te);
var se = Gt(o, "changes"), de = Gt(o, "change");
if (de || se) {
var Ee = {
from: R,
to: L,
text: l.text,
removed: l.removed,
origin: l.origin
};
de && cn(o, "change", o, Ee), se && (o.curOp.changeObjs || (o.curOp.changeObjs = [])).push(Ee);
}
o.display.selForContextMenu = null;
}
function vo(o, l, c, f, v) {
var R;
f || (f = c), $e(f, c) < 0 && (R = [f, c], c = R[0], f = R[1]), typeof l == "string" && (l = o.splitLines(l)), mo(o, { from: c, to: f, text: l, origin: v });
}
function em(o, l, c, f) {
c < o.line ? o.line += f : l < o.line && (o.line = l, o.ch = 0);
}
function tm(o, l, c, f) {
for (var v = 0; v < o.length; ++v) {
var R = o[v], L = !0;
if (R.ranges) {
R.copied || (R = o[v] = R.deepCopy(), R.copied = !0);
for (var j = 0; j < R.ranges.length; j++)
em(R.ranges[j].anchor, l, c, f), em(R.ranges[j].head, l, c, f);
continue;
}
for (var Q = 0; Q < R.changes.length; ++Q) {
var te = R.changes[Q];
if (c < te.from.line)
te.from = ge(te.from.line + f, te.from.ch), te.to = ge(te.to.line + f, te.to.ch);
else if (l <= te.to.line) {
L = !1;
break;
}
}
L || (o.splice(0, v + 1), v = 0);
}
}
function nm(o, l) {
var c = l.from.line, f = l.to.line, v = l.text.length - (f - c) - 1;
tm(o.done, c, f, v), tm(o.undone, c, f, v);
}
function _a(o, l, c, f) {
var v = l, R = l;
return typeof l == "number" ? R = ut(o, Zn(o, l)) : v = Ft(l), v == null ? null : (f(R, v) && o.cm && pr(o.cm, v, c), R);
}
function wa(o) {
this.lines = o, this.parent = null;
for (var l = 0, c = 0; c < o.length; ++c)
o[c].parent = this, l += o[c].height;
this.height = l;
}
wa.prototype = {
chunkSize: function() {
return this.lines.length;
},
removeInner: function(o, l) {
for (var c = o, f = o + l; c < f; ++c) {
var v = this.lines[c];
this.height -= v.height, Fb(v), cn(v, "delete");
}
this.lines.splice(o, l);
},
collapse: function(o) {
o.push.apply(o, this.lines);
},
insertInner: function(o, l, c) {
this.height += c, this.lines = this.lines.slice(0, o).concat(l).concat(this.lines.slice(o));
for (var f = 0; f < l.length; ++f)
l[f].parent = this;
},
iterN: function(o, l, c) {
for (var f = o + l; o < f; ++o)
if (c(this.lines[o]))
return !0;
}
};
function Aa(o) {
this.children = o;
for (var l = 0, c = 0, f = 0; f < o.length; ++f) {
var v = o[f];
l += v.chunkSize(), c += v.height, v.parent = this;
}
this.size = l, this.height = c, this.parent = null;
}
Aa.prototype = {
chunkSize: function() {
return this.size;
},
removeInner: function(o, l) {
this.size -= l;
for (var c = 0; c < this.children.length; ++c) {
var f = this.children[c], v = f.chunkSize();
if (o < v) {
var R = Math.min(l, v - o), L = f.height;
if (f.removeInner(o, R), this.height -= L - f.height, v == R && (this.children.splice(c--, 1), f.parent = null), (l -= R) == 0)
break;
o = 0;
} else
o -= v;
}
if (this.size - l < 25 && (this.children.length > 1 || !(this.children[0] instanceof wa))) {
var j = [];
this.collapse(j), this.children = [new wa(j)], this.children[0].parent = this;
}
},
collapse: function(o) {
for (var l = 0; l < this.children.length; ++l)
this.children[l].collapse(o);
},
insertInner: function(o, l, c) {
this.size += l.length, this.height += c;
for (var f = 0; f < this.children.length; ++f) {
var v = this.children[f], R = v.chunkSize();
if (o <= R) {
if (v.insertInner(o, l, c), v.lines && v.lines.length > 50) {
for (var L = v.lines.length % 25 + 25, j = L; j < v.lines.length; ) {
var Q = new wa(v.lines.slice(j, j += 25));
v.height -= Q.height, this.children.splice(++f, 0, Q), Q.parent = this;
}
v.lines = v.lines.slice(0, L), this.maybeSpill();
}
break;
}
o -= R;
}
},
maybeSpill: function() {
if (!(this.children.length <= 10)) {
var o = this;
do {
var l = o.children.splice(o.children.length - 5, 5), c = new Aa(l);
if (o.parent) {
o.size -= c.size, o.height -= c.height;
var v = he(o.parent.children, o);
o.parent.children.splice(v + 1, 0, c);
} else {
var f = new Aa(o.children);
f.parent = o, o.children = [f, c], o = f;
}
c.parent = o.parent;
} while (o.children.length > 10);
o.parent.maybeSpill();
}
},
iterN: function(o, l, c) {
for (var f = 0; f < this.children.length; ++f) {
var v = this.children[f], R = v.chunkSize();
if (o < R) {
var L = Math.min(l, R - o);
if (v.iterN(o, L, c))
return !0;
if ((l -= L) == 0)
break;
o = 0;
} else
o -= R;
}
}
};
var Ca = function(o, l, c) {
if (c)
for (var f in c)
c.hasOwnProperty(f) && (this[f] = c[f]);
this.doc = o, this.node = l;
};
Ca.prototype.clear = function() {
var o = this.doc.cm, l = this.line.widgets, c = this.line, f = Ft(c);
if (!(f == null || !l)) {
for (var v = 0; v < l.length; ++v)
l[v] == this && l.splice(v--, 1);
l.length || (c.widgets = null);
var R = ua(this);
di(c, Math.max(0, c.height - R)), o && (Hn(o, function() {
im(o, c, -R), pr(o, f, "widget");
}), cn(o, "lineWidgetCleared", o, this, f));
}
}, Ca.prototype.changed = function() {
var o = this, l = this.height, c = this.doc.cm, f = this.line;
this.height = null;
var v = ua(this) - l;
!v || (cr(this.doc, f) || di(f, f.height + v), c && Hn(c, function() {
c.curOp.forceUpdate = !0, im(c, f, v), cn(c, "lineWidgetChanged", c, o, Ft(f));
}));
}, Ut(Ca);
function im(o, l, c) {
Yi(l) < (o.curOp && o.curOp.scrollTop || o.doc.scrollTop) && Ju(o, c);
}
function F1(o, l, c, f) {
var v = new Ca(o, c, f), R = o.cm;
return R && v.noHScroll && (R.display.alignWidgets = !0), _a(o, l, "widget", function(L) {
var j = L.widgets || (L.widgets = []);
if (v.insertAt == null ? j.push(v) : j.splice(Math.min(j.length, Math.max(0, v.insertAt)), 0, v), v.line = L, R && !cr(o, L)) {
var Q = Yi(L) < o.scrollTop;
di(L, L.height + ua(v)), Q && Ju(R, v.height), R.curOp.forceUpdate = !0;
}
return !0;
}), R && cn(R, "lineWidgetAdded", R, v, typeof l == "number" ? l : Ft(l)), v;
}
var rm = 0, yr = function(o, l) {
this.lines = [], this.type = l, this.doc = o, this.id = ++rm;
};
yr.prototype.clear = function() {
if (!this.explicitlyCleared) {
var o = this.doc.cm, l = o && !o.curOp;
if (l && Pr(o), Gt(this, "clear")) {
var c = this.find();
c && cn(this, "clear", c.from, c.to);
}
for (var f = null, v = null, R = 0; R < this.lines.length; ++R) {
var L = this.lines[R], j = aa(L.markedSpans, this);
o && !this.collapsed ? pr(o, Ft(L), "text") : o && (j.to != null && (v = Ft(L)), j.from != null && (f = Ft(L))), L.markedSpans = Eb(L.markedSpans, j), j.from == null && this.collapsed && !cr(this.doc, L) && o && di(L, lo(o.display));
}
if (o && this.collapsed && !o.options.lineWrapping)
for (var Q = 0; Q < this.lines.length; ++Q) {
var te = yi(this.lines[Q]), se = Cl(te);
se > o.display.maxLineLength && (o.display.maxLine = te, o.display.maxLineLength = se, o.display.maxLineChanged = !0);
}
f != null && o && this.collapsed && Pn(o, f, v + 1), this.lines.length = 0, this.explicitlyCleared = !0, this.atomic && this.doc.cantEdit && (this.doc.cantEdit = !1, o && Kh(o.doc)), o && cn(o, "markerCleared", o, this, f, v), l && Lr(o), this.parent && this.parent.clear();
}
}, yr.prototype.find = function(o, l) {
o == null && this.type == "bookmark" && (o = 1);
for (var c, f, v = 0; v < this.lines.length; ++v) {
var R = this.lines[v], L = aa(R.markedSpans, this);
if (L.from != null && (c = ge(l ? R : Ft(R), L.from), o == -1))
return c;
if (L.to != null && (f = ge(l ? R : Ft(R), L.to), o == 1))
return f;
}
return c && { from: c, to: f };
}, yr.prototype.changed = function() {
var o = this, l = this.find(-1, !0), c = this, f = this.doc.cm;
!l || !f || Hn(f, function() {
var v = l.line, R = Ft(l.line), L = Lu(f, R);
if (L && (dh(L), f.curOp.selectionChanged = f.curOp.forceUpdate = !0), f.curOp.updateMaxLine = !0, !cr(c.doc, v) && c.height != null) {
var j = c.height;
c.height = null;
var Q = ua(c) - j;
Q && di(v, v.height + Q);
}
cn(f, "markerChanged", f, o);
});
}, yr.prototype.attachLine = function(o) {
if (!this.lines.length && this.doc.cm) {
var l = this.doc.cm.curOp;
(!l.maybeHiddenMarkers || he(l.maybeHiddenMarkers, this) == -1) && (l.maybeUnhiddenMarkers || (l.maybeUnhiddenMarkers = [])).push(this);
}
this.lines.push(o);
}, yr.prototype.detachLine = function(o) {
if (this.lines.splice(he(this.lines, o), 1), !this.lines.length && this.doc.cm) {
var l = this.doc.cm.curOp;
(l.maybeHiddenMarkers || (l.maybeHiddenMarkers = [])).push(this);
}
}, Ut(yr);
function go(o, l, c, f, v) {
if (f && f.shared)
return M1(o, l, c, f, v);
if (o.cm && !o.cm.curOp)
return pn(o.cm, go)(o, l, c, f, v);
var R = new yr(o, v), L = $e(l, c);
if (f && ve(f, R, !1), L > 0 || L == 0 && R.clearWhenEmpty !== !1)
return R;
if (R.replacedWith && (R.collapsed = !0, R.widgetNode = U("span", [R.replacedWith], "CodeMirror-widget"), f.handleMouseEvents || R.widgetNode.setAttribute("cm-ignore-events", "true"), f.insertLeft && (R.widgetNode.insertLeft = !0)), R.collapsed) {
if (Yp(o, l.line, l, c, R) || l.line != c.line && Yp(o, c.line, l, c, R))
throw new Error("Inserting collapsed marker partially overlapping an existing one");
Sb();
}
R.addToHistory && Vh(o, { from: l, to: c, origin: "markText" }, o.sel, NaN);
var j = l.line, Q = o.cm, te;
if (o.iter(j, c.line + 1, function(de) {
Q && R.collapsed && !Q.options.lineWrapping && yi(de) == Q.display.maxLine && (te = !0), R.collapsed && j != l.line && di(de, 0), xb(de, new bl(
R,
j == l.line ? l.ch : null,
j == c.line ? c.ch : null
), o.cm && o.cm.curOp), ++j;
}), R.collapsed && o.iter(l.line, c.line + 1, function(de) {
cr(o, de) && di(de, 0);
}), R.clearOnEnter && Re(R, "beforeCursorEnter", function() {
return R.clear();
}), R.readOnly && (Cb(), (o.history.done.length || o.history.undone.length) && o.clearHistory()), R.collapsed && (R.id = ++rm, R.atomic = !0), Q) {
if (te && (Q.curOp.updateMaxLine = !0), R.collapsed)
Pn(Q, l.line, c.line + 1);
else if (R.className || R.startStyle || R.endStyle || R.css || R.attributes || R.title)
for (var se = l.line; se <= c.line; se++)
pr(Q, se, "text");
R.atomic && Kh(Q.doc), cn(Q, "markerAdded", Q, R);
}
return R;
}
var Sa = function(o, l) {
this.markers = o, this.primary = l;
for (var c = 0; c < o.length; ++c)
o[c].parent = this;
};
Sa.prototype.clear = function() {
if (!this.explicitlyCleared) {
this.explicitlyCleared = !0;
for (var o = 0; o < this.markers.length; ++o)
this.markers[o].clear();
cn(this, "clear");
}
}, Sa.prototype.find = function(o, l) {
return this.primary.find(o, l);
}, Ut(Sa);
function M1(o, l, c, f, v) {
f = ve(f), f.shared = !1;
var R = [go(o, l, c, f, v)], L = R[0], j = f.widgetNode;
return gr(o, function(Q) {
j && (f.widgetNode = j.cloneNode(!0)), R.push(go(Q, bt(Q, l), bt(Q, c), f, v));
for (var te = 0; te < Q.linked.length; ++te)
if (Q.linked[te].isParent)
return;
L = Ae(R);
}), new Sa(R, L);
}
function om(o) {
return o.findMarks(ge(o.first, 0), o.clipPos(ge(o.lastLine())), function(l) {
return l.parent;
});
}
function P1(o, l) {
for (var c = 0; c < l.length; c++) {
var f = l[c], v = f.find(), R = o.clipPos(v.from), L = o.clipPos(v.to);
if ($e(R, L)) {
var j = go(o, R, L, f.primary, f.primary.type);
f.markers.push(j), j.parent = f;
}
}
}
function L1(o) {
for (var l = function(f) {
var v = o[f], R = [v.primary.doc];
gr(v.primary.doc, function(Q) {
return R.push(Q);
});
for (var L = 0; L < v.markers.length; L++) {
var j = v.markers[L];
he(R, j.doc) == -1 && (j.parent = null, v.markers.splice(L--, 1));
}
}, c = 0; c < o.length; c++)
l(c);
}
var N1 = 0, Ln = function(o, l, c, f, v) {
if (!(this instanceof Ln))
return new Ln(o, l, c, f, v);
c == null && (c = 0), Aa.call(this, [new wa([new ro("", null)])]), this.first = c, this.scrollTop = this.scrollLeft = 0, this.cantEdit = !1, this.cleanGeneration = 1, this.modeFrontier = this.highlightFrontier = c;
var R = ge(c, 0);
this.sel = mr(R), this.history = new Ml(null), this.id = ++N1, this.modeOption = l, this.lineSep = f, this.direction = v == "rtl" ? "rtl" : "ltr", this.extend = !1, typeof o == "string" && (o = this.splitLines(o)), rd(this, { from: R, to: R, text: o }), Cn(this, mr(R), O);
};
Ln.prototype = be(Aa.prototype, {
constructor: Ln,
iter: function(o, l, c) {
c ? this.iterN(o - this.first, l - o, c) : this.iterN(this.first, this.first + this.size, o);
},
insert: function(o, l) {
for (var c = 0, f = 0; f < l.length; ++f)
c += l[f].height;
this.insertInner(o - this.first, l, c);
},
remove: function(o, l) {
this.removeInner(o - this.first, l);
},
getValue: function(o) {
var l = io(this, this.first, this.first + this.size);
return o === !1 ? l : l.join(o || this.lineSeparator());
},
setValue: hn(function(o) {
var l = ge(this.first, 0), c = this.first + this.size - 1;
mo(this, {
from: l,
to: ge(c, ut(this, c).text.length),
text: this.splitLines(o),
origin: "setValue",
full: !0
}, !0), this.cm && ca(this.cm, 0, 0), Cn(this, mr(l), O);
}),
replaceRange: function(o, l, c, f) {
l = bt(this, l), c = c ? bt(this, c) : l, vo(this, o, l, c, f);
},
getRange: function(o, l, c) {
var f = Gi(this, bt(this, o), bt(this, l));
return c === !1 ? f : c === "" ? f.join("") : f.join(c || this.lineSeparator());
},
getLine: function(o) {
var l = this.getLineHandle(o);
return l && l.text;
},
getLineHandle: function(o) {
if (oe(this, o))
return ut(this, o);
},
getLineNumber: function(o) {
return Ft(o);
},
getLineHandleVisualStart: function(o) {
return typeof o == "number" && (o = ut(this, o)), yi(o);
},
lineCount: function() {
return this.size;
},
firstLine: function() {
return this.first;
},
lastLine: function() {
return this.first + this.size - 1;
},
clipPos: function(o) {
return bt(this, o);
},
getCursor: function(o) {
var l = this.sel.primary(), c;
return o == null || o == "head" ? c = l.head : o == "anchor" ? c = l.anchor : o == "end" || o == "to" || o === !1 ? c = l.to() : c = l.from(), c;
},
listSelections: function() {
return this.sel.ranges;
},
somethingSelected: function() {
return this.sel.somethingSelected();
},
setCursor: hn(function(o, l, c) {
Hh(this, bt(this, typeof o == "number" ? ge(o, l || 0) : o), null, c);
}),
setSelection: hn(function(o, l, c) {
Hh(this, bt(this, o), bt(this, l || o), c);
}),
extendSelection: hn(function(o, l, c) {
Ll(this, bt(this, o), l && bt(this, l), c);
}),
extendSelections: hn(function(o, l) {
zh(this, Fp(this, o), l);
}),
extendSelectionsBy: hn(function(o, l) {
var c = Fe(this.sel.ranges, o);
zh(this, Fp(this, c), l);
}),
setSelections: hn(function(o, l, c) {
if (!!o.length) {
for (var f = [], v = 0; v < o.length; v++)
f[v] = new Mt(
bt(this, o[v].anchor),
bt(this, o[v].head || o[v].anchor)
);
l == null && (l = Math.min(o.length - 1, this.sel.primIndex)), Cn(this, _i(this.cm, f, l), c);
}
}),
addSelection: hn(function(o, l, c) {
var f = this.sel.ranges.slice(0);
f.push(new Mt(bt(this, o), bt(this, l || o))), Cn(this, _i(this.cm, f, f.length - 1), c);
}),
getSelection: function(o) {
for (var l = this.sel.ranges, c, f = 0; f < l.length; f++) {
var v = Gi(this, l[f].from(), l[f].to());
c = c ? c.concat(v) : v;
}
return o === !1 ? c : c.join(o || this.lineSeparator());
},
getSelections: function(o) {
for (var l = [], c = this.sel.ranges, f = 0; f < c.length; f++) {
var v = Gi(this, c[f].from(), c[f].to());
o !== !1 && (v = v.join(o || this.lineSeparator())), l[f] = v;
}
return l;
},
replaceSelection: function(o, l, c) {
for (var f = [], v = 0; v < this.sel.ranges.length; v++)
f[v] = o;
this.replaceSelections(f, l, c || "+input");
},
replaceSelections: hn(function(o, l, c) {
for (var f = [], v = this.sel, R = 0; R < v.ranges.length; R++) {
var L = v.ranges[R];
f[R] = { from: L.from(), to: L.to(), text: this.splitLines(o[R]), origin: c };
}
for (var j = l && l != "end" && E1(this, f, l), Q = f.length - 1; Q >= 0; Q--)
mo(this, f[Q]);
j ? Wh(this, j) : this.cm && fo(this.cm);
}),
undo: hn(function() {
Vl(this, "undo");
}),
redo: hn(function() {
Vl(this, "redo");
}),
undoSelection: hn(function() {
Vl(this, "undo", !0);
}),
redoSelection: hn(function() {
Vl(this, "redo", !0);
}),
setExtending: function(o) {
this.extend = o;
},
getExtending: function() {
return this.extend;
},
historySize: function() {
for (var o = this.history, l = 0, c = 0, f = 0; f < o.done.length; f++)
o.done[f].ranges || ++l;
for (var v = 0; v < o.undone.length; v++)
o.undone[v].ranges || ++c;
return { undo: l, redo: c };
},
clearHistory: function() {
var o = this;
this.history = new Ml(this.history), gr(this, function(l) {
return l.history = o.history;
}, !0);
},
markClean: function() {
this.cleanGeneration = this.changeGeneration(!0);
},
changeGeneration: function(o) {
return o && (this.history.lastOp = this.history.lastSelOp = this.history.lastOrigin = null), this.history.generation;
},
isClean: function(o) {
return this.history.generation == (o || this.cleanGeneration);
},
getHistory: function() {
return {
done: po(this.history.done),
undone: po(this.history.undone)
};
},
setHistory: function(o) {
var l = this.history = new Ml(this.history);
l.done = po(o.done.slice(0), null, !0), l.undone = po(o.undone.slice(0), null, !0);
},
setGutterMarker: hn(function(o, l, c) {
return _a(this, o, "gutter", function(f) {
var v = f.gutterMarkers || (f.gutterMarkers = {});
return v[l] = c, !c && pt(v) && (f.gutterMarkers = null), !0;
});
}),
clearGutter: hn(function(o) {
var l = this;
this.iter(function(c) {
c.gutterMarkers && c.gutterMarkers[o] && _a(l, c, "gutter", function() {
return c.gutterMarkers[o] = null, pt(c.gutterMarkers) && (c.gutterMarkers = null), !0;
});
});
}),
lineInfo: function(o) {
var l;
if (typeof o == "number") {
if (!oe(this, o) || (l = o, o = ut(this, o), !o))
return null;
} else if (l = Ft(o), l == null)
return null;
return {
line: l,
handle: o,
text: o.text,
gutterMarkers: o.gutterMarkers,
textClass: o.textClass,
bgClass: o.bgClass,
wrapClass: o.wrapClass,
widgets: o.widgets
};
},
addLineClass: hn(function(o, l, c) {
return _a(this, o, l == "gutter" ? "gutter" : "class", function(f) {
var v = l == "text" ? "textClass" : l == "background" ? "bgClass" : l == "gutter" ? "gutterClass" : "wrapClass";
if (!f[v])
f[v] = c;
else {
if ($(c).test(f[v]))
return !1;
f[v] += " " + c;
}
return !0;
});
}),
removeLineClass: hn(function(o, l, c) {
return _a(this, o, l == "gutter" ? "gutter" : "class", function(f) {
var v = l == "text" ? "textClass" : l == "background" ? "bgClass" : l == "gutter" ? "gutterClass" : "wrapClass", R = f[v];
if (R)
if (c == null)
f[v] = null;
else {
var L = R.match($(c));
if (!L)
return !1;
var j = L.index + L[0].length;
f[v] = R.slice(0, L.index) + (!L.index || j == R.length ? "" : " ") + R.slice(j) || null;
}
else
return !1;
return !0;
});
}),
addLineWidget: hn(function(o, l, c) {
return F1(this, o, l, c);
}),
removeLineWidget: function(o) {
o.clear();
},
markText: function(o, l, c) {
return go(this, bt(this, o), bt(this, l), c, c && c.type || "range");
},
setBookmark: function(o, l) {
var c = {
replacedWith: l && (l.nodeType == null ? l.widget : l),
insertLeft: l && l.insertLeft,
clearWhenEmpty: !1,
shared: l && l.shared,
handleMouseEvents: l && l.handleMouseEvents
};
return o = bt(this, o), go(this, o, o, c, "bookmark");
},
findMarksAt: function(o) {
o = bt(this, o);
var l = [], c = ut(this, o.line).markedSpans;
if (c)
for (var f = 0; f < c.length; ++f) {
var v = c[f];
(v.from == null || v.from <= o.ch) && (v.to == null || v.to >= o.ch) && l.push(v.marker.parent || v.marker);
}
return l;
},
findMarks: function(o, l, c) {
o = bt(this, o), l = bt(this, l);
var f = [], v = o.line;
return this.iter(o.line, l.line + 1, function(R) {
var L = R.markedSpans;
if (L)
for (var j = 0; j < L.length; j++) {
var Q = L[j];
!(Q.to != null && v == o.line && o.ch >= Q.to || Q.from == null && v != o.line || Q.from != null && v == l.line && Q.from >= l.ch) && (!c || c(Q.marker)) && f.push(Q.marker.parent || Q.marker);
}
++v;
}), f;
},
getAllMarks: function() {
var o = [];
return this.iter(function(l) {
var c = l.markedSpans;
if (c)
for (var f = 0; f < c.length; ++f)
c[f].from != null && o.push(c[f].marker);
}), o;
},
posFromIndex: function(o) {
var l, c = this.first, f = this.lineSeparator().length;
return this.iter(function(v) {
var R = v.text.length + f;
if (R > o)
return l = o, !0;
o -= R, ++c;
}), bt(this, ge(c, l));
},
indexFromPos: function(o) {
o = bt(this, o);
var l = o.ch;
if (o.line < this.first || o.ch < 0)
return 0;
var c = this.lineSeparator().length;
return this.iter(this.first, o.line, function(f) {
l += f.text.length + c;
}), l;
},
copy: function(o) {
var l = new Ln(
io(this, this.first, this.first + this.size),
this.modeOption,
this.first,
this.lineSep,
this.direction
);
return l.scrollTop = this.scrollTop, l.scrollLeft = this.scrollLeft, l.sel = this.sel, l.extend = !1, o && (l.history.undoDepth = this.history.undoDepth, l.setHistory(this.getHistory())), l;
},
linkedDoc: function(o) {
o || (o = {});
var l = this.first, c = this.first + this.size;
o.from != null && o.from > l && (l = o.from), o.to != null && o.to < c && (c = o.to);
var f = new Ln(io(this, l, c), o.mode || this.modeOption, l, this.lineSep, this.direction);
return o.sharedHist && (f.history = this.history), (this.linked || (this.linked = [])).push({ doc: f, sharedHist: o.sharedHist }), f.linked = [{ doc: this, isParent: !0, sharedHist: o.sharedHist }], P1(f, om(this)), f;
},
unlinkDoc: function(o) {
if (o instanceof Ht && (o = o.doc), this.linked)
for (var l = 0; l < this.linked.length; ++l) {
var c = this.linked[l];
if (c.doc == o) {
this.linked.splice(l, 1), o.unlinkDoc(this), L1(om(this));
break;
}
}
if (o.history == this.history) {
var f = [o.id];
gr(o, function(v) {
return f.push(v.id);
}, !0), o.history = new Ml(null), o.history.done = po(this.history.done, f), o.history.undone = po(this.history.undone, f);
}
},
iterLinkedDocs: function(o) {
gr(this, o);
},
getMode: function() {
return this.mode;
},
getEditor: function() {
return this.cm;
},
splitLines: function(o) {
return this.lineSep ? o.split(this.lineSep) : ia(o);
},
lineSeparator: function() {
return this.lineSep || `
`;
},
setDirection: hn(function(o) {
o != "rtl" && (o = "ltr"), o != this.direction && (this.direction = o, this.iter(function(l) {
return l.order = null;
}), this.cm && x1(this.cm));
})
}), Ln.prototype.eachLine = Ln.prototype.iter;
var am = 0;
function B1(o) {
var l = this;
if (lm(l), !(Ct(l, o) || Qi(l.display, o))) {
It(o), d && (am = +new Date());
var c = $r(l, o, !0), f = o.dataTransfer.files;
if (!(!c || l.isReadOnly()))
if (f && f.length && window.FileReader && window.File)
for (var v = f.length, R = Array(v), L = 0, j = function() {
++L == v && pn(l, function() {
c = bt(l.doc, c);
var Ce = {
from: c,
to: c,
text: l.doc.splitLines(
R.filter(function(Ie) {
return Ie != null;
}).join(l.doc.lineSeparator())
),
origin: "paste"
};
mo(l.doc, Ce), Wh(l.doc, mr(bt(l.doc, c), bt(l.doc, vr(Ce))));
})();
}, Q = function(Ce, Ie) {
if (l.options.allowDropFileTypes && he(l.options.allowDropFileTypes, Ce.type) == -1) {
j();
return;
}
var Ne = new FileReader();
Ne.onerror = function() {
return j();
}, Ne.onload = function() {
var Ue = Ne.result;
if (/[\x00-\x08\x0e-\x1f]{2}/.test(Ue)) {
j();
return;
}
R[Ie] = Ue, j();
}, Ne.readAsText(Ce);
}, te = 0; te < f.length; te++)
Q(f[te], te);
else {
if (l.state.draggingText && l.doc.sel.contains(c) > -1) {
l.state.draggingText(o), setTimeout(function() {
return l.display.input.focus();
}, 20);
return;
}
try {
var se = o.dataTransfer.getData("Text");
if (se) {
var de;
if (l.state.draggingText && !l.state.draggingText.copy && (de = l.listSelections()), Nl(l.doc, mr(c, c)), de)
for (var Ee = 0; Ee < de.length; ++Ee)
vo(l.doc, "", de[Ee].anchor, de[Ee].head, "drag");
l.replaceSelection(se, "around", "paste"), l.display.input.focus();
}
} catch {
}
}
}
}
function V1(o, l) {
if (d && (!o.state.draggingText || +new Date() - am < 100)) {
vi(l);
return;
}
if (!(Ct(o, l) || Qi(o.display, l)) && (l.dataTransfer.setData("Text", o.getSelection()), l.dataTransfer.effectAllowed = "copyMove", l.dataTransfer.setDragImage && !A)) {
var c = I("img", null, null, "position: fixed; left: 0; top: 0;");
c.src = "data:image/gif;base64,R0lGODlhAQABAAAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==", b && (c.width = c.height = 1, o.display.wrapper.appendChild(c), c._top = c.offsetTop), l.dataTransfer.setDragImage(c, 0, 0), b && c.parentNode.removeChild(c);
}
}
function j1(o, l) {
var c = $r(o, l);
if (!!c) {
var f = document.createDocumentFragment();
Wu(o, c, f), o.display.dragCursor || (o.display.dragCursor = I("div", null, "CodeMirror-cursors CodeMirror-dragcursors"), o.display.lineSpace.insertBefore(o.display.dragCursor, o.display.cursorDiv)), H(o.display.dragCursor, f);
}
}
function lm(o) {
o.display.dragCursor && (o.display.lineSpace.removeChild(o.display.dragCursor), o.display.dragCursor = null);
}
function sm(o) {
if (!!document.getElementsByClassName) {
for (var l = document.getElementsByClassName("CodeMirror"), c = [], f = 0; f < l.length; f++) {
var v = l[f].CodeMirror;
v && c.push(v);
}
c.length && c[0].operation(function() {
for (var R = 0; R < c.length; R++)
o(c[R]);
});
}
}
var um = !1;
function U1() {
um || (z1(), um = !0);
}
function z1() {
var o;
Re(window, "resize", function() {
o == null && (o = setTimeout(function() {
o = null, sm(H1);
}, 100));
}), Re(window, "blur", function() {
return sm(uo);
});
}
function H1(o) {
var l = o.display;
l.cachedCharWidth = l.cachedTextHeight = l.cachedPaddingH = null, l.scrollbarsClipped = !1, o.setSize();
}
for (var br = {
3: "Pause",
8: "Backspace",
9: "Tab",
13: "Enter",
16: "Shift",
17: "Ctrl",
18: "Alt",
19: "Pause",
20: "CapsLock",
27: "Esc",
32: "Space",
33: "PageUp",
34: "PageDown",
35: "End",
36: "Home",
37: "Left",
38: "Up",
39: "Right",
40: "Down",
44: "PrintScrn",
45: "Insert",
46: "Delete",
59: ";",
61: "=",
91: "Mod",
92: "Mod",
93: "Mod",
106: "*",
107: "=",
109: "-",
110: ".",
111: "/",
145: "ScrollLock",
173: "-",
186: ";",
187: "=",
188: ",",
189: "-",
190: ".",
191: "/",
192: "`",
219: "[",
220: "\\",
221: "]",
222: "'",
224: "Mod",
63232: "Up",
63233: "Down",
63234: "Left",
63235: "Right",
63272: "Delete",
63273: "Home",
63275: "End",
63276: "PageUp",
63277: "PageDown",
63302: "Insert"
}, Ea = 0; Ea < 10; Ea++)
br[Ea + 48] = br[Ea + 96] = String(Ea);
for (var jl = 65; jl <= 90; jl++)
br[jl] = String.fromCharCode(jl);
for (var xa = 1; xa <= 12; xa++)
br[xa + 111] = br[xa + 63235] = "F" + xa;
var Xi = {};
Xi.basic = {
Left: "goCharLeft",
Right: "goCharRight",
Up: "goLineUp",
Down: "goLineDown",
End: "goLineEnd",
Home: "goLineStartSmart",
PageUp: "goPageUp",
PageDown: "goPageDown",
Delete: "delCharAfter",
Backspace: "delCharBefore",
"Shift-Backspace": "delCharBefore",
Tab: "defaultTab",
"Shift-Tab": "indentAuto",
Enter: "newlineAndIndent",
Insert: "toggleOverwrite",
Esc: "singleSelection"
}, Xi.pcDefault = {
"Ctrl-A": "selectAll",
"Ctrl-D": "deleteLine",
"Ctrl-Z": "undo",
"Shift-Ctrl-Z": "redo",
"Ctrl-Y": "redo",
"Ctrl-Home": "goDocStart",
"Ctrl-End": "goDocEnd",
"Ctrl-Up": "goLineUp",
"Ctrl-Down": "goLineDown",
"Ctrl-Left": "goGroupLeft",
"Ctrl-Right": "goGroupRight",
"Alt-Left": "goLineStart",
"Alt-Right": "goLineEnd",
"Ctrl-Backspace": "delGroupBefore",
"Ctrl-Delete": "delGroupAfter",
"Ctrl-S": "save",
"Ctrl-F": "find",
"Ctrl-G": "findNext",
"Shift-Ctrl-G": "findPrev",
"Shift-Ctrl-F": "replace",
"Shift-Ctrl-R": "replaceAll",
"Ctrl-[": "indentLess",
"Ctrl-]": "indentMore",
"Ctrl-U": "undoSelection",
"Shift-Ctrl-U": "redoSelection",
"Alt-U": "redoSelection",
fallthrough: "basic"
}, Xi.emacsy = {
"Ctrl-F": "goCharRight",
"Ctrl-B": "goCharLeft",
"Ctrl-P": "goLineUp",
"Ctrl-N": "goLineDown",
"Ctrl-A": "goLineStart",
"Ctrl-E": "goLineEnd",
"Ctrl-V": "goPageDown",
"Shift-Ctrl-V": "goPageUp",
"Ctrl-D": "delCharAfter",
"Ctrl-H": "delCharBefore",
"Alt-Backspace": "delWordBefore",
"Ctrl-K": "killLine",
"Ctrl-T": "transposeChars",
"Ctrl-O": "openLine"
}, Xi.macDefault = {
"Cmd-A": "selectAll",
"Cmd-D": "deleteLine",
"Cmd-Z": "undo",
"Shift-Cmd-Z": "redo",
"Cmd-Y": "redo",
"Cmd-Home": "goDocStart",
"Cmd-Up": "goDocStart",
"Cmd-End": "goDocEnd",
"Cmd-Down": "goDocEnd",
"Alt-Left": "goGroupLeft",
"Alt-Right": "goGroupRight",
"Cmd-Left": "goLineLeft",
"Cmd-Right": "goLineRight",
"Alt-Backspace": "delGroupBefore",
"Ctrl-Alt-Backspace": "delGroupAfter",
"Alt-Delete": "delGroupAfter",
"Cmd-S": "save",
"Cmd-F": "find",
"Cmd-G": "findNext",
"Shift-Cmd-G": "findPrev",
"Cmd-Alt-F": "replace",
"Shift-Cmd-Alt-F": "replaceAll",
"Cmd-[": "indentLess",
"Cmd-]": "indentMore",
"Cmd-Backspace": "delWrappedLineLeft",
"Cmd-Delete": "delWrappedLineRight",
"Cmd-U": "undoSelection",
"Shift-Cmd-U": "redoSelection",
"Ctrl-Up": "goDocStart",
"Ctrl-Down": "goDocEnd",
fallthrough: ["basic", "emacsy"]
}, Xi.default = k ? Xi.macDefault : Xi.pcDefault;
function W1(o) {
var l = o.split(/-(?!$)/);
o = l[l.length - 1];
for (var c, f, v, R, L = 0; L < l.length - 1; L++) {
var j = l[L];
if (/^(cmd|meta|m)$/i.test(j))
R = !0;
else if (/^a(lt)?$/i.test(j))
c = !0;
else if (/^(c|ctrl|control)$/i.test(j))
f = !0;
else if (/^s(hift)?$/i.test(j))
v = !0;
else
throw new Error("Unrecognized modifier name: " + j);
}
return c && (o = "Alt-" + o), f && (o = "Ctrl-" + o), R && (o = "Cmd-" + o), v && (o = "Shift-" + o), o;
}
function G1(o) {
var l = {};
for (var c in o)
if (o.hasOwnProperty(c)) {
var f = o[c];
if (/^(name|fallthrough|(de|at)tach)$/.test(c))
continue;
if (f == "...") {
delete o[c];
continue;
}
for (var v = Fe(c.split(" "), W1), R = 0; R < v.length; R++) {
var L = void 0, j = void 0;
R == v.length - 1 ? (j = v.join(" "), L = f) : (j = v.slice(0, R + 1).join(" "), L = "...");
var Q = l[j];
if (!Q)
l[j] = L;
else if (Q != L)
throw new Error("Inconsistent bindings for " + j);
}
delete o[c];
}
for (var te in l)
o[te] = l[te];
return o;
}
function yo(o, l, c, f) {
l = Ul(l);
var v = l.call ? l.call(o, f) : l[o];
if (v === !1)
return "nothing";
if (v === "...")
return "multi";
if (v != null && c(v))
return "handled";
if (l.fallthrough) {
if (Object.prototype.toString.call(l.fallthrough) != "[object Array]")
return yo(o, l.fallthrough, c, f);
for (var R = 0; R < l.fallthrough.length; R++) {
var L = yo(o, l.fallthrough[R], c, f);
if (L)
return L;
}
}
}
function dm(o) {
var l = typeof o == "string" ? o : br[o.keyCode];
return l == "Ctrl" || l == "Alt" || l == "Shift" || l == "Mod";
}
function fm(o, l, c) {
var f = o;
return l.altKey && f != "Alt" && (o = "Alt-" + o), (B ? l.metaKey : l.ctrlKey) && f != "Ctrl" && (o = "Ctrl-" + o), (B ? l.ctrlKey : l.metaKey) && f != "Mod" && (o = "Cmd-" + o), !c && l.shiftKey && f != "Shift" && (o = "Shift-" + o), o;
}
function cm(o, l) {
if (b && o.keyCode == 34 && o.char)
return !1;
var c = br[o.keyCode];
return c == null || o.altGraphKey ? !1 : (o.keyCode == 3 && o.code && (c = o.code), fm(c, o, l));
}
function Ul(o) {
return typeof o == "string" ? Xi[o] : o;
}
function bo(o, l) {
for (var c = o.doc.sel.ranges, f = [], v = 0; v < c.length; v++) {
for (var R = l(c[v]); f.length && $e(R.from, Ae(f).to) <= 0; ) {
var L = f.pop();
if ($e(L.from, R.from) < 0) {
R.from = L.from;
break;
}
}
f.push(R);
}
Hn(o, function() {
for (var j = f.length - 1; j >= 0; j--)
vo(o.doc, "", f[j].from, f[j].to, "+delete");
fo(o);
});
}
function sd(o, l, c) {
var f = at(o.text, l + c, c);
return f < 0 || f > o.text.length ? null : f;
}
function ud(o, l, c) {
var f = sd(o, l.ch, c);
return f == null ? null : new ge(l.line, f, c < 0 ? "after" : "before");
}
function dd(o, l, c, f, v) {
if (o) {
l.doc.direction == "rtl" && (v = -v);
var R = ht(c, l.doc.direction);
if (R) {
var L = v < 0 ? Ae(R) : R[0], j = v < 0 == (L.level == 1), Q = j ? "after" : "before", te;
if (L.level > 0 || l.doc.direction == "rtl") {
var se = ao(l, c);
te = v < 0 ? c.text.length - 1 : 0;
var de = $i(l, se, te).top;
te = He(function(Ee) {
return $i(l, se, Ee).top == de;
}, v < 0 == (L.level == 1) ? L.from : L.to - 1, te), Q == "before" && (te = sd(c, te, 1));
} else
te = v < 0 ? L.to : L.from;
return new ge(f, te, Q);
}
}
return new ge(f, v < 0 ? c.text.length : 0, v < 0 ? "before" : "after");
}
function K1(o, l, c, f) {
var v = ht(l, o.doc.direction);
if (!v)
return ud(l, c, f);
c.ch >= l.text.length ? (c.ch = l.text.length, c.sticky = "before") : c.ch <= 0 && (c.ch = 0, c.sticky = "after");
var R = Be(v, c.ch, c.sticky), L = v[R];
if (o.doc.direction == "ltr" && L.level % 2 == 0 && (f > 0 ? L.to > c.ch : L.from < c.ch))
return ud(l, c, f);
var j = function(Ye, nt) {
return sd(l, Ye instanceof ge ? Ye.ch : Ye, nt);
}, Q, te = function(Ye) {
return o.options.lineWrapping ? (Q = Q || ao(o, l), gh(o, l, Q, Ye)) : { begin: 0, end: l.text.length };
}, se = te(c.sticky == "before" ? j(c, -1) : c.ch);
if (o.doc.direction == "rtl" || L.level == 1) {
var de = L.level == 1 == f < 0, Ee = j(c, de ? 1 : -1);
if (Ee != null && (de ? Ee <= L.to && Ee <= se.end : Ee >= L.from && Ee >= se.begin)) {
var Ce = de ? "before" : "after";
return new ge(c.line, Ee, Ce);
}
}
var Ie = function(Ye, nt, Qe) {
for (var ot = function(Bt, mn) {
return mn ? new ge(c.line, j(Bt, 1), "before") : new ge(c.line, Bt, "after");
}; Ye >= 0 && Ye < v.length; Ye += nt) {
var mt = v[Ye], ct = nt > 0 == (mt.level != 1), Et = ct ? Qe.begin : j(Qe.end, -1);
if (mt.from <= Et && Et < mt.to || (Et = ct ? mt.from : j(mt.to, -1), Qe.begin <= Et && Et < Qe.end))
return ot(Et, ct);
}
}, Ne = Ie(R + f, f, se);
if (Ne)
return Ne;
var Ue = f > 0 ? se.end : j(se.begin, -1);
return Ue != null && !(f > 0 && Ue == l.text.length) && (Ne = Ie(f > 0 ? 0 : v.length - 1, f, te(Ue)), Ne) ? Ne : null;
}
var Ta = {
selectAll: Jh,
singleSelection: function(o) {
return o.setSelection(o.getCursor("anchor"), o.getCursor("head"), O);
},
killLine: function(o) {
return bo(o, function(l) {
if (l.empty()) {
var c = ut(o.doc, l.head.line).text.length;
return l.head.ch == c && l.head.line < o.lastLine() ? { from: l.head, to: ge(l.head.line + 1, 0) } : { from: l.head, to: ge(l.head.line, c) };
} else
return { from: l.from(), to: l.to() };
});
},
deleteLine: function(o) {
return bo(o, function(l) {
return {
from: ge(l.from().line, 0),
to: bt(o.doc, ge(l.to().line + 1, 0))
};
});
},
delLineLeft: function(o) {
return bo(o, function(l) {
return {
from: ge(l.from().line, 0),
to: l.from()
};
});
},
delWrappedLineLeft: function(o) {
return bo(o, function(l) {
var c = o.charCoords(l.head, "div").top + 5, f = o.coordsChar({ left: 0, top: c }, "div");
return { from: f, to: l.from() };
});
},
delWrappedLineRight: function(o) {
return bo(o, function(l) {
var c = o.charCoords(l.head, "div").top + 5, f = o.coordsChar({ left: o.display.lineDiv.offsetWidth + 100, top: c }, "div");
return { from: l.from(), to: f };
});
},
undo: function(o) {
return o.undo();
},
redo: function(o) {
return o.redo();
},
undoSelection: function(o) {
return o.undoSelection();
},
redoSelection: function(o) {
return o.redoSelection();
},
goDocStart: function(o) {
return o.extendSelection(ge(o.firstLine(), 0));
},
goDocEnd: function(o) {
return o.extendSelection(ge(o.lastLine()));
},
goLineStart: function(o) {
return o.extendSelectionsBy(
function(l) {
return pm(o, l.head.line);
},
{ origin: "+move", bias: 1 }
);
},
goLineStartSmart: function(o) {
return o.extendSelectionsBy(
function(l) {
return hm(o, l.head);
},
{ origin: "+move", bias: 1 }
);
},
goLineEnd: function(o) {
return o.extendSelectionsBy(
function(l) {
return Y1(o, l.head.line);
},
{ origin: "+move", bias: -1 }
);
},
goLineRight: function(o) {
return o.extendSelectionsBy(function(l) {
var c = o.cursorCoords(l.head, "div").top + 5;
return o.coordsChar({ left: o.display.lineDiv.offsetWidth + 100, top: c }, "div");
}, J);
},
goLineLeft: function(o) {
return o.extendSelectionsBy(function(l) {
var c = o.cursorCoords(l.head, "div").top + 5;
return o.coordsChar({ left: 0, top: c }, "div");
}, J);
},
goLineLeftSmart: function(o) {
return o.extendSelectionsBy(function(l) {
var c = o.cursorCoords(l.head, "div").top + 5, f = o.coordsChar({ left: 0, top: c }, "div");
return f.ch < o.getLine(f.line).search(/\S/) ? hm(o, l.head) : f;
}, J);
},
goLineUp: function(o) {
return o.moveV(-1, "line");
},
goLineDown: function(o) {
return o.moveV(1, "line");
},
goPageUp: function(o) {
return o.moveV(-1, "page");
},
goPageDown: function(o) {
return o.moveV(1, "page");
},
goCharLeft: function(o) {
return o.moveH(-1, "char");
},
goCharRight: function(o) {
return o.moveH(1, "char");
},
goColumnLeft: function(o) {
return o.moveH(-1, "column");
},
goColumnRight: function(o) {
return o.moveH(1, "column");
},
goWordLeft: function(o) {
return o.moveH(-1, "word");
},
goGroupRight: function(o) {
return o.moveH(1, "group");
},
goGroupLeft: function(o) {
return o.moveH(-1, "group");
},
goWordRight: function(o) {
return o.moveH(1, "word");
},
delCharBefore: function(o) {
return o.deleteH(-1, "codepoint");
},
delCharAfter: function(o) {
return o.deleteH(1, "char");
},
delWordBefore: function(o) {
return o.deleteH(-1, "word");
},
delWordAfter: function(o) {
return o.deleteH(1, "word");
},
delGroupBefore: function(o) {
return o.deleteH(-1, "group");
},
delGroupAfter: function(o) {
return o.deleteH(1, "group");
},
indentAuto: function(o) {
return o.indentSelection("smart");
},
indentMore: function(o) {
return o.indentSelection("add");
},
indentLess: function(o) {
return o.indentSelection("subtract");
},
insertTab: function(o) {
return o.replaceSelection(" ");
},
insertSoftTab: function(o) {
for (var l = [], c = o.listSelections(), f = o.options.tabSize, v = 0; v < c.length; v++) {
var R = c[v].from(), L = me(o.getLine(R.line), R.ch, f);
l.push(fe(f - L % f));
}
o.replaceSelections(l);
},
defaultTab: function(o) {
o.somethingSelected() ? o.indentSelection("add") : o.execCommand("insertTab");
},
transposeChars: function(o) {
return Hn(o, function() {
for (var l = o.listSelections(), c = [], f = 0; f < l.length; f++)
if (!!l[f].empty()) {
var v = l[f].head, R = ut(o.doc, v.line).text;
if (R) {
if (v.ch == R.length && (v = new ge(v.line, v.ch - 1)), v.ch > 0)
v = new ge(v.line, v.ch + 1), o.replaceRange(
R.charAt(v.ch - 1) + R.charAt(v.ch - 2),
ge(v.line, v.ch - 2),
v,
"+transpose"
);
else if (v.line > o.doc.first) {
var L = ut(o.doc, v.line - 1).text;
L && (v = new ge(v.line, 1), o.replaceRange(
R.charAt(0) + o.doc.lineSeparator() + L.charAt(L.length - 1),
ge(v.line - 1, L.length - 1),
v,
"+transpose"
));
}
}
c.push(new Mt(v, v));
}
o.setSelections(c);
});
},
newlineAndIndent: function(o) {
return Hn(o, function() {
for (var l = o.listSelections(), c = l.length - 1; c >= 0; c--)
o.replaceRange(o.doc.lineSeparator(), l[c].anchor, l[c].head, "+input");
l = o.listSelections();
for (var f = 0; f < l.length; f++)
o.indentLine(l[f].from().line, null, !0);
fo(o);
});
},
openLine: function(o) {
return o.replaceSelection(`
`, "start");
},
toggleOverwrite: function(o) {
return o.toggleOverwrite();
}
};
function pm(o, l) {
var c = ut(o.doc, l), f = yi(c);
return f != c && (l = Ft(f)), dd(!0, o, f, l, 1);
}
function Y1(o, l) {
var c = ut(o.doc, l), f = Db(c);
return f != c && (l = Ft(f)), dd(!0, o, c, l, -1);
}
function hm(o, l) {
var c = pm(o, l.line), f = ut(o.doc, c.line), v = ht(f, o.doc.direction);
if (!v || v[0].level == 0) {
var R = Math.max(c.ch, f.text.search(/\S/)), L = l.line == c.line && l.ch <= R && l.ch;
return ge(c.line, L ? 0 : R, c.sticky);
}
return c;
}
function zl(o, l, c) {
if (typeof l == "string" && (l = Ta[l], !l))
return !1;
o.display.input.ensurePolled();
var f = o.display.shift, v = !1;
try {
o.isReadOnly() && (o.state.suppressEdits = !0), c && (o.display.shift = !1), v = l(o) != xe;
} finally {
o.display.shift = f, o.state.suppressEdits = !1;
}
return v;
}
function Q1(o, l, c) {
for (var f = 0; f < o.state.keyMaps.length; f++) {
var v = yo(l, o.state.keyMaps[f], c, o);
if (v)
return v;
}
return o.options.extraKeys && yo(l, o.options.extraKeys, c, o) || yo(l, o.options.keyMap, c, o);
}
var J1 = new we();
function ka(o, l, c, f) {
var v = o.state.keySeq;
if (v) {
if (dm(l))
return "handled";
if (/\'$/.test(l) ? o.state.keySeq = null : J1.set(50, function() {
o.state.keySeq == v && (o.state.keySeq = null, o.display.input.reset());
}), mm(o, v + " " + l, c, f))
return !0;
}
return mm(o, l, c, f);
}
function mm(o, l, c, f) {
var v = Q1(o, l, f);
return v == "multi" && (o.state.keySeq = l), v == "handled" && cn(o, "keyHandled", o, l, c), (v == "handled" || v == "multi") && (It(c), Gu(o)), !!v;
}
function vm(o, l) {
var c = cm(l, !0);
return c ? l.shiftKey && !o.state.keySeq ? ka(o, "Shift-" + c, l, function(f) {
return zl(o, f, !0);
}) || ka(o, c, l, function(f) {
if (typeof f == "string" ? /^go[A-Z]/.test(f) : f.motion)
return zl(o, f);
}) : ka(o, c, l, function(f) {
return zl(o, f);
}) : !1;
}
function X1(o, l, c) {
return ka(o, "'" + c + "'", l, function(f) {
return zl(o, f, !0);
});
}
var fd = null;
function gm(o) {
var l = this;
if (!(o.target && o.target != l.display.input.getField()) && (l.curOp.focus = q(ee(l)), !Ct(l, o))) {
d && h < 11 && o.keyCode == 27 && (o.returnValue = !1);
var c = o.keyCode;
l.display.shift = c == 16 || o.shiftKey;
var f = vm(l, o);
b && (fd = f ? c : null, !f && c == 88 && !Ti && (k ? o.metaKey : o.ctrlKey) && l.replaceSelection("", null, "cut")), n && !k && !f && c == 46 && o.shiftKey && !o.ctrlKey && document.execCommand && document.execCommand("cut"), c == 18 && !/\bCodeMirror-crosshair\b/.test(l.display.lineDiv.className) && Z1(l);
}
}
function Z1(o) {
var l = o.display.lineDiv;
X(l, "CodeMirror-crosshair");
function c(f) {
(f.keyCode == 18 || !f.altKey) && (V(l, "CodeMirror-crosshair"), lt(document, "keyup", c), lt(document, "mouseover", c));
}
Re(document, "keyup", c), Re(document, "mouseover", c);
}
function ym(o) {
o.keyCode == 16 && (this.doc.sel.shift = !1), Ct(this, o);
}
function bm(o) {
var l = this;
if (!(o.target && o.target != l.display.input.getField()) && !(Qi(l.display, o) || Ct(l, o) || o.ctrlKey && !o.altKey || k && o.metaKey)) {
var c = o.keyCode, f = o.charCode;
if (b && c == fd) {
fd = null, It(o);
return;
}
if (!(b && (!o.which || o.which < 10) && vm(l, o))) {
var v = String.fromCharCode(f == null ? c : f);
v != "\b" && (X1(l, o, v) || l.display.input.onKeyPress(o));
}
}
}
var q1 = 400, cd = function(o, l, c) {
this.time = o, this.pos = l, this.button = c;
};
cd.prototype.compare = function(o, l, c) {
return this.time + q1 > o && $e(l, this.pos) == 0 && c == this.button;
};
var Oa, Ra;
function e_(o, l) {
var c = +new Date();
return Ra && Ra.compare(c, o, l) ? (Oa = Ra = null, "triple") : Oa && Oa.compare(c, o, l) ? (Ra = new cd(c, o, l), Oa = null, "double") : (Oa = new cd(c, o, l), Ra = null, "single");
}
function _m(o) {
var l = this, c = l.display;
if (!(Ct(l, o) || c.activeTouch && c.input.supportsTouch())) {
if (c.input.ensurePolled(), c.shift = o.shiftKey, Qi(c, o)) {
p || (c.scroller.draggable = !1, setTimeout(function() {
return c.scroller.draggable = !0;
}, 100));
return;
}
if (!pd(l, o)) {
var f = $r(l, o), v = na(o), R = f ? e_(f, v) : "single";
pe(l).focus(), v == 1 && l.state.selectingText && l.state.selectingText(o), !(f && t_(l, v, f, R, o)) && (v == 1 ? f ? i_(l, f, R, o) : Mn(o) == c.scroller && It(o) : v == 2 ? (f && Ll(l.doc, f), setTimeout(function() {
return c.input.focus();
}, 20)) : v == 3 && (T ? l.display.input.onContextMenu(o) : Ku(l)));
}
}
}
function t_(o, l, c, f, v) {
var R = "Click";
return f == "double" ? R = "Double" + R : f == "triple" && (R = "Triple" + R), R = (l == 1 ? "Left" : l == 2 ? "Middle" : "Right") + R, ka(o, fm(R, v), v, function(L) {
if (typeof L == "string" && (L = Ta[L]), !L)
return !1;
var j = !1;
try {
o.isReadOnly() && (o.state.suppressEdits = !0), j = L(o, c) != xe;
} finally {
o.state.suppressEdits = !1;
}
return j;
});
}
function n_(o, l, c) {
var f = o.getOption("configureMouse"), v = f ? f(o, l, c) : {};
if (v.unit == null) {
var R = D ? c.shiftKey && c.metaKey : c.altKey;
v.unit = R ? "rectangle" : l == "single" ? "char" : l == "double" ? "word" : "line";
}
return (v.extend == null || o.doc.extend) && (v.extend = o.doc.extend || c.shiftKey), v.addNew == null && (v.addNew = k ? c.metaKey : c.ctrlKey), v.moveOnDrag == null && (v.moveOnDrag = !(k ? c.altKey : c.ctrlKey)), v;
}
function i_(o, l, c, f) {
d ? setTimeout(Te(wh, o), 0) : o.curOp.focus = q(ee(o));
var v = n_(o, c, f), R = o.doc.sel, L;
o.options.dragDrop && Eu && !o.isReadOnly() && c == "single" && (L = R.contains(l)) > -1 && ($e((L = R.ranges[L]).from(), l) < 0 || l.xRel > 0) && ($e(L.to(), l) > 0 || l.xRel < 0) ? r_(o, f, l, v) : o_(o, f, l, v);
}
function r_(o, l, c, f) {
var v = o.display, R = !1, L = pn(o, function(te) {
p && (v.scroller.draggable = !1), o.state.draggingText = !1, o.state.delayingBlurEvent && (o.hasFocus() ? o.state.delayingBlurEvent = !1 : Ku(o)), lt(v.wrapper.ownerDocument, "mouseup", L), lt(v.wrapper.ownerDocument, "mousemove", j), lt(v.scroller, "dragstart", Q), lt(v.scroller, "drop", L), R || (It(te), f.addNew || Ll(o.doc, c, null, null, f.extend), p && !A || d && h == 9 ? setTimeout(function() {
v.wrapper.ownerDocument.body.focus({ preventScroll: !0 }), v.input.focus();
}, 20) : v.input.focus());
}), j = function(te) {
R = R || Math.abs(l.clientX - te.clientX) + Math.abs(l.clientY - te.clientY) >= 10;
}, Q = function() {
return R = !0;
};
p && (v.scroller.draggable = !0), o.state.draggingText = L, L.copy = !f.moveOnDrag, Re(v.wrapper.ownerDocument, "mouseup", L), Re(v.wrapper.ownerDocument, "mousemove", j), Re(v.scroller, "dragstart", Q), Re(v.scroller, "drop", L), o.state.delayingBlurEvent = !0, setTimeout(function() {
return v.input.focus();
}, 20), v.scroller.dragDrop && v.scroller.dragDrop();
}
function wm(o, l, c) {
if (c == "char")
return new Mt(l, l);
if (c == "word")
return o.findWordAt(l);
if (c == "line")
return new Mt(ge(l.line, 0), bt(o.doc, ge(l.line + 1, 0)));
var f = c(o, l);
return new Mt(f.from, f.to);
}
function o_(o, l, c, f) {
d && Ku(o);
var v = o.display, R = o.doc;
It(l);
var L, j, Q = R.sel, te = Q.ranges;
if (f.addNew && !f.extend ? (j = R.sel.contains(c), j > -1 ? L = te[j] : L = new Mt(c, c)) : (L = R.sel.primary(), j = R.sel.primIndex), f.unit == "rectangle")
f.addNew || (L = new Mt(c, c)), c = $r(o, l, !0, !0), j = -1;
else {
var se = wm(o, c, f.unit);
f.extend ? L = ad(L, se.anchor, se.head, f.extend) : L = se;
}
f.addNew ? j == -1 ? (j = te.length, Cn(
R,
_i(o, te.concat([L]), j),
{ scroll: !1, origin: "*mouse" }
)) : te.length > 1 && te[j].empty() && f.unit == "char" && !f.extend ? (Cn(
R,
_i(o, te.slice(0, j).concat(te.slice(j + 1)), 0),
{ scroll: !1, origin: "*mouse" }
), Q = R.sel) : ld(R, j, L, K) : (j = 0, Cn(R, new qn([L], 0), K), Q = R.sel);
var de = c;
function Ee(Qe) {
if ($e(de, Qe) != 0)
if (de = Qe, f.unit == "rectangle") {
for (var ot = [], mt = o.options.tabSize, ct = me(ut(R, c.line).text, c.ch, mt), Et = me(ut(R, Qe.line).text, Qe.ch, mt), Bt = Math.min(ct, Et), mn = Math.max(ct, Et), Kt = Math.min(c.line, Qe.line), Wn = Math.min(o.lastLine(), Math.max(c.line, Qe.line)); Kt <= Wn; Kt++) {
var Nn = ut(R, Kt).text, rn = ne(Nn, Bt, mt);
Bt == mn ? ot.push(new Mt(ge(Kt, rn), ge(Kt, rn))) : Nn.length > rn && ot.push(new Mt(ge(Kt, rn), ge(Kt, ne(Nn, mn, mt))));
}
ot.length || ot.push(new Mt(c, c)), Cn(
R,
_i(o, Q.ranges.slice(0, j).concat(ot), j),
{ origin: "*mouse", scroll: !1 }
), o.scrollIntoView(Qe);
} else {
var Bn = L, bn = wm(o, Qe, f.unit), ln = Bn.anchor, on;
$e(bn.anchor, ln) > 0 ? (on = bn.head, ln = an(Bn.from(), bn.anchor)) : (on = bn.anchor, ln = Dt(Bn.to(), bn.head));
var Jt = Q.ranges.slice(0);
Jt[j] = a_(o, new Mt(bt(R, ln), on)), Cn(R, _i(o, Jt, j), K);
}
}
var Ce = v.wrapper.getBoundingClientRect(), Ie = 0;
function Ne(Qe) {
var ot = ++Ie, mt = $r(o, Qe, !0, f.unit == "rectangle");
if (!!mt)
if ($e(mt, de) != 0) {
o.curOp.focus = q(ee(o)), Ee(mt);
var ct = Dl(v, R);
(mt.line >= ct.to || mt.line < ct.from) && setTimeout(pn(o, function() {
Ie == ot && Ne(Qe);
}), 150);
} else {
var Et = Qe.clientY < Ce.top ? -20 : Qe.clientY > Ce.bottom ? 20 : 0;
Et && setTimeout(pn(o, function() {
Ie == ot && (v.scroller.scrollTop += Et, Ne(Qe));
}), 50);
}
}
function Ue(Qe) {
o.state.selectingText = !1, Ie = 1 / 0, Qe && (It(Qe), v.input.focus()), lt(v.wrapper.ownerDocument, "mousemove", Ye), lt(v.wrapper.ownerDocument, "mouseup", nt), R.history.lastSelOrigin = null;
}
var Ye = pn(o, function(Qe) {
Qe.buttons === 0 || !na(Qe) ? Ue(Qe) : Ne(Qe);
}), nt = pn(o, Ue);
o.state.selectingText = nt, Re(v.wrapper.ownerDocument, "mousemove", Ye), Re(v.wrapper.ownerDocument, "mouseup", nt);
}
function a_(o, l) {
var c = l.anchor, f = l.head, v = ut(o.doc, c.line);
if ($e(c, f) == 0 && c.sticky == f.sticky)
return l;
var R = ht(v);
if (!R)
return l;
var L = Be(R, c.ch, c.sticky), j = R[L];
if (j.from != c.ch && j.to != c.ch)
return l;
var Q = L + (j.from == c.ch == (j.level != 1) ? 0 : 1);
if (Q == 0 || Q == R.length)
return l;
var te;
if (f.line != c.line)
te = (f.line - c.line) * (o.doc.direction == "ltr" ? 1 : -1) > 0;
else {
var se = Be(R, f.ch, f.sticky), de = se - L || (f.ch - c.ch) * (j.level == 1 ? -1 : 1);
se == Q - 1 || se == Q ? te = de < 0 : te = de > 0;
}
var Ee = R[Q + (te ? -1 : 0)], Ce = te == (Ee.level == 1), Ie = Ce ? Ee.from : Ee.to, Ne = Ce ? "after" : "before";
return c.ch == Ie && c.sticky == Ne ? l : new Mt(new ge(c.line, Ie, Ne), f);
}
function Am(o, l, c, f) {
var v, R;
if (l.touches)
v = l.touches[0].clientX, R = l.touches[0].clientY;
else
try {
v = l.clientX, R = l.clientY;
} catch {
return !1;
}
if (v >= Math.floor(o.display.gutters.getBoundingClientRect().right))
return !1;
f && It(l);
var L = o.display, j = L.lineDiv.getBoundingClientRect();
if (R > j.bottom || !Gt(o, c))
return lr(l);
R -= j.top - L.viewOffset;
for (var Q = 0; Q < o.display.gutterSpecs.length; ++Q) {
var te = L.gutters.childNodes[Q];
if (te && te.getBoundingClientRect().right >= v) {
var se = Oi(o.doc, R), de = o.display.gutterSpecs[Q];
return st(o, c, o, se, de.className, l), lr(l);
}
}
}
function pd(o, l) {
return Am(o, l, "gutterClick", !0);
}
function Cm(o, l) {
Qi(o.display, l) || l_(o, l) || Ct(o, l, "contextmenu") || T || o.display.input.onContextMenu(l);
}
function l_(o, l) {
return Gt(o, "gutterContextMenu") ? Am(o, l, "gutterContextMenu", !1) : !1;
}
function Sm(o) {
o.display.wrapper.className = o.display.wrapper.className.replace(/\s*cm-s-\S+/g, "") + o.options.theme.replace(/(^|\s)\s*/g, " cm-s-"), da(o);
}
var _o = { toString: function() {
return "CodeMirror.Init";
} }, Em = {}, Hl = {};
function s_(o) {
var l = o.optionHandlers;
function c(f, v, R, L) {
o.defaults[f] = v, R && (l[f] = L ? function(j, Q, te) {
te != _o && R(j, Q, te);
} : R);
}
o.defineOption = c, o.Init = _o, c("value", "", function(f, v) {
return f.setValue(v);
}, !0), c("mode", null, function(f, v) {
f.doc.modeOption = v, id(f);
}, !0), c("indentUnit", 2, id, !0), c("indentWithTabs", !1), c("smartIndent", !0), c("tabSize", 4, function(f) {
ya(f), da(f), Pn(f);
}, !0), c("lineSeparator", null, function(f, v) {
if (f.doc.lineSep = v, !!v) {
var R = [], L = f.doc.first;
f.doc.iter(function(Q) {
for (var te = 0; ; ) {
var se = Q.text.indexOf(v, te);
if (se == -1)
break;
te = se + v.length, R.push(ge(L, se));
}
L++;
});
for (var j = R.length - 1; j >= 0; j--)
vo(f.doc, v, R[j], ge(R[j].line, R[j].ch + v.length));
}
}), c("specialChars", /[\u0000-\u001f\u007f-\u009f\u00ad\u061c\u200b\u200e\u200f\u2028\u2029\ufeff\ufff9-\ufffc]/g, function(f, v, R) {
f.state.specialChars = new RegExp(v.source + (v.test(" ") ? "" : "| "), "g"), R != _o && f.refresh();
}), c("specialCharPlaceholder", Lb, function(f) {
return f.refresh();
}, !0), c("electricChars", !0), c("inputStyle", x ? "contenteditable" : "textarea", function() {
throw new Error("inputStyle can not (yet) be changed in a running editor");
}, !0), c("spellcheck", !1, function(f, v) {
return f.getInputField().spellcheck = v;
}, !0), c("autocorrect", !1, function(f, v) {
return f.getInputField().autocorrect = v;
}, !0), c("autocapitalize", !1, function(f, v) {
return f.getInputField().autocapitalize = v;
}, !0), c("rtlMoveVisually", !P), c("wholeLineUpdateBefore", !0), c("theme", "default", function(f) {
Sm(f), ga(f);
}, !0), c("keyMap", "default", function(f, v, R) {
var L = Ul(v), j = R != _o && Ul(R);
j && j.detach && j.detach(f, L), L.attach && L.attach(f, j || null);
}), c("extraKeys", null), c("configureMouse", null), c("lineWrapping", !1, d_, !0), c("gutters", [], function(f, v) {
f.display.gutterSpecs = td(v, f.options.lineNumbers), ga(f);
}, !0), c("fixedGutter", !0, function(f, v) {
f.display.gutters.style.left = v ? zu(f.display) + "px" : "0", f.refresh();
}, !0), c("coverGutterNextToScrollbar", !1, function(f) {
return co(f);
}, !0), c("scrollbarStyle", "native", function(f) {
Th(f), co(f), f.display.scrollbars.setScrollTop(f.doc.scrollTop), f.display.scrollbars.setScrollLeft(f.doc.scrollLeft);
}, !0), c("lineNumbers", !1, function(f, v) {
f.display.gutterSpecs = td(f.options.gutters, v), ga(f);
}, !0), c("firstLineNumber", 1, ga, !0), c("lineNumberFormatter", function(f) {
return f;
}, ga, !0), c("showCursorWhenSelecting", !1, fa, !0), c("resetSelectionOnContextMenu", !0), c("lineWiseCopyCut", !0), c("pasteLinesPerSelection", !0), c("selectionsMayTouch", !1), c("readOnly", !1, function(f, v) {
v == "nocursor" && (uo(f), f.display.input.blur()), f.display.input.readOnlyChanged(v);
}), c("screenReaderLabel", null, function(f, v) {
v = v === "" ? null : v, f.display.input.screenReaderLabelChanged(v);
}), c("disableInput", !1, function(f, v) {
v || f.display.input.reset();
}, !0), c("dragDrop", !0, u_), c("allowDropFileTypes", null), c("cursorBlinkRate", 530), c("cursorScrollMargin", 0), c("cursorHeight", 1, fa, !0), c("singleCursorHeightPerLine", !0, fa, !0), c("workTime", 100), c("workDelay", 100), c("flattenSpans", !0, ya, !0), c("addModeClass", !1, ya, !0), c("pollInterval", 100), c("undoDepth", 200, function(f, v) {
return f.doc.history.undoDepth = v;
}), c("historyEventDelay", 1250), c("viewportMargin", 10, function(f) {
return f.refresh();
}, !0), c("maxHighlightLength", 1e4, ya, !0), c("moveInputWithCursor", !0, function(f, v) {
v || f.display.input.resetPosition();
}), c("tabindex", null, function(f, v) {
return f.display.input.getField().tabIndex = v || "";
}), c("autofocus", null), c("direction", "ltr", function(f, v) {
return f.doc.setDirection(v);
}, !0), c("phrases", null);
}
function u_(o, l, c) {
var f = c && c != _o;
if (!l != !f) {
var v = o.display.dragFunctions, R = l ? Re : lt;
R(o.display.scroller, "dragstart", v.start), R(o.display.scroller, "dragenter", v.enter), R(o.display.scroller, "dragover", v.over), R(o.display.scroller, "dragleave", v.leave), R(o.display.scroller, "drop", v.drop);
}
}
function d_(o) {
o.options.lineWrapping ? (X(o.display.wrapper, "CodeMirror-wrap"), o.display.sizer.style.minWidth = "", o.display.sizerWidth = null) : (V(o.display.wrapper, "CodeMirror-wrap"), Iu(o)), Hu(o), Pn(o), da(o), setTimeout(function() {
return co(o);
}, 100);
}
function Ht(o, l) {
var c = this;
if (!(this instanceof Ht))
return new Ht(o, l);
this.options = l = l ? ve(l) : {}, ve(Em, l, !1);
var f = l.value;
typeof f == "string" ? f = new Ln(f, l.mode, null, l.lineSeparator, l.direction) : l.mode && (f.modeOption = l.mode), this.doc = f;
var v = new Ht.inputStyles[l.inputStyle](this), R = this.display = new C1(o, f, v, l);
R.wrapper.CodeMirror = this, Sm(this), l.lineWrapping && (this.display.wrapper.className += " CodeMirror-wrap"), Th(this), this.state = {
keyMaps: [],
overlays: [],
modeGen: 0,
overwrite: !1,
delayingBlurEvent: !1,
focused: !1,
suppressEdits: !1,
pasteIncoming: -1,
cutIncoming: -1,
selectingText: !1,
draggingText: !1,
highlight: new we(),
keySeq: null,
specialChars: null
}, l.autofocus && !x && R.input.focus(), d && h < 11 && setTimeout(function() {
return c.display.input.reset(!0);
}, 20), f_(this), U1(), Pr(this), this.curOp.forceUpdate = !0, Lh(this, f), l.autofocus && !x || this.hasFocus() ? setTimeout(function() {
c.hasFocus() && !c.state.focused && Yu(c);
}, 20) : uo(this);
for (var L in Hl)
Hl.hasOwnProperty(L) && Hl[L](this, l[L], _o);
Rh(this), l.finishInit && l.finishInit(this);
for (var j = 0; j < hd.length; ++j)
hd[j](this);
Lr(this), p && l.lineWrapping && getComputedStyle(R.lineDiv).textRendering == "optimizelegibility" && (R.lineDiv.style.textRendering = "auto");
}
Ht.defaults = Em, Ht.optionHandlers = Hl;
function f_(o) {
var l = o.display;
Re(l.scroller, "mousedown", pn(o, _m)), d && h < 11 ? Re(l.scroller, "dblclick", pn(o, function(Q) {
if (!Ct(o, Q)) {
var te = $r(o, Q);
if (!(!te || pd(o, Q) || Qi(o.display, Q))) {
It(Q);
var se = o.findWordAt(te);
Ll(o.doc, se.anchor, se.head);
}
}
})) : Re(l.scroller, "dblclick", function(Q) {
return Ct(o, Q) || It(Q);
}), Re(l.scroller, "contextmenu", function(Q) {
return Cm(o, Q);
}), Re(l.input.getField(), "contextmenu", function(Q) {
l.scroller.contains(Q.target) || Cm(o, Q);
});
var c, f = { end: 0 };
function v() {
l.activeTouch && (c = setTimeout(function() {
return l.activeTouch = null;
}, 1e3), f = l.activeTouch, f.end = +new Date());
}
function R(Q) {
if (Q.touches.length != 1)
return !1;
var te = Q.touches[0];
return te.radiusX <= 1 && te.radiusY <= 1;
}
function L(Q, te) {
if (te.left == null)
return !0;
var se = te.left - Q.left, de = te.top - Q.top;
return se * se + de * de > 20 * 20;
}
Re(l.scroller, "touchstart", function(Q) {
if (!Ct(o, Q) && !R(Q) && !pd(o, Q)) {
l.input.ensurePolled(), clearTimeout(c);
var te = +new Date();
l.activeTouch = {
start: te,
moved: !1,
prev: te - f.end <= 300 ? f : null
}, Q.touches.length == 1 && (l.activeTouch.left = Q.touches[0].pageX, l.activeTouch.top = Q.touches[0].pageY);
}
}), Re(l.scroller, "touchmove", function() {
l.activeTouch && (l.activeTouch.moved = !0);
}), Re(l.scroller, "touchend", function(Q) {
var te = l.activeTouch;
if (te && !Qi(l, Q) && te.left != null && !te.moved && new Date() - te.start < 300) {
var se = o.coordsChar(l.activeTouch, "page"), de;
!te.prev || L(te, te.prev) ? de = new Mt(se, se) : !te.prev.prev || L(te, te.prev.prev) ? de = o.findWordAt(se) : de = new Mt(ge(se.line, 0), bt(o.doc, ge(se.line + 1, 0))), o.setSelection(de.anchor, de.head), o.focus(), It(Q);
}
v();
}), Re(l.scroller, "touchcancel", v), Re(l.scroller, "scroll", function() {
l.scroller.clientHeight && (pa(o, l.scroller.scrollTop), Fr(o, l.scroller.scrollLeft, !0), st(o, "scroll", o));
}), Re(l.scroller, "mousewheel", function(Q) {
return Ih(o, Q);
}), Re(l.scroller, "DOMMouseScroll", function(Q) {
return Ih(o, Q);
}), Re(l.wrapper, "scroll", function() {
return l.wrapper.scrollTop = l.wrapper.scrollLeft = 0;
}), l.dragFunctions = {
enter: function(Q) {
Ct(o, Q) || vi(Q);
},
over: function(Q) {
Ct(o, Q) || (j1(o, Q), vi(Q));
},
start: function(Q) {
return V1(o, Q);
},
drop: pn(o, B1),
leave: function(Q) {
Ct(o, Q) || lm(o);
}
};
var j = l.input.getField();
Re(j, "keyup", function(Q) {
return ym.call(o, Q);
}), Re(j, "keydown", pn(o, gm)), Re(j, "keypress", pn(o, bm)), Re(j, "focus", function(Q) {
return Yu(o, Q);
}), Re(j, "blur", function(Q) {
return uo(o, Q);
});
}
var hd = [];
Ht.defineInitHook = function(o) {
return hd.push(o);
};
function Da(o, l, c, f) {
var v = o.doc, R;
c == null && (c = "add"), c == "smart" && (v.mode.indent ? R = oa(o, l).state : c = "prev");
var L = o.options.tabSize, j = ut(v, l), Q = me(j.text, null, L);
j.stateAfter && (j.stateAfter = null);
var te = j.text.match(/^\s*/)[0], se;
if (!f && !/\S/.test(j.text))
se = 0, c = "not";
else if (c == "smart" && (se = v.mode.indent(R, j.text.slice(te.length), j.text), se == xe || se > 150)) {
if (!f)
return;
c = "prev";
}
c == "prev" ? l > v.first ? se = me(ut(v, l - 1).text, null, L) : se = 0 : c == "add" ? se = Q + o.options.indentUnit : c == "subtract" ? se = Q - o.options.indentUnit : typeof c == "number" && (se = Q + c), se = Math.max(0, se);
var de = "", Ee = 0;
if (o.options.indentWithTabs)
for (var Ce = Math.floor(se / L); Ce; --Ce)
Ee += L, de += " ";
if (Ee < se && (de += fe(se - Ee)), de != te)
return vo(v, de, ge(l, 0), ge(l, te.length), "+input"), j.stateAfter = null, !0;
for (var Ie = 0; Ie < v.sel.ranges.length; Ie++) {
var Ne = v.sel.ranges[Ie];
if (Ne.head.line == l && Ne.head.ch < te.length) {
var Ue = ge(l, te.length);
ld(v, Ie, new Mt(Ue, Ue));
break;
}
}
}
var wi = null;
function Wl(o) {
wi = o;
}
function md(o, l, c, f, v) {
var R = o.doc;
o.display.shift = !1, f || (f = R.sel);
var L = +new Date() - 200, j = v == "paste" || o.state.pasteIncoming > L, Q = ia(l), te = null;
if (j && f.ranges.length > 1)
if (wi && wi.text.join(`
`) == l) {
if (f.ranges.length % wi.text.length == 0) {
te = [];
for (var se = 0; se < wi.text.length; se++)
te.push(R.splitLines(wi.text[se]));
}
} else
Q.length == f.ranges.length && o.options.pasteLinesPerSelection && (te = Fe(Q, function(Ye) {
return [Ye];
}));
for (var de = o.curOp.updateInput, Ee = f.ranges.length - 1; Ee >= 0; Ee--) {
var Ce = f.ranges[Ee], Ie = Ce.from(), Ne = Ce.to();
Ce.empty() && (c && c > 0 ? Ie = ge(Ie.line, Ie.ch - c) : o.state.overwrite && !j ? Ne = ge(Ne.line, Math.min(ut(R, Ne.line).text.length, Ne.ch + Ae(Q).length)) : j && wi && wi.lineWise && wi.text.join(`
`) == Q.join(`
`) && (Ie = Ne = ge(Ie.line, 0)));
var Ue = {
from: Ie,
to: Ne,
text: te ? te[Ee % te.length] : Q,
origin: v || (j ? "paste" : o.state.cutIncoming > L ? "cut" : "+input")
};
mo(o.doc, Ue), cn(o, "inputRead", o, Ue);
}
l && !j && Tm(o, l), fo(o), o.curOp.updateInput < 2 && (o.curOp.updateInput = de), o.curOp.typing = !0, o.state.pasteIncoming = o.state.cutIncoming = -1;
}
function xm(o, l) {
var c = o.clipboardData && o.clipboardData.getData("Text");
if (c)
return o.preventDefault(), !l.isReadOnly() && !l.options.disableInput && l.hasFocus() && Hn(l, function() {
return md(l, c, 0, null, "paste");
}), !0;
}
function Tm(o, l) {
if (!(!o.options.electricChars || !o.options.smartIndent))
for (var c = o.doc.sel, f = c.ranges.length - 1; f >= 0; f--) {
var v = c.ranges[f];
if (!(v.head.ch > 100 || f && c.ranges[f - 1].head.line == v.head.line)) {
var R = o.getModeAt(v.head), L = !1;
if (R.electricChars) {
for (var j = 0; j < R.electricChars.length; j++)
if (l.indexOf(R.electricChars.charAt(j)) > -1) {
L = Da(o, v.head.line, "smart");
break;
}
} else
R.electricInput && R.electricInput.test(ut(o.doc, v.head.line).text.slice(0, v.head.ch)) && (L = Da(o, v.head.line, "smart"));
L && cn(o, "electricInput", o, v.head.line);
}
}
}
function km(o) {
for (var l = [], c = [], f = 0; f < o.doc.sel.ranges.length; f++) {
var v = o.doc.sel.ranges[f].head.line, R = { anchor: ge(v, 0), head: ge(v + 1, 0) };
c.push(R), l.push(o.getRange(R.anchor, R.head));
}
return { text: l, ranges: c };
}
function Om(o, l, c, f) {
o.setAttribute("autocorrect", c ? "" : "off"), o.setAttribute("autocapitalize", f ? "" : "off"), o.setAttribute("spellcheck", !!l);
}
function Rm() {
var o = I("textarea", null, null, "position: absolute; bottom: -1em; padding: 0; width: 1px; height: 1em; min-height: 1em; outline: none"), l = I("div", [o], null, "overflow: hidden; position: relative; width: 3px; height: 0px;");
return p ? o.style.width = "1000px" : o.setAttribute("wrap", "off"), y && (o.style.border = "1px solid black"), Om(o), l;
}
function c_(o) {
var l = o.optionHandlers, c = o.helpers = {};
o.prototype = {
constructor: o,
focus: function() {
pe(this).focus(), this.display.input.focus();
},
setOption: function(f, v) {
var R = this.options, L = R[f];
R[f] == v && f != "mode" || (R[f] = v, l.hasOwnProperty(f) && pn(this, l[f])(this, v, L), st(this, "optionChange", this, f));
},
getOption: function(f) {
return this.options[f];
},
getDoc: function() {
return this.doc;
},
addKeyMap: function(f, v) {
this.state.keyMaps[v ? "push" : "unshift"](Ul(f));
},
removeKeyMap: function(f) {
for (var v = this.state.keyMaps, R = 0; R < v.length; ++R)
if (v[R] == f || v[R].name == f)
return v.splice(R, 1), !0;
},
addOverlay: Tn(function(f, v) {
var R = f.token ? f : o.getMode(this.options, f);
if (R.startState)
throw new Error("Overlays may not be stateful.");
Xe(
this.state.overlays,
{
mode: R,
modeSpec: f,
opaque: v && v.opaque,
priority: v && v.priority || 0
},
function(L) {
return L.priority;
}
), this.state.modeGen++, Pn(this);
}),
removeOverlay: Tn(function(f) {
for (var v = this.state.overlays, R = 0; R < v.length; ++R) {
var L = v[R].modeSpec;
if (L == f || typeof f == "string" && L.name == f) {
v.splice(R, 1), this.state.modeGen++, Pn(this);
return;
}
}
}),
indentLine: Tn(function(f, v, R) {
typeof v != "string" && typeof v != "number" && (v == null ? v = this.options.smartIndent ? "smart" : "prev" : v = v ? "add" : "subtract"), oe(this.doc, f) && Da(this, f, v, R);
}),
indentSelection: Tn(function(f) {
for (var v = this.doc.sel.ranges, R = -1, L = 0; L < v.length; L++) {
var j = v[L];
if (j.empty())
j.head.line > R && (Da(this, j.head.line, f, !0), R = j.head.line, L == this.doc.sel.primIndex && fo(this));
else {
var Q = j.from(), te = j.to(), se = Math.max(R, Q.line);
R = Math.min(this.lastLine(), te.line - (te.ch ? 0 : 1)) + 1;
for (var de = se; de < R; ++de)
Da(this, de, f);
var Ee = this.doc.sel.ranges;
Q.ch == 0 && v.length == Ee.length && Ee[L].from().ch > 0 && ld(this.doc, L, new Mt(Q, Ee[L].to()), O);
}
}
}),
getTokenAt: function(f, v) {
return Bp(this, f, v);
},
getLineTokens: function(f, v) {
return Bp(this, ge(f), v, !0);
},
getTokenTypeAt: function(f) {
f = bt(this.doc, f);
var v = Pp(this, ut(this.doc, f.line)), R = 0, L = (v.length - 1) / 2, j = f.ch, Q;
if (j == 0)
Q = v[2];
else
for (; ; ) {
var te = R + L >> 1;
if ((te ? v[te * 2 - 1] : 0) >= j)
L = te;
else if (v[te * 2 + 1] < j)
R = te + 1;
else {
Q = v[te * 2 + 2];
break;
}
}
var se = Q ? Q.indexOf("overlay ") : -1;
return se < 0 ? Q : se == 0 ? null : Q.slice(0, se - 1);
},
getModeAt: function(f) {
var v = this.doc.mode;
return v.innerMode ? o.innerMode(v, this.getTokenAt(f).state).mode : v;
},
getHelper: function(f, v) {
return this.getHelpers(f, v)[0];
},
getHelpers: function(f, v) {
var R = [];
if (!c.hasOwnProperty(v))
return R;
var L = c[v], j = this.getModeAt(f);
if (typeof j[v] == "string")
L[j[v]] && R.push(L[j[v]]);
else if (j[v])
for (var Q = 0; Q < j[v].length; Q++) {
var te = L[j[v][Q]];
te && R.push(te);
}
else
j.helperType && L[j.helperType] ? R.push(L[j.helperType]) : L[j.name] && R.push(L[j.name]);
for (var se = 0; se < L._global.length; se++) {
var de = L._global[se];
de.pred(j, this) && he(R, de.val) == -1 && R.push(de.val);
}
return R;
},
getStateAfter: function(f, v) {
var R = this.doc;
return f = Zn(R, f == null ? R.first + R.size - 1 : f), oa(this, f + 1, v).state;
},
cursorCoords: function(f, v) {
var R, L = this.doc.sel.primary();
return f == null ? R = L.head : typeof f == "object" ? R = bt(this.doc, f) : R = f ? L.from() : L.to(), bi(this, R, v || "page");
},
charCoords: function(f, v) {
return Tl(this, bt(this.doc, f), v || "page");
},
coordsChar: function(f, v) {
return f = hh(this, f, v || "page"), Vu(this, f.left, f.top);
},
lineAtHeight: function(f, v) {
return f = hh(this, { top: f, left: 0 }, v || "page").top, Oi(this.doc, f + this.display.viewOffset);
},
heightAtLine: function(f, v, R) {
var L = !1, j;
if (typeof f == "number") {
var Q = this.doc.first + this.doc.size - 1;
f < this.doc.first ? f = this.doc.first : f > Q && (f = Q, L = !0), j = ut(this.doc, f);
} else
j = f;
return xl(this, j, { top: 0, left: 0 }, v || "page", R || L).top + (L ? this.doc.height - Yi(j) : 0);
},
defaultTextHeight: function() {
return lo(this.display);
},
defaultCharWidth: function() {
return so(this.display);
},
getViewport: function() {
return { from: this.display.viewFrom, to: this.display.viewTo };
},
addWidget: function(f, v, R, L, j) {
var Q = this.display;
f = bi(this, bt(this.doc, f));
var te = f.bottom, se = f.left;
if (v.style.position = "absolute", v.setAttribute("cm-ignore-events", "true"), this.display.input.setUneditable(v), Q.sizer.appendChild(v), L == "over")
te = f.top;
else if (L == "above" || L == "near") {
var de = Math.max(Q.wrapper.clientHeight, this.doc.height), Ee = Math.max(Q.sizer.clientWidth, Q.lineSpace.clientWidth);
(L == "above" || f.bottom + v.offsetHeight > de) && f.top > v.offsetHeight ? te = f.top - v.offsetHeight : f.bottom + v.offsetHeight <= de && (te = f.bottom), se + v.offsetWidth > Ee && (se = Ee - v.offsetWidth);
}
v.style.top = te + "px", v.style.left = v.style.right = "", j == "right" ? (se = Q.sizer.clientWidth - v.offsetWidth, v.style.right = "0px") : (j == "left" ? se = 0 : j == "middle" && (se = (Q.sizer.clientWidth - v.offsetWidth) / 2), v.style.left = se + "px"), R && u1(this, { left: se, top: te, right: se + v.offsetWidth, bottom: te + v.offsetHeight });
},
triggerOnKeyDown: Tn(gm),
triggerOnKeyPress: Tn(bm),
triggerOnKeyUp: ym,
triggerOnMouseDown: Tn(_m),
execCommand: function(f) {
if (Ta.hasOwnProperty(f))
return Ta[f].call(null, this);
},
triggerElectric: Tn(function(f) {
Tm(this, f);
}),
findPosH: function(f, v, R, L) {
var j = 1;
v < 0 && (j = -1, v = -v);
for (var Q = bt(this.doc, f), te = 0; te < v && (Q = vd(this.doc, Q, j, R, L), !Q.hitSide); ++te)
;
return Q;
},
moveH: Tn(function(f, v) {
var R = this;
this.extendSelectionsBy(function(L) {
return R.display.shift || R.doc.extend || L.empty() ? vd(R.doc, L.head, f, v, R.options.rtlMoveVisually) : f < 0 ? L.from() : L.to();
}, J);
}),
deleteH: Tn(function(f, v) {
var R = this.doc.sel, L = this.doc;
R.somethingSelected() ? L.replaceSelection("", null, "+delete") : bo(this, function(j) {
var Q = vd(L, j.head, f, v, !1);
return f < 0 ? { from: Q, to: j.head } : { from: j.head, to: Q };
});
}),
findPosV: function(f, v, R, L) {
var j = 1, Q = L;
v < 0 && (j = -1, v = -v);
for (var te = bt(this.doc, f), se = 0; se < v; ++se) {
var de = bi(this, te, "div");
if (Q == null ? Q = de.left : de.left = Q, te = Dm(this, de, j, R), te.hitSide)
break;
}
return te;
},
moveV: Tn(function(f, v) {
var R = this, L = this.doc, j = [], Q = !this.display.shift && !L.extend && L.sel.somethingSelected();
if (L.extendSelectionsBy(function(se) {
if (Q)
return f < 0 ? se.from() : se.to();
var de = bi(R, se.head, "div");
se.goalColumn != null && (de.left = se.goalColumn), j.push(de.left);
var Ee = Dm(R, de, f, v);
return v == "page" && se == L.sel.primary() && Ju(R, Tl(R, Ee, "div").top - de.top), Ee;
}, J), j.length)
for (var te = 0; te < L.sel.ranges.length; te++)
L.sel.ranges[te].goalColumn = j[te];
}),
findWordAt: function(f) {
var v = this.doc, R = ut(v, f.line).text, L = f.ch, j = f.ch;
if (R) {
var Q = this.getHelper(f, "wordChars");
(f.sticky == "before" || j == R.length) && L ? --L : ++j;
for (var te = R.charAt(L), se = it(te, Q) ? function(de) {
return it(de, Q);
} : /\s/.test(te) ? function(de) {
return /\s/.test(de);
} : function(de) {
return !/\s/.test(de) && !it(de);
}; L > 0 && se(R.charAt(L - 1)); )
--L;
for (; j < R.length && se(R.charAt(j)); )
++j;
}
return new Mt(ge(f.line, L), ge(f.line, j));
},
toggleOverwrite: function(f) {
f != null && f == this.state.overwrite || ((this.state.overwrite = !this.state.overwrite) ? X(this.display.cursorDiv, "CodeMirror-overwrite") : V(this.display.cursorDiv, "CodeMirror-overwrite"), st(this, "overwriteToggle", this, this.state.overwrite));
},
hasFocus: function() {
return this.display.input.getField() == q(ee(this));
},
isReadOnly: function() {
return !!(this.options.readOnly || this.doc.cantEdit);
},
scrollTo: Tn(function(f, v) {
ca(this, f, v);
}),
getScrollInfo: function() {
var f = this.display.scroller;
return {
left: f.scrollLeft,
top: f.scrollTop,
height: f.scrollHeight - Di(this) - this.display.barHeight,
width: f.scrollWidth - Di(this) - this.display.barWidth,
clientHeight: Pu(this),
clientWidth: Rr(this)
};
},
scrollIntoView: Tn(function(f, v) {
f == null ? (f = { from: this.doc.sel.primary().head, to: null }, v == null && (v = this.options.cursorScrollMargin)) : typeof f == "number" ? f = { from: ge(f, 0), to: null } : f.from == null && (f = { from: f, to: null }), f.to || (f.to = f.from), f.margin = v || 0, f.from.line != null ? d1(this, f) : Ch(this, f.from, f.to, f.margin);
}),
setSize: Tn(function(f, v) {
var R = this, L = function(Q) {
return typeof Q == "number" || /^\d+$/.test(String(Q)) ? Q + "px" : Q;
};
f != null && (this.display.wrapper.style.width = L(f)), v != null && (this.display.wrapper.style.height = L(v)), this.options.lineWrapping && fh(this);
var j = this.display.viewFrom;
this.doc.iter(j, this.display.viewTo, function(Q) {
if (Q.widgets) {
for (var te = 0; te < Q.widgets.length; te++)
if (Q.widgets[te].noHScroll) {
pr(R, j, "widget");
break;
}
}
++j;
}), this.curOp.forceUpdate = !0, st(this, "refresh", this);
}),
operation: function(f) {
return Hn(this, f);
},
startOperation: function() {
return Pr(this);
},
endOperation: function() {
return Lr(this);
},
refresh: Tn(function() {
var f = this.display.cachedTextHeight;
Pn(this), this.curOp.forceUpdate = !0, da(this), ca(this, this.doc.scrollLeft, this.doc.scrollTop), qu(this.display), (f == null || Math.abs(f - lo(this.display)) > 0.5 || this.options.lineWrapping) && Hu(this), st(this, "refresh", this);
}),
swapDoc: Tn(function(f) {
var v = this.doc;
return v.cm = null, this.state.selectingText && this.state.selectingText(), Lh(this, f), da(this), this.display.input.reset(), ca(this, f.scrollLeft, f.scrollTop), this.curOp.forceScroll = !0, cn(this, "swapDoc", this, v), v;
}),
phrase: function(f) {
var v = this.options.phrases;
return v && Object.prototype.hasOwnProperty.call(v, f) ? v[f] : f;
},
getInputField: function() {
return this.display.input.getField();
},
getWrapperElement: function() {
return this.display.wrapper;
},
getScrollerElement: function() {
return this.display.scroller;
},
getGutterElement: function() {
return this.display.gutters;
}
}, Ut(o), o.registerHelper = function(f, v, R) {
c.hasOwnProperty(f) || (c[f] = o[f] = { _global: [] }), c[f][v] = R;
}, o.registerGlobalHelper = function(f, v, R, L) {
o.registerHelper(f, v, L), c[f]._global.push({ pred: R, val: L });
};
}
function vd(o, l, c, f, v) {
var R = l, L = c, j = ut(o, l.line), Q = v && o.direction == "rtl" ? -c : c;
function te() {
var nt = l.line + Q;
return nt < o.first || nt >= o.first + o.size ? !1 : (l = new ge(nt, l.ch, l.sticky), j = ut(o, nt));
}
function se(nt) {
var Qe;
if (f == "codepoint") {
var ot = j.text.charCodeAt(l.ch + (c > 0 ? 0 : -1));
if (isNaN(ot))
Qe = null;
else {
var mt = c > 0 ? ot >= 55296 && ot < 56320 : ot >= 56320 && ot < 57343;
Qe = new ge(l.line, Math.max(0, Math.min(j.text.length, l.ch + c * (mt ? 2 : 1))), -c);
}
} else
v ? Qe = K1(o.cm, j, l, c) : Qe = ud(j, l, c);
if (Qe == null)
if (!nt && te())
l = dd(v, o.cm, j, l.line, Q);
else
return !1;
else
l = Qe;
return !0;
}
if (f == "char" || f == "codepoint")
se();
else if (f == "column")
se(!0);
else if (f == "word" || f == "group")
for (var de = null, Ee = f == "group", Ce = o.cm && o.cm.getHelper(l, "wordChars"), Ie = !0; !(c < 0 && !se(!Ie)); Ie = !1) {
var Ne = j.text.charAt(l.ch) || `
`, Ue = it(Ne, Ce) ? "w" : Ee && Ne == `
` ? "n" : !Ee || /\s/.test(Ne) ? null : "p";
if (Ee && !Ie && !Ue && (Ue = "s"), de && de != Ue) {
c < 0 && (c = 1, se(), l.sticky = "after");
break;
}
if (Ue && (de = Ue), c > 0 && !se(!Ie))
break;
}
var Ye = Bl(o, l, R, L, !0);
return yt(R, Ye) && (Ye.hitSide = !0), Ye;
}
function Dm(o, l, c, f) {
var v = o.doc, R = l.left, L;
if (f == "page") {
var j = Math.min(o.display.wrapper.clientHeight, pe(o).innerHeight || v(o).documentElement.clientHeight), Q = Math.max(j - 0.5 * lo(o.display), 3);
L = (c > 0 ? l.bottom : l.top) + c * Q;
} else
f == "line" && (L = c > 0 ? l.bottom + 3 : l.top - 3);
for (var te; te = Vu(o, R, L), !!te.outside; ) {
if (c < 0 ? L <= 0 : L >= v.height) {
te.hitSide = !0;
break;
}
L += c * 5;
}
return te;
}
var Lt = function(o) {
this.cm = o, this.lastAnchorNode = this.lastAnchorOffset = this.lastFocusNode = this.lastFocusOffset = null, this.polling = new we(), this.composing = null, this.gracePeriod = !1, this.readDOMTimeout = null;
};
Lt.prototype.init = function(o) {
var l = this, c = this, f = c.cm, v = c.div = o.lineDiv;
v.contentEditable = !0, Om(v, f.options.spellcheck, f.options.autocorrect, f.options.autocapitalize);
function R(j) {
for (var Q = j.target; Q; Q = Q.parentNode) {
if (Q == v)
return !0;
if (/\bCodeMirror-(?:line)?widget\b/.test(Q.className))
break;
}
return !1;
}
Re(v, "paste", function(j) {
!R(j) || Ct(f, j) || xm(j, f) || h <= 11 && setTimeout(pn(f, function() {
return l.updateFromDOM();
}), 20);
}), Re(v, "compositionstart", function(j) {
l.composing = { data: j.data, done: !1 };
}), Re(v, "compositionupdate", function(j) {
l.composing || (l.composing = { data: j.data, done: !1 });
}), Re(v, "compositionend", function(j) {
l.composing && (j.data != l.composing.data && l.readFromDOMSoon(), l.composing.done = !0);
}), Re(v, "touchstart", function() {
return c.forceCompositionEnd();
}), Re(v, "input", function() {
l.composing || l.readFromDOMSoon();
});
function L(j) {
if (!(!R(j) || Ct(f, j))) {
if (f.somethingSelected())
Wl({ lineWise: !1, text: f.getSelections() }), j.type == "cut" && f.replaceSelection("", null, "cut");
else if (f.options.lineWiseCopyCut) {
var Q = km(f);
Wl({ lineWise: !0, text: Q.text }), j.type == "cut" && f.operation(function() {
f.setSelections(Q.ranges, 0, O), f.replaceSelection("", null, "cut");
});
} else
return;
if (j.clipboardData) {
j.clipboardData.clearData();
var te = wi.text.join(`
`);
if (j.clipboardData.setData("Text", te), j.clipboardData.getData("Text") == te) {
j.preventDefault();
return;
}
}
var se = Rm(), de = se.firstChild;
f.display.lineSpace.insertBefore(se, f.display.lineSpace.firstChild), de.value = wi.text.join(`
`);
var Ee = q(v.ownerDocument);
ue(de), setTimeout(function() {
f.display.lineSpace.removeChild(se), Ee.focus(), Ee == v && c.showPrimarySelection();
}, 50);
}
}
Re(v, "copy", L), Re(v, "cut", L);
}, Lt.prototype.screenReaderLabelChanged = function(o) {
o ? this.div.setAttribute("aria-label", o) : this.div.removeAttribute("aria-label");
}, Lt.prototype.prepareSelection = function() {
var o = _h(this.cm, !1);
return o.focus = q(this.div.ownerDocument) == this.div, o;
}, Lt.prototype.showSelection = function(o, l) {
!o || !this.cm.display.view.length || ((o.focus || l) && this.showPrimarySelection(), this.showMultipleSelections(o));
}, Lt.prototype.getSelection = function() {
return this.cm.display.wrapper.ownerDocument.getSelection();
}, Lt.prototype.showPrimarySelection = function() {
var o = this.getSelection(), l = this.cm, c = l.doc.sel.primary(), f = c.from(), v = c.to();
if (l.display.viewTo == l.display.viewFrom || f.line >= l.display.viewTo || v.line < l.display.viewFrom) {
o.removeAllRanges();
return;
}
var R = Gl(l, o.anchorNode, o.anchorOffset), L = Gl(l, o.focusNode, o.focusOffset);
if (!(R && !R.bad && L && !L.bad && $e(an(R, L), f) == 0 && $e(Dt(R, L), v) == 0)) {
var j = l.display.view, Q = f.line >= l.display.viewFrom && $m(l, f) || { node: j[0].measure.map[2], offset: 0 }, te = v.line < l.display.viewTo && $m(l, v);
if (!te) {
var se = j[j.length - 1].measure, de = se.maps ? se.maps[se.maps.length - 1] : se.map;
te = { node: de[de.length - 1], offset: de[de.length - 2] - de[de.length - 3] };
}
if (!Q || !te) {
o.removeAllRanges();
return;
}
var Ee = o.rangeCount && o.getRangeAt(0), Ce;
try {
Ce = F(Q.node, Q.offset, te.offset, te.node);
} catch {
}
Ce && (!n && l.state.focused ? (o.collapse(Q.node, Q.offset), Ce.collapsed || (o.removeAllRanges(), o.addRange(Ce))) : (o.removeAllRanges(), o.addRange(Ce)), Ee && o.anchorNode == null ? o.addRange(Ee) : n && this.startGracePeriod()), this.rememberSelection();
}
}, Lt.prototype.startGracePeriod = function() {
var o = this;
clearTimeout(this.gracePeriod), this.gracePeriod = setTimeout(function() {
o.gracePeriod = !1, o.selectionChanged() && o.cm.operation(function() {
return o.cm.curOp.selectionChanged = !0;
});
}, 20);
}, Lt.prototype.showMultipleSelections = function(o) {
H(this.cm.display.cursorDiv, o.cursors), H(this.cm.display.selectionDiv, o.selection);
}, Lt.prototype.rememberSelection = function() {
var o = this.getSelection();
this.lastAnchorNode = o.anchorNode, this.lastAnchorOffset = o.anchorOffset, this.lastFocusNode = o.focusNode, this.lastFocusOffset = o.focusOffset;
}, Lt.prototype.selectionInEditor = function() {
var o = this.getSelection();
if (!o.rangeCount)
return !1;
var l = o.getRangeAt(0).commonAncestorContainer;
return C(this.div, l);
}, Lt.prototype.focus = function() {
this.cm.options.readOnly != "nocursor" && ((!this.selectionInEditor() || q(this.div.ownerDocument) != this.div) && this.showSelection(this.prepareSelection(), !0), this.div.focus());
}, Lt.prototype.blur = function() {
this.div.blur();
}, Lt.prototype.getField = function() {
return this.div;
}, Lt.prototype.supportsTouch = function() {
return !0;
}, Lt.prototype.receivedFocus = function() {
var o = this, l = this;
this.selectionInEditor() ? setTimeout(function() {
return o.pollSelection();
}, 20) : Hn(this.cm, function() {
return l.cm.curOp.selectionChanged = !0;
});
function c() {
l.cm.state.focused && (l.pollSelection(), l.polling.set(l.cm.options.pollInterval, c));
}
this.polling.set(this.cm.options.pollInterval, c);
}, Lt.prototype.selectionChanged = function() {
var o = this.getSelection();
return o.anchorNode != this.lastAnchorNode || o.anchorOffset != this.lastAnchorOffset || o.focusNode != this.lastFocusNode || o.focusOffset != this.lastFocusOffset;
}, Lt.prototype.pollSelection = function() {
if (!(this.readDOMTimeout != null || this.gracePeriod || !this.selectionChanged())) {
var o = this.getSelection(), l = this.cm;
if (E && _ && this.cm.display.gutterSpecs.length && p_(o.anchorNode)) {
this.cm.triggerOnKeyDown({ type: "keydown", keyCode: 8, preventDefault: Math.abs }), this.blur(), this.focus();
return;
}
if (!this.composing) {
this.rememberSelection();
var c = Gl(l, o.anchorNode, o.anchorOffset), f = Gl(l, o.focusNode, o.focusOffset);
c && f && Hn(l, function() {
Cn(l.doc, mr(c, f), O), (c.bad || f.bad) && (l.curOp.selectionChanged = !0);
});
}
}
}, Lt.prototype.pollContent = function() {
this.readDOMTimeout != null && (clearTimeout(this.readDOMTimeout), this.readDOMTimeout = null);
var o = this.cm, l = o.display, c = o.doc.sel.primary(), f = c.from(), v = c.to();
if (f.ch == 0 && f.line > o.firstLine() && (f = ge(f.line - 1, ut(o.doc, f.line - 1).length)), v.ch == ut(o.doc, v.line).text.length && v.line < o.lastLine() && (v = ge(v.line + 1, 0)), f.line < l.viewFrom || v.line > l.viewTo - 1)
return !1;
var R, L, j;
f.line == l.viewFrom || (R = Ir(o, f.line)) == 0 ? (L = Ft(l.view[0].line), j = l.view[0].node) : (L = Ft(l.view[R].line), j = l.view[R - 1].node.nextSibling);
var Q = Ir(o, v.line), te, se;
if (Q == l.view.length - 1 ? (te = l.viewTo - 1, se = l.lineDiv.lastChild) : (te = Ft(l.view[Q + 1].line) - 1, se = l.view[Q + 1].node.previousSibling), !j)
return !1;
for (var de = o.doc.splitLines(h_(o, j, se, L, te)), Ee = Gi(o.doc, ge(L, 0), ge(te, ut(o.doc, te).text.length)); de.length > 1 && Ee.length > 1; )
if (Ae(de) == Ae(Ee))
de.pop(), Ee.pop(), te--;
else if (de[0] == Ee[0])
de.shift(), Ee.shift(), L++;
else
break;
for (var Ce = 0, Ie = 0, Ne = de[0], Ue = Ee[0], Ye = Math.min(Ne.length, Ue.length); Ce < Ye && Ne.charCodeAt(Ce) == Ue.charCodeAt(Ce); )
++Ce;
for (var nt = Ae(de), Qe = Ae(Ee), ot = Math.min(
nt.length - (de.length == 1 ? Ce : 0),
Qe.length - (Ee.length == 1 ? Ce : 0)
); Ie < ot && nt.charCodeAt(nt.length - Ie - 1) == Qe.charCodeAt(Qe.length - Ie - 1); )
++Ie;
if (de.length == 1 && Ee.length == 1 && L == f.line)
for (; Ce && Ce > f.ch && nt.charCodeAt(nt.length - Ie - 1) == Qe.charCodeAt(Qe.length - Ie - 1); )
Ce--, Ie++;
de[de.length - 1] = nt.slice(0, nt.length - Ie).replace(/^\u200b+/, ""), de[0] = de[0].slice(Ce).replace(/\u200b+$/, "");
var mt = ge(L, Ce), ct = ge(te, Ee.length ? Ae(Ee).length - Ie : 0);
if (de.length > 1 || de[0] || $e(mt, ct))
return vo(o.doc, de, mt, ct, "+input"), !0;
}, Lt.prototype.ensurePolled = function() {
this.forceCompositionEnd();
}, Lt.prototype.reset = function() {
this.forceCompositionEnd();
}, Lt.prototype.forceCompositionEnd = function() {
!this.composing || (clearTimeout(this.readDOMTimeout), this.composing = null, this.updateFromDOM(), this.div.blur(), this.div.focus());
}, Lt.prototype.readFromDOMSoon = function() {
var o = this;
this.readDOMTimeout == null && (this.readDOMTimeout = setTimeout(function() {
if (o.readDOMTimeout = null, o.composing)
if (o.composing.done)
o.composing = null;
else
return;
o.updateFromDOM();
}, 80));
}, Lt.prototype.updateFromDOM = function() {
var o = this;
(this.cm.isReadOnly() || !this.pollContent()) && Hn(this.cm, function() {
return Pn(o.cm);
});
}, Lt.prototype.setUneditable = function(o) {
o.contentEditable = "false";
}, Lt.prototype.onKeyPress = function(o) {
o.charCode == 0 || this.composing || (o.preventDefault(), this.cm.isReadOnly() || pn(this.cm, md)(this.cm, String.fromCharCode(o.charCode == null ? o.keyCode : o.charCode), 0));
}, Lt.prototype.readOnlyChanged = function(o) {
this.div.contentEditable = String(o != "nocursor");
}, Lt.prototype.onContextMenu = function() {
}, Lt.prototype.resetPosition = function() {
}, Lt.prototype.needsContentAttribute = !0;
function $m(o, l) {
var c = Lu(o, l.line);
if (!c || c.hidden)
return null;
var f = ut(o.doc, l.line), v = ah(c, f, l.line), R = ht(f, o.doc.direction), L = "left";
if (R) {
var j = Be(R, l.ch);
L = j % 2 ? "right" : "left";
}
var Q = uh(v.map, l.ch, L);
return Q.offset = Q.collapse == "right" ? Q.end : Q.start, Q;
}
function p_(o) {
for (var l = o; l; l = l.parentNode)
if (/CodeMirror-gutter-wrapper/.test(l.className))
return !0;
return !1;
}
function wo(o, l) {
return l && (o.bad = !0), o;
}
function h_(o, l, c, f, v) {
var R = "", L = !1, j = o.doc.lineSeparator(), Q = !1;
function te(Ce) {
return function(Ie) {
return Ie.id == Ce;
};
}
function se() {
L && (R += j, Q && (R += j), L = Q = !1);
}
function de(Ce) {
Ce && (se(), R += Ce);
}
function Ee(Ce) {
if (Ce.nodeType == 1) {
var Ie = Ce.getAttribute("cm-text");
if (Ie) {
de(Ie);
return;
}
var Ne = Ce.getAttribute("cm-marker"), Ue;
if (Ne) {
var Ye = o.findMarks(ge(f, 0), ge(v + 1, 0), te(+Ne));
Ye.length && (Ue = Ye[0].find(0)) && de(Gi(o.doc, Ue.from, Ue.to).join(j));
return;
}
if (Ce.getAttribute("contenteditable") == "false")
return;
var nt = /^(pre|div|p|li|table|br)$/i.test(Ce.nodeName);
if (!/^br$/i.test(Ce.nodeName) && Ce.textContent.length == 0)
return;
nt && se();
for (var Qe = 0; Qe < Ce.childNodes.length; Qe++)
Ee(Ce.childNodes[Qe]);
/^(pre|p)$/i.test(Ce.nodeName) && (Q = !0), nt && (L = !0);
} else
Ce.nodeType == 3 && de(Ce.nodeValue.replace(/\u200b/g, "").replace(/\u00a0/g, " "));
}
for (; Ee(l), l != c; )
l = l.nextSibling, Q = !1;
return R;
}
function Gl(o, l, c) {
var f;
if (l == o.display.lineDiv) {
if (f = o.display.lineDiv.childNodes[c], !f)
return wo(o.clipPos(ge(o.display.viewTo - 1)), !0);
l = null, c = 0;
} else
for (f = l; ; f = f.parentNode) {
if (!f || f == o.display.lineDiv)
return null;
if (f.parentNode && f.parentNode == o.display.lineDiv)
break;
}
for (var v = 0; v < o.display.view.length; v++) {
var R = o.display.view[v];
if (R.node == f)
return m_(R, l, c);
}
}
function m_(o, l, c) {
var f = o.text.firstChild, v = !1;
if (!l || !C(f, l))
return wo(ge(Ft(o.line), 0), !0);
if (l == f && (v = !0, l = f.childNodes[c], c = 0, !l)) {
var R = o.rest ? Ae(o.rest) : o.line;
return wo(ge(Ft(R), R.text.length), v);
}
var L = l.nodeType == 3 ? l : null, j = l;
for (!L && l.childNodes.length == 1 && l.firstChild.nodeType == 3 && (L = l.firstChild, c && (c = L.nodeValue.length)); j.parentNode != f; )
j = j.parentNode;
var Q = o.measure, te = Q.maps;
function se(Ue, Ye, nt) {
for (var Qe = -1; Qe < (te ? te.length : 0); Qe++)
for (var ot = Qe < 0 ? Q.map : te[Qe], mt = 0; mt < ot.length; mt += 3) {
var ct = ot[mt + 2];
if (ct == Ue || ct == Ye) {
var Et = Ft(Qe < 0 ? o.line : o.rest[Qe]), Bt = ot[mt] + nt;
return (nt < 0 || ct != Ue) && (Bt = ot[mt + (nt ? 1 : 0)]), ge(Et, Bt);
}
}
}
var de = se(L, j, c);
if (de)
return wo(de, v);
for (var Ee = j.nextSibling, Ce = L ? L.nodeValue.length - c : 0; Ee; Ee = Ee.nextSibling) {
if (de = se(Ee, Ee.firstChild, 0), de)
return wo(ge(de.line, de.ch - Ce), v);
Ce += Ee.textContent.length;
}
for (var Ie = j.previousSibling, Ne = c; Ie; Ie = Ie.previousSibling) {
if (de = se(Ie, Ie.firstChild, -1), de)
return wo(ge(de.line, de.ch + Ne), v);
Ne += Ie.textContent.length;
}
}
var Zt = function(o) {
this.cm = o, this.prevInput = "", this.pollingFast = !1, this.polling = new we(), this.hasSelection = !1, this.composing = null;
};
Zt.prototype.init = function(o) {
var l = this, c = this, f = this.cm;
this.createField(o);
var v = this.textarea;
o.wrapper.insertBefore(this.wrapper, o.wrapper.firstChild), y && (v.style.width = "0px"), Re(v, "input", function() {
d && h >= 9 && l.hasSelection && (l.hasSelection = null), c.poll();
}), Re(v, "paste", function(L) {
Ct(f, L) || xm(L, f) || (f.state.pasteIncoming = +new Date(), c.fastPoll());
});
function R(L) {
if (!Ct(f, L)) {
if (f.somethingSelected())
Wl({ lineWise: !1, text: f.getSelections() });
else if (f.options.lineWiseCopyCut) {
var j = km(f);
Wl({ lineWise: !0, text: j.text }), L.type == "cut" ? f.setSelections(j.ranges, null, O) : (c.prevInput = "", v.value = j.text.join(`
`), ue(v));
} else
return;
L.type == "cut" && (f.state.cutIncoming = +new Date());
}
}
Re(v, "cut", R), Re(v, "copy", R), Re(o.scroller, "paste", function(L) {
if (!(Qi(o, L) || Ct(f, L))) {
if (!v.dispatchEvent) {
f.state.pasteIncoming = +new Date(), c.focus();
return;
}
var j = new Event("paste");
j.clipboardData = L.clipboardData, v.dispatchEvent(j);
}
}), Re(o.lineSpace, "selectstart", function(L) {
Qi(o, L) || It(L);
}), Re(v, "compositionstart", function() {
var L = f.getCursor("from");
c.composing && c.composing.range.clear(), c.composing = {
start: L,
range: f.markText(L, f.getCursor("to"), { className: "CodeMirror-composing" })
};
}), Re(v, "compositionend", function() {
c.composing && (c.poll(), c.composing.range.clear(), c.composing = null);
});
}, Zt.prototype.createField = function(o) {
this.wrapper = Rm(), this.textarea = this.wrapper.firstChild;
}, Zt.prototype.screenReaderLabelChanged = function(o) {
o ? this.textarea.setAttribute("aria-label", o) : this.textarea.removeAttribute("aria-label");
}, Zt.prototype.prepareSelection = function() {
var o = this.cm, l = o.display, c = o.doc, f = _h(o);
if (o.options.moveInputWithCursor) {
var v = bi(o, c.sel.primary().head, "div"), R = l.wrapper.getBoundingClientRect(), L = l.lineDiv.getBoundingClientRect();
f.teTop = Math.max(0, Math.min(
l.wrapper.clientHeight - 10,
v.top + L.top - R.top
)), f.teLeft = Math.max(0, Math.min(
l.wrapper.clientWidth - 10,
v.left + L.left - R.left
));
}
return f;
}, Zt.prototype.showSelection = function(o) {
var l = this.cm, c = l.display;
H(c.cursorDiv, o.cursors), H(c.selectionDiv, o.selection), o.teTop != null && (this.wrapper.style.top = o.teTop + "px", this.wrapper.style.left = o.teLeft + "px");
}, Zt.prototype.reset = function(o) {
if (!(this.contextMenuPending || this.composing)) {
var l = this.cm;
if (l.somethingSelected()) {
this.prevInput = "";
var c = l.getSelection();
this.textarea.value = c, l.state.focused && ue(this.textarea), d && h >= 9 && (this.hasSelection = c);
} else
o || (this.prevInput = this.textarea.value = "", d && h >= 9 && (this.hasSelection = null));
}
}, Zt.prototype.getField = function() {
return this.textarea;
}, Zt.prototype.supportsTouch = function() {
return !1;
}, Zt.prototype.focus = function() {
if (this.cm.options.readOnly != "nocursor" && (!x || q(this.textarea.ownerDocument) != this.textarea))
try {
this.textarea.focus();
} catch {
}
}, Zt.prototype.blur = function() {
this.textarea.blur();
}, Zt.prototype.resetPosition = function() {
this.wrapper.style.top = this.wrapper.style.left = 0;
}, Zt.prototype.receivedFocus = function() {
this.slowPoll();
}, Zt.prototype.slowPoll = function() {
var o = this;
this.pollingFast || this.polling.set(this.cm.options.pollInterval, function() {
o.poll(), o.cm.state.focused && o.slowPoll();
});
}, Zt.prototype.fastPoll = function() {
var o = !1, l = this;
l.pollingFast = !0;
function c() {
var f = l.poll();
!f && !o ? (o = !0, l.polling.set(60, c)) : (l.pollingFast = !1, l.slowPoll());
}
l.polling.set(20, c);
}, Zt.prototype.poll = function() {
var o = this, l = this.cm, c = this.textarea, f = this.prevInput;
if (this.contextMenuPending || !l.state.focused || sr(c) && !f && !this.composing || l.isReadOnly() || l.options.disableInput || l.state.keySeq)
return !1;
var v = c.value;
if (v == f && !l.somethingSelected())
return !1;
if (d && h >= 9 && this.hasSelection === v || k && /[\uf700-\uf7ff]/.test(v))
return l.display.input.reset(), !1;
if (l.doc.sel == l.display.selForContextMenu) {
var R = v.charCodeAt(0);
if (R == 8203 && !f && (f = "\u200B"), R == 8666)
return this.reset(), this.cm.execCommand("undo");
}
for (var L = 0, j = Math.min(f.length, v.length); L < j && f.charCodeAt(L) == v.charCodeAt(L); )
++L;
return Hn(l, function() {
md(
l,
v.slice(L),
f.length - L,
null,
o.composing ? "*compose" : null
), v.length > 1e3 || v.indexOf(`
`) > -1 ? c.value = o.prevInput = "" : o.prevInput = v, o.composing && (o.composing.range.clear(), o.composing.range = l.markText(
o.composing.start,
l.getCursor("to"),
{ className: "CodeMirror-composing" }
));
}), !0;
}, Zt.prototype.ensurePolled = function() {
this.pollingFast && this.poll() && (this.pollingFast = !1);
}, Zt.prototype.onKeyPress = function() {
d && h >= 9 && (this.hasSelection = null), this.fastPoll();
}, Zt.prototype.onContextMenu = function(o) {
var l = this, c = l.cm, f = c.display, v = l.textarea;
l.contextMenuPending && l.contextMenuPending();
var R = $r(c, o), L = f.scroller.scrollTop;
if (!R || b)
return;
var j = c.options.resetSelectionOnContextMenu;
j && c.doc.sel.contains(R) == -1 && pn(c, Cn)(c.doc, mr(R), O);
var Q = v.style.cssText, te = l.wrapper.style.cssText, se = l.wrapper.offsetParent.getBoundingClientRect();
l.wrapper.style.cssText = "position: static", v.style.cssText = `position: absolute; width: 30px; height: 30px;
top: ` + (o.clientY - se.top - 5) + "px; left: " + (o.clientX - se.left - 5) + `px;
z-index: 1000; background: ` + (d ? "rgba(255, 255, 255, .05)" : "transparent") + `;
outline: none; border-width: 0; outline: none; overflow: hidden; opacity: .05; filter: alpha(opacity=5);`;
var de;
p && (de = v.ownerDocument.defaultView.scrollY), f.input.focus(), p && v.ownerDocument.defaultView.scrollTo(null, de), f.input.reset(), c.somethingSelected() || (v.value = l.prevInput = " "), l.contextMenuPending = Ce, f.selForContextMenu = c.doc.sel, clearTimeout(f.detectingSelectAll);
function Ee() {
if (v.selectionStart != null) {
var Ne = c.somethingSelected(), Ue = "\u200B" + (Ne ? v.value : "");
v.value = "\u21DA", v.value = Ue, l.prevInput = Ne ? "" : "\u200B", v.selectionStart = 1, v.selectionEnd = Ue.length, f.selForContextMenu = c.doc.sel;
}
}
function Ce() {
if (l.contextMenuPending == Ce && (l.contextMenuPending = !1, l.wrapper.style.cssText = te, v.style.cssText = Q, d && h < 9 && f.scrollbars.setScrollTop(f.scroller.scrollTop = L), v.selectionStart != null)) {
(!d || d && h < 9) && Ee();
var Ne = 0, Ue = function() {
f.selForContextMenu == c.doc.sel && v.selectionStart == 0 && v.selectionEnd > 0 && l.prevInput == "\u200B" ? pn(c, Jh)(c) : Ne++ < 10 ? f.detectingSelectAll = setTimeout(Ue, 500) : (f.selForContextMenu = null, f.input.reset());
};
f.detectingSelectAll = setTimeout(Ue, 200);
}
}
if (d && h >= 9 && Ee(), T) {
vi(o);
var Ie = function() {
lt(window, "mouseup", Ie), setTimeout(Ce, 20);
};
Re(window, "mouseup", Ie);
} else
setTimeout(Ce, 50);
}, Zt.prototype.readOnlyChanged = function(o) {
o || this.reset(), this.textarea.disabled = o == "nocursor", this.textarea.readOnly = !!o;
}, Zt.prototype.setUneditable = function() {
}, Zt.prototype.needsContentAttribute = !1;
function v_(o, l) {
if (l = l ? ve(l) : {}, l.value = o.value, !l.tabindex && o.tabIndex && (l.tabindex = o.tabIndex), !l.placeholder && o.placeholder && (l.placeholder = o.placeholder), l.autofocus == null) {
var c = q(o.ownerDocument);
l.autofocus = c == o || o.getAttribute("autofocus") != null && c == document.body;
}
function f() {
o.value = j.getValue();
}
var v;
if (o.form && (Re(o.form, "submit", f), !l.leaveSubmitMethodAlone)) {
var R = o.form;
v = R.submit;
try {
var L = R.submit = function() {
f(), R.submit = v, R.submit(), R.submit = L;
};
} catch {
}
}
l.finishInit = function(Q) {
Q.save = f, Q.getTextArea = function() {
return o;
}, Q.toTextArea = function() {
Q.toTextArea = isNaN, f(), o.parentNode.removeChild(Q.getWrapperElement()), o.style.display = "", o.form && (lt(o.form, "submit", f), !l.leaveSubmitMethodAlone && typeof o.form.submit == "function" && (o.form.submit = v));
};
}, o.style.display = "none";
var j = Ht(
function(Q) {
return o.parentNode.insertBefore(Q, o.nextSibling);
},
l
);
return j;
}
function g_(o) {
o.off = lt, o.on = Re, o.wheelEventPixels = S1, o.Doc = Ln, o.splitLines = ia, o.countColumn = me, o.findColumn = ne, o.isWordChar = ke, o.Pass = xe, o.signal = st, o.Line = ro, o.changeEnd = vr, o.scrollbarModel = xh, o.Pos = ge, o.cmpPos = $e, o.modes = gi, o.mimeModes = ur, o.resolveMode = zn, o.getMode = Hi, o.modeExtensions = dr, o.extendMode = gl, o.copyState = Wi, o.startState = ra, o.innerMode = fr, o.commands = Ta, o.keyMap = Xi, o.keyName = cm, o.isModifierKey = dm, o.lookupKey = yo, o.normalizeKeyMap = G1, o.StringStream = Qt, o.SharedTextMarker = Sa, o.TextMarker = yr, o.LineWidget = Ca, o.e_preventDefault = It, o.e_stopPropagation = si, o.e_stop = vi, o.addClass = X, o.contains = C, o.rmClass = V, o.keyNames = br;
}
s_(Ht), c_(Ht);
var y_ = "iter insert remove copy getEditor constructor".split(" ");
for (var Kl in Ln.prototype)
Ln.prototype.hasOwnProperty(Kl) && he(y_, Kl) < 0 && (Ht.prototype[Kl] = function(o) {
return function() {
return o.apply(this.doc, arguments);
};
}(Ln.prototype[Kl]));
return Ut(Ln), Ht.inputStyles = { textarea: Zt, contenteditable: Lt }, Ht.defineMode = function(o) {
!Ht.defaults.mode && o != "null" && (Ht.defaults.mode = o), vl.apply(this, arguments);
}, Ht.defineMIME = no, Ht.defineMode("null", function() {
return { token: function(o) {
return o.skipToEnd();
} };
}), Ht.defineMIME("text/plain", "null"), Ht.defineExtension = function(o, l) {
Ht.prototype[o] = l;
}, Ht.defineDocExtension = function(o, l) {
Ln.prototype[o] = l;
}, Ht.fromTextArea = v_, g_(Ht), Ht.version = "6.65.7", Ht;
});
}(Ef)), Ef.exports;
}
var nr = Ko();
(function(e, t) {
(function(i) {
i(Ko());
})(function(i) {
i.defineMode("javascript", function(r, n) {
var a = r.indentUnit, s = n.statementIndent, u = n.jsonld, d = n.json || u, h = n.trackScope !== !1, p = n.typescript, g = n.wordCharacters || /[\w$\xa1-\uffff]/, _ = function() {
function oe(an) {
return { type: an, style: "keyword" };
}
var ce = oe("keyword a"), ge = oe("keyword b"), $e = oe("keyword c"), yt = oe("keyword d"), Ot = oe("operator"), Dt = { type: "atom", style: "atom" };
return {
if: oe("if"),
while: ce,
with: ce,
else: ge,
do: ge,
try: ge,
finally: ge,
return: yt,
break: yt,
continue: yt,
new: oe("new"),
delete: $e,
void: $e,
throw: $e,
debugger: oe("debugger"),
var: oe("var"),
const: oe("var"),
let: oe("var"),
function: oe("function"),
catch: oe("catch"),
for: oe("for"),
switch: oe("switch"),
case: oe("case"),
default: oe("default"),
in: Ot,
typeof: Ot,
instanceof: Ot,
true: Dt,
false: Dt,
null: Dt,
undefined: Dt,
NaN: Dt,
Infinity: Dt,
this: oe("this"),
class: oe("class"),
super: oe("atom"),
yield: $e,
export: oe("export"),
import: oe("import"),
extends: $e,
await: $e
};
}(), S = /[+\-*&%=<>!?|~^@]/, b = /^@(context|id|value|language|type|container|list|set|reverse|index|base|vocab|graph)"/;
function A(oe) {
for (var ce = !1, ge, $e = !1; (ge = oe.next()) != null; ) {
if (!ce) {
if (ge == "/" && !$e)
return;
ge == "[" ? $e = !0 : $e && ge == "]" && ($e = !1);
}
ce = !ce && ge == "\\";
}
}
var w, m;
function y(oe, ce, ge) {
return w = oe, m = ge, ce;
}
function E(oe, ce) {
var ge = oe.next();
if (ge == '"' || ge == "'")
return ce.tokenize = x(ge), ce.tokenize(oe, ce);
if (ge == "." && oe.match(/^\d[\d_]*(?:[eE][+\-]?[\d_]+)?/))
return y("number", "number");
if (ge == "." && oe.match(".."))
return y("spread", "meta");
if (/[\[\]{}\(\),;\:\.]/.test(ge))
return y(ge);
if (ge == "=" && oe.eat(">"))
return y("=>", "operator");
if (ge == "0" && oe.match(/^(?:x[\dA-Fa-f_]+|o[0-7_]+|b[01_]+)n?/))
return y("number", "number");
if (/\d/.test(ge))
return oe.match(/^[\d_]*(?:n|(?:\.[\d_]*)?(?:[eE][+\-]?[\d_]+)?)?/), y("number", "number");
if (ge == "/")
return oe.eat("*") ? (ce.tokenize = k, k(oe, ce)) : oe.eat("/") ? (oe.skipToEnd(), y("comment", "comment")) : Oi(oe, ce, 1) ? (A(oe), oe.match(/^\b(([gimyus])(?![gimyus]*\2))+\b/), y("regexp", "string-2")) : (oe.eat("="), y("operator", "operator", oe.current()));
if (ge == "`")
return ce.tokenize = D, D(oe, ce);
if (ge == "#" && oe.peek() == "!")
return oe.skipToEnd(), y("meta", "meta");
if (ge == "#" && oe.eatWhile(g))
return y("variable", "property");
if (ge == "<" && oe.match("!--") || ge == "-" && oe.match("->") && !/\S/.test(oe.string.slice(0, oe.start)))
return oe.skipToEnd(), y("comment", "comment");
if (S.test(ge))
return (ge != ">" || !ce.lexical || ce.lexical.type != ">") && (oe.eat("=") ? (ge == "!" || ge == "=") && oe.eat("=") : /[<>*+\-|&?]/.test(ge) && (oe.eat(ge), ge == ">" && oe.eat(ge))), ge == "?" && oe.eat(".") ? y(".") : y("operator", "operator", oe.current());
if (g.test(ge)) {
oe.eatWhile(g);
var $e = oe.current();
if (ce.lastType != ".") {
if (_.propertyIsEnumerable($e)) {
var yt = _[$e];
return y(yt.type, yt.style, $e);
}
if ($e == "async" && oe.match(/^(\s|\/\*([^*]|\*(?!\/))*?\*\/)*[\[\(\w]/, !1))
return y("async", "keyword", $e);
}
return y("variable", "variable", $e);
}
}
function x(oe) {
return function(ce, ge) {
var $e = !1, yt;
if (u && ce.peek() == "@" && ce.match(b))
return ge.tokenize = E, y("jsonld-keyword", "meta");
for (; (yt = ce.next()) != null && !(yt == oe && !$e); )
$e = !$e && yt == "\\";
return $e || (ge.tokenize = E), y("string", "string");
};
}
function k(oe, ce) {
for (var ge = !1, $e; $e = oe.next(); ) {
if ($e == "/" && ge) {
ce.tokenize = E;
break;
}
ge = $e == "*";
}
return y("comment", "comment");
}
function D(oe, ce) {
for (var ge = !1, $e; ($e = oe.next()) != null; ) {
if (!ge && ($e == "`" || $e == "$" && oe.eat("{"))) {
ce.tokenize = E;
break;
}
ge = !ge && $e == "\\";
}
return y("quasi", "string-2", oe.current());
}
var P = "([{}])";
function M(oe, ce) {
ce.fatArrowAt && (ce.fatArrowAt = null);
var ge = oe.string.indexOf("=>", oe.start);
if (!(ge < 0)) {
if (p) {
var $e = /:\s*(?:\w+(?:<[^>]*>|\[\])?|\{[^}]*\})\s*$/.exec(oe.string.slice(oe.start, ge));
$e && (ge = $e.index);
}
for (var yt = 0, Ot = !1, Dt = ge - 1; Dt >= 0; --Dt) {
var an = oe.string.charAt(Dt), Zn = P.indexOf(an);
if (Zn >= 0 && Zn < 3) {
if (!yt) {
++Dt;
break;
}
if (--yt == 0) {
an == "(" && (Ot = !0);
break;
}
} else if (Zn >= 3 && Zn < 6)
++yt;
else if (g.test(an))
Ot = !0;
else if (/["'\/`]/.test(an))
for (; ; --Dt) {
if (Dt == 0)
return;
var bt = oe.string.charAt(Dt - 1);
if (bt == an && oe.string.charAt(Dt - 2) != "\\") {
Dt--;
break;
}
}
else if (Ot && !yt) {
++Dt;
break;
}
}
Ot && !yt && (ce.fatArrowAt = Dt);
}
}
var B = {
atom: !0,
number: !0,
variable: !0,
string: !0,
regexp: !0,
this: !0,
import: !0,
"jsonld-keyword": !0
};
function T(oe, ce, ge, $e, yt, Ot) {
this.indented = oe, this.column = ce, this.type = ge, this.prev = yt, this.info = Ot, $e != null && (this.align = $e);
}
function $(oe, ce) {
if (!h)
return !1;
for (var ge = oe.localVars; ge; ge = ge.next)
if (ge.name == ce)
return !0;
for (var $e = oe.context; $e; $e = $e.prev)
for (var ge = $e.vars; ge; ge = ge.next)
if (ge.name == ce)
return !0;
}
function V(oe, ce, ge, $e, yt) {
var Ot = oe.cc;
for (z.state = oe, z.stream = yt, z.marked = null, z.cc = Ot, z.style = ce, oe.lexical.hasOwnProperty("align") || (oe.lexical.align = !0); ; ) {
var Dt = Ot.length ? Ot.pop() : d ? xe : he;
if (Dt(ge, $e)) {
for (; Ot.length && Ot[Ot.length - 1].lex; )
Ot.pop()();
return z.marked ? z.marked : ge == "variable" && $(oe, $e) ? "variable-2" : ce;
}
}
}
var z = { state: null, column: null, marked: null, cc: null };
function H() {
for (var oe = arguments.length - 1; oe >= 0; oe--)
z.cc.push(arguments[oe]);
}
function I() {
return H.apply(null, arguments), !0;
}
function U(oe, ce) {
for (var ge = ce; ge; ge = ge.next)
if (ge.name == oe)
return !0;
return !1;
}
function F(oe) {
var ce = z.state;
if (z.marked = "def", !!h) {
if (ce.context) {
if (ce.lexical.info == "var" && ce.context && ce.context.block) {
var ge = C(oe, ce.context);
if (ge != null) {
ce.context = ge;
return;
}
} else if (!U(oe, ce.localVars)) {
ce.localVars = new Y(oe, ce.localVars);
return;
}
}
n.globalVars && !U(oe, ce.globalVars) && (ce.globalVars = new Y(oe, ce.globalVars));
}
}
function C(oe, ce) {
if (ce)
if (ce.block) {
var ge = C(oe, ce.prev);
return ge ? ge == ce.prev ? ce : new X(ge, ce.vars, !0) : null;
} else
return U(oe, ce.vars) ? ce : new X(ce.prev, new Y(oe, ce.vars), !1);
else
return null;
}
function q(oe) {
return oe == "public" || oe == "private" || oe == "protected" || oe == "abstract" || oe == "readonly";
}
function X(oe, ce, ge) {
this.prev = oe, this.vars = ce, this.block = ge;
}
function Y(oe, ce) {
this.name = oe, this.next = ce;
}
var ue = new Y("this", new Y("arguments", null));
function ee() {
z.state.context = new X(z.state.context, z.state.localVars, !1), z.state.localVars = ue;
}
function pe() {
z.state.context = new X(z.state.context, z.state.localVars, !0), z.state.localVars = null;
}
ee.lex = pe.lex = !0;
function Te() {
z.state.localVars = z.state.context.vars, z.state.context = z.state.context.prev;
}
Te.lex = !0;
function ve(oe, ce) {
var ge = function() {
var $e = z.state, yt = $e.indented;
if ($e.lexical.type == "stat")
yt = $e.lexical.indented;
else
for (var Ot = $e.lexical; Ot && Ot.type == ")" && Ot.align; Ot = Ot.prev)
yt = Ot.indented;
$e.lexical = new T(yt, z.stream.column(), oe, null, $e.lexical, ce);
};
return ge.lex = !0, ge;
}
function me() {
var oe = z.state;
oe.lexical.prev && (oe.lexical.type == ")" && (oe.indented = oe.lexical.indented), oe.lexical = oe.lexical.prev);
}
me.lex = !0;
function we(oe) {
function ce(ge) {
return ge == oe ? I() : oe == ";" || ge == "}" || ge == ")" || ge == "]" ? H() : I(ce);
}
return ce;
}
function he(oe, ce) {
return oe == "var" ? I(ve("vardef", ce), vi, we(";"), me) : oe == "keyword a" ? I(ve("form"), K, he, me) : oe == "keyword b" ? I(ve("form"), he, me) : oe == "keyword d" ? z.stream.match(/^\s*$/, !1) ? I() : I(ve("stat"), ne, we(";"), me) : oe == "debugger" ? I(we(";")) : oe == "{" ? I(ve("}"), pe, ft, me, Te) : oe == ";" ? I() : oe == "if" ? (z.state.lexical.info == "else" && z.state.cc[z.state.cc.length - 1] == me && z.state.cc.pop()(), I(ve("form"), K, he, me, to)) : oe == "function" ? I(Ti) : oe == "for" ? I(ve("form"), pe, hl, he, Te, me) : oe == "class" || p && ce == "interface" ? (z.marked = "keyword", I(ve("form", oe == "class" ? oe : ce), vl, me)) : oe == "variable" ? p && ce == "declare" ? (z.marked = "keyword", I(he)) : p && (ce == "module" || ce == "enum" || ce == "type") && z.stream.match(/^\s*\w/, !1) ? (z.marked = "keyword", ce == "enum" ? I(io) : ce == "type" ? I(ml, we("operator"), Re, we(";")) : I(ve("form"), Mn, we("{"), ve("}"), ft, me, me)) : p && ce == "namespace" ? (z.marked = "keyword", I(ve("form"), xe, he, me)) : p && ce == "abstract" ? (z.marked = "keyword", I(he)) : I(ve("stat"), it) : oe == "switch" ? I(
ve("form"),
K,
we("{"),
ve("}", "switch"),
pe,
ft,
me,
me,
Te
) : oe == "case" ? I(xe, we(":")) : oe == "default" ? I(we(":")) : oe == "catch" ? I(ve("form"), ee, Se, he, me, Te) : oe == "export" ? I(ve("stat"), dr, me) : oe == "import" ? I(ve("stat"), Wi, me) : oe == "async" ? I(he) : ce == "@" ? I(xe, he) : H(ve("stat"), xe, we(";"), me);
}
function Se(oe) {
if (oe == "(")
return I(gi, we(")"));
}
function xe(oe, ce) {
return J(oe, ce, !1);
}
function O(oe, ce) {
return J(oe, ce, !0);
}
function K(oe) {
return oe != "(" ? H() : I(ve(")"), ne, we(")"), me);
}
function J(oe, ce, ge) {
if (z.state.fatArrowAt == z.stream.start) {
var $e = ge ? Ze : Xe;
if (oe == "(")
return I(ee, ve(")"), He(gi, ")"), me, we("=>"), $e, Te);
if (oe == "variable")
return H(ee, Mn, we("=>"), $e, Te);
}
var yt = ge ? fe : re;
return B.hasOwnProperty(oe) ? I(yt) : oe == "function" ? I(Ti, yt) : oe == "class" || p && ce == "interface" ? (z.marked = "keyword", I(ve("form"), ur, me)) : oe == "keyword c" || oe == "async" ? I(ge ? O : xe) : oe == "(" ? I(ve(")"), ne, we(")"), me, yt) : oe == "operator" || oe == "spread" ? I(ge ? O : xe) : oe == "[" ? I(ve("]"), Gi, me, yt) : oe == "{" ? Rt(De, "}", null, yt) : oe == "quasi" ? H(Ae, yt) : oe == "new" ? I(be(ge)) : I();
}
function ne(oe) {
return oe.match(/[;\}\)\],]/) ? H() : H(xe);
}
function re(oe, ce) {
return oe == "," ? I(ne) : fe(oe, ce, !1);
}
function fe(oe, ce, ge) {
var $e = ge == !1 ? re : fe, yt = ge == !1 ? xe : O;
if (oe == "=>")
return I(ee, ge ? Ze : Xe, Te);
if (oe == "operator")
return /\+\+|--/.test(ce) || p && ce == "!" ? I($e) : p && ce == "<" && z.stream.match(/^([^<>]|<[^<>]*>)*>\s*\(/, !1) ? I(ve(">"), He(Re, ">"), me, $e) : ce == "?" ? I(xe, we(":"), yt) : I(yt);
if (oe == "quasi")
return H(Ae, $e);
if (oe != ";") {
if (oe == "(")
return Rt(O, ")", "call", $e);
if (oe == ".")
return I(pt, $e);
if (oe == "[")
return I(ve("]"), ne, we("]"), me, $e);
if (p && ce == "as")
return z.marked = "keyword", I(Re, $e);
if (oe == "regexp")
return z.state.lastType = z.marked = "operator", z.stream.backUp(z.stream.pos - z.stream.start - 1), I(yt);
}
}
function Ae(oe, ce) {
return oe != "quasi" ? H() : ce.slice(ce.length - 2) != "${" ? I(Ae) : I(ne, Fe);
}
function Fe(oe) {
if (oe == "}")
return z.marked = "string-2", z.state.tokenize = D, I(Ae);
}
function Xe(oe) {
return M(z.stream, z.state), H(oe == "{" ? he : xe);
}
function Ze(oe) {
return M(z.stream, z.state), H(oe == "{" ? he : O);
}
function be(oe) {
return function(ce) {
return ce == "." ? I(oe ? ke : Le) : ce == "variable" && p ? I(It, oe ? fe : re) : H(oe ? O : xe);
};
}
function Le(oe, ce) {
if (ce == "target")
return z.marked = "keyword", I(re);
}
function ke(oe, ce) {
if (ce == "target")
return z.marked = "keyword", I(fe);
}
function it(oe) {
return oe == ":" ? I(me, he) : H(re, we(";"), me);
}
function pt(oe) {
if (oe == "variable")
return z.marked = "property", I();
}
function De(oe, ce) {
if (oe == "async")
return z.marked = "property", I(De);
if (oe == "variable" || z.style == "keyword") {
if (z.marked = "property", ce == "get" || ce == "set")
return I(ze);
var ge;
return p && z.state.fatArrowAt == z.stream.start && (ge = z.stream.match(/^\s*:\s*/, !1)) && (z.state.fatArrowAt = z.stream.pos + ge[0].length), I(at);
} else {
if (oe == "number" || oe == "string")
return z.marked = u ? "property" : z.style + " property", I(at);
if (oe == "jsonld-keyword")
return I(at);
if (p && q(ce))
return z.marked = "keyword", I(De);
if (oe == "[")
return I(xe, Be, we("]"), at);
if (oe == "spread")
return I(O, at);
if (ce == "*")
return z.marked = "keyword", I(De);
if (oe == ":")
return H(at);
}
}
function ze(oe) {
return oe != "variable" ? H(at) : (z.marked = "property", I(Ti));
}
function at(oe) {
if (oe == ":")
return I(O);
if (oe == "(")
return H(Ti);
}
function He(oe, ce, ge) {
function $e(yt, Ot) {
if (ge ? ge.indexOf(yt) > -1 : yt == ",") {
var Dt = z.state.lexical;
return Dt.info == "call" && (Dt.pos = (Dt.pos || 0) + 1), I(function(an, Zn) {
return an == ce || Zn == ce ? H() : H(oe);
}, $e);
}
return yt == ce || Ot == ce ? I() : ge && ge.indexOf(";") > -1 ? H(oe) : I(we(ce));
}
return function(yt, Ot) {
return yt == ce || Ot == ce ? I() : H(oe, $e);
};
}
function Rt(oe, ce, ge) {
for (var $e = 3; $e < arguments.length; $e++)
z.cc.push(arguments[$e]);
return I(ve(ce, ge), He(oe, ce), me);
}
function ft(oe) {
return oe == "}" ? I() : H(he, ft);
}
function Be(oe, ce) {
if (p) {
if (oe == ":")
return I(Re);
if (ce == "?")
return I(Be);
}
}
function Je(oe, ce) {
if (p && (oe == ":" || ce == "in"))
return I(Re);
}
function ht(oe) {
if (p && oe == ":")
return z.stream.match(/^\s*\w+\s+is\b/, !1) ? I(xe, We, Re) : I(Re);
}
function We(oe, ce) {
if (ce == "is")
return z.marked = "keyword", I();
}
function Re(oe, ce) {
if (ce == "keyof" || ce == "typeof" || ce == "infer" || ce == "readonly")
return z.marked = "keyword", I(ce == "typeof" ? O : Re);
if (oe == "variable" || ce == "void")
return z.marked = "type", I(Ut);
if (ce == "|" || ce == "&")
return I(Re);
if (oe == "string" || oe == "number" || oe == "atom")
return I(Ut);
if (oe == "[")
return I(ve("]"), He(Re, "]", ","), me, Ut);
if (oe == "{")
return I(ve("}"), lt, me, Ut);
if (oe == "(")
return I(He(Gt, ")"), dt, Ut);
if (oe == "<")
return I(He(Re, ">"), Re);
if (oe == "quasi")
return H(Ct, Ut);
}
function dt(oe) {
if (oe == "=>")
return I(Re);
}
function lt(oe) {
return oe.match(/[\}\)\]]/) ? I() : oe == "," || oe == ";" ? I(lt) : H(st, lt);
}
function st(oe, ce) {
if (oe == "variable" || z.style == "keyword")
return z.marked = "property", I(st);
if (ce == "?" || oe == "number" || oe == "string")
return I(st);
if (oe == ":")
return I(Re);
if (oe == "[")
return I(we("variable"), Je, we("]"), st);
if (oe == "(")
return H(ki, st);
if (!oe.match(/[;\}\)\],]/))
return I();
}
function Ct(oe, ce) {
return oe != "quasi" ? H() : ce.slice(ce.length - 2) != "${" ? I(Ct) : I(Re, Fn);
}
function Fn(oe) {
if (oe == "}")
return z.marked = "string-2", z.state.tokenize = D, I(Ct);
}
function Gt(oe, ce) {
return oe == "variable" && z.stream.match(/^\s*[?:]/, !1) || ce == "?" ? I(Gt) : oe == ":" ? I(Re) : oe == "spread" ? I(Gt) : H(Re);
}
function Ut(oe, ce) {
if (ce == "<")
return I(ve(">"), He(Re, ">"), me, Ut);
if (ce == "|" || oe == "." || ce == "&")
return I(Re);
if (oe == "[")
return I(Re, we("]"), Ut);
if (ce == "extends" || ce == "implements")
return z.marked = "keyword", I(Re);
if (ce == "?")
return I(Re, we(":"), Re);
}
function It(oe, ce) {
if (ce == "<")
return I(ve(">"), He(Re, ">"), me, Ut);
}
function si() {
return H(Re, lr);
}
function lr(oe, ce) {
if (ce == "=")
return I(Re);
}
function vi(oe, ce) {
return ce == "enum" ? (z.marked = "keyword", I(io)) : H(Mn, Be, ui, xu);
}
function Mn(oe, ce) {
if (p && q(ce))
return z.marked = "keyword", I(Mn);
if (oe == "variable")
return F(ce), I();
if (oe == "spread")
return I(Mn);
if (oe == "[")
return Rt(Eu, "]");
if (oe == "{")
return Rt(na, "}");
}
function na(oe, ce) {
return oe == "variable" && !z.stream.match(/^\s*:/, !1) ? (F(ce), I(ui)) : (oe == "variable" && (z.marked = "property"), oe == "spread" ? I(Mn) : oe == "}" ? H() : oe == "[" ? I(xe, we("]"), we(":"), na) : I(we(":"), Mn, ui));
}
function Eu() {
return H(Mn, ui);
}
function ui(oe, ce) {
if (ce == "=")
return I(O);
}
function xu(oe) {
if (oe == ",")
return I(vi);
}
function to(oe, ce) {
if (oe == "keyword b" && ce == "else")
return I(ve("form", "else"), he, me);
}
function hl(oe, ce) {
if (ce == "await")
return I(hl);
if (oe == "(")
return I(ve(")"), ia, me);
}
function ia(oe) {
return oe == "var" ? I(vi, sr) : oe == "variable" ? I(sr) : H(sr);
}
function sr(oe, ce) {
return oe == ")" ? I() : oe == ";" ? I(sr) : ce == "in" || ce == "of" ? (z.marked = "keyword", I(xe, sr)) : H(xe, sr);
}
function Ti(oe, ce) {
if (ce == "*")
return z.marked = "keyword", I(Ti);
if (oe == "variable")
return F(ce), I(Ti);
if (oe == "(")
return I(ee, ve(")"), He(gi, ")"), me, ht, he, Te);
if (p && ce == "<")
return I(ve(">"), He(si, ">"), me, Ti);
}
function ki(oe, ce) {
if (ce == "*")
return z.marked = "keyword", I(ki);
if (oe == "variable")
return F(ce), I(ki);
if (oe == "(")
return I(ee, ve(")"), He(gi, ")"), me, ht, Te);
if (p && ce == "<")
return I(ve(">"), He(si, ">"), me, ki);
}
function ml(oe, ce) {
if (oe == "keyword" || oe == "variable")
return z.marked = "type", I(ml);
if (ce == "<")
return I(ve(">"), He(si, ">"), me);
}
function gi(oe, ce) {
return ce == "@" && I(xe, gi), oe == "spread" ? I(gi) : p && q(ce) ? (z.marked = "keyword", I(gi)) : p && oe == "this" ? I(Be, ui) : H(Mn, Be, ui);
}
function ur(oe, ce) {
return oe == "variable" ? vl(oe, ce) : no(oe, ce);
}
function vl(oe, ce) {
if (oe == "variable")
return F(ce), I(no);
}
function no(oe, ce) {
if (ce == "<")
return I(ve(">"), He(si, ">"), me, no);
if (ce == "extends" || ce == "implements" || p && oe == ",")
return ce == "implements" && (z.marked = "keyword"), I(p ? Re : xe, no);
if (oe == "{")
return I(ve("}"), zn, me);
}
function zn(oe, ce) {
if (oe == "async" || oe == "variable" && (ce == "static" || ce == "get" || ce == "set" || p && q(ce)) && z.stream.match(/^\s+[\w$\xa1-\uffff]/, !1))
return z.marked = "keyword", I(zn);
if (oe == "variable" || z.style == "keyword")
return z.marked = "property", I(Hi, zn);
if (oe == "number" || oe == "string")
return I(Hi, zn);
if (oe == "[")
return I(xe, Be, we("]"), Hi, zn);
if (ce == "*")
return z.marked = "keyword", I(zn);
if (p && oe == "(")
return H(ki, zn);
if (oe == ";" || oe == ",")
return I(zn);
if (oe == "}")
return I();
if (ce == "@")
return I(xe, zn);
}
function Hi(oe, ce) {
if (ce == "!" || ce == "?")
return I(Hi);
if (oe == ":")
return I(Re, ui);
if (ce == "=")
return I(O);
var ge = z.state.lexical.prev, $e = ge && ge.info == "interface";
return H($e ? ki : Ti);
}
function dr(oe, ce) {
return ce == "*" ? (z.marked = "keyword", I(ut, we(";"))) : ce == "default" ? (z.marked = "keyword", I(xe, we(";"))) : oe == "{" ? I(He(gl, "}"), ut, we(";")) : H(he);
}
function gl(oe, ce) {
if (ce == "as")
return z.marked = "keyword", I(we("variable"));
if (oe == "variable")
return H(O, gl);
}
function Wi(oe) {
return oe == "string" ? I() : oe == "(" ? H(xe) : oe == "." ? H(re) : H(fr, ra, ut);
}
function fr(oe, ce) {
return oe == "{" ? Rt(fr, "}") : (oe == "variable" && F(ce), ce == "*" && (z.marked = "keyword"), I(Qt));
}
function ra(oe) {
if (oe == ",")
return I(fr, ra);
}
function Qt(oe, ce) {
if (ce == "as")
return z.marked = "keyword", I(fr);
}
function ut(oe, ce) {
if (ce == "from")
return z.marked = "keyword", I(xe);
}
function Gi(oe) {
return oe == "]" ? I() : H(He(O, "]"));
}
function io() {
return H(ve("form"), Mn, we("{"), ve("}"), He(di, "}"), me, me);
}
function di() {
return H(Mn, ui);
}
function Ft(oe, ce) {
return oe.lastType == "operator" || oe.lastType == "," || S.test(ce.charAt(0)) || /[,.]/.test(ce.charAt(0));
}
function Oi(oe, ce, ge) {
return ce.tokenize == E && /^(?:operator|sof|keyword [bcd]|case|new|export|default|spread|[\[{}\(,;:]|=>)$/.test(ce.lastType) || ce.lastType == "quasi" && /\{\s*$/.test(oe.string.slice(0, oe.pos - (ge || 0)));
}
return {
startState: function(oe) {
var ce = {
tokenize: E,
lastType: "sof",
cc: [],
lexical: new T((oe || 0) - a, 0, "block", !1),
localVars: n.localVars,
context: n.localVars && new X(null, null, !1),
indented: oe || 0
};
return n.globalVars && typeof n.globalVars == "object" && (ce.globalVars = n.globalVars), ce;
},
token: function(oe, ce) {
if (oe.sol() && (ce.lexical.hasOwnProperty("align") || (ce.lexical.align = !1), ce.indented = oe.indentation(), M(oe, ce)), ce.tokenize != k && oe.eatSpace())
return null;
var ge = ce.tokenize(oe, ce);
return w == "comment" ? ge : (ce.lastType = w == "operator" && (m == "++" || m == "--") ? "incdec" : w, V(ce, ge, w, m, oe));
},
indent: function(oe, ce) {
if (oe.tokenize == k || oe.tokenize == D)
return i.Pass;
if (oe.tokenize != E)
return 0;
var ge = ce && ce.charAt(0), $e = oe.lexical, yt;
if (!/^\s*else\b/.test(ce))
for (var Ot = oe.cc.length - 1; Ot >= 0; --Ot) {
var Dt = oe.cc[Ot];
if (Dt == me)
$e = $e.prev;
else if (Dt != to && Dt != Te)
break;
}
for (; ($e.type == "stat" || $e.type == "form") && (ge == "}" || (yt = oe.cc[oe.cc.length - 1]) && (yt == re || yt == fe) && !/^[,\.=+\-*:?[\(]/.test(ce)); )
$e = $e.prev;
s && $e.type == ")" && $e.prev.type == "stat" && ($e = $e.prev);
var an = $e.type, Zn = ge == an;
return an == "vardef" ? $e.indented + (oe.lastType == "operator" || oe.lastType == "," ? $e.info.length + 1 : 0) : an == "form" && ge == "{" ? $e.indented : an == "form" ? $e.indented + a : an == "stat" ? $e.indented + (Ft(oe, ce) ? s || a : 0) : $e.info == "switch" && !Zn && n.doubleIndentSwitch != !1 ? $e.indented + (/^(?:case|default)\b/.test(ce) ? a : 2 * a) : $e.align ? $e.column + (Zn ? 0 : 1) : $e.indented + (Zn ? 0 : a);
},
electricInput: /^\s*(?:case .*?:|default:|\{|\})$/,
blockCommentStart: d ? null : "/*",
blockCommentEnd: d ? null : "*/",
blockCommentContinue: d ? null : " * ",
lineComment: d ? null : "//",
fold: "brace",
closeBrackets: "()[]{}''\"\"``",
helperType: d ? "json" : "javascript",
jsonldMode: u,
jsonMode: d,
expressionAllowed: Oi,
skipExpression: function(oe) {
V(oe, "atom", "atom", "true", new i.StringStream("", 2, null));
}
};
}), i.registerHelper("wordChars", "javascript", /[\w$]/), i.defineMIME("text/javascript", "javascript"), i.defineMIME("text/ecmascript", "javascript"), i.defineMIME("application/javascript", "javascript"), i.defineMIME("application/x-javascript", "javascript"), i.defineMIME("application/ecmascript", "javascript"), i.defineMIME("application/json", { name: "javascript", json: !0 }), i.defineMIME("application/x-json", { name: "javascript", json: !0 }), i.defineMIME("application/manifest+json", { name: "javascript", json: !0 }), i.defineMIME("application/ld+json", { name: "javascript", jsonld: !0 }), i.defineMIME("text/typescript", { name: "javascript", typescript: !0 }), i.defineMIME("application/typescript", { name: "javascript", typescript: !0 });
});
})();
(function(e, t) {
(function(i) {
i(Ko());
})(function(i) {
var r = "CodeMirror-hint", n = "CodeMirror-hint-active";
i.showHint = function(m, y, E) {
if (!y)
return m.showHint(E);
E && E.async && (y.async = !0);
var x = { hint: y };
if (E)
for (var k in E)
x[k] = E[k];
return m.showHint(x);
}, i.defineExtension("showHint", function(m) {
m = d(this, this.getCursor("start"), m);
var y = this.listSelections();
if (!(y.length > 1)) {
if (this.somethingSelected()) {
if (!m.hint.supportsSelection)
return;
for (var E = 0; E < y.length; E++)
if (y[E].head.line != y[E].anchor.line)
return;
}
this.state.completionActive && this.state.completionActive.close();
var x = this.state.completionActive = new a(this, m);
!x.options.hint || (i.signal(this, "startCompletion", this), x.update(!0));
}
}), i.defineExtension("closeHint", function() {
this.state.completionActive && this.state.completionActive.close();
});
function a(m, y) {
if (this.cm = m, this.options = y, this.widget = null, this.debounce = 0, this.tick = 0, this.startPos = this.cm.getCursor("start"), this.startLen = this.cm.getLine(this.startPos.line).length - this.cm.getSelection().length, this.options.updateOnCursorActivity) {
var E = this;
m.on("cursorActivity", this.activityFunc = function() {
E.cursorActivity();
});
}
}
var s = window.requestAnimationFrame || function(m) {
return setTimeout(m, 1e3 / 60);
}, u = window.cancelAnimationFrame || clearTimeout;
a.prototype = {
close: function() {
!this.active() || (this.cm.state.completionActive = null, this.tick = null, this.options.updateOnCursorActivity && this.cm.off("cursorActivity", this.activityFunc), this.widget && this.data && i.signal(this.data, "close"), this.widget && this.widget.close(), i.signal(this.cm, "endCompletion", this.cm));
},
active: function() {
return this.cm.state.completionActive == this;
},
pick: function(m, y) {
var E = m.list[y], x = this;
this.cm.operation(function() {
E.hint ? E.hint(x.cm, m, E) : x.cm.replaceRange(
h(E),
E.from || m.from,
E.to || m.to,
"complete"
), i.signal(m, "pick", E), x.cm.scrollIntoView();
}), this.options.closeOnPick && this.close();
},
cursorActivity: function() {
this.debounce && (u(this.debounce), this.debounce = 0);
var m = this.startPos;
this.data && (m = this.data.from);
var y = this.cm.getCursor(), E = this.cm.getLine(y.line);
if (y.line != this.startPos.line || E.length - y.ch != this.startLen - this.startPos.ch || y.ch < m.ch || this.cm.somethingSelected() || !y.ch || this.options.closeCharacters.test(E.charAt(y.ch - 1)))
this.close();
else {
var x = this;
this.debounce = s(function() {
x.update();
}), this.widget && this.widget.disable();
}
},
update: function(m) {
if (this.tick != null) {
var y = this, E = ++this.tick;
b(this.options.hint, this.cm, this.options, function(x) {
y.tick == E && y.finishUpdate(x, m);
});
}
},
finishUpdate: function(m, y) {
this.data && i.signal(this.data, "update");
var E = this.widget && this.widget.picked || y && this.options.completeSingle;
this.widget && this.widget.close(), this.data = m, m && m.list.length && (E && m.list.length == 1 ? this.pick(m, 0) : (this.widget = new _(this, m), i.signal(m, "shown")));
}
};
function d(m, y, E) {
var x = m.options.hintOptions, k = {};
for (var D in w)
k[D] = w[D];
if (x)
for (var D in x)
x[D] !== void 0 && (k[D] = x[D]);
if (E)
for (var D in E)
E[D] !== void 0 && (k[D] = E[D]);
return k.hint.resolve && (k.hint = k.hint.resolve(m, y)), k;
}
function h(m) {
return typeof m == "string" ? m : m.text;
}
function p(m, y) {
var E = {
Up: function() {
y.moveFocus(-1);
},
Down: function() {
y.moveFocus(1);
},
PageUp: function() {
y.moveFocus(-y.menuSize() + 1, !0);
},
PageDown: function() {
y.moveFocus(y.menuSize() - 1, !0);
},
Home: function() {
y.setFocus(0);
},
End: function() {
y.setFocus(y.length - 1);
},
Enter: y.pick,
Tab: y.pick,
Esc: y.close
}, x = /Mac/.test(navigator.platform);
x && (E["Ctrl-P"] = function() {
y.moveFocus(-1);
}, E["Ctrl-N"] = function() {
y.moveFocus(1);
});
var k = m.options.customKeys, D = k ? {} : E;
function P(T, $) {
var V;
typeof $ != "string" ? V = function(z) {
return $(z, y);
} : E.hasOwnProperty($) ? V = E[$] : V = $, D[T] = V;
}
if (k)
for (var M in k)
k.hasOwnProperty(M) && P(M, k[M]);
var B = m.options.extraKeys;
if (B)
for (var M in B)
B.hasOwnProperty(M) && P(M, B[M]);
return D;
}
function g(m, y) {
for (; y && y != m; ) {
if (y.nodeName.toUpperCase() === "LI" && y.parentNode == m)
return y;
y = y.parentNode;
}
}
function _(m, y) {
this.id = "cm-complete-" + Math.floor(Math.random(1e6)), this.completion = m, this.data = y, this.picked = !1;
var E = this, x = m.cm, k = x.getInputField().ownerDocument, D = k.defaultView || k.parentWindow, P = this.hints = k.createElement("ul");
P.setAttribute("role", "listbox"), P.setAttribute("aria-expanded", "true"), P.id = this.id;
var M = m.cm.options.theme;
P.className = "CodeMirror-hints " + M, this.selectedHint = y.selectedHint || 0;
for (var B = y.list, T = 0; T < B.length; ++T) {
var $ = P.appendChild(k.createElement("li")), V = B[T], z = r + (T != this.selectedHint ? "" : " " + n);
V.className != null && (z = V.className + " " + z), $.className = z, T == this.selectedHint && $.setAttribute("aria-selected", "true"), $.id = this.id + "-" + T, $.setAttribute("role", "option"), V.render ? V.render($, y, V) : $.appendChild(k.createTextNode(V.displayText || h(V))), $.hintId = T;
}
var H = m.options.container || k.body, I = x.cursorCoords(m.options.alignWithWord ? y.from : null), U = I.left, F = I.bottom, C = !0, q = 0, X = 0;
if (H !== k.body) {
var Y = ["absolute", "relative", "fixed"].indexOf(D.getComputedStyle(H).position) !== -1, ue = Y ? H : H.offsetParent, ee = ue.getBoundingClientRect(), pe = k.body.getBoundingClientRect();
q = ee.left - pe.left - ue.scrollLeft, X = ee.top - pe.top - ue.scrollTop;
}
P.style.left = U - q + "px", P.style.top = F - X + "px";
var Te = D.innerWidth || Math.max(k.body.offsetWidth, k.documentElement.offsetWidth), ve = D.innerHeight || Math.max(k.body.offsetHeight, k.documentElement.offsetHeight);
H.appendChild(P), x.getInputField().setAttribute("aria-autocomplete", "list"), x.getInputField().setAttribute("aria-owns", this.id), x.getInputField().setAttribute("aria-activedescendant", this.id + "-" + this.selectedHint);
var me = m.options.moveOnOverlap ? P.getBoundingClientRect() : new DOMRect(), we = m.options.paddingForScrollbar ? P.scrollHeight > P.clientHeight + 1 : !1, he;
setTimeout(function() {
he = x.getScrollInfo();
});
var Se = me.bottom - ve;
if (Se > 0) {
var xe = me.bottom - me.top, O = I.top - (I.bottom - me.top);
if (O - xe > 0)
P.style.top = (F = I.top - xe - X) + "px", C = !1;
else if (xe > ve) {
P.style.height = ve - 5 + "px", P.style.top = (F = I.bottom - me.top - X) + "px";
var K = x.getCursor();
y.from.ch != K.ch && (I = x.cursorCoords(K), P.style.left = (U = I.left - q) + "px", me = P.getBoundingClientRect());
}
}
var J = me.right - Te;
if (we && (J += x.display.nativeBarWidth), J > 0 && (me.right - me.left > Te && (P.style.width = Te - 5 + "px", J -= me.right - me.left - Te), P.style.left = (U = Math.max(I.left - J - q, 0)) + "px"), we)
for (var ne = P.firstChild; ne; ne = ne.nextSibling)
ne.style.paddingRight = x.display.nativeBarWidth + "px";
if (x.addKeyMap(this.keyMap = p(m, {
moveFocus: function(Ae, Fe) {
E.changeActive(E.selectedHint + Ae, Fe);
},
setFocus: function(Ae) {
E.changeActive(Ae);
},
menuSize: function() {
return E.screenAmount();
},
length: B.length,
close: function() {
m.close();
},
pick: function() {
E.pick();
},
data: y
})), m.options.closeOnUnfocus) {
var re;
x.on("blur", this.onBlur = function() {
re = setTimeout(function() {
m.close();
}, 100);
}), x.on("focus", this.onFocus = function() {
clearTimeout(re);
});
}
x.on("scroll", this.onScroll = function() {
var Ae = x.getScrollInfo(), Fe = x.getWrapperElement().getBoundingClientRect();
he || (he = x.getScrollInfo());
var Xe = F + he.top - Ae.top, Ze = Xe - (D.pageYOffset || (k.documentElement || k.body).scrollTop);
if (C || (Ze += P.offsetHeight), Ze <= Fe.top || Ze >= Fe.bottom)
return m.close();
P.style.top = Xe + "px", P.style.left = U + he.left - Ae.left + "px";
}), i.on(P, "dblclick", function(Ae) {
var Fe = g(P, Ae.target || Ae.srcElement);
Fe && Fe.hintId != null && (E.changeActive(Fe.hintId), E.pick());
}), i.on(P, "click", function(Ae) {
var Fe = g(P, Ae.target || Ae.srcElement);
Fe && Fe.hintId != null && (E.changeActive(Fe.hintId), m.options.completeOnSingleClick && E.pick());
}), i.on(P, "mousedown", function() {
setTimeout(function() {
x.focus();
}, 20);
});
var fe = this.getSelectedHintRange();
return (fe.from !== 0 || fe.to !== 0) && this.scrollToActive(), i.signal(y, "select", B[this.selectedHint], P.childNodes[this.selectedHint]), !0;
}
_.prototype = {
close: function() {
if (this.completion.widget == this) {
this.completion.widget = null, this.hints.parentNode && this.hints.parentNode.removeChild(this.hints), this.completion.cm.removeKeyMap(this.keyMap);
var m = this.completion.cm.getInputField();
m.removeAttribute("aria-activedescendant"), m.removeAttribute("aria-owns");
var y = this.completion.cm;
this.completion.options.closeOnUnfocus && (y.off("blur", this.onBlur), y.off("focus", this.onFocus)), y.off("scroll", this.onScroll);
}
},
disable: function() {
this.completion.cm.removeKeyMap(this.keyMap);
var m = this;
this.keyMap = { Enter: function() {
m.picked = !0;
} }, this.completion.cm.addKeyMap(this.keyMap);
},
pick: function() {
this.completion.pick(this.data, this.selectedHint);
},
changeActive: function(m, y) {
if (m >= this.data.list.length ? m = y ? this.data.list.length - 1 : 0 : m < 0 && (m = y ? 0 : this.data.list.length - 1), this.selectedHint != m) {
var E = this.hints.childNodes[this.selectedHint];
E && (E.className = E.className.replace(" " + n, ""), E.removeAttribute("aria-selected")), E = this.hints.childNodes[this.selectedHint = m], E.className += " " + n, E.setAttribute("aria-selected", "true"), this.completion.cm.getInputField().setAttribute("aria-activedescendant", E.id), this.scrollToActive(), i.signal(this.data, "select", this.data.list[this.selectedHint], E);
}
},
scrollToActive: function() {
var m = this.getSelectedHintRange(), y = this.hints.childNodes[m.from], E = this.hints.childNodes[m.to], x = this.hints.firstChild;
y.offsetTop < this.hints.scrollTop ? this.hints.scrollTop = y.offsetTop - x.offsetTop : E.offsetTop + E.offsetHeight > this.hints.scrollTop + this.hints.clientHeight && (this.hints.scrollTop = E.offsetTop + E.offsetHeight - this.hints.clientHeight + x.offsetTop);
},
screenAmount: function() {
return Math.floor(this.hints.clientHeight / this.hints.firstChild.offsetHeight) || 1;
},
getSelectedHintRange: function() {
var m = this.completion.options.scrollMargin || 0;
return {
from: Math.max(0, this.selectedHint - m),
to: Math.min(this.data.list.length - 1, this.selectedHint + m)
};
}
};
function S(m, y) {
if (!m.somethingSelected())
return y;
for (var E = [], x = 0; x < y.length; x++)
y[x].supportsSelection && E.push(y[x]);
return E;
}
function b(m, y, E, x) {
if (m.async)
m(y, x, E);
else {
var k = m(y, E);
k && k.then ? k.then(x) : x(k);
}
}
function A(m, y) {
var E = m.getHelpers(y, "hint"), x;
if (E.length) {
var k = function(D, P, M) {
var B = S(D, E);
function T($) {
if ($ == B.length)
return P(null);
b(B[$], D, M, function(V) {
V && V.list.length > 0 ? P(V) : T($ + 1);
});
}
T(0);
};
return k.async = !0, k.supportsSelection = !0, k;
} else
return (x = m.getHelper(m.getCursor(), "hintWords")) ? function(D) {
return i.hint.fromList(D, { words: x });
} : i.hint.anyword ? function(D, P) {
return i.hint.anyword(D, P);
} : function() {
};
}
i.registerHelper("hint", "auto", {
resolve: A
}), i.registerHelper("hint", "fromList", function(m, y) {
var E = m.getCursor(), x = m.getTokenAt(E), k, D = i.Pos(E.line, x.start), P = E;
x.start < E.ch && /\w/.test(x.string.charAt(E.ch - x.start - 1)) ? k = x.string.substr(0, E.ch - x.start) : (k = "", D = E);
for (var M = [], B = 0; B < y.words.length; B++) {
var T = y.words[B];
T.slice(0, k.length) == k && M.push(T);
}
if (M.length)
return { list: M, from: D, to: P };
}), i.commands.autocomplete = i.showHint;
var w = {
hint: i.hint.auto,
completeSingle: !0,
alignWithWord: !0,
closeCharacters: /[\s()\[\]{};:>,]/,
closeOnPick: !0,
closeOnUnfocus: !0,
updateOnCursorActivity: !0,
completeOnSingleClick: !0,
container: null,
customKeys: null,
extraKeys: null,
paddingForScrollbar: !0,
moveOnOverlap: !0
};
i.defineOption("hintOptions", null);
});
})();
(function(e, t) {
(function(i) {
i(Ko());
})(function(i) {
var r = i.Pos;
function n(m, y) {
for (var E = 0, x = m.length; E < x; ++E)
y(m[E]);
}
function a(m, y) {
if (!Array.prototype.indexOf) {
for (var E = m.length; E--; )
if (m[E] === y)
return !0;
return !1;
}
return m.indexOf(y) != -1;
}
function s(m, y, E, x) {
var k = m.getCursor(), D = E(m, k);
if (!/\b(?:string|comment)\b/.test(D.type)) {
var P = i.innerMode(m.getMode(), D.state);
if (P.mode.helperType !== "json") {
D.state = P.state, /^[\w$_]*$/.test(D.string) ? D.end > k.ch && (D.end = k.ch, D.string = D.string.slice(0, k.ch - D.start)) : D = {
start: k.ch,
end: k.ch,
string: "",
state: D.state,
type: D.string == "." ? "property" : null
};
for (var M = D; M.type == "property"; ) {
if (M = E(m, r(k.line, M.start)), M.string != ".")
return;
if (M = E(m, r(k.line, M.start)), !B)
var B = [];
B.push(M);
}
return {
list: w(D, B, y, x),
from: r(k.line, D.start),
to: r(k.line, D.end)
};
}
}
}
function u(m, y) {
return s(
m,
S,
function(E, x) {
return E.getTokenAt(x);
},
y
);
}
i.registerHelper("hint", "javascript", u);
function d(m, y) {
var E = m.getTokenAt(y);
return y.ch == E.start + 1 && E.string.charAt(0) == "." ? (E.end = E.start, E.string = ".", E.type = "property") : /^\.[\w$_]*$/.test(E.string) && (E.type = "property", E.start++, E.string = E.string.replace(/\./, "")), E;
}
function h(m, y) {
return s(m, b, d, y);
}
i.registerHelper("hint", "coffeescript", h);
var p = "charAt charCodeAt indexOf lastIndexOf substring substr slice trim trimLeft trimRight toUpperCase toLowerCase split concat match replace search".split(" "), g = "length concat join splice push pop shift unshift slice reverse sort indexOf lastIndexOf every some filter forEach map reduce reduceRight ".split(" "), _ = "prototype apply call bind".split(" "), S = "break case catch class const continue debugger default delete do else export extends false finally for function if in import instanceof new null return super switch this throw true try typeof var void while with yield".split(" "), b = "and break catch class continue delete do else extends false finally for if in instanceof isnt new no not null of off on or return switch then throw true try typeof until void while with yes".split(" ");
function A(m, y) {
if (!Object.getOwnPropertyNames || !Object.getPrototypeOf)
for (var E in m)
y(E);
else
for (var x = m; x; x = Object.getPrototypeOf(x))
Object.getOwnPropertyNames(x).forEach(y);
}
function w(m, y, E, x) {
var k = [], D = m.string, P = x && x.globalScope || window;
function M(I) {
I.lastIndexOf(D, 0) == 0 && !a(k, I) && k.push(I);
}
function B(I) {
typeof I == "string" ? n(p, M) : I instanceof Array ? n(g, M) : I instanceof Function && n(_, M), A(I, M);
}
if (y && y.length) {
var T = y.pop(), $;
for (T.type && T.type.indexOf("variable") === 0 ? (x && x.additionalContext && ($ = x.additionalContext[T.string]), (!x || x.useGlobalScope !== !1) && ($ = $ || P[T.string])) : T.type == "string" ? $ = "" : T.type == "atom" ? $ = 1 : T.type == "function" && (P.jQuery != null && (T.string == "$" || T.string == "jQuery") && typeof P.jQuery == "function" ? $ = P.jQuery() : P._ != null && T.string == "_" && typeof P._ == "function" && ($ = P._())); $ != null && y.length; )
$ = $[y.pop().string];
$ != null && B($);
} else {
for (var V = m.state.localVars; V; V = V.next)
M(V.name);
for (var z = m.state.context; z; z = z.prev)
for (var V = z.vars; V; V = V.next)
M(V.name);
for (var V = m.state.globalVars; V; V = V.next)
M(V.name);
if (x && x.additionalContext != null)
for (var H in x.additionalContext)
M(H);
(!x || x.useGlobalScope !== !1) && B(P), n(E, M);
}
return k;
}
});
})();
const je = (e, t) => {
const i = e.__vccOpts || e;
for (const [r, n] of t)
i[r] = n;
return i;
}, RE = "[[FORM-CREATE-PREFIX-", DE = "-FORM-CREATE-SUFFIX]]", $E = Ve({
name: "FnEditor",
emits: ["update:modelValue", "change"],
props: {
modelValue: [String, Function],
name: String,
args: Array,
body: Boolean,
button: Boolean,
fnx: Boolean
},
inject: ["designer"],
data() {
return {
editor: null,
fn: "",
visible: !1,
value: ""
};
},
watch: {
modelValue(e) {
e != this.value && (!e || !e.__json || e.__json && e.__json != this.value) && this.editor && this.editor.setValue(this.tidyValue());
}
},
computed: {
t() {
return this.designer.setupState.t;
},
argStr() {
return (this.args || []).map((e) => typeof e == "string" ? e : e.name).join(", ");
},
argList() {
return this.args.map((e) => typeof e == "string" ? {
name: e,
type: "string"
} : e);
}
},
mounted() {
this.$nextTick(() => {
this.load();
});
},
methods: {
save() {
const e = this.editor.getValue() || "";
if (e.trim() === "")
this.fn = "";
else {
let t;
try {
t = new Function("return function (" + this.argStr + `){
` + e + `
}`)();
} catch (i) {
return console.error(i), $n(this.t("struct.errorMsg")), !1;
}
this.body ? this.fn = (this.fnx ? "$FNX:" : "") + e : this.fn = RE + t + DE;
}
return this.submit(), !0;
},
submit() {
this.$emit("update:modelValue", this.fn), this.$emit("change", this.fn), this.value = this.fn, this.visible = !1;
},
trimString(e) {
const t = e.indexOf("{"), i = e.lastIndexOf("}");
return t === -1 || i === -1 || t >= i ? e : e.slice(t + 1, i).replace(/^\n+|\n+$/g, "");
},
tidyValue() {
let e = this.modelValue || "";
return e.__json && (e = e.__json), this.fnx && typeof e == "string" && e.indexOf("$FNX:") === 0 && (e = e.slice(5)), typeof e == "function" ? e = this.trimString(ai(e)).trim() : this.body || (e = this.trimString(e).trim()), this.value = e, e;
},
load() {
this.$nextTick(() => {
let e = this.tidyValue();
this.editor = Xt(nr(this.$refs.editor, {
lineNumbers: !0,
mode: { name: "javascript", globalVars: !0 },
extraKeys: { "Ctrl-Space": "autocomplete" },
line: !0,
tabSize: 2,
lineWrapping: !0,
value: e
})), this.editor.on("inputRead", (t, i) => {
i.keyCode === 32 && i.ctrlKey && nr.showHint(t, nr.hint.javascript);
}), this.editor.on("change", () => {
this.visible = !0;
}), this.editor;
});
}
}
}), IE = { class: "_fd-fn" }, FE = { class: "_fd-fn-tip" }, ME = { class: "cm-keyword" }, PE = { key: 0 }, LE = { class: "_fd-fn-arg" }, NE = {
ref: "editor",
class: "_fd-fn-editor"
};
function BE(e, t, i, r, n, a) {
const s = ie("el-table-column"), u = ie("el-table"), d = ie("el-popover"), h = ie("el-button");
return W(), ae("div", IE, [
Z("div", FE, [
t[2] || (t[2] = Z("div", { class: "_fd-fn-ind" }, null, -1)),
Z("div", ME, [
Z("span", null, [
_e("function " + le(e.name) + "(", 1),
(W(!0), ae(Pe, null, Ge(e.argList, (p, g) => (W(), ae(Pe, null, [
_e(le(g > 0 ? ", " : ""), 1),
p.type === "string" ? (W(), ae("span", PE, le(p.name), 1)) : (W(), ye(d, {
key: 1,
placement: "top-start",
width: 400,
"hide-after": 0,
trigger: "click",
title: p.name,
content: p.info || ""
}, {
reference: N(() => [
Z("span", LE, [
_e(le(p.name), 1),
t[0] || (t[0] = Z("i", { class: "fc-icon icon-question" }, null, -1))
])
]),
default: N(() => [
p.columns ? (W(), ye(u, {
key: 0,
data: p.columns,
border: ""
}, {
default: N(() => [
G(s, {
width: "120",
property: "label",
label: e.t("props.field")
}, null, 8, ["label"]),
G(s, {
property: "info",
label: e.t("event.info")
}, null, 8, ["label"]),
G(s, {
width: "80",
property: "type",
label: e.t("event.type")
}, null, 8, ["label"])
]),
_: 2
}, 1032, ["data"])) : Oe("", !0)
]),
_: 2
}, 1032, ["title", "content"]))
], 64))), 256)),
t[1] || (t[1] = _e(") {"))
])
])
]),
Z("div", NE, null, 512),
t[3] || (t[3] = Z("div", { class: "_fd-fn-tip" }, [
Z("div", { class: "_fd-fn-ind" }),
Z("div", { class: "cm-keyword" }, "}")
], -1)),
e.visible && e.button ? (W(), ye(h, {
key: 0,
type: "primary",
size: "small",
onClick: e.save
}, {
default: N(() => [
_e(le(e.t("props.save")), 1)
]),
_: 1
}, 8, ["onClick"])) : Oe("", !0)
]);
}
const ar = /* @__PURE__ */ je($E, [["render", BE]]);
const VE = Ve({
name: "ConditionInput",
inject: ["designer"],
emits: ["update:modelValue", "change"],
props: {
type: String,
options: Array,
props: Object,
modelValue: [String, Number, Array, Object, Boolean]
},
watch: {
modelValue() {
this.value = this.modelValue || void 0;
}
},
data() {
return {
value: this.modelValue || void 0
};
},
methods: {
onInput() {
this.$emit("update:modelValue", this.value), this.$emit("change", this.value);
}
},
created() {
}
}), jE = { class: "_fd-cdi-input" };
function UE(e, t, i, r, n, a) {
const s = ie("el-cascader"), u = ie("el-input-number"), d = ie("el-option"), h = ie("el-select"), p = ie("el-switch"), g = ie("el-input");
return W(), ae("div", jE, [
e.type === "cascader" ? (W(), ye(s, dn({
key: 0,
size: "default",
props: { checkStrictly: !0, emitPath: !1 }
}, e.props || {}, {
options: e.options,
modelValue: e.value,
"onUpdate:modelValue": t[0] || (t[0] = (_) => e.value = _),
onChange: e.onInput
}), null, 16, ["options", "modelValue", "onChange"])) : e.type === "number" ? (W(), ye(u, dn({
key: 1,
size: "default"
}, e.props || {}, {
modelValue: e.value,
"onUpdate:modelValue": t[1] || (t[1] = (_) => e.value = _),
onChange: e.onInput
}), null, 16, ["modelValue", "onChange"])) : e.type === "select" ? (W(), ye(h, dn({
key: 2,
size: "default",
filterable: "",
"allow-create": "",
"default-first-option": ""
}, e.props || {}, {
modelValue: e.value,
"onUpdate:modelValue": t[2] || (t[2] = (_) => e.value = _),
onChange: e.onInput
}), {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.options, (_) => (W(), ye(d, {
label: _.label,
value: _.value,
key: _.value
}, null, 8, ["label", "value"]))), 128))
]),
_: 1
}, 16, ["modelValue", "onChange"])) : e.type === "switch" ? (W(), ye(p, dn({
key: 3,
size: "default"
}, e.props || {}, {
modelValue: e.value,
"onUpdate:modelValue": t[3] || (t[3] = (_) => e.value = _),
onChange: e.onInput
}), null, 16, ["modelValue", "onChange"])) : (W(), ye(g, dn({
key: 4,
size: "default"
}, e.props || {}, {
modelValue: e.value,
"onUpdate:modelValue": t[4] || (t[4] = (_) => e.value = _),
onBlur: e.onInput
}), null, 16, ["modelValue", "onBlur"]))
]);
}
const zE = /* @__PURE__ */ je(VE, [["render", UE]]);
const HE = Ve({
name: "PatternInput",
emits: ["update:modelValue", "change"],
props: {
size: String,
modelValue: String
},
data() {
return {
value: this.modelValue || "",
options: [
{
label: "\u90AE\u7BB1",
value: "^[a-zA-Z0-9_-]+@[a-zA-Z0-9_-]+(\\.[a-zA-Z0-9_-]+)+$"
},
{
label: "\u57DF\u540D",
value: "^((http:\\/\\/)|(https:\\/\\/))?([a-zA-Z0-9]([a-zA-Z0-9\\-]{0,61}[a-zA-Z0-9])?\\.)+[a-zA-Z]{2,6}(\\/)$"
},
{
label: "\u624B\u673A\u53F7",
value: "^(?:(?:\\+|00)86)?1[3-9]\\d{9}$"
},
{
label: "\u5EA7\u673A\u7535\u8BDD",
value: "^(?:(?:\\d{3}-)?\\d{8}|^(?:\\d{4}-)?\\d{7,8})(?:-\\d+)?$"
},
{
label: "\u8EAB\u4EFD\u8BC1\u53F7",
value: "^[1-9]\\d{5}(?:18|19|20)\\d{2}(?:0[1-9]|10|11|12)(?:0[1-9]|[1-2]\\d|30|31)\\d{3}[\\dXx]$"
},
{
label: "\u94F6\u884C\u5361\u53F7",
value: "^[1-9]\\d{9,29}$"
},
{
label: "\u8F66\u724C\u53F7",
value: "^[\u4EAC\u6D25\u6CAA\u6E1D\u5180\u8C6B\u4E91\u8FBD\u9ED1\u6E58\u7696\u9C81\u65B0\u82CF\u6D59\u8D63\u9102\u6842\u7518\u664B\u8499\u9655\u5409\u95FD\u8D35\u7CA4\u9752\u85CF\u5DDD\u5B81\u743C\u4F7F\u9886][A-HJ-NP-Z][A-HJ-NP-Z0-9]{4,5}[A-HJ-NP-Z0-9\u6302\u5B66\u8B66\u6E2F\u6FB3]$"
},
{
label: "\u4E2D\u6587",
value: "^(?:[\\u3400-\\u4DB5\\u4E00-\\u9FEA\\uFA0E\\uFA0F\\uFA11\\uFA13\\uFA14\\uFA1F\\uFA21\\uFA23\\uFA24\\uFA27-\\uFA29]|[\\uD840-\\uD868\\uD86A-\\uD86C\\uD86F-\\uD872\\uD874-\\uD879][\\uDC00-\\uDFFF]|\\uD869[\\uDC00-\\uDED6\\uDF00-\\uDFFF]|\\uD86D[\\uDC00-\\uDF34\\uDF40-\\uDFFF]|\\uD86E[\\uDC00-\\uDC1D\\uDC20-\\uDFFF]|\\uD873[\\uDC00-\\uDEA1\\uDEB0-\\uDFFF]|\\uD87A[\\uDC00-\\uDFE0])+$"
},
{
label: "\u6570\u5B57",
value: "^\\d+$"
},
{
label: "\u6574\u6570",
value: "^(?:0|(?:-?[1-9]\\d*))$"
},
{
label: "\u6B63\u6574\u6570",
value: "^\\+?[1-9]\\d*$"
},
{
label: "\u8D1F\u6574\u6570",
value: "^-[1-9]\\d*$"
},
{
label: "\u6D6E\u70B9\u6570",
value: "^(-?[1-9]\\d*\\.\\d+|-?0\\.\\d*[1-9])$"
},
{
label: "\u6B63\u6D6E\u70B9\u6570",
value: "^([1-9]\\d*\\.\\d+|-?0\\.\\d*[1-9])$"
},
{
label: "\u8D1F\u6D6E\u70B9\u6570",
value: "^-([1-9]\\d*\\.\\d+|-?0\\.\\d*[1-9])$"
},
{
label: "\u82F1\u6587\u5B57\u6BCD",
value: "^[a-zA-Z]+$"
},
{
label: "\u6570\u5B57\u548C\u5B57\u6BCD",
value: "^[A-Za-z0-9]+$"
}
]
};
},
methods: {
setValue(e) {
this.value = e, this.onInput();
},
onInput() {
this.$emit("update:modelValue", this.value), this.$emit("change", this.value);
}
}
}), WE = { class: "_fd-pattern-input" };
function GE(e, t, i, r, n, a) {
const s = ie("el-dropdown-item"), u = ie("el-dropdown-menu"), d = ie("el-dropdown"), h = ie("el-input");
return W(), ae("div", WE, [
G(h, {
size: e.size,
modelValue: e.value,
"onUpdate:modelValue": t[0] || (t[0] = (p) => e.value = p),
onBlur: e.onInput,
clearable: ""
}, {
append: N(() => [
G(d, {
size: "default",
trigger: "click",
"popper-class": "_fd-pattern-popper"
}, {
dropdown: N(() => [
G(u, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.options, (p) => (W(), ye(s, {
key: p.value,
onClick: (g) => e.setValue(p.value)
}, {
default: N(() => [
_e(le(p.label), 1)
]),
_: 2
}, 1032, ["onClick"]))), 128))
]),
_: 1
})
]),
default: N(() => [
t[1] || (t[1] = Z("i", { class: "fc-icon icon-setting" }, null, -1))
]),
_: 1
})
]),
_: 1
}, 8, ["size", "modelValue", "onBlur"])
]);
}
const Dc = /* @__PURE__ */ je(HE, [["render", GE]]);
const KE = Ve({
name: "RuleSelect",
inject: ["designer"],
emits: ["update:modelValue", "change"],
props: {
modelValue: [String, Number, Array],
onlyField: Boolean,
valueType: String,
size: String,
multiple: Boolean
},
computed: {
activeRule() {
return this.designer.setupState.activeRule;
},
t() {
return this.designer.setupState.t;
},
tree() {
var r, n, a;
const e = this.designer.setupState.activePage;
let t = [];
e.default ? t = this.getFields(this.designer.setupState.treeInfo) : t = this.getFields(e.main.field && e.main === this.activeRule ? this.designer.setupState.treeInfo : this.designer.setupState.treeInfo[0].children);
let i = (r = this.activeRule) == null ? void 0 : r.__fc__.parent;
for (; i; )
if (i.rule === e.main)
i = void 0;
else if (i.rule._menu && ["array", "object", "scope"].indexOf(i.rule._menu.subForm) > -1) {
const s = this.getFields(this.designer.setupState.findTree(i.rule._fc_id));
s.length && t.unshift({
value: "___subform",
disabled: !0,
label: ((a = (n = i.refRule) == null ? void 0 : n.__$title) == null ? void 0 : a.value) || i.rule.title || i.rule._menu.label,
children: s
}), i = void 0;
} else
i = i.parent;
return t;
}
},
methods: {
getFields(e, t = []) {
const i = [];
return e.forEach(({ rule: r, children: n }) => {
var u, d, h;
const a = [...t];
r.field && a.push(r);
const s = ["array", "scope"].indexOf(r._menu.subForm) > -1 ? [] : this.getFields(n || [], a);
if (!this.onlyField || this.onlyField && r.field) {
const p = {
value: t.length ? t.map((g) => g[this.valueType || "_fc_id"]).join(".") + "." + r[this.valueType || "_fc_id"] : r[this.valueType || "_fc_id"],
label: (((h = (d = (u = r == null ? void 0 : r.__fc__) == null ? void 0 : u.refRule) == null ? void 0 : d.__$title) == null ? void 0 : h.value) || r.title || "").trim() || r.props && r.props.label || this.t("com." + (r._menu && r._menu.name) + ".name") || r._menu && r._menu.label || r.type,
rule: r,
parent: t
};
s.length && (p.children = s), i.push(p);
} else
i.push(...s);
}), i;
},
input(e) {
this.$emit("update:modelValue", e), this.$emit("change", e);
}
}
}), YE = {
key: 0,
class: "_fd-rule-select-node"
};
function QE(e, t, i, r, n, a) {
const s = ie("el-tree-select");
return W(), ye(s, {
class: "_fd-rule-select",
modelValue: e.modelValue,
"onUpdate:modelValue": e.input,
size: e.size,
multiple: e.multiple,
checkStrictly: "",
showCheckbox: e.multiple,
data: e.tree
}, {
default: N(({ data: u }) => [
u.value === "___subform" ? (W(), ae("div", YE, [
Z("div", null, le(u.label), 1),
Z("span", null, le(e.t("props.subform")), 1)
])) : (W(), ae(Pe, { key: 1 }, [
_e(le(u.label), 1)
], 64))
]),
_: 1
}, 8, ["modelValue", "onUpdate:modelValue", "size", "multiple", "showCheckbox", "data"]);
}
const $c = /* @__PURE__ */ je(KE, [["render", QE]]);
const JE = Ve({
name: "ValueInput",
emits: ["update:modelValue", "change", "change-type", "blur"],
inject: ["designer"],
props: {
modelValue: [String, Number, Boolean]
},
data() {
return {
type: "1",
value: ""
};
},
computed: {
t() {
return this.designer.setupState.t;
}
},
watch: {
modelValue: {
handler: function(e) {
typeof e == "number" ? this.type = "2" : typeof e == "boolean" ? this.type = "3" : this.type = "1", this.value = e == null ? "" : "" + e;
},
immediate: !0
},
type() {
this.updateValue(this.value), this.$emit("change-type", this.type);
}
},
methods: {
onBlur(...e) {
this.value !== this.toValue(this.modelValue) && this.updateValue(this.value), this.$emit("blur", ...e);
},
updateValue(e) {
const t = this.toValue(e);
this.$emit("update:modelValue", t), this.$emit("change", t);
},
toValue(e) {
return this.type === "1" ? "" + e : this.type === "2" ? parseFloat(e) || 0 : e === "true";
}
}
});
function XE(e, t, i, r, n, a) {
const s = ie("el-option"), u = ie("el-select"), d = ie("el-input");
return W(), ye(d, dn({
class: "_fd-value-input",
modelValue: e.value,
"onUpdate:modelValue": t[1] || (t[1] = (h) => e.value = h),
onBlur: e.onBlur
}, e.$attrs), ii({
prepend: N(() => [
G(u, {
modelValue: e.type,
"onUpdate:modelValue": t[0] || (t[0] = (h) => e.type = h),
style: { width: "60px" }
}, {
default: N(() => [
G(s, {
label: e.t("validate.types.string"),
value: "1"
}, null, 8, ["label"]),
G(s, {
label: e.t("validate.types.number"),
value: "2"
}, null, 8, ["label"]),
G(s, {
label: e.t("validate.types.boolean"),
value: "3"
}, null, 8, ["label"])
]),
_: 1
}, 8, ["modelValue"])
]),
_: 2
}, [
e.$slots.append ? {
name: "append",
fn: N(() => [
kt(e.$slots, "append")
]),
key: "0"
} : void 0
]), 1040, ["modelValue", "onBlur"]);
}
const nu = /* @__PURE__ */ je(JE, [["render", XE]]);
const ZE = Ve({
name: "Warning",
props: {
tooltip: String
},
data() {
return {};
}
}), qE = ["innerHTML"], ex = {
key: 0,
class: "_fd-warning-text"
}, tx = {
key: 1,
class: "fc-icon icon-question"
};
function nx(e, t, i, r, n, a) {
const s = ie("el-tooltip");
return W(), ye(s, {
effect: "dark",
placement: "top-start",
"popper-class": "_fd-warning-pop"
}, {
content: N(() => [
Z("span", { innerHTML: e.tooltip }, null, 8, qE)
]),
default: N(() => [
e.$slots.default ? (W(), ae("span", ex, [
kt(e.$slots, "default")
])) : (W(), ae("i", tx))
]),
_: 3
});
}
const Ei = /* @__PURE__ */ je(ZE, [["render", nx]]);
const ix = Ve({
name: "VariableConfig",
components: { Warning: Ei },
emits: ["submit", "confirm"],
props: {
popover: Boolean
},
inject: ["designer"],
data() {
return {
visible: !1,
activeIdx: 0,
variable: "",
value: {},
fields: [],
expandedKeys: [
"$topForm",
"$cookie",
"$localStorage",
"$sessionStorage",
"$globalData",
"$var"
]
};
},
computed: {
t() {
return this.designer.setupState.t;
},
activeRule() {
return this.designer.setupState.activeRule;
},
eventNum() {
return ((this.activeRule || {})._loadData || []).length;
},
treeInfo() {
var n, a, s, u, d, h;
const e = this.toObject(this.designer.setupState.varList || []), t = [
{
id: "$topForm",
label: this.t("computed.form"),
driver: !0,
children: this.getFormTree(this.designer.setupState.treeInfo)
},
{
id: "$cookie",
label: "cookie"
},
{
id: "$localStorage",
label: "localStorage"
},
{
id: "$sessionStorage",
label: "sessionStorage"
},
{
id: "$globalData",
label: this.t("props.globalData"),
driver: !0,
children: Object.keys(this.designer.setupState.formOptions.globalData || {}).map((p) => ({
label: this.designer.setupState.formOptions.globalData[p].label,
id: p
}))
},
{
id: "$var",
label: this.t("computed.variable.title"),
driver: !0,
children: Object.keys(this.designer.setupState.formOptions.globalVariable || {}).map((p) => ({
label: this.designer.setupState.formOptions.globalVariable[p].label,
id: p
}))
}
], i = this.designer.setupState.activePage;
!i.default && i.main.field && i.main !== this.activeRule && (t[0].id = "$scopeForm", t[0].children.length && (t[0].children = t[0].children[0].children));
let r = (n = this.activeRule) == null ? void 0 : n.__fc__.parent;
for (; r; )
if (r.rule === i.main)
r = void 0;
else if (r.rule._menu && ["array", "object", "scope"].indexOf(r.rule._menu.subForm) > -1) {
const p = this.getFormTree(this.designer.setupState.findTree(r.rule._fc_id));
p.length && t.unshift({
id: "$form",
driver: !0,
label: ((s = (a = r.refRule) == null ? void 0 : a.__$title) == null ? void 0 : s.value) || r.rule.title || r.rule._menu.label,
children: p
}), r = void 0;
} else
r = r.parent;
if (this.designer.setupState.getConfig("showLanguage") !== !1) {
let p = ((u = this.designer.setupState.formOptions) == null ? void 0 : u.language) || {}, g = p[((h = (d = this.designer.props) == null ? void 0 : d.locale) == null ? void 0 : h.name) || "zh-cn"] || p[Object.keys(p)[0]] || {};
t.push({
id: "$t",
label: this.t("language.name"),
driver: !0,
children: Object.keys(g).map((_) => ({
label: g[_],
id: _
}))
});
}
return e.$cookie && (t[1] = { ...t[1], ...e.$cookie }), e.$localStorage && (t[2] = { ...t[2], ...e.$localStorage }), e.$sessionStorage && (t[3] = { ...t[3], ...e.$sessionStorage }), e.$globalData && e.$globalData.children && (t[4].children = Object.values({ ...this.toObject(t[4].children), ...this.toObject(e.$globalData.children || []) })), e.$var && e.$var.children && (t[5].children = Object.values({ ...this.toObject(t[5].children), ...this.toObject(e.$var.children || []) })), delete e.$cookie, delete e.$localStorage, delete e.$sessionStorage, delete e.$globalData, delete e.$var, t.push(...Object.values(e)), t;
}
},
watch: {
visible(e) {
e && (this.updateFields(), this.activeIdx = 0);
}
},
methods: {
openVariableConfig() {
this.designer.setupState.openGlobalVariableDialog();
},
toObject(e) {
const t = {};
return e && e.forEach((i) => {
t[i.id] = i;
}), t;
},
nodeClick(e, t) {
if ((this.popover || this.fields[this.activeIdx]) && !e.driver) {
let i = e.id;
for (t = t.parent; t.level >= 1; )
i = t.data.id + "." + i, t = t.parent;
this.popover ? this.variable = i : this.fields[this.activeIdx].value = i;
}
},
getTitle(e) {
var t, i, r;
return (((r = (i = (t = e == null ? void 0 : e.__fc__) == null ? void 0 : t.refRule) == null ? void 0 : i.__$title) == null ? void 0 : r.value) || e.title || "").trim() || e._menu && e._menu.label || e.field || e._fc_id;
},
getFormTree(e) {
const t = [];
return e.forEach(({ rule: i, children: r }) => {
var a, s, u;
const n = i.field && (!i._menu || i._menu.subForm !== "object") ? [] : this.getFormTree(r || []);
if (i.field) {
const d = {
id: i.field,
label: ((u = (s = (a = i == null ? void 0 : i.__fc__) == null ? void 0 : a.refRule) == null ? void 0 : s.__$title) == null ? void 0 : u.value) || i.title,
rule: i
};
n.length && (d.children = n), t.push(d);
} else
t.push(...n);
}), t;
},
tranField(e) {
return e.indexOf("formCreate") === 0 ? e = Fs(e.replace("formCreate", "")) : e = "props." + e, e.replaceAll(">", ".");
},
updateFields() {
const e = this.designer.setupState, t = [], i = {};
(e.activeRule._loadData || []).forEach((a) => {
i[a.to] = a.attr;
});
const r = [];
e.activeRule.field && r.push({
label: this.t("computed.value.name"),
attach: !0,
modify: !0,
field: "value"
});
const n = e.propsForm.api.model();
Object.keys(n).forEach((a) => {
if (a && (a[0] !== "_" || n[a]._fc_important_prop) && n[a].title && n[a]._fc_important_prop !== !1 && !n[a].hidden && n[a].display !== !1) {
const s = typeof n[a]._fc_important_prop == "string" ? n[a]._fc_important_prop : a;
(n[a]._fc_important_prop === !0 ? r : t).push({
label: n[a].title,
modify: s === "formCreateChild",
field: this.tranField(s)
});
}
}), t.unshift(...r), t.forEach((a) => {
a.value = i[a.field] || "";
}), this.fields = t;
},
open() {
this.visible = !0;
},
active(e) {
this.activeIdx !== e && (this.activeIdx = e);
},
submit() {
const e = [];
this.fields.forEach((t) => {
let i = (t.value || "").trim();
if (i) {
const r = {
attr: i,
to: t.field
};
t.modify && (r.modify = !0), e.push(r);
}
}), this.designer.setupState.activeRule._loadData = e, this.visible = !1;
},
confirm() {
const e = (this.variable || "").trim();
e && (this.$emit("confirm", `{{${e}}}`), this.$refs.pop.hide(), this.variable = "");
}
}
}), rx = { class: "_fd-variable" }, ox = { style: { width: "230px" } }, ax = { class: "_fd-variable-item-label" }, lx = { class: "_fd-variable-info" };
function sx(e, t, i, r, n, a) {
const s = ie("el-input"), u = ie("el-header"), d = ie("el-tree"), h = ie("el-main"), p = ie("el-container"), g = ie("el-popover"), _ = ie("el-badge"), S = ie("Warning"), b = ie("el-aside"), A = ie("el-button"), w = ie("el-dialog");
return W(), ae("div", rx, [
e.popover ? (W(), ye(g, {
key: 0,
ref: "pop",
placement: "bottom",
width: 330,
"hide-after": 0,
trigger: "click",
persistent: !1,
"popper-class": "_fd-variable-pop"
}, {
reference: N(() => t[7] || (t[7] = [
Z("i", {
class: "fc-icon icon-variable",
style: { cursor: "pointer" }
}, null, -1)
])),
default: N(() => [
G(p, { style: { height: "100%" } }, {
default: N(() => [
G(u, {
height: "55px",
class: "_fd-variable-pop-header"
}, {
default: N(() => [
G(s, {
size: "small",
modelValue: e.variable,
"onUpdate:modelValue": t[1] || (t[1] = (m) => e.variable = m)
}, {
prefix: N(() => t[8] || (t[8] = [
Z("span", null, "{{", -1)
])),
suffix: N(() => t[9] || (t[9] = [
_e(" }} ")
])),
append: N(() => [
Z("div", {
onClick: t[0] || (t[0] = (...m) => e.confirm && e.confirm(...m))
}, le(e.t("props.append")), 1)
]),
_: 1
}, 8, ["modelValue"]),
Z("i", {
class: "fc-icon icon-setting",
onClick: t[2] || (t[2] = (...m) => e.openVariableConfig && e.openVariableConfig(...m))
})
]),
_: 1
}),
G(h, null, {
default: N(() => [
G(d, {
ref: "treeRef",
data: e.treeInfo,
"default-expanded-keys": e.expandedKeys,
"expand-on-click-node": !1,
indent: 10,
"node-key": "id",
onNodeClick: e.nodeClick
}, {
default: N(({ node: m, data: y }) => [
Z("div", {
class: qe(["_fd-variable-pop-node", { disabled: y.disabled }])
}, [
Z("div", null, [
Z("span", null, le((y.label || "").trim() || (y.rule ? e.getTitle(y.rule) : y.id)), 1)
]),
Z("span", null, le(y.id), 1)
], 2)
]),
_: 1
}, 8, ["data", "default-expanded-keys", "onNodeClick"])
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}, 512)) : (W(), ae(Pe, { key: 1 }, [
G(_, {
value: e.eventNum,
type: "warning",
hidden: e.eventNum < 1
}, {
default: N(() => [
Z("div", {
class: "_fd-variable-btn",
onClick: t[3] || (t[3] = (...m) => e.open && e.open(...m))
}, [
t[10] || (t[10] = Z("i", { class: "fc-icon icon-variable" }, null, -1)),
_e(le(e.t("computed.variable.bind")), 1)
])
]),
_: 1
}, 8, ["value", "hidden"]),
G(w, {
class: "_fd-variable-dialog _fd-config-dialog",
modelValue: e.visible,
"onUpdate:modelValue": t[6] || (t[6] = (m) => e.visible = m),
"destroy-on-close": "",
"close-on-click-modal": !1,
"append-to-body": "",
width: "980px"
}, {
header: N(() => [
_e(le(e.t("computed.variable.bind")) + " ", 1),
G(S, {
tooltip: e.t("warning.variable")
}, null, 8, ["tooltip"])
]),
footer: N(() => [
Z("div", null, [
G(A, {
size: "default",
onClick: t[5] || (t[5] = (m) => e.visible = !1)
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}),
G(A, {
type: "primary",
size: "default",
onClick: e.submit
}, {
default: N(() => [
_e(le(e.t("props.ok")), 1)
]),
_: 1
}, 8, ["onClick"])
])
]),
default: N(() => [
G(p, {
class: "_fd-variable-con",
style: { height: "600px" }
}, {
default: N(() => [
G(h, null, {
default: N(() => [
G(p, { class: "_fd-variable-l" }, {
default: N(() => [
G(u, null, {
default: N(() => [
Z("div", ox, le(e.t("computed.variable.attr")), 1),
Z("div", null, le(e.t("computed.variable.bind")), 1)
]),
_: 1
}),
G(h, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.fields, (m, y) => (W(), ae("div", {
key: m.label,
class: qe(["_fd-variable-item", { active: y === e.activeIdx, "_fd-variable-top": m.attach === !0 }])
}, [
Z("div", ax, le(m.label), 1),
t[13] || (t[13] = Z("div", null, "=", -1)),
G(s, {
modelValue: m.value,
"onUpdate:modelValue": (E) => m.value = E,
placeholder: "_",
onFocus: (E) => e.activeIdx = y,
clearable: ""
}, {
prefix: N(() => t[11] || (t[11] = [
Z("span", null, "{{", -1)
])),
suffix: N(() => t[12] || (t[12] = [
_e(" }} ")
])),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue", "onFocus"])
], 2))), 128))
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}),
G(b, { style: { width: "328px" } }, {
default: N(() => [
G(p, { class: "_fd-variable-r" }, {
default: N(() => [
G(u, null, {
default: N(() => [
_e(le(e.t("computed.variable.list")) + " ", 1),
Z("i", {
class: "fc-icon icon-setting",
onClick: t[4] || (t[4] = (...m) => e.openVariableConfig && e.openVariableConfig(...m))
})
]),
_: 1
}),
G(h, null, {
default: N(() => [
Z("div", lx, le(e.t("warning.variableInfo")), 1),
G(d, {
ref: "treeRef",
data: e.treeInfo,
"default-expanded-keys": e.expandedKeys,
"expand-on-click-node": !1,
"node-key": "id",
indent: 10,
onNodeClick: e.nodeClick
}, {
default: N(({ node: m, data: y }) => [
Z("div", {
class: qe(["_fd-variable-node", { disabled: y.disabled }])
}, [
Z("div", null, [
Z("span", null, le((y.label || "").trim() || (y.rule ? e.getTitle(y.rule) : y.id)), 1)
]),
Z("span", null, le(y.id), 1)
], 2)
]),
_: 1
}, 8, ["data", "default-expanded-keys", "onNodeClick"])
]),
_: 1
})
]),
_: 1
})
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}, 8, ["modelValue"])
], 64))
]);
}
const al = /* @__PURE__ */ je(ix, [["render", sx]]);
const Lo = {
input: ["==", "!=", "on", "notOn", "empty", "notEmpty", "pattern"],
select: ["==", "!=", "on", "notOn", "empty", "notEmpty"],
switch: ["==", "!="],
number: ["==", "!=", ">", ">=", "<", "<=", "empty", "notEmpty"]
};
Lo.cascader = Lo.select;
const x0 = Ve({
name: "ConditionGroup",
components: { VariableConfig: al, ValueInput: nu, RuleSelect: $c, PatternInput: Dc, ConditionInput: zE },
inject: ["designer"],
emits: ["update:modelValue", "change"],
props: {
modelValue: [Object, Array]
},
computed: {
formulaLabel() {
return ["==", "!=", "on", "notOn", "empty", "notEmpty", "pattern", ">", ">=", "<", "<="].reduce((e, t) => (e[t] = this.t("computed.formulas." + t), e), {});
},
activeRule() {
return this.designer.setupState.activeRule;
},
rules() {
var i;
let e = (i = this.activeRule) == null ? void 0 : i.__fc__.parent, t = [];
for (; e; )
if (e.rule._menu && e.rule._menu.subForm) {
t = this.getFields(this.designer.setupState.findTree(e.rule._fc_id));
break;
} else
e = e.parent;
return [...t, ...this.getFields(this.designer.setupState.treeInfo)];
},
t() {
return this.designer.setupState.t;
}
},
data() {
return {
mode: "AND",
list: [],
ConditionGroup: Xt(x0)
};
},
methods: {
selectVar(e, t) {
e.field = t.slice(2, -2), this.changeField(e);
},
addItem() {
this.list.push({
type: "field"
});
},
addItemGroup() {
this.list.push({ mode: "AND" });
},
removeItem(e) {
this.list.splice(e, 1), this.onInput();
},
changeType(e) {
e.field = "", e.input = null, e.formula = null;
},
changeField(e) {
e.field ? (e.condition = "==", e.type === "field" ? this.tidyItem(e) : (e.input = !0, e.formula = Lo.select.map((t) => ({
label: this.formulaLabel[t],
value: t
})))) : (e.input = null, e.formula = null), this.onInput();
},
getFields(e, t = []) {
const i = [];
return e.forEach(({ rule: r, children: n }) => {
const a = [...t];
r.field && a.push(r);
const s = this.getFields(n || [], a);
if (r.field) {
const u = {
field: r.field,
value: t.length ? t.map((d) => d.field).join(".") + "." + r.field : r.field,
label: r.title,
rule: r
};
i.push(u, ...s);
} else
i.push(...s);
}), i;
},
tidyValue() {
let e = this.modelValue;
e && (Array.isArray(e) && (e = {
mode: "AND",
group: e
}), this.mode = e.mode === "OR" ? "OR" : "AND", this.list = (e.group || []).map((t) => t.mode != null ? t : this.tidyItem({ ...t }))), this.list.length || this.list.push({ type: "field" }, { type: "field" });
},
tidyItem(e) {
return e.variable ? (e.input = !0, e.field = e.variable, e.formula = Lo.select.map((t) => ({
label: this.formulaLabel[t],
value: t
})), e.type = "variable", e) : (e.type = "field", this.rules.forEach((t) => {
if (t.value === e.field || t.field === e.field) {
const i = t.rule._menu.condition, r = i ? St.Function(i) ? i(t.rule) : St.String(i) ? {
type: i
} : { ...i } : {
type: "input"
};
r.options && (r.options = St.String(r.options) ? zo(t.rule.__fc__.prop, r.options) : r.options), e.formula = (Lo[r.type] || Lo.input).map((n) => ({
label: this.formulaLabel[n],
value: n
})), e.var = !!e.compare, e.input = r;
}
}), e);
},
onInput() {
let e = [];
this.list.forEach((t) => {
if (t.field && t.condition && (t.compare || ["empty", "notEmpty"].indexOf(t.condition) > -1 || t.value != null && t.value !== "")) {
const i = {
[t.type]: t.field,
condition: t.condition
};
t.compare && t.var ? i.compare = t.compare : i.value = t.value, e.push(i);
} else
t.group && e.push(t);
}), e.length === 1 && e[0].mode != null ? e = e[0] : e = e.length > 0 ? {
mode: this.mode,
group: e
} : void 0, !(!e && (!this.modelValue || !this.modelValue.group)) && (this.$emit("update:modelValue", e), this.$emit("change", e));
}
},
created() {
this.tidyValue();
}
}), ux = x0, dx = { class: "_fd-cdg-input" }, fx = { class: "_fd-cdg-item" }, cx = { class: "_fd-cdg-and" }, px = { class: "_fd-cdg-options" }, hx = ["onClick"], mx = {
key: 3,
class: "_fd-cfg-value"
}, vx = ["onClick"], gx = { class: "_fd-cdg-btns" };
function yx(e, t, i, r, n, a) {
const s = ie("el-option"), u = ie("el-select"), d = ie("ConditionGroup", !0), h = ie("VariableConfig"), p = ie("el-input"), g = ie("RuleSelect"), _ = ie("ValueInput"), S = ie("PatternInput"), b = ie("ConditionInput"), A = ie("el-checkbox"), w = ie("el-button");
return W(), ae("div", dx, [
Z("div", fx, [
Z("div", cx, [
e.list.length > 0 ? (W(), ye(u, {
key: 0,
size: "default",
modelValue: e.mode,
"onUpdate:modelValue": t[0] || (t[0] = (m) => e.mode = m),
onChange: e.onInput
}, {
default: N(() => [
G(s, {
label: "AND",
value: "AND"
}),
G(s, {
label: "OR",
value: "OR"
})
]),
_: 1
}, 8, ["modelValue", "onChange"])) : Oe("", !0)
]),
Z("div", px, [
(W(!0), ae(Pe, null, Ge(e.list, (m, y) => (W(), ae(Pe, null, [
m.mode != null ? (W(), ae("div", {
class: "_fd-cdg-option is-group",
key: m.field + "a" + y + e.list.length
}, [
G(d, {
modelValue: e.list[y],
"onUpdate:modelValue": (E) => e.list[y] = E,
onChange: e.onInput
}, null, 8, ["modelValue", "onUpdate:modelValue", "onChange"]),
Z("i", {
class: qe(["fc-icon icon-add-circle", { disabled: e.list.length === 1 }]),
onClick: (E) => e.removeItem(y)
}, null, 10, hx)
])) : (W(), ae("div", {
class: "_fd-cdg-option",
key: y
}, [
G(u, {
style: { width: "85px" },
size: "default",
modelValue: m.type,
"onUpdate:modelValue": (E) => m.type = E,
onChange: (E) => e.changeType(m)
}, {
default: N(() => [
G(s, {
label: e.t("props.field"),
value: "field"
}, null, 8, ["label"]),
G(s, {
label: e.t("props.variable"),
value: "variable"
}, null, 8, ["label"])
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue", "onChange"]),
m.type === "variable" ? (W(), ye(p, {
class: "_fd-cdg-variable",
size: "default",
modelValue: m.field,
"onUpdate:modelValue": (E) => m.field = E,
clearable: "",
onChange: (E) => e.changeField(m),
key: "variable"
}, {
suffix: N(() => [
G(h, {
popover: "",
onConfirm: (E) => e.selectVar(m, E)
}, null, 8, ["onConfirm"])
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue", "onChange"])) : (W(), ye(g, {
class: "_fd-cdg-field",
size: "default",
onlyField: "",
valueType: "field",
modelValue: m.field,
"onUpdate:modelValue": (E) => m.field = E,
clearable: "",
multiple: !1,
onChange: (E) => e.changeField(m),
key: "field"
}, null, 8, ["modelValue", "onUpdate:modelValue", "onChange"])),
m.formula ? (W(), ye(u, {
key: 2,
class: "_fd-cdg-term",
size: "default",
modelValue: m.condition,
"onUpdate:modelValue": (E) => m.condition = E,
onChange: e.onInput
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(m.formula, (E) => (W(), ye(s, {
key: E.value,
label: E.label,
value: E.value
}, null, 8, ["label", "value"]))), 128))
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue", "onChange"])) : Oe("", !0),
m.input && ["empty", "notEmpty"].indexOf(m.condition) === -1 ? (W(), ae("div", mx, [
m.var ? (W(), ye(g, {
key: 0,
class: "_fd-cdg-field",
size: "default",
onlyField: "",
valueType: "field",
modelValue: m.compare,
"onUpdate:modelValue": (E) => m.compare = E,
clearable: "",
multiple: !1,
onChange: e.onInput
}, null, 8, ["modelValue", "onUpdate:modelValue", "onChange"])) : m.type === "variable" ? (W(), ye(_, {
key: 1,
size: "default",
modelValue: m.value,
"onUpdate:modelValue": (E) => m.value = E,
onChange: e.onInput
}, null, 8, ["modelValue", "onUpdate:modelValue", "onChange"])) : m.condition === "pattern" ? (W(), ye(S, {
size: "default",
key: m.field,
modelValue: m.value,
"onUpdate:modelValue": (E) => m.value = E,
onChange: e.onInput
}, null, 8, ["modelValue", "onUpdate:modelValue", "onChange"])) : (W(), ye(b, dn({
key: 3,
ref_for: !0
}, m.input, {
key: m.field,
modelValue: m.value,
"onUpdate:modelValue": (E) => m.value = E,
onChange: e.onInput
}), null, 16, ["modelValue", "onUpdate:modelValue", "onChange"])),
G(A, {
modelValue: m.var,
"onUpdate:modelValue": (E) => m.var = E,
size: "default",
label: e.t("props.field")
}, null, 8, ["modelValue", "onUpdate:modelValue", "label"])
])) : Oe("", !0),
Z("i", {
class: "fc-icon icon-delete",
onClick: (E) => e.removeItem(y)
}, null, 8, vx)
]))
], 64))), 256))
])
]),
Z("div", gx, [
G(w, {
link: "",
type: "primary",
onClick: e.addItem
}, {
default: N(() => [
t[1] || (t[1] = Z("i", { class: "fc-icon icon-add-circle" }, null, -1)),
_e(" " + le(e.t("computed.addCondition")), 1)
]),
_: 1
}, 8, ["onClick"]),
G(w, {
link: "",
type: "primary",
onClick: e.addItemGroup
}, {
default: N(() => [
t[2] || (t[2] = Z("i", { class: "fc-icon icon-add-circle" }, null, -1)),
_e(" " + le(e.t("computed.addGroup")), 1)
]),
_: 1
}, 8, ["onClick"])
])
]);
}
const bx = /* @__PURE__ */ je(ux, [["render", yx]]);
const _x = Ve({
name: "ComputedConfig",
components: { Warning: Ei, RuleSelect: $c, ConditionGroup: bx },
props: {
modelValue: [String, Object, Array],
type: String,
title: String,
name: String,
btn: String,
validLabel: String,
invertLabel: String
},
inject: ["designer"],
data() {
const e = (t, i, r, n = []) => {
const a = [];
return t.forEach(({ rule: s, children: u }) => {
var g, _, S;
const d = [...n];
let h = r;
s.field && (d.push(s), h || (h = s.field === i && this.type === "value"));
const p = e(u || [], i, h, d);
if (s.field) {
const b = {
value: s.field,
label: ((S = (_ = (g = s == null ? void 0 : s.__fc__) == null ? void 0 : g.refRule) == null ? void 0 : _.__$title) == null ? void 0 : S.value) || s.title,
rule: s,
parent: n,
formula: !0
};
p.length && (b.children = p), a.push(b);
} else
a.push(...p);
}), a;
};
return {
editor: null,
visible: !1,
expandedKeys: [
"_form",
"_formula",
"_subform"
],
err: "",
status: "computed",
value: "",
condition: void 0,
formulaInfo: "",
formulaExample: "",
oldValue: "",
invert: !1,
linkage: "",
getFields: e
};
},
computed: {
t() {
return this.designer.setupState.t;
},
configured() {
return !!this.modelValue;
},
activeRule() {
return this.designer.setupState.activeRule;
},
treeInfo() {
var n, a, s;
let e = (n = this.activeRule) == null ? void 0 : n.__fc__.parent;
const t = this.designer.setupState.activePage;
let i = [];
t.default ? i = this.getFields(this.designer.setupState.treeInfo, this.activeRule.field) : i = this.getFields(t.main.field && t.main === this.activeRule ? this.designer.setupState.treeInfo : this.designer.setupState.treeInfo[0].children, this.activeRule.field);
const r = [
{
id: "_form",
label: this.t("computed.form"),
children: i
},
{
id: "_formula",
label: this.t("computed.formula"),
children: b0.map((u) => ({
label: this.t("formula." + u.key),
children: u.children.map((d) => ({
label: d,
info: this.t("formula." + d),
example: oc[d] || "",
formula: !0
}))
}))
}
];
for (; e; )
if (e.rule === t.main)
e = void 0;
else if (e.rule._menu && ["array", "object"].indexOf(e.rule._menu.subForm) > -1) {
const u = this.getFields(this.designer.setupState.findTree(e.rule._fc_id), this.activeRule.field);
u.length && r.unshift({
id: "_subform",
label: ((s = (a = e == null ? void 0 : e.refRule) == null ? void 0 : a.__$title) == null ? void 0 : s.value) || e.rule.title || e.rule._menu.label,
children: u
}), e = void 0;
} else
e = e.parent;
return r;
}
},
watch: {
visible(e) {
e && this.update();
},
status(e) {
e === "computed" && this.load();
}
},
beforeUnmount() {
document.querySelector("._fd-comp-script") && document.querySelector("._fd-comp-script").removeEventListener("mouseover", this.spanOver);
},
methods: {
update() {
this.linkage = "", this.type === "value" || this.modelValue && St.String(this.modelValue) ? (this.status = "computed", this.load(), this.condition = void 0) : (this.status = "condition", this.condition = this.modelValue ? At(this.modelValue) : void 0, this.condition && (this.invert = this.condition.invert === !0, this.linkage = this.condition.linkage || ""));
},
getTitle(e) {
var t, i, r;
return (((r = (i = (t = e == null ? void 0 : e.__fc__) == null ? void 0 : t.refRule) == null ? void 0 : i.__$title) == null ? void 0 : r.value) || e.title || "").trim() || e._menu && e._menu.label || e.field || e._fc_id;
},
setField(e) {
e.disabled !== !0 && this.markRule(`"${e.rule.field}"`, this.getTitle(e.rule), "id");
},
spanOver(e) {
if (e.target.classList.contains("cm-keyword")) {
const t = e.target.innerText.trim();
this.formulaInfo = this.t("formula." + t) || "", this.formulaExample = oc[t] || "";
}
},
nodeOver(e) {
this.formulaInfo = e.info || "", this.formulaExample = e.example || "";
},
markRule(e, t, i) {
const r = this.editor.getValue();
if (r) {
const s = this.editor.getCursor().ch;
[" ", "(", ",", ")", "{", "}", "[", "]"].indexOf(r.substr(s - 1, 1)) === -1 && this.editor.replaceRange(" ", this.editor.getCursor());
}
this.editor.replaceRange(e, this.editor.getCursor());
const n = this.editor.getCursor(), a = document.createElement("span");
a.innerText = t, a.classList.add("cm-fc-" + i), this.editor.markText({
line: n.line,
ch: n.ch - e.length
}, n, {
replacedWith: a
});
},
nodeClick(e) {
if (!(!e.formula || e.disabled === !0)) {
if (e.rule) {
const t = [], i = [];
let r = !1;
if (e.parent.forEach((n) => {
n._menu && n._menu.subForm === "array" && (r = !0), t.push(n.field), i.push(this.getTitle(n));
}), r)
return this.setColumn(e);
t.push(e.rule.field), i.push(this.getTitle(e.rule)), this.markRule(t.join("."), i.join("."), "field");
} else
this.editor.replaceRange(e.label + "()", this.editor.getCursor()), this.editor.moveH(-1, "char");
this.editor.focus();
}
},
setColumn(e) {
let t = !1;
const i = [], r = [], n = [];
e.parent.forEach((a) => {
t ? n.push(a) : (t = a._menu && a._menu.subForm === "array", i.push(a.field), r.push(this.getTitle(a)));
}), n.push(e.rule), n.reverse().forEach((a) => {
this.nodeClick({ label: "COLUMN", formula: !0 }), this.editor.replaceRange(",", this.editor.getCursor()), this.setField({ rule: a }), this.editor.moveH(-1 - a.field.length - 2, "char");
}), this.markRule(i.join("."), r.join("."), "field");
},
submit() {
if (this.status === "computed") {
const e = this.editor.getValue().trim();
(this.oldValue !== e || !St.String(this.modelValue)) && (this.oldValue = e, this.$emit("update:modelValue", e));
} else {
let e = this.condition ? { ...this.condition } : this.condition;
e && (this.type === "linkage" ? this.linkage ? e.linkage = this.linkage : e = "" : this.invert ? e.invert = !0 : delete e.invert), this.$emit("update:modelValue", e || "");
}
this.visible = !1;
},
setValue(e) {
const t = this.designer.setupState.fields().map(Kg);
e = e.replace(new RegExp(`["'](${t.join("|")})(\\.(${t.join("|")}))*(?![a-zA-Z0-9_$])["']`, "g"), (i) => "__var___" + i + "__var__"), e = e.replace(new RegExp(`(?<!__var___")(${t.join("|")})(\\.(${t.join("|")}))*(?![a-zA-Z0-9_$])`, "g"), (i) => "__var___" + i + "__var__"), e.split("__var__").forEach((i) => {
let r;
if (i.indexOf("_") === 0) {
i = i.slice(1);
const n = ["'", '"'].indexOf(i[0]) > -1;
n && (i = i.slice(1).slice(0, -1));
let a = 0;
if (i.indexOf(".") > -1) {
const s = i.split(".");
i = s.pop(), a = s.length;
}
if (r = this.designer.setupState.dragForm.api.all().filter((s) => s && s.field === i)[0], r) {
if (n)
this.setField({ rule: r });
else {
const s = [r.field], u = [this.getTitle(r)];
let d = r.__fc__.parent;
for (; d && a > 0; )
d.input && (a--, s.unshift(d.rule.field), u.unshift(this.getTitle(d.rule))), d = d.parent;
this.markRule(s.join("."), u.join("."), "field");
}
return;
}
}
this.editor.replaceRange(i, this.editor.getCursor());
});
},
load() {
this.value = St.String(this.modelValue) ? this.modelValue : "", this.oldValue = this.value, this.err = this.formulaInfo = "", this.$nextTick(() => {
document.querySelector("._fd-comp-script").addEventListener("mouseover", this.spanOver), this.editor = Xt(nr(this.$refs.editor, {
lineNumbers: !0,
mode: "fcComputedMode",
line: !0,
tabSize: 2,
lineWrapping: !0,
value: "",
extraKeys: {
Enter: function() {
return !1;
}
}
})), this.setValue(this.value || ""), this.editor.on("beforeChange", (e, t) => {
if (t.origin === "paste") {
const i = t.text[0] || "";
i && this.setValue(i), t.cancel();
}
}), this.editor;
});
}
}
}), wx = { class: "_fd-computed" }, Ax = { class: "_fd-comp-title" }, Cx = {
class: "_fd-comp-title",
style: { "margin-top": "30px" }
}, Sx = { class: "_fd-comp-linkage" }, Ex = {
class: "_fd-comp-title",
style: { "margin-top": "30px" }
}, xx = ["onMouseover"], Tx = {
key: 0,
class: "_group"
}, kx = {
key: 1,
class: "_subform"
}, Ox = ["onClick"], Rx = {
key: 0,
ref: "editor",
class: "_fd-comp-script"
}, Dx = {
key: 0,
class: "_fd-comp-info"
}, $x = { key: 0 }, Ix = { key: 1 }, Fx = {
key: 2,
style: { color: "#f56c6c" }
};
function Mx(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-badge"), d = ie("Warning"), h = ie("el-tab-pane"), p = ie("el-tabs"), g = ie("ConditionGroup"), _ = ie("RuleSelect"), S = ie("el-radio"), b = ie("el-radio-group"), A = ie("el-main"), w = ie("el-container"), m = ie("el-tree"), y = ie("el-aside"), E = ie("el-header"), x = ie("el-dialog");
return W(), ae("div", wx, [
G(u, {
type: "warning",
"is-dot": "",
hidden: !e.configured
}, {
default: N(() => [
G(s, {
class: "_fd-plain-button",
plain: "",
onClick: t[0] || (t[0] = (k) => e.visible = !0),
size: "small"
}, {
default: N(() => [
_e(le(e.btn || e.title), 1)
]),
_: 1
})
]),
_: 1
}, 8, ["hidden"]),
G(x, {
class: "_fd-comp-dialog _fd-config-dialog",
title: e.title,
modelValue: e.visible,
"onUpdate:modelValue": t[6] || (t[6] = (k) => e.visible = k),
"destroy-on-close": "",
"close-on-click-modal": !1,
"append-to-body": "",
width: "980px"
}, {
footer: N(() => [
Z("div", null, [
G(s, {
onClick: t[5] || (t[5] = (k) => e.visible = !1),
size: "default"
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}),
G(s, {
type: "primary",
onClick: e.submit,
size: "default"
}, {
default: N(() => [
_e(le(e.t("props.ok")), 1)
]),
_: 1
}, 8, ["onClick"])
])
]),
default: N(() => [
e.type !== "value" ? (W(), ye(p, {
key: 0,
class: "_fd-preview-tabs",
modelValue: e.status,
"onUpdate:modelValue": t[1] || (t[1] = (k) => e.status = k)
}, {
default: N(() => [
G(h, { name: "condition" }, {
label: N(() => [
_e(le(e.type === "linkage" ? e.t("computed.value.title") : e.t("computed.condition")) + " ", 1),
G(d, {
tooltip: e.t("warning.computedCondition")
}, null, 8, ["tooltip"])
]),
_: 1
}),
G(h, { name: "computed" }, {
label: N(() => [
_e(le(e.t("computed.name")) + " ", 1),
G(d, {
tooltip: e.t("warning.computedFormula")
}, null, 8, ["tooltip"])
]),
_: 1
})
]),
_: 1
}, 8, ["modelValue"])) : Oe("", !0),
e.status === "condition" ? (W(), ye(w, {
key: 1,
class: "_fd-comp-condition"
}, {
default: N(() => [
G(A, null, {
default: N(() => [
Z("div", Ax, le(e.t("computed.setting")), 1),
e.visible ? (W(), ye(g, {
key: 0,
modelValue: e.condition,
"onUpdate:modelValue": t[2] || (t[2] = (k) => e.condition = k),
ref: "condition"
}, null, 8, ["modelValue"])) : Oe("", !0),
e.type === "linkage" ? (W(), ae(Pe, { key: 1 }, [
Z("div", Cx, le(e.t("computed.linkage.trigger")), 1),
Z("div", Sx, [
_e(le(e.t("computed.linkage.info.0")) + " ", 1),
G(_, {
modelValue: e.linkage,
"onUpdate:modelValue": t[3] || (t[3] = (k) => e.linkage = k),
size: "small",
onlyField: "",
valueType: "field",
clearable: ""
}, null, 8, ["modelValue"]),
_e(" " + le(e.t("computed.linkage.info.1")), 1)
])
], 64)) : (W(), ae(Pe, { key: 2 }, [
Z("div", Ex, le(e.t("computed.invert")), 1),
G(b, {
modelValue: e.invert,
"onUpdate:modelValue": t[4] || (t[4] = (k) => e.invert = k)
}, {
default: N(() => [
G(S, { value: !0 }, {
default: N(() => [
_e(le(e.invertLabel), 1)
]),
_: 1
}),
G(S, { value: !1 }, {
default: N(() => [
_e(le(e.validLabel), 1)
]),
_: 1
})
]),
_: 1
}, 8, ["modelValue"])
], 64))
]),
_: 1
})
]),
_: 1
})) : (W(), ye(w, {
key: 2,
class: "_fd-comp-con"
}, {
default: N(() => [
G(y, null, {
default: N(() => [
G(m, {
ref: "treeRef",
data: e.treeInfo,
"default-expanded-keys": e.expandedKeys,
"expand-on-click-node": !1,
"node-key": "id",
indent: 10,
onNodeClick: e.nodeClick
}, {
default: N(({ node: k, data: D }) => [
Z("div", {
class: qe(["_fd-comp-node", { disabled: D.disabled }]),
onMouseover: (P) => e.nodeOver(D)
}, [
Z("div", null, [
D.rule ? (W(), ae(Pe, { key: 0 }, [
D.rule._menu.subForm === "object" ? (W(), ae("span", Tx, "{ " + le(e.t("props.group")) + " }", 1)) : Oe("", !0),
D.rule._menu.subForm === "array" ? (W(), ae("span", kx, "[ " + le(e.t("props.collection")) + " ]", 1)) : Oe("", !0)
], 64)) : Oe("", !0),
Z("span", null, le(D.rule ? e.getTitle(D.rule) : (D.label || "").trim()), 1)
]),
D.rule ? (W(), ae("span", {
key: 0,
class: "_fd-comp-id",
onClick: vt((P) => e.setField(D), ["stop"])
}, " ID ", 8, Ox)) : Oe("", !0)
], 42, xx)
]),
_: 1
}, 8, ["data", "default-expanded-keys", "onNodeClick"])
]),
_: 1
}),
G(A, null, {
default: N(() => [
G(w, { class: "_fd-comp-r" }, {
default: N(() => [
G(E, {
class: "_fd-comp-head",
height: "40px"
}, {
default: N(() => [
_e(le(e.name || e.title), 1)
]),
_: 1
}),
G(A, null, {
default: N(() => [
e.visible ? (W(), ae("div", Rx, null, 512)) : Oe("", !0)
]),
_: 1
}),
e.formulaInfo || e.err ? (W(), ae("div", Dx, [
e.formulaInfo ? (W(), ae("div", $x, le(e.t("computed.formulaInfo")) + ": " + le(e.formulaInfo), 1)) : Oe("", !0),
e.formulaExample ? (W(), ae("div", Ix, le(e.t("computed.formulaExample")) + ": " + le(e.formulaExample), 1)) : Oe("", !0),
e.err ? (W(), ae("div", Fx, le(e.t("validate.message")) + ": " + le(e.err), 1)) : Oe("", !0)
])) : Oe("", !0)
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}))
]),
_: 1
}, 8, ["title", "modelValue"])
]);
}
const T0 = /* @__PURE__ */ je(_x, [["render", Mx]]);
const Ts = "$FNX:", bv = (e) => St.String(e) && e.indexOf(Ts) === 0, Px = Ve({
name: "EventConfig",
emits: ["update:modelValue"],
props: {
modelValue: [Object, void 0, null],
componentName: "",
hook: {
type: Boolean,
default: !0
},
eventName: {
type: Array,
default: () => []
}
},
inject: ["designer"],
components: {
Warning: Ei,
ComputedConfig: T0,
FnEditor: ar,
fcDraggable: Go,
DragForm: tt.$form()
},
data() {
return {
visible: !1,
activeData: null,
activeBehavior: null,
val: null,
defActive: "no",
hookList: ["hook_load", "hook_mounted", "hook_deleted", "hook_watch", "hook_value", "hook_hidden"],
event: [],
cus: !1,
cusValue: "",
eventType: "fn",
eventKey: "",
eventStr: "",
eventNum: 0,
id: 0,
form: {
rule: [],
options: {
form: {
labelPosition: "right",
size: "small",
labelWidth: "auto"
},
appendValue: !1,
submitBtn: !1
},
api: {},
formData: {}
}
};
},
computed: {
useEventKeys() {
const e = {};
return this.event.forEach((t) => {
e[t.name] = !0;
}), Object.keys(e);
},
behaviorMenu() {
const e = [];
return _0.forEach((t) => {
e.push({
label: t.key,
children: t.children.map((i) => ({
label: i,
value: i
}))
});
}), e;
},
t() {
return this.designer.setupState.t;
},
activeRule() {
return this.designer.setupState.activeRule;
},
eventInfo() {
const e = {};
return this.eventName.forEach((t) => {
e[t] = this.t("com." + this.componentName + ".event." + t) || this.t("eventInfo." + t) || "";
}), this.hookList.forEach((t) => {
e[t] = this.t("eventInfo." + t) || "";
}), e;
},
globalEvent() {
return this.designer.setupState.formOptions.globalEvent || {};
},
options() {
return Object.keys(this.globalEvent).map((e) => ({
label: this.globalEvent[e].label,
value: "$GLOBAL:" + e
}));
},
fnArgs() {
return [In(this.t)];
}
},
watch: {
visible(e) {
e ? this.init() : (this.destroy(), this.closeCus());
}
},
methods: {
openConfig() {
this.designer.setupState.openGlobalEventDialog();
},
addCus() {
const e = this.cusValue && this.cusValue.trim();
e && (this.closeCus(), this.add(e));
},
closeCus() {
this.cus = !1, this.cusValue = "";
},
cusEvent() {
this.cus = !0;
},
loadFnStr(e) {
if (bv(e))
return e.replace(Ts, "");
if (St.Function(e)) {
const t = e.__json || "";
return t ? bv(t) ? t.replace(Ts, "") : t : "" + e;
} else if (e && e.indexOf("$GLOBAL:") === 0)
return e;
},
parseBehavior(e) {
if (e.id = this.id++, e.method === "callback") {
const t = this.loadFnStr(e.callback);
t && (e.callback = t);
}
return e;
},
init() {
const e = this.activeRule ? At(this.activeRule.$behavior || {}) : {}, t = this.activeRule ? { ...this.activeRule.hook || {} } : {}, i = { ...At(this.modelValue || {}) };
Object.keys(t).forEach((n) => {
i["hook_" + n] = t[n];
});
const r = [];
Object.keys(i).forEach((n) => {
(Array.isArray(i[n]) ? i[n] : [i[n]]).forEach((s) => {
const u = {
name: n,
id: this.id++
}, d = this.loadFnStr(s);
d && (u.handle = d), u.behaviors = (e[n] || []).map(this.parseBehavior), delete e[n], r.push(u);
});
}), Object.keys(e).forEach((n) => {
r.push({
name: n,
id: this.id++,
handle: "",
behaviors: (e[n] || []).map(this.parseBehavior)
});
}), this.event = r, this.eventNum = r.length;
},
getValue() {
const e = {}, t = {}, i = {};
let r = 0;
return this.event.forEach((n) => {
let a = !1;
if (n.handle) {
a = !0;
let s = e;
const u = n.handle.indexOf("$GLOBAL:") !== 0 ? Ts + n.handle : n.handle;
n.name.indexOf("hook_") > -1 ? i[n.name.replace("hook_", "")] = u : (s[n.name] || (s[n.name] = []), s[n.name].push(u));
}
n.behaviors && n.behaviors.length && (a = !0, t[n.name] = n.behaviors.map((s) => (delete s.id, s))), a && r++;
}), Object.keys(e).forEach((n) => {
e[n] = e[n].length === 1 ? e[n][0] : e[n];
}), { on: e, behaviors: t, hooks: i, num: r };
},
add(e) {
this.event.push({
name: e,
id: this.id++,
behaviors: []
}), this.activeData || this.edit(this.event.length - 1);
},
edit(e) {
this.defActive !== this.event[e].id && (this.destroy(), this.activeData = this.event[e], this.val = this.activeData.handle || "", this.eventType = this.val.indexOf("$GLOBAL:") === 0 ? "event" : "fn", this.eventType === "event" ? (this.eventKey = this.val, this.eventStr = "") : (this.eventStr = this.val, this.eventKey = ""), this.defActive = this.activeData.id);
},
rm(e) {
this.event.splice(e, 1), (this.activeData && this.defActive === this.activeData.id || this.activeBehavior && e === this.activeBehavior.pid) && this.destroy();
},
save() {
return new Promise((e) => {
if (this.activeData) {
let t = this.eventKey;
if (this.eventType !== "event") {
if (!this.$refs.fn.save())
return !1;
t = this.eventStr;
}
this.activeData.handle = t, this.destroy(), e();
} else if (this.activeBehavior) {
const t = (i) => {
this.activeBehavior.config = { ...i || {} };
const r = { ...this.activeBehavior }, n = r.pid;
Object.keys(r.config).length || delete r.config, delete r.pid, this.event[n].behaviors.forEach((a, s) => {
a.id === r.id && (this.event[n].behaviors[s] = r);
});
};
this.form.rule && this.form.rule.length ? this.form.api.validate().then(() => {
t(this.form.formData), this.destroy(), e();
}).catch(() => {
}) : (t(), this.destroy(), e());
} else
e();
});
},
addBehavior(e) {
this.event[e].behaviors.push({
method: "openModel",
id: this.id++,
ignoreError: !1,
stopPropagation: "",
expression: ""
}), !this.activeData && !this.activeBehavior && this.editBehavior(e, this.event[e].behaviors.length - 1);
},
editBehavior(e, t) {
this.destroy(), this.activeBehavior = At(this.event[e].behaviors[t]), this.activeBehavior.pid = e, this.defActive = this.activeBehavior.id, this.updateBehaviorForm();
},
updateBehaviorForm() {
let e = w0[this.activeBehavior.method];
St.Function(e) && (e = e(this.designer.setupState));
const t = (i) => {
i.field && !i.title && (i.title = this.t("behavior." + this.activeBehavior.method + ".props." + i.field) || this.t("behavior.props." + i.field) || this.t("props." + i.field), i.warning = this.t("behavior." + this.activeBehavior.method + ".warning." + i.field));
};
e ? (this.form.rule = e.map((i) => (t(i), i.control && i.control.forEach((r) => {
r.rule && r.rule.forEach((n) => {
t(n);
});
}), i)), this.$nextTick(() => {
this.form.api.setValue(this.activeBehavior.config || {});
})) : this.clearBehaviorForm();
},
clearBehaviorForm() {
this.form.rule = [], this.form.formData = {};
},
rmBehavior(e, t) {
this.event[e].behaviors.splice(t, 1), this.activeBehavior && this.defActive === this.activeBehavior.id && this.destroy();
},
handleSelect(e) {
this.activeBehavior.method !== e && (this.activeBehavior.method = e, this.updateBehaviorForm());
},
destroy() {
this.activeBehavior = null, this.activeData = null, this.val = null, this.defActive = null, this.clearBehaviorForm();
},
close() {
this.destroy();
},
submit() {
this.save().then(() => {
const { on: e, behaviors: t, num: i, hooks: r } = this.getValue();
this.$emit("update:modelValue", e), this.activeRule.$behavior = t, this.activeRule.hook = r, this.visible = !1, this.eventNum = i;
});
}
},
beforeCreate() {
window.$inject = {
$f: {},
rule: [],
self: {},
option: {},
inject: {},
args: []
};
},
created() {
this.init();
}
}), Lx = { class: "_fd-event" }, Nx = { class: "_fd-event-item" }, Bx = {
key: 0,
class: "_fd-label"
}, Vx = { class: "_fd-event-item" }, jx = { class: "_fd-label" }, Ux = { class: "_fd-menu" }, zx = ["onClick"], Hx = { class: "_fd-event-method" }, Wx = {
key: 0,
class: "_fd-label"
}, Gx = ["onClick"], Kx = ["onClick"], Yx = { class: "_fd-event-behaviors" }, Qx = ["onClick"], Jx = { class: "_fd-event-behavior-label" }, Xx = ["onClick"], Zx = { class: "_fd-event-behavior-info" }, qx = {
key: 0,
class: "_fd-menu-item",
style: { "padding-left": "10px" }
}, e2 = { class: "_fd-event-title" }, t2 = { class: "_fd-event-select" }, n2 = { class: "_fd-event-behavior-title" }, i2 = { class: "_fd-event-behavior-title" }, r2 = {
key: 0,
class: "_fd-event-behavior-title"
}, o2 = { class: "_fd-event-behavior-title" }, a2 = { class: "_fd-form-item-warning" }, l2 = { class: "_fd-form-item-warning" }, s2 = { class: "_fd-form-item-warning" };
function u2(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-badge"), d = ie("el-dropdown-item"), h = ie("el-dropdown-menu"), p = ie("el-dropdown"), g = ie("el-header"), _ = ie("el-tooltip"), S = ie("fcDraggable"), b = ie("el-input"), A = ie("el-main"), w = ie("el-container"), m = ie("el-aside"), y = ie("FnEditor"), E = ie("el-tab-pane"), x = ie("el-option"), k = ie("el-select"), D = ie("el-tabs"), P = ie("el-menu-item"), M = ie("el-sub-menu"), B = ie("el-menu"), T = ie("Warning"), $ = ie("DragForm"), V = ie("el-radio-button"), z = ie("el-radio-group"), H = ie("el-form-item"), I = ie("ComputedConfig"), U = ie("el-form"), F = ie("el-dialog");
return W(), ae("div", Lx, [
G(u, {
value: e.eventNum,
type: "warning",
hidden: e.eventNum < 1
}, {
default: N(() => [
G(s, {
class: "_fd-plain-button",
plain: "",
size: "small",
onClick: t[0] || (t[0] = (C) => e.visible = !0)
}, {
default: N(() => [
_e(le(e.t("event.title")), 1)
]),
_: 1
})
]),
_: 1
}, 8, ["value", "hidden"]),
G(F, {
class: "_fd-event-dialog _fd-config-dialog",
title: e.t("event.title"),
modelValue: e.visible,
"onUpdate:modelValue": t[14] || (t[14] = (C) => e.visible = C),
"destroy-on-close": "",
"close-on-click-modal": !1,
"append-to-body": "",
width: "1080px"
}, {
footer: N(() => [
Z("div", null, [
G(s, {
size: "default",
onClick: t[13] || (t[13] = (C) => e.visible = !1)
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}),
G(s, {
type: "primary",
size: "default",
onClick: e.submit
}, {
default: N(() => [
_e(le(e.t("props.ok")), 1)
]),
_: 1
}, 8, ["onClick"])
])
]),
default: N(() => [
G(w, {
class: "_fd-event-con",
style: { height: "600px" }
}, {
default: N(() => [
G(m, { style: { width: "300px" } }, {
default: N(() => [
G(w, { class: "_fd-event-l" }, {
default: N(() => [
G(g, {
class: "_fd-event-head",
height: "40px"
}, {
default: N(() => [
G(p, {
"popper-class": "_fd-event-dropdown",
trigger: "click",
size: "default",
placement: "bottom-start"
}, {
dropdown: N(() => [
G(h, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.eventName, (C) => (W(), ye(d, {
key: C,
onClick: (q) => e.add(C),
disabled: e.useEventKeys.indexOf(C) > -1
}, {
default: N(() => [
Z("div", Nx, [
Z("span", null, le(C), 1),
e.eventInfo[C] ? (W(), ae("span", Bx, le(e.eventInfo[C]), 1)) : Oe("", !0)
])
]),
_: 2
}, 1032, ["onClick", "disabled"]))), 128)),
(W(!0), ae(Pe, null, Ge(e.hookList, (C, q) => (W(), ye(d, {
divided: e.eventName.length > 0 && !q,
onClick: (X) => e.add(C),
disabled: e.useEventKeys.indexOf(C) > -1
}, {
default: N(() => [
Z("div", Vx, [
Z("div", null, le(C), 1),
Z("span", jx, le(e.eventInfo[C]), 1)
])
]),
_: 2
}, 1032, ["divided", "onClick", "disabled"]))), 256)),
G(d, {
divided: e.eventName.length > 0 || e.hook,
onClick: e.cusEvent
}, {
default: N(() => [
Z("div", null, le(e.t("props.custom")), 1)
]),
_: 1
}, 8, ["divided", "onClick"])
]),
_: 1
})
]),
default: N(() => [
G(s, {
link: "",
type: "primary",
size: "default"
}, {
default: N(() => [
_e(le(e.t("event.create")), 1),
t[15] || (t[15] = Z("i", {
class: "fc-icon icon-down",
style: { "font-size": "14px" }
}, null, -1))
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}),
G(A, null, {
default: N(() => [
Z("div", Ux, [
(W(!0), ae(Pe, null, Ge(e.event, (C, q) => (W(), ae("div", {
key: C.id,
class: qe(["_fd-menu-item", { "is-active": C.id === e.defActive }])
}, [
Z("div", {
class: "_fd-event-title",
onClick: vt((X) => e.edit(q), ["stop"])
}, [
Z("div", Hx, [
Z("span", null, [
t[16] || (t[16] = _e("function")),
Z("span", null, le(C.name), 1)
]),
e.eventInfo[C.name] ? (W(), ae("span", Wx, le(e.eventInfo[C.name]), 1)) : Oe("", !0)
]),
C.name !== "hook_load" ? (W(), ye(_, {
key: 0,
effect: "dark",
content: e.t("behavior.add"),
placement: "top",
"hide-after": 0
}, {
default: N(() => [
Z("i", {
class: "fc-icon icon-task-add",
onClick: vt((X) => e.addBehavior(q), ["stop"])
}, null, 8, Gx)
]),
_: 2
}, 1032, ["content"])) : Oe("", !0),
Z("i", {
class: "fc-icon icon-delete-circle",
onClick: vt((X) => e.rm(q), ["stop"])
}, null, 8, Kx)
], 8, zx),
Z("div", Yx, [
G(S, {
group: { name: "behavior", put: !1 },
sort: !0,
handle: ".icon-drag",
direction: "vertical",
animation: 0,
itemKey: "_fc_id",
list: C.behaviors
}, {
item: N(({ element: X, index: Y }) => [
Z("div", {
class: qe(["_fd-event-behavior", { "is-active": X.id === e.defActive }]),
onClick: vt((ue) => e.editBehavior(q, Y), ["stop"])
}, [
Z("div", Jx, [
Z("div", null, [
t[17] || (t[17] = Z("i", { class: "fc-icon icon-drag" }, null, -1)),
Z("span", null, le(e.t("behavior." + X.method + ".name")), 1)
]),
Z("i", {
class: "fc-icon icon-delete-circle",
onClick: vt((ue) => e.rmBehavior(q, Y), ["stop"])
}, null, 8, Xx)
]),
Z("div", Zx, le(e.t("behavior." + X.method + ".info") || e.t("behavior." + X.method + ".name")), 1)
], 10, Qx)
]),
_: 2
}, 1032, ["list"])
])
], 2))), 128)),
e.cus ? (W(), ae("div", qx, [
Z("div", e2, [
G(b, {
type: "text",
modelValue: e.cusValue,
"onUpdate:modelValue": t[1] || (t[1] = (C) => e.cusValue = C),
size: "default",
onKeydown: nl(e.addCus, ["enter"]),
placeholder: e.t("event.placeholder")
}, null, 8, ["modelValue", "onKeydown", "placeholder"]),
Z("div", null, [
Z("i", {
class: "fc-icon icon-add",
onClick: t[2] || (t[2] = vt((...C) => e.addCus && e.addCus(...C), ["stop"]))
}),
Z("i", {
class: "fc-icon icon-delete",
onClick: t[3] || (t[3] = vt((...C) => e.closeCus && e.closeCus(...C), ["stop"]))
})
])
])
])) : Oe("", !0)
])
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}),
G(A, null, {
default: N(() => [
G(w, { class: "_fd-event-r" }, {
default: N(() => [
e.activeData || e.activeBehavior ? (W(), ye(g, {
key: 0,
class: "_fd-event-head",
height: "40px"
}, {
default: N(() => [
G(s, {
size: "small",
onClick: e.close
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}, 8, ["onClick"]),
G(s, {
size: "small",
type: "primary",
onClick: e.save
}, {
default: N(() => [
_e(le(e.t("props.save")), 1)
]),
_: 1
}, 8, ["onClick"])
]),
_: 1
})) : Oe("", !0),
e.activeData ? (W(), ye(A, { key: 1 }, {
default: N(() => [
(W(), ye(D, {
modelValue: e.eventType,
"onUpdate:modelValue": t[7] || (t[7] = (C) => e.eventType = C),
class: "_fc-tabs",
key: e.activeData.key
}, {
default: N(() => [
G(E, {
label: e.t("props.custom"),
name: "fn",
lazy: ""
}, {
default: N(() => [
G(y, {
ref: "fn",
modelValue: e.eventStr,
"onUpdate:modelValue": t[4] || (t[4] = (C) => e.eventStr = C),
body: "",
name: e.activeData.name,
args: e.fnArgs,
style: { height: "519px" }
}, null, 8, ["modelValue", "name", "args"])
]),
_: 1
}, 8, ["label"]),
G(E, {
label: e.t("form.globalEvent"),
name: "event"
}, {
default: N(() => [
Z("div", t2, [
G(k, {
modelValue: e.eventKey,
"onUpdate:modelValue": t[5] || (t[5] = (C) => e.eventKey = C),
clearable: "",
filterable: "",
style: { width: "240px", "margin-left": "15px" }
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.options, (C) => (W(), ye(x, {
key: C.value,
label: C.label,
value: C.value
}, null, 8, ["label", "value"]))), 128))
]),
_: 1
}, 8, ["modelValue"]),
Z("span", {
class: "_fc-manage-text",
onClick: t[6] || (t[6] = (...C) => e.openConfig && e.openConfig(...C))
}, t[18] || (t[18] = [
Z("i", { class: "fc-icon icon-setting" }, null, -1)
]))
])
]),
_: 1
}, 8, ["label"])
]),
_: 1
}, 8, ["modelValue"]))
]),
_: 1
})) : Oe("", !0),
e.activeBehavior ? (W(), ye(A, {
key: 2,
class: "is-behavior"
}, {
default: N(() => [
G(m, {
width: "220px",
class: "_fd-event-behavior-list"
}, {
default: N(() => [
Z("div", n2, le(e.t("behavior.props.execute")), 1),
G(B, {
defaultActive: e.activeBehavior.method,
onSelect: e.handleSelect
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.behaviorMenu, (C) => (W(), ye(M, {
index: C.label
}, {
title: N(() => [
Z("span", null, le(e.t("props." + C.label)), 1)
]),
default: N(() => [
(W(!0), ae(Pe, null, Ge(C.children, (q) => (W(), ye(P, {
key: q.value,
index: q.value
}, {
default: N(() => [
_e(le(e.t("behavior." + q.label + ".name")), 1)
]),
_: 2
}, 1032, ["index"]))), 128))
]),
_: 2
}, 1032, ["index"]))), 256))
]),
_: 1
}, 8, ["defaultActive", "onSelect"])
]),
_: 1
}),
G(A, { class: "_fd-event-behavior-con" }, {
default: N(() => [
Z("div", i2, [
_e(le(e.t("behavior.props.info")) + " ", 1),
Z("div", null, le(e.t("behavior." + e.activeBehavior.method + ".info") || e.t("behavior." + e.activeBehavior.method + ".name")), 1)
]),
e.form.rule && e.form.rule.length ? (W(), ae("div", r2, le(e.t("designer.rule")), 1)) : Oe("", !0),
e.form.rule && e.form.rule.length ? (W(), ye($, {
key: 1,
rule: e.form.rule,
option: e.form.options,
modelValue: e.form.formData,
"onUpdate:modelValue": t[8] || (t[8] = (C) => e.form.formData = C),
api: e.form.api,
"onUpdate:api": t[9] || (t[9] = (C) => e.form.api = C)
}, {
title: N((C) => [
C.rule.warning ? (W(), ye(T, {
key: 0,
tooltip: C.rule.warning
}, {
default: N(() => [
_e(le(C.rule.title), 1)
]),
_: 2
}, 1032, ["tooltip"])) : (W(), ae(Pe, { key: 1 }, [
_e(le(C.rule.title), 1)
], 64))
]),
_: 1
}, 8, ["rule", "option", "modelValue", "api"])) : Oe("", !0),
Z("div", o2, le(e.t("designer.advanced")), 1),
G(U, {
size: "small",
labelWidth: "auto"
}, {
default: N(() => [
G(H, {
label: e.t("behavior.props.ignoreError")
}, {
default: N(() => [
G(z, {
modelValue: e.activeBehavior.ignoreError,
"onUpdate:modelValue": t[10] || (t[10] = (C) => e.activeBehavior.ignoreError = C)
}, {
default: N(() => [
G(V, { value: !0 }, {
default: N(() => [
_e(le(e.t("behavior.props.continue")), 1)
]),
_: 1
}),
G(V, { value: !1 }, {
default: N(() => [
_e(le(e.t("behavior.props.stop")), 1)
]),
_: 1
})
]),
_: 1
}, 8, ["modelValue"]),
Z("div", a2, le(e.t("warning.behaviorIgnoreError")), 1)
]),
_: 1
}, 8, ["label"]),
G(H, {
label: e.t("behavior.props.expression")
}, {
default: N(() => [
G(I, {
modelValue: e.activeBehavior.expression,
"onUpdate:modelValue": t[11] || (t[11] = (C) => e.activeBehavior.expression = C),
title: e.t("behavior.props.setFormula"),
invertLabel: e.t("behavior.props.break"),
validLabel: e.t("behavior.props.continue")
}, null, 8, ["modelValue", "title", "invertLabel", "validLabel"]),
Z("div", l2, le(e.t("warning.behaviorExpression")), 1)
]),
_: 1
}, 8, ["label"]),
G(H, {
label: e.t("behavior.props.stopPropagation")
}, {
default: N(() => [
G(I, {
modelValue: e.activeBehavior.stopPropagation,
"onUpdate:modelValue": t[12] || (t[12] = (C) => e.activeBehavior.stopPropagation = C),
title: e.t("behavior.props.setFormula"),
invertLabel: e.t("behavior.props.continue"),
validLabel: e.t("behavior.props.stop")
}, null, 8, ["modelValue", "title", "invertLabel", "validLabel"]),
Z("div", s2, le(e.t("warning.behaviorStopPropagation")), 1)
]),
_: 1
}, 8, ["label"])
]),
_: 1
})
]),
_: 1
})
]),
_: 1
})) : Oe("", !0)
]),
_: 1
})
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}, 8, ["title", "modelValue"])
]);
}
const k0 = /* @__PURE__ */ je(Px, [["render", u2]]), O0 = Ve({
name: "VNode",
props: {
fn: Function
},
render() {
const e = this.fn();
return Array.isArray(e) ? tn(Pe, {}, e) : e;
}
});
function zs(e, t) {
var i = null;
return function(...r) {
i !== null && clearTimeout(i), i = setTimeout(() => e.call(this, ...r), t);
};
}
/*!
Highlight.js v11.9.0 (git: b7ec4bfafc)
(c) 2006-2024 undefined and other contributors
License: BSD-3-Clause
*/
function R0(e) {
return e instanceof Map ? e.clear = e.delete = e.set = () => {
throw Error("map is read-only");
} : e instanceof Set && (e.add = e.clear = e.delete = () => {
throw Error("set is read-only");
}), Object.freeze(e), Object.getOwnPropertyNames(e).forEach((t) => {
const i = e[t], r = typeof i;
r !== "object" && r !== "function" || Object.isFrozen(i) || R0(i);
}), e;
}
class _v {
constructor(t) {
t.data === void 0 && (t.data = {}), this.data = t.data, this.isMatchIgnored = !1;
}
ignoreMatch() {
this.isMatchIgnored = !0;
}
}
function D0(e) {
return e.replace(/&/g, "&amp;").replace(/</g, "&lt;").replace(/>/g, "&gt;").replace(/"/g, "&quot;").replace(/'/g, "&#x27;");
}
function xr(e, ...t) {
const i = /* @__PURE__ */ Object.create(null);
for (const r in e)
i[r] = e[r];
return t.forEach((r) => {
for (const n in r)
i[n] = r[n];
}), i;
}
const wv = (e) => !!e.scope;
class d2 {
constructor(t, i) {
this.buffer = "", this.classPrefix = i.classPrefix, t.walk(this);
}
addText(t) {
this.buffer += D0(t);
}
openNode(t) {
if (!wv(t))
return;
const i = ((r, { prefix: n }) => {
if (r.startsWith("language:"))
return r.replace("language:", "language-");
if (r.includes(".")) {
const a = r.split(".");
return [`${n}${a.shift()}`, ...a.map((s, u) => `${s}${"_".repeat(u + 1)}`)].join(" ");
}
return `${n}${r}`;
})(t.scope, { prefix: this.classPrefix });
this.span(i);
}
closeNode(t) {
wv(t) && (this.buffer += "</span>");
}
value() {
return this.buffer;
}
span(t) {
this.buffer += `<span class="${t}">`;
}
}
const Av = (e = {}) => {
const t = { children: [] };
return Object.assign(t, e), t;
};
class Ic {
constructor() {
this.rootNode = Av(), this.stack = [this.rootNode];
}
get top() {
return this.stack[this.stack.length - 1];
}
get root() {
return this.rootNode;
}
add(t) {
this.top.children.push(t);
}
openNode(t) {
const i = Av({ scope: t });
this.add(i), this.stack.push(i);
}
closeNode() {
if (this.stack.length > 1)
return this.stack.pop();
}
closeAllNodes() {
for (; this.closeNode(); )
;
}
toJSON() {
return JSON.stringify(this.rootNode, null, 4);
}
walk(t) {
return this.constructor._walk(t, this.rootNode);
}
static _walk(t, i) {
return typeof i == "string" ? t.addText(i) : i.children && (t.openNode(i), i.children.forEach((r) => this._walk(t, r)), t.closeNode(i)), t;
}
static _collapse(t) {
typeof t != "string" && t.children && (t.children.every((i) => typeof i == "string") ? t.children = [t.children.join("")] : t.children.forEach((i) => {
Ic._collapse(i);
}));
}
}
class f2 extends Ic {
constructor(t) {
super(), this.options = t;
}
addText(t) {
t !== "" && this.add(t);
}
startScope(t) {
this.openNode(t);
}
endScope() {
this.closeNode();
}
__addSublanguage(t, i) {
const r = t.root;
i && (r.scope = "language:" + i), this.add(r);
}
toHTML() {
return new d2(this, this.options).value();
}
finalize() {
return this.closeAllNodes(), !0;
}
}
function el(e) {
return e ? typeof e == "string" ? e : e.source : null;
}
function $0(e) {
return Jr("(?=", e, ")");
}
function c2(e) {
return Jr("(?:", e, ")*");
}
function p2(e) {
return Jr("(?:", e, ")?");
}
function Jr(...e) {
return e.map((t) => el(t)).join("");
}
function Fc(...e) {
return "(" + (((i) => {
const r = i[i.length - 1];
return typeof r == "object" && r.constructor === Object ? (i.splice(i.length - 1, 1), r) : {};
})(e).capture ? "" : "?:") + e.map((i) => el(i)).join("|") + ")";
}
function I0(e) {
return RegExp(e.toString() + "|").exec("").length - 1;
}
const h2 = /\[(?:[^\\\]]|\\.)*\]|\(\??|\\([1-9][0-9]*)|\\./;
function lc(e, { joinWith: t }) {
let i = 0;
return e.map((r) => {
i += 1;
const n = i;
let a = el(r), s = "";
for (; a.length > 0; ) {
const u = h2.exec(a);
if (!u) {
s += a;
break;
}
s += a.substring(0, u.index), a = a.substring(u.index + u[0].length), u[0][0] === "\\" && u[1] ? s += "\\" + (Number(u[1]) + n) : (s += u[0], u[0] === "(" && i++);
}
return s;
}).map((r) => `(${r})`).join(t);
}
const Cv = "[a-zA-Z]\\w*", xf = "[a-zA-Z_]\\w*", Sv = "\\b\\d+(\\.\\d+)?", Ev = "(-?)(\\b0[xX][a-fA-F0-9]+|(\\b\\d+(\\.\\d*)?|\\.\\d+)([eE][-+]?\\d+)?)", xv = "\\b(0b[01]+)", Xa = {
begin: "\\\\[\\s\\S]",
relevance: 0
}, m2 = {
scope: "string",
begin: "'",
end: "'",
illegal: "\\n",
contains: [Xa]
}, v2 = {
scope: "string",
begin: '"',
end: '"',
illegal: "\\n",
contains: [Xa]
}, iu = (e, t, i = {}) => {
const r = xr({
scope: "comment",
begin: e,
end: t,
contains: []
}, i);
r.contains.push({
scope: "doctag",
begin: "[ ]*(?=(TODO|FIXME|NOTE|BUG|OPTIMIZE|HACK|XXX):)",
end: /(TODO|FIXME|NOTE|BUG|OPTIMIZE|HACK|XXX):/,
excludeBegin: !0,
relevance: 0
});
const n = Fc("I", "a", "is", "so", "us", "to", "at", "if", "in", "it", "on", /[A-Za-z]+['](d|ve|re|ll|t|s|n)/, /[A-Za-z]+[-][a-z]+/, /[A-Za-z][a-z]{2,}/);
return r.contains.push({ begin: Jr(/[ ]+/, "(", n, /[.]?[:]?([.][ ]|[ ])/, "){3}") }), r;
}, g2 = iu("//", "$"), y2 = iu("/\\*", "\\*/"), b2 = iu("#", "$");
var ss = Object.freeze({
__proto__: null,
APOS_STRING_MODE: m2,
BACKSLASH_ESCAPE: Xa,
BINARY_NUMBER_MODE: {
scope: "number",
begin: xv,
relevance: 0
},
BINARY_NUMBER_RE: xv,
COMMENT: iu,
C_BLOCK_COMMENT_MODE: y2,
C_LINE_COMMENT_MODE: g2,
C_NUMBER_MODE: {
scope: "number",
begin: Ev,
relevance: 0
},
C_NUMBER_RE: Ev,
END_SAME_AS_BEGIN: (e) => Object.assign(e, {
"on:begin": (t, i) => {
i.data._beginMatch = t[1];
},
"on:end": (t, i) => {
i.data._beginMatch !== t[1] && i.ignoreMatch();
}
}),
HASH_COMMENT_MODE: b2,
IDENT_RE: Cv,
MATCH_NOTHING_RE: /\b\B/,
METHOD_GUARD: { begin: "\\.\\s*" + xf, relevance: 0 },
NUMBER_MODE: { scope: "number", begin: Sv, relevance: 0 },
NUMBER_RE: Sv,
PHRASAL_WORDS_MODE: {
begin: /\b(a|an|the|are|I'm|isn't|don't|doesn't|won't|but|just|should|pretty|simply|enough|gonna|going|wtf|so|such|will|you|your|they|like|more)\b/
},
QUOTE_STRING_MODE: v2,
REGEXP_MODE: {
scope: "regexp",
begin: /\/(?=[^/\n]*\/)/,
end: /\/[gimuy]*/,
contains: [Xa, { begin: /\[/, end: /\]/, relevance: 0, contains: [Xa] }]
},
RE_STARTERS_RE: "!|!=|!==|%|%=|&|&&|&=|\\*|\\*=|\\+|\\+=|,|-|-=|/=|/|:|;|<<|<<=|<=|<|===|==|=|>>>=|>>=|>=|>>>|>>|>|\\?|\\[|\\{|\\(|\\^|\\^=|\\||\\|=|\\|\\||~",
SHEBANG: (e = {}) => {
const t = /^#![ ]*\//;
return e.binary && (e.begin = Jr(t, /.*\b/, e.binary, /\b.*/)), xr({
scope: "meta",
begin: t,
end: /$/,
relevance: 0,
"on:begin": (i, r) => {
i.index !== 0 && r.ignoreMatch();
}
}, e);
},
TITLE_MODE: { scope: "title", begin: Cv, relevance: 0 },
UNDERSCORE_IDENT_RE: xf,
UNDERSCORE_TITLE_MODE: { scope: "title", begin: xf, relevance: 0 }
});
function _2(e, t) {
e.input[e.index - 1] === "." && t.ignoreMatch();
}
function w2(e, t) {
e.className !== void 0 && (e.scope = e.className, delete e.className);
}
function A2(e, t) {
t && e.beginKeywords && (e.begin = "\\b(" + e.beginKeywords.split(" ").join("|") + ")(?!\\.)(?=\\b|\\s)", e.__beforeBegin = _2, e.keywords = e.keywords || e.beginKeywords, delete e.beginKeywords, e.relevance === void 0 && (e.relevance = 0));
}
function C2(e, t) {
Array.isArray(e.illegal) && (e.illegal = Fc(...e.illegal));
}
function S2(e, t) {
if (e.match) {
if (e.begin || e.end)
throw Error("begin & end are not supported with match");
e.begin = e.match, delete e.match;
}
}
function E2(e, t) {
e.relevance === void 0 && (e.relevance = 1);
}
const x2 = (e, t) => {
if (!e.beforeMatch)
return;
if (e.starts)
throw Error("beforeMatch cannot be used with starts");
const i = Object.assign({}, e);
Object.keys(e).forEach((r) => {
delete e[r];
}), e.keywords = i.keywords, e.begin = Jr(i.beforeMatch, $0(i.begin)), e.starts = {
relevance: 0,
contains: [Object.assign(i, { endsParent: !0 })]
}, e.relevance = 0, delete i.beforeMatch;
}, T2 = ["of", "and", "for", "in", "not", "or", "if", "then", "parent", "list", "value"], k2 = "keyword";
function F0(e, t, i = k2) {
const r = /* @__PURE__ */ Object.create(null);
return typeof e == "string" ? n(i, e.split(" ")) : Array.isArray(e) ? n(i, e) : Object.keys(e).forEach((a) => {
Object.assign(r, F0(e[a], t, a));
}), r;
function n(a, s) {
t && (s = s.map((u) => u.toLowerCase())), s.forEach((u) => {
const d = u.split("|");
r[d[0]] = [a, O2(d[0], d[1])];
});
}
}
function O2(e, t) {
return t ? Number(t) : ((i) => T2.includes(i.toLowerCase()))(e) ? 0 : 1;
}
const Tv = {}, zr = (e) => {
console.error(e);
}, kv = (e, ...t) => {
console.log("WARN: " + e, ...t);
}, Oo = (e, t) => {
Tv[`${e}/${t}`] || (console.log(`Deprecated as of ${e}. ${t}`), Tv[`${e}/${t}`] = !0);
}, us = Error();
function Ov(e, t, { key: i }) {
let r = 0;
const n = e[i], a = {}, s = {};
for (let u = 1; u <= t.length; u++)
s[u + r] = n[u], a[u + r] = !0, r += I0(t[u - 1]);
e[i] = s, e[i]._emit = a, e[i]._multi = !0;
}
function R2(e) {
((t) => {
t.scope && typeof t.scope == "object" && t.scope !== null && (t.beginScope = t.scope, delete t.scope);
})(e), typeof e.beginScope == "string" && (e.beginScope = {
_wrap: e.beginScope
}), typeof e.endScope == "string" && (e.endScope = {
_wrap: e.endScope
}), ((t) => {
if (Array.isArray(t.begin)) {
if (t.skip || t.excludeBegin || t.returnBegin)
throw zr("skip, excludeBegin, returnBegin not compatible with beginScope: {}"), us;
if (typeof t.beginScope != "object" || t.beginScope === null)
throw zr("beginScope must be object"), us;
Ov(t, t.begin, { key: "beginScope" }), t.begin = lc(t.begin, { joinWith: "" });
}
})(e), ((t) => {
if (Array.isArray(t.end)) {
if (t.skip || t.excludeEnd || t.returnEnd)
throw zr("skip, excludeEnd, returnEnd not compatible with endScope: {}"), us;
if (typeof t.endScope != "object" || t.endScope === null)
throw zr("endScope must be object"), us;
Ov(t, t.end, { key: "endScope" }), t.end = lc(t.end, { joinWith: "" });
}
})(e);
}
function D2(e) {
function t(n, a) {
return RegExp(el(n), "m" + (e.case_insensitive ? "i" : "") + (e.unicodeRegex ? "u" : "") + (a ? "g" : ""));
}
class i {
constructor() {
this.matchIndexes = {}, this.regexes = [], this.matchAt = 1, this.position = 0;
}
addRule(a, s) {
s.position = this.position++, this.matchIndexes[this.matchAt] = s, this.regexes.push([s, a]), this.matchAt += I0(a) + 1;
}
compile() {
this.regexes.length === 0 && (this.exec = () => null);
const a = this.regexes.map((s) => s[1]);
this.matcherRe = t(lc(a, {
joinWith: "|"
}), !0), this.lastIndex = 0;
}
exec(a) {
this.matcherRe.lastIndex = this.lastIndex;
const s = this.matcherRe.exec(a);
if (!s)
return null;
const u = s.findIndex((h, p) => p > 0 && h !== void 0), d = this.matchIndexes[u];
return s.splice(0, u), Object.assign(s, d);
}
}
class r {
constructor() {
this.rules = [], this.multiRegexes = [], this.count = 0, this.lastIndex = 0, this.regexIndex = 0;
}
getMatcher(a) {
if (this.multiRegexes[a])
return this.multiRegexes[a];
const s = new i();
return this.rules.slice(a).forEach(([u, d]) => s.addRule(u, d)), s.compile(), this.multiRegexes[a] = s, s;
}
resumingScanAtSamePosition() {
return this.regexIndex !== 0;
}
considerAll() {
this.regexIndex = 0;
}
addRule(a, s) {
this.rules.push([a, s]), s.type === "begin" && this.count++;
}
exec(a) {
const s = this.getMatcher(this.regexIndex);
s.lastIndex = this.lastIndex;
let u = s.exec(a);
if (this.resumingScanAtSamePosition() && !(u && u.index === this.lastIndex)) {
const d = this.getMatcher(0);
d.lastIndex = this.lastIndex + 1, u = d.exec(a);
}
return u && (this.regexIndex += u.position + 1, this.regexIndex === this.count && this.considerAll()), u;
}
}
if (e.compilerExtensions || (e.compilerExtensions = []), e.contains && e.contains.includes("self"))
throw Error("ERR: contains `self` is not supported at the top-level of a language. See documentation.");
return e.classNameAliases = xr(e.classNameAliases || {}), function n(a, s) {
const u = a;
if (a.isCompiled)
return u;
[w2, S2, R2, x2].forEach((h) => h(a, s)), e.compilerExtensions.forEach((h) => h(a, s)), a.__beforeBegin = null, [A2, C2, E2].forEach((h) => h(a, s)), a.isCompiled = !0;
let d = null;
return typeof a.keywords == "object" && a.keywords.$pattern && (a.keywords = Object.assign({}, a.keywords), d = a.keywords.$pattern, delete a.keywords.$pattern), d = d || /\w+/, a.keywords && (a.keywords = F0(a.keywords, e.case_insensitive)), u.keywordPatternRe = t(d, !0), s && (a.begin || (a.begin = /\B|\b/), u.beginRe = t(u.begin), a.end || a.endsWithParent || (a.end = /\B|\b/), a.end && (u.endRe = t(u.end)), u.terminatorEnd = el(u.end) || "", a.endsWithParent && s.terminatorEnd && (u.terminatorEnd += (a.end ? "|" : "") + s.terminatorEnd)), a.illegal && (u.illegalRe = t(a.illegal)), a.contains || (a.contains = []), a.contains = [].concat(...a.contains.map((h) => ((p) => (p.variants && !p.cachedVariants && (p.cachedVariants = p.variants.map((g) => xr(p, {
variants: null
}, g))), p.cachedVariants ? p.cachedVariants : M0(p) ? xr(p, {
starts: p.starts ? xr(p.starts) : null
}) : Object.isFrozen(p) ? xr(p) : p))(h === "self" ? a : h))), a.contains.forEach((h) => {
n(h, u);
}), a.starts && n(a.starts, s), u.matcher = ((h) => {
const p = new r();
return h.contains.forEach((g) => p.addRule(g.begin, {
rule: g,
type: "begin"
})), h.terminatorEnd && p.addRule(h.terminatorEnd, {
type: "end"
}), h.illegal && p.addRule(h.illegal, { type: "illegal" }), p;
})(u), u;
}(e);
}
function M0(e) {
return !!e && (e.endsWithParent || M0(e.starts));
}
class $2 extends Error {
constructor(t, i) {
super(t), this.name = "HTMLInjectionError", this.html = i;
}
}
const Tf = D0, Rv = xr, Dv = Symbol("nomatch"), P0 = (e) => {
const t = /* @__PURE__ */ Object.create(null), i = /* @__PURE__ */ Object.create(null), r = [];
let n = !0;
const a = "Could not find the language '{}', did you forget to load/include a language module?", s = {
disableAutodetect: !0,
name: "Plain text",
contains: []
};
let u = {
ignoreUnescapedHTML: !1,
throwUnescapedHTML: !1,
noHighlightRe: /^(no-?highlight)$/i,
languageDetectRe: /\blang(?:uage)?-([\w-]+)\b/i,
classPrefix: "hljs-",
cssSelector: "pre code",
languages: null,
__emitter: f2
};
function d(E) {
return u.noHighlightRe.test(E);
}
function h(E, x, k) {
let D = "", P = "";
typeof x == "object" ? (D = E, k = x.ignoreIllegals, P = x.language) : (Oo("10.7.0", "highlight(lang, code, ...args) has been deprecated."), Oo("10.7.0", `Please use highlight(code, options) instead.
https://github.com/highlightjs/highlight.js/issues/2277`), P = E, D = x), k === void 0 && (k = !0);
const M = { code: D, language: P };
y("before:highlight", M);
const B = M.result ? M.result : p(M.language, M.code, k);
return B.code = M.code, y("after:highlight", B), B;
}
function p(E, x, k, D) {
const P = /* @__PURE__ */ Object.create(null);
function M() {
if (!Y.keywords)
return ee.addText(pe);
let he = 0;
Y.keywordPatternRe.lastIndex = 0;
let Se = Y.keywordPatternRe.exec(pe), xe = "";
for (; Se; ) {
xe += pe.substring(he, Se.index);
const K = C.case_insensitive ? Se[0].toLowerCase() : Se[0], J = (O = K, Y.keywords[O]);
if (J) {
const [ne, re] = J;
if (ee.addText(xe), xe = "", P[K] = (P[K] || 0) + 1, P[K] <= 7 && (Te += re), ne.startsWith("_"))
xe += Se[0];
else {
const fe = C.classNameAliases[ne] || ne;
T(Se[0], fe);
}
} else
xe += Se[0];
he = Y.keywordPatternRe.lastIndex, Se = Y.keywordPatternRe.exec(pe);
}
var O;
xe += pe.substring(he), ee.addText(xe);
}
function B() {
Y.subLanguage != null ? (() => {
if (pe === "")
return;
let he = null;
if (typeof Y.subLanguage == "string") {
if (!t[Y.subLanguage])
return ee.addText(pe);
he = p(Y.subLanguage, pe, !0, ue[Y.subLanguage]), ue[Y.subLanguage] = he._top;
} else
he = g(pe, Y.subLanguage.length ? Y.subLanguage : null);
Y.relevance > 0 && (Te += he.relevance), ee.__addSublanguage(he._emitter, he.language);
})() : M(), pe = "";
}
function T(he, Se) {
he !== "" && (ee.startScope(Se), ee.addText(he), ee.endScope());
}
function $(he, Se) {
let xe = 1;
const O = Se.length - 1;
for (; xe <= O; ) {
if (!he._emit[xe]) {
xe++;
continue;
}
const K = C.classNameAliases[he[xe]] || he[xe], J = Se[xe];
K ? T(J, K) : (pe = J, M(), pe = ""), xe++;
}
}
function V(he, Se) {
return he.scope && typeof he.scope == "string" && ee.openNode(C.classNameAliases[he.scope] || he.scope), he.beginScope && (he.beginScope._wrap ? (T(pe, C.classNameAliases[he.beginScope._wrap] || he.beginScope._wrap), pe = "") : he.beginScope._multi && ($(he.beginScope, Se), pe = "")), Y = Object.create(he, { parent: {
value: Y
} }), Y;
}
function z(he, Se, xe) {
let O = ((K, J) => {
const ne = K && K.exec(J);
return ne && ne.index === 0;
})(he.endRe, xe);
if (O) {
if (he["on:end"]) {
const K = new _v(he);
he["on:end"](Se, K), K.isMatchIgnored && (O = !1);
}
if (O) {
for (; he.endsParent && he.parent; )
he = he.parent;
return he;
}
}
if (he.endsWithParent)
return z(he.parent, Se, xe);
}
function H(he) {
return Y.matcher.regexIndex === 0 ? (pe += he[0], 1) : (we = !0, 0);
}
function I(he) {
const Se = he[0], xe = x.substring(he.index), O = z(Y, he, xe);
if (!O)
return Dv;
const K = Y;
Y.endScope && Y.endScope._wrap ? (B(), T(Se, Y.endScope._wrap)) : Y.endScope && Y.endScope._multi ? (B(), $(Y.endScope, he)) : K.skip ? pe += Se : (K.returnEnd || K.excludeEnd || (pe += Se), B(), K.excludeEnd && (pe = Se));
do
Y.scope && ee.closeNode(), Y.skip || Y.subLanguage || (Te += Y.relevance), Y = Y.parent;
while (Y !== O.parent);
return O.starts && V(O.starts, he), K.returnEnd ? 0 : Se.length;
}
let U = {};
function F(he, Se) {
const xe = Se && Se[0];
if (pe += he, xe == null)
return B(), 0;
if (U.type === "begin" && Se.type === "end" && U.index === Se.index && xe === "") {
if (pe += x.slice(Se.index, Se.index + 1), !n) {
const O = Error(`0 width match regex (${E})`);
throw O.languageName = E, O.badRule = U.rule, O;
}
return 1;
}
if (U = Se, Se.type === "begin")
return ((O) => {
const K = O[0], J = O.rule, ne = new _v(J), re = [J.__beforeBegin, J["on:begin"]];
for (const fe of re)
if (fe && (fe(O, ne), ne.isMatchIgnored))
return H(K);
return J.skip ? pe += K : (J.excludeBegin && (pe += K), B(), J.returnBegin || J.excludeBegin || (pe = K)), V(J, O), J.returnBegin ? 0 : K.length;
})(Se);
if (Se.type === "illegal" && !k) {
const O = Error('Illegal lexeme "' + xe + '" for mode "' + (Y.scope || "<unnamed>") + '"');
throw O.mode = Y, O;
}
if (Se.type === "end") {
const O = I(Se);
if (O !== Dv)
return O;
}
if (Se.type === "illegal" && xe === "")
return 1;
if (me > 1e5 && me > 3 * Se.index)
throw Error("potential infinite loop, way more iterations than matches");
return pe += xe, xe.length;
}
const C = A(E);
if (!C)
throw zr(a.replace("{}", E)), Error('Unknown language: "' + E + '"');
const q = D2(C);
let X = "", Y = D || q;
const ue = {}, ee = new u.__emitter(u);
(() => {
const he = [];
for (let Se = Y; Se !== C; Se = Se.parent)
Se.scope && he.unshift(Se.scope);
he.forEach((Se) => ee.openNode(Se));
})();
let pe = "", Te = 0, ve = 0, me = 0, we = !1;
try {
if (C.__emitTokens)
C.__emitTokens(x, ee);
else {
for (Y.matcher.considerAll(); ; ) {
me++, we ? we = !1 : Y.matcher.considerAll(), Y.matcher.lastIndex = ve;
const he = Y.matcher.exec(x);
if (!he)
break;
const Se = F(x.substring(ve, he.index), he);
ve = he.index + Se;
}
F(x.substring(ve));
}
return ee.finalize(), X = ee.toHTML(), {
language: E,
value: X,
relevance: Te,
illegal: !1,
_emitter: ee,
_top: Y
};
} catch (he) {
if (he.message && he.message.includes("Illegal"))
return {
language: E,
value: Tf(x),
illegal: !0,
relevance: 0,
_illegalBy: {
message: he.message,
index: ve,
context: x.slice(ve - 100, ve + 100),
mode: he.mode,
resultSoFar: X
},
_emitter: ee
};
if (n)
return {
language: E,
value: Tf(x),
illegal: !1,
relevance: 0,
errorRaised: he,
_emitter: ee,
_top: Y
};
throw he;
}
}
function g(E, x) {
x = x || u.languages || Object.keys(t);
const k = (($) => {
const V = { value: Tf($), illegal: !1, relevance: 0, _top: s, _emitter: new u.__emitter(u) };
return V._emitter.addText($), V;
})(E), D = x.filter(A).filter(m).map(($) => p($, E, !1));
D.unshift(k);
const P = D.sort(($, V) => {
if ($.relevance !== V.relevance)
return V.relevance - $.relevance;
if ($.language && V.language) {
if (A($.language).supersetOf === V.language)
return 1;
if (A(V.language).supersetOf === $.language)
return -1;
}
return 0;
}), [M, B] = P, T = M;
return T.secondBest = B, T;
}
function _(E) {
let x = null;
const k = ((M) => {
let B = M.className + " ";
B += M.parentNode ? M.parentNode.className : "";
const T = u.languageDetectRe.exec(B);
if (T) {
const $ = A(T[1]);
return $ || (kv(a.replace("{}", T[1])), kv("Falling back to no-highlight mode for this block.", M)), $ ? T[1] : "no-highlight";
}
return B.split(/\s+/).find(($) => d($) || A($));
})(E);
if (d(k))
return;
if (y("before:highlightElement", {
el: E,
language: k
}), E.dataset.highlighted)
return console.log("Element previously highlighted. To highlight again, first unset `dataset.highlighted`.", E);
if (E.children.length > 0 && (u.ignoreUnescapedHTML || (console.warn("One of your code blocks includes unescaped HTML. This is a potentially serious security risk."), console.warn("https://github.com/highlightjs/highlight.js/wiki/security"), console.warn("The element with unescaped HTML:"), console.warn(E)), u.throwUnescapedHTML))
throw new $2("One of your code blocks includes unescaped HTML.", E.innerHTML);
x = E;
const D = x.textContent, P = k ? h(D, { language: k, ignoreIllegals: !0 }) : g(D);
E.innerHTML = P.value, E.dataset.highlighted = "yes", ((M, B, T) => {
const $ = B && i[B] || T;
M.classList.add("hljs"), M.classList.add("language-" + $);
})(E, k, P.language), E.result = {
language: P.language,
re: P.relevance,
relevance: P.relevance
}, P.secondBest && (E.secondBest = {
language: P.secondBest.language,
relevance: P.secondBest.relevance
}), y("after:highlightElement", { el: E, result: P, text: D });
}
let S = !1;
function b() {
document.readyState !== "loading" ? document.querySelectorAll(u.cssSelector).forEach(_) : S = !0;
}
function A(E) {
return E = (E || "").toLowerCase(), t[E] || t[i[E]];
}
function w(E, { languageName: x }) {
typeof E == "string" && (E = [E]), E.forEach((k) => {
i[k.toLowerCase()] = x;
});
}
function m(E) {
const x = A(E);
return x && !x.disableAutodetect;
}
function y(E, x) {
const k = E;
r.forEach((D) => {
D[k] && D[k](x);
});
}
typeof window < "u" && window.addEventListener && window.addEventListener("DOMContentLoaded", () => {
S && b();
}, !1), Object.assign(e, {
highlight: h,
highlightAuto: g,
highlightAll: b,
highlightElement: _,
highlightBlock: (E) => (Oo("10.7.0", "highlightBlock will be removed entirely in v12.0"), Oo("10.7.0", "Please use highlightElement now."), _(E)),
configure: (E) => {
u = Rv(u, E);
},
initHighlighting: () => {
b(), Oo("10.6.0", "initHighlighting() deprecated. Use highlightAll() now.");
},
initHighlightingOnLoad: () => {
b(), Oo("10.6.0", "initHighlightingOnLoad() deprecated. Use highlightAll() now.");
},
registerLanguage: (E, x) => {
let k = null;
try {
k = x(e);
} catch (D) {
if (zr("Language definition for '{}' could not be registered.".replace("{}", E)), !n)
throw D;
zr(D), k = s;
}
k.name || (k.name = E), t[E] = k, k.rawDefinition = x.bind(null, e), k.aliases && w(k.aliases, {
languageName: E
});
},
unregisterLanguage: (E) => {
delete t[E];
for (const x of Object.keys(i))
i[x] === E && delete i[x];
},
listLanguages: () => Object.keys(t),
getLanguage: A,
registerAliases: w,
autoDetection: m,
inherit: Rv,
addPlugin: (E) => {
((x) => {
x["before:highlightBlock"] && !x["before:highlightElement"] && (x["before:highlightElement"] = (k) => {
x["before:highlightBlock"](Object.assign({ block: k.el }, k));
}), x["after:highlightBlock"] && !x["after:highlightElement"] && (x["after:highlightElement"] = (k) => {
x["after:highlightBlock"](Object.assign({ block: k.el }, k));
});
})(E), r.push(E);
},
removePlugin: (E) => {
const x = r.indexOf(E);
x !== -1 && r.splice(x, 1);
}
}), e.debugMode = () => {
n = !1;
}, e.safeMode = () => {
n = !0;
}, e.versionString = "11.9.0", e.regex = {
concat: Jr,
lookahead: $0,
either: Fc,
optional: p2,
anyNumberOfTimes: c2
};
for (const E in ss)
typeof ss[E] == "object" && R0(ss[E]);
return Object.assign(e, ss), e;
}, Bo = P0({});
Bo.newInstance = () => P0({});
/*! `xml` grammar compiled for Highlight.js 11.9.0 */
var I2 = (() => (e) => {
const t = e.regex, i = t.concat(/[\p{L}_]/u, t.optional(/[\p{L}0-9_.-]*:/u), /[\p{L}0-9_.-]*/u), r = {
className: "symbol",
begin: /&[a-z]+;|&#[0-9]+;|&#x[a-f0-9]+;/
}, n = {
begin: /\s/,
contains: [{ className: "keyword", begin: /#?[a-z_][a-z1-9_-]+/, illegal: /\n/ }]
}, a = e.inherit(n, { begin: /\(/, end: /\)/ }), s = e.inherit(e.APOS_STRING_MODE, {
className: "string"
}), u = e.inherit(e.QUOTE_STRING_MODE, { className: "string" }), d = {
endsWithParent: !0,
illegal: /</,
relevance: 0,
contains: [{
className: "attr",
begin: /[\p{L}0-9._:-]+/u,
relevance: 0
}, { begin: /=\s*/, relevance: 0, contains: [{
className: "string",
endsParent: !0,
variants: [{ begin: /"/, end: /"/, contains: [r] }, {
begin: /'/,
end: /'/,
contains: [r]
}, { begin: /[^\s"'=<>`]+/ }]
}] }]
};
return {
name: "HTML, XML",
aliases: ["html", "xhtml", "rss", "atom", "xjb", "xsd", "xsl", "plist", "wsf", "svg"],
case_insensitive: !0,
unicodeRegex: !0,
contains: [{
className: "meta",
begin: /<![a-z]/,
end: />/,
relevance: 10,
contains: [n, u, s, a, { begin: /\[/, end: /\]/, contains: [{
className: "meta",
begin: /<![a-z]/,
end: />/,
contains: [n, a, u, s]
}] }]
}, e.COMMENT(/<!--/, /-->/, { relevance: 10 }), {
begin: /<!\[CDATA\[/,
end: /\]\]>/,
relevance: 10
}, r, { className: "meta", end: /\?>/, variants: [{
begin: /<\?xml/,
relevance: 10,
contains: [u]
}, { begin: /<\?[a-z][a-z0-9]+/ }] }, {
className: "tag",
begin: /<style(?=\s|>)/,
end: />/,
keywords: { name: "style" },
contains: [d],
starts: {
end: /<\/style>/,
returnEnd: !0,
subLanguage: ["css", "xml"]
}
}, {
className: "tag",
begin: /<script(?=\s|>)/,
end: />/,
keywords: { name: "script" },
contains: [d],
starts: {
end: /<\/script>/,
returnEnd: !0,
subLanguage: ["javascript", "handlebars", "xml"]
}
}, {
className: "tag",
begin: /<>|<\/>/
}, {
className: "tag",
begin: t.concat(/</, t.lookahead(t.concat(i, t.either(/\/>/, />/, /\s/)))),
end: /\/?>/,
contains: [{ className: "name", begin: i, relevance: 0, starts: d }]
}, {
className: "tag",
begin: t.concat(/<\//, t.lookahead(t.concat(i, />/))),
contains: [{
className: "name",
begin: i,
relevance: 0
}, { begin: />/, relevance: 0, endsParent: !0 }]
}]
};
})();
/*! `javascript` grammar compiled for Highlight.js 11.9.0 */
var F2 = (() => {
const e = "[A-Za-z$_][0-9A-Za-z$_]*", t = ["as", "in", "of", "if", "for", "while", "finally", "var", "new", "function", "do", "return", "void", "else", "break", "catch", "instanceof", "with", "throw", "case", "default", "try", "switch", "continue", "typeof", "delete", "let", "yield", "const", "class", "debugger", "async", "await", "static", "import", "from", "export", "extends"], i = ["true", "false", "null", "undefined", "NaN", "Infinity"], r = ["Object", "Function", "Boolean", "Symbol", "Math", "Date", "Number", "BigInt", "String", "RegExp", "Array", "Float32Array", "Float64Array", "Int8Array", "Uint8Array", "Uint8ClampedArray", "Int16Array", "Int32Array", "Uint16Array", "Uint32Array", "BigInt64Array", "BigUint64Array", "Set", "Map", "WeakSet", "WeakMap", "ArrayBuffer", "SharedArrayBuffer", "Atomics", "DataView", "JSON", "Promise", "Generator", "GeneratorFunction", "AsyncFunction", "Reflect", "Proxy", "Intl", "WebAssembly"], n = ["Error", "EvalError", "InternalError", "RangeError", "ReferenceError", "SyntaxError", "TypeError", "URIError"], a = ["setInterval", "setTimeout", "clearInterval", "clearTimeout", "require", "exports", "eval", "isFinite", "isNaN", "parseFloat", "parseInt", "decodeURI", "decodeURIComponent", "encodeURI", "encodeURIComponent", "escape", "unescape"], s = ["arguments", "this", "super", "console", "window", "document", "localStorage", "sessionStorage", "module", "global"], u = [].concat(a, r, n);
return (d) => {
const h = d.regex, p = e, g = {
begin: /<[A-Za-z0-9\\._:-]+/,
end: /\/[A-Za-z0-9\\._:-]+>|\/>/,
isTrulyOpeningTag: (X, Y) => {
const ue = X[0].length + X.index, ee = X.input[ue];
if (ee === "<" || ee === ",")
return void Y.ignoreMatch();
let pe;
ee === ">" && (((ve, { after: me }) => {
const we = "</" + ve[0].slice(1);
return ve.input.indexOf(we, me) !== -1;
})(X, { after: ue }) || Y.ignoreMatch());
const Te = X.input.substring(ue);
((pe = Te.match(/^\s*=/)) || (pe = Te.match(/^\s+extends\s+/)) && pe.index === 0) && Y.ignoreMatch();
}
}, _ = {
$pattern: e,
keyword: t,
literal: i,
built_in: u,
"variable.language": s
}, S = "[0-9](_?[0-9])*", b = `\\.(${S})`, A = "0|[1-9](_?[0-9])*|0[0-7]*[89][0-9]*", w = {
className: "number",
variants: [{
begin: `(\\b(${A})((${b})|\\.)?|(${b}))[eE][+-]?(${S})\\b`
}, {
begin: `\\b(${A})\\b((${b})\\b|\\.)?|(${b})\\b`
}, {
begin: "\\b(0|[1-9](_?[0-9])*)n\\b"
}, {
begin: "\\b0[xX][0-9a-fA-F](_?[0-9a-fA-F])*n?\\b"
}, {
begin: "\\b0[bB][0-1](_?[0-1])*n?\\b"
}, { begin: "\\b0[oO][0-7](_?[0-7])*n?\\b" }, {
begin: "\\b0[0-7]+n?\\b"
}],
relevance: 0
}, m = {
className: "subst",
begin: "\\$\\{",
end: "\\}",
keywords: _,
contains: []
}, y = { begin: "html`", end: "", starts: {
end: "`",
returnEnd: !1,
contains: [d.BACKSLASH_ESCAPE, m],
subLanguage: "xml"
} }, E = {
begin: "css`",
end: "",
starts: {
end: "`",
returnEnd: !1,
contains: [d.BACKSLASH_ESCAPE, m],
subLanguage: "css"
}
}, x = {
begin: "gql`",
end: "",
starts: {
end: "`",
returnEnd: !1,
contains: [d.BACKSLASH_ESCAPE, m],
subLanguage: "graphql"
}
}, k = {
className: "string",
begin: "`",
end: "`",
contains: [d.BACKSLASH_ESCAPE, m]
}, D = {
className: "comment",
variants: [d.COMMENT(/\/\*\*(?!\/)/, "\\*/", {
relevance: 0,
contains: [{
begin: "(?=@[A-Za-z]+)",
relevance: 0,
contains: [{
className: "doctag",
begin: "@[A-Za-z]+"
}, {
className: "type",
begin: "\\{",
end: "\\}",
excludeEnd: !0,
excludeBegin: !0,
relevance: 0
}, {
className: "variable",
begin: p + "(?=\\s*(-)|$)",
endsParent: !0,
relevance: 0
}, { begin: /(?=[^\n])\s/, relevance: 0 }]
}]
}), d.C_BLOCK_COMMENT_MODE, d.C_LINE_COMMENT_MODE]
}, P = [d.APOS_STRING_MODE, d.QUOTE_STRING_MODE, y, E, x, k, { match: /\$\d+/ }, w];
m.contains = P.concat({
begin: /\{/,
end: /\}/,
keywords: _,
contains: ["self"].concat(P)
});
const M = [].concat(D, m.contains), B = M.concat([{
begin: /\(/,
end: /\)/,
keywords: _,
contains: ["self"].concat(M)
}]), T = {
className: "params",
begin: /\(/,
end: /\)/,
excludeBegin: !0,
excludeEnd: !0,
keywords: _,
contains: B
}, $ = { variants: [{
match: [/class/, /\s+/, p, /\s+/, /extends/, /\s+/, h.concat(p, "(", h.concat(/\./, p), ")*")],
scope: { 1: "keyword", 3: "title.class", 5: "keyword", 7: "title.class.inherited" }
}, {
match: [/class/, /\s+/, p],
scope: { 1: "keyword", 3: "title.class" }
}] }, V = {
relevance: 0,
match: h.either(/\bJSON/, /\b[A-Z][a-z]+([A-Z][a-z]*|\d)*/, /\b[A-Z]{2,}([A-Z][a-z]+|\d)+([A-Z][a-z]*)*/, /\b[A-Z]{2,}[a-z]+([A-Z][a-z]+|\d)*([A-Z][a-z]*)*/),
className: "title.class",
keywords: { _: [...r, ...n] }
}, z = {
variants: [{
match: [/function/, /\s+/, p, /(?=\s*\()/]
}, { match: [/function/, /\s*(?=\()/] }],
className: { 1: "keyword", 3: "title.function" },
label: "func.def",
contains: [T],
illegal: /%/
}, H = {
match: h.concat(/\b/, (I = [...a, "super", "import"], h.concat("(?!", I.join("|"), ")")), p, h.lookahead(/\(/)),
className: "title.function",
relevance: 0
};
var I;
const U = {
begin: h.concat(/\./, h.lookahead(h.concat(p, /(?![0-9A-Za-z$_(])/))),
end: p,
excludeBegin: !0,
keywords: "prototype",
className: "property",
relevance: 0
}, F = {
match: [/get|set/, /\s+/, p, /(?=\()/],
className: { 1: "keyword", 3: "title.function" },
contains: [{ begin: /\(\)/ }, T]
}, C = "(\\([^()]*(\\([^()]*(\\([^()]*\\)[^()]*)*\\)[^()]*)*\\)|" + d.UNDERSCORE_IDENT_RE + ")\\s*=>", q = {
match: [/const|var|let/, /\s+/, p, /\s*/, /=\s*/, /(async\s*)?/, h.lookahead(C)],
keywords: "async",
className: { 1: "keyword", 3: "title.function" },
contains: [T]
};
return {
name: "JavaScript",
aliases: ["js", "jsx", "mjs", "cjs"],
keywords: _,
exports: {
PARAMS_CONTAINS: B,
CLASS_REFERENCE: V
},
illegal: /#(?![$_A-z])/,
contains: [d.SHEBANG({ label: "shebang", binary: "node", relevance: 5 }), {
label: "use_strict",
className: "meta",
relevance: 10,
begin: /^\s*['"]use (strict|asm)['"]/
}, d.APOS_STRING_MODE, d.QUOTE_STRING_MODE, y, E, x, k, D, { match: /\$\d+/ }, w, V, {
className: "attr",
begin: p + h.lookahead(":"),
relevance: 0
}, q, {
begin: "(" + d.RE_STARTERS_RE + "|\\b(case|return|throw)\\b)\\s*",
keywords: "return throw case",
relevance: 0,
contains: [D, d.REGEXP_MODE, {
className: "function",
begin: C,
returnBegin: !0,
end: "\\s*=>",
contains: [{
className: "params",
variants: [{ begin: d.UNDERSCORE_IDENT_RE, relevance: 0 }, {
className: null,
begin: /\(\s*\)/,
skip: !0
}, {
begin: /\(/,
end: /\)/,
excludeBegin: !0,
excludeEnd: !0,
keywords: _,
contains: B
}]
}]
}, { begin: /,/, relevance: 0 }, {
match: /\s+/,
relevance: 0
}, { variants: [{ begin: "<>", end: "</>" }, {
match: /<[A-Za-z0-9\\._:-]+\s*\/>/
}, {
begin: g.begin,
"on:begin": g.isTrulyOpeningTag,
end: g.end
}], subLanguage: "xml", contains: [{
begin: g.begin,
end: g.end,
skip: !0,
contains: ["self"]
}] }]
}, z, {
beginKeywords: "while if switch catch for"
}, {
begin: "\\b(?!function)" + d.UNDERSCORE_IDENT_RE + "\\([^()]*(\\([^()]*(\\([^()]*\\)[^()]*)*\\)[^()]*)*\\)\\s*\\{",
returnBegin: !0,
label: "func.def",
contains: [T, d.inherit(d.TITLE_MODE, {
begin: p,
className: "title.function"
})]
}, { match: /\.\.\./, relevance: 0 }, U, {
match: "\\$" + p,
relevance: 0
}, {
match: [/\bconstructor(?=\s*\()/],
className: { 1: "title.function" },
contains: [T]
}, H, {
relevance: 0,
match: /\b[A-Z][A-Z_0-9]+\b/,
className: "variable.constant"
}, $, F, { match: /\$[(.]/ }]
};
};
})();
const M2 = Ve({
name: "ConfigItem",
components: { Warning: Ei },
props: {
label: String,
info: String,
warning: String,
appendBackground: String,
arrow: {
type: Boolean,
default: !0
},
showAppend: Boolean
},
data() {
return {
visit: !1
};
}
}), P2 = { class: "_fd-config-item" }, L2 = { class: "_fd-ci-head" }, N2 = {
key: 0,
class: "_fd-ci-con"
}, B2 = {
key: 1,
class: "_fd-ci-info"
};
function V2(e, t, i, r, n, a) {
const s = ie("Warning");
return W(), ae("div", P2, [
Z("div", L2, [
Z("div", {
class: qe(["_fd-ci-label", e.$slots.append && e.arrow !== !1 ? "is-arrow" : ""]),
onClick: t[0] || (t[0] = (u) => e.visit = e.$slots.append && e.arrow !== !1 && !e.visit)
}, [
e.warning ? (W(), ye(s, {
key: 0,
tooltip: e.warning
}, {
default: N(() => [
kt(e.$slots, "label", {}, () => [
Z("span", null, le(e.label), 1)
])
]),
_: 3
}, 8, ["tooltip"])) : kt(e.$slots, "label", { key: 1 }, () => [
Z("span", null, le(e.label), 1)
]),
e.$slots.append && e.arrow !== !1 ? (W(), ae("i", {
key: 2,
class: qe(["fc-icon icon-down", e.showAppend || e.visit ? "down" : ""])
}, null, 2)) : Oe("", !0)
], 2),
e.$slots.default || e.info ? (W(), ae("div", N2, [
e.$slots.default ? kt(e.$slots, "default", { key: 0 }) : (W(), ae("span", B2, le(e.info), 1))
])) : Oe("", !0)
]),
e.showAppend || e.visit ? (W(), ae("div", {
key: 0,
class: "_fd-ci-append",
style: An("background:" + e.appendBackground)
}, [
kt(e.$slots, "append")
], 4)) : Oe("", !0)
]);
}
const li = /* @__PURE__ */ je(M2, [["render", V2]]);
const j2 = Ve({
name: "PageInput",
inject: ["designer"],
emits: ["add", "delete", "change"],
computed: {
activePage() {
return this.designer.setupState.activePage;
},
pageData() {
return this.designer.setupState.pageData;
},
t() {
return this.designer.setupState.t;
},
containerList() {
const e = this.designer.setupState.dragRuleList;
return Object.keys(e).map((t) => {
if (e[t].container)
return e[t];
}).filter((t) => !!t);
}
},
methods: {
copy(e) {
er(e);
},
getPageName(e) {
return this.t("com." + e.name + ".name") || e.label;
},
getPageLabel(e) {
return e.default ? this.t("designer.main") : zo(e.main, e.config.labelField, "") || this.getPageName(e.main._menu);
}
}
}), U2 = { class: "_fd-page-input" }, z2 = ["onClick"], H2 = { class: "_fd-page-label" }, W2 = {
key: 0,
class: "fc-icon icon-yes"
}, G2 = {
key: 0,
class: "_fd-page-id"
}, K2 = ["onClick"], Y2 = {
key: 0,
class: "_fd-page-btns"
}, Q2 = ["onClick"], J2 = ["onClick"];
function X2(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-dropdown-item"), d = ie("el-dropdown-menu"), h = ie("el-dropdown");
return W(), ae("div", U2, [
(W(!0), ae(Pe, null, Ge(e.pageData, (p, g) => (W(), ae("div", {
key: p.main ? p.main.name : "",
class: qe(["_fd-page-item", { active: p === e.activePage }]),
onClick: (_) => e.$emit("change", g)
}, [
Z("div", null, [
Z("div", H2, [
Z("span", null, le(e.getPageLabel(p)), 1),
p === e.activePage ? (W(), ae("i", W2)) : Oe("", !0)
]),
p.main ? (W(), ae("div", G2, [
_e(" ID\uFF1A" + le(p.main.name) + " ", 1),
Z("i", {
onClick: vt((_) => e.copy(p.main.name), ["stop"]),
class: "fc-icon icon-group"
}, null, 8, K2)
])) : Oe("", !0)
]),
p.default ? Oe("", !0) : (W(), ae("div", Y2, [
Z("div", {
class: "_fd-page-copy",
onClick: vt((_) => e.$emit("copy", g), ["stop"])
}, t[0] || (t[0] = [
Z("i", { class: "fc-icon icon-copy" }, null, -1)
]), 8, Q2),
Z("div", {
class: "_fd-page-del",
onClick: vt((_) => e.$emit("delete", g), ["stop"])
}, t[1] || (t[1] = [
Z("i", { class: "fc-icon icon-delete" }, null, -1)
]), 8, J2)
]))
], 10, z2))), 128)),
G(h, {
size: "default",
trigger: "click"
}, {
dropdown: N(() => [
G(d, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.containerList, (p) => (W(), ye(u, {
key: p.name,
onClick: (g) => e.$emit("add", p.name)
}, {
default: N(() => [
_e(le(e.getPageName(p)), 1)
]),
_: 2
}, 1032, ["onClick"]))), 128))
]),
_: 1
})
]),
default: N(() => [
G(s, {
link: "",
type: "primary"
}, {
default: N(() => [
_e(le(e.t("designer.addPage")), 1),
t[2] || (t[2] = Z("i", { class: "fc-icon icon-down" }, null, -1))
]),
_: 1
})
]),
_: 1
})
]);
}
const Z2 = /* @__PURE__ */ je(j2, [["render", X2]]);
function $v(e) {
return Array.isArray(e) ? e : [null, void 0, ""].indexOf(e) > -1 ? [] : [e];
}
function ll(e) {
let t = e.replace(/([A-Z])/g, "-$1").toLocaleLowerCase();
return t.indexOf("-") === 0 && (t = t.substr(1)), t;
}
function Iv(e, t, i) {
let r = e, n;
return (t || "").split(".").forEach((a) => {
n && ((!r[n] || typeof r[n] != "object") && (r[n] = {}), r = r[n]), n = a;
}), r[n] = i, r;
}
var L0 = { exports: {} }, Fa = {}, ds = { exports: {} }, kf = {}, Of = {}, Fv;
function Mc() {
if (Fv)
return Of;
Fv = 1;
function e(r) {
this.__parent = r, this.__character_count = 0, this.__indent_count = -1, this.__alignment_count = 0, this.__wrap_point_index = 0, this.__wrap_point_character_count = 0, this.__wrap_point_indent_count = -1, this.__wrap_point_alignment_count = 0, this.__items = [];
}
e.prototype.clone_empty = function() {
var r = new e(this.__parent);
return r.set_indent(this.__indent_count, this.__alignment_count), r;
}, e.prototype.item = function(r) {
return r < 0 ? this.__items[this.__items.length + r] : this.__items[r];
}, e.prototype.has_match = function(r) {
for (var n = this.__items.length - 1; n >= 0; n--)
if (this.__items[n].match(r))
return !0;
return !1;
}, e.prototype.set_indent = function(r, n) {
this.is_empty() && (this.__indent_count = r || 0, this.__alignment_count = n || 0, this.__character_count = this.__parent.get_indent_size(this.__indent_count, this.__alignment_count));
}, e.prototype._set_wrap_point = function() {
this.__parent.wrap_line_length && (this.__wrap_point_index = this.__items.length, this.__wrap_point_character_count = this.__character_count, this.__wrap_point_indent_count = this.__parent.next_line.__indent_count, this.__wrap_point_alignment_count = this.__parent.next_line.__alignment_count);
}, e.prototype._should_wrap = function() {
return this.__wrap_point_index && this.__character_count > this.__parent.wrap_line_length && this.__wrap_point_character_count > this.__parent.next_line.__character_count;
}, e.prototype._allow_wrap = function() {
if (this._should_wrap()) {
this.__parent.add_new_line();
var r = this.__parent.current_line;
return r.set_indent(this.__wrap_point_indent_count, this.__wrap_point_alignment_count), r.__items = this.__items.slice(this.__wrap_point_index), this.__items = this.__items.slice(0, this.__wrap_point_index), r.__character_count += this.__character_count - this.__wrap_point_character_count, this.__character_count = this.__wrap_point_character_count, r.__items[0] === " " && (r.__items.splice(0, 1), r.__character_count -= 1), !0;
}
return !1;
}, e.prototype.is_empty = function() {
return this.__items.length === 0;
}, e.prototype.last = function() {
return this.is_empty() ? null : this.__items[this.__items.length - 1];
}, e.prototype.push = function(r) {
this.__items.push(r);
var n = r.lastIndexOf(`
`);
n !== -1 ? this.__character_count = r.length - n : this.__character_count += r.length;
}, e.prototype.pop = function() {
var r = null;
return this.is_empty() || (r = this.__items.pop(), this.__character_count -= r.length), r;
}, e.prototype._remove_indent = function() {
this.__indent_count > 0 && (this.__indent_count -= 1, this.__character_count -= this.__parent.indent_size);
}, e.prototype._remove_wrap_indent = function() {
this.__wrap_point_indent_count > 0 && (this.__wrap_point_indent_count -= 1);
}, e.prototype.trim = function() {
for (; this.last() === " "; )
this.__items.pop(), this.__character_count -= 1;
}, e.prototype.toString = function() {
var r = "";
return this.is_empty() ? this.__parent.indent_empty_lines && (r = this.__parent.get_indent_string(this.__indent_count)) : (r = this.__parent.get_indent_string(this.__indent_count, this.__alignment_count), r += this.__items.join("")), r;
};
function t(r, n) {
this.__cache = [""], this.__indent_size = r.indent_size, this.__indent_string = r.indent_char, r.indent_with_tabs || (this.__indent_string = new Array(r.indent_size + 1).join(r.indent_char)), n = n || "", r.indent_level > 0 && (n = new Array(r.indent_level + 1).join(this.__indent_string)), this.__base_string = n, this.__base_string_length = n.length;
}
t.prototype.get_indent_size = function(r, n) {
var a = this.__base_string_length;
return n = n || 0, r < 0 && (a = 0), a += r * this.__indent_size, a += n, a;
}, t.prototype.get_indent_string = function(r, n) {
var a = this.__base_string;
return n = n || 0, r < 0 && (r = 0, a = ""), n += r * this.__indent_size, this.__ensure_cache(n), a += this.__cache[n], a;
}, t.prototype.__ensure_cache = function(r) {
for (; r >= this.__cache.length; )
this.__add_column();
}, t.prototype.__add_column = function() {
var r = this.__cache.length, n = 0, a = "";
this.__indent_size && r >= this.__indent_size && (n = Math.floor(r / this.__indent_size), r -= n * this.__indent_size, a = new Array(n + 1).join(this.__indent_string)), r && (a += new Array(r + 1).join(" ")), this.__cache.push(a);
};
function i(r, n) {
this.__indent_cache = new t(r, n), this.raw = !1, this._end_with_newline = r.end_with_newline, this.indent_size = r.indent_size, this.wrap_line_length = r.wrap_line_length, this.indent_empty_lines = r.indent_empty_lines, this.__lines = [], this.previous_line = null, this.current_line = null, this.next_line = new e(this), this.space_before_token = !1, this.non_breaking_space = !1, this.previous_token_wrapped = !1, this.__add_outputline();
}
return i.prototype.__add_outputline = function() {
this.previous_line = this.current_line, this.current_line = this.next_line.clone_empty(), this.__lines.push(this.current_line);
}, i.prototype.get_line_number = function() {
return this.__lines.length;
}, i.prototype.get_indent_string = function(r, n) {
return this.__indent_cache.get_indent_string(r, n);
}, i.prototype.get_indent_size = function(r, n) {
return this.__indent_cache.get_indent_size(r, n);
}, i.prototype.is_empty = function() {
return !this.previous_line && this.current_line.is_empty();
}, i.prototype.add_new_line = function(r) {
return this.is_empty() || !r && this.just_added_newline() ? !1 : (this.raw || this.__add_outputline(), !0);
}, i.prototype.get_code = function(r) {
this.trim(!0);
var n = this.current_line.pop();
n && (n[n.length - 1] === `
` && (n = n.replace(/\n+$/g, "")), this.current_line.push(n)), this._end_with_newline && this.__add_outputline();
var a = this.__lines.join(`
`);
return r !== `
` && (a = a.replace(/[\n]/g, r)), a;
}, i.prototype.set_wrap_point = function() {
this.current_line._set_wrap_point();
}, i.prototype.set_indent = function(r, n) {
return r = r || 0, n = n || 0, this.next_line.set_indent(r, n), this.__lines.length > 1 ? (this.current_line.set_indent(r, n), !0) : (this.current_line.set_indent(), !1);
}, i.prototype.add_raw_token = function(r) {
for (var n = 0; n < r.newlines; n++)
this.__add_outputline();
this.current_line.set_indent(-1), this.current_line.push(r.whitespace_before), this.current_line.push(r.text), this.space_before_token = !1, this.non_breaking_space = !1, this.previous_token_wrapped = !1;
}, i.prototype.add_token = function(r) {
this.__add_space_before_token(), this.current_line.push(r), this.space_before_token = !1, this.non_breaking_space = !1, this.previous_token_wrapped = this.current_line._allow_wrap();
}, i.prototype.__add_space_before_token = function() {
this.space_before_token && !this.just_added_newline() && (this.non_breaking_space || this.set_wrap_point(), this.current_line.push(" "));
}, i.prototype.remove_indent = function(r) {
for (var n = this.__lines.length; r < n; )
this.__lines[r]._remove_indent(), r++;
this.current_line._remove_wrap_indent();
}, i.prototype.trim = function(r) {
for (r = r === void 0 ? !1 : r, this.current_line.trim(); r && this.__lines.length > 1 && this.current_line.is_empty(); )
this.__lines.pop(), this.current_line = this.__lines[this.__lines.length - 1], this.current_line.trim();
this.previous_line = this.__lines.length > 1 ? this.__lines[this.__lines.length - 2] : null;
}, i.prototype.just_added_newline = function() {
return this.current_line.is_empty();
}, i.prototype.just_added_blankline = function() {
return this.is_empty() || this.current_line.is_empty() && this.previous_line.is_empty();
}, i.prototype.ensure_empty_line_above = function(r, n) {
for (var a = this.__lines.length - 2; a >= 0; ) {
var s = this.__lines[a];
if (s.is_empty())
break;
if (s.item(0).indexOf(r) !== 0 && s.item(-1) !== n) {
this.__lines.splice(a + 1, 0, new e(this)), this.previous_line = this.__lines[this.__lines.length - 2];
break;
}
a--;
}
}, Of.Output = i, Of;
}
var Rf = {}, Mv;
function N0() {
if (Mv)
return Rf;
Mv = 1;
function e(t, i, r, n) {
this.type = t, this.text = i, this.comments_before = null, this.newlines = r || 0, this.whitespace_before = n || "", this.parent = null, this.next = null, this.previous = null, this.opened = null, this.closed = null, this.directives = null;
}
return Rf.Token = e, Rf;
}
var Df = {}, Pv;
function B0() {
return Pv || (Pv = 1, function(e) {
var t = "\\x23\\x24\\x40\\x41-\\x5a\\x5f\\x61-\\x7a", i = "\\x24\\x30-\\x39\\x41-\\x5a\\x5f\\x61-\\x7a", r = "\\xaa\\xb5\\xba\\xc0-\\xd6\\xd8-\\xf6\\xf8-\\u02c1\\u02c6-\\u02d1\\u02e0-\\u02e4\\u02ec\\u02ee\\u0370-\\u0374\\u0376\\u0377\\u037a-\\u037d\\u0386\\u0388-\\u038a\\u038c\\u038e-\\u03a1\\u03a3-\\u03f5\\u03f7-\\u0481\\u048a-\\u0527\\u0531-\\u0556\\u0559\\u0561-\\u0587\\u05d0-\\u05ea\\u05f0-\\u05f2\\u0620-\\u064a\\u066e\\u066f\\u0671-\\u06d3\\u06d5\\u06e5\\u06e6\\u06ee\\u06ef\\u06fa-\\u06fc\\u06ff\\u0710\\u0712-\\u072f\\u074d-\\u07a5\\u07b1\\u07ca-\\u07ea\\u07f4\\u07f5\\u07fa\\u0800-\\u0815\\u081a\\u0824\\u0828\\u0840-\\u0858\\u08a0\\u08a2-\\u08ac\\u0904-\\u0939\\u093d\\u0950\\u0958-\\u0961\\u0971-\\u0977\\u0979-\\u097f\\u0985-\\u098c\\u098f\\u0990\\u0993-\\u09a8\\u09aa-\\u09b0\\u09b2\\u09b6-\\u09b9\\u09bd\\u09ce\\u09dc\\u09dd\\u09df-\\u09e1\\u09f0\\u09f1\\u0a05-\\u0a0a\\u0a0f\\u0a10\\u0a13-\\u0a28\\u0a2a-\\u0a30\\u0a32\\u0a33\\u0a35\\u0a36\\u0a38\\u0a39\\u0a59-\\u0a5c\\u0a5e\\u0a72-\\u0a74\\u0a85-\\u0a8d\\u0a8f-\\u0a91\\u0a93-\\u0aa8\\u0aaa-\\u0ab0\\u0ab2\\u0ab3\\u0ab5-\\u0ab9\\u0abd\\u0ad0\\u0ae0\\u0ae1\\u0b05-\\u0b0c\\u0b0f\\u0b10\\u0b13-\\u0b28\\u0b2a-\\u0b30\\u0b32\\u0b33\\u0b35-\\u0b39\\u0b3d\\u0b5c\\u0b5d\\u0b5f-\\u0b61\\u0b71\\u0b83\\u0b85-\\u0b8a\\u0b8e-\\u0b90\\u0b92-\\u0b95\\u0b99\\u0b9a\\u0b9c\\u0b9e\\u0b9f\\u0ba3\\u0ba4\\u0ba8-\\u0baa\\u0bae-\\u0bb9\\u0bd0\\u0c05-\\u0c0c\\u0c0e-\\u0c10\\u0c12-\\u0c28\\u0c2a-\\u0c33\\u0c35-\\u0c39\\u0c3d\\u0c58\\u0c59\\u0c60\\u0c61\\u0c85-\\u0c8c\\u0c8e-\\u0c90\\u0c92-\\u0ca8\\u0caa-\\u0cb3\\u0cb5-\\u0cb9\\u0cbd\\u0cde\\u0ce0\\u0ce1\\u0cf1\\u0cf2\\u0d05-\\u0d0c\\u0d0e-\\u0d10\\u0d12-\\u0d3a\\u0d3d\\u0d4e\\u0d60\\u0d61\\u0d7a-\\u0d7f\\u0d85-\\u0d96\\u0d9a-\\u0db1\\u0db3-\\u0dbb\\u0dbd\\u0dc0-\\u0dc6\\u0e01-\\u0e30\\u0e32\\u0e33\\u0e40-\\u0e46\\u0e81\\u0e82\\u0e84\\u0e87\\u0e88\\u0e8a\\u0e8d\\u0e94-\\u0e97\\u0e99-\\u0e9f\\u0ea1-\\u0ea3\\u0ea5\\u0ea7\\u0eaa\\u0eab\\u0ead-\\u0eb0\\u0eb2\\u0eb3\\u0ebd\\u0ec0-\\u0ec4\\u0ec6\\u0edc-\\u0edf\\u0f00\\u0f40-\\u0f47\\u0f49-\\u0f6c\\u0f88-\\u0f8c\\u1000-\\u102a\\u103f\\u1050-\\u1055\\u105a-\\u105d\\u1061\\u1065\\u1066\\u106e-\\u1070\\u1075-\\u1081\\u108e\\u10a0-\\u10c5\\u10c7\\u10cd\\u10d0-\\u10fa\\u10fc-\\u1248\\u124a-\\u124d\\u1250-\\u1256\\u1258\\u125a-\\u125d\\u1260-\\u1288\\u128a-\\u128d\\u1290-\\u12b0\\u12b2-\\u12b5\\u12b8-\\u12be\\u12c0\\u12c2-\\u12c5\\u12c8-\\u12d6\\u12d8-\\u1310\\u1312-\\u1315\\u1318-\\u135a\\u1380-\\u138f\\u13a0-\\u13f4\\u1401-\\u166c\\u166f-\\u167f\\u1681-\\u169a\\u16a0-\\u16ea\\u16ee-\\u16f0\\u1700-\\u170c\\u170e-\\u1711\\u1720-\\u1731\\u1740-\\u1751\\u1760-\\u176c\\u176e-\\u1770\\u1780-\\u17b3\\u17d7\\u17dc\\u1820-\\u1877\\u1880-\\u18a8\\u18aa\\u18b0-\\u18f5\\u1900-\\u191c\\u1950-\\u196d\\u1970-\\u1974\\u1980-\\u19ab\\u19c1-\\u19c7\\u1a00-\\u1a16\\u1a20-\\u1a54\\u1aa7\\u1b05-\\u1b33\\u1b45-\\u1b4b\\u1b83-\\u1ba0\\u1bae\\u1baf\\u1bba-\\u1be5\\u1c00-\\u1c23\\u1c4d-\\u1c4f\\u1c5a-\\u1c7d\\u1ce9-\\u1cec\\u1cee-\\u1cf1\\u1cf5\\u1cf6\\u1d00-\\u1dbf\\u1e00-\\u1f15\\u1f18-\\u1f1d\\u1f20-\\u1f45\\u1f48-\\u1f4d\\u1f50-\\u1f57\\u1f59\\u1f5b\\u1f5d\\u1f5f-\\u1f7d\\u1f80-\\u1fb4\\u1fb6-\\u1fbc\\u1fbe\\u1fc2-\\u1fc4\\u1fc6-\\u1fcc\\u1fd0-\\u1fd3\\u1fd6-\\u1fdb\\u1fe0-\\u1fec\\u1ff2-\\u1ff4\\u1ff6-\\u1ffc\\u2071\\u207f\\u2090-\\u209c\\u2102\\u2107\\u210a-\\u2113\\u2115\\u2119-\\u211d\\u2124\\u2126\\u2128\\u212a-\\u212d\\u212f-\\u2139\\u213c-\\u213f\\u2145-\\u2149\\u214e\\u2160-\\u2188\\u2c00-\\u2c2e\\u2c30-\\u2c5e\\u2c60-\\u2ce4\\u2ceb-\\u2cee\\u2cf2\\u2cf3\\u2d00-\\u2d25\\u2d27\\u2d2d\\u2d30-\\u2d67\\u2d6f\\u2d80-\\u2d96\\u2da0-\\u2da6\\u2da8-\\u2dae\\u2db0-\\u2db6\\u2db8-\\u2dbe\\u2dc0-\\u2dc6\\u2dc8-\\u2dce\\u2dd0-\\u2dd6\\u2dd8-\\u2dde\\u2e2f\\u3005-\\u3007\\u3021-\\u3029\\u3031-\\u3035\\u3038-\\u303c\\u3041-\\u3096\\u309d-\\u309f\\u30a1-\\u30fa\\u30fc-\\u30ff\\u3105-\\u312d\\u3131-\\u318e\\u31a0-\\u31ba\\u31f0-\\u31ff\\u3400-\\u4db5\\u4e00-\\u9fcc\\ua000-\\ua48c\\ua4d0-\\ua4fd\\ua500-\\ua60c\\ua610-\\ua61f\\ua62a\\ua62b\\ua640-\\ua66e\\ua67f-\\ua697\\ua6a0-\\ua6ef\\ua717-\\ua71f\\ua722-\\ua788\\ua78b-\\ua78e\\ua790-\\ua793\\ua7a0-\\ua7aa\\ua7f8-\\ua801\\ua803-\\ua805\\ua807-\\ua80a\\ua80c-\\ua822\\ua840-\\ua873\\ua882-\\ua8b3\\ua8f2-\\ua8f7\\ua8fb\\ua90a-\\ua925\\ua930-\\ua946\\ua960-\\ua97c\\ua984-\\ua9b2\\ua9cf\\uaa00-\\uaa28\\uaa40-\\uaa42\\uaa44-\\uaa4b\\uaa60-\\uaa76\\uaa7a\\uaa80-\\uaaaf\\uaab1\\uaab5\\uaab6\\uaab9-\\uaabd\\uaac0\\uaac2\\uaadb-\\uaadd\\uaae0-\\uaaea\\uaaf2-\\uaaf4\\uab01-\\uab06\\uab09-\\uab0e\\uab11-\\uab16\\uab20-\\uab26\\uab28-\\uab2e\\uabc0-\\uabe2\\uac00-\\ud7a3\\ud7b0-\\ud7c6\\ud7cb-\\ud7fb\\uf900-\\ufa6d\\ufa70-\\ufad9\\ufb00-\\ufb06\\ufb13-\\ufb17\\ufb1d\\ufb1f-\\ufb28\\ufb2a-\\ufb36\\ufb38-\\ufb3c\\ufb3e\\ufb40\\ufb41\\ufb43\\ufb44\\ufb46-\\ufbb1\\ufbd3-\\ufd3d\\ufd50-\\ufd8f\\ufd92-\\ufdc7\\ufdf0-\\ufdfb\\ufe70-\\ufe74\\ufe76-\\ufefc\\uff21-\\uff3a\\uff41-\\uff5a\\uff66-\\uffbe\\uffc2-\\uffc7\\uffca-\\uffcf\\uffd2-\\uffd7\\uffda-\\uffdc", n = "\\u0300-\\u036f\\u0483-\\u0487\\u0591-\\u05bd\\u05bf\\u05c1\\u05c2\\u05c4\\u05c5\\u05c7\\u0610-\\u061a\\u0620-\\u0649\\u0672-\\u06d3\\u06e7-\\u06e8\\u06fb-\\u06fc\\u0730-\\u074a\\u0800-\\u0814\\u081b-\\u0823\\u0825-\\u0827\\u0829-\\u082d\\u0840-\\u0857\\u08e4-\\u08fe\\u0900-\\u0903\\u093a-\\u093c\\u093e-\\u094f\\u0951-\\u0957\\u0962-\\u0963\\u0966-\\u096f\\u0981-\\u0983\\u09bc\\u09be-\\u09c4\\u09c7\\u09c8\\u09d7\\u09df-\\u09e0\\u0a01-\\u0a03\\u0a3c\\u0a3e-\\u0a42\\u0a47\\u0a48\\u0a4b-\\u0a4d\\u0a51\\u0a66-\\u0a71\\u0a75\\u0a81-\\u0a83\\u0abc\\u0abe-\\u0ac5\\u0ac7-\\u0ac9\\u0acb-\\u0acd\\u0ae2-\\u0ae3\\u0ae6-\\u0aef\\u0b01-\\u0b03\\u0b3c\\u0b3e-\\u0b44\\u0b47\\u0b48\\u0b4b-\\u0b4d\\u0b56\\u0b57\\u0b5f-\\u0b60\\u0b66-\\u0b6f\\u0b82\\u0bbe-\\u0bc2\\u0bc6-\\u0bc8\\u0bca-\\u0bcd\\u0bd7\\u0be6-\\u0bef\\u0c01-\\u0c03\\u0c46-\\u0c48\\u0c4a-\\u0c4d\\u0c55\\u0c56\\u0c62-\\u0c63\\u0c66-\\u0c6f\\u0c82\\u0c83\\u0cbc\\u0cbe-\\u0cc4\\u0cc6-\\u0cc8\\u0cca-\\u0ccd\\u0cd5\\u0cd6\\u0ce2-\\u0ce3\\u0ce6-\\u0cef\\u0d02\\u0d03\\u0d46-\\u0d48\\u0d57\\u0d62-\\u0d63\\u0d66-\\u0d6f\\u0d82\\u0d83\\u0dca\\u0dcf-\\u0dd4\\u0dd6\\u0dd8-\\u0ddf\\u0df2\\u0df3\\u0e34-\\u0e3a\\u0e40-\\u0e45\\u0e50-\\u0e59\\u0eb4-\\u0eb9\\u0ec8-\\u0ecd\\u0ed0-\\u0ed9\\u0f18\\u0f19\\u0f20-\\u0f29\\u0f35\\u0f37\\u0f39\\u0f41-\\u0f47\\u0f71-\\u0f84\\u0f86-\\u0f87\\u0f8d-\\u0f97\\u0f99-\\u0fbc\\u0fc6\\u1000-\\u1029\\u1040-\\u1049\\u1067-\\u106d\\u1071-\\u1074\\u1082-\\u108d\\u108f-\\u109d\\u135d-\\u135f\\u170e-\\u1710\\u1720-\\u1730\\u1740-\\u1750\\u1772\\u1773\\u1780-\\u17b2\\u17dd\\u17e0-\\u17e9\\u180b-\\u180d\\u1810-\\u1819\\u1920-\\u192b\\u1930-\\u193b\\u1951-\\u196d\\u19b0-\\u19c0\\u19c8-\\u19c9\\u19d0-\\u19d9\\u1a00-\\u1a15\\u1a20-\\u1a53\\u1a60-\\u1a7c\\u1a7f-\\u1a89\\u1a90-\\u1a99\\u1b46-\\u1b4b\\u1b50-\\u1b59\\u1b6b-\\u1b73\\u1bb0-\\u1bb9\\u1be6-\\u1bf3\\u1c00-\\u1c22\\u1c40-\\u1c49\\u1c5b-\\u1c7d\\u1cd0-\\u1cd2\\u1d00-\\u1dbe\\u1e01-\\u1f15\\u200c\\u200d\\u203f\\u2040\\u2054\\u20d0-\\u20dc\\u20e1\\u20e5-\\u20f0\\u2d81-\\u2d96\\u2de0-\\u2dff\\u3021-\\u3028\\u3099\\u309a\\ua640-\\ua66d\\ua674-\\ua67d\\ua69f\\ua6f0-\\ua6f1\\ua7f8-\\ua800\\ua806\\ua80b\\ua823-\\ua827\\ua880-\\ua881\\ua8b4-\\ua8c4\\ua8d0-\\ua8d9\\ua8f3-\\ua8f7\\ua900-\\ua909\\ua926-\\ua92d\\ua930-\\ua945\\ua980-\\ua983\\ua9b3-\\ua9c0\\uaa00-\\uaa27\\uaa40-\\uaa41\\uaa4c-\\uaa4d\\uaa50-\\uaa59\\uaa7b\\uaae0-\\uaae9\\uaaf2-\\uaaf3\\uabc0-\\uabe1\\uabec\\uabed\\uabf0-\\uabf9\\ufb20-\\ufb28\\ufe00-\\ufe0f\\ufe20-\\ufe26\\ufe33\\ufe34\\ufe4d-\\ufe4f\\uff10-\\uff19\\uff3f", a = "\\\\u[0-9a-fA-F]{4}|\\\\u\\{[0-9a-fA-F]+\\}", s = "(?:" + a + "|[" + t + r + "])", u = "(?:" + a + "|[" + i + r + n + "])*";
e.identifier = new RegExp(s + u, "g"), e.identifierStart = new RegExp(s), e.identifierMatch = new RegExp("(?:" + a + "|[" + i + r + n + "])+"), e.newline = /[\n\r\u2028\u2029]/, e.lineBreak = new RegExp(`\r
|` + e.newline.source), e.allLineBreaks = new RegExp(e.lineBreak.source, "g");
}(Df)), Df;
}
var $f = {}, Ma = {}, Lv;
function Pc() {
if (Lv)
return Ma;
Lv = 1;
function e(r, n) {
this.raw_options = t(r, n), this.disabled = this._get_boolean("disabled"), this.eol = this._get_characters("eol", "auto"), this.end_with_newline = this._get_boolean("end_with_newline"), this.indent_size = this._get_number("indent_size", 4), this.indent_char = this._get_characters("indent_char", " "), this.indent_level = this._get_number("indent_level"), this.preserve_newlines = this._get_boolean("preserve_newlines", !0), this.max_preserve_newlines = this._get_number("max_preserve_newlines", 32786), this.preserve_newlines || (this.max_preserve_newlines = 0), this.indent_with_tabs = this._get_boolean("indent_with_tabs", this.indent_char === " "), this.indent_with_tabs && (this.indent_char = " ", this.indent_size === 1 && (this.indent_size = 4)), this.wrap_line_length = this._get_number("wrap_line_length", this._get_number("max_char")), this.indent_empty_lines = this._get_boolean("indent_empty_lines"), this.templating = this._get_selection_list("templating", ["auto", "none", "angular", "django", "erb", "handlebars", "php", "smarty"], ["auto"]);
}
e.prototype._get_array = function(r, n) {
var a = this.raw_options[r], s = n || [];
return typeof a == "object" ? a !== null && typeof a.concat == "function" && (s = a.concat()) : typeof a == "string" && (s = a.split(/[^a-zA-Z0-9_\/\-]+/)), s;
}, e.prototype._get_boolean = function(r, n) {
var a = this.raw_options[r], s = a === void 0 ? !!n : !!a;
return s;
}, e.prototype._get_characters = function(r, n) {
var a = this.raw_options[r], s = n || "";
return typeof a == "string" && (s = a.replace(/\\r/, "\r").replace(/\\n/, `
`).replace(/\\t/, " ")), s;
}, e.prototype._get_number = function(r, n) {
var a = this.raw_options[r];
n = parseInt(n, 10), isNaN(n) && (n = 0);
var s = parseInt(a, 10);
return isNaN(s) && (s = n), s;
}, e.prototype._get_selection = function(r, n, a) {
var s = this._get_selection_list(r, n, a);
if (s.length !== 1)
throw new Error(
"Invalid Option Value: The option '" + r + `' can only be one of the following values:
` + n + `
You passed in: '` + this.raw_options[r] + "'"
);
return s[0];
}, e.prototype._get_selection_list = function(r, n, a) {
if (!n || n.length === 0)
throw new Error("Selection list cannot be empty.");
if (a = a || [n[0]], !this._is_valid_selection(a, n))
throw new Error("Invalid Default Value!");
var s = this._get_array(r, a);
if (!this._is_valid_selection(s, n))
throw new Error(
"Invalid Option Value: The option '" + r + `' can contain only the following values:
` + n + `
You passed in: '` + this.raw_options[r] + "'"
);
return s;
}, e.prototype._is_valid_selection = function(r, n) {
return r.length && n.length && !r.some(function(a) {
return n.indexOf(a) === -1;
});
};
function t(r, n) {
var a = {};
r = i(r);
var s;
for (s in r)
s !== n && (a[s] = r[s]);
if (n && r[n])
for (s in r[n])
a[s] = r[n][s];
return a;
}
function i(r) {
var n = {}, a;
for (a in r) {
var s = a.replace(/-/g, "_");
n[s] = r[a];
}
return n;
}
return Ma.Options = e, Ma.normalizeOpts = i, Ma.mergeOpts = t, Ma;
}
var Nv;
function V0() {
if (Nv)
return $f;
Nv = 1;
var e = Pc().Options, t = ["before-newline", "after-newline", "preserve-newline"];
function i(r) {
e.call(this, r, "js");
var n = this.raw_options.brace_style || null;
n === "expand-strict" ? this.raw_options.brace_style = "expand" : n === "collapse-preserve-inline" ? this.raw_options.brace_style = "collapse,preserve-inline" : this.raw_options.braces_on_own_line !== void 0 && (this.raw_options.brace_style = this.raw_options.braces_on_own_line ? "expand" : "collapse");
var a = this._get_selection_list("brace_style", ["collapse", "expand", "end-expand", "none", "preserve-inline"]);
this.brace_preserve_inline = !1, this.brace_style = "collapse";
for (var s = 0; s < a.length; s++)
a[s] === "preserve-inline" ? this.brace_preserve_inline = !0 : this.brace_style = a[s];
this.unindent_chained_methods = this._get_boolean("unindent_chained_methods"), this.break_chained_methods = this._get_boolean("break_chained_methods"), this.space_in_paren = this._get_boolean("space_in_paren"), this.space_in_empty_paren = this._get_boolean("space_in_empty_paren"), this.jslint_happy = this._get_boolean("jslint_happy"), this.space_after_anon_function = this._get_boolean("space_after_anon_function"), this.space_after_named_function = this._get_boolean("space_after_named_function"), this.keep_array_indentation = this._get_boolean("keep_array_indentation"), this.space_before_conditional = this._get_boolean("space_before_conditional", !0), this.unescape_strings = this._get_boolean("unescape_strings"), this.e4x = this._get_boolean("e4x"), this.comma_first = this._get_boolean("comma_first"), this.operator_position = this._get_selection("operator_position", t), this.test_output_raw = this._get_boolean("test_output_raw"), this.jslint_happy && (this.space_after_anon_function = !0);
}
return i.prototype = new e(), $f.Options = i, $f;
}
var Ro = {}, If = {}, Bv;
function Lc() {
if (Bv)
return If;
Bv = 1;
var e = RegExp.prototype.hasOwnProperty("sticky");
function t(i) {
this.__input = i || "", this.__input_length = this.__input.length, this.__position = 0;
}
return t.prototype.restart = function() {
this.__position = 0;
}, t.prototype.back = function() {
this.__position > 0 && (this.__position -= 1);
}, t.prototype.hasNext = function() {
return this.__position < this.__input_length;
}, t.prototype.next = function() {
var i = null;
return this.hasNext() && (i = this.__input.charAt(this.__position), this.__position += 1), i;
}, t.prototype.peek = function(i) {
var r = null;
return i = i || 0, i += this.__position, i >= 0 && i < this.__input_length && (r = this.__input.charAt(i)), r;
}, t.prototype.__match = function(i, r) {
i.lastIndex = r;
var n = i.exec(this.__input);
return n && !(e && i.sticky) && n.index !== r && (n = null), n;
}, t.prototype.test = function(i, r) {
return r = r || 0, r += this.__position, r >= 0 && r < this.__input_length ? !!this.__match(i, r) : !1;
}, t.prototype.testChar = function(i, r) {
var n = this.peek(r);
return i.lastIndex = 0, n !== null && i.test(n);
}, t.prototype.match = function(i) {
var r = this.__match(i, this.__position);
return r ? this.__position += r[0].length : r = null, r;
}, t.prototype.read = function(i, r, n) {
var a = "", s;
return i && (s = this.match(i), s && (a += s[0])), r && (s || !i) && (a += this.readUntil(r, n)), a;
}, t.prototype.readUntil = function(i, r) {
var n = "", a = this.__position;
i.lastIndex = this.__position;
var s = i.exec(this.__input);
return s ? (a = s.index, r && (a += s[0].length)) : a = this.__input_length, n = this.__input.substring(this.__position, a), this.__position = a, n;
}, t.prototype.readUntilAfter = function(i) {
return this.readUntil(i, !0);
}, t.prototype.get_regexp = function(i, r) {
var n = null, a = "g";
return r && e && (a = "y"), typeof i == "string" && i !== "" ? n = new RegExp(i, a) : i && (n = new RegExp(i.source, a)), n;
}, t.prototype.get_literal_regexp = function(i) {
return RegExp(i.replace(/[-\/\\^$*+?.()|[\]{}]/g, "\\$&"));
}, t.prototype.peekUntilAfter = function(i) {
var r = this.__position, n = this.readUntilAfter(i);
return this.__position = r, n;
}, t.prototype.lookBack = function(i) {
var r = this.__position - 1;
return r >= i.length && this.__input.substring(r - i.length, r).toLowerCase() === i;
}, If.InputScanner = t, If;
}
var fs = {}, Ff = {}, Vv;
function q2() {
if (Vv)
return Ff;
Vv = 1;
function e(t) {
this.__tokens = [], this.__tokens_length = this.__tokens.length, this.__position = 0, this.__parent_token = t;
}
return e.prototype.restart = function() {
this.__position = 0;
}, e.prototype.isEmpty = function() {
return this.__tokens_length === 0;
}, e.prototype.hasNext = function() {
return this.__position < this.__tokens_length;
}, e.prototype.next = function() {
var t = null;
return this.hasNext() && (t = this.__tokens[this.__position], this.__position += 1), t;
}, e.prototype.peek = function(t) {
var i = null;
return t = t || 0, t += this.__position, t >= 0 && t < this.__tokens_length && (i = this.__tokens[t]), i;
}, e.prototype.add = function(t) {
this.__parent_token && (t.parent = this.__parent_token), this.__tokens.push(t), this.__tokens_length += 1;
}, Ff.TokenStream = e, Ff;
}
var Mf = {}, Pf = {}, jv;
function ru() {
if (jv)
return Pf;
jv = 1;
function e(t, i) {
this._input = t, this._starting_pattern = null, this._match_pattern = null, this._until_pattern = null, this._until_after = !1, i && (this._starting_pattern = this._input.get_regexp(i._starting_pattern, !0), this._match_pattern = this._input.get_regexp(i._match_pattern, !0), this._until_pattern = this._input.get_regexp(i._until_pattern), this._until_after = i._until_after);
}
return e.prototype.read = function() {
var t = this._input.read(this._starting_pattern);
return (!this._starting_pattern || t) && (t += this._input.read(this._match_pattern, this._until_pattern, this._until_after)), t;
}, e.prototype.read_match = function() {
return this._input.match(this._match_pattern);
}, e.prototype.until_after = function(t) {
var i = this._create();
return i._until_after = !0, i._until_pattern = this._input.get_regexp(t), i._update(), i;
}, e.prototype.until = function(t) {
var i = this._create();
return i._until_after = !1, i._until_pattern = this._input.get_regexp(t), i._update(), i;
}, e.prototype.starting_with = function(t) {
var i = this._create();
return i._starting_pattern = this._input.get_regexp(t, !0), i._update(), i;
}, e.prototype.matching = function(t) {
var i = this._create();
return i._match_pattern = this._input.get_regexp(t, !0), i._update(), i;
}, e.prototype._create = function() {
return new e(this._input, this);
}, e.prototype._update = function() {
}, Pf.Pattern = e, Pf;
}
var Uv;
function eT() {
if (Uv)
return Mf;
Uv = 1;
var e = ru().Pattern;
function t(i, r) {
e.call(this, i, r), r ? this._line_regexp = this._input.get_regexp(r._line_regexp) : this.__set_whitespace_patterns("", ""), this.newline_count = 0, this.whitespace_before_token = "";
}
return t.prototype = new e(), t.prototype.__set_whitespace_patterns = function(i, r) {
i += "\\t ", r += "\\n\\r", this._match_pattern = this._input.get_regexp(
"[" + i + r + "]+",
!0
), this._newline_regexp = this._input.get_regexp(
"\\r\\n|[" + r + "]"
);
}, t.prototype.read = function() {
this.newline_count = 0, this.whitespace_before_token = "";
var i = this._input.read(this._match_pattern);
if (i === " ")
this.whitespace_before_token = " ";
else if (i) {
var r = this.__split(this._newline_regexp, i);
this.newline_count = r.length - 1, this.whitespace_before_token = r[this.newline_count];
}
return i;
}, t.prototype.matching = function(i, r) {
var n = this._create();
return n.__set_whitespace_patterns(i, r), n._update(), n;
}, t.prototype._create = function() {
return new t(this._input, this);
}, t.prototype.__split = function(i, r) {
i.lastIndex = 0;
for (var n = 0, a = [], s = i.exec(r); s; )
a.push(r.substring(n, s.index)), n = s.index + s[0].length, s = i.exec(r);
return n < r.length ? a.push(r.substring(n, r.length)) : a.push(""), a;
}, Mf.WhitespacePattern = t, Mf;
}
var zv;
function Hs() {
if (zv)
return fs;
zv = 1;
var e = Lc().InputScanner, t = N0().Token, i = q2().TokenStream, r = eT().WhitespacePattern, n = {
START: "TK_START",
RAW: "TK_RAW",
EOF: "TK_EOF"
}, a = function(s, u) {
this._input = new e(s), this._options = u || {}, this.__tokens = null, this._patterns = {}, this._patterns.whitespace = new r(this._input);
};
return a.prototype.tokenize = function() {
this._input.restart(), this.__tokens = new i(), this._reset();
for (var s, u = new t(n.START, ""), d = null, h = [], p = new i(); u.type !== n.EOF; ) {
for (s = this._get_next_token(u, d); this._is_comment(s); )
p.add(s), s = this._get_next_token(u, d);
p.isEmpty() || (s.comments_before = p, p = new i()), s.parent = d, this._is_opening(s) ? (h.push(d), d = s) : d && this._is_closing(s, d) && (s.opened = d, d.closed = s, d = h.pop(), s.parent = d), s.previous = u, u.next = s, this.__tokens.add(s), u = s;
}
return this.__tokens;
}, a.prototype._is_first_token = function() {
return this.__tokens.isEmpty();
}, a.prototype._reset = function() {
}, a.prototype._get_next_token = function(s, u) {
this._readWhitespace();
var d = this._input.read(/.+/g);
return d ? this._create_token(n.RAW, d) : this._create_token(n.EOF, "");
}, a.prototype._is_comment = function(s) {
return !1;
}, a.prototype._is_opening = function(s) {
return !1;
}, a.prototype._is_closing = function(s, u) {
return !1;
}, a.prototype._create_token = function(s, u) {
var d = new t(
s,
u,
this._patterns.whitespace.newline_count,
this._patterns.whitespace.whitespace_before_token
);
return d;
}, a.prototype._readWhitespace = function() {
return this._patterns.whitespace.read();
}, fs.Tokenizer = a, fs.TOKEN = n, fs;
}
var Lf = {}, Hv;
function Nc() {
if (Hv)
return Lf;
Hv = 1;
function e(t, i) {
t = typeof t == "string" ? t : t.source, i = typeof i == "string" ? i : i.source, this.__directives_block_pattern = new RegExp(t + / beautify( \w+[:]\w+)+ /.source + i, "g"), this.__directive_pattern = / (\w+)[:](\w+)/g, this.__directives_end_ignore_pattern = new RegExp(t + /\sbeautify\signore:end\s/.source + i, "g");
}
return e.prototype.get_directives = function(t) {
if (!t.match(this.__directives_block_pattern))
return null;
var i = {};
this.__directive_pattern.lastIndex = 0;
for (var r = this.__directive_pattern.exec(t); r; )
i[r[1]] = r[2], r = this.__directive_pattern.exec(t);
return i;
}, e.prototype.readIgnored = function(t) {
return t.readUntilAfter(this.__directives_end_ignore_pattern);
}, Lf.Directives = e, Lf;
}
var Nf = {}, Wv;
function j0() {
if (Wv)
return Nf;
Wv = 1;
var e = ru().Pattern, t = {
django: !1,
erb: !1,
handlebars: !1,
php: !1,
smarty: !1,
angular: !1
};
function i(r, n) {
e.call(this, r, n), this.__template_pattern = null, this._disabled = Object.assign({}, t), this._excluded = Object.assign({}, t), n && (this.__template_pattern = this._input.get_regexp(n.__template_pattern), this._excluded = Object.assign(this._excluded, n._excluded), this._disabled = Object.assign(this._disabled, n._disabled));
var a = new e(r);
this.__patterns = {
handlebars_comment: a.starting_with(/{{!--/).until_after(/--}}/),
handlebars_unescaped: a.starting_with(/{{{/).until_after(/}}}/),
handlebars: a.starting_with(/{{/).until_after(/}}/),
php: a.starting_with(/<\?(?:[= ]|php)/).until_after(/\?>/),
erb: a.starting_with(/<%[^%]/).until_after(/[^%]%>/),
django: a.starting_with(/{%/).until_after(/%}/),
django_value: a.starting_with(/{{/).until_after(/}}/),
django_comment: a.starting_with(/{#/).until_after(/#}/),
smarty: a.starting_with(/{(?=[^}{\s\n])/).until_after(/[^\s\n]}/),
smarty_comment: a.starting_with(/{\*/).until_after(/\*}/),
smarty_literal: a.starting_with(/{literal}/).until_after(/{\/literal}/)
};
}
return i.prototype = new e(), i.prototype._create = function() {
return new i(this._input, this);
}, i.prototype._update = function() {
this.__set_templated_pattern();
}, i.prototype.disable = function(r) {
var n = this._create();
return n._disabled[r] = !0, n._update(), n;
}, i.prototype.read_options = function(r) {
var n = this._create();
for (var a in t)
n._disabled[a] = r.templating.indexOf(a) === -1;
return n._update(), n;
}, i.prototype.exclude = function(r) {
var n = this._create();
return n._excluded[r] = !0, n._update(), n;
}, i.prototype.read = function() {
var r = "";
this._match_pattern ? r = this._input.read(this._starting_pattern) : r = this._input.read(this._starting_pattern, this.__template_pattern);
for (var n = this._read_template(); n; )
this._match_pattern ? n += this._input.read(this._match_pattern) : n += this._input.readUntil(this.__template_pattern), r += n, n = this._read_template();
return this._until_after && (r += this._input.readUntilAfter(this._until_pattern)), r;
}, i.prototype.__set_templated_pattern = function() {
var r = [];
this._disabled.php || r.push(this.__patterns.php._starting_pattern.source), this._disabled.handlebars || r.push(this.__patterns.handlebars._starting_pattern.source), this._disabled.angular || r.push(this.__patterns.handlebars._starting_pattern.source), this._disabled.erb || r.push(this.__patterns.erb._starting_pattern.source), this._disabled.django || (r.push(this.__patterns.django._starting_pattern.source), r.push(this.__patterns.django_value._starting_pattern.source), r.push(this.__patterns.django_comment._starting_pattern.source)), this._disabled.smarty || r.push(this.__patterns.smarty._starting_pattern.source), this._until_pattern && r.push(this._until_pattern.source), this.__template_pattern = this._input.get_regexp("(?:" + r.join("|") + ")");
}, i.prototype._read_template = function() {
var r = "", n = this._input.peek();
if (n === "<") {
var a = this._input.peek(1);
!this._disabled.php && !this._excluded.php && a === "?" && (r = r || this.__patterns.php.read()), !this._disabled.erb && !this._excluded.erb && a === "%" && (r = r || this.__patterns.erb.read());
} else
n === "{" && (!this._disabled.handlebars && !this._excluded.handlebars && (r = r || this.__patterns.handlebars_comment.read(), r = r || this.__patterns.handlebars_unescaped.read(), r = r || this.__patterns.handlebars.read()), this._disabled.django || (!this._excluded.django && !this._excluded.handlebars && (r = r || this.__patterns.django_value.read()), this._excluded.django || (r = r || this.__patterns.django_comment.read(), r = r || this.__patterns.django.read())), this._disabled.smarty || this._disabled.django && this._disabled.handlebars && (r = r || this.__patterns.smarty_comment.read(), r = r || this.__patterns.smarty_literal.read(), r = r || this.__patterns.smarty.read()));
return r;
}, Nf.TemplatablePattern = i, Nf;
}
var Gv;
function cs() {
if (Gv)
return Ro;
Gv = 1;
var e = Lc().InputScanner, t = Hs().Tokenizer, i = Hs().TOKEN, r = Nc().Directives, n = B0(), a = ru().Pattern, s = j0().TemplatablePattern;
function u(D, P) {
return P.indexOf(D) !== -1;
}
var d = {
START_EXPR: "TK_START_EXPR",
END_EXPR: "TK_END_EXPR",
START_BLOCK: "TK_START_BLOCK",
END_BLOCK: "TK_END_BLOCK",
WORD: "TK_WORD",
RESERVED: "TK_RESERVED",
SEMICOLON: "TK_SEMICOLON",
STRING: "TK_STRING",
EQUALS: "TK_EQUALS",
OPERATOR: "TK_OPERATOR",
COMMA: "TK_COMMA",
BLOCK_COMMENT: "TK_BLOCK_COMMENT",
COMMENT: "TK_COMMENT",
DOT: "TK_DOT",
UNKNOWN: "TK_UNKNOWN",
START: i.START,
RAW: i.RAW,
EOF: i.EOF
}, h = new r(/\/\*/, /\*\//), p = /0[xX][0123456789abcdefABCDEF_]*n?|0[oO][01234567_]*n?|0[bB][01_]*n?|\d[\d_]*n|(?:\.\d[\d_]*|\d[\d_]*\.?[\d_]*)(?:[eE][+-]?[\d_]+)?/, g = /[0-9]/, _ = /[^\d\.]/, S = ">>> === !== &&= ??= ||= << && >= ** != == <= >> || ?? |> < / - + > : & % ? ^ | *".split(" "), b = ">>>= ... >>= <<= === >>> !== **= &&= ??= ||= => ^= :: /= << <= == && -= >= >> != -- += ** || ?? ++ %= &= *= |= |> = ! ? > < : / ^ - + * & % ~ |";
b = b.replace(/[-[\]{}()*+?.,\\^$|#]/g, "\\$&"), b = "\\?\\.(?!\\d) " + b, b = b.replace(/ /g, "|");
var A = new RegExp(b), w = "continue,try,throw,return,var,let,const,if,switch,case,default,for,while,break,function,import,export".split(","), m = w.concat(["do", "in", "of", "else", "get", "set", "new", "catch", "finally", "typeof", "yield", "async", "await", "from", "as", "class", "extends"]), y = new RegExp("^(?:" + m.join("|") + ")$"), E, x = function(D, P) {
t.call(this, D, P), this._patterns.whitespace = this._patterns.whitespace.matching(
/\u00A0\u1680\u180e\u2000-\u200a\u202f\u205f\u3000\ufeff/.source,
/\u2028\u2029/.source
);
var M = new a(this._input), B = new s(this._input).read_options(this._options);
this.__patterns = {
template: B,
identifier: B.starting_with(n.identifier).matching(n.identifierMatch),
number: M.matching(p),
punct: M.matching(A),
comment: M.starting_with(/\/\//).until(/[\n\r\u2028\u2029]/),
block_comment: M.starting_with(/\/\*/).until_after(/\*\//),
html_comment_start: M.matching(/<!--/),
html_comment_end: M.matching(/-->/),
include: M.starting_with(/#include/).until_after(n.lineBreak),
shebang: M.starting_with(/#!/).until_after(n.lineBreak),
xml: M.matching(/[\s\S]*?<(\/?)([-a-zA-Z:0-9_.]+|{[^}]+?}|!\[CDATA\[[^\]]*?\]\]|)(\s*{[^}]+?}|\s+[-a-zA-Z:0-9_.]+|\s+[-a-zA-Z:0-9_.]+\s*=\s*('[^']*'|"[^"]*"|{([^{}]|{[^}]+?})+?}))*\s*(\/?)\s*>/),
single_quote: B.until(/['\\\n\r\u2028\u2029]/),
double_quote: B.until(/["\\\n\r\u2028\u2029]/),
template_text: B.until(/[`\\$]/),
template_expression: B.until(/[`}\\]/)
};
};
x.prototype = new t(), x.prototype._is_comment = function(D) {
return D.type === d.COMMENT || D.type === d.BLOCK_COMMENT || D.type === d.UNKNOWN;
}, x.prototype._is_opening = function(D) {
return D.type === d.START_BLOCK || D.type === d.START_EXPR;
}, x.prototype._is_closing = function(D, P) {
return (D.type === d.END_BLOCK || D.type === d.END_EXPR) && P && (D.text === "]" && P.text === "[" || D.text === ")" && P.text === "(" || D.text === "}" && P.text === "{");
}, x.prototype._reset = function() {
E = !1;
}, x.prototype._get_next_token = function(D, P) {
var M = null;
this._readWhitespace();
var B = this._input.peek();
return B === null ? this._create_token(d.EOF, "") : (M = M || this._read_non_javascript(B), M = M || this._read_string(B), M = M || this._read_pair(B, this._input.peek(1)), M = M || this._read_word(D), M = M || this._read_singles(B), M = M || this._read_comment(B), M = M || this._read_regexp(B, D), M = M || this._read_xml(B, D), M = M || this._read_punctuation(), M = M || this._create_token(d.UNKNOWN, this._input.next()), M);
}, x.prototype._read_word = function(D) {
var P;
if (P = this.__patterns.identifier.read(), P !== "")
return P = P.replace(n.allLineBreaks, `
`), !(D.type === d.DOT || D.type === d.RESERVED && (D.text === "set" || D.text === "get")) && y.test(P) ? (P === "in" || P === "of") && (D.type === d.WORD || D.type === d.STRING) ? this._create_token(d.OPERATOR, P) : this._create_token(d.RESERVED, P) : this._create_token(d.WORD, P);
if (P = this.__patterns.number.read(), P !== "")
return this._create_token(d.WORD, P);
}, x.prototype._read_singles = function(D) {
var P = null;
return D === "(" || D === "[" ? P = this._create_token(d.START_EXPR, D) : D === ")" || D === "]" ? P = this._create_token(d.END_EXPR, D) : D === "{" ? P = this._create_token(d.START_BLOCK, D) : D === "}" ? P = this._create_token(d.END_BLOCK, D) : D === ";" ? P = this._create_token(d.SEMICOLON, D) : D === "." && _.test(this._input.peek(1)) ? P = this._create_token(d.DOT, D) : D === "," && (P = this._create_token(d.COMMA, D)), P && this._input.next(), P;
}, x.prototype._read_pair = function(D, P) {
var M = null;
return D === "#" && P === "{" && (M = this._create_token(d.START_BLOCK, D + P)), M && (this._input.next(), this._input.next()), M;
}, x.prototype._read_punctuation = function() {
var D = this.__patterns.punct.read();
if (D !== "")
return D === "=" ? this._create_token(d.EQUALS, D) : D === "?." ? this._create_token(d.DOT, D) : this._create_token(d.OPERATOR, D);
}, x.prototype._read_non_javascript = function(D) {
var P = "";
if (D === "#") {
if (this._is_first_token() && (P = this.__patterns.shebang.read(), P))
return this._create_token(d.UNKNOWN, P.trim() + `
`);
if (P = this.__patterns.include.read(), P)
return this._create_token(d.UNKNOWN, P.trim() + `
`);
D = this._input.next();
var M = "#";
if (this._input.hasNext() && this._input.testChar(g)) {
do
D = this._input.next(), M += D;
while (this._input.hasNext() && D !== "#" && D !== "=");
return D === "#" || (this._input.peek() === "[" && this._input.peek(1) === "]" ? (M += "[]", this._input.next(), this._input.next()) : this._input.peek() === "{" && this._input.peek(1) === "}" && (M += "{}", this._input.next(), this._input.next())), this._create_token(d.WORD, M);
}
this._input.back();
} else if (D === "<" && this._is_first_token()) {
if (P = this.__patterns.html_comment_start.read(), P) {
for (; this._input.hasNext() && !this._input.testChar(n.newline); )
P += this._input.next();
return E = !0, this._create_token(d.COMMENT, P);
}
} else if (E && D === "-" && (P = this.__patterns.html_comment_end.read(), P))
return E = !1, this._create_token(d.COMMENT, P);
return null;
}, x.prototype._read_comment = function(D) {
var P = null;
if (D === "/") {
var M = "";
if (this._input.peek(1) === "*") {
M = this.__patterns.block_comment.read();
var B = h.get_directives(M);
B && B.ignore === "start" && (M += h.readIgnored(this._input)), M = M.replace(n.allLineBreaks, `
`), P = this._create_token(d.BLOCK_COMMENT, M), P.directives = B;
} else
this._input.peek(1) === "/" && (M = this.__patterns.comment.read(), P = this._create_token(d.COMMENT, M));
}
return P;
}, x.prototype._read_string = function(D) {
if (D === "`" || D === "'" || D === '"') {
var P = this._input.next();
return this.has_char_escapes = !1, D === "`" ? P += this._read_string_recursive("`", !0, "${") : P += this._read_string_recursive(D), this.has_char_escapes && this._options.unescape_strings && (P = k(P)), this._input.peek() === D && (P += this._input.next()), P = P.replace(n.allLineBreaks, `
`), this._create_token(d.STRING, P);
}
return null;
}, x.prototype._allow_regexp_or_xml = function(D) {
return D.type === d.RESERVED && u(D.text, ["return", "case", "throw", "else", "do", "typeof", "yield"]) || D.type === d.END_EXPR && D.text === ")" && D.opened.previous.type === d.RESERVED && u(D.opened.previous.text, ["if", "while", "for"]) || u(D.type, [
d.COMMENT,
d.START_EXPR,
d.START_BLOCK,
d.START,
d.END_BLOCK,
d.OPERATOR,
d.EQUALS,
d.EOF,
d.SEMICOLON,
d.COMMA
]);
}, x.prototype._read_regexp = function(D, P) {
if (D === "/" && this._allow_regexp_or_xml(P)) {
for (var M = this._input.next(), B = !1, T = !1; this._input.hasNext() && (B || T || this._input.peek() !== D) && !this._input.testChar(n.newline); )
M += this._input.peek(), B ? B = !1 : (B = this._input.peek() === "\\", this._input.peek() === "[" ? T = !0 : this._input.peek() === "]" && (T = !1)), this._input.next();
return this._input.peek() === D && (M += this._input.next(), M += this._input.read(n.identifier)), this._create_token(d.STRING, M);
}
return null;
}, x.prototype._read_xml = function(D, P) {
if (this._options.e4x && D === "<" && this._allow_regexp_or_xml(P)) {
var M = "", B = this.__patterns.xml.read_match();
if (B) {
for (var T = B[2].replace(/^{\s+/, "{").replace(/\s+}$/, "}"), $ = T.indexOf("{") === 0, V = 0; B; ) {
var z = !!B[1], H = B[2], I = !!B[B.length - 1] || H.slice(0, 8) === "![CDATA[";
if (!I && (H === T || $ && H.replace(/^{\s+/, "{").replace(/\s+}$/, "}")) && (z ? --V : ++V), M += B[0], V <= 0)
break;
B = this.__patterns.xml.read_match();
}
return B || (M += this._input.match(/[\s\S]*/g)[0]), M = M.replace(n.allLineBreaks, `
`), this._create_token(d.STRING, M);
}
}
return null;
};
function k(D) {
for (var P = "", M = 0, B = new e(D), T = null; B.hasNext(); )
if (T = B.match(/([\s]|[^\\]|\\\\)+/g), T && (P += T[0]), B.peek() === "\\") {
if (B.next(), B.peek() === "x")
T = B.match(/x([0-9A-Fa-f]{2})/g);
else if (B.peek() === "u")
T = B.match(/u([0-9A-Fa-f]{4})/g), T || (T = B.match(/u\{([0-9A-Fa-f]+)\}/g));
else {
P += "\\", B.hasNext() && (P += B.next());
continue;
}
if (!T || (M = parseInt(T[1], 16), M > 126 && M <= 255 && T[0].indexOf("x") === 0))
return D;
M >= 0 && M < 32 || M > 1114111 ? P += "\\" + T[0] : M === 34 || M === 39 || M === 92 ? P += "\\" + String.fromCharCode(M) : P += String.fromCharCode(M);
}
return P;
}
return x.prototype._read_string_recursive = function(D, P, M) {
var B, T;
D === "'" ? T = this.__patterns.single_quote : D === '"' ? T = this.__patterns.double_quote : D === "`" ? T = this.__patterns.template_text : D === "}" && (T = this.__patterns.template_expression);
for (var $ = T.read(), V = ""; this._input.hasNext(); ) {
if (V = this._input.next(), V === D || !P && n.newline.test(V)) {
this._input.back();
break;
} else
V === "\\" && this._input.hasNext() ? (B = this._input.peek(), B === "x" || B === "u" ? this.has_char_escapes = !0 : B === "\r" && this._input.peek(1) === `
` && this._input.next(), V += this._input.next()) : M && (M === "${" && V === "$" && this._input.peek() === "{" && (V += this._input.next()), M === V && (D === "`" ? V += this._read_string_recursive("}", P, "`") : V += this._read_string_recursive("`", P, "${"), this._input.hasNext() && (V += this._input.next())));
V += T.read(), $ += V;
}
return $;
}, Ro.Tokenizer = x, Ro.TOKEN = d, Ro.positionable_operators = S.slice(), Ro.line_starters = w.slice(), Ro;
}
var Kv;
function tT() {
if (Kv)
return kf;
Kv = 1;
var e = Mc().Output, t = N0().Token, i = B0(), r = V0().Options, n = cs().Tokenizer, a = cs().line_starters, s = cs().positionable_operators, u = cs().TOKEN;
function d(T, $) {
return $.indexOf(T) !== -1;
}
function h(T) {
return T.replace(/^\s+/g, "");
}
function p(T) {
for (var $ = {}, V = 0; V < T.length; V++)
$[T[V].replace(/-/g, "_")] = T[V];
return $;
}
function g(T, $) {
return T && T.type === u.RESERVED && T.text === $;
}
function _(T, $) {
return T && T.type === u.RESERVED && d(T.text, $);
}
var S = ["case", "return", "do", "if", "throw", "else", "await", "break", "continue", "async"], b = ["before-newline", "after-newline", "preserve-newline"], A = p(b), w = [A.before_newline, A.preserve_newline], m = {
BlockStatement: "BlockStatement",
Statement: "Statement",
ObjectLiteral: "ObjectLiteral",
ArrayLiteral: "ArrayLiteral",
ForInitializer: "ForInitializer",
Conditional: "Conditional",
Expression: "Expression"
};
function y(T, $) {
$.multiline_frame || $.mode === m.ForInitializer || $.mode === m.Conditional || T.remove_indent($.start_line_index);
}
function E(T) {
T = T.replace(i.allLineBreaks, `
`);
for (var $ = [], V = T.indexOf(`
`); V !== -1; )
$.push(T.substring(0, V)), T = T.substring(V + 1), V = T.indexOf(`
`);
return T.length && $.push(T), $;
}
function x(T) {
return T === m.ArrayLiteral;
}
function k(T) {
return d(T, [m.Expression, m.ForInitializer, m.Conditional]);
}
function D(T, $) {
for (var V = 0; V < T.length; V++) {
var z = T[V].trim();
if (z.charAt(0) !== $)
return !1;
}
return !0;
}
function P(T, $) {
for (var V = 0, z = T.length, H; V < z; V++)
if (H = T[V], H && H.indexOf($) !== 0)
return !1;
return !0;
}
function M(T, $) {
$ = $ || {}, this._source_text = T || "", this._output = null, this._tokens = null, this._last_last_text = null, this._flags = null, this._previous_flags = null, this._flag_store = null, this._options = new r($);
}
M.prototype.create_flags = function(T, $) {
var V = 0;
T && (V = T.indentation_level, !this._output.just_added_newline() && T.line_indent_level > V && (V = T.line_indent_level));
var z = {
mode: $,
parent: T,
last_token: T ? T.last_token : new t(u.START_BLOCK, ""),
last_word: T ? T.last_word : "",
declaration_statement: !1,
declaration_assignment: !1,
multiline_frame: !1,
inline_frame: !1,
if_block: !1,
else_block: !1,
class_start_block: !1,
do_block: !1,
do_while: !1,
import_block: !1,
in_case_statement: !1,
in_case: !1,
case_body: !1,
case_block: !1,
indentation_level: V,
alignment: 0,
line_indent_level: T ? T.line_indent_level : V,
start_line_index: this._output.get_line_number(),
ternary_depth: 0
};
return z;
}, M.prototype._reset = function(T) {
var $ = T.match(/^[\t ]*/)[0];
this._last_last_text = "", this._output = new e(this._options, $), this._output.raw = this._options.test_output_raw, this._flag_store = [], this.set_mode(m.BlockStatement);
var V = new n(T, this._options);
return this._tokens = V.tokenize(), T;
}, M.prototype.beautify = function() {
if (this._options.disabled)
return this._source_text;
var T, $ = this._reset(this._source_text), V = this._options.eol;
this._options.eol === "auto" && (V = `
`, $ && i.lineBreak.test($ || "") && (V = $.match(i.lineBreak)[0]));
for (var z = this._tokens.next(); z; )
this.handle_token(z), this._last_last_text = this._flags.last_token.text, this._flags.last_token = z, z = this._tokens.next();
return T = this._output.get_code(V), T;
}, M.prototype.handle_token = function(T, $) {
T.type === u.START_EXPR ? this.handle_start_expr(T) : T.type === u.END_EXPR ? this.handle_end_expr(T) : T.type === u.START_BLOCK ? this.handle_start_block(T) : T.type === u.END_BLOCK ? this.handle_end_block(T) : T.type === u.WORD ? this.handle_word(T) : T.type === u.RESERVED ? this.handle_word(T) : T.type === u.SEMICOLON ? this.handle_semicolon(T) : T.type === u.STRING ? this.handle_string(T) : T.type === u.EQUALS ? this.handle_equals(T) : T.type === u.OPERATOR ? this.handle_operator(T) : T.type === u.COMMA ? this.handle_comma(T) : T.type === u.BLOCK_COMMENT ? this.handle_block_comment(T, $) : T.type === u.COMMENT ? this.handle_comment(T, $) : T.type === u.DOT ? this.handle_dot(T) : T.type === u.EOF ? this.handle_eof(T) : T.type === u.UNKNOWN ? this.handle_unknown(T, $) : this.handle_unknown(T, $);
}, M.prototype.handle_whitespace_and_comments = function(T, $) {
var V = T.newlines, z = this._options.keep_array_indentation && x(this._flags.mode);
if (T.comments_before)
for (var H = T.comments_before.next(); H; )
this.handle_whitespace_and_comments(H, $), this.handle_token(H, $), H = T.comments_before.next();
if (z)
for (var I = 0; I < V; I += 1)
this.print_newline(I > 0, $);
else if (this._options.max_preserve_newlines && V > this._options.max_preserve_newlines && (V = this._options.max_preserve_newlines), this._options.preserve_newlines && V > 1) {
this.print_newline(!1, $);
for (var U = 1; U < V; U += 1)
this.print_newline(!0, $);
}
};
var B = ["async", "break", "continue", "return", "throw", "yield"];
return M.prototype.allow_wrap_or_preserved_newline = function(T, $) {
if ($ = $ === void 0 ? !1 : $, !this._output.just_added_newline()) {
var V = this._options.preserve_newlines && T.newlines || $, z = d(this._flags.last_token.text, s) || d(T.text, s);
if (z) {
var H = d(this._flags.last_token.text, s) && d(this._options.operator_position, w) || d(T.text, s);
V = V && H;
}
if (V)
this.print_newline(!1, !0);
else if (this._options.wrap_line_length) {
if (_(this._flags.last_token, B))
return;
this._output.set_wrap_point();
}
}
}, M.prototype.print_newline = function(T, $) {
if (!$ && this._flags.last_token.text !== ";" && this._flags.last_token.text !== "," && this._flags.last_token.text !== "=" && (this._flags.last_token.type !== u.OPERATOR || this._flags.last_token.text === "--" || this._flags.last_token.text === "++"))
for (var V = this._tokens.peek(); this._flags.mode === m.Statement && !(this._flags.if_block && g(V, "else")) && !this._flags.do_block; )
this.restore_mode();
this._output.add_new_line(T) && (this._flags.multiline_frame = !0);
}, M.prototype.print_token_line_indentation = function(T) {
this._output.just_added_newline() && (this._options.keep_array_indentation && T.newlines && (T.text === "[" || x(this._flags.mode)) ? (this._output.current_line.set_indent(-1), this._output.current_line.push(T.whitespace_before), this._output.space_before_token = !1) : this._output.set_indent(this._flags.indentation_level, this._flags.alignment) && (this._flags.line_indent_level = this._flags.indentation_level));
}, M.prototype.print_token = function(T) {
if (this._output.raw) {
this._output.add_raw_token(T);
return;
}
if (this._options.comma_first && T.previous && T.previous.type === u.COMMA && this._output.just_added_newline() && this._output.previous_line.last() === ",") {
var $ = this._output.previous_line.pop();
this._output.previous_line.is_empty() && (this._output.previous_line.push($), this._output.trim(!0), this._output.current_line.pop(), this._output.trim()), this.print_token_line_indentation(T), this._output.add_token(","), this._output.space_before_token = !0;
}
this.print_token_line_indentation(T), this._output.non_breaking_space = !0, this._output.add_token(T.text), this._output.previous_token_wrapped && (this._flags.multiline_frame = !0);
}, M.prototype.indent = function() {
this._flags.indentation_level += 1, this._output.set_indent(this._flags.indentation_level, this._flags.alignment);
}, M.prototype.deindent = function() {
this._flags.indentation_level > 0 && (!this._flags.parent || this._flags.indentation_level > this._flags.parent.indentation_level) && (this._flags.indentation_level -= 1, this._output.set_indent(this._flags.indentation_level, this._flags.alignment));
}, M.prototype.set_mode = function(T) {
this._flags ? (this._flag_store.push(this._flags), this._previous_flags = this._flags) : this._previous_flags = this.create_flags(null, T), this._flags = this.create_flags(this._previous_flags, T), this._output.set_indent(this._flags.indentation_level, this._flags.alignment);
}, M.prototype.restore_mode = function() {
this._flag_store.length > 0 && (this._previous_flags = this._flags, this._flags = this._flag_store.pop(), this._previous_flags.mode === m.Statement && y(this._output, this._previous_flags), this._output.set_indent(this._flags.indentation_level, this._flags.alignment));
}, M.prototype.start_of_object_property = function() {
return this._flags.parent.mode === m.ObjectLiteral && this._flags.mode === m.Statement && (this._flags.last_token.text === ":" && this._flags.ternary_depth === 0 || _(this._flags.last_token, ["get", "set"]));
}, M.prototype.start_of_statement = function(T) {
var $ = !1;
return $ = $ || _(this._flags.last_token, ["var", "let", "const"]) && T.type === u.WORD, $ = $ || g(this._flags.last_token, "do"), $ = $ || !(this._flags.parent.mode === m.ObjectLiteral && this._flags.mode === m.Statement) && _(this._flags.last_token, B) && !T.newlines, $ = $ || g(this._flags.last_token, "else") && !(g(T, "if") && !T.comments_before), $ = $ || this._flags.last_token.type === u.END_EXPR && (this._previous_flags.mode === m.ForInitializer || this._previous_flags.mode === m.Conditional), $ = $ || this._flags.last_token.type === u.WORD && this._flags.mode === m.BlockStatement && !this._flags.in_case && !(T.text === "--" || T.text === "++") && this._last_last_text !== "function" && T.type !== u.WORD && T.type !== u.RESERVED, $ = $ || this._flags.mode === m.ObjectLiteral && (this._flags.last_token.text === ":" && this._flags.ternary_depth === 0 || _(this._flags.last_token, ["get", "set"])), $ ? (this.set_mode(m.Statement), this.indent(), this.handle_whitespace_and_comments(T, !0), this.start_of_object_property() || this.allow_wrap_or_preserved_newline(
T,
_(T, ["do", "for", "if", "while"])
), !0) : !1;
}, M.prototype.handle_start_expr = function(T) {
this.start_of_statement(T) || this.handle_whitespace_and_comments(T);
var $ = m.Expression;
if (T.text === "[") {
if (this._flags.last_token.type === u.WORD || this._flags.last_token.text === ")") {
_(this._flags.last_token, a) && (this._output.space_before_token = !0), this.print_token(T), this.set_mode($), this.indent(), this._options.space_in_paren && (this._output.space_before_token = !0);
return;
}
$ = m.ArrayLiteral, x(this._flags.mode) && (this._flags.last_token.text === "[" || this._flags.last_token.text === "," && (this._last_last_text === "]" || this._last_last_text === "}")) && (this._options.keep_array_indentation || this.print_newline()), d(this._flags.last_token.type, [u.START_EXPR, u.END_EXPR, u.WORD, u.OPERATOR, u.DOT]) || (this._output.space_before_token = !0);
} else {
if (this._flags.last_token.type === u.RESERVED)
this._flags.last_token.text === "for" ? (this._output.space_before_token = this._options.space_before_conditional, $ = m.ForInitializer) : d(this._flags.last_token.text, ["if", "while", "switch"]) ? (this._output.space_before_token = this._options.space_before_conditional, $ = m.Conditional) : d(this._flags.last_word, ["await", "async"]) ? this._output.space_before_token = !0 : this._flags.last_token.text === "import" && T.whitespace_before === "" ? this._output.space_before_token = !1 : (d(this._flags.last_token.text, a) || this._flags.last_token.text === "catch") && (this._output.space_before_token = !0);
else if (this._flags.last_token.type === u.EQUALS || this._flags.last_token.type === u.OPERATOR)
this.start_of_object_property() || this.allow_wrap_or_preserved_newline(T);
else if (this._flags.last_token.type === u.WORD) {
this._output.space_before_token = !1;
var V = this._tokens.peek(-3);
if (this._options.space_after_named_function && V) {
var z = this._tokens.peek(-4);
_(V, ["async", "function"]) || V.text === "*" && _(z, ["async", "function"]) ? this._output.space_before_token = !0 : this._flags.mode === m.ObjectLiteral ? (V.text === "{" || V.text === "," || V.text === "*" && (z.text === "{" || z.text === ",")) && (this._output.space_before_token = !0) : this._flags.parent && this._flags.parent.class_start_block && (this._output.space_before_token = !0);
}
} else
this.allow_wrap_or_preserved_newline(T);
(this._flags.last_token.type === u.RESERVED && (this._flags.last_word === "function" || this._flags.last_word === "typeof") || this._flags.last_token.text === "*" && (d(this._last_last_text, ["function", "yield"]) || this._flags.mode === m.ObjectLiteral && d(this._last_last_text, ["{", ","]))) && (this._output.space_before_token = this._options.space_after_anon_function);
}
this._flags.last_token.text === ";" || this._flags.last_token.type === u.START_BLOCK ? this.print_newline() : (this._flags.last_token.type === u.END_EXPR || this._flags.last_token.type === u.START_EXPR || this._flags.last_token.type === u.END_BLOCK || this._flags.last_token.text === "." || this._flags.last_token.type === u.COMMA) && this.allow_wrap_or_preserved_newline(T, T.newlines), this.print_token(T), this.set_mode($), this._options.space_in_paren && (this._output.space_before_token = !0), this.indent();
}, M.prototype.handle_end_expr = function(T) {
for (; this._flags.mode === m.Statement; )
this.restore_mode();
this.handle_whitespace_and_comments(T), this._flags.multiline_frame && this.allow_wrap_or_preserved_newline(
T,
T.text === "]" && x(this._flags.mode) && !this._options.keep_array_indentation
), this._options.space_in_paren && (this._flags.last_token.type === u.START_EXPR && !this._options.space_in_empty_paren ? (this._output.trim(), this._output.space_before_token = !1) : this._output.space_before_token = !0), this.deindent(), this.print_token(T), this.restore_mode(), y(this._output, this._previous_flags), this._flags.do_while && this._previous_flags.mode === m.Conditional && (this._previous_flags.mode = m.Expression, this._flags.do_block = !1, this._flags.do_while = !1);
}, M.prototype.handle_start_block = function(T) {
this.handle_whitespace_and_comments(T);
var $ = this._tokens.peek(), V = this._tokens.peek(1);
this._flags.last_word === "switch" && this._flags.last_token.type === u.END_EXPR ? (this.set_mode(m.BlockStatement), this._flags.in_case_statement = !0) : this._flags.case_body ? this.set_mode(m.BlockStatement) : V && (d(V.text, [":", ","]) && d($.type, [u.STRING, u.WORD, u.RESERVED]) || d($.text, ["get", "set", "..."]) && d(V.type, [u.WORD, u.RESERVED])) ? d(this._last_last_text, ["class", "interface"]) && !d(V.text, [":", ","]) ? this.set_mode(m.BlockStatement) : this.set_mode(m.ObjectLiteral) : this._flags.last_token.type === u.OPERATOR && this._flags.last_token.text === "=>" ? this.set_mode(m.BlockStatement) : d(this._flags.last_token.type, [u.EQUALS, u.START_EXPR, u.COMMA, u.OPERATOR]) || _(this._flags.last_token, ["return", "throw", "import", "default"]) ? this.set_mode(m.ObjectLiteral) : this.set_mode(m.BlockStatement), this._flags.last_token && _(this._flags.last_token.previous, ["class", "extends"]) && (this._flags.class_start_block = !0);
var z = !$.comments_before && $.text === "}", H = z && this._flags.last_word === "function" && this._flags.last_token.type === u.END_EXPR;
if (this._options.brace_preserve_inline) {
var I = 0, U = null;
this._flags.inline_frame = !0;
do
if (I += 1, U = this._tokens.peek(I - 1), U.newlines) {
this._flags.inline_frame = !1;
break;
}
while (U.type !== u.EOF && !(U.type === u.END_BLOCK && U.opened === T));
}
(this._options.brace_style === "expand" || this._options.brace_style === "none" && T.newlines) && !this._flags.inline_frame ? this._flags.last_token.type !== u.OPERATOR && (H || this._flags.last_token.type === u.EQUALS || _(this._flags.last_token, S) && this._flags.last_token.text !== "else") ? this._output.space_before_token = !0 : this.print_newline(!1, !0) : (x(this._previous_flags.mode) && (this._flags.last_token.type === u.START_EXPR || this._flags.last_token.type === u.COMMA) && ((this._flags.last_token.type === u.COMMA || this._options.space_in_paren) && (this._output.space_before_token = !0), (this._flags.last_token.type === u.COMMA || this._flags.last_token.type === u.START_EXPR && this._flags.inline_frame) && (this.allow_wrap_or_preserved_newline(T), this._previous_flags.multiline_frame = this._previous_flags.multiline_frame || this._flags.multiline_frame, this._flags.multiline_frame = !1)), this._flags.last_token.type !== u.OPERATOR && this._flags.last_token.type !== u.START_EXPR && (d(this._flags.last_token.type, [u.START_BLOCK, u.SEMICOLON]) && !this._flags.inline_frame ? this.print_newline() : this._output.space_before_token = !0)), this.print_token(T), this.indent(), !z && !(this._options.brace_preserve_inline && this._flags.inline_frame) && this.print_newline();
}, M.prototype.handle_end_block = function(T) {
for (this.handle_whitespace_and_comments(T); this._flags.mode === m.Statement; )
this.restore_mode();
var $ = this._flags.last_token.type === u.START_BLOCK;
this._flags.inline_frame && !$ ? this._output.space_before_token = !0 : this._options.brace_style === "expand" ? $ || this.print_newline() : $ || (x(this._flags.mode) && this._options.keep_array_indentation ? (this._options.keep_array_indentation = !1, this.print_newline(), this._options.keep_array_indentation = !0) : this.print_newline()), this.restore_mode(), this.print_token(T);
}, M.prototype.handle_word = function(T) {
if (T.type === u.RESERVED) {
if (d(T.text, ["set", "get"]) && this._flags.mode !== m.ObjectLiteral)
T.type = u.WORD;
else if (T.text === "import" && d(this._tokens.peek().text, ["(", "."]))
T.type = u.WORD;
else if (d(T.text, ["as", "from"]) && !this._flags.import_block)
T.type = u.WORD;
else if (this._flags.mode === m.ObjectLiteral) {
var $ = this._tokens.peek();
$.text === ":" && (T.type = u.WORD);
}
}
if (this.start_of_statement(T) ? _(this._flags.last_token, ["var", "let", "const"]) && T.type === u.WORD && (this._flags.declaration_statement = !0) : T.newlines && !k(this._flags.mode) && (this._flags.last_token.type !== u.OPERATOR || this._flags.last_token.text === "--" || this._flags.last_token.text === "++") && this._flags.last_token.type !== u.EQUALS && (this._options.preserve_newlines || !_(this._flags.last_token, ["var", "let", "const", "set", "get"])) ? (this.handle_whitespace_and_comments(T), this.print_newline()) : this.handle_whitespace_and_comments(T), this._flags.do_block && !this._flags.do_while)
if (g(T, "while")) {
this._output.space_before_token = !0, this.print_token(T), this._output.space_before_token = !0, this._flags.do_while = !0;
return;
} else
this.print_newline(), this._flags.do_block = !1;
if (this._flags.if_block)
if (!this._flags.else_block && g(T, "else"))
this._flags.else_block = !0;
else {
for (; this._flags.mode === m.Statement; )
this.restore_mode();
this._flags.if_block = !1, this._flags.else_block = !1;
}
if (this._flags.in_case_statement && _(T, ["case", "default"])) {
this.print_newline(), !this._flags.case_block && (this._flags.case_body || this._options.jslint_happy) && this.deindent(), this._flags.case_body = !1, this.print_token(T), this._flags.in_case = !0;
return;
}
if ((this._flags.last_token.type === u.COMMA || this._flags.last_token.type === u.START_EXPR || this._flags.last_token.type === u.EQUALS || this._flags.last_token.type === u.OPERATOR) && !this.start_of_object_property() && !(d(this._flags.last_token.text, ["+", "-"]) && this._last_last_text === ":" && this._flags.parent.mode === m.ObjectLiteral) && this.allow_wrap_or_preserved_newline(T), g(T, "function")) {
(d(this._flags.last_token.text, ["}", ";"]) || this._output.just_added_newline() && !(d(this._flags.last_token.text, ["(", "[", "{", ":", "=", ","]) || this._flags.last_token.type === u.OPERATOR)) && !this._output.just_added_blankline() && !T.comments_before && (this.print_newline(), this.print_newline(!0)), this._flags.last_token.type === u.RESERVED || this._flags.last_token.type === u.WORD ? _(this._flags.last_token, ["get", "set", "new", "export"]) || _(this._flags.last_token, B) ? this._output.space_before_token = !0 : g(this._flags.last_token, "default") && this._last_last_text === "export" ? this._output.space_before_token = !0 : this._flags.last_token.text === "declare" ? this._output.space_before_token = !0 : this.print_newline() : this._flags.last_token.type === u.OPERATOR || this._flags.last_token.text === "=" ? this._output.space_before_token = !0 : !this._flags.multiline_frame && (k(this._flags.mode) || x(this._flags.mode)) || this.print_newline(), this.print_token(T), this._flags.last_word = T.text;
return;
}
var V = "NONE";
if (this._flags.last_token.type === u.END_BLOCK ? this._previous_flags.inline_frame ? V = "SPACE" : _(T, ["else", "catch", "finally", "from"]) ? this._options.brace_style === "expand" || this._options.brace_style === "end-expand" || this._options.brace_style === "none" && T.newlines ? V = "NEWLINE" : (V = "SPACE", this._output.space_before_token = !0) : V = "NEWLINE" : this._flags.last_token.type === u.SEMICOLON && this._flags.mode === m.BlockStatement ? V = "NEWLINE" : this._flags.last_token.type === u.SEMICOLON && k(this._flags.mode) ? V = "SPACE" : this._flags.last_token.type === u.STRING ? V = "NEWLINE" : this._flags.last_token.type === u.RESERVED || this._flags.last_token.type === u.WORD || this._flags.last_token.text === "*" && (d(this._last_last_text, ["function", "yield"]) || this._flags.mode === m.ObjectLiteral && d(this._last_last_text, ["{", ","])) ? V = "SPACE" : this._flags.last_token.type === u.START_BLOCK ? this._flags.inline_frame ? V = "SPACE" : V = "NEWLINE" : this._flags.last_token.type === u.END_EXPR && (this._output.space_before_token = !0, V = "NEWLINE"), _(T, a) && this._flags.last_token.text !== ")" && (this._flags.inline_frame || this._flags.last_token.text === "else" || this._flags.last_token.text === "export" ? V = "SPACE" : V = "NEWLINE"), _(T, ["else", "catch", "finally"]))
if ((!(this._flags.last_token.type === u.END_BLOCK && this._previous_flags.mode === m.BlockStatement) || this._options.brace_style === "expand" || this._options.brace_style === "end-expand" || this._options.brace_style === "none" && T.newlines) && !this._flags.inline_frame)
this.print_newline();
else {
this._output.trim(!0);
var z = this._output.current_line;
z.last() !== "}" && this.print_newline(), this._output.space_before_token = !0;
}
else
V === "NEWLINE" ? _(this._flags.last_token, S) ? this._output.space_before_token = !0 : this._flags.last_token.text === "declare" && _(T, ["var", "let", "const"]) ? this._output.space_before_token = !0 : this._flags.last_token.type !== u.END_EXPR ? (this._flags.last_token.type !== u.START_EXPR || !_(T, ["var", "let", "const"])) && this._flags.last_token.text !== ":" && (g(T, "if") && g(T.previous, "else") ? this._output.space_before_token = !0 : this.print_newline()) : _(T, a) && this._flags.last_token.text !== ")" && this.print_newline() : this._flags.multiline_frame && x(this._flags.mode) && this._flags.last_token.text === "," && this._last_last_text === "}" ? this.print_newline() : V === "SPACE" && (this._output.space_before_token = !0);
T.previous && (T.previous.type === u.WORD || T.previous.type === u.RESERVED) && (this._output.space_before_token = !0), this.print_token(T), this._flags.last_word = T.text, T.type === u.RESERVED && (T.text === "do" ? this._flags.do_block = !0 : T.text === "if" ? this._flags.if_block = !0 : T.text === "import" ? this._flags.import_block = !0 : this._flags.import_block && g(T, "from") && (this._flags.import_block = !1));
}, M.prototype.handle_semicolon = function(T) {
this.start_of_statement(T) ? this._output.space_before_token = !1 : this.handle_whitespace_and_comments(T);
for (var $ = this._tokens.peek(); this._flags.mode === m.Statement && !(this._flags.if_block && g($, "else")) && !this._flags.do_block; )
this.restore_mode();
this._flags.import_block && (this._flags.import_block = !1), this.print_token(T);
}, M.prototype.handle_string = function(T) {
T.text.startsWith("`") && T.newlines === 0 && T.whitespace_before === "" && (T.previous.text === ")" || this._flags.last_token.type === u.WORD) || (this.start_of_statement(T) ? this._output.space_before_token = !0 : (this.handle_whitespace_and_comments(T), this._flags.last_token.type === u.RESERVED || this._flags.last_token.type === u.WORD || this._flags.inline_frame ? this._output.space_before_token = !0 : this._flags.last_token.type === u.COMMA || this._flags.last_token.type === u.START_EXPR || this._flags.last_token.type === u.EQUALS || this._flags.last_token.type === u.OPERATOR ? this.start_of_object_property() || this.allow_wrap_or_preserved_newline(T) : T.text.startsWith("`") && this._flags.last_token.type === u.END_EXPR && (T.previous.text === "]" || T.previous.text === ")") && T.newlines === 0 ? this._output.space_before_token = !0 : this.print_newline())), this.print_token(T);
}, M.prototype.handle_equals = function(T) {
this.start_of_statement(T) || this.handle_whitespace_and_comments(T), this._flags.declaration_statement && (this._flags.declaration_assignment = !0), this._output.space_before_token = !0, this.print_token(T), this._output.space_before_token = !0;
}, M.prototype.handle_comma = function(T) {
this.handle_whitespace_and_comments(T, !0), this.print_token(T), this._output.space_before_token = !0, this._flags.declaration_statement ? (k(this._flags.parent.mode) && (this._flags.declaration_assignment = !1), this._flags.declaration_assignment ? (this._flags.declaration_assignment = !1, this.print_newline(!1, !0)) : this._options.comma_first && this.allow_wrap_or_preserved_newline(T)) : this._flags.mode === m.ObjectLiteral || this._flags.mode === m.Statement && this._flags.parent.mode === m.ObjectLiteral ? (this._flags.mode === m.Statement && this.restore_mode(), this._flags.inline_frame || this.print_newline()) : this._options.comma_first && this.allow_wrap_or_preserved_newline(T);
}, M.prototype.handle_operator = function(T) {
var $ = T.text === "*" && (_(this._flags.last_token, ["function", "yield"]) || d(this._flags.last_token.type, [u.START_BLOCK, u.COMMA, u.END_BLOCK, u.SEMICOLON])), V = d(T.text, ["-", "+"]) && (d(this._flags.last_token.type, [u.START_BLOCK, u.START_EXPR, u.EQUALS, u.OPERATOR]) || d(this._flags.last_token.text, a) || this._flags.last_token.text === ",");
if (!this.start_of_statement(T)) {
var z = !$;
this.handle_whitespace_and_comments(T, z);
}
if (T.text === "*" && this._flags.last_token.type === u.DOT) {
this.print_token(T);
return;
}
if (T.text === "::") {
this.print_token(T);
return;
}
if (d(T.text, ["-", "+"]) && this.start_of_object_property()) {
this.print_token(T);
return;
}
if (this._flags.last_token.type === u.OPERATOR && d(this._options.operator_position, w) && this.allow_wrap_or_preserved_newline(T), T.text === ":" && this._flags.in_case) {
this.print_token(T), this._flags.in_case = !1, this._flags.case_body = !0, this._tokens.peek().type !== u.START_BLOCK ? (this.indent(), this.print_newline(), this._flags.case_block = !1) : (this._flags.case_block = !0, this._output.space_before_token = !0);
return;
}
var H = !0, I = !0, U = !1;
if (T.text === ":" ? this._flags.ternary_depth === 0 ? H = !1 : (this._flags.ternary_depth -= 1, U = !0) : T.text === "?" && (this._flags.ternary_depth += 1), !V && !$ && this._options.preserve_newlines && d(T.text, s)) {
var F = T.text === ":", C = F && U, q = F && !U;
switch (this._options.operator_position) {
case A.before_newline:
this._output.space_before_token = !q, this.print_token(T), (!F || C) && this.allow_wrap_or_preserved_newline(T), this._output.space_before_token = !0;
return;
case A.after_newline:
this._output.space_before_token = !0, !F || C ? this._tokens.peek().newlines ? this.print_newline(!1, !0) : this.allow_wrap_or_preserved_newline(T) : this._output.space_before_token = !1, this.print_token(T), this._output.space_before_token = !0;
return;
case A.preserve_newline:
q || this.allow_wrap_or_preserved_newline(T), H = !(this._output.just_added_newline() || q), this._output.space_before_token = H, this.print_token(T), this._output.space_before_token = !0;
return;
}
}
if ($) {
this.allow_wrap_or_preserved_newline(T), H = !1;
var X = this._tokens.peek();
I = X && d(X.type, [u.WORD, u.RESERVED]);
} else if (T.text === "...")
this.allow_wrap_or_preserved_newline(T), H = this._flags.last_token.type === u.START_BLOCK, I = !1;
else if (d(T.text, ["--", "++", "!", "~"]) || V) {
if ((this._flags.last_token.type === u.COMMA || this._flags.last_token.type === u.START_EXPR) && this.allow_wrap_or_preserved_newline(T), H = !1, I = !1, T.newlines && (T.text === "--" || T.text === "++" || T.text === "~")) {
var Y = _(this._flags.last_token, S) && T.newlines;
Y && (this._previous_flags.if_block || this._previous_flags.else_block) && this.restore_mode(), this.print_newline(Y, !0);
}
this._flags.last_token.text === ";" && k(this._flags.mode) && (H = !0), this._flags.last_token.type === u.RESERVED ? H = !0 : this._flags.last_token.type === u.END_EXPR ? H = !(this._flags.last_token.text === "]" && (T.text === "--" || T.text === "++")) : this._flags.last_token.type === u.OPERATOR && (H = d(T.text, ["--", "-", "++", "+"]) && d(this._flags.last_token.text, ["--", "-", "++", "+"]), d(T.text, ["+", "-"]) && d(this._flags.last_token.text, ["--", "++"]) && (I = !0)), (this._flags.mode === m.BlockStatement && !this._flags.inline_frame || this._flags.mode === m.Statement) && (this._flags.last_token.text === "{" || this._flags.last_token.text === ";") && this.print_newline();
}
this._output.space_before_token = this._output.space_before_token || H, this.print_token(T), this._output.space_before_token = I;
}, M.prototype.handle_block_comment = function(T, $) {
if (this._output.raw) {
this._output.add_raw_token(T), T.directives && T.directives.preserve === "end" && (this._output.raw = this._options.test_output_raw);
return;
}
if (T.directives) {
this.print_newline(!1, $), this.print_token(T), T.directives.preserve === "start" && (this._output.raw = !0), this.print_newline(!1, !0);
return;
}
if (!i.newline.test(T.text) && !T.newlines) {
this._output.space_before_token = !0, this.print_token(T), this._output.space_before_token = !0;
return;
} else
this.print_block_commment(T, $);
}, M.prototype.print_block_commment = function(T, $) {
var V = E(T.text), z, H = !1, I = !1, U = T.whitespace_before, F = U.length;
if (this.print_newline(!1, $), this.print_token_line_indentation(T), this._output.add_token(V[0]), this.print_newline(!1, $), V.length > 1) {
for (V = V.slice(1), H = D(V, "*"), I = P(V, U), H && (this._flags.alignment = 1), z = 0; z < V.length; z++)
H ? (this.print_token_line_indentation(T), this._output.add_token(h(V[z]))) : I && V[z] ? (this.print_token_line_indentation(T), this._output.add_token(V[z].substring(F))) : (this._output.current_line.set_indent(-1), this._output.add_token(V[z])), this.print_newline(!1, $);
this._flags.alignment = 0;
}
}, M.prototype.handle_comment = function(T, $) {
T.newlines ? this.print_newline(!1, $) : this._output.trim(!0), this._output.space_before_token = !0, this.print_token(T), this.print_newline(!1, $);
}, M.prototype.handle_dot = function(T) {
this.start_of_statement(T) || this.handle_whitespace_and_comments(T, !0), this._flags.last_token.text.match("^[0-9]+$") && (this._output.space_before_token = !0), _(this._flags.last_token, S) ? this._output.space_before_token = !1 : this.allow_wrap_or_preserved_newline(
T,
this._flags.last_token.text === ")" && this._options.break_chained_methods
), this._options.unindent_chained_methods && this._output.just_added_newline() && this.deindent(), this.print_token(T);
}, M.prototype.handle_unknown = function(T, $) {
this.print_token(T), T.text[T.text.length - 1] === `
` && this.print_newline(!1, $);
}, M.prototype.handle_eof = function(T) {
for (; this._flags.mode === m.Statement; )
this.restore_mode();
this.handle_whitespace_and_comments(T);
}, kf.Beautifier = M, kf;
}
var Yv;
function nT() {
if (Yv)
return ds.exports;
Yv = 1;
var e = tT().Beautifier, t = V0().Options;
function i(r, n) {
var a = new e(r, n);
return a.beautify();
}
return ds.exports = i, ds.exports.defaultOptions = function() {
return new t();
}, ds.exports;
}
var ps = { exports: {} }, Bf = {}, Vf = {}, Qv;
function U0() {
if (Qv)
return Vf;
Qv = 1;
var e = Pc().Options;
function t(i) {
e.call(this, i, "css"), this.selector_separator_newline = this._get_boolean("selector_separator_newline", !0), this.newline_between_rules = this._get_boolean("newline_between_rules", !0);
var r = this._get_boolean("space_around_selector_separator");
this.space_around_combinator = this._get_boolean("space_around_combinator") || r;
var n = this._get_selection_list("brace_style", ["collapse", "expand", "end-expand", "none", "preserve-inline"]);
this.brace_style = "collapse";
for (var a = 0; a < n.length; a++)
n[a] !== "expand" ? this.brace_style = "collapse" : this.brace_style = n[a];
}
return t.prototype = new e(), Vf.Options = t, Vf;
}
var Jv;
function iT() {
if (Jv)
return Bf;
Jv = 1;
var e = U0().Options, t = Mc().Output, i = Lc().InputScanner, r = Nc().Directives, n = new r(/\/\*/, /\*\//), a = /\r\n|[\r\n]/, s = /\r\n|[\r\n]/g, u = /\s/, d = /(?:\s|\n)+/g, h = /\/\*(?:[\s\S]*?)((?:\*\/)|$)/g, p = /\/\/(?:[^\n\r\u2028\u2029]*)/g;
function g(_, S) {
this._source_text = _ || "", this._options = new e(S), this._ch = null, this._input = null, this.NESTED_AT_RULE = {
page: !0,
"font-face": !0,
keyframes: !0,
media: !0,
supports: !0,
document: !0
}, this.CONDITIONAL_GROUP_RULE = {
media: !0,
supports: !0,
document: !0
}, this.NON_SEMICOLON_NEWLINE_PROPERTY = [
"grid-template-areas",
"grid-template"
];
}
return g.prototype.eatString = function(_) {
var S = "";
for (this._ch = this._input.next(); this._ch; ) {
if (S += this._ch, this._ch === "\\")
S += this._input.next();
else if (_.indexOf(this._ch) !== -1 || this._ch === `
`)
break;
this._ch = this._input.next();
}
return S;
}, g.prototype.eatWhitespace = function(_) {
for (var S = u.test(this._input.peek()), b = 0; u.test(this._input.peek()); )
this._ch = this._input.next(), _ && this._ch === `
` && (b === 0 || b < this._options.max_preserve_newlines) && (b++, this._output.add_new_line(!0));
return S;
}, g.prototype.foundNestedPseudoClass = function() {
for (var _ = 0, S = 1, b = this._input.peek(S); b; ) {
if (b === "{")
return !0;
if (b === "(")
_ += 1;
else if (b === ")") {
if (_ === 0)
return !1;
_ -= 1;
} else if (b === ";" || b === "}")
return !1;
S++, b = this._input.peek(S);
}
return !1;
}, g.prototype.print_string = function(_) {
this._output.set_indent(this._indentLevel), this._output.non_breaking_space = !0, this._output.add_token(_);
}, g.prototype.preserveSingleSpace = function(_) {
_ && (this._output.space_before_token = !0);
}, g.prototype.indent = function() {
this._indentLevel++;
}, g.prototype.outdent = function() {
this._indentLevel > 0 && this._indentLevel--;
}, g.prototype.beautify = function() {
if (this._options.disabled)
return this._source_text;
var _ = this._source_text, S = this._options.eol;
S === "auto" && (S = `
`, _ && a.test(_ || "") && (S = _.match(a)[0])), _ = _.replace(s, `
`);
var b = _.match(/^[\t ]*/)[0];
this._output = new t(this._options, b), this._input = new i(_), this._indentLevel = 0, this._nestedLevel = 0, this._ch = null;
for (var A = 0, w = !1, m = !1, y = !1, E = !1, x = !1, k = this._ch, D = !1, P, M, B; P = this._input.read(d), M = P !== "", B = k, this._ch = this._input.next(), this._ch === "\\" && this._input.hasNext() && (this._ch += this._input.next()), k = this._ch, this._ch; )
if (this._ch === "/" && this._input.peek() === "*") {
this._output.add_new_line(), this._input.back();
var T = this._input.read(h), $ = n.get_directives(T);
$ && $.ignore === "start" && (T += n.readIgnored(this._input)), this.print_string(T), this.eatWhitespace(!0), this._output.add_new_line();
} else if (this._ch === "/" && this._input.peek() === "/")
this._output.space_before_token = !0, this._input.back(), this.print_string(this._input.read(p)), this.eatWhitespace(!0);
else if (this._ch === "$") {
this.preserveSingleSpace(M), this.print_string(this._ch);
var V = this._input.peekUntilAfter(/[: ,;{}()[\]\/='"]/g);
V.match(/[ :]$/) && (V = this.eatString(": ").replace(/\s+$/, ""), this.print_string(V), this._output.space_before_token = !0), A === 0 && V.indexOf(":") !== -1 && (m = !0, this.indent());
} else if (this._ch === "@")
if (this.preserveSingleSpace(M), this._input.peek() === "{")
this.print_string(this._ch + this.eatString("}"));
else {
this.print_string(this._ch);
var z = this._input.peekUntilAfter(/[: ,;{}()[\]\/='"]/g);
z.match(/[ :]$/) && (z = this.eatString(": ").replace(/\s+$/, ""), this.print_string(z), this._output.space_before_token = !0), A === 0 && z.indexOf(":") !== -1 ? (m = !0, this.indent()) : z in this.NESTED_AT_RULE ? (this._nestedLevel += 1, z in this.CONDITIONAL_GROUP_RULE && (y = !0)) : A === 0 && !m && (E = !0);
}
else if (this._ch === "#" && this._input.peek() === "{")
this.preserveSingleSpace(M), this.print_string(this._ch + this.eatString("}"));
else if (this._ch === "{")
m && (m = !1, this.outdent()), E = !1, y ? (y = !1, w = this._indentLevel >= this._nestedLevel) : w = this._indentLevel >= this._nestedLevel - 1, this._options.newline_between_rules && w && this._output.previous_line && this._output.previous_line.item(-1) !== "{" && this._output.ensure_empty_line_above("/", ","), this._output.space_before_token = !0, this._options.brace_style === "expand" ? (this._output.add_new_line(), this.print_string(this._ch), this.indent(), this._output.set_indent(this._indentLevel)) : (B === "(" ? this._output.space_before_token = !1 : B !== "," && this.indent(), this.print_string(this._ch)), this.eatWhitespace(!0), this._output.add_new_line();
else if (this._ch === "}")
this.outdent(), this._output.add_new_line(), B === "{" && this._output.trim(!0), m && (this.outdent(), m = !1), this.print_string(this._ch), w = !1, this._nestedLevel && this._nestedLevel--, this.eatWhitespace(!0), this._output.add_new_line(), this._options.newline_between_rules && !this._output.just_added_blankline() && this._input.peek() !== "}" && this._output.add_new_line(!0), this._input.peek() === ")" && (this._output.trim(!0), this._options.brace_style === "expand" && this._output.add_new_line(!0));
else if (this._ch === ":") {
for (var H = 0; H < this.NON_SEMICOLON_NEWLINE_PROPERTY.length; H++)
if (this._input.lookBack(this.NON_SEMICOLON_NEWLINE_PROPERTY[H])) {
D = !0;
break;
}
(w || y) && !(this._input.lookBack("&") || this.foundNestedPseudoClass()) && !this._input.lookBack("(") && !E && A === 0 ? (this.print_string(":"), m || (m = !0, this._output.space_before_token = !0, this.eatWhitespace(!0), this.indent())) : (this._input.lookBack(" ") && (this._output.space_before_token = !0), this._input.peek() === ":" ? (this._ch = this._input.next(), this.print_string("::")) : this.print_string(":"));
} else if (this._ch === '"' || this._ch === "'") {
var I = B === '"' || B === "'";
this.preserveSingleSpace(I || M), this.print_string(this._ch + this.eatString(this._ch)), this.eatWhitespace(!0);
} else if (this._ch === ";")
D = !1, A === 0 ? (m && (this.outdent(), m = !1), E = !1, this.print_string(this._ch), this.eatWhitespace(!0), this._input.peek() !== "/" && this._output.add_new_line()) : (this.print_string(this._ch), this.eatWhitespace(!0), this._output.space_before_token = !0);
else if (this._ch === "(")
if (this._input.lookBack("url"))
this.print_string(this._ch), this.eatWhitespace(), A++, this.indent(), this._ch = this._input.next(), this._ch === ")" || this._ch === '"' || this._ch === "'" ? this._input.back() : this._ch && (this.print_string(this._ch + this.eatString(")")), A && (A--, this.outdent()));
else {
var U = !1;
this._input.lookBack("with") && (U = !0), this.preserveSingleSpace(M || U), this.print_string(this._ch), m && B === "$" && this._options.selector_separator_newline ? (this._output.add_new_line(), x = !0) : (this.eatWhitespace(), A++, this.indent());
}
else if (this._ch === ")")
A && (A--, this.outdent()), x && this._input.peek() === ";" && this._options.selector_separator_newline && (x = !1, this.outdent(), this._output.add_new_line()), this.print_string(this._ch);
else if (this._ch === ",")
this.print_string(this._ch), this.eatWhitespace(!0), this._options.selector_separator_newline && (!m || x) && A === 0 && !E ? this._output.add_new_line() : this._output.space_before_token = !0;
else if ((this._ch === ">" || this._ch === "+" || this._ch === "~") && !m && A === 0)
this._options.space_around_combinator ? (this._output.space_before_token = !0, this.print_string(this._ch), this._output.space_before_token = !0) : (this.print_string(this._ch), this.eatWhitespace(), this._ch && u.test(this._ch) && (this._ch = ""));
else if (this._ch === "]")
this.print_string(this._ch);
else if (this._ch === "[")
this.preserveSingleSpace(M), this.print_string(this._ch);
else if (this._ch === "=")
this.eatWhitespace(), this.print_string("="), u.test(this._ch) && (this._ch = "");
else if (this._ch === "!" && !this._input.lookBack("\\"))
this._output.space_before_token = !0, this.print_string(this._ch);
else {
var F = B === '"' || B === "'";
this.preserveSingleSpace(F || M), this.print_string(this._ch), !this._output.just_added_newline() && this._input.peek() === `
` && D && this._output.add_new_line();
}
var C = this._output.get_code(S);
return C;
}, Bf.Beautifier = g, Bf;
}
var Xv;
function rT() {
if (Xv)
return ps.exports;
Xv = 1;
var e = iT().Beautifier, t = U0().Options;
function i(r, n) {
var a = new e(r, n);
return a.beautify();
}
return ps.exports = i, ps.exports.defaultOptions = function() {
return new t();
}, ps.exports;
}
var hs = { exports: {} }, jf = {}, Uf = {}, Zv;
function z0() {
if (Zv)
return Uf;
Zv = 1;
var e = Pc().Options;
function t(i) {
e.call(this, i, "html"), this.templating.length === 1 && this.templating[0] === "auto" && (this.templating = ["django", "erb", "handlebars", "php"]), this.indent_inner_html = this._get_boolean("indent_inner_html"), this.indent_body_inner_html = this._get_boolean("indent_body_inner_html", !0), this.indent_head_inner_html = this._get_boolean("indent_head_inner_html", !0), this.indent_handlebars = this._get_boolean("indent_handlebars", !0), this.wrap_attributes = this._get_selection(
"wrap_attributes",
["auto", "force", "force-aligned", "force-expand-multiline", "aligned-multiple", "preserve", "preserve-aligned"]
), this.wrap_attributes_min_attrs = this._get_number("wrap_attributes_min_attrs", 2), this.wrap_attributes_indent_size = this._get_number("wrap_attributes_indent_size", this.indent_size), this.extra_liners = this._get_array("extra_liners", ["head", "body", "/html"]), this.inline = this._get_array("inline", [
"a",
"abbr",
"area",
"audio",
"b",
"bdi",
"bdo",
"br",
"button",
"canvas",
"cite",
"code",
"data",
"datalist",
"del",
"dfn",
"em",
"embed",
"i",
"iframe",
"img",
"input",
"ins",
"kbd",
"keygen",
"label",
"map",
"mark",
"math",
"meter",
"noscript",
"object",
"output",
"progress",
"q",
"ruby",
"s",
"samp",
"select",
"small",
"span",
"strong",
"sub",
"sup",
"svg",
"template",
"textarea",
"time",
"u",
"var",
"video",
"wbr",
"text",
"acronym",
"big",
"strike",
"tt"
]), this.inline_custom_elements = this._get_boolean("inline_custom_elements", !0), this.void_elements = this._get_array("void_elements", [
"area",
"base",
"br",
"col",
"embed",
"hr",
"img",
"input",
"keygen",
"link",
"menuitem",
"meta",
"param",
"source",
"track",
"wbr",
"!doctype",
"?xml",
"basefont",
"isindex"
]), this.unformatted = this._get_array("unformatted", []), this.content_unformatted = this._get_array("content_unformatted", [
"pre",
"textarea"
]), this.unformatted_content_delimiter = this._get_characters("unformatted_content_delimiter"), this.indent_scripts = this._get_selection("indent_scripts", ["normal", "keep", "separate"]);
}
return t.prototype = new e(), Uf.Options = t, Uf;
}
var ms = {}, qv;
function eg() {
if (qv)
return ms;
qv = 1;
var e = Hs().Tokenizer, t = Hs().TOKEN, i = Nc().Directives, r = j0().TemplatablePattern, n = ru().Pattern, a = {
TAG_OPEN: "TK_TAG_OPEN",
TAG_CLOSE: "TK_TAG_CLOSE",
CONTROL_FLOW_OPEN: "TK_CONTROL_FLOW_OPEN",
CONTROL_FLOW_CLOSE: "TK_CONTROL_FLOW_CLOSE",
ATTRIBUTE: "TK_ATTRIBUTE",
EQUALS: "TK_EQUALS",
VALUE: "TK_VALUE",
COMMENT: "TK_COMMENT",
TEXT: "TK_TEXT",
UNKNOWN: "TK_UNKNOWN",
START: t.START,
RAW: t.RAW,
EOF: t.EOF
}, s = new i(/<\!--/, /-->/), u = function(d, h) {
e.call(this, d, h), this._current_tag_name = "";
var p = new r(this._input).read_options(this._options), g = new n(this._input);
if (this.__patterns = {
word: p.until(/[\n\r\t <]/),
word_control_flow_close_excluded: p.until(/[\n\r\t <}]/),
single_quote: p.until_after(/'/),
double_quote: p.until_after(/"/),
attribute: p.until(/[\n\r\t =>]|\/>/),
element_name: p.until(/[\n\r\t >\/]/),
angular_control_flow_start: g.matching(/\@[a-zA-Z]+[^({]*[({]/),
handlebars_comment: g.starting_with(/{{!--/).until_after(/--}}/),
handlebars: g.starting_with(/{{/).until_after(/}}/),
handlebars_open: g.until(/[\n\r\t }]/),
handlebars_raw_close: g.until(/}}/),
comment: g.starting_with(/<!--/).until_after(/-->/),
cdata: g.starting_with(/<!\[CDATA\[/).until_after(/]]>/),
conditional_comment: g.starting_with(/<!\[/).until_after(/]>/),
processing: g.starting_with(/<\?/).until_after(/\?>/)
}, this._options.indent_handlebars && (this.__patterns.word = this.__patterns.word.exclude("handlebars"), this.__patterns.word_control_flow_close_excluded = this.__patterns.word_control_flow_close_excluded.exclude("handlebars")), this._unformatted_content_delimiter = null, this._options.unformatted_content_delimiter) {
var _ = this._input.get_literal_regexp(this._options.unformatted_content_delimiter);
this.__patterns.unformatted_content_delimiter = g.matching(_).until_after(_);
}
};
return u.prototype = new e(), u.prototype._is_comment = function(d) {
return !1;
}, u.prototype._is_opening = function(d) {
return d.type === a.TAG_OPEN || d.type === a.CONTROL_FLOW_OPEN;
}, u.prototype._is_closing = function(d, h) {
return d.type === a.TAG_CLOSE && h && ((d.text === ">" || d.text === "/>") && h.text[0] === "<" || d.text === "}}" && h.text[0] === "{" && h.text[1] === "{") || d.type === a.CONTROL_FLOW_CLOSE && d.text === "}" && h.text.endsWith("{");
}, u.prototype._reset = function() {
this._current_tag_name = "";
}, u.prototype._get_next_token = function(d, h) {
var p = null;
this._readWhitespace();
var g = this._input.peek();
return g === null ? this._create_token(a.EOF, "") : (p = p || this._read_open_handlebars(g, h), p = p || this._read_attribute(g, d, h), p = p || this._read_close(g, h), p = p || this._read_script_and_style(g, d), p = p || this._read_control_flows(g, h), p = p || this._read_raw_content(g, d, h), p = p || this._read_content_word(g, h), p = p || this._read_comment_or_cdata(g), p = p || this._read_processing(g), p = p || this._read_open(g, h), p = p || this._create_token(a.UNKNOWN, this._input.next()), p);
}, u.prototype._read_comment_or_cdata = function(d) {
var h = null, p = null, g = null;
if (d === "<") {
var _ = this._input.peek(1);
_ === "!" && (p = this.__patterns.comment.read(), p ? (g = s.get_directives(p), g && g.ignore === "start" && (p += s.readIgnored(this._input))) : p = this.__patterns.cdata.read()), p && (h = this._create_token(a.COMMENT, p), h.directives = g);
}
return h;
}, u.prototype._read_processing = function(d) {
var h = null, p = null, g = null;
if (d === "<") {
var _ = this._input.peek(1);
(_ === "!" || _ === "?") && (p = this.__patterns.conditional_comment.read(), p = p || this.__patterns.processing.read()), p && (h = this._create_token(a.COMMENT, p), h.directives = g);
}
return h;
}, u.prototype._read_open = function(d, h) {
var p = null, g = null;
return (!h || h.type === a.CONTROL_FLOW_OPEN) && d === "<" && (p = this._input.next(), this._input.peek() === "/" && (p += this._input.next()), p += this.__patterns.element_name.read(), g = this._create_token(a.TAG_OPEN, p)), g;
}, u.prototype._read_open_handlebars = function(d, h) {
var p = null, g = null;
return (!h || h.type === a.CONTROL_FLOW_OPEN) && (this._options.templating.includes("angular") || this._options.indent_handlebars) && d === "{" && this._input.peek(1) === "{" && (this._options.indent_handlebars && this._input.peek(2) === "!" ? (p = this.__patterns.handlebars_comment.read(), p = p || this.__patterns.handlebars.read(), g = this._create_token(a.COMMENT, p)) : (p = this.__patterns.handlebars_open.read(), g = this._create_token(a.TAG_OPEN, p))), g;
}, u.prototype._read_control_flows = function(d, h) {
var p = "", g = null;
if (!this._options.templating.includes("angular"))
return g;
if (d === "@") {
if (p = this.__patterns.angular_control_flow_start.read(), p === "")
return g;
for (var _ = p.endsWith("(") ? 1 : 0, S = 0; !(p.endsWith("{") && _ === S); ) {
var b = this._input.next();
if (b === null)
break;
b === "(" ? _++ : b === ")" && S++, p += b;
}
g = this._create_token(a.CONTROL_FLOW_OPEN, p);
} else
d === "}" && h && h.type === a.CONTROL_FLOW_OPEN && (p = this._input.next(), g = this._create_token(a.CONTROL_FLOW_CLOSE, p));
return g;
}, u.prototype._read_close = function(d, h) {
var p = null, g = null;
return h && h.type === a.TAG_OPEN && (h.text[0] === "<" && (d === ">" || d === "/" && this._input.peek(1) === ">") ? (p = this._input.next(), d === "/" && (p += this._input.next()), g = this._create_token(a.TAG_CLOSE, p)) : h.text[0] === "{" && d === "}" && this._input.peek(1) === "}" && (this._input.next(), this._input.next(), g = this._create_token(a.TAG_CLOSE, "}}"))), g;
}, u.prototype._read_attribute = function(d, h, p) {
var g = null, _ = "";
if (p && p.text[0] === "<")
if (d === "=")
g = this._create_token(a.EQUALS, this._input.next());
else if (d === '"' || d === "'") {
var S = this._input.next();
d === '"' ? S += this.__patterns.double_quote.read() : S += this.__patterns.single_quote.read(), g = this._create_token(a.VALUE, S);
} else
_ = this.__patterns.attribute.read(), _ && (h.type === a.EQUALS ? g = this._create_token(a.VALUE, _) : g = this._create_token(a.ATTRIBUTE, _));
return g;
}, u.prototype._is_content_unformatted = function(d) {
return this._options.void_elements.indexOf(d) === -1 && (this._options.content_unformatted.indexOf(d) !== -1 || this._options.unformatted.indexOf(d) !== -1);
}, u.prototype._read_raw_content = function(d, h, p) {
var g = "";
if (p && p.text[0] === "{")
g = this.__patterns.handlebars_raw_close.read();
else if (h.type === a.TAG_CLOSE && h.opened.text[0] === "<" && h.text[0] !== "/") {
var _ = h.opened.text.substr(1).toLowerCase();
this._is_content_unformatted(_) && (g = this._input.readUntil(new RegExp("</" + _ + "[\\n\\r\\t ]*?>", "ig")));
}
return g ? this._create_token(a.TEXT, g) : null;
}, u.prototype._read_script_and_style = function(d, h) {
if (h.type === a.TAG_CLOSE && h.opened.text[0] === "<" && h.text[0] !== "/") {
var p = h.opened.text.substr(1).toLowerCase();
if (p === "script" || p === "style") {
var g = this._read_comment_or_cdata(d);
if (g)
return g.type = a.TEXT, g;
var _ = this._input.readUntil(new RegExp("</" + p + "[\\n\\r\\t ]*?>", "ig"));
if (_)
return this._create_token(a.TEXT, _);
}
}
return null;
}, u.prototype._read_content_word = function(d, h) {
var p = "";
return this._options.unformatted_content_delimiter && d === this._options.unformatted_content_delimiter[0] && (p = this.__patterns.unformatted_content_delimiter.read()), p || (p = h && h.type === a.CONTROL_FLOW_OPEN ? this.__patterns.word_control_flow_close_excluded.read() : this.__patterns.word.read()), p ? this._create_token(a.TEXT, p) : null;
}, ms.Tokenizer = u, ms.TOKEN = a, ms;
}
var tg;
function oT() {
if (tg)
return jf;
tg = 1;
var e = z0().Options, t = Mc().Output, i = eg().Tokenizer, r = eg().TOKEN, n = /\r\n|[\r\n]/, a = /\r\n|[\r\n]/g, s = function(w, m) {
this.indent_level = 0, this.alignment_size = 0, this.max_preserve_newlines = w.max_preserve_newlines, this.preserve_newlines = w.preserve_newlines, this._output = new t(w, m);
};
s.prototype.current_line_has_match = function(w) {
return this._output.current_line.has_match(w);
}, s.prototype.set_space_before_token = function(w, m) {
this._output.space_before_token = w, this._output.non_breaking_space = m;
}, s.prototype.set_wrap_point = function() {
this._output.set_indent(this.indent_level, this.alignment_size), this._output.set_wrap_point();
}, s.prototype.add_raw_token = function(w) {
this._output.add_raw_token(w);
}, s.prototype.print_preserved_newlines = function(w) {
var m = 0;
w.type !== r.TEXT && w.previous.type !== r.TEXT && (m = w.newlines ? 1 : 0), this.preserve_newlines && (m = w.newlines < this.max_preserve_newlines + 1 ? w.newlines : this.max_preserve_newlines + 1);
for (var y = 0; y < m; y++)
this.print_newline(y > 0);
return m !== 0;
}, s.prototype.traverse_whitespace = function(w) {
return w.whitespace_before || w.newlines ? (this.print_preserved_newlines(w) || (this._output.space_before_token = !0), !0) : !1;
}, s.prototype.previous_token_wrapped = function() {
return this._output.previous_token_wrapped;
}, s.prototype.print_newline = function(w) {
this._output.add_new_line(w);
}, s.prototype.print_token = function(w) {
w.text && (this._output.set_indent(this.indent_level, this.alignment_size), this._output.add_token(w.text));
}, s.prototype.indent = function() {
this.indent_level++;
}, s.prototype.deindent = function() {
this.indent_level > 0 && (this.indent_level--, this._output.set_indent(this.indent_level, this.alignment_size));
}, s.prototype.get_full_indent = function(w) {
return w = this.indent_level + (w || 0), w < 1 ? "" : this._output.get_indent_string(w);
};
var u = function(w) {
for (var m = null, y = w.next; y.type !== r.EOF && w.closed !== y; ) {
if (y.type === r.ATTRIBUTE && y.text === "type") {
y.next && y.next.type === r.EQUALS && y.next.next && y.next.next.type === r.VALUE && (m = y.next.next.text);
break;
}
y = y.next;
}
return m;
}, d = function(w, m) {
var y = null, E = null;
return m.closed ? (w === "script" ? y = "text/javascript" : w === "style" && (y = "text/css"), y = u(m) || y, y.search("text/css") > -1 ? E = "css" : y.search(/module|((text|application|dojo)\/(x-)?(javascript|ecmascript|jscript|livescript|(ld\+)?json|method|aspect))/) > -1 ? E = "javascript" : y.search(/(text|application|dojo)\/(x-)?(html)/) > -1 ? E = "html" : y.search(/test\/null/) > -1 && (E = "null"), E) : null;
};
function h(w, m) {
return m.indexOf(w) !== -1;
}
function p(w, m, y) {
this.parent = w || null, this.tag = m ? m.tag_name : "", this.indent_level = y || 0, this.parser_token = m || null;
}
function g(w) {
this._printer = w, this._current_frame = null;
}
g.prototype.get_parser_token = function() {
return this._current_frame ? this._current_frame.parser_token : null;
}, g.prototype.record_tag = function(w) {
var m = new p(this._current_frame, w, this._printer.indent_level);
this._current_frame = m;
}, g.prototype._try_pop_frame = function(w) {
var m = null;
return w && (m = w.parser_token, this._printer.indent_level = w.indent_level, this._current_frame = w.parent), m;
}, g.prototype._get_frame = function(w, m) {
for (var y = this._current_frame; y && w.indexOf(y.tag) === -1; ) {
if (m && m.indexOf(y.tag) !== -1) {
y = null;
break;
}
y = y.parent;
}
return y;
}, g.prototype.try_pop = function(w, m) {
var y = this._get_frame([w], m);
return this._try_pop_frame(y);
}, g.prototype.indent_to_tag = function(w) {
var m = this._get_frame(w);
m && (this._printer.indent_level = m.indent_level);
};
function _(w, m, y, E) {
this._source_text = w || "", m = m || {}, this._js_beautify = y, this._css_beautify = E, this._tag_stack = null;
var x = new e(m, "html");
this._options = x, this._is_wrap_attributes_force = this._options.wrap_attributes.substr(0, 5) === "force", this._is_wrap_attributes_force_expand_multiline = this._options.wrap_attributes === "force-expand-multiline", this._is_wrap_attributes_force_aligned = this._options.wrap_attributes === "force-aligned", this._is_wrap_attributes_aligned_multiple = this._options.wrap_attributes === "aligned-multiple", this._is_wrap_attributes_preserve = this._options.wrap_attributes.substr(0, 8) === "preserve", this._is_wrap_attributes_preserve_aligned = this._options.wrap_attributes === "preserve-aligned";
}
_.prototype.beautify = function() {
if (this._options.disabled)
return this._source_text;
var w = this._source_text, m = this._options.eol;
this._options.eol === "auto" && (m = `
`, w && n.test(w) && (m = w.match(n)[0])), w = w.replace(a, `
`);
var y = w.match(/^[\t ]*/)[0], E = {
text: "",
type: ""
}, x = new S(this._options), k = new s(this._options, y), D = new i(w, this._options).tokenize();
this._tag_stack = new g(k);
for (var P = null, M = D.next(); M.type !== r.EOF; )
M.type === r.TAG_OPEN || M.type === r.COMMENT ? (P = this._handle_tag_open(k, M, x, E, D), x = P) : M.type === r.ATTRIBUTE || M.type === r.EQUALS || M.type === r.VALUE || M.type === r.TEXT && !x.tag_complete ? P = this._handle_inside_tag(k, M, x, E) : M.type === r.TAG_CLOSE ? P = this._handle_tag_close(k, M, x) : M.type === r.TEXT ? P = this._handle_text(k, M, x) : M.type === r.CONTROL_FLOW_OPEN ? P = this._handle_control_flow_open(k, M) : M.type === r.CONTROL_FLOW_CLOSE ? P = this._handle_control_flow_close(k, M) : k.add_raw_token(M), E = P, M = D.next();
var B = k._output.get_code(m);
return B;
}, _.prototype._handle_control_flow_open = function(w, m) {
var y = {
text: m.text,
type: m.type
};
return w.set_space_before_token(m.newlines || m.whitespace_before !== "", !0), m.newlines ? w.print_preserved_newlines(m) : w.set_space_before_token(m.newlines || m.whitespace_before !== "", !0), w.print_token(m), w.indent(), y;
}, _.prototype._handle_control_flow_close = function(w, m) {
var y = {
text: m.text,
type: m.type
};
return w.deindent(), m.newlines ? w.print_preserved_newlines(m) : w.set_space_before_token(m.newlines || m.whitespace_before !== "", !0), w.print_token(m), y;
}, _.prototype._handle_tag_close = function(w, m, y) {
var E = {
text: m.text,
type: m.type
};
return w.alignment_size = 0, y.tag_complete = !0, w.set_space_before_token(m.newlines || m.whitespace_before !== "", !0), y.is_unformatted ? w.add_raw_token(m) : (y.tag_start_char === "<" && (w.set_space_before_token(m.text[0] === "/", !0), this._is_wrap_attributes_force_expand_multiline && y.has_wrapped_attrs && w.print_newline(!1)), w.print_token(m)), y.indent_content && !(y.is_unformatted || y.is_content_unformatted) && (w.indent(), y.indent_content = !1), !y.is_inline_element && !(y.is_unformatted || y.is_content_unformatted) && w.set_wrap_point(), E;
}, _.prototype._handle_inside_tag = function(w, m, y, E) {
var x = y.has_wrapped_attrs, k = {
text: m.text,
type: m.type
};
return w.set_space_before_token(m.newlines || m.whitespace_before !== "", !0), y.is_unformatted ? w.add_raw_token(m) : y.tag_start_char === "{" && m.type === r.TEXT ? w.print_preserved_newlines(m) ? (m.newlines = 0, w.add_raw_token(m)) : w.print_token(m) : (m.type === r.ATTRIBUTE ? w.set_space_before_token(!0) : (m.type === r.EQUALS || m.type === r.VALUE && m.previous.type === r.EQUALS) && w.set_space_before_token(!1), m.type === r.ATTRIBUTE && y.tag_start_char === "<" && ((this._is_wrap_attributes_preserve || this._is_wrap_attributes_preserve_aligned) && (w.traverse_whitespace(m), x = x || m.newlines !== 0), this._is_wrap_attributes_force && y.attr_count >= this._options.wrap_attributes_min_attrs && (E.type !== r.TAG_OPEN || this._is_wrap_attributes_force_expand_multiline) && (w.print_newline(!1), x = !0)), w.print_token(m), x = x || w.previous_token_wrapped(), y.has_wrapped_attrs = x), k;
}, _.prototype._handle_text = function(w, m, y) {
var E = {
text: m.text,
type: "TK_CONTENT"
};
return y.custom_beautifier_name ? this._print_custom_beatifier_text(w, m, y) : y.is_unformatted || y.is_content_unformatted ? w.add_raw_token(m) : (w.traverse_whitespace(m), w.print_token(m)), E;
}, _.prototype._print_custom_beatifier_text = function(w, m, y) {
var E = this;
if (m.text !== "") {
var x = m.text, k, D = 1, P = "", M = "";
y.custom_beautifier_name === "javascript" && typeof this._js_beautify == "function" ? k = this._js_beautify : y.custom_beautifier_name === "css" && typeof this._css_beautify == "function" ? k = this._css_beautify : y.custom_beautifier_name === "html" && (k = function(H, I) {
var U = new _(H, I, E._js_beautify, E._css_beautify);
return U.beautify();
}), this._options.indent_scripts === "keep" ? D = 0 : this._options.indent_scripts === "separate" && (D = -w.indent_level);
var B = w.get_full_indent(D);
if (x = x.replace(/\n[ \t]*$/, ""), y.custom_beautifier_name !== "html" && x[0] === "<" && x.match(/^(<!--|<!\[CDATA\[)/)) {
var T = /^(<!--[^\n]*|<!\[CDATA\[)(\n?)([ \t\n]*)([\s\S]*)(-->|]]>)$/.exec(x);
if (!T) {
w.add_raw_token(m);
return;
}
P = B + T[1] + `
`, x = T[4], T[5] && (M = B + T[5]), x = x.replace(/\n[ \t]*$/, ""), (T[2] || T[3].indexOf(`
`) !== -1) && (T = T[3].match(/[ \t]+$/), T && (m.whitespace_before = T[0]));
}
if (x)
if (k) {
var $ = function() {
this.eol = `
`;
};
$.prototype = this._options.raw_options;
var V = new $();
x = k(B + x, V);
} else {
var z = m.whitespace_before;
z && (x = x.replace(new RegExp(`
(` + z + ")?", "g"), `
`)), x = B + x.replace(/\n/g, `
` + B);
}
P && (x ? x = P + x + `
` + M : x = P + M), w.print_newline(!1), x && (m.text = x, m.whitespace_before = "", m.newlines = 0, w.add_raw_token(m), w.print_newline(!0));
}
}, _.prototype._handle_tag_open = function(w, m, y, E, x) {
var k = this._get_tag_open_token(m);
if ((y.is_unformatted || y.is_content_unformatted) && !y.is_empty_element && m.type === r.TAG_OPEN && !k.is_start_tag ? (w.add_raw_token(m), k.start_tag_token = this._tag_stack.try_pop(k.tag_name)) : (w.traverse_whitespace(m), this._set_tag_position(w, m, k, y, E), k.is_inline_element || w.set_wrap_point(), w.print_token(m)), k.is_start_tag && this._is_wrap_attributes_force) {
var D = 0, P;
do
P = x.peek(D), P.type === r.ATTRIBUTE && (k.attr_count += 1), D += 1;
while (P.type !== r.EOF && P.type !== r.TAG_CLOSE);
}
return (this._is_wrap_attributes_force_aligned || this._is_wrap_attributes_aligned_multiple || this._is_wrap_attributes_preserve_aligned) && (k.alignment_size = m.text.length + 1), !k.tag_complete && !k.is_unformatted && (w.alignment_size = k.alignment_size), k;
};
var S = function(w, m, y) {
if (this.parent = m || null, this.text = "", this.type = "TK_TAG_OPEN", this.tag_name = "", this.is_inline_element = !1, this.is_unformatted = !1, this.is_content_unformatted = !1, this.is_empty_element = !1, this.is_start_tag = !1, this.is_end_tag = !1, this.indent_content = !1, this.multiline_content = !1, this.custom_beautifier_name = null, this.start_tag_token = null, this.attr_count = 0, this.has_wrapped_attrs = !1, this.alignment_size = 0, this.tag_complete = !1, this.tag_start_char = "", this.tag_check = "", !y)
this.tag_complete = !0;
else {
var E;
this.tag_start_char = y.text[0], this.text = y.text, this.tag_start_char === "<" ? (E = y.text.match(/^<([^\s>]*)/), this.tag_check = E ? E[1] : "") : (E = y.text.match(/^{{~?(?:[\^]|#\*?)?([^\s}]+)/), this.tag_check = E ? E[1] : "", (y.text.startsWith("{{#>") || y.text.startsWith("{{~#>")) && this.tag_check[0] === ">" && (this.tag_check === ">" && y.next !== null ? this.tag_check = y.next.text.split(" ")[0] : this.tag_check = y.text.split(">")[1])), this.tag_check = this.tag_check.toLowerCase(), y.type === r.COMMENT && (this.tag_complete = !0), this.is_start_tag = this.tag_check.charAt(0) !== "/", this.tag_name = this.is_start_tag ? this.tag_check : this.tag_check.substr(1), this.is_end_tag = !this.is_start_tag || y.closed && y.closed.text === "/>";
var x = 2;
this.tag_start_char === "{" && this.text.length >= 3 && this.text.charAt(2) === "~" && (x = 3), this.is_end_tag = this.is_end_tag || this.tag_start_char === "{" && (!w.indent_handlebars || this.text.length < 3 || /[^#\^]/.test(this.text.charAt(x)));
}
};
_.prototype._get_tag_open_token = function(w) {
var m = new S(this._options, this._tag_stack.get_parser_token(), w);
return m.alignment_size = this._options.wrap_attributes_indent_size, m.is_end_tag = m.is_end_tag || h(m.tag_check, this._options.void_elements), m.is_empty_element = m.tag_complete || m.is_start_tag && m.is_end_tag, m.is_unformatted = !m.tag_complete && h(m.tag_check, this._options.unformatted), m.is_content_unformatted = !m.is_empty_element && h(m.tag_check, this._options.content_unformatted), m.is_inline_element = h(m.tag_name, this._options.inline) || this._options.inline_custom_elements && m.tag_name.includes("-") || m.tag_start_char === "{", m;
}, _.prototype._set_tag_position = function(w, m, y, E, x) {
if (y.is_empty_element || (y.is_end_tag ? y.start_tag_token = this._tag_stack.try_pop(y.tag_name) : (this._do_optional_end_element(y) && (y.is_inline_element || w.print_newline(!1)), this._tag_stack.record_tag(y), (y.tag_name === "script" || y.tag_name === "style") && !(y.is_unformatted || y.is_content_unformatted) && (y.custom_beautifier_name = d(y.tag_check, m)))), h(y.tag_check, this._options.extra_liners) && (w.print_newline(!1), w._output.just_added_blankline() || w.print_newline(!0)), y.is_empty_element) {
if (y.tag_start_char === "{" && y.tag_check === "else") {
this._tag_stack.indent_to_tag(["if", "unless", "each"]), y.indent_content = !0;
var k = w.current_line_has_match(/{{#if/);
k || w.print_newline(!1);
}
y.tag_name === "!--" && x.type === r.TAG_CLOSE && E.is_end_tag && y.text.indexOf(`
`) === -1 || (y.is_inline_element || y.is_unformatted || w.print_newline(!1), this._calcluate_parent_multiline(w, y));
} else if (y.is_end_tag) {
var D = !1;
D = y.start_tag_token && y.start_tag_token.multiline_content, D = D || !y.is_inline_element && !(E.is_inline_element || E.is_unformatted) && !(x.type === r.TAG_CLOSE && y.start_tag_token === E) && x.type !== "TK_CONTENT", (y.is_content_unformatted || y.is_unformatted) && (D = !1), D && w.print_newline(!1);
} else
y.indent_content = !y.custom_beautifier_name, y.tag_start_char === "<" && (y.tag_name === "html" ? y.indent_content = this._options.indent_inner_html : y.tag_name === "head" ? y.indent_content = this._options.indent_head_inner_html : y.tag_name === "body" && (y.indent_content = this._options.indent_body_inner_html)), !(y.is_inline_element || y.is_unformatted) && (x.type !== "TK_CONTENT" || y.is_content_unformatted) && w.print_newline(!1), this._calcluate_parent_multiline(w, y);
}, _.prototype._calcluate_parent_multiline = function(w, m) {
m.parent && w._output.just_added_newline() && !((m.is_inline_element || m.is_unformatted) && m.parent.is_inline_element) && (m.parent.multiline_content = !0);
};
var b = ["address", "article", "aside", "blockquote", "details", "div", "dl", "fieldset", "figcaption", "figure", "footer", "form", "h1", "h2", "h3", "h4", "h5", "h6", "header", "hr", "main", "menu", "nav", "ol", "p", "pre", "section", "table", "ul"], A = ["a", "audio", "del", "ins", "map", "noscript", "video"];
return _.prototype._do_optional_end_element = function(w) {
var m = null;
if (!(w.is_empty_element || !w.is_start_tag || !w.parent)) {
if (w.tag_name === "body")
m = m || this._tag_stack.try_pop("head");
else if (w.tag_name === "li")
m = m || this._tag_stack.try_pop("li", ["ol", "ul", "menu"]);
else if (w.tag_name === "dd" || w.tag_name === "dt")
m = m || this._tag_stack.try_pop("dt", ["dl"]), m = m || this._tag_stack.try_pop("dd", ["dl"]);
else if (w.parent.tag_name === "p" && b.indexOf(w.tag_name) !== -1) {
var y = w.parent.parent;
(!y || A.indexOf(y.tag_name) === -1) && (m = m || this._tag_stack.try_pop("p"));
} else
w.tag_name === "rp" || w.tag_name === "rt" ? (m = m || this._tag_stack.try_pop("rt", ["ruby", "rtc"]), m = m || this._tag_stack.try_pop("rp", ["ruby", "rtc"])) : w.tag_name === "optgroup" ? m = m || this._tag_stack.try_pop("optgroup", ["select"]) : w.tag_name === "option" ? m = m || this._tag_stack.try_pop("option", ["select", "datalist", "optgroup"]) : w.tag_name === "colgroup" ? m = m || this._tag_stack.try_pop("caption", ["table"]) : w.tag_name === "thead" ? (m = m || this._tag_stack.try_pop("caption", ["table"]), m = m || this._tag_stack.try_pop("colgroup", ["table"])) : w.tag_name === "tbody" || w.tag_name === "tfoot" ? (m = m || this._tag_stack.try_pop("caption", ["table"]), m = m || this._tag_stack.try_pop("colgroup", ["table"]), m = m || this._tag_stack.try_pop("thead", ["table"]), m = m || this._tag_stack.try_pop("tbody", ["table"])) : w.tag_name === "tr" ? (m = m || this._tag_stack.try_pop("caption", ["table"]), m = m || this._tag_stack.try_pop("colgroup", ["table"]), m = m || this._tag_stack.try_pop("tr", ["table", "thead", "tbody", "tfoot"])) : (w.tag_name === "th" || w.tag_name === "td") && (m = m || this._tag_stack.try_pop("td", ["table", "thead", "tbody", "tfoot", "tr"]), m = m || this._tag_stack.try_pop("th", ["table", "thead", "tbody", "tfoot", "tr"]));
return w.parent = this._tag_stack.get_parser_token(), m;
}
}, jf.Beautifier = _, jf;
}
var ng;
function aT() {
if (ng)
return hs.exports;
ng = 1;
var e = oT().Beautifier, t = z0().Options;
function i(r, n, a, s) {
var u = new e(r, n, a, s);
return u.beautify();
}
return hs.exports = i, hs.exports.defaultOptions = function() {
return new t();
}, hs.exports;
}
var ig;
function lT() {
if (ig)
return Fa;
ig = 1;
var e = nT(), t = rT(), i = aT();
function r(n, a, s, u) {
return s = s || e, u = u || t, i(n, a, s, u);
}
return r.defaultOptions = i.defaultOptions, Fa.js = e, Fa.css = t, Fa.html = r, Fa;
}
(function(e) {
function t(i, r, n) {
var a = function(s, u) {
return i.js_beautify(s, u);
};
return a.js = i.js_beautify, a.css = r.css_beautify, a.html = n.html_beautify, a.js_beautify = i.js_beautify, a.css_beautify = r.css_beautify, a.html_beautify = n.html_beautify, a;
}
(function(i) {
var r = lT();
r.js_beautify = r.js, r.css_beautify = r.css, r.html_beautify = r.html, i.exports = t(r, r, r);
})(e);
})(L0);
const Vo = L0.exports;
function sT(e) {
const t = {};
return Object.values(e.import).forEach((i) => {
t[i.name] = i.path;
}), ` import { defineComponent } from "vue";
${Object.keys(t).map((i) => `import ${i} from '${t[i]}';`).join(`
`)}
export default defineComponent({
name: "FcTemplate",
components: {
${Object.keys(t).join(",")}
},
props: {},
data() {
return ${ai(e.data)}
},
methods: ${ai(e.methods)}
});
`;
}
function uT(e) {
const t = {};
return Object.values(e.import).forEach((i) => {
t[i.name] = i.path;
}), ` import { ref } from "vue";
${Object.keys(t).map((i) => `import ${i} from '${t[i]}';`).join(`
`)}
${Object.keys(e.data).map((i) => `const ${i} = ref(${ai(e.data[i])})`).join(`
`)}
${Object.keys(e.methods).map((i) => ai(e.methods[i])).join(`
`)}
`;
}
function sc(e, t) {
const i = [];
return e && e.forEach((r) => {
if (!(r && r._menu && r._menu.sfc === !1))
if (typeof r == "string")
i.push(r);
else if (r._fc_drag_tag) {
const n = {
...r,
children: sc(r.children),
_sfc: {}
};
t && (n.slot = t), n.children.length ? typeof n.children[0] == "string" && (n._sfc.content = n.children[0], delete n.children) : delete n.children, i.push(n);
} else
i.push(...sc(r.children, ["DragBox", "DragTool"].indexOf(r.type) > -1 ? r.slot || t : ""));
}), i;
}
function dT(e, t, i, r) {
const n = e[0] ? e[0].__fc__.vNode.aliasMap : void 0, a = {
style: {},
import: {},
data: {
formData: {}
},
methods: {
submit() {
this.$refs.form.validate().then(() => {
});
},
reset() {
this.$refs.form.resetFields();
}
}
}, s = [];
function u() {
let w = s.join(".");
return w && (w += "."), w;
}
function d(w, m) {
return m ? `<${w.type}${h(w)}>${m}</${w.type}>` : `<${w.type}${h(w)}/>`;
}
function h(w) {
const m = w.props || {}, y = w._sfc || {};
let E = [];
if (w.class && E.push(`class="${Array.isArray(w.class) ? w.class.join(" ") : w.class}"`), w.slot && w.slot !== "default" && E.push("#" + w.slot), Object.keys(m).forEach((k) => {
const D = m[k];
if (D && typeof D == "object") {
const P = w._fc_id ? w._fc_id + "_" + k : k;
a.data[P] = D, E.push(`:${k}="${P}"`);
} else if (D != null && D !== "" && typeof D != "function") {
let P = typeof D == "string" ? "" : ":";
P += `${k}="${D}"`, E.push(P);
}
}), w.field) {
let k = w.value;
const D = {
array: [],
string: "",
number: 0
};
if (w.value == null) {
const P = i[w._fc_drag_tag];
P && Array.isArray(P.validate) && Li(D, P.validate[0]) && (k = D[P.validate[0]]);
}
a.data.formData[w.field] = k, y.vModel !== !1 && E.push(`v-model${y.modelField ? ":" + y.modelField : ""}="formData.${u()}${w.field}"`);
}
if (w.style) {
const k = fT(w.style || "");
k && E.push(`style="${k}"`);
}
y.attr && Object.keys(y.attr).forEach((k) => {
E.push(`${k}="${y.attr[k]}"`);
}), y.prop && Object.keys(y.prop).forEach((k) => {
const D = w._fc_id + "_" + k;
a.data[D] = y.prop[k], E.push(`:${k}="${D}"`);
}), y.flag && y.flag.forEach((k) => {
E.push(k);
});
let x = E.join(" ");
return x && (x = " " + x.trim()), x;
}
function p(w) {
return w ? w.map((m) => {
var P, M, B;
let y = "";
const E = m._menu;
let x = At(m), k;
if (E && E.sfc) {
let T;
if (typeof E.sfc == "object" ? (T = E.sfc.handle, E.sfc.style && (a.style[E.name] = E.sfc.style), E.sfc.import && (a.import[E.name] = E.sfc.import)) : T = E.sfc, T) {
const $ = T(x, { transition: p, scope: a, getParentFieldStr: u }) || x;
typeof $ == "string" ? k = $ : x = $;
}
}
const D = x.native !== !1 && (x.field || x.title);
return k || (x._sfc && x._sfc.parentField && s.push(x.parentField), x._sfc && x._sfc.content ? y = `${x._sfc.content}` : x.children && (y = `
` + p(x.children) + `
`), n && n[x.type] && (x.type = Sc(n[x.type])), k = d(x, y), x._sfc && x._sfc.parentField && s.pop()), D && ((P = x == null ? void 0 : x.wrap) == null ? void 0 : P.show) !== !1 && (k = d({
type: "elFormItem",
props: {
labelWidth: x.title ? void 0 : "0px",
...x.wrap || {},
prop: u() + x.field,
label: x.title,
required: x.$required === !0 ? !0 : void 0
},
style: (M = x == null ? void 0 : x.wrap) == null ? void 0 : M.style,
class: (B = x == null ? void 0 : x.wrap) == null ? void 0 : B.class
}, `
` + k + `
`)), k;
}).join(`
`) : "";
}
e = sc(e);
const g = [];
t.submitBtn.show && g.push({
type: "elButton",
props: {
type: "primary"
},
_sfc: {
attr: {
"@click": "submit"
},
content: t.submitBtn.innerText || "\u63D0\u4EA4"
}
}), t.resetBtn.show && g.push({
type: "elButton",
props: {
type: "default"
},
_sfc: {
attr: {
"@click": "reset"
},
content: t.resetBtn.innerText || "\u91CD\u7F6E"
}
}), g.length && e.push({
type: "elFormItem",
children: g
});
const _ = p([
{
type: "template",
children: [
{
type: "elForm",
props: t.form || {},
children: e,
_sfc: {
attr: {
ref: "form",
":model": "formData"
},
flag: ["@submit.prevent"]
}
}
]
}
]);
t.formData && tu(a.data.formData, t.formData);
const S = Vo.html(_, {
indent_size: 2,
indent_char: " ",
indent_scripts: "separate",
jslint_happy: !1
}), b = Vo.js(r ? sT(a) : uT(a), {
indent_size: 2,
indent_char: " ",
indent_scripts: "separate"
}), A = Vo.css(Object.values(a.style).join(`
`), {
indent_size: 2,
indent_char: " ",
indent_scripts: "separate"
});
return `${S}
<script${r ? "" : " setup"}>
${b}
<\/script>
<style>
${A}
</style>
`;
}
function fT(e) {
return !e || typeof e == "string" ? e || "" : Object.keys(e).reduce((t, i) => (e[i] != null && e[i] !== "" && t.push(ll(i) + ":" + e[i] + ";"), t), []).join("");
}
const cT = Ve({
name: "SubList",
components: { fcDraggable: Go, VNode: O0, ConfigItem: li },
inject: ["designer"],
computed: {
t() {
return this.designer.setupState.t;
},
activeRuleChildren() {
return this.designer.setupState.activeRuleChildren;
},
activeRule() {
return this.designer.setupState.activeRule;
}
},
methods: {
toolHandle(...e) {
this.designer.setupState.toolHandle(...e);
},
subRender(...e) {
return this.designer.setupState.subRender(...e);
},
end({ oldIndex: e, newIndex: t }) {
if (e === t)
return;
const i = this.activeRule.children.splice(e, 1);
this.activeRule.children.splice(t, 0, i[0]), this.activeRule.key = rt();
}
}
}), pT = { class: "_fc-sublist" }, hT = { class: "_fc-r-title" }, mT = ["onClick"], vT = ["onClick"];
function gT(e, t, i, r, n, a) {
const s = ie("VNode"), u = ie("ConfigItem"), d = ie("fcDraggable");
return W(), ae("div", pT, [
Z("p", hT, [
Z("span", null, le(e.t("designer.sublist")), 1),
Z("i", {
class: "fc-icon icon-add-circle",
onClick: t[0] || (t[0] = (h) => e.toolHandle(e.activeRule, "addChild"))
})
]),
G(d, {
group: { name: "sub", pull: "clone", put: !1 },
sort: !0,
handle: ".icon-drag",
direction: "vertical",
animation: 0,
itemKey: "_fc_id",
onEnd: e.end,
list: e.activeRuleChildren
}, {
item: N(({ element: h, index: p }) => [
G(u, null, ii({
label: N(() => [
t[1] || (t[1] = Z("i", { class: "fc-icon icon-drag" }, null, -1)),
Z("span", null, le((e.t("com." + h._menu.name + ".name") || e.activeRule._menu.label) + " " + (p + 1)), 1)
]),
default: N(() => [
Z("i", {
class: "fc-icon icon-copy",
onClick: (g) => e.toolHandle(h, "copy")
}, null, 8, mT),
Z("i", {
class: "fc-icon icon-delete",
onClick: (g) => e.toolHandle(h, "delete")
}, null, 8, vT)
]),
_: 2
}, [
e.activeRule._menu.subRender ? {
name: "append",
fn: N(() => [
G(s, {
fn: () => e.subRender(e.activeRule._menu.subRender, e.activeRule, h)
}, null, 8, ["fn"])
]),
key: "0"
} : void 0
]), 1024)
]),
_: 1
}, 8, ["onEnd", "list"])
]);
}
const yT = /* @__PURE__ */ je(cT, [["render", gT]]);
const bT = Ve({
name: "ToolsBar",
inject: ["designer"],
computed: {
t() {
return this.designer.setupState.t;
},
tools() {
const e = this.designer.setupState, t = [];
return !e.activeRule && !e.customForm.config || (e.baseForm.isShow && t.push({
label: this.t("designer.rule"),
icon: "base"
}), (e.propsForm.isShow || e.customForm.isShow && e.customForm.propsShow) && t.push({
label: this.t("designer.props"),
icon: "props"
}), e.advancedForm.isShow && t.push({
label: this.t("designer.advanced"),
icon: "advanced"
}), e.styleForm.isShow && t.push({
label: this.t("designer.style"),
icon: "style"
}), e.eventShow && t.push({
label: this.t("designer.event"),
icon: "event"
}), e.validateForm.isShow && t.push({
label: this.t("designer.validate"),
icon: "validate"
})), t;
}
},
methods: {
onClick(e) {
document.querySelector(`#_fd-config-${e}`).scrollIntoView({
block: "start",
inline: "nearest",
behavior: "smooth"
});
},
clearActiveRule() {
this.designer.setupState.clearActiveRule();
}
}
}), _T = {
key: 0,
class: "_fc-r-tools-bar"
}, wT = { class: "_fc-r-tools" }, AT = ["onClick"];
function CT(e, t, i, r, n, a) {
const s = ie("el-tooltip");
return e.tools.length > 2 ? (W(), ae("div", _T, [
Z("div", wT, [
(W(!0), ae(Pe, null, Ge(e.tools, (u) => (W(), ye(s, {
key: u.icon,
effect: "dark",
content: u.label,
placement: "bottom",
persistent: "",
"hide-after": 0
}, {
default: N(() => [
Z("div", {
class: "_fc-r-tool",
onClick: (d) => e.onClick(u.icon)
}, [
Z("i", {
class: qe(["fc-icon", `icon-config-${u.icon}`])
}, null, 2)
], 8, AT)
]),
_: 2
}, 1032, ["content"]))), 128)),
Z("div", {
class: "_fc-r-tools-close _fc-r-tool",
onClick: t[0] || (t[0] = (...u) => e.clearActiveRule && e.clearActiveRule(...u))
}, t[1] || (t[1] = [
Z("i", { class: "fc-icon icon-add2" }, null, -1)
]))
])
])) : Oe("", !0);
}
const ST = /* @__PURE__ */ je(bT, [["render", CT]]);
const ET = Ve({
name: "ConfigTitle"
}), xT = {
ref: "cell",
class: "_fd-config-title"
};
function TT(e, t, i, r, n, a) {
return W(), ae("div", xT, [
kt(e.$slots, "default")
], 512);
}
const H0 = /* @__PURE__ */ je(ET, [["render", TT]]);
var kT = {
name: "zh-cn",
el: {
breadcrumb: {
label: "\u9762\u5305\u5C51"
},
colorpicker: {
confirm: "\u786E\u5B9A",
clear: "\u6E05\u7A7A",
defaultLabel: "\u989C\u8272\u9009\u62E9\u5668",
description: "\u5F53\u524D\u989C\u8272 {color}\uFF0C\u6309 Enter \u952E\u9009\u62E9\u65B0\u989C\u8272",
alphaLabel: "\u9009\u62E9\u900F\u660E\u5EA6\u7684\u503C"
},
datepicker: {
now: "\u6B64\u523B",
today: "\u4ECA\u5929",
cancel: "\u53D6\u6D88",
clear: "\u6E05\u7A7A",
confirm: "\u786E\u5B9A",
dateTablePrompt: "\u4F7F\u7528\u65B9\u5411\u952E\u4E0E Enter \u952E\u53EF\u9009\u62E9\u65E5\u671F",
monthTablePrompt: "\u4F7F\u7528\u65B9\u5411\u952E\u4E0E Enter \u952E\u53EF\u9009\u62E9\u6708\u4EFD",
yearTablePrompt: "\u4F7F\u7528\u65B9\u5411\u952E\u4E0E Enter \u952E\u53EF\u9009\u62E9\u5E74\u4EFD",
selectedDate: "\u5DF2\u9009\u65E5\u671F",
selectDate: "\u9009\u62E9\u65E5\u671F",
selectTime: "\u9009\u62E9\u65F6\u95F4",
startDate: "\u5F00\u59CB\u65E5\u671F",
startTime: "\u5F00\u59CB\u65F6\u95F4",
endDate: "\u7ED3\u675F\u65E5\u671F",
endTime: "\u7ED3\u675F\u65F6\u95F4",
prevYear: "\u524D\u4E00\u5E74",
nextYear: "\u540E\u4E00\u5E74",
prevMonth: "\u4E0A\u4E2A\u6708",
nextMonth: "\u4E0B\u4E2A\u6708",
year: "\u5E74",
month1: "1 \u6708",
month2: "2 \u6708",
month3: "3 \u6708",
month4: "4 \u6708",
month5: "5 \u6708",
month6: "6 \u6708",
month7: "7 \u6708",
month8: "8 \u6708",
month9: "9 \u6708",
month10: "10 \u6708",
month11: "11 \u6708",
month12: "12 \u6708",
weeks: {
sun: "\u65E5",
mon: "\u4E00",
tue: "\u4E8C",
wed: "\u4E09",
thu: "\u56DB",
fri: "\u4E94",
sat: "\u516D"
},
weeksFull: {
sun: "\u661F\u671F\u65E5",
mon: "\u661F\u671F\u4E00",
tue: "\u661F\u671F\u4E8C",
wed: "\u661F\u671F\u4E09",
thu: "\u661F\u671F\u56DB",
fri: "\u661F\u671F\u4E94",
sat: "\u661F\u671F\u516D"
},
months: {
jan: "\u4E00\u6708",
feb: "\u4E8C\u6708",
mar: "\u4E09\u6708",
apr: "\u56DB\u6708",
may: "\u4E94\u6708",
jun: "\u516D\u6708",
jul: "\u4E03\u6708",
aug: "\u516B\u6708",
sep: "\u4E5D\u6708",
oct: "\u5341\u6708",
nov: "\u5341\u4E00\u6708",
dec: "\u5341\u4E8C\u6708"
}
},
inputNumber: {
decrease: "\u51CF\u5C11\u6570\u503C",
increase: "\u589E\u52A0\u6570\u503C"
},
select: {
loading: "\u52A0\u8F7D\u4E2D",
noMatch: "\u65E0\u5339\u914D\u6570\u636E",
noData: "\u65E0\u6570\u636E",
placeholder: "\u8BF7\u9009\u62E9"
},
dropdown: {
toggleDropdown: "\u5207\u6362\u4E0B\u62C9\u9009\u9879"
},
mention: {
loading: "\u52A0\u8F7D\u4E2D"
},
cascader: {
noMatch: "\u65E0\u5339\u914D\u6570\u636E",
loading: "\u52A0\u8F7D\u4E2D",
placeholder: "\u8BF7\u9009\u62E9",
noData: "\u6682\u65E0\u6570\u636E"
},
pagination: {
goto: "\u524D\u5F80",
pagesize: "\u6761/\u9875",
total: "\u5171 {total} \u6761",
pageClassifier: "\u9875",
page: "\u9875",
prev: "\u4E0A\u4E00\u9875",
next: "\u4E0B\u4E00\u9875",
currentPage: "\u7B2C {pager} \u9875",
prevPages: "\u5411\u524D {pager} \u9875",
nextPages: "\u5411\u540E {pager} \u9875",
deprecationWarning: "\u4F60\u4F7F\u7528\u4E86\u4E00\u4E9B\u5DF2\u88AB\u5E9F\u5F03\u7684\u7528\u6CD5\uFF0C\u8BF7\u53C2\u8003 el-pagination \u7684\u5B98\u65B9\u6587\u6863"
},
dialog: {
close: "\u5173\u95ED\u6B64\u5BF9\u8BDD\u6846"
},
drawer: {
close: "\u5173\u95ED\u6B64\u5BF9\u8BDD\u6846"
},
messagebox: {
title: "\u63D0\u793A",
confirm: "\u786E\u5B9A",
cancel: "\u53D6\u6D88",
error: "\u8F93\u5165\u7684\u6570\u636E\u4E0D\u5408\u6CD5!",
close: "\u5173\u95ED\u6B64\u5BF9\u8BDD\u6846"
},
upload: {
deleteTip: "\u6309 Delete \u952E\u53EF\u5220\u9664",
delete: "\u5220\u9664",
preview: "\u67E5\u770B\u56FE\u7247",
continue: "\u7EE7\u7EED\u4E0A\u4F20"
},
slider: {
defaultLabel: "\u6ED1\u5757\u4ECB\u4E8E {min} \u81F3 {max}",
defaultRangeStartLabel: "\u9009\u62E9\u8D77\u59CB\u503C",
defaultRangeEndLabel: "\u9009\u62E9\u7ED3\u675F\u503C"
},
table: {
emptyText: "\u6682\u65E0\u6570\u636E",
confirmFilter: "\u7B5B\u9009",
resetFilter: "\u91CD\u7F6E",
clearFilter: "\u5168\u90E8",
sumText: "\u5408\u8BA1"
},
tour: {
next: "\u4E0B\u4E00\u6B65",
previous: "\u4E0A\u4E00\u6B65",
finish: "\u7ED3\u675F\u5BFC\u89C8"
},
tree: {
emptyText: "\u6682\u65E0\u6570\u636E"
},
transfer: {
noMatch: "\u65E0\u5339\u914D\u6570\u636E",
noData: "\u65E0\u6570\u636E",
titles: ["\u5217\u8868 1", "\u5217\u8868 2"],
filterPlaceholder: "\u8BF7\u8F93\u5165\u641C\u7D22\u5185\u5BB9",
noCheckedFormat: "\u5171 {total} \u9879",
hasCheckedFormat: "\u5DF2\u9009 {checked}/{total} \u9879"
},
image: {
error: "\u52A0\u8F7D\u5931\u8D25"
},
pageHeader: {
title: "\u8FD4\u56DE"
},
popconfirm: {
confirmButtonText: "\u786E\u5B9A",
cancelButtonText: "\u53D6\u6D88"
},
carousel: {
leftArrow: "\u4E0A\u4E00\u5F20\u5E7B\u706F\u7247",
rightArrow: "\u4E0B\u4E00\u5F20\u5E7B\u706F\u7247",
indicator: "\u5E7B\u706F\u7247\u5207\u6362\u81F3\u7D22\u5F15 {index}"
}
}
};
const OT = Ve({
name: "TypeSelect",
inject: ["designer"],
computed: {
t() {
return this.designer.setupState.t;
},
activeRule() {
return this.designer.setupState.activeRule;
},
customForm() {
return this.designer.setupState.customForm;
},
menus() {
let e = [];
const t = this.designer.setupState;
if (this.activeRule) {
const i = this.activeRule._menu.name, r = t.getConfig("switchType", []);
if (r === !1)
return e;
let n = [];
r.forEach((a) => {
a.indexOf(i) > -1 && n.push(...a);
}), n = n.filter((a, s) => a !== i && n.indexOf(a) === s), n.length ? t.menuList.forEach((a) => {
a.list.forEach((s) => {
n.indexOf(s.name) > -1 && e.push(s);
});
}) : t.menuList.forEach((a) => {
a.name === this.activeRule._menu.menu && a.list.forEach((s) => {
s.name !== i && e.push(s);
});
});
}
return e.filter((i) => this.designer.setupState.hiddenItem.indexOf(i.name) === -1);
}
},
methods: {
handleCommand(e) {
var s;
let t = this.activeRule, i = this.activeRule;
i._menu.inside || (i = i.__fc__.parent.rule);
const r = i.__fc__.parent.rule.children, n = this.designer.setupState.makeRule(e);
let a = n;
n.type === "DragTool" && (a = n.children[0]), a.field && t.field ? ["title", "info", "field", "validate", "computed", "control", "$required", "style"].forEach((u) => {
a[u] = t[u];
}) : (s = t == null ? void 0 : t.computed) != null && s.hidden && (a.computed = { hidden: t.computed.hidden }), t.name && (a.name = t.name), ["name", "wrap", "class", "id", "control", "on"].forEach((u) => {
t[u] && (a[u] = t[u]);
}), r.splice(r.indexOf(i), 1, n), this.$nextTick(() => {
this.designer.setupState.triggerActive(a);
});
}
}
}), RT = {
key: 0,
class: "fc-icon icon-down"
};
function DT(e, t, i, r, n, a) {
const s = ie("el-tag"), u = ie("el-dropdown-item"), d = ie("el-dropdown-menu"), h = ie("el-dropdown");
return W(), ye(h, {
class: "_fd-type-select",
trigger: "click",
size: "default",
"popper-class": "_fd-type-select-pop",
disabled: !e.menus.length,
onCommand: e.handleCommand
}, {
dropdown: N(() => [
G(d, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.menus, (p) => (W(), ye(u, {
command: p,
key: p.name
}, {
default: N(() => [
Z("div", null, [
Z("i", {
class: qe(["fc-icon", p.icon || "icon-input"])
}, null, 2),
_e(le(e.t("com." + p.name + ".name") || p.label), 1)
])
]),
_: 2
}, 1032, ["command"]))), 128))
]),
_: 1
})
]),
default: N(() => [
G(s, {
type: "success",
effect: "plain",
"disable-transitions": ""
}, {
default: N(() => [
e.activeRule ? (W(), ae(Pe, { key: 0 }, [
_e(le(e.t("com." + e.activeRule._menu.name + ".name") || e.activeRule._menu.label) + " ", 1),
e.menus.length ? (W(), ae("i", RT)) : Oe("", !0)
], 64)) : (W(), ae(Pe, { key: 1 }, [
_e(le(e.t("com." + e.customForm.config.name + ".name") || e.customForm.config.label || e.customForm.config.name), 1)
], 64))
]),
_: 1
})
]),
_: 1
}, 8, ["disabled", "onCommand"]);
}
const $T = /* @__PURE__ */ je(OT, [["render", DT]]);
const IT = Ve({
name: "FieldList",
inject: ["designer"],
props: {
field: Array
},
components: {
fcDraggable: Go
},
methods: {
nodeClick(e) {
if (e.rule || e.item) {
const t = { ...e };
this.designer.setupState.clickField(t);
}
}
}
}), FT = { class: "_fc-field-node" }, MT = { class: "_fc-field-node-label" }, PT = {
key: 1,
class: "fc-icon icon-folder"
}, LT = {
key: 1,
class: "_fc-field-node"
}, NT = { class: "_fc-field-node-label" }, BT = {
key: 1,
class: "fc-icon icon-folder"
};
function VT(e, t, i, r, n, a) {
const s = ie("fcDraggable"), u = ie("el-tree");
return W(), ye(u, {
ref: "treeRef",
class: "_fc-field-tree",
data: e.field,
"default-expand-all": "",
"expand-on-click-node": !1,
indent: 10,
onNodeClick: e.nodeClick
}, {
default: N(({ node: d, data: h }) => [
h.rule || h.item ? (W(), ye(s, {
key: 0,
group: { name: "default", pull: "clone", put: !1 },
sort: !1,
list: [{ ...h, _field: !0 }],
itemKey: "label",
class: "_fc-field-drag"
}, {
item: N(() => [
Z("div", FT, [
Z("div", MT, [
d.isLeaf ? (W(), ae("i", {
key: 0,
class: qe(["fc-icon", h.icon || "icon-input"])
}, null, 2)) : (W(), ae("i", PT)),
Z("span", null, le(h.label), 1)
])
])
]),
_: 2
}, 1032, ["list"])) : (W(), ae("div", LT, [
Z("div", NT, [
d.isLeaf ? (W(), ae("i", {
key: 0,
class: qe(["fc-icon", h.icon || "icon-input"])
}, null, 2)) : (W(), ae("i", BT)),
Z("span", null, le(h.label), 1)
])
]))
]),
_: 1
}, 8, ["data", "onNodeClick"]);
}
const jT = /* @__PURE__ */ je(IT, [["render", VT]]), UT = ["props"], zT = ["class", "style", "directives"], HT = ["on", "hook"], W0 = (e, t = {}, i = {}) => {
const r = [...UT, ...i.normal || []], n = [...zT, ...i.array || []], a = [...HT, ...i.functional || []], s = i.props || [];
return e.reduce((u, d) => {
for (const h in d)
if (u[h])
if (s.indexOf(h) > -1)
u[h] = W0([d[h]], u[h]);
else if (r.indexOf(h) > -1)
u[h] = { ...u[h], ...d[h] };
else if (n.indexOf(h) > -1) {
const p = u[h] instanceof Array ? u[h] : [u[h]], g = d[h] instanceof Array ? d[h] : [d[h]];
u[h] = [...p, ...g];
} else if (a.indexOf(h) > -1)
for (const p in d[h])
if (u[h][p]) {
const g = u[h][p] instanceof Array ? u[h][p] : [u[h][p]], _ = d[h][p] instanceof Array ? d[h][p] : [d[h][p]];
u[h][p] = [...g, ..._];
} else
u[h][p] = d[h][p];
else if (h === "hook")
for (let p in d[h])
u[h][p] ? u[h][p] = WT(u[h][p], d[h][p]) : u[h][p] = d[h][p];
else
u[h] = d[h];
else
r.indexOf(h) > -1 || a.indexOf(h) > -1 || s.indexOf(h) > -1 ? u[h] = { ...d[h] } : n.indexOf(h) > -1 ? u[h] = d[h] instanceof Array ? [...d[h]] : typeof d[h] == "object" ? { ...d[h] } : d[h] : u[h] = d[h];
return u;
}, t);
}, WT = (e, t) => function() {
e && e.apply(this, arguments), t && t.apply(this, arguments);
};
const GT = Ve({
name: "FormList",
inject: ["designer"],
props: {
list: Array
},
data() {
return {
loading: !1,
timerId: void 0,
load: void 0
};
},
methods: {
loadConfig(e, t) {
this.designer.setupState.openInputData(!1), this.designer.setupState.pageData = [], this.designer.setupState.setOptions(e.options), this.designer.setupState.setRule(e.rule), this.designer.emit("switchForm", t);
},
starLoad() {
this.loading || (this.load = S_.service({
target: document.getElementsByClassName("_fc-m-drag")[0],
lock: !0
}), this.loading = !0, this.timerId = setTimeout(() => {
this.endLoad();
}, 5e3));
},
endLoad() {
this.loading = !1, this.load && this.load.close(), this.timerId && clearTimeout(this.timerId), this.load = void 0, this.timerId = void 0;
},
nodeClick(e) {
if (this.loading)
return;
let t = {
rule: e.rule || [],
options: e.options || {}
};
if (e.load) {
const i = e.load(e);
if (i && i.then) {
this.starLoad(), i.then((r) => {
r.rule && (t.rule = r.rule), r.options && (t.options = r.options), this.loadConfig(t, e), this.endLoad();
}).catch((r) => {
this.endLoad();
});
return;
} else
i && (i.rule && (t.rule = i.rule), i.options && (t.options = i.options));
}
this.loadConfig(t, e);
}
}
}), KT = { class: "_fc-form-node" }, YT = { class: "_fc-form-node-label" }, QT = {
key: 0,
class: "fc-icon icon-form"
}, JT = {
key: 1,
class: "fc-icon icon-folder"
}, XT = {
key: 0,
class: "_fc-form-node-info"
}, ZT = ["onClick"];
function qT(e, t, i, r, n, a) {
const s = ie("el-tree");
return W(), ye(s, {
ref: "treeRef",
class: "_fc-form-tree",
data: e.list,
indent: 5
}, {
default: N(({ node: u, data: d }) => [
Z("div", KT, [
Z("div", YT, [
u.isLeaf ? (W(), ae("i", QT)) : (W(), ae("i", JT)),
Z("div", null, [
Z("div", null, le(d.label), 1),
d.info ? (W(), ae("span", XT, le(d.info), 1)) : Oe("", !0)
])
]),
u.isLeaf && !d.disabled ? (W(), ae("i", {
key: 0,
class: "fc-icon icon-edit",
onClick: vt((h) => e.nodeClick(d), ["stop"])
}, null, 8, ZT)) : Oe("", !0)
])
]),
_: 1
}, 8, ["data"]);
}
const ek = /* @__PURE__ */ je(GT, [["render", qT]]);
const tk = Ve({
name: "GlobalEventConfig",
emits: ["update:modelValue"],
props: {
modelValue: Object,
eventName: Array
},
components: {
Warning: Ei,
FnEditor: ar
},
inject: ["designer"],
data() {
return {
visible: !1,
activeIdx: "",
event: {},
cus: !1,
cusValue: "",
handle: ""
};
},
computed: {
t() {
return this.designer.setupState.t;
},
eventNum() {
return Object.keys(this.modelValue || {}).length;
},
fnArgs() {
return [In(this.t)];
}
},
watch: {
visible(e) {
e && (this.activeIdx = "", this.event = At(this.modelValue || {}));
}
},
methods: {
open() {
this.visible = !0;
},
active(e) {
this.activeIdx !== e && (this.handle = this.event[e].handle || "", this.activeIdx = e);
},
addCus() {
const e = this.cusValue && this.cusValue.trim();
if (e) {
const t = "event_" + rt();
this.event[t] = {
label: e,
handle: ""
}, this.active(t), this.closeCus();
}
},
closeCus() {
this.cus = !1, this.cusValue = "";
},
cusEvent() {
this.cus = !0;
},
save() {
return this.$refs.data.save() ? (this.event[this.activeIdx].handle = this.handle, this.activeIdx = "", !0) : !1;
},
rm(e) {
delete this.event[e], e === this.activeIdx && (this.activeIdx = "");
},
close() {
this.activeIdx = "";
},
submit() {
this.activeIdx && !this.save() || (this.$emit("update:modelValue", { ...this.event }), this.visible = !1);
}
},
beforeCreate() {
window.$inject = {
$f: {},
rule: [],
self: {},
option: {},
inject: {},
args: []
};
}
}), nk = { class: "_fd-gec" }, ik = ["onClick"], rk = { class: "_fd-gec-method" }, ok = {
key: 0,
class: "_fd-label"
}, ak = ["onClick"];
function lk(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-badge"), d = ie("Warning"), h = ie("el-header"), p = ie("el-menu-item"), g = ie("el-input"), _ = ie("el-menu"), S = ie("el-main"), b = ie("el-container"), A = ie("el-aside"), w = ie("FnEditor"), m = ie("el-dialog");
return W(), ae("div", nk, [
G(u, {
value: e.eventNum,
type: "warning",
hidden: e.eventNum < 1
}, {
default: N(() => [
G(s, {
class: "_fd-plain-button",
plain: "",
onClick: e.open,
size: "small"
}, {
default: N(() => [
_e(le(e.t("event.title")), 1)
]),
_: 1
}, 8, ["onClick"])
]),
_: 1
}, 8, ["value", "hidden"]),
G(m, {
class: "_fd-gec-dialog _fd-config-dialog",
modelValue: e.visible,
"onUpdate:modelValue": t[6] || (t[6] = (y) => e.visible = y),
"destroy-on-close": "",
"close-on-click-modal": !1,
"append-to-body": "",
width: "980px"
}, {
header: N(() => [
_e(le(e.t("form.globalEvent")), 1),
G(d, {
tooltip: e.t("warning.globalEvent")
}, null, 8, ["tooltip"])
]),
footer: N(() => [
Z("div", null, [
G(s, {
size: "default",
onClick: t[5] || (t[5] = (y) => e.visible = !1)
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}),
G(s, {
type: "primary",
size: "default",
onClick: e.submit
}, {
default: N(() => [
_e(le(e.t("props.ok")), 1)
]),
_: 1
}, 8, ["onClick"])
])
]),
default: N(() => [
G(b, {
class: "_fd-gec-con",
style: { height: "600px" }
}, {
default: N(() => [
G(A, { style: { width: "300px" } }, {
default: N(() => [
G(b, { class: "_fd-gec-l" }, {
default: N(() => [
G(h, {
class: "_fd-gec-head",
height: "40px"
}, {
default: N(() => [
G(s, {
link: "",
type: "primary",
size: "default",
onClick: e.cusEvent
}, {
default: N(() => [
_e(le(e.t("event.create")), 1)
]),
_: 1
}, 8, ["onClick"])
]),
_: 1
}),
G(S, null, {
default: N(() => [
G(_, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.event, (y, E) => (W(), ye(p, {
class: qe({ "is-active": E === e.activeIdx })
}, {
default: N(() => [
Z("div", {
class: "_fd-gec-title",
onClick: vt((x) => e.active(E), ["stop"])
}, [
Z("div", rk, [
Z("span", null, le(E), 1),
y.label ? (W(), ae("span", ok, le(y.label), 1)) : Oe("", !0)
]),
y.deletable !== !1 ? (W(), ae("i", {
key: 0,
class: "fc-icon icon-delete",
onClick: vt((x) => e.rm(E), ["stop"])
}, null, 8, ak)) : Oe("", !0)
], 8, ik)
]),
_: 2
}, 1032, ["class"]))), 256)),
e.cus ? (W(), ye(p, {
key: 0,
style: { "padding-left": "10px" }
}, {
default: N(() => [
Z("div", {
class: "_fd-gec-title",
onClick: t[3] || (t[3] = vt(() => {
}, ["stop"]))
}, [
G(g, {
type: "text",
modelValue: e.cusValue,
"onUpdate:modelValue": t[0] || (t[0] = (y) => e.cusValue = y),
size: "default",
onKeydown: nl(e.addCus, ["enter"]),
placeholder: e.t("event.placeholder")
}, null, 8, ["modelValue", "onKeydown", "placeholder"]),
Z("div", null, [
Z("i", {
class: "fc-icon icon-add",
onClick: t[1] || (t[1] = vt((...y) => e.addCus && e.addCus(...y), ["stop"]))
}),
Z("i", {
class: "fc-icon icon-delete",
onClick: t[2] || (t[2] = vt((...y) => e.closeCus && e.closeCus(...y), ["stop"]))
})
])
])
]),
_: 1
})) : Oe("", !0)
]),
_: 1
})
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}),
G(S, null, {
default: N(() => [
G(b, { class: "_fd-gec-r" }, {
default: N(() => [
e.activeIdx ? (W(), ye(h, {
key: 0,
class: "_fd-gec-head",
height: "40px"
}, {
default: N(() => [
G(s, {
size: "small",
onClick: e.close
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}, 8, ["onClick"]),
G(s, {
size: "small",
type: "primary",
onClick: e.save
}, {
default: N(() => [
_e(le(e.t("props.save")), 1)
]),
_: 1
}, 8, ["onClick"])
]),
_: 1
})) : Oe("", !0),
e.activeIdx ? (W(), ye(S, { key: e.activeIdx }, {
default: N(() => [
G(w, {
modelValue: e.handle,
"onUpdate:modelValue": t[4] || (t[4] = (y) => e.handle = y),
name: "handle",
args: e.fnArgs,
ref: "data"
}, null, 8, ["modelValue", "args"])
]),
_: 1
})) : Oe("", !0)
]),
_: 1
})
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}, 8, ["modelValue"])
]);
}
const G0 = /* @__PURE__ */ je(tk, [["render", lk]]);
const sk = Ve({
name: "StructEditor",
props: {
modelValue: [Object, Array, Function],
format: Boolean,
defaultValue: {
require: !1
}
},
emits: ["blur", "focus", "update:modelValue"],
inject: ["designer"],
data() {
return {
editor: null,
visible: !1,
err: !1,
oldVal: null
};
},
computed: {
t() {
return this.designer.setupState.t;
}
},
watch: {
modelValue(e) {
if (this.editor) {
const t = e ? this.toJson(e) : "";
this.oldVal = t;
const r = this.editor.getScrollInfo().top;
this.editor.setValue(t), this.editor.scrollTo(0, r);
}
}
},
mounted() {
this.$nextTick(() => {
this.load();
});
},
methods: {
toJson(e) {
return this.format ? tt.toJson(e, 2) : ai(e);
},
load() {
const e = this.modelValue ? this.toJson(this.modelValue) : "";
this.oldVal = e, this.$nextTick(() => {
this.editor = Xt(nr(this.$refs.editor, {
lineNumbers: !0,
mode: "javascript",
lint: !0,
line: !0,
tabSize: 2,
lineWrapping: !0,
value: e ? Vo.js(e, {
indent_size: "2",
indent_char: " ",
max_preserve_newlines: "5",
indent_scripts: "separate"
}) : ""
})), this.editor.on("blur", () => {
this.$emit("blur");
}), this.editor.on("focus", () => {
this.$emit("focus");
});
});
},
save() {
const e = (this.editor.getValue() || "").trim();
let t;
try {
t = new Function("return " + e)();
} catch (i) {
return console.error(i), $n(this.t("struct.errorMsg")), !1;
}
return this.validate && this.validate(t) === !1 ? (this.err = !0, !1) : (this.visible = !1, this.toJson(t) !== this.oldVal && this.$emit("update:modelValue", t), !0);
}
}
}), uk = { class: "_fd-struct-editor" }, dk = { ref: "editor" };
function fk(e, t, i, r, n, a) {
return W(), ae("div", uk, [
Z("div", dk, null, 512)
]);
}
const Bc = /* @__PURE__ */ je(sk, [["render", fk]]);
const ck = (e) => [
{
type: "input",
field: "action",
title: e("fetch.action"),
value: "",
validate: [{ required: !0, message: e("fetch.actionRequired"), trigger: "blur" }],
inject: !0,
on: {
blur({ self: t }, i) {
t._start = i.target.selectionStart;
}
},
children: [
{
type: "VariableConfig",
slot: "suffix",
props: {
popover: !0
},
inject: !0,
on: {
confirm({ api: t }, i) {
const r = t.getRule("action");
r.value = r.value.substring(0, r._start) + i + r.value.substring(r._start);
}
}
}
]
},
{
type: "radio",
field: "method",
title: e("fetch.method"),
value: "GET",
options: [
{ label: "GET", value: "GET" },
{ label: "POST", value: "POST" }
],
$required: !0
},
{
type: "radio",
field: "dataType",
title: e("fetch.dataType"),
warning: e("warning.fetchDataType"),
value: "json",
options: [
{ label: "JSON", value: "json" },
{ label: "FormData", value: "formData" }
],
$required: !0
},
{
type: "FetchTable",
field: "headers",
title: e("fetch.headers"),
value: {}
},
{
type: "FetchTable",
field: "query",
title: e("fetch.query"),
warning: e("warning.fetchQuery"),
value: {}
},
{
type: "FetchTable",
field: "data",
title: e("fetch.data"),
warning: e("warning.fetchData"),
value: {}
}
], pk = Ve({
name: "GlobalFetchConfig",
emits: ["update:modelValue"],
props: {
modelValue: Object
},
components: {
Warning: Ei,
VariableConfig: al,
DragForm: tt.$form(),
FnEditor: ar,
StructEditor: Bc
},
inject: ["designer"],
data() {
return {
visible: !1,
activeIdx: "",
list: {},
cus: !1,
cusValue: "",
form: {
api: {},
formData: {},
rule: [],
options: {
form: {
labelWidth: "90px",
size: "small"
},
submitBtn: !1,
resetBtn: !1
}
}
};
},
computed: {
t() {
return this.designer.setupState.t;
},
types() {
return { fetch: this.t("fetch.remote"), static: this.t("fetch.static") };
},
dataNum() {
return Object.keys(this.modelValue || {}).length;
}
},
watch: {
visible(e) {
e && (this.list = At(this.modelValue || {}), this.activeIdx = "");
}
},
methods: {
open() {
this.visible = !0;
},
active(e) {
if (this.activeIdx !== e) {
const t = this.list[e];
this.form.rule = t.type === "static" ? [] : ck(this.t), this.form.formData = { ...t }, this.form.label = t.label, this.form.type = t.type, this.form.data = t.data, this.form.dataType = t.dataType, this.form.parse = t.parse || "", this.form.beforeFetch = t.beforeFetch || "", this.form.onError = t.onError || "", this.activeIdx = e;
}
},
addCus() {
const e = this.cusValue && this.cusValue.trim();
if (e) {
const t = "data_" + rt();
this.list[t] = {
label: e,
type: this.cus,
data: []
}, this.active(t), this.closeCus();
}
},
closeCus() {
this.cus = !1, this.cusValue = "";
},
cusEvent(e) {
this.cus = e;
},
saveData() {
!this.$refs.data.save() || (this.list[this.activeIdx].data = this.form.data || [], this.activeIdx = "");
},
save() {
if (this.list[this.activeIdx].type === "static")
return this.saveData();
this.form.api.validate().then(() => {
const e = { ...this.form.formData };
this.$refs.parse && !this.$refs.parse.save() || this.$refs.beforeFetch && !this.$refs.beforeFetch.save() || this.$refs.error && !this.$refs.error.save() || (e.parse = tt.parseFn(this.form.parse), e.beforeFetch = tt.parseFn(this.form.beforeFetch), e.onError = this.form.onError, e.label = this.form.label, e.type = this.form.type, this.list[this.activeIdx] = e, this.activeIdx = "");
}).catch((e) => {
console.error(e), $n(e[Object.keys(e)[0]][0].message);
});
},
rm(e) {
delete this.list[e], e === this.activeIdx && (this.activeIdx = "");
},
close() {
this.activeIdx = "";
},
submit() {
if (this.activeIdx)
return $n(this.t("event.saveMsg"));
this.$emit("update:modelValue", { ...this.list }), this.visible = !1;
}
}
}), hk = { class: "_fd-gfc" }, mk = ["onClick"], vk = { class: "_fd-gfc-method" }, gk = {
key: 0,
class: "_fd-label"
}, yk = ["onClick"], bk = { class: "_fd-gfc-info" };
function _k(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-badge"), d = ie("Warning"), h = ie("el-dropdown-item"), p = ie("el-dropdown-menu"), g = ie("el-dropdown"), _ = ie("el-header"), S = ie("el-menu-item"), b = ie("el-input"), A = ie("el-menu"), w = ie("el-main"), m = ie("el-container"), y = ie("el-aside"), E = ie("DragForm"), x = ie("el-tab-pane"), k = ie("FnEditor"), D = ie("el-tabs"), P = ie("StructEditor"), M = ie("el-dialog");
return W(), ae("div", hk, [
G(u, {
value: e.dataNum,
type: "warning",
hidden: e.dataNum < 1
}, {
default: N(() => [
G(s, {
class: "_fd-plain-button",
plain: "",
onClick: e.open,
size: "small"
}, {
default: N(() => [
_e(le(e.t("fetch.title")), 1)
]),
_: 1
}, 8, ["onClick"])
]),
_: 1
}, 8, ["value", "hidden"]),
G(M, {
class: "_fd-gfc-dialog _fd-config-dialog",
modelValue: e.visible,
"onUpdate:modelValue": t[11] || (t[11] = (B) => e.visible = B),
"destroy-on-close": "",
"close-on-click-modal": !1,
"append-to-body": "",
width: "980px"
}, {
header: N(() => [
_e(le(e.t("form.globalFetch")) + " ", 1),
G(d, {
tooltip: e.t("warning.globalFetch")
}, null, 8, ["tooltip"])
]),
footer: N(() => [
Z("div", null, [
G(s, {
size: "default",
onClick: t[10] || (t[10] = (B) => e.visible = !1)
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}),
G(s, {
type: "primary",
size: "default",
onClick: e.submit
}, {
default: N(() => [
_e(le(e.t("props.ok")), 1)
]),
_: 1
}, 8, ["onClick"])
])
]),
default: N(() => [
G(m, {
class: "_fd-gfc-con",
style: { height: "600px" }
}, {
default: N(() => [
G(y, { style: { width: "300px" } }, {
default: N(() => [
G(m, { class: "_fd-gfc-l" }, {
default: N(() => [
G(_, {
class: "_fd-gfc-head",
height: "40px"
}, {
default: N(() => [
G(g, {
trigger: "click",
size: "default"
}, {
dropdown: N(() => [
G(p, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.types, (B, T) => (W(), ye(h, {
key: T,
onClick: ($) => e.cusEvent(T)
}, {
default: N(() => [
Z("div", null, le(B), 1)
]),
_: 2
}, 1032, ["onClick"]))), 128))
]),
_: 1
})
]),
default: N(() => [
G(s, {
link: "",
type: "primary",
size: "default"
}, {
default: N(() => [
_e(le(e.t("fetch.create")), 1),
t[12] || (t[12] = Z("i", {
class: "fc-icon icon-down",
style: { "font-size": "14px" }
}, null, -1))
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}),
G(w, null, {
default: N(() => [
G(A, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.list, (B, T) => (W(), ye(S, {
class: qe({ "is-active": T === e.activeIdx })
}, {
default: N(() => [
Z("div", {
class: "_fd-gfc-title",
onClick: vt(($) => e.active(T), ["stop"])
}, [
Z("div", vk, [
Z("span", null, le(T), 1),
B.label ? (W(), ae("span", gk, le(B.label), 1)) : Oe("", !0)
]),
B.deletable !== !1 ? (W(), ae("i", {
key: 0,
class: "fc-icon icon-delete",
onClick: vt(($) => e.rm(T), ["stop"])
}, null, 8, yk)) : Oe("", !0)
], 8, mk)
]),
_: 2
}, 1032, ["class"]))), 256)),
e.cus ? (W(), ye(S, {
key: 0,
style: { "padding-left": "10px" }
}, {
default: N(() => [
Z("div", {
class: "_fd-gfc-title",
onClick: t[3] || (t[3] = vt(() => {
}, ["stop"]))
}, [
G(b, {
type: "text",
modelValue: e.cusValue,
"onUpdate:modelValue": t[0] || (t[0] = (B) => e.cusValue = B),
size: "default",
onKeydown: nl(e.addCus, ["enter"]),
placeholder: e.t("fetch.placeholder")
}, null, 8, ["modelValue", "onKeydown", "placeholder"]),
Z("div", null, [
Z("i", {
class: "fc-icon icon-add",
onClick: t[1] || (t[1] = vt((...B) => e.addCus && e.addCus(...B), ["stop"]))
}),
Z("i", {
class: "fc-icon icon-delete",
onClick: t[2] || (t[2] = vt((...B) => e.closeCus && e.closeCus(...B), ["stop"]))
})
])
])
]),
_: 1
})) : Oe("", !0)
]),
_: 1
})
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}),
G(w, null, {
default: N(() => [
G(m, { class: "_fd-gfc-r" }, {
default: N(() => [
e.activeIdx ? (W(), ye(_, {
key: 0,
class: "_fd-gfc-head",
height: "40px"
}, {
default: N(() => [
G(s, {
size: "small",
onClick: e.close
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}, 8, ["onClick"]),
G(s, {
size: "small",
type: "primary",
onClick: e.save
}, {
default: N(() => [
_e(le(e.t("props.save")), 1)
]),
_: 1
}, 8, ["onClick"])
]),
_: 1
})) : Oe("", !0),
e.activeIdx ? (W(), ye(w, { key: e.activeIdx }, {
default: N(() => [
e.list[e.activeIdx].type === "fetch" ? (W(), ye(D, {
key: 0,
"model-value": "first",
class: "_fc-tabs",
style: { width: "100%" }
}, {
default: N(() => [
G(x, {
label: e.t("fetch.config"),
name: "first",
style: { "padding-right": "15px" }
}, {
default: N(() => [
Z("div", bk, le(e.t("fetch.info")), 1),
G(E, {
api: e.form.api,
"onUpdate:api": t[4] || (t[4] = (B) => e.form.api = B),
modelValue: e.form.formData,
"onUpdate:modelValue": t[5] || (t[5] = (B) => e.form.formData = B),
rule: e.form.rule,
option: e.form.options
}, {
title: N((B) => [
B.rule.warning ? (W(), ye(d, {
key: 0,
tooltip: B.rule.warning
}, {
default: N(() => [
_e(le(B.rule.title), 1)
]),
_: 2
}, 1032, ["tooltip"])) : (W(), ae(Pe, { key: 1 }, [
_e(le(B.rule.title), 1)
], 64))
]),
_: 1
}, 8, ["api", "modelValue", "rule", "option"])
]),
_: 1
}, 8, ["label"]),
G(x, {
lazy: "",
label: e.t("fetch.beforeFetch"),
name: "second"
}, {
label: N(() => [
_e(le(e.t("fetch.beforeFetch")) + " ", 1),
G(d, {
tooltip: e.t("warning.beforeFetch")
}, null, 8, ["tooltip"])
]),
default: N(() => [
G(k, {
style: { height: "100%" },
modelValue: e.form.beforeFetch,
"onUpdate:modelValue": t[6] || (t[6] = (B) => e.form.beforeFetch = B),
name: "beforeFetch",
args: ["config", "data"],
ref: "beforeFetch"
}, null, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"]),
G(x, {
lazy: "",
name: "third"
}, {
label: N(() => [
_e(le(e.t("fetch.parse")) + " ", 1),
G(d, {
tooltip: e.t("warning.fetchParse")
}, null, 8, ["tooltip"])
]),
default: N(() => [
G(k, {
style: { height: "100%" },
modelValue: e.form.parse,
"onUpdate:modelValue": t[7] || (t[7] = (B) => e.form.parse = B),
name: "parse",
args: [{ name: "res", info: e.t("fetch.response") }, "rule", "api"],
ref: "parse"
}, null, 8, ["modelValue", "args"])
]),
_: 1
}),
G(x, {
lazy: "",
label: e.t("fetch.onError"),
name: "fourth"
}, {
default: N(() => [
G(k, {
style: { height: "100%" },
modelValue: e.form.onError,
"onUpdate:modelValue": t[8] || (t[8] = (B) => e.form.onError = B),
name: "onError",
args: ["e"],
ref: "error"
}, null, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"])
]),
_: 1
})) : (W(), ye(P, {
key: 1,
modelValue: e.form.data,
"onUpdate:modelValue": t[9] || (t[9] = (B) => e.form.data = B),
ref: "data"
}, null, 8, ["modelValue"]))
]),
_: 1
})) : Oe("", !0)
]),
_: 1
})
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}, 8, ["modelValue"])
]);
}
const K0 = /* @__PURE__ */ je(pk, [["render", _k]]);
const wk = Ve({
name: "SizeInput",
inject: ["designer"],
emits: ["update:modelValue", "change"],
props: {
modelValue: String,
size: String,
unit: {
type: Array,
default: () => ["auto", "px", "%", "vh", "vw", "em", "rem"]
},
defaultUnit: {
type: String,
default: "px"
}
},
watch: {
modelValue() {
this.parseValue();
}
},
data() {
return {
idx: 1,
num: 0,
oldValue: this.modelValue || ""
};
},
methods: {
parseValue() {
this.modelValue !== "auto" ? (this.idx = Math.max(this.unit.indexOf(this.defaultUnit), 0), this.unit.forEach((e, t) => {
(this.modelValue || "").indexOf(e) > -1 && (this.idx = t);
}), this.num = Ni(this.modelValue) ? null : parseFloat(this.modelValue || 0)) : (this.idx = 0, this.num = 0);
},
submit() {
this.oldValue = Ni(this.num) ? "" : "" + this.num + this.unit[this.idx], this.$emit("update:modelValue", this.oldValue), this.$emit("change", this.oldValue);
},
changeType(e) {
if (e !== void 0) {
if (this.idx === e)
return;
this.idx = e;
} else
this.idx++, this.idx > 4 && (this.idx = 0);
this.unit[this.idx] === "auto" ? (this.oldValue = "auto", this.$emit("update:modelValue", "auto"), this.$emit("change", "auto")) : this.submit();
}
},
created() {
this.parseValue();
}
}), Ak = { class: "_fd-size-input" };
function Ck(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-inputNumber"), d = ie("el-dropdown-item"), h = ie("el-dropdown-menu"), p = ie("el-dropdown");
return W(), ae("div", Ak, [
e.unit[e.idx] === "auto" ? (W(), ye(s, {
key: 0,
size: e.size,
style: { width: "150px" },
onClick: t[0] || (t[0] = (g) => e.changeType())
}, {
default: N(() => [
_e(le(e.unit[e.idx]), 1)
]),
_: 1
}, 8, ["size"])) : (W(), ae(Pe, { key: 1 }, [
G(u, {
size: e.size,
modelValue: e.num,
"onUpdate:modelValue": t[1] || (t[1] = (g) => e.num = g),
onChange: e.submit,
"controls-position": "right"
}, null, 8, ["size", "modelValue", "onChange"]),
G(p, {
trigger: "click",
size: "small"
}, {
dropdown: N(() => [
G(h, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.unit, (g, _) => (W(), ye(d, {
key: g,
onClick: (S) => e.changeType(_)
}, {
default: N(() => [
Z("div", null, le(g), 1)
]),
_: 2
}, 1032, ["onClick"]))), 128))
]),
_: 1
})
]),
default: N(() => [
G(s, { size: e.size }, {
default: N(() => [
_e(le(e.unit[e.idx]), 1)
]),
_: 1
}, 8, ["size"])
]),
_: 1
})
], 64))
]);
}
const Yo = /* @__PURE__ */ je(wk, [["render", Ck]]);
const Sk = Ve({
name: "BoxSizeInput",
components: { SizeInput: Yo, ConfigItem: li },
props: {
modelValue: {
type: Object,
default: () => ({})
}
},
inject: ["designer"],
emits: ["update:modelValue", "change"],
data() {
return {
overflow: [
{
value: "visible",
icon: "icon-eye"
},
{
value: "hidden",
icon: "icon-eye-close"
},
{
value: "scroll",
icon: "icon-scroll"
},
{
value: "auto",
text: "Auto"
}
],
keys: ["width", "height", "minWidth", "minHeight", "maxWidth", "maxHeight"],
boxStyle: {
width: "",
minWidth: "",
maxWidth: "",
height: "",
minHeight: "",
maxHeight: "",
overflow: ""
}
};
},
watch: {
modelValue() {
this.tidyValue();
}
},
computed: {
t() {
return this.designer.setupState.t;
}
},
methods: {
tidyValue() {
this.boxStyle = {
width: "",
minWidth: "",
maxWidth: "",
height: "",
minHeight: "",
maxHeight: "",
overflow: ""
}, this.modelValue && Object.keys(this.boxStyle).forEach((e) => {
this.modelValue[e] && (this.boxStyle[e] = this.modelValue[e]);
});
},
onInput() {
const e = Object.keys(this.boxStyle).reduce((t, i) => (this.boxStyle[i] !== "" && (t[i] = this.boxStyle[i]), t), {});
this.$emit("update:modelValue", e), this.$emit("change", e);
},
changeOverflow(e) {
this.boxStyle.overflow = this.boxStyle.overflow === e ? "" : e, this.onInput();
},
change(e, t) {
this.boxStyle[e] = t.target.value;
}
},
created() {
this.tidyValue();
}
}), Ek = { class: "_fd-box-size-input" }, xk = {
key: 0,
style: { "font-size": "12px", "line-height": "16px" }
};
function Tk(e, t, i, r, n, a) {
const s = ie("SizeInput"), u = ie("el-form-item"), d = ie("el-radio-button"), h = ie("el-tooltip"), p = ie("el-radio-group"), g = ie("el-form"), _ = ie("ConfigItem");
return W(), ae("div", Ek, [
G(_, {
label: e.t("props.size"),
info: Object.keys(e.modelValue).length > 0 ? e.t("struct.configured") : ""
}, {
append: N(() => [
G(g, {
"label-position": "top",
size: "small"
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.keys, (S) => (W(), ye(u, {
label: e.t("style." + S),
key: S
}, {
default: N(() => [
G(s, {
modelValue: e.boxStyle[S],
"onUpdate:modelValue": (b) => e.boxStyle[S] = b,
onChange: e.onInput
}, null, 8, ["modelValue", "onUpdate:modelValue", "onChange"])
]),
_: 2
}, 1032, ["label"]))), 128)),
G(u, {
label: e.t("style.overflow.name"),
style: { "grid-column": "span 2" }
}, {
default: N(() => [
G(p, {
modelValue: e.boxStyle.overflow
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.overflow, (S) => (W(), ye(h, {
effect: "dark",
content: e.t("style.overflow." + S.value),
placement: "top",
persistent: "",
"hide-after": 0,
key: S.value
}, {
default: N(() => [
G(d, {
label: S.value,
value: S.value,
onClick: (b) => e.changeOverflow(S.value)
}, {
default: N(() => [
S.text ? (W(), ae("span", xk, "Auto ")) : (W(), ae("i", {
key: 1,
class: qe(["fc-icon", S.icon])
}, null, 2))
]),
_: 2
}, 1032, ["label", "value", "onClick"])
]),
_: 2
}, 1032, ["content"]))), 128))
]),
_: 1
}, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"])
]),
_: 1
})
]),
_: 1
}, 8, ["label", "info"])
]);
}
const kk = /* @__PURE__ */ je(Sk, [["render", Tk]]);
const Ok = Ve({
name: "ColorInput",
inject: ["designer"],
emits: ["update:modelValue", "change"],
props: {
modelValue: String
},
watch: {
modelValue() {
this.value = this.modelValue || "";
},
value(e) {
this.$emit("update:modelValue", e), this.$emit("change", e);
}
},
data() {
return {
value: this.modelValue || "",
predefine: [
"#c9e6fc",
"#c3f2f2",
"#c2f1d2",
"#fef6c6",
"#ffe5c2",
"#fdcac2",
"#fadcce",
"#dec2fa",
"#ccd2f1",
"#2196f3",
"#08c9c9",
"#00c344",
"#fad714",
"#ff9300",
"#f52222",
"#eb2f96",
"#800080",
"#7500ea",
"#2d46c4",
"#000000",
"#333333",
"#5a5a5a",
"#757575",
"#9e9e9e",
"#bdbdbd",
"#dddddd",
"#f5f5f5",
"#ffffff"
]
};
},
methods: {},
created() {
}
}), Rk = { class: "_fd-color-input" };
function Dk(e, t, i, r, n, a) {
const s = ie("el-color-picker"), u = ie("el-input");
return W(), ae("div", Rk, [
G(u, {
clearable: "",
modelValue: e.value,
"onUpdate:modelValue": t[1] || (t[1] = (d) => e.value = d)
}, {
append: N(() => [
G(s, {
"show-alpha": "",
"color-format": "hex",
predefine: e.predefine,
modelValue: e.value,
"onUpdate:modelValue": t[0] || (t[0] = (d) => e.value = d)
}, null, 8, ["predefine", "modelValue"])
]),
_: 1
}, 8, ["modelValue"])
]);
}
const Qo = /* @__PURE__ */ je(Ok, [["render", Dk]]);
const $k = Ve({
name: "BorderInput",
components: { ColorInput: Qo, SizeInput: Yo, ConfigItem: li },
inject: ["designer"],
emits: ["update:modelValue", "change"],
props: {
modelValue: {
type: Object,
default: () => ({})
}
},
watch: {
modelValue() {
this.tidyValue(), this.initCur();
},
active() {
this.initCur();
}
},
computed: {
borderStyleStr() {
let e = "";
return Object.keys(this.borderStyle).forEach((t) => {
this.borderStyle[t] !== "" && (e += ll(t) + ": " + this.borderStyle[t] + ";");
}, {}), e;
}
},
data() {
const e = this.designer.setupState.t;
return {
t: e,
active: "",
borderStyle: {},
curStyle: "",
curColor: "",
curWidth: "",
lineType: ["solid", "dashed", "dotted", "double"].map((t) => ({ value: t, label: e("style." + t) })),
position: ["Top", "Left", "Bottom", "Right"],
type: ["Style", "Color", "Width"],
unwatch: null
};
},
methods: {
tidyValue() {
const e = [];
this.borderStyle = {}, ["", ...this.position].forEach((t) => {
this.type.forEach((i) => {
e.push("border" + t + i);
});
}), e.forEach((t) => {
this.borderStyle[t] = this.modelValue[t] || "";
});
},
onInput() {
const e = Object.keys(this.borderStyle).reduce((t, i) => (this.borderStyle[i] !== "" && (t[i] = this.borderStyle[i]), t), {});
this.$emit("update:modelValue", e), this.$emit("change", e);
},
pushCur() {
this.borderStyle["border" + this.active + "Style"] = this.curStyle || "", this.borderStyle["border" + this.active + "Color"] = this.curColor || "", this.borderStyle["border" + this.active + "Width"] = this.curWidth || "", this.onInput();
},
initCur() {
this.unwatch && this.unwatch(), this.curStyle = this.borderStyle["border" + this.active + "Style"] || "", this.curColor = this.borderStyle["border" + this.active + "Color"] || "", this.curWidth = this.borderStyle["border" + this.active + "Width"] || "", this.unwatch = this.$watch(() => [this.curStyle, this.curColor, this.curWidth], () => {
this.pushCur();
});
}
},
created() {
this.tidyValue(), this.initCur();
}
}), Ik = { class: "_fd-border-input" }, Fk = { class: "_fd-bi-left" }, Mk = { class: "_fd-bil-row" }, Pk = { class: "_fd-bil-row" }, Lk = { class: "_fd-bil-row" }, Nk = { class: "_fd-bi-right" }, Bk = { class: "_fd-bi-opt" };
function Vk(e, t, i, r, n, a) {
const s = ie("el-option"), u = ie("el-select"), d = ie("SizeInput"), h = ie("ColorInput"), p = ie("ConfigItem");
return W(), ye(p, {
label: e.t("style.border")
}, {
append: N(() => [
Z("div", Ik, [
Z("div", Fk, [
Z("div", Mk, [
Z("div", {
class: qe(["_fd-bil-col", e.active === "Top" ? "active" : ""]),
onClick: t[0] || (t[0] = (g) => e.active = "Top")
}, "\u2533 ", 2)
]),
Z("div", Pk, [
Z("div", {
class: qe(["_fd-bil-col", e.active === "Left" ? "active" : ""]),
onClick: t[1] || (t[1] = (g) => e.active = "Left")
}, "\u2523 ", 2),
Z("div", {
class: qe(["_fd-bil-col", e.active === "" ? "active" : ""]),
onClick: t[2] || (t[2] = (g) => e.active = "")
}, "\u254B", 2),
Z("div", {
class: qe(["_fd-bil-col", e.active === "Right" ? "active" : ""]),
onClick: t[3] || (t[3] = (g) => e.active = "Right")
}, " \u252B ", 2)
]),
Z("div", Lk, [
Z("div", {
class: qe(["_fd-bil-col", e.active === "Bottom" ? "active" : ""]),
onClick: t[4] || (t[4] = (g) => e.active = "Bottom")
}, "\u253B ", 2)
])
]),
Z("div", Nk, [
G(u, {
modelValue: e.curStyle,
"onUpdate:modelValue": t[5] || (t[5] = (g) => e.curStyle = g),
clearable: ""
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.lineType, (g) => (W(), ye(s, {
key: g.value,
label: g.label,
value: g.value
}, {
default: N(() => [
Z("div", Bk, [
Z("div", {
class: qe(["_line", g.value])
}, null, 2)
])
]),
_: 2
}, 1032, ["label", "value"]))), 128))
]),
_: 1
}, 8, ["modelValue"]),
G(d, {
modelValue: e.curWidth,
"onUpdate:modelValue": t[6] || (t[6] = (g) => e.curWidth = g)
}, null, 8, ["modelValue"]),
G(h, {
modelValue: e.curColor,
"onUpdate:modelValue": t[7] || (t[7] = (g) => e.curColor = g)
}, null, 8, ["modelValue"])
])
])
]),
default: N(() => [
Z("div", {
class: "line-box",
style: An(e.borderStyleStr)
}, t[8] || (t[8] = [
Z("div", { class: "line-box-con" }, null, -1)
]), 4)
]),
_: 1
}, 8, ["label"]);
}
const jk = /* @__PURE__ */ je($k, [["render", Vk]]);
const Uk = Ve({
name: "RadiusInput",
components: { ConfigItem: li, ColorInput: Qo, SizeInput: Yo },
inject: ["designer"],
emits: ["update:modelValue", "change"],
props: {
modelValue: String
},
watch: {
modelValue(e) {
e !== this.oldValue && this.tidyValue();
}
},
computed: {
t() {
return this.designer.setupState.t;
}
},
data() {
return {
visit: !1,
active: "",
style: {
com: "",
left: "",
right: "",
top: "",
bottom: ""
},
unit: ["px", "%"],
oldValue: ""
};
},
methods: {
batch() {
this.style.left = this.style.com, this.style.right = this.style.com, this.style.top = this.style.com, this.style.bottom = this.style.com, this.onInput();
},
tidyValue() {
if (this.style = {
com: "",
left: "",
right: "",
top: "",
bottom: ""
}, !this.modelValue)
return;
let e = (this.modelValue || "").split(" ").filter((t) => t !== "");
e.length === 1 ? e = [e[0], e[0], e[0], e[0]] : e.length === 2 ? e = [e[0], e[1], e[0], e[1]] : e.length === 3 && (e = [e[0], e[1], e[2], e[1]]), this.style.left = e[0], this.style.top = e[1], this.style.right = e[2], this.style.bottom = e[3], this.updateCom();
},
updateCom() {
let e = `${this.style.left || "0px"} ${this.style.top || "0px"} ${this.style.right || "0px"} ${this.style.bottom || "0px"}`;
this.style.com = e.replaceAll(this.style.left, "").trim() === "" ? this.style.left : "";
},
onInput() {
let e = `${this.style.left || "0px"} ${this.style.top || "0px"} ${this.style.right || "0px"} ${this.style.bottom || "0px"}`;
`${this.style.left}${this.style.top}${this.style.right}${this.style.bottom}`.trim() === "" ? e = "" : this.updateCom(), this.oldValue = e, this.$emit("update:modelValue", e), this.$emit("change", e);
}
},
created() {
this.tidyValue();
}
}), zk = { class: "_fd-radius-input" }, Hk = { class: "_fd-radius-con" }, Wk = { class: "_fd-radius-item" }, Gk = { class: "_fd-radius-item" }, Kk = { class: "_fd-radius-item" }, Yk = { class: "_fd-radius-item" };
function Qk(e, t, i, r, n, a) {
const s = ie("SizeInput"), u = ie("ConfigItem");
return W(), ae("div", zk, [
G(u, {
label: e.t("style.borderRadius")
}, {
append: N(() => [
Z("div", Hk, [
Z("div", Wk, [
t[5] || (t[5] = Z("div", {
class: "_fd-radius-icon",
style: { transform: "rotate(180deg)" }
}, [
Z("i", { class: "fc-icon icon-radius" })
], -1)),
G(s, {
unit: e.unit,
modelValue: e.style.left,
"onUpdate:modelValue": t[1] || (t[1] = (d) => e.style.left = d),
onChange: e.onInput
}, null, 8, ["unit", "modelValue", "onChange"])
]),
Z("div", Gk, [
t[6] || (t[6] = Z("div", {
class: "_fd-radius-icon",
style: { transform: "rotate(-90deg)" }
}, [
Z("i", { class: "fc-icon icon-radius" })
], -1)),
G(s, {
unit: e.unit,
modelValue: e.style.top,
"onUpdate:modelValue": t[2] || (t[2] = (d) => e.style.top = d),
onChange: e.onInput
}, null, 8, ["unit", "modelValue", "onChange"])
]),
Z("div", Kk, [
t[7] || (t[7] = Z("div", {
class: "_fd-radius-icon",
style: { transform: "rotate(90deg)" }
}, [
Z("i", { class: "fc-icon icon-radius" })
], -1)),
G(s, {
unit: e.unit,
modelValue: e.style.bottom,
"onUpdate:modelValue": t[3] || (t[3] = (d) => e.style.bottom = d),
onChange: e.onInput
}, null, 8, ["unit", "modelValue", "onChange"])
]),
Z("div", Yk, [
t[8] || (t[8] = Z("div", { class: "_fd-radius-icon" }, [
Z("i", { class: "fc-icon icon-radius" })
], -1)),
G(s, {
unit: e.unit,
modelValue: e.style.right,
"onUpdate:modelValue": t[4] || (t[4] = (d) => e.style.right = d),
onChange: e.onInput
}, null, 8, ["unit", "modelValue", "onChange"])
])
])
]),
default: N(() => [
G(s, {
unit: e.unit,
modelValue: e.style.com,
"onUpdate:modelValue": t[0] || (t[0] = (d) => e.style.com = d),
onChange: e.batch
}, null, 8, ["unit", "modelValue", "onChange"])
]),
_: 1
}, 8, ["label"])
]);
}
const Jk = /* @__PURE__ */ je(Uk, [["render", Qk]]);
const Xk = Ve({
name: "BorderInput",
components: { ColorInput: Qo, SizeInput: Yo, ConfigItem: li },
inject: ["designer"],
emits: ["update:modelValue", "change"],
props: {
modelValue: {
type: Object,
default: () => ({})
}
},
watch: {
modelValue() {
this.tidyValue();
}
},
computed: {
borderStyleStr() {
let e = "";
return Object.keys(this.borderStyle).forEach((t) => {
this.borderStyle[t] !== "" && (e += ll(t) + ": " + this.borderStyle[t] + ";");
}, {}), e;
},
alignType() {
return ["left", "center", "right"].map((e) => ({ label: this.t("props." + e), value: e }));
},
decorationType() {
return ["underline", "line-through", "overline"].map((e) => ({ label: this.t("style.decoration." + e), value: e }));
},
weightType() {
return [300, 400, 500, 700].map((e) => ({ label: this.t("style.weight." + e), value: e }));
}
},
data() {
return {
t: this.designer.setupState.t,
fontStyle: {
fontSize: "",
fontWeight: "",
fontStyle: "",
textDecoration: "",
textAlign: "",
lineHeight: "",
letterSpacing: ""
}
};
},
methods: {
tidyValue() {
Object.keys(this.fontStyle).forEach((e) => {
this.fontStyle[e] = this.modelValue[e] || "";
});
},
onInput() {
const e = Object.keys(this.fontStyle).reduce((t, i) => (this.fontStyle[i] !== "" && (t[i] = this.fontStyle[i]), t), {});
this.$emit("update:modelValue", e), this.$emit("change", e);
}
},
created() {
this.tidyValue();
}
}), Zk = { class: "_fd-font-input" };
function qk(e, t, i, r, n, a) {
const s = ie("SizeInput"), u = ie("el-form-item"), d = ie("el-option"), h = ie("el-select"), p = ie("el-form"), g = ie("ConfigItem");
return W(), ye(g, {
label: e.t("style.font.name")
}, {
append: N(() => [
Z("div", Zk, [
G(p, {
"label-width": "50px",
"label-position": "top",
inline: "",
size: "small"
}, {
default: N(() => [
G(u, {
label: e.t("style.font.size")
}, {
default: N(() => [
G(s, {
modelValue: e.fontStyle.fontSize,
"onUpdate:modelValue": t[0] || (t[0] = (_) => e.fontStyle.fontSize = _),
onChange: e.onInput
}, null, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["label"]),
G(u, {
label: e.t("style.weight.name")
}, {
default: N(() => [
G(h, {
modelValue: e.fontStyle.fontWeight,
"onUpdate:modelValue": t[1] || (t[1] = (_) => e.fontStyle.fontWeight = _),
clearable: "",
onChange: e.onInput
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.weightType, (_) => (W(), ye(d, {
key: _.value,
label: _.label,
value: _.value
}, {
default: N(() => [
Z("span", {
style: An({ fontWeight: _.value })
}, le(_.label), 5)
]),
_: 2
}, 1032, ["label", "value"]))), 128))
]),
_: 1
}, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["label"]),
G(u, {
label: e.t("style.decoration.name")
}, {
default: N(() => [
G(h, {
modelValue: e.fontStyle.textDecoration,
"onUpdate:modelValue": t[2] || (t[2] = (_) => e.fontStyle.textDecoration = _),
clearable: "",
onChange: e.onInput
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.decorationType, (_) => (W(), ye(d, {
key: _.value,
label: _.label,
value: _.value
}, {
default: N(() => [
Z("span", {
style: An({ textDecoration: _.value })
}, le(_.label), 5)
]),
_: 2
}, 1032, ["label", "value"]))), 128))
]),
_: 1
}, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["label"]),
G(u, {
label: e.t("style.font.align")
}, {
default: N(() => [
G(h, {
modelValue: e.fontStyle.textAlign,
"onUpdate:modelValue": t[3] || (t[3] = (_) => e.fontStyle.textAlign = _),
clearable: "",
onChange: e.onInput
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.alignType, (_) => (W(), ye(d, {
key: _.value,
label: _.label,
value: _.value
}, null, 8, ["label", "value"]))), 128))
]),
_: 1
}, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["label"]),
G(u, {
label: e.t("style.font.height")
}, {
default: N(() => [
G(s, {
modelValue: e.fontStyle.lineHeight,
"onUpdate:modelValue": t[4] || (t[4] = (_) => e.fontStyle.lineHeight = _),
onChange: e.onInput
}, null, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["label"]),
G(u, {
label: e.t("style.font.spacing")
}, {
default: N(() => [
G(s, {
modelValue: e.fontStyle.letterSpacing,
"onUpdate:modelValue": t[5] || (t[5] = (_) => e.fontStyle.letterSpacing = _),
onChange: e.onInput
}, null, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["label"])
]),
_: 1
})
])
]),
default: N(() => [
Z("div", {
class: "_fd-fi-box",
style: An(e.fontStyle)
}, le(e.t("style.font.preview")), 5)
]),
_: 1
}, 8, ["label"]);
}
const eO = /* @__PURE__ */ je(Xk, [["render", qk]]);
const tO = Ve({
name: "DisplayInput",
components: { ConfigItem: li },
inject: ["designer"],
emits: ["update:modelValue", "change"],
props: {
modelValue: Object
},
watch: {
modelValue() {
this.tidyValue();
}
},
computed: {
t() {
return this.designer.setupState.t;
}
},
data() {
return {
style: {},
displayOptions: [
{ value: "block", icon: "block" },
{ value: "inline-block", icon: "inlineblock" },
{ value: "inline", icon: "inline" },
{ value: "flex", icon: "flex" }
],
options: [
{
key: "flexDirection",
items: [
{ value: "row", icon: "direction-row" },
{ value: "column", icon: "direction-column" },
{ value: "row-reverse", icon: "direction-rowreverse" },
{ value: "column-reverse", icon: "direction-columnreverse" }
]
},
{
key: "flexWrap",
items: [
{ value: "nowrap", icon: "flex-nowrap", row: !0 },
{ value: "wrap", icon: "flex-wrap", row: !0 }
]
},
{
key: "alignContent",
items: [
{ value: "center", icon: "align-center", row: !0 },
{ value: "flex-start", icon: "align-flexstart", row: !0 },
{ value: "flex-end", icon: "align-flexend", row: !0 },
{ value: "space-around", icon: "align-spacearound", row: !0 },
{ value: "space-between", icon: "align-spacebetween", row: !0 },
{ value: "stretch", icon: "align-stretch", row: !0 }
]
},
{
key: "justifyContent",
items: [
{ value: "center", icon: "justify-center", row: !0 },
{ value: "flex-start", icon: "justify-flexstart", row: !0 },
{ value: "flex-end", icon: "justify-flexend", row: !0 },
{ value: "space-between", icon: "justify-spacebetween", row: !0 },
{ value: "space-around", icon: "justify-spacearound", row: !0 },
{ value: "space-evenly", icon: "justify-stretch", row: !0 }
]
},
{
key: "alignItems",
items: [
{ value: "center", icon: "alignitems-center", row: !0 },
{ value: "flex-start", icon: "alignitems-flexstart", row: !0 },
{ value: "flex-end", icon: "alignitems-flexend", row: !0 },
{ value: "stretch", icon: "alignitems-stretch", row: !0 },
{ value: "baseline", icon: "alignitems-baseline" }
]
}
]
};
},
methods: {
tidyValue() {
this.style = {
display: "",
flexDirection: "",
flexWrap: "",
alignContent: "",
justifyContent: "",
alignItems: ""
}, this.modelValue && Object.keys(this.style).forEach((e) => {
this.modelValue[e] && (this.style[e] = this.modelValue[e]);
});
},
onInput() {
const e = Object.keys(this.style).reduce((t, i) => (this.style[i] !== "" && (t[i] = this.style[i]), t), {});
this.$emit("update:modelValue", e), this.$emit("change", e);
},
radioClick(e, t) {
const i = this.style[e];
this.style[e] === t.value ? this.style[e] = "" : e === "display" && t.value !== "flex" ? this.style = {
display: t.value,
flexDirection: "",
flexWrap: "",
alignContent: "",
justifyContent: "",
alignItems: ""
} : this.style[e] = t.value, this.style[e] !== i && this.onInput();
}
},
created() {
this.tidyValue();
}
}), nO = { class: "_fd-display-input" }, iO = { class: "_fd-display-raw" }, rO = { class: "_label" };
function oO(e, t, i, r, n, a) {
const s = ie("el-radio-button"), u = ie("el-tooltip"), d = ie("el-radio-group"), h = ie("ConfigItem");
return W(), ae("div", nO, [
G(h, {
label: e.t("style.display.name"),
arrow: !1,
showAppend: e.style.display === "flex"
}, {
append: N(() => [
Z("div", {
class: qe(["_fd-display-con", [e.style.flexDirection, ["column", "column-reverse"].indexOf(e.style.flexDirection) > -1 ? "rotate-flag" : ""]])
}, [
(W(!0), ae(Pe, null, Ge(e.options, (p) => (W(), ae("div", iO, [
Z("div", rO, le(e.t("style." + p.key + ".name")) + ": ", 1),
G(d, {
"model-value": e.style[p.key],
size: "small"
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(p.items, (g) => (W(), ye(u, {
effect: "dark",
content: e.t("style." + p.key + "." + g.value),
placement: "top",
persistent: "",
"hide-after": 0,
key: g.value
}, {
default: N(() => [
G(s, {
label: g.value,
value: g.value,
onClick: (_) => e.radioClick(p.key, g)
}, {
default: N(() => [
Z("span", {
class: qe(g.row ? "rotate" : "")
}, [
Z("i", {
class: qe(["fc-icon", "icon-" + g.icon])
}, null, 2)
], 2)
]),
_: 2
}, 1032, ["label", "value", "onClick"])
]),
_: 2
}, 1032, ["content"]))), 128))
]),
_: 2
}, 1032, ["model-value"])
]))), 256))
], 2)
]),
default: N(() => [
G(d, {
"model-value": e.style.display,
size: "small",
style: { width: "150px" }
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.displayOptions, (p) => (W(), ye(u, {
effect: "dark",
content: e.t("style.display." + p.value),
placement: "top",
persistent: "",
"hide-after": 0,
key: p.value
}, {
default: N(() => [
G(s, {
label: p.value,
value: p.value,
onClick: (g) => e.radioClick("display", p)
}, {
default: N(() => [
Z("i", {
class: qe(["fc-icon", "icon-display-" + p.icon])
}, null, 2)
]),
_: 2
}, 1032, ["label", "value", "onClick"])
]),
_: 2
}, 1032, ["content"]))), 128))
]),
_: 1
}, 8, ["model-value"])
]),
_: 1
}, 8, ["label", "showAppend"])
]);
}
const aO = /* @__PURE__ */ je(tO, [["render", oO]]);
const lO = Ve({
name: "ShadowContent",
components: { ColorInput: Qo },
inject: ["designer"],
emits: ["update:modelValue", "change"],
props: {
modelValue: {
default: "0px 0px 0px rgba(0, 0, 0, 0)",
type: String
}
},
data() {
return {
max: 24,
boxSize: 250,
options: [
{ key: "external", icon: "shadow" },
{ key: "inset", icon: "shadow-inset" }
],
form: {
color: "",
type: "external",
x: 0,
y: 0,
vague: 0,
extend: 0,
x_unit: "px",
y_unit: "px",
vague_unit: "px",
extend_unit: "px"
},
units: ["px", "%", "rem", "em", "vw", "vh"],
down: !1,
position: {
left: 0,
top: 0
}
};
},
computed: {
spotStyle() {
return {
left: this.position.left + "px",
top: this.position.top + "px"
};
},
t() {
return this.designer.setupState.t;
}
},
watch: {
position(e) {
this.form.x = parseInt(String((e.left - this.boxSize / 2) / this.boxSize * this.max)), this.form.y = parseInt(String((e.top - this.boxSize / 2) / this.boxSize * this.max));
const t = this.max / 2;
this.form.x = this.form.x < 0 ? Math.max(this.form.x, t * -1) : Math.min(this.form.x, t), this.form.y = this.form.y < 0 ? Math.max(this.form.y, t * -1) : Math.min(this.form.y, t);
},
modelValue(e) {
this.initStyle(e);
}
},
methods: {
getMouseXY(e, t) {
if (this.down || t) {
const i = this.$refs.box.getBoundingClientRect();
this.position = {
left: parseInt(String(e.clientX - i.x)),
top: parseInt(String(e.clientY - i.y))
};
}
},
onMouseup() {
this.down = !1, this.onInput();
},
onMousedown(e) {
this.getMouseXY(e, !0), this.down = !0;
},
onInput() {
const e = this.form;
let t = `${e.x}${e.x_unit} ${e.y}${e.y_unit} ${e.vague}${e.vague_unit} ${e.extend}${e.extend_unit} ${e.color}`;
`${e.x}${e.y}${e.vague}${e.extend}`.replaceAll("0", "") === "" ? t = "" : e.type === "inset" && (t += " inset"), this.$emit("update:modelValue", t), this.$emit("change", t);
},
initStyle(e) {
(this.modelValue || "").indexOf(" inset") > -1 && (this.form.type = "inset", e = e.replace(" inset", ""));
const t = e.split("rgba");
let i, r;
t.length > 1 ? (i = "rgba" + t[1].trim(), r = t[0].trim().split(" ")) : (r = t[0].trim().split(" "), i = r.pop()), this.form.color = i || "#000", this.form.x = parseInt(r[0]) || 0, this.form.y = parseInt(r[1]) || 0, this.form.vague = parseInt(r[2]) || 0, this.form.extend = parseInt(r[3]) || 0;
const n = (a) => (a == null ? void 0 : a.replace(/[-\d.]/g, "")) || "px";
this.form.x_unit = n(r[0]), this.form.y_unit = n(r[1]), this.form.vague_unit = n(r[2]), this.form.extend_unit = n(r[3]), this.position.left = this.boxSize / 2 + this.form.x / this.max * this.boxSize || 0, this.position.top = this.boxSize / 2 + this.form.y / this.max * this.boxSize || 0;
}
},
mounted() {
this.initStyle(this.modelValue);
}
}), sO = { class: "_fd-shadow-content" }, uO = { class: "_fd-sc-right" };
function dO(e, t, i, r, n, a) {
const s = ie("el-radio-button"), u = ie("el-tooltip"), d = ie("el-radio-group"), h = ie("el-form-item"), p = ie("ColorInput"), g = ie("el-option"), _ = ie("el-select"), S = ie("el-input"), b = ie("el-form");
return W(), ae("div", sO, [
G(b, {
"label-width": "50px",
"label-position": "top",
inline: "",
class: "_fd-sc-form",
size: "small"
}, {
default: N(() => [
G(h, {
label: e.t("style.shadow.mode")
}, {
default: N(() => [
G(d, {
modelValue: e.form.type,
"onUpdate:modelValue": t[0] || (t[0] = (A) => e.form.type = A),
onChange: e.onInput,
size: "small",
class: "_fd-sc-radio"
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.options, (A) => (W(), ye(u, {
key: A.key,
effect: "dark",
content: e.t("style.shadow." + A.key),
placement: "top",
"hide-after": 0,
persistent: ""
}, {
default: N(() => [
G(s, {
label: A.key,
value: A.key
}, {
default: N(() => [
Z("i", {
class: qe(["fc-icon", "icon-" + A.icon])
}, null, 2)
]),
_: 2
}, 1032, ["label", "value"])
]),
_: 2
}, 1032, ["content"]))), 128))
]),
_: 1
}, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["label"]),
G(h, {
label: e.t("style.color")
}, {
default: N(() => [
G(p, {
modelValue: e.form.color,
"onUpdate:modelValue": t[1] || (t[1] = (A) => e.form.color = A),
onChange: e.onInput
}, null, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["label"]),
G(h, {
label: e.t("style.shadow.x")
}, {
default: N(() => [
G(S, {
modelValue: e.form.x,
"onUpdate:modelValue": t[3] || (t[3] = (A) => e.form.x = A),
type: "number",
onChange: e.onInput
}, {
append: N(() => [
G(_, {
modelValue: e.form.x_unit,
"onUpdate:modelValue": t[2] || (t[2] = (A) => e.form.x_unit = A),
onChange: e.onInput
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.units, (A) => (W(), ye(g, {
key: A,
label: A,
value: A
}, null, 8, ["label", "value"]))), 128))
]),
_: 1
}, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["label"]),
G(h, {
label: e.t("style.shadow.y")
}, {
default: N(() => [
G(S, {
modelValue: e.form.y,
"onUpdate:modelValue": t[5] || (t[5] = (A) => e.form.y = A),
type: "number",
onChange: e.onInput
}, {
append: N(() => [
G(_, {
modelValue: e.form.y_unit,
"onUpdate:modelValue": t[4] || (t[4] = (A) => e.form.y_unit = A),
onChange: e.onInput
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.units, (A) => (W(), ye(g, {
key: A,
label: A,
value: A
}, null, 8, ["label", "value"]))), 128))
]),
_: 1
}, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["label"]),
G(h, {
label: e.t("style.shadow.vague")
}, {
default: N(() => [
G(S, {
modelValue: e.form.vague,
"onUpdate:modelValue": t[7] || (t[7] = (A) => e.form.vague = A),
type: "number",
onChange: e.onInput
}, {
append: N(() => [
G(_, {
modelValue: e.form.vague_unit,
"onUpdate:modelValue": t[6] || (t[6] = (A) => e.form.vague_unit = A),
onChange: e.onInput
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.units, (A) => (W(), ye(g, {
key: A,
label: A,
value: A
}, null, 8, ["label", "value"]))), 128))
]),
_: 1
}, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["label"]),
G(h, {
label: e.t("style.shadow.extend")
}, {
default: N(() => [
G(S, {
modelValue: e.form.extend,
"onUpdate:modelValue": t[9] || (t[9] = (A) => e.form.extend = A),
type: "number",
onChange: e.onInput
}, {
append: N(() => [
G(_, {
modelValue: e.form.extend_unit,
"onUpdate:modelValue": t[8] || (t[8] = (A) => e.form.extend_unit = A),
onChange: e.onInput
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.units, (A) => (W(), ye(g, {
key: A,
label: A,
value: A
}, null, 8, ["label", "value"]))), 128))
]),
_: 1
}, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["label"])
]),
_: 1
}),
Z("div", uO, [
Z("div", {
ref: "box",
class: qe(["_fd-sc-box", e.down ? "down" : ""]),
onClick: t[10] || (t[10] = (A) => e.getMouseXY(A, 1)),
onMousedown: t[11] || (t[11] = (...A) => e.onMousedown && e.onMousedown(...A)),
onMouseup: t[12] || (t[12] = (...A) => e.onMouseup && e.onMouseup(...A)),
onMousemove: t[13] || (t[13] = (A) => e.getMouseXY(A, 0))
}, [
Z("span", {
class: "spot",
style: An(e.spotStyle)
}, t[14] || (t[14] = [
Z("i", { class: "spot-id" }, null, -1)
]), 4),
t[15] || (t[15] = Z("span", { class: "center-spot" }, null, -1)),
t[16] || (t[16] = Z("div", { class: "x-hr" }, null, -1)),
t[17] || (t[17] = Z("div", { class: "y-hr" }, null, -1))
], 34)
])
]);
}
const fO = /* @__PURE__ */ je(lO, [["render", dO]]);
const cO = Ve({
name: "ShadowInput",
emits: ["update:modelValue", "change"],
components: { ConfigItem: li, ShadowContent: fO },
inject: ["designer"],
props: {
modelValue: String
},
watch: {
modelValue() {
this.value = this.modelValue || "";
},
value(e) {
this.$emit("update:modelValue", e), this.$emit("change", e);
}
},
data() {
const e = this.designer.setupState.t;
return {
t: e,
options: [
{ label: e("style.shadow.classic"), value: "3px 5px 7px 2px #CBCBCBFF" },
{ label: e("style.shadow.flat"), value: "4px 4px 3px -2px #E7E5E5FF" },
{ label: e("style.shadow.solid"), value: "1px 2px 4px 2px #979797FF" }
],
value: this.modelValue || ""
};
},
methods: {
changeValue(e) {
this.value = e;
}
},
created() {
}
}), pO = { class: "_fd-shadow-input" };
function hO(e, t, i, r, n, a) {
const s = ie("el-dropdown-item"), u = ie("el-dropdown-menu"), d = ie("el-dropdown"), h = ie("el-input"), p = ie("ShadowContent"), g = ie("ConfigItem");
return W(), ae("div", pO, [
G(g, {
label: e.t("style.shadow.name")
}, {
append: N(() => [
G(p, {
modelValue: e.value,
"onUpdate:modelValue": t[1] || (t[1] = (_) => e.value = _)
}, null, 8, ["modelValue"])
]),
default: N(() => [
G(h, {
clearable: "",
modelValue: e.value,
"onUpdate:modelValue": t[0] || (t[0] = (_) => e.value = _),
class: "_fd-si-input"
}, {
append: N(() => [
G(d, null, {
dropdown: N(() => [
G(u, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.options, (_) => (W(), ye(s, {
onClick: (S) => e.changeValue(_.value)
}, {
default: N(() => [
_e(le(_.label), 1)
]),
_: 2
}, 1032, ["onClick"]))), 256))
]),
_: 1
})
]),
default: N(() => [
t[2] || (t[2] = Z("i", { class: "fc-icon icon-setting" }, null, -1))
]),
_: 1
})
]),
_: 1
}, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"])
]);
}
const mO = /* @__PURE__ */ je(cO, [["render", hO]]);
const vO = Ve({
name: "TableOptions",
components: { ValueInput: nu },
emits: ["update:modelValue", "change"],
props: {
modelValue: [Array, Object],
column: {
type: Array,
default: () => [{ label: "label", key: "label" }, { label: "value", key: "value" }]
},
valueType: String,
keyValue: String,
max: Number,
size: String
},
inject: ["designer"],
watch: {
modelValue() {
this.value = this.tidyModelValue();
}
},
computed: {
t() {
return this.designer.setupState.t;
},
overColumn() {
let e = this.column;
if (this.checked) {
for (let t = 0; t < e.length; t++)
if (e[t].key === this.keyValue)
return [e[t]];
}
return e;
}
},
data() {
return {
value: this.tidyModelValue(),
checked: !1
};
},
created() {
this.keyValue && (this.checked = this.isChecked(), this.$watch("checked", (e) => {
e && this.input();
}));
},
methods: {
isChecked() {
for (let e = 0; e < this.value.length; e++) {
const t = this.value[e], i = Object.keys(t), r = t[this.keyValue];
for (let n = 0; n < i.length; n++)
if (r !== t[i[n]])
return !1;
}
return !0;
},
tidyModelValue() {
const e = this.modelValue;
return this.valueType === "string" ? (e || []).map((t) => ({ value: "" + t })) : this.valueType === "object" ? Object.keys(e || {}).map((t) => ({ label: t, value: e[t] })) : [...e || []].map((t) => OE(t));
},
tidyValue() {
if (this.valueType === "object") {
const e = {};
return this.value.forEach((t) => {
t.label && t.value && (e[t.label] = t.value);
}), e;
} else
return this.value.map((e) => {
if (this.valueType === "string")
return e.value;
if (this.checked) {
const t = e[this.keyValue];
return this.column.reduce((i, r) => (i[r.key] = t, i), {});
} else
return { ...e };
});
},
onInput(e) {
if (this.column.length === 1 && e[this.column[0].key] === "")
return;
this.column.every((i) => i.required === !1 ? !0 : ["object", "string"].indexOf(this.valueType) > -1 ? e[i.key] !== void 0 && e[i.key] !== "" && e[i.key] !== null : e[i.key] !== void 0) && this.input();
},
input() {
const e = this.tidyValue();
this.$emit("update:modelValue", e), this.$emit("change", e);
},
add() {
this.value.push(this.column.reduce((e, t) => (e[t.key] = "", e), {}));
},
del(e) {
this.value.splice(e, 1), this.input();
}
}
}), gO = { class: "_td-table-opt" }, yO = ["onClick"], bO = { class: "_td-table-opt-handle" };
function _O(e, t, i, r, n, a) {
const s = ie("ValueInput"), u = ie("el-input"), d = ie("el-table-column"), h = ie("el-table"), p = ie("el-button"), g = ie("el-checkbox");
return W(), ae("div", gO, [
(W(), ye(h, {
data: e.value,
key: e.checked ? "2" : "1",
border: "",
size: e.size || "small",
style: { width: "100%" }
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.overColumn, (_, S) => (W(), ye(d, {
key: _.label + S,
label: _.label
}, {
default: N((b) => [
_.value ? (W(), ye(s, {
key: 0,
size: e.size || "small",
modelValue: b.row[_.key],
"onUpdate:modelValue": (A) => b.row[_.key] = A,
onBlur: (A) => e.onInput(b.row),
onChangeType: (A) => e.onInput(b.row)
}, null, 8, ["size", "modelValue", "onUpdate:modelValue", "onBlur", "onChangeType"])) : (W(), ye(u, {
key: 1,
size: e.size || "small",
modelValue: b.row[_.key],
"onUpdate:modelValue": (A) => b.row[_.key] = A,
onBlur: (A) => e.onInput(b.row)
}, null, 8, ["size", "modelValue", "onUpdate:modelValue", "onBlur"]))
]),
_: 2
}, 1032, ["label"]))), 128)),
G(d, {
width: "35",
align: "center",
fixed: "right"
}, {
default: N((_) => [
Z("i", {
class: "fc-icon icon-delete",
onClick: (S) => e.del(_.$index)
}, null, 8, yO)
]),
_: 1
})
]),
_: 1
}, 8, ["data", "size"])),
Z("div", bO, [
!e.max || e.max > e.value.length ? (W(), ye(p, {
key: 0,
link: "",
type: "primary",
onClick: e.add
}, {
default: N(() => [
t[1] || (t[1] = Z("i", { class: "fc-icon icon-add" }, null, -1)),
_e(" " + le(e.t("tableOptions.add")), 1)
]),
_: 1
}, 8, ["onClick"])) : Oe("", !0),
e.keyValue ? (W(), ye(g, {
key: 1,
modelValue: e.checked,
"onUpdate:modelValue": t[0] || (t[0] = (_) => e.checked = _),
label: e.t("tableOptions.keyValue")
}, null, 8, ["modelValue", "label"])) : Oe("", !0)
])
]);
}
const Y0 = /* @__PURE__ */ je(vO, [["render", _O]]);
const wO = Ve({
name: "BoxSpaceInput",
components: { ConfigItem: li },
props: {
modelValue: {
type: Object,
default: () => ({})
}
},
inject: ["designer"],
emits: ["update:modelValue", "change"],
data() {
return {
position: ["Top", "Right", "Bottom", "Left"],
boxStyle: {
margin: "",
padding: "",
marginLeft: "",
marginRight: "",
marginTop: "",
marginBottom: "",
paddingLeft: "",
paddingRight: "",
paddingTop: "",
paddingBottom: ""
},
marginLock: !1,
paddingLock: !1
};
},
watch: {
modelValue() {
this.tidyValue();
}
},
computed: {
t() {
return this.designer.setupState.t;
}
},
methods: {
tidyValue() {
this.boxStyle = {}, ["margin", "padding"].forEach((e) => {
this.boxStyle[e] = this.modelValue[e] || "", this.position.forEach((t) => {
this.boxStyle[e + t] = this.tidySize(this.modelValue[e + t] || this.modelValue[e] || "");
});
});
},
onInput() {
const e = Object.keys(this.boxStyle).reduce((t, i) => (this.boxStyle[i] !== "" && (t[i] = this.boxStyle[i]), t), {});
this.$emit("update:modelValue", e), this.$emit("change", e);
},
tidySize(e) {
if (!/^(\d*\.?\d+)(px|rem|%|vh|vw|em)$/.test(e)) {
if (e === "auto")
return e;
const i = parseInt(e);
return isNaN(i) ? "" : i + "px";
}
return e;
},
setValue(e, t, i) {
const r = this.tidySize(i.target.value);
e ? this[e + "Lock"] ? this.position.forEach((n) => {
this.boxStyle[e + n] = r;
}) : this.boxStyle[e + t] = r : this.boxStyle[t] = r, this.onInput();
},
change(e, t) {
this.boxStyle[e] = t.target.value;
},
clear(e) {
this.position.forEach((t) => {
this.boxStyle[e + t] = "";
}), this.onInput();
},
lock(e) {
const t = e + "Lock";
this[t] = !this[t];
}
},
created() {
this.tidyValue();
}
}), AO = { class: "_fd-box-space-input" }, CO = { class: "_padding" }, SO = { class: "_padding-title" }, EO = ["value"], xO = ["value"], TO = ["value"], kO = ["value"], OO = { class: "_fd-help" }, RO = { class: "_margin" }, DO = { class: "_margin-title" }, $O = { class: "_fd-help" }, IO = ["value"], FO = ["value"], MO = ["value"], PO = ["value"];
function LO(e, t, i, r, n, a) {
return W(), ae("div", AO, [
Z("div", CO, [
Z("span", SO, le(e.t("style.margin")), 1),
Z("input", {
class: "_fd-input _fd-top",
placeholder: " ",
value: e.boxStyle.marginTop,
type: "text",
onBlur: t[0] || (t[0] = (s) => e.setValue("margin", "Top", s)),
onInput: t[1] || (t[1] = (s) => e.change("marginTop", s))
}, null, 40, EO),
Z("input", {
class: "_fd-input _fd-right",
placeholder: " ",
value: e.boxStyle.marginRight,
type: "text",
onBlur: t[2] || (t[2] = (s) => e.setValue("margin", "Right", s)),
onInput: t[3] || (t[3] = (s) => e.change("marginRight", s))
}, null, 40, xO),
Z("input", {
class: "_fd-input _fd-bottom",
placeholder: " ",
value: e.boxStyle.marginBottom,
type: "text",
onBlur: t[4] || (t[4] = (s) => e.setValue("margin", "Bottom", s)),
onInput: t[5] || (t[5] = (s) => e.change("marginBottom", s))
}, null, 40, TO),
Z("input", {
class: "_fd-input _fd-left",
placeholder: " ",
value: e.boxStyle.marginLeft,
type: "text",
onBlur: t[6] || (t[6] = (s) => e.setValue("margin", "Left", s)),
onInput: t[7] || (t[7] = (s) => e.change("marginLeft", s))
}, null, 40, kO),
Z("div", OO, [
Z("i", {
class: qe(["fc-icon icon-link2", e.marginLock ? "active" : ""]),
title: "lock",
onClick: t[8] || (t[8] = (s) => e.lock("margin"))
}, null, 2),
Z("i", {
class: "fc-icon icon-delete-circle",
title: "clear",
onClick: t[9] || (t[9] = (s) => e.clear("margin"))
})
]),
Z("div", RO, [
Z("span", DO, le(e.t("style.padding")), 1),
Z("div", $O, [
Z("i", {
class: qe(["fc-icon icon-link2", e.paddingLock ? "active" : ""]),
title: "lock",
onClick: t[10] || (t[10] = (s) => e.lock("padding"))
}, null, 2),
Z("i", {
class: "fc-icon icon-delete-circle",
title: "clear",
onClick: t[11] || (t[11] = (s) => e.clear("padding"))
})
]),
Z("input", {
class: "_fd-input _fd-top",
placeholder: " ",
value: e.boxStyle.paddingTop,
type: "text",
onBlur: t[12] || (t[12] = (s) => e.setValue("padding", "Top", s)),
onInput: t[13] || (t[13] = (s) => e.change("paddingTop", s))
}, null, 40, IO),
Z("input", {
class: "_fd-input _fd-right",
placeholder: " ",
value: e.boxStyle.paddingRight,
type: "text",
onBlur: t[14] || (t[14] = (s) => e.setValue("padding", "Right", s)),
onInput: t[15] || (t[15] = (s) => e.change("paddingRight", s))
}, null, 40, FO),
Z("input", {
class: "_fd-input _fd-bottom",
placeholder: " ",
value: e.boxStyle.paddingBottom,
type: "text",
onBlur: t[16] || (t[16] = (s) => e.setValue("padding", "Bottom", s)),
onInput: t[17] || (t[17] = (s) => e.change("paddingBottom", s))
}, null, 40, MO),
Z("input", {
class: "_fd-input _fd-left",
placeholder: " ",
value: e.boxStyle.paddingLeft,
type: "text",
onBlur: t[18] || (t[18] = (s) => e.setValue("padding", "Left", s)),
onInput: t[19] || (t[19] = (s) => e.change("paddingLeft", s))
}, null, 40, PO),
t[20] || (t[20] = Z("div", { class: "_box" }, null, -1))
])
])
]);
}
const NO = /* @__PURE__ */ je(wO, [["render", LO]]);
const Q0 = [
"display",
"flexDirection",
"flexWrap",
"alignContent",
"justifyContent",
"alignItems"
], J0 = [
"fontSize",
"fontWeight",
"fontStyle",
"textDecoration",
"textAlign",
"lineHeight",
"letterSpacing"
], X0 = [
"height",
"width",
"minWidth",
"minHeight",
"maxWidth",
"maxHeight",
"overflow"
], rg = [
"color",
"backgroundColor",
"scale",
"borderRadius",
"boxShadow",
"marginTop",
"marginRight",
"marginBottom",
"marginLeft",
"paddingTop",
"paddingRight",
"paddingBottom",
"paddingLeft",
"margin",
"padding",
"opacity",
"borderStyle",
"borderColor",
"borderWidth",
"borderTopStyle",
"borderTopColor",
"borderTopWidth",
"borderLeftStyle",
"borderLeftColor",
"borderLeftWidth",
"borderBottomStyle",
"borderBottomColor",
"borderBottomWidth",
"borderRightStyle",
"borderRightColor",
"borderRightWidth",
...Q0,
...J0,
...X0
], BO = Ve({
name: "StyleConfig",
inject: ["designer"],
emits: ["update:modelValue"],
components: {
BoxSpaceInput: NO,
TableOptions: Y0,
ColorInput: Qo,
ConfigItem: li,
DisplayInput: aO,
RadiusInput: Jk,
BoxSizeInput: kk,
BorderInput: jk,
ShadowInput: mO,
FontInput: eO
},
props: {
modelValue: {
type: Object,
default: () => ({})
}
},
watch: {
modelValue: {
handler() {
this.tidyStyle();
},
deep: !0
}
},
data() {
return {
t: this.designer.setupState.t,
formData: {},
space: {},
size: {},
border: {},
display: {},
font: {},
radius: "",
backgroundColor: "",
color: "",
boxShadow: "",
opacity: 100,
scale: 100
};
},
methods: {
tidyStyle() {
const e = { ...this.modelValue || {} }, t = {};
Object.keys(e).forEach((d) => {
const h = Sc(d);
(["margin", "padding"].indexOf(d) > -1 || d.indexOf("margin") > -1 || d.indexOf("padding") > -1) && (t[h] = e[d]);
});
const i = {};
X0.forEach((d) => {
e[d] && (i[d] = e[d]);
}), this.radius = e.borderRadius || "", delete e.borderRadius;
const r = {};
Object.keys(e).forEach((d) => {
d.indexOf("border") === 0 && (r[d] = e[d]);
});
let n = Ni(e.opacity) ? 100 : parseFloat(e.opacity) || 0;
n && n < 1 && (n = n * 100);
let a = e.scale;
Ni(e.scale) ? a = 100 : isNaN(Number(a)) ? a = parseFloat(a) || 100 : a = a > 0 ? a * 100 : 0;
const s = {};
Q0.forEach((d) => {
e[d] && (s[d] = e[d]);
});
const u = {};
J0.forEach((d) => {
e[d] && (u[d] = e[d]);
}), this.opacity = n, this.scale = a, this.size = i, this.space = t, this.border = r, this.display = s, this.font = u, this.boxShadow = e.boxShadow || "", this.color = e.color || "", this.backgroundColor = e.backgroundColor || "", rg.forEach((d) => {
delete e[d];
}), this.formData = e;
},
onInput() {
let e = { ...this.formData }, t = {};
rg.forEach((r) => {
if (e[r])
t[r] = e[r], delete e[r];
else {
const n = ll(r);
e[n] && (t[r] = e[n], delete e[n]);
}
});
const i = {
...e,
color: this.color || "",
backgroundColor: this.backgroundColor || "",
opacity: this.opacity >= 0 && this.opacity < 100 ? this.opacity + "%" : "",
borderRadius: this.radius || "",
boxShadow: this.boxShadow || "",
scale: this.scale >= 0 && this.scale !== 100 ? this.scale + "%" : "",
...this.space,
...this.size,
...this.border,
...this.display,
...this.font,
...t
};
Object.keys(i).forEach((r) => {
Ni(i[r]) && delete i[r];
}), this.$emit("update:modelValue", i);
}
},
created() {
this.tidyStyle();
}
}), VO = { class: "_fd-style-config" };
function jO(e, t, i, r, n, a) {
const s = ie("BoxSpaceInput"), u = ie("BoxSizeInput"), d = ie("DisplayInput"), h = ie("ColorInput"), p = ie("ConfigItem"), g = ie("BorderInput"), _ = ie("RadiusInput"), S = ie("FontInput"), b = ie("ShadowInput"), A = ie("el-slider"), w = ie("TableOptions");
return W(), ae("div", VO, [
G(s, {
modelValue: e.space,
"onUpdate:modelValue": t[0] || (t[0] = (m) => e.space = m),
onChange: e.onInput,
style: { "margin-bottom": "10px" }
}, null, 8, ["modelValue", "onChange"]),
G(u, {
modelValue: e.size,
"onUpdate:modelValue": t[1] || (t[1] = (m) => e.size = m),
onChange: e.onInput
}, null, 8, ["modelValue", "onChange"]),
G(d, {
modelValue: e.display,
"onUpdate:modelValue": t[2] || (t[2] = (m) => e.display = m),
onChange: e.onInput
}, null, 8, ["modelValue", "onChange"]),
G(p, {
label: e.t("style.color")
}, {
default: N(() => [
G(h, {
modelValue: e.color,
"onUpdate:modelValue": t[3] || (t[3] = (m) => e.color = m),
onChange: e.onInput
}, null, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["label"]),
G(p, {
label: e.t("style.backgroundColor")
}, {
default: N(() => [
G(h, {
modelValue: e.backgroundColor,
"onUpdate:modelValue": t[4] || (t[4] = (m) => e.backgroundColor = m),
onChange: e.onInput
}, null, 8, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["label"]),
G(g, {
modelValue: e.border,
"onUpdate:modelValue": t[5] || (t[5] = (m) => e.border = m),
onChange: e.onInput
}, null, 8, ["modelValue", "onChange"]),
G(_, {
modelValue: e.radius,
"onUpdate:modelValue": t[6] || (t[6] = (m) => e.radius = m),
onChange: e.onInput
}, null, 8, ["modelValue", "onChange"]),
G(S, {
modelValue: e.font,
"onUpdate:modelValue": t[7] || (t[7] = (m) => e.font = m),
onChange: e.onInput
}, null, 8, ["modelValue", "onChange"]),
G(b, {
modelValue: e.boxShadow,
"onUpdate:modelValue": t[8] || (t[8] = (m) => e.boxShadow = m),
onChange: e.onInput
}, null, 8, ["modelValue", "onChange"]),
G(p, {
label: e.t("style.opacity"),
class: "_fd-opacity-input"
}, {
default: N(() => [
G(A, {
"show-tooltip": !1,
modelValue: e.opacity,
"onUpdate:modelValue": t[9] || (t[9] = (m) => e.opacity = m),
onChange: e.onInput
}, null, 8, ["modelValue", "onChange"]),
Z("span", null, le(e.opacity) + "%", 1)
]),
_: 1
}, 8, ["label"]),
G(p, {
label: e.t("style.scale"),
class: "_fd-opacity-input"
}, {
default: N(() => [
G(A, {
min: 80,
max: 120,
"show-tooltip": !1,
modelValue: e.scale,
"onUpdate:modelValue": t[10] || (t[10] = (m) => e.scale = m),
onChange: e.onInput
}, null, 8, ["modelValue", "onChange"]),
Z("span", null, le(e.scale) + "%", 1)
]),
_: 1
}, 8, ["label"]),
G(p, {
label: e.t("props.custom"),
info: Object.keys(e.formData).length > 0 ? e.t("struct.configured") : ""
}, {
append: N(() => [
G(w, dn({
modelValue: e.formData,
"onUpdate:modelValue": t[11] || (t[11] = (m) => e.formData = m),
onChange: e.onInput
}, {
column: [{ label: e.t("props.key"), key: "label" }, { label: e.t("props.value"), key: "value" }],
valueType: "object"
}), null, 16, ["modelValue", "onChange"])
]),
_: 1
}, 8, ["label", "info"])
]);
}
const Z0 = /* @__PURE__ */ je(BO, [["render", jO]]);
(function(e, t) {
(function(i) {
i(Ko());
})(function(i) {
i.defineMode("css", function(T, $) {
var V = $.inline;
$.propertyKeywords || ($ = i.resolveMode("text/css"));
var z = T.indentUnit, H = $.tokenHooks, I = $.documentTypes || {}, U = $.mediaTypes || {}, F = $.mediaFeatures || {}, C = $.mediaValueKeywords || {}, q = $.propertyKeywords || {}, X = $.nonStandardPropertyKeywords || {}, Y = $.fontProperties || {}, ue = $.counterDescriptors || {}, ee = $.colorKeywords || {}, pe = $.valueKeywords || {}, Te = $.allowNested, ve = $.lineComment, me = $.supportsAtComponent === !0, we = T.highlightNonStandardPropertyKeywords !== !1, he, Se;
function xe(be, Le) {
return he = Le, be;
}
function O(be, Le) {
var ke = be.next();
if (H[ke]) {
var it = H[ke](be, Le);
if (it !== !1)
return it;
}
if (ke == "@")
return be.eatWhile(/[\w\\\-]/), xe("def", be.current());
if (ke == "=" || (ke == "~" || ke == "|") && be.eat("="))
return xe(null, "compare");
if (ke == '"' || ke == "'")
return Le.tokenize = K(ke), Le.tokenize(be, Le);
if (ke == "#")
return be.eatWhile(/[\w\\\-]/), xe("atom", "hash");
if (ke == "!")
return be.match(/^\s*\w*/), xe("keyword", "important");
if (/\d/.test(ke) || ke == "." && be.eat(/\d/))
return be.eatWhile(/[\w.%]/), xe("number", "unit");
if (ke === "-") {
if (/[\d.]/.test(be.peek()))
return be.eatWhile(/[\w.%]/), xe("number", "unit");
if (be.match(/^-[\w\\\-]*/))
return be.eatWhile(/[\w\\\-]/), be.match(/^\s*:/, !1) ? xe("variable-2", "variable-definition") : xe("variable-2", "variable");
if (be.match(/^\w+-/))
return xe("meta", "meta");
} else
return /[,+>*\/]/.test(ke) ? xe(null, "select-op") : ke == "." && be.match(/^-?[_a-z][_a-z0-9-]*/i) ? xe("qualifier", "qualifier") : /[:;{}\[\]\(\)]/.test(ke) ? xe(null, ke) : be.match(/^[\w-.]+(?=\()/) ? (/^(url(-prefix)?|domain|regexp)$/i.test(be.current()) && (Le.tokenize = J), xe("variable callee", "variable")) : /[\w\\\-]/.test(ke) ? (be.eatWhile(/[\w\\\-]/), xe("property", "word")) : xe(null, null);
}
function K(be) {
return function(Le, ke) {
for (var it = !1, pt; (pt = Le.next()) != null; ) {
if (pt == be && !it) {
be == ")" && Le.backUp(1);
break;
}
it = !it && pt == "\\";
}
return (pt == be || !it && be != ")") && (ke.tokenize = null), xe("string", "string");
};
}
function J(be, Le) {
return be.next(), be.match(/^\s*[\"\')]/, !1) ? Le.tokenize = null : Le.tokenize = K(")"), xe(null, "(");
}
function ne(be, Le, ke) {
this.type = be, this.indent = Le, this.prev = ke;
}
function re(be, Le, ke, it) {
return be.context = new ne(ke, Le.indentation() + (it === !1 ? 0 : z), be.context), ke;
}
function fe(be) {
return be.context.prev && (be.context = be.context.prev), be.context.type;
}
function Ae(be, Le, ke) {
return Ze[ke.context.type](be, Le, ke);
}
function Fe(be, Le, ke, it) {
for (var pt = it || 1; pt > 0; pt--)
ke.context = ke.context.prev;
return Ae(be, Le, ke);
}
function Xe(be) {
var Le = be.current().toLowerCase();
pe.hasOwnProperty(Le) ? Se = "atom" : ee.hasOwnProperty(Le) ? Se = "keyword" : Se = "variable";
}
var Ze = {};
return Ze.top = function(be, Le, ke) {
if (be == "{")
return re(ke, Le, "block");
if (be == "}" && ke.context.prev)
return fe(ke);
if (me && /@component/i.test(be))
return re(ke, Le, "atComponentBlock");
if (/^@(-moz-)?document$/i.test(be))
return re(ke, Le, "documentTypes");
if (/^@(media|supports|(-moz-)?document|import)$/i.test(be))
return re(ke, Le, "atBlock");
if (/^@(font-face|counter-style)/i.test(be))
return ke.stateArg = be, "restricted_atBlock_before";
if (/^@(-(moz|ms|o|webkit)-)?keyframes$/i.test(be))
return "keyframes";
if (be && be.charAt(0) == "@")
return re(ke, Le, "at");
if (be == "hash")
Se = "builtin";
else if (be == "word")
Se = "tag";
else {
if (be == "variable-definition")
return "maybeprop";
if (be == "interpolation")
return re(ke, Le, "interpolation");
if (be == ":")
return "pseudo";
if (Te && be == "(")
return re(ke, Le, "parens");
}
return ke.context.type;
}, Ze.block = function(be, Le, ke) {
if (be == "word") {
var it = Le.current().toLowerCase();
return q.hasOwnProperty(it) ? (Se = "property", "maybeprop") : X.hasOwnProperty(it) ? (Se = we ? "string-2" : "property", "maybeprop") : Te ? (Se = Le.match(/^\s*:(?:\s|$)/, !1) ? "property" : "tag", "block") : (Se += " error", "maybeprop");
} else
return be == "meta" ? "block" : !Te && (be == "hash" || be == "qualifier") ? (Se = "error", "block") : Ze.top(be, Le, ke);
}, Ze.maybeprop = function(be, Le, ke) {
return be == ":" ? re(ke, Le, "prop") : Ae(be, Le, ke);
}, Ze.prop = function(be, Le, ke) {
if (be == ";")
return fe(ke);
if (be == "{" && Te)
return re(ke, Le, "propBlock");
if (be == "}" || be == "{")
return Fe(be, Le, ke);
if (be == "(")
return re(ke, Le, "parens");
if (be == "hash" && !/^#([0-9a-fA-F]{3,4}|[0-9a-fA-F]{6}|[0-9a-fA-F]{8})$/.test(Le.current()))
Se += " error";
else if (be == "word")
Xe(Le);
else if (be == "interpolation")
return re(ke, Le, "interpolation");
return "prop";
}, Ze.propBlock = function(be, Le, ke) {
return be == "}" ? fe(ke) : be == "word" ? (Se = "property", "maybeprop") : ke.context.type;
}, Ze.parens = function(be, Le, ke) {
return be == "{" || be == "}" ? Fe(be, Le, ke) : be == ")" ? fe(ke) : be == "(" ? re(ke, Le, "parens") : be == "interpolation" ? re(ke, Le, "interpolation") : (be == "word" && Xe(Le), "parens");
}, Ze.pseudo = function(be, Le, ke) {
return be == "meta" ? "pseudo" : be == "word" ? (Se = "variable-3", ke.context.type) : Ae(be, Le, ke);
}, Ze.documentTypes = function(be, Le, ke) {
return be == "word" && I.hasOwnProperty(Le.current()) ? (Se = "tag", ke.context.type) : Ze.atBlock(be, Le, ke);
}, Ze.atBlock = function(be, Le, ke) {
if (be == "(")
return re(ke, Le, "atBlock_parens");
if (be == "}" || be == ";")
return Fe(be, Le, ke);
if (be == "{")
return fe(ke) && re(ke, Le, Te ? "block" : "top");
if (be == "interpolation")
return re(ke, Le, "interpolation");
if (be == "word") {
var it = Le.current().toLowerCase();
it == "only" || it == "not" || it == "and" || it == "or" ? Se = "keyword" : U.hasOwnProperty(it) ? Se = "attribute" : F.hasOwnProperty(it) ? Se = "property" : C.hasOwnProperty(it) ? Se = "keyword" : q.hasOwnProperty(it) ? Se = "property" : X.hasOwnProperty(it) ? Se = we ? "string-2" : "property" : pe.hasOwnProperty(it) ? Se = "atom" : ee.hasOwnProperty(it) ? Se = "keyword" : Se = "error";
}
return ke.context.type;
}, Ze.atComponentBlock = function(be, Le, ke) {
return be == "}" ? Fe(be, Le, ke) : be == "{" ? fe(ke) && re(ke, Le, Te ? "block" : "top", !1) : (be == "word" && (Se = "error"), ke.context.type);
}, Ze.atBlock_parens = function(be, Le, ke) {
return be == ")" ? fe(ke) : be == "{" || be == "}" ? Fe(be, Le, ke, 2) : Ze.atBlock(be, Le, ke);
}, Ze.restricted_atBlock_before = function(be, Le, ke) {
return be == "{" ? re(ke, Le, "restricted_atBlock") : be == "word" && ke.stateArg == "@counter-style" ? (Se = "variable", "restricted_atBlock_before") : Ae(be, Le, ke);
}, Ze.restricted_atBlock = function(be, Le, ke) {
return be == "}" ? (ke.stateArg = null, fe(ke)) : be == "word" ? (ke.stateArg == "@font-face" && !Y.hasOwnProperty(Le.current().toLowerCase()) || ke.stateArg == "@counter-style" && !ue.hasOwnProperty(Le.current().toLowerCase()) ? Se = "error" : Se = "property", "maybeprop") : "restricted_atBlock";
}, Ze.keyframes = function(be, Le, ke) {
return be == "word" ? (Se = "variable", "keyframes") : be == "{" ? re(ke, Le, "top") : Ae(be, Le, ke);
}, Ze.at = function(be, Le, ke) {
return be == ";" ? fe(ke) : be == "{" || be == "}" ? Fe(be, Le, ke) : (be == "word" ? Se = "tag" : be == "hash" && (Se = "builtin"), "at");
}, Ze.interpolation = function(be, Le, ke) {
return be == "}" ? fe(ke) : be == "{" || be == ";" ? Fe(be, Le, ke) : (be == "word" ? Se = "variable" : be != "variable" && be != "(" && be != ")" && (Se = "error"), "interpolation");
}, {
startState: function(be) {
return {
tokenize: null,
state: V ? "block" : "top",
stateArg: null,
context: new ne(V ? "block" : "top", be || 0, null)
};
},
token: function(be, Le) {
if (!Le.tokenize && be.eatSpace())
return null;
var ke = (Le.tokenize || O)(be, Le);
return ke && typeof ke == "object" && (he = ke[1], ke = ke[0]), Se = ke, he != "comment" && (Le.state = Ze[Le.state](he, be, Le)), Se;
},
indent: function(be, Le) {
var ke = be.context, it = Le && Le.charAt(0), pt = ke.indent;
return ke.type == "prop" && (it == "}" || it == ")") && (ke = ke.prev), ke.prev && (it == "}" && (ke.type == "block" || ke.type == "top" || ke.type == "interpolation" || ke.type == "restricted_atBlock") ? (ke = ke.prev, pt = ke.indent) : (it == ")" && (ke.type == "parens" || ke.type == "atBlock_parens") || it == "{" && (ke.type == "at" || ke.type == "atBlock")) && (pt = Math.max(0, ke.indent - z))), pt;
},
electricChars: "}",
blockCommentStart: "/*",
blockCommentEnd: "*/",
blockCommentContinue: " * ",
lineComment: ve,
fold: "brace"
};
});
function r(T) {
for (var $ = {}, V = 0; V < T.length; ++V)
$[T[V].toLowerCase()] = !0;
return $;
}
var n = [
"domain",
"regexp",
"url",
"url-prefix"
], a = r(n), s = [
"all",
"aural",
"braille",
"handheld",
"print",
"projection",
"screen",
"tty",
"tv",
"embossed"
], u = r(s), d = [
"width",
"min-width",
"max-width",
"height",
"min-height",
"max-height",
"device-width",
"min-device-width",
"max-device-width",
"device-height",
"min-device-height",
"max-device-height",
"aspect-ratio",
"min-aspect-ratio",
"max-aspect-ratio",
"device-aspect-ratio",
"min-device-aspect-ratio",
"max-device-aspect-ratio",
"color",
"min-color",
"max-color",
"color-index",
"min-color-index",
"max-color-index",
"monochrome",
"min-monochrome",
"max-monochrome",
"resolution",
"min-resolution",
"max-resolution",
"scan",
"grid",
"orientation",
"device-pixel-ratio",
"min-device-pixel-ratio",
"max-device-pixel-ratio",
"pointer",
"any-pointer",
"hover",
"any-hover",
"prefers-color-scheme",
"dynamic-range",
"video-dynamic-range"
], h = r(d), p = [
"landscape",
"portrait",
"none",
"coarse",
"fine",
"on-demand",
"hover",
"interlace",
"progressive",
"dark",
"light",
"standard",
"high"
], g = r(p), _ = [
"align-content",
"align-items",
"align-self",
"alignment-adjust",
"alignment-baseline",
"all",
"anchor-point",
"animation",
"animation-delay",
"animation-direction",
"animation-duration",
"animation-fill-mode",
"animation-iteration-count",
"animation-name",
"animation-play-state",
"animation-timing-function",
"appearance",
"azimuth",
"backdrop-filter",
"backface-visibility",
"background",
"background-attachment",
"background-blend-mode",
"background-clip",
"background-color",
"background-image",
"background-origin",
"background-position",
"background-position-x",
"background-position-y",
"background-repeat",
"background-size",
"baseline-shift",
"binding",
"bleed",
"block-size",
"bookmark-label",
"bookmark-level",
"bookmark-state",
"bookmark-target",
"border",
"border-bottom",
"border-bottom-color",
"border-bottom-left-radius",
"border-bottom-right-radius",
"border-bottom-style",
"border-bottom-width",
"border-collapse",
"border-color",
"border-image",
"border-image-outset",
"border-image-repeat",
"border-image-slice",
"border-image-source",
"border-image-width",
"border-left",
"border-left-color",
"border-left-style",
"border-left-width",
"border-radius",
"border-right",
"border-right-color",
"border-right-style",
"border-right-width",
"border-spacing",
"border-style",
"border-top",
"border-top-color",
"border-top-left-radius",
"border-top-right-radius",
"border-top-style",
"border-top-width",
"border-width",
"bottom",
"box-decoration-break",
"box-shadow",
"box-sizing",
"break-after",
"break-before",
"break-inside",
"caption-side",
"caret-color",
"clear",
"clip",
"color",
"color-profile",
"column-count",
"column-fill",
"column-gap",
"column-rule",
"column-rule-color",
"column-rule-style",
"column-rule-width",
"column-span",
"column-width",
"columns",
"contain",
"content",
"counter-increment",
"counter-reset",
"crop",
"cue",
"cue-after",
"cue-before",
"cursor",
"direction",
"display",
"dominant-baseline",
"drop-initial-after-adjust",
"drop-initial-after-align",
"drop-initial-before-adjust",
"drop-initial-before-align",
"drop-initial-size",
"drop-initial-value",
"elevation",
"empty-cells",
"fit",
"fit-content",
"fit-position",
"flex",
"flex-basis",
"flex-direction",
"flex-flow",
"flex-grow",
"flex-shrink",
"flex-wrap",
"float",
"float-offset",
"flow-from",
"flow-into",
"font",
"font-family",
"font-feature-settings",
"font-kerning",
"font-language-override",
"font-optical-sizing",
"font-size",
"font-size-adjust",
"font-stretch",
"font-style",
"font-synthesis",
"font-variant",
"font-variant-alternates",
"font-variant-caps",
"font-variant-east-asian",
"font-variant-ligatures",
"font-variant-numeric",
"font-variant-position",
"font-variation-settings",
"font-weight",
"gap",
"grid",
"grid-area",
"grid-auto-columns",
"grid-auto-flow",
"grid-auto-rows",
"grid-column",
"grid-column-end",
"grid-column-gap",
"grid-column-start",
"grid-gap",
"grid-row",
"grid-row-end",
"grid-row-gap",
"grid-row-start",
"grid-template",
"grid-template-areas",
"grid-template-columns",
"grid-template-rows",
"hanging-punctuation",
"height",
"hyphens",
"icon",
"image-orientation",
"image-rendering",
"image-resolution",
"inline-box-align",
"inset",
"inset-block",
"inset-block-end",
"inset-block-start",
"inset-inline",
"inset-inline-end",
"inset-inline-start",
"isolation",
"justify-content",
"justify-items",
"justify-self",
"left",
"letter-spacing",
"line-break",
"line-height",
"line-height-step",
"line-stacking",
"line-stacking-ruby",
"line-stacking-shift",
"line-stacking-strategy",
"list-style",
"list-style-image",
"list-style-position",
"list-style-type",
"margin",
"margin-bottom",
"margin-left",
"margin-right",
"margin-top",
"marks",
"marquee-direction",
"marquee-loop",
"marquee-play-count",
"marquee-speed",
"marquee-style",
"mask-clip",
"mask-composite",
"mask-image",
"mask-mode",
"mask-origin",
"mask-position",
"mask-repeat",
"mask-size",
"mask-type",
"max-block-size",
"max-height",
"max-inline-size",
"max-width",
"min-block-size",
"min-height",
"min-inline-size",
"min-width",
"mix-blend-mode",
"move-to",
"nav-down",
"nav-index",
"nav-left",
"nav-right",
"nav-up",
"object-fit",
"object-position",
"offset",
"offset-anchor",
"offset-distance",
"offset-path",
"offset-position",
"offset-rotate",
"opacity",
"order",
"orphans",
"outline",
"outline-color",
"outline-offset",
"outline-style",
"outline-width",
"overflow",
"overflow-style",
"overflow-wrap",
"overflow-x",
"overflow-y",
"padding",
"padding-bottom",
"padding-left",
"padding-right",
"padding-top",
"page",
"page-break-after",
"page-break-before",
"page-break-inside",
"page-policy",
"pause",
"pause-after",
"pause-before",
"perspective",
"perspective-origin",
"pitch",
"pitch-range",
"place-content",
"place-items",
"place-self",
"play-during",
"position",
"presentation-level",
"punctuation-trim",
"quotes",
"region-break-after",
"region-break-before",
"region-break-inside",
"region-fragment",
"rendering-intent",
"resize",
"rest",
"rest-after",
"rest-before",
"richness",
"right",
"rotate",
"rotation",
"rotation-point",
"row-gap",
"ruby-align",
"ruby-overhang",
"ruby-position",
"ruby-span",
"scale",
"scroll-behavior",
"scroll-margin",
"scroll-margin-block",
"scroll-margin-block-end",
"scroll-margin-block-start",
"scroll-margin-bottom",
"scroll-margin-inline",
"scroll-margin-inline-end",
"scroll-margin-inline-start",
"scroll-margin-left",
"scroll-margin-right",
"scroll-margin-top",
"scroll-padding",
"scroll-padding-block",
"scroll-padding-block-end",
"scroll-padding-block-start",
"scroll-padding-bottom",
"scroll-padding-inline",
"scroll-padding-inline-end",
"scroll-padding-inline-start",
"scroll-padding-left",
"scroll-padding-right",
"scroll-padding-top",
"scroll-snap-align",
"scroll-snap-type",
"shape-image-threshold",
"shape-inside",
"shape-margin",
"shape-outside",
"size",
"speak",
"speak-as",
"speak-header",
"speak-numeral",
"speak-punctuation",
"speech-rate",
"stress",
"string-set",
"tab-size",
"table-layout",
"target",
"target-name",
"target-new",
"target-position",
"text-align",
"text-align-last",
"text-combine-upright",
"text-decoration",
"text-decoration-color",
"text-decoration-line",
"text-decoration-skip",
"text-decoration-skip-ink",
"text-decoration-style",
"text-emphasis",
"text-emphasis-color",
"text-emphasis-position",
"text-emphasis-style",
"text-height",
"text-indent",
"text-justify",
"text-orientation",
"text-outline",
"text-overflow",
"text-rendering",
"text-shadow",
"text-size-adjust",
"text-space-collapse",
"text-transform",
"text-underline-position",
"text-wrap",
"top",
"touch-action",
"transform",
"transform-origin",
"transform-style",
"transition",
"transition-delay",
"transition-duration",
"transition-property",
"transition-timing-function",
"translate",
"unicode-bidi",
"user-select",
"vertical-align",
"visibility",
"voice-balance",
"voice-duration",
"voice-family",
"voice-pitch",
"voice-range",
"voice-rate",
"voice-stress",
"voice-volume",
"volume",
"white-space",
"widows",
"width",
"will-change",
"word-break",
"word-spacing",
"word-wrap",
"writing-mode",
"z-index",
"clip-path",
"clip-rule",
"mask",
"enable-background",
"filter",
"flood-color",
"flood-opacity",
"lighting-color",
"stop-color",
"stop-opacity",
"pointer-events",
"color-interpolation",
"color-interpolation-filters",
"color-rendering",
"fill",
"fill-opacity",
"fill-rule",
"image-rendering",
"marker",
"marker-end",
"marker-mid",
"marker-start",
"paint-order",
"shape-rendering",
"stroke",
"stroke-dasharray",
"stroke-dashoffset",
"stroke-linecap",
"stroke-linejoin",
"stroke-miterlimit",
"stroke-opacity",
"stroke-width",
"text-rendering",
"baseline-shift",
"dominant-baseline",
"glyph-orientation-horizontal",
"glyph-orientation-vertical",
"text-anchor",
"writing-mode"
], S = r(_), b = [
"accent-color",
"aspect-ratio",
"border-block",
"border-block-color",
"border-block-end",
"border-block-end-color",
"border-block-end-style",
"border-block-end-width",
"border-block-start",
"border-block-start-color",
"border-block-start-style",
"border-block-start-width",
"border-block-style",
"border-block-width",
"border-inline",
"border-inline-color",
"border-inline-end",
"border-inline-end-color",
"border-inline-end-style",
"border-inline-end-width",
"border-inline-start",
"border-inline-start-color",
"border-inline-start-style",
"border-inline-start-width",
"border-inline-style",
"border-inline-width",
"content-visibility",
"margin-block",
"margin-block-end",
"margin-block-start",
"margin-inline",
"margin-inline-end",
"margin-inline-start",
"overflow-anchor",
"overscroll-behavior",
"padding-block",
"padding-block-end",
"padding-block-start",
"padding-inline",
"padding-inline-end",
"padding-inline-start",
"scroll-snap-stop",
"scrollbar-3d-light-color",
"scrollbar-arrow-color",
"scrollbar-base-color",
"scrollbar-dark-shadow-color",
"scrollbar-face-color",
"scrollbar-highlight-color",
"scrollbar-shadow-color",
"scrollbar-track-color",
"searchfield-cancel-button",
"searchfield-decoration",
"searchfield-results-button",
"searchfield-results-decoration",
"shape-inside",
"zoom"
], A = r(b), w = [
"font-display",
"font-family",
"src",
"unicode-range",
"font-variant",
"font-feature-settings",
"font-stretch",
"font-weight",
"font-style"
], m = r(w), y = [
"additive-symbols",
"fallback",
"negative",
"pad",
"prefix",
"range",
"speak-as",
"suffix",
"symbols",
"system"
], E = r(y), x = [
"aliceblue",
"antiquewhite",
"aqua",
"aquamarine",
"azure",
"beige",
"bisque",
"black",
"blanchedalmond",
"blue",
"blueviolet",
"brown",
"burlywood",
"cadetblue",
"chartreuse",
"chocolate",
"coral",
"cornflowerblue",
"cornsilk",
"crimson",
"cyan",
"darkblue",
"darkcyan",
"darkgoldenrod",
"darkgray",
"darkgreen",
"darkgrey",
"darkkhaki",
"darkmagenta",
"darkolivegreen",
"darkorange",
"darkorchid",
"darkred",
"darksalmon",
"darkseagreen",
"darkslateblue",
"darkslategray",
"darkslategrey",
"darkturquoise",
"darkviolet",
"deeppink",
"deepskyblue",
"dimgray",
"dimgrey",
"dodgerblue",
"firebrick",
"floralwhite",
"forestgreen",
"fuchsia",
"gainsboro",
"ghostwhite",
"gold",
"goldenrod",
"gray",
"grey",
"green",
"greenyellow",
"honeydew",
"hotpink",
"indianred",
"indigo",
"ivory",
"khaki",
"lavender",
"lavenderblush",
"lawngreen",
"lemonchiffon",
"lightblue",
"lightcoral",
"lightcyan",
"lightgoldenrodyellow",
"lightgray",
"lightgreen",
"lightgrey",
"lightpink",
"lightsalmon",
"lightseagreen",
"lightskyblue",
"lightslategray",
"lightslategrey",
"lightsteelblue",
"lightyellow",
"lime",
"limegreen",
"linen",
"magenta",
"maroon",
"mediumaquamarine",
"mediumblue",
"mediumorchid",
"mediumpurple",
"mediumseagreen",
"mediumslateblue",
"mediumspringgreen",
"mediumturquoise",
"mediumvioletred",
"midnightblue",
"mintcream",
"mistyrose",
"moccasin",
"navajowhite",
"navy",
"oldlace",
"olive",
"olivedrab",
"orange",
"orangered",
"orchid",
"palegoldenrod",
"palegreen",
"paleturquoise",
"palevioletred",
"papayawhip",
"peachpuff",
"peru",
"pink",
"plum",
"powderblue",
"purple",
"rebeccapurple",
"red",
"rosybrown",
"royalblue",
"saddlebrown",
"salmon",
"sandybrown",
"seagreen",
"seashell",
"sienna",
"silver",
"skyblue",
"slateblue",
"slategray",
"slategrey",
"snow",
"springgreen",
"steelblue",
"tan",
"teal",
"thistle",
"tomato",
"turquoise",
"violet",
"wheat",
"white",
"whitesmoke",
"yellow",
"yellowgreen"
], k = r(x), D = [
"above",
"absolute",
"activeborder",
"additive",
"activecaption",
"afar",
"after-white-space",
"ahead",
"alias",
"all",
"all-scroll",
"alphabetic",
"alternate",
"always",
"amharic",
"amharic-abegede",
"antialiased",
"appworkspace",
"arabic-indic",
"armenian",
"asterisks",
"attr",
"auto",
"auto-flow",
"avoid",
"avoid-column",
"avoid-page",
"avoid-region",
"axis-pan",
"background",
"backwards",
"baseline",
"below",
"bidi-override",
"binary",
"bengali",
"blink",
"block",
"block-axis",
"blur",
"bold",
"bolder",
"border",
"border-box",
"both",
"bottom",
"break",
"break-all",
"break-word",
"brightness",
"bullets",
"button",
"buttonface",
"buttonhighlight",
"buttonshadow",
"buttontext",
"calc",
"cambodian",
"capitalize",
"caps-lock-indicator",
"caption",
"captiontext",
"caret",
"cell",
"center",
"checkbox",
"circle",
"cjk-decimal",
"cjk-earthly-branch",
"cjk-heavenly-stem",
"cjk-ideographic",
"clear",
"clip",
"close-quote",
"col-resize",
"collapse",
"color",
"color-burn",
"color-dodge",
"column",
"column-reverse",
"compact",
"condensed",
"conic-gradient",
"contain",
"content",
"contents",
"content-box",
"context-menu",
"continuous",
"contrast",
"copy",
"counter",
"counters",
"cover",
"crop",
"cross",
"crosshair",
"cubic-bezier",
"currentcolor",
"cursive",
"cyclic",
"darken",
"dashed",
"decimal",
"decimal-leading-zero",
"default",
"default-button",
"dense",
"destination-atop",
"destination-in",
"destination-out",
"destination-over",
"devanagari",
"difference",
"disc",
"discard",
"disclosure-closed",
"disclosure-open",
"document",
"dot-dash",
"dot-dot-dash",
"dotted",
"double",
"down",
"drop-shadow",
"e-resize",
"ease",
"ease-in",
"ease-in-out",
"ease-out",
"element",
"ellipse",
"ellipsis",
"embed",
"end",
"ethiopic",
"ethiopic-abegede",
"ethiopic-abegede-am-et",
"ethiopic-abegede-gez",
"ethiopic-abegede-ti-er",
"ethiopic-abegede-ti-et",
"ethiopic-halehame-aa-er",
"ethiopic-halehame-aa-et",
"ethiopic-halehame-am-et",
"ethiopic-halehame-gez",
"ethiopic-halehame-om-et",
"ethiopic-halehame-sid-et",
"ethiopic-halehame-so-et",
"ethiopic-halehame-ti-er",
"ethiopic-halehame-ti-et",
"ethiopic-halehame-tig",
"ethiopic-numeric",
"ew-resize",
"exclusion",
"expanded",
"extends",
"extra-condensed",
"extra-expanded",
"fantasy",
"fast",
"fill",
"fill-box",
"fixed",
"flat",
"flex",
"flex-end",
"flex-start",
"footnotes",
"forwards",
"from",
"geometricPrecision",
"georgian",
"grayscale",
"graytext",
"grid",
"groove",
"gujarati",
"gurmukhi",
"hand",
"hangul",
"hangul-consonant",
"hard-light",
"hebrew",
"help",
"hidden",
"hide",
"higher",
"highlight",
"highlighttext",
"hiragana",
"hiragana-iroha",
"horizontal",
"hsl",
"hsla",
"hue",
"hue-rotate",
"icon",
"ignore",
"inactiveborder",
"inactivecaption",
"inactivecaptiontext",
"infinite",
"infobackground",
"infotext",
"inherit",
"initial",
"inline",
"inline-axis",
"inline-block",
"inline-flex",
"inline-grid",
"inline-table",
"inset",
"inside",
"intrinsic",
"invert",
"italic",
"japanese-formal",
"japanese-informal",
"justify",
"kannada",
"katakana",
"katakana-iroha",
"keep-all",
"khmer",
"korean-hangul-formal",
"korean-hanja-formal",
"korean-hanja-informal",
"landscape",
"lao",
"large",
"larger",
"left",
"level",
"lighter",
"lighten",
"line-through",
"linear",
"linear-gradient",
"lines",
"list-item",
"listbox",
"listitem",
"local",
"logical",
"loud",
"lower",
"lower-alpha",
"lower-armenian",
"lower-greek",
"lower-hexadecimal",
"lower-latin",
"lower-norwegian",
"lower-roman",
"lowercase",
"ltr",
"luminosity",
"malayalam",
"manipulation",
"match",
"matrix",
"matrix3d",
"media-play-button",
"media-slider",
"media-sliderthumb",
"media-volume-slider",
"media-volume-sliderthumb",
"medium",
"menu",
"menulist",
"menulist-button",
"menutext",
"message-box",
"middle",
"min-intrinsic",
"mix",
"mongolian",
"monospace",
"move",
"multiple",
"multiple_mask_images",
"multiply",
"myanmar",
"n-resize",
"narrower",
"ne-resize",
"nesw-resize",
"no-close-quote",
"no-drop",
"no-open-quote",
"no-repeat",
"none",
"normal",
"not-allowed",
"nowrap",
"ns-resize",
"numbers",
"numeric",
"nw-resize",
"nwse-resize",
"oblique",
"octal",
"opacity",
"open-quote",
"optimizeLegibility",
"optimizeSpeed",
"oriya",
"oromo",
"outset",
"outside",
"outside-shape",
"overlay",
"overline",
"padding",
"padding-box",
"painted",
"page",
"paused",
"persian",
"perspective",
"pinch-zoom",
"plus-darker",
"plus-lighter",
"pointer",
"polygon",
"portrait",
"pre",
"pre-line",
"pre-wrap",
"preserve-3d",
"progress",
"push-button",
"radial-gradient",
"radio",
"read-only",
"read-write",
"read-write-plaintext-only",
"rectangle",
"region",
"relative",
"repeat",
"repeating-linear-gradient",
"repeating-radial-gradient",
"repeating-conic-gradient",
"repeat-x",
"repeat-y",
"reset",
"reverse",
"rgb",
"rgba",
"ridge",
"right",
"rotate",
"rotate3d",
"rotateX",
"rotateY",
"rotateZ",
"round",
"row",
"row-resize",
"row-reverse",
"rtl",
"run-in",
"running",
"s-resize",
"sans-serif",
"saturate",
"saturation",
"scale",
"scale3d",
"scaleX",
"scaleY",
"scaleZ",
"screen",
"scroll",
"scrollbar",
"scroll-position",
"se-resize",
"searchfield",
"searchfield-cancel-button",
"searchfield-decoration",
"searchfield-results-button",
"searchfield-results-decoration",
"self-start",
"self-end",
"semi-condensed",
"semi-expanded",
"separate",
"sepia",
"serif",
"show",
"sidama",
"simp-chinese-formal",
"simp-chinese-informal",
"single",
"skew",
"skewX",
"skewY",
"skip-white-space",
"slide",
"slider-horizontal",
"slider-vertical",
"sliderthumb-horizontal",
"sliderthumb-vertical",
"slow",
"small",
"small-caps",
"small-caption",
"smaller",
"soft-light",
"solid",
"somali",
"source-atop",
"source-in",
"source-out",
"source-over",
"space",
"space-around",
"space-between",
"space-evenly",
"spell-out",
"square",
"square-button",
"start",
"static",
"status-bar",
"stretch",
"stroke",
"stroke-box",
"sub",
"subpixel-antialiased",
"svg_masks",
"super",
"sw-resize",
"symbolic",
"symbols",
"system-ui",
"table",
"table-caption",
"table-cell",
"table-column",
"table-column-group",
"table-footer-group",
"table-header-group",
"table-row",
"table-row-group",
"tamil",
"telugu",
"text",
"text-bottom",
"text-top",
"textarea",
"textfield",
"thai",
"thick",
"thin",
"threeddarkshadow",
"threedface",
"threedhighlight",
"threedlightshadow",
"threedshadow",
"tibetan",
"tigre",
"tigrinya-er",
"tigrinya-er-abegede",
"tigrinya-et",
"tigrinya-et-abegede",
"to",
"top",
"trad-chinese-formal",
"trad-chinese-informal",
"transform",
"translate",
"translate3d",
"translateX",
"translateY",
"translateZ",
"transparent",
"ultra-condensed",
"ultra-expanded",
"underline",
"unidirectional-pan",
"unset",
"up",
"upper-alpha",
"upper-armenian",
"upper-greek",
"upper-hexadecimal",
"upper-latin",
"upper-norwegian",
"upper-roman",
"uppercase",
"urdu",
"url",
"var",
"vertical",
"vertical-text",
"view-box",
"visible",
"visibleFill",
"visiblePainted",
"visibleStroke",
"visual",
"w-resize",
"wait",
"wave",
"wider",
"window",
"windowframe",
"windowtext",
"words",
"wrap",
"wrap-reverse",
"x-large",
"x-small",
"xor",
"xx-large",
"xx-small"
], P = r(D), M = n.concat(s).concat(d).concat(p).concat(_).concat(b).concat(x).concat(D);
i.registerHelper("hintWords", "css", M);
function B(T, $) {
for (var V = !1, z; (z = T.next()) != null; ) {
if (V && z == "/") {
$.tokenize = null;
break;
}
V = z == "*";
}
return ["comment", "comment"];
}
i.defineMIME("text/css", {
documentTypes: a,
mediaTypes: u,
mediaFeatures: h,
mediaValueKeywords: g,
propertyKeywords: S,
nonStandardPropertyKeywords: A,
fontProperties: m,
counterDescriptors: E,
colorKeywords: k,
valueKeywords: P,
tokenHooks: {
"/": function(T, $) {
return T.eat("*") ? ($.tokenize = B, B(T, $)) : !1;
}
},
name: "css"
}), i.defineMIME("text/x-scss", {
mediaTypes: u,
mediaFeatures: h,
mediaValueKeywords: g,
propertyKeywords: S,
nonStandardPropertyKeywords: A,
colorKeywords: k,
valueKeywords: P,
fontProperties: m,
allowNested: !0,
lineComment: "//",
tokenHooks: {
"/": function(T, $) {
return T.eat("/") ? (T.skipToEnd(), ["comment", "comment"]) : T.eat("*") ? ($.tokenize = B, B(T, $)) : ["operator", "operator"];
},
":": function(T) {
return T.match(/^\s*\{/, !1) ? [null, null] : !1;
},
$: function(T) {
return T.match(/^[\w-]+/), T.match(/^\s*:/, !1) ? ["variable-2", "variable-definition"] : ["variable-2", "variable"];
},
"#": function(T) {
return T.eat("{") ? [null, "interpolation"] : !1;
}
},
name: "css",
helperType: "scss"
}), i.defineMIME("text/x-less", {
mediaTypes: u,
mediaFeatures: h,
mediaValueKeywords: g,
propertyKeywords: S,
nonStandardPropertyKeywords: A,
colorKeywords: k,
valueKeywords: P,
fontProperties: m,
allowNested: !0,
lineComment: "//",
tokenHooks: {
"/": function(T, $) {
return T.eat("/") ? (T.skipToEnd(), ["comment", "comment"]) : T.eat("*") ? ($.tokenize = B, B(T, $)) : ["operator", "operator"];
},
"@": function(T) {
return T.eat("{") ? [null, "interpolation"] : T.match(/^(charset|document|font-face|import|(-(moz|ms|o|webkit)-)?keyframes|media|namespace|page|supports)\b/i, !1) ? !1 : (T.eatWhile(/[\w\\\-]/), T.match(/^\s*:/, !1) ? ["variable-2", "variable-definition"] : ["variable-2", "variable"]);
},
"&": function() {
return ["atom", "atom"];
}
},
name: "css",
helperType: "less"
}), i.defineMIME("text/x-gss", {
documentTypes: a,
mediaTypes: u,
mediaFeatures: h,
propertyKeywords: S,
nonStandardPropertyKeywords: A,
fontProperties: m,
counterDescriptors: E,
colorKeywords: k,
valueKeywords: P,
supportsAtComponent: !0,
tokenHooks: {
"/": function(T, $) {
return T.eat("*") ? ($.tokenize = B, B(T, $)) : !1;
}
},
name: "css",
helperType: "gss"
});
});
})();
const UO = Ve({
name: "StyleEditor",
props: {
modelValue: String
},
data() {
return {
editor: null,
oldVal: null
};
},
mounted() {
this.$nextTick(() => {
this.load();
});
},
methods: {
load() {
const e = this.modelValue;
this.oldVal = e, this.$nextTick(() => {
this.editor = Xt(nr(this.$refs.editor, {
lineNumbers: !0,
mode: "css",
lint: !0,
line: !0,
tabSize: 2,
lineWrapping: !0,
value: e ? Vo.css(e, {
indent_size: 2,
indent_char: " ",
indent_scripts: "separate"
}) : ""
}));
});
},
save() {
const e = this.editor.getValue();
return e !== this.oldVal && this.$emit("update:modelValue", e), !0;
}
}
}), zO = { class: "_fd-style-editor" }, HO = { ref: "editor" };
function WO(e, t, i, r, n, a) {
return W(), ae("div", zO, [
Z("div", HO, null, 512)
]);
}
const GO = /* @__PURE__ */ je(UO, [["render", WO]]);
const KO = Ve({
name: "GlobalClassConfig",
emits: ["update:modelValue"],
props: {
modelValue: Object
},
components: {
Warning: Ei,
StyleEditor: GO,
StyleConfig: Z0
},
inject: ["designer"],
data() {
return {
visible: !1,
activeIdx: "",
value: {},
cus: !1,
cusValue: "",
handle: "",
styleEl: null,
content: "",
activeStyle: !1
};
},
computed: {
t() {
return this.designer.setupState.t;
},
eventNum() {
return Object.keys(this.modelValue || {}).length;
},
fnArgs() {
return [In(this.t)];
}
},
watch: {
visible(e) {
e && (this.activeIdx = "", this.value = At(this.modelValue || {}));
},
modelValue() {
this.updateGlobalStyle();
}
},
methods: {
open() {
this.visible = !0;
},
changeStyle() {
this.content = this.designer.setupState.formOptions.style || `#_demo1{
display:flex;
}
._demo2{
display:flex;
}`, this.activeStyle = !0, this.activeIdx = "";
},
active(e) {
this.activeStyle = !1, this.activeIdx !== e && (this.handle = this.value[e].style || "", this.activeIdx = e);
},
addCus() {
const e = this.cusValue && this.cusValue.trim();
if (e) {
const t = "cls_" + rt();
this.value[t] = {
label: e,
style: {}
}, this.active(t), this.closeCus();
}
},
closeCus() {
this.cus = !1, this.cusValue = "";
},
cusEvent() {
this.cus = !0;
},
save() {
this.activeStyle ? (this.$refs.editor.save(), this.designer.setupState.formOptions.style = this.content, this.activeStyle = !1) : (this.value[this.activeIdx].style = this.handle, this.activeIdx = "");
},
rm(e) {
delete this.value[e], e === this.activeIdx && (this.activeIdx = "");
},
close() {
this.activeIdx = "";
},
submit() {
(this.activeIdx || this.activeStyle) && this.save(), this.$emit("update:modelValue", { ...this.value }), this.visible = !1;
},
updateGlobalStyle() {
let e = "";
const t = this.modelValue || {};
Object.keys(t).forEach((i) => {
let r = "";
t[i].style && Object.keys(t[i].style).forEach((n) => {
r += ll(n) + ":" + t[i].style[n] + ";";
}), t[i].content && (r += t[i].content + ";"), r && (e += `.${i}{${r}}`);
}), e && (this.styleEl.innerHTML = e);
}
},
created() {
this.styleEl = Xt(document.createElement("style")), this.styleEl.type = "text/css", document.head.appendChild(this.styleEl), this.updateGlobalStyle();
},
unmounted() {
document.head.removeChild(this.styleEl);
}
}), YO = { class: "_fd-gcc" }, QO = { class: "_fd-gcc-method" }, JO = { class: "_fd-label" }, XO = ["onClick"], ZO = { class: "_fd-gcc-method" }, qO = {
key: 0,
class: "_fd-label"
}, eR = ["onClick"];
function tR(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-badge"), d = ie("Warning"), h = ie("el-header"), p = ie("el-menu-item"), g = ie("el-input"), _ = ie("el-menu"), S = ie("el-main"), b = ie("el-container"), A = ie("el-aside"), w = ie("StyleEditor"), m = ie("StyleConfig"), y = ie("el-form"), E = ie("el-dialog");
return W(), ae("div", YO, [
G(u, {
value: e.eventNum,
type: "warning",
hidden: e.eventNum < 1
}, {
default: N(() => [
G(s, {
class: "_fd-plain-button",
plain: "",
onClick: e.open,
size: "small"
}, {
default: N(() => [
_e(le(e.t("class.title")), 1)
]),
_: 1
}, 8, ["onClick"])
]),
_: 1
}, 8, ["value", "hidden"]),
G(E, {
class: "_fd-gcc-dialog _fd-config-dialog",
modelValue: e.visible,
"onUpdate:modelValue": t[8] || (t[8] = (x) => e.visible = x),
"destroy-on-close": "",
"close-on-click-modal": !1,
"append-to-body": "",
width: "700px"
}, {
header: N(() => [
_e(le(e.t("form.globalClass")) + " ", 1),
G(d, {
tooltip: e.t("warning.globalClass")
}, null, 8, ["tooltip"])
]),
footer: N(() => [
Z("div", null, [
G(s, {
size: "default",
onClick: t[7] || (t[7] = (x) => e.visible = !1)
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}),
G(s, {
type: "primary",
size: "default",
onClick: e.submit
}, {
default: N(() => [
_e(le(e.t("props.ok")), 1)
]),
_: 1
}, 8, ["onClick"])
])
]),
default: N(() => [
G(b, {
class: "_fd-gcc-con",
style: { height: "600px" }
}, {
default: N(() => [
G(A, { style: { width: "255px" } }, {
default: N(() => [
G(b, { class: "_fd-gcc-l" }, {
default: N(() => [
G(h, {
class: "_fd-gcc-head",
height: "40px"
}, {
default: N(() => [
G(s, {
link: "",
type: "primary",
size: "default",
onClick: e.cusEvent
}, {
default: N(() => [
_e(le(e.t("class.create")), 1)
]),
_: 1
}, 8, ["onClick"])
]),
_: 1
}),
G(S, null, {
default: N(() => [
G(_, null, {
default: N(() => [
G(p, {
class: qe({ "is-active": e.activeStyle, "_fd-gcc-default": !0 })
}, {
default: N(() => [
Z("div", {
class: "_fd-gcc-title",
onClick: t[0] || (t[0] = vt((...x) => e.changeStyle && e.changeStyle(...x), ["stop"]))
}, [
Z("div", QO, [
Z("span", JO, le(e.t("form.globalClass")), 1)
])
])
]),
_: 1
}, 8, ["class"]),
(W(!0), ae(Pe, null, Ge(e.value, (x, k) => (W(), ye(p, {
class: qe({ "is-active": k === e.activeIdx })
}, {
default: N(() => [
Z("div", {
class: "_fd-gcc-title",
onClick: vt((D) => e.active(k), ["stop"])
}, [
Z("div", ZO, [
Z("span", null, "." + le(k), 1),
x.label ? (W(), ae("span", qO, le(x.label), 1)) : Oe("", !0)
]),
x.deletable !== !1 ? (W(), ae("i", {
key: 0,
class: "fc-icon icon-delete",
onClick: vt((D) => e.rm(k), ["stop"])
}, null, 8, eR)) : Oe("", !0)
], 8, XO)
]),
_: 2
}, 1032, ["class"]))), 256)),
e.cus ? (W(), ye(p, {
key: 0,
style: { "padding-left": "10px" }
}, {
default: N(() => [
Z("div", {
class: "_fd-gcc-title",
onClick: t[4] || (t[4] = vt(() => {
}, ["stop"]))
}, [
G(g, {
type: "text",
modelValue: e.cusValue,
"onUpdate:modelValue": t[1] || (t[1] = (x) => e.cusValue = x),
size: "default",
onKeydown: nl(e.addCus, ["enter"]),
placeholder: e.t("class.placeholder")
}, null, 8, ["modelValue", "onKeydown", "placeholder"]),
Z("div", null, [
Z("i", {
class: "fc-icon icon-add",
onClick: t[2] || (t[2] = vt((...x) => e.addCus && e.addCus(...x), ["stop"]))
}),
Z("i", {
class: "fc-icon icon-delete",
onClick: t[3] || (t[3] = vt((...x) => e.closeCus && e.closeCus(...x), ["stop"]))
})
])
])
]),
_: 1
})) : Oe("", !0)
]),
_: 1
})
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}),
G(S, null, {
default: N(() => [
G(b, { class: "_fd-gcc-r" }, {
default: N(() => [
e.activeIdx || e.activeStyle ? (W(), ye(h, {
key: 0,
class: "_fd-gcc-head",
height: "40px"
}, {
default: N(() => [
G(s, {
size: "small",
onClick: e.close
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}, 8, ["onClick"]),
G(s, {
size: "small",
type: "primary",
onClick: e.save
}, {
default: N(() => [
_e(le(e.t("props.save")), 1)
]),
_: 1
}, 8, ["onClick"])
]),
_: 1
})) : Oe("", !0),
e.activeIdx || e.activeStyle ? (W(), ye(S, {
key: e.activeIdx,
class: qe(e.activeStyle ? "_fd-gcc-style" : "")
}, {
default: N(() => [
e.activeStyle ? (W(), ye(w, {
key: 0,
ref: "editor",
modelValue: e.content,
"onUpdate:modelValue": t[5] || (t[5] = (x) => e.content = x)
}, null, 8, ["modelValue"])) : (W(), ye(y, {
key: 1,
size: "small"
}, {
default: N(() => [
G(m, {
modelValue: e.handle,
"onUpdate:modelValue": t[6] || (t[6] = (x) => e.handle = x)
}, null, 8, ["modelValue"])
]),
_: 1
}))
]),
_: 1
}, 8, ["class"])) : Oe("", !0)
]),
_: 1
})
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}, 8, ["modelValue"])
]);
}
const q0 = /* @__PURE__ */ je(KO, [["render", tR]]);
const nR = Ve({
name: "GlobalVariableConfig",
emits: ["update:modelValue"],
props: {
modelValue: Object
},
components: {
Warning: Ei,
FnEditor: ar
},
inject: ["designer"],
data() {
return {
visible: !1,
activeIdx: "",
value: {},
cus: !1,
cusValue: "",
handle: ""
};
},
computed: {
t() {
return this.designer.setupState.t;
},
eventNum() {
return Object.keys(this.modelValue || {}).length;
}
},
watch: {
visible(e) {
e && (this.activeIdx = "", this.value = At(this.modelValue || {}));
}
},
methods: {
open() {
this.visible = !0;
},
active(e) {
this.activeIdx !== e && (this.handle = this.value[e].handle || "", this.activeIdx = e);
},
addCus() {
const e = this.cusValue && this.cusValue.trim();
if (e) {
const t = "var_" + rt();
this.value[t] = {
label: e,
handle: ""
}, this.active(t), this.closeCus();
}
},
closeCus() {
this.cus = !1, this.cusValue = "";
},
cusEvent() {
this.cus = !0;
},
save() {
if (!this.$refs.editor.save())
return !1;
this.value[this.activeIdx].handle = this.handle, this.activeIdx = "";
},
rm(e) {
delete this.value[e], e === this.activeIdx && (this.activeIdx = "");
},
close() {
this.activeIdx = "";
},
submit() {
this.activeIdx && !this.save() || (this.$emit("update:modelValue", { ...this.value }), this.visible = !1);
}
}
}), iR = { class: "_fd-gvc" }, rR = ["onClick"], oR = { class: "_fd-gvc-method" }, aR = {
key: 0,
class: "_fd-label"
}, lR = ["onClick"];
function sR(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-badge"), d = ie("Warning"), h = ie("el-header"), p = ie("el-menu-item"), g = ie("el-input"), _ = ie("el-menu"), S = ie("el-main"), b = ie("el-container"), A = ie("el-aside"), w = ie("FnEditor"), m = ie("el-dialog");
return W(), ae("div", iR, [
G(u, {
value: e.eventNum,
type: "warning",
hidden: e.eventNum < 1
}, {
default: N(() => [
G(s, {
class: "_fd-plain-button",
plain: "",
onClick: e.open,
size: "small"
}, {
default: N(() => [
_e(le(e.t("computed.variable.btn")), 1)
]),
_: 1
}, 8, ["onClick"])
]),
_: 1
}, 8, ["value", "hidden"]),
G(m, {
class: "_fd-gvc-dialog _fd-config-dialog",
modelValue: e.visible,
"onUpdate:modelValue": t[6] || (t[6] = (y) => e.visible = y),
"destroy-on-close": "",
"close-on-click-modal": !1,
"append-to-body": "",
width: "980px"
}, {
header: N(() => [
_e(le(e.t("computed.variable.title")) + " ", 1),
G(d, {
tooltip: e.t("warning.globalVariable")
}, null, 8, ["tooltip"])
]),
footer: N(() => [
Z("div", null, [
G(s, {
size: "default",
onClick: t[5] || (t[5] = (y) => e.visible = !1)
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}),
G(s, {
type: "primary",
size: "default",
onClick: e.submit
}, {
default: N(() => [
_e(le(e.t("props.ok")), 1)
]),
_: 1
}, 8, ["onClick"])
])
]),
default: N(() => [
G(b, {
class: "_fd-gvc-con",
style: { height: "600px" }
}, {
default: N(() => [
G(A, { style: { width: "255px" } }, {
default: N(() => [
G(b, { class: "_fd-gvc-l" }, {
default: N(() => [
G(h, {
class: "_fd-gvc-head",
height: "40px"
}, {
default: N(() => [
G(s, {
link: "",
type: "primary",
size: "default",
onClick: e.cusEvent
}, {
default: N(() => [
_e(le(e.t("computed.variable.create")), 1)
]),
_: 1
}, 8, ["onClick"])
]),
_: 1
}),
G(S, null, {
default: N(() => [
G(_, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.value, (y, E) => (W(), ye(p, {
class: qe({ "is-active": E === e.activeIdx })
}, {
default: N(() => [
Z("div", {
class: "_fd-gvc-title",
onClick: vt((x) => e.active(E), ["stop"])
}, [
Z("div", oR, [
Z("span", null, le(E), 1),
y.label ? (W(), ae("span", aR, le(y.label), 1)) : Oe("", !0)
]),
y.deletable !== !1 ? (W(), ae("i", {
key: 0,
class: "fc-icon icon-delete",
onClick: vt((x) => e.rm(E), ["stop"])
}, null, 8, lR)) : Oe("", !0)
], 8, rR)
]),
_: 2
}, 1032, ["class"]))), 256)),
e.cus ? (W(), ye(p, {
key: 0,
style: { "padding-left": "10px" }
}, {
default: N(() => [
Z("div", {
class: "_fd-gvc-title",
onClick: t[3] || (t[3] = vt(() => {
}, ["stop"]))
}, [
G(g, {
type: "text",
modelValue: e.cusValue,
"onUpdate:modelValue": t[0] || (t[0] = (y) => e.cusValue = y),
size: "default",
onKeydown: nl(e.addCus, ["enter"]),
placeholder: e.t("computed.variable.placeholder")
}, null, 8, ["modelValue", "onKeydown", "placeholder"]),
Z("div", null, [
Z("i", {
class: "fc-icon icon-add",
onClick: t[1] || (t[1] = vt((...y) => e.addCus && e.addCus(...y), ["stop"]))
}),
Z("i", {
class: "fc-icon icon-delete",
onClick: t[2] || (t[2] = vt((...y) => e.closeCus && e.closeCus(...y), ["stop"]))
})
])
])
]),
_: 1
})) : Oe("", !0)
]),
_: 1
})
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}),
G(S, null, {
default: N(() => [
G(b, { class: "_fd-gvc-r" }, {
default: N(() => [
e.activeIdx ? (W(), ye(h, {
key: 0,
class: "_fd-gvc-head",
height: "40px"
}, {
default: N(() => [
G(s, {
size: "small",
onClick: e.close
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}, 8, ["onClick"]),
G(s, {
size: "small",
type: "primary",
onClick: e.save
}, {
default: N(() => [
_e(le(e.t("props.save")), 1)
]),
_: 1
}, 8, ["onClick"])
]),
_: 1
})) : Oe("", !0),
e.activeIdx ? (W(), ye(S, { key: e.activeIdx }, {
default: N(() => [
G(w, {
ref: "editor",
modelValue: e.handle,
"onUpdate:modelValue": t[4] || (t[4] = (y) => e.handle = y),
name: "handle",
args: ["get", "api"]
}, null, 8, ["modelValue"])
]),
_: 1
})) : Oe("", !0)
]),
_: 1
})
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}, 8, ["modelValue"])
]);
}
const ey = /* @__PURE__ */ je(nR, [["render", sR]]);
const uR = Ve({
name: "JsonPreview",
components: { StructEditor: Bc },
inject: ["designer"],
data() {
return {
active: "rule",
value: this.designer.setupState.getRule(),
oldValue: ""
};
},
watch: {
active() {
this.updateValue();
}
},
computed: {
change() {
return this.active === "rule" ? this.designer.setupState.children : this.designer.setupState.formOptions;
},
t() {
return this.designer.setupState.t;
}
},
methods: {
updateValue() {
this.active === "rule" ? this.value = this.designer.setupState.getRule() : this.value = this.designer.setupState.getOptions();
},
handleFocus() {
this.oldValue = tt.toJson(this.value);
},
handleBlur() {
let e;
this.$refs.editor.save() && (e = tt.toJson(this.value)) !== this.oldValue && (this.active === "rule" ? this.designer.setupState.setRule(e) : this.designer.setupState.setOptions(this.value || {}));
}
},
mounted() {
this.$watch(() => this.change, () => {
this.updateValue();
}, { deep: !0 });
}
});
function dR(e, t, i, r, n, a) {
const s = ie("el-header"), u = ie("StructEditor"), d = ie("el-main"), h = ie("el-container");
return W(), ye(h, { class: "_fc-json-preview" }, {
default: N(() => [
G(s, {
height: "40px",
class: "_fc-l-tabs"
}, {
default: N(() => [
Z("div", {
class: qe(["_fc-l-tab", { active: e.active === "rule" }]),
onClick: t[0] || (t[0] = (p) => e.active = "rule")
}, le(e.t("designer.json")), 3),
Z("div", {
class: qe(["_fc-l-tab", { active: e.active === "options" }]),
onClick: t[1] || (t[1] = (p) => e.active = "options")
}, le(e.t("designer.form")), 3)
]),
_: 1
}),
G(d, { style: { padding: "8px" } }, {
default: N(() => [
G(u, {
ref: "editor",
modelValue: e.value,
"onUpdate:modelValue": t[2] || (t[2] = (p) => e.value = p),
onBlur: e.handleBlur,
onFocus: e.handleFocus,
format: "",
style: { height: "100%" }
}, null, 8, ["modelValue", "onBlur", "onFocus"])
]),
_: 1
})
]),
_: 1
});
}
const fR = /* @__PURE__ */ je(uR, [["render", dR]]);
const cR = Ve({
name: "Struct",
emits: ["update:modelValue"],
props: {
modelValue: [Object, Array, Function],
title: String,
defaultValue: {
require: !1
},
validate: Function
},
inject: ["designer"],
computed: {
t() {
return this.designer.setupState.t;
},
configured() {
return !St.empty(this.modelValue) && Object.keys(this.modelValue).length > 0;
}
},
data() {
return {
editor: null,
visible: !1,
oldVal: null
};
},
watch: {
modelValue() {
this.load();
},
visible(e) {
e && this.load();
}
},
methods: {
load() {
const e = ai(Gg(this.modelValue ? At(this.modelValue) : this.defaultValue));
this.oldVal = e, this.$nextTick(() => {
this.editor = Xt(nr(this.$refs.editor, {
lineNumbers: !0,
mode: "javascript",
lint: !0,
line: !0,
tabSize: 2,
lineWrapping: !0,
value: e ? Vo.js(e, {
indent_size: "2",
indent_char: " ",
max_preserve_newlines: "5",
indent_scripts: "separate"
}) : ""
}));
});
},
onOk() {
const e = (this.editor.getValue() || "").trim();
let t;
try {
t = new Function("return " + e)();
} catch (i) {
return console.error(i), $n(this.t("struct.errorMsg")), !1;
}
return this.validate && this.validate(t) === !1 ? ($n(this.t("struct.errorMsg")), !1) : (this.visible = !1, ai(t) !== this.oldVal && this.$emit("update:modelValue", t), !0);
}
}
}), pR = { class: "_fd-struct" }, hR = {
key: 0,
ref: "editor"
};
function mR(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-badge"), d = ie("el-dialog");
return W(), ae("div", pR, [
G(u, {
type: "warning",
"is-dot": "",
hidden: !e.configured
}, {
default: N(() => [
Z("div", {
onClick: t[0] || (t[0] = (h) => e.visible = !0)
}, [
kt(e.$slots, "default", {}, () => [
G(s, {
class: "_fd-plain-button",
plain: "",
size: "small"
}, {
default: N(() => [
_e(le(e.title || e.t("struct.title")), 1)
]),
_: 1
})
])
])
]),
_: 3
}, 8, ["hidden"]),
G(d, {
class: "_fd-struct-dialog _fd-config-dialog",
title: e.title || e.t("struct.title"),
modelValue: e.visible,
"onUpdate:modelValue": t[2] || (t[2] = (h) => e.visible = h),
"destroy-on-close": "",
"close-on-click-modal": !1,
"append-to-body": "",
width: "800px"
}, {
footer: N(() => [
Z("div", null, [
G(s, {
onClick: t[1] || (t[1] = (h) => e.visible = !1),
size: "default"
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}),
G(s, {
type: "primary",
onClick: e.onOk,
size: "default"
}, {
default: N(() => [
_e(le(e.t("props.ok")), 1)
]),
_: 1
}, 8, ["onClick"])
])
]),
default: N(() => [
e.visible ? (W(), ae("div", hR, null, 512)) : Oe("", !0)
]),
_: 1
}, 8, ["title", "modelValue"])
]);
}
const ty = /* @__PURE__ */ je(cR, [["render", mR]]);
const vR = Ve({
name: "PropsInput",
components: { Struct: ty },
inject: ["designer"],
data() {
return {};
},
computed: {
t() {
return this.designer.setupState.t;
},
activeRule() {
return this.designer.setupState.activeRule;
},
props() {
var i;
const e = ((i = this.activeRule._fc_store) == null ? void 0 : i.props_keys) || [], t = {};
return e.forEach((r) => {
this.activeRule.props && this.activeRule.props[r] != null && (t[r] = this.activeRule.props[r]);
}), t;
}
},
methods: {
onInput(e) {
this.activeRule.props || (this.activeRule.props = {}), this.activeRule._fc_store || (this.activeRule._fc_store = {}), Object.keys(this.props).forEach((i) => {
(e || {})[i] == null && delete this.activeRule.props[i];
}), tu(this.activeRule.props, e || {});
const t = Object.keys(e || {});
t.length ? this.activeRule._fc_store.props_keys = t : delete this.activeRule._fc_store.props_keys;
}
}
});
function gR(e, t, i, r, n, a) {
const s = ie("el-tooltip"), u = ie("Struct");
return W(), ye(u, {
class: "_fd-props-input",
modelValue: e.props,
"onUpdate:modelValue": e.onInput,
title: e.t("designer.customProps")
}, {
default: N(() => [
G(s, {
effect: "dark",
content: e.t("designer.customProps"),
placement: "top",
"hide-after": 0
}, {
default: N(() => t[0] || (t[0] = [
Z("i", { class: "fc-icon icon-edit" }, null, -1)
])),
_: 1
}, 8, ["content"])
]),
_: 1
}, 8, ["modelValue", "onUpdate:modelValue", "title"]);
}
const yR = /* @__PURE__ */ je(vR, [["render", gR]]);
const bR = Ve({
name: "LanguageConfig",
inject: ["designer"],
computed: {
localeOptions() {
return this.designer.setupState.getConfig("localeOptions", [
{ value: "zh-cn", label: "\u7B80\u4F53\u4E2D\u6587" },
{ value: "en", label: "English" }
]);
},
t() {
return this.designer.setupState.t;
}
},
data() {
return {
column: [],
uni: 0,
selected: []
};
},
methods: {
copy(e) {
er(e);
},
addColumn() {
this.column.unshift({
key: this.randomString(),
input: !0
});
},
saveColumn(e, t) {
e.input = t || !1;
const i = this.designer.setupState.formOptions.language;
this.localeOptions.forEach((r) => {
i[r.value] || (i[r.value] = {}), i[r.value][e.key] = e[r.value];
});
},
rmColumn(e) {
const t = this.column[e];
this.column.splice(e, 1);
const i = this.designer.setupState.formOptions.language;
this.localeOptions.forEach((r) => {
i[r.value] && delete i[r.value][t.key];
});
},
batchRmColumn() {
this.selected.forEach((e) => {
this.rmColumn(this.column.indexOf(e));
}), this.selected = [];
},
selectionChange(e) {
this.selected = e;
},
randomString() {
const e = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789";
let t = "";
const i = e.length;
for (let r = 0; r < 7; r++)
t += e.charAt(Math.floor(Math.random() * i));
return e.charAt(this.uni++ % 26) + t;
}
},
mounted() {
const e = this.designer.setupState.formOptions.language || {}, t = {};
Object.keys(e).forEach((i) => {
Object.keys(e[i]).forEach((r) => {
t[r] || (t[r] = {
key: r
}), t[r][i] = e[i][r];
});
}), this.column = Object.values(t);
}
}), _R = { class: "_fd-language-config" }, wR = { class: "_fc-l-label" }, AR = { class: "_fc-l-info" }, CR = { class: "_fd-lc-header" }, SR = { class: "_fd-lc-body" }, ER = { class: "_fd-lc-handle" }, xR = ["onClick"], TR = ["onClick"], kR = ["onClick"], OR = ["onClick"];
function RR(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-table-column"), d = ie("el-input"), h = ie("el-table");
return W(), ae("div", _R, [
Z("div", wR, le(e.t("language.name")), 1),
Z("div", AR, le(e.t("warning.language")), 1),
Z("div", CR, [
G(s, {
size: "small",
onClick: e.addColumn
}, {
default: N(() => [
_e(le(e.t("language.add")), 1)
]),
_: 1
}, 8, ["onClick"]),
G(s, {
size: "small",
type: "danger",
plain: "",
disabled: !e.selected.length,
onClick: e.batchRmColumn
}, {
default: N(() => [
_e(le(e.t("language.batchRemove")), 1)
]),
_: 1
}, 8, ["disabled", "onClick"])
]),
Z("div", SR, [
G(h, {
data: e.column,
size: "small",
ref: "table",
onSelectionChange: e.selectionChange,
"row-key": "key"
}, {
default: N(() => [
G(u, {
type: "selection",
width: "30px"
}),
G(u, {
prop: "key",
label: "Key",
width: "90px"
}),
(W(!0), ae(Pe, null, Ge(e.localeOptions, (p) => (W(), ye(u, {
key: p.value,
prop: p.value,
label: p.label,
"min-width": "100px"
}, {
default: N((g) => [
g.row.input ? (W(), ye(d, {
key: 0,
size: "small",
modelValue: g.row[p.value],
"onUpdate:modelValue": (_) => g.row[p.value] = _,
onBlur: (_) => e.saveColumn(g.row, !0)
}, null, 8, ["modelValue", "onUpdate:modelValue", "onBlur"])) : (W(), ae(Pe, { key: 1 }, [
_e(le(g.row[p.value] || "-"), 1)
], 64))
]),
_: 2
}, 1032, ["prop", "label"]))), 128)),
G(u, {
width: "75px",
label: e.t("tableOptions.handle"),
fixed: "right"
}, {
default: N((p) => [
Z("div", ER, [
p.row.input ? (W(), ae("i", {
key: 1,
class: "fc-icon icon-check",
onClick: (g) => e.saveColumn(p.row)
}, null, 8, TR)) : (W(), ae("i", {
key: 0,
class: "fc-icon icon-edit",
onClick: (g) => p.row.input = !0
}, null, 8, xR)),
Z("i", {
class: "fc-icon icon-group",
onClick: (g) => e.copy(p.row.key)
}, null, 8, kR),
Z("i", {
class: "fc-icon icon-delete-circle",
onClick: (g) => e.rmColumn(p.$index)
}, null, 8, OR)
])
]),
_: 1
}, 8, ["label"])
]),
_: 1
}, 8, ["data", "onSelectionChange"])
])
]);
}
const DR = /* @__PURE__ */ je(bR, [["render", RR]]);
const $R = Ve({
name: "SlotsConfig",
inject: ["designer"],
components: { ConfigItem: li },
data() {
return {
type: ["icon", "text"],
easySlots: {}
};
},
computed: {
t() {
return this.designer.setupState.t;
},
slots() {
var i, r;
const e = ((r = (i = this.designer.setupState) == null ? void 0 : i.activeRule) == null ? void 0 : r._menu) || {};
return (e.easySlots || []).map((n) => {
if (typeof n == "string")
return {
value: n,
label: this.t("com." + e.name + ".slots." + n) || this.t("slots." + n) || this.t("props." + n) || n
};
{
const a = { ...n };
return a.label || (a.label = this.t("com." + e.name + ".slots." + n.value) || this.t("slots." + n.value) || this.t("props." + n.value) || n.value), a;
}
});
},
modelValue() {
var e, t;
return ((t = (e = this.designer.setupState) == null ? void 0 : e.activeRule) == null ? void 0 : t.$easySlots) || {};
},
icons() {
return Ms([
...this.designer.setupState.getConfig("icons", []),
"icon-layout",
"icon-column1",
"icon-column2",
"icon-column3",
"icon-column4",
"icon-tab",
"icon-config-event",
"icon-step-form",
"icon-slider",
"icon-dialog",
"icon-justify-spacearound",
"icon-upload",
"icon-copy",
"icon-time-range",
"icon-task-add",
"icon-justify-spacebetween",
"icon-import",
"icon-config-base",
"icon-alignitems-stretch",
"icon-alignitems-flexend",
"icon-check",
"icon-auto",
"icon-calendar",
"icon-config-style",
"icon-config-advanced",
"icon-config-props",
"icon-delete-circle2",
"icon-delete-circle",
"icon-delete",
"icon-direction-rowreverse",
"icon-display-flex",
"icon-drag",
"icon-display-block",
"icon-data",
"icon-edit2",
"icon-edit",
"icon-add-col",
"icon-display-inlineblock",
"icon-config-validate",
"icon-down",
"icon-display-inline",
"icon-eye",
"icon-eye-close",
"icon-preview",
"icon-flex-nowrap",
"icon-folder",
"icon-form-circle",
"icon-flex-wrap",
"icon-form",
"icon-form-item",
"icon-icon",
"icon-image",
"icon-justify-flexstart",
"icon-justify-center",
"icon-justify-stretch",
"icon-link2",
"icon-minus",
"icon-menu2",
"icon-more",
"icon-menu",
"icon-language",
"icon-pad",
"icon-mobile",
"icon-page-max",
"icon-move",
"icon-page-min",
"icon-pre-step",
"icon-pc",
"icon-page",
"icon-refresh",
"icon-radius",
"icon-save-filled",
"icon-question",
"icon-scroll",
"icon-script",
"icon-setting",
"icon-save",
"icon-shadow",
"icon-variable",
"icon-yes",
"icon-shadow-inset",
"icon-date",
"icon-date-range",
"icon-collapse",
"icon-switch",
"icon-subform",
"icon-tree-select",
"icon-value",
"icon-alert",
"icon-card",
"icon-checkbox",
"icon-cascader",
"icon-button",
"icon-data-table",
"icon-group",
"icon-divider",
"icon-flex",
"icon-descriptions",
"icon-html",
"icon-editor",
"icon-input",
"icon-link",
"icon-password",
"icon-radio",
"icon-row",
"icon-inline",
"icon-rate",
"icon-color",
"icon-select",
"icon-json",
"icon-number",
"icon-space",
"icon-table-form",
"icon-table-form2",
"icon-time",
"icon-span",
"icon-textarea",
"icon-tooltip",
"icon-slot",
"icon-transfer",
"icon-tag",
"icon-watermark",
"icon-tree",
"icon-table",
"icon-add-child",
"icon-add2",
"icon-add",
"icon-alignitems-baseline",
"icon-add-circle",
"icon-alignitems-center"
]);
}
},
watch: {
modelValue: {
handler: function(e) {
const t = {};
this.slots.forEach(({ value: i, label: r, type: n }) => {
e[i] ? t[i] = { ...e[i] } : this.easySlots[i] ? t[i] = {
type: this.easySlots[i].type
} : t[i] = {
type: n || "icon",
value: ""
}, t[i].only = n, t[i].label = r;
}), this.easySlots = t;
},
immediate: !0
}
},
methods: {
changeIcon(e, t, i) {
e.value = t, this.onChange(), this.$refs[i][0].hide();
},
changeType(e) {
e.value && (e.value = "", this.onChange());
},
onChange() {
var e;
if ((e = this.designer.setupState) != null && e.activeRule) {
const t = {};
Object.keys(this.easySlots).forEach((i) => {
this.easySlots[i].value && (t[i] = { ...this.easySlots[i] }, delete t[i].label, delete t[i].only);
}), Object.keys(t).length === 0 ? delete this.designer.setupState.activeRule.$easySlots : this.designer.setupState.activeRule.$easySlots = t, this.designer.setupState.activeRule.key = rt();
}
}
},
mounted() {
}
}), IR = { class: "_fd-slots-config" }, FR = { class: "_fd-slots-icons" }, MR = ["onClick"];
function PR(e, t, i, r, n, a) {
const s = ie("el-option"), u = ie("el-select"), d = ie("el-popover"), h = ie("el-input"), p = ie("ConfigItem");
return W(), ae("div", IR, [
(W(!0), ae(Pe, null, Ge(e.easySlots, (g, _) => (W(), ye(p, {
label: g.label
}, {
default: N(() => [
G(h, {
size: "small",
modelValue: g.value,
"onUpdate:modelValue": (S) => g.value = S,
clearable: "",
onBlur: e.onChange
}, ii({ _: 2 }, [
g.only ? void 0 : {
name: "prepend",
fn: N(() => [
G(u, {
size: "small",
modelValue: g.type,
"onUpdate:modelValue": (S) => g.type = S,
onChange: (S) => e.changeType(g)
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.type, (S) => (W(), ye(s, {
label: e.t("props." + S),
value: S
}, null, 8, ["label", "value"]))), 256))
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue", "onChange"])
]),
key: "0"
},
g.type === "icon" ? {
name: "append",
fn: N(() => [
G(d, {
ref_for: !0,
ref: _,
placement: "bottom",
"popper-class": "_fd-slots-config-pop",
width: 400,
trigger: "click"
}, {
reference: N(() => t[0] || (t[0] = [
Z("i", { class: "fc-icon icon-menu" }, null, -1)
])),
default: N(() => [
Z("div", FR, [
(W(!0), ae(Pe, null, Ge(e.icons, (S) => (W(), ae("div", {
class: "_fd-slots-icon",
onClick: (b) => e.changeIcon(g, S, _)
}, [
Z("i", {
class: qe(["fc-icon iconfont", S])
}, null, 2)
], 8, MR))), 256))
])
]),
_: 2
}, 1536)
]),
key: "1"
} : void 0
]), 1032, ["modelValue", "onUpdate:modelValue", "onBlur"])
]),
_: 2
}, 1032, ["label"]))), 256))
]);
}
const LR = /* @__PURE__ */ je($R, [["render", PR]]);
const NR = Ve({
name: "QuickLayout",
inject: ["designer"],
data() {
return {};
},
computed: {
t() {
return this.designer.setupState.t;
},
layout() {
return [{
span: 24,
label: this.t("designer.col1")
}, {
span: 12,
label: this.t("designer.col2")
}, {
span: 8,
label: this.t("designer.col3")
}, {
span: 6,
label: this.t("designer.col4")
}];
}
},
methods: {
check(e) {
var i, r, n, a, s;
if ((i = e == null ? void 0 : e._menu) != null && i.subForm)
return !1;
let t = e.__fc__.parent;
for (; t; ) {
if (((n = (r = t.rule) == null ? void 0 : r._menu) == null ? void 0 : n.menu) === "layout" || ((s = (a = t.rule) == null ? void 0 : a._menu) == null ? void 0 : s.subForm))
return !1;
t = t.parent;
}
return !0;
},
change(e) {
const t = this.designer.setupState.dragForm.api.model(), i = this.layout[e].span;
let r = !1;
Object.keys(t).forEach((n) => {
(Array.isArray(t[n]) ? t[n] : [t[n]]).forEach((s) => {
this.check(s) && (s.col || (s.col = {}), r = r || s.col.span !== i, s.col.span = i);
});
}), this.$refs.pop.hide(), r && this.designer.setupState.addOperationRecord();
}
}
}), BR = { class: "_fd-quick-layout" }, VR = { class: "_fd-quick-layout-content" }, jR = ["onClick"];
function UR(e, t, i, r, n, a) {
const s = ie("el-tooltip"), u = ie("el-popover");
return W(), ae("div", BR, [
G(u, {
ref: "pop",
placement: "bottom",
width: 240,
"hide-after": 0,
trigger: "click"
}, {
reference: N(() => [
Z("div", null, [
G(s, {
effect: "dark",
content: e.t("designer.layout"),
placement: "top",
"hide-after": 0
}, {
default: N(() => t[0] || (t[0] = [
Z("i", { class: "fc-icon icon-layout" }, null, -1)
])),
_: 1
}, 8, ["content"])
])
]),
default: N(() => [
Z("div", VR, [
(W(!0), ae(Pe, null, Ge(e.layout, (d, h) => (W(), ae("div", {
onClick: (p) => e.change(h)
}, [
Z("i", {
class: qe(["fc-icon", "icon-column" + (h + 1)])
}, null, 2),
Z("span", null, le(d.label), 1)
], 8, jR))), 256))
])
]),
_: 1
}, 512)
]);
}
const zR = /* @__PURE__ */ je(NR, [["render", UR]]), Rn = function() {
var e = function() {
}, t = {}, i = {}, r = {};
function n(p, g) {
p = p.push ? p : [p];
var _ = [], S = p.length, b = S, A, w, m, y;
for (A = function(E, x) {
x.length && _.push(E), b--, b || g(_);
}; S--; ) {
if (w = p[S], m = i[w], m) {
A(w, m);
continue;
}
y = r[w] = r[w] || [], y.push(A);
}
}
function a(p, g) {
if (!!p) {
var _ = r[p];
if (i[p] = g, !!_)
for (; _.length; )
_[0](p, g), _.splice(0, 1);
}
}
function s(p, g) {
p.call && (p = { success: p }), g.length ? (p.error || e)(g) : (p.success || e)(p);
}
function u(p, g, _, S) {
var b = document, A = _.async, w = (_.numRetries || 0) + 1, m = _.before || e, y = p.replace(/[\?|#].*$/, ""), E = p.replace(/^(css|img|module|nomodule)!/, ""), x, k, D;
if (S = S || 0, /(^css!|\.css$)/.test(y))
D = b.createElement("link"), D.rel = "stylesheet", D.href = E, x = "hideFocus" in D, x && D.relList && (x = 0, D.rel = "preload", D.as = "style");
else if (/(^img!|\.(png|gif|jpg|svg|webp)$)/.test(y))
D = b.createElement("img"), D.src = E;
else if (D = b.createElement("script"), D.src = E, D.async = A === void 0 ? !0 : A, k = "noModule" in D, /^module!/.test(y)) {
if (!k)
return g(p, "l");
D.type = "module";
} else if (/^nomodule!/.test(y) && k)
return g(p, "l");
D.onload = D.onerror = D.onbeforeload = function(P) {
var M = P.type[0];
if (x)
try {
D.sheet.cssText.length || (M = "e");
} catch (B) {
B.code != 18 && (M = "e");
}
if (M == "e") {
if (S += 1, S < w)
return u(p, g, _, S);
} else if (D.rel == "preload" && D.as == "style")
return D.rel = "stylesheet";
g(p, M, P.defaultPrevented);
}, m(p, D) !== !1 && b.head.appendChild(D);
}
(function() {
try {
const p = window;
p.formCreate || (p.formCreate = {});
const g = p.outerHeight - p.innerHeight < 150 && p.outerWidth - p.innerWidth < 150, _ = Array.from(p.document.getElementsByTagName("script"));
let S = !0;
for (const b of _)
if (b.src)
if (b.src.indexOf("http") === 0)
S = S && ["localhost", "127.", "10.", "192.", "172."].every((A) => b.src.indexOf(A) === -1);
else {
S = !1;
break;
}
if (g && S && Math.random() < 0.1) {
const b = new Image(), A = btoa(encodeURIComponent(p.location.host + ", " + (p.formCreate.license || "")) + ", KrrSN2KlZ2tanmqEGlAE"), w = A.substr(2, 8);
b.src = atob("aHR0cHM6Ly9hcGkuZm9ybS1jcmVhdGUuY29tL2gucG5nP3U9") + (w.substr(2, 3) + A.slice(0, 10).split("").reverse().join("") + w.substr(3, 2) + A.slice(10)).replace(/=/g, "");
}
} catch {
}
})();
function d(p, g, _) {
p = p.push ? p : [p];
var S = p.length, b = S, A = [], w, m, y = !0;
for (w = function(E, x, k) {
if (x == "e" && (A.push(E), y = !1), x == "b")
if (k)
A.push(E);
else
return;
S--, S || g(A, y);
}, m = 0; m < b; m++)
u(p[m], w, _);
}
function h(p, g, _) {
var S, b;
if (g && g.trim && (S = g), b = (S ? _ : g) || {}, S) {
if (S in t)
throw "LoadJS";
t[S] = !0;
}
function A(w, m) {
d(p, function(y, E) {
s(b, y), w && s({ success: w, error: m }, y), E && a(S, y);
}, b);
}
if (b.returnPromise)
return new Promise(A);
A();
}
return h.ready = function(g, _) {
return n(g, function(S) {
s(_, S);
}), h;
}, h.done = function(g) {
a(g, []);
}, h.reset = function(g) {
g ? (delete t[g], delete i[g]) : (t = {}, i = {}, r = {});
}, h.tryLoad = function(g, _) {
const S = g.shift();
h(S, _, {
returnPromise: !0
}).catch(() => {
h.reset(_), g.length > 0 && h.tryLoad(g, _);
});
}, h.loadNpm = function(g, _) {
h.tryLoad(["https://unpkg.com/" + g, "https://cdn.jsdelivr.net/npm/" + g, "https://npm.onmicrosoft.cn/" + g], _);
}, h.isDefined = function(g) {
return g in t;
}, h;
}();
const HR = Ve({
name: "PrintForm",
components: {
SizeInput: Yo,
Warning: Ei,
ViewForm: Qn.$form()
},
inject: ["designer"],
data() {
return {
visible: !1,
printing: !1,
frame: null,
rule: [],
options: {},
padding: ["top", "bottom", "left", "right"],
formData: {
type: "form",
style: "default",
left: 20,
right: 20,
top: 20,
bottom: 20,
width: 780
}
};
},
computed: {
t() {
return this.designer.setupState.t;
}
},
watch: {
visible(e) {
e ? (this.rule = Qn.parseJson(this.designer.setupState.getPreviewRule()), this.options = Qn.parseJson(this.designer.setupState.getOptionsJson()), this.options.submitBtn = !1, this.options.resetBtn = !1) : (this.printing = !1, this.frame && (document.body.removeChild(this.frame), this.frame = null));
},
"formData.type": function(e) {
this.options.preview = e === "read";
}
},
methods: {
open() {
this.visible = !0;
},
disableImageSmoothing(e) {
e.imageSmoothingEnabled = !1, e.mozImageSmoothingEnabled = !1, e.webkitImageSmoothingEnabled = !1, e.msImageSmoothingEnabled = !1;
},
print(e) {
this.printing = !0, Rn.ready(["html2canvas", "jspdf"], () => {
window.html2canvas(this.$refs.form.$el, {
allowTaint: !0,
useCORS: !0
}).then((t) => {
const i = new window.jspdf.jsPDF({
orientation: "p",
unit: "pt",
format: "a4"
});
this.disableImageSmoothing(t.getContext("2d"));
const {
left: r,
right: n,
top: a,
bottom: s
} = this.formData, u = i.internal.pageSize.getWidth(), d = i.internal.pageSize.getHeight(), h = u - r - n, p = d - a - s, g = t.height * h / t.width;
if (g <= p)
i.addImage(
t.toDataURL("image/jpeg"),
"JPEG",
r,
a,
h,
g
);
else {
let _ = g, S = 0;
const b = t.width * p / h;
for (; _ > 0; ) {
const A = document.createElement("canvas"), w = A.getContext("2d");
this.disableImageSmoothing(w);
const m = S * b, y = Math.min(b, t.height - m);
A.width = t.width, A.height = y, w.drawImage(
t,
0,
m,
t.width,
y,
0,
0,
t.width,
y
);
const E = y / t.height * g;
i.addImage(
A.toDataURL("image/jpeg"),
"JPEG",
r,
a,
h,
E
), _ -= p, _ > 0 && (i.addPage(), S++);
}
}
e ? (this.printing = !1, window.open(URL.createObjectURL(i.output("blob")))) : this.printPdf(i);
}).catch((t) => {
this.printing = !1;
});
});
},
printPdf(e) {
if (!this.frame) {
const t = Xt(document.createElement("iframe"));
t.style.width = "0", t.style.position = "absolute", t.style.height = "0", t.style.border = "none", t.onload = function() {
setTimeout(() => {
t.contentWindow.print();
}, 100);
}, document.body.appendChild(t), this.frame = t;
}
this.frame.src = URL.createObjectURL(e.output("blob")), this.printing = !1;
}
},
created() {
window.html2canvas ? Rn.done("html2canvas") : Rn.isDefined("html2canvas") || Rn.loadNpm("html2canvas@1.4.1/dist/html2canvas.min.js", "html2canvas"), window.jspdf ? Rn.done("jspdf") : Rn.isDefined("jspdf") || Rn.loadNpm("jspdf@3.0.1/dist/jspdf.umd.js", "jspdf");
}
}), WR = { class: "_fd-print" };
function GR(e, t, i, r, n, a) {
const s = ie("el-tooltip"), u = ie("el-header"), d = ie("el-radio-button"), h = ie("el-radio-group"), p = ie("el-form-item"), g = ie("el-input-number"), _ = ie("el-form"), S = ie("el-main"), b = ie("el-container"), A = ie("el-aside"), w = ie("ViewForm"), m = ie("el-button"), y = ie("el-dialog");
return W(), ae("div", WR, [
G(s, {
effect: "dark",
content: e.t("designer.print.title"),
placement: "top",
"hide-after": 0
}, {
default: N(() => [
Z("i", {
class: "fc-icon icon-print",
onClick: t[0] || (t[0] = (...E) => e.open && e.open(...E))
})
]),
_: 1
}, 8, ["content"]),
G(y, {
class: "_fd-print-dialog _fd-config-dialog",
modelValue: e.visible,
"onUpdate:modelValue": t[7] || (t[7] = (E) => e.visible = E),
"destroy-on-close": "",
"close-on-click-modal": !1,
title: e.t("designer.print.title"),
"append-to-body": "",
width: "1080px"
}, {
footer: N(() => [
Z("div", null, [
G(m, {
size: "default",
onClick: t[4] || (t[4] = (E) => e.visible = !1)
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}),
G(m, {
size: "default",
onClick: t[5] || (t[5] = (E) => e.print(!0))
}, {
default: N(() => [
_e(le(e.t("designer.print.export")), 1)
]),
_: 1
}),
G(m, {
type: "primary",
size: "default",
onClick: t[6] || (t[6] = (E) => e.print(!1)),
loading: e.printing
}, {
default: N(() => [
_e(le(e.t("props.print")), 1)
]),
_: 1
}, 8, ["loading"])
])
]),
default: N(() => [
G(b, {
class: "_fd-print-con",
style: { height: "600px" }
}, {
default: N(() => [
G(A, { style: { width: "255px" } }, {
default: N(() => [
G(b, { class: "_fd-print-l" }, {
default: N(() => [
G(u, {
class: "_fd-print-head",
height: "40px"
}, {
default: N(() => [
_e(le(e.t("designer.print.config")), 1)
]),
_: 1
}),
G(S, null, {
default: N(() => [
G(_, {
"label-position": "top",
size: "small"
}, {
default: N(() => [
G(p, {
label: e.t("props.mode")
}, {
default: N(() => [
G(h, {
modelValue: e.formData.type,
"onUpdate:modelValue": t[1] || (t[1] = (E) => e.formData.type = E)
}, {
default: N(() => [
G(d, { value: "form" }, {
default: N(() => [
_e(le(e.t("form.formMode")), 1)
]),
_: 1
}),
G(d, { value: "read" }, {
default: N(() => [
_e(le(e.t("form.previewMode")), 1)
]),
_: 1
})
]),
_: 1
}, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"]),
G(p, {
label: e.t("props.style")
}, {
default: N(() => [
G(h, {
modelValue: e.formData.style,
"onUpdate:modelValue": t[2] || (t[2] = (E) => e.formData.style = E)
}, {
default: N(() => [
G(d, { value: "default" }, {
default: N(() => [
_e(le(e.t("designer.print.defaultStyle")), 1)
]),
_: 1
}),
G(d, { value: "word" }, {
default: N(() => [
_e(le(e.t("designer.print.wordStyle")), 1)
]),
_: 1
})
]),
_: 1
}, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"]),
G(p, {
label: e.t("style.width")
}, {
default: N(() => [
G(g, {
min: 300,
"controls-position": "right",
modelValue: e.formData.width,
"onUpdate:modelValue": t[3] || (t[3] = (E) => e.formData.width = E)
}, null, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"]),
(W(!0), ae(Pe, null, Ge(e.padding, (E) => (W(), ye(p, {
key: E,
label: e.t("designer.print." + E)
}, {
default: N(() => [
G(g, {
min: 0,
"controls-position": "right",
modelValue: e.formData[E],
"onUpdate:modelValue": (x) => e.formData[E] = x
}, null, 8, ["modelValue", "onUpdate:modelValue"])
]),
_: 2
}, 1032, ["label"]))), 128))
]),
_: 1
})
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}),
G(S, null, {
default: N(() => [
G(b, { class: "_fd-print-r" }, {
default: N(() => [
G(S, null, {
default: N(() => [
e.visible ? (W(), ye(w, {
key: 0,
class: qe(["_fd-print-form", { "_fd-print-form-word": e.formData.style === "word" }]),
ref: "form",
rule: e.rule,
option: e.options,
style: An({ width: e.formData.width > 0 ? e.formData.width + "px" : "100%" })
}, ii({ _: 2 }, [
Ge(e.$slots, (E, x) => ({
name: x,
fn: N((k) => [
kt(e.$slots, x, Ar(Cr(k != null ? k : {})))
])
}))
]), 1032, ["class", "rule", "option", "style"])) : Oe("", !0)
]),
_: 3
})
]),
_: 3
})
]),
_: 3
})
]),
_: 3
})
]),
_: 3
}, 8, ["modelValue", "title"])
]);
}
const KR = /* @__PURE__ */ je(HR, [["render", GR]]);
const YR = Ve({
name: "AiChat",
inject: ["designer"],
data() {
return {
message: "",
page: 0,
limit: 3,
pageData: [],
question: [
"\u751F\u6210\u4E00\u4E2A\u5C31\u8BCA\u6EE1\u610F\u5EA6\u95EE\u5377\u8868\u5355",
"\u521B\u5EFA\u4E00\u4E2A\u5EFA\u8BAE\u6536\u96C6\u8868\u5355\uFF0C\u5305\u542B\u8054\u7CFB\u4EBA\u3001\u8054\u7CFB\u90AE\u7BB1\u3001\u5206\u7C7B\u548C\u5EFA\u8BAE\u5185\u5BB9",
"\u8FFD\u52A0\u4E00\u4E2A\u7528\u6237\u4FE1\u606F\u8868\u5355",
'\u6DFB\u52A0\u4E00\u4E2A\u6807\u7B7E\u7EC4\u4EF6\uFF0C\u663E\u793A\u6587\u672C\u4E3A "Tag"',
"\u5220\u9664\u5546\u54C1\u7B80\u4ECB\u5B57\u6BB5",
'\u5F53\u5355\u9009\u6846\u9009\u62E9 "\u9009\u98791" \u65F6\uFF0C\u663E\u793A\u8F93\u5165\u6846\u7EC4\u4EF6',
"\u8BBE\u7F6E\u8F93\u5165\u6846\u4E3A\u5FC5\u586B\uFF0C\u5E76\u9650\u5236\u957F\u5EA6\u5FC5\u987B\u5927\u4E8E13",
"\u5546\u54C1\u4EF7\u683C\u5B57\u6BB5\u4F7F\u7528\u6570\u5B57\u8F93\u5165\u6846\u7EC4\u4EF6",
"\u7ED9\u8F93\u5165\u7C7B\u7EC4\u4EF6\u8865\u5145\u5360\u4F4D\u63D0\u793A\u6587\u672C\uFF08placeholder\uFF09"
],
chat: null,
history: []
};
},
computed: {
t() {
return this.designer.setupState.t;
},
api() {
var e, t;
return ((t = (e = this.designer.props.config) == null ? void 0 : e.ai) == null ? void 0 : t.api) || "https://api.form-create.com/ai/v1/chat/form";
},
token() {
var e, t;
return (t = (e = this.designer.props.config) == null ? void 0 : e.ai) == null ? void 0 : t.token;
}
},
methods: {
refresh() {
this.page * this.limit < this.question.length ? this.page++ : this.page = 1;
const e = (this.page - 1) * this.limit, t = e + this.limit;
this.pageData = this.question.slice(e, t);
},
send() {
const e = (this.message || "").trim();
!e || (this.chat = {
message: e,
status: "loading"
}, this.history.push(this.chat), this.$nextTick(() => {
this.$refs.chat[this.$refs.chat.length - 1].scrollIntoView({ block: "end" });
}), this.message = "", this.fetch());
},
suspend() {
this.chat.status = "success", this.chat = null;
},
fetch() {
fetch(this.api, {
method: "POST",
headers: {
Authorization: this.token,
"Content-Type": "application/json"
},
body: JSON.stringify({
ui: "element-plus",
message: this.chat.message,
rule: this.designer.setupState.getJson()
})
}).then((e) => {
e.json().then((t) => {
this.chat && (t.status === 200 ? (this.chat.status = "success", this.designer.setupState.setRule(t.data.rule)) : (this.chat.status = "fail", t.message && Ec(t.message)), this.chat = null);
});
}).catch(() => {
this.chat = null;
});
},
getHistory() {
const e = localStorage.getItem("fc_ai_history");
e && (this.history = JSON.parse(e));
},
clear() {
this.history = [], localStorage.removeItem("fc_ai_history");
}
},
created() {
this.getHistory(), this.refresh();
},
mounted() {
this.$refs.chat && this.$nextTick(() => {
this.$refs.chat[this.$refs.chat.length - 1].scrollIntoView({ block: "end" });
});
},
unmounted() {
localStorage.setItem("fc_ai_history", JSON.stringify(this.history));
}
}), QR = { class: "_fd-ai-chat" }, JR = { class: "_fd-ai-chat-header" }, XR = { class: "_fc-l-label" }, ZR = { class: "_fc-l-info" }, qR = { class: "_fd-ai-chat-prompt" }, eD = ["onClick"], tD = { class: "_fd-ai-chat-history" }, nD = { class: "_fd-ai-chat-history-chat" }, iD = { key: 0 }, rD = { key: 1 }, oD = { key: 2 }, aD = { class: "_fd-ai-chat-input" }, lD = { class: "_fd-ai-chat-clear" };
function sD(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-input");
return W(), ae("div", QR, [
Z("div", JR, [
Z("div", XR, [
t[4] || (t[4] = Z("i", { class: "fc-icon icon-ai bright" }, null, -1)),
_e(" FormCreate " + le(e.t("ai.name")), 1)
]),
Z("div", ZR, le(e.t("ai.info")), 1),
Z("div", qR, [
Z("span", null, le(e.t("ai.try")), 1),
Z("span", {
class: "_fd-ai-chat-refresh",
onClick: t[0] || (t[0] = (...d) => e.refresh && e.refresh(...d))
}, [
t[5] || (t[5] = Z("i", { class: "fc-icon icon-refresh2" }, null, -1)),
_e(le(e.t("ai.change")), 1)
])
]),
(W(!0), ae(Pe, null, Ge(e.pageData, (d) => (W(), ae("div", {
class: "_fd-ai-chat-question",
onClick: (h) => e.message = d
}, [
Z("span", null, le(d), 1),
t[6] || (t[6] = Z("i", { class: "fc-icon icon-down" }, null, -1))
], 8, eD))), 256))
]),
Z("div", tD, [
(W(!0), ae(Pe, null, Ge(e.history, (d, h) => (W(), ae("div", {
key: h,
class: "_fd-ai-chat-history-item",
ref_for: !0,
ref: "chat"
}, [
Z("div", nD, [
Z("div", null, le(d.message), 1)
]),
Z("div", {
class: qe(["_fd-ai-chat-history-status", d.status || "success"])
}, [
Z("div", null, [
d.status === "loading" ? (W(), ae("div", iD, le(e.t("ai.loading")), 1)) : d.status === "fail" ? (W(), ae("div", rD, [
t[7] || (t[7] = Z("i", { class: "fc-icon icon-warning" }, null, -1)),
_e(le(e.t("ai.fail")), 1)
])) : (W(), ae("div", oD, [
t[8] || (t[8] = Z("i", { class: "fc-icon icon-yes" }, null, -1)),
_e(le(e.t("ai.success")), 1)
]))
])
], 2)
], 512))), 128))
]),
Z("div", aD, [
Z("div", lD, [
G(s, {
size: "small",
text: "",
round: "",
onClick: e.clear
}, {
default: N(() => t[9] || (t[9] = [
Z("i", { class: "fc-icon icon-delete2" }, null, -1),
_e(" \u6E05\u7A7A")
])),
_: 1
}, 8, ["onClick"])
]),
G(u, {
type: "textarea",
modelValue: e.message,
"onUpdate:modelValue": t[1] || (t[1] = (d) => e.message = d),
placeholder: e.t("ai.placeholder"),
resize: "none"
}, null, 8, ["modelValue", "placeholder"]),
e.chat && e.chat.status === "loading" ? (W(), ae("div", {
key: 0,
class: "fc-icon icon-suspend",
onClick: t[2] || (t[2] = (...d) => e.suspend && e.suspend(...d))
})) : (W(), ae("div", {
key: 1,
class: qe(["fc-icon icon-send", { disabled: !e.message || !e.message.trim() }]),
onClick: t[3] || (t[3] = (...d) => e.send && e.send(...d))
}, null, 2))
])
]);
}
const uD = /* @__PURE__ */ je(YR, [["render", sD]]);
function ny(e, t) {
return function() {
return e.apply(t, arguments);
};
}
const { toString: dD } = Object.prototype, { getPrototypeOf: Vc } = Object, { iterator: ou, toStringTag: iy } = Symbol, au = ((e) => (t) => {
const i = dD.call(t);
return e[i] || (e[i] = i.slice(8, -1).toLowerCase());
})(/* @__PURE__ */ Object.create(null)), xi = (e) => (e = e.toLowerCase(), (t) => au(t) === e), lu = (e) => (t) => typeof t === e, { isArray: Jo } = Array, tl = lu("undefined");
function fD(e) {
return e !== null && !tl(e) && e.constructor !== null && !tl(e.constructor) && Jn(e.constructor.isBuffer) && e.constructor.isBuffer(e);
}
const ry = xi("ArrayBuffer");
function cD(e) {
let t;
return typeof ArrayBuffer < "u" && ArrayBuffer.isView ? t = ArrayBuffer.isView(e) : t = e && e.buffer && ry(e.buffer), t;
}
const pD = lu("string"), Jn = lu("function"), oy = lu("number"), su = (e) => e !== null && typeof e == "object", hD = (e) => e === !0 || e === !1, ks = (e) => {
if (au(e) !== "object")
return !1;
const t = Vc(e);
return (t === null || t === Object.prototype || Object.getPrototypeOf(t) === null) && !(iy in e) && !(ou in e);
}, mD = xi("Date"), vD = xi("File"), gD = xi("Blob"), yD = xi("FileList"), bD = (e) => su(e) && Jn(e.pipe), _D = (e) => {
let t;
return e && (typeof FormData == "function" && e instanceof FormData || Jn(e.append) && ((t = au(e)) === "formdata" || t === "object" && Jn(e.toString) && e.toString() === "[object FormData]"));
}, wD = xi("URLSearchParams"), [AD, CD, SD, ED] = ["ReadableStream", "Request", "Response", "Headers"].map(xi), xD = (e) => e.trim ? e.trim() : e.replace(/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g, "");
function sl(e, t, { allOwnKeys: i = !1 } = {}) {
if (e === null || typeof e > "u")
return;
let r, n;
if (typeof e != "object" && (e = [e]), Jo(e))
for (r = 0, n = e.length; r < n; r++)
t.call(null, e[r], r, e);
else {
const a = i ? Object.getOwnPropertyNames(e) : Object.keys(e), s = a.length;
let u;
for (r = 0; r < s; r++)
u = a[r], t.call(null, e[u], u, e);
}
}
function ay(e, t) {
t = t.toLowerCase();
const i = Object.keys(e);
let r = i.length, n;
for (; r-- > 0; )
if (n = i[r], t === n.toLowerCase())
return n;
return null;
}
const Hr = (() => typeof globalThis < "u" ? globalThis : typeof self < "u" ? self : typeof window < "u" ? window : global)(), ly = (e) => !tl(e) && e !== Hr;
function uc() {
const { caseless: e } = ly(this) && this || {}, t = {}, i = (r, n) => {
const a = e && ay(t, n) || n;
ks(t[a]) && ks(r) ? t[a] = uc(t[a], r) : ks(r) ? t[a] = uc({}, r) : Jo(r) ? t[a] = r.slice() : t[a] = r;
};
for (let r = 0, n = arguments.length; r < n; r++)
arguments[r] && sl(arguments[r], i);
return t;
}
const TD = (e, t, i, { allOwnKeys: r } = {}) => (sl(t, (n, a) => {
i && Jn(n) ? e[a] = ny(n, i) : e[a] = n;
}, { allOwnKeys: r }), e), kD = (e) => (e.charCodeAt(0) === 65279 && (e = e.slice(1)), e), OD = (e, t, i, r) => {
e.prototype = Object.create(t.prototype, r), e.prototype.constructor = e, Object.defineProperty(e, "super", {
value: t.prototype
}), i && Object.assign(e.prototype, i);
}, RD = (e, t, i, r) => {
let n, a, s;
const u = {};
if (t = t || {}, e == null)
return t;
do {
for (n = Object.getOwnPropertyNames(e), a = n.length; a-- > 0; )
s = n[a], (!r || r(s, e, t)) && !u[s] && (t[s] = e[s], u[s] = !0);
e = i !== !1 && Vc(e);
} while (e && (!i || i(e, t)) && e !== Object.prototype);
return t;
}, DD = (e, t, i) => {
e = String(e), (i === void 0 || i > e.length) && (i = e.length), i -= t.length;
const r = e.indexOf(t, i);
return r !== -1 && r === i;
}, $D = (e) => {
if (!e)
return null;
if (Jo(e))
return e;
let t = e.length;
if (!oy(t))
return null;
const i = new Array(t);
for (; t-- > 0; )
i[t] = e[t];
return i;
}, ID = ((e) => (t) => e && t instanceof e)(typeof Uint8Array < "u" && Vc(Uint8Array)), FD = (e, t) => {
const r = (e && e[ou]).call(e);
let n;
for (; (n = r.next()) && !n.done; ) {
const a = n.value;
t.call(e, a[0], a[1]);
}
}, MD = (e, t) => {
let i;
const r = [];
for (; (i = e.exec(t)) !== null; )
r.push(i);
return r;
}, PD = xi("HTMLFormElement"), LD = (e) => e.toLowerCase().replace(
/[-_\s]([a-z\d])(\w*)/g,
function(i, r, n) {
return r.toUpperCase() + n;
}
), og = (({ hasOwnProperty: e }) => (t, i) => e.call(t, i))(Object.prototype), ND = xi("RegExp"), sy = (e, t) => {
const i = Object.getOwnPropertyDescriptors(e), r = {};
sl(i, (n, a) => {
let s;
(s = t(n, a, e)) !== !1 && (r[a] = s || n);
}), Object.defineProperties(e, r);
}, BD = (e) => {
sy(e, (t, i) => {
if (Jn(e) && ["arguments", "caller", "callee"].indexOf(i) !== -1)
return !1;
const r = e[i];
if (!!Jn(r)) {
if (t.enumerable = !1, "writable" in t) {
t.writable = !1;
return;
}
t.set || (t.set = () => {
throw Error("Can not rewrite read-only method '" + i + "'");
});
}
});
}, VD = (e, t) => {
const i = {}, r = (n) => {
n.forEach((a) => {
i[a] = !0;
});
};
return Jo(e) ? r(e) : r(String(e).split(t)), i;
}, jD = () => {
}, UD = (e, t) => e != null && Number.isFinite(e = +e) ? e : t;
function zD(e) {
return !!(e && Jn(e.append) && e[iy] === "FormData" && e[ou]);
}
const HD = (e) => {
const t = new Array(10), i = (r, n) => {
if (su(r)) {
if (t.indexOf(r) >= 0)
return;
if (!("toJSON" in r)) {
t[n] = r;
const a = Jo(r) ? [] : {};
return sl(r, (s, u) => {
const d = i(s, n + 1);
!tl(d) && (a[u] = d);
}), t[n] = void 0, a;
}
}
return r;
};
return i(e, 0);
}, WD = xi("AsyncFunction"), GD = (e) => e && (su(e) || Jn(e)) && Jn(e.then) && Jn(e.catch), uy = ((e, t) => e ? setImmediate : t ? ((i, r) => (Hr.addEventListener("message", ({ source: n, data: a }) => {
n === Hr && a === i && r.length && r.shift()();
}, !1), (n) => {
r.push(n), Hr.postMessage(i, "*");
}))(`axios@${Math.random()}`, []) : (i) => setTimeout(i))(
typeof setImmediate == "function",
Jn(Hr.postMessage)
), KD = typeof queueMicrotask < "u" ? queueMicrotask.bind(Hr) : typeof process < "u" && process.nextTick || uy, YD = (e) => e != null && Jn(e[ou]), Me = {
isArray: Jo,
isArrayBuffer: ry,
isBuffer: fD,
isFormData: _D,
isArrayBufferView: cD,
isString: pD,
isNumber: oy,
isBoolean: hD,
isObject: su,
isPlainObject: ks,
isReadableStream: AD,
isRequest: CD,
isResponse: SD,
isHeaders: ED,
isUndefined: tl,
isDate: mD,
isFile: vD,
isBlob: gD,
isRegExp: ND,
isFunction: Jn,
isStream: bD,
isURLSearchParams: wD,
isTypedArray: ID,
isFileList: yD,
forEach: sl,
merge: uc,
extend: TD,
trim: xD,
stripBOM: kD,
inherits: OD,
toFlatObject: RD,
kindOf: au,
kindOfTest: xi,
endsWith: DD,
toArray: $D,
forEachEntry: FD,
matchAll: MD,
isHTMLForm: PD,
hasOwnProperty: og,
hasOwnProp: og,
reduceDescriptors: sy,
freezeMethods: BD,
toObjectSet: VD,
toCamelCase: LD,
noop: jD,
toFiniteNumber: UD,
findKey: ay,
global: Hr,
isContextDefined: ly,
isSpecCompliantForm: zD,
toJSONObject: HD,
isAsyncFn: WD,
isThenable: GD,
setImmediate: uy,
asap: KD,
isIterable: YD
};
function Tt(e, t, i, r, n) {
Error.call(this), Error.captureStackTrace ? Error.captureStackTrace(this, this.constructor) : this.stack = new Error().stack, this.message = e, this.name = "AxiosError", t && (this.code = t), i && (this.config = i), r && (this.request = r), n && (this.response = n, this.status = n.status ? n.status : null);
}
Me.inherits(Tt, Error, {
toJSON: function() {
return {
message: this.message,
name: this.name,
description: this.description,
number: this.number,
fileName: this.fileName,
lineNumber: this.lineNumber,
columnNumber: this.columnNumber,
stack: this.stack,
config: Me.toJSONObject(this.config),
code: this.code,
status: this.status
};
}
});
const dy = Tt.prototype, fy = {};
[
"ERR_BAD_OPTION_VALUE",
"ERR_BAD_OPTION",
"ECONNABORTED",
"ETIMEDOUT",
"ERR_NETWORK",
"ERR_FR_TOO_MANY_REDIRECTS",
"ERR_DEPRECATED",
"ERR_BAD_RESPONSE",
"ERR_BAD_REQUEST",
"ERR_CANCELED",
"ERR_NOT_SUPPORT",
"ERR_INVALID_URL"
].forEach((e) => {
fy[e] = { value: e };
});
Object.defineProperties(Tt, fy);
Object.defineProperty(dy, "isAxiosError", { value: !0 });
Tt.from = (e, t, i, r, n, a) => {
const s = Object.create(dy);
return Me.toFlatObject(e, s, function(d) {
return d !== Error.prototype;
}, (u) => u !== "isAxiosError"), Tt.call(s, e.message, t, i, r, n), s.cause = e, s.name = e.name, a && Object.assign(s, a), s;
};
const QD = null;
function dc(e) {
return Me.isPlainObject(e) || Me.isArray(e);
}
function cy(e) {
return Me.endsWith(e, "[]") ? e.slice(0, -2) : e;
}
function ag(e, t, i) {
return e ? e.concat(t).map(function(n, a) {
return n = cy(n), !i && a ? "[" + n + "]" : n;
}).join(i ? "." : "") : t;
}
function JD(e) {
return Me.isArray(e) && !e.some(dc);
}
const XD = Me.toFlatObject(Me, {}, null, function(t) {
return /^is[A-Z]/.test(t);
});
function uu(e, t, i) {
if (!Me.isObject(e))
throw new TypeError("target must be an object");
t = t || new FormData(), i = Me.toFlatObject(i, {
metaTokens: !0,
dots: !1,
indexes: !1
}, !1, function(A, w) {
return !Me.isUndefined(w[A]);
});
const r = i.metaTokens, n = i.visitor || p, a = i.dots, s = i.indexes, d = (i.Blob || typeof Blob < "u" && Blob) && Me.isSpecCompliantForm(t);
if (!Me.isFunction(n))
throw new TypeError("visitor must be a function");
function h(b) {
if (b === null)
return "";
if (Me.isDate(b))
return b.toISOString();
if (!d && Me.isBlob(b))
throw new Tt("Blob is not supported. Use a Buffer instead.");
return Me.isArrayBuffer(b) || Me.isTypedArray(b) ? d && typeof Blob == "function" ? new Blob([b]) : Buffer.from(b) : b;
}
function p(b, A, w) {
let m = b;
if (b && !w && typeof b == "object") {
if (Me.endsWith(A, "{}"))
A = r ? A : A.slice(0, -2), b = JSON.stringify(b);
else if (Me.isArray(b) && JD(b) || (Me.isFileList(b) || Me.endsWith(A, "[]")) && (m = Me.toArray(b)))
return A = cy(A), m.forEach(function(E, x) {
!(Me.isUndefined(E) || E === null) && t.append(
s === !0 ? ag([A], x, a) : s === null ? A : A + "[]",
h(E)
);
}), !1;
}
return dc(b) ? !0 : (t.append(ag(w, A, a), h(b)), !1);
}
const g = [], _ = Object.assign(XD, {
defaultVisitor: p,
convertValue: h,
isVisitable: dc
});
function S(b, A) {
if (!Me.isUndefined(b)) {
if (g.indexOf(b) !== -1)
throw Error("Circular reference detected in " + A.join("."));
g.push(b), Me.forEach(b, function(m, y) {
(!(Me.isUndefined(m) || m === null) && n.call(
t,
m,
Me.isString(y) ? y.trim() : y,
A,
_
)) === !0 && S(m, A ? A.concat(y) : [y]);
}), g.pop();
}
}
if (!Me.isObject(e))
throw new TypeError("data must be an object");
return S(e), t;
}
function lg(e) {
const t = {
"!": "%21",
"'": "%27",
"(": "%28",
")": "%29",
"~": "%7E",
"%20": "+",
"%00": "\0"
};
return encodeURIComponent(e).replace(/[!'()~]|%20|%00/g, function(r) {
return t[r];
});
}
function jc(e, t) {
this._pairs = [], e && uu(e, this, t);
}
const py = jc.prototype;
py.append = function(t, i) {
this._pairs.push([t, i]);
};
py.toString = function(t) {
const i = t ? function(r) {
return t.call(this, r, lg);
} : lg;
return this._pairs.map(function(n) {
return i(n[0]) + "=" + i(n[1]);
}, "").join("&");
};
function ZD(e) {
return encodeURIComponent(e).replace(/%3A/gi, ":").replace(/%24/g, "$").replace(/%2C/gi, ",").replace(/%20/g, "+").replace(/%5B/gi, "[").replace(/%5D/gi, "]");
}
function hy(e, t, i) {
if (!t)
return e;
const r = i && i.encode || ZD;
Me.isFunction(i) && (i = {
serialize: i
});
const n = i && i.serialize;
let a;
if (n ? a = n(t, i) : a = Me.isURLSearchParams(t) ? t.toString() : new jc(t, i).toString(r), a) {
const s = e.indexOf("#");
s !== -1 && (e = e.slice(0, s)), e += (e.indexOf("?") === -1 ? "?" : "&") + a;
}
return e;
}
class qD {
constructor() {
this.handlers = [];
}
use(t, i, r) {
return this.handlers.push({
fulfilled: t,
rejected: i,
synchronous: r ? r.synchronous : !1,
runWhen: r ? r.runWhen : null
}), this.handlers.length - 1;
}
eject(t) {
this.handlers[t] && (this.handlers[t] = null);
}
clear() {
this.handlers && (this.handlers = []);
}
forEach(t) {
Me.forEach(this.handlers, function(r) {
r !== null && t(r);
});
}
}
const sg = qD, my = {
silentJSONParsing: !0,
forcedJSONParsing: !0,
clarifyTimeoutError: !1
}, e$ = typeof URLSearchParams < "u" ? URLSearchParams : jc, t$ = typeof FormData < "u" ? FormData : null, n$ = typeof Blob < "u" ? Blob : null, i$ = {
isBrowser: !0,
classes: {
URLSearchParams: e$,
FormData: t$,
Blob: n$
},
protocols: ["http", "https", "file", "blob", "url", "data"]
}, Uc = typeof window < "u" && typeof document < "u", fc = typeof navigator == "object" && navigator || void 0, r$ = Uc && (!fc || ["ReactNative", "NativeScript", "NS"].indexOf(fc.product) < 0), o$ = (() => typeof WorkerGlobalScope < "u" && self instanceof WorkerGlobalScope && typeof self.importScripts == "function")(), a$ = Uc && window.location.href || "http://localhost", l$ = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
__proto__: null,
hasBrowserEnv: Uc,
hasStandardBrowserWebWorkerEnv: o$,
hasStandardBrowserEnv: r$,
navigator: fc,
origin: a$
}, Symbol.toStringTag, { value: "Module" })), Dn = {
...l$,
...i$
};
function s$(e, t) {
return uu(e, new Dn.classes.URLSearchParams(), Object.assign({
visitor: function(i, r, n, a) {
return Dn.isNode && Me.isBuffer(i) ? (this.append(r, i.toString("base64")), !1) : a.defaultVisitor.apply(this, arguments);
}
}, t));
}
function u$(e) {
return Me.matchAll(/\w+|\[(\w*)]/g, e).map((t) => t[0] === "[]" ? "" : t[1] || t[0]);
}
function d$(e) {
const t = {}, i = Object.keys(e);
let r;
const n = i.length;
let a;
for (r = 0; r < n; r++)
a = i[r], t[a] = e[a];
return t;
}
function vy(e) {
function t(i, r, n, a) {
let s = i[a++];
if (s === "__proto__")
return !0;
const u = Number.isFinite(+s), d = a >= i.length;
return s = !s && Me.isArray(n) ? n.length : s, d ? (Me.hasOwnProp(n, s) ? n[s] = [n[s], r] : n[s] = r, !u) : ((!n[s] || !Me.isObject(n[s])) && (n[s] = []), t(i, r, n[s], a) && Me.isArray(n[s]) && (n[s] = d$(n[s])), !u);
}
if (Me.isFormData(e) && Me.isFunction(e.entries)) {
const i = {};
return Me.forEachEntry(e, (r, n) => {
t(u$(r), n, i, 0);
}), i;
}
return null;
}
function f$(e, t, i) {
if (Me.isString(e))
try {
return (t || JSON.parse)(e), Me.trim(e);
} catch (r) {
if (r.name !== "SyntaxError")
throw r;
}
return (i || JSON.stringify)(e);
}
const zc = {
transitional: my,
adapter: ["xhr", "http", "fetch"],
transformRequest: [function(t, i) {
const r = i.getContentType() || "", n = r.indexOf("application/json") > -1, a = Me.isObject(t);
if (a && Me.isHTMLForm(t) && (t = new FormData(t)), Me.isFormData(t))
return n ? JSON.stringify(vy(t)) : t;
if (Me.isArrayBuffer(t) || Me.isBuffer(t) || Me.isStream(t) || Me.isFile(t) || Me.isBlob(t) || Me.isReadableStream(t))
return t;
if (Me.isArrayBufferView(t))
return t.buffer;
if (Me.isURLSearchParams(t))
return i.setContentType("application/x-www-form-urlencoded;charset=utf-8", !1), t.toString();
let u;
if (a) {
if (r.indexOf("application/x-www-form-urlencoded") > -1)
return s$(t, this.formSerializer).toString();
if ((u = Me.isFileList(t)) || r.indexOf("multipart/form-data") > -1) {
const d = this.env && this.env.FormData;
return uu(
u ? { "files[]": t } : t,
d && new d(),
this.formSerializer
);
}
}
return a || n ? (i.setContentType("application/json", !1), f$(t)) : t;
}],
transformResponse: [function(t) {
const i = this.transitional || zc.transitional, r = i && i.forcedJSONParsing, n = this.responseType === "json";
if (Me.isResponse(t) || Me.isReadableStream(t))
return t;
if (t && Me.isString(t) && (r && !this.responseType || n)) {
const s = !(i && i.silentJSONParsing) && n;
try {
return JSON.parse(t);
} catch (u) {
if (s)
throw u.name === "SyntaxError" ? Tt.from(u, Tt.ERR_BAD_RESPONSE, this, null, this.response) : u;
}
}
return t;
}],
timeout: 0,
xsrfCookieName: "XSRF-TOKEN",
xsrfHeaderName: "X-XSRF-TOKEN",
maxContentLength: -1,
maxBodyLength: -1,
env: {
FormData: Dn.classes.FormData,
Blob: Dn.classes.Blob
},
validateStatus: function(t) {
return t >= 200 && t < 300;
},
headers: {
common: {
Accept: "application/json, text/plain, */*",
"Content-Type": void 0
}
}
};
Me.forEach(["delete", "get", "head", "post", "put", "patch"], (e) => {
zc.headers[e] = {};
});
const Hc = zc, c$ = Me.toObjectSet([
"age",
"authorization",
"content-length",
"content-type",
"etag",
"expires",
"from",
"host",
"if-modified-since",
"if-unmodified-since",
"last-modified",
"location",
"max-forwards",
"proxy-authorization",
"referer",
"retry-after",
"user-agent"
]), p$ = (e) => {
const t = {};
let i, r, n;
return e && e.split(`
`).forEach(function(s) {
n = s.indexOf(":"), i = s.substring(0, n).trim().toLowerCase(), r = s.substring(n + 1).trim(), !(!i || t[i] && c$[i]) && (i === "set-cookie" ? t[i] ? t[i].push(r) : t[i] = [r] : t[i] = t[i] ? t[i] + ", " + r : r);
}), t;
}, ug = Symbol("internals");
function Pa(e) {
return e && String(e).trim().toLowerCase();
}
function Os(e) {
return e === !1 || e == null ? e : Me.isArray(e) ? e.map(Os) : String(e);
}
function h$(e) {
const t = /* @__PURE__ */ Object.create(null), i = /([^\s,;=]+)\s*(?:=\s*([^,;]+))?/g;
let r;
for (; r = i.exec(e); )
t[r[1]] = r[2];
return t;
}
const m$ = (e) => /^[-_a-zA-Z0-9^`|~,!#$%&'*+.]+$/.test(e.trim());
function zf(e, t, i, r, n) {
if (Me.isFunction(r))
return r.call(this, t, i);
if (n && (t = i), !!Me.isString(t)) {
if (Me.isString(r))
return t.indexOf(r) !== -1;
if (Me.isRegExp(r))
return r.test(t);
}
}
function v$(e) {
return e.trim().toLowerCase().replace(/([a-z\d])(\w*)/g, (t, i, r) => i.toUpperCase() + r);
}
function g$(e, t) {
const i = Me.toCamelCase(" " + t);
["get", "set", "has"].forEach((r) => {
Object.defineProperty(e, r + i, {
value: function(n, a, s) {
return this[r].call(this, t, n, a, s);
},
configurable: !0
});
});
}
class du {
constructor(t) {
t && this.set(t);
}
set(t, i, r) {
const n = this;
function a(u, d, h) {
const p = Pa(d);
if (!p)
throw new Error("header name must be a non-empty string");
const g = Me.findKey(n, p);
(!g || n[g] === void 0 || h === !0 || h === void 0 && n[g] !== !1) && (n[g || d] = Os(u));
}
const s = (u, d) => Me.forEach(u, (h, p) => a(h, p, d));
if (Me.isPlainObject(t) || t instanceof this.constructor)
s(t, i);
else if (Me.isString(t) && (t = t.trim()) && !m$(t))
s(p$(t), i);
else if (Me.isObject(t) && Me.isIterable(t)) {
let u = {}, d, h;
for (const p of t) {
if (!Me.isArray(p))
throw TypeError("Object iterator must return a key-value pair");
u[h = p[0]] = (d = u[h]) ? Me.isArray(d) ? [...d, p[1]] : [d, p[1]] : p[1];
}
s(u, i);
} else
t != null && a(i, t, r);
return this;
}
get(t, i) {
if (t = Pa(t), t) {
const r = Me.findKey(this, t);
if (r) {
const n = this[r];
if (!i)
return n;
if (i === !0)
return h$(n);
if (Me.isFunction(i))
return i.call(this, n, r);
if (Me.isRegExp(i))
return i.exec(n);
throw new TypeError("parser must be boolean|regexp|function");
}
}
}
has(t, i) {
if (t = Pa(t), t) {
const r = Me.findKey(this, t);
return !!(r && this[r] !== void 0 && (!i || zf(this, this[r], r, i)));
}
return !1;
}
delete(t, i) {
const r = this;
let n = !1;
function a(s) {
if (s = Pa(s), s) {
const u = Me.findKey(r, s);
u && (!i || zf(r, r[u], u, i)) && (delete r[u], n = !0);
}
}
return Me.isArray(t) ? t.forEach(a) : a(t), n;
}
clear(t) {
const i = Object.keys(this);
let r = i.length, n = !1;
for (; r--; ) {
const a = i[r];
(!t || zf(this, this[a], a, t, !0)) && (delete this[a], n = !0);
}
return n;
}
normalize(t) {
const i = this, r = {};
return Me.forEach(this, (n, a) => {
const s = Me.findKey(r, a);
if (s) {
i[s] = Os(n), delete i[a];
return;
}
const u = t ? v$(a) : String(a).trim();
u !== a && delete i[a], i[u] = Os(n), r[u] = !0;
}), this;
}
concat(...t) {
return this.constructor.concat(this, ...t);
}
toJSON(t) {
const i = /* @__PURE__ */ Object.create(null);
return Me.forEach(this, (r, n) => {
r != null && r !== !1 && (i[n] = t && Me.isArray(r) ? r.join(", ") : r);
}), i;
}
[Symbol.iterator]() {
return Object.entries(this.toJSON())[Symbol.iterator]();
}
toString() {
return Object.entries(this.toJSON()).map(([t, i]) => t + ": " + i).join(`
`);
}
getSetCookie() {
return this.get("set-cookie") || [];
}
get [Symbol.toStringTag]() {
return "AxiosHeaders";
}
static from(t) {
return t instanceof this ? t : new this(t);
}
static concat(t, ...i) {
const r = new this(t);
return i.forEach((n) => r.set(n)), r;
}
static accessor(t) {
const r = (this[ug] = this[ug] = {
accessors: {}
}).accessors, n = this.prototype;
function a(s) {
const u = Pa(s);
r[u] || (g$(n, s), r[u] = !0);
}
return Me.isArray(t) ? t.forEach(a) : a(t), this;
}
}
du.accessor(["Content-Type", "Content-Length", "Accept", "Accept-Encoding", "User-Agent", "Authorization"]);
Me.reduceDescriptors(du.prototype, ({ value: e }, t) => {
let i = t[0].toUpperCase() + t.slice(1);
return {
get: () => e,
set(r) {
this[i] = r;
}
};
});
Me.freezeMethods(du);
const Ci = du;
function Hf(e, t) {
const i = this || Hc, r = t || i, n = Ci.from(r.headers);
let a = r.data;
return Me.forEach(e, function(u) {
a = u.call(i, a, n.normalize(), t ? t.status : void 0);
}), n.normalize(), a;
}
function gy(e) {
return !!(e && e.__CANCEL__);
}
function Xo(e, t, i) {
Tt.call(this, e == null ? "canceled" : e, Tt.ERR_CANCELED, t, i), this.name = "CanceledError";
}
Me.inherits(Xo, Tt, {
__CANCEL__: !0
});
function yy(e, t, i) {
const r = i.config.validateStatus;
!i.status || !r || r(i.status) ? e(i) : t(new Tt(
"Request failed with status code " + i.status,
[Tt.ERR_BAD_REQUEST, Tt.ERR_BAD_RESPONSE][Math.floor(i.status / 100) - 4],
i.config,
i.request,
i
));
}
function y$(e) {
const t = /^([-+\w]{1,25})(:?\/\/|:)/.exec(e);
return t && t[1] || "";
}
function b$(e, t) {
e = e || 10;
const i = new Array(e), r = new Array(e);
let n = 0, a = 0, s;
return t = t !== void 0 ? t : 1e3, function(d) {
const h = Date.now(), p = r[a];
s || (s = h), i[n] = d, r[n] = h;
let g = a, _ = 0;
for (; g !== n; )
_ += i[g++], g = g % e;
if (n = (n + 1) % e, n === a && (a = (a + 1) % e), h - s < t)
return;
const S = p && h - p;
return S ? Math.round(_ * 1e3 / S) : void 0;
};
}
function _$(e, t) {
let i = 0, r = 1e3 / t, n, a;
const s = (h, p = Date.now()) => {
i = p, n = null, a && (clearTimeout(a), a = null), e.apply(null, h);
};
return [(...h) => {
const p = Date.now(), g = p - i;
g >= r ? s(h, p) : (n = h, a || (a = setTimeout(() => {
a = null, s(n);
}, r - g)));
}, () => n && s(n)];
}
const Ws = (e, t, i = 3) => {
let r = 0;
const n = b$(50, 250);
return _$((a) => {
const s = a.loaded, u = a.lengthComputable ? a.total : void 0, d = s - r, h = n(d), p = s <= u;
r = s;
const g = {
loaded: s,
total: u,
progress: u ? s / u : void 0,
bytes: d,
rate: h || void 0,
estimated: h && u && p ? (u - s) / h : void 0,
event: a,
lengthComputable: u != null,
[t ? "download" : "upload"]: !0
};
e(g);
}, i);
}, dg = (e, t) => {
const i = e != null;
return [(r) => t[0]({
lengthComputable: i,
total: e,
loaded: r
}), t[1]];
}, fg = (e) => (...t) => Me.asap(() => e(...t)), w$ = Dn.hasStandardBrowserEnv ? ((e, t) => (i) => (i = new URL(i, Dn.origin), e.protocol === i.protocol && e.host === i.host && (t || e.port === i.port)))(
new URL(Dn.origin),
Dn.navigator && /(msie|trident)/i.test(Dn.navigator.userAgent)
) : () => !0, A$ = Dn.hasStandardBrowserEnv ? {
write(e, t, i, r, n, a) {
const s = [e + "=" + encodeURIComponent(t)];
Me.isNumber(i) && s.push("expires=" + new Date(i).toGMTString()), Me.isString(r) && s.push("path=" + r), Me.isString(n) && s.push("domain=" + n), a === !0 && s.push("secure"), document.cookie = s.join("; ");
},
read(e) {
const t = document.cookie.match(new RegExp("(^|;\\s*)(" + e + ")=([^;]*)"));
return t ? decodeURIComponent(t[3]) : null;
},
remove(e) {
this.write(e, "", Date.now() - 864e5);
}
} : {
write() {
},
read() {
return null;
},
remove() {
}
};
function C$(e) {
return /^([a-z][a-z\d+\-.]*:)?\/\//i.test(e);
}
function S$(e, t) {
return t ? e.replace(/\/?\/$/, "") + "/" + t.replace(/^\/+/, "") : e;
}
function by(e, t, i) {
let r = !C$(t);
return e && (r || i == !1) ? S$(e, t) : t;
}
const cg = (e) => e instanceof Ci ? { ...e } : e;
function Gr(e, t) {
t = t || {};
const i = {};
function r(h, p, g, _) {
return Me.isPlainObject(h) && Me.isPlainObject(p) ? Me.merge.call({ caseless: _ }, h, p) : Me.isPlainObject(p) ? Me.merge({}, p) : Me.isArray(p) ? p.slice() : p;
}
function n(h, p, g, _) {
if (Me.isUndefined(p)) {
if (!Me.isUndefined(h))
return r(void 0, h, g, _);
} else
return r(h, p, g, _);
}
function a(h, p) {
if (!Me.isUndefined(p))
return r(void 0, p);
}
function s(h, p) {
if (Me.isUndefined(p)) {
if (!Me.isUndefined(h))
return r(void 0, h);
} else
return r(void 0, p);
}
function u(h, p, g) {
if (g in t)
return r(h, p);
if (g in e)
return r(void 0, h);
}
const d = {
url: a,
method: a,
data: a,
baseURL: s,
transformRequest: s,
transformResponse: s,
paramsSerializer: s,
timeout: s,
timeoutMessage: s,
withCredentials: s,
withXSRFToken: s,
adapter: s,
responseType: s,
xsrfCookieName: s,
xsrfHeaderName: s,
onUploadProgress: s,
onDownloadProgress: s,
decompress: s,
maxContentLength: s,
maxBodyLength: s,
beforeRedirect: s,
transport: s,
httpAgent: s,
httpsAgent: s,
cancelToken: s,
socketPath: s,
responseEncoding: s,
validateStatus: u,
headers: (h, p, g) => n(cg(h), cg(p), g, !0)
};
return Me.forEach(Object.keys(Object.assign({}, e, t)), function(p) {
const g = d[p] || n, _ = g(e[p], t[p], p);
Me.isUndefined(_) && g !== u || (i[p] = _);
}), i;
}
const _y = (e) => {
const t = Gr({}, e);
let { data: i, withXSRFToken: r, xsrfHeaderName: n, xsrfCookieName: a, headers: s, auth: u } = t;
t.headers = s = Ci.from(s), t.url = hy(by(t.baseURL, t.url, t.allowAbsoluteUrls), e.params, e.paramsSerializer), u && s.set(
"Authorization",
"Basic " + btoa((u.username || "") + ":" + (u.password ? unescape(encodeURIComponent(u.password)) : ""))
);
let d;
if (Me.isFormData(i)) {
if (Dn.hasStandardBrowserEnv || Dn.hasStandardBrowserWebWorkerEnv)
s.setContentType(void 0);
else if ((d = s.getContentType()) !== !1) {
const [h, ...p] = d ? d.split(";").map((g) => g.trim()).filter(Boolean) : [];
s.setContentType([h || "multipart/form-data", ...p].join("; "));
}
}
if (Dn.hasStandardBrowserEnv && (r && Me.isFunction(r) && (r = r(t)), r || r !== !1 && w$(t.url))) {
const h = n && a && A$.read(a);
h && s.set(n, h);
}
return t;
}, E$ = typeof XMLHttpRequest < "u", x$ = E$ && function(e) {
return new Promise(function(i, r) {
const n = _y(e);
let a = n.data;
const s = Ci.from(n.headers).normalize();
let { responseType: u, onUploadProgress: d, onDownloadProgress: h } = n, p, g, _, S, b;
function A() {
S && S(), b && b(), n.cancelToken && n.cancelToken.unsubscribe(p), n.signal && n.signal.removeEventListener("abort", p);
}
let w = new XMLHttpRequest();
w.open(n.method.toUpperCase(), n.url, !0), w.timeout = n.timeout;
function m() {
if (!w)
return;
const E = Ci.from(
"getAllResponseHeaders" in w && w.getAllResponseHeaders()
), k = {
data: !u || u === "text" || u === "json" ? w.responseText : w.response,
status: w.status,
statusText: w.statusText,
headers: E,
config: e,
request: w
};
yy(function(P) {
i(P), A();
}, function(P) {
r(P), A();
}, k), w = null;
}
"onloadend" in w ? w.onloadend = m : w.onreadystatechange = function() {
!w || w.readyState !== 4 || w.status === 0 && !(w.responseURL && w.responseURL.indexOf("file:") === 0) || setTimeout(m);
}, w.onabort = function() {
!w || (r(new Tt("Request aborted", Tt.ECONNABORTED, e, w)), w = null);
}, w.onerror = function() {
r(new Tt("Network Error", Tt.ERR_NETWORK, e, w)), w = null;
}, w.ontimeout = function() {
let x = n.timeout ? "timeout of " + n.timeout + "ms exceeded" : "timeout exceeded";
const k = n.transitional || my;
n.timeoutErrorMessage && (x = n.timeoutErrorMessage), r(new Tt(
x,
k.clarifyTimeoutError ? Tt.ETIMEDOUT : Tt.ECONNABORTED,
e,
w
)), w = null;
}, a === void 0 && s.setContentType(null), "setRequestHeader" in w && Me.forEach(s.toJSON(), function(x, k) {
w.setRequestHeader(k, x);
}), Me.isUndefined(n.withCredentials) || (w.withCredentials = !!n.withCredentials), u && u !== "json" && (w.responseType = n.responseType), h && ([_, b] = Ws(h, !0), w.addEventListener("progress", _)), d && w.upload && ([g, S] = Ws(d), w.upload.addEventListener("progress", g), w.upload.addEventListener("loadend", S)), (n.cancelToken || n.signal) && (p = (E) => {
!w || (r(!E || E.type ? new Xo(null, e, w) : E), w.abort(), w = null);
}, n.cancelToken && n.cancelToken.subscribe(p), n.signal && (n.signal.aborted ? p() : n.signal.addEventListener("abort", p)));
const y = y$(n.url);
if (y && Dn.protocols.indexOf(y) === -1) {
r(new Tt("Unsupported protocol " + y + ":", Tt.ERR_BAD_REQUEST, e));
return;
}
w.send(a || null);
});
}, T$ = (e, t) => {
const { length: i } = e = e ? e.filter(Boolean) : [];
if (t || i) {
let r = new AbortController(), n;
const a = function(h) {
if (!n) {
n = !0, u();
const p = h instanceof Error ? h : this.reason;
r.abort(p instanceof Tt ? p : new Xo(p instanceof Error ? p.message : p));
}
};
let s = t && setTimeout(() => {
s = null, a(new Tt(`timeout ${t} of ms exceeded`, Tt.ETIMEDOUT));
}, t);
const u = () => {
e && (s && clearTimeout(s), s = null, e.forEach((h) => {
h.unsubscribe ? h.unsubscribe(a) : h.removeEventListener("abort", a);
}), e = null);
};
e.forEach((h) => h.addEventListener("abort", a));
const { signal: d } = r;
return d.unsubscribe = () => Me.asap(u), d;
}
}, k$ = T$, O$ = function* (e, t) {
let i = e.byteLength;
if (!t || i < t) {
yield e;
return;
}
let r = 0, n;
for (; r < i; )
n = r + t, yield e.slice(r, n), r = n;
}, R$ = async function* (e, t) {
for await (const i of D$(e))
yield* O$(i, t);
}, D$ = async function* (e) {
if (e[Symbol.asyncIterator]) {
yield* e;
return;
}
const t = e.getReader();
try {
for (; ; ) {
const { done: i, value: r } = await t.read();
if (i)
break;
yield r;
}
} finally {
await t.cancel();
}
}, pg = (e, t, i, r) => {
const n = R$(e, t);
let a = 0, s, u = (d) => {
s || (s = !0, r && r(d));
};
return new ReadableStream({
async pull(d) {
try {
const { done: h, value: p } = await n.next();
if (h) {
u(), d.close();
return;
}
let g = p.byteLength;
if (i) {
let _ = a += g;
i(_);
}
d.enqueue(new Uint8Array(p));
} catch (h) {
throw u(h), h;
}
},
cancel(d) {
return u(d), n.return();
}
}, {
highWaterMark: 2
});
}, fu = typeof fetch == "function" && typeof Request == "function" && typeof Response == "function", wy = fu && typeof ReadableStream == "function", $$ = fu && (typeof TextEncoder == "function" ? ((e) => (t) => e.encode(t))(new TextEncoder()) : async (e) => new Uint8Array(await new Response(e).arrayBuffer())), Ay = (e, ...t) => {
try {
return !!e(...t);
} catch {
return !1;
}
}, I$ = wy && Ay(() => {
let e = !1;
const t = new Request(Dn.origin, {
body: new ReadableStream(),
method: "POST",
get duplex() {
return e = !0, "half";
}
}).headers.has("Content-Type");
return e && !t;
}), hg = 64 * 1024, cc = wy && Ay(() => Me.isReadableStream(new Response("").body)), Gs = {
stream: cc && ((e) => e.body)
};
fu && ((e) => {
["text", "arrayBuffer", "blob", "formData", "stream"].forEach((t) => {
!Gs[t] && (Gs[t] = Me.isFunction(e[t]) ? (i) => i[t]() : (i, r) => {
throw new Tt(`Response type '${t}' is not supported`, Tt.ERR_NOT_SUPPORT, r);
});
});
})(new Response());
const F$ = async (e) => {
if (e == null)
return 0;
if (Me.isBlob(e))
return e.size;
if (Me.isSpecCompliantForm(e))
return (await new Request(Dn.origin, {
method: "POST",
body: e
}).arrayBuffer()).byteLength;
if (Me.isArrayBufferView(e) || Me.isArrayBuffer(e))
return e.byteLength;
if (Me.isURLSearchParams(e) && (e = e + ""), Me.isString(e))
return (await $$(e)).byteLength;
}, M$ = async (e, t) => {
const i = Me.toFiniteNumber(e.getContentLength());
return i == null ? F$(t) : i;
}, P$ = fu && (async (e) => {
let {
url: t,
method: i,
data: r,
signal: n,
cancelToken: a,
timeout: s,
onDownloadProgress: u,
onUploadProgress: d,
responseType: h,
headers: p,
withCredentials: g = "same-origin",
fetchOptions: _
} = _y(e);
h = h ? (h + "").toLowerCase() : "text";
let S = k$([n, a && a.toAbortSignal()], s), b;
const A = S && S.unsubscribe && (() => {
S.unsubscribe();
});
let w;
try {
if (d && I$ && i !== "get" && i !== "head" && (w = await M$(p, r)) !== 0) {
let k = new Request(t, {
method: "POST",
body: r,
duplex: "half"
}), D;
if (Me.isFormData(r) && (D = k.headers.get("content-type")) && p.setContentType(D), k.body) {
const [P, M] = dg(
w,
Ws(fg(d))
);
r = pg(k.body, hg, P, M);
}
}
Me.isString(g) || (g = g ? "include" : "omit");
const m = "credentials" in Request.prototype;
b = new Request(t, {
..._,
signal: S,
method: i.toUpperCase(),
headers: p.normalize().toJSON(),
body: r,
duplex: "half",
credentials: m ? g : void 0
});
let y = await fetch(b);
const E = cc && (h === "stream" || h === "response");
if (cc && (u || E && A)) {
const k = {};
["status", "statusText", "headers"].forEach((B) => {
k[B] = y[B];
});
const D = Me.toFiniteNumber(y.headers.get("content-length")), [P, M] = u && dg(
D,
Ws(fg(u), !0)
) || [];
y = new Response(
pg(y.body, hg, P, () => {
M && M(), A && A();
}),
k
);
}
h = h || "text";
let x = await Gs[Me.findKey(Gs, h) || "text"](y, e);
return !E && A && A(), await new Promise((k, D) => {
yy(k, D, {
data: x,
headers: Ci.from(y.headers),
status: y.status,
statusText: y.statusText,
config: e,
request: b
});
});
} catch (m) {
throw A && A(), m && m.name === "TypeError" && /Load failed|fetch/i.test(m.message) ? Object.assign(
new Tt("Network Error", Tt.ERR_NETWORK, e, b),
{
cause: m.cause || m
}
) : Tt.from(m, m && m.code, e, b);
}
}), pc = {
http: QD,
xhr: x$,
fetch: P$
};
Me.forEach(pc, (e, t) => {
if (e) {
try {
Object.defineProperty(e, "name", { value: t });
} catch {
}
Object.defineProperty(e, "adapterName", { value: t });
}
});
const mg = (e) => `- ${e}`, L$ = (e) => Me.isFunction(e) || e === null || e === !1, Cy = {
getAdapter: (e) => {
e = Me.isArray(e) ? e : [e];
const { length: t } = e;
let i, r;
const n = {};
for (let a = 0; a < t; a++) {
i = e[a];
let s;
if (r = i, !L$(i) && (r = pc[(s = String(i)).toLowerCase()], r === void 0))
throw new Tt(`Unknown adapter '${s}'`);
if (r)
break;
n[s || "#" + a] = r;
}
if (!r) {
const a = Object.entries(n).map(
([u, d]) => `adapter ${u} ` + (d === !1 ? "is not supported by the environment" : "is not available in the build")
);
let s = t ? a.length > 1 ? `since :
` + a.map(mg).join(`
`) : " " + mg(a[0]) : "as no adapter specified";
throw new Tt(
"There is no suitable adapter to dispatch the request " + s,
"ERR_NOT_SUPPORT"
);
}
return r;
},
adapters: pc
};
function Wf(e) {
if (e.cancelToken && e.cancelToken.throwIfRequested(), e.signal && e.signal.aborted)
throw new Xo(null, e);
}
function vg(e) {
return Wf(e), e.headers = Ci.from(e.headers), e.data = Hf.call(
e,
e.transformRequest
), ["post", "put", "patch"].indexOf(e.method) !== -1 && e.headers.setContentType("application/x-www-form-urlencoded", !1), Cy.getAdapter(e.adapter || Hc.adapter)(e).then(function(r) {
return Wf(e), r.data = Hf.call(
e,
e.transformResponse,
r
), r.headers = Ci.from(r.headers), r;
}, function(r) {
return gy(r) || (Wf(e), r && r.response && (r.response.data = Hf.call(
e,
e.transformResponse,
r.response
), r.response.headers = Ci.from(r.response.headers))), Promise.reject(r);
});
}
const Sy = "1.9.0", cu = {};
["object", "boolean", "number", "function", "string", "symbol"].forEach((e, t) => {
cu[e] = function(r) {
return typeof r === e || "a" + (t < 1 ? "n " : " ") + e;
};
});
const gg = {};
cu.transitional = function(t, i, r) {
function n(a, s) {
return "[Axios v" + Sy + "] Transitional option '" + a + "'" + s + (r ? ". " + r : "");
}
return (a, s, u) => {
if (t === !1)
throw new Tt(
n(s, " has been removed" + (i ? " in " + i : "")),
Tt.ERR_DEPRECATED
);
return i && !gg[s] && (gg[s] = !0, console.warn(
n(
s,
" has been deprecated since v" + i + " and will be removed in the near future"
)
)), t ? t(a, s, u) : !0;
};
};
cu.spelling = function(t) {
return (i, r) => (console.warn(`${r} is likely a misspelling of ${t}`), !0);
};
function N$(e, t, i) {
if (typeof e != "object")
throw new Tt("options must be an object", Tt.ERR_BAD_OPTION_VALUE);
const r = Object.keys(e);
let n = r.length;
for (; n-- > 0; ) {
const a = r[n], s = t[a];
if (s) {
const u = e[a], d = u === void 0 || s(u, a, e);
if (d !== !0)
throw new Tt("option " + a + " must be " + d, Tt.ERR_BAD_OPTION_VALUE);
continue;
}
if (i !== !0)
throw new Tt("Unknown option " + a, Tt.ERR_BAD_OPTION);
}
}
const Rs = {
assertOptions: N$,
validators: cu
}, Fi = Rs.validators;
class Ks {
constructor(t) {
this.defaults = t || {}, this.interceptors = {
request: new sg(),
response: new sg()
};
}
async request(t, i) {
try {
return await this._request(t, i);
} catch (r) {
if (r instanceof Error) {
let n = {};
Error.captureStackTrace ? Error.captureStackTrace(n) : n = new Error();
const a = n.stack ? n.stack.replace(/^.+\n/, "") : "";
try {
r.stack ? a && !String(r.stack).endsWith(a.replace(/^.+\n.+\n/, "")) && (r.stack += `
` + a) : r.stack = a;
} catch {
}
}
throw r;
}
}
_request(t, i) {
typeof t == "string" ? (i = i || {}, i.url = t) : i = t || {}, i = Gr(this.defaults, i);
const { transitional: r, paramsSerializer: n, headers: a } = i;
r !== void 0 && Rs.assertOptions(r, {
silentJSONParsing: Fi.transitional(Fi.boolean),
forcedJSONParsing: Fi.transitional(Fi.boolean),
clarifyTimeoutError: Fi.transitional(Fi.boolean)
}, !1), n != null && (Me.isFunction(n) ? i.paramsSerializer = {
serialize: n
} : Rs.assertOptions(n, {
encode: Fi.function,
serialize: Fi.function
}, !0)), i.allowAbsoluteUrls !== void 0 || (this.defaults.allowAbsoluteUrls !== void 0 ? i.allowAbsoluteUrls = this.defaults.allowAbsoluteUrls : i.allowAbsoluteUrls = !0), Rs.assertOptions(i, {
baseUrl: Fi.spelling("baseURL"),
withXsrfToken: Fi.spelling("withXSRFToken")
}, !0), i.method = (i.method || this.defaults.method || "get").toLowerCase();
let s = a && Me.merge(
a.common,
a[i.method]
);
a && Me.forEach(
["delete", "get", "head", "post", "put", "patch", "common"],
(b) => {
delete a[b];
}
), i.headers = Ci.concat(s, a);
const u = [];
let d = !0;
this.interceptors.request.forEach(function(A) {
typeof A.runWhen == "function" && A.runWhen(i) === !1 || (d = d && A.synchronous, u.unshift(A.fulfilled, A.rejected));
});
const h = [];
this.interceptors.response.forEach(function(A) {
h.push(A.fulfilled, A.rejected);
});
let p, g = 0, _;
if (!d) {
const b = [vg.bind(this), void 0];
for (b.unshift.apply(b, u), b.push.apply(b, h), _ = b.length, p = Promise.resolve(i); g < _; )
p = p.then(b[g++], b[g++]);
return p;
}
_ = u.length;
let S = i;
for (g = 0; g < _; ) {
const b = u[g++], A = u[g++];
try {
S = b(S);
} catch (w) {
A.call(this, w);
break;
}
}
try {
p = vg.call(this, S);
} catch (b) {
return Promise.reject(b);
}
for (g = 0, _ = h.length; g < _; )
p = p.then(h[g++], h[g++]);
return p;
}
getUri(t) {
t = Gr(this.defaults, t);
const i = by(t.baseURL, t.url, t.allowAbsoluteUrls);
return hy(i, t.params, t.paramsSerializer);
}
}
Me.forEach(["delete", "get", "head", "options"], function(t) {
Ks.prototype[t] = function(i, r) {
return this.request(Gr(r || {}, {
method: t,
url: i,
data: (r || {}).data
}));
};
});
Me.forEach(["post", "put", "patch"], function(t) {
function i(r) {
return function(a, s, u) {
return this.request(Gr(u || {}, {
method: t,
headers: r ? {
"Content-Type": "multipart/form-data"
} : {},
url: a,
data: s
}));
};
}
Ks.prototype[t] = i(), Ks.prototype[t + "Form"] = i(!0);
});
const Ds = Ks;
class Wc {
constructor(t) {
if (typeof t != "function")
throw new TypeError("executor must be a function.");
let i;
this.promise = new Promise(function(a) {
i = a;
});
const r = this;
this.promise.then((n) => {
if (!r._listeners)
return;
let a = r._listeners.length;
for (; a-- > 0; )
r._listeners[a](n);
r._listeners = null;
}), this.promise.then = (n) => {
let a;
const s = new Promise((u) => {
r.subscribe(u), a = u;
}).then(n);
return s.cancel = function() {
r.unsubscribe(a);
}, s;
}, t(function(a, s, u) {
r.reason || (r.reason = new Xo(a, s, u), i(r.reason));
});
}
throwIfRequested() {
if (this.reason)
throw this.reason;
}
subscribe(t) {
if (this.reason) {
t(this.reason);
return;
}
this._listeners ? this._listeners.push(t) : this._listeners = [t];
}
unsubscribe(t) {
if (!this._listeners)
return;
const i = this._listeners.indexOf(t);
i !== -1 && this._listeners.splice(i, 1);
}
toAbortSignal() {
const t = new AbortController(), i = (r) => {
t.abort(r);
};
return this.subscribe(i), t.signal.unsubscribe = () => this.unsubscribe(i), t.signal;
}
static source() {
let t;
return {
token: new Wc(function(n) {
t = n;
}),
cancel: t
};
}
}
const B$ = Wc;
function V$(e) {
return function(i) {
return e.apply(null, i);
};
}
function j$(e) {
return Me.isObject(e) && e.isAxiosError === !0;
}
const hc = {
Continue: 100,
SwitchingProtocols: 101,
Processing: 102,
EarlyHints: 103,
Ok: 200,
Created: 201,
Accepted: 202,
NonAuthoritativeInformation: 203,
NoContent: 204,
ResetContent: 205,
PartialContent: 206,
MultiStatus: 207,
AlreadyReported: 208,
ImUsed: 226,
MultipleChoices: 300,
MovedPermanently: 301,
Found: 302,
SeeOther: 303,
NotModified: 304,
UseProxy: 305,
Unused: 306,
TemporaryRedirect: 307,
PermanentRedirect: 308,
BadRequest: 400,
Unauthorized: 401,
PaymentRequired: 402,
Forbidden: 403,
NotFound: 404,
MethodNotAllowed: 405,
NotAcceptable: 406,
ProxyAuthenticationRequired: 407,
RequestTimeout: 408,
Conflict: 409,
Gone: 410,
LengthRequired: 411,
PreconditionFailed: 412,
PayloadTooLarge: 413,
UriTooLong: 414,
UnsupportedMediaType: 415,
RangeNotSatisfiable: 416,
ExpectationFailed: 417,
ImATeapot: 418,
MisdirectedRequest: 421,
UnprocessableEntity: 422,
Locked: 423,
FailedDependency: 424,
TooEarly: 425,
UpgradeRequired: 426,
PreconditionRequired: 428,
TooManyRequests: 429,
RequestHeaderFieldsTooLarge: 431,
UnavailableForLegalReasons: 451,
InternalServerError: 500,
NotImplemented: 501,
BadGateway: 502,
ServiceUnavailable: 503,
GatewayTimeout: 504,
HttpVersionNotSupported: 505,
VariantAlsoNegotiates: 506,
InsufficientStorage: 507,
LoopDetected: 508,
NotExtended: 510,
NetworkAuthenticationRequired: 511
};
Object.entries(hc).forEach(([e, t]) => {
hc[t] = e;
});
const U$ = hc;
function Ey(e) {
const t = new Ds(e), i = ny(Ds.prototype.request, t);
return Me.extend(i, Ds.prototype, t, { allOwnKeys: !0 }), Me.extend(i, t, null, { allOwnKeys: !0 }), i.create = function(n) {
return Ey(Gr(e, n));
}, i;
}
const fn = Ey(Hc);
fn.Axios = Ds;
fn.CanceledError = Xo;
fn.CancelToken = B$;
fn.isCancel = gy;
fn.VERSION = Sy;
fn.toFormData = uu;
fn.AxiosError = Tt;
fn.Cancel = fn.CanceledError;
fn.all = function(t) {
return Promise.all(t);
};
fn.spread = V$;
fn.isAxiosError = j$;
fn.mergeConfig = Gr;
fn.AxiosHeaders = Ci;
fn.formToJSON = (e) => vy(Me.isHTMLForm(e) ? new FormData(e) : e);
fn.getAdapter = Cy.getAdapter;
fn.HttpStatusCode = U$;
fn.default = fn;
const yg = fn;
Bo.registerLanguage("javascript", F2);
Bo.registerLanguage("xml", I2);
const z$ = Ve({
name: "FcDesigner",
components: {
AiChat: uD,
SlotsConfig: LR,
Warning: Ei,
QuickLayout: zR,
PrintForm: KR,
LanguageConfig: DR,
PropsInput: yR,
JsonPreview: fR,
GlobalVariableConfig: ey,
GlobalClassConfig: q0,
GlobalEventConfig: G0,
GlobalFetchConfig: K0,
FormList: ek,
FieldList: jT,
TypeSelect: $T,
ConfigTitle: H0,
VariableConfig: al,
ToolsBar: ST,
SubList: yT,
PageInput: Z2,
fcDraggable: Go,
DragForm: tt.$form(),
ViewForm: Qn.$form(),
DragFormMobile: tt.$form(),
ViewFormMobile: Qn.$form(),
EventConfig: k0,
ConfigItem: li,
VNode: O0
},
props: {
menu: Array,
field: Array,
appId: String,
appUrl: String,
list: Array,
theme: String,
height: [String, Number],
config: {
type: Object,
default: () => ({})
},
mask: {
type: Boolean,
default: void 0
},
locale: Object,
handle: Array
},
data() {
return {};
},
emits: ["active", "create", "copy", "delete", "drag", "inputData", "inputPageData", "save", "clear", "switchForm", "copyRule", "pasteRule", "sortUp", "sortDown", "changeDevice", "previewSubmit", "previewReset"],
setup(e) {
var ve, me, we, he, Se, xe;
let t;
t = !0;
const { menu: i, height: r, mask: n, locale: a, handle: s } = Im(e), u = A_(), d = Vi({ active: null });
Fm("fcx", d), Fm("designer", u);
const h = e.appUrl, p = qi(e, "config", {}), g = qi(e, "theme"), _ = qi(e, "field", []), S = qi(e, "list", []), b = qi(p.value, "baseRule", null), A = qi(p.value, "componentRule", {}), w = qi(p.value, "updateDefaultRule", {}), m = qi(p.value, "validateRule", null), y = qi(p.value, "formRule", null), E = _n(() => {
const O = r.value;
return O ? St.Number(O) ? `${O}px` : O : "100%";
}), x = _n(() => p.value.fieldReadonly !== !1), k = _n(() => p.value.fieldList || []), D = _n(() => p.value.varList || []), P = _n(() => p.value.hiddenMenu || []), M = _n(() => p.value.hiddenItem || []), B = _n(() => p.value.hiddenDragMenu === !0), T = _n(() => p.value.hiddenDragBtn === !0), $ = _n(() => u.refs.dragCon.clientHeight), V = _n(() => {
var O;
return (((O = a.value) == null ? void 0 : O.name) || "zh-cn") === "zh-cn" ? kT : null;
}), z = _n(() => ee.getConfig("showGridLine") !== !1 || ee.getConfig("showQuickLayout") !== !1 || ee.getConfig("showPrintBtn") !== !1), H = _n(() => {
const O = ["base", "advanced", "props", "slots", "style", "event", "validate"];
let K = p.value.configFormOrder ? [...p.value.configFormOrder] : [], J = [];
return K.length ? [...K, ...O].forEach((ne) => {
J.indexOf(ne) === -1 && O.indexOf(ne) > -1 && J.push(ne);
}) : J = O, J.map((ne) => `"${ne}"`).join(" ");
});
So(g, (O, K) => {
K && document.body.classList.remove("fd-theme-" + K), O && document.body.classList.add("fd-theme-" + O);
});
let I = ac;
a.value && (I = Zf(a).t);
const U = (...O) => I(...O), F = (O, K, ...J) => {
if (K) {
if (St.Function(K))
return K(...J);
if (K.rule) {
let ne = K.rule(...J);
return K.prepend ? ne = [...ne, ...O(...J)] : K.append && (ne = [...O(...J), ...ne]), ne;
}
}
return O(...J);
}, C = Vi({
cacheProps: {},
operation: {
idx: -1,
list: []
},
modelValue: "",
selectedNodeName: "",
datasetData: [],
datasetInfo: {},
dsSelectProps: {
label: "name",
children: "children",
value: "id",
isLeaf: (O) => {
var K;
return !((K = O.children) != null && K.length);
}
},
fieldData: [],
tableId: "",
pageData: [],
gridLine: !1,
hiddenLeft: !1,
hiddenRight: !1,
moveRule: null,
addRule: null,
added: null,
bus: B_(),
device: ((ve = p.value) == null ? void 0 : ve.device) || "pc",
activeModule: "base",
activeTab: "form",
activeMenuTab: "menu",
activePage: null,
activeRule: null,
children: $s([]),
treeInfo: [],
menuList: i.value || wE(),
dragRuleList: {},
eventShow: !1,
unloadStatus: !1,
previewStatus: "form",
previewDevice: "pc",
t: U,
preview: {
state: !1,
rule: [],
option: {},
api: {}
},
inputForm: {
state: !1,
rule: [],
option: {},
api: {},
data: {},
key: ""
},
dragForm: $s({
rule: [],
api: {}
}),
formOptions: {
appUrl: h,
datasetInfo: {}
},
oldOptionsKeys: [],
form: {
rule: F(Vm, y.value, { t: U }),
api: {},
option: {
global: {
input: ((me = p.value) == null ? void 0 : me.updateConfigOnBlur) !== !1 ? {
modelEmit: "blur"
} : {},
select: {
props: {
clearable: !0
}
}
},
form: {
labelPosition: "top",
size: "small"
},
submitBtn: !1
},
value: {
form: {},
submitBtn: !1
}
},
baseForm: {
isShow: !1,
rule: F($a, b.value, { t: U }),
api: {},
value: {},
options: {
global: {
input: ((we = p.value) == null ? void 0 : we.updateConfigOnBlur) !== !1 ? {
modelEmit: "blur"
} : {},
select: {
props: {
clearable: !0
}
}
},
form: {
labelPosition: "top",
size: "small"
},
submitBtn: !1,
mounted: (O) => {
O.activeRule = C.activeRule, O.setValue(O.options.formData || {});
}
}
},
advancedForm: {
isShow: !1,
rule: Um({ t: U }),
api: {},
value: {},
options: {
global: {
input: ((he = p.value) == null ? void 0 : he.updateConfigOnBlur) !== !1 ? {
modelEmit: "blur"
} : {},
select: {
props: {
clearable: !0
}
}
},
form: {
labelPosition: "top",
size: "small"
},
submitBtn: !1,
mounted: (O) => {
O.activeRule = C.activeRule, O.setValue(O.options.formData || {});
}
}
},
styleForm: {
isShow: !1,
rule: jm({ t: U }),
api: {},
value: {},
options: {
form: {
labelPosition: "left",
size: "small"
},
submitBtn: !1,
mounted: (O) => {
O.activeRule = C.activeRule, O.setValue(O.options.formData || {});
}
}
},
validateForm: {
isShow: !1,
rule: F(zm, m.value, { t: U }),
api: {},
value: [],
options: {
form: {
labelPosition: "top",
size: "small"
},
submitBtn: !1,
mounted: (O) => {
O.activeRule = C.activeRule, O.setValue(O.options.formData || {});
}
}
},
propsForm: {
isShow: !1,
variable: !1,
rule: [],
api: {},
value: {},
options: {
global: {
input: ((Se = p.value) == null ? void 0 : Se.updateConfigOnBlur) !== !1 ? {
modelEmit: "blur"
} : {},
inputNumber: {
props: {
controlsPosition: "right"
}
},
select: {
props: {
clearable: !0
}
}
},
form: {
labelPosition: "top",
size: "small"
},
submitBtn: !1,
mounted: (O) => {
O.activeRule = C.activeRule, O.setValue(O.options.formData || {});
}
}
},
customForm: {
isShow: !1,
config: null,
key: "",
rule: [],
api: {},
options: {
global: {
input: ((xe = p.value) == null ? void 0 : xe.updateConfigOnBlur) !== !1 ? {
modelEmit: "blur"
} : {},
select: {
props: {
clearable: !0
}
}
},
form: {
labelPosition: "top",
size: "small"
},
submitBtn: !1
}
}
}), q = _n(() => {
const O = C.activeRule;
if (!O || !O._menu.children || O._fc_drag_tag === O._menu.children)
return null;
const K = C.dragRuleList[O._fc_drag_tag], J = C.dragRuleList[O._menu.children];
let ne = O.children;
return K.inside && (ne = ne[0].children), J.inside || (ne = ne.map((re) => re.children[0])), ne.filter((re) => re._fc_drag_tag === J.name);
});
So(() => C.preview.state, function(O) {
O || Kn(() => {
C.previewStatus = "form", C.preview.rule = C.preview.option = null;
});
}), So(() => C.previewStatus, (O) => {
C.preview.rule && (C.preview.option.preview = O === "preview");
});
let X = null;
const Y = (O, K) => {
if (O[10] !== ">") {
if (O = O.replace("formCreate", ""), !O)
return;
O = Fs(O);
} else
O = O.replace("formCreate>", "");
const J = O.split(">"), ne = J.pop();
let re = C.activeRule;
J.forEach((fe, Ae) => {
Ae || (fe = Fs(fe)), re[fe] || (re[fe] = {}), re = re[fe];
}), K({ source: re, field: ne });
}, ue = _n(() => C.pageData.filter((O) => !O.default).length);
So(() => a.value, (O) => {
I = O ? Zf(a).t : ac, ee.clearActiveRule();
const K = C.form.api.formData && C.form.api.formData(), J = C.baseForm.api.formData && C.baseForm.api.formData(), ne = C.validateForm.api.formData && C.validateForm.api.formData();
C.validateForm.rule = F(zm, m.value, { t: U }), C.baseForm.rule = F($a, b.value, { t: U }), C.form.rule = F(Vm, y.value, { t: U }), C.styleForm.rule = jm({ t: U }), C.advancedForm.rule = Um({ t: U }), C.cacheProps = {};
const re = C.activeRule;
let fe = null;
re && (fe = C.propsForm.api.formData && C.propsForm.api.formData(), C.propsForm.rule = C.cacheProps[re._fc_id] = ee.getPropsRule(re)), Kn(() => {
K && C.form.api.setValue(K), J && C.baseForm.api.setValue(J), ne && C.validateForm.api.setValue(ne), fe && C.propsForm.api.setValue(fe);
});
}), So(() => p.value.license, (O) => {
Qn.license = O, tt.license = O, window && window.formCreate && (window.formCreate.license = O);
}, { immediate: !0 });
const ee = {
dsClick(O) {
C.datasetInfo = {}, C.formOptions.datasetInfo = {}, C.datasetData.forEach((K) => {
K.table_id == O && (C.datasetInfo = K, C.formOptions.datasetInfo = K);
}), ee.onDatasetChange(C.datasetInfo);
},
onDatasetChange(O) {
let K = "eyJ0eXAiOiJKV1QiLCJhbGciOiJIUzI1NiJ9.eyJ1aWQiOjEsIm9pZCI6MX0.i8pMPviPZoQyjXML3dLfLek4XML2acUf-x0K90u9KoY";
if (localStorage.getItem("user.token") != null && localStorage.getItem("user.token") != "") {
const ne = JSON.parse(localStorage.getItem("user.token"));
K = JSON.parse(ne.v);
}
let J = h;
J == null && (J = ""), C.fieldData = [], window.globalvariableData = [], yg.get(J + "/datasetData/getFieldsByTableId", {
headers: {
"X-De-Token": K
},
params: {
datasourceId: O.datasource_id,
tablename: O.table_name
}
}).then((ne) => {
C.datasetInfo.keyfeilds = ne.data.data.keyfeilds, C.formOptions.datasetInfo.keyfeilds = ne.data.data.keyfeilds, window.globalvariableData = ne.data.data.fields, ne.data.data.fields.forEach((re) => {
re.label = re.name, re.item = "input", re.iskey = re.iskey, re.fieldtype = re.type, re.maxlength = re.size, re.field = re.field, re.update = {
disabled: re.iskey
}, C.fieldData.push(re);
});
}).catch((ne) => {
console.error(" \u8BF7\u6C42\u51FA\u9519:", ne);
});
},
getInit() {
C.formOptions.appUrl = h;
let O = h;
O == null && (O = "");
let K = "eyJ0eXAiOiJKV1QiLCJhbGciOiJIUzI1NiJ9.eyJ1aWQiOjEsIm9pZCI6MX0.i8pMPviPZoQyjXML3dLfLek4XML2acUf-x0K90u9KoY";
if (localStorage.getItem("user.token") != null && localStorage.getItem("user.token") != "") {
const J = JSON.parse(localStorage.getItem("user.token"));
K = JSON.parse(J.v);
}
yg.get(O + "/datasetData/getTablesByAppId", {
headers: {
"X-De-Token": K
},
params: {
appid: e.appId
}
}).then((J) => {
C.datasetData = J.data.data;
}).catch((J) => {
console.error(" \u8BF7\u6C42\u51FA\u9519:", J);
});
},
setDevice(O) {
C.device = O, u.emit("changeDevice", O);
},
initPage() {
C.children = ee.makeChildren([]), C.dragForm.rule = ee.makeDragRule(C.children), C.operation = C.pageData[0] ? C.pageData[0].operation : {
idx: -1,
list: []
}, C.pageData = [{
default: !0,
rule: C.dragForm.rule,
operation: C.operation
}], C.activePage = C.pageData[0];
},
changePage(O) {
const K = C.pageData[O];
if (C.activePage !== K) {
if (C.activePage) {
const J = C.activePage;
J.rule = C.dragForm.rule, J.operation = C.operation;
}
K.operation || (K.operation = {
idx: -1,
list: []
}), C.dragForm.rule = K.rule, K.default ? C.children = K.rule[0].children : C.children = K.rule[0].children[0].children[0].children, C.activePage = K, C.operation = K.operation, C.preview.state = !1, C.inputForm.state = !1, ee.clearActiveRule(), ee.updateTree();
}
},
deletePage(O) {
O && (C.pageData[O] === C.activePage && ee.changePage(0), C.pageData.splice(O, 1));
},
copyPage(O) {
if (O) {
const K = C.pageData[O], J = At(C.pageData[O].rule)[0], ne = J.type === "DragTool" ? J.children[0] : J;
ne.name = "ref_" + rt(), ne._fc_id = "id_" + rt(), Iv(ne, K.config.labelField, zo(ne, K.config.labelField, "") + " Copy"), C.pageData.splice(O + 1, 0, {
config: K.config,
type: K.type,
main: ne,
rule: [J]
});
}
},
addPage(O) {
const K = ee.makeRule(C.dragRuleList[O]);
ee.appendPage(O, K);
},
appendPage(O, K) {
const J = K.type === "DragTool" ? K.children[0] : K;
C.pageData.push({
config: C.dragRuleList[O].container,
main: J,
type: O,
rule: [K]
});
},
openGlobalFetchDialog() {
const O = u.refs.globalFetch;
O && O.open();
},
openGlobalClassDialog() {
const O = u.refs.globalClass;
O && O.open();
},
openGlobalEventDialog() {
const O = u.refs.globalEvent;
O && O.open();
},
openGlobalVariableDialog() {
const O = u.refs.globalVariable;
O && O.open();
},
unWatchActiveRule() {
X && X(), X = null;
},
watchActiveRule() {
ee.unWatchActiveRule(), X = So(() => C.activeRule, function(O) {
O && ee.updateRuleFormData();
}, { deep: !0, flush: "post" });
},
makeChildren(O) {
return Vi({ children: O }).children;
},
addMenu(O) {
if (!O.name)
return;
let K = !0;
C.menuList.forEach((J, ne) => {
J.name === O.name && (C.menuList[ne] = O, K = !1);
}), K && (O.before ? C.menuList.unshift(O) : C.menuList.push(O));
},
removeMenu(O) {
[...C.menuList].forEach((K, J) => {
K.name === O && C.menuList.splice(J, 1);
});
},
setMenuItem(O, K) {
C.menuList.forEach((J) => {
J.name === O && (J.list = K);
});
},
appendMenuItem(O, K) {
C.menuList.forEach((J) => {
J.name === O && J.list.push(...Array.isArray(K) ? K : [K]);
});
},
removeMenuItem(O) {
C.menuList.forEach((K) => {
let J;
St.String(O) ? [...K.list].forEach((ne, re) => {
ne.name === O && K.list.splice(re, 1);
}) : (J = K.list.indexOf(O)) > -1 && K.list.splice(J, 1);
});
},
addComponent(O) {
Array.isArray(O) ? O.forEach((K) => {
C.dragRuleList[K.name] = K, K.menu && ee.appendMenuItem(K.menu, K);
}) : (C.dragRuleList[O.name] = O, O.menu && ee.appendMenuItem(O.menu, O));
},
openInputData(O) {
C.inputForm.state = O === void 0 ? !C.inputForm.state : !!O, C.inputForm.state && (C.inputForm.option = tt.parseJson(ee.getOptionsJson()), ee.inputReset(), C.inputForm.option.appendValue = !1, C.inputForm.option.submitBtn.show = !1, C.inputForm.option.resetBtn.show = !1, ee.clearActiveRule());
},
inputSave() {
const O = C.inputForm.api.formData();
Object.keys(O).forEach((J) => {
Ni(O[J]) && delete O[J];
});
const K = JSON.stringify(ee.getPreviewFormData()) !== JSON.stringify(O);
C.activePage.default ? (C.inputForm.data = O, u.emit("inputData", O)) : (Iv(C.activePage.main, C.activePage.config.formDataField, O), u.emit("inputPageData", O)), C.inputForm.state = !1, K && ee.addOperationRecord();
},
inputClear() {
ee.inputReset({});
},
inputReset(O) {
C.inputForm.rule = tt.parseJson(ee.getPreviewRule()), C.inputForm.option.formData = O || At(ee.getPreviewFormData()), C.inputForm.key = rt();
},
setFormData(O) {
C.inputForm.data = O || {};
},
getFormData() {
return C.inputForm.data;
},
getParent(O) {
let K = O.__fc__.parent.rule;
const J = K._menu;
return J && J.inside && (O = K, K = K.__fc__.parent.rule), { root: K, parent: O };
},
copyName() {
er(C.activeRule.name);
},
updateName() {
C.activeRule.name = "ref_" + rt();
},
makeDrag(O, K, J, ne, re) {
return {
type: "DragBox",
wrap: {
show: !1
},
col: {
show: !1
},
inject: !0,
props: {
rule: {
props: {
tag: "el-col",
group: {
name: O === !0 ? "default" : O,
put(...fe) {
return ee.dragPut(...fe);
}
},
swapThreshold: K === "draggable" ? 0.25 : 0.8,
ghostClass: "ghost",
animation: 150,
handle: "._fd-drag-btn",
emptyInsertThreshold: 0,
direction: "auto",
itemKey: "_fc_id"
}
},
tag: K
},
children: J,
slot: re,
on: ne
};
},
clearDragRule() {
C.children.length = 0, ee.clearActiveRule(), ee.addOperationRecord(), ee.updateTree(), C.unloadStatus = !1, u.emit("clear");
},
makeDragRule(O) {
return ee.makeChildren([ee.makeDrag(!0, "draggable", O, {
add: (K, J) => ee.dragAdd(O, J),
end: (K, J) => ee.dragEnd(O, J),
start: (K, J) => ee.dragStart(O, J),
unchoose: (K, J) => ee.dragUnchoose(O, J)
})]);
},
handleSave() {
u.emit("save", {
rule: ee.getJson(),
options: ee.getOptionsJson()
});
},
getPreviewFormData() {
return C.activePage.default ? C.inputForm.data : zo(C.activePage.main, C.activePage.config.formDataField, {}) || {};
},
getPreviewRule() {
return C.activePage.default ? ee.getJson() : tt.toJson(ee.parseRule(At(C.children)));
},
previewSubmit(...O) {
u.emit("previewSubmit", ...O);
},
previewReset(...O) {
u.emit("previewReset", ...O);
},
openPreview() {
C.preview.state = !0, C.previewDevice = C.device === "mobile" ? "mobile" : "pc";
const O = ee.getPreviewRule(), K = ee.getOptionsJson(), J = ee.getConfig("useTemplate", !1);
C.preview.option = tt.parseJson(K), C.activePage.default || (C.preview.option.formData = At(ee.getPreviewFormData())), C.preview.rule = tt.parseJson(O), C.preview.html = Bo.highlight(
J ? O_(O, K) : R_(O, K),
{ language: "xml" }
).value, C.preview.mobileHtml = Bo.highlight(
J ? D_(O, K) : $_(O, K),
{ language: "xml" }
).value, C.preview.sfc = Bo.highlight(
dT(C.children, C.preview.option, C.dragRuleList, J),
{ language: "xml" }
).value;
},
copyCode() {
er(this.$refs.previewCode.innerText);
},
getPageRule() {
return ee.parseRule(At(C.children));
},
getPageJson() {
return tt.toJson(ee.getPageRule());
},
getRule() {
let O;
if (C.pageData.length > 1) {
const K = [];
C.pageData.map((J) => {
J.default ? O = ee.parseRule(At(J.rule)) : K.push(ee.parseRule(At(J.rule))[0]);
}), O.push(...K);
} else
O = ee.getPageRule();
return O;
},
getJson() {
return tt.toJson(ee.getRule());
},
getOption() {
var J;
const O = At(C.formOptions);
["onReset", "onSubmit", "beforeSubmit", "onCreated", "onMounted", "onReload", "onChange", "beforeFetch"].forEach((ne) => {
delete O[ne];
}), Object.keys(O._event || {}).forEach((ne) => {
O._event[ne] && (O[ne] = O._event[ne]);
}), O.style || delete O.style, delete O._event, O.submitBtn = O._submitBtn, O.resetBtn = O._resetBtn, O.resetBtn.innerText = U("props.reset"), O.submitBtn.innerText = U("props.submit");
const K = At(C.inputForm.data);
return Object.keys(K).length > 0 && (O.formData = K), (J = O == null ? void 0 : O.wrap) != null && J.style && (O.wrap.style.marginBottom || delete O.wrap.style.marginBottom, Object.keys(O.wrap.style).length || delete O.wrap.style, Object.keys(O.wrap).length || delete O.wrap), O.language && Object.keys(O.language).forEach((ne) => {
Object.keys(O.language[ne]).forEach((re) => {
O.language[ne][re] || delete O.language[ne][re];
}), Object.keys(O.language[ne]).length || delete O.language[ne];
}), Object.keys(O).forEach((ne) => {
Object.keys(O[ne]).length || delete O[ne];
}), delete O._submitBtn, delete O._resetBtn, O;
},
subRender(O, K, J) {
const ne = O({ h: tn, resolveComponent: ie, rule: K, subRule: J, t: U });
return Array.isArray(ne) ? ne.map((re) => tn(li, { label: re.label }, () => re.vnode)) : ne;
},
getOptions() {
return ee.getOption();
},
getOptionsJson() {
return tt.toJson([ee.getOption()]).slice(1).slice(0, -1);
},
setRule(O, K) {
O || (O = []), !K && ee.initPage();
const J = ee.loadRule(St.String(O) ? tt.parseJson(O) : At(O)), ne = [];
J.forEach((re) => {
re._fc_page_tag ? K || ee.appendPage(re._fc_page_tag, re) : ne.push(re);
}), C.children.length = 0, C.children.push(...ne), ee.clearActiveRule(), K || (ee.addOperationRecord(), !ne.length && C.pageData.length > 1 && ee.changePage(1)), ee.updateTree();
},
setBaseRuleConfig(O, K) {
b.value = { rule: O, append: K }, C.baseForm.rule = F($a, b.value, { t: U });
},
setComponentRuleConfig(O, K, J) {
A.value[O] = { rule: K, append: J }, C.cacheProps = {};
const ne = C.activeRule;
if (ne) {
const re = C.propsForm.api.formData && C.propsForm.api.formData();
C.propsForm.rule = C.cacheProps[ne._fc_id] = F(ne._menu.props, A.value && A.value[ne._menu.name], ne, {
t: U,
api: C.dragForm.api
}), Kn(() => {
re && C.propsForm.api.setValue(re);
});
}
},
setValidateRuleConfig(O, K) {
m.value = { rule: O, append: K }, C.validateForm.rule = F($a, m.value, { t: U });
},
setFormRuleConfig(O, K) {
y.value = { rule: O, append: K }, C.form.rule = F($a, y.value, { t: U });
},
clearActiveRule() {
C.activeRule = null, C.customForm.config = null, C.activeTab = "form", d.active = "";
},
setOption(O) {
O.datasetInfo && O.datasetInfo.table_id && (C.tableId = O.datasetInfo.table_id, ee.dsClick(C.tableId));
const K = At(ee.getConfig("formOptions", {})), J = K.form || {};
delete K.form;
let ne = { ...K, ...St.String(O) ? JSON.parse(O) : At(O || {}) };
ne.form = {
inline: !1,
hideRequiredAsterisk: !1,
labelPosition: "right",
size: "default",
labelWidth: "125px",
...J,
...ne.form || {}
}, ne._event = {
onReset: ne.onReset || "",
onSubmit: ne.onSubmit || "",
onCreated: ne.onCreated || "",
onMounted: ne.onMounted || "",
onReload: ne.onReload || "",
beforeSubmit: ne.beforeSubmit || "",
onChange: ne.onChange || "",
beforeFetch: ne.beforeFetch || ""
}, Li(ne, "globalEvent") || (ne.globalEvent = {}), ne.appUrl = h || "", Li(ne, "globalData") || (ne.globalData = {}), Li(ne, "language") || (ne.language = {}), ne._resetBtn = typeof ne.resetBtn == "object" ? ne.resetBtn : { show: ne.resetBtn === !0 }, ne._submitBtn = typeof ne.submitBtn == "object" ? ne.submitBtn : { show: ne.submitBtn !== !1 }, ne.submitBtn = ne.resetBtn = !1, C.inputForm.data = ne.formData || {}, C.oldOptionsKeys = Object.keys(C.form.value), delete ne.formData, C.formOptions = ne, ee.updateOptionsValue();
},
setOptions(O) {
ee.setOption(O);
},
mergeOptions(O) {
if (["globalEvent", "globalData", "globalClass", "globalVariable", "form"].forEach((K) => {
O[K] && (C.formOptions[K] = { ...C.formOptions[K] || {}, ...O[K] });
}), O.style && (!C.formOptions.style || C.formOptions.style.indexOf(O.style) === -1) && (C.formOptions.style = (C.formOptions.style || "") + `
` + O.style), C.formOptions.language || (C.formOptions.language = {}), O.language && Object.keys(O.language).forEach((K) => {
C.formOptions.language[K] = { ...C.formOptions.language[K] || {}, ...O.language[K] };
}), O.languageKey) {
const K = ee.getConfig("localeOptions", [
{ value: "zh-cn", label: "\u7B80\u4F53\u4E2D\u6587" },
{ value: "en", label: "English" }
]);
O.languageKey.forEach((J) => {
K.forEach(({ value: ne }) => {
C.formOptions.language[ne] || (C.formOptions.language[ne] = {}), C.formOptions.language[ne][J] || (C.formOptions.language[ne][J] = "");
});
});
}
},
updateOptionsValue() {
const O = {};
C.oldOptionsKeys.forEach((J) => {
O[J] = void 0;
});
const K = { ...O, ...C.formOptions.form };
Object.keys(C.formOptions).forEach((J) => {
const ne = C.formOptions[J];
K[">" + J] = ne, typeof ne == "object" && Object.keys(ne).forEach((re) => {
K[J + ">" + re] = ne[re];
});
}), C.form.value = K;
},
setGlobalEvent(O) {
C.formOptions.globalEvent = { ...C.formOptions.globalEvent || {}, ...O }, ee.updateOptionsValue();
},
setGlobalData(O) {
C.formOptions.globalData = { ...C.formOptions.globalData || {}, ...O }, ee.updateOptionsValue();
},
setGlobalClass(O) {
C.formOptions.globalClass = { ...C.formOptions.globalClass || {}, ...O }, ee.updateOptionsValue();
},
setGlobalVariable(O) {
C.formOptions.globalVariable = { ...C.formOptions.globalVariable || {}, ...O }, ee.updateOptionsValue();
},
tidyRule(O) {
var J;
["control", "computed", "on", "hidden", "display"].forEach((ne) => {
O[ne] != null && (O["_" + ne] = O[ne], delete O[ne]);
}), (J = O.effect) != null && J.loadData && (O._loadData = O.effect.loadData, delete O.effect.loadData), O.$loadData && (O._loadData = O.$loadData, delete O.$loadData);
},
loadRule(O, K, J) {
const ne = [];
return O.forEach((re) => {
if (St.String(re))
return ne.push(re);
if (re._fc_drag_skip)
return;
let fe = C.dragRuleList[re._fc_drag_tag] || C.dragRuleList[re.type];
if (fe || (fe = xS(re), re._fc_drag_tag = "_"), J && (re._fc_template = J), fe && fe.loadRule && fe.loadRule(re), re.children = ee.loadRule(re.children || [], fe, J), fe) {
const Ae = re.slot;
let Fe;
K && K.slot && Ae && Ae !== "default" && (Fe = ee.getSlotConfig(K, Ae, fe)), delete re.slot, re = ee.makeRule(Fe || fe, re), Ae && (re.slot = Ae);
} else
ee.tidyRule(re);
ne.push(re);
}), ne;
},
parseRule(O, K) {
return [...O].reduce((J, ne) => {
let re = K;
if (St.String(ne))
return J.push(ne), J;
if (ne.type === "DragBox")
return J.push(...ee.parseRule(ne.children, re || ne.slot)), J;
if (ne.type === "DragTool") {
if (re = ne.slot || K, ne = ne.children[0], St.String(ne))
return J.push(ne), J;
if (ne.type === "DragBox")
return J.push(...ee.parseRule(ne.children, re || ne.slot)), J;
}
return !ne || ne._fc_drag_skip || (ne = { ...ne }, re && re !== "default" && (ne.slot = re), ne.children && ne.children.length && (ne.children = ee.parseRule(ne.children)), delete ne.key, delete ne.component, delete ne._fc_page_tag, ne._menu && (ne._menu.parseRule && ne._menu.parseRule(ne), delete ne._menu), ne._fc_drag_tag === "_" && delete ne._fc_drag_tag, ["control", "computed", "on", "hidden", "display"].forEach((Ae) => {
ne["_" + Ae] != null && ne["_" + Ae] !== "" && (ne[Ae] = ne["_" + Ae]), delete ne["_" + Ae];
}), ne.slot || delete ne.slot, ne._loadData && (ne.$loadData = ne._loadData, delete ne._loadData), ne.props && Object.keys(ne.props).forEach((Ae) => {
const Fe = ne.props[Ae];
Ni(Fe) && delete ne.props[Ae];
}), ne.props && ne.props.key && (ne.key = ne.props.key), [ne.wrap, ne.title, ne.info, ne].forEach((Ae) => {
Ae && Object.keys(Ae).filter((Fe) => Fe.indexOf("__") === 0 || Ae[Fe] === "" || Array.isArray(Ae[Fe]) && Ae[Fe].length === 0 || St.Object(Ae[Fe]) && Object.keys(Ae[Fe]).length === 0).forEach((Fe) => {
delete Ae[Fe];
});
}), J.push(ne)), J;
}, []);
},
fields() {
return C.dragForm.api.all().map((O) => O.field).filter((O) => !!O);
},
getTitle(O) {
var K, J, ne;
return (((ne = (J = (K = O == null ? void 0 : O.__fc__) == null ? void 0 : K.refRule) == null ? void 0 : J.__$title) == null ? void 0 : ne.value) || O.title || "").trim() || O.props && O.props.label || U("com." + (O._menu && O._menu.name) + ".name") || O._menu && O._menu.label || O.type;
},
baseChange(O, K, J, ne) {
ee.handleChange("", O, K, J, ne);
},
formOptChange(O, K) {
C.form.value[O] = K, O.indexOf(">") === -1 && (O = "form>" + O);
let J = C.formOptions;
const ne = O.split(">"), re = ne.pop();
ne.forEach((fe) => {
fe && (J[fe] || (J[fe] = {}), J = J[fe]);
}), J[re] = K;
},
propRemoveField(O, K, J) {
var ne, re, fe;
if (C.activeRule && J[C.activeRule._fc_id] === C.activeRule) {
ee.unWatchActiveRule();
const Ae = O;
C.dragForm.api.sync(C.activeRule), O.indexOf("__") !== 0 && (O === "formCreateChild" ? delete C.activeRule.children[0] : O.indexOf("formCreate") === 0 || O.indexOf(">") > 0 ? (O.indexOf("formCreate") < 0 && (O = "props>" + O), Y(O, ({ source: Fe, field: Xe }) => {
delete Fe[Xe];
})) : delete C.activeRule.props[O]), ee.watchActiveRule(), (fe = (re = (ne = C.activeRule._menu) == null ? void 0 : ne.watch) == null ? void 0 : re[Ae]) == null || fe.call(re, {
field: Ae,
value: void 0,
api: J,
rule: C.activeRule,
ctx: u
});
}
},
propChange(O, K, J, ne) {
ee.handleChange("props", O, K, J, ne);
},
computedChange(O, K, J, ne) {
ee.handleChange("_computed", O, K, J, ne);
},
styleChange(O, K, J, ne) {
if (C.customForm.config)
return C.customForm.config.style.change(O, K);
ee.handleChange("", O, K, J, ne);
},
handleChange(O, K, J, ne, re) {
var fe, Ae, Fe;
if (C.activeRule && re[C.activeRule._fc_id] === C.activeRule) {
ee.unWatchActiveRule();
const Xe = K;
K.indexOf("__") !== 0 && (K === "formCreateChild" ? C.activeRule.children[0] = J : K.indexOf("formCreate") === 0 || K.indexOf(">") > 0 ? (K.indexOf("formCreate") < 0 && (K = (O ? O + ">" : "") + K), Y(K, ({ source: Ze, field: be }) => {
Ni(J) ? delete Ze[be] : Ze[be] = J;
})) : O && Ni(J) ? delete C.activeRule[O][K] : (O ? C.activeRule[O] : C.activeRule)[K] = J), ee.watchActiveRule(), (Fe = (Ae = (fe = C.activeRule._menu) == null ? void 0 : fe.watch) == null ? void 0 : Ae[Xe]) == null || Fe.call(Ae, {
field: Xe,
value: J,
api: re,
rule: C.activeRule,
ctx: u
});
}
},
validateChange(O, K, J, ne) {
!C.activeRule || C.validateForm.api[C.activeRule._fc_id] !== C.activeRule || (ee.handleChange("", O, K, J, ne), C.dragForm.api.refreshValidate(), C.dragForm.api.nextTick(() => {
var re;
C.dragForm.api.clearValidateState((re = C.activeRule) == null ? void 0 : re.__fc__.id);
}));
},
triggerActive(O) {
let K;
if (St.String(O) && (O = ee.findRule(O)), !!O && (O._menu.inside ? K = O.children[0] : K = O.__fc__.parent.rule, K && K.type === "DragTool")) {
const J = C.dragForm.api.el(K.__fc__.id);
J && (d.active = J.id, u.emit("active", O), ee.toolActive(O));
}
},
customFormChange(O, K) {
C.customForm.config && C.customForm.config.change(O, K);
},
customActive(O) {
C.baseForm.isShow = !1, C.propsForm.isShow = !1, C.propsForm.variable = !1, C.advancedForm.isShow = !1, C.styleForm.isShow = !!O.style && ee.getConfig("showStyleForm") !== !1, C.eventShow = !1, C.validateForm.isShow = !1, C.activeRule = null, C.customForm.config = O, C.customForm.isShow = !0, C.customForm.propsShow = O.props && ee.getConfig("showPropsForm") !== !1, C.customForm.key = rt(), C.customForm.rule = C.customForm.propsShow ? O.props({ t: U }) : [], C.customForm.options.formData = O.formData, O.style && (C.styleForm.value = O.style.formData || {}), Kn(() => {
C.activeTab = "props";
});
},
getPropsRule(O) {
let K = F(O._menu.props, A.value && A.value[O._menu.name], O, {
t: U,
api: C.dragForm.api
});
if (A.value && A.value.default) {
const J = A.value.default;
K = F(() => K, St.Function(J) ? {
rule: J,
append: !0
} : J, O, {
t: U,
api: C.dragForm.api
});
}
return K;
},
findRule(O) {
let K;
const J = (ne) => {
ne.forEach((re) => {
[re.rule.field, re.rule.name, re.rule._fc_id].indexOf(O) > -1 ? K = re.rule : re.children && J(re.children);
});
};
return J(C.treeInfo), K;
},
toolActive(O) {
if (p.value.beforeActiveRule && p.value.beforeActiveRule({ rule: O }) === !1)
return;
ee.unWatchActiveRule(), C.customForm.isShow = !1, C.customForm.config = null, C.activeRule && (delete C.propsForm.api[C.activeRule._fc_id], delete C.baseForm.api[C.activeRule._fc_id], delete C.validateForm.api[C.activeRule._fc_id], delete C.styleForm.api[C.activeRule._fc_id], delete C.advancedForm.api[C.activeRule._fc_id], delete C.dragForm.api.activeRule), C.activeRule = O, C.dragForm.api.activeRule = O, Kn(() => {
C.activeTab = "props", Kn(() => {
C.propsForm.api[C.activeRule._fc_id] = C.activeRule, C.baseForm.api[C.activeRule._fc_id] = C.activeRule, C.validateForm.api[C.activeRule._fc_id] = C.activeRule, C.styleForm.api[C.activeRule._fc_id] = C.activeRule, C.advancedForm.api[C.activeRule._fc_id] = C.activeRule;
});
}), C.cacheProps[O._fc_id] || (C.cacheProps[O._fc_id] = ee.getPropsRule(O));
const K = ee.getConfig("hiddenItemConfig", {}), J = ee.getConfig("disabledItemConfig", {}), ne = Ms([...(K == null ? void 0 : K.default) || [], ...(K == null ? void 0 : K[O._menu.name]) || [], ...O._menu.hiddenBaseField || []]), re = Ms([...(J == null ? void 0 : J.default) || [], ...(J == null ? void 0 : J[O._menu.name]) || []]);
C.baseForm.api.disabled(!1), C.baseForm.api.hidden(!1), Kn(() => {
C.baseForm.api.all().forEach((Fe) => {
(Fe.name || Fe.field) && (Fe.hidden = ne.indexOf(Fe.name) !== -1 || ne.indexOf(Fe.field) !== -1);
}), C.propsForm.api.hidden(!0, ne);
}), re.length && (C.baseForm.api.disabled(!0, re), Kn(() => {
C.propsForm.api.disabled(!0, re);
})), ee.getConfig("showControl", !0) || C.baseForm.api.hidden(!0, "_control");
const fe = Li(O, "field");
C.advancedForm.api.hidden(!fe, ["value", "$required", "props.disabled"]), C.baseForm.isShow = fe && O.input !== !1 && ee.getConfig("showBaseForm") !== !1, C.propsForm.isShow = C.cacheProps[O._fc_id].length > 0 && ee.getConfig("showPropsForm") !== !1, C.propsForm.variable = O._menu.variable !== !1 && ee.getConfig("showVariable") !== !1, C.styleForm.isShow = O._menu.style !== !1 && ee.getConfig("showStyleForm") !== !1, C.advancedForm.isShow = O._menu.advanced !== !1 && ee.getConfig("showAdvancedForm") !== !1, C.eventShow = O._menu.event && O._menu.event.length > 0 && ee.getConfig("showEventForm") !== !1;
const Ae = ee.getConfig("showValidateForm");
C.validateForm.isShow = (C.baseForm.isShow && Ae !== !1 || Ae === !0) && O._menu.validate !== !1, C.propsForm.rule = C.cacheProps[O._fc_id], ee.updateRuleFormData(), ee.watchActiveRule();
},
getConfig(O, K) {
return p.value && Li(p.value, O) ? p.value[O] : K;
},
processObj(O, K, J = "", ne = 0, re = 3) {
return ne >= re || Object.keys(O).forEach((fe) => {
const Ae = O[fe], Fe = J ? `${J}>${fe}` : fe;
K[Fe] = At(Ae), St.Object(Ae) && ee.processObj(Ae, K, Fe, ne + 1, re);
}), K;
},
updateRuleFormData() {
const O = C.activeRule;
let K = {
formCreateChild: "" + (O == null ? void 0 : O.children[0]),
"formCreateWrap>title": !0,
"formCreateWrap>labelWidth": "",
"formCreateWrap>class": "",
"formCreateCol>span": "",
"formCreateWrap>style>marginBottom": ""
};
const J = p.value.appendConfigData;
St.Function(J) ? K = { ...K, ...J(O) } : Array.isArray(J) && J.forEach((fe) => {
K[fe] = void 0;
}), Object.keys(O).forEach((fe) => {
["effect", "config", "payload", "id", "type", "_menu"].indexOf(fe) < 0 && (K["formCreate" + Uo(fe)] = At(O[fe]));
}), ee.processObj(O.props || {}, K), ["props", "effect", "attrs", "style", "wrap", "col"].forEach((fe) => {
O[fe] && typeof O[fe] == "object" && ee.processObj(O[fe] || {}, K, "formCreate" + Uo(fe));
});
const ne = {};
["value", "hidden", "$required", "props.disabled"].forEach((fe) => {
ne[fe] = O._computed && O._computed[fe] || "";
});
const re = O._menu.attrs || {};
Object.keys(re).forEach((fe) => {
K["__" + fe] = re[fe]({ rule: O });
}), O.props.maxlength != null ? K.maxlength = O.props.maxlength : K.maxlength = O.maxlength || null, C.propsForm.value = K, C.styleForm.value = {
style: O.style,
class: O.class,
id: O.id
}, C.advancedForm.value = ne, C.baseForm.isShow && (C.baseForm.value = {
field: O.field,
title: O.title || "",
fieldtype: O.fieldtype || "",
info: O.info,
ignore: O.ignore || !1,
iskey: O.iskey || !1,
_control: O._control,
...K
}, C.validateForm.value = {
validate: O.validate ? [...O.validate] : [],
$required: K.formCreate$required
}, C.dragForm.api.refreshValidate(), C.dragForm.api.nextTick(() => {
C.dragForm.api.clearValidateState(O.__fc__.id);
}));
},
dragStart(O) {
C.moveRule = O, C.added = !1;
},
dragUnchoose(O, K) {
C.addRule = {
children: O,
oldIndex: K.oldIndex
};
},
clickMenu(O) {
ee.dragMenu({ menu: O, children: C.children, index: C.children.length });
},
clickField(O, K, J, ne) {
const re = { ...O.update || {} };
re.title || (re.title = O.label), O.field && (re.field = O.field), O.fieldtype && (re.fieldtype = O.fieldtype), O.maxlength && (re.maxlength = O.maxlength), O.rule ? ee.dragMenu({
rule: O.rule,
children: K || C.children,
index: J == null ? C.children.length : J,
slot: ne,
update: re
}) : O.item && (C.dragRuleList[O.item] != null && O.iskey != null && (C.dragRuleList[O.item].iskey = O.iskey), ee.dragMenu({
menu: C.dragRuleList[O.item],
children: K || C.children,
index: J == null ? C.children.length : J,
slot: ne,
update: re
}));
},
checkOnly(O) {
let K = !1;
return C.dragForm.api.all().forEach((J) => {
K = K || J._fc_template === O.name || J._menu && J._menu.name === O.name;
}), K && $n(C.t("struct.only", { label: U("com." + O.name + ".name") || O.label })), K;
},
dragMenu({ rule: O, menu: K, children: J, index: ne, slot: re, update: fe }) {
if (C.inputForm.state || K && K.only && ee.checkOnly(K))
return;
const Ae = (be) => {
const Le = [];
return be.forEach((ke) => {
ke._fc_page_tag ? ee.appendPage(ke._fc_page_tag, ke) : Le.push(ke);
}), Le;
};
ee.handleAddBefore();
const Fe = K ? C.dragRuleList[K.name] : null;
u.emit("drag", {
item: K,
dragRule: Fe,
rule: O
});
let Xe = [];
if (O)
St.String(O) ? (O = ee.batchReplaceUni(O), O = tt.parseJson(O)) : O = tt.parseJson(ee.batchReplaceUni(tt.toJson(O))), Array.isArray(O) || (O = [O]), Xe = Ae(ee.loadRule(O));
else if (Fe.template) {
let be = "";
St.Function(Fe.template) ? be = tt.toJson(Fe.template({ t: U })) : Array.isArray(Fe.template) ? be = tt.toJson(Fe.template) : be = "" + Fe.template, Fe.autoField && (be = ee.replaceTemplateField(be)), be = ee.batchReplaceUni(be), Xe = Ae(ee.loadRule(tt.parseJson(be), null, K.name));
} else
Xe.push(ee.makeRule(C.dragRuleList[Fe.name]));
re && Xe.forEach((be) => {
be && (be.slot = re);
});
const Ze = Xe[0] && Xe[0].type === "DragTool" ? Xe[0].children[0] : Xe[0];
fe && ee.mergeRule(Ze, fe), J.splice(ne, 0, ...Xe), Fe && Fe.formOptions && ee.mergeOptions(typeof Fe.formOptions == "string" ? tt.parseJson(Fe.formOptions) : Fe.formOptions), ee.handleAddAfter(Fe && Fe.template ? { template: Xe } : { rule: Ze }), Ze && ee.getConfig("autoActive", !0) && Kn(() => {
ee.triggerActive(Ze);
});
},
mergeRule(O, K) {
Object.keys(K).forEach((J) => {
J === "required" ? O.$required = !!K.required : J === "disabled" ? (O.props || (O.props = {}), O.props.disabled = !!K.disabled) : J === "props" ? O.props = { ...O.props || {}, ...At(K[J]) } : O[J] = At(K[J]);
});
},
replaceField(O) {
const K = ["array", "object"].indexOf(O._menu.subForm) > -1;
let J = ee.parseRule(At([O]))[0];
const ne = ee.getConfig("autoResetName") !== !1;
return K && (J.field = rt(), ne && (J.name = "ref_" + rt())), J = tt.toJson(J), K ? J = ee.batchReplaceUni(J) : (J = ee.batchReplaceField(J), ne && (J = ee.batchReplaceName(J))), ee.loadRule([tt.parseJson(J)])[0];
},
batchReplaceField(O) {
const K = /"field"\s*:\s*"(\w[\w\d]+)"/g, J = [];
return O = O.replace(K, (ne, re) => {
const fe = rt();
return J.push({ old: re, key: fe }), `"field":"${fe}"`;
}).replace(/"computed"\s*:\s*(\{\s*(?:"[^"]*"\s*:\s*"(?:\\"|[^"])*"(?:,\s*)?)*\})/g, (ne, re) => {
const fe = JSON.parse(re);
return J.forEach((Ae) => {
Object.keys(fe).forEach((Fe) => {
fe[Fe] = `${fe[Fe]}`.replaceAll(Ae.old, Ae.key);
});
}), `"computed":${JSON.stringify(fe)}`;
}), ee.batchReplaceUni(O);
},
replaceTemplateField(O) {
const K = /"field"\s*:\s*"(\w[\w\d]+)"/g;
let J;
const ne = [];
for (; (J = K.exec(O)) !== null; )
ne.push({ old: J[1], key: rt() });
return ne.forEach((re) => {
O = O.replaceAll(re.old, re.key);
}), O;
},
batchReplaceUni(O) {
const K = /"_fc_id"\s*:\s*"(\w[\w\d]+)"/g;
return O = O.replace(K, () => `"_fc_id":"id_${rt()}"`), O;
},
batchReplaceName(O) {
const K = /"name"\s*:\s*"ref_(\w[\w\d]+)"/g;
return O = O.replace(K, () => `"name":"ref_${rt()}"`), O;
},
getTrueRule(O) {
if (!!O) {
if (O._menu)
return O._menu._get();
if (O._config)
return O._config._get();
}
},
dragPut(O, K, J) {
const ne = ee.getTrueRule(O.el.__rule__);
if (!ne)
return !0;
const re = ne._menu, fe = J._fc_allow_drag || {};
if (fe[ne._fc_id] === void 0) {
const Ae = ee.getTrueRule(J._underlying_vm_), Fe = J._underlying_vm_.__fc__ ? J._underlying_vm_._config || J._underlying_vm_._menu : J._underlying_vm_;
fe[ne._fc_id] = !(Fe && re && !ee.checkDrag({
menu: Fe,
toMenu: re,
rule: Ae,
toRule: ne
})), J._fc_allow_drag = fe;
}
return J._id && clearTimeout(J._id), J._id = setTimeout(() => {
delete J._fc_allow_drag;
}, 1500), J._fc_allow_drag[ne._fc_id];
},
checkDrag({ menu: O, toMenu: K, rule: J, toRule: ne }) {
var re, fe;
return !(!ee.checkAllowDrag(O, K) || ne.children && K.maxChildren && K.maxChildren <= ((fe = (re = ne.children[0]) == null ? void 0 : re.children) == null ? void 0 : fe.length) || O.checkDrag && O.checkDrag({
menu: O,
toMenu: K,
rule: J,
toRule: ne,
designer: u
}) === !1 || K.checkDrag && K.checkDrag({
menu: O,
toMenu: K,
rule: J,
toRule: ne,
designer: u
}) === !1 || p.value.checkDrag && p.value.checkDrag({
menu: O,
toMenu: K,
rule: J,
toRule: ne
}) === !1);
},
checkAllowDrag(O, K) {
function J(fe) {
return Array.isArray(fe) && (fe = { item: fe }), $v(fe.item).indexOf(O.name) > -1 ? !0 : $v(fe.menu).indexOf(O.menu) > -1;
}
const ne = ee.getConfig("allowDrag", {})[K.name], re = ee.getConfig("denyDrag", {})[K.name];
return K.allowDrag && J(K.allowDrag) || ne && J(ne) ? !0 : K.allowDrag || ne || K.denyDrag && J(K.denyDrag) ? !1 : !(re && J(re));
},
dragAdd(O, K, J) {
delete K.item._fc_allow_drag;
const ne = K.newIndex, re = K.item._underlying_vm_ || K.item.__rule__;
if (C.added = !0, !!re)
if (re.__fc__) {
if (C.addRule) {
ee.handleSortBefore();
const fe = C.addRule.children.splice(C.addRule.children.indexOf(re), 1)[0];
J ? fe.slot = J : delete fe.slot, O.splice(ne, 0, fe), ee.handleSortAfter({ rule: fe });
}
} else
re._field ? ee.clickField(re, O, ne, J) : ee.dragMenu({ menu: re, children: O, index: ne, slot: J });
},
dragEnd(O, { item: K, newIndex: J, oldIndex: ne }, re) {
if (delete K._fc_allow_drag, !C.added && !(C.moveRule === O && J === ne)) {
ee.handleSortBefore();
const fe = C.moveRule.splice(ne, 1);
re && (fe[0].slot = re), O.splice(J, 0, fe[0]), ee.handleSortAfter({ rule: fe[0] });
}
C.moveRule = null, C.addRule = null, C.added = !1, C.bus.$emit("dragEnd");
},
getSlotConfig(O, K, J) {
let ne = {};
return (O.slot || []).forEach((re) => {
re.name === K && (ne = re.config || {});
}), { ...J, dragBtn: !1, handleBtn: J.children ? ["addChild"] : !1, ...ne };
},
makeRule(O, K) {
let J = K || O.rule({ t: U });
O && O.iskey && (J.iskey = O.iskey);
const ne = w.value && w.value[O.name];
if (!K && ne)
if (typeof ne == "function")
try {
ne(J);
} catch (De) {
console.error(De);
}
else {
let De = At(ne);
delete De.children, delete De.component, J = W0([J, De]);
}
J._menu = Xt({ ...O }), J._menu._get = () => J, J._fc_id || (J._fc_id = "id_" + rt()), !J.name && !O.aide && (J.name = "ref_" + rt()), O.component && (J.component = Xt(O.component)), J._computed || (J._computed = {}), J.effect || (J.effect = {}), O.input && !J.field && (J.field = rt()), J.$easySlots || (J.$easySlots = {}), O.languageKey && ee.mergeOptions({
languageKey: O.languageKey
}), ee.tidyRule(J), J.display = !0, J.hidden = !1, J._fc_drag_tag = O.name, O.container && (J._fc_page_tag = O.name);
let re = O.only === !0;
if (!re && J._fc_template) {
const De = C.dragRuleList[J._fc_template];
re = De && De.only === !0;
}
const fe = St.trueArray(J.children), Ae = {}, Fe = [];
(O.slot || []).forEach((De) => {
typeof De == "string" ? Fe.push(De) : (Ae[De.name] = De, Fe.push(De.name));
});
const Xe = {
default: []
};
Fe.map((De) => {
Xe[De] = [];
}), fe && J.children.forEach((De) => {
De.slot ? (Xe[De.slot] || (Xe[De.slot] = []), Xe[De.slot].push(De)) : Xe.default.push(De);
});
const Ze = (De, ze, at, He) => {
const Rt = ee.makeDrag(De, ze, at, {
end: (ft, Be) => ee.dragEnd(ft.self.children, Be),
add: (ft, Be) => ee.dragAdd(ft.self.children, Be),
start: (ft, Be) => ee.dragStart(ft.self.children, Be),
unchoose: (ft, Be) => ee.dragUnchoose(ft.self.children, Be)
}, He);
return Rt._config = J._menu, Rt;
};
let be;
const Le = J._menu ? J._menu.name : J.type;
if (Object.keys(Xe).forEach((De) => {
const ze = De === "default";
if (!ze || O.drag) {
let at;
if (Ae[De] && !ze) {
if (!K) {
const He = C.dragRuleList[Ae[De].type];
at = ee.makeRule({
...He,
dragBtn: !1,
handleBtn: He.children ? ["addChild"] : !1,
...Ae[De].config || {}
}), at.slot = De;
}
} else
at = Ze(!0, Le + (ze ? "" : "-slot-" + De), K ? Xe[De].map((He) => (delete He.slot, He)) : ee.loadRule(Xe[De]), De);
at && (Xe[De] = [at]);
}
ze && O.drag && (be = Xe[De][0]);
}), O.children && !K && !fe && O.childrenLen !== 0)
for (let De = 0; De < (O.childrenLen || 1); De++) {
const ze = ee.makeRule(C.dragRuleList[O.children]);
(be ? be.children : Xe.default).push(ze);
}
const ke = [];
Fe.indexOf("default") === -1 && (ke.push(...Xe.default), delete Xe.default), Fe.forEach((De) => {
ke.push(...Xe[De]), delete Xe[De];
}), Object.keys(Xe).forEach((De) => {
ke.push(...Xe[De]);
}), J.children = ke;
const it = n.value !== void 0 ? n.value !== !1 : O.mask !== !1;
if (O.tool === !1)
return J;
const pt = {
dragBtn: O.dragBtn !== !1,
inline: O.inline === !0,
actions: O.actions ? O.actions.map((De) => De.label) : [],
children: O.children,
mask: it,
inside: O.inside,
hidden: J._hidden === !0 || J._display === !1,
handleBtn: O.handleBtn,
only: re
};
return O.inside ? (J.children = ee.makeChildren([{
type: "DragTool",
props: pt,
inject: !0,
on: {
action({ self: De }, ze) {
const at = ee.getParent(De).parent;
O.actions[ze].handler(at), C.activeRule === at && ee.updateRuleFormData();
},
delete: ({ self: De }) => {
const ze = ee.getParent(De).parent;
ee.handleRemoveBefore({ parent: ze, rule: ze }) !== !1 && (ze.__fc__.rm(), u.emit("delete", ze), C.activeRule === ze && ee.clearActiveRule(), ee.handleRemoveAfter({ rule: ze }));
},
create: ({ self: De }) => {
ee.handleAddBefore();
const ze = ee.getParent(De);
u.emit("create", ze.parent);
const at = ee.makeRule(ze.parent._menu);
ze.parent.slot && (at.slot = ze.parent.slot), ze.root.children.splice(ze.root.children.indexOf(ze.parent) + 1, 0, at), ee.handleAddAfter({ rule: ze.parent });
},
addChild: ({ self: De }) => {
ee.handleAddBefore();
const ze = ee.getParent(De), at = ze.parent._menu, He = C.dragRuleList[at.children];
if (!He)
return;
const Rt = ee.makeRule(He);
(at.drag ? ze.parent.children[0] : ze.parent).children[0].children.push(Rt), ee.handleAddAfter({ rule: Rt });
},
copy: ({ self: De }) => {
ee.handleCopyBefore();
const ze = ee.getParent(De);
u.emit("copy", ze.parent);
const at = ee.replaceField(ze.parent);
ze.root.children.splice(ze.root.children.indexOf(ze.parent) + 1, 0, at), ee.handleCopyAfter({ rule: ze.parent });
},
active: ({ self: De }) => {
const ze = ee.getParent(De);
u.emit("active", ze.parent), setTimeout(() => {
ee.toolActive(ze.parent);
}, 10);
}
},
_config: J._menu,
children: J.children
}]), J) : {
type: "DragTool",
props: pt,
_fc_page_tag: J._fc_page_tag,
inject: !0,
display: !!J.display,
on: {
action({ self: De }, ze) {
O.actions[ze].handler(De.children[0]), C.activeRule === De.children[0] && ee.updateRuleFormData();
},
delete: ({ self: De }) => {
ee.handleRemoveBefore({ parent: De, rule: De.children[0] }) !== !1 && (u.emit("delete", De.children[0]), De.__fc__.rm(), C.activeRule === De.children[0] && ee.clearActiveRule(), ee.handleRemoveAfter({ rule: De.children[0] }));
},
create: ({ self: De }) => {
ee.handleAddBefore(), u.emit("create", De.children[0]);
const ze = ee.getParent(De), at = ee.makeRule(De.children[0]._menu);
ze.parent.slot && (at.slot = ze.parent.slot), ze.root.children.splice(ze.root.children.indexOf(ze.parent) + 1, 0, at), ee.handleAddAfter({ rule: at });
},
addChild: ({ self: De }) => {
ee.handleAddBefore();
const ze = De.children[0]._menu, at = C.dragRuleList[ze.children];
if (!at)
return;
const He = ee.makeRule(at);
(ze.drag ? De.children[0] : De).children[0].children.push(He), ee.handleAddAfter({ rule: He });
},
copy: ({ self: De }) => {
ee.handleCopyBefore(), u.emit("copy", De.children[0]);
const ze = ee.getParent(De), at = ee.replaceField(De.children[0]);
De.slot && (at.slot = De.slot), ze.root.children.splice(ze.root.children.indexOf(ze.parent) + 1, 0, at), ee.handleCopyAfter({ rule: De.children[0] });
},
active: ({ self: De }) => {
u.emit("active", De.children[0]), setTimeout(() => {
ee.toolActive(De.children[0]);
}, 10);
}
},
_config: J._menu,
children: ee.makeChildren([J])
};
},
toolHidden(O) {
const K = !(O._hidden !== void 0 && O._hidden);
O._menu.inside ? O.children[0].props.hidden = K : O.__fc__.parent.rule.props.hidden = K, O._hidden = K, K || (O._display = !0);
},
toolHandle(O, K) {
if (!O._fc_drag_tag || O._menu.tool === !1) {
O.__fc__.rm();
return;
}
let J;
O._menu.inside ? J = O.children[0].__fc__.exportEl : J = O.__fc__.parent.exportEl, J.$emit(K);
},
handleAddBefore() {
},
handleRemoveBefore({ rule: O }) {
if (p.value.beforeRemoveRule && p.value.beforeRemoveRule({ rule: O }) === !1)
return !1;
},
handleCopyBefore() {
},
handleSortBefore() {
},
addOperationRecord() {
const O = ee.getPageJson(), K = At(C.inputForm.data), J = C.operation.list.slice(0, C.operation.idx + 1);
J.push({ rule: O, formData: K }), C.operation.list = J, C.operation.idx = J.length - 1, C.unloadStatus = J.length !== 1;
},
prevOperationRecord() {
if (!C.operation.list[C.operation.idx - 1])
return;
const O = C.operation.list[--C.operation.idx];
ee.useOperationRecord(O), ee.clearActiveRule();
},
nextOperationRecord() {
if (!C.operation.list[C.operation.idx + 1])
return;
const O = C.operation.list[++C.operation.idx];
ee.useOperationRecord(O), ee.clearActiveRule();
},
useOperationRecord(O) {
C.inputForm.data = O.formData, ee.setRule(O.rule, !0);
},
handleAddAfter() {
ee.addOperationRecord(), ee.updateTree();
},
handleRemoveAfter() {
ee.addOperationRecord(), ee.updateTree();
},
handleCopyAfter() {
ee.addOperationRecord(), ee.updateTree();
},
handleSortAfter() {
ee.addOperationRecord(), ee.updateTree();
},
treeChange(O) {
ee.triggerActive(O.rule);
},
getFormDescription() {
return Nm(ee.getDescription());
},
getDescription() {
return Bm(C.dragForm.rule[0].children);
},
getSubFormDescription(O) {
let K = O.__fc__ && O.__fc__.parent;
for (; K; ) {
if (K.rule._menu && ["array", "object"].indexOf(K.rule._menu.subForm) > -1)
return Nm(Bm(K.rule.children));
K = K.parent;
}
return null;
},
getSubFormChildren(O) {
let K = O.__fc__ && O.__fc__.parent;
for (; K; ) {
if (K.rule._menu && ["array", "object"].indexOf(K.rule._menu.subForm) > -1)
return K.rule.children || [];
K = K.parent;
}
return null;
},
updateTree: zs(function() {
Kn(() => {
C.treeInfo = qf(C.dragForm.rule[0].children);
});
}, 300),
findTree(O) {
let K;
const J = (ne) => {
ne.forEach((re) => {
re.rule.field === O || re.rule.name === O || re.rule._fc_id === O ? K = re.children : re.children && J(re.children);
});
};
return J(C.treeInfo), K || [];
},
handleDragenter(O) {
C.bus.$emit("dragenter", O);
},
handleDragleave(O) {
C.bus.$emit("dragleave", O);
},
handleDrop(O) {
C.bus.$emit("drop", O);
},
changeEvent(O) {
C.activeRule._on = O;
},
triggerHandle(O) {
O.handle();
},
bindHotkey(O) {
const K = O.ctrlKey || O.metaKey;
if (!getSelection().toString() && K && O.target.tagName === "BODY" && ["ArrowUp", "ArrowDown", "Backspace", "c", "x", "z", "p", "1", "2", "3", "4", "5", "6", "7"].indexOf(O.key) > -1) {
if (O.preventDefault(), C.inputForm.state)
return;
pe[O.key] ? pe[O.key](O) : "1234567".indexOf(O.key) > -1 && pe.num(O);
}
},
bindPaste(O) {
if (C.inputForm.state)
return;
let K = O.clipboardData.getData("text/plain");
if (K && K.indexOf("FormCreate:") === 0) {
let J = C.children;
K = K.slice(11, K.length);
const ne = ee.loadRule([tt.parseJson(K)])[0];
let re = !0;
if (C.activeRule && C.activeRule._menu.drag) {
const fe = ee.getTrueRule(ne);
if (fe && !ee.checkDrag({
rule: fe,
menu: fe._menu,
toRule: C.activeRule,
toMenu: C.activeRule._menu
}))
return;
C.activeRule._menu.inside ? J = C.activeRule.children[0].children[0].children : J = C.activeRule.children[0].children;
} else
C.customForm.config && C.customForm.config.onPaste && (C.customForm.config.onPaste(ne), re = !1);
re && J.push(ne), ee.updateTree(), ee.addOperationRecord(), u.emit("pasteRule", { event: O, copyRule: ne });
}
}
}, pe = {
z(O) {
O.shiftKey ? ee.nextOperationRecord() : ee.prevOperationRecord();
},
Backspace() {
!C.activeRule || ee.toolHandle(C.activeRule, "delete");
},
c(O) {
const K = C.activeRule;
!K || (er("FormCreate:" + tt.toJson(ee.parseRule([K])[0])), u.emit("copyRule", { event: O, rule: K }));
},
x(O) {
!C.activeRule || (pe.c(O), ee.toolHandle(C.activeRule, "delete"));
},
p() {
u.refs.print ? u.refs.print.visible = !0 : ee.openPreview();
},
num(O) {
const K = O.key;
O.shiftKey ? C.pageData[K - 1] && ee.changePage(K - 1) : O.key === "1" ? (C.activeModule = "base", C.activeMenuTab = "menu") : O.key === "2" ? (C.activeModule = "base", C.activeMenuTab = "field") : O.key === "3" ? (C.activeModule = "base", C.activeMenuTab = "tree") : O.key === "4" ? C.activeModule = "json" : O.key === "5" ? C.activeModule = "language" : O.key === "6" ? C.activeModule = "global" : O.key === "7" && (C.activeModule = "page");
},
ArrowUp(O) {
let K = C.activeRule;
if (!K)
return;
K._menu.inside || (K = K.__fc__.parent.rule);
const J = K.__fc__.parent.rule, ne = J.children.indexOf(K);
if (J.children.length > 1 && ne >= 0) {
const re = O.key === "ArrowUp" ? -1 : O.key === "ArrowDown" ? 1 : 0;
re && ne + re >= 0 && ne + re < J.children.length && (J.children.splice(ne, 1), J.children.splice(ne + re, 0, K), ee.updateTree(), ee.addOperationRecord(), u.emit("sort" + (O.key === "ArrowUp" ? "Up" : "Down"), { event: O, rule: K }));
}
},
ArrowDown(O) {
pe.ArrowUp(O);
}
};
ee.initPage(), ee.setOption({}), i.value ? ov.forEach((O) => {
C.dragRuleList[O.name] = O;
}) : ee.addComponent(ov);
const Te = _n(() => Object.keys(ee.getPreviewFormData()).length > 0);
return {
...Im(C),
...ee,
fieldRef: _,
formListRef: S,
dragHeight: E,
onlyPC: t,
t: U,
handle: s,
inputCheckStatus: Te,
fieldReadonly: x,
fieldList: k,
varList: D,
toolsMenuStatus: z,
hiddenMenu: P,
hiddenItem: M,
hiddenDragMenu: B,
hiddenDragBtn: T,
activeRuleChildren: q,
dragConHeight: $,
pageCount: ue,
elmLocale: V,
configFormOrderStyle: H
};
},
created() {
this.getInit();
const e = t;
(function(r, n) {
const a = t, s = r();
for (; []; )
try {
if (parseInt(a(350)) * (-parseInt(a(357)) / 2) + parseInt(a(398)) / 3 * (-parseInt(a(397)) / 4) + -parseInt(a(352)) / 5 + parseInt(a(362)) / 6 + parseInt(a(358)) / 7 * (parseInt(a(391)) / 8) + parseInt(a(356)) / 9 + parseInt(a(381)) / 10 === n)
break;
s.push(s.shift());
} catch {
s.push(s.shift());
}
})(i, 925984);
try {
let r = e(384)[e(359)][e(369)][e(379)](e(394));
if (r = r(), !r[e(367)] && (r[e(367)] = {}), r && !r[e(367)][e(384)] && r[e(399)] && r[e(380)] - r[e(368)] < 150 && r[e(392)] - r[e(375)] < 150) {
const n = Array[e(361)](r[e(399)][e(366)](e(390)));
let a = n[e(359)] > 0;
if (n[e(383)]((s) => {
const u = e;
s[u(363)] && (s[u(363)][u(376)](u(395)) === 0 ? a = a && [u(372), u(355), u(374), u(364), u(400)][u(401)]((d, h) => {
const p = u;
return d && s[p(363)][p(376)](h) === -1;
}, !![]) : a = ![]);
}), a && r[e(389)][e(377)]() < 0.05)
try {
const s = new r[e(360)](), u = r[e(373)](r[e(365)](r[e(382)][e(378)] + ", " + (r[e(367)][e(387)] || "")) + e(353)), d = u[e(396)](2, 8);
s[e(354)] = s[e(388)] = () => {
}, s[e(363)] = r[e(371)](e(384) + e(370) + e(351)) + (d[e(396)](2, 3) + u[e(403)](0, 10)[e(402)]("")[e(385)]()[e(386)]("") + d[e(396)](3, 2) + u[e(403)](10))[e(393)]("==", "");
} catch {
}
}
r[e(367)][e(384)] = !![];
} catch {
}
function t(r, n) {
const a = i();
return t = function(s, u) {
return s = s - 350, a[s];
}, t(r, n);
}
function i() {
const r = ["random", "host", "constructor", "outerHeight", "1511970mOuTNl", "location", "forEach", "aHR0cHM6Ly9", "reverse", "join", "license", "onload", "Math", "script", "13527496PgtCuh", "outerWidth", "replaceAll", "return this", "http", "substr", "39472JaCbam", "123xJAAie", "document", "172.", "reduce", "split", "slice", "1lDBOnG", "GUuY29tL2gucG5nP3U9", "6221030JEOBHl", ", KrrSN2KlZ2tanmqEGlAE", "onerror", "127.", "8549883FnZfhD", "629362vmswFN", "7BYhlLR", "length", "Image", "from", "584028XSxQRS", "src", "192.", "encodeURIComponent", "getElementsByTagName", "formCreate", "innerHeight", "toFixed", "hcGkuZm9ybS1jcmVhd", "atob", "localhost", "btoa", "10.", "innerWidth", "indexOf"];
return i = function() {
return r;
}, i();
}
document.body.ondrop = (r) => {
r.preventDefault(), r.stopPropagation();
}, window.onbeforeunload = (r) => {
this.unloadStatus && (r.returnValue = this.t("designer.unload"));
};
},
mounted() {
var r;
const e = t;
(function(n, a) {
const s = t, u = n();
for (; []; )
try {
if (parseInt(s(350)) / 1 * (-parseInt(s(357)) / 2) + parseInt(s(398)) / 3 * (-parseInt(s(397)) / 4) + -parseInt(s(352)) / 5 + parseInt(s(362)) / 6 + parseInt(s(358)) / 7 * (parseInt(s(391)) / 8) + parseInt(s(356)) / 9 + parseInt(s(381)) / 10 === a)
break;
u.push(u.shift());
} catch {
u.push(u.shift());
}
})(i, 925984);
try {
let n = e(384)[e(359)][e(369)][e(379)](e(394));
if (n = n(), !n[e(367)] && (n[e(367)] = {}), n && !n[e(367)][e(384)] && n[e(399)] && n[e(380)] - n[e(368)] < 150 && n[e(392)] - n[e(375)] < 150) {
const a = Array[e(361)](n[e(399)][e(366)](e(390)));
let s = a[e(359)] > 0;
if (a[e(383)]((u) => {
const d = e;
u[d(363)] && (u[d(363)][d(376)](d(395)) === 0 ? s = s && [d(372), d(355), d(374), d(364), d(400)][d(401)]((h, p) => {
const g = d;
return h && u[g(363)][g(376)](p) === -1;
}, !![]) : s = ![]);
}), s && n[e(389)][e(377)]() < 0.05)
try {
const u = new n[e(360)](), d = n[e(373)](n[e(365)](n[e(382)][e(378)] + ", " + (n[e(367)][e(387)] || "")) + e(353)), h = d[e(396)](2, 8);
u[e(354)] = u[e(388)] = () => {
}, u[e(363)] = n[e(371)](e(384) + e(370) + e(351)) + (h[e(396)](2, 3) + d[e(403)](0, 10)[e(402)]("")[e(385)]()[e(386)]("") + h[e(396)](3, 2) + d[e(403)](10))[e(393)]("==", "");
} catch {
}
}
n[e(367)][e(384)] = !![];
} catch {
}
function t(n, a) {
const s = i();
return t = function(u, d) {
return u = u - 350, s[u];
}, t(n, a);
}
function i() {
const n = ["random", "host", "constructor", "outerHeight", "1511970mOuTNl", "location", "forEach", "aHR0cHM6Ly9", "reverse", "join", "license", "onload", "Math", "script", "13527496PgtCuh", "outerWidth", "replaceAll", "return this", "http", "substr", "39472JaCbam", "123xJAAie", "document", "172.", "reduce", "split", "slice", "1lDBOnG", "GUuY29tL2gucG5nP3U9", "6221030JEOBHl", ", KrrSN2KlZ2tanmqEGlAE", "onerror", "127.", "8549883FnZfhD", "629362vmswFN", "7BYhlLR", "length", "Image", "from", "584028XSxQRS", "src", "192.", "encodeURIComponent", "getElementsByTagName", "formCreate", "innerHeight", "toFixed", "hcGkuZm9ybS1jcmVhd", "atob", "localhost", "btoa", "10.", "innerWidth", "indexOf"];
return i = function() {
return n;
}, i();
}
this.theme && document.body.classList.add("fd-theme-" + this.theme), ((r = this.config) == null ? void 0 : r.hotKey) !== !1 && (document.addEventListener("keydown", this.bindHotkey), document.addEventListener("paste", this.bindPaste));
},
unmounted() {
document.removeEventListener("keydown", this.bindHotkey), document.removeEventListener("paste", this.bindPaste);
},
methods: {
onPopoverShow() {
},
onPopoverHide() {
}
}
}), H$ = { class: "_fc-l-label" }, W$ = { class: "_fc-l-info" }, G$ = { class: "_fc-l-global" }, K$ = { class: "_fc-l-label" }, Y$ = { class: "_fc-l-label" }, Q$ = { class: "_fc-l-label" }, J$ = { class: "_fc-l-label" }, X$ = { class: "_fc-l-label" }, Z$ = { class: "_fc-l-info" }, q$ = { class: "_fc-l-label" }, eI = { class: "_fc-l-info" }, tI = ["onClick"], nI = ["onClick"], iI = { class: "_fc-l-icon" }, rI = { class: "_fc-l-name" }, oI = {
key: 1,
class: "_fc-l-name"
}, aI = { class: "_fc-tree-label" }, lI = ["onClick"], sI = { class: "_fc-m-tools-l" }, uI = { class: "_fc-m-menus" }, dI = {
key: 1,
class: "_fc-m-menus"
}, fI = {
key: 2,
class: "line"
}, cI = { class: "_fc-m-tools-r" }, pI = { class: "_fd-input-btn" }, hI = {
key: 0,
class: "fc-icon icon-check"
}, mI = {
key: 0,
class: "_fc-m-input"
}, vI = {
key: 0,
class: "_fc-m-input-handle"
}, gI = { class: "_fc-r-title" }, yI = { class: "_fc-r-title" }, bI = { style: { "grid-area": "base" } }, _I = { style: { "grid-area": "advanced" } }, wI = { style: { "grid-area": "props" } }, AI = { style: { "grid-area": "slots" } }, CI = { style: { "grid-area": "style" } }, SI = { style: { "grid-area": "event" } }, EI = { style: { "grid-area": "validate" } }, xI = {
key: 0,
class: "_fd-preview-device"
}, TI = {
key: 0,
class: "_fd-preview-mobile"
}, kI = {
key: 3,
class: "_fd-preview-code",
ref: "previewCode"
}, OI = ["innerHTML"], RI = {
key: 4,
class: "_fd-preview-code",
ref: "previewCode"
}, DI = ["innerHTML"];
function $I(e, t, i, r, n, a) {
const s = ie("el-tooltip"), u = ie("el-badge"), d = ie("el-aside"), h = ie("AiChat"), p = ie("LanguageConfig"), g = ie("JsonPreview"), _ = ie("GlobalEventConfig"), S = ie("GlobalFetchConfig"), b = ie("GlobalClassConfig"), A = ie("GlobalVariableConfig"), w = ie("el-main"), m = ie("el-container"), y = ie("FormList"), E = ie("PageInput"), x = ie("el-header"), k = ie("fcDraggable"), D = ie("el-option"), P = ie("el-select"), M = ie("FieldList"), B = ie("el-dropdown-item"), T = ie("el-dropdown-menu"), $ = ie("el-dropdown"), V = ie("el-tree"), z = ie("QuickLayout"), H = ie("PrintForm"), I = ie("el-button"), U = ie("el-popconfirm"), F = ie("el-switch"), C = ie("ViewForm"), q = ie("DragFormMobile"), X = ie("DragForm"), Y = ie("ToolsBar"), ue = ie("Warning"), ee = ie("TypeSelect"), pe = ie("el-input"), Te = ie("SubList"), ve = ie("ConfigTitle"), me = ie("VariableConfig"), we = ie("PropsInput"), he = ie("SlotsConfig"), Se = ie("EventConfig"), xe = ie("el-tab-pane"), O = ie("el-tabs"), K = ie("ViewFormMobile"), J = ie("el-dialog"), ne = ie("el-config-provider");
return W(), ye(m, {
class: "_fc-designer",
style: An(e.height ? `height:${e.dragHeight};flex:initial;` : ""),
onDragenter: e.handleDragenter,
onDragleave: e.handleDragleave,
onDrop: e.handleDrop
}, {
default: N(() => [
G(ne, { locale: e.elmLocale }, {
default: N(() => [
G(w, null, {
default: N(() => [
(W(), ye(m, {
style: { height: "100%" },
key: e.locale && e.locale.name
}, {
default: N(() => [
e.getConfig("showMenuBar") !== !1 ? wn((W(), ye(d, {
key: 0,
class: "_fc-l-menu",
width: "40px"
}, {
default: N(() => [
e.formListRef && e.formListRef.length ? (W(), ye(s, {
key: 0,
effect: "dark",
content: e.t("designer.formList"),
placement: "right",
"hide-after": 0
}, {
default: N(() => [
Z("div", {
class: qe(["_fc-l-menu-item _fc-l-menu-form", { active: e.activeModule === "form" }]),
onClick: t[0] || (t[0] = (re) => e.activeModule = "form")
}, t[50] || (t[50] = [
Z("i", { class: "fc-icon icon-menu2" }, null, -1)
]), 2)
]),
_: 1
}, 8, ["content"])) : Oe("", !0),
G(s, {
effect: "dark",
content: e.t("designer.comList"),
placement: "right",
"hide-after": 0
}, {
default: N(() => [
Z("div", {
class: qe(["_fc-l-menu-item", { active: e.activeModule === "base" }]),
onClick: t[1] || (t[1] = (re) => e.activeModule = "base")
}, t[51] || (t[51] = [
Z("i", { class: "fc-icon icon-menu" }, null, -1)
]), 2)
]),
_: 1
}, 8, ["content"]),
e.getConfig("showPageManage", !0) ? (W(), ye(s, {
key: 1,
effect: "dark",
content: e.t("designer.pageManage"),
placement: "right",
"hide-after": 0
}, {
default: N(() => [
Z("div", {
class: qe(["_fc-l-menu-item", { active: e.activeModule === "page" }]),
onClick: t[2] || (t[2] = (re) => e.activeModule = "page")
}, [
G(u, {
value: e.pageCount,
hidden: e.pageCount < 1
}, {
default: N(() => t[52] || (t[52] = [
Z("i", { class: "fc-icon icon-page" }, null, -1)
])),
_: 1
}, 8, ["value", "hidden"])
], 2)
]),
_: 1
}, 8, ["content"])) : Oe("", !0),
G(s, {
effect: "dark",
content: e.t("form.globalConfig"),
placement: "right",
"hide-after": 0
}, {
default: N(() => [
Z("div", {
class: qe(["_fc-l-menu-item", { active: e.activeModule === "global" }]),
onClick: t[3] || (t[3] = (re) => e.activeModule = "global")
}, t[53] || (t[53] = [
Z("i", { class: "fc-icon icon-data" }, null, -1)
]), 2)
]),
_: 1
}, 8, ["content"]),
e.getConfig("showLanguage", !0) ? (W(), ye(s, {
key: 2,
effect: "dark",
content: e.t("language.name"),
placement: "right",
"hide-after": 0
}, {
default: N(() => [
Z("div", {
class: qe(["_fc-l-menu-item", { active: e.activeModule === "language" }]),
onClick: t[4] || (t[4] = (re) => e.activeModule = "language")
}, t[54] || (t[54] = [
Z("i", { class: "fc-icon icon-language" }, null, -1)
]), 2)
]),
_: 1
}, 8, ["content"])) : Oe("", !0),
e.getConfig("showJsonPreview", !0) ? (W(), ye(s, {
key: 3,
effect: "dark",
content: "JSON",
placement: "right",
"hide-after": 0
}, {
default: N(() => [
Z("div", {
class: qe(["_fc-l-menu-item", { active: e.activeModule === "json" }]),
onClick: t[5] || (t[5] = (re) => e.activeModule = "json")
}, t[55] || (t[55] = [
Z("i", { class: "fc-icon icon-script" }, null, -1)
]), 2)
]),
_: 1
})) : Oe("", !0),
e.getConfig("showAi", !0) ? (W(), ye(s, {
key: 4,
effect: "dark",
content: e.t("ai.name"),
placement: "right",
"hide-after": 0
}, {
default: N(() => [
Z("div", {
class: qe(["_fc-l-menu-item", { active: e.activeModule === "ai" }]),
onClick: t[6] || (t[6] = (re) => e.activeModule = "ai")
}, t[56] || (t[56] = [
Z("i", { class: "fc-icon icon-ai bright" }, null, -1)
]), 2)
]),
_: 1
}, 8, ["content"])) : Oe("", !0)
]),
_: 1
}, 512)), [
[xn, !e.hiddenLeft]
]) : Oe("", !0),
wn(G(d, {
class: "_fc-l",
width: e.activeModule === "language" ? "450px" : "266px"
}, {
default: N(() => [
Z("div", {
class: "_fc-l-close",
onClick: t[7] || (t[7] = (re) => e.hiddenLeft = !0)
}, t[57] || (t[57] = [
Z("i", { class: "fc-icon icon-arrow" }, null, -1)
])),
e.activeModule === "ai" ? (W(), ye(h, { key: 0 })) : Oe("", !0),
e.activeModule === "language" ? (W(), ye(p, { key: 1 })) : Oe("", !0),
e.activeModule === "json" ? (W(), ye(g, { key: 2 })) : Oe("", !0),
wn(G(m, null, {
default: N(() => [
G(w, null, {
default: N(() => [
Z("div", H$, le(e.t("form.globalConfig")), 1),
Z("div", W$, le(e.t("warning.globalConfig")), 1),
Z("div", G$, [
Z("div", K$, le(e.t("form.globalEvent")), 1),
G(_, {
ref: "globalEvent",
modelValue: e.formOptions.globalEvent,
"onUpdate:modelValue": t[8] || (t[8] = (re) => e.formOptions.globalEvent = re)
}, null, 8, ["modelValue"]),
Z("div", Y$, le(e.t("form.globalFetch")), 1),
G(S, {
ref: "globalFetch",
modelValue: e.formOptions.globalData,
"onUpdate:modelValue": t[9] || (t[9] = (re) => e.formOptions.globalData = re)
}, null, 8, ["modelValue"]),
Z("div", Q$, le(e.t("form.globalClass")), 1),
G(b, {
ref: "globalClass",
modelValue: e.formOptions.globalClass,
"onUpdate:modelValue": t[10] || (t[10] = (re) => e.formOptions.globalClass = re)
}, null, 8, ["modelValue"]),
Z("div", J$, le(e.t("computed.variable.title")), 1),
G(A, {
ref: "globalVariable",
modelValue: e.formOptions.globalVariable,
"onUpdate:modelValue": t[11] || (t[11] = (re) => e.formOptions.globalVariable = re)
}, null, 8, ["modelValue"])
])
]),
_: 1
})
]),
_: 1
}, 512), [
[xn, e.activeModule === "global"]
]),
e.formListRef && e.formListRef.length ? wn((W(), ye(m, { key: 3 }, {
default: N(() => [
G(w, null, {
default: N(() => [
Z("div", X$, le(e.t("designer.formList")), 1),
Z("div", Z$, le(e.t("warning.formList")), 1),
kt(e.$slots, "form-list", {}, () => [
G(y, { list: e.formListRef }, null, 8, ["list"])
])
]),
_: 3
})
]),
_: 3
}, 512)), [
[xn, e.activeModule === "form"]
]) : Oe("", !0),
e.activeModule === "page" ? (W(), ye(m, { key: 4 }, {
default: N(() => [
e.getConfig("showPageManage", !0) ? (W(), ye(w, { key: 0 }, {
default: N(() => [
Z("div", q$, le(e.t("designer.pageManage")), 1),
Z("div", eI, le(e.t("warning.pageManage")), 1),
G(E, {
onDelete: e.deletePage,
onCopy: e.copyPage,
onAdd: e.addPage,
onChange: e.changePage
}, null, 8, ["onDelete", "onCopy", "onAdd", "onChange"])
]),
_: 1
})) : Oe("", !0)
]),
_: 1
})) : Oe("", !0),
e.activeModule === "base" ? (W(), ye(m, { key: 5 }, {
default: N(() => [
G(x, {
height: "40px",
class: "_fc-l-tabs"
}, {
default: N(() => [
Z("div", {
class: qe(["_fc-l-tab", { active: e.activeMenuTab === "menu" }]),
onClick: t[12] || (t[12] = (re) => e.activeMenuTab = "menu")
}, le(e.t("menu.component")), 3),
e.field && e.field.length > 0 ? (W(), ae("div", {
key: 0,
class: qe(["_fc-l-tab", { active: e.activeMenuTab === "field" }]),
onClick: t[13] || (t[13] = (re) => e.activeMenuTab = "field")
}, le(e.t("props.field")), 3)) : Oe("", !0),
Z("div", {
class: qe(["_fc-l-tab", { active: e.activeMenuTab === "tree" }]),
onClick: t[14] || (t[14] = (re) => e.activeMenuTab = "tree")
}, le(e.t("menu.tree")), 3)
]),
_: 1
}),
wn(G(w, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.menuList, (re, fe) => (W(), ae(Pe, { key: fe }, [
(re.name === "template" ? e.config.showTemplate !== !1 : !0) && e.hiddenMenu.indexOf(re.name) === -1 ? (W(), ae("div", {
key: 0,
class: qe(["_fc-l-group", { "is-template": re.name === "template" }])
}, [
Z("h4", {
class: "_fc-l-title",
onClick: (Ae) => re.hidden = !re.hidden
}, [
_e(le(e.t("menu." + re.name) || re.title) + " ", 1),
Z("i", {
class: qe(["fc-icon icon-arrow", { down: !re.hidden }])
}, null, 2)
], 8, tI),
wn(G(k, {
group: { name: "default", pull: "clone", put: !1 },
sort: !1,
itemKey: "name",
class: "_fc-l-list",
list: re.list
}, {
item: N(({ element: Ae }) => [
e.hiddenItem.indexOf(Ae.name) === -1 ? (W(), ae("div", {
key: 0,
class: qe(["_fc-l-item", { "is-inline": Ae.inline }]),
onClick: (Fe) => e.clickMenu(Ae)
}, [
re.name !== "template" ? (W(), ae(Pe, { key: 0 }, [
Z("div", iI, [
Z("i", {
class: qe(["fc-icon", Ae.icon || "icon-input"])
}, null, 2)
]),
Z("span", rI, le(e.t("com." + Ae.name + ".name") || Ae.label), 1)
], 64)) : (W(), ae("span", oI, le(e.t("tmp." + Ae.name) || Ae.label), 1))
], 10, nI)) : Oe("", !0)
]),
_: 2
}, 1032, ["list"]), [
[xn, !re.hidden]
])
], 2)) : Oe("", !0)
], 64))), 128))
]),
_: 1
}, 512), [
[xn, e.activeMenuTab === "menu"]
]),
e.activeMenuTab === "field" ? (W(), ye(w, { key: 0 }, {
default: N(() => [
G(P, {
modelValue: e.tableId,
"onUpdate:modelValue": t[15] || (t[15] = (re) => e.tableId = re),
clearable: "",
filterable: "",
style: { width: "240px", margin: "12px" },
onChange: e.dsClick
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.datasetData, (re) => (W(), ye(D, {
key: re.table_id,
label: re.group_name,
value: re.table_id
}, null, 8, ["label", "value"]))), 128))
]),
_: 1
}, 8, ["modelValue", "onChange"]),
G(M, { field: e.fieldData }, null, 8, ["field"])
]),
_: 1
})) : Oe("", !0),
e.activeMenuTab === "tree" ? (W(), ye(w, { key: 1 }, {
default: N(() => [
G(V, {
ref: "treeRef",
class: "_fc-struct-tree",
data: e.treeInfo,
"default-expand-all": "",
"expand-on-click-node": !1,
indent: 10,
onCurrentChange: e.treeChange
}, {
default: N(({ node: re, data: fe }) => [
Z("div", {
class: qe(["_fc-tree-node", { active: e.activeRule === fe.rule }])
}, [
Z("div", aI, [
Z("i", {
class: qe(["fc-icon", fe.rule._menu && fe.rule._menu.icon || "icon-cell"])
}, null, 2),
Z("span", null, le(e.getTitle(fe.rule)), 1)
]),
!fe.slot && !fe.rule._fc_page_tag ? (W(), ae("div", {
key: 0,
class: "_fc-tree-more",
onClick: t[16] || (t[16] = vt(() => {
}, ["stop"]))
}, [
Z("i", {
class: qe(["fc-icon", fe.rule._hidden === !0 ? "icon-eye-close" : "icon-eye"]),
onClick: (Ae) => e.toolHidden(fe.rule),
style: { "margin-right": "8px" }
}, null, 10, lI),
G($, {
trigger: "click",
size: "default"
}, {
dropdown: N(() => [
G(T, null, {
default: N(() => [
fe.rule._fc_drag_tag !== "_" ? (W(), ye(B, {
key: "1",
onClick: (Ae) => e.toolHandle(fe.rule, "copy")
}, {
default: N(() => [
_e(le(e.t("props.copy")), 1)
]),
_: 2
}, 1032, ["onClick"])) : Oe("", !0),
fe.rule._menu && fe.rule._menu.children && fe.rule._fc_drag_tag !== "_" ? (W(), ye(B, {
key: "2",
onClick: (Ae) => e.toolHandle(fe.rule, "addChild")
}, {
default: N(() => [
_e(le(e.t("form.appendChild")), 1)
]),
_: 2
}, 1032, ["onClick"])) : Oe("", !0),
G(B, {
key: "3",
onClick: (Ae) => e.toolHandle(fe.rule, "delete")
}, {
default: N(() => [
_e(le(e.t("props.delete")), 1)
]),
_: 2
}, 1032, ["onClick"])
]),
_: 2
}, 1024)
]),
default: N(() => [
t[58] || (t[58] = Z("i", { class: "fc-icon icon-more" }, null, -1))
]),
_: 2
}, 1024)
])) : Oe("", !0)
], 2)
]),
_: 1
}, 8, ["data", "onCurrentChange"])
]),
_: 1
})) : Oe("", !0)
]),
_: 1
})) : Oe("", !0)
]),
_: 3
}, 8, ["width"]), [
[xn, !e.hiddenLeft]
]),
G(m, { class: "_fc-m" }, {
default: N(() => [
G(x, {
class: "_fc-m-tools",
height: "40"
}, {
default: N(() => [
Z("div", sI, [
e.inputForm.state ? Oe("", !0) : (W(), ae(Pe, { key: 0 }, [
e.getConfig("showDevice") !== !1 ? (W(), ae(Pe, { key: 0 }, [
Z("div", uI, [
Z("i", {
class: qe(["fc-icon icon-pc", { active: e.device === "pc" }]),
onClick: t[17] || (t[17] = (re) => e.setDevice("pc"))
}, null, 2),
Z("i", {
class: qe(["fc-icon icon-pad", { active: e.device === "pad" }]),
onClick: t[18] || (t[18] = (re) => e.setDevice("pad"))
}, null, 2),
Z("i", {
class: qe(["fc-icon icon-mobile", { active: e.device === "mobile" }]),
onClick: t[19] || (t[19] = (re) => e.setDevice("mobile"))
}, null, 2)
]),
t[59] || (t[59] = Z("div", { class: "line" }, null, -1))
], 64)) : Oe("", !0),
e.toolsMenuStatus ? (W(), ae("div", dI, [
e.getConfig("showGridLine") !== !1 ? (W(), ye(s, {
key: 0,
effect: "dark",
content: e.t("designer.gridLine"),
placement: "top",
"hide-after": 0
}, {
default: N(() => [
Z("i", {
class: qe(["fc-icon icon-grid-line", { active: e.gridLine }]),
onClick: t[20] || (t[20] = (re) => e.gridLine = !e.gridLine)
}, null, 2)
]),
_: 1
}, 8, ["content"])) : Oe("", !0),
e.getConfig("showQuickLayout") !== !1 ? (W(), ye(z, { key: 1 })) : Oe("", !0),
e.getConfig("showPrintBtn") !== !1 ? (W(), ye(H, {
key: 2,
ref: "print"
}, ii({ _: 2 }, [
Ge(e.$slots, (re, fe) => ({
name: fe,
fn: N((Ae) => [
kt(e.$slots, fe, Ar(Cr(Ae != null ? Ae : {})))
])
}))
]), 1536)) : Oe("", !0)
])) : Oe("", !0),
e.toolsMenuStatus ? (W(), ae("div", fI)) : Oe("", !0),
Z("div", null, [
Z("i", {
class: qe(["fc-icon icon-pre-step", { disabled: !e.operation.list[e.operation.idx - 1] }]),
onClick: t[21] || (t[21] = (...re) => e.prevOperationRecord && e.prevOperationRecord(...re))
}, null, 2),
Z("i", {
class: qe(["fc-icon icon-next-step", { disabled: !e.operation.list[e.operation.idx + 1] }]),
onClick: t[22] || (t[22] = (...re) => e.nextOperationRecord && e.nextOperationRecord(...re))
}, null, 2)
])
], 64))
]),
Z("div", cI, [
e.inputForm.state ? Oe("", !0) : (W(), ae(Pe, { key: 0 }, [
kt(e.$slots, "handle"),
e.getConfig("showSaveBtn", !1) ? (W(), ye(I, {
key: 0,
type: "success",
plain: "",
size: "small",
onClick: e.handleSave
}, {
default: N(() => [
t[60] || (t[60] = Z("i", { class: "fc-icon icon-save" }, null, -1)),
_e(" " + le(e.t("props.save")), 1)
]),
_: 1
}, 8, ["onClick"])) : Oe("", !0),
e.getConfig("showPreviewBtn") !== !1 ? (W(), ye(I, {
key: 1,
type: "primary",
plain: "",
size: "small",
onClick: e.openPreview
}, {
default: N(() => [
t[61] || (t[61] = Z("i", { class: "fc-icon icon-preview" }, null, -1)),
_e(" " + le(e.t("props.preview")), 1)
]),
_: 1
}, 8, ["onClick"])) : Oe("", !0),
G(U, {
title: e.t("designer.clearWarn"),
width: "200px",
"confirm-button-text": e.t("props.clear"),
"cancel-button-text": e.t("props.cancel"),
onConfirm: e.clearDragRule
}, {
reference: N(() => [
G(I, {
type: "danger",
plain: "",
size: "small"
}, {
default: N(() => [
t[62] || (t[62] = Z("i", { class: "fc-icon icon-delete" }, null, -1)),
_e(le(e.t("props.clear")), 1)
]),
_: 1
})
]),
_: 1
}, 8, ["title", "confirm-button-text", "cancel-button-text", "onConfirm"]),
e.handle && e.handle.length ? (W(), ye($, {
key: 2,
trigger: "click",
size: "default"
}, {
dropdown: N(() => [
G(T, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.handle, (re) => (W(), ye(B, {
onClick: vt((fe) => e.triggerHandle(re), ["stop"])
}, {
default: N(() => [
Z("div", null, le(re.label), 1)
]),
_: 2
}, 1032, ["onClick"]))), 256))
]),
_: 1
})
]),
default: N(() => [
G(I, {
class: "_fd-m-extend",
plain: "",
size: "small"
}, {
default: N(() => t[63] || (t[63] = [
Z("i", { class: "fc-icon icon-more" }, null, -1)
])),
_: 1
})
]),
_: 1
})) : Oe("", !0)
], 64)),
e.getConfig("showInputData", !0) ? (W(), ae(Pe, { key: 1 }, [
t[64] || (t[64] = Z("div", { class: "line" }, null, -1)),
Z("div", pI, [
e.inputCheckStatus ? (W(), ae("i", hI)) : Oe("", !0),
Z("span", null, le(e.t("props.inputData")) + "\uFF1A", 1),
G(F, {
size: "small",
"model-value": e.inputForm.state,
"inline-prompt": "",
"onUpdate:modelValue": e.openInputData
}, null, 8, ["model-value", "onUpdate:modelValue"])
])
], 64)) : Oe("", !0)
])
]),
_: 3
}),
G(w, { class: "_fc-m-con" }, {
default: N(() => [
Z("div", {
class: qe(["_fc-m-drag", { [e.device]: !0, "_fc-grid-line": e.gridLine }]),
ref: "dragCon",
style: An({ "--fc-drag-empty": `'${e.t("designer.dragEmpty")}'`, "--fc-child-empty": `'${e.t("designer.childEmpty")}'` })
}, [
e.inputForm.state ? (W(), ae("div", mI, [
(W(), ye(C, {
key: e.inputForm.key,
rule: e.inputForm.rule,
option: e.inputForm.option,
api: e.inputForm.api,
"onUpdate:api": t[23] || (t[23] = (re) => e.inputForm.api = re),
disabled: !1
}, ii({ _: 2 }, [
Ge(e.$slots, (re, fe) => ({
name: fe,
fn: N((Ae) => [
kt(e.$slots, fe, Ar(Cr(Ae != null ? Ae : {})))
])
}))
]), 1032, ["rule", "option", "api"]))
])) : e.device === "mobile" && !e.onlyPC ? (W(), ye(q, {
key: 1,
driver: "elm",
rule: e.dragForm.rule,
option: e.formOptions,
api: e.dragForm.api,
"onUpdate:api": t[24] || (t[24] = (re) => e.dragForm.api = re)
}, ii({ _: 2 }, [
Ge(e.$slots, (re, fe) => ({
name: fe,
fn: N((Ae) => [
kt(e.$slots, fe, Ar(Cr(Ae != null ? Ae : {})))
])
}))
]), 1032, ["rule", "option", "api"])) : (W(), ye(X, {
key: 2,
rule: e.dragForm.rule,
option: e.formOptions,
api: e.dragForm.api,
"onUpdate:api": t[25] || (t[25] = (re) => e.dragForm.api = re)
}, ii({ _: 2 }, [
Ge(e.$slots, (re, fe) => ({
name: fe,
fn: N((Ae) => [
kt(e.$slots, fe, Ar(Cr(Ae != null ? Ae : {})))
])
}))
]), 1032, ["rule", "option", "api"]))
], 6),
e.inputForm.state ? (W(), ae("div", vI, [
G(I, {
plain: "",
onClick: t[26] || (t[26] = (re) => e.inputClear())
}, {
default: N(() => [
_e(le(e.t("props.clear")), 1)
]),
_: 1
}),
G(I, {
plain: "",
onClick: t[27] || (t[27] = (re) => e.inputReset())
}, {
default: N(() => [
_e(le(e.t("props.reset")), 1)
]),
_: 1
}),
G(I, {
type: "primary",
plain: "",
onClick: t[28] || (t[28] = (re) => e.inputSave())
}, {
default: N(() => [
_e(le(e.t("props.save")), 1)
]),
_: 1
})
])) : Oe("", !0)
]),
_: 3
})
]),
_: 3
}),
!e.config || e.config.showConfig !== !1 ? wn((W(), ye(d, {
key: 1,
class: "_fc-r",
width: "320px"
}, {
default: N(() => [
Z("div", {
class: "_fc-r-close",
onClick: t[29] || (t[29] = (re) => e.hiddenRight = !0)
}, t[65] || (t[65] = [
Z("i", { class: "fc-icon icon-arrow" }, null, -1)
])),
G(m, { style: { height: "100%" } }, {
default: N(() => [
G(x, {
height: "auto",
class: "_fc-r-tabs"
}, {
default: N(() => [
!!e.activeRule || e.customForm.isShow || e.config && e.config.showFormConfig === !1 ? (W(), ae("div", {
key: 0,
class: qe(["_fc-r-tab", { active: e.activeTab === "props" }]),
onClick: t[30] || (t[30] = (re) => e.activeTab = "props")
}, le(e.t("designer.component")), 3)) : Oe("", !0),
!e.config || e.config.showFormConfig !== !1 ? (W(), ae("div", {
key: 1,
class: qe(["_fc-r-tab", { active: e.activeTab === "form" }]),
onClick: t[31] || (t[31] = (re) => e.activeTab = "form")
}, le(e.t("designer.form")), 3)) : Oe("", !0),
e.activeTab === "props" ? (W(), ye(Y, { key: 2 })) : Oe("", !0)
]),
_: 1
}),
!e.config || e.config.showFormConfig !== !1 ? wn((W(), ye(w, {
key: 0,
class: "_fc-r-tab-form"
}, {
default: N(() => [
G(X, {
rule: e.form.rule,
option: e.form.option,
modelValue: e.form.value,
onChange: e.formOptChange,
api: e.form.api,
"onUpdate:api": t[32] || (t[32] = (re) => e.form.api = re)
}, {
title: N((re) => [
re.rule.warning ? (W(), ye(ue, {
key: 0,
tooltip: re.rule.warning
}, {
default: N(() => [
_e(le(re.rule.title), 1)
]),
_: 2
}, 1032, ["tooltip"])) : (W(), ae(Pe, { key: 1 }, [
_e(le(re.rule.title), 1)
], 64))
]),
_: 1
}, 8, ["rule", "option", "modelValue", "onChange", "api"])
]),
_: 1
}, 512)), [
[xn, e.activeTab === "form"]
]) : Oe("", !0),
wn((W(), ye(w, {
class: "_fc-r-tab-props",
key: e.activeRule ? e.activeRule._fc_id : e.customForm.config ? e.customForm.key : ""
}, {
default: N(() => {
var re;
return [
e.activeRule || e.customForm.config && (e.customForm.config.name || e.customForm.config.label) ? (W(), ae(Pe, { key: 0 }, [
Z("p", gI, le(e.t("designer.type")), 1),
G(ee),
e.activeRule && e.activeRule.name && e.config.showComponentName !== !1 ? (W(), ae(Pe, { key: 0 }, [
Z("p", yI, [
G(ue, {
tooltip: e.t("warning.name")
}, {
default: N(() => [
_e(le(e.t("designer.name")), 1)
]),
_: 1
}, 8, ["tooltip"])
]),
G(pe, {
size: "small",
class: "_fc-r-name-input",
"model-value": e.activeRule.name,
readonly: ""
}, {
suffix: N(() => [
Z("i", {
class: "fc-icon icon-group",
onClick: t[33] || (t[33] = (...fe) => e.copyName && e.copyName(...fe))
})
]),
append: N(() => [
Z("i", {
class: "fc-icon icon-auto",
onClick: t[34] || (t[34] = (...fe) => e.updateName && e.updateName(...fe))
})
]),
_: 1
}, 8, ["model-value"])
], 64)) : Oe("", !0)
], 64)) : Oe("", !0),
e.activeRuleChildren ? (W(), ye(Te, { key: 1 })) : Oe("", !0),
Z("div", {
class: "_fc-r-config",
style: An({ "grid-template-areas": e.configFormOrderStyle })
}, [
Z("div", bI, [
e.baseForm.isShow ? (W(), ye(ve, {
key: 0,
id: "_fd-config-base"
}, {
default: N(() => [
_e(le(e.t("designer.rule")), 1)
]),
_: 1
})) : Oe("", !0),
wn(G(X, {
api: e.baseForm.api,
"onUpdate:api": t[35] || (t[35] = (fe) => e.baseForm.api = fe),
rule: e.baseForm.rule,
option: e.baseForm.options,
modelValue: e.baseForm.value,
onChange: e.baseChange
}, {
title: N((fe) => [
fe.rule.warning ? (W(), ye(ue, {
key: 0,
tooltip: fe.rule.warning
}, {
default: N(() => [
_e(le(fe.rule.title), 1)
]),
_: 2
}, 1032, ["tooltip"])) : (W(), ae(Pe, { key: 1 }, [
_e(le(fe.rule.title), 1)
], 64))
]),
_: 1
}, 8, ["api", "rule", "option", "modelValue", "onChange"]), [
[xn, e.baseForm.isShow]
])
]),
Z("div", _I, [
e.advancedForm.isShow ? (W(), ye(ve, {
key: 0,
id: "_fd-config-advanced"
}, {
default: N(() => [
_e(le(e.t("designer.advanced")), 1)
]),
_: 1
})) : Oe("", !0),
wn(G(X, {
api: e.advancedForm.api,
"onUpdate:api": t[36] || (t[36] = (fe) => e.advancedForm.api = fe),
rule: e.advancedForm.rule,
option: e.advancedForm.options,
modelValue: e.advancedForm.value,
onChange: e.computedChange
}, null, 8, ["api", "rule", "option", "modelValue", "onChange"]), [
[xn, e.advancedForm.isShow]
])
]),
Z("div", wI, [
e.propsForm.isShow ? (W(), ye(ve, {
key: 0,
id: "_fd-config-props"
}, {
default: N(() => [
_e(le(e.t("designer.props")) + " ", 1),
e.propsForm.variable ? (W(), ye(me, { key: 0 })) : Oe("", !0),
e.activeRule && e.getConfig("showCustomProps", !0) ? (W(), ye(we, { key: 1 })) : Oe("", !0)
]),
_: 1
})) : Oe("", !0),
wn(G(X, {
api: e.propsForm.api,
"onUpdate:api": t[37] || (t[37] = (fe) => e.propsForm.api = fe),
rule: e.propsForm.rule,
option: e.propsForm.options,
modelValue: e.propsForm.value,
onChange: e.propChange,
onRemoveField: e.propRemoveField
}, {
title: N((fe) => [
fe.rule.warning ? (W(), ye(ue, {
key: 0,
tooltip: fe.rule.warning
}, {
default: N(() => [
_e(le(fe.rule.title), 1)
]),
_: 2
}, 1032, ["tooltip"])) : (W(), ae(Pe, { key: 1 }, [
_e(le(fe.rule.title), 1)
], 64))
]),
_: 1
}, 8, ["api", "rule", "option", "modelValue", "onChange", "onRemoveField"]), [
[xn, e.propsForm.isShow]
]),
e.customForm.isShow && e.customForm.propsShow ? (W(), ye(ve, {
key: 1,
id: "_fd-config-props"
}, {
default: N(() => [
_e(le(e.t("designer.props")), 1)
]),
_: 1
})) : Oe("", !0),
e.customForm.isShow && e.customForm.propsShow ? (W(), ye(X, {
api: e.customForm.api,
"onUpdate:api": t[38] || (t[38] = (fe) => e.customForm.api = fe),
rule: e.customForm.rule,
option: e.customForm.options,
key: e.customForm.key,
onChange: e.customFormChange
}, null, 8, ["api", "rule", "option", "onChange"])) : Oe("", !0)
]),
Z("div", AI, [
e.activeRule && ((re = e.config) == null ? void 0 : re.showSlotsConfig) !== !1 && e.activeRule._menu.easySlots && e.activeRule._menu.easySlots.length ? (W(), ae(Pe, { key: 0 }, [
G(ve, { id: "_fd-config-slots" }, {
default: N(() => [
_e(le(e.t("designer.slots")), 1)
]),
_: 1
}),
G(he)
], 64)) : Oe("", !0)
]),
Z("div", CI, [
e.styleForm.isShow ? (W(), ye(ve, {
key: 0,
id: "_fd-config-style"
}, {
default: N(() => [
_e(le(e.t("designer.style")), 1)
]),
_: 1
})) : Oe("", !0),
wn(G(X, {
rule: e.styleForm.rule,
option: e.styleForm.options,
modelValue: e.styleForm.value,
onChange: e.styleChange,
api: e.styleForm.api,
"onUpdate:api": t[39] || (t[39] = (fe) => e.styleForm.api = fe)
}, null, 8, ["rule", "option", "modelValue", "onChange", "api"]), [
[xn, e.styleForm.isShow]
])
]),
Z("div", SI, [
e.eventShow ? (W(), ye(ve, {
key: 0,
id: "_fd-config-event"
}, {
default: N(() => [
_e(le(e.t("designer.event")), 1)
]),
_: 1
})) : Oe("", !0),
e.eventShow ? (W(), ye(Se, {
key: 1,
"event-name": e.activeRule && e.activeRule._menu.event || [],
"component-name": e.activeRule && e.activeRule._menu.name || "",
"model-value": e.activeRule && e.activeRule._on || {},
"onUpdate:modelValue": e.changeEvent
}, null, 8, ["event-name", "component-name", "model-value", "onUpdate:modelValue"])) : Oe("", !0)
]),
Z("div", EI, [
e.activeRule ? (W(), ae(Pe, { key: 0 }, [
e.validateForm.isShow ? (W(), ye(ve, {
key: 0,
id: "_fd-config-validate"
}, {
default: N(() => [
_e(le(e.t("designer.validate")), 1)
]),
_: 1
})) : Oe("", !0),
e.validateForm.isShow ? (W(), ye(X, {
api: e.validateForm.api,
"onUpdate:api": t[40] || (t[40] = (fe) => e.validateForm.api = fe),
rule: e.validateForm.rule,
option: e.validateForm.options,
modelValue: e.validateForm.value,
onChange: e.validateChange,
key: e.activeRule._fc_id
}, null, 8, ["api", "rule", "option", "modelValue", "onChange"])) : Oe("", !0)
], 64)) : Oe("", !0)
])
], 4)
];
}),
_: 1
})), [
[xn, e.activeTab === "props"]
])
]),
_: 1
})
]),
_: 1
}, 512)), [
[xn, !e.hiddenRight]
]) : Oe("", !0),
e.hiddenLeft ? (W(), ae("div", {
key: 2,
class: "_fc-l-open",
onClick: t[41] || (t[41] = (re) => e.hiddenLeft = !1)
}, t[66] || (t[66] = [
Z("i", { class: "fc-icon icon-arrow" }, null, -1)
]))) : Oe("", !0),
e.hiddenRight ? (W(), ae("div", {
key: 3,
class: "_fc-r-open",
onClick: t[42] || (t[42] = (re) => e.hiddenRight = !1)
}, t[67] || (t[67] = [
Z("i", { class: "fc-icon icon-arrow" }, null, -1)
]))) : Oe("", !0),
G(J, {
modelValue: e.preview.state,
"onUpdate:modelValue": t[49] || (t[49] = (re) => e.preview.state = re),
width: "80%",
class: "_fd-preview-dialog",
"append-to-body": ""
}, {
default: N(() => [
G(O, {
class: "_fd-preview-tabs",
modelValue: e.previewStatus,
"onUpdate:modelValue": t[43] || (t[43] = (re) => e.previewStatus = re)
}, {
default: N(() => [
G(xe, {
label: e.t("form.formMode"),
name: "form"
}, null, 8, ["label"]),
G(xe, {
label: e.t("form.previewMode"),
name: "preview"
}, null, 8, ["label"]),
G(xe, {
label: e.t("form.componentMode"),
name: "component"
}, null, 8, ["label"]),
e.previewDevice !== "mobile" ? (W(), ye(xe, {
key: 0,
label: e.t("form.sfcMode"),
name: "sfc"
}, null, 8, ["label"])) : Oe("", !0)
]),
_: 1
}, 8, ["modelValue"]),
e.previewStatus !== "sfc" && !e.onlyPC ? (W(), ae("div", xI, [
Z("div", {
class: qe({ active: e.previewDevice === "pc" }),
onClick: t[44] || (t[44] = (re) => e.previewDevice = "pc")
}, [
t[68] || (t[68] = Z("i", { class: "fc-icon icon-pc2" }, null, -1)),
_e(le(e.t("props.pc")), 1)
], 2),
Z("div", {
class: qe({ active: e.previewDevice === "mobile" }),
onClick: t[45] || (t[45] = (re) => e.previewDevice = "mobile")
}, [
t[69] || (t[69] = Z("i", { class: "fc-icon icon-mobile2" }, null, -1)),
_e(le(e.t("props.mobile")), 1)
], 2)
])) : Oe("", !0),
["component", "sfc"].indexOf(e.previewStatus) > -1 ? (W(), ae("div", {
key: 1,
class: "_fd-preview-copy",
onClick: t[46] || (t[46] = (...re) => e.copyCode && e.copyCode(...re))
}, t[70] || (t[70] = [
Z("i", { class: "fc-icon icon-copy" }, null, -1)
]))) : Oe("", !0),
e.previewStatus === "form" || e.previewStatus === "preview" ? (W(), ae(Pe, { key: 2 }, [
e.previewDevice === "mobile" ? (W(), ae("div", TI, [
Z("div", null, [
e.preview.state ? (W(), ye(K, {
key: 0,
driver: "elm",
rule: e.preview.rule,
option: e.preview.option,
onSubmit: e.previewSubmit,
onReset: e.previewReset,
api: e.preview.api,
"onUpdate:api": t[47] || (t[47] = (re) => e.preview.api = re)
}, ii({ _: 2 }, [
Ge(e.$slots, (re, fe) => ({
name: fe,
fn: N((Ae) => [
kt(e.$slots, fe, Ar(Cr(Ae != null ? Ae : {})))
])
}))
]), 1032, ["rule", "option", "onSubmit", "onReset", "api"])) : Oe("", !0)
])
])) : (W(), ae(Pe, { key: 1 }, [
e.preview.state ? (W(), ye(C, {
key: 0,
rule: e.preview.rule,
option: e.preview.option,
onSubmit: e.previewSubmit,
onReset: e.previewReset,
api: e.preview.api,
"onUpdate:api": t[48] || (t[48] = (re) => e.preview.api = re)
}, ii({ _: 2 }, [
Ge(e.$slots, (re, fe) => ({
name: fe,
fn: N((Ae) => [
kt(e.$slots, fe, Ar(Cr(Ae != null ? Ae : {})))
])
}))
]), 1032, ["rule", "option", "onSubmit", "onReset", "api"])) : Oe("", !0)
], 64))
], 64)) : e.previewStatus === "component" ? (W(), ae("pre", kI, [
Z("code", {
innerHTML: e.previewDevice === "mobile" ? e.preview.mobileHtml : e.preview.html
}, null, 8, OI)
], 512)) : (W(), ae("pre", RI, [
Z("code", {
innerHTML: e.preview.sfc
}, null, 8, DI)
], 512))
]),
_: 3
}, 8, ["modelValue"])
]),
_: 3
}))
]),
_: 3
})
]),
_: 3
}, 8, ["locale"])
]),
_: 3
}, 8, ["style", "onDragenter", "onDragleave", "onDrop"]);
}
const nn = /* @__PURE__ */ je(z$, [["render", $I]]);
const II = Ve({
name: "DragTool",
emits: ["create", "copy", "addChild", "delete", "active", "action", "fc.el"],
props: {
dragBtn: Boolean,
children: String,
inside: Boolean,
inline: Boolean,
hidden: Boolean,
mask: Boolean,
actions: Array,
handleBtn: [Boolean, Array],
formCreateInject: Object,
unique: String,
only: Boolean
},
inject: {
fcx: {
default: null
},
designer: {
default: null
},
dragTool: {
default: null
}
},
provide() {
return {
dragTool: this
};
},
computed: {
isCreate() {
return this.dragTool ? !!this.dragTool.children : !1;
},
btns() {
return Array.isArray(this.handleBtn) ? this.handleBtn.length ? this.handleBtn : !1 : this.handleBtn !== !1;
},
id() {
return this.unique || this.formCreateInject.id;
},
hiddenMenu() {
return this.designer.setupState.hiddenDragMenu;
},
t() {
return this.designer.setupState.t;
},
hiddenBtn() {
return this.designer.setupState.hiddenDragBtn;
}
},
methods: {
command(e) {
this.$emit("action", e);
},
active() {
this.fcx.active !== this.id && (this.fcx.active = this.id, this.$emit("active"));
}
},
mounted() {
this.$emit("fc.el", this);
}
}), FI = {
key: 0,
class: "_fd-drag-mask"
}, MI = {
key: 1,
class: "_fd-drag-hidden"
}, PI = {
key: 0,
class: "_fd-drag-btn",
style: { cursor: "move" }
}, LI = {
key: 3,
class: "_fd-drag-r"
};
function NI(e, t, i, r, n, a) {
const s = ie("el-dropdown-item"), u = ie("el-dropdown-menu"), d = ie("el-dropdown");
return W(), ae("div", {
class: qe(["_fd-drag-tool", { active: e.fcx.active === e.id, "is-inside": e.inside, "is-inline": e.inline }]),
onClick: t[10] || (t[10] = vt((...h) => e.active && e.active(...h), ["stop"]))
}, [
e.mask ? (W(), ae("div", FI)) : Oe("", !0),
e.hidden ? (W(), ae("div", MI, [
t[11] || (t[11] = Z("i", { class: "fc-icon icon-eye-close" }, null, -1)),
_e(" " + le(e.t("props.hide")), 1)
])) : Oe("", !0),
e.hiddenBtn ? Oe("", !0) : (W(), ae("div", {
key: 2,
class: "_fd-drag-l",
onClick: t[0] || (t[0] = vt(() => {
}, ["stop"]))
}, [
e.dragBtn !== !1 ? wn((W(), ae("div", PI, t[12] || (t[12] = [
Z("i", { class: "fc-icon icon-move" }, null, -1)
]), 512)), [
[xn, e.fcx.active === e.id]
]) : Oe("", !0)
])),
e.btns !== !1 && !e.hiddenMenu ? (W(), ae("div", LI, [
kt(e.$slots, "handle", {}, () => [
e.actions && e.actions.length > 0 ? (W(), ae("div", {
key: 0,
class: "_fd-drag-btn",
onClick: t[1] || (t[1] = vt(() => {
}, ["stop"]))
}, [
G(d, {
trigger: "click",
onCommand: e.command
}, {
dropdown: N(() => [
G(u, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.actions, (h, p) => (W(), ye(s, { command: p }, {
default: N(() => [
_e(le(e.t(h) || h), 1)
]),
_: 2
}, 1032, ["command"]))), 256))
]),
_: 1
})
]),
default: N(() => [
t[13] || (t[13] = Z("i", { class: "fc-icon icon-setting" }, null, -1))
]),
_: 1
}, 8, ["onCommand"])
])) : Oe("", !0),
e.isCreate && (e.btns === !0 || e.btns.indexOf("create") > -1) ? (W(), ae("div", {
key: 1,
class: "_fd-drag-btn",
onClick: [
t[2] || (t[2] = vt(() => {
}, ["stop"])),
t[3] || (t[3] = (h) => e.$emit("create"))
]
}, t[14] || (t[14] = [
Z("i", { class: "fc-icon icon-add" }, null, -1)
]))) : Oe("", !0),
!e.only && (e.btns === !0 || e.btns.indexOf("copy") > -1) ? (W(), ae("div", {
key: 2,
class: "_fd-drag-btn",
onClick: [
t[4] || (t[4] = vt(() => {
}, ["stop"])),
t[5] || (t[5] = (h) => e.$emit("copy"))
]
}, t[15] || (t[15] = [
Z("i", { class: "fc-icon icon-copy" }, null, -1)
]))) : Oe("", !0),
e.children && (e.btns === !0 || e.btns.indexOf("addChild") > -1) ? (W(), ae("div", {
key: 3,
class: "_fd-drag-btn",
onClick: [
t[6] || (t[6] = vt(() => {
}, ["stop"])),
t[7] || (t[7] = (h) => e.$emit("addChild"))
]
}, t[16] || (t[16] = [
Z("i", { class: "fc-icon icon-add-child" }, null, -1)
]))) : Oe("", !0),
e.btns === !0 || e.btns.indexOf("delete") > -1 ? (W(), ae("div", {
key: 4,
class: "_fd-drag-btn _fd-drag-danger",
onClick: [
t[8] || (t[8] = vt(() => {
}, ["stop"])),
t[9] || (t[9] = (h) => e.$emit("delete"))
]
}, t[17] || (t[17] = [
Z("i", { class: "fc-icon icon-delete" }, null, -1)
]))) : Oe("", !0)
])
])) : Oe("", !0),
kt(e.$slots, "default")
], 2);
}
const xy = /* @__PURE__ */ je(II, [["render", NI]]);
const BI = Ve({
name: "HtmlEditor",
emits: ["update:modelValue"],
props: {
modelValue: String,
title: String,
text: Boolean,
defaultValue: {
require: !1
}
},
inject: ["designer"],
computed: {
t() {
return this.designer.setupState.t;
}
},
data() {
return {
editor: null,
visible: !1,
oldVal: null
};
},
watch: {
modelValue() {
this.load();
},
visible(e) {
e && this.load();
}
},
methods: {
validateXML(e) {
var n;
const r = new DOMParser().parseFromString(e, "application/xml").getElementsByTagName("parsererror");
return r.length > 0 && (n = r[0].innerText.split(`
`)[0]) != null ? n : "";
},
load() {
this.oldVal = this.modelValue, this.$nextTick(() => {
this.editor = Xt(nr(this.$refs.editor, {
lineNumbers: !0,
mode: "xml",
lint: !0,
line: !0,
tabSize: 2,
lineWrapping: !0,
value: this.modelValue || ""
}));
});
},
onOk() {
const e = this.editor.getValue();
return !this.text && this.validateXML(e) ? ($n(this.t("struct.errorMsg")), !1) : (this.visible = !1, e !== this.oldVal && this.$emit("update:modelValue", e), !0);
}
}
}), VI = { class: "_fd-html-editor" }, jI = {
key: 0,
ref: "editor"
};
function UI(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-dialog");
return W(), ae("div", VI, [
G(s, {
class: "_fd-plain-button",
plain: "",
onClick: t[0] || (t[0] = (d) => e.visible = !0)
}, {
default: N(() => [
_e(le(e.title || e.t("struct.title")), 1)
]),
_: 1
}),
G(u, {
class: "_fd-html-editor-con",
title: e.title || e.t("struct.title"),
modelValue: e.visible,
"onUpdate:modelValue": t[2] || (t[2] = (d) => e.visible = d),
"close-on-click-modal": !1,
"append-to-body": "",
width: "800px"
}, {
footer: N(() => [
Z("div", null, [
G(s, {
onClick: t[1] || (t[1] = (d) => e.visible = !1),
size: "default"
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}),
G(s, {
type: "primary",
onClick: e.onOk,
size: "default"
}, {
default: N(() => [
_e(le(e.t("props.ok")), 1)
]),
_: 1
}, 8, ["onClick"])
])
]),
default: N(() => [
e.visible ? (W(), ae("div", jI, null, 512)) : Oe("", !0)
]),
_: 1
}, 8, ["title", "modelValue"])
]);
}
const zI = /* @__PURE__ */ je(BI, [["render", UI]]);
const HI = Ve({
name: "FieldInput",
inject: ["designer"],
emits: ["update:modelValue"],
props: {
modelValue: String,
disabled: Boolean
},
computed: {
fieldList() {
if (this.key)
return this.getFieldList();
},
subformFieldList() {
const e = this.designer.setupState.fieldList || [], t = this.fieldLeafSelectable ? e : this.removeLeafNodes(At(e));
return t.length ? t : e;
},
fieldReadonly() {
return this.designer.setupState.fieldReadonly;
},
isSubform() {
return this.activeRule && this.activeRule._menu.subForm;
},
activeRule() {
return this.designer.setupState.activeRule;
},
relationField() {
return this.designer.props.config.relationField;
},
fieldLeafSelectable() {
return this.designer.props.config.fieldLeafSelectable !== !1;
},
t() {
return this.designer.setupState.t;
}
},
data() {
return {
value: this.modelValue || "",
oldValue: "",
key: 1,
activeNode: null
};
},
watch: {
modelValue(e) {
this.value = e;
}
},
methods: {
getFieldList() {
let e = this.designer.setupState.fieldList || [];
if (this.relationField === !1)
return e;
if (this.isSubform)
e = this.subformFieldList;
else {
const t = this.activeRule;
let i = t && t.__fc__ && t.__fc__.parent;
for (; i; )
if (i.rule._menu && ["array", "object"].indexOf(i.rule._menu.subForm) > -1) {
const r = this.findChildrenById(e, i.rule.field) || e;
r.length && (e = r);
break;
} else
i = i.parent;
}
return e;
},
removeLeafNodes(e) {
if (!Array.isArray(e) || e.length === 0)
return e;
function t(i) {
return i.filter((r) => r.children && r.children.length > 0 ? (r.children = t(r.children), !0) : !1);
}
return t(e);
},
findChildrenById(e, t) {
if (!Array.isArray(e))
return null;
for (const i of e) {
if (i.value === t)
return i.children || [];
if (i.children) {
const r = this.findChildrenById(i.children, t);
if (r !== null)
return r;
}
}
return null;
},
copy() {
er(this.modelValue);
},
getSubChildren() {
let e = this.designer.setupState.getSubFormChildren(this.activeRule) || [];
return e = St.trueArray(e) ? e : this.designer.setupState.children, e;
},
getSubFieldChildren() {
const e = this.getSubChildren(), t = [], i = (r) => (r && r.forEach((n) => {
n && n._fc_drag_tag && n.field ? t.push({ ...n, children: [] }) : n && n.children && i(n.children);
}), t);
return i(e);
},
checkValue() {
const e = this.oldValue;
Kg(e);
let t = (this.value || "").replace(/[\s\　]/g, "");
if (t)
if (/^[a-zA-Z]/.test(t)) {
if (e !== t) {
const i = t.indexOf(".") > -1;
if (i && (t = t.replaceAll(".", "_")), this.getSubFieldChildren().filter((r) => r.field === t).length > 0)
return $n(this.t("computed.fieldExist", { label: t })), e;
if (i)
return t;
}
} else
return $n(this.t("computed.fieldChar")), e;
else
return $n(this.t("computed.fieldEmpty")), e;
return this.oldValue = "", t;
},
onFocus() {
this.oldValue = this.value;
},
makeField() {
this.oldValue = this.value, this.value = rt(), this.onInput();
},
updateRule(e) {
const t = { ...e.update || {} };
t.title || (t.title = e.label), this.designer.setupState.mergeRule(this.activeRule, t), this.designer.setupState.updateRuleFormData();
},
onInput() {
if (this.value !== this.modelValue && (this.value = this.checkValue(), this.value !== this.modelValue)) {
const e = this.activeNode;
this.activeNode = null, this.oldValue = this.value, this.$emit("update:modelValue", this.value), e && this.updateRule(e);
}
},
currentChange(e) {
this.activeNode = e;
}
},
mounted() {
const e = () => {
Kn(() => {
++this.key;
});
};
this.designer.setupState.bus.$on("dragEnd", e), wc(() => {
this.designer.setupState.bus.$off("dragEnd", e);
});
}
}), WI = { class: "_fd-field-input" };
function GI(e, t, i, r, n, a) {
const s = ie("el-input"), u = ie("el-tree-select");
return W(), ae("div", WI, [
Z("i", {
class: "fc-icon icon-group",
onClick: t[0] || (t[0] = vt((...d) => e.copy && e.copy(...d), ["stop"]))
}),
e.fieldList.length ? (W(), ye(u, {
key: 1,
modelValue: e.value,
"onUpdate:modelValue": t[3] || (t[3] = (d) => e.value = d),
readonly: e.fieldReadonly || e.disabled,
disabled: e.disabled,
"allow-create": !e.fieldReadonly,
filterable: !0,
"default-first-option": !e.fieldReadonly,
indent: 10,
checkStrictly: e.isSubform && e.relationField !== !0,
"popper-class": "_fd-field-popper",
onFocus: e.onFocus,
onChange: e.onInput,
onCurrentChange: e.currentChange,
data: e.fieldList
}, null, 8, ["modelValue", "readonly", "disabled", "allow-create", "default-first-option", "checkStrictly", "onFocus", "onChange", "onCurrentChange", "data"])) : (W(), ye(s, {
key: 0,
modelValue: e.value,
"onUpdate:modelValue": t[2] || (t[2] = (d) => e.value = d),
readonly: e.fieldReadonly || e.disabled,
disabled: e.fieldReadonly || e.disabled,
onFocus: e.onFocus,
onBlur: e.onInput
}, ii({ _: 2 }, [
e.fieldReadonly ? void 0 : {
name: "append",
fn: N(() => [
Z("i", {
class: "fc-icon icon-auto",
onClick: t[1] || (t[1] = (...d) => e.makeField && e.makeField(...d))
})
]),
key: "0"
}
]), 1032, ["modelValue", "readonly", "disabled", "onFocus", "onBlur"]))
]);
}
const KI = /* @__PURE__ */ je(HI, [["render", GI]]);
const YI = Ve({
name: "PromptInput",
emits: ["update:modelValue", "change"],
props: {
size: String,
modelValue: String,
popperClass: String,
options: Array
},
data() {
return {
value: this.modelValue || ""
};
},
methods: {
setValue(e) {
this.value = e, this.onInput();
},
onInput() {
this.$emit("update:modelValue", this.value), this.$emit("change", this.value);
}
}
});
function QI(e, t, i, r, n, a) {
const s = ie("el-dropdown-item"), u = ie("el-dropdown-menu"), d = ie("el-dropdown"), h = ie("el-input");
return W(), ye(h, {
size: e.size,
modelValue: e.value,
"onUpdate:modelValue": t[0] || (t[0] = (p) => e.value = p),
onBlur: e.onInput,
clearable: "",
class: "_fd-list-input"
}, {
append: N(() => [
G(d, {
size: "default",
trigger: "click",
"popper-class": e.popperClass
}, {
dropdown: N(() => [
G(u, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.options, (p) => (W(), ye(s, {
key: p.value,
onClick: (g) => e.setValue(p.value)
}, {
default: N(() => [
_e(le(p.label), 1)
]),
_: 2
}, 1032, ["onClick"]))), 128))
]),
_: 1
})
]),
default: N(() => [
t[1] || (t[1] = Z("i", { class: "fc-icon icon-setting" }, null, -1))
]),
_: 1
}, 8, ["popper-class"])
]),
_: 1
}, 8, ["size", "modelValue", "onBlur"]);
}
const JI = /* @__PURE__ */ je(YI, [["render", QI]]);
const XI = (e) => [
{
type: "input",
field: "action",
title: e("fetch.action"),
value: "",
validate: [{ required: !0, message: e("fetch.actionRequired"), trigger: "blur" }],
inject: !0,
on: {
blur({ self: t }, i) {
t._start = i.target.selectionStart;
}
},
children: [
{
type: "VariableConfig",
slot: "suffix",
props: {
popover: !0
},
inject: !0,
on: {
confirm({ api: t }, i) {
const r = t.getRule("action");
r.value = r.value.substring(0, r._start) + i + r.value.substring(r._start);
}
}
}
]
},
{
type: "radio",
field: "method",
title: e("fetch.method"),
value: "GET",
options: [
{ label: "GET", value: "GET" },
{ label: "POST", value: "POST" }
],
$required: !0
},
{
type: "radio",
field: "dataType",
title: e("fetch.dataType"),
warning: e("warning.fetchDataType"),
value: "json",
options: [
{ label: "JSON", value: "json" },
{ label: "FormData", value: "formData" }
],
$required: !0
},
{
type: "FetchTable",
field: "headers",
title: e("fetch.headers"),
value: {}
},
{
type: "FetchTable",
field: "query",
title: e("fetch.query"),
warning: e("warning.fetchQuery"),
value: {}
},
{
type: "FetchTable",
field: "data",
title: e("fetch.data"),
warning: e("warning.fetchData"),
value: {}
}
], ZI = Ve({
name: "FetchConfig",
emits: ["update:modelValue"],
props: {
modelValue: [Object, String],
to: String
},
components: {
Warning: Ei,
DragForm: tt.$form(),
FnEditor: ar,
StructEditor: Bc
},
inject: ["designer"],
data() {
return {
visible: !1,
value: At(this.modelValue || {}),
form: {
api: {},
formData: {},
rule: [],
options: {
form: {
labelWidth: "90px",
size: "default"
},
submitBtn: !1,
resetBtn: !1
}
}
};
},
computed: {
t() {
return this.designer.setupState.t;
},
configured() {
return !St.empty(this.modelValue);
}
},
watch: {
visible(e) {
e && (this.value = At(this.modelValue || {}), this.active());
}
},
methods: {
open() {
this.visible = !0;
},
active() {
const e = this.value;
this.form.rule = e.type === "static" ? [] : XI(this.t), this.form.formData = { ...e }, this.form.label = e.label, this.form.type = e.type, this.form.data = e.data, this.form.dataType = e.dataType, this.form.parse = e.parse || "", this.form.beforeFetch = e.beforeFetch || "", this.form.onError = e.onError || "";
},
save() {
this.form.api.validate().then(() => {
const e = { ...this.form.formData };
this.$refs.parse && !this.$refs.parse.save() || this.$refs.beforeFetch && !this.$refs.beforeFetch.save() || this.$refs.error && !this.$refs.error.save() || (e.parse = tt.parseFn(this.form.parse), e.beforeFetch = tt.parseFn(this.form.beforeFetch), e.onError = this.form.onError, e.label = this.form.label, e.type = this.form.type, e.to = this.to || "options", this.$emit("update:modelValue", e), this.visible = !1);
}).catch((e) => {
console.error(e), $n(e[Object.keys(e)[0]][0].message);
});
}
},
created() {
this.active();
}
}), qI = { class: "_fd-fetch-config" }, eF = { class: "_fd-fetch-info" };
function tF(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-badge"), d = ie("Warning"), h = ie("DragForm"), p = ie("el-tab-pane"), g = ie("FnEditor"), _ = ie("el-tabs"), S = ie("el-container"), b = ie("el-dialog");
return W(), ae("div", qI, [
G(u, {
type: "warning",
"is-dot": "",
hidden: !e.configured
}, {
default: N(() => [
G(s, {
class: "_fd-plain-button",
plain: "",
onClick: t[0] || (t[0] = (A) => e.visible = !0),
size: "small"
}, {
default: N(() => [
_e(le(e.t("struct.title")), 1)
]),
_: 1
})
]),
_: 1
}, 8, ["hidden"]),
G(b, {
class: "_fd-fetch-dialog _fd-config-dialog",
modelValue: e.visible,
"onUpdate:modelValue": t[7] || (t[7] = (A) => e.visible = A),
"destroy-on-close": "",
"close-on-click-modal": !1,
"append-to-body": "",
width: "980px"
}, {
header: N(() => [
_e(le(e.t("fetch.optionsType.fetch")) + " ", 1),
G(d, {
tooltip: e.t("warning.fetch")
}, null, 8, ["tooltip"])
]),
footer: N(() => [
Z("div", null, [
G(s, {
size: "default",
onClick: t[6] || (t[6] = (A) => e.visible = !1)
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}),
G(s, {
type: "primary",
size: "default",
onClick: e.save
}, {
default: N(() => [
_e(le(e.t("props.ok")), 1)
]),
_: 1
}, 8, ["onClick"])
])
]),
default: N(() => [
G(S, {
class: "_fd-fetch-con",
style: { height: "450px" }
}, {
default: N(() => [
G(_, {
"model-value": "first",
class: "_fc-tabs",
style: { width: "100%" }
}, {
default: N(() => [
G(p, {
label: e.t("fetch.config"),
name: "first",
style: { "padding-right": "15px" }
}, {
default: N(() => [
Z("div", eF, le(e.t("fetch.info")), 1),
G(h, {
api: e.form.api,
"onUpdate:api": t[1] || (t[1] = (A) => e.form.api = A),
modelValue: e.form.formData,
"onUpdate:modelValue": t[2] || (t[2] = (A) => e.form.formData = A),
rule: e.form.rule,
option: e.form.options
}, {
title: N((A) => [
A.rule.warning ? (W(), ye(d, {
key: 0,
tooltip: A.rule.warning
}, {
default: N(() => [
_e(le(A.rule.title), 1)
]),
_: 2
}, 1032, ["tooltip"])) : (W(), ae(Pe, { key: 1 }, [
_e(le(A.rule.title), 1)
], 64))
]),
_: 1
}, 8, ["api", "modelValue", "rule", "option"])
]),
_: 1
}, 8, ["label"]),
G(p, {
lazy: "",
label: e.t("fetch.beforeFetch"),
name: "second"
}, {
label: N(() => [
_e(le(e.t("fetch.beforeFetch")) + " ", 1),
G(d, {
tooltip: e.t("warning.beforeFetch")
}, null, 8, ["tooltip"])
]),
default: N(() => [
G(g, {
style: { height: "100%" },
modelValue: e.form.beforeFetch,
"onUpdate:modelValue": t[3] || (t[3] = (A) => e.form.beforeFetch = A),
name: "beforeFetch",
args: ["config", "data"],
ref: "beforeFetch"
}, null, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"]),
G(p, {
lazy: "",
name: "third"
}, {
label: N(() => [
_e(le(e.t("fetch.parse")) + " ", 1),
G(d, {
tooltip: e.t("warning.fetchParse")
}, null, 8, ["tooltip"])
]),
default: N(() => [
G(g, {
style: { height: "100%" },
modelValue: e.form.parse,
"onUpdate:modelValue": t[4] || (t[4] = (A) => e.form.parse = A),
name: "parse",
args: [{ name: "res", info: e.t("fetch.response") }, "rule", "api"],
ref: "parse"
}, null, 8, ["modelValue", "args"])
]),
_: 1
}),
G(p, {
lazy: "",
label: e.t("fetch.onError"),
name: "fourth"
}, {
default: N(() => [
G(g, {
style: { height: "100%" },
modelValue: e.form.onError,
"onUpdate:modelValue": t[5] || (t[5] = (A) => e.form.onError = A),
name: "onError",
args: ["e"],
ref: "error"
}, null, 8, ["modelValue"])
]),
_: 1
}, 8, ["label"])
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}, 8, ["modelValue"])
]);
}
const nF = /* @__PURE__ */ je(ZI, [["render", tF]]);
const iF = Ve({
name: "TableColumnConfig",
components: { FnEditor: ar },
props: {
modelValue: Array
},
inject: ["designer"],
data() {
return {
column: [],
visible: !1,
activeRow: null,
treeData: [],
defaultProps: { label: "label" }
};
},
computed: {
t() {
return this.designer.setupState.t;
},
configured() {
return !!this.modelValue;
},
list() {
var e;
return ((e = this.designer.setupState.activeRule) == null ? void 0 : e.__fc__.el.list) || [];
},
propColumns() {
return Object.keys(this.list[0] || {});
},
format() {
return ["default", "tag", "image", "custom"].map((e) => ({ label: this.t("com.dataTable.format." + e), value: e }));
},
align() {
return ["left", "center", "right"].map((e) => ({ label: this.t("props." + e), value: e }));
},
fixed() {
return [!1, "left", "right"].map((e) => ({ label: this.t("com.dataTable.fixed." + (e || "default")), value: e }));
},
sortable() {
return [!1, !0, "custom"].map((e) => ({
label: this.t("com.dataTable.sortable." + (typeof e == "boolean" ? e ? "default" : "disabled" : "custom")),
value: e
}));
}
},
mounted() {
window.globalvariableData && (this.treeData = window.globalvariableData);
},
watch: {
visible(e) {
e ? this.tidyValue() : this.activeRow = null;
}
},
methods: {
handleNodeClick(e) {
this.databaseAdd(void 0, e);
},
getColumnData(e) {
const t = [];
return e && (this.list || []).forEach((i) => {
Li(i, e) && t.indexOf(i[e]) === -1 && t.push(i[e]);
}), t;
},
add(e) {
const t = { format: "default", filter: [], id: rt() };
e != null ? this.column.splice(e + 1, 0, t) : this.column.push(t);
},
databaseAdd(e, t) {
let i = !0;
if (this.column.forEach((n) => {
n.prop == t.field && (i = !1);
}), i == !1)
return;
const r = {
format: "default",
prop: t.field,
label: t.name,
filter: [],
width: "",
id: rt()
};
e != null ? this.column.splice(e + 1, 0, r) : this.column.push(r);
},
addChild(e) {
const t = { p: e, format: "default", filter: [], id: rt() };
e.children || (e.children = []), e.children.push(t);
},
remove(e) {
const t = e.p && e.p.children || this.column;
t.splice(t.indexOf(e), 1), e.p && !t.length && delete e.p.children;
},
editFn(e) {
this.activeRow = e;
},
updateFn() {
this.activeRow = null;
},
tidyValue() {
this.column = this.fullId(At(this.modelValue || []));
},
fullId(e, t) {
return e.map((i) => {
i.id || (i.id = rt()), i.p = t, i.children && this.fullId(i.children, i);
}), e;
},
close() {
this.activeRow ? this.activeRow = null : this.visible = !1;
},
parseColumns(e) {
return e.map((t) => {
const i = { ...t };
return delete i.p, i.children && i.children.length > 0 ? i.children = this.parseColumns(i.children) : delete i.children, i;
});
},
submit() {
if (this.activeRow) {
this.$refs.fn.save() && (this.activeRow = null);
return;
}
const e = [], t = this.parseColumns(this.column);
for (let i = 0; i < t.length; i++) {
const r = t[i];
if (!r.label) {
$n(this.t("com.dataTable.requiredLabel"));
return;
}
const n = { ...r };
if (n.label) {
if (!n.children) {
if (n.format !== "custom")
delete n.render;
else if (!n.render) {
$n(this.t("com.dataTable.requiredRender"));
return;
}
}
n.render && (n.render = jo(n.render)), e.push(n);
}
}
this.$emit("update:modelValue", e), this.$emit("change", e), this.visible = !1;
}
}
}), rF = { class: "_fd-table-column-config" }, oF = { style: { display: "flex" } }, aF = { class: "flex" }, lF = ["onClick"], sF = ["onClick"], uF = ["onClick"], dF = ["onClick"];
function fF(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-badge"), d = ie("FnEditor"), h = ie("el-tree"), p = ie("el-table-column"), g = ie("el-input"), _ = ie("el-option"), S = ie("el-select"), b = ie("el-switch"), A = ie("el-table"), w = ie("el-dialog");
return W(), ae("div", rF, [
G(u, {
type: "warning",
"is-dot": "",
hidden: !e.configured
}, {
default: N(() => [
G(s, {
class: "_fd-plain-button",
plain: "",
onClick: t[0] || (t[0] = (m) => e.visible = !0),
size: "small"
}, {
default: N(() => [
_e(le(e.t("com.dataTable.column.btn")), 1)
]),
_: 1
})
]),
_: 1
}, 8, ["hidden"]),
G(w, {
class: "_fd-tcc-dialog _fd-config-dialog",
title: e.t("com.dataTable.column.title"),
modelValue: e.visible,
"onUpdate:modelValue": t[3] || (t[3] = (m) => e.visible = m),
"destroy-on-close": "",
"close-on-click-modal": !1,
"append-to-body": "",
width: "1180px"
}, {
footer: N(() => [
Z("div", null, [
G(s, {
size: "default",
onClick: e.close
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}, 8, ["onClick"]),
G(s, {
type: "primary",
size: "default",
onClick: e.submit
}, {
default: N(() => [
_e(le(e.t("props.ok")), 1)
]),
_: 1
}, 8, ["onClick"])
])
]),
default: N(() => [
e.activeRow ? (W(), ye(d, {
key: 0,
ref: "fn",
modelValue: e.activeRow.render,
"onUpdate:modelValue": t[1] || (t[1] = (m) => e.activeRow.render = m),
args: ["scope", "h", " resolveComponent", "api"],
name: "render"
}, null, 8, ["modelValue"])) : Oe("", !0),
wn(Z("div", oF, [
G(h, {
ref: "treeRef",
data: e.treeData,
"default-expand-all": "",
class: "TableColumnConfigTree",
"highlight-current": !0,
props: e.defaultProps,
"expand-on-click-node": !1,
onNodeClick: e.handleNodeClick,
style: { "min-width": "200px" }
}, null, 8, ["data", "props", "onNodeClick"]),
G(A, {
data: e.column,
size: "small",
"row-key": "id",
class: "_fd-tcc-table"
}, {
default: N(() => [
G(p, {
type: "index",
width: "50"
}),
G(p, {
label: e.t("com.dataTable.column.prop"),
width: "130"
}, {
default: N(({ row: m }) => [
!m.children || !m.children.length ? (W(), ae(Pe, { key: 0 }, [
!e.propColumns || !e.propColumns.length ? (W(), ye(g, {
key: 0,
modelValue: m.prop,
"onUpdate:modelValue": (y) => m.prop = y
}, null, 8, ["modelValue", "onUpdate:modelValue"])) : (W(), ye(S, {
key: 1,
modelValue: m.prop,
"onUpdate:modelValue": (y) => m.prop = y,
"allow-create": "",
clearable: "",
"default-first-option": "",
filterable: ""
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.propColumns, (y) => (W(), ye(_, {
label: y,
value: y
}, {
default: N(() => [
_e(le(y), 1)
]),
_: 2
}, 1032, ["label", "value"]))), 256))
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue"]))
], 64)) : (W(), ae(Pe, { key: 1 }, [
_e(le(e.t("com.dataTable.header")), 1)
], 64))
]),
_: 1
}, 8, ["label"]),
G(p, { width: "100" }, {
default: N(({ row: m }) => [
G(g, {
modelValue: m.label,
"onUpdate:modelValue": (y) => m.label = y
}, null, 8, ["modelValue", "onUpdate:modelValue"])
]),
header: N(() => [
_e(le(e.t("props.title")), 1),
t[4] || (t[4] = Z("span", { style: { color: "red" } }, "*", -1))
]),
_: 1
}),
G(p, {
label: e.t("style.width"),
width: "100"
}, {
default: N(({ row: m }) => [
!m.children || !m.children.length ? (W(), ye(g, {
key: 0,
modelValue: m.width,
"onUpdate:modelValue": (y) => m.width = y
}, null, 8, ["modelValue", "onUpdate:modelValue"])) : Oe("", !0)
]),
_: 1
}, 8, ["label"]),
G(p, {
label: e.t("com.dataTable.filter"),
width: "120"
}, {
default: N(({ row: m }) => [
!m.children || !m.children.length ? (W(), ye(S, {
key: 0,
modelValue: m.filter,
"onUpdate:modelValue": (y) => m.filter = y,
multiple: "",
clearable: ""
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.getColumnData(m.prop), (y) => (W(), ye(_, {
label: y,
value: y
}, {
default: N(() => [
_e(le(y), 1)
]),
_: 2
}, 1032, ["label", "value"]))), 256))
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue"])) : Oe("", !0)
]),
_: 1
}, 8, ["label"]),
G(p, { label: "Class" }, {
default: N(({ row: m }) => [
G(g, {
modelValue: m.className,
"onUpdate:modelValue": (y) => m.className = y
}, null, 8, ["modelValue", "onUpdate:modelValue"])
]),
_: 1
}),
G(p, {
label: e.t("com.dataTable.column.sort"),
width: "100"
}, {
default: N(({ row: m }) => [
!m.children || !m.children.length ? (W(), ye(S, {
key: 0,
modelValue: m.sortable,
"onUpdate:modelValue": (y) => m.sortable = y,
clearable: ""
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.sortable, (y) => (W(), ye(_, {
label: y.label,
value: y.value,
key: y.value
}, null, 8, ["label", "value"]))), 128))
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue"])) : Oe("", !0)
]),
_: 1
}, 8, ["label"]),
G(p, {
label: e.t("props.position"),
width: "100"
}, {
default: N(({ row: m }) => [
G(S, {
modelValue: m.fixed,
"onUpdate:modelValue": (y) => m.fixed = y,
clearable: ""
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.fixed, (y) => (W(), ye(_, {
label: y.label,
value: y.value,
key: y.value || "default"
}, null, 8, ["label", "value"]))), 128))
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue"])
]),
_: 1
}, 8, ["label"]),
G(p, {
label: e.t("style.font.align"),
width: "100"
}, {
default: N(({ row: m }) => [
G(S, {
modelValue: m.align,
"onUpdate:modelValue": (y) => m.align = y,
clearable: ""
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.align, (y) => (W(), ye(_, {
label: y.label,
value: y.value,
key: y.value
}, null, 8, ["label", "value"]))), 128))
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue"])
]),
_: 1
}, 8, ["label"]),
G(p, { width: "110" }, {
default: N(({ row: m }) => [
Z("div", aF, [
G(S, {
modelValue: m.format,
"onUpdate:modelValue": (y) => m.format = y,
clearable: ""
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.format, (y) => (W(), ye(_, {
label: y.label,
value: y.value,
key: y.value
}, null, 8, ["label", "value"]))), 128))
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue"]),
m.format === "custom" ? (W(), ae("i", {
key: 0,
class: "fc-icon icon-edit",
onClick: (y) => e.editFn(m)
}, null, 8, lF)) : Oe("", !0)
])
]),
header: N(() => [
_e(le(e.t("props.render")), 1),
t[5] || (t[5] = Z("span", { style: { color: "red" } }, "*", -1))
]),
_: 1
}),
G(p, {
label: e.t("props.hide"),
width: "50",
fixed: "right"
}, {
default: N(({ row: m }) => [
!m.children || !m.children.length ? (W(), ye(b, {
key: 0,
modelValue: m.hidden,
"onUpdate:modelValue": (y) => m.hidden = y
}, null, 8, ["modelValue", "onUpdate:modelValue"])) : Oe("", !0)
]),
_: 1
}, 8, ["label"]),
G(p, {
label: e.t("tableOptions.handle"),
width: "90",
fixed: "right"
}, {
default: N(({ row: m, $index: y }) => [
Z("i", {
class: "fc-icon icon-add-circle",
onClick: (E) => e.add(y)
}, null, 8, sF),
Z("i", {
class: "fc-icon icon-add-child",
onClick: (E) => e.addChild(m)
}, null, 8, uF),
Z("i", {
class: "fc-icon icon-delete-circle",
onClick: (E) => e.remove(m)
}, null, 8, dF)
]),
_: 1
}, 8, ["label"])
]),
_: 1
}, 8, ["data"])
], 512), [
[xn, !e.activeRow]
]),
wn(G(s, {
link: "",
type: "primary",
onClick: t[2] || (t[2] = (m) => e.add())
}, {
default: N(() => [
t[6] || (t[6] = Z("i", { class: "fc-icon icon-add-circle" }, null, -1)),
_e(" " + le(e.t("tableOptions.add")), 1)
]),
_: 1
}, 512), [
[xn, !e.activeRow]
])
]),
_: 1
}, 8, ["title", "modelValue"])
]);
}
const cF = /* @__PURE__ */ je(iF, [["render", fF]]);
const pF = Ve({
name: "TableColumnConfig",
props: {
modelValue: Array
},
inject: ["designer"],
data() {
return {
column: [],
visible: !1,
activeRow: null,
activeKey: "",
activeArgs: []
};
},
computed: {
t() {
return this.designer.setupState.t;
},
configured() {
return !!this.modelValue;
},
decoration() {
return ["link", "round", "plain", "disabled"].map((e) => ({ label: this.t("com.dataTable.button." + e), value: e }));
},
size() {
return ["large", "default", "small"].map((e) => ({ label: this.t("props." + e), value: e }));
},
type() {
return ["primary", "success", "warning", "danger", "info"].map((e) => ({ label: this.t("props." + e), value: e }));
}
},
watch: {
visible(e) {
e ? this.tidyValue() : this.activeRow = null;
}
},
methods: {
btnProps(e) {
const t = e.prop || [];
return {
type: e.type,
size: e.size,
round: t.indexOf("round") > -1,
link: t.indexOf("link") > -1,
plain: t.indexOf("plain") > -1,
disabled: t.indexOf("disabled") > -1
};
},
defaultData() {
return {
key: this.column.length + 1,
name: this.t("props.button") + (this.column.length + 1)
};
},
add(e) {
e != null ? this.column.splice(e + 1, 0, this.defaultData()) : this.column.push(this.defaultData());
},
handle(e, t, i) {
this.activeKey = t, this.activeRow = e, this.activeArgs = i;
},
remove(e) {
this.column.splice(e, 1);
},
tidyValue() {
this.column = At(this.modelValue || []), this.column.length || this.add();
},
close() {
this.activeRow ? this.activeRow = null : this.visible = !1;
},
submit() {
if (this.activeRow) {
this.$refs.fn.save() && (this.activeRow = null);
return;
}
const e = [];
for (let t = 0; t < this.column.length; t++) {
const i = this.column[t];
if (!i.name) {
$n(this.t("com.dataTable.requiredName"));
return;
}
if (!i.key) {
$n(this.t("com.dataTable.requiredKey"));
return;
}
e.push({ ...i });
}
this.$emit("update:modelValue", e), this.$emit("change", e), this.visible = !1;
}
}
}), hF = { class: "_fd-table-button-config" }, mF = ["onClick"], vF = ["onClick"], gF = ["onClick"], yF = ["onClick"];
function bF(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-badge"), d = ie("FnEditor"), h = ie("el-table-column"), p = ie("el-input"), g = ie("el-option"), _ = ie("el-select"), S = ie("el-switch"), b = ie("el-table"), A = ie("el-dialog");
return W(), ae("div", hF, [
G(u, {
type: "warning",
"is-dot": "",
hidden: !e.configured
}, {
default: N(() => [
G(s, {
class: "_fd-plain-button",
plain: "",
onClick: t[0] || (t[0] = (w) => e.visible = !0),
size: "small"
}, {
default: N(() => [
_e(le(e.t("com.dataTable.button.btn")), 1)
]),
_: 1
})
]),
_: 1
}, 8, ["hidden"]),
G(A, {
class: "_fd-tcb-dialog _fd-config-dialog",
title: e.t("com.dataTable.button.title"),
modelValue: e.visible,
"onUpdate:modelValue": t[3] || (t[3] = (w) => e.visible = w),
"destroy-on-close": "",
"close-on-click-modal": !1,
"append-to-body": "",
width: "980px"
}, {
footer: N(() => [
Z("div", null, [
G(s, {
size: "default",
onClick: e.close
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}, 8, ["onClick"]),
G(s, {
type: "primary",
size: "default",
onClick: e.submit
}, {
default: N(() => [
_e(le(e.t("props.ok")), 1)
]),
_: 1
}, 8, ["onClick"])
])
]),
default: N(() => [
e.activeRow ? (W(), ye(d, {
key: 0,
ref: "fn",
modelValue: e.activeRow[e.activeKey],
"onUpdate:modelValue": t[1] || (t[1] = (w) => e.activeRow[e.activeKey] = w),
args: e.activeArgs,
name: e.activeKey
}, null, 8, ["modelValue", "args", "name"])) : (W(), ae(Pe, { key: 1 }, [
G(b, {
data: e.column,
size: "small"
}, {
default: N(() => [
G(h, {
type: "index",
width: "50"
}),
G(h, {
label: e.t("props.preview"),
width: "100"
}, {
default: N(({ row: w }) => [
G(s, Ar(Cr(e.btnProps(w))), {
default: N(() => [
_e(le(w.name), 1)
]),
_: 2
}, 1040)
]),
_: 1
}, 8, ["label"]),
G(h, { width: "100" }, {
default: N(({ row: w }) => [
G(p, {
modelValue: w.key,
"onUpdate:modelValue": (m) => w.key = m
}, null, 8, ["modelValue", "onUpdate:modelValue"])
]),
header: N(() => t[4] || (t[4] = [
_e(" ID"),
Z("span", { style: { color: "red" } }, "*", -1)
])),
_: 1
}),
G(h, null, {
default: N(({ row: w }) => [
G(p, {
modelValue: w.name,
"onUpdate:modelValue": (m) => w.name = m
}, null, 8, ["modelValue", "onUpdate:modelValue"])
]),
header: N(() => [
_e(le(e.t("props.name")), 1),
t[5] || (t[5] = Z("span", { style: { color: "red" } }, "*", -1))
]),
_: 1
}),
G(h, {
label: e.t("event.type"),
width: "120"
}, {
default: N(({ row: w }) => [
G(_, {
modelValue: w.type,
"onUpdate:modelValue": (m) => w.type = m
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.type, (m) => (W(), ye(g, {
label: m.label,
value: m.value,
key: m.value
}, null, 8, ["label", "value"]))), 128))
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue"])
]),
_: 1
}, 8, ["label"]),
G(h, {
label: e.t("style.font.size"),
width: "120"
}, {
default: N(({ row: w }) => [
G(_, {
modelValue: w.size,
"onUpdate:modelValue": (m) => w.size = m
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.size, (m) => (W(), ye(g, {
label: m.label,
value: m.value,
key: m.value
}, null, 8, ["label", "value"]))), 128))
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue"])
]),
_: 1
}, 8, ["label"]),
G(h, {
label: e.t("style.decoration.name"),
width: "120"
}, {
default: N(({ row: w }) => [
G(_, {
multiple: "",
modelValue: w.prop,
"onUpdate:modelValue": (m) => w.prop = m
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.decoration, (m) => (W(), ye(g, {
label: m.label,
value: m.value,
key: m.value
}, null, 8, ["label", "value"]))), 128))
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue"])
]),
_: 1
}, 8, ["label"]),
G(h, {
label: e.t("props.hide"),
width: "80"
}, {
default: N(({ row: w }) => [
G(S, {
modelValue: w.hidden,
"onUpdate:modelValue": (m) => w.hidden = m
}, null, 8, ["modelValue", "onUpdate:modelValue"])
]),
_: 1
}, 8, ["label"]),
G(h, {
label: e.t("props.callback"),
width: "80"
}, {
default: N(({ row: w }) => [
Z("div", {
class: "_fd-tcb-btn",
onClick: (m) => e.handle(w, "handle", ["props", "scope", "api"])
}, [
_e(le(e.t("com.dataTable.handle")), 1),
t[6] || (t[6] = Z("i", { class: "fc-icon icon-edit" }, null, -1))
], 8, mF),
Z("div", {
class: "_fd-tcb-btn",
onClick: (m) => e.handle(w, "click", ["scope", "api"])
}, [
_e(le(e.t("com.dataTable.click")), 1),
t[7] || (t[7] = Z("i", { class: "fc-icon icon-edit" }, null, -1))
], 8, vF)
]),
_: 1
}, 8, ["label"]),
G(h, {
label: e.t("tableOptions.handle"),
width: "80"
}, {
default: N(({ $index: w }) => [
Z("i", {
class: "fc-icon icon-add-circle",
onClick: (m) => e.add(w)
}, null, 8, gF),
Z("i", {
class: "fc-icon icon-delete-circle",
onClick: (m) => e.remove(w)
}, null, 8, yF)
]),
_: 1
}, 8, ["label"])
]),
_: 1
}, 8, ["data"]),
G(s, {
link: "",
type: "primary",
onClick: t[2] || (t[2] = (w) => e.add())
}, {
default: N(() => [
t[8] || (t[8] = Z("i", { class: "fc-icon icon-add-circle" }, null, -1)),
_e(" " + le(e.t("tableOptions.add")), 1)
]),
_: 1
})
], 64))
]),
_: 1
}, 8, ["title", "modelValue"])
]);
}
const _F = /* @__PURE__ */ je(pF, [["render", bF]]);
const Ty = Ve({
name: "DataTable",
emits: ["sortChange", "handleClick"],
props: {
column: {
type: Array,
default: () => []
},
globalDataKey: [String, Object],
fetch: Object,
data: {
type: Array,
default: () => []
},
button: Object,
index: Boolean,
selection: Boolean,
page: Object,
formCreateInject: Object
},
data() {
return {
total: 0,
loading: !1,
unwatch: null,
list: [],
currentPage: 1,
id: 1,
order: "",
orderBy: ""
};
},
watch: {
globalDataKey() {
this.initPage();
},
fetch() {
this.globalDataKey || this.initPage();
},
data() {
!this.globalDataKey && !this.fetch && this.initPage();
},
selection() {
this.id++;
},
index() {
this.id++;
},
page: {
handler() {
this.initPage(), this.id++;
},
deep: !0
},
button: {
handler() {
this.id++;
},
deep: !0
}
},
computed: {
filterList() {
let e = this.list || [];
const t = [];
return this.column.forEach((i) => {
i.prop && Array.isArray(i.filter) && i.filter.length > 0 && t.push((r) => i.filter.indexOf(r[i.prop]) > -1);
}), t.forEach((i) => {
e = e.filter(i);
}), e;
}
},
render() {
return wn(tn("div", {
class: "_fc-data-table"
}, [
tn(ie("el-table"), {
data: this.filterList,
...this.$attrs,
key: this.id,
ref: "table",
onSortChange: (e) => {
this.$emit("sortChange", e), e.order ? (this.orderBy = e.order === "descending" ? "DESC" : "ASC", this.order = e.prop) : (this.orderBy = "", this.order = ""), this.initPage();
}
}, () => {
const e = this.column.filter((i) => i.hidden !== !0).map((i) => this.makeColumn(i));
this.selection && e.unshift(tn(ie("el-table-column"), {
type: "selection",
width: "50px"
}));
const t = this.makeButtonCol();
return t && e.push(t), this.index && e.unshift(tn(ie("el-table-column"), {
type: "index",
width: "50px"
})), e;
}),
this.makePage()
]), [
[C_("loading"), this.loading]
]);
},
methods: {
getEl() {
return this.$refs.table;
},
deepGet(e, t, i) {
t = (t || "").split(".");
let r = 0, n = t.length;
for (; e != null && r < n; )
e = e[t[r++]];
return r && r === n && e != null ? e : i;
},
initPage() {
this.loading = !1, this.page && this.page.open ? (this.currentPage = 1, this.nextList()) : this.globalDataKey || this.fetch ? this.fetchData().then(({ list: e }) => {
this.list = e;
}) : this.list = this.data;
},
btnProps(e, t) {
const i = e.prop || [], r = {
type: e.type,
size: e.size,
round: i.indexOf("round") > -1,
link: i.indexOf("link") > -1,
plain: i.indexOf("plain") > -1,
disabled: i.indexOf("disabled") > -1,
onClick: (a) => {
a.stopPropagation();
const s = jo(e.click);
try {
s && s(t, this.formCreateInject.api);
} catch (u) {
console.error(u);
}
this.$emit("handleClick", { name: e.name, key: e.key, scope: t, column: t.row });
}
}, n = jo(e.handle);
try {
const a = n && n(r, t, this.formCreateInject.api);
typeof a == "boolean" && (r.disabled = a);
} catch (a) {
console.error(a);
}
return r;
},
getLimit() {
return this.page.props && this.page.props.pageSize || 20;
},
nextList() {
if (this.globalDataKey || this.fetch)
this.fetchData(!0).then(({ list: e, total: t }) => {
this.list = e, this.total = t;
});
else {
const e = this.data, t = this.getLimit(), i = this.currentPage * t;
this.list = e.slice(i - t, i), this.total = e.length;
}
},
fetchData(e) {
return this.unwatch && this.unwatch(), new Promise((t) => {
let i = this.fetch;
if (this.globalDataKey) {
const r = typeof this.globalDataKey == "string" ? this.globalDataKey : this.globalDataKey.key;
i = this.formCreateInject.api.options.globalData[r];
}
if (i)
if (i.type === "fetch" || !this.globalDataKey) {
i = { ...i };
let r = {};
if (e) {
const a = this.page.props && this.page.props.pageSize || 20, s = this.page.pageField || "page", u = this.page.pageSizeField || "limit";
r = {
[s]: this.currentPage,
[u]: a
};
}
if (this.order) {
const a = this.page.orderField || "order", s = this.page.orderByField || "orderBy";
r[a] = this.order, r[s] = this.orderBy;
}
const n = Object.keys(r).map((a) => encodeURIComponent(a) + "=" + encodeURIComponent(r[a]), "").join("&");
n && (i.action += (i.action.indexOf("?") !== -1 ? "&" : "?") + n), this.loading = !0, i.wait = 1e3, this.unwatch = this.formCreateInject.api.watchFetch(i, (a, s) => {
this.loading = !1;
const u = this.page.totalField, d = this.page.dataField, h = d ? this.deepGet(a, d, []) : a;
let p = u ? this.deepGet(a, u) : 0;
p || (p = h.length || 0), t({ list: h, total: p });
}, (a) => {
console.error(a), this.loading = !1;
}, (a, s) => {
if (s)
return this.unwatch && this.unwatch(), this.unwatch = null, setTimeout(() => {
this.changePage(1);
}), !1;
});
} else {
let r = i.data || [], n = i.data.length;
if (e) {
const a = this.getLimit(), s = this.currentPage * a;
r = r.slice(s - a, s), n = r.length;
}
t({ list: r, total: n });
}
else
t({ list: [], total: 0 });
});
},
changePage(e) {
this.currentPage = e, this.nextList();
},
makePage() {
if (this.page && this.page.open === !0)
return tn(ie("el-pagination"), {
layout: "prev, pager, next",
total: this.total,
currentPage: this.currentPage,
"onUpdate:currentPage": (e) => {
this.currentPage !== e && this.changePage(e);
},
class: this.page.position || "right",
...this.page.props || {},
pageSize: this.page.props && this.page.props.pageSize || 20
});
},
makeButtonCol() {
if (this.button && this.button.open === !0 && this.button.column)
return tn(ie("el-table-column"), {
label: this.button.label || this.formCreateInject.t("operation") || "\u64CD\u4F5C",
fixed: this.button.fixed === void 0 ? "right" : this.button.fixed,
width: this.button.width || "100px"
}, {
default: (e) => this.button.column.filter((t) => t.hidden !== !0).map((t) => tn(ie("el-button"), this.btnProps(t, e), () => [t.name]))
});
},
makeColumn(e) {
return tn(ie("el-table-column"), {
label: e.label,
prop: e.prop,
width: e.width,
align: e.align,
className: e.className,
fixed: e.fixed,
sortable: e.sortable
}, {
default: (t) => {
if (e.children && e.children.length > 0)
return e.children.map((i) => this.makeColumn(i));
if (!(!e.format || e.format === "default"))
return this.makeTd(e, t);
}
});
},
makeTd(e, t) {
return e.format === "custom" && e.render ? e.render(t, tn, ie, this.formCreateInject.api) : e.format === "tag" ? tn(ie("el-tag"), { disableTransitions: !0 }, () => [this.deepGet(t.row, e.prop, "")]) : e.format === "image" ? tn("div", {
class: "_fc-data-table-img-list"
}, (() => {
let i = this.deepGet(t.row, e.prop, "");
return i = (Array.isArray(i) ? i : [i]).filter((r) => !!r), i.map((r, n) => tn(ie("el-image"), {
src: r,
previewSrcList: i,
previewTeleported: !0,
initialIndex: n,
fit: "cover"
}));
})()) : "" + this.deepGet(t.row, e.prop, "");
}
},
created() {
this.initPage(), this.$watch(() => this.data && this.data.length, () => {
!this.globalDataKey && !this.fetch && this.initPage();
});
}
});
const wF = "[[FORM-CREATE-PREFIX-", AF = "-FORM-CREATE-SUFFIX]]", CF = Ve({
name: "FnConfig",
emits: ["update:modelValue"],
props: {
modelValue: [Object, void 0, null],
eventConfig: {
type: Array,
default: () => []
}
},
inject: ["designer"],
components: {
FnEditor: ar
},
data() {
return {
visible: !1,
activeData: null,
defActive: "no",
event: {},
cus: !1,
eventStr: ""
};
},
computed: {
eventInfo() {
const e = {};
return this.eventConfig.forEach((t) => {
e[t.name] = t.info;
}), e;
},
t() {
return this.designer.setupState.t;
},
eventNum() {
let e = 0;
return Object.keys(this.modelValue || {}).forEach((t) => {
this.modelValue[t] && e++;
}), e;
}
},
watch: {
visible(e) {
this.event = e ? this.loadFN(Cc({}, this.modelValue || {})) : {}, e || this.destroy();
}
},
methods: {
getArgs(e) {
return e.args.join(", ");
},
loadFN(e) {
const t = {};
return this.eventConfig.forEach((i) => {
const r = i.name, n = e[r] || "";
t[r] = {
item: i,
fn: n
};
}), t;
},
parseFN(e) {
const t = {};
return Object.keys(e).forEach((i) => {
e[i].fn && (t[i] = e[i].fn);
}), t;
},
edit(e) {
e.key = rt(), this.activeData = e, this.eventStr = e.fn || wF + `function ${e.item.name}(${this.getArgs(e.item)}){}` + AF, this.defActive = e.item.name;
},
save() {
return this.$refs.fn.save() ? (this.activeData.fn = this.eventStr, this.destroy(), !0) : !1;
},
destroy() {
this.activeData = null, this.defActive = "no";
},
close() {
this.destroy();
},
submit() {
this.activeData && !this.save() || (this.$emit("update:modelValue", this.parseFN(this.event)), this.visible = !1, this.destroy());
}
}
}), SF = { class: "_fd-fn-list" }, EF = ["onClick"], xF = {
key: 0,
class: "_fd-label"
}, TF = {
key: 1,
class: "_fd-dot"
};
function kF(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-badge"), d = ie("el-text"), h = ie("el-header"), p = ie("el-menu-item"), g = ie("el-menu"), _ = ie("el-main"), S = ie("el-container"), b = ie("el-aside"), A = ie("FnEditor"), w = ie("el-dialog");
return W(), ae("div", SF, [
G(u, {
value: e.eventNum,
type: "warning",
hidden: e.eventNum < 1
}, {
default: N(() => [
G(s, {
class: "_fd-plain-button",
plain: "",
onClick: t[0] || (t[0] = (m) => e.visible = !0),
size: "small"
}, {
default: N(() => [
_e(le(e.t("event.title")), 1)
]),
_: 1
})
]),
_: 1
}, 8, ["value", "hidden"]),
G(w, {
class: "_fd-fn-list-dialog _fd-config-dialog",
title: e.t("event.title"),
modelValue: e.visible,
"onUpdate:modelValue": t[4] || (t[4] = (m) => e.visible = m),
"destroy-on-close": "",
"close-on-click-modal": !1,
"append-to-body": "",
width: "980px"
}, {
footer: N(() => [
Z("div", null, [
G(s, {
size: "default",
onClick: t[3] || (t[3] = (m) => e.visible = !1)
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}),
G(s, {
type: "primary",
size: "default",
onClick: e.submit
}, {
default: N(() => [
_e(le(e.t("props.ok")), 1)
]),
_: 1
}, 8, ["onClick"])
])
]),
default: N(() => [
G(S, {
class: "_fd-fn-list-con",
style: { height: "600px" }
}, {
default: N(() => [
G(b, { style: { width: "300px" } }, {
default: N(() => [
G(S, { class: "_fd-fn-list-l" }, {
default: N(() => [
G(h, {
class: "_fd-fn-list-head",
height: "40px"
}, {
default: N(() => [
G(d, {
type: "primary",
size: "default"
}, {
default: N(() => [
_e(le(e.t("event.list")), 1)
]),
_: 1
})
]),
_: 1
}),
G(_, null, {
default: N(() => [
G(g, {
"default-active": e.defActive,
modelValue: e.activeData,
"onUpdate:modelValue": t[1] || (t[1] = (m) => e.activeData = m)
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.event, (m, y) => (W(), ye(p, {
key: y,
index: y
}, {
default: N(() => [
Z("div", {
class: "_fd-fn-list-method",
onClick: vt((E) => e.edit(m), ["stop"])
}, [
Z("span", null, [
t[5] || (t[5] = _e("function")),
Z("span", null, le(y), 1)
]),
e.eventInfo[y] ? (W(), ae("span", xF, le(e.eventInfo[y]), 1)) : Oe("", !0),
m.fn ? (W(), ae("span", TF)) : Oe("", !0)
], 8, EF)
]),
_: 2
}, 1032, ["index"]))), 128))
]),
_: 1
}, 8, ["default-active", "modelValue"])
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}),
G(_, null, {
default: N(() => [
G(S, { class: "_fd-fn-list-r" }, {
default: N(() => [
e.activeData ? (W(), ye(h, {
key: 0,
class: "_fd-fn-list-head",
height: "40px"
}, {
default: N(() => [
G(s, {
size: "small",
onClick: e.close
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}, 8, ["onClick"]),
G(s, {
size: "small",
type: "primary",
onClick: e.save
}, {
default: N(() => [
_e(le(e.t("props.save")), 1)
]),
_: 1
}, 8, ["onClick"])
]),
_: 1
})) : Oe("", !0),
e.activeData ? (W(), ye(_, { key: 1 }, {
default: N(() => [
G(A, {
ref: "fn",
modelValue: e.eventStr,
"onUpdate:modelValue": t[2] || (t[2] = (m) => e.eventStr = m),
name: e.activeData.item.name,
args: e.activeData.item.args
}, null, 8, ["modelValue", "name", "args"])
]),
_: 1
})) : Oe("", !0)
]),
_: 1
})
]),
_: 1
})
]),
_: 1
})
]),
_: 1
}, 8, ["title", "modelValue"])
]);
}
const OF = /* @__PURE__ */ je(CF, [["render", kF]]);
const RF = Ve({
name: "FnInput",
components: { FnEditor: ar },
emits: ["update:modelValue", "change"],
props: {
modelValue: [String, Function],
name: String,
args: Array,
title: String,
body: Boolean,
fnx: Boolean,
defaultValue: {
require: !1
},
validate: Function
},
inject: ["designer"],
computed: {
t() {
return this.designer.setupState.t;
},
configured() {
return !!this.modelValue;
}
},
data() {
return {
visible: !1,
value: this.modelValue
};
},
watch: {
modelValue(e) {
this.value = e;
}
},
methods: {
onOk() {
this.$refs.editor.save() && (this.$emit("update:modelValue", this.value), this.$emit("change", this.value), this.visible = !1);
}
}
}), DF = { class: "_fd-fn-input" };
function $F(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-badge"), d = ie("FnEditor"), h = ie("el-dialog");
return W(), ae("div", DF, [
G(u, {
type: "warning",
"is-dot": "",
hidden: !e.configured
}, {
default: N(() => [
G(s, {
class: "_fd-plain-button",
plain: "",
onClick: t[0] || (t[0] = (p) => e.visible = !0),
size: "small"
}, {
default: N(() => [
kt(e.$slots, "default", {}, () => [
_e(le(e.t("event.action")), 1)
])
]),
_: 3
})
]),
_: 3
}, 8, ["hidden"]),
G(h, {
class: "_fd-fn-input-dialog _fd-config-dialog",
title: e.title || e.t("struct.title"),
modelValue: e.visible,
"onUpdate:modelValue": t[3] || (t[3] = (p) => e.visible = p),
"destroy-on-close": "",
"close-on-click-modal": !1,
"append-to-body": "",
width: "800px"
}, {
footer: N(() => [
Z("div", null, [
G(s, {
onClick: t[2] || (t[2] = (p) => e.visible = !1),
size: "default"
}, {
default: N(() => [
_e(le(e.t("props.cancel")), 1)
]),
_: 1
}),
G(s, {
type: "primary",
onClick: e.onOk,
size: "default"
}, {
default: N(() => [
_e(le(e.t("props.ok")), 1)
]),
_: 1
}, 8, ["onClick"])
])
]),
default: N(() => [
G(d, {
ref: "editor",
modelValue: e.value,
"onUpdate:modelValue": t[1] || (t[1] = (p) => e.value = p),
name: e.name,
args: e.args,
body: e.body,
fnx: e.fnx
}, null, 8, ["modelValue", "name", "args", "body", "fnx"])
]),
_: 1
}, 8, ["title", "modelValue"])
]);
}
const ky = /* @__PURE__ */ je(RF, [["render", $F]]);
const IF = Ve({
name: "GlobalFetchSelect",
emits: ["update:modelValue"],
props: {
modelValue: [Object, String],
to: String
},
inject: ["designer"],
computed: {
t() {
return this.designer.setupState.t;
},
options() {
return Object.keys(this.designer.setupState.formOptions.globalData || {}).map((e) => ({ label: this.designer.setupState.formOptions.globalData[e].label, value: e }));
}
},
watch: {
modelValue() {
this.value = (this.modelValue || {}).key || "";
}
},
data() {
return {
value: (this.modelValue || {}).key || "",
uni: 1,
loading: !1
};
},
methods: {
refresh() {
!this.value || (this.uni = this.uni === 1 ? 0 : 1, this.input(), this.loading = !0, setTimeout(() => {
this.loading = !1;
}, 1e3));
},
openConfig() {
this.designer.setupState.openGlobalFetchDialog();
},
input() {
const e = typeof this.modelValue == "object" ? { ...this.modelValue } : {};
e.to = this.to || "options", e.key = this.value, e._uni = this.uni, this.$emit("update:modelValue", e);
}
}
}), FF = { class: "_fd-gfs" }, MF = { class: "_fd-gfs-handle" };
function PF(e, t, i, r, n, a) {
const s = ie("el-option"), u = ie("el-select");
return W(), ae("div", FF, [
G(u, {
modelValue: e.value,
"onUpdate:modelValue": t[0] || (t[0] = (d) => e.value = d),
clearable: "",
filterable: "",
onChange: e.input
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.options, (d) => (W(), ye(s, {
key: d.value,
label: d.label,
value: d.value
}, null, 8, ["label", "value"]))), 128))
]),
_: 1
}, 8, ["modelValue", "onChange"]),
Z("div", MF, [
Z("i", {
onClick: t[1] || (t[1] = (...d) => e.refresh && e.refresh(...d)),
class: qe(["fc-icon icon-refresh", { disabled: !e.value, "_fc-loading": this.loading }]),
title: "reload"
}, null, 2),
Z("div", {
class: "_fc-manage-text",
onClick: t[2] || (t[2] = (...d) => e.openConfig && e.openConfig(...d))
}, t[3] || (t[3] = [
Z("i", { class: "fc-icon icon-setting" }, null, -1)
]))
])
]);
}
const LF = /* @__PURE__ */ je(IF, [["render", PF]]);
const NF = Ve({
name: "GlobalClassSelect",
emits: ["update:modelValue"],
props: {
modelValue: [Array, String],
to: String
},
inject: ["designer"],
computed: {
t() {
return this.designer.setupState.t;
},
options() {
return Object.keys(this.designer.setupState.formOptions.globalClass || {}).map((e) => ({ label: this.designer.setupState.formOptions.globalClass[e].label, value: e }));
}
},
watch: {
modelValue() {
this.tidyValue();
}
},
data() {
return {
value: []
};
},
methods: {
tidyValue() {
this.value = Array.isArray(this.modelValue) ? this.modelValue : (this.modelValue || "").split(" ").filter((e) => !!e);
},
openConfig() {
this.designer.setupState.openGlobalClassDialog();
},
input() {
this.$emit("update:modelValue", this.value.join(" "));
}
},
created() {
this.tidyValue();
}
}), BF = { class: "_fd-gcs" }, VF = { class: "_fd-gcs-handle" };
function jF(e, t, i, r, n, a) {
const s = ie("el-option"), u = ie("el-select");
return W(), ae("div", BF, [
G(u, {
modelValue: e.value,
"onUpdate:modelValue": t[0] || (t[0] = (d) => e.value = d),
multiple: "",
filterable: "",
"allow-create": "",
"default-first-option": "",
"reserve-keyword": !1,
clearable: "",
onChange: e.input
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.options, (d) => (W(), ye(s, {
key: d.value,
label: d.label,
value: d.value
}, null, 8, ["label", "value"]))), 128))
]),
_: 1
}, 8, ["modelValue", "onChange"]),
Z("div", VF, [
Z("div", {
class: "_fc-manage-text",
onClick: t[1] || (t[1] = (...d) => e.openConfig && e.openConfig(...d))
}, t[2] || (t[2] = [
Z("i", { class: "fc-icon icon-setting" }, null, -1)
]))
])
]);
}
const UF = /* @__PURE__ */ je(NF, [["render", jF]]);
const zF = Ve({
name: "FetchTable",
components: { VariableConfig: al },
inject: ["designer"],
emits: ["update:modelValue"],
props: {
modelValue: Object
},
computed: {
t() {
return this.designer.setupState.t;
}
},
data() {
return {
value: [],
active: null,
start: null
};
},
methods: {
onConfirm(e, t, i) {
e === this.active ? e[t] = (e[t] || "").substring(0, this.start) + i + (e[t] || "").substring(this.start) : (e[t] += i, this.active = null, this.start = null), this.submit();
},
onBlur(e, t) {
this.active = e, this.start = t.target.selectionStart, this.submit();
},
submit() {
const e = {};
this.value.forEach((t) => {
t.key && t.value && (e[t.key] = t.value);
}), this.$emit("update:modelValue", e);
},
add() {
this.value.push({});
},
rm(e) {
this.value.splice(e, 1), this.submit();
}
},
created() {
const e = [];
Object.keys(this.modelValue || {}).forEach((t) => {
e.push({
key: t,
value: this.modelValue[t]
});
}), this.value = e;
}
}), HF = { class: "_fd-fetch-table" }, WF = { style: { width: "40%" } }, GF = { class: "_fd-fetch-table-key" }, KF = ["onClick"];
function YF(e, t, i, r, n, a) {
const s = ie("el-header"), u = ie("VariableConfig"), d = ie("el-input"), h = ie("el-main"), p = ie("el-container"), g = ie("el-button");
return W(), ae("div", HF, [
e.value.length > 0 ? (W(), ye(p, {
key: 0,
class: "_fd-fetch-table-con"
}, {
default: N(() => [
G(s, null, {
default: N(() => [
Z("div", WF, le(e.t("props.key")), 1),
Z("div", null, le(e.t("props.value")), 1)
]),
_: 1
}),
G(h, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.value, (_, S) => (W(), ae("div", {
key: S,
class: "_fd-fetch-table-row"
}, [
Z("div", GF, [
G(d, {
modelValue: _.key,
"onUpdate:modelValue": (b) => _.key = b,
onBlur: (b) => e.onBlur(_, b)
}, {
suffix: N(() => [
G(u, {
popover: "",
onConfirm: (b) => e.onConfirm(_, "key", b)
}, null, 8, ["onConfirm"])
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue", "onBlur"])
]),
G(d, {
modelValue: _.value,
"onUpdate:modelValue": (b) => _.value = b,
onBlur: (b) => e.onBlur(_, b)
}, {
suffix: N(() => [
G(u, {
popover: "",
onConfirm: (b) => e.onConfirm(_, "value", b)
}, null, 8, ["onConfirm"])
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue", "onBlur"]),
Z("i", {
class: "fc-icon icon-delete-circle",
onClick: (b) => e.rm(S)
}, null, 8, KF)
]))), 128))
]),
_: 1
})
]),
_: 1
})) : Oe("", !0),
G(g, {
link: "",
type: "primary",
onClick: e.add
}, {
default: N(() => [
t[0] || (t[0] = Z("i", { class: "fc-icon icon-add" }, null, -1)),
_e(" " + le(e.t("tableOptions.add")), 1)
]),
_: 1
}, 8, ["onClick"])
]);
}
const QF = /* @__PURE__ */ je(zF, [["render", YF]]), Oy = Ve({
name: "DragBox",
props: ["rule", "tag", "formCreateInject", "list"],
render(e) {
const t = { ...e.$props.rule.props, ...e.$attrs };
let i = "_fd-" + e.$props.tag + "-drag _fd-drag-box";
Object.keys(e.$slots).length || (i += " drag-holder"), t.class = i, t.modelValue = e.$props.list || [...e.$props.formCreateInject.children];
const r = {};
return e.$slots.default && e.$slots.default().forEach((a) => {
a.key && (r[a.key] = a);
}), tn(Go, t, {
item: ({ element: n, index: a }) => {
var d, h, p;
let s = "";
(((d = n == null ? void 0 : n._menu) == null ? void 0 : d.inline) || ((h = n == null ? void 0 : n._config) == null ? void 0 : h.inline)) && (s = " is-inline");
const u = (p = n == null ? void 0 : n.__fc__) == null ? void 0 : p.key;
if (u) {
let g = r["_" + n.slot];
if (g ? g.children.forEach((_) => {
_.key === u + "fc" && (g = _);
}) : g = r[u + "fc"], g)
return tn("div", { class: "_fc-" + e.$props.tag + "-item _fd-drag-item" + s, key: u }, g);
}
return tn("div", { class: "_fc-" + e.$props.tag + "-item _fd-drag-item", key: a }, null);
}
});
}
});
const JF = Ve({
name: "FcTableView",
props: {
mini: Boolean,
label: String,
width: [Number, String],
formCreateInject: Object,
border: {
type: Boolean,
default: !0
},
borderWidth: String,
borderColor: String,
rule: {
type: Object,
default: () => ({ row: 1, col: 1 })
}
},
inject: ["designer"],
components: {
DragTool: xy,
DragBox: Oy
},
watch: {
rule: {
handler() {
this.initRule(), this.style = this.rule.style;
},
immediate: !0
}
},
data() {
return {
unique: {},
style: {},
dragProp: {
rule: {
props: {
tag: "el-col",
group: {
name: "default",
put: (e, ...t) => (e.el.__rule__ = this.formCreateInject.rule, this.designer.setupState.dragPut(e, ...t))
},
ghostClass: "ghost",
animation: 150,
handle: "._fd-drag-btn",
emptyInsertThreshold: 0,
direction: "vertical",
itemKey: "type"
}
},
tag: "tableCell"
},
lattice: {},
uni: {}
};
},
computed: {
t() {
return this.designer.setupState.t;
},
tableColor() {
const e = {};
return this.border === !1 ? e.border = "0 none" : (this.borderColor && (e.borderColor = this.borderColor), this.borderWidth && (e.borderWidth = this.borderWidth)), e;
}
},
methods: {
getUnique(e) {
return this.unique[e] || (this.unique[e] = rt()), this.unique[e];
},
getSlotChildren(e) {
const t = [];
return this.formCreateInject.children.forEach((i) => {
e.indexOf(i.slot) > -1 && t.push(i);
}), t;
},
dragAdd(e, t) {
const i = this.designer.setupState, r = this.formCreateInject.children, n = `${t.pid}:${t.idx}`, a = e.item._underlying_vm_, s = i.addRule && i.addRule.children === i.moveRule;
s && i.moveRule.splice(i.moveRule.indexOf(a), 1);
let u = 0;
const d = "drag" + t.pid + t.idx;
if (this.$refs[d][0].list.length) {
let h = this.$refs[d][0].list[e.newIndex ? e.newIndex - 1 : 0];
u = r.indexOf(h) + (e.newIndex ? 1 : 0);
} else if (r.length) {
const h = Object.keys(this.$refs);
for (let p = h.indexOf(d) - 1; p >= 0; p--) {
if (!this.$refs[h[p]] || !this.$refs[h[p]].length)
continue;
const g = this.$refs[h[p]][0].list || [];
if (g.length) {
u = r.indexOf(g[g.length - 1]) + 1;
break;
}
}
}
e.newIndex = u, s ? (a.slot = n, r.splice(e.newIndex, 0, a), i.added = !0, i.handleSortAfter({ rule: a })) : i.dragAdd(r, e, `${t.pid}:${t.idx}`);
},
dragEnd(e, t) {
const i = this.designer.setupState, r = this.formCreateInject.children, n = e.item._underlying_vm_, a = r.indexOf(n);
e.newIndex = a + (e.newIndex - e.oldIndex), e.oldIndex = a, i.dragEnd(this.formCreateInject.children, e, `${t.pid}:${t.idx}`);
},
dragStart() {
this.designer.setupState.dragStart(this.formCreateInject.children);
},
dragUnchoose(e) {
this.designer.setupState.dragUnchoose(this.formCreateInject.children, e);
},
initRule() {
const e = this.rule;
e.style || (e.style = {}), e.class || (e.class = {}), e.layout || (e.layout = []), e.row || (e.row = 1), e.col || (e.col = 1);
},
active(e) {
const t = `${e.pid}:${e.idx}`;
this.designer.setupState.customActive({
name: "fcTableGrid",
onPaste: (i) => {
i.slot = t, this.formCreateInject.children.push(i);
},
style: {
formData: {
style: this.rule.style[t] || {},
class: this.rule.class[t] || ""
},
change: (i, r) => {
this.rule[i][t] = r || {};
}
}
});
},
command(e) {
this[e[0]](...e[1]);
},
rmSlot(e, t) {
const i = Object.keys(e), r = this.formCreateInject.children;
let n = 0;
[...r].forEach((a, s) => {
if (!a.slot)
return;
let u;
t.indexOf(a.slot) > -1 ? (r.splice(s - n, 1), n++) : (u = i.indexOf(a.slot)) > -1 && (a.slot = e[i[u]]);
}), t.forEach((a) => {
delete this.style[a];
}), this.loadRule();
},
rmRow(e) {
this.rule.row--;
const t = {}, i = [];
for (let a = e.pid; a < this.rule.row + 1; a++)
for (let s = 0; s < this.rule.col; s++)
a === e.pid ? i.push(`${e.pid}:${s}`) : t[`${a}:${s}`] = `${a - 1}:${s}`;
let r = 0;
const n = this.rule.layout;
[...n].forEach((a, s) => {
a.top === e.pid && (n.splice(s - r, 1), r++);
}), n.forEach((a) => {
a.top > e.pid && a.top--;
}), this.rmSlot(t, i);
},
rmCol(e) {
this.rule.col--;
const t = {}, i = [];
for (let a = 0; a < this.rule.row; a++) {
for (let s = e.idx + 1; s < this.rule.col + 1; s++)
t[`${a}:${s}`] = `${a}:${s - 1}`;
i.push(`${a}:${e.idx}`);
}
let r = 0;
const n = this.rule.layout;
[...n].forEach((a, s) => {
a.left === e.idx && (n.splice(s - r, 1), r++);
}), n.forEach((a) => {
a.left > e.idx && a.left--;
}), this.rmSlot(t, i);
},
splitRow(e) {
const t = e.data.layout, i = t.row;
if (t.row = 0, i > 1)
for (let r = 1; r < i; r++)
this.rule.layout.push({
...t,
top: t.top + r
});
this.loadRule();
},
splitCol(e) {
const t = e.data.layout, i = t.col;
if (t.col = 0, i > 1)
for (let r = 1; r < i; r++)
this.rule.layout.push({
...t,
left: t.left + r
});
this.loadRule();
},
makeMap(e) {
let t = [];
for (let i = e.top; i < (e.row || e.top + 1); i++)
for (let r = e.left; r < (e.col || e.left + 1); r++)
t.push(`${i}:${r}`);
return t;
},
mergeRight(e) {
let t;
if (e.data.layout) {
const r = (e.data.layout.col || 1) + 1;
e.data.layout.col = r + e.idx > this.rule.col ? this.rule.col - e.idx : r, t = e.data.layout;
} else
t = {
top: e.pid,
left: e.idx,
col: 2
}, this.rule.layout.push(t);
const i = this.makeMap(t);
this.formCreateInject.children.forEach((r) => {
!r.slot || i.indexOf(r.slot) > -1 && (r.slot = `${e.pid}:${e.idx}`);
}), this.loadRule();
},
mergeBottom(e) {
let t;
if (e.data.layout) {
const r = (e.data.layout.row || 1) + 1;
e.data.layout.row = r + r.pid > this.rule.col ? this.rule.col - e.pid : r, t = e.data.layout;
} else
t = {
top: e.pid,
left: e.idx,
row: 2
}, this.rule.layout.push(t);
const i = this.makeMap(t);
this.formCreateInject.children.forEach((r) => {
!r.slot || i.indexOf(r.slot) > -1 && (r.slot = `${e.pid}:${e.idx}`);
}), this.loadRule();
},
addCol(e, t) {
if (this.rule.col++, this.rule.layout.forEach((i) => {
i.left > (t ? e.idx - 1 : e.idx) && i.left++;
}), t || e.idx < this.rule.col - 2) {
const i = {};
for (let n = 0; n < this.rule.row; n++)
for (let a = t ? e.idx - 1 : e.idx + 1; a < this.rule.col - 1; a++)
i[`${n}:${a}`] = `${n}:${a + 1}`;
const r = Object.keys(i);
this.formCreateInject.children.forEach((n) => {
let a;
n.slot && (a = r.indexOf(n.slot)) > -1 && (n.slot = i[r[a]]);
}), r.forEach((n) => {
this.style[n] && (this.style[i[n]] = this.style[n], delete this.style[n]);
});
}
this.loadRule();
},
addRow(e, t) {
if (this.rule.row++, this.rule.layout.forEach((i) => {
i.top > (t ? e.pid - 1 : e.pid) && i.top++;
}), t || e.pid < this.rule.row - 2) {
const i = {};
for (let n = t ? e.pid - 1 : e.pid + 1; n < this.rule.row; n++)
for (let a = 0; a < this.rule.col; a++)
i[`${n}:${a}`] = `${n + 1}:${a}`;
const r = Object.keys(i);
this.formCreateInject.children.forEach((n) => {
let a;
n.slot && (a = r.indexOf(n.slot)) > -1 && (n.slot = i[r[a]]);
}), r.reverse().forEach((n) => {
this.style[n] && (this.style[i[n]] = this.style[n], delete this.style[n]);
});
}
this.loadRule();
},
loadRule() {
const e = [], t = this.rule || { row: 1, col: 1 };
for (let r = 0; r < t.row; r++) {
const n = [];
e.push(n);
for (let a = 0; a < t.col; a++)
n.push({ rowspan: 1, colspan: 1, slot: [], show: !0, id: this.getUnique(`${r}${a}`) });
}
[...t.layout || []].forEach((r, n) => {
if ((!r.row || r.row <= 0) && (!r.col || r.col <= 0) || !e[r.top] || !e[r.top][r.left] || !e[r.top][r.left].show) {
t.layout.splice(n, 1);
return;
}
const a = e[r.top][r.left];
a.layout = r;
let s = 1, u = 1;
if (r.col && (s = r.col + r.left > t.col ? t.col - r.left : r.col, a.colspan = s), r.row && (u = r.row + r.top > t.row ? t.row - r.top : r.row, a.rowspan = u), u && s)
for (let d = 0; d < u; d++) {
const h = e[r.top + d];
if (h)
for (let p = 0; p < s; p++)
!p && !d || (h[r.left + p] && (h[r.left + p].show = !1), a.slot.push(`${r.top + d}:${r.left + p}`));
}
});
const i = (r) => !!(!r || r.layout || !r.show);
e.forEach((r, n) => {
r.forEach((a, s) => {
let u = !1, d = !1;
if (a.layout) {
const h = a.layout.col || 1, p = a.layout.row || 1;
for (let g = 0; g < h; g++)
if (!e[n + p] || i(e[n + p][s + g])) {
d = !0;
continue;
}
for (let g = 0; g < p; g++)
if (!e[n + g] || i(e[n + g][s + h])) {
u = !0;
continue;
}
} else
u = i(r[s + 1]), d = e[n + 1] ? i(e[n + 1][s]) : !0;
a.right = u, a.bottom = d;
});
}), this.lattice = e, this.formCreateInject.rule.props.rule = t;
}
},
beforeMount() {
this.loadRule();
}
}), XF = { class: "_fd-table-view-cell" }, ZF = ["onClick"], qF = ["onClick"];
function e3(e, t, i, r, n, a) {
const s = ie("DragBox"), u = ie("el-dropdown-item"), d = ie("el-dropdown-menu"), h = ie("el-dropdown"), p = ie("DragTool");
return W(), ae("div", {
class: qe(["_fd-table-view", { "is-mini": e.mini }])
}, [
Z("table", {
border: "1",
cellspacing: "0",
cellpadding: "0",
style: An(e.tableColor)
}, [
(W(!0), ae(Pe, null, Ge(e.rule.row, (g, _) => (W(), ae("tr", { key: _ }, [
(W(!0), ae(Pe, null, Ge(e.rule.col, (S, b) => (W(), ae(Pe, null, [
e.lattice[_][b].show ? (W(), ae("td", dn({
key: `${_}${b}`,
ref_for: !0
}, e.lattice[_][b] ? { colspan: e.lattice[_][b].colspan, rowspan: e.lattice[_][b].rowspan } : {}, {
style: [e.tableColor, e.style && e.style[`${_}:${b}`] || {}],
class: e.rule.class && e.rule.class[`${_}:${b}`] || ""
}), [
Z("div", XF, [
G(p, {
"drag-btn": !1,
"handle-btn": !0,
onActive: (A) => e.active({ pid: _, idx: b }),
unique: e.lattice[_][b].id
}, {
handle: N(() => [
Z("div", {
class: "_fd-drag-btn _fd-table-view-btn",
onClick: vt((A) => e.addRow({ pid: _, idx: b, data: e.lattice[_][b] }, 0), ["stop"])
}, t[3] || (t[3] = [
Z("i", { class: "fc-icon icon-add-col" }, null, -1)
]), 8, ZF),
Z("div", {
class: "_fd-drag-btn _fd-table-view-btn",
onClick: vt((A) => e.addCol({ pid: _, idx: b, data: e.lattice[_][b] }, 0), ["stop"])
}, t[4] || (t[4] = [
Z("i", {
class: "fc-icon icon-add-col",
style: { transform: "rotate(90deg)" }
}, null, -1)
]), 8, qF),
Z("div", {
class: "_fd-drag-btn _fd-table-view-btn",
onClick: t[2] || (t[2] = vt(() => {
}, ["stop"]))
}, [
G(h, {
trigger: "click",
onCommand: e.command
}, {
dropdown: N(() => [
G(d, null, {
default: N(() => [
G(u, {
command: ["addCol", [{ pid: _, idx: b, data: e.lattice[_][b] }, 1]]
}, {
default: N(() => [
_e(le(e.t("tableOptions.addLeft")), 1)
]),
_: 2
}, 1032, ["command"]),
G(u, {
command: ["addCol", [{ pid: _, idx: b, data: e.lattice[_][b] }, 0]]
}, {
default: N(() => [
_e(le(e.t("tableOptions.addRight")), 1)
]),
_: 2
}, 1032, ["command"]),
G(u, {
command: ["addRow", [{ pid: _, idx: b, data: e.lattice[_][b] }, 1]]
}, {
default: N(() => [
_e(le(e.t("tableOptions.addTop")), 1)
]),
_: 2
}, 1032, ["command"]),
G(u, {
command: ["addRow", [{ pid: _, idx: b, data: e.lattice[_][b] }, 0]]
}, {
default: N(() => [
_e(le(e.t("tableOptions.addBottom")), 1)
]),
_: 2
}, 1032, ["command"]),
G(u, {
divided: "",
disabled: e.lattice[_][b].right,
command: ["mergeRight", [{ pid: _, idx: b, data: e.lattice[_][b] }]]
}, {
default: N(() => [
_e(le(e.t("tableOptions.mergeRight")), 1)
]),
_: 2
}, 1032, ["disabled", "command"]),
G(u, {
disabled: e.lattice[_][b].bottom,
command: ["mergeBottom", [{ pid: _, idx: b, data: e.lattice[_][b] }]]
}, {
default: N(() => [
_e(le(e.t("tableOptions.mergeBottom")), 1)
]),
_: 2
}, 1032, ["disabled", "command"]),
G(u, {
divided: "",
disabled: !(e.lattice[_][b].layout && e.lattice[_][b].layout.col > 1),
command: ["splitCol", [{ pid: _, idx: b, data: e.lattice[_][b] }]]
}, {
default: N(() => [
_e(le(e.t("tableOptions.splitCol")), 1)
]),
_: 2
}, 1032, ["disabled", "command"]),
G(u, {
disabled: !(e.lattice[_][b].layout && e.lattice[_][b].layout.row > 1),
command: ["splitRow", [{ pid: _, idx: b, data: e.lattice[_][b] }]]
}, {
default: N(() => [
_e(le(e.t("tableOptions.splitRow")), 1)
]),
_: 2
}, 1032, ["disabled", "command"]),
G(u, {
divided: "",
disabled: e.rule.col < 2,
command: ["rmCol", [{ pid: _, idx: b, data: e.lattice[_][b] }]]
}, {
default: N(() => [
_e(le(e.t("tableOptions.rmCol")), 1)
]),
_: 2
}, 1032, ["disabled", "command"]),
G(u, {
disabled: e.rule.row < 2,
command: ["rmRow", [{ pid: _, idx: b, data: e.lattice[_][b] }]]
}, {
default: N(() => [
_e(le(e.t("tableOptions.rmRow")), 1)
]),
_: 2
}, 1032, ["disabled", "command"])
]),
_: 2
}, 1024)
]),
default: N(() => [
t[5] || (t[5] = Z("i", { class: "fc-icon icon-setting" }, null, -1))
]),
_: 2
}, 1032, ["onCommand"])
])
]),
default: N(() => [
G(s, dn({ ref_for: !0 }, e.dragProp, {
onAdd: (A) => e.dragAdd(A, { pid: _, idx: b }),
ref_for: !0,
ref: "drag" + _ + b,
onEnd: (A) => e.dragEnd(A, { pid: _, idx: b }),
onStart: t[0] || (t[0] = (A) => e.dragStart(A)),
onUnchoose: t[1] || (t[1] = (A) => e.dragUnchoose(A)),
list: e.getSlotChildren([`${_}:${b}`, ...e.lattice[_][b].slot])
}), {
default: N(() => [
kt(e.$slots, `${_}:${b}`)
]),
_: 2
}, 1040, ["onAdd", "onEnd", "list"])
]),
_: 2
}, 1032, ["onActive", "unique"])
])
], 16)) : Oe("", !0)
], 64))), 256))
]))), 128))
], 4)
], 2);
}
const t3 = /* @__PURE__ */ je(JF, [["render", e3]]);
const n3 = {
name: "FcTable",
props: {
mini: Boolean,
label: String,
width: [Number, String],
border: {
type: Boolean,
default: !0
},
borderWidth: String,
borderColor: String,
rule: {
type: Object,
default: () => ({ row: 1, col: 1 })
}
},
watch: {
rule: {
handler() {
this.initRule(), this.loadRule(), this.tdStyle = this.rule.style || {}, this.tdClass = this.rule.class || {};
},
immediate: !0,
deep: !0
}
},
data() {
return {
tdStyle: {},
tdClass: {},
lattice: {}
};
},
computed: {
tableColor() {
const e = {};
return this.border === !1 ? e.border = "0 none" : (this.borderColor && (e.borderColor = this.borderColor), this.borderWidth && (e.borderWidth = this.borderWidth)), e;
}
},
methods: {
initRule() {
const e = this.rule;
e.style || (e.style = {}), e.layout || (e.layout = []), e.row || (e.row = 1), e.col || (e.col = 1);
},
loadRule() {
const e = [], t = this.rule || { row: 1, col: 1 };
for (let r = 0; r < t.row; r++) {
const n = [];
e.push(n);
for (let a = 0; a < t.col; a++)
n.push({ rowspan: 1, colspan: 1, slot: [], show: !0 });
}
[...t.layout || []].forEach((r, n) => {
if ((!r.row || r.row <= 0) && (!r.col || r.col <= 0) || !e[r.top] || !e[r.top][r.left] || !e[r.top][r.left].show) {
t.layout.splice(n, 1);
return;
}
const a = e[r.top][r.left];
a.layout = r;
let s = 1, u = 1;
if (r.col && (s = r.col + r.left > t.col ? t.col - r.left : r.col, a.colspan = s), r.row && (u = r.row + r.top > t.row ? t.row - r.top : r.row, a.rowspan = u), u && s)
for (let d = 0; d < u; d++) {
const h = e[r.top + d];
if (h)
for (let p = 0; p < s; p++)
!p && !d || (h[r.left + p] && (h[r.left + p].show = !1), a.slot.push(`${r.top + d}:${r.left + p}`));
}
});
const i = (r) => !!(!r || r.layout || !r.show);
e.forEach((r, n) => {
r.forEach((a, s) => {
let u = !1, d = !1;
if (a.layout) {
const h = a.layout.col || 1, p = a.layout.row || 1;
for (let g = 0; g < h; g++)
if (!e[n + p] || i(e[n + p][s + g])) {
d = !0;
continue;
}
for (let g = 0; g < p; g++)
if (!e[n + g] || i(e[n + g][s + h])) {
u = !0;
continue;
}
} else
u = i(r[s + 1]), d = e[n + 1] ? i(e[n + 1][s]) : !0;
a.right = u, a.bottom = d;
});
}), this.lattice = e;
}
}
};
function i3(e, t, i, r, n, a) {
const s = ie("el-col");
return W(), ye(s, { span: 24 }, {
default: N(() => [
Z("div", {
class: qe(["_fc-table", { "is-mini": i.mini }])
}, [
Z("table", {
border: "1",
cellspacing: "0",
cellpadding: "0",
style: An(a.tableColor)
}, [
(W(!0), ae(Pe, null, Ge(i.rule.row, (u, d) => (W(), ae("tr", { key: d }, [
(W(!0), ae(Pe, null, Ge(i.rule.col, (h, p) => (W(), ae(Pe, {
key: `${d}${p}`
}, [
n.lattice[d][p].show ? (W(), ae("td", dn({
key: 0,
ref_for: !0
}, n.lattice[d][p] ? { colspan: n.lattice[d][p].colspan, rowspan: n.lattice[d][p].rowspan } : {}, {
valign: "top",
class: n.tdClass && n.tdClass[`${d}:${p}`] || "",
style: [a.tableColor, n.tdStyle && n.tdStyle[`${d}:${p}`] || {}]
}), [
kt(e.$slots, `${d}:${p}`),
(W(!0), ae(Pe, null, Ge(n.lattice[d][p].slot, (g) => kt(e.$slots, `${g}`)), 256))
], 16)) : Oe("", !0)
], 64))), 128))
]))), 128))
], 4)
], 2)
]),
_: 3
});
}
const r3 = /* @__PURE__ */ je(n3, [["render", i3]]);
const o3 = Ve({
name: "FcValue",
props: ["modelValue"],
inject: ["designer"],
watch: {
modelValue(e) {
this.$emit("change", e);
}
},
computed: {
t() {
return this.designer.setupState.t;
}
}
}), a3 = { class: "_fd-value" };
function l3(e, t, i, r, n, a) {
return W(), ae("div", a3, le(e.t("com.fcValue.empty")), 1);
}
const s3 = /* @__PURE__ */ je(o3, [["render", l3]]), u3 = Ve({
name: "FcValue",
props: ["modelValue"],
watch: {
modelValue(e) {
this.$emit("change", e);
}
}
}), d3 = { class: "_fc-value" };
function f3(e, t, i, r, n, a) {
return W(), ae("div", d3, le(e.modelValue), 1);
}
const c3 = /* @__PURE__ */ je(u3, [["render", f3]]), p3 = Ve({
name: "FcSlot",
inheritAttrs: !1,
inject: ["parentFC"],
props: {
name: String,
formCreateInject: Object
},
computed: {
slotName() {
return this.name || "block_default";
},
slotArg() {
const { rule: e, preview: t, api: i } = this.formCreateInject, r = e.__fc__.prop;
return {
rule: e,
prop: r,
preview: t,
api: i,
model: r.model || {}
};
}
},
render() {
const e = this.getSlot();
return G(Pe, {}, e ? [e(this.slotArg)] : []);
},
methods: {
getSlot() {
const e = (t) => {
if (t) {
let i = t.slots[this.slotName];
return i || e(t.setupState.parent);
}
};
return e(this.parentFC);
}
}
}), h3 = Ve({
name: "FcSlotView",
inheritAttrs: !1,
inject: ["parentFC", "designer"],
props: {
name: String,
formCreateInject: Object
},
computed: {
slotName() {
return this.name || "block_default";
},
slotArg() {
const { rule: e, preview: t, api: i } = this.formCreateInject, r = e.__fc__.prop;
return {
rule: e,
prop: r,
preview: t,
api: i,
model: r.model || {}
};
}
},
render() {
const e = this.getSlot();
return e ? G(Pe, {}, [e(this.slotArg)]) : G("div", {
class: "_fd-slot-empty",
innerHTML: this.designer.setupState.t("com.fcSlot.empty", { tag: "<span>&lt;template #" + this.slotName + " /&gt;</span>" })
});
},
methods: {
getSlot() {
const e = (t) => {
if (t) {
let i = t.slots[this.slotName];
return i || e(t.setupState.parent);
}
};
return e(this.parentFC);
}
}
}), m3 = Ve({
name: "FcJson",
inheritAttrs: !1,
props: {
rule: [Array, String, Object],
type: String,
disabled: Boolean,
expand: Number,
button: {
type: Boolean,
default: !0
},
max: {
type: Number,
default: 0
},
min: {
type: Number,
default: 0
},
sortBtn: {
type: Boolean,
default: !0
},
modelValue: [Object, Array],
formCreateInject: Object
},
data() {
return {
fcSubForm: Is(this.formCreateInject.form.component("fcSubForm")),
fcGroup: Is(this.formCreateInject.form.component("fcGroup")),
uni: 0,
formRule: [],
formOptions: {
submitBtn: !1,
resetBtn: !1
}
};
},
watch: {
rule() {
this.uni++, this.loadRule();
},
type() {
this.loadRule();
}
},
render() {
var e, t;
if (this.rule)
return this.type === "object" ? G(this.fcSubForm, {
key: 2,
...this.$attrs,
modelValue: this.modelValue,
"onUpdate:modelValue": (i) => {
this.$emit("update:modelValue", i);
},
disabled: this.disabled,
formCreateInject: this.formCreateInject,
rule: this.formRule,
options: this.formOptions
}) : this.type === "array" ? G(this.fcGroup, {
key: 3,
...this.$attrs,
modelValue: this.modelValue,
"onUpdate:modelValue": (i) => {
this.$emit("update:modelValue", i);
},
sortBtn: this.sortBtn,
min: this.min,
max: this.max,
expand: this.expand,
button: this.button,
disabled: this.disabled,
formCreateInject: this.formCreateInject,
rule: this.formRule,
options: this.formOptions
}) : G(Pe, {
key: this.uni
}, [(t = (e = this.$slots) == null ? void 0 : e.default) == null ? void 0 : t.call(e)]);
},
methods: {
loadRule() {
let e = At(this.rule);
typeof e == "string" && (e = this.formCreateInject.form.parseJson(e)), Array.isArray(e) ? this.formRule = e : typeof e == "object" && (this.formRule = e.rule || [], this.formOptions = {
submitBtn: !1,
resetBtn: !1,
...e.options || {}
}), e != null ? ["array", "object"].indexOf(this.type) === -1 && (this.formCreateInject.rule.children = [
{
type: "template",
_fc_drag_skip: !0,
children: this.formRule
}
]) : this.formCreateInject.rule.children = [];
}
},
created() {
this.rule && this.loadRule();
}
});
const v3 = Ve({
name: "FcJsonView",
inheritAttrs: !1,
inject: ["designer"],
props: {
rule: [Array, String, Object],
type: String,
disabled: Boolean,
expand: Number,
button: {
type: Boolean,
default: !0
},
max: {
type: Number,
default: 0
},
min: {
type: Number,
default: 0
},
sortBtn: {
type: Boolean,
default: !0
},
modelValue: [Object, Array],
formCreateInject: Object
},
data() {
return {
fcSubForm: Is(this.formCreateInject.form.component("fcSubForm")),
fcGroup: Is(this.formCreateInject.form.component("fcGroup")),
uni: 0,
formRule: [],
formOptions: {
submitBtn: !1,
resetBtn: !1
}
};
},
watch: {
rule() {
this.uni++, this.loadRule();
},
type() {
this.loadRule();
}
},
render() {
var e, t;
if (this.rule) {
let i = null;
return this.type === "object" ? i = G(this.fcSubForm, {
key: 2,
...this.$attrs,
modelValue: this.modelValue,
"onUpdate:modelValue": (r) => {
this.$emit("update:modelValue", r);
},
disabled: this.disabled,
formCreateInject: this.formCreateInject,
rule: this.formRule,
options: this.formOptions
}) : this.type === "array" ? i = G(this.fcGroup, {
key: 3,
...this.$attrs,
modelValue: this.modelValue,
"onUpdate:modelValue": (r) => {
this.$emit("update:modelValue", r);
},
sortBtn: this.sortBtn,
expand: 1,
button: this.button,
disabled: this.disabled,
formCreateInject: this.formCreateInject,
rule: this.formRule,
options: this.formOptions
}) : i = G(Pe, {
key: 1
}, [(t = (e = this.$slots) == null ? void 0 : e.default) == null ? void 0 : t.call(e)]), Z("div", {
key: this.uni,
style: { "--fc-json-mask": `'${this.designer.setupState.t("com.fcJson.name")}'` },
class: "_fd-json-container"
}, [i]);
} else
return Z("div", {
class: "_fd-slot-empty",
innerHTML: this.designer.setupState.t("com.fcJson.empty", { tag: "<span>JSON</span>" })
});
},
methods: {
loadRule() {
let e = At(this.rule);
typeof e == "string" && (e = this.formCreateInject.form.parseJson(e)), Array.isArray(e) ? this.formRule = e : typeof e == "object" && (this.formRule = e.rule || [], this.formOptions = {
submitBtn: !1,
resetBtn: !1,
...e.options || {}
}), e != null ? ["array", "object"].indexOf(this.type) === -1 && (this.formCreateInject.rule.children = [
{
type: "template",
_fc_drag_skip: !0,
children: this.formRule
}
]) : this.formCreateInject.rule.children = [];
}
},
created() {
this.rule && this.loadRule();
}
});
const g3 = Ve({
name: "fcInlineForm"
}), y3 = { class: "_fc-line-form" };
function b3(e, t, i, r, n, a) {
return W(), ae("div", y3, [
kt(e.$slots, "default")
]);
}
const Ry = /* @__PURE__ */ je(g3, [["render", b3]]);
const _3 = Ve({
name: "LanguageInput",
inject: ["designer"],
emits: ["update:modelValue", "blur", "change"],
props: {
size: String,
placeholder: String,
modelValue: String,
disabled: Boolean
},
computed: {
isVar() {
return !!(this.modelValue || "").match(/^\{\{\s*\$t\.(.+)\s*\}\}$/);
},
t() {
return this.designer.setupState.t;
},
showLanguage() {
return this.designer.setupState.getConfig("showLanguage");
},
localeList() {
var r, n;
const e = this.designer.setupState.getConfig("localeOptions", [
{ value: "zh-cn", label: "\u7B80\u4F53\u4E2D\u6587" },
{ value: "en", label: "English" }
]), t = [], i = ((n = (r = this.designer.props) == null ? void 0 : r.locale) == null ? void 0 : n.name) || "zh-cn";
return e.forEach((a) => {
a.value === i ? t.unshift(a) : t.length < 2 && t.push(a);
}), t.length > 2 && t.pop(), t;
},
language() {
const e = this.designer.setupState.formOptions.language || {}, t = {};
return Object.keys(e).forEach((i) => {
Object.keys(e[i]).forEach((r) => {
t[r] || (t[r] = {
key: r
}), t[r][i] = e[i][r];
});
}), Object.values(t);
}
},
methods: {
openConfig() {
this.designer.setupState.activeModule = "language";
},
clickLang(e) {
this.onInput(`{{$t.${e}}}`), this.$refs.pop.hide();
},
onInput(e) {
this.$emit("update:modelValue", e), this.$emit("change", e);
}
},
mounted() {
}
}), w3 = { class: "_fd-language-list" }, A3 = { class: "_fd-language-header" }, C3 = { class: "_fd-language-title" }, S3 = { class: "_fd-language-name" }, E3 = ["onClick"];
function x3(e, t, i, r, n, a) {
const s = ie("el-popover"), u = ie("el-input");
return W(), ye(u, {
class: qe(["_fd-language-input", { "is-variable": e.isVar }]),
placeholder: e.placeholder,
disabled: e.disabled,
modelValue: e.modelValue,
"onUpdate:modelValue": e.onInput,
onBlur: t[1] || (t[1] = (d) => e.$emit("blur")),
size: e.size || "small"
}, ii({ _: 2 }, [
e.showLanguage !== !1 ? {
name: "append",
fn: N(() => [
G(s, {
placement: "bottom-end",
width: 300,
"hide-after": 0,
trigger: "click",
ref: "pop",
"popper-class": "_fd-language-popover"
}, {
reference: N(() => t[2] || (t[2] = [
Z("i", { class: "fc-icon icon-language" }, null, -1)
])),
default: N(() => [
Z("div", w3, [
Z("div", A3, [
Z("div", C3, [
_e(le(e.t("language.select")), 1),
Z("i", {
class: "fc-icon icon-setting",
onClick: t[0] || (t[0] = (...d) => e.openConfig && e.openConfig(...d))
})
]),
Z("div", S3, [
(W(!0), ae(Pe, null, Ge(e.localeList, (d) => (W(), ae("div", {
key: d.value
}, le(d.label), 1))), 128))
])
]),
(W(!0), ae(Pe, null, Ge(e.language, (d) => (W(), ae("div", {
key: d.key,
class: "_fd-language-item",
onClick: (h) => e.clickLang(d.key)
}, [
(W(!0), ae(Pe, null, Ge(e.localeList, (h) => (W(), ae("div", {
key: h.value
}, le(d[h.value] || "-"), 1))), 128))
], 8, E3))), 128))
])
]),
_: 1
}, 512)
]),
key: "0"
} : void 0
]), 1032, ["class", "placeholder", "disabled", "modelValue", "onUpdate:modelValue", "size"]);
}
const Gc = /* @__PURE__ */ je(_3, [["render", x3]]);
const T3 = Ve({
name: "Validate",
inject: ["designer"],
emits: ["update:modelValue"],
props: {
modelValue: Array
},
components: {
LanguageInput: Gc,
FnInput: ky,
PatternInput: Dc
},
watch: {
modelValue(e) {
this.validate = this.parseValue(e || []);
}
},
data() {
return {
validate: this.parseValue(this.modelValue || [])
};
},
computed: {
t() {
return this.designer.setupState.t;
},
modes() {
const e = this.designer.setupState.activeRule;
return e && e._menu.subForm === "object" ? {
validator: this.t("validate.modes.validator")
} : {
min: this.t("validate.modes.min"),
max: this.t("validate.modes.max"),
len: this.t("validate.modes.len"),
pattern: this.t("validate.modes.pattern"),
validator: this.t("validate.modes.validator")
};
},
triggers() {
return gt(this.t, [
{ label: "blur", value: "blur" },
{ label: "change", value: "change" },
{ label: "submit", value: "submit" }
]);
}
},
methods: {
handleCommand(e) {
this.validate.push({
transform: new Function("val", "this.type = val == null ? 'string' : (Array.isArray(val) ? 'array' : (typeof val)); return val;"),
mode: e,
trigger: "blur"
});
},
autoMessage(e) {
const t = this.designer.setupState.activeRule.title;
this.designer.setupState.activeRule && (e.message = this.t("validate.autoRequired", { title: t }), this.onInput());
},
getSpan(e) {
return ["pattern", "validator", "required"].indexOf(e.mode) > -1 ? 24 : 12;
},
onInput: function() {
this.$emit("update:modelValue", this.validate.map((e) => (e = { ...e }, e.message || delete e.message, e)));
},
remove(e) {
this.validate.splice(e, 1), this.onInput();
},
parseValue(e) {
return At(e.map((t) => (t.validator && (t.mode = "validator"), t.mode || Object.keys(t).forEach((i) => {
["message", "type", "trigger", "mode"].indexOf(i) < 0 && (t.mode = i);
}), t)));
}
}
}), k3 = { class: "_fd-validate" }, O3 = { class: "_fd-validate-item" }, R3 = { class: "_fd-validate-title" }, D3 = ["onClick"];
function $3(e, t, i, r, n, a) {
const s = ie("el-option"), u = ie("el-select"), d = ie("el-form-item"), h = ie("el-col"), p = ie("PatternInput"), g = ie("FnInput"), _ = ie("el-input-number"), S = ie("LanguageInput"), b = ie("el-row"), A = ie("el-button"), w = ie("el-dropdown-item"), m = ie("el-dropdown-menu"), y = ie("el-dropdown");
return W(), ae("div", k3, [
(W(!0), ae(Pe, null, Ge(e.validate, (E, x) => (W(), ae("div", O3, [
Z("div", R3, [
Z("div", null, [
Z("span", null, le(x + 1), 1),
_e(" " + le(e.modes[E.mode]), 1)
]),
Z("i", {
class: "fc-icon icon-delete-circle",
onClick: (k) => e.remove(x)
}, null, 8, D3)
]),
G(b, null, {
default: N(() => [
G(h, {
span: e.getSpan(E)
}, {
default: N(() => [
G(d, {
label: e.t("validate.mode")
}, {
default: N(() => [
G(u, {
modelValue: E.trigger,
"onUpdate:modelValue": (k) => E.trigger = k,
onChange: e.onInput
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.triggers, (k) => (W(), ye(s, {
key: k.value,
label: k.label,
value: k.value
}, null, 8, ["label", "value"]))), 128))
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue", "onChange"])
]),
_: 2
}, 1032, ["label"])
]),
_: 2
}, 1032, ["span"]),
G(h, {
span: e.getSpan(E)
}, {
default: N(() => [
G(d, {
label: e.modes[E.mode]
}, {
default: N(() => [
E.mode === "pattern" ? (W(), ye(p, {
key: 0,
modelValue: E[E.mode],
"onUpdate:modelValue": (k) => E[E.mode] = k,
onChange: e.onInput
}, null, 8, ["modelValue", "onUpdate:modelValue", "onChange"])) : E.mode === "validator" ? (W(), ye(g, {
key: 1,
modelValue: E[E.mode],
"onUpdate:modelValue": (k) => E[E.mode] = k,
name: "validator",
args: ["rule", "value", "callback"],
onChange: e.onInput
}, {
default: N(() => [
_e(le(e.t("validate.modes.validator")), 1)
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue", "onChange"])) : (W(), ye(_, {
key: 2,
modelValue: E[E.mode],
"onUpdate:modelValue": (k) => E[E.mode] = k,
onChange: e.onInput
}, null, 8, ["modelValue", "onUpdate:modelValue", "onChange"]))
]),
_: 2
}, 1032, ["label"])
]),
_: 2
}, 1032, ["span"]),
G(h, { span: 24 }, {
default: N(() => [
G(d, {
label: e.t("validate.message")
}, {
default: N(() => [
G(S, {
modelValue: E.message,
"onUpdate:modelValue": (k) => E.message = k,
placeholder: e.t("validate.requiredPlaceholder"),
onChange: e.onInput
}, null, 8, ["modelValue", "onUpdate:modelValue", "placeholder", "onChange"])
]),
_: 2
}, 1032, ["label"])
]),
_: 2
}, 1024)
]),
_: 2
}, 1024)
]))), 256)),
G(y, {
trigger: "click",
size: "default",
"popper-class": "_fd-validate-pop",
onCommand: e.handleCommand
}, {
dropdown: N(() => [
G(m, null, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.modes, (E, x) => (W(), ye(w, {
command: x,
key: x
}, {
default: N(() => [
Z("div", null, le(E), 1)
]),
_: 2
}, 1032, ["command"]))), 128))
]),
_: 1
})
]),
default: N(() => [
G(A, {
class: "_fd-validate-btn _fd-plain-button",
plain: "",
size: "small"
}, {
default: N(() => [
_e(le(e.t("validate.rule")) + " + ", 1)
]),
_: 1
})
]),
_: 1
}, 8, ["onCommand"])
]);
}
const I3 = /* @__PURE__ */ je(T3, [["render", $3]]);
const F3 = Ve({
name: "Required",
components: { LanguageInput: Gc },
emits: ["update:modelValue"],
props: {
modelValue: {}
},
inject: ["designer"],
watch: {
required() {
this.update();
},
requiredMsg() {
this.update();
},
modelValue(e) {
const t = St.String(e);
this.required = e === void 0 ? !1 : t ? !0 : !!e, this.requiredMsg = t ? e : "";
}
},
computed: {
t() {
return this.designer.setupState.t;
}
},
data() {
const e = St.String(this.modelValue);
return {
required: this.modelValue === void 0 ? !1 : e ? !0 : !!this.modelValue,
requiredMsg: e ? this.modelValue : ""
};
},
methods: {
update() {
let e;
this.required === !1 ? e = !1 : e = this.requiredMsg || !0, this.$emit("update:modelValue", e);
}
}
}), M3 = { class: "_fd-required" };
function P3(e, t, i, r, n, a) {
const s = ie("el-switch"), u = ie("LanguageInput");
return W(), ae("div", M3, [
G(s, {
modelValue: e.required,
"onUpdate:modelValue": t[0] || (t[0] = (d) => e.required = d)
}, null, 8, ["modelValue"]),
e.required ? (W(), ye(u, {
key: 0,
modelValue: e.requiredMsg,
"onUpdate:modelValue": t[1] || (t[1] = (d) => e.requiredMsg = d),
placeholder: e.t("validate.requiredPlaceholder")
}, null, 8, ["modelValue", "placeholder"])) : Oe("", !0)
]);
}
const L3 = /* @__PURE__ */ je(F3, [["render", P3]]);
const N3 = Ve({
name: "TreeOptions",
components: { ValueInput: nu },
emits: ["update:modelValue"],
props: {
modelValue: Array,
columns: Object,
keyValue: String
},
inject: ["designer"],
data() {
return {
value: [...At(this.modelValue || [])],
checked: !1
};
},
computed: {
t() {
return this.designer.setupState.t;
},
overColumns() {
return this.columns ? {
label: this.columns.label || "label",
value: this.columns.value || "value"
} : {
label: "label",
value: "value"
};
}
},
created() {
this.value.length || (this.value = [{}]), this.keyValue && (this.checked = this.isChecked(), this.$watch("checked", (e) => {
e && this.change();
}));
},
methods: {
isChecked() {
const e = (t) => {
for (let i = 0; i < t.length; i++) {
const r = t[i];
if (r[this.overColumns.label] !== r[this.overColumns.value] || r.children && !e(r.children))
return !1;
}
return !0;
};
return e(this.modelValue || []);
},
tidyValue() {
const e = (t) => {
let i = [];
return t.map((r) => {
const n = r[this.keyValue], a = {
[this.overColumns.label]: n,
[this.overColumns.value]: n
};
i.push(a), r.children && (a.children = e(r.children));
}), i;
};
return this.checked && this.keyValue ? e(this.value) : At(this.value);
},
change() {
this.$emit("update:modelValue", this.tidyValue());
},
add(e) {
const t = e.parent;
(t.data.children || t.data).push({});
},
append(e) {
e.children || (e.children = []), e.children.push({});
},
remove(e, t) {
const i = e.parent;
i.data.children ? (i.data.children.splice(i.data.children.indexOf(t), 1), i.data.children.length || delete i.data.children) : i.data.splice(i.data.indexOf(t), 1), this.change();
}
}
}), B3 = { class: "_fd-tree-opt" }, V3 = { class: "_fd-tree-opt-node" }, j3 = ["onClick"], U3 = ["onClick"], z3 = ["onClick"], H3 = ["onClick"], W3 = ["onClick"], G3 = ["onClick"];
function K3(e, t, i, r, n, a) {
const s = ie("el-input"), u = ie("ValueInput"), d = ie("el-tree"), h = ie("el-checkbox");
return W(), ae("div", B3, [
(W(), ye(d, {
data: e.value,
"node-key": "index",
key: e.checked ? "1" : "2",
indent: 5,
"expand-on-click-node": !1
}, {
default: N(({ node: p, data: g }) => [
Z("div", V3, [
e.checked ? (W(), ye(s, {
key: 1,
class: "_fd-tree-opt-last _label",
modelValue: g[e.keyValue],
"onUpdate:modelValue": (_) => g[e.keyValue] = _,
onBlur: e.change
}, {
append: N(() => [
Z("div", {
class: "_fd-tree-opt-btn",
onClick: (_) => e.add(p, g)
}, t[4] || (t[4] = [
Z("i", { class: "fc-icon icon-add" }, null, -1)
]), 8, H3),
Z("div", {
class: "_fd-tree-opt-btn",
onClick: (_) => e.append(g)
}, t[5] || (t[5] = [
Z("i", { class: "fc-icon icon-add-child" }, null, -1)
]), 8, W3),
Z("div", {
class: "_fd-tree-opt-btn _fd-tree-opt-danger",
onClick: (_) => e.remove(p, g)
}, t[6] || (t[6] = [
Z("i", { class: "fc-icon icon-delete" }, null, -1)
]), 8, G3)
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue", "onBlur"])) : (W(), ae(Pe, { key: 0 }, [
G(s, {
class: "_fd-tree-opt-first",
modelValue: g[e.overColumns.label],
"onUpdate:modelValue": (_) => g[e.overColumns.label] = _,
onBlur: e.change
}, null, 8, ["modelValue", "onUpdate:modelValue", "onBlur"]),
G(u, {
class: "_fd-tree-opt-last",
modelValue: g[e.overColumns.value],
"onUpdate:modelValue": (_) => g[e.overColumns.value] = _,
onBlur: e.change,
onChangeType: e.change
}, {
append: N(() => [
Z("div", {
class: "_fd-tree-opt-btn",
onClick: (_) => e.add(p, g)
}, t[1] || (t[1] = [
Z("i", { class: "fc-icon icon-add" }, null, -1)
]), 8, j3),
Z("div", {
class: "_fd-tree-opt-btn",
onClick: (_) => e.append(g)
}, t[2] || (t[2] = [
Z("i", { class: "fc-icon icon-add-child" }, null, -1)
]), 8, U3),
Z("div", {
class: "_fd-tree-opt-btn _fd-tree-opt-danger",
onClick: (_) => e.remove(p, g)
}, t[3] || (t[3] = [
Z("i", { class: "fc-icon icon-delete" }, null, -1)
]), 8, z3)
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue", "onBlur", "onChangeType"])
], 64))
])
]),
_: 1
}, 8, ["data"])),
e.keyValue ? (W(), ye(h, {
key: 0,
modelValue: e.checked,
"onUpdate:modelValue": t[0] || (t[0] = (p) => e.checked = p),
label: e.t("tableOptions.keyValue")
}, null, 8, ["modelValue", "label"])) : Oe("", !0)
]);
}
const Y3 = /* @__PURE__ */ je(N3, [["render", K3]]);
const Dy = (e) => {
const t = [];
return e.forEach((i) => {
i.field && t.push(i.field), i.children && t.push(...Dy(i.children));
}), t;
}, Q3 = Ve({
name: "StepForm",
props: {
stepsProps: Object,
modelValue: Object,
formCreateInject: Object,
autoValidate: Boolean,
submitBtn: Boolean,
steps: {
type: Array,
required: !0,
default: () => []
},
options: {
type: Object,
default: () => Vi({
submitBtn: !1,
resetBtn: !1
})
}
},
emits: ["update:modelValue", "change", "itemMounted", "submit", "next"],
data() {
return {
active: 0,
cacheRule: [],
cacheValue: {},
subApi: {},
Form: Xt(this.formCreateInject.form.$form())
};
},
watch: {
active() {
this.init();
},
modelValue(e) {
this.setValue(e);
}
},
methods: {
init() {
this.steps.forEach((e, t) => {
this.cacheRule[t] ? this.cacheRule[t].display = t === this.active : this.cacheRule[t] = {
type: "FcRow",
native: !0,
display: t === this.active,
children: e.rule
};
});
},
onPrev() {
this.active--;
},
validate() {
return new Promise((e, t) => {
const i = Dy(this.cacheRule[this.active].children);
i.length > 0 ? Promise.all(i.map((r) => this.subApi.validateField(r))).then(() => {
e();
}).catch((r) => {
t(r);
}) : e();
});
},
onNext() {
this.autoValidate ? this.validate().then(() => {
this.active++;
}).catch((e) => {
}) : this.active++, this.$emit("next", { active: this.active, api: this.subApi });
},
submit() {
const e = () => {
this.$emit("submit", this.subApi.formData(), this.subApi);
};
this.autoValidate ? this.validate().then(() => {
e();
}).catch((t) => {
this.$emit("validateFail", this.subApi);
}) : e();
},
addSubApi(e) {
this.subApi = e, this.$emit("itemMounted", e);
},
formData(e) {
this.cacheValue = JSON.stringify(e), this.$emit("update:modelValue", e), this.$emit("change", e);
},
setValue(e) {
const t = JSON.stringify(e);
this.cacheValue !== t && (this.cacheValue = t, this.subApi.coverValue(e || {}));
}
},
created() {
this.init();
}
}), J3 = { class: "_fc-step-form" };
function X3(e, t, i, r, n, a) {
const s = ie("el-step"), u = ie("el-steps"), d = ie("el-button"), h = ie("el-col"), p = ie("el-row");
return W(), ae("div", J3, [
G(u, dn({ active: e.active }, e.stepsProps), {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.steps, (g) => (W(), ye(s, dn({ ref_for: !0 }, g.props), null, 16))), 256))
]),
_: 1
}, 16, ["active"]),
(W(), ye(Yr(e.Form), {
option: e.options,
rule: e.cacheRule,
extendOption: !0,
modelValue: e.modelValue,
"onUpdate:api": e.addSubApi,
onEmitEvent: e.$emit,
"onUpdate:modelValue": e.formData
}, null, 40, ["option", "rule", "modelValue", "onUpdate:api", "onEmitEvent", "onUpdate:modelValue"])),
G(p, null, {
default: N(() => [
G(h, {
span: 24,
style: { display: "flex", "justify-content": "flex-end", "margin-top": "15px" }
}, {
default: N(() => [
e.active > 0 ? (W(), ye(d, {
key: 0,
onClick: e.onPrev
}, {
default: N(() => [
_e(le(e.formCreateInject.t("prevStep") || "\u4E0A\u4E00\u6B65"), 1)
]),
_: 1
}, 8, ["onClick"])) : Oe("", !0),
e.active < e.cacheRule.length - 1 ? (W(), ye(d, {
key: 1,
type: "primary",
onClick: e.onNext
}, {
default: N(() => [
_e(le(e.formCreateInject.t("nextStep") || "\u4E0B\u4E00\u6B65"), 1)
]),
_: 1
}, 8, ["onClick"])) : Oe("", !0),
e.submitBtn !== !1 && e.active === e.cacheRule.length - 1 ? (W(), ye(d, {
key: 2,
class: "fc-clock",
type: "primary",
onClick: e.submit
}, {
default: N(() => [
_e(le(e.formCreateInject.t("submit") || "\u63D0\u4EA4"), 1)
]),
_: 1
}, 8, ["onClick"])) : Oe("", !0)
]),
_: 1
})
]),
_: 1
})
]);
}
const Z3 = /* @__PURE__ */ je(Q3, [["render", X3]]);
const q3 = Ve({
name: "StepFormView",
props: {
stepsProps: Object,
formCreateInject: Object
},
provide() {
return {
stepForm: this
};
},
inject: ["designer"],
data() {
return {
active: void 0,
activeId: void 0,
stepItemRef: [],
activeRef: void 0
};
},
watch: {
"stepItemRef.length"() {
(!this.active || this.formCreateInject.children.indexOf(this.activeRef) === -1) && (this.active = this.formCreateInject.children.length > 0 ? 0 : -1);
},
active(e) {
this.activeRef = this.formCreateInject.children[e], this.activeId = this.activeRef ? this.activeRef._fc_id : null;
}
},
methods: {
onPrev() {
this.active--, this.triggerActive();
},
onNext() {
this.active++, this.triggerActive();
},
change(e) {
this.active = e, this.triggerActive();
},
triggerActive() {
this.$nextTick(() => {
this.designer.setupState.triggerActive(this.activeRef);
});
}
},
created() {
this.$watch(() => [...this.formCreateInject.children], () => {
this.activeRef && (this.active = this.formCreateInject.children.indexOf(this.activeRef));
});
}
}), eM = { class: "_fd-step-form" };
function tM(e, t, i, r, n, a) {
const s = ie("el-step"), u = ie("el-steps"), d = ie("el-button"), h = ie("el-col"), p = ie("el-row");
return W(), ae("div", eM, [
G(u, dn({ active: e.active }, e.stepsProps), {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.formCreateInject.children, (g, _) => (W(), ye(s, {
key: g._fc_id + _,
onClick: vt((S) => e.change(_), ["stop"]),
title: g.props.title,
description: g.props.description
}, null, 8, ["onClick", "title", "description"]))), 128))
]),
_: 1
}, 16, ["active"]),
kt(e.$slots, "default"),
G(p, null, {
default: N(() => [
G(h, {
span: 24,
style: { display: "flex", "justify-content": "flex-end", padding: "15px" }
}, {
default: N(() => [
e.active > 0 ? (W(), ye(d, {
key: 0,
onClick: vt(e.onPrev, ["stop"])
}, {
default: N(() => [
_e(le(e.formCreateInject.t("prevStep") || "\u4E0A\u4E00\u6B65"), 1)
]),
_: 1
}, 8, ["onClick"])) : Oe("", !0),
e.active < e.stepItemRef.length - 1 ? (W(), ye(d, {
key: 1,
type: "primary",
onClick: vt(e.onNext, ["stop"])
}, {
default: N(() => [
_e(le(e.formCreateInject.t("nextStep") || "\u4E0B\u4E00\u6B65"), 1)
]),
_: 1
}, 8, ["onClick"])) : Oe("", !0)
]),
_: 1
})
]),
_: 1
})
]);
}
const nM = /* @__PURE__ */ je(q3, [["render", tM]]);
const iM = Ve({
name: "TableFormView",
data() {
return {};
}
}), rM = { class: "_fd-table-form" }, oM = {
key: 0,
class: "_fd-tf-wrap"
}, aM = {
key: 1,
class: "_fc-child-empty"
};
function lM(e, t, i, r, n, a) {
return W(), ae("div", rM, [
e.$slots.default ? (W(), ae("div", oM, [
kt(e.$slots, "default")
])) : (W(), ae("div", aM))
]);
}
const $y = /* @__PURE__ */ je(iM, [["render", lM]]);
const sM = Ve({
name: "NestedTableFormView",
inject: ["designer"],
data() {
return {};
},
computed: {
t() {
return this.designer.setupState.t;
}
}
}), uM = { class: "_fd-ntable-form" }, dM = {
key: 0,
class: "_fd-ntf-wrap"
}, fM = {
key: 1,
class: "_fc-child-empty"
}, cM = {
key: 2,
class: "_fd-ntable-sub"
}, pM = { class: "_title" };
function hM(e, t, i, r, n, a) {
return W(), ae("div", uM, [
e.$slots.default ? (W(), ae("div", dM, [
kt(e.$slots, "default")
])) : (W(), ae("div", fM)),
e.$slots.default ? (W(), ae("div", cM, [
Z("div", pM, le(e.t("com.nestedSubTableForm.name")), 1),
kt(e.$slots, "nested")
])) : Oe("", !0)
]);
}
const mM = /* @__PURE__ */ je(sM, [["render", hM]]);
const vM = {
name: "NestedTableForm",
emits: ["change", "add", "delete", "update:modelValue"],
props: {
formCreateInject: Object,
modelValue: {
type: Array,
default: () => []
},
nested: Array,
nestedField: String,
columns: {
type: Array,
required: !0,
default: () => []
},
options: {
type: Object,
default: () => Vi({
submitBtn: !1,
resetBtn: !1
})
},
max: Number,
nestedMax: Number,
disabled: Boolean
},
computed: {
preview() {
return this.formCreateInject.preview;
}
},
watch: {
modelValue() {
this.updateTable();
},
"formCreateInject.preview"(e) {
this.trs.forEach((t) => {
const i = t.children[1].children[0].props.colspan;
t.children[1].children[0].props.colspan = e ? i - 1 : i + 1;
});
}
},
data() {
return {
rule: [],
trs: [],
fapi: {},
Form: Xt(this.formCreateInject.form.$form()),
copyTrs: "",
oldValue: ""
};
},
methods: {
formChange(e, t, i, r, n) {
n === !1 && this.updateValue();
},
updateValue() {
const e = this.trs.map((i, r) => ({
...this.modelValue[r] || {},
...this.fapi.getChildrenFormData(i)
})).filter((i) => {
if (i == null)
return !1;
let r = !1;
return Object.keys(i).forEach((n) => {
r || (r = r || i[n] !== void 0 && i[n] !== "" && i[n] !== null && (Array.isArray(i[n]) ? !!i[n].length : !0));
}), r;
}), t = JSON.stringify(e);
t !== this.oldValue && (this.oldValue = t, this.$emit("update:modelValue", e), this.$emit("change", e));
},
setRawData(e, t) {
const i = this.trs[e];
this.fapi.setChildrenFormData(i, t, !0);
},
updateTable() {
const e = JSON.stringify(this.modelValue);
this.oldValue !== e && (this.oldValue = e, this.trs = this.trs.splice(0, this.modelValue.length), this.modelValue.length || this.addRaw(), this.modelValue.forEach((t, i) => {
this.trs[i] || this.addRaw(), this.setRawData(i, t || {});
}), this.rule[0].children[1].children = this.trs);
},
delRaw(e) {
this.disabled || (this.trs.splice(e, 1), this.updateValue(), this.trs.length ? this.trs.forEach((t) => this.updateRaw(t)) : this.addRaw(), this.$emit("delete", e));
},
addRaw(e) {
if (e && this.disabled)
return;
const t = this.formCreateInject.form.parseJson(this.copyTrs)[0], i = {
type: "template",
subRule: !0,
children: []
};
i.children.push(t), i.children.push({
type: "tr",
native: !0,
display: !1,
children: [{
type: "td",
native: !0,
props: {
colspan: t.children.length - (this.preview ? 1 : 0)
},
class: "_fc-ntf-sub",
children: [{
type: "TableForm",
field: this.nestedField,
value: [],
props: {
disabled: this.disabled,
max: this.nestedMax || 0,
columns: At(this.nested),
options: At(this.options)
}
}]
}]
}), this.trs.push(i), this.updateRaw(i), e && this.$emit("add", this.trs);
},
updateRaw(e) {
const t = this.trs.indexOf(e), i = e.children[0];
i.children[0].children[0].props.onClick = (r) => {
const n = r.self.children[0] === "-" ? "+" : "-";
r.self.children = [n], this.trs[t].children[1].display = n === "-";
}, i.children[1].props.innerText = t + 1, i.children[i.children.length - 1].children[0].props.onClick = () => {
this.delRaw(t);
};
},
loadRule() {
const e = [{
type: "th",
native: !0,
class: "_fc-ntf-sub-idx"
}, {
type: "th",
native: !0,
class: "_fc-ntf-head-idx",
props: {
innerText: "#"
}
}];
let t = [{
type: "td",
class: "_fc-ntf-idx",
native: !0,
children: [
{
type: "div",
hidden: !1,
children: ["+"],
inject: !0,
props: {}
}
]
}, {
type: "td",
class: "_fc-ntf-idx",
native: !0,
props: {
innerText: "0"
}
}];
this.columns.forEach((i) => {
e.push({
type: "th",
native: !0,
class: i.required ? "_fc-ntf-head-required" : "",
style: i.style,
props: {
innerText: i.label || ""
}
}), t.push({
type: "td",
native: !0,
children: [...i.rule || []]
});
}), e.push({
type: "th",
native: !0,
class: "_fc-ntf-edit fc-clock",
props: {
innerText: this.formCreateInject.t("operation") || "\u64CD\u4F5C"
}
}), t.push({
type: "td",
native: !0,
class: "_fc-ntf-btn fc-clock",
children: [
{
type: "i",
native: !0,
class: "fc-icon icon-delete",
props: {}
}
]
}), this.copyTrs = this.formCreateInject.form.toJson([
{
type: "tr",
native: !0,
children: t
}
]), this.rule = [
{
type: "table",
native: !0,
class: "_fc-ntf-table",
props: {
border: "1",
cellspacing: "0",
cellpadding: "0"
},
children: [
{
type: "thead",
native: !0,
children: [
{
type: "tr",
native: !0,
children: e
}
]
},
{
type: "tbody",
native: !0,
children: this.trs
}
]
}
];
}
},
created() {
this.loadRule();
},
mounted() {
this.updateTable();
}
};
function gM(e, t, i, r, n, a) {
const s = ie("el-button");
return W(), ae("div", {
class: qe(["_fc-nested-table-form", { "_fc-disabled": i.disabled }])
}, [
(W(), ye(Yr(n.Form), {
option: i.options,
rule: n.rule,
extendOption: !0,
onChange: a.formChange,
disabled: i.disabled,
api: n.fapi,
"onUpdate:api": t[0] || (t[0] = (u) => n.fapi = u),
onEmitEvent: e.$emit
}, null, 40, ["option", "rule", "onChange", "disabled", "api", "onEmitEvent"])),
!i.max || i.max > this.trs.length ? (W(), ye(s, {
key: 0,
link: "",
type: "primary",
class: "fc-clock",
onClick: t[1] || (t[1] = (u) => a.addRaw(!0))
}, {
default: N(() => [
t[2] || (t[2] = Z("i", {
class: "fc-icon icon-add-circle",
style: { "font-weight": "700" }
}, null, -1)),
_e(" " + le(i.formCreateInject.t("add") || "\u6DFB\u52A0"), 1)
]),
_: 1
})) : Oe("", !0)
], 2);
}
const yM = /* @__PURE__ */ je(vM, [["render", gM]]);
const bM = Ve({
name: "InfiniteTableFormView",
inject: ["designer"],
data() {
return {};
},
computed: {
t() {
return this.designer.setupState.t;
}
}
}), _M = { class: "_fd-itable-form" }, wM = {
key: 0,
class: "_fd-itf-wrap"
}, AM = {
key: 1,
class: "_fc-child-empty"
};
function CM(e, t, i, r, n, a) {
return W(), ae("div", _M, [
e.$slots.default ? (W(), ae("div", wM, [
kt(e.$slots, "default")
])) : (W(), ae("div", AM))
]);
}
const SM = /* @__PURE__ */ je(bM, [["render", CM]]);
const EM = {
name: "InfiniteTableForm",
emits: ["change", "add", "delete", "update:modelValue"],
props: {
formCreateInject: Object,
modelValue: {
type: Array,
default: () => []
},
columns: {
type: Array,
required: !0,
default: () => []
},
options: {
type: Object,
default: () => Vi({
submitBtn: !1,
resetBtn: !1
})
},
max: Number,
layerMax: {
type: Number,
default: 0
},
childrenField: String,
disabled: Boolean
},
computed: {
preview() {
return this.formCreateInject.preview;
},
subField() {
return this.childrenField || "children";
}
},
watch: {
modelValue() {
this.updateTable();
},
"formCreateInject.preview"(e) {
this.trs.forEach((t, i) => {
t.children[1] && (t.children[1].children[0].props.colspan = this.rule[0].children[0].children[0].children.length - (e ? 1 : 0)), t.children[0].children[0].children[0].hidden = this.layerMax === 1 || e && !(this.modelValue && this.modelValue[i] && Array.isArray(this.modelValue[i][this.subField]) && this.modelValue[i][this.subField].length > 0);
});
}
},
data() {
return {
rule: [],
trs: [],
fapi: {},
Form: Xt(this.formCreateInject.form.$form()),
copyTrs: "",
oldValue: ""
};
},
methods: {
formChange(e, t, i, r, n) {
n === !1 && this.updateValue();
},
updateValue() {
const e = this.trs.map((i, r) => {
const n = {
...this.modelValue[r] || {},
...this.fapi.getChildrenFormData(i)
};
return !Li(n, this.subField) && this.modelValue[r] && (n[this.subField] = this.modelValue[r][this.subField]), n[this.subField] == null && delete n[this.subField], n;
}), t = JSON.stringify(e);
t !== this.oldValue && (this.oldValue = t, this.$emit("update:modelValue", e), this.$emit("change", e));
},
setRawData(e, t) {
const i = this.trs[e];
this.fapi.setChildrenFormData(i, t, !0);
},
updateTable() {
const e = JSON.stringify(this.modelValue);
this.oldValue !== e && (this.oldValue = e, this.trs = this.trs.splice(0, this.modelValue.length), this.modelValue.length || this.addRaw(), this.modelValue.forEach((t, i) => {
this.trs[i] || this.addRaw(), this.setRawData(i, t || {});
}), this.rule[0].children[1].children = this.trs);
},
delRaw(e) {
this.disabled || (this.trs.splice(e, 1), this.updateValue(), this.trs.length ? this.trs.forEach((t) => this.updateRaw(t)) : this.addRaw(), this.$emit("delete", e));
},
addRaw(e) {
if (e && this.disabled)
return;
const t = this.formCreateInject.form.parseJson(this.copyTrs)[0], i = {
type: "template",
subRule: !0,
children: []
};
i.children.push(t), this.trs.push(i), this.trs.forEach((r) => this.updateRaw(r)), e && this.$emit("add", this.trs);
},
updateRaw(e) {
const t = this.trs.indexOf(e), i = e.children[0];
i.children[0].children[0].hidden = this.layerMax === 1 || this.preview && !(this.modelValue && this.modelValue[t] && Array.isArray(this.modelValue[t][this.subField]) && this.modelValue[t][this.subField].length > 0), i.children[0].children[0].props.onClick = (r) => {
if (this.trs[t].children.length === 1) {
if (this.disabled && !(this.modelValue && this.modelValue[t] && Array.isArray(this.modelValue[t][this.subField]) && this.modelValue[t][this.subField].length > 0))
return;
this.trs[t].children.push({
type: "tr",
native: !0,
display: !0,
children: [{
type: "td",
native: !0,
props: {
colspan: this.rule[0].children[0].children[0].children.length - (this.preview ? 1 : 0)
},
class: "_fc-itf-sub",
children: [{
type: "infiniteTableForm",
field: this.subField,
value: [...this.modelValue[t] && this.modelValue[t][this.subField] || []],
props: {
disabled: this.disabled,
layerMax: this.layerMax === 0 ? 0 : this.layerMax > 1 ? this.layerMax - 1 : 1,
max: this.max || 0,
columns: At(this.columns),
options: At(this.options)
}
}]
}]
});
}
const n = r.self.children[0] === "-" ? "+" : "-";
r.self.children = [n], this.trs[t].children[1].display = n === "-";
}, i.children[1].props.innerText = t + 1, i.children[i.children.length - 1].children[0].props.onClick = () => {
this.delRaw(t);
};
},
loadRule() {
const e = [{
type: "th",
native: !0,
class: "_fc-itf-sub-idx"
}, {
type: "th",
native: !0,
class: "_fc-itf-head-idx",
props: {
innerText: "#"
}
}];
let t = [{
type: "td",
class: "_fc-itf-idx",
native: !0,
children: [
{
type: "div",
hidden: !1,
children: ["+"],
inject: !0,
props: {}
}
]
}, {
type: "td",
class: "_fc-itf-idx",
native: !0,
props: {
innerText: "0"
}
}];
this.columns.forEach((i) => {
e.push({
type: "th",
native: !0,
class: i.required ? "_fc-itf-head-required" : "",
style: i.style,
props: {
innerText: i.label || ""
}
}), t.push({
type: "td",
native: !0,
children: [...i.rule || []]
});
}), e.push({
type: "th",
native: !0,
class: "_fc-itf-edit fc-clock",
props: {
innerText: this.formCreateInject.t("operation") || "\u64CD\u4F5C"
}
}), t.push({
type: "td",
native: !0,
class: "_fc-itf-btn fc-clock",
children: [
{
type: "i",
native: !0,
class: "fc-icon icon-delete",
props: {}
}
]
}), this.copyTrs = this.formCreateInject.form.toJson([
{
type: "tr",
native: !0,
children: t
}
]), this.rule = [
{
type: "table",
native: !0,
class: "_fc-itf-table",
props: {
border: "1",
cellspacing: "0",
cellpadding: "0"
},
children: [
{
type: "thead",
native: !0,
children: [
{
type: "tr",
native: !0,
children: e
}
]
},
{
type: "tbody",
native: !0,
children: this.trs
}
]
}
];
}
},
created() {
this.loadRule();
},
mounted() {
this.updateTable();
}
};
function xM(e, t, i, r, n, a) {
const s = ie("el-button");
return W(), ae("div", {
class: qe(["_fc-infinite-table-form", { "_fc-disabled": i.disabled }])
}, [
(W(), ye(Yr(n.Form), {
option: i.options,
rule: n.rule,
extendOption: !0,
onChange: a.formChange,
disabled: i.disabled,
api: n.fapi,
"onUpdate:api": t[0] || (t[0] = (u) => n.fapi = u),
onEmitEvent: e.$emit
}, null, 40, ["option", "rule", "onChange", "disabled", "api", "onEmitEvent"])),
!i.max || i.max > this.trs.length ? (W(), ye(s, {
key: 0,
link: "",
type: "primary",
class: "fc-clock",
onClick: t[1] || (t[1] = (u) => a.addRaw(!0))
}, {
default: N(() => [
t[2] || (t[2] = Z("i", {
class: "fc-icon icon-add-circle",
style: { "font-weight": "700" }
}, null, -1)),
_e(" " + le(i.formCreateInject.t("add") || "\u6DFB\u52A0"), 1)
]),
_: 1
})) : Oe("", !0)
], 2);
}
const TM = /* @__PURE__ */ je(EM, [["render", xM]]);
const kM = {
name: "TableForm",
emits: ["change", "add", "delete", "update:modelValue"],
props: {
formCreateInject: Object,
modelValue: {
type: Array,
default: () => []
},
columns: {
type: Array,
required: !0,
default: () => []
},
filterEmptyColumn: {
type: Boolean,
default: !0
},
deletable: {
type: Boolean,
default: !0
},
addable: {
type: Boolean,
default: !0
},
options: {
type: Object,
default: () => Vi({
submitBtn: !1,
resetBtn: !1
})
},
max: Number,
min: Number,
disabled: Boolean
},
watch: {
modelValue: {
handler() {
this.updateTable();
},
deep: !0
},
"formCreateInject.preview": function(e) {
this.emptyRule.children[0].props.colspan = this.columns.length + (e ? 1 : 2);
}
},
data() {
return {
rule: [],
trs: [],
fapi: {},
Form: Xt(this.formCreateInject.form.$form()),
copyTrs: "",
oldValue: "",
emptyRule: {
type: "tr",
_isEmpty: !0,
native: !0,
subRule: !0,
children: [
{
type: "td",
style: {
textAlign: "center"
},
native: !0,
subRule: !0,
props: {
colspan: this.columns.length + (this.formCreateInject.preview ? 1 : 2)
},
children: [this.formCreateInject.t("dataEmpty") || "\u6682\u65E0\u6570\u636E"]
}
]
}
};
},
methods: {
formChange() {
this.updateValue();
},
updateValue() {
const e = this.trs.map((i, r) => ({
...this.modelValue[r] || {},
...this.fapi.getChildrenFormData(i)
})).filter((i) => {
if (!this.filterEmptyColumn)
return !0;
if (i == null)
return !1;
let r = !1;
return Object.keys(i).forEach((n) => {
r = r || i[n] !== void 0 && i[n] !== "" && i[n] !== null;
}), r;
}), t = JSON.stringify(e);
t !== this.oldValue && (this.oldValue = t, this.$emit("update:modelValue", e), this.$emit("change", e));
},
setRawData(e, t) {
const i = this.trs[e];
this.fapi.setChildrenFormData(i, t, !0);
},
updateTable() {
const e = JSON.stringify(this.modelValue);
this.oldValue !== e && (this.oldValue = e, this.trs = this.trs.splice(0, this.modelValue.length), this.modelValue.length ? this.clearEmpty() : this.addEmpty(), this.modelValue.forEach((t, i) => {
this.trs[i] || this.addRaw(), this.setRawData(i, t || {});
}), this.rule[0].children[1].children = this.trs);
},
addEmpty() {
this.trs.length && this.trs.splice(0, this.trs.length), this.trs.push(this.emptyRule);
},
clearEmpty() {
this.trs[0] && this.trs[0]._isEmpty && this.trs.splice(0, 1);
},
delRaw(e) {
this.disabled || !this.deletable || this.min > 0 && this.trs.length <= this.min || (this.trs.splice(e, 1), this.updateValue(), this.trs.length ? this.trs.forEach((t) => this.updateRaw(t)) : this.addEmpty(), this.$emit("delete", e));
},
addRaw(e) {
if (e && this.disabled)
return;
const t = this.formCreateInject.form.parseJson(this.copyTrs)[0];
this.trs.length === 1 && this.trs[0]._isEmpty && this.trs.splice(0, 1), this.trs.push(t), this.updateRaw(t), e && (this.$emit("add", this.trs.length), this.updateValue());
},
updateRaw(e) {
const t = this.trs.indexOf(e);
e.children[0].props.innerText = t + 1, e.children[e.children.length - 1].children[0].props.onClick = () => {
this.delRaw(t);
};
},
loadRule() {
const e = [{
type: "th",
native: !0,
class: "_fc-tf-head-idx",
props: {
innerText: "#"
}
}];
let t = [{
type: "td",
class: "_fc-tf-idx",
native: !0,
props: {
innerText: "0"
}
}];
this.columns.forEach((i) => {
e.push({
type: "th",
native: !0,
style: i.style,
class: i.required ? "_fc-tf-head-required" : "",
props: {
innerText: i.label || ""
}
}), t.push({
type: "td",
native: !0,
children: [...i.rule || []]
});
}), e.push({
type: "th",
native: !0,
class: "_fc-tf-edit fc-clock",
props: {
innerText: this.formCreateInject.t("operation") || "\u64CD\u4F5C"
}
}), t.push({
type: "td",
native: !0,
class: "_fc-tf-btn fc-clock",
children: [
{
type: "i",
native: !0,
class: "fc-icon icon-delete",
props: {}
}
]
}), this.copyTrs = this.formCreateInject.form.toJson([
{
type: "tr",
native: !0,
subRule: !0,
children: t
}
]), this.rule = [
{
type: "table",
native: !0,
class: "_fc-tf-table",
props: {
border: "1",
cellspacing: "0",
cellpadding: "0"
},
children: [
{
type: "thead",
native: !0,
children: [
{
type: "tr",
native: !0,
children: e
}
]
},
{
type: "tbody",
native: !0,
children: this.trs
}
]
}
];
}
},
created() {
this.loadRule();
},
mounted() {
this.updateTable();
}
};
function OM(e, t, i, r, n, a) {
const s = ie("el-button");
return W(), ae("div", {
class: qe(["_fc-table-form", { "_fc-disabled": i.disabled }])
}, [
(W(), ye(Yr(n.Form), {
option: i.options,
rule: n.rule,
extendOption: !0,
disabled: i.disabled,
onChange: a.formChange,
api: n.fapi,
"onUpdate:api": t[0] || (t[0] = (u) => n.fapi = u),
onEmitEvent: e.$emit
}, null, 40, ["option", "rule", "disabled", "onChange", "api", "onEmitEvent"])),
i.addable && (!i.max || i.max > this.trs.length) ? (W(), ye(s, {
key: 0,
link: "",
type: "primary",
class: "fc-clock",
onClick: t[1] || (t[1] = (u) => a.addRaw(!0))
}, {
default: N(() => [
t[2] || (t[2] = Z("i", {
class: "fc-icon icon-add-circle",
style: { "font-weight": "700" }
}, null, -1)),
_e(" " + le(i.formCreateInject.t("add") || "\u6DFB\u52A0"), 1)
]),
_: 1
})) : Oe("", !0)
], 2);
}
const RM = /* @__PURE__ */ je(kM, [["render", OM]]);
const DM = {
name: "TableFormPro",
emits: ["change", "add", "delete", "update:modelValue", "handleClick"],
props: {
formCreateInject: Object,
height: [String, Number],
modelValue: {
type: Array,
default: () => []
},
columns: {
type: Array,
required: !0,
default: () => []
},
button: Object,
page: Object,
size: String,
filterEmptyColumn: {
type: Boolean,
default: !0
},
newColumn: Boolean,
deletable: {
type: Boolean,
default: !0
},
addable: {
type: Boolean,
default: !0
},
options: {
type: Object,
default: () => Vi({
submitBtn: !1,
resetBtn: !1
})
},
showIndex: Boolean,
max: Number,
min: Number,
disabled: Boolean
},
watch: {
modelValue: {
handler() {
const e = JSON.stringify(this.modelValue || []);
this.oldValue !== e && (this.chunk = [[]], this.nowPage = 1, this.updateTable(), this.oldValue = e);
}
}
},
computed: {
total() {
return this.chunk.reduce((e, t) => (e += t.length, e), 0);
},
limit() {
return !this.page || this.page.open !== !0 ? 1e6 : this.page.props && this.page.props.pageSize || 20;
},
pageData() {
return this.chunk[this.nowPage - 1];
}
},
data() {
return {
chunk: [[]],
data: [],
rule: [],
trs: [],
fapi: {},
Form: Xt(this.formCreateInject.form.$form()),
copyTrs: "",
oldValue: "",
nowPage: 1,
indexRule: {
type: "el-table-column",
props: {
label: "#",
type: "index",
fixed: "left"
}
}
};
},
methods: {
paginateArray() {
const e = this.modelValue || [], t = this.limit, i = [];
for (let r = 0; r < e.length; r += t) {
const n = e.slice(r, r + t);
i.push(n);
}
i.length && i.forEach((r, n) => {
this.chunk[n] = [...this.chunk[n] || [], ...r];
}), this.nowPage > this.chunk.length && (this.nowPage = this.chunk.length);
},
formChange() {
this.updateValue();
},
updateValue() {
this.trs.forEach((i, r) => {
tu(this.pageData[r], this.fapi.getChildrenFormData(i));
});
const e = At(this.chunk.reduce((i, r) => [...i, ...r], []).filter((i) => {
if (!this.filterEmptyColumn)
return !0;
if (i == null)
return !1;
let r = !1;
return Object.keys(i).forEach((n) => {
r = r || i[n] !== void 0 && i[n] !== "" && i[n] !== null;
}), r;
})), t = JSON.stringify(e);
t !== this.oldValue && (this.oldValue = t, this.$emit("update:modelValue", e), this.$emit("change", e));
},
setRawData(e, t) {
const i = this.trs[e];
this.fapi.setChildrenFormData(i, t, !0);
},
changePage(e) {
e !== this.nowPage && (this.chunk[this.nowPage - 1] = this.pageData, this.nowPage = e, this.rule[1].props.data = this.pageData, this.trs.splice(0, this.trs.length), this.pageData.forEach((t, i) => {
this.trs[i] || this.addRaw(), this.setRawData(i, t || {});
}), this.rule[0].children = this.trs);
},
updateTable() {
this.paginateArray(), this.rule[1].props.data = this.pageData, this.trs.splice(0, this.trs.length), this.pageData.forEach((e, t) => {
this.trs[t] || this.addRaw(), this.setRawData(t, e || {});
}), this.rule[0].children = this.trs;
},
delRaw(e) {
this.disabled || this.deletable === !1 || this.min > 0 && this.total <= this.min || (this.trs.splice(e, 1), this.rule[1].props.data.splice(e, 1), this.updateValue(), this.$emit("delete", e), this.oldValue = "");
},
addRaw(e) {
if (!(e && (this.disabled || this.addable === !1))) {
if (!e) {
const t = this.formCreateInject.form.parseJson(this.copy);
this.trs.push(t);
return;
}
if (this.chunk[this.chunk.length - 1].length >= this.limit)
this.chunk.push([{}]);
else if (e && this.chunk[this.chunk.length - 1].push({}), e && this.nowPage === this.chunk.length) {
const t = this.formCreateInject.form.parseJson(this.copy);
this.trs.push(t);
}
e && (this.$emit("add", this.total), this.updateValue());
}
},
btnProps(e, t) {
const i = { ...t };
i.row = this.modelValue[t.$index] || {};
const r = e.prop || [], n = {
type: e.type,
size: e.size,
round: r.indexOf("round") > -1,
link: r.indexOf("link") > -1,
plain: r.indexOf("plain") > -1,
disabled: r.indexOf("disabled") > -1 || this.disabled || e.key === "delete" && this.deletable === !1,
onClick: (a) => {
if (i.row = this.modelValue[t.$index] || {}, a.stopPropagation(), e.key === "delete") {
this.delRaw(t.$index);
return;
}
const s = jo(e.click);
try {
s && s(i, this.formCreateInject.api);
} catch (u) {
console.error(u);
}
this.$emit("handleClick", { name: e.name, key: e.key, _scope: i, column: i.row });
}
};
try {
if (!this.disabled) {
const a = jo(e.handle), s = a && a(n, i, this.formCreateInject.api);
typeof s == "boolean" && (n.disabled = s);
}
} catch (a) {
console.error(a);
}
return n;
},
processRule(e) {
let t = [];
return e.forEach((i) => {
i.children ? t.push(...this.processRule(i.children)) : (i._renderId = rt(), t.push({
type: "template",
name: i._renderId,
children: [...i.rule || []]
}));
}), t;
},
processColumns(e) {
return e.map((t, i) => {
var n;
const r = {
type: "el-table-column",
hidden: t.hidden === !0,
props: {
fixed: t.fixed || !1,
width: ((n = t == null ? void 0 : t.style) == null ? void 0 : n.width) || "auto",
minWidth: 120
},
renderSlots: {
header() {
var a;
return tn("span", {
class: t.required ? "is-required" : "",
style: { color: (a = t == null ? void 0 : t.style) == null ? void 0 : a.color }
}, t.label);
}
}
};
return t.children ? r.children = this.processColumns(t.children) : r.renderSlots.default = ({ $index: a }) => {
var s, u, d, h, p, g, _, S;
for (let b = 0; b < ((u = (s = this.rule[0]) == null ? void 0 : s.children[a]) == null ? void 0 : u.children.length); b++)
if (((h = (d = this.rule[0]) == null ? void 0 : d.children[a]) == null ? void 0 : h.children[b].name) === t._renderId)
return (S = (_ = this.fapi.renderRule((g = (p = this.rule[0]) == null ? void 0 : p.children[a]) == null ? void 0 : g.children[b], void 0, !0)) == null ? void 0 : _.default) == null ? void 0 : S.call(_);
}, r;
});
},
loadRule() {
this.copy = this.formCreateInject.form.toJson({
type: "template",
name: "template",
subRule: !0,
children: this.processRule(this.columns)
}), this.rule = [
{
type: "hidden",
children: this.trs
},
{
type: "elTable",
style: {
width: "100%"
},
key: 1,
props: {
...this.$attrs,
height: this.height,
size: this.size,
data: []
},
children: []
}
];
}
},
created() {
this.loadRule();
},
mounted() {
const e = this.fapi.sync;
this.fapi.sync = (t) => {
t.tableRenderUni = rt(), e(t);
}, this.updateTable(), this.newColumn && (!this.modelValue || !this.modelValue.length) && this.addRaw(!0), this.$watch(() => [...this.columns], (t) => {
this.rule[1].children.splice(this.rule[1].children.indexOf(this.indexRule) > -1 ? 1 : 0, 0, ...this.processColumns(t)), this.rule[1].key++;
}, { immediate: !0 }), this.$watch(() => this.showIndex, (t) => {
t === !1 && this.rule[1].children.indexOf(this.indexRule) > -1 ? this.rule[1].children.splice(0, 1) : t !== !1 && this.rule[1].children.indexOf(this.indexRule) === -1 && this.rule[1].children.unshift(this.indexRule);
}, { immediate: !0 }), this.$watch(() => this.formCreateInject.preview && this.button && this.button.column && [{ ...this.button }, ...this.button.column], (t) => {
this.rule[1].children.forEach((i, r) => {
i._tableHandle && this.rule[1].children.splice(r, 1);
}), !this.formCreateInject.preview && this.button.open !== !1 && this.rule[1].children.push({
type: "el-table-column",
_tableHandle: !0,
props: {
label: this.button.label || this.formCreateInject.t("operation") || "\u64CD\u4F5C",
fixed: this.button.fixed === void 0 ? "right" : this.button.fixed,
width: this.button.width || "100px"
},
renderSlots: {
default: (i) => this.button.column.filter((r) => r.hidden !== !0).map((r) => tn(ie("el-button"), this.btnProps(r, i), () => [r.key === "delete" && this.formCreateInject.t("delete") || r.name]))
}
});
}, { immediate: !0 });
}
}, $M = { class: "_fc-tf-pro-handle" };
function IM(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-pagination");
return W(), ae("div", {
class: qe(["_fc-table-form-v2", { "_fc-disabled": i.disabled }])
}, [
(W(), ye(Yr(n.Form), {
option: i.options,
rule: n.rule,
extendOption: !0,
disabled: i.disabled,
onChange: a.formChange,
api: n.fapi,
"onUpdate:api": t[0] || (t[0] = (d) => n.fapi = d),
onEmitEvent: e.$emit
}, null, 40, ["option", "rule", "disabled", "onChange", "api", "onEmitEvent"])),
Z("div", $M, [
Z("div", null, [
(!i.max || i.max > a.total) && i.addable !== !1 && i.disabled !== !0 ? (W(), ye(s, {
key: 0,
link: "",
type: "primary",
class: "fc-clock",
onClick: t[1] || (t[1] = (d) => a.addRaw(!0))
}, {
default: N(() => [
t[2] || (t[2] = Z("i", {
class: "fc-icon icon-add-circle",
style: { "font-weight": "700" }
}, null, -1)),
_e(" " + le(i.formCreateInject.t("add") || "\u6DFB\u52A0"), 1)
]),
_: 1
})) : Oe("", !0)
]),
i.page && i.page.open === !0 && n.chunk.length > 1 ? (W(), ye(u, dn({ key: 0 }, i.page.props || {}, {
layout: "prev, pager, next",
currentPage: n.nowPage,
"onUpdate:currentPage": a.changePage,
total: a.total,
pageSize: a.limit
}), null, 16, ["currentPage", "onUpdate:currentPage", "total", "pageSize"])) : Oe("", !0)
])
], 2);
}
const FM = /* @__PURE__ */ je(DM, [["render", IM]]);
const MM = Ve({
name: "TableFormColumnView",
props: {
label: String,
width: [Number, String],
color: String,
required: Boolean
},
computed: {
colStyle() {
const e = this.width, t = { width: St.Number(e) ? `${e}px` : !e || e === "auto" ? "180px" : e };
return this.color && (t.color = this.color), t;
}
},
data() {
return {};
}
}), PM = { class: "_fd-tf-title" }, LM = {
key: 0,
class: "_fd-tf-required"
}, NM = { class: "_fd-tf-con" };
function BM(e, t, i, r, n, a) {
return W(), ae("div", {
class: "_fd-tf-col",
style: An(e.colStyle)
}, [
Z("div", PM, [
e.required ? (W(), ae("span", LM, "*")) : Oe("", !0),
_e(le(e.label || ""), 1)
]),
Z("div", NM, [
kt(e.$slots, "default")
])
], 4);
}
const Iy = /* @__PURE__ */ je(MM, [["render", BM]]);
const VM = Ve({
name: "StepFormItemView",
props: {
title: String,
description: String,
formCreateInject: Object
},
inject: ["stepForm"],
data() {
return {};
},
created() {
const e = this.stepForm.formCreateInject.children.indexOf(this.formCreateInject.rule);
this.stepForm.stepItemRef.splice(e, 0, this);
},
unmounted() {
this.stepForm.stepItemRef.splice(this.stepForm.stepItemRef.indexOf(this), 1);
},
methods: {}
}), jM = { class: "_fd-step-form-item" };
function UM(e, t, i, r, n, a) {
return W(), ae("div", jM, [
wn(Z("div", null, [
kt(e.$slots, "default")
], 512), [
[xn, e.stepForm.activeId === e.formCreateInject.rule._fc_id]
])
]);
}
const zM = /* @__PURE__ */ je(VM, [["render", UM]]);
const HM = Ve({
name: "FcDialog",
inject: ["designer"],
inheritAttrs: !1,
props: {
title: String,
footer: {
type: Boolean,
default: !0
},
fullscreen: Boolean
},
computed: {
dragConHeight() {
return this.designer.setupState.dragConHeight;
},
t() {
return this.designer.setupState.t;
}
}
}), WM = { class: "el-dialog__header show-close" }, GM = { class: "el-dialog__title" }, KM = {
key: 0,
class: "el-dialog__headerbtn",
type: "button",
style: { right: "48px" }
}, YM = { class: "el-dialog__body" }, QM = { class: "el-dialog__footer" };
function JM(e, t, i, r, n, a) {
const s = ie("el-button");
return W(), ae("div", {
class: "_fd-dialog el-dialog",
style: An(`--fc-dialog-height:${e.dragConHeight - 23}px;`)
}, [
Z("header", WM, [
Z("span", GM, le(e.title), 1),
e.fullscreen ? Oe("", !0) : (W(), ae("button", KM, t[0] || (t[0] = [
Z("i", { class: "fc-icon icon-page-max" }, null, -1)
]))),
t[1] || (t[1] = Z("button", {
class: "el-dialog__headerbtn",
type: "button"
}, [
Z("i", { class: "el-icon el-dialog__close" }, [
Z("svg", {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, [
Z("path", {
fill: "currentColor",
d: "M764.288 214.592 512 466.88 259.712 214.592a31.936 31.936 0 0 0-45.12 45.12L466.752 512 214.528 764.224a31.936 31.936 0 1 0 45.12 45.184L512 557.184l252.288 252.288a31.936 31.936 0 0 0 45.12-45.12L557.12 512.064l252.288-252.352a31.936 31.936 0 1 0-45.12-45.184z"
})
])
])
], -1))
]),
Z("div", YM, [
kt(e.$slots, "default")
]),
Z("footer", QM, [
e.footer !== !1 ? (W(), ae(Pe, { key: 0 }, [
G(s, null, {
default: N(() => [
_e(le(e.t("props.close")), 1)
]),
_: 1
}),
G(s, { type: "primary" }, {
default: N(() => [
_e(le(e.t("props.ok")), 1)
]),
_: 1
})
], 64)) : Oe("", !0)
])
], 4);
}
const XM = /* @__PURE__ */ je(HM, [["render", JM]]);
const ZM = Ve({
name: "FcDialog",
emits: ["confirm", "submit", "validateFail", "update:modelValue"],
props: {
formData: Object,
options: {
type: Object,
default: () => Vi({
submitBtn: !1,
resetBtn: !1
})
},
rule: Array,
autoClose: {
type: Boolean,
default: !0
},
footer: {
type: Boolean,
default: !0
},
preview: Boolean,
modelValue: Object,
formCreateInject: Object
},
computed: {
formOptions() {
const e = { ...this.options };
return this.preview && (e.preview = this.preview), e;
}
},
data() {
return {
visible: !1,
max: this.$attrs.fullscreen || !1,
fapi: {},
value: {},
formRule: [],
Form: Xt(this.formCreateInject.form.$form())
};
},
methods: {
formChange() {
this.$emit("update:modelValue", this.fapi.formData());
},
open(e) {
this.$nextTick(() => {
this.visible = !0, this.value = At(e || this.modelValue || this.formData || {}), this.formRule = At(this.rule || []);
});
},
close() {
this.visible = !1;
},
handleConfirm() {
this.$emit("confirm", this.fapi), this.fapi.submit().then((e) => {
this.$emit("submit", e, this.fapi, this.close), this.autoClose && this.close();
}).catch((e) => {
this.$emit("validateFail", e, this.fapi);
});
}
},
mounted() {
this.formCreateInject.api.top.bus.$on("fc.closeDialog", this.close), wc(() => {
this.formCreateInject.api.top.bus.$off("fc.closeDialog", this.close);
});
}
}), qM = {
key: 0,
class: "el-dialog__headerbtn",
type: "button",
style: { right: "36px" }
};
function eP(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-dialog");
return W(), ye(u, dn({ class: "_fc-dialog" }, e.$attrs, {
fullscreen: e.max,
modelValue: e.visible,
"onUpdate:modelValue": t[3] || (t[3] = (d) => e.visible = d),
destroyOnClose: ""
}), ii({
default: N(() => [
e.$attrs.fullscreen ? Oe("", !0) : (W(), ae("button", qM, [
e.max ? (W(), ae("i", {
key: 0,
class: "fc-icon icon-page-min",
onClick: t[0] || (t[0] = (d) => e.max = !1)
})) : (W(), ae("i", {
key: 1,
class: "fc-icon icon-page-max",
onClick: t[1] || (t[1] = (d) => e.max = !0)
}))
])),
(W(), ye(Yr(e.Form), {
option: e.formOptions,
rule: e.formRule,
extendOption: !0,
api: e.fapi,
"onUpdate:api": t[2] || (t[2] = (d) => e.fapi = d),
"model-value": e.value,
subForm: !1,
onChange: e.formChange,
onEmitEvent: e.$emit
}, null, 40, ["option", "rule", "api", "model-value", "onChange", "onEmitEvent"]))
]),
_: 2
}, [
e.footer !== !1 ? {
name: "footer",
fn: N(() => [
G(s, { onClick: e.close }, {
default: N(() => [
_e(le(e.formCreateInject.t("close") || "\u5173\u95ED"), 1)
]),
_: 1
}, 8, ["onClick"]),
G(s, {
type: "primary",
onClick: e.handleConfirm
}, {
default: N(() => [
_e(le(e.formCreateInject.t("ok") || "\u786E\u5B9A"), 1)
]),
_: 1
}, 8, ["onClick"])
]),
key: "0"
} : void 0
]), 1040, ["fullscreen", "modelValue"]);
}
const Fy = /* @__PURE__ */ je(ZM, [["render", eP]]);
const tP = Ve({
name: "FcDialog",
inject: ["designer"],
inheritAttrs: !1,
props: {
title: String,
footer: {
type: Boolean,
default: !0
},
size: String
},
computed: {
dragConHeight() {
return this.designer.setupState.dragConHeight;
},
t() {
return this.designer.setupState.t;
}
}
}), nP = { class: "el-drawer__header" }, iP = {
key: 0,
class: "el-drawer__close-btn",
type: "button"
}, rP = { class: "el-drawer__body" }, oP = { class: "el-drawer__footer" };
function aP(e, t, i, r, n, a) {
const s = ie("el-button");
return W(), ae("div", {
class: "el-drawer _fd-drawer",
style: An(`--fc-drawer-height:${e.dragConHeight - 23}px;`)
}, [
t[2] || (t[2] = Z("span", {
class: "el-drawer__sr-focus",
tabindex: "-1"
}, null, -1)),
Z("header", nP, [
Z("span", null, le(e.title), 1),
e.size !== "100%" ? (W(), ae("button", iP, t[0] || (t[0] = [
Z("i", { class: "fc-icon icon-page-max" }, null, -1)
]))) : Oe("", !0),
t[1] || (t[1] = Z("button", {
class: "el-drawer__close-btn",
type: "button"
}, [
Z("i", { class: "el-icon el-drawer__close" }, [
Z("svg", {
xmlns: "http://www.w3.org/2000/svg",
viewBox: "0 0 1024 1024"
}, [
Z("path", {
fill: "currentColor",
d: "M764.288 214.592 512 466.88 259.712 214.592a31.936 31.936 0 0 0-45.12 45.12L466.752 512 214.528 764.224a31.936 31.936 0 1 0 45.12 45.184L512 557.184l252.288 252.288a31.936 31.936 0 0 0 45.12-45.12L557.12 512.064l252.288-252.352a31.936 31.936 0 1 0-45.12-45.184z"
})
])
])
], -1))
]),
Z("div", rP, [
kt(e.$slots, "default")
]),
Z("div", oP, [
e.footer !== !1 ? (W(), ae(Pe, { key: 0 }, [
G(s, null, {
default: N(() => [
_e(le(e.t("props.close")), 1)
]),
_: 1
}),
G(s, { type: "primary" }, {
default: N(() => [
_e(le(e.t("props.ok")), 1)
]),
_: 1
})
], 64)) : Oe("", !0)
])
], 4);
}
const lP = /* @__PURE__ */ je(tP, [["render", aP]]);
const sP = Ve({
name: "FcDialog",
emits: ["confirm", "submit", "validateFail", "update:modelValue"],
props: {
formData: Object,
options: {
type: Object,
default: () => Vi({
submitBtn: !1,
resetBtn: !1
})
},
size: [Number, String],
title: String,
rule: Array,
autoClose: {
type: Boolean,
default: !0
},
footer: {
type: Boolean,
default: !0
},
preview: Boolean,
modelValue: Object,
formCreateInject: Object
},
computed: {
formOptions() {
const e = { ...this.options };
return this.preview && (e.preview = this.preview), e;
}
},
data() {
return {
visible: !1,
max: this.size === "100%",
fapi: {},
value: {},
formRule: [],
Form: Xt(this.formCreateInject.form.$form())
};
},
methods: {
formChange() {
this.$emit("update:modelValue", this.fapi.formData());
},
open(e) {
this.$nextTick(() => {
this.visible = !0, this.value = At(e || this.modelValue || this.formData || {}), this.formRule = At(this.rule || []);
});
},
close() {
this.visible = !1;
},
handleConfirm() {
this.$emit("confirm", this.fapi), this.fapi.submit().then((e) => {
this.$emit("submit", e, this.fapi, this.close), this.autoClose && this.close();
}).catch((e) => {
this.$emit("validateFail", e, this.fapi);
});
}
},
mounted() {
this.formCreateInject.api.top.bus.$on("fc.closeDialog", this.close), wc(() => {
this.formCreateInject.api.top.bus.$off("fc.closeDialog", this.close);
});
}
}), uP = { class: "el-drawer__title" }, dP = {
key: 0,
class: "el-drawer__close-btn",
type: "button"
};
function fP(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-drawer");
return W(), ye(u, dn({ class: "_fc-drawer" }, e.$attrs, {
size: e.max ? "100%" : e.size,
modelValue: e.visible,
"onUpdate:modelValue": t[3] || (t[3] = (d) => e.visible = d),
destroyOnClose: ""
}), {
header: N(() => [
Z("span", uP, le(e.title), 1),
e.size !== "100%" ? (W(), ae("button", dP, [
e.max ? (W(), ae("i", {
key: 0,
class: "fc-icon icon-page-min",
onClick: t[0] || (t[0] = (d) => e.max = !1)
})) : (W(), ae("i", {
key: 1,
class: "fc-icon icon-page-max",
onClick: t[1] || (t[1] = (d) => e.max = !0)
}))
])) : Oe("", !0)
]),
footer: N(() => [
e.footer !== !1 ? (W(), ae(Pe, { key: 0 }, [
G(s, { onClick: e.close }, {
default: N(() => [
_e(le(e.formCreateInject.t("close") || "\u5173\u95ED"), 1)
]),
_: 1
}, 8, ["onClick"]),
G(s, {
type: "primary",
onClick: e.handleConfirm
}, {
default: N(() => [
_e(le(e.formCreateInject.t("ok") || "\u786E\u5B9A"), 1)
]),
_: 1
}, 8, ["onClick"])
], 64)) : Oe("", !0)
]),
default: N(() => [
(W(), ye(Yr(e.Form), {
option: e.formOptions,
rule: e.formRule,
extendOption: !0,
api: e.fapi,
"onUpdate:api": t[2] || (t[2] = (d) => e.fapi = d),
"model-value": e.value,
subForm: !1,
onChange: e.formChange,
onEmitEvent: e.$emit
}, null, 40, ["option", "rule", "api", "model-value", "onChange", "onEmitEvent"]))
]),
_: 1
}, 16, ["size", "modelValue"]);
}
const cP = /* @__PURE__ */ je(sP, [["render", fP]]);
const pP = Ve({
name: "FcCell"
}), hP = {
ref: "cell",
class: "_fc-cell"
};
function mP(e, t, i, r, n, a) {
return W(), ae("div", hP, [
kt(e.$slots, "default")
], 512);
}
const vP = /* @__PURE__ */ je(pP, [["render", mP]]);
const gP = Ve({
name: "FcCell",
inheritAttrs: !1,
data() {
return {
isNew: !1
};
},
computed: {
style() {
const e = this.$attrs.style || {}, t = {
"--fc-cell-display": e.display || "block",
"--fc-cell-flexDirection": e.flexDirection || "inherit",
"--fc-cell-flexWrap": e.flexWrap || "inherit",
"--fc-cell-alignContent": e.alignContent || "inherit",
"--fc-cell-justifyContent": e.justifyContent || "inherit",
"--fc-cell-alignItems": e.alignItems || "inherit"
};
return e.height && (t.height = e.height || "auto"), e.width && (t.width = e.width || "auto"), t;
}
},
mounted() {
this.isNew = this.$el.parentNode.classList.contains("_fd-drag-item"), this.isNew && this.$watch("$attrs.style.width", (e) => {
Kn(() => {
this.$el.parentNode.style.width = e || "100%";
});
}, {
immediate: !0
});
}
});
function yP(e, t, i, r, n, a) {
return W(), ae("div", {
ref: "cell",
class: qe(["_fd-cell", { "is-new": e.isNew }]),
style: An(e.style)
}, [
Z("div", dn(e.$attrs, { style: { height: "100%", width: "100%" } }), [
kt(e.$slots, "default")
], 16)
], 6);
}
const bP = /* @__PURE__ */ je(gP, [["render", yP]]);
const _P = Ve({
name: "fcRow",
mounted() {
}
});
function wP(e, t, i, r, n, a) {
const s = ie("el-col");
return W(), ye(s, { span: 24 }, {
default: N(() => [
Z("div", dn({
class: ["_fd-row el-row", { "_fc-child-empty": !e.$slots.default }]
}, e.$attrs), [
kt(e.$slots, "default")
], 16)
]),
_: 3
});
}
const AP = /* @__PURE__ */ je(_P, [["render", wP]]);
const CP = Ve({
name: "HideSwitch",
props: {
modelValue: [String, Boolean, Number],
activeValue: {
type: [String, Boolean, Number],
default: !0
},
inactiveValue: {
type: [String, Boolean, Number],
default: !1
},
disabled: Boolean
},
events: ["update:modelValue"],
inject: ["designer"],
computed: {
t() {
return this.designer.setupState.t;
}
},
methods: {
onInput() {
this.disabled || this.$emit("update:modelValue", this.modelValue !== this.activeValue ? this.activeValue : this.inactiveValue);
}
}
});
function SP(e, t, i, r, n, a) {
return W(), ae("div", {
class: qe(["_fd-hide-config", { disabled: !!e.disabled, active: e.modelValue === e.activeValue }]),
onClick: t[0] || (t[0] = (...s) => e.onInput && e.onInput(...s))
}, [
e.modelValue === e.activeValue ? (W(), ae(Pe, { key: 0 }, [
t[1] || (t[1] = Z("i", { class: "fc-icon icon-eye" }, null, -1)),
_e(" " + le(e.t("props.show")), 1)
], 64)) : (W(), ae(Pe, { key: 1 }, [
t[2] || (t[2] = Z("i", { class: "fc-icon icon-eye-close" }, null, -1)),
_e(" " + le(e.t("props.hide")), 1)
], 64))
], 2);
}
const EP = /* @__PURE__ */ je(CP, [["render", SP]]);
const xP = Ve({
name: "SpanInput",
props: {
modelValue: [Number, String]
},
inject: ["designer"],
computed: {
t() {
return this.designer.setupState.t;
}
},
data() {
return {
layout: [
{ label: "1/4", value: 6 },
{ label: "1/3", value: 8 },
{ label: "1/2", value: 12 },
{ label: "2/3", value: 16 },
{ label: "3/4", value: 18 },
{ label: "\u6574\u884C", value: 24 }
]
};
},
methods: {
onInput(e) {
this.$emit("update:modelValue", e === this.modelValue ? "" : e);
}
}
});
function TP(e, t, i, r, n, a) {
const s = ie("el-radio-button"), u = ie("el-radio-group");
return W(), ye(u, {
modelValue: e.modelValue,
class: "_fd-span-input"
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.layout, (d) => (W(), ye(s, {
value: d.value,
label: d.value,
key: d.value,
onClick: (h) => e.onInput(d.value)
}, {
default: N(() => [
_e(le(d.value === 24 ? e.t("form.row") : d.label), 1)
]),
_: 2
}, 1032, ["value", "label", "onClick"]))), 128))
]),
_: 1
}, 8, ["modelValue"]);
}
const kP = /* @__PURE__ */ je(xP, [["render", TP]]);
function mc(e, t, i) {
for (var r = [], n = Math.max(e.length, t.length), a = 0, s = 0; s < n || a; ) {
var u = s < e.length ? e[s] : 0, d = s < t.length ? t[s] : 0, h = a + u + d;
r.push(h % i), a = Math.floor(h / i), s++;
}
return r;
}
function bg(e, t, i) {
if (e < 0)
return null;
if (e == 0)
return [];
for (var r = [], n = t; e & 1 && (r = mc(r, n, i)), e = e >> 1, e !== 0; )
n = mc(n, n, i);
return r;
}
function OP(e, t) {
for (var i = e.split(""), r = [], n = i.length - 1; n >= 0; n--) {
var a = parseInt(i[n], t);
if (isNaN(a))
return null;
r.push(a);
}
return r;
}
function RP(e, t, i) {
var r = OP(e, t);
if (r === null)
return null;
for (var n = [], a = [1], s = 0; s < r.length; s++)
r[s] && (n = mc(
n,
bg(r[s], a, i),
i
)), a = bg(t, a, i);
for (var u = "", s = n.length - 1; s >= 0; s--)
u += n[s].toString(i);
return u;
}
function DP(e) {
return e.substring(0, 2) === "0x" && (e = e.substring(2)), e = e.toLowerCase(), RP(e, 16, 10);
}
class $P {
constructor(t) {
t = t || {}, this.seq = 0, this.mid = (t.mid || 1) % 1023, this.offset = t.offset || 0, this.lastTime = 0;
}
generate() {
const t = Date.now(), i = (t - this.offset).toString(2);
this.lastTime == t ? (this.seq++, this.seq > 4095 && (this.seq = 0)) : this.seq = 0, this.lastTime = t;
let r = this.seq.toString(2), n = this.mid.toString(2);
for (; r.length < 12; )
r = "0" + r;
for (; n.length < 10; )
n = "0" + n;
const a = i + n + r;
let s = "";
for (let u = a.length; u > 0; u -= 4)
s = parseInt(a.substring(u - 4, u), 2).toString(16) + s;
return DP(s);
}
}
const IP = Ve({
name: "FcId",
props: ["modelValue", "prefix"],
emits: ["update:modelValue"],
inject: {
designer: {
default: null
}
},
data() {
return {
preview: "7379787000000000"
};
},
watch: {
modelValue: {
handler: function(e) {
if (!e) {
const t = new $P({
mid: 42,
offset: 173448e7
});
this.$emit("update:modelValue", "" + (this.prefix || "") + t.generate());
}
},
immediate: !0
}
}
});
function FP(e, t, i, r, n, a) {
const s = ie("el-input");
return W(), ye(s, {
modelValue: e.designer ? "" + (e.prefix || "") + e.preview : e.modelValue,
readonly: "",
disabled: ""
}, null, 8, ["modelValue"]);
}
const MP = /* @__PURE__ */ je(IP, [["render", FP]]), PP = Ve({
name: "AudioBox",
emits: ["pause", "play", "ended"],
data() {
return {};
},
props: {
src: String,
type: String,
controls: {
type: Boolean,
default: !0
},
autoplay: Boolean,
loop: Boolean,
preload: {
type: String,
default: "auto"
},
muted: Boolean
}
}), LP = ["controls", "autoplay", "loop", "preload", "muted"], NP = ["src", "type"];
function BP(e, t, i, r, n, a) {
return W(), ae("audio", {
key: e.src,
controls: e.controls,
autoplay: e.autoplay,
loop: e.loop,
preload: e.preload,
muted: e.muted,
onPause: t[0] || (t[0] = (s) => e.$emit("pause", s)),
onPlay: t[1] || (t[1] = (s) => e.$emit("play", s)),
onEnded: t[2] || (t[2] = (s) => e.$emit("ended", s))
}, [
Z("source", {
src: e.src,
type: e.type
}, null, 8, NP),
t[3] || (t[3] = _e(" Your browser does not support the audio element. "))
], 40, LP);
}
const VP = /* @__PURE__ */ je(PP, [["render", BP]]);
const jP = Ve({
name: "VideoBox",
emits: ["pause", "play", "ended", "error"],
data() {
return {
player: null
};
},
props: {
src: String,
type: String,
controls: {
type: Boolean,
default: !0
},
autoplay: Boolean,
isLive: Boolean,
withCredentials: Boolean,
loop: Boolean
},
watch: {
src: {
handler: function() {
this.$nextTick(() => {
Rn.ready("mpegts", () => {
const e = this.$refs.video, t = window.mpegts.createPlayer({
isLive: this.isLive,
type: this.type,
url: this.src
});
t.attachMediaElement(e), t.on("error", (i) => {
this.$emit("error", i);
}), t.load(), this.autoplay && t.play().catch((i) => {
this.$emit("error", i);
}), this.player = t;
});
});
},
immediate: !0
}
},
created() {
window.mpegts ? Rn.done("mpegts") : Rn.isDefined("mpegts") || Rn.loadNpm("mpegts.js@1.8.0/dist/mpegts.js", "mpegts");
}
}), UP = ["controls", "loop"];
function zP(e, t, i, r, n, a) {
return W(), ae("video", {
ref: "video",
class: "_fc-video-box",
controls: e.controls,
loop: e.loop,
onPause: t[0] || (t[0] = (s) => e.$emit("pause", s)),
onPlay: t[1] || (t[1] = (s) => e.$emit("play", s)),
onEnded: t[2] || (t[2] = (s) => e.$emit("ended", s))
}, null, 40, UP);
}
const HP = /* @__PURE__ */ je(jP, [["render", zP]]);
var Kc = {}, pu = {}, Xn = {};
Object.defineProperty(Xn, "__esModule", {
value: !0
});
function WP(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
var GP = function e(t, i) {
WP(this, e), this.data = t, this.text = i.text || t, this.options = i;
};
Xn.default = GP;
Object.defineProperty(pu, "__esModule", {
value: !0
});
pu.CODE39 = void 0;
var KP = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), YP = Xn, QP = JP(YP);
function JP(e) {
return e && e.__esModule ? e : { default: e };
}
function XP(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function ZP(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function qP(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var eL = function(e) {
qP(t, e);
function t(i, r) {
return XP(this, t), i = i.toUpperCase(), r.mod43 && (i += iL(rL(i))), ZP(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
return KP(t, [{
key: "encode",
value: function() {
for (var r = Gf("*"), n = 0; n < this.data.length; n++)
r += Gf(this.data[n]) + "0";
return r += Gf("*"), {
data: r,
text: this.text
};
}
}, {
key: "valid",
value: function() {
return this.data.search(/^[0-9A-Z\-\.\ \$\/\+\%]+$/) !== -1;
}
}]), t;
}(QP.default), My = ["0", "1", "2", "3", "4", "5", "6", "7", "8", "9", "A", "B", "C", "D", "E", "F", "G", "H", "I", "J", "K", "L", "M", "N", "O", "P", "Q", "R", "S", "T", "U", "V", "W", "X", "Y", "Z", "-", ".", " ", "$", "/", "+", "%", "*"], tL = [20957, 29783, 23639, 30485, 20951, 29813, 23669, 20855, 29789, 23645, 29975, 23831, 30533, 22295, 30149, 24005, 21623, 29981, 23837, 22301, 30023, 23879, 30545, 22343, 30161, 24017, 21959, 30065, 23921, 22385, 29015, 18263, 29141, 17879, 29045, 18293, 17783, 29021, 18269, 17477, 17489, 17681, 20753, 35770];
function Gf(e) {
return nL(Py(e));
}
function nL(e) {
return tL[e].toString(2);
}
function iL(e) {
return My[e];
}
function Py(e) {
return My.indexOf(e);
}
function rL(e) {
for (var t = 0, i = 0; i < e.length; i++)
t += Py(e[i]);
return t = t % 43, t;
}
pu.CODE39 = eL;
var Bi = {}, Yc = {}, Zo = {}, Wt = {};
Object.defineProperty(Wt, "__esModule", {
value: !0
});
var La;
function Kf(e, t, i) {
return t in e ? Object.defineProperty(e, t, { value: i, enumerable: !0, configurable: !0, writable: !0 }) : e[t] = i, e;
}
var Ly = Wt.SET_A = 0, Ny = Wt.SET_B = 1, By = Wt.SET_C = 2;
Wt.SHIFT = 98;
var oL = Wt.START_A = 103, aL = Wt.START_B = 104, lL = Wt.START_C = 105;
Wt.MODULO = 103;
Wt.STOP = 106;
Wt.FNC1 = 207;
Wt.SET_BY_CODE = (La = {}, Kf(La, oL, Ly), Kf(La, aL, Ny), Kf(La, lL, By), La);
Wt.SWAP = {
101: Ly,
100: Ny,
99: By
};
Wt.A_START_CHAR = String.fromCharCode(208);
Wt.B_START_CHAR = String.fromCharCode(209);
Wt.C_START_CHAR = String.fromCharCode(210);
Wt.A_CHARS = "[\0-_\xC8-\xCF]";
Wt.B_CHARS = "[ -\x7F\xC8-\xCF]";
Wt.C_CHARS = "(\xCF*[0-9]{2}\xCF*)";
Wt.BARS = [11011001100, 11001101100, 11001100110, 10010011e3, 10010001100, 10001001100, 10011001e3, 10011000100, 10001100100, 11001001e3, 11001000100, 11000100100, 10110011100, 10011011100, 10011001110, 10111001100, 10011101100, 10011100110, 11001110010, 11001011100, 11001001110, 11011100100, 11001110100, 11101101110, 11101001100, 11100101100, 11100100110, 11101100100, 11100110100, 11100110010, 11011011e3, 11011000110, 11000110110, 10100011e3, 10001011e3, 10001000110, 10110001e3, 10001101e3, 10001100010, 11010001e3, 11000101e3, 11000100010, 10110111e3, 10110001110, 10001101110, 10111011e3, 10111000110, 10001110110, 11101110110, 11010001110, 11000101110, 11011101e3, 11011100010, 11011101110, 11101011e3, 11101000110, 11100010110, 11101101e3, 11101100010, 11100011010, 11101111010, 11001000010, 11110001010, 1010011e4, 10100001100, 1001011e4, 10010000110, 10000101100, 10000100110, 1011001e4, 10110000100, 1001101e4, 10011000010, 10000110100, 10000110010, 11000010010, 1100101e4, 11110111010, 11000010100, 10001111010, 10100111100, 10010111100, 10010011110, 10111100100, 10011110100, 10011110010, 11110100100, 11110010100, 11110010010, 11011011110, 11011110110, 11110110110, 10101111e3, 10100011110, 10001011110, 10111101e3, 10111100010, 11110101e3, 11110100010, 10111011110, 10111101110, 11101011110, 11110101110, 11010000100, 1101001e4, 11010011100, 1100011101011];
Object.defineProperty(Zo, "__esModule", {
value: !0
});
var sL = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), uL = Xn, dL = fL(uL), ei = Wt;
function fL(e) {
return e && e.__esModule ? e : { default: e };
}
function cL(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function pL(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function hL(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var mL = function(e) {
hL(t, e);
function t(i, r) {
cL(this, t);
var n = pL(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i.substring(1), r));
return n.bytes = i.split("").map(function(a) {
return a.charCodeAt(0);
}), n;
}
return sL(t, [{
key: "valid",
value: function() {
return /^[\x00-\x7F\xC8-\xD3]+$/.test(this.data);
}
}, {
key: "encode",
value: function() {
var r = this.bytes, n = r.shift() - 105, a = ei.SET_BY_CODE[n];
if (a === void 0)
throw new RangeError("The encoding does not start with a start character.");
this.shouldEncodeAsEan128() === !0 && r.unshift(ei.FNC1);
var s = t.next(r, 1, a);
return {
text: this.text === this.data ? this.text.replace(/[^\x20-\x7E]/g, "") : this.text,
data: t.getBar(n) + s.result + t.getBar((s.checksum + n) % ei.MODULO) + t.getBar(ei.STOP)
};
}
}, {
key: "shouldEncodeAsEan128",
value: function() {
var r = this.options.ean128 || !1;
return typeof r == "string" && (r = r.toLowerCase() === "true"), r;
}
}], [{
key: "getBar",
value: function(r) {
return ei.BARS[r] ? ei.BARS[r].toString() : "";
}
}, {
key: "correctIndex",
value: function(r, n) {
if (n === ei.SET_A) {
var a = r.shift();
return a < 32 ? a + 64 : a - 32;
} else
return n === ei.SET_B ? r.shift() - 32 : (r.shift() - 48) * 10 + r.shift() - 48;
}
}, {
key: "next",
value: function(r, n, a) {
if (!r.length)
return { result: "", checksum: 0 };
var s = void 0, u = void 0;
if (r[0] >= 200) {
u = r.shift() - 105;
var d = ei.SWAP[u];
d !== void 0 ? s = t.next(r, n + 1, d) : ((a === ei.SET_A || a === ei.SET_B) && u === ei.SHIFT && (r[0] = a === ei.SET_A ? r[0] > 95 ? r[0] - 96 : r[0] : r[0] < 32 ? r[0] + 96 : r[0]), s = t.next(r, n + 1, a));
} else
u = t.correctIndex(r, a), s = t.next(r, n + 1, a);
var h = t.getBar(u), p = u * n;
return {
result: h + s.result,
checksum: p + s.checksum
};
}
}]), t;
}(dL.default);
Zo.default = mL;
var Qc = {};
Object.defineProperty(Qc, "__esModule", {
value: !0
});
var kr = Wt, Vy = function(t) {
return t.match(new RegExp("^" + kr.A_CHARS + "*"))[0].length;
}, jy = function(t) {
return t.match(new RegExp("^" + kr.B_CHARS + "*"))[0].length;
}, Uy = function(t) {
return t.match(new RegExp("^" + kr.C_CHARS + "*"))[0];
};
function Jc(e, t) {
var i = t ? kr.A_CHARS : kr.B_CHARS, r = e.match(new RegExp("^(" + i + "+?)(([0-9]{2}){2,})([^0-9]|$)"));
if (r)
return r[1] + String.fromCharCode(204) + zy(e.substring(r[1].length));
var n = e.match(new RegExp("^" + i + "+"))[0];
return n.length === e.length ? e : n + String.fromCharCode(t ? 205 : 206) + Jc(e.substring(n.length), !t);
}
function zy(e) {
var t = Uy(e), i = t.length;
if (i === e.length)
return e;
e = e.substring(i);
var r = Vy(e) >= jy(e);
return t + String.fromCharCode(r ? 206 : 205) + Jc(e, r);
}
Qc.default = function(e) {
var t = void 0, i = Uy(e).length;
if (i >= 2)
t = kr.C_START_CHAR + zy(e);
else {
var r = Vy(e) > jy(e);
t = (r ? kr.A_START_CHAR : kr.B_START_CHAR) + Jc(e, r);
}
return t.replace(
/[\xCD\xCE]([^])[\xCD\xCE]/,
function(n, a) {
return String.fromCharCode(203) + a;
}
);
};
Object.defineProperty(Yc, "__esModule", {
value: !0
});
var vL = Zo, gL = Hy(vL), yL = Qc, bL = Hy(yL);
function Hy(e) {
return e && e.__esModule ? e : { default: e };
}
function _L(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function Yf(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function wL(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var AL = function(e) {
wL(t, e);
function t(i, r) {
if (_L(this, t), /^[\x00-\x7F\xC8-\xD3]+$/.test(i))
var n = Yf(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, (0, bL.default)(i), r));
else
var n = Yf(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
return Yf(n);
}
return t;
}(gL.default);
Yc.default = AL;
var Xc = {};
Object.defineProperty(Xc, "__esModule", {
value: !0
});
var CL = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), SL = Zo, EL = xL(SL), _g = Wt;
function xL(e) {
return e && e.__esModule ? e : { default: e };
}
function TL(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function kL(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function OL(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var RL = function(e) {
OL(t, e);
function t(i, r) {
return TL(this, t), kL(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, _g.A_START_CHAR + i, r));
}
return CL(t, [{
key: "valid",
value: function() {
return new RegExp("^" + _g.A_CHARS + "+$").test(this.data);
}
}]), t;
}(EL.default);
Xc.default = RL;
var Zc = {};
Object.defineProperty(Zc, "__esModule", {
value: !0
});
var DL = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), $L = Zo, IL = FL($L), wg = Wt;
function FL(e) {
return e && e.__esModule ? e : { default: e };
}
function ML(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function PL(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function LL(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var NL = function(e) {
LL(t, e);
function t(i, r) {
return ML(this, t), PL(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, wg.B_START_CHAR + i, r));
}
return DL(t, [{
key: "valid",
value: function() {
return new RegExp("^" + wg.B_CHARS + "+$").test(this.data);
}
}]), t;
}(IL.default);
Zc.default = NL;
var qc = {};
Object.defineProperty(qc, "__esModule", {
value: !0
});
var BL = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), VL = Zo, jL = UL(VL), Ag = Wt;
function UL(e) {
return e && e.__esModule ? e : { default: e };
}
function zL(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function HL(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function WL(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var GL = function(e) {
WL(t, e);
function t(i, r) {
return zL(this, t), HL(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, Ag.C_START_CHAR + i, r));
}
return BL(t, [{
key: "valid",
value: function() {
return new RegExp("^" + Ag.C_CHARS + "+$").test(this.data);
}
}]), t;
}(jL.default);
qc.default = GL;
Object.defineProperty(Bi, "__esModule", {
value: !0
});
Bi.CODE128C = Bi.CODE128B = Bi.CODE128A = Bi.CODE128 = void 0;
var KL = Yc, YL = hu(KL), QL = Xc, JL = hu(QL), XL = Zc, ZL = hu(XL), qL = qc, eN = hu(qL);
function hu(e) {
return e && e.__esModule ? e : { default: e };
}
Bi.CODE128 = YL.default;
Bi.CODE128A = JL.default;
Bi.CODE128B = ZL.default;
Bi.CODE128C = eN.default;
var Yn = {}, ep = {}, mi = {};
Object.defineProperty(mi, "__esModule", {
value: !0
});
mi.SIDE_BIN = "101";
mi.MIDDLE_BIN = "01010";
mi.BINARIES = {
L: [
"0001101",
"0011001",
"0010011",
"0111101",
"0100011",
"0110001",
"0101111",
"0111011",
"0110111",
"0001011"
],
G: [
"0100111",
"0110011",
"0011011",
"0100001",
"0011101",
"0111001",
"0000101",
"0010001",
"0001001",
"0010111"
],
R: [
"1110010",
"1100110",
"1101100",
"1000010",
"1011100",
"1001110",
"1010000",
"1000100",
"1001000",
"1110100"
],
O: [
"0001101",
"0011001",
"0010011",
"0111101",
"0100011",
"0110001",
"0101111",
"0111011",
"0110111",
"0001011"
],
E: [
"0100111",
"0110011",
"0011011",
"0100001",
"0011101",
"0111001",
"0000101",
"0010001",
"0001001",
"0010111"
]
};
mi.EAN2_STRUCTURE = ["LL", "LG", "GL", "GG"];
mi.EAN5_STRUCTURE = ["GGLLL", "GLGLL", "GLLGL", "GLLLG", "LGGLL", "LLGGL", "LLLGG", "LGLGL", "LGLLG", "LLGLG"];
mi.EAN13_STRUCTURE = ["LLLLLL", "LLGLGG", "LLGGLG", "LLGGGL", "LGLLGG", "LGGLLG", "LGGGLL", "LGLGLG", "LGLGGL", "LGGLGL"];
var mu = {}, Xr = {};
Object.defineProperty(Xr, "__esModule", {
value: !0
});
var tN = mi, nN = function(t, i, r) {
var n = t.split("").map(function(s, u) {
return tN.BINARIES[i[u]];
}).map(function(s, u) {
return s ? s[t[u]] : "";
});
if (r) {
var a = t.length - 1;
n = n.map(function(s, u) {
return u < a ? s + r : s;
});
}
return n.join("");
};
Xr.default = nN;
Object.defineProperty(mu, "__esModule", {
value: !0
});
var iN = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), Do = mi, rN = Xr, Cg = Wy(rN), oN = Xn, aN = Wy(oN);
function Wy(e) {
return e && e.__esModule ? e : { default: e };
}
function lN(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function sN(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function uN(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var dN = function(e) {
uN(t, e);
function t(i, r) {
lN(this, t);
var n = sN(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
return n.fontSize = !r.flat && r.fontSize > r.width * 10 ? r.width * 10 : r.fontSize, n.guardHeight = r.height + n.fontSize / 2 + r.textMargin, n;
}
return iN(t, [{
key: "encode",
value: function() {
return this.options.flat ? this.encodeFlat() : this.encodeGuarded();
}
}, {
key: "leftText",
value: function(r, n) {
return this.text.substr(r, n);
}
}, {
key: "leftEncode",
value: function(r, n) {
return (0, Cg.default)(r, n);
}
}, {
key: "rightText",
value: function(r, n) {
return this.text.substr(r, n);
}
}, {
key: "rightEncode",
value: function(r, n) {
return (0, Cg.default)(r, n);
}
}, {
key: "encodeGuarded",
value: function() {
var r = { fontSize: this.fontSize }, n = { height: this.guardHeight };
return [{ data: Do.SIDE_BIN, options: n }, { data: this.leftEncode(), text: this.leftText(), options: r }, { data: Do.MIDDLE_BIN, options: n }, { data: this.rightEncode(), text: this.rightText(), options: r }, { data: Do.SIDE_BIN, options: n }];
}
}, {
key: "encodeFlat",
value: function() {
var r = [Do.SIDE_BIN, this.leftEncode(), Do.MIDDLE_BIN, this.rightEncode(), Do.SIDE_BIN];
return {
data: r.join(""),
text: this.text
};
}
}]), t;
}(aN.default);
mu.default = dN;
Object.defineProperty(ep, "__esModule", {
value: !0
});
var fN = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), Na = function e(t, i, r) {
t === null && (t = Function.prototype);
var n = Object.getOwnPropertyDescriptor(t, i);
if (n === void 0) {
var a = Object.getPrototypeOf(t);
return a === null ? void 0 : e(a, i, r);
} else {
if ("value" in n)
return n.value;
var s = n.get;
return s === void 0 ? void 0 : s.call(r);
}
}, cN = mi, pN = mu, hN = mN(pN);
function mN(e) {
return e && e.__esModule ? e : { default: e };
}
function vN(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function gN(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function yN(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var Sg = function(t) {
var i = t.substr(0, 12).split("").map(function(r) {
return +r;
}).reduce(function(r, n, a) {
return a % 2 ? r + n * 3 : r + n;
}, 0);
return (10 - i % 10) % 10;
}, bN = function(e) {
yN(t, e);
function t(i, r) {
vN(this, t), i.search(/^[0-9]{12}$/) !== -1 && (i += Sg(i));
var n = gN(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
return n.lastChar = r.lastChar, n;
}
return fN(t, [{
key: "valid",
value: function() {
return this.data.search(/^[0-9]{13}$/) !== -1 && +this.data[12] === Sg(this.data);
}
}, {
key: "leftText",
value: function() {
return Na(t.prototype.__proto__ || Object.getPrototypeOf(t.prototype), "leftText", this).call(this, 1, 6);
}
}, {
key: "leftEncode",
value: function() {
var r = this.data.substr(1, 6), n = cN.EAN13_STRUCTURE[this.data[0]];
return Na(t.prototype.__proto__ || Object.getPrototypeOf(t.prototype), "leftEncode", this).call(this, r, n);
}
}, {
key: "rightText",
value: function() {
return Na(t.prototype.__proto__ || Object.getPrototypeOf(t.prototype), "rightText", this).call(this, 7, 6);
}
}, {
key: "rightEncode",
value: function() {
var r = this.data.substr(7, 6);
return Na(t.prototype.__proto__ || Object.getPrototypeOf(t.prototype), "rightEncode", this).call(this, r, "RRRRRR");
}
}, {
key: "encodeGuarded",
value: function() {
var r = Na(t.prototype.__proto__ || Object.getPrototypeOf(t.prototype), "encodeGuarded", this).call(this);
return this.options.displayValue && (r.unshift({
data: "000000000000",
text: this.text.substr(0, 1),
options: { textAlign: "left", fontSize: this.fontSize }
}), this.options.lastChar && (r.push({
data: "00"
}), r.push({
data: "00000",
text: this.options.lastChar,
options: { fontSize: this.fontSize }
}))), r;
}
}]), t;
}(hN.default);
ep.default = bN;
var tp = {};
Object.defineProperty(tp, "__esModule", {
value: !0
});
var _N = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), vs = function e(t, i, r) {
t === null && (t = Function.prototype);
var n = Object.getOwnPropertyDescriptor(t, i);
if (n === void 0) {
var a = Object.getPrototypeOf(t);
return a === null ? void 0 : e(a, i, r);
} else {
if ("value" in n)
return n.value;
var s = n.get;
return s === void 0 ? void 0 : s.call(r);
}
}, wN = mu, AN = CN(wN);
function CN(e) {
return e && e.__esModule ? e : { default: e };
}
function SN(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function EN(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function xN(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var Eg = function(t) {
var i = t.substr(0, 7).split("").map(function(r) {
return +r;
}).reduce(function(r, n, a) {
return a % 2 ? r + n : r + n * 3;
}, 0);
return (10 - i % 10) % 10;
}, TN = function(e) {
xN(t, e);
function t(i, r) {
return SN(this, t), i.search(/^[0-9]{7}$/) !== -1 && (i += Eg(i)), EN(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
return _N(t, [{
key: "valid",
value: function() {
return this.data.search(/^[0-9]{8}$/) !== -1 && +this.data[7] === Eg(this.data);
}
}, {
key: "leftText",
value: function() {
return vs(t.prototype.__proto__ || Object.getPrototypeOf(t.prototype), "leftText", this).call(this, 0, 4);
}
}, {
key: "leftEncode",
value: function() {
var r = this.data.substr(0, 4);
return vs(t.prototype.__proto__ || Object.getPrototypeOf(t.prototype), "leftEncode", this).call(this, r, "LLLL");
}
}, {
key: "rightText",
value: function() {
return vs(t.prototype.__proto__ || Object.getPrototypeOf(t.prototype), "rightText", this).call(this, 4, 4);
}
}, {
key: "rightEncode",
value: function() {
var r = this.data.substr(4, 4);
return vs(t.prototype.__proto__ || Object.getPrototypeOf(t.prototype), "rightEncode", this).call(this, r, "RRRR");
}
}]), t;
}(AN.default);
tp.default = TN;
var np = {};
Object.defineProperty(np, "__esModule", {
value: !0
});
var kN = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), ON = mi, RN = Xr, DN = Gy(RN), $N = Xn, IN = Gy($N);
function Gy(e) {
return e && e.__esModule ? e : { default: e };
}
function FN(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function MN(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function PN(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var LN = function(t) {
var i = t.split("").map(function(r) {
return +r;
}).reduce(function(r, n, a) {
return a % 2 ? r + n * 9 : r + n * 3;
}, 0);
return i % 10;
}, NN = function(e) {
PN(t, e);
function t(i, r) {
return FN(this, t), MN(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
return kN(t, [{
key: "valid",
value: function() {
return this.data.search(/^[0-9]{5}$/) !== -1;
}
}, {
key: "encode",
value: function() {
var r = ON.EAN5_STRUCTURE[LN(this.data)];
return {
data: "1011" + (0, DN.default)(this.data, r, "01"),
text: this.text
};
}
}]), t;
}(IN.default);
np.default = NN;
var ip = {};
Object.defineProperty(ip, "__esModule", {
value: !0
});
var BN = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), VN = mi, jN = Xr, UN = Ky(jN), zN = Xn, HN = Ky(zN);
function Ky(e) {
return e && e.__esModule ? e : { default: e };
}
function WN(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function GN(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function KN(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var YN = function(e) {
KN(t, e);
function t(i, r) {
return WN(this, t), GN(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
return BN(t, [{
key: "valid",
value: function() {
return this.data.search(/^[0-9]{2}$/) !== -1;
}
}, {
key: "encode",
value: function() {
var r = VN.EAN2_STRUCTURE[parseInt(this.data) % 4];
return {
data: "1011" + (0, UN.default)(this.data, r, "01"),
text: this.text
};
}
}]), t;
}(HN.default);
ip.default = YN;
var ul = {};
Object.defineProperty(ul, "__esModule", {
value: !0
});
var QN = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}();
ul.checksum = vc;
var JN = Xr, $o = Yy(JN), XN = Xn, ZN = Yy(XN);
function Yy(e) {
return e && e.__esModule ? e : { default: e };
}
function qN(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function eB(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function tB(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var nB = function(e) {
tB(t, e);
function t(i, r) {
qN(this, t), i.search(/^[0-9]{11}$/) !== -1 && (i += vc(i));
var n = eB(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
return n.displayValue = r.displayValue, r.fontSize > r.width * 10 ? n.fontSize = r.width * 10 : n.fontSize = r.fontSize, n.guardHeight = r.height + n.fontSize / 2 + r.textMargin, n;
}
return QN(t, [{
key: "valid",
value: function() {
return this.data.search(/^[0-9]{12}$/) !== -1 && this.data[11] == vc(this.data);
}
}, {
key: "encode",
value: function() {
return this.options.flat ? this.flatEncoding() : this.guardedEncoding();
}
}, {
key: "flatEncoding",
value: function() {
var r = "";
return r += "101", r += (0, $o.default)(this.data.substr(0, 6), "LLLLLL"), r += "01010", r += (0, $o.default)(this.data.substr(6, 6), "RRRRRR"), r += "101", {
data: r,
text: this.text
};
}
}, {
key: "guardedEncoding",
value: function() {
var r = [];
return this.displayValue && r.push({
data: "00000000",
text: this.text.substr(0, 1),
options: { textAlign: "left", fontSize: this.fontSize }
}), r.push({
data: "101" + (0, $o.default)(this.data[0], "L"),
options: { height: this.guardHeight }
}), r.push({
data: (0, $o.default)(this.data.substr(1, 5), "LLLLL"),
text: this.text.substr(1, 5),
options: { fontSize: this.fontSize }
}), r.push({
data: "01010",
options: { height: this.guardHeight }
}), r.push({
data: (0, $o.default)(this.data.substr(6, 5), "RRRRR"),
text: this.text.substr(6, 5),
options: { fontSize: this.fontSize }
}), r.push({
data: (0, $o.default)(this.data[11], "R") + "101",
options: { height: this.guardHeight }
}), this.displayValue && r.push({
data: "00000000",
text: this.text.substr(11, 1),
options: { textAlign: "right", fontSize: this.fontSize }
}), r;
}
}]), t;
}(ZN.default);
function vc(e) {
var t = 0, i;
for (i = 1; i < 11; i += 2)
t += parseInt(e[i]);
for (i = 0; i < 11; i += 2)
t += parseInt(e[i]) * 3;
return (10 - t % 10) % 10;
}
ul.default = nB;
var rp = {};
Object.defineProperty(rp, "__esModule", {
value: !0
});
var iB = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), rB = Xr, oB = Qy(rB), aB = Xn, lB = Qy(aB), sB = ul;
function Qy(e) {
return e && e.__esModule ? e : { default: e };
}
function uB(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function Qf(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function dB(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var fB = ["XX00000XXX", "XX10000XXX", "XX20000XXX", "XXX00000XX", "XXXX00000X", "XXXXX00005", "XXXXX00006", "XXXXX00007", "XXXXX00008", "XXXXX00009"], cB = [["EEEOOO", "OOOEEE"], ["EEOEOO", "OOEOEE"], ["EEOOEO", "OOEEOE"], ["EEOOOE", "OOEEEO"], ["EOEEOO", "OEOOEE"], ["EOOEEO", "OEEOOE"], ["EOOOEE", "OEEEOO"], ["EOEOEO", "OEOEOE"], ["EOEOOE", "OEOEEO"], ["EOOEOE", "OEEOEO"]], pB = function(e) {
dB(t, e);
function t(i, r) {
uB(this, t);
var n = Qf(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
if (n.isValid = !1, i.search(/^[0-9]{6}$/) !== -1)
n.middleDigits = i, n.upcA = xg(i, "0"), n.text = r.text || "" + n.upcA[0] + i + n.upcA[n.upcA.length - 1], n.isValid = !0;
else if (i.search(/^[01][0-9]{7}$/) !== -1)
if (n.middleDigits = i.substring(1, i.length - 1), n.upcA = xg(n.middleDigits, i[0]), n.upcA[n.upcA.length - 1] === i[i.length - 1])
n.isValid = !0;
else
return Qf(n);
else
return Qf(n);
return n.displayValue = r.displayValue, r.fontSize > r.width * 10 ? n.fontSize = r.width * 10 : n.fontSize = r.fontSize, n.guardHeight = r.height + n.fontSize / 2 + r.textMargin, n;
}
return iB(t, [{
key: "valid",
value: function() {
return this.isValid;
}
}, {
key: "encode",
value: function() {
return this.options.flat ? this.flatEncoding() : this.guardedEncoding();
}
}, {
key: "flatEncoding",
value: function() {
var r = "";
return r += "101", r += this.encodeMiddleDigits(), r += "010101", {
data: r,
text: this.text
};
}
}, {
key: "guardedEncoding",
value: function() {
var r = [];
return this.displayValue && r.push({
data: "00000000",
text: this.text[0],
options: { textAlign: "left", fontSize: this.fontSize }
}), r.push({
data: "101",
options: { height: this.guardHeight }
}), r.push({
data: this.encodeMiddleDigits(),
text: this.text.substring(1, 7),
options: { fontSize: this.fontSize }
}), r.push({
data: "010101",
options: { height: this.guardHeight }
}), this.displayValue && r.push({
data: "00000000",
text: this.text[7],
options: { textAlign: "right", fontSize: this.fontSize }
}), r;
}
}, {
key: "encodeMiddleDigits",
value: function() {
var r = this.upcA[0], n = this.upcA[this.upcA.length - 1], a = cB[parseInt(n)][parseInt(r)];
return (0, oB.default)(this.middleDigits, a);
}
}]), t;
}(lB.default);
function xg(e, t) {
for (var i = parseInt(e[e.length - 1]), r = fB[i], n = "", a = 0, s = 0; s < r.length; s++) {
var u = r[s];
u === "X" ? n += e[a++] : n += u;
}
return n = "" + t + n, "" + n + (0, sB.checksum)(n);
}
rp.default = pB;
Object.defineProperty(Yn, "__esModule", {
value: !0
});
Yn.UPCE = Yn.UPC = Yn.EAN2 = Yn.EAN5 = Yn.EAN8 = Yn.EAN13 = void 0;
var hB = ep, mB = qo(hB), vB = tp, gB = qo(vB), yB = np, bB = qo(yB), _B = ip, wB = qo(_B), AB = ul, CB = qo(AB), SB = rp, EB = qo(SB);
function qo(e) {
return e && e.__esModule ? e : { default: e };
}
Yn.EAN13 = mB.default;
Yn.EAN8 = gB.default;
Yn.EAN5 = bB.default;
Yn.EAN2 = wB.default;
Yn.UPC = CB.default;
Yn.UPCE = EB.default;
var Wo = {}, vu = {}, dl = {};
Object.defineProperty(dl, "__esModule", {
value: !0
});
dl.START_BIN = "1010";
dl.END_BIN = "11101";
dl.BINARIES = ["00110", "10001", "01001", "11000", "00101", "10100", "01100", "00011", "10010", "01010"];
Object.defineProperty(vu, "__esModule", {
value: !0
});
var xB = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), gs = dl, TB = Xn, kB = OB(TB);
function OB(e) {
return e && e.__esModule ? e : { default: e };
}
function RB(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function DB(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function $B(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var IB = function(e) {
$B(t, e);
function t() {
return RB(this, t), DB(this, (t.__proto__ || Object.getPrototypeOf(t)).apply(this, arguments));
}
return xB(t, [{
key: "valid",
value: function() {
return this.data.search(/^([0-9]{2})+$/) !== -1;
}
}, {
key: "encode",
value: function() {
var r = this, n = this.data.match(/.{2}/g).map(function(a) {
return r.encodePair(a);
}).join("");
return {
data: gs.START_BIN + n + gs.END_BIN,
text: this.text
};
}
}, {
key: "encodePair",
value: function(r) {
var n = gs.BINARIES[r[1]];
return gs.BINARIES[r[0]].split("").map(function(a, s) {
return (a === "1" ? "111" : "1") + (n[s] === "1" ? "000" : "0");
}).join("");
}
}]), t;
}(kB.default);
vu.default = IB;
var op = {};
Object.defineProperty(op, "__esModule", {
value: !0
});
var FB = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), MB = vu, PB = LB(MB);
function LB(e) {
return e && e.__esModule ? e : { default: e };
}
function NB(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function BB(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function VB(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var Tg = function(t) {
var i = t.substr(0, 13).split("").map(function(r) {
return parseInt(r, 10);
}).reduce(function(r, n, a) {
return r + n * (3 - a % 2 * 2);
}, 0);
return Math.ceil(i / 10) * 10 - i;
}, jB = function(e) {
VB(t, e);
function t(i, r) {
return NB(this, t), i.search(/^[0-9]{13}$/) !== -1 && (i += Tg(i)), BB(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
return FB(t, [{
key: "valid",
value: function() {
return this.data.search(/^[0-9]{14}$/) !== -1 && +this.data[13] === Tg(this.data);
}
}]), t;
}(PB.default);
op.default = jB;
Object.defineProperty(Wo, "__esModule", {
value: !0
});
Wo.ITF14 = Wo.ITF = void 0;
var UB = vu, zB = Jy(UB), HB = op, WB = Jy(HB);
function Jy(e) {
return e && e.__esModule ? e : { default: e };
}
Wo.ITF = zB.default;
Wo.ITF14 = WB.default;
var ci = {}, Zr = {};
Object.defineProperty(Zr, "__esModule", {
value: !0
});
var GB = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), KB = Xn, YB = QB(KB);
function QB(e) {
return e && e.__esModule ? e : { default: e };
}
function JB(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function XB(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function ZB(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var qB = function(e) {
ZB(t, e);
function t(i, r) {
return JB(this, t), XB(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
return GB(t, [{
key: "encode",
value: function() {
for (var r = "110", n = 0; n < this.data.length; n++) {
var a = parseInt(this.data[n]), s = a.toString(2);
s = e8(s, 4 - s.length);
for (var u = 0; u < s.length; u++)
r += s[u] == "0" ? "100" : "110";
}
return r += "1001", {
data: r,
text: this.text
};
}
}, {
key: "valid",
value: function() {
return this.data.search(/^[0-9]+$/) !== -1;
}
}]), t;
}(YB.default);
function e8(e, t) {
for (var i = 0; i < t; i++)
e = "0" + e;
return e;
}
Zr.default = qB;
var ap = {}, qr = {};
Object.defineProperty(qr, "__esModule", {
value: !0
});
qr.mod10 = t8;
qr.mod11 = n8;
function t8(e) {
for (var t = 0, i = 0; i < e.length; i++) {
var r = parseInt(e[i]);
(i + e.length) % 2 === 0 ? t += r : t += r * 2 % 10 + Math.floor(r * 2 / 10);
}
return (10 - t % 10) % 10;
}
function n8(e) {
for (var t = 0, i = [2, 3, 4, 5, 6, 7], r = 0; r < e.length; r++) {
var n = parseInt(e[e.length - 1 - r]);
t += i[r % i.length] * n;
}
return (11 - t % 11) % 11;
}
Object.defineProperty(ap, "__esModule", {
value: !0
});
var i8 = Zr, r8 = a8(i8), o8 = qr;
function a8(e) {
return e && e.__esModule ? e : { default: e };
}
function l8(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function s8(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function u8(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var d8 = function(e) {
u8(t, e);
function t(i, r) {
return l8(this, t), s8(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i + (0, o8.mod10)(i), r));
}
return t;
}(r8.default);
ap.default = d8;
var lp = {};
Object.defineProperty(lp, "__esModule", {
value: !0
});
var f8 = Zr, c8 = h8(f8), p8 = qr;
function h8(e) {
return e && e.__esModule ? e : { default: e };
}
function m8(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function v8(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function g8(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var y8 = function(e) {
g8(t, e);
function t(i, r) {
return m8(this, t), v8(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i + (0, p8.mod11)(i), r));
}
return t;
}(c8.default);
lp.default = y8;
var sp = {};
Object.defineProperty(sp, "__esModule", {
value: !0
});
var b8 = Zr, _8 = w8(b8), kg = qr;
function w8(e) {
return e && e.__esModule ? e : { default: e };
}
function A8(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function C8(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function S8(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var E8 = function(e) {
S8(t, e);
function t(i, r) {
return A8(this, t), i += (0, kg.mod10)(i), i += (0, kg.mod10)(i), C8(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
return t;
}(_8.default);
sp.default = E8;
var up = {};
Object.defineProperty(up, "__esModule", {
value: !0
});
var x8 = Zr, T8 = k8(x8), Og = qr;
function k8(e) {
return e && e.__esModule ? e : { default: e };
}
function O8(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function R8(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function D8(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var $8 = function(e) {
D8(t, e);
function t(i, r) {
return O8(this, t), i += (0, Og.mod11)(i), i += (0, Og.mod10)(i), R8(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
return t;
}(T8.default);
up.default = $8;
Object.defineProperty(ci, "__esModule", {
value: !0
});
ci.MSI1110 = ci.MSI1010 = ci.MSI11 = ci.MSI10 = ci.MSI = void 0;
var I8 = Zr, F8 = fl(I8), M8 = ap, P8 = fl(M8), L8 = lp, N8 = fl(L8), B8 = sp, V8 = fl(B8), j8 = up, U8 = fl(j8);
function fl(e) {
return e && e.__esModule ? e : { default: e };
}
ci.MSI = F8.default;
ci.MSI10 = P8.default;
ci.MSI11 = N8.default;
ci.MSI1010 = V8.default;
ci.MSI1110 = U8.default;
var gu = {};
Object.defineProperty(gu, "__esModule", {
value: !0
});
gu.pharmacode = void 0;
var z8 = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), H8 = Xn, W8 = G8(H8);
function G8(e) {
return e && e.__esModule ? e : { default: e };
}
function K8(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function Y8(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function Q8(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var J8 = function(e) {
Q8(t, e);
function t(i, r) {
K8(this, t);
var n = Y8(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
return n.number = parseInt(i, 10), n;
}
return z8(t, [{
key: "encode",
value: function() {
for (var r = this.number, n = ""; !isNaN(r) && r != 0; )
r % 2 === 0 ? (n = "11100" + n, r = (r - 2) / 2) : (n = "100" + n, r = (r - 1) / 2);
return n = n.slice(0, -2), {
data: n,
text: this.text
};
}
}, {
key: "valid",
value: function() {
return this.number >= 3 && this.number <= 131070;
}
}]), t;
}(W8.default);
gu.pharmacode = J8;
var yu = {};
Object.defineProperty(yu, "__esModule", {
value: !0
});
yu.codabar = void 0;
var X8 = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), Z8 = Xn, q8 = e5(Z8);
function e5(e) {
return e && e.__esModule ? e : { default: e };
}
function t5(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function n5(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function i5(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var r5 = function(e) {
i5(t, e);
function t(i, r) {
t5(this, t), i.search(/^[0-9\-\$\:\.\+\/]+$/) === 0 && (i = "A" + i + "A");
var n = n5(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i.toUpperCase(), r));
return n.text = n.options.text || n.text.replace(/[A-D]/g, ""), n;
}
return X8(t, [{
key: "valid",
value: function() {
return this.data.search(/^[A-D][0-9\-\$\:\.\+\/]+[A-D]$/) !== -1;
}
}, {
key: "encode",
value: function() {
for (var r = [], n = this.getEncodings(), a = 0; a < this.data.length; a++)
r.push(n[this.data.charAt(a)]), a !== this.data.length - 1 && r.push("0");
return {
text: this.text,
data: r.join("")
};
}
}, {
key: "getEncodings",
value: function() {
return {
0: "101010011",
1: "101011001",
2: "101001011",
3: "110010101",
4: "101101001",
5: "110101001",
6: "100101011",
7: "100101101",
8: "100110101",
9: "110100101",
"-": "101001101",
$: "101100101",
":": "1101011011",
"/": "1101101011",
".": "1101101101",
"+": "1011011011",
A: "1011001001",
B: "1001001011",
C: "1010010011",
D: "1010011001"
};
}
}]), t;
}(q8.default);
yu.codabar = r5;
var bu = {};
Object.defineProperty(bu, "__esModule", {
value: !0
});
bu.GenericBarcode = void 0;
var o5 = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), a5 = Xn, l5 = s5(a5);
function s5(e) {
return e && e.__esModule ? e : { default: e };
}
function u5(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function d5(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function f5(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var c5 = function(e) {
f5(t, e);
function t(i, r) {
return u5(this, t), d5(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
return o5(t, [{
key: "encode",
value: function() {
return {
data: "10101010101010101010101010101010101010101",
text: this.text
};
}
}, {
key: "valid",
value: function() {
return !0;
}
}]), t;
}(l5.default);
bu.GenericBarcode = c5;
Object.defineProperty(Kc, "__esModule", {
value: !0
});
var p5 = pu, ys = Bi, Io = Yn, Rg = Wo, Ba = ci, h5 = gu, m5 = yu, v5 = bu;
Kc.default = {
CODE39: p5.CODE39,
CODE128: ys.CODE128,
CODE128A: ys.CODE128A,
CODE128B: ys.CODE128B,
CODE128C: ys.CODE128C,
EAN13: Io.EAN13,
EAN8: Io.EAN8,
EAN5: Io.EAN5,
EAN2: Io.EAN2,
UPC: Io.UPC,
UPCE: Io.UPCE,
ITF14: Rg.ITF14,
ITF: Rg.ITF,
MSI: Ba.MSI,
MSI10: Ba.MSI10,
MSI11: Ba.MSI11,
MSI1010: Ba.MSI1010,
MSI1110: Ba.MSI1110,
pharmacode: h5.pharmacode,
codabar: m5.codabar,
GenericBarcode: v5.GenericBarcode
};
var ea = {};
Object.defineProperty(ea, "__esModule", {
value: !0
});
var g5 = Object.assign || function(e) {
for (var t = 1; t < arguments.length; t++) {
var i = arguments[t];
for (var r in i)
Object.prototype.hasOwnProperty.call(i, r) && (e[r] = i[r]);
}
return e;
};
ea.default = function(e, t) {
return g5({}, e, t);
};
var dp = {};
Object.defineProperty(dp, "__esModule", {
value: !0
});
dp.default = y5;
function y5(e) {
var t = [];
function i(r) {
if (Array.isArray(r))
for (var n = 0; n < r.length; n++)
i(r[n]);
else
r.text = r.text || "", r.data = r.data || "", t.push(r);
}
return i(e), t;
}
var fp = {};
Object.defineProperty(fp, "__esModule", {
value: !0
});
fp.default = b5;
function b5(e) {
return e.marginTop = e.marginTop || e.margin, e.marginBottom = e.marginBottom || e.margin, e.marginRight = e.marginRight || e.margin, e.marginLeft = e.marginLeft || e.margin, e;
}
var cp = {}, pp = {}, _u = {};
Object.defineProperty(_u, "__esModule", {
value: !0
});
_u.default = _5;
function _5(e) {
var t = ["width", "height", "textMargin", "fontSize", "margin", "marginTop", "marginBottom", "marginLeft", "marginRight"];
for (var i in t)
t.hasOwnProperty(i) && (i = t[i], typeof e[i] == "string" && (e[i] = parseInt(e[i], 10)));
return typeof e.displayValue == "string" && (e.displayValue = e.displayValue != "false"), e;
}
var wu = {};
Object.defineProperty(wu, "__esModule", {
value: !0
});
var w5 = {
width: 2,
height: 100,
format: "auto",
displayValue: !0,
fontOptions: "",
font: "monospace",
text: void 0,
textAlign: "center",
textPosition: "bottom",
textMargin: 2,
fontSize: 20,
background: "#ffffff",
lineColor: "#000000",
margin: 10,
marginTop: void 0,
marginBottom: void 0,
marginLeft: void 0,
marginRight: void 0,
valid: function() {
}
};
wu.default = w5;
Object.defineProperty(pp, "__esModule", {
value: !0
});
var A5 = _u, C5 = Xy(A5), S5 = wu, Dg = Xy(S5);
function Xy(e) {
return e && e.__esModule ? e : { default: e };
}
function E5(e) {
var t = {};
for (var i in Dg.default)
Dg.default.hasOwnProperty(i) && (e.hasAttribute("jsbarcode-" + i.toLowerCase()) && (t[i] = e.getAttribute("jsbarcode-" + i.toLowerCase())), e.hasAttribute("data-" + i.toLowerCase()) && (t[i] = e.getAttribute("data-" + i.toLowerCase())));
return t.value = e.getAttribute("jsbarcode-value") || e.getAttribute("data-value"), t = (0, C5.default)(t), t;
}
pp.default = E5;
var hp = {}, mp = {}, oi = {};
Object.defineProperty(oi, "__esModule", {
value: !0
});
oi.getTotalWidthOfEncodings = oi.calculateEncodingAttributes = oi.getBarcodePadding = oi.getEncodingHeight = oi.getMaximumHeightOfEncodings = void 0;
var x5 = ea, T5 = k5(x5);
function k5(e) {
return e && e.__esModule ? e : { default: e };
}
function Zy(e, t) {
return t.height + (t.displayValue && e.text.length > 0 ? t.fontSize + t.textMargin : 0) + t.marginTop + t.marginBottom;
}
function qy(e, t, i) {
if (i.displayValue && t < e) {
if (i.textAlign == "center")
return Math.floor((e - t) / 2);
if (i.textAlign == "left")
return 0;
if (i.textAlign == "right")
return Math.floor(e - t);
}
return 0;
}
function O5(e, t, i) {
for (var r = 0; r < e.length; r++) {
var n = e[r], a = (0, T5.default)(t, n.options), s;
a.displayValue ? s = $5(n.text, a, i) : s = 0;
var u = n.data.length * a.width;
n.width = Math.ceil(Math.max(s, u)), n.height = Zy(n, a), n.barcodePadding = qy(s, u, a);
}
}
function R5(e) {
for (var t = 0, i = 0; i < e.length; i++)
t += e[i].width;
return t;
}
function D5(e) {
for (var t = 0, i = 0; i < e.length; i++)
e[i].height > t && (t = e[i].height);
return t;
}
function $5(e, t, i) {
var r;
if (i)
r = i;
else if (typeof document < "u")
r = document.createElement("canvas").getContext("2d");
else
return 0;
r.font = t.fontOptions + " " + t.fontSize + "px " + t.font;
var n = r.measureText(e);
if (!n)
return 0;
var a = n.width;
return a;
}
oi.getMaximumHeightOfEncodings = D5;
oi.getEncodingHeight = Zy;
oi.getBarcodePadding = qy;
oi.calculateEncodingAttributes = O5;
oi.getTotalWidthOfEncodings = R5;
Object.defineProperty(mp, "__esModule", {
value: !0
});
var I5 = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), F5 = ea, M5 = P5(F5), Jf = oi;
function P5(e) {
return e && e.__esModule ? e : { default: e };
}
function L5(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
var N5 = function() {
function e(t, i, r) {
L5(this, e), this.canvas = t, this.encodings = i, this.options = r;
}
return I5(e, [{
key: "render",
value: function() {
if (!this.canvas.getContext)
throw new Error("The browser does not support canvas.");
this.prepareCanvas();
for (var i = 0; i < this.encodings.length; i++) {
var r = (0, M5.default)(this.options, this.encodings[i].options);
this.drawCanvasBarcode(r, this.encodings[i]), this.drawCanvasText(r, this.encodings[i]), this.moveCanvasDrawing(this.encodings[i]);
}
this.restoreCanvas();
}
}, {
key: "prepareCanvas",
value: function() {
var i = this.canvas.getContext("2d");
i.save(), (0, Jf.calculateEncodingAttributes)(this.encodings, this.options, i);
var r = (0, Jf.getTotalWidthOfEncodings)(this.encodings), n = (0, Jf.getMaximumHeightOfEncodings)(this.encodings);
this.canvas.width = r + this.options.marginLeft + this.options.marginRight, this.canvas.height = n, i.clearRect(0, 0, this.canvas.width, this.canvas.height), this.options.background && (i.fillStyle = this.options.background, i.fillRect(0, 0, this.canvas.width, this.canvas.height)), i.translate(this.options.marginLeft, 0);
}
}, {
key: "drawCanvasBarcode",
value: function(i, r) {
var n = this.canvas.getContext("2d"), a = r.data, s;
i.textPosition == "top" ? s = i.marginTop + i.fontSize + i.textMargin : s = i.marginTop, n.fillStyle = i.lineColor;
for (var u = 0; u < a.length; u++) {
var d = u * i.width + r.barcodePadding;
a[u] === "1" ? n.fillRect(d, s, i.width, i.height) : a[u] && n.fillRect(d, s, i.width, i.height * a[u]);
}
}
}, {
key: "drawCanvasText",
value: function(i, r) {
var n = this.canvas.getContext("2d"), a = i.fontOptions + " " + i.fontSize + "px " + i.font;
if (i.displayValue) {
var s, u;
i.textPosition == "top" ? u = i.marginTop + i.fontSize - i.textMargin : u = i.height + i.textMargin + i.marginTop + i.fontSize, n.font = a, i.textAlign == "left" || r.barcodePadding > 0 ? (s = 0, n.textAlign = "left") : i.textAlign == "right" ? (s = r.width - 1, n.textAlign = "right") : (s = r.width / 2, n.textAlign = "center"), n.fillText(r.text, s, u);
}
}
}, {
key: "moveCanvasDrawing",
value: function(i) {
var r = this.canvas.getContext("2d");
r.translate(i.width, 0);
}
}, {
key: "restoreCanvas",
value: function() {
var i = this.canvas.getContext("2d");
i.restore();
}
}]), e;
}();
mp.default = N5;
var vp = {};
Object.defineProperty(vp, "__esModule", {
value: !0
});
var B5 = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}(), V5 = ea, j5 = U5(V5), Xf = oi;
function U5(e) {
return e && e.__esModule ? e : { default: e };
}
function z5(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
var bs = "http://www.w3.org/2000/svg", H5 = function() {
function e(t, i, r) {
z5(this, e), this.svg = t, this.encodings = i, this.options = r, this.document = r.xmlDocument || document;
}
return B5(e, [{
key: "render",
value: function() {
var i = this.options.marginLeft;
this.prepareSVG();
for (var r = 0; r < this.encodings.length; r++) {
var n = this.encodings[r], a = (0, j5.default)(this.options, n.options), s = this.createGroup(i, a.marginTop, this.svg);
this.setGroupOptions(s, a), this.drawSvgBarcode(s, a, n), this.drawSVGText(s, a, n), i += n.width;
}
}
}, {
key: "prepareSVG",
value: function() {
for (; this.svg.firstChild; )
this.svg.removeChild(this.svg.firstChild);
(0, Xf.calculateEncodingAttributes)(this.encodings, this.options);
var i = (0, Xf.getTotalWidthOfEncodings)(this.encodings), r = (0, Xf.getMaximumHeightOfEncodings)(this.encodings), n = i + this.options.marginLeft + this.options.marginRight;
this.setSvgAttributes(n, r), this.options.background && this.drawRect(0, 0, n, r, this.svg).setAttribute("style", "fill:" + this.options.background + ";");
}
}, {
key: "drawSvgBarcode",
value: function(i, r, n) {
var a = n.data, s;
r.textPosition == "top" ? s = r.fontSize + r.textMargin : s = 0;
for (var u = 0, d = 0, h = 0; h < a.length; h++)
d = h * r.width + n.barcodePadding, a[h] === "1" ? u++ : u > 0 && (this.drawRect(d - r.width * u, s, r.width * u, r.height, i), u = 0);
u > 0 && this.drawRect(d - r.width * (u - 1), s, r.width * u, r.height, i);
}
}, {
key: "drawSVGText",
value: function(i, r, n) {
var a = this.document.createElementNS(bs, "text");
if (r.displayValue) {
var s, u;
a.setAttribute("style", "font:" + r.fontOptions + " " + r.fontSize + "px " + r.font), r.textPosition == "top" ? u = r.fontSize - r.textMargin : u = r.height + r.textMargin + r.fontSize, r.textAlign == "left" || n.barcodePadding > 0 ? (s = 0, a.setAttribute("text-anchor", "start")) : r.textAlign == "right" ? (s = n.width - 1, a.setAttribute("text-anchor", "end")) : (s = n.width / 2, a.setAttribute("text-anchor", "middle")), a.setAttribute("x", s), a.setAttribute("y", u), a.appendChild(this.document.createTextNode(n.text)), i.appendChild(a);
}
}
}, {
key: "setSvgAttributes",
value: function(i, r) {
var n = this.svg;
n.setAttribute("width", i + "px"), n.setAttribute("height", r + "px"), n.setAttribute("x", "0px"), n.setAttribute("y", "0px"), n.setAttribute("viewBox", "0 0 " + i + " " + r), n.setAttribute("xmlns", bs), n.setAttribute("version", "1.1"), n.setAttribute("style", "transform: translate(0,0)");
}
}, {
key: "createGroup",
value: function(i, r, n) {
var a = this.document.createElementNS(bs, "g");
return a.setAttribute("transform", "translate(" + i + ", " + r + ")"), n.appendChild(a), a;
}
}, {
key: "setGroupOptions",
value: function(i, r) {
i.setAttribute("style", "fill:" + r.lineColor + ";");
}
}, {
key: "drawRect",
value: function(i, r, n, a, s) {
var u = this.document.createElementNS(bs, "rect");
return u.setAttribute("x", i), u.setAttribute("y", r), u.setAttribute("width", n), u.setAttribute("height", a), s.appendChild(u), u;
}
}]), e;
}();
vp.default = H5;
var gp = {};
Object.defineProperty(gp, "__esModule", {
value: !0
});
var W5 = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}();
function G5(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
var K5 = function() {
function e(t, i, r) {
G5(this, e), this.object = t, this.encodings = i, this.options = r;
}
return W5(e, [{
key: "render",
value: function() {
this.object.encodings = this.encodings;
}
}]), e;
}();
gp.default = K5;
Object.defineProperty(hp, "__esModule", {
value: !0
});
var Y5 = mp, Q5 = yp(Y5), J5 = vp, X5 = yp(J5), Z5 = gp, q5 = yp(Z5);
function yp(e) {
return e && e.__esModule ? e : { default: e };
}
hp.default = { CanvasRenderer: Q5.default, SVGRenderer: X5.default, ObjectRenderer: q5.default };
var ta = {};
Object.defineProperty(ta, "__esModule", {
value: !0
});
function bp(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
function _p(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
function wp(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
var e4 = function(e) {
wp(t, e);
function t(i, r) {
bp(this, t);
var n = _p(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this));
return n.name = "InvalidInputException", n.symbology = i, n.input = r, n.message = '"' + n.input + '" is not a valid input for ' + n.symbology, n;
}
return t;
}(Error), t4 = function(e) {
wp(t, e);
function t() {
bp(this, t);
var i = _p(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this));
return i.name = "InvalidElementException", i.message = "Not supported type to render on", i;
}
return t;
}(Error), n4 = function(e) {
wp(t, e);
function t() {
bp(this, t);
var i = _p(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this));
return i.name = "NoElementException", i.message = "No element to render on.", i;
}
return t;
}(Error);
ta.InvalidInputException = e4;
ta.InvalidElementException = t4;
ta.NoElementException = n4;
Object.defineProperty(cp, "__esModule", {
value: !0
});
var i4 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(e) {
return typeof e;
} : function(e) {
return e && typeof Symbol == "function" && e.constructor === Symbol && e !== Symbol.prototype ? "symbol" : typeof e;
}, r4 = pp, gc = eb(r4), o4 = hp, Wa = eb(o4), a4 = ta;
function eb(e) {
return e && e.__esModule ? e : { default: e };
}
function Ap(e) {
if (typeof e == "string")
return l4(e);
if (Array.isArray(e)) {
for (var t = [], i = 0; i < e.length; i++)
t.push(Ap(e[i]));
return t;
} else {
if (typeof HTMLCanvasElement < "u" && e instanceof HTMLImageElement)
return s4(e);
if (e && e.nodeName && e.nodeName.toLowerCase() === "svg" || typeof SVGElement < "u" && e instanceof SVGElement)
return {
element: e,
options: (0, gc.default)(e),
renderer: Wa.default.SVGRenderer
};
if (typeof HTMLCanvasElement < "u" && e instanceof HTMLCanvasElement)
return {
element: e,
options: (0, gc.default)(e),
renderer: Wa.default.CanvasRenderer
};
if (e && e.getContext)
return {
element: e,
renderer: Wa.default.CanvasRenderer
};
if (e && (typeof e > "u" ? "undefined" : i4(e)) === "object" && !e.nodeName)
return {
element: e,
renderer: Wa.default.ObjectRenderer
};
throw new a4.InvalidElementException();
}
}
function l4(e) {
var t = document.querySelectorAll(e);
if (t.length !== 0) {
for (var i = [], r = 0; r < t.length; r++)
i.push(Ap(t[r]));
return i;
}
}
function s4(e) {
var t = document.createElement("canvas");
return {
element: t,
options: (0, gc.default)(e),
renderer: Wa.default.CanvasRenderer,
afterRender: function() {
e.setAttribute("src", t.toDataURL());
}
};
}
cp.default = Ap;
var Cp = {};
Object.defineProperty(Cp, "__esModule", {
value: !0
});
var u4 = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
}
}
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
}();
function d4(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
var f4 = function() {
function e(t) {
d4(this, e), this.api = t;
}
return u4(e, [{
key: "handleCatch",
value: function(i) {
if (i.name === "InvalidInputException")
if (this.api._options.valid !== this.api._defaults.valid)
this.api._options.valid(!1);
else
throw i.message;
else
throw i;
this.api.render = function() {
};
}
}, {
key: "wrapBarcodeCall",
value: function(i) {
try {
var r = i.apply(void 0, arguments);
return this.api._options.valid(!0), r;
} catch (n) {
return this.handleCatch(n), this.api;
}
}
}]), e;
}();
Cp.default = f4;
var c4 = Kc, Wr = Or(c4), p4 = ea, cl = Or(p4), h4 = dp, tb = Or(h4), m4 = fp, $g = Or(m4), v4 = cp, g4 = Or(v4), y4 = _u, b4 = Or(y4), _4 = Cp, w4 = Or(_4), nb = ta, A4 = wu, ib = Or(A4);
function Or(e) {
return e && e.__esModule ? e : { default: e };
}
var ir = function() {
}, Au = function(t, i, r) {
var n = new ir();
if (typeof t > "u")
throw Error("No element to render on was provided.");
return n._renderProperties = (0, g4.default)(t), n._encodings = [], n._options = ib.default, n._errorHandler = new w4.default(n), typeof i < "u" && (r = r || {}, r.format || (r.format = ob()), n.options(r)[r.format](i, r).render()), n;
};
Au.getModule = function(e) {
return Wr.default[e];
};
for (var Ig in Wr.default)
Wr.default.hasOwnProperty(Ig) && C4(Wr.default, Ig);
function C4(e, t) {
ir.prototype[t] = ir.prototype[t.toUpperCase()] = ir.prototype[t.toLowerCase()] = function(i, r) {
var n = this;
return n._errorHandler.wrapBarcodeCall(function() {
r.text = typeof r.text > "u" ? void 0 : "" + r.text;
var a = (0, cl.default)(n._options, r);
a = (0, b4.default)(a);
var s = e[t], u = rb(i, s, a);
return n._encodings.push(u), n;
});
};
}
function rb(e, t, i) {
e = "" + e;
var r = new t(e, i);
if (!r.valid())
throw new nb.InvalidInputException(r.constructor.name, e);
var n = r.encode();
n = (0, tb.default)(n);
for (var a = 0; a < n.length; a++)
n[a].options = (0, cl.default)(i, n[a].options);
return n;
}
function ob() {
return Wr.default.CODE128 ? "CODE128" : Object.keys(Wr.default)[0];
}
ir.prototype.options = function(e) {
return this._options = (0, cl.default)(this._options, e), this;
};
ir.prototype.blank = function(e) {
var t = new Array(e + 1).join("0");
return this._encodings.push({ data: t }), this;
};
ir.prototype.init = function() {
if (!!this._renderProperties) {
Array.isArray(this._renderProperties) || (this._renderProperties = [this._renderProperties]);
var e;
for (var t in this._renderProperties) {
e = this._renderProperties[t];
var i = (0, cl.default)(this._options, e.options);
i.format == "auto" && (i.format = ob()), this._errorHandler.wrapBarcodeCall(function() {
var r = i.value, n = Wr.default[i.format.toUpperCase()], a = rb(r, n, i);
yc(e, a, i);
});
}
}
};
ir.prototype.render = function() {
if (!this._renderProperties)
throw new nb.NoElementException();
if (Array.isArray(this._renderProperties))
for (var e = 0; e < this._renderProperties.length; e++)
yc(this._renderProperties[e], this._encodings, this._options);
else
yc(this._renderProperties, this._encodings, this._options);
return this;
};
ir.prototype._defaults = ib.default;
function yc(e, t, i) {
t = (0, tb.default)(t);
for (var r = 0; r < t.length; r++)
t[r].options = (0, cl.default)(i, t[r].options), (0, $g.default)(t[r].options);
(0, $g.default)(i);
var n = e.renderer, a = new n(e.element, t, i);
a.render(), e.afterRender && e.afterRender();
}
typeof window < "u" && (window.JsBarcode = Au);
typeof jQuery < "u" && (jQuery.fn.JsBarcode = function(e, t) {
var i = [];
return jQuery(this).each(function() {
i.push(this);
}), Au(i, e, t);
});
var S4 = Au;
const E4 = Ve({
name: "BarCodeBox",
data() {
return {};
},
props: {
value: String,
format: String,
displayValue: {
type: Boolean,
default: !0
},
fontSize: Number,
textPosition: String,
textAlign: String,
textMargin: Number,
width: {
type: Number,
default: 2
},
height: {
type: Number,
default: 50
},
background: String,
lineColor: String
},
methods: {},
computed: {},
components: {},
watch: {
$props: {
handler() {
const e = this.value, t = {};
Object.keys(this.$props).forEach((i) => {
this.$props[i] != null && this.$props[i] !== "" && (t[i] = this.$props[i]);
}), delete t.value, delete t.formCreateInject, this.$nextTick(() => {
S4(this.$refs.bar, e || "", t);
});
},
deep: !0,
immediate: !0
}
}
}), x4 = {
class: "_fc-barcode",
ref: "bar"
};
function T4(e, t, i, r, n, a) {
return W(), ae("img", x4, null, 512);
}
const k4 = /* @__PURE__ */ je(E4, [["render", T4]]);
const O4 = Ve({
name: "IframeBox",
emits: ["load"],
data() {
return {};
},
props: {
src: String,
loading: String
}
}), R4 = ["src"];
function D4(e, t, i, r, n, a) {
return W(), ae("iframe", {
class: "_fc-iframe-box",
src: e.src,
frameborder: "0",
onLoad: t[0] || (t[0] = (s) => e.$emit("load", s))
}, null, 40, R4);
}
const $4 = /* @__PURE__ */ je(O4, [["render", D4]]);
var ab = { exports: {} };
(function(e, t) {
(function(i, r) {
e.exports = r();
})(Oc, () => (() => {
var i = { 873: (s, u) => {
var d, h, p = function() {
var g = function(H, I) {
var U = H, F = m[I], C = null, q = 0, X = null, Y = [], ue = {}, ee = function(O, K) {
C = function(J) {
for (var ne = new Array(J), re = 0; re < J; re += 1) {
ne[re] = new Array(J);
for (var fe = 0; fe < J; fe += 1)
ne[re][fe] = null;
}
return ne;
}(q = 4 * U + 17), pe(0, 0), pe(q - 7, 0), pe(0, q - 7), ve(), Te(), we(O, K), U >= 7 && me(O), X == null && (X = Se(U, F, Y)), he(X, K);
}, pe = function(O, K) {
for (var J = -1; J <= 7; J += 1)
if (!(O + J <= -1 || q <= O + J))
for (var ne = -1; ne <= 7; ne += 1)
K + ne <= -1 || q <= K + ne || (C[O + J][K + ne] = 0 <= J && J <= 6 && (ne == 0 || ne == 6) || 0 <= ne && ne <= 6 && (J == 0 || J == 6) || 2 <= J && J <= 4 && 2 <= ne && ne <= 4);
}, Te = function() {
for (var O = 8; O < q - 8; O += 1)
C[O][6] == null && (C[O][6] = O % 2 == 0);
for (var K = 8; K < q - 8; K += 1)
C[6][K] == null && (C[6][K] = K % 2 == 0);
}, ve = function() {
for (var O = y.getPatternPosition(U), K = 0; K < O.length; K += 1)
for (var J = 0; J < O.length; J += 1) {
var ne = O[K], re = O[J];
if (C[ne][re] == null)
for (var fe = -2; fe <= 2; fe += 1)
for (var Ae = -2; Ae <= 2; Ae += 1)
C[ne + fe][re + Ae] = fe == -2 || fe == 2 || Ae == -2 || Ae == 2 || fe == 0 && Ae == 0;
}
}, me = function(O) {
for (var K = y.getBCHTypeNumber(U), J = 0; J < 18; J += 1) {
var ne = !O && (K >> J & 1) == 1;
C[Math.floor(J / 3)][J % 3 + q - 8 - 3] = ne;
}
for (J = 0; J < 18; J += 1)
ne = !O && (K >> J & 1) == 1, C[J % 3 + q - 8 - 3][Math.floor(J / 3)] = ne;
}, we = function(O, K) {
for (var J = F << 3 | K, ne = y.getBCHTypeInfo(J), re = 0; re < 15; re += 1) {
var fe = !O && (ne >> re & 1) == 1;
re < 6 ? C[re][8] = fe : re < 8 ? C[re + 1][8] = fe : C[q - 15 + re][8] = fe;
}
for (re = 0; re < 15; re += 1)
fe = !O && (ne >> re & 1) == 1, re < 8 ? C[8][q - re - 1] = fe : re < 9 ? C[8][15 - re - 1 + 1] = fe : C[8][15 - re - 1] = fe;
C[q - 8][8] = !O;
}, he = function(O, K) {
for (var J = -1, ne = q - 1, re = 7, fe = 0, Ae = y.getMaskFunction(K), Fe = q - 1; Fe > 0; Fe -= 2)
for (Fe == 6 && (Fe -= 1); ; ) {
for (var Xe = 0; Xe < 2; Xe += 1)
if (C[ne][Fe - Xe] == null) {
var Ze = !1;
fe < O.length && (Ze = (O[fe] >>> re & 1) == 1), Ae(ne, Fe - Xe) && (Ze = !Ze), C[ne][Fe - Xe] = Ze, (re -= 1) == -1 && (fe += 1, re = 7);
}
if ((ne += J) < 0 || q <= ne) {
ne -= J, J = -J;
break;
}
}
}, Se = function(O, K, J) {
for (var ne = k.getRSBlocks(O, K), re = D(), fe = 0; fe < J.length; fe += 1) {
var Ae = J[fe];
re.put(Ae.getMode(), 4), re.put(Ae.getLength(), y.getLengthInBits(Ae.getMode(), O)), Ae.write(re);
}
var Fe = 0;
for (fe = 0; fe < ne.length; fe += 1)
Fe += ne[fe].dataCount;
if (re.getLengthInBits() > 8 * Fe)
throw "code length overflow. (" + re.getLengthInBits() + ">" + 8 * Fe + ")";
for (re.getLengthInBits() + 4 <= 8 * Fe && re.put(0, 4); re.getLengthInBits() % 8 != 0; )
re.putBit(!1);
for (; !(re.getLengthInBits() >= 8 * Fe || (re.put(236, 8), re.getLengthInBits() >= 8 * Fe)); )
re.put(17, 8);
return function(Xe, Ze) {
for (var be = 0, Le = 0, ke = 0, it = new Array(Ze.length), pt = new Array(Ze.length), De = 0; De < Ze.length; De += 1) {
var ze = Ze[De].dataCount, at = Ze[De].totalCount - ze;
Le = Math.max(Le, ze), ke = Math.max(ke, at), it[De] = new Array(ze);
for (var He = 0; He < it[De].length; He += 1)
it[De][He] = 255 & Xe.getBuffer()[He + be];
be += ze;
var Rt = y.getErrorCorrectPolynomial(at), ft = x(it[De], Rt.getLength() - 1).mod(Rt);
for (pt[De] = new Array(Rt.getLength() - 1), He = 0; He < pt[De].length; He += 1) {
var Be = He + ft.getLength() - pt[De].length;
pt[De][He] = Be >= 0 ? ft.getAt(Be) : 0;
}
}
var Je = 0;
for (He = 0; He < Ze.length; He += 1)
Je += Ze[He].totalCount;
var ht = new Array(Je), We = 0;
for (He = 0; He < Le; He += 1)
for (De = 0; De < Ze.length; De += 1)
He < it[De].length && (ht[We] = it[De][He], We += 1);
for (He = 0; He < ke; He += 1)
for (De = 0; De < Ze.length; De += 1)
He < pt[De].length && (ht[We] = pt[De][He], We += 1);
return ht;
}(re, ne);
};
ue.addData = function(O, K) {
var J = null;
switch (K = K || "Byte") {
case "Numeric":
J = P(O);
break;
case "Alphanumeric":
J = M(O);
break;
case "Byte":
J = B(O);
break;
case "Kanji":
J = T(O);
break;
default:
throw "mode:" + K;
}
Y.push(J), X = null;
}, ue.isDark = function(O, K) {
if (O < 0 || q <= O || K < 0 || q <= K)
throw O + "," + K;
return C[O][K];
}, ue.getModuleCount = function() {
return q;
}, ue.make = function() {
if (U < 1) {
for (var O = 1; O < 40; O++) {
for (var K = k.getRSBlocks(O, F), J = D(), ne = 0; ne < Y.length; ne++) {
var re = Y[ne];
J.put(re.getMode(), 4), J.put(re.getLength(), y.getLengthInBits(re.getMode(), O)), re.write(J);
}
var fe = 0;
for (ne = 0; ne < K.length; ne++)
fe += K[ne].dataCount;
if (J.getLengthInBits() <= 8 * fe)
break;
}
U = O;
}
ee(!1, function() {
for (var Ae = 0, Fe = 0, Xe = 0; Xe < 8; Xe += 1) {
ee(!0, Xe);
var Ze = y.getLostPoint(ue);
(Xe == 0 || Ae > Ze) && (Ae = Ze, Fe = Xe);
}
return Fe;
}());
}, ue.createTableTag = function(O, K) {
O = O || 2;
var J = "";
J += '<table style="', J += " border-width: 0px; border-style: none;", J += " border-collapse: collapse;", J += " padding: 0px; margin: " + (K = K === void 0 ? 4 * O : K) + "px;", J += '">', J += "<tbody>";
for (var ne = 0; ne < ue.getModuleCount(); ne += 1) {
J += "<tr>";
for (var re = 0; re < ue.getModuleCount(); re += 1)
J += '<td style="', J += " border-width: 0px; border-style: none;", J += " border-collapse: collapse;", J += " padding: 0px; margin: 0px;", J += " width: " + O + "px;", J += " height: " + O + "px;", J += " background-color: ", J += ue.isDark(ne, re) ? "#000000" : "#ffffff", J += ";", J += '"/>';
J += "</tr>";
}
return (J += "</tbody>") + "</table>";
}, ue.createSvgTag = function(O, K, J, ne) {
var re = {};
typeof arguments[0] == "object" && (O = (re = arguments[0]).cellSize, K = re.margin, J = re.alt, ne = re.title), O = O || 2, K = K === void 0 ? 4 * O : K, (J = typeof J == "string" ? { text: J } : J || {}).text = J.text || null, J.id = J.text ? J.id || "qrcode-description" : null, (ne = typeof ne == "string" ? { text: ne } : ne || {}).text = ne.text || null, ne.id = ne.text ? ne.id || "qrcode-title" : null;
var fe, Ae, Fe, Xe, Ze = ue.getModuleCount() * O + 2 * K, be = "";
for (Xe = "l" + O + ",0 0," + O + " -" + O + ",0 0,-" + O + "z ", be += '<svg version="1.1" xmlns="http://www.w3.org/2000/svg"', be += re.scalable ? "" : ' width="' + Ze + 'px" height="' + Ze + 'px"', be += ' viewBox="0 0 ' + Ze + " " + Ze + '" ', be += ' preserveAspectRatio="xMinYMin meet"', be += ne.text || J.text ? ' role="img" aria-labelledby="' + xe([ne.id, J.id].join(" ").trim()) + '"' : "", be += ">", be += ne.text ? '<title id="' + xe(ne.id) + '">' + xe(ne.text) + "</title>" : "", be += J.text ? '<description id="' + xe(J.id) + '">' + xe(J.text) + "</description>" : "", be += '<rect width="100%" height="100%" fill="white" cx="0" cy="0"/>', be += '<path d="', Ae = 0; Ae < ue.getModuleCount(); Ae += 1)
for (Fe = Ae * O + K, fe = 0; fe < ue.getModuleCount(); fe += 1)
ue.isDark(Ae, fe) && (be += "M" + (fe * O + K) + "," + Fe + Xe);
return (be += '" stroke="transparent" fill="black"/>') + "</svg>";
}, ue.createDataURL = function(O, K) {
O = O || 2, K = K === void 0 ? 4 * O : K;
var J = ue.getModuleCount() * O + 2 * K, ne = K, re = J - K;
return z(J, J, function(fe, Ae) {
if (ne <= fe && fe < re && ne <= Ae && Ae < re) {
var Fe = Math.floor((fe - ne) / O), Xe = Math.floor((Ae - ne) / O);
return ue.isDark(Xe, Fe) ? 0 : 1;
}
return 1;
});
}, ue.createImgTag = function(O, K, J) {
O = O || 2, K = K === void 0 ? 4 * O : K;
var ne = ue.getModuleCount() * O + 2 * K, re = "";
return re += "<img", re += ' src="', re += ue.createDataURL(O, K), re += '"', re += ' width="', re += ne, re += '"', re += ' height="', re += ne, re += '"', J && (re += ' alt="', re += xe(J), re += '"'), re + "/>";
};
var xe = function(O) {
for (var K = "", J = 0; J < O.length; J += 1) {
var ne = O.charAt(J);
switch (ne) {
case "<":
K += "&lt;";
break;
case ">":
K += "&gt;";
break;
case "&":
K += "&amp;";
break;
case '"':
K += "&quot;";
break;
default:
K += ne;
}
}
return K;
};
return ue.createASCII = function(O, K) {
if ((O = O || 1) < 2)
return function(it) {
it = it === void 0 ? 2 : it;
var pt, De, ze, at, He, Rt = 1 * ue.getModuleCount() + 2 * it, ft = it, Be = Rt - it, Je = { "\u2588\u2588": "\u2588", "\u2588 ": "\u2580", " \u2588": "\u2584", " ": " " }, ht = { "\u2588\u2588": "\u2580", "\u2588 ": "\u2580", " \u2588": " ", " ": " " }, We = "";
for (pt = 0; pt < Rt; pt += 2) {
for (ze = Math.floor((pt - ft) / 1), at = Math.floor((pt + 1 - ft) / 1), De = 0; De < Rt; De += 1)
He = "\u2588", ft <= De && De < Be && ft <= pt && pt < Be && ue.isDark(ze, Math.floor((De - ft) / 1)) && (He = " "), ft <= De && De < Be && ft <= pt + 1 && pt + 1 < Be && ue.isDark(at, Math.floor((De - ft) / 1)) ? He += " " : He += "\u2588", We += it < 1 && pt + 1 >= Be ? ht[He] : Je[He];
We += `
`;
}
return Rt % 2 && it > 0 ? We.substring(0, We.length - Rt - 1) + Array(Rt + 1).join("\u2580") : We.substring(0, We.length - 1);
}(K);
O -= 1, K = K === void 0 ? 2 * O : K;
var J, ne, re, fe, Ae = ue.getModuleCount() * O + 2 * K, Fe = K, Xe = Ae - K, Ze = Array(O + 1).join("\u2588\u2588"), be = Array(O + 1).join(" "), Le = "", ke = "";
for (J = 0; J < Ae; J += 1) {
for (re = Math.floor((J - Fe) / O), ke = "", ne = 0; ne < Ae; ne += 1)
fe = 1, Fe <= ne && ne < Xe && Fe <= J && J < Xe && ue.isDark(re, Math.floor((ne - Fe) / O)) && (fe = 0), ke += fe ? Ze : be;
for (re = 0; re < O; re += 1)
Le += ke + `
`;
}
return Le.substring(0, Le.length - 1);
}, ue.renderTo2dContext = function(O, K) {
K = K || 2;
for (var J = ue.getModuleCount(), ne = 0; ne < J; ne++)
for (var re = 0; re < J; re++)
O.fillStyle = ue.isDark(ne, re) ? "black" : "white", O.fillRect(ne * K, re * K, K, K);
}, ue;
};
g.stringToBytes = (g.stringToBytesFuncs = { default: function(H) {
for (var I = [], U = 0; U < H.length; U += 1) {
var F = H.charCodeAt(U);
I.push(255 & F);
}
return I;
} }).default, g.createStringToBytes = function(H, I) {
var U = function() {
for (var C = V(H), q = function() {
var Te = C.read();
if (Te == -1)
throw "eof";
return Te;
}, X = 0, Y = {}; ; ) {
var ue = C.read();
if (ue == -1)
break;
var ee = q(), pe = q() << 8 | q();
Y[String.fromCharCode(ue << 8 | ee)] = pe, X += 1;
}
if (X != I)
throw X + " != " + I;
return Y;
}(), F = "?".charCodeAt(0);
return function(C) {
for (var q = [], X = 0; X < C.length; X += 1) {
var Y = C.charCodeAt(X);
if (Y < 128)
q.push(Y);
else {
var ue = U[C.charAt(X)];
typeof ue == "number" ? (255 & ue) == ue ? q.push(ue) : (q.push(ue >>> 8), q.push(255 & ue)) : q.push(F);
}
}
return q;
};
};
var _, S, b, A, w, m = { L: 1, M: 0, Q: 3, H: 2 }, y = (_ = [[], [6, 18], [6, 22], [6, 26], [6, 30], [6, 34], [6, 22, 38], [6, 24, 42], [6, 26, 46], [6, 28, 50], [6, 30, 54], [6, 32, 58], [6, 34, 62], [6, 26, 46, 66], [6, 26, 48, 70], [6, 26, 50, 74], [6, 30, 54, 78], [6, 30, 56, 82], [6, 30, 58, 86], [6, 34, 62, 90], [6, 28, 50, 72, 94], [6, 26, 50, 74, 98], [6, 30, 54, 78, 102], [6, 28, 54, 80, 106], [6, 32, 58, 84, 110], [6, 30, 58, 86, 114], [6, 34, 62, 90, 118], [6, 26, 50, 74, 98, 122], [6, 30, 54, 78, 102, 126], [6, 26, 52, 78, 104, 130], [6, 30, 56, 82, 108, 134], [6, 34, 60, 86, 112, 138], [6, 30, 58, 86, 114, 142], [6, 34, 62, 90, 118, 146], [6, 30, 54, 78, 102, 126, 150], [6, 24, 50, 76, 102, 128, 154], [6, 28, 54, 80, 106, 132, 158], [6, 32, 58, 84, 110, 136, 162], [6, 26, 54, 82, 110, 138, 166], [6, 30, 58, 86, 114, 142, 170]], S = 1335, b = 7973, w = function(H) {
for (var I = 0; H != 0; )
I += 1, H >>>= 1;
return I;
}, (A = {}).getBCHTypeInfo = function(H) {
for (var I = H << 10; w(I) - w(S) >= 0; )
I ^= S << w(I) - w(S);
return 21522 ^ (H << 10 | I);
}, A.getBCHTypeNumber = function(H) {
for (var I = H << 12; w(I) - w(b) >= 0; )
I ^= b << w(I) - w(b);
return H << 12 | I;
}, A.getPatternPosition = function(H) {
return _[H - 1];
}, A.getMaskFunction = function(H) {
switch (H) {
case 0:
return function(I, U) {
return (I + U) % 2 == 0;
};
case 1:
return function(I, U) {
return I % 2 == 0;
};
case 2:
return function(I, U) {
return U % 3 == 0;
};
case 3:
return function(I, U) {
return (I + U) % 3 == 0;
};
case 4:
return function(I, U) {
return (Math.floor(I / 2) + Math.floor(U / 3)) % 2 == 0;
};
case 5:
return function(I, U) {
return I * U % 2 + I * U % 3 == 0;
};
case 6:
return function(I, U) {
return (I * U % 2 + I * U % 3) % 2 == 0;
};
case 7:
return function(I, U) {
return (I * U % 3 + (I + U) % 2) % 2 == 0;
};
default:
throw "bad maskPattern:" + H;
}
}, A.getErrorCorrectPolynomial = function(H) {
for (var I = x([1], 0), U = 0; U < H; U += 1)
I = I.multiply(x([1, E.gexp(U)], 0));
return I;
}, A.getLengthInBits = function(H, I) {
if (1 <= I && I < 10)
switch (H) {
case 1:
return 10;
case 2:
return 9;
case 4:
case 8:
return 8;
default:
throw "mode:" + H;
}
else if (I < 27)
switch (H) {
case 1:
return 12;
case 2:
return 11;
case 4:
return 16;
case 8:
return 10;
default:
throw "mode:" + H;
}
else {
if (!(I < 41))
throw "type:" + I;
switch (H) {
case 1:
return 14;
case 2:
return 13;
case 4:
return 16;
case 8:
return 12;
default:
throw "mode:" + H;
}
}
}, A.getLostPoint = function(H) {
for (var I = H.getModuleCount(), U = 0, F = 0; F < I; F += 1)
for (var C = 0; C < I; C += 1) {
for (var q = 0, X = H.isDark(F, C), Y = -1; Y <= 1; Y += 1)
if (!(F + Y < 0 || I <= F + Y))
for (var ue = -1; ue <= 1; ue += 1)
C + ue < 0 || I <= C + ue || Y == 0 && ue == 0 || X == H.isDark(F + Y, C + ue) && (q += 1);
q > 5 && (U += 3 + q - 5);
}
for (F = 0; F < I - 1; F += 1)
for (C = 0; C < I - 1; C += 1) {
var ee = 0;
H.isDark(F, C) && (ee += 1), H.isDark(F + 1, C) && (ee += 1), H.isDark(F, C + 1) && (ee += 1), H.isDark(F + 1, C + 1) && (ee += 1), ee != 0 && ee != 4 || (U += 3);
}
for (F = 0; F < I; F += 1)
for (C = 0; C < I - 6; C += 1)
H.isDark(F, C) && !H.isDark(F, C + 1) && H.isDark(F, C + 2) && H.isDark(F, C + 3) && H.isDark(F, C + 4) && !H.isDark(F, C + 5) && H.isDark(F, C + 6) && (U += 40);
for (C = 0; C < I; C += 1)
for (F = 0; F < I - 6; F += 1)
H.isDark(F, C) && !H.isDark(F + 1, C) && H.isDark(F + 2, C) && H.isDark(F + 3, C) && H.isDark(F + 4, C) && !H.isDark(F + 5, C) && H.isDark(F + 6, C) && (U += 40);
var pe = 0;
for (C = 0; C < I; C += 1)
for (F = 0; F < I; F += 1)
H.isDark(F, C) && (pe += 1);
return U + Math.abs(100 * pe / I / I - 50) / 5 * 10;
}, A), E = function() {
for (var H = new Array(256), I = new Array(256), U = 0; U < 8; U += 1)
H[U] = 1 << U;
for (U = 8; U < 256; U += 1)
H[U] = H[U - 4] ^ H[U - 5] ^ H[U - 6] ^ H[U - 8];
for (U = 0; U < 255; U += 1)
I[H[U]] = U;
return { glog: function(F) {
if (F < 1)
throw "glog(" + F + ")";
return I[F];
}, gexp: function(F) {
for (; F < 0; )
F += 255;
for (; F >= 256; )
F -= 255;
return H[F];
} };
}();
function x(H, I) {
if (H.length === void 0)
throw H.length + "/" + I;
var U = function() {
for (var C = 0; C < H.length && H[C] == 0; )
C += 1;
for (var q = new Array(H.length - C + I), X = 0; X < H.length - C; X += 1)
q[X] = H[X + C];
return q;
}(), F = { getAt: function(C) {
return U[C];
}, getLength: function() {
return U.length;
}, multiply: function(C) {
for (var q = new Array(F.getLength() + C.getLength() - 1), X = 0; X < F.getLength(); X += 1)
for (var Y = 0; Y < C.getLength(); Y += 1)
q[X + Y] ^= E.gexp(E.glog(F.getAt(X)) + E.glog(C.getAt(Y)));
return x(q, 0);
}, mod: function(C) {
if (F.getLength() - C.getLength() < 0)
return F;
for (var q = E.glog(F.getAt(0)) - E.glog(C.getAt(0)), X = new Array(F.getLength()), Y = 0; Y < F.getLength(); Y += 1)
X[Y] = F.getAt(Y);
for (Y = 0; Y < C.getLength(); Y += 1)
X[Y] ^= E.gexp(E.glog(C.getAt(Y)) + q);
return x(X, 0).mod(C);
} };
return F;
}
var k = function() {
var H = [[1, 26, 19], [1, 26, 16], [1, 26, 13], [1, 26, 9], [1, 44, 34], [1, 44, 28], [1, 44, 22], [1, 44, 16], [1, 70, 55], [1, 70, 44], [2, 35, 17], [2, 35, 13], [1, 100, 80], [2, 50, 32], [2, 50, 24], [4, 25, 9], [1, 134, 108], [2, 67, 43], [2, 33, 15, 2, 34, 16], [2, 33, 11, 2, 34, 12], [2, 86, 68], [4, 43, 27], [4, 43, 19], [4, 43, 15], [2, 98, 78], [4, 49, 31], [2, 32, 14, 4, 33, 15], [4, 39, 13, 1, 40, 14], [2, 121, 97], [2, 60, 38, 2, 61, 39], [4, 40, 18, 2, 41, 19], [4, 40, 14, 2, 41, 15], [2, 146, 116], [3, 58, 36, 2, 59, 37], [4, 36, 16, 4, 37, 17], [4, 36, 12, 4, 37, 13], [2, 86, 68, 2, 87, 69], [4, 69, 43, 1, 70, 44], [6, 43, 19, 2, 44, 20], [6, 43, 15, 2, 44, 16], [4, 101, 81], [1, 80, 50, 4, 81, 51], [4, 50, 22, 4, 51, 23], [3, 36, 12, 8, 37, 13], [2, 116, 92, 2, 117, 93], [6, 58, 36, 2, 59, 37], [4, 46, 20, 6, 47, 21], [7, 42, 14, 4, 43, 15], [4, 133, 107], [8, 59, 37, 1, 60, 38], [8, 44, 20, 4, 45, 21], [12, 33, 11, 4, 34, 12], [3, 145, 115, 1, 146, 116], [4, 64, 40, 5, 65, 41], [11, 36, 16, 5, 37, 17], [11, 36, 12, 5, 37, 13], [5, 109, 87, 1, 110, 88], [5, 65, 41, 5, 66, 42], [5, 54, 24, 7, 55, 25], [11, 36, 12, 7, 37, 13], [5, 122, 98, 1, 123, 99], [7, 73, 45, 3, 74, 46], [15, 43, 19, 2, 44, 20], [3, 45, 15, 13, 46, 16], [1, 135, 107, 5, 136, 108], [10, 74, 46, 1, 75, 47], [1, 50, 22, 15, 51, 23], [2, 42, 14, 17, 43, 15], [5, 150, 120, 1, 151, 121], [9, 69, 43, 4, 70, 44], [17, 50, 22, 1, 51, 23], [2, 42, 14, 19, 43, 15], [3, 141, 113, 4, 142, 114], [3, 70, 44, 11, 71, 45], [17, 47, 21, 4, 48, 22], [9, 39, 13, 16, 40, 14], [3, 135, 107, 5, 136, 108], [3, 67, 41, 13, 68, 42], [15, 54, 24, 5, 55, 25], [15, 43, 15, 10, 44, 16], [4, 144, 116, 4, 145, 117], [17, 68, 42], [17, 50, 22, 6, 51, 23], [19, 46, 16, 6, 47, 17], [2, 139, 111, 7, 140, 112], [17, 74, 46], [7, 54, 24, 16, 55, 25], [34, 37, 13], [4, 151, 121, 5, 152, 122], [4, 75, 47, 14, 76, 48], [11, 54, 24, 14, 55, 25], [16, 45, 15, 14, 46, 16], [6, 147, 117, 4, 148, 118], [6, 73, 45, 14, 74, 46], [11, 54, 24, 16, 55, 25], [30, 46, 16, 2, 47, 17], [8, 132, 106, 4, 133, 107], [8, 75, 47, 13, 76, 48], [7, 54, 24, 22, 55, 25], [22, 45, 15, 13, 46, 16], [10, 142, 114, 2, 143, 115], [19, 74, 46, 4, 75, 47], [28, 50, 22, 6, 51, 23], [33, 46, 16, 4, 47, 17], [8, 152, 122, 4, 153, 123], [22, 73, 45, 3, 74, 46], [8, 53, 23, 26, 54, 24], [12, 45, 15, 28, 46, 16], [3, 147, 117, 10, 148, 118], [3, 73, 45, 23, 74, 46], [4, 54, 24, 31, 55, 25], [11, 45, 15, 31, 46, 16], [7, 146, 116, 7, 147, 117], [21, 73, 45, 7, 74, 46], [1, 53, 23, 37, 54, 24], [19, 45, 15, 26, 46, 16], [5, 145, 115, 10, 146, 116], [19, 75, 47, 10, 76, 48], [15, 54, 24, 25, 55, 25], [23, 45, 15, 25, 46, 16], [13, 145, 115, 3, 146, 116], [2, 74, 46, 29, 75, 47], [42, 54, 24, 1, 55, 25], [23, 45, 15, 28, 46, 16], [17, 145, 115], [10, 74, 46, 23, 75, 47], [10, 54, 24, 35, 55, 25], [19, 45, 15, 35, 46, 16], [17, 145, 115, 1, 146, 116], [14, 74, 46, 21, 75, 47], [29, 54, 24, 19, 55, 25], [11, 45, 15, 46, 46, 16], [13, 145, 115, 6, 146, 116], [14, 74, 46, 23, 75, 47], [44, 54, 24, 7, 55, 25], [59, 46, 16, 1, 47, 17], [12, 151, 121, 7, 152, 122], [12, 75, 47, 26, 76, 48], [39, 54, 24, 14, 55, 25], [22, 45, 15, 41, 46, 16], [6, 151, 121, 14, 152, 122], [6, 75, 47, 34, 76, 48], [46, 54, 24, 10, 55, 25], [2, 45, 15, 64, 46, 16], [17, 152, 122, 4, 153, 123], [29, 74, 46, 14, 75, 47], [49, 54, 24, 10, 55, 25], [24, 45, 15, 46, 46, 16], [4, 152, 122, 18, 153, 123], [13, 74, 46, 32, 75, 47], [48, 54, 24, 14, 55, 25], [42, 45, 15, 32, 46, 16], [20, 147, 117, 4, 148, 118], [40, 75, 47, 7, 76, 48], [43, 54, 24, 22, 55, 25], [10, 45, 15, 67, 46, 16], [19, 148, 118, 6, 149, 119], [18, 75, 47, 31, 76, 48], [34, 54, 24, 34, 55, 25], [20, 45, 15, 61, 46, 16]], I = function(F, C) {
var q = {};
return q.totalCount = F, q.dataCount = C, q;
}, U = { getRSBlocks: function(F, C) {
var q = function(me, we) {
switch (we) {
case m.L:
return H[4 * (me - 1) + 0];
case m.M:
return H[4 * (me - 1) + 1];
case m.Q:
return H[4 * (me - 1) + 2];
case m.H:
return H[4 * (me - 1) + 3];
default:
return;
}
}(F, C);
if (q === void 0)
throw "bad rs block @ typeNumber:" + F + "/errorCorrectionLevel:" + C;
for (var X = q.length / 3, Y = [], ue = 0; ue < X; ue += 1)
for (var ee = q[3 * ue + 0], pe = q[3 * ue + 1], Te = q[3 * ue + 2], ve = 0; ve < ee; ve += 1)
Y.push(I(pe, Te));
return Y;
} };
return U;
}(), D = function() {
var H = [], I = 0, U = { getBuffer: function() {
return H;
}, getAt: function(F) {
var C = Math.floor(F / 8);
return (H[C] >>> 7 - F % 8 & 1) == 1;
}, put: function(F, C) {
for (var q = 0; q < C; q += 1)
U.putBit((F >>> C - q - 1 & 1) == 1);
}, getLengthInBits: function() {
return I;
}, putBit: function(F) {
var C = Math.floor(I / 8);
H.length <= C && H.push(0), F && (H[C] |= 128 >>> I % 8), I += 1;
} };
return U;
}, P = function(H) {
var I = H, U = { getMode: function() {
return 1;
}, getLength: function(q) {
return I.length;
}, write: function(q) {
for (var X = I, Y = 0; Y + 2 < X.length; )
q.put(F(X.substring(Y, Y + 3)), 10), Y += 3;
Y < X.length && (X.length - Y == 1 ? q.put(F(X.substring(Y, Y + 1)), 4) : X.length - Y == 2 && q.put(F(X.substring(Y, Y + 2)), 7));
} }, F = function(q) {
for (var X = 0, Y = 0; Y < q.length; Y += 1)
X = 10 * X + C(q.charAt(Y));
return X;
}, C = function(q) {
if ("0" <= q && q <= "9")
return q.charCodeAt(0) - "0".charCodeAt(0);
throw "illegal char :" + q;
};
return U;
}, M = function(H) {
var I = H, U = { getMode: function() {
return 2;
}, getLength: function(C) {
return I.length;
}, write: function(C) {
for (var q = I, X = 0; X + 1 < q.length; )
C.put(45 * F(q.charAt(X)) + F(q.charAt(X + 1)), 11), X += 2;
X < q.length && C.put(F(q.charAt(X)), 6);
} }, F = function(C) {
if ("0" <= C && C <= "9")
return C.charCodeAt(0) - "0".charCodeAt(0);
if ("A" <= C && C <= "Z")
return C.charCodeAt(0) - "A".charCodeAt(0) + 10;
switch (C) {
case " ":
return 36;
case "$":
return 37;
case "%":
return 38;
case "*":
return 39;
case "+":
return 40;
case "-":
return 41;
case ".":
return 42;
case "/":
return 43;
case ":":
return 44;
default:
throw "illegal char :" + C;
}
};
return U;
}, B = function(H) {
var I = g.stringToBytes(H);
return { getMode: function() {
return 4;
}, getLength: function(U) {
return I.length;
}, write: function(U) {
for (var F = 0; F < I.length; F += 1)
U.put(I[F], 8);
} };
}, T = function(H) {
var I = g.stringToBytesFuncs.SJIS;
if (!I)
throw "sjis not supported.";
(function() {
var C = I("\u53CB");
if (C.length != 2 || (C[0] << 8 | C[1]) != 38726)
throw "sjis not supported.";
})();
var U = I(H), F = { getMode: function() {
return 8;
}, getLength: function(C) {
return ~~(U.length / 2);
}, write: function(C) {
for (var q = U, X = 0; X + 1 < q.length; ) {
var Y = (255 & q[X]) << 8 | 255 & q[X + 1];
if (33088 <= Y && Y <= 40956)
Y -= 33088;
else {
if (!(57408 <= Y && Y <= 60351))
throw "illegal char at " + (X + 1) + "/" + Y;
Y -= 49472;
}
Y = 192 * (Y >>> 8 & 255) + (255 & Y), C.put(Y, 13), X += 2;
}
if (X < q.length)
throw "illegal char at " + (X + 1);
} };
return F;
}, $ = function() {
var H = [], I = { writeByte: function(U) {
H.push(255 & U);
}, writeShort: function(U) {
I.writeByte(U), I.writeByte(U >>> 8);
}, writeBytes: function(U, F, C) {
F = F || 0, C = C || U.length;
for (var q = 0; q < C; q += 1)
I.writeByte(U[q + F]);
}, writeString: function(U) {
for (var F = 0; F < U.length; F += 1)
I.writeByte(U.charCodeAt(F));
}, toByteArray: function() {
return H;
}, toString: function() {
var U = "";
U += "[";
for (var F = 0; F < H.length; F += 1)
F > 0 && (U += ","), U += H[F];
return U + "]";
} };
return I;
}, V = function(H) {
var I = H, U = 0, F = 0, C = 0, q = { read: function() {
for (; C < 8; ) {
if (U >= I.length) {
if (C == 0)
return -1;
throw "unexpected end of file./" + C;
}
var Y = I.charAt(U);
if (U += 1, Y == "=")
return C = 0, -1;
Y.match(/^\s$/) || (F = F << 6 | X(Y.charCodeAt(0)), C += 6);
}
var ue = F >>> C - 8 & 255;
return C -= 8, ue;
} }, X = function(Y) {
if (65 <= Y && Y <= 90)
return Y - 65;
if (97 <= Y && Y <= 122)
return Y - 97 + 26;
if (48 <= Y && Y <= 57)
return Y - 48 + 52;
if (Y == 43)
return 62;
if (Y == 47)
return 63;
throw "c:" + Y;
};
return q;
}, z = function(H, I, U) {
for (var F = function(pe, Te) {
var ve = pe, me = Te, we = new Array(pe * Te), he = { setPixel: function(O, K, J) {
we[K * ve + O] = J;
}, write: function(O) {
O.writeString("GIF87a"), O.writeShort(ve), O.writeShort(me), O.writeByte(128), O.writeByte(0), O.writeByte(0), O.writeByte(0), O.writeByte(0), O.writeByte(0), O.writeByte(255), O.writeByte(255), O.writeByte(255), O.writeString(","), O.writeShort(0), O.writeShort(0), O.writeShort(ve), O.writeShort(me), O.writeByte(0);
var K = Se(2);
O.writeByte(2);
for (var J = 0; K.length - J > 255; )
O.writeByte(255), O.writeBytes(K, J, 255), J += 255;
O.writeByte(K.length - J), O.writeBytes(K, J, K.length - J), O.writeByte(0), O.writeString(";");
} }, Se = function(O) {
for (var K = 1 << O, J = 1 + (1 << O), ne = O + 1, re = xe(), fe = 0; fe < K; fe += 1)
re.add(String.fromCharCode(fe));
re.add(String.fromCharCode(K)), re.add(String.fromCharCode(J));
var Ae, Fe, Xe, Ze = $(), be = (Ae = Ze, Fe = 0, Xe = 0, { write: function(pt, De) {
if (pt >>> De != 0)
throw "length over";
for (; Fe + De >= 8; )
Ae.writeByte(255 & (pt << Fe | Xe)), De -= 8 - Fe, pt >>>= 8 - Fe, Xe = 0, Fe = 0;
Xe |= pt << Fe, Fe += De;
}, flush: function() {
Fe > 0 && Ae.writeByte(Xe);
} });
be.write(K, ne);
var Le = 0, ke = String.fromCharCode(we[Le]);
for (Le += 1; Le < we.length; ) {
var it = String.fromCharCode(we[Le]);
Le += 1, re.contains(ke + it) ? ke += it : (be.write(re.indexOf(ke), ne), re.size() < 4095 && (re.size() == 1 << ne && (ne += 1), re.add(ke + it)), ke = it);
}
return be.write(re.indexOf(ke), ne), be.write(J, ne), be.flush(), Ze.toByteArray();
}, xe = function() {
var O = {}, K = 0, J = { add: function(ne) {
if (J.contains(ne))
throw "dup key:" + ne;
O[ne] = K, K += 1;
}, size: function() {
return K;
}, indexOf: function(ne) {
return O[ne];
}, contains: function(ne) {
return O[ne] !== void 0;
} };
return J;
};
return he;
}(H, I), C = 0; C < I; C += 1)
for (var q = 0; q < H; q += 1)
F.setPixel(q, C, U(q, C));
var X = $();
F.write(X);
for (var Y = function() {
var pe = 0, Te = 0, ve = 0, me = "", we = {}, he = function(xe) {
me += String.fromCharCode(Se(63 & xe));
}, Se = function(xe) {
if (!(xe < 0)) {
if (xe < 26)
return 65 + xe;
if (xe < 52)
return xe - 26 + 97;
if (xe < 62)
return xe - 52 + 48;
if (xe == 62)
return 43;
if (xe == 63)
return 47;
}
throw "n:" + xe;
};
return we.writeByte = function(xe) {
for (pe = pe << 8 | 255 & xe, Te += 8, ve += 1; Te >= 6; )
he(pe >>> Te - 6), Te -= 6;
}, we.flush = function() {
if (Te > 0 && (he(pe << 6 - Te), pe = 0, Te = 0), ve % 3 != 0)
for (var xe = 3 - ve % 3, O = 0; O < xe; O += 1)
me += "=";
}, we.toString = function() {
return me;
}, we;
}(), ue = X.toByteArray(), ee = 0; ee < ue.length; ee += 1)
Y.writeByte(ue[ee]);
return Y.flush(), "data:image/gif;base64," + Y;
};
return g;
}();
p.stringToBytesFuncs["UTF-8"] = function(g) {
return function(_) {
for (var S = [], b = 0; b < _.length; b++) {
var A = _.charCodeAt(b);
A < 128 ? S.push(A) : A < 2048 ? S.push(192 | A >> 6, 128 | 63 & A) : A < 55296 || A >= 57344 ? S.push(224 | A >> 12, 128 | A >> 6 & 63, 128 | 63 & A) : (b++, A = 65536 + ((1023 & A) << 10 | 1023 & _.charCodeAt(b)), S.push(240 | A >> 18, 128 | A >> 12 & 63, 128 | A >> 6 & 63, 128 | 63 & A));
}
return S;
}(g);
}, (h = typeof (d = function() {
return p;
}) == "function" ? d.apply(u, []) : d) === void 0 || (s.exports = h);
} }, r = {};
function n(s) {
var u = r[s];
if (u !== void 0)
return u.exports;
var d = r[s] = { exports: {} };
return i[s](d, d.exports, n), d.exports;
}
n.n = (s) => {
var u = s && s.__esModule ? () => s.default : () => s;
return n.d(u, { a: u }), u;
}, n.d = (s, u) => {
for (var d in u)
n.o(u, d) && !n.o(s, d) && Object.defineProperty(s, d, { enumerable: !0, get: u[d] });
}, n.o = (s, u) => Object.prototype.hasOwnProperty.call(s, u);
var a = {};
return (() => {
n.d(a, { default: () => I });
const s = (U) => !!U && typeof U == "object" && !Array.isArray(U);
function u(U, ...F) {
if (!F.length)
return U;
const C = F.shift();
return C !== void 0 && s(U) && s(C) ? (U = Object.assign({}, U), Object.keys(C).forEach((q) => {
const X = U[q], Y = C[q];
Array.isArray(X) && Array.isArray(Y) ? U[q] = Y : s(X) && s(Y) ? U[q] = u(Object.assign({}, X), Y) : U[q] = Y;
}), u(U, ...F)) : U;
}
function d(U, F) {
const C = document.createElement("a");
C.download = F, C.href = U, document.body.appendChild(C), C.click(), document.body.removeChild(C);
}
const h = { L: 0.07, M: 0.15, Q: 0.25, H: 0.3 };
class p {
constructor({ svg: F, type: C, window: q }) {
this._svg = F, this._type = C, this._window = q;
}
draw(F, C, q, X) {
let Y;
switch (this._type) {
case "dots":
Y = this._drawDot;
break;
case "classy":
Y = this._drawClassy;
break;
case "classy-rounded":
Y = this._drawClassyRounded;
break;
case "rounded":
Y = this._drawRounded;
break;
case "extra-rounded":
Y = this._drawExtraRounded;
break;
default:
Y = this._drawSquare;
}
Y.call(this, { x: F, y: C, size: q, getNeighbor: X });
}
_rotateFigure({ x: F, y: C, size: q, rotation: X = 0, draw: Y }) {
var ue;
const ee = F + q / 2, pe = C + q / 2;
Y(), (ue = this._element) === null || ue === void 0 || ue.setAttribute("transform", `rotate(${180 * X / Math.PI},${ee},${pe})`);
}
_basicDot(F) {
const { size: C, x: q, y: X } = F;
this._rotateFigure(Object.assign(Object.assign({}, F), { draw: () => {
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "circle"), this._element.setAttribute("cx", String(q + C / 2)), this._element.setAttribute("cy", String(X + C / 2)), this._element.setAttribute("r", String(C / 2));
} }));
}
_basicSquare(F) {
const { size: C, x: q, y: X } = F;
this._rotateFigure(Object.assign(Object.assign({}, F), { draw: () => {
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "rect"), this._element.setAttribute("x", String(q)), this._element.setAttribute("y", String(X)), this._element.setAttribute("width", String(C)), this._element.setAttribute("height", String(C));
} }));
}
_basicSideRounded(F) {
const { size: C, x: q, y: X } = F;
this._rotateFigure(Object.assign(Object.assign({}, F), { draw: () => {
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "path"), this._element.setAttribute("d", `M ${q} ${X}v ${C}h ` + C / 2 + `a ${C / 2} ${C / 2}, 0, 0, 0, 0 ${-C}`);
} }));
}
_basicCornerRounded(F) {
const { size: C, x: q, y: X } = F;
this._rotateFigure(Object.assign(Object.assign({}, F), { draw: () => {
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "path"), this._element.setAttribute("d", `M ${q} ${X}v ${C}h ${C}v ` + -C / 2 + `a ${C / 2} ${C / 2}, 0, 0, 0, ${-C / 2} ${-C / 2}`);
} }));
}
_basicCornerExtraRounded(F) {
const { size: C, x: q, y: X } = F;
this._rotateFigure(Object.assign(Object.assign({}, F), { draw: () => {
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "path"), this._element.setAttribute("d", `M ${q} ${X}v ${C}h ${C}a ${C} ${C}, 0, 0, 0, ${-C} ${-C}`);
} }));
}
_basicCornersRounded(F) {
const { size: C, x: q, y: X } = F;
this._rotateFigure(Object.assign(Object.assign({}, F), { draw: () => {
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "path"), this._element.setAttribute("d", `M ${q} ${X}v ` + C / 2 + `a ${C / 2} ${C / 2}, 0, 0, 0, ${C / 2} ${C / 2}h ` + C / 2 + "v " + -C / 2 + `a ${C / 2} ${C / 2}, 0, 0, 0, ${-C / 2} ${-C / 2}`);
} }));
}
_drawDot({ x: F, y: C, size: q }) {
this._basicDot({ x: F, y: C, size: q, rotation: 0 });
}
_drawSquare({ x: F, y: C, size: q }) {
this._basicSquare({ x: F, y: C, size: q, rotation: 0 });
}
_drawRounded({ x: F, y: C, size: q, getNeighbor: X }) {
const Y = X ? +X(-1, 0) : 0, ue = X ? +X(1, 0) : 0, ee = X ? +X(0, -1) : 0, pe = X ? +X(0, 1) : 0, Te = Y + ue + ee + pe;
if (Te !== 0)
if (Te > 2 || Y && ue || ee && pe)
this._basicSquare({ x: F, y: C, size: q, rotation: 0 });
else {
if (Te === 2) {
let ve = 0;
return Y && ee ? ve = Math.PI / 2 : ee && ue ? ve = Math.PI : ue && pe && (ve = -Math.PI / 2), void this._basicCornerRounded({ x: F, y: C, size: q, rotation: ve });
}
if (Te === 1) {
let ve = 0;
return ee ? ve = Math.PI / 2 : ue ? ve = Math.PI : pe && (ve = -Math.PI / 2), void this._basicSideRounded({ x: F, y: C, size: q, rotation: ve });
}
}
else
this._basicDot({ x: F, y: C, size: q, rotation: 0 });
}
_drawExtraRounded({ x: F, y: C, size: q, getNeighbor: X }) {
const Y = X ? +X(-1, 0) : 0, ue = X ? +X(1, 0) : 0, ee = X ? +X(0, -1) : 0, pe = X ? +X(0, 1) : 0, Te = Y + ue + ee + pe;
if (Te !== 0)
if (Te > 2 || Y && ue || ee && pe)
this._basicSquare({ x: F, y: C, size: q, rotation: 0 });
else {
if (Te === 2) {
let ve = 0;
return Y && ee ? ve = Math.PI / 2 : ee && ue ? ve = Math.PI : ue && pe && (ve = -Math.PI / 2), void this._basicCornerExtraRounded({ x: F, y: C, size: q, rotation: ve });
}
if (Te === 1) {
let ve = 0;
return ee ? ve = Math.PI / 2 : ue ? ve = Math.PI : pe && (ve = -Math.PI / 2), void this._basicSideRounded({ x: F, y: C, size: q, rotation: ve });
}
}
else
this._basicDot({ x: F, y: C, size: q, rotation: 0 });
}
_drawClassy({ x: F, y: C, size: q, getNeighbor: X }) {
const Y = X ? +X(-1, 0) : 0, ue = X ? +X(1, 0) : 0, ee = X ? +X(0, -1) : 0, pe = X ? +X(0, 1) : 0;
Y + ue + ee + pe !== 0 ? Y || ee ? ue || pe ? this._basicSquare({ x: F, y: C, size: q, rotation: 0 }) : this._basicCornerRounded({ x: F, y: C, size: q, rotation: Math.PI / 2 }) : this._basicCornerRounded({ x: F, y: C, size: q, rotation: -Math.PI / 2 }) : this._basicCornersRounded({ x: F, y: C, size: q, rotation: Math.PI / 2 });
}
_drawClassyRounded({ x: F, y: C, size: q, getNeighbor: X }) {
const Y = X ? +X(-1, 0) : 0, ue = X ? +X(1, 0) : 0, ee = X ? +X(0, -1) : 0, pe = X ? +X(0, 1) : 0;
Y + ue + ee + pe !== 0 ? Y || ee ? ue || pe ? this._basicSquare({ x: F, y: C, size: q, rotation: 0 }) : this._basicCornerExtraRounded({ x: F, y: C, size: q, rotation: Math.PI / 2 }) : this._basicCornerExtraRounded({ x: F, y: C, size: q, rotation: -Math.PI / 2 }) : this._basicCornersRounded({ x: F, y: C, size: q, rotation: Math.PI / 2 });
}
}
const g = { dot: "dot", square: "square", extraRounded: "extra-rounded" }, _ = Object.values(g);
class S {
constructor({ svg: F, type: C, window: q }) {
this._svg = F, this._type = C, this._window = q;
}
draw(F, C, q, X) {
let Y;
switch (this._type) {
case g.square:
Y = this._drawSquare;
break;
case g.extraRounded:
Y = this._drawExtraRounded;
break;
default:
Y = this._drawDot;
}
Y.call(this, { x: F, y: C, size: q, rotation: X });
}
_rotateFigure({ x: F, y: C, size: q, rotation: X = 0, draw: Y }) {
var ue;
const ee = F + q / 2, pe = C + q / 2;
Y(), (ue = this._element) === null || ue === void 0 || ue.setAttribute("transform", `rotate(${180 * X / Math.PI},${ee},${pe})`);
}
_basicDot(F) {
const { size: C, x: q, y: X } = F, Y = C / 7;
this._rotateFigure(Object.assign(Object.assign({}, F), { draw: () => {
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "path"), this._element.setAttribute("clip-rule", "evenodd"), this._element.setAttribute("d", `M ${q + C / 2} ${X}a ${C / 2} ${C / 2} 0 1 0 0.1 0zm 0 ${Y}a ${C / 2 - Y} ${C / 2 - Y} 0 1 1 -0.1 0Z`);
} }));
}
_basicSquare(F) {
const { size: C, x: q, y: X } = F, Y = C / 7;
this._rotateFigure(Object.assign(Object.assign({}, F), { draw: () => {
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "path"), this._element.setAttribute("clip-rule", "evenodd"), this._element.setAttribute("d", `M ${q} ${X}v ${C}h ${C}v ` + -C + `zM ${q + Y} ${X + Y}h ` + (C - 2 * Y) + "v " + (C - 2 * Y) + "h " + (2 * Y - C) + "z");
} }));
}
_basicExtraRounded(F) {
const { size: C, x: q, y: X } = F, Y = C / 7;
this._rotateFigure(Object.assign(Object.assign({}, F), { draw: () => {
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "path"), this._element.setAttribute("clip-rule", "evenodd"), this._element.setAttribute("d", `M ${q} ${X + 2.5 * Y}v ` + 2 * Y + `a ${2.5 * Y} ${2.5 * Y}, 0, 0, 0, ${2.5 * Y} ${2.5 * Y}h ` + 2 * Y + `a ${2.5 * Y} ${2.5 * Y}, 0, 0, 0, ${2.5 * Y} ${2.5 * -Y}v ` + -2 * Y + `a ${2.5 * Y} ${2.5 * Y}, 0, 0, 0, ${2.5 * -Y} ${2.5 * -Y}h ` + -2 * Y + `a ${2.5 * Y} ${2.5 * Y}, 0, 0, 0, ${2.5 * -Y} ${2.5 * Y}M ${q + 2.5 * Y} ${X + Y}h ` + 2 * Y + `a ${1.5 * Y} ${1.5 * Y}, 0, 0, 1, ${1.5 * Y} ${1.5 * Y}v ` + 2 * Y + `a ${1.5 * Y} ${1.5 * Y}, 0, 0, 1, ${1.5 * -Y} ${1.5 * Y}h ` + -2 * Y + `a ${1.5 * Y} ${1.5 * Y}, 0, 0, 1, ${1.5 * -Y} ${1.5 * -Y}v ` + -2 * Y + `a ${1.5 * Y} ${1.5 * Y}, 0, 0, 1, ${1.5 * Y} ${1.5 * -Y}`);
} }));
}
_drawDot({ x: F, y: C, size: q, rotation: X }) {
this._basicDot({ x: F, y: C, size: q, rotation: X });
}
_drawSquare({ x: F, y: C, size: q, rotation: X }) {
this._basicSquare({ x: F, y: C, size: q, rotation: X });
}
_drawExtraRounded({ x: F, y: C, size: q, rotation: X }) {
this._basicExtraRounded({ x: F, y: C, size: q, rotation: X });
}
}
const b = { dot: "dot", square: "square" }, A = Object.values(b);
class w {
constructor({ svg: F, type: C, window: q }) {
this._svg = F, this._type = C, this._window = q;
}
draw(F, C, q, X) {
let Y;
Y = this._type === b.square ? this._drawSquare : this._drawDot, Y.call(this, { x: F, y: C, size: q, rotation: X });
}
_rotateFigure({ x: F, y: C, size: q, rotation: X = 0, draw: Y }) {
var ue;
const ee = F + q / 2, pe = C + q / 2;
Y(), (ue = this._element) === null || ue === void 0 || ue.setAttribute("transform", `rotate(${180 * X / Math.PI},${ee},${pe})`);
}
_basicDot(F) {
const { size: C, x: q, y: X } = F;
this._rotateFigure(Object.assign(Object.assign({}, F), { draw: () => {
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "circle"), this._element.setAttribute("cx", String(q + C / 2)), this._element.setAttribute("cy", String(X + C / 2)), this._element.setAttribute("r", String(C / 2));
} }));
}
_basicSquare(F) {
const { size: C, x: q, y: X } = F;
this._rotateFigure(Object.assign(Object.assign({}, F), { draw: () => {
this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "rect"), this._element.setAttribute("x", String(q)), this._element.setAttribute("y", String(X)), this._element.setAttribute("width", String(C)), this._element.setAttribute("height", String(C));
} }));
}
_drawDot({ x: F, y: C, size: q, rotation: X }) {
this._basicDot({ x: F, y: C, size: q, rotation: X });
}
_drawSquare({ x: F, y: C, size: q, rotation: X }) {
this._basicSquare({ x: F, y: C, size: q, rotation: X });
}
}
const m = "circle", y = [[1, 1, 1, 1, 1, 1, 1], [1, 0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 0, 1], [1, 0, 0, 0, 0, 0, 1], [1, 1, 1, 1, 1, 1, 1]], E = [[0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0], [0, 0, 1, 1, 1, 0, 0], [0, 0, 1, 1, 1, 0, 0], [0, 0, 1, 1, 1, 0, 0], [0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0]];
class x {
constructor(F, C) {
this._roundSize = (q) => this._options.dotsOptions.roundSize ? Math.floor(q) : q, this._window = C, this._element = this._window.document.createElementNS("http://www.w3.org/2000/svg", "svg"), this._element.setAttribute("width", String(F.width)), this._element.setAttribute("height", String(F.height)), this._element.setAttribute("xmlns:xlink", "http://www.w3.org/1999/xlink"), F.dotsOptions.roundSize || this._element.setAttribute("shape-rendering", "crispEdges"), this._element.setAttribute("viewBox", `0 0 ${F.width} ${F.height}`), this._defs = this._window.document.createElementNS("http://www.w3.org/2000/svg", "defs"), this._element.appendChild(this._defs), this._imageUri = F.image, this._instanceId = x.instanceCount++, this._options = F;
}
get width() {
return this._options.width;
}
get height() {
return this._options.height;
}
getElement() {
return this._element;
}
async drawQR(F) {
const C = F.getModuleCount(), q = Math.min(this._options.width, this._options.height) - 2 * this._options.margin, X = this._options.shape === m ? q / Math.sqrt(2) : q, Y = this._roundSize(X / C);
let ue = { hideXDots: 0, hideYDots: 0, width: 0, height: 0 };
if (this._qr = F, this._options.image) {
if (await this.loadImage(), !this._image)
return;
const { imageOptions: ee, qrOptions: pe } = this._options, Te = ee.imageSize * h[pe.errorCorrectionLevel], ve = Math.floor(Te * C * C);
ue = function({ originalHeight: me, originalWidth: we, maxHiddenDots: he, maxHiddenAxisDots: Se, dotSize: xe }) {
const O = { x: 0, y: 0 }, K = { x: 0, y: 0 };
if (me <= 0 || we <= 0 || he <= 0 || xe <= 0)
return { height: 0, width: 0, hideYDots: 0, hideXDots: 0 };
const J = me / we;
return O.x = Math.floor(Math.sqrt(he / J)), O.x <= 0 && (O.x = 1), Se && Se < O.x && (O.x = Se), O.x % 2 == 0 && O.x--, K.x = O.x * xe, O.y = 1 + 2 * Math.ceil((O.x * J - 1) / 2), K.y = Math.round(K.x * J), (O.y * O.x > he || Se && Se < O.y) && (Se && Se < O.y ? (O.y = Se, O.y % 2 == 0 && O.x--) : O.y -= 2, K.y = O.y * xe, O.x = 1 + 2 * Math.ceil((O.y / J - 1) / 2), K.x = Math.round(K.y / J)), { height: K.y, width: K.x, hideYDots: O.y, hideXDots: O.x };
}({ originalWidth: this._image.width, originalHeight: this._image.height, maxHiddenDots: ve, maxHiddenAxisDots: C - 14, dotSize: Y });
}
this.drawBackground(), this.drawDots((ee, pe) => {
var Te, ve, me, we, he, Se;
return !(this._options.imageOptions.hideBackgroundDots && ee >= (C - ue.hideYDots) / 2 && ee < (C + ue.hideYDots) / 2 && pe >= (C - ue.hideXDots) / 2 && pe < (C + ue.hideXDots) / 2 || ((Te = y[ee]) === null || Te === void 0 ? void 0 : Te[pe]) || ((ve = y[ee - C + 7]) === null || ve === void 0 ? void 0 : ve[pe]) || ((me = y[ee]) === null || me === void 0 ? void 0 : me[pe - C + 7]) || ((we = E[ee]) === null || we === void 0 ? void 0 : we[pe]) || ((he = E[ee - C + 7]) === null || he === void 0 ? void 0 : he[pe]) || ((Se = E[ee]) === null || Se === void 0 ? void 0 : Se[pe - C + 7]));
}), this.drawCorners(), this._options.image && await this.drawImage({ width: ue.width, height: ue.height, count: C, dotSize: Y });
}
drawBackground() {
var F, C, q;
const X = this._element, Y = this._options;
if (X) {
const ue = (F = Y.backgroundOptions) === null || F === void 0 ? void 0 : F.gradient, ee = (C = Y.backgroundOptions) === null || C === void 0 ? void 0 : C.color;
let pe = Y.height, Te = Y.width;
if (ue || ee) {
const ve = this._window.document.createElementNS("http://www.w3.org/2000/svg", "rect");
this._backgroundClipPath = this._window.document.createElementNS("http://www.w3.org/2000/svg", "clipPath"), this._backgroundClipPath.setAttribute("id", `clip-path-background-color-${this._instanceId}`), this._defs.appendChild(this._backgroundClipPath), !((q = Y.backgroundOptions) === null || q === void 0) && q.round && (pe = Te = Math.min(Y.width, Y.height), ve.setAttribute("rx", String(pe / 2 * Y.backgroundOptions.round))), ve.setAttribute("x", String(this._roundSize((Y.width - Te) / 2))), ve.setAttribute("y", String(this._roundSize((Y.height - pe) / 2))), ve.setAttribute("width", String(Te)), ve.setAttribute("height", String(pe)), this._backgroundClipPath.appendChild(ve), this._createColor({ options: ue, color: ee, additionalRotation: 0, x: 0, y: 0, height: Y.height, width: Y.width, name: `background-color-${this._instanceId}` });
}
}
}
drawDots(F) {
var C, q;
if (!this._qr)
throw "QR code is not defined";
const X = this._options, Y = this._qr.getModuleCount();
if (Y > X.width || Y > X.height)
throw "The canvas is too small.";
const ue = Math.min(X.width, X.height) - 2 * X.margin, ee = X.shape === m ? ue / Math.sqrt(2) : ue, pe = this._roundSize(ee / Y), Te = this._roundSize((X.width - Y * pe) / 2), ve = this._roundSize((X.height - Y * pe) / 2), me = new p({ svg: this._element, type: X.dotsOptions.type, window: this._window });
this._dotsClipPath = this._window.document.createElementNS("http://www.w3.org/2000/svg", "clipPath"), this._dotsClipPath.setAttribute("id", `clip-path-dot-color-${this._instanceId}`), this._defs.appendChild(this._dotsClipPath), this._createColor({ options: (C = X.dotsOptions) === null || C === void 0 ? void 0 : C.gradient, color: X.dotsOptions.color, additionalRotation: 0, x: 0, y: 0, height: X.height, width: X.width, name: `dot-color-${this._instanceId}` });
for (let we = 0; we < Y; we++)
for (let he = 0; he < Y; he++)
F && !F(we, he) || !((q = this._qr) === null || q === void 0) && q.isDark(we, he) && (me.draw(Te + he * pe, ve + we * pe, pe, (Se, xe) => !(he + Se < 0 || we + xe < 0 || he + Se >= Y || we + xe >= Y) && !(F && !F(we + xe, he + Se)) && !!this._qr && this._qr.isDark(we + xe, he + Se)), me._element && this._dotsClipPath && this._dotsClipPath.appendChild(me._element));
if (X.shape === m) {
const we = this._roundSize((ue / pe - Y) / 2), he = Y + 2 * we, Se = Te - we * pe, xe = ve - we * pe, O = [], K = this._roundSize(he / 2);
for (let J = 0; J < he; J++) {
O[J] = [];
for (let ne = 0; ne < he; ne++)
J >= we - 1 && J <= he - we && ne >= we - 1 && ne <= he - we || Math.sqrt((J - K) * (J - K) + (ne - K) * (ne - K)) > K ? O[J][ne] = 0 : O[J][ne] = this._qr.isDark(ne - 2 * we < 0 ? ne : ne >= Y ? ne - 2 * we : ne - we, J - 2 * we < 0 ? J : J >= Y ? J - 2 * we : J - we) ? 1 : 0;
}
for (let J = 0; J < he; J++)
for (let ne = 0; ne < he; ne++)
O[J][ne] && (me.draw(Se + ne * pe, xe + J * pe, pe, (re, fe) => {
var Ae;
return !!(!((Ae = O[J + fe]) === null || Ae === void 0) && Ae[ne + re]);
}), me._element && this._dotsClipPath && this._dotsClipPath.appendChild(me._element));
}
}
drawCorners() {
if (!this._qr)
throw "QR code is not defined";
const F = this._element, C = this._options;
if (!F)
throw "Element code is not defined";
const q = this._qr.getModuleCount(), X = Math.min(C.width, C.height) - 2 * C.margin, Y = C.shape === m ? X / Math.sqrt(2) : X, ue = this._roundSize(Y / q), ee = 7 * ue, pe = 3 * ue, Te = this._roundSize((C.width - q * ue) / 2), ve = this._roundSize((C.height - q * ue) / 2);
[[0, 0, 0], [1, 0, Math.PI / 2], [0, 1, -Math.PI / 2]].forEach(([me, we, he]) => {
var Se, xe, O, K, J, ne, re, fe, Ae, Fe, Xe, Ze, be, Le;
const ke = Te + me * ue * (q - 7), it = ve + we * ue * (q - 7);
let pt = this._dotsClipPath, De = this._dotsClipPath;
if ((((Se = C.cornersSquareOptions) === null || Se === void 0 ? void 0 : Se.gradient) || ((xe = C.cornersSquareOptions) === null || xe === void 0 ? void 0 : xe.color)) && (pt = this._window.document.createElementNS("http://www.w3.org/2000/svg", "clipPath"), pt.setAttribute("id", `clip-path-corners-square-color-${me}-${we}-${this._instanceId}`), this._defs.appendChild(pt), this._cornersSquareClipPath = this._cornersDotClipPath = De = pt, this._createColor({ options: (O = C.cornersSquareOptions) === null || O === void 0 ? void 0 : O.gradient, color: (K = C.cornersSquareOptions) === null || K === void 0 ? void 0 : K.color, additionalRotation: he, x: ke, y: it, height: ee, width: ee, name: `corners-square-color-${me}-${we}-${this._instanceId}` })), ((J = C.cornersSquareOptions) === null || J === void 0 ? void 0 : J.type) && _.includes(C.cornersSquareOptions.type)) {
const ze = new S({ svg: this._element, type: C.cornersSquareOptions.type, window: this._window });
ze.draw(ke, it, ee, he), ze._element && pt && pt.appendChild(ze._element);
} else {
const ze = new p({ svg: this._element, type: ((ne = C.cornersSquareOptions) === null || ne === void 0 ? void 0 : ne.type) || C.dotsOptions.type, window: this._window });
for (let at = 0; at < y.length; at++)
for (let He = 0; He < y[at].length; He++)
!((re = y[at]) === null || re === void 0) && re[He] && (ze.draw(ke + He * ue, it + at * ue, ue, (Rt, ft) => {
var Be;
return !!(!((Be = y[at + ft]) === null || Be === void 0) && Be[He + Rt]);
}), ze._element && pt && pt.appendChild(ze._element));
}
if ((((fe = C.cornersDotOptions) === null || fe === void 0 ? void 0 : fe.gradient) || ((Ae = C.cornersDotOptions) === null || Ae === void 0 ? void 0 : Ae.color)) && (De = this._window.document.createElementNS("http://www.w3.org/2000/svg", "clipPath"), De.setAttribute("id", `clip-path-corners-dot-color-${me}-${we}-${this._instanceId}`), this._defs.appendChild(De), this._cornersDotClipPath = De, this._createColor({ options: (Fe = C.cornersDotOptions) === null || Fe === void 0 ? void 0 : Fe.gradient, color: (Xe = C.cornersDotOptions) === null || Xe === void 0 ? void 0 : Xe.color, additionalRotation: he, x: ke + 2 * ue, y: it + 2 * ue, height: pe, width: pe, name: `corners-dot-color-${me}-${we}-${this._instanceId}` })), ((Ze = C.cornersDotOptions) === null || Ze === void 0 ? void 0 : Ze.type) && A.includes(C.cornersDotOptions.type)) {
const ze = new w({ svg: this._element, type: C.cornersDotOptions.type, window: this._window });
ze.draw(ke + 2 * ue, it + 2 * ue, pe, he), ze._element && De && De.appendChild(ze._element);
} else {
const ze = new p({ svg: this._element, type: ((be = C.cornersDotOptions) === null || be === void 0 ? void 0 : be.type) || C.dotsOptions.type, window: this._window });
for (let at = 0; at < E.length; at++)
for (let He = 0; He < E[at].length; He++)
!((Le = E[at]) === null || Le === void 0) && Le[He] && (ze.draw(ke + He * ue, it + at * ue, ue, (Rt, ft) => {
var Be;
return !!(!((Be = E[at + ft]) === null || Be === void 0) && Be[He + Rt]);
}), ze._element && De && De.appendChild(ze._element));
}
});
}
loadImage() {
return new Promise((F, C) => {
var q;
const X = this._options;
if (!X.image)
return C("Image is not defined");
if (!((q = X.nodeCanvas) === null || q === void 0) && q.loadImage)
X.nodeCanvas.loadImage(X.image).then((Y) => {
var ue, ee;
if (this._image = Y, this._options.imageOptions.saveAsBlob) {
const pe = (ue = X.nodeCanvas) === null || ue === void 0 ? void 0 : ue.createCanvas(this._image.width, this._image.height);
(ee = pe == null ? void 0 : pe.getContext("2d")) === null || ee === void 0 || ee.drawImage(Y, 0, 0), this._imageUri = pe == null ? void 0 : pe.toDataURL();
}
F();
}).catch(C);
else {
const Y = new this._window.Image();
typeof X.imageOptions.crossOrigin == "string" && (Y.crossOrigin = X.imageOptions.crossOrigin), this._image = Y, Y.onload = async () => {
this._options.imageOptions.saveAsBlob && (this._imageUri = await async function(ue, ee) {
return new Promise((pe) => {
const Te = new ee.XMLHttpRequest();
Te.onload = function() {
const ve = new ee.FileReader();
ve.onloadend = function() {
pe(ve.result);
}, ve.readAsDataURL(Te.response);
}, Te.open("GET", ue), Te.responseType = "blob", Te.send();
});
}(X.image || "", this._window)), F();
}, Y.src = X.image;
}
});
}
async drawImage({ width: F, height: C, count: q, dotSize: X }) {
const Y = this._options, ue = this._roundSize((Y.width - q * X) / 2), ee = this._roundSize((Y.height - q * X) / 2), pe = ue + this._roundSize(Y.imageOptions.margin + (q * X - F) / 2), Te = ee + this._roundSize(Y.imageOptions.margin + (q * X - C) / 2), ve = F - 2 * Y.imageOptions.margin, me = C - 2 * Y.imageOptions.margin, we = this._window.document.createElementNS("http://www.w3.org/2000/svg", "image");
we.setAttribute("href", this._imageUri || ""), we.setAttribute("xlink:href", this._imageUri || ""), we.setAttribute("x", String(pe)), we.setAttribute("y", String(Te)), we.setAttribute("width", `${ve}px`), we.setAttribute("height", `${me}px`), this._element.appendChild(we);
}
_createColor({ options: F, color: C, additionalRotation: q, x: X, y: Y, height: ue, width: ee, name: pe }) {
const Te = ee > ue ? ee : ue, ve = this._window.document.createElementNS("http://www.w3.org/2000/svg", "rect");
if (ve.setAttribute("x", String(X)), ve.setAttribute("y", String(Y)), ve.setAttribute("height", String(ue)), ve.setAttribute("width", String(ee)), ve.setAttribute("clip-path", `url('#clip-path-${pe}')`), F) {
let me;
if (F.type === "radial")
me = this._window.document.createElementNS("http://www.w3.org/2000/svg", "radialGradient"), me.setAttribute("id", pe), me.setAttribute("gradientUnits", "userSpaceOnUse"), me.setAttribute("fx", String(X + ee / 2)), me.setAttribute("fy", String(Y + ue / 2)), me.setAttribute("cx", String(X + ee / 2)), me.setAttribute("cy", String(Y + ue / 2)), me.setAttribute("r", String(Te / 2));
else {
const we = ((F.rotation || 0) + q) % (2 * Math.PI), he = (we + 2 * Math.PI) % (2 * Math.PI);
let Se = X + ee / 2, xe = Y + ue / 2, O = X + ee / 2, K = Y + ue / 2;
he >= 0 && he <= 0.25 * Math.PI || he > 1.75 * Math.PI && he <= 2 * Math.PI ? (Se -= ee / 2, xe -= ue / 2 * Math.tan(we), O += ee / 2, K += ue / 2 * Math.tan(we)) : he > 0.25 * Math.PI && he <= 0.75 * Math.PI ? (xe -= ue / 2, Se -= ee / 2 / Math.tan(we), K += ue / 2, O += ee / 2 / Math.tan(we)) : he > 0.75 * Math.PI && he <= 1.25 * Math.PI ? (Se += ee / 2, xe += ue / 2 * Math.tan(we), O -= ee / 2, K -= ue / 2 * Math.tan(we)) : he > 1.25 * Math.PI && he <= 1.75 * Math.PI && (xe += ue / 2, Se += ee / 2 / Math.tan(we), K -= ue / 2, O -= ee / 2 / Math.tan(we)), me = this._window.document.createElementNS("http://www.w3.org/2000/svg", "linearGradient"), me.setAttribute("id", pe), me.setAttribute("gradientUnits", "userSpaceOnUse"), me.setAttribute("x1", String(Math.round(Se))), me.setAttribute("y1", String(Math.round(xe))), me.setAttribute("x2", String(Math.round(O))), me.setAttribute("y2", String(Math.round(K)));
}
F.colorStops.forEach(({ offset: we, color: he }) => {
const Se = this._window.document.createElementNS("http://www.w3.org/2000/svg", "stop");
Se.setAttribute("offset", 100 * we + "%"), Se.setAttribute("stop-color", he), me.appendChild(Se);
}), ve.setAttribute("fill", `url('#${pe}')`), this._defs.appendChild(me);
} else
C && ve.setAttribute("fill", C);
this._element.appendChild(ve);
}
}
x.instanceCount = 0;
const k = x, D = "canvas", P = {};
for (let U = 0; U <= 40; U++)
P[U] = U;
const M = { type: D, shape: "square", width: 300, height: 300, data: "", margin: 0, qrOptions: { typeNumber: P[0], mode: void 0, errorCorrectionLevel: "Q" }, imageOptions: { saveAsBlob: !0, hideBackgroundDots: !0, imageSize: 0.4, crossOrigin: void 0, margin: 0 }, dotsOptions: { type: "square", color: "#000", roundSize: !0 }, backgroundOptions: { round: 0, color: "#fff" } };
function B(U) {
const F = Object.assign({}, U);
if (!F.colorStops || !F.colorStops.length)
throw "Field 'colorStops' is required in gradient";
return F.rotation ? F.rotation = Number(F.rotation) : F.rotation = 0, F.colorStops = F.colorStops.map((C) => Object.assign(Object.assign({}, C), { offset: Number(C.offset) })), F;
}
function T(U) {
const F = Object.assign({}, U);
return F.width = Number(F.width), F.height = Number(F.height), F.margin = Number(F.margin), F.imageOptions = Object.assign(Object.assign({}, F.imageOptions), { hideBackgroundDots: Boolean(F.imageOptions.hideBackgroundDots), imageSize: Number(F.imageOptions.imageSize), margin: Number(F.imageOptions.margin) }), F.margin > Math.min(F.width, F.height) && (F.margin = Math.min(F.width, F.height)), F.dotsOptions = Object.assign({}, F.dotsOptions), F.dotsOptions.gradient && (F.dotsOptions.gradient = B(F.dotsOptions.gradient)), F.cornersSquareOptions && (F.cornersSquareOptions = Object.assign({}, F.cornersSquareOptions), F.cornersSquareOptions.gradient && (F.cornersSquareOptions.gradient = B(F.cornersSquareOptions.gradient))), F.cornersDotOptions && (F.cornersDotOptions = Object.assign({}, F.cornersDotOptions), F.cornersDotOptions.gradient && (F.cornersDotOptions.gradient = B(F.cornersDotOptions.gradient))), F.backgroundOptions && (F.backgroundOptions = Object.assign({}, F.backgroundOptions), F.backgroundOptions.gradient && (F.backgroundOptions.gradient = B(F.backgroundOptions.gradient))), F;
}
var $ = n(873), V = n.n($);
function z(U) {
if (!U)
throw new Error("Extension must be defined");
U[0] === "." && (U = U.substring(1));
const F = { bmp: "image/bmp", gif: "image/gif", ico: "image/vnd.microsoft.icon", jpeg: "image/jpeg", jpg: "image/jpeg", png: "image/png", svg: "image/svg+xml", tif: "image/tiff", tiff: "image/tiff", webp: "image/webp", pdf: "application/pdf" }[U.toLowerCase()];
if (!F)
throw new Error(`Extension "${U}" is not supported`);
return F;
}
class H {
constructor(F) {
F != null && F.jsdom ? this._window = new F.jsdom("", { resources: "usable" }).window : this._window = window, this._options = F ? T(u(M, F)) : M, this.update();
}
static _clearContainer(F) {
F && (F.innerHTML = "");
}
_setupSvg() {
if (!this._qr)
return;
const F = new k(this._options, this._window);
this._svg = F.getElement(), this._svgDrawingPromise = F.drawQR(this._qr).then(() => {
var C;
this._svg && ((C = this._extension) === null || C === void 0 || C.call(this, F.getElement(), this._options));
});
}
_setupCanvas() {
var F, C;
this._qr && (!((F = this._options.nodeCanvas) === null || F === void 0) && F.createCanvas ? (this._nodeCanvas = this._options.nodeCanvas.createCanvas(this._options.width, this._options.height), this._nodeCanvas.width = this._options.width, this._nodeCanvas.height = this._options.height) : (this._domCanvas = document.createElement("canvas"), this._domCanvas.width = this._options.width, this._domCanvas.height = this._options.height), this._setupSvg(), this._canvasDrawingPromise = (C = this._svgDrawingPromise) === null || C === void 0 ? void 0 : C.then(() => {
var q;
if (!this._svg)
return;
const X = this._svg, Y = new this._window.XMLSerializer().serializeToString(X), ue = btoa(Y), ee = `data:${z("svg")};base64,${ue}`;
if (!((q = this._options.nodeCanvas) === null || q === void 0) && q.loadImage)
return this._options.nodeCanvas.loadImage(ee).then((pe) => {
var Te, ve;
pe.width = this._options.width, pe.height = this._options.height, (ve = (Te = this._nodeCanvas) === null || Te === void 0 ? void 0 : Te.getContext("2d")) === null || ve === void 0 || ve.drawImage(pe, 0, 0);
});
{
const pe = new this._window.Image();
return new Promise((Te) => {
pe.onload = () => {
var ve, me;
(me = (ve = this._domCanvas) === null || ve === void 0 ? void 0 : ve.getContext("2d")) === null || me === void 0 || me.drawImage(pe, 0, 0), Te();
}, pe.src = ee;
});
}
}));
}
async _getElement(F = "png") {
if (!this._qr)
throw "QR code is empty";
return F.toLowerCase() === "svg" ? (this._svg && this._svgDrawingPromise || this._setupSvg(), await this._svgDrawingPromise, this._svg) : ((this._domCanvas || this._nodeCanvas) && this._canvasDrawingPromise || this._setupCanvas(), await this._canvasDrawingPromise, this._domCanvas || this._nodeCanvas);
}
update(F) {
H._clearContainer(this._container), this._options = F ? T(u(this._options, F)) : this._options, this._options.data && (this._qr = V()(this._options.qrOptions.typeNumber, this._options.qrOptions.errorCorrectionLevel), this._qr.addData(this._options.data, this._options.qrOptions.mode || function(C) {
switch (!0) {
case /^[0-9]*$/.test(C):
return "Numeric";
case /^[0-9A-Z $%*+\-./:]*$/.test(C):
return "Alphanumeric";
default:
return "Byte";
}
}(this._options.data)), this._qr.make(), this._options.type === D ? this._setupCanvas() : this._setupSvg(), this.append(this._container));
}
append(F) {
if (F) {
if (typeof F.appendChild != "function")
throw "Container should be a single DOM node";
this._options.type === D ? this._domCanvas && F.appendChild(this._domCanvas) : this._svg && F.appendChild(this._svg), this._container = F;
}
}
applyExtension(F) {
if (!F)
throw "Extension function should be defined.";
this._extension = F, this.update();
}
deleteExtension() {
this._extension = void 0, this.update();
}
async getRawData(F = "png") {
if (!this._qr)
throw "QR code is empty";
const C = await this._getElement(F), q = z(F);
if (!C)
return null;
if (F.toLowerCase() === "svg") {
const X = `<?xml version="1.0" standalone="no"?>\r
${new this._window.XMLSerializer().serializeToString(C)}`;
return typeof Blob > "u" || this._options.jsdom ? Buffer.from(X) : new Blob([X], { type: q });
}
return new Promise((X) => {
const Y = C;
if ("toBuffer" in Y)
if (q === "image/png")
X(Y.toBuffer(q));
else if (q === "image/jpeg")
X(Y.toBuffer(q));
else {
if (q !== "application/pdf")
throw Error("Unsupported extension");
X(Y.toBuffer(q));
}
else
"toBlob" in Y && Y.toBlob(X, q, 1);
});
}
async download(F) {
if (!this._qr)
throw "QR code is empty";
if (typeof Blob > "u")
throw "Cannot download in Node.js, call getRawData instead.";
let C = "png", q = "qr";
typeof F == "string" ? (C = F, console.warn("Extension is deprecated as argument for 'download' method, please pass object { name: '...', extension: '...' } as argument")) : typeof F == "object" && F !== null && (F.name && (q = F.name), F.extension && (C = F.extension));
const X = await this._getElement(C);
if (X)
if (C.toLowerCase() === "svg") {
let Y = new XMLSerializer().serializeToString(X);
Y = `<?xml version="1.0" standalone="no"?>\r
` + Y, d(`data:${z(C)};charset=utf-8,${encodeURIComponent(Y)}`, `${q}.svg`);
} else
d(X.toDataURL(z(C)), `${q}.${C}`);
}
}
const I = H;
})(), a.default;
})());
})(ab);
const I4 = /* @__PURE__ */ AE(ab.exports), F4 = Ve({
name: "QrCodeBox",
data() {
return {
qrcode: null
};
},
props: {
data: String,
image: String,
width: Number,
height: Number,
circleType: String,
circleColor: String
},
methods: {},
computed: {},
components: {},
watch: {
$props: {
handler() {
const e = {
dotsOptions: {}
};
Object.keys(this.$props).forEach((t) => {
this.$props[t] != null && this.$props[t] !== "" && (e[t] = this.$props[t]);
}), delete e.formCreateInject, e.circleType && (e.dotsOptions.type = e.circleType), e.circleColor && (e.dotsOptions.color = e.circleColor), delete e.circleColor, delete e.circleType, this.$nextTick(() => {
this.qrcode ? this.qrcode.update(e) : (this.qrcode = Xt(new I4(e)), this.qrcode.append(this.$refs.qr));
});
},
deep: !0,
immediate: !0
}
}
}), M4 = {
class: "_fc-qrcode",
ref: "qr"
};
function P4(e, t, i, r, n, a) {
return W(), ae("div", M4, null, 512);
}
const L4 = /* @__PURE__ */ je(F4, [["render", P4]]);
const N4 = Ve({
name: "FcCity",
props: {
modelValue: Array,
clearable: Boolean,
disabled: Boolean,
filter: Function,
level: {
type: Number,
default: 3
},
api: String
},
emits: ["update:modelValue", "change"],
data() {
return {
value: {
p: "",
c: "",
a: ""
},
oldValue: "",
province: []
};
},
watch: {
modelValue: {
handler(e) {
JSON.stringify(e) !== this.oldValue && this.updateValue();
},
deep: !0
}
},
computed: {
city() {
if (this.value.p) {
for (let e = 0; e < this.province.length; e++)
if (this.province[e].n === this.value.p)
return this.province[e].d;
}
return [];
},
area() {
var e;
if (this.value.c) {
for (let t = 0; t < this.city.length; t++)
if (this.city[t].n === this.value.c)
return ((e = this.city[t]) == null ? void 0 : e.d) || [];
}
return [];
}
},
methods: {
updateValue() {
var t, i, r;
const e = JSON.stringify(this.modelValue);
e !== JSON.stringify(this.oldValue) && (this.value = {
p: ((t = this.modelValue) == null ? void 0 : t[0]) || "",
c: ((i = this.modelValue) == null ? void 0 : i[1]) || "",
a: ((r = this.modelValue) == null ? void 0 : r[2]) || ""
}), this.oldValue = e;
},
changeProvince(e) {
this.value.p = e, this.value.c = "", this.value.a = "";
},
changeCity(e) {
this.value.c = e, this.value.a = "";
},
onInput() {
let e = [];
this.value.p && (e = [this.value.p, this.value.c, this.value.a].filter((t) => !!t), this.level < 3 && e.length !== this.level || this.level > 2 && (e.length < 2 || e.length === 2 && this.area.length)) || (this.oldValue = JSON.stringify(e), this.$emit("update:modelValue", e), this.$emit("change", e));
},
loadData(e) {
return fetch(e).then((t) => t.json()).then((t) => {
this.province = Xt(this.filter ? this.filter(t) || [] : t);
});
}
},
created() {
this.api ? this.loadData(this.api) : this.loadData("https://unpkg.com/@province-city-china/level/level.min.json").catch(() => {
this.loadData("https://cdn.jsdelivr.net/npm/@province-city-china/level/level.min.json").catch(() => {
this.loadData("https://npm.onmicrosoft.cn/@province-city-china/level/level.min.json");
});
});
},
mounted() {
this.updateValue();
}
}), B4 = { class: "_fc-city" };
function V4(e, t, i, r, n, a) {
const s = ie("el-option"), u = ie("el-select");
return W(), ae("div", B4, [
G(u, {
disabled: e.disabled,
clearable: e.clearable,
modelValue: e.value.p,
"onUpdate:modelValue": e.changeProvince,
onChange: e.onInput
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.province, (d) => (W(), ye(s, {
label: d.n,
value: d.n
}, null, 8, ["label", "value"]))), 256))
]),
_: 1
}, 8, ["disabled", "clearable", "modelValue", "onUpdate:modelValue", "onChange"]),
e.level > 1 && e.city.length ? (W(), ye(u, {
key: 0,
disabled: e.disabled,
clearable: e.clearable,
modelValue: e.value.c,
"onUpdate:modelValue": e.changeCity,
onChange: e.onInput
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.city, (d) => (W(), ye(s, {
label: d.n,
value: d.n
}, null, 8, ["label", "value"]))), 256))
]),
_: 1
}, 8, ["disabled", "clearable", "modelValue", "onUpdate:modelValue", "onChange"])) : Oe("", !0),
e.level > 2 && e.area.length ? (W(), ye(u, {
key: 1,
disabled: e.disabled,
clearable: e.clearable,
modelValue: e.value.a,
"onUpdate:modelValue": t[0] || (t[0] = (d) => e.value.a = d),
onChange: e.onInput
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.area, (d) => (W(), ye(s, {
label: d.n,
value: d.n
}, null, 8, ["label", "value"]))), 256))
]),
_: 1
}, 8, ["disabled", "clearable", "modelValue", "onChange"])) : Oe("", !0)
]);
}
const j4 = /* @__PURE__ */ je(N4, [["render", V4]]);
const U4 = Ve({
name: "FcTitle",
data() {
return {};
},
props: {
title: String,
size: String,
align: String
},
computed: {
textStyle() {
return {
textAlign: this.align || "left"
};
}
}
});
function z4(e, t, i, r, n, a) {
return W(), ae("div", {
class: qe(["_fc-title", e.size || "h2"]),
style: An(e.textStyle)
}, le(e.title), 7);
}
const H4 = /* @__PURE__ */ je(U4, [["render", z4]]);
function Sp() {
return {
async: !1,
breaks: !1,
extensions: null,
gfm: !0,
hooks: null,
pedantic: !1,
renderer: null,
silent: !1,
tokenizer: null,
walkTokens: null
};
}
let eo = Sp();
function lb(e) {
eo = e;
}
const Za = { exec: () => null };
function Nt(e, t = "") {
let i = typeof e == "string" ? e : e.source;
const r = {
replace: (n, a) => {
let s = typeof a == "string" ? a : a.source;
return s = s.replace(Un.caret, "$1"), i = i.replace(n, s), r;
},
getRegex: () => new RegExp(i, t)
};
return r;
}
const Un = {
codeRemoveIndent: /^(?: {1,4}| {0,3}\t)/gm,
outputLinkReplace: /\\([\[\]])/g,
indentCodeCompensation: /^(\s+)(?:```)/,
beginningSpace: /^\s+/,
endingHash: /#$/,
startingSpaceChar: /^ /,
endingSpaceChar: / $/,
nonSpaceChar: /[^ ]/,
newLineCharGlobal: /\n/g,
tabCharGlobal: /\t/g,
multipleSpaceGlobal: /\s+/g,
blankLine: /^[ \t]*$/,
doubleBlankLine: /\n[ \t]*\n[ \t]*$/,
blockquoteStart: /^ {0,3}>/,
blockquoteSetextReplace: /\n {0,3}((?:=+|-+) *)(?=\n|$)/g,
blockquoteSetextReplace2: /^ {0,3}>[ \t]?/gm,
listReplaceTabs: /^\t+/,
listReplaceNesting: /^ {1,4}(?=( {4})*[^ ])/g,
listIsTask: /^\[[ xX]\] /,
listReplaceTask: /^\[[ xX]\] +/,
anyLine: /\n.*\n/,
hrefBrackets: /^<(.*)>$/,
tableDelimiter: /[:|]/,
tableAlignChars: /^\||\| *$/g,
tableRowBlankLine: /\n[ \t]*$/,
tableAlignRight: /^ *-+: *$/,
tableAlignCenter: /^ *:-+: *$/,
tableAlignLeft: /^ *:-+ *$/,
startATag: /^<a /i,
endATag: /^<\/a>/i,
startPreScriptTag: /^<(pre|code|kbd|script)(\s|>)/i,
endPreScriptTag: /^<\/(pre|code|kbd|script)(\s|>)/i,
startAngleBracket: /^</,
endAngleBracket: />$/,
pedanticHrefTitle: /^([^'"]*[^\s])\s+(['"])(.*)\2/,
unicodeAlphaNumeric: /[\p{L}\p{N}]/u,
escapeTest: /[&<>"']/,
escapeReplace: /[&<>"']/g,
escapeTestNoEncode: /[<>"']|&(?!(#\d{1,7}|#[Xx][a-fA-F0-9]{1,6}|\w+);)/,
escapeReplaceNoEncode: /[<>"']|&(?!(#\d{1,7}|#[Xx][a-fA-F0-9]{1,6}|\w+);)/g,
unescapeTest: /&(#(?:\d+)|(?:#x[0-9A-Fa-f]+)|(?:\w+));?/ig,
caret: /(^|[^\[])\^/g,
percentDecode: /%25/g,
findPipe: /\|/g,
splitPipe: / \|/,
slashPipe: /\\\|/g,
carriageReturn: /\r\n|\r/g,
spaceLine: /^ +$/gm,
notSpaceStart: /^\S*/,
endingNewline: /\n$/,
listItemRegex: (e) => new RegExp(`^( {0,3}${e})((?:[ ][^\\n]*)?(?:\\n|$))`),
nextBulletRegex: (e) => new RegExp(`^ {0,${Math.min(3, e - 1)}}(?:[*+-]|\\d{1,9}[.)])((?:[ ][^\\n]*)?(?:\\n|$))`),
hrRegex: (e) => new RegExp(`^ {0,${Math.min(3, e - 1)}}((?:- *){3,}|(?:_ *){3,}|(?:\\* *){3,})(?:\\n+|$)`),
fencesBeginRegex: (e) => new RegExp(`^ {0,${Math.min(3, e - 1)}}(?:\`\`\`|~~~)`),
headingBeginRegex: (e) => new RegExp(`^ {0,${Math.min(3, e - 1)}}#`),
htmlBeginRegex: (e) => new RegExp(`^ {0,${Math.min(3, e - 1)}}<(?:[a-z].*>|!--)`, "i")
}, W4 = /^(?:[ \t]*(?:\n|$))+/, G4 = /^((?: {4}| {0,3}\t)[^\n]+(?:\n(?:[ \t]*(?:\n|$))*)?)+/, K4 = /^ {0,3}(`{3,}(?=[^`\n]*(?:\n|$))|~{3,})([^\n]*)(?:\n|$)(?:|([\s\S]*?)(?:\n|$))(?: {0,3}\1[~`]* *(?=\n|$)|$)/, pl = /^ {0,3}((?:-[\t ]*){3,}|(?:_[ \t]*){3,}|(?:\*[ \t]*){3,})(?:\n+|$)/, Y4 = /^ {0,3}(#{1,6})(?=\s|$)(.*)(?:\n+|$)/, Ep = /(?:[*+-]|\d{1,9}[.)])/, sb = /^(?!bull |blockCode|fences|blockquote|heading|html|table)((?:.|\n(?!\s*?\n|bull |blockCode|fences|blockquote|heading|html|table))+?)\n {0,3}(=+|-+) *(?:\n+|$)/, ub = Nt(sb).replace(/bull/g, Ep).replace(/blockCode/g, /(?: {4}| {0,3}\t)/).replace(/fences/g, / {0,3}(?:`{3,}|~{3,})/).replace(/blockquote/g, / {0,3}>/).replace(/heading/g, / {0,3}#{1,6}/).replace(/html/g, / {0,3}<[^\n>]+>\n/).replace(/\|table/g, "").getRegex(), Q4 = Nt(sb).replace(/bull/g, Ep).replace(/blockCode/g, /(?: {4}| {0,3}\t)/).replace(/fences/g, / {0,3}(?:`{3,}|~{3,})/).replace(/blockquote/g, / {0,3}>/).replace(/heading/g, / {0,3}#{1,6}/).replace(/html/g, / {0,3}<[^\n>]+>\n/).replace(/table/g, / {0,3}\|?(?:[:\- ]*\|)+[\:\- ]*\n/).getRegex(), xp = /^([^\n]+(?:\n(?!hr|heading|lheading|blockquote|fences|list|html|table| +\n)[^\n]+)*)/, J4 = /^[^\n]+/, Tp = /(?!\s*\])(?:\\.|[^\[\]\\])+/, X4 = Nt(/^ {0,3}\[(label)\]: *(?:\n[ \t]*)?([^<\s][^\s]*|<.*?>)(?:(?: +(?:\n[ \t]*)?| *\n[ \t]*)(title))? *(?:\n+|$)/).replace("label", Tp).replace("title", /(?:"(?:\\"?|[^"\\])*"|'[^'\n]*(?:\n[^'\n]+)*\n?'|\([^()]*\))/).getRegex(), Z4 = Nt(/^( {0,3}bull)([ \t][^\n]+?)?(?:\n|$)/).replace(/bull/g, Ep).getRegex(), Cu = "address|article|aside|base|basefont|blockquote|body|caption|center|col|colgroup|dd|details|dialog|dir|div|dl|dt|fieldset|figcaption|figure|footer|form|frame|frameset|h[1-6]|head|header|hr|html|iframe|legend|li|link|main|menu|menuitem|meta|nav|noframes|ol|optgroup|option|p|param|search|section|summary|table|tbody|td|tfoot|th|thead|title|tr|track|ul", kp = /<!--(?:-?>|[\s\S]*?(?:-->|$))/, q4 = Nt("^ {0,3}(?:<(script|pre|style|textarea)[\\s>][\\s\\S]*?(?:</\\1>[^\\n]*\\n+|$)|comment[^\\n]*(\\n+|$)|<\\?[\\s\\S]*?(?:\\?>\\n*|$)|<![A-Z][\\s\\S]*?(?:>\\n*|$)|<!\\[CDATA\\[[\\s\\S]*?(?:\\]\\]>\\n*|$)|</?(tag)(?: +|\\n|/?>)[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$)|<(?!script|pre|style|textarea)([a-z][\\w-]*)(?:attribute)*? */?>(?=[ \\t]*(?:\\n|$))[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$)|</(?!script|pre|style|textarea)[a-z][\\w-]*\\s*>(?=[ \\t]*(?:\\n|$))[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$))", "i").replace("comment", kp).replace("tag", Cu).replace("attribute", / +[a-zA-Z:_][\w.:-]*(?: *= *"[^"\n]*"| *= *'[^'\n]*'| *= *[^\s"'=<>`]+)?/).getRegex(), db = Nt(xp).replace("hr", pl).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("|lheading", "").replace("|table", "").replace("blockquote", " {0,3}>").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", "</?(?:tag)(?: +|\\n|/?>)|<(?:script|pre|style|textarea|!--)").replace("tag", Cu).getRegex(), eV = Nt(/^( {0,3}> ?(paragraph|[^\n]*)(?:\n|$))+/).replace("paragraph", db).getRegex(), Op = {
blockquote: eV,
code: G4,
def: X4,
fences: K4,
heading: Y4,
hr: pl,
html: q4,
lheading: ub,
list: Z4,
newline: W4,
paragraph: db,
table: Za,
text: J4
}, Fg = Nt("^ *([^\\n ].*)\\n {0,3}((?:\\| *)?:?-+:? *(?:\\| *:?-+:? *)*(?:\\| *)?)(?:\\n((?:(?! *\\n|hr|heading|blockquote|code|fences|list|html).*(?:\\n|$))*)\\n*|$)").replace("hr", pl).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("blockquote", " {0,3}>").replace("code", "(?: {4}| {0,3} )[^\\n]").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", "</?(?:tag)(?: +|\\n|/?>)|<(?:script|pre|style|textarea|!--)").replace("tag", Cu).getRegex(), tV = {
...Op,
lheading: Q4,
table: Fg,
paragraph: Nt(xp).replace("hr", pl).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("|lheading", "").replace("table", Fg).replace("blockquote", " {0,3}>").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", "</?(?:tag)(?: +|\\n|/?>)|<(?:script|pre|style|textarea|!--)").replace("tag", Cu).getRegex()
}, nV = {
...Op,
html: Nt(`^ *(?:comment *(?:\\n|\\s*$)|<(tag)[\\s\\S]+?</\\1> *(?:\\n{2,}|\\s*$)|<tag(?:"[^"]*"|'[^']*'|\\s[^'"/>\\s]*)*?/?> *(?:\\n{2,}|\\s*$))`).replace("comment", kp).replace(/tag/g, "(?!(?:a|em|strong|small|s|cite|q|dfn|abbr|data|time|code|var|samp|kbd|sub|sup|i|b|u|mark|ruby|rt|rp|bdi|bdo|span|br|wbr|ins|del|img)\\b)\\w+(?!:|[^\\w\\s@]*@)\\b").getRegex(),
def: /^ *\[([^\]]+)\]: *<?([^\s>]+)>?(?: +(["(][^\n]+[")]))? *(?:\n+|$)/,
heading: /^(#{1,6})(.*)(?:\n+|$)/,
fences: Za,
lheading: /^(.+?)\n {0,3}(=+|-+) *(?:\n+|$)/,
paragraph: Nt(xp).replace("hr", pl).replace("heading", ` *#{1,6} *[^
]`).replace("lheading", ub).replace("|table", "").replace("blockquote", " {0,3}>").replace("|fences", "").replace("|list", "").replace("|html", "").replace("|tag", "").getRegex()
}, iV = /^\\([!"#$%&'()*+,\-./:;<=>?@\[\]\\^_`{|}~])/, rV = /^(`+)([^`]|[^`][\s\S]*?[^`])\1(?!`)/, fb = /^( {2,}|\\)\n(?!\s*$)/, oV = /^(`+|[^`])(?:(?= {2,}\n)|[\s\S]*?(?:(?=[\\<!\[`*_]|\b_|$)|[^ ](?= {2,}\n)))/, Su = /[\p{P}\p{S}]/u, Rp = /[\s\p{P}\p{S}]/u, cb = /[^\s\p{P}\p{S}]/u, aV = Nt(/^((?![*_])punctSpace)/, "u").replace(/punctSpace/g, Rp).getRegex(), pb = /(?!~)[\p{P}\p{S}]/u, lV = /(?!~)[\s\p{P}\p{S}]/u, sV = /(?:[^\s\p{P}\p{S}]|~)/u, uV = /\[[^[\]]*?\]\((?:\\.|[^\\\(\)]|\((?:\\.|[^\\\(\)])*\))*\)|`[^`]*?`|<[^<>]*?>/g, hb = /^(?:\*+(?:((?!\*)punct)|[^\s*]))|^_+(?:((?!_)punct)|([^\s_]))/, dV = Nt(hb, "u").replace(/punct/g, Su).getRegex(), fV = Nt(hb, "u").replace(/punct/g, pb).getRegex(), mb = "^[^_*]*?__[^_*]*?\\*[^_*]*?(?=__)|[^*]+(?=[^*])|(?!\\*)punct(\\*+)(?=[\\s]|$)|notPunctSpace(\\*+)(?!\\*)(?=punctSpace|$)|(?!\\*)punctSpace(\\*+)(?=notPunctSpace)|[\\s](\\*+)(?!\\*)(?=punct)|(?!\\*)punct(\\*+)(?!\\*)(?=punct)|notPunctSpace(\\*+)(?=notPunctSpace)", cV = Nt(mb, "gu").replace(/notPunctSpace/g, cb).replace(/punctSpace/g, Rp).replace(/punct/g, Su).getRegex(), pV = Nt(mb, "gu").replace(/notPunctSpace/g, sV).replace(/punctSpace/g, lV).replace(/punct/g, pb).getRegex(), hV = Nt("^[^_*]*?\\*\\*[^_*]*?_[^_*]*?(?=\\*\\*)|[^_]+(?=[^_])|(?!_)punct(_+)(?=[\\s]|$)|notPunctSpace(_+)(?!_)(?=punctSpace|$)|(?!_)punctSpace(_+)(?=notPunctSpace)|[\\s](_+)(?!_)(?=punct)|(?!_)punct(_+)(?!_)(?=punct)", "gu").replace(/notPunctSpace/g, cb).replace(/punctSpace/g, Rp).replace(/punct/g, Su).getRegex(), mV = Nt(/\\(punct)/, "gu").replace(/punct/g, Su).getRegex(), vV = Nt(/^<(scheme:[^\s\x00-\x1f<>]*|email)>/).replace("scheme", /[a-zA-Z][a-zA-Z0-9+.-]{1,31}/).replace("email", /[a-zA-Z0-9.!#$%&'*+/=?^_`{|}~-]+(@)[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)+(?![-_])/).getRegex(), gV = Nt(kp).replace("(?:-->|$)", "-->").getRegex(), yV = Nt("^comment|^</[a-zA-Z][\\w:-]*\\s*>|^<[a-zA-Z][\\w-]*(?:attribute)*?\\s*/?>|^<\\?[\\s\\S]*?\\?>|^<![a-zA-Z]+\\s[\\s\\S]*?>|^<!\\[CDATA\\[[\\s\\S]*?\\]\\]>").replace("comment", gV).replace("attribute", /\s+[a-zA-Z:_][\w.:-]*(?:\s*=\s*"[^"]*"|\s*=\s*'[^']*'|\s*=\s*[^\s"'=<>`]+)?/).getRegex(), Ys = /(?:\[(?:\\.|[^\[\]\\])*\]|\\.|`[^`]*`|[^\[\]\\`])*?/, bV = Nt(/^!?\[(label)\]\(\s*(href)(?:(?:[ \t]*(?:\n[ \t]*)?)(title))?\s*\)/).replace("label", Ys).replace("href", /<(?:\\.|[^\n<>\\])+>|[^ \t\n\x00-\x1f]*/).replace("title", /"(?:\\"?|[^"\\])*"|'(?:\\'?|[^'\\])*'|\((?:\\\)?|[^)\\])*\)/).getRegex(), vb = Nt(/^!?\[(label)\]\[(ref)\]/).replace("label", Ys).replace("ref", Tp).getRegex(), gb = Nt(/^!?\[(ref)\](?:\[\])?/).replace("ref", Tp).getRegex(), _V = Nt("reflink|nolink(?!\\()", "g").replace("reflink", vb).replace("nolink", gb).getRegex(), Dp = {
_backpedal: Za,
anyPunctuation: mV,
autolink: vV,
blockSkip: uV,
br: fb,
code: rV,
del: Za,
emStrongLDelim: dV,
emStrongRDelimAst: cV,
emStrongRDelimUnd: hV,
escape: iV,
link: bV,
nolink: gb,
punctuation: aV,
reflink: vb,
reflinkSearch: _V,
tag: yV,
text: oV,
url: Za
}, wV = {
...Dp,
link: Nt(/^!?\[(label)\]\((.*?)\)/).replace("label", Ys).getRegex(),
reflink: Nt(/^!?\[(label)\]\s*\[([^\]]*)\]/).replace("label", Ys).getRegex()
}, bc = {
...Dp,
emStrongRDelimAst: pV,
emStrongLDelim: fV,
url: Nt(/^((?:ftp|https?):\/\/|www\.)(?:[a-zA-Z0-9\-]+\.?)+[^\s<]*|^email/, "i").replace("email", /[A-Za-z0-9._+-]+(@)[a-zA-Z0-9-_]+(?:\.[a-zA-Z0-9-_]*[a-zA-Z0-9])+(?![-_])/).getRegex(),
_backpedal: /(?:[^?!.,:;*_'"~()&]+|\([^)]*\)|&(?![a-zA-Z0-9]+;$)|[?!.,:;*_'"~)]+(?!$))+/,
del: /^(~~?)(?=[^\s~])((?:\\.|[^\\])*?(?:\\.|[^\s~\\]))\1(?=[^~]|$)/,
text: /^([`~]+|[^`~])(?:(?= {2,}\n)|(?=[a-zA-Z0-9.!#$%&'*+\/=?_`{\|}~-]+@)|[\s\S]*?(?:(?=[\\<!\[`*~_]|\b_|https?:\/\/|ftp:\/\/|www\.|$)|[^ ](?= {2,}\n)|[^a-zA-Z0-9.!#$%&'*+\/=?_`{\|}~-](?=[a-zA-Z0-9.!#$%&'*+\/=?_`{\|}~-]+@)))/
}, AV = {
...bc,
br: Nt(fb).replace("{2,}", "*").getRegex(),
text: Nt(bc.text).replace("\\b_", "\\b_| {2,}\\n").replace(/\{2,\}/g, "*").getRegex()
}, _s = {
normal: Op,
gfm: tV,
pedantic: nV
}, Va = {
normal: Dp,
gfm: bc,
breaks: AV,
pedantic: wV
}, CV = {
"&": "&amp;",
"<": "&lt;",
">": "&gt;",
'"': "&quot;",
"'": "&#39;"
}, Mg = (e) => CV[e];
function Mi(e, t) {
if (t) {
if (Un.escapeTest.test(e))
return e.replace(Un.escapeReplace, Mg);
} else if (Un.escapeTestNoEncode.test(e))
return e.replace(Un.escapeReplaceNoEncode, Mg);
return e;
}
function Pg(e) {
try {
e = encodeURI(e).replace(Un.percentDecode, "%");
} catch {
return null;
}
return e;
}
function Lg(e, t) {
var a;
const i = e.replace(Un.findPipe, (s, u, d) => {
let h = !1, p = u;
for (; --p >= 0 && d[p] === "\\"; )
h = !h;
return h ? "|" : " |";
}), r = i.split(Un.splitPipe);
let n = 0;
if (r[0].trim() || r.shift(), r.length > 0 && !((a = r.at(-1)) != null && a.trim()) && r.pop(), t)
if (r.length > t)
r.splice(t);
else
for (; r.length < t; )
r.push("");
for (; n < r.length; n++)
r[n] = r[n].trim().replace(Un.slashPipe, "|");
return r;
}
function ja(e, t, i) {
const r = e.length;
if (r === 0)
return "";
let n = 0;
for (; n < r && e.charAt(r - n - 1) === t; )
n++;
return e.slice(0, r - n);
}
function SV(e, t) {
if (e.indexOf(t[1]) === -1)
return -1;
let i = 0;
for (let r = 0; r < e.length; r++)
if (e[r] === "\\")
r++;
else if (e[r] === t[0])
i++;
else if (e[r] === t[1] && (i--, i < 0))
return r;
return i > 0 ? -2 : -1;
}
function Ng(e, t, i, r, n) {
const a = t.href, s = t.title || null, u = e[1].replace(n.other.outputLinkReplace, "$1");
r.state.inLink = !0;
const d = {
type: e[0].charAt(0) === "!" ? "image" : "link",
raw: i,
href: a,
title: s,
text: u,
tokens: r.inlineTokens(u)
};
return r.state.inLink = !1, d;
}
function EV(e, t, i) {
const r = e.match(i.other.indentCodeCompensation);
if (r === null)
return t;
const n = r[1];
return t.split(`
`).map((a) => {
const s = a.match(i.other.beginningSpace);
if (s === null)
return a;
const [u] = s;
return u.length >= n.length ? a.slice(n.length) : a;
}).join(`
`);
}
class Qs {
constructor(t) {
zt(this, "options");
zt(this, "rules");
zt(this, "lexer");
this.options = t || eo;
}
space(t) {
const i = this.rules.block.newline.exec(t);
if (i && i[0].length > 0)
return {
type: "space",
raw: i[0]
};
}
code(t) {
const i = this.rules.block.code.exec(t);
if (i) {
const r = i[0].replace(this.rules.other.codeRemoveIndent, "");
return {
type: "code",
raw: i[0],
codeBlockStyle: "indented",
text: this.options.pedantic ? r : ja(r, `
`)
};
}
}
fences(t) {
const i = this.rules.block.fences.exec(t);
if (i) {
const r = i[0], n = EV(r, i[3] || "", this.rules);
return {
type: "code",
raw: r,
lang: i[2] ? i[2].trim().replace(this.rules.inline.anyPunctuation, "$1") : i[2],
text: n
};
}
}
heading(t) {
const i = this.rules.block.heading.exec(t);
if (i) {
let r = i[2].trim();
if (this.rules.other.endingHash.test(r)) {
const n = ja(r, "#");
(this.options.pedantic || !n || this.rules.other.endingSpaceChar.test(n)) && (r = n.trim());
}
return {
type: "heading",
raw: i[0],
depth: i[1].length,
text: r,
tokens: this.lexer.inline(r)
};
}
}
hr(t) {
const i = this.rules.block.hr.exec(t);
if (i)
return {
type: "hr",
raw: ja(i[0], `
`)
};
}
blockquote(t) {
const i = this.rules.block.blockquote.exec(t);
if (i) {
let r = ja(i[0], `
`).split(`
`), n = "", a = "";
const s = [];
for (; r.length > 0; ) {
let u = !1;
const d = [];
let h;
for (h = 0; h < r.length; h++)
if (this.rules.other.blockquoteStart.test(r[h]))
d.push(r[h]), u = !0;
else if (!u)
d.push(r[h]);
else
break;
r = r.slice(h);
const p = d.join(`
`), g = p.replace(this.rules.other.blockquoteSetextReplace, `
$1`).replace(this.rules.other.blockquoteSetextReplace2, "");
n = n ? `${n}
${p}` : p, a = a ? `${a}
${g}` : g;
const _ = this.lexer.state.top;
if (this.lexer.state.top = !0, this.lexer.blockTokens(g, s, !0), this.lexer.state.top = _, r.length === 0)
break;
const S = s.at(-1);
if ((S == null ? void 0 : S.type) === "code")
break;
if ((S == null ? void 0 : S.type) === "blockquote") {
const b = S, A = b.raw + `
` + r.join(`
`), w = this.blockquote(A);
s[s.length - 1] = w, n = n.substring(0, n.length - b.raw.length) + w.raw, a = a.substring(0, a.length - b.text.length) + w.text;
break;
} else if ((S == null ? void 0 : S.type) === "list") {
const b = S, A = b.raw + `
` + r.join(`
`), w = this.list(A);
s[s.length - 1] = w, n = n.substring(0, n.length - S.raw.length) + w.raw, a = a.substring(0, a.length - b.raw.length) + w.raw, r = A.substring(s.at(-1).raw.length).split(`
`);
continue;
}
}
return {
type: "blockquote",
raw: n,
tokens: s,
text: a
};
}
}
list(t) {
let i = this.rules.block.list.exec(t);
if (i) {
let r = i[1].trim();
const n = r.length > 1, a = {
type: "list",
raw: "",
ordered: n,
start: n ? +r.slice(0, -1) : "",
loose: !1,
items: []
};
r = n ? `\\d{1,9}\\${r.slice(-1)}` : `\\${r}`, this.options.pedantic && (r = n ? r : "[*+-]");
const s = this.rules.other.listItemRegex(r);
let u = !1;
for (; t; ) {
let h = !1, p = "", g = "";
if (!(i = s.exec(t)) || this.rules.block.hr.test(t))
break;
p = i[0], t = t.substring(p.length);
let _ = i[2].split(`
`, 1)[0].replace(this.rules.other.listReplaceTabs, (y) => " ".repeat(3 * y.length)), S = t.split(`
`, 1)[0], b = !_.trim(), A = 0;
if (this.options.pedantic ? (A = 2, g = _.trimStart()) : b ? A = i[1].length + 1 : (A = i[2].search(this.rules.other.nonSpaceChar), A = A > 4 ? 1 : A, g = _.slice(A), A += i[1].length), b && this.rules.other.blankLine.test(S) && (p += S + `
`, t = t.substring(S.length + 1), h = !0), !h) {
const y = this.rules.other.nextBulletRegex(A), E = this.rules.other.hrRegex(A), x = this.rules.other.fencesBeginRegex(A), k = this.rules.other.headingBeginRegex(A), D = this.rules.other.htmlBeginRegex(A);
for (; t; ) {
const P = t.split(`
`, 1)[0];
let M;
if (S = P, this.options.pedantic ? (S = S.replace(this.rules.other.listReplaceNesting, " "), M = S) : M = S.replace(this.rules.other.tabCharGlobal, " "), x.test(S) || k.test(S) || D.test(S) || y.test(S) || E.test(S))
break;
if (M.search(this.rules.other.nonSpaceChar) >= A || !S.trim())
g += `
` + M.slice(A);
else {
if (b || _.replace(this.rules.other.tabCharGlobal, " ").search(this.rules.other.nonSpaceChar) >= 4 || x.test(_) || k.test(_) || E.test(_))
break;
g += `
` + S;
}
!b && !S.trim() && (b = !0), p += P + `
`, t = t.substring(P.length + 1), _ = M.slice(A);
}
}
a.loose || (u ? a.loose = !0 : this.rules.other.doubleBlankLine.test(p) && (u = !0));
let w = null, m;
this.options.gfm && (w = this.rules.other.listIsTask.exec(g), w && (m = w[0] !== "[ ] ", g = g.replace(this.rules.other.listReplaceTask, ""))), a.items.push({
type: "list_item",
raw: p,
task: !!w,
checked: m,
loose: !1,
text: g,
tokens: []
}), a.raw += p;
}
const d = a.items.at(-1);
if (d)
d.raw = d.raw.trimEnd(), d.text = d.text.trimEnd();
else
return;
a.raw = a.raw.trimEnd();
for (let h = 0; h < a.items.length; h++)
if (this.lexer.state.top = !1, a.items[h].tokens = this.lexer.blockTokens(a.items[h].text, []), !a.loose) {
const p = a.items[h].tokens.filter((_) => _.type === "space"), g = p.length > 0 && p.some((_) => this.rules.other.anyLine.test(_.raw));
a.loose = g;
}
if (a.loose)
for (let h = 0; h < a.items.length; h++)
a.items[h].loose = !0;
return a;
}
}
html(t) {
const i = this.rules.block.html.exec(t);
if (i)
return {
type: "html",
block: !0,
raw: i[0],
pre: i[1] === "pre" || i[1] === "script" || i[1] === "style",
text: i[0]
};
}
def(t) {
const i = this.rules.block.def.exec(t);
if (i) {
const r = i[1].toLowerCase().replace(this.rules.other.multipleSpaceGlobal, " "), n = i[2] ? i[2].replace(this.rules.other.hrefBrackets, "$1").replace(this.rules.inline.anyPunctuation, "$1") : "", a = i[3] ? i[3].substring(1, i[3].length - 1).replace(this.rules.inline.anyPunctuation, "$1") : i[3];
return {
type: "def",
tag: r,
raw: i[0],
href: n,
title: a
};
}
}
table(t) {
var u;
const i = this.rules.block.table.exec(t);
if (!i || !this.rules.other.tableDelimiter.test(i[2]))
return;
const r = Lg(i[1]), n = i[2].replace(this.rules.other.tableAlignChars, "").split("|"), a = (u = i[3]) != null && u.trim() ? i[3].replace(this.rules.other.tableRowBlankLine, "").split(`
`) : [], s = {
type: "table",
raw: i[0],
header: [],
align: [],
rows: []
};
if (r.length === n.length) {
for (const d of n)
this.rules.other.tableAlignRight.test(d) ? s.align.push("right") : this.rules.other.tableAlignCenter.test(d) ? s.align.push("center") : this.rules.other.tableAlignLeft.test(d) ? s.align.push("left") : s.align.push(null);
for (let d = 0; d < r.length; d++)
s.header.push({
text: r[d],
tokens: this.lexer.inline(r[d]),
header: !0,
align: s.align[d]
});
for (const d of a)
s.rows.push(Lg(d, s.header.length).map((h, p) => ({
text: h,
tokens: this.lexer.inline(h),
header: !1,
align: s.align[p]
})));
return s;
}
}
lheading(t) {
const i = this.rules.block.lheading.exec(t);
if (i)
return {
type: "heading",
raw: i[0],
depth: i[2].charAt(0) === "=" ? 1 : 2,
text: i[1],
tokens: this.lexer.inline(i[1])
};
}
paragraph(t) {
const i = this.rules.block.paragraph.exec(t);
if (i) {
const r = i[1].charAt(i[1].length - 1) === `
` ? i[1].slice(0, -1) : i[1];
return {
type: "paragraph",
raw: i[0],
text: r,
tokens: this.lexer.inline(r)
};
}
}
text(t) {
const i = this.rules.block.text.exec(t);
if (i)
return {
type: "text",
raw: i[0],
text: i[0],
tokens: this.lexer.inline(i[0])
};
}
escape(t) {
const i = this.rules.inline.escape.exec(t);
if (i)
return {
type: "escape",
raw: i[0],
text: i[1]
};
}
tag(t) {
const i = this.rules.inline.tag.exec(t);
if (i)
return !this.lexer.state.inLink && this.rules.other.startATag.test(i[0]) ? this.lexer.state.inLink = !0 : this.lexer.state.inLink && this.rules.other.endATag.test(i[0]) && (this.lexer.state.inLink = !1), !this.lexer.state.inRawBlock && this.rules.other.startPreScriptTag.test(i[0]) ? this.lexer.state.inRawBlock = !0 : this.lexer.state.inRawBlock && this.rules.other.endPreScriptTag.test(i[0]) && (this.lexer.state.inRawBlock = !1), {
type: "html",
raw: i[0],
inLink: this.lexer.state.inLink,
inRawBlock: this.lexer.state.inRawBlock,
block: !1,
text: i[0]
};
}
link(t) {
const i = this.rules.inline.link.exec(t);
if (i) {
const r = i[2].trim();
if (!this.options.pedantic && this.rules.other.startAngleBracket.test(r)) {
if (!this.rules.other.endAngleBracket.test(r))
return;
const s = ja(r.slice(0, -1), "\\");
if ((r.length - s.length) % 2 === 0)
return;
} else {
const s = SV(i[2], "()");
if (s === -2)
return;
if (s > -1) {
const d = (i[0].indexOf("!") === 0 ? 5 : 4) + i[1].length + s;
i[2] = i[2].substring(0, s), i[0] = i[0].substring(0, d).trim(), i[3] = "";
}
}
let n = i[2], a = "";
if (this.options.pedantic) {
const s = this.rules.other.pedanticHrefTitle.exec(n);
s && (n = s[1], a = s[3]);
} else
a = i[3] ? i[3].slice(1, -1) : "";
return n = n.trim(), this.rules.other.startAngleBracket.test(n) && (this.options.pedantic && !this.rules.other.endAngleBracket.test(r) ? n = n.slice(1) : n = n.slice(1, -1)), Ng(i, {
href: n && n.replace(this.rules.inline.anyPunctuation, "$1"),
title: a && a.replace(this.rules.inline.anyPunctuation, "$1")
}, i[0], this.lexer, this.rules);
}
}
reflink(t, i) {
let r;
if ((r = this.rules.inline.reflink.exec(t)) || (r = this.rules.inline.nolink.exec(t))) {
const n = (r[2] || r[1]).replace(this.rules.other.multipleSpaceGlobal, " "), a = i[n.toLowerCase()];
if (!a) {
const s = r[0].charAt(0);
return {
type: "text",
raw: s,
text: s
};
}
return Ng(r, a, r[0], this.lexer, this.rules);
}
}
emStrong(t, i, r = "") {
let n = this.rules.inline.emStrongLDelim.exec(t);
if (!n || n[3] && r.match(this.rules.other.unicodeAlphaNumeric))
return;
if (!(n[1] || n[2] || "") || !r || this.rules.inline.punctuation.exec(r)) {
const s = [...n[0]].length - 1;
let u, d, h = s, p = 0;
const g = n[0][0] === "*" ? this.rules.inline.emStrongRDelimAst : this.rules.inline.emStrongRDelimUnd;
for (g.lastIndex = 0, i = i.slice(-1 * t.length + s); (n = g.exec(i)) != null; ) {
if (u = n[1] || n[2] || n[3] || n[4] || n[5] || n[6], !u)
continue;
if (d = [...u].length, n[3] || n[4]) {
h += d;
continue;
} else if ((n[5] || n[6]) && s % 3 && !((s + d) % 3)) {
p += d;
continue;
}
if (h -= d, h > 0)
continue;
d = Math.min(d, d + h + p);
const _ = [...n[0]][0].length, S = t.slice(0, s + n.index + _ + d);
if (Math.min(s, d) % 2) {
const A = S.slice(1, -1);
return {
type: "em",
raw: S,
text: A,
tokens: this.lexer.inlineTokens(A)
};
}
const b = S.slice(2, -2);
return {
type: "strong",
raw: S,
text: b,
tokens: this.lexer.inlineTokens(b)
};
}
}
}
codespan(t) {
const i = this.rules.inline.code.exec(t);
if (i) {
let r = i[2].replace(this.rules.other.newLineCharGlobal, " ");
const n = this.rules.other.nonSpaceChar.test(r), a = this.rules.other.startingSpaceChar.test(r) && this.rules.other.endingSpaceChar.test(r);
return n && a && (r = r.substring(1, r.length - 1)), {
type: "codespan",
raw: i[0],
text: r
};
}
}
br(t) {
const i = this.rules.inline.br.exec(t);
if (i)
return {
type: "br",
raw: i[0]
};
}
del(t) {
const i = this.rules.inline.del.exec(t);
if (i)
return {
type: "del",
raw: i[0],
text: i[2],
tokens: this.lexer.inlineTokens(i[2])
};
}
autolink(t) {
const i = this.rules.inline.autolink.exec(t);
if (i) {
let r, n;
return i[2] === "@" ? (r = i[1], n = "mailto:" + r) : (r = i[1], n = r), {
type: "link",
raw: i[0],
text: r,
href: n,
tokens: [
{
type: "text",
raw: r,
text: r
}
]
};
}
}
url(t) {
var r, n;
let i;
if (i = this.rules.inline.url.exec(t)) {
let a, s;
if (i[2] === "@")
a = i[0], s = "mailto:" + a;
else {
let u;
do
u = i[0], i[0] = (n = (r = this.rules.inline._backpedal.exec(i[0])) == null ? void 0 : r[0]) != null ? n : "";
while (u !== i[0]);
a = i[0], i[1] === "www." ? s = "http://" + i[0] : s = i[0];
}
return {
type: "link",
raw: i[0],
text: a,
href: s,
tokens: [
{
type: "text",
raw: a,
text: a
}
]
};
}
}
inlineText(t) {
const i = this.rules.inline.text.exec(t);
if (i) {
const r = this.lexer.state.inRawBlock;
return {
type: "text",
raw: i[0],
text: i[0],
escaped: r
};
}
}
}
class pi {
constructor(t) {
zt(this, "tokens");
zt(this, "options");
zt(this, "state");
zt(this, "tokenizer");
zt(this, "inlineQueue");
this.tokens = [], this.tokens.links = /* @__PURE__ */ Object.create(null), this.options = t || eo, this.options.tokenizer = this.options.tokenizer || new Qs(), this.tokenizer = this.options.tokenizer, this.tokenizer.options = this.options, this.tokenizer.lexer = this, this.inlineQueue = [], this.state = {
inLink: !1,
inRawBlock: !1,
top: !0
};
const i = {
other: Un,
block: _s.normal,
inline: Va.normal
};
this.options.pedantic ? (i.block = _s.pedantic, i.inline = Va.pedantic) : this.options.gfm && (i.block = _s.gfm, this.options.breaks ? i.inline = Va.breaks : i.inline = Va.gfm), this.tokenizer.rules = i;
}
static get rules() {
return {
block: _s,
inline: Va
};
}
static lex(t, i) {
return new pi(i).lex(t);
}
static lexInline(t, i) {
return new pi(i).inlineTokens(t);
}
lex(t) {
t = t.replace(Un.carriageReturn, `
`), this.blockTokens(t, this.tokens);
for (let i = 0; i < this.inlineQueue.length; i++) {
const r = this.inlineQueue[i];
this.inlineTokens(r.src, r.tokens);
}
return this.inlineQueue = [], this.tokens;
}
blockTokens(t, i = [], r = !1) {
var n, a, s;
for (this.options.pedantic && (t = t.replace(Un.tabCharGlobal, " ").replace(Un.spaceLine, "")); t; ) {
let u;
if ((a = (n = this.options.extensions) == null ? void 0 : n.block) != null && a.some((h) => (u = h.call({ lexer: this }, t, i)) ? (t = t.substring(u.raw.length), i.push(u), !0) : !1))
continue;
if (u = this.tokenizer.space(t)) {
t = t.substring(u.raw.length);
const h = i.at(-1);
u.raw.length === 1 && h !== void 0 ? h.raw += `
` : i.push(u);
continue;
}
if (u = this.tokenizer.code(t)) {
t = t.substring(u.raw.length);
const h = i.at(-1);
(h == null ? void 0 : h.type) === "paragraph" || (h == null ? void 0 : h.type) === "text" ? (h.raw += `
` + u.raw, h.text += `
` + u.text, this.inlineQueue.at(-1).src = h.text) : i.push(u);
continue;
}
if (u = this.tokenizer.fences(t)) {
t = t.substring(u.raw.length), i.push(u);
continue;
}
if (u = this.tokenizer.heading(t)) {
t = t.substring(u.raw.length), i.push(u);
continue;
}
if (u = this.tokenizer.hr(t)) {
t = t.substring(u.raw.length), i.push(u);
continue;
}
if (u = this.tokenizer.blockquote(t)) {
t = t.substring(u.raw.length), i.push(u);
continue;
}
if (u = this.tokenizer.list(t)) {
t = t.substring(u.raw.length), i.push(u);
continue;
}
if (u = this.tokenizer.html(t)) {
t = t.substring(u.raw.length), i.push(u);
continue;
}
if (u = this.tokenizer.def(t)) {
t = t.substring(u.raw.length);
const h = i.at(-1);
(h == null ? void 0 : h.type) === "paragraph" || (h == null ? void 0 : h.type) === "text" ? (h.raw += `
` + u.raw, h.text += `
` + u.raw, this.inlineQueue.at(-1).src = h.text) : this.tokens.links[u.tag] || (this.tokens.links[u.tag] = {
href: u.href,
title: u.title
});
continue;
}
if (u = this.tokenizer.table(t)) {
t = t.substring(u.raw.length), i.push(u);
continue;
}
if (u = this.tokenizer.lheading(t)) {
t = t.substring(u.raw.length), i.push(u);
continue;
}
let d = t;
if ((s = this.options.extensions) != null && s.startBlock) {
let h = 1 / 0;
const p = t.slice(1);
let g;
this.options.extensions.startBlock.forEach((_) => {
g = _.call({ lexer: this }, p), typeof g == "number" && g >= 0 && (h = Math.min(h, g));
}), h < 1 / 0 && h >= 0 && (d = t.substring(0, h + 1));
}
if (this.state.top && (u = this.tokenizer.paragraph(d))) {
const h = i.at(-1);
r && (h == null ? void 0 : h.type) === "paragraph" ? (h.raw += `
` + u.raw, h.text += `
` + u.text, this.inlineQueue.pop(), this.inlineQueue.at(-1).src = h.text) : i.push(u), r = d.length !== t.length, t = t.substring(u.raw.length);
continue;
}
if (u = this.tokenizer.text(t)) {
t = t.substring(u.raw.length);
const h = i.at(-1);
(h == null ? void 0 : h.type) === "text" ? (h.raw += `
` + u.raw, h.text += `
` + u.text, this.inlineQueue.pop(), this.inlineQueue.at(-1).src = h.text) : i.push(u);
continue;
}
if (t) {
const h = "Infinite loop on byte: " + t.charCodeAt(0);
if (this.options.silent) {
console.error(h);
break;
} else
throw new Error(h);
}
}
return this.state.top = !0, i;
}
inline(t, i = []) {
return this.inlineQueue.push({ src: t, tokens: i }), i;
}
inlineTokens(t, i = []) {
var u, d, h;
let r = t, n = null;
if (this.tokens.links) {
const p = Object.keys(this.tokens.links);
if (p.length > 0)
for (; (n = this.tokenizer.rules.inline.reflinkSearch.exec(r)) != null; )
p.includes(n[0].slice(n[0].lastIndexOf("[") + 1, -1)) && (r = r.slice(0, n.index) + "[" + "a".repeat(n[0].length - 2) + "]" + r.slice(this.tokenizer.rules.inline.reflinkSearch.lastIndex));
}
for (; (n = this.tokenizer.rules.inline.anyPunctuation.exec(r)) != null; )
r = r.slice(0, n.index) + "++" + r.slice(this.tokenizer.rules.inline.anyPunctuation.lastIndex);
for (; (n = this.tokenizer.rules.inline.blockSkip.exec(r)) != null; )
r = r.slice(0, n.index) + "[" + "a".repeat(n[0].length - 2) + "]" + r.slice(this.tokenizer.rules.inline.blockSkip.lastIndex);
let a = !1, s = "";
for (; t; ) {
a || (s = ""), a = !1;
let p;
if ((d = (u = this.options.extensions) == null ? void 0 : u.inline) != null && d.some((_) => (p = _.call({ lexer: this }, t, i)) ? (t = t.substring(p.raw.length), i.push(p), !0) : !1))
continue;
if (p = this.tokenizer.escape(t)) {
t = t.substring(p.raw.length), i.push(p);
continue;
}
if (p = this.tokenizer.tag(t)) {
t = t.substring(p.raw.length), i.push(p);
continue;
}
if (p = this.tokenizer.link(t)) {
t = t.substring(p.raw.length), i.push(p);
continue;
}
if (p = this.tokenizer.reflink(t, this.tokens.links)) {
t = t.substring(p.raw.length);
const _ = i.at(-1);
p.type === "text" && (_ == null ? void 0 : _.type) === "text" ? (_.raw += p.raw, _.text += p.text) : i.push(p);
continue;
}
if (p = this.tokenizer.emStrong(t, r, s)) {
t = t.substring(p.raw.length), i.push(p);
continue;
}
if (p = this.tokenizer.codespan(t)) {
t = t.substring(p.raw.length), i.push(p);
continue;
}
if (p = this.tokenizer.br(t)) {
t = t.substring(p.raw.length), i.push(p);
continue;
}
if (p = this.tokenizer.del(t)) {
t = t.substring(p.raw.length), i.push(p);
continue;
}
if (p = this.tokenizer.autolink(t)) {
t = t.substring(p.raw.length), i.push(p);
continue;
}
if (!this.state.inLink && (p = this.tokenizer.url(t))) {
t = t.substring(p.raw.length), i.push(p);
continue;
}
let g = t;
if ((h = this.options.extensions) != null && h.startInline) {
let _ = 1 / 0;
const S = t.slice(1);
let b;
this.options.extensions.startInline.forEach((A) => {
b = A.call({ lexer: this }, S), typeof b == "number" && b >= 0 && (_ = Math.min(_, b));
}), _ < 1 / 0 && _ >= 0 && (g = t.substring(0, _ + 1));
}
if (p = this.tokenizer.inlineText(g)) {
t = t.substring(p.raw.length), p.raw.slice(-1) !== "_" && (s = p.raw.slice(-1)), a = !0;
const _ = i.at(-1);
(_ == null ? void 0 : _.type) === "text" ? (_.raw += p.raw, _.text += p.text) : i.push(p);
continue;
}
if (t) {
const _ = "Infinite loop on byte: " + t.charCodeAt(0);
if (this.options.silent) {
console.error(_);
break;
} else
throw new Error(_);
}
}
return i;
}
}
class Js {
constructor(t) {
zt(this, "options");
zt(this, "parser");
this.options = t || eo;
}
space(t) {
return "";
}
code({ text: t, lang: i, escaped: r }) {
var s;
const n = (s = (i || "").match(Un.notSpaceStart)) == null ? void 0 : s[0], a = t.replace(Un.endingNewline, "") + `
`;
return n ? '<pre><code class="language-' + Mi(n) + '">' + (r ? a : Mi(a, !0)) + `</code></pre>
` : "<pre><code>" + (r ? a : Mi(a, !0)) + `</code></pre>
`;
}
blockquote({ tokens: t }) {
return `<blockquote>
${this.parser.parse(t)}</blockquote>
`;
}
html({ text: t }) {
return t;
}
heading({ tokens: t, depth: i }) {
return `<h${i}>${this.parser.parseInline(t)}</h${i}>
`;
}
hr(t) {
return `<hr>
`;
}
list(t) {
const i = t.ordered, r = t.start;
let n = "";
for (let u = 0; u < t.items.length; u++) {
const d = t.items[u];
n += this.listitem(d);
}
const a = i ? "ol" : "ul", s = i && r !== 1 ? ' start="' + r + '"' : "";
return "<" + a + s + `>
` + n + "</" + a + `>
`;
}
listitem(t) {
var r;
let i = "";
if (t.task) {
const n = this.checkbox({ checked: !!t.checked });
t.loose ? ((r = t.tokens[0]) == null ? void 0 : r.type) === "paragraph" ? (t.tokens[0].text = n + " " + t.tokens[0].text, t.tokens[0].tokens && t.tokens[0].tokens.length > 0 && t.tokens[0].tokens[0].type === "text" && (t.tokens[0].tokens[0].text = n + " " + Mi(t.tokens[0].tokens[0].text), t.tokens[0].tokens[0].escaped = !0)) : t.tokens.unshift({
type: "text",
raw: n + " ",
text: n + " ",
escaped: !0
}) : i += n + " ";
}
return i += this.parser.parse(t.tokens, !!t.loose), `<li>${i}</li>
`;
}
checkbox({ checked: t }) {
return "<input " + (t ? 'checked="" ' : "") + 'disabled="" type="checkbox">';
}
paragraph({ tokens: t }) {
return `<p>${this.parser.parseInline(t)}</p>
`;
}
table(t) {
let i = "", r = "";
for (let a = 0; a < t.header.length; a++)
r += this.tablecell(t.header[a]);
i += this.tablerow({ text: r });
let n = "";
for (let a = 0; a < t.rows.length; a++) {
const s = t.rows[a];
r = "";
for (let u = 0; u < s.length; u++)
r += this.tablecell(s[u]);
n += this.tablerow({ text: r });
}
return n && (n = `<tbody>${n}</tbody>`), `<table>
<thead>
` + i + `</thead>
` + n + `</table>
`;
}
tablerow({ text: t }) {
return `<tr>
${t}</tr>
`;
}
tablecell(t) {
const i = this.parser.parseInline(t.tokens), r = t.header ? "th" : "td";
return (t.align ? `<${r} align="${t.align}">` : `<${r}>`) + i + `</${r}>
`;
}
strong({ tokens: t }) {
return `<strong>${this.parser.parseInline(t)}</strong>`;
}
em({ tokens: t }) {
return `<em>${this.parser.parseInline(t)}</em>`;
}
codespan({ text: t }) {
return `<code>${Mi(t, !0)}</code>`;
}
br(t) {
return "<br>";
}
del({ tokens: t }) {
return `<del>${this.parser.parseInline(t)}</del>`;
}
link({ href: t, title: i, tokens: r }) {
const n = this.parser.parseInline(r), a = Pg(t);
if (a === null)
return n;
t = a;
let s = '<a href="' + t + '"';
return i && (s += ' title="' + Mi(i) + '"'), s += ">" + n + "</a>", s;
}
image({ href: t, title: i, text: r, tokens: n }) {
n && (r = this.parser.parseInline(n, this.parser.textRenderer));
const a = Pg(t);
if (a === null)
return Mi(r);
t = a;
let s = `<img src="${t}" alt="${r}"`;
return i && (s += ` title="${Mi(i)}"`), s += ">", s;
}
text(t) {
return "tokens" in t && t.tokens ? this.parser.parseInline(t.tokens) : "escaped" in t && t.escaped ? t.text : Mi(t.text);
}
}
class $p {
strong({ text: t }) {
return t;
}
em({ text: t }) {
return t;
}
codespan({ text: t }) {
return t;
}
del({ text: t }) {
return t;
}
html({ text: t }) {
return t;
}
text({ text: t }) {
return t;
}
link({ text: t }) {
return "" + t;
}
image({ text: t }) {
return "" + t;
}
br() {
return "";
}
}
class hi {
constructor(t) {
zt(this, "options");
zt(this, "renderer");
zt(this, "textRenderer");
this.options = t || eo, this.options.renderer = this.options.renderer || new Js(), this.renderer = this.options.renderer, this.renderer.options = this.options, this.renderer.parser = this, this.textRenderer = new $p();
}
static parse(t, i) {
return new hi(i).parse(t);
}
static parseInline(t, i) {
return new hi(i).parseInline(t);
}
parse(t, i = !0) {
var n, a;
let r = "";
for (let s = 0; s < t.length; s++) {
const u = t[s];
if ((a = (n = this.options.extensions) == null ? void 0 : n.renderers) != null && a[u.type]) {
const h = u, p = this.options.extensions.renderers[h.type].call({ parser: this }, h);
if (p !== !1 || !["space", "hr", "heading", "code", "table", "blockquote", "list", "html", "paragraph", "text"].includes(h.type)) {
r += p || "";
continue;
}
}
const d = u;
switch (d.type) {
case "space": {
r += this.renderer.space(d);
continue;
}
case "hr": {
r += this.renderer.hr(d);
continue;
}
case "heading": {
r += this.renderer.heading(d);
continue;
}
case "code": {
r += this.renderer.code(d);
continue;
}
case "table": {
r += this.renderer.table(d);
continue;
}
case "blockquote": {
r += this.renderer.blockquote(d);
continue;
}
case "list": {
r += this.renderer.list(d);
continue;
}
case "html": {
r += this.renderer.html(d);
continue;
}
case "paragraph": {
r += this.renderer.paragraph(d);
continue;
}
case "text": {
let h = d, p = this.renderer.text(h);
for (; s + 1 < t.length && t[s + 1].type === "text"; )
h = t[++s], p += `
` + this.renderer.text(h);
i ? r += this.renderer.paragraph({
type: "paragraph",
raw: p,
text: p,
tokens: [{ type: "text", raw: p, text: p, escaped: !0 }]
}) : r += p;
continue;
}
default: {
const h = 'Token with "' + d.type + '" type was not found.';
if (this.options.silent)
return console.error(h), "";
throw new Error(h);
}
}
}
return r;
}
parseInline(t, i = this.renderer) {
var n, a;
let r = "";
for (let s = 0; s < t.length; s++) {
const u = t[s];
if ((a = (n = this.options.extensions) == null ? void 0 : n.renderers) != null && a[u.type]) {
const h = this.options.extensions.renderers[u.type].call({ parser: this }, u);
if (h !== !1 || !["escape", "html", "link", "image", "strong", "em", "codespan", "br", "del", "text"].includes(u.type)) {
r += h || "";
continue;
}
}
const d = u;
switch (d.type) {
case "escape": {
r += i.text(d);
break;
}
case "html": {
r += i.html(d);
break;
}
case "link": {
r += i.link(d);
break;
}
case "image": {
r += i.image(d);
break;
}
case "strong": {
r += i.strong(d);
break;
}
case "em": {
r += i.em(d);
break;
}
case "codespan": {
r += i.codespan(d);
break;
}
case "br": {
r += i.br(d);
break;
}
case "del": {
r += i.del(d);
break;
}
case "text": {
r += i.text(d);
break;
}
default: {
const h = 'Token with "' + d.type + '" type was not found.';
if (this.options.silent)
return console.error(h), "";
throw new Error(h);
}
}
}
return r;
}
}
class qa {
constructor(t) {
zt(this, "options");
zt(this, "block");
this.options = t || eo;
}
preprocess(t) {
return t;
}
postprocess(t) {
return t;
}
processAllTokens(t) {
return t;
}
provideLexer() {
return this.block ? pi.lex : pi.lexInline;
}
provideParser() {
return this.block ? hi.parse : hi.parseInline;
}
}
zt(qa, "passThroughHooks", /* @__PURE__ */ new Set([
"preprocess",
"postprocess",
"processAllTokens"
]));
class yb {
constructor(...t) {
zt(this, "defaults", Sp());
zt(this, "options", this.setOptions);
zt(this, "parse", this.parseMarkdown(!0));
zt(this, "parseInline", this.parseMarkdown(!1));
zt(this, "Parser", hi);
zt(this, "Renderer", Js);
zt(this, "TextRenderer", $p);
zt(this, "Lexer", pi);
zt(this, "Tokenizer", Qs);
zt(this, "Hooks", qa);
this.use(...t);
}
walkTokens(t, i) {
var n, a;
let r = [];
for (const s of t)
switch (r = r.concat(i.call(this, s)), s.type) {
case "table": {
const u = s;
for (const d of u.header)
r = r.concat(this.walkTokens(d.tokens, i));
for (const d of u.rows)
for (const h of d)
r = r.concat(this.walkTokens(h.tokens, i));
break;
}
case "list": {
const u = s;
r = r.concat(this.walkTokens(u.items, i));
break;
}
default: {
const u = s;
(a = (n = this.defaults.extensions) == null ? void 0 : n.childTokens) != null && a[u.type] ? this.defaults.extensions.childTokens[u.type].forEach((d) => {
const h = u[d].flat(1 / 0);
r = r.concat(this.walkTokens(h, i));
}) : u.tokens && (r = r.concat(this.walkTokens(u.tokens, i)));
}
}
return r;
}
use(...t) {
const i = this.defaults.extensions || { renderers: {}, childTokens: {} };
return t.forEach((r) => {
const n = { ...r };
if (n.async = this.defaults.async || n.async || !1, r.extensions && (r.extensions.forEach((a) => {
if (!a.name)
throw new Error("extension name required");
if ("renderer" in a) {
const s = i.renderers[a.name];
s ? i.renderers[a.name] = function(...u) {
let d = a.renderer.apply(this, u);
return d === !1 && (d = s.apply(this, u)), d;
} : i.renderers[a.name] = a.renderer;
}
if ("tokenizer" in a) {
if (!a.level || a.level !== "block" && a.level !== "inline")
throw new Error("extension level must be 'block' or 'inline'");
const s = i[a.level];
s ? s.unshift(a.tokenizer) : i[a.level] = [a.tokenizer], a.start && (a.level === "block" ? i.startBlock ? i.startBlock.push(a.start) : i.startBlock = [a.start] : a.level === "inline" && (i.startInline ? i.startInline.push(a.start) : i.startInline = [a.start]));
}
"childTokens" in a && a.childTokens && (i.childTokens[a.name] = a.childTokens);
}), n.extensions = i), r.renderer) {
const a = this.defaults.renderer || new Js(this.defaults);
for (const s in r.renderer) {
if (!(s in a))
throw new Error(`renderer '${s}' does not exist`);
if (["options", "parser"].includes(s))
continue;
const u = s, d = r.renderer[u], h = a[u];
a[u] = (...p) => {
let g = d.apply(a, p);
return g === !1 && (g = h.apply(a, p)), g || "";
};
}
n.renderer = a;
}
if (r.tokenizer) {
const a = this.defaults.tokenizer || new Qs(this.defaults);
for (const s in r.tokenizer) {
if (!(s in a))
throw new Error(`tokenizer '${s}' does not exist`);
if (["options", "rules", "lexer"].includes(s))
continue;
const u = s, d = r.tokenizer[u], h = a[u];
a[u] = (...p) => {
let g = d.apply(a, p);
return g === !1 && (g = h.apply(a, p)), g;
};
}
n.tokenizer = a;
}
if (r.hooks) {
const a = this.defaults.hooks || new qa();
for (const s in r.hooks) {
if (!(s in a))
throw new Error(`hook '${s}' does not exist`);
if (["options", "block"].includes(s))
continue;
const u = s, d = r.hooks[u], h = a[u];
qa.passThroughHooks.has(s) ? a[u] = (p) => {
if (this.defaults.async)
return Promise.resolve(d.call(a, p)).then((_) => h.call(a, _));
const g = d.call(a, p);
return h.call(a, g);
} : a[u] = (...p) => {
let g = d.apply(a, p);
return g === !1 && (g = h.apply(a, p)), g;
};
}
n.hooks = a;
}
if (r.walkTokens) {
const a = this.defaults.walkTokens, s = r.walkTokens;
n.walkTokens = function(u) {
let d = [];
return d.push(s.call(this, u)), a && (d = d.concat(a.call(this, u))), d;
};
}
this.defaults = { ...this.defaults, ...n };
}), this;
}
setOptions(t) {
return this.defaults = { ...this.defaults, ...t }, this;
}
lexer(t, i) {
return pi.lex(t, i != null ? i : this.defaults);
}
parser(t, i) {
return hi.parse(t, i != null ? i : this.defaults);
}
parseMarkdown(t) {
return (r, n) => {
const a = { ...n }, s = { ...this.defaults, ...a }, u = this.onError(!!s.silent, !!s.async);
if (this.defaults.async === !0 && a.async === !1)
return u(new Error("marked(): The async option was set to true by an extension. Remove async: false from the parse options object to return a Promise."));
if (typeof r > "u" || r === null)
return u(new Error("marked(): input parameter is undefined or null"));
if (typeof r != "string")
return u(new Error("marked(): input parameter is of type " + Object.prototype.toString.call(r) + ", string expected"));
s.hooks && (s.hooks.options = s, s.hooks.block = t);
const d = s.hooks ? s.hooks.provideLexer() : t ? pi.lex : pi.lexInline, h = s.hooks ? s.hooks.provideParser() : t ? hi.parse : hi.parseInline;
if (s.async)
return Promise.resolve(s.hooks ? s.hooks.preprocess(r) : r).then((p) => d(p, s)).then((p) => s.hooks ? s.hooks.processAllTokens(p) : p).then((p) => s.walkTokens ? Promise.all(this.walkTokens(p, s.walkTokens)).then(() => p) : p).then((p) => h(p, s)).then((p) => s.hooks ? s.hooks.postprocess(p) : p).catch(u);
try {
s.hooks && (r = s.hooks.preprocess(r));
let p = d(r, s);
s.hooks && (p = s.hooks.processAllTokens(p)), s.walkTokens && this.walkTokens(p, s.walkTokens);
let g = h(p, s);
return s.hooks && (g = s.hooks.postprocess(g)), g;
} catch (p) {
return u(p);
}
};
}
onError(t, i) {
return (r) => {
if (r.message += `
Please report this to https://github.com/markedjs/marked.`, t) {
const n = "<p>An error occurred:</p><pre>" + Mi(r.message + "", !0) + "</pre>";
return i ? Promise.resolve(n) : n;
}
if (i)
return Promise.reject(r);
throw r;
};
}
}
const Kr = new yb();
function Vt(e, t) {
return Kr.parse(e, t);
}
Vt.options = Vt.setOptions = function(e) {
return Kr.setOptions(e), Vt.defaults = Kr.defaults, lb(Vt.defaults), Vt;
};
Vt.getDefaults = Sp;
Vt.defaults = eo;
Vt.use = function(...e) {
return Kr.use(...e), Vt.defaults = Kr.defaults, lb(Vt.defaults), Vt;
};
Vt.walkTokens = function(e, t) {
return Kr.walkTokens(e, t);
};
Vt.parseInline = Kr.parseInline;
Vt.Parser = hi;
Vt.parser = hi.parse;
Vt.Renderer = Js;
Vt.TextRenderer = $p;
Vt.Lexer = pi;
Vt.lexer = pi.lex;
Vt.Tokenizer = Qs;
Vt.Hooks = qa;
Vt.parse = Vt;
Vt.options;
Vt.setOptions;
Vt.use;
Vt.walkTokens;
Vt.parseInline;
hi.parse;
pi.lex;
const xV = Ve({
name: "FcMarkdown",
data() {
return {
marked: Xt(new yb()),
html: ""
};
},
props: {
content: String
},
watch: {
content: {
handler() {
this.html = this.marked.parse(this.content || "");
},
immediate: !0
}
}
}), TV = ["innerHTML"];
function kV(e, t, i, r, n, a) {
return W(), ae("div", {
class: "_fc-markdown",
innerHTML: e.html
}, null, 8, TV);
}
const OV = /* @__PURE__ */ je(xV, [["render", kV]]);
/*!
* Signature Pad v5.0.7 | https://github.com/szimek/signature_pad
* (c) 2025 Szymon Nowak | Released under the MIT license
*/
class Xs {
constructor(t, i, r, n) {
if (isNaN(t) || isNaN(i))
throw new Error(`Point is invalid: (${t}, ${i})`);
this.x = +t, this.y = +i, this.pressure = r || 0, this.time = n || Date.now();
}
distanceTo(t) {
return Math.sqrt(Math.pow(this.x - t.x, 2) + Math.pow(this.y - t.y, 2));
}
equals(t) {
return this.x === t.x && this.y === t.y && this.pressure === t.pressure && this.time === t.time;
}
velocityFrom(t) {
return this.time !== t.time ? this.distanceTo(t) / (this.time - t.time) : 0;
}
}
class Ip {
static fromPoints(t, i) {
const r = this.calculateControlPoints(t[0], t[1], t[2]).c2, n = this.calculateControlPoints(t[1], t[2], t[3]).c1;
return new Ip(t[1], r, n, t[2], i.start, i.end);
}
static calculateControlPoints(t, i, r) {
const n = t.x - i.x, a = t.y - i.y, s = i.x - r.x, u = i.y - r.y, d = { x: (t.x + i.x) / 2, y: (t.y + i.y) / 2 }, h = { x: (i.x + r.x) / 2, y: (i.y + r.y) / 2 }, p = Math.sqrt(n * n + a * a), g = Math.sqrt(s * s + u * u), _ = d.x - h.x, S = d.y - h.y, b = p + g == 0 ? 0 : g / (p + g), A = { x: h.x + _ * b, y: h.y + S * b }, w = i.x - A.x, m = i.y - A.y;
return {
c1: new Xs(d.x + w, d.y + m),
c2: new Xs(h.x + w, h.y + m)
};
}
constructor(t, i, r, n, a, s) {
this.startPoint = t, this.control2 = i, this.control1 = r, this.endPoint = n, this.startWidth = a, this.endWidth = s;
}
length() {
let i = 0, r, n;
for (let a = 0; a <= 10; a += 1) {
const s = a / 10, u = this.point(s, this.startPoint.x, this.control1.x, this.control2.x, this.endPoint.x), d = this.point(s, this.startPoint.y, this.control1.y, this.control2.y, this.endPoint.y);
if (a > 0) {
const h = u - r, p = d - n;
i += Math.sqrt(h * h + p * p);
}
r = u, n = d;
}
return i;
}
point(t, i, r, n, a) {
return i * (1 - t) * (1 - t) * (1 - t) + 3 * r * (1 - t) * (1 - t) * t + 3 * n * (1 - t) * t * t + a * t * t * t;
}
}
class RV {
constructor() {
try {
this._et = new EventTarget();
} catch {
this._et = document;
}
}
addEventListener(t, i, r) {
this._et.addEventListener(t, i, r);
}
dispatchEvent(t) {
return this._et.dispatchEvent(t);
}
removeEventListener(t, i, r) {
this._et.removeEventListener(t, i, r);
}
}
function DV(e, t = 250) {
let i = 0, r = null, n, a, s;
const u = () => {
i = Date.now(), r = null, n = e.apply(a, s), r || (a = null, s = []);
};
return function(...h) {
const p = Date.now(), g = t - (p - i);
return a = this, s = h, g <= 0 || g > t ? (r && (clearTimeout(r), r = null), i = p, n = e.apply(a, s), r || (a = null, s = [])) : r || (r = window.setTimeout(u, g)), n;
};
}
class Zs extends RV {
constructor(t, i = {}) {
var r, n, a;
super(), this.canvas = t, this._drawingStroke = !1, this._isEmpty = !0, this._lastPoints = [], this._data = [], this._lastVelocity = 0, this._lastWidth = 0, this._handleMouseDown = (s) => {
!this._isLeftButtonPressed(s, !0) || this._drawingStroke || this._strokeBegin(this._pointerEventToSignatureEvent(s));
}, this._handleMouseMove = (s) => {
if (!this._isLeftButtonPressed(s, !0) || !this._drawingStroke) {
this._strokeEnd(this._pointerEventToSignatureEvent(s), !1);
return;
}
this._strokeMoveUpdate(this._pointerEventToSignatureEvent(s));
}, this._handleMouseUp = (s) => {
this._isLeftButtonPressed(s) || this._strokeEnd(this._pointerEventToSignatureEvent(s));
}, this._handleTouchStart = (s) => {
s.targetTouches.length !== 1 || this._drawingStroke || (s.cancelable && s.preventDefault(), this._strokeBegin(this._touchEventToSignatureEvent(s)));
}, this._handleTouchMove = (s) => {
if (s.targetTouches.length === 1) {
if (s.cancelable && s.preventDefault(), !this._drawingStroke) {
this._strokeEnd(this._touchEventToSignatureEvent(s), !1);
return;
}
this._strokeMoveUpdate(this._touchEventToSignatureEvent(s));
}
}, this._handleTouchEnd = (s) => {
s.targetTouches.length === 0 && (s.cancelable && s.preventDefault(), this.canvas.removeEventListener("touchmove", this._handleTouchMove), this._strokeEnd(this._touchEventToSignatureEvent(s)));
}, this._handlePointerDown = (s) => {
!s.isPrimary || !this._isLeftButtonPressed(s) || this._drawingStroke || (s.preventDefault(), this._strokeBegin(this._pointerEventToSignatureEvent(s)));
}, this._handlePointerMove = (s) => {
if (!!s.isPrimary) {
if (!this._isLeftButtonPressed(s, !0) || !this._drawingStroke) {
this._strokeEnd(this._pointerEventToSignatureEvent(s), !1);
return;
}
s.preventDefault(), this._strokeMoveUpdate(this._pointerEventToSignatureEvent(s));
}
}, this._handlePointerUp = (s) => {
!s.isPrimary || this._isLeftButtonPressed(s) || (s.preventDefault(), this._strokeEnd(this._pointerEventToSignatureEvent(s)));
}, this.velocityFilterWeight = i.velocityFilterWeight || 0.7, this.minWidth = i.minWidth || 0.5, this.maxWidth = i.maxWidth || 2.5, this.throttle = (r = i.throttle) !== null && r !== void 0 ? r : 16, this.minDistance = (n = i.minDistance) !== null && n !== void 0 ? n : 5, this.dotSize = i.dotSize || 0, this.penColor = i.penColor || "black", this.backgroundColor = i.backgroundColor || "rgba(0,0,0,0)", this.compositeOperation = i.compositeOperation || "source-over", this.canvasContextOptions = (a = i.canvasContextOptions) !== null && a !== void 0 ? a : {}, this._strokeMoveUpdate = this.throttle ? DV(Zs.prototype._strokeUpdate, this.throttle) : Zs.prototype._strokeUpdate, this._ctx = t.getContext("2d", this.canvasContextOptions), this.clear(), this.on();
}
clear() {
const { _ctx: t, canvas: i } = this;
t.fillStyle = this.backgroundColor, t.clearRect(0, 0, i.width, i.height), t.fillRect(0, 0, i.width, i.height), this._data = [], this._reset(this._getPointGroupOptions()), this._isEmpty = !0;
}
fromDataURL(t, i = {}) {
return new Promise((r, n) => {
const a = new Image(), s = i.ratio || window.devicePixelRatio || 1, u = i.width || this.canvas.width / s, d = i.height || this.canvas.height / s, h = i.xOffset || 0, p = i.yOffset || 0;
this._reset(this._getPointGroupOptions()), a.onload = () => {
this._ctx.drawImage(a, h, p, u, d), r();
}, a.onerror = (g) => {
n(g);
}, a.crossOrigin = "anonymous", a.src = t, this._isEmpty = !1;
});
}
toDataURL(t = "image/png", i) {
switch (t) {
case "image/svg+xml":
return typeof i != "object" && (i = void 0), `data:image/svg+xml;base64,${btoa(this.toSVG(i))}`;
default:
return typeof i != "number" && (i = void 0), this.canvas.toDataURL(t, i);
}
}
on() {
this.canvas.style.touchAction = "none", this.canvas.style.msTouchAction = "none", this.canvas.style.userSelect = "none";
const t = /Macintosh/.test(navigator.userAgent) && "ontouchstart" in document;
window.PointerEvent && !t ? this._handlePointerEvents() : (this._handleMouseEvents(), "ontouchstart" in window && this._handleTouchEvents());
}
off() {
this.canvas.style.touchAction = "auto", this.canvas.style.msTouchAction = "auto", this.canvas.style.userSelect = "auto", this.canvas.removeEventListener("pointerdown", this._handlePointerDown), this.canvas.removeEventListener("mousedown", this._handleMouseDown), this.canvas.removeEventListener("touchstart", this._handleTouchStart), this._removeMoveUpEventListeners();
}
_getListenerFunctions() {
var t;
const i = window.document === this.canvas.ownerDocument ? window : (t = this.canvas.ownerDocument.defaultView) !== null && t !== void 0 ? t : this.canvas.ownerDocument;
return {
addEventListener: i.addEventListener.bind(i),
removeEventListener: i.removeEventListener.bind(i)
};
}
_removeMoveUpEventListeners() {
const { removeEventListener: t } = this._getListenerFunctions();
t("pointermove", this._handlePointerMove), t("pointerup", this._handlePointerUp), t("mousemove", this._handleMouseMove), t("mouseup", this._handleMouseUp), t("touchmove", this._handleTouchMove), t("touchend", this._handleTouchEnd);
}
isEmpty() {
return this._isEmpty;
}
fromData(t, { clear: i = !0 } = {}) {
i && this.clear(), this._fromData(t, this._drawCurve.bind(this), this._drawDot.bind(this)), this._data = this._data.concat(t);
}
toData() {
return this._data;
}
_isLeftButtonPressed(t, i) {
return i ? t.buttons === 1 : (t.buttons & 1) === 1;
}
_pointerEventToSignatureEvent(t) {
return {
event: t,
type: t.type,
x: t.clientX,
y: t.clientY,
pressure: "pressure" in t ? t.pressure : 0
};
}
_touchEventToSignatureEvent(t) {
const i = t.changedTouches[0];
return {
event: t,
type: t.type,
x: i.clientX,
y: i.clientY,
pressure: i.force
};
}
_getPointGroupOptions(t) {
return {
penColor: t && "penColor" in t ? t.penColor : this.penColor,
dotSize: t && "dotSize" in t ? t.dotSize : this.dotSize,
minWidth: t && "minWidth" in t ? t.minWidth : this.minWidth,
maxWidth: t && "maxWidth" in t ? t.maxWidth : this.maxWidth,
velocityFilterWeight: t && "velocityFilterWeight" in t ? t.velocityFilterWeight : this.velocityFilterWeight,
compositeOperation: t && "compositeOperation" in t ? t.compositeOperation : this.compositeOperation
};
}
_strokeBegin(t) {
if (!this.dispatchEvent(new CustomEvent("beginStroke", { detail: t, cancelable: !0 })))
return;
const { addEventListener: r } = this._getListenerFunctions();
switch (t.event.type) {
case "mousedown":
r("mousemove", this._handleMouseMove), r("mouseup", this._handleMouseUp);
break;
case "touchstart":
r("touchmove", this._handleTouchMove), r("touchend", this._handleTouchEnd);
break;
case "pointerdown":
r("pointermove", this._handlePointerMove), r("pointerup", this._handlePointerUp);
break;
}
this._drawingStroke = !0;
const n = this._getPointGroupOptions(), a = Object.assign(Object.assign({}, n), { points: [] });
this._data.push(a), this._reset(n), this._strokeUpdate(t);
}
_strokeUpdate(t) {
if (!this._drawingStroke)
return;
if (this._data.length === 0) {
this._strokeBegin(t);
return;
}
this.dispatchEvent(new CustomEvent("beforeUpdateStroke", { detail: t }));
const i = this._createPoint(t.x, t.y, t.pressure), r = this._data[this._data.length - 1], n = r.points, a = n.length > 0 && n[n.length - 1], s = a ? i.distanceTo(a) <= this.minDistance : !1, u = this._getPointGroupOptions(r);
if (!a || !(a && s)) {
const d = this._addPoint(i, u);
a ? d && this._drawCurve(d, u) : this._drawDot(i, u), n.push({
time: i.time,
x: i.x,
y: i.y,
pressure: i.pressure
});
}
this.dispatchEvent(new CustomEvent("afterUpdateStroke", { detail: t }));
}
_strokeEnd(t, i = !0) {
this._removeMoveUpEventListeners(), this._drawingStroke && (i && this._strokeUpdate(t), this._drawingStroke = !1, this.dispatchEvent(new CustomEvent("endStroke", { detail: t })));
}
_handlePointerEvents() {
this._drawingStroke = !1, this.canvas.addEventListener("pointerdown", this._handlePointerDown);
}
_handleMouseEvents() {
this._drawingStroke = !1, this.canvas.addEventListener("mousedown", this._handleMouseDown);
}
_handleTouchEvents() {
this.canvas.addEventListener("touchstart", this._handleTouchStart);
}
_reset(t) {
this._lastPoints = [], this._lastVelocity = 0, this._lastWidth = (t.minWidth + t.maxWidth) / 2, this._ctx.fillStyle = t.penColor, this._ctx.globalCompositeOperation = t.compositeOperation;
}
_createPoint(t, i, r) {
const n = this.canvas.getBoundingClientRect();
return new Xs(t - n.left, i - n.top, r, new Date().getTime());
}
_addPoint(t, i) {
const { _lastPoints: r } = this;
if (r.push(t), r.length > 2) {
r.length === 3 && r.unshift(r[0]);
const n = this._calculateCurveWidths(r[1], r[2], i), a = Ip.fromPoints(r, n);
return r.shift(), a;
}
return null;
}
_calculateCurveWidths(t, i, r) {
const n = r.velocityFilterWeight * i.velocityFrom(t) + (1 - r.velocityFilterWeight) * this._lastVelocity, a = this._strokeWidth(n, r), s = {
end: a,
start: this._lastWidth
};
return this._lastVelocity = n, this._lastWidth = a, s;
}
_strokeWidth(t, i) {
return Math.max(i.maxWidth / (t + 1), i.minWidth);
}
_drawCurveSegment(t, i, r) {
const n = this._ctx;
n.moveTo(t, i), n.arc(t, i, r, 0, 2 * Math.PI, !1), this._isEmpty = !1;
}
_drawCurve(t, i) {
const r = this._ctx, n = t.endWidth - t.startWidth, a = Math.ceil(t.length()) * 2;
r.beginPath(), r.fillStyle = i.penColor;
for (let s = 0; s < a; s += 1) {
const u = s / a, d = u * u, h = d * u, p = 1 - u, g = p * p, _ = g * p;
let S = _ * t.startPoint.x;
S += 3 * g * u * t.control1.x, S += 3 * p * d * t.control2.x, S += h * t.endPoint.x;
let b = _ * t.startPoint.y;
b += 3 * g * u * t.control1.y, b += 3 * p * d * t.control2.y, b += h * t.endPoint.y;
const A = Math.min(t.startWidth + h * n, i.maxWidth);
this._drawCurveSegment(S, b, A);
}
r.closePath(), r.fill();
}
_drawDot(t, i) {
const r = this._ctx, n = i.dotSize > 0 ? i.dotSize : (i.minWidth + i.maxWidth) / 2;
r.beginPath(), this._drawCurveSegment(t.x, t.y, n), r.closePath(), r.fillStyle = i.penColor, r.fill();
}
_fromData(t, i, r) {
for (const n of t) {
const { points: a } = n, s = this._getPointGroupOptions(n);
if (a.length > 1)
for (let u = 0; u < a.length; u += 1) {
const d = a[u], h = new Xs(d.x, d.y, d.pressure, d.time);
u === 0 && this._reset(s);
const p = this._addPoint(h, s);
p && i(p, s);
}
else
this._reset(s), r(a[0], s);
}
}
toSVG({ includeBackgroundColor: t = !1 } = {}) {
const i = this._data, r = Math.max(window.devicePixelRatio || 1, 1), n = 0, a = 0, s = this.canvas.width / r, u = this.canvas.height / r, d = document.createElementNS("http://www.w3.org/2000/svg", "svg");
if (d.setAttribute("xmlns", "http://www.w3.org/2000/svg"), d.setAttribute("xmlns:xlink", "http://www.w3.org/1999/xlink"), d.setAttribute("viewBox", `${n} ${a} ${s} ${u}`), d.setAttribute("width", s.toString()), d.setAttribute("height", u.toString()), t && this.backgroundColor) {
const h = document.createElement("rect");
h.setAttribute("width", "100%"), h.setAttribute("height", "100%"), h.setAttribute("fill", this.backgroundColor), d.appendChild(h);
}
return this._fromData(i, (h, { penColor: p }) => {
const g = document.createElement("path");
if (!isNaN(h.control1.x) && !isNaN(h.control1.y) && !isNaN(h.control2.x) && !isNaN(h.control2.y)) {
const _ = `M ${h.startPoint.x.toFixed(3)},${h.startPoint.y.toFixed(3)} C ${h.control1.x.toFixed(3)},${h.control1.y.toFixed(3)} ${h.control2.x.toFixed(3)},${h.control2.y.toFixed(3)} ${h.endPoint.x.toFixed(3)},${h.endPoint.y.toFixed(3)}`;
g.setAttribute("d", _), g.setAttribute("stroke-width", (h.endWidth * 2.25).toFixed(3)), g.setAttribute("stroke", p), g.setAttribute("fill", "none"), g.setAttribute("stroke-linecap", "round"), d.appendChild(g);
}
}, (h, { penColor: p, dotSize: g, minWidth: _, maxWidth: S }) => {
const b = document.createElement("circle"), A = g > 0 ? g : (_ + S) / 2;
b.setAttribute("r", A.toString()), b.setAttribute("cx", h.x.toString()), b.setAttribute("cy", h.y.toString()), b.setAttribute("fill", p), d.appendChild(b);
}), d.outerHTML;
}
}
const $V = Ve({
name: "SignaturePad",
emits: ["update:modelValue", "change", "remove"],
data() {
return {
visible: !1,
isEmpty: !0,
signaturePad: null
};
},
props: {
modelValue: String,
penColor: String,
formCreateInject: Object
},
watch: {
visible(e) {
e ? (this.isEmpty = !0, this.$nextTick(() => {
this.signaturePad = Xt(new Zs(this.$refs.pad, {
penColor: this.penColor
})), this.signaturePad.addEventListener("endStroke", () => {
this.isEmpty = this.signaturePad.isEmpty();
});
})) : (this.signaturePad.off(), this.signaturePad = null);
}
},
methods: {
clear() {
this.signaturePad.clear(), this.isEmpty = !0;
},
submit() {
const e = this.signaturePad.toDataURL();
this.updateValue(e), this.visible = !1;
},
updateValue(e) {
this.$emit("update:modelValue", e), this.$emit("change", e);
},
remove() {
this.updateValue(""), this.$emit("remove");
}
}
}), IV = { class: "_fc-signature" }, FV = {
key: 0,
class: "_fc-signature-preview"
}, MV = ["src"], PV = {
class: "_fc-signature-pad",
ref: "pad",
width: "600px",
height: "270px"
};
function LV(e, t, i, r, n, a) {
const s = ie("el-button"), u = ie("el-dialog");
return W(), ae("div", IV, [
e.modelValue ? (W(), ae("div", FV, [
Z("i", {
class: "fc-icon icon-delete2",
onClick: t[0] || (t[0] = (...d) => e.remove && e.remove(...d))
}),
Z("img", {
src: e.modelValue,
alt: "signature"
}, null, 8, MV)
])) : (W(), ae("div", {
key: 1,
class: "_fc-signature-btn",
onClick: t[1] || (t[1] = (d) => e.visible = !0)
}, [
t[4] || (t[4] = Z("i", { class: "fc-icon icon-edit2" }, null, -1)),
_e(" " + le(e.formCreateInject.t("signaturePadTip") || "\u70B9\u51FB\u6DFB\u52A0\u624B\u5199\u7B7E\u540D"), 1)
])),
G(u, {
class: "_fc-signature-dialog",
title: e.formCreateInject.t("signaturePadTitle") || "\u8BF7\u5728\u865A\u7EBF\u6846\u5185\u4E66\u5199",
modelValue: e.visible,
"onUpdate:modelValue": t[3] || (t[3] = (d) => e.visible = d),
"destroy-on-close": "",
"close-on-click-modal": !1,
"append-to-body": "",
width: "640px"
}, {
footer: N(() => [
Z("div", null, [
G(s, {
size: "default",
onClick: t[2] || (t[2] = (d) => e.clear())
}, {
default: N(() => [
_e(le(e.formCreateInject.t("reset") || "\u91CD\u7F6E"), 1)
]),
_: 1
}),
G(s, {
type: "primary",
disabled: e.isEmpty,
onClick: e.submit,
size: "default"
}, {
default: N(() => [
_e(le(e.formCreateInject.t("ok") || "\u786E\u5B9A"), 1)
]),
_: 1
}, 8, ["disabled", "onClick"])
])
]),
default: N(() => [
Z("canvas", PV, null, 512)
]),
_: 1
}, 8, ["title", "modelValue"])
]);
}
const NV = /* @__PURE__ */ je($V, [["render", LV]]);
const BV = Ve({
name: "FcDataSelectView",
components: { FcInlineForm: Ry, DataTable: Ty },
inject: ["designer"],
props: {
title: String,
placeholder: String,
multiple: Boolean,
disabled: Boolean,
multipleLimit: Number,
valueKey: String,
labelKey: String,
clearable: Boolean
},
computed: {
t() {
return this.designer.setupState.t;
}
},
data() {
return {
visible: !0
};
},
methods: {
handleClick(e) {
e.stopPropagation(), this.visible = !this.visible;
}
}
}), VV = {
key: 0,
class: "el-dialog"
}, jV = { class: "el-dialog__header show-close" }, UV = { class: "el-dialog__title" };
function zV(e, t, i, r, n, a) {
const s = ie("el-select");
return W(), ae("div", {
class: "_fd-data-select",
style: An({ "--fc-drag-empty": `'${e.t("com.select.emptyText")}'` })
}, [
G(s, {
onClickCapture: e.handleClick,
disabled: e.disabled,
placeholder: e.placeholder
}, null, 8, ["onClickCapture", "disabled", "placeholder"]),
e.visible ? (W(), ae("div", VV, [
Z("header", jV, [
Z("span", UV, le(e.title), 1)
]),
kt(e.$slots, "search"),
kt(e.$slots, "table")
])) : Oe("", !0)
], 4);
}
const HV = /* @__PURE__ */ je(BV, [["render", zV]]), WV = (e) => e !== null && typeof e == "object", GV = (e) => e != null;
function _c(e) {
if (!GV(e))
return e;
if (Array.isArray(e))
return e.map((t) => _c(t));
if (WV(e)) {
const t = {};
return Object.keys(e).forEach((i) => {
t[i] = _c(e[i]);
}), t;
}
return e;
}
const KV = Ve({
name: "FcDataSelect",
components: { FcDialog: Fy },
emits: ["update:modelValue", "change", "clear"],
props: {
title: String,
formCreateInject: Object,
placeholder: String,
multiple: Boolean,
disabled: Boolean,
multipleLimit: Number,
valueKey: String,
labelKey: String,
clearable: Boolean,
searchRule: Object,
tableRule: Object,
autoLoad: Boolean,
modelValue: [Object, Array]
},
computed: {
options() {
return this.list.map((e) => ({
label: e[this.labelKey || "label"],
value: e[this.valueKey || "value"]
}));
},
selectValue() {
const e = this.options.map((t) => t.value);
return this.multiple === !0 ? e : e[0];
},
fapi() {
var e, t;
return (t = (e = this.$refs) == null ? void 0 : e.dialog) == null ? void 0 : t.fapi;
}
},
data() {
return {
list: [],
visible: !1,
formRule: [],
load: zs(() => {
this.$refs.dialog.fapi.el(this.formRule[1].name).initPage();
}, 500)
};
},
watch: {
modelValue: {
handler(e) {
e ? this.list = Array.isArray(e) ? e : [e] : this.list = [];
},
immediate: !0
}
},
methods: {
getTableEl() {
return this.$refs.dialog.fapi.el(this.formRule[1].name);
},
getDialogEl() {
return this.$refs.dialog;
},
formChange() {
this.autoLoad && this.load();
},
changeSelectValue(e) {
e == null ? this.list = [] : this.list = this.list.filter((t) => e.indexOf(t[this.valueKey || "value"]) !== -1), this.updateValue();
},
confirm() {
const e = Ms([...this.list, ...this.$refs.dialog.fapi.el(this.formRule[1].name).getEl().getSelectionRows()]), t = e.map((i) => i[this.valueKey || "value"]);
this.list = e.filter((i, r) => t.indexOf(i[this.valueKey || "value"]) === r), this.$refs.dialog.close(), this.updateValue();
},
tableRowClick(e) {
this.multiple ? this.$refs.dialog.fapi.el(this.formRule[1].name).getEl().toggleRowSelection(e) : (this.list = [e], this.updateValue(), this.$refs.dialog.close());
},
updateValue() {
this.multipleLimit > 0 && this.list.length > this.multipleLimit && (this.list = this.list.splice(0, this.multipleLimit));
const e = this.list.map((t) => ({
[this.valueKey || "value"]: t[this.valueKey || "value"],
[this.labelKey || "label"]: t[this.labelKey || "label"]
}));
this.$emit("update:modelValue", this.multiple ? e : e[0]), this.$emit("change", this.multiple ? e : e[0]);
},
getFormRule() {
const e = _c([
this.searchRule,
this.tableRule
]);
return e[1].on || (e[1].on = {}), e[1].props || (e[1].props = {}), this.multiple && (e[1].props.rowKey || (e[1].props.rowKey = this.valueKey || "value"), e[1].name || (e[1].name = rt())), e[1].props.selection = !0, e[1].on.rowClick ? e[1].on.rowClick = [(...t) => this.tableRowClick(...t), e[1].on.rowClick] : e[1].on.rowClick = (...t) => this.tableRowClick(...t), e[1].on.selectionChange ? e[1].on.selectionChange = [(...t) => this.selectionChange(...t), e[1].on.selectionChange] : e[1].on.selectionChange = (...t) => this.selectionChange(...t), e;
},
selectionChange(e) {
this.multiple || this.tableRowClick(e[0]);
},
handleClear(...e) {
this.$emit("clear", ...e);
},
handleClick(e) {
this.disabled || !e || (this.visible = !0, this.formRule = this.getFormRule(), this.$refs.dialog.open());
}
}
}), YV = { class: "_fc-data-select" };
function QV(e, t, i, r, n, a) {
const s = ie("el-option"), u = ie("el-select"), d = ie("FcDialog");
return W(), ae("div", YV, [
G(u, {
disabled: e.disabled,
placeholder: e.placeholder,
multiple: e.multiple,
multipleLimit: e.multipleLimit,
clearable: e.clearable,
"model-value": e.selectValue,
"onUpdate:modelValue": e.changeSelectValue,
"popper-class": "_fc-data-select-pop",
onVisibleChange: e.handleClick,
onClear: e.handleClear
}, {
default: N(() => [
(W(!0), ae(Pe, null, Ge(e.options, (h) => (W(), ye(s, {
key: h.value,
label: h.label,
value: h.value
}, null, 8, ["label", "value"]))), 128))
]),
_: 1
}, 8, ["disabled", "placeholder", "multiple", "multipleLimit", "clearable", "model-value", "onUpdate:modelValue", "onVisibleChange", "onClear"]),
G(d, {
ref: "dialog",
formCreateInject: e.formCreateInject,
rule: e.formRule,
"onUpdate:modelValue": e.formChange,
footer: e.multiple,
title: e.title,
width: "900px",
onConfirm: e.confirm
}, null, 8, ["formCreateInject", "rule", "onUpdate:modelValue", "footer", "title", "onConfirm"])
]);
}
const JV = /* @__PURE__ */ je(KV, [["render", QV]]);
const XV = Ve({
name: "FcEcharts",
data() {
return {
chart: null,
debounceLoad: zs(() => {
this.load();
}, 600),
debounceResize: zs(() => {
this.chart && this.chart.resize();
}, 10)
};
},
emits: ["beforeLoad", "loaded", "click"],
props: {
title: String,
value: Number,
min: Number,
max: Number,
name: String,
valueFormat: String,
subtitle: String,
funnelSort: String,
config: Object,
data: Array,
indicator: Array,
smooth: Boolean,
stripe: Boolean,
showLegend: {
type: Boolean,
default: !0
},
loadOptions: {
type: Function,
default: () => {
}
},
showSeriesLabel: Boolean,
type: String,
pieType: String,
stack: Boolean,
barBackgroundColor: String
},
watch: {
$props: {
handler() {
this.debounceLoad();
},
deep: !0
}
},
methods: {
getSeries() {
var i;
const e = {
type: "line",
stack: this.stack ? "Total" : "",
smooth: this.smooth,
showBackground: !1,
label: {
show: this.showSeriesLabel,
position: this.stripe ? "inside" : "top"
}
};
this.type === "area" ? (e.areaStyle = {}, e.emphasis = {
focus: "series"
}) : this.type === "bar" && (e.type = "bar", this.barBackgroundColor && (e.showBackground = !0, e.backgroundStyle = {
color: this.barBackgroundColor
}));
let t = ((i = this.config) == null ? void 0 : i.series) || [];
return t.length ? (typeof t[0] != "object" && (t = [{
data: t
}]), t = t.map((r) => ({
...e,
...r
})), t) : [];
},
getTooltip() {
const e = {
trigger: "axis",
valueFormat: void 0
};
return this.valueFormat && (e.valueFormatter = (t) => this.valueFormat ? this.valueFormat.replaceAll("{value}", t) : t), this.type === "bar" && (e.axisPointer = {
type: "shadow"
}), e;
},
getAxis() {
var e, t;
return this.stripe ? {
yAxis: {
type: "category",
boundaryGap: this.type === "bar",
data: ((t = this.config) == null ? void 0 : t.category) || []
},
xAxis: {
type: "value"
}
} : {
xAxis: {
type: "category",
boundaryGap: this.type === "bar",
data: (e = this.config) == null ? void 0 : e.category
},
yAxis: {
type: "value"
}
};
},
getDefOptions() {
return {
title: {
text: this.title,
subtext: this.subtitle
},
tooltip: this.getTooltip(),
legend: {
left: "right",
show: this.showLegend
},
grid: {
left: "20px",
right: "20px",
bottom: "20px",
containLabel: !0
},
...this.getAxis(),
series: this.getSeries()
};
},
getPieOptions() {
const e = {
radius: "50%",
center: "50%",
startAngle: 0,
avoidLabelOverlap: !0,
labelLine: {
show: !0
},
emphasis: {
itemStyle: {
shadowBlur: 10,
shadowOffsetX: 0,
shadowColor: "rgba(0, 0, 0, 0.5)"
}
}
};
return this.pieType === "doughnut" ? (e.radius = ["40%", "70%"], e.avoidLabelOverlap = !1) : this.pieType === "half-doughnut" && (e.radius = ["40%", "70%"], e.center = ["50%", "70%"], e.startAngle = 180, e.endAngle = 360), {
title: {
text: this.title,
subtext: this.subtitle,
left: "left"
},
tooltip: {
trigger: "item"
},
legend: {
left: "right",
show: this.showLegend
},
series: [
{
type: "pie",
data: this.data,
...e
}
]
};
},
getGaugeOptions() {
return {
title: {
text: this.title,
subtext: this.subtitle,
left: "center"
},
series: [
{
name: "Pressure",
type: "gauge",
min: this.min || 0,
max: this.max || 60,
progress: {
show: !0
},
detail: {
valueAnimation: !0,
formatter: "{value}"
},
data: [
{
value: this.value,
name: this.name
}
]
}
]
};
},
getRadarOptions() {
return {
title: {
text: this.title,
subtext: this.subtitle,
left: "left"
},
tooltip: {
trigger: "axis"
},
legend: {
left: "right",
show: this.showLegend
},
radar: {
indicator: this.indicator
},
series: [
{
type: "radar",
tooltip: {
trigger: "item"
},
data: this.data
}
]
};
},
getScatterOptions() {
return {
title: {
text: this.title,
subtext: this.subtitle,
left: "left"
},
tooltip: {
trigger: "axis"
},
legend: {
left: "right",
show: !0
},
xAxis: {
scale: !0
},
yAxis: {
scale: !0
},
grid: {
left: "20px",
right: "20px",
bottom: "20px",
containLabel: !0
},
series: (this.data || []).map((e) => Array.isArray(e) ? {
type: "scatter",
data: e
} : { type: "scatter", ...e })
};
},
getFunnelOptions() {
return {
title: {
text: this.title,
subtext: this.subtitle,
left: "left"
},
tooltip: {
trigger: "item"
},
legend: {
left: "right",
show: this.showLegend
},
series: [
{
name: "Funnel",
type: "funnel",
left: "10%",
top: "40px",
bottom: "20px",
width: "80%",
min: 0,
max: Math.max(...(this.data || []).map((e) => e.value)),
minSize: "0%",
maxSize: "100%",
sort: this.funnelSort || "descending",
gap: 2,
label: {
show: !0,
position: "inside"
},
labelLine: {
length: 10,
lineStyle: {
width: 1,
type: "solid"
}
},
itemStyle: {
borderColor: "#fff",
borderWidth: 1
},
emphasis: {
label: {}
},
data: this.data
}
]
};
},
load() {
this.$nextTick(() => {
Rn.ready("echarts", () => {
this.chart = Xt(window.echarts.init(this.$refs.chart)), this.chart.on("click", (...t) => {
this.$emit("click", ...t);
});
let e;
if (this.type === "pie")
e = this.getPieOptions();
else if (this.type === "funnel")
e = this.getFunnelOptions();
else if (this.type === "gauge")
e = this.getGaugeOptions();
else if (this.type === "radar")
e = this.getRadarOptions();
else if (this.type === "scatter")
e = this.getScatterOptions();
else if (this.type === "custom") {
if (e = this.loadOptions(this.config, this.chart) || {}, typeof e.then == "function") {
e.then((t) => {
this.$emit("beforeLoad", this.chart, t), this.chart.setOption(t), this.$emit("loaded", this.chart, t);
});
return;
}
} else
e = this.getDefOptions();
this.$emit("beforeLoad", this.chart, e), this.chart.setOption(e), this.$emit("loaded", this.chart, e);
});
});
}
},
created() {
window.echarts ? Rn.done("echarts") : Rn.isDefined("echarts") || Rn.loadNpm("echarts@5.6.0/dist/echarts.min.js", "echarts");
},
mounted() {
this.load(), window.addEventListener("resize", this.debounceResize);
},
unmounted() {
window.removeEventListener("resize", this.debounceResize);
}
}), ZV = {
class: "_fc-echarts",
ref: "chart"
};
function qV(e, t, i, r, n, a) {
return W(), ae("div", ZV, null, 512);
}
const e6 = /* @__PURE__ */ je(XV, [["render", qV]]);
/*!
* @form-create/component-wangeditor v3.2.14
* (c) 2018-2024 xaboy
* Github https://github.com/xaboy/form-create with wangeditor
* Released under the MIT License.
*/
function Bg(e, t) {
var i = Object.keys(e);
if (Object.getOwnPropertySymbols) {
var r = Object.getOwnPropertySymbols(e);
t && (r = r.filter(function(n) {
return Object.getOwnPropertyDescriptor(e, n).enumerable;
})), i.push.apply(i, r);
}
return i;
}
function t6(e) {
for (var t = 1; t < arguments.length; t++) {
var i = arguments[t] != null ? arguments[t] : {};
t % 2 ? Bg(Object(i), !0).forEach(function(r) {
n6(e, r, i[r]);
}) : Object.getOwnPropertyDescriptors ? Object.defineProperties(e, Object.getOwnPropertyDescriptors(i)) : Bg(Object(i)).forEach(function(r) {
Object.defineProperty(e, r, Object.getOwnPropertyDescriptor(i, r));
});
}
return e;
}
function gn(e) {
return typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? gn = function(t) {
return typeof t;
} : gn = function(t) {
return t && typeof Symbol == "function" && t.constructor === Symbol && t !== Symbol.prototype ? "symbol" : typeof t;
}, gn(e);
}
function n6(e, t, i) {
return t in e ? Object.defineProperty(e, t, {
value: i,
enumerable: !0,
configurable: !0,
writable: !0
}) : e[t] = i, e;
}
function i6(e) {
return e && e.__esModule && Object.prototype.hasOwnProperty.call(e, "default") ? e.default : e;
}
var bb = { exports: {} };
(function(e, t) {
(function(r, n) {
e.exports = n();
})(window, function() {
return function(i) {
var r = {};
function n(a) {
if (r[a])
return r[a].exports;
var s = r[a] = { i: a, l: !1, exports: {} };
return i[a].call(s.exports, s, s.exports, n), s.l = !0, s.exports;
}
return n.m = i, n.c = r, n.d = function(a, s, u) {
n.o(a, s) || Object.defineProperty(a, s, { enumerable: !0, get: u });
}, n.r = function(a) {
typeof Symbol < "u" && Symbol.toStringTag && Object.defineProperty(a, Symbol.toStringTag, { value: "Module" }), Object.defineProperty(a, "__esModule", { value: !0 });
}, n.t = function(a, s) {
if (s & 1 && (a = n(a)), s & 8 || s & 4 && gn(a) === "object" && a && a.__esModule)
return a;
var u = /* @__PURE__ */ Object.create(null);
if (n.r(u), Object.defineProperty(u, "default", { enumerable: !0, value: a }), s & 2 && typeof a != "string")
for (var d in a)
n.d(u, d, function(h) {
return a[h];
}.bind(null, d));
return u;
}, n.n = function(a) {
var s = a && a.__esModule ? function() {
return a.default;
} : function() {
return a;
};
return n.d(s, "a", s), s;
}, n.o = function(a, s) {
return Object.prototype.hasOwnProperty.call(a, s);
}, n.p = "", n(n.s = 141);
}([function(i, r) {
function n(a) {
return a && a.__esModule ? a : { default: a };
}
i.exports = n;
}, function(i, r, n) {
i.exports = n(142);
}, function(i, r, n) {
n.r(r), n.d(r, "__extends", function() {
return s;
}), n.d(r, "__assign", function() {
return u;
}), n.d(r, "__rest", function() {
return d;
}), n.d(r, "__decorate", function() {
return h;
}), n.d(r, "__param", function() {
return p;
}), n.d(r, "__metadata", function() {
return g;
}), n.d(r, "__awaiter", function() {
return _;
}), n.d(r, "__generator", function() {
return S;
}), n.d(r, "__createBinding", function() {
return b;
}), n.d(r, "__exportStar", function() {
return A;
}), n.d(r, "__values", function() {
return w;
}), n.d(r, "__read", function() {
return m;
}), n.d(r, "__spread", function() {
return y;
}), n.d(r, "__spreadArrays", function() {
return E;
}), n.d(r, "__spreadArray", function() {
return x;
}), n.d(r, "__await", function() {
return k;
}), n.d(r, "__asyncGenerator", function() {
return D;
}), n.d(r, "__asyncDelegator", function() {
return P;
}), n.d(r, "__asyncValues", function() {
return M;
}), n.d(r, "__makeTemplateObject", function() {
return B;
}), n.d(r, "__importStar", function() {
return $;
}), n.d(r, "__importDefault", function() {
return V;
}), n.d(r, "__classPrivateFieldGet", function() {
return z;
}), n.d(r, "__classPrivateFieldSet", function() {
return H;
});
/*! *****************************************************************************
Copyright (c) Microsoft Corporation.
Permission to use, copy, modify, and/or distribute this software for any
purpose with or without fee is hereby granted.
THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
PERFORMANCE OF THIS SOFTWARE.
***************************************************************************** */
var a = function(U, F) {
return a = Object.setPrototypeOf || { __proto__: [] } instanceof Array && function(C, q) {
C.__proto__ = q;
} || function(C, q) {
for (var X in q)
Object.prototype.hasOwnProperty.call(q, X) && (C[X] = q[X]);
}, a(U, F);
};
function s(I, U) {
if (typeof U != "function" && U !== null)
throw new TypeError("Class extends value " + String(U) + " is not a constructor or null");
a(I, U);
function F() {
this.constructor = I;
}
I.prototype = U === null ? Object.create(U) : (F.prototype = U.prototype, new F());
}
var u = function() {
return u = Object.assign || function(F) {
for (var C, q = 1, X = arguments.length; q < X; q++) {
C = arguments[q];
for (var Y in C)
Object.prototype.hasOwnProperty.call(C, Y) && (F[Y] = C[Y]);
}
return F;
}, u.apply(this, arguments);
};
function d(I, U) {
var F = {};
for (var C in I)
Object.prototype.hasOwnProperty.call(I, C) && U.indexOf(C) < 0 && (F[C] = I[C]);
if (I != null && typeof Object.getOwnPropertySymbols == "function")
for (var q = 0, C = Object.getOwnPropertySymbols(I); q < C.length; q++)
U.indexOf(C[q]) < 0 && Object.prototype.propertyIsEnumerable.call(I, C[q]) && (F[C[q]] = I[C[q]]);
return F;
}
function h(I, U, F, C) {
var q = arguments.length, X = q < 3 ? U : C === null ? C = Object.getOwnPropertyDescriptor(U, F) : C, Y;
if ((typeof Reflect > "u" ? "undefined" : gn(Reflect)) === "object" && typeof Reflect.decorate == "function")
X = Reflect.decorate(I, U, F, C);
else
for (var ue = I.length - 1; ue >= 0; ue--)
(Y = I[ue]) && (X = (q < 3 ? Y(X) : q > 3 ? Y(U, F, X) : Y(U, F)) || X);
return q > 3 && X && Object.defineProperty(U, F, X), X;
}
function p(I, U) {
return function(F, C) {
U(F, C, I);
};
}
function g(I, U) {
if ((typeof Reflect > "u" ? "undefined" : gn(Reflect)) === "object" && typeof Reflect.metadata == "function")
return Reflect.metadata(I, U);
}
function _(I, U, F, C) {
function q(X) {
return X instanceof F ? X : new F(function(Y) {
Y(X);
});
}
return new (F || (F = Promise))(function(X, Y) {
function ue(Te) {
try {
pe(C.next(Te));
} catch (ve) {
Y(ve);
}
}
function ee(Te) {
try {
pe(C.throw(Te));
} catch (ve) {
Y(ve);
}
}
function pe(Te) {
Te.done ? X(Te.value) : q(Te.value).then(ue, ee);
}
pe((C = C.apply(I, U || [])).next());
});
}
function S(I, U) {
var F = { label: 0, sent: function() {
if (X[0] & 1)
throw X[1];
return X[1];
}, trys: [], ops: [] }, C, q, X, Y;
return Y = { next: ue(0), throw: ue(1), return: ue(2) }, typeof Symbol == "function" && (Y[Symbol.iterator] = function() {
return this;
}), Y;
function ue(pe) {
return function(Te) {
return ee([pe, Te]);
};
}
function ee(pe) {
if (C)
throw new TypeError("Generator is already executing.");
for (; F; )
try {
if (C = 1, q && (X = pe[0] & 2 ? q.return : pe[0] ? q.throw || ((X = q.return) && X.call(q), 0) : q.next) && !(X = X.call(q, pe[1])).done)
return X;
switch (q = 0, X && (pe = [pe[0] & 2, X.value]), pe[0]) {
case 0:
case 1:
X = pe;
break;
case 4:
return F.label++, { value: pe[1], done: !1 };
case 5:
F.label++, q = pe[1], pe = [0];
continue;
case 7:
pe = F.ops.pop(), F.trys.pop();
continue;
default:
if (X = F.trys, !(X = X.length > 0 && X[X.length - 1]) && (pe[0] === 6 || pe[0] === 2)) {
F = 0;
continue;
}
if (pe[0] === 3 && (!X || pe[1] > X[0] && pe[1] < X[3])) {
F.label = pe[1];
break;
}
if (pe[0] === 6 && F.label < X[1]) {
F.label = X[1], X = pe;
break;
}
if (X && F.label < X[2]) {
F.label = X[2], F.ops.push(pe);
break;
}
X[2] && F.ops.pop(), F.trys.pop();
continue;
}
pe = U.call(I, F);
} catch (Te) {
pe = [6, Te], q = 0;
} finally {
C = X = 0;
}
if (pe[0] & 5)
throw pe[1];
return { value: pe[0] ? pe[1] : void 0, done: !0 };
}
}
var b = Object.create ? function(I, U, F, C) {
C === void 0 && (C = F), Object.defineProperty(I, C, { enumerable: !0, get: function() {
return U[F];
} });
} : function(I, U, F, C) {
C === void 0 && (C = F), I[C] = U[F];
};
function A(I, U) {
for (var F in I)
F !== "default" && !Object.prototype.hasOwnProperty.call(U, F) && b(U, I, F);
}
function w(I) {
var U = typeof Symbol == "function" && Symbol.iterator, F = U && I[U], C = 0;
if (F)
return F.call(I);
if (I && typeof I.length == "number")
return { next: function() {
return I && C >= I.length && (I = void 0), { value: I && I[C++], done: !I };
} };
throw new TypeError(U ? "Object is not iterable." : "Symbol.iterator is not defined.");
}
function m(I, U) {
var F = typeof Symbol == "function" && I[Symbol.iterator];
if (!F)
return I;
var C = F.call(I), q, X = [], Y;
try {
for (; (U === void 0 || U-- > 0) && !(q = C.next()).done; )
X.push(q.value);
} catch (ue) {
Y = { error: ue };
} finally {
try {
q && !q.done && (F = C.return) && F.call(C);
} finally {
if (Y)
throw Y.error;
}
}
return X;
}
function y() {
for (var I = [], U = 0; U < arguments.length; U++)
I = I.concat(m(arguments[U]));
return I;
}
function E() {
for (var I = 0, U = 0, F = arguments.length; U < F; U++)
I += arguments[U].length;
for (var C = Array(I), q = 0, U = 0; U < F; U++)
for (var X = arguments[U], Y = 0, ue = X.length; Y < ue; Y++, q++)
C[q] = X[Y];
return C;
}
function x(I, U) {
for (var F = 0, C = U.length, q = I.length; F < C; F++, q++)
I[q] = U[F];
return I;
}
function k(I) {
return this instanceof k ? (this.v = I, this) : new k(I);
}
function D(I, U, F) {
if (!Symbol.asyncIterator)
throw new TypeError("Symbol.asyncIterator is not defined.");
var C = F.apply(I, U || []), q, X = [];
return q = {}, Y("next"), Y("throw"), Y("return"), q[Symbol.asyncIterator] = function() {
return this;
}, q;
function Y(me) {
C[me] && (q[me] = function(we) {
return new Promise(function(he, Se) {
X.push([me, we, he, Se]) > 1 || ue(me, we);
});
});
}
function ue(me, we) {
try {
ee(C[me](we));
} catch (he) {
ve(X[0][3], he);
}
}
function ee(me) {
me.value instanceof k ? Promise.resolve(me.value.v).then(pe, Te) : ve(X[0][2], me);
}
function pe(me) {
ue("next", me);
}
function Te(me) {
ue("throw", me);
}
function ve(me, we) {
me(we), X.shift(), X.length && ue(X[0][0], X[0][1]);
}
}
function P(I) {
var U, F;
return U = {}, C("next"), C("throw", function(q) {
throw q;
}), C("return"), U[Symbol.iterator] = function() {
return this;
}, U;
function C(q, X) {
U[q] = I[q] ? function(Y) {
return (F = !F) ? { value: k(I[q](Y)), done: q === "return" } : X ? X(Y) : Y;
} : X;
}
}
function M(I) {
if (!Symbol.asyncIterator)
throw new TypeError("Symbol.asyncIterator is not defined.");
var U = I[Symbol.asyncIterator], F;
return U ? U.call(I) : (I = typeof w == "function" ? w(I) : I[Symbol.iterator](), F = {}, C("next"), C("throw"), C("return"), F[Symbol.asyncIterator] = function() {
return this;
}, F);
function C(X) {
F[X] = I[X] && function(Y) {
return new Promise(function(ue, ee) {
Y = I[X](Y), q(ue, ee, Y.done, Y.value);
});
};
}
function q(X, Y, ue, ee) {
Promise.resolve(ee).then(function(pe) {
X({ value: pe, done: ue });
}, Y);
}
}
function B(I, U) {
return Object.defineProperty ? Object.defineProperty(I, "raw", { value: U }) : I.raw = U, I;
}
var T = Object.create ? function(I, U) {
Object.defineProperty(I, "default", { enumerable: !0, value: U });
} : function(I, U) {
I.default = U;
};
function $(I) {
if (I && I.__esModule)
return I;
var U = {};
if (I != null)
for (var F in I)
F !== "default" && Object.prototype.hasOwnProperty.call(I, F) && b(U, I, F);
return T(U, I), U;
}
function V(I) {
return I && I.__esModule ? I : { default: I };
}
function z(I, U) {
if (!U.has(I))
throw new TypeError("attempted to get private field on non-instance");
return U.get(I);
}
function H(I, U, F) {
if (!U.has(I))
throw new TypeError("attempted to set private field on non-instance");
return U.set(I, F), F;
}
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(89)), d = a(n(4)), h = a(n(26)), p = a(n(17)), g = a(n(121)), _ = a(n(27)), S = a(n(91)), b = a(n(70)), A = a(n(28)), w = a(n(57));
(0, s.default)(r, "__esModule", { value: !0 }), r.DomElement = void 0;
var m = n(2), y = n(6), E = [];
function x(T) {
var $ = document.createElement("div");
$.innerHTML = T;
var V = $.children;
return y.toArray(V);
}
function k(T) {
return T ? T instanceof HTMLCollection || T instanceof NodeList : !1;
}
function D(T) {
var $ = document.querySelectorAll(T);
return y.toArray($);
}
function P(T) {
var $ = [], V = [];
return (0, u.default)(T) ? $ = T : $ = T.split(";"), (0, d.default)($).call($, function(z) {
var H, I = (0, h.default)(H = z.split(":")).call(H, function(U) {
return (0, p.default)(U).call(U);
});
I.length === 2 && V.push(I[0] + ":" + I[1]);
}), V;
}
var M = function() {
function T($) {
if (this.elems = [], this.length = this.elems.length, this.dataSource = new g.default(), !!$) {
if ($ instanceof T)
return $;
var V = [], z = $ instanceof Node ? $.nodeType : -1;
if (this.selector = $, z === 1 || z === 9)
V = [$];
else if (k($))
V = y.toArray($);
else if ($ instanceof Array)
V = $;
else if (typeof $ == "string") {
var H, I = (0, p.default)(H = $.replace(`/
/mg`, "")).call(H);
(0, _.default)(I).call(I, "<") === 0 ? V = x(I) : V = D(I);
}
var U = V.length;
if (!U)
return this;
for (var F = 0; F < U; F++)
this.elems.push(V[F]);
this.length = U;
}
}
return (0, s.default)(T.prototype, "id", {
get: function() {
return this.elems[0].id;
},
enumerable: !1,
configurable: !0
}), T.prototype.forEach = function($) {
for (var V = 0; V < this.length; V++) {
var z = this.elems[V], H = $.call(z, z, V);
if (H === !1)
break;
}
return this;
}, T.prototype.clone = function($) {
var V;
$ === void 0 && ($ = !1);
var z = [];
return (0, d.default)(V = this.elems).call(V, function(H) {
z.push(H.cloneNode(!!$));
}), B(z);
}, T.prototype.get = function($) {
$ === void 0 && ($ = 0);
var V = this.length;
return $ >= V && ($ = $ % V), B(this.elems[$]);
}, T.prototype.first = function() {
return this.get(0);
}, T.prototype.last = function() {
var $ = this.length;
return this.get($ - 1);
}, T.prototype.on = function($, V, z) {
var H;
return $ ? (typeof V == "function" && (z = V, V = ""), (0, d.default)(H = this).call(H, function(I) {
if (!V) {
I.addEventListener($, z);
return;
}
var U = function(C) {
var q = C.target;
q.matches(V) && z.call(q, C);
};
I.addEventListener($, U), E.push({ elem: I, selector: V, fn: z, agentFn: U });
})) : this;
}, T.prototype.off = function($, V, z) {
var H;
return $ ? (typeof V == "function" && (z = V, V = ""), (0, d.default)(H = this).call(H, function(I) {
if (V) {
for (var U = -1, F = 0; F < E.length; F++) {
var C = E[F];
if (C.selector === V && C.fn === z && C.elem === I) {
U = F;
break;
}
}
if (U !== -1) {
var q = (0, S.default)(E).call(E, U, 1)[0].agentFn;
I.removeEventListener($, q);
}
} else
I.removeEventListener($, z);
})) : this;
}, T.prototype.attr = function($, V) {
var z;
return V == null ? this.elems[0].getAttribute($) || "" : (0, d.default)(z = this).call(z, function(H) {
H.setAttribute($, V);
});
}, T.prototype.removeAttr = function($) {
var V;
(0, d.default)(V = this).call(V, function(z) {
z.removeAttribute($);
});
}, T.prototype.addClass = function($) {
var V;
return $ ? (0, d.default)(V = this).call(V, function(z) {
if (z.className) {
var H = z.className.split(/\s/);
H = (0, b.default)(H).call(H, function(I) {
return !!(0, p.default)(I).call(I);
}), (0, _.default)(H).call(H, $) < 0 && H.push($), z.className = H.join(" ");
} else
z.className = $;
}) : this;
}, T.prototype.removeClass = function($) {
var V;
return $ ? (0, d.default)(V = this).call(V, function(z) {
if (!!z.className) {
var H = z.className.split(/\s/);
H = (0, b.default)(H).call(H, function(I) {
return I = (0, p.default)(I).call(I), !(!I || I === $);
}), z.className = H.join(" ");
}
}) : this;
}, T.prototype.hasClass = function($) {
if (!$)
return !1;
var V = this.elems[0];
if (!V.className)
return !1;
var z = V.className.split(/\s/);
return (0, A.default)(z).call(z, $);
}, T.prototype.css = function($, V) {
var z, H;
return V == "" ? H = "" : H = $ + ":" + V + ";", (0, d.default)(z = this).call(z, function(I) {
var U, F = (0, p.default)(U = I.getAttribute("style") || "").call(U);
if (F) {
var C = P(F);
C = (0, h.default)(C).call(C, function(q) {
return (0, _.default)(q).call(q, $) === 0 ? H : q;
}), H != "" && (0, _.default)(C).call(C, H) < 0 && C.push(H), H == "" && (C = P(C)), I.setAttribute("style", C.join("; "));
} else
I.setAttribute("style", H);
});
}, T.prototype.getBoundingClientRect = function() {
var $ = this.elems[0];
return $.getBoundingClientRect();
}, T.prototype.show = function() {
return this.css("display", "block");
}, T.prototype.hide = function() {
return this.css("display", "none");
}, T.prototype.children = function() {
var $ = this.elems[0];
return $ ? B($.children) : null;
}, T.prototype.childNodes = function() {
var $ = this.elems[0];
return $ ? B($.childNodes) : null;
}, T.prototype.replaceChildAll = function($) {
for (var V = this.getNode(), z = this.elems[0]; z.hasChildNodes(); )
V.firstChild && z.removeChild(V.firstChild);
this.append($);
}, T.prototype.append = function($) {
var V;
return (0, d.default)(V = this).call(V, function(z) {
(0, d.default)($).call($, function(H) {
z.appendChild(H);
});
});
}, T.prototype.remove = function() {
var $;
return (0, d.default)($ = this).call($, function(V) {
if (V.remove)
V.remove();
else {
var z = V.parentElement;
z && z.removeChild(V);
}
});
}, T.prototype.isContain = function($) {
var V = this.elems[0], z = $.elems[0];
return V.contains(z);
}, T.prototype.getNodeName = function() {
var $ = this.elems[0];
return $.nodeName;
}, T.prototype.getNode = function($) {
$ === void 0 && ($ = 0);
var V;
return V = this.elems[$], V;
}, T.prototype.find = function($) {
var V = this.elems[0];
return B(V.querySelectorAll($));
}, T.prototype.text = function($) {
if ($) {
var z;
return (0, d.default)(z = this).call(z, function(H) {
H.innerHTML = $;
});
} else {
var V = this.elems[0];
return V.innerHTML.replace(/<[^>]+>/g, function() {
return "";
});
}
}, T.prototype.html = function($) {
var V = this.elems[0];
return $ ? (V.innerHTML = $, this) : V.innerHTML;
}, T.prototype.val = function() {
var $, V = this.elems[0];
return (0, p.default)($ = V.value).call($);
}, T.prototype.focus = function() {
var $;
return (0, d.default)($ = this).call($, function(V) {
V.focus();
});
}, T.prototype.prev = function() {
var $ = this.elems[0];
return B($.previousElementSibling);
}, T.prototype.next = function() {
var $ = this.elems[0];
return B($.nextElementSibling);
}, T.prototype.getNextSibling = function() {
var $ = this.elems[0];
return B($.nextSibling);
}, T.prototype.parent = function() {
var $ = this.elems[0];
return B($.parentElement);
}, T.prototype.parentUntil = function($, V) {
var z = V || this.elems[0];
if (z.nodeName === "BODY")
return null;
var H = z.parentElement;
return H === null ? null : H.matches($) ? B(H) : this.parentUntil($, H);
}, T.prototype.parentUntilEditor = function($, V, z) {
var H = z || this.elems[0];
if (B(H).equal(V.$textContainerElem) || B(H).equal(V.$toolbarElem))
return null;
var I = H.parentElement;
return I === null ? null : I.matches($) ? B(I) : this.parentUntilEditor($, V, I);
}, T.prototype.equal = function($) {
return $ instanceof T ? this.elems[0] === $.elems[0] : $ instanceof HTMLElement ? this.elems[0] === $ : !1;
}, T.prototype.insertBefore = function($) {
var V, z = B($), H = z.elems[0];
return H ? (0, d.default)(V = this).call(V, function(I) {
var U = H.parentNode;
U == null || U.insertBefore(I, H);
}) : this;
}, T.prototype.insertAfter = function($) {
var V, z = B($), H = z.elems[0], I = H && H.nextSibling;
return H ? (0, d.default)(V = this).call(V, function(U) {
var F = H.parentNode;
I ? F.insertBefore(U, I) : F.appendChild(U);
}) : this;
}, T.prototype.data = function($, V) {
if (V != null)
this.dataSource.set($, V);
else
return this.dataSource.get($);
}, T.prototype.getNodeTop = function($) {
if (this.length < 1)
return this;
var V = this.parent();
return $.$textElem.equal(this) || $.$textElem.equal(V) ? this : (V.prior = this, V.getNodeTop($));
}, T.prototype.getOffsetData = function() {
var $ = this.elems[0];
return { top: $.offsetTop, left: $.offsetLeft, width: $.offsetWidth, height: $.offsetHeight, parent: $.offsetParent };
}, T.prototype.scrollTop = function($) {
var V = this.elems[0];
V.scrollTo({ top: $ });
}, T;
}();
r.DomElement = M;
function B() {
for (var T = [], $ = 0; $ < arguments.length; $++)
T[$] = arguments[$];
return new ((0, w.default)(M).apply(M, m.__spreadArrays([void 0], T)))();
}
r.default = B;
}, function(i, r, n) {
i.exports = n(180);
}, function(i, r, n) {
var a = n(8), s = n(71).f, u = n(101), d = n(9), h = n(40), p = n(19), g = n(16), _ = function(b) {
var A = function(m, y, E) {
if (this instanceof b) {
switch (arguments.length) {
case 0:
return new b();
case 1:
return new b(m);
case 2:
return new b(m, y);
}
return new b(m, y, E);
}
return b.apply(this, arguments);
};
return A.prototype = b.prototype, A;
};
i.exports = function(S, b) {
var A = S.target, w = S.global, m = S.stat, y = S.proto, E = w ? a : m ? a[A] : (a[A] || {}).prototype, x = w ? d : d[A] || (d[A] = {}), k = x.prototype, D, P, M, B, T, $, V, z, H;
for (B in b)
D = u(w ? B : A + (m ? "." : "#") + B, S.forced), P = !D && E && g(E, B), $ = x[B], P && (S.noTargetGet ? (H = s(E, B), V = H && H.value) : V = E[B]), T = P && V ? V : b[B], !(P && gn($) === gn(T)) && (S.bind && P ? z = h(T, a) : S.wrap && P ? z = _(T) : y && typeof T == "function" ? z = h(Function.call, T) : z = T, (S.sham || T && T.sham || $ && $.sham) && p(z, "sham", !0), x[B] = z, y && (M = A + "Prototype", g(d, M) || p(d, M, {}), d[M][B] = T, S.real && k && !k[B] && p(k, B, T)));
};
}, function(i, r, n) {
var a = n(0), s = a(n(92)), u = a(n(1)), d = a(n(256)), h = a(n(45)), p = a(n(46)), g = a(n(89)), _ = a(n(26));
(0, u.default)(r, "__esModule", { value: !0 }), r.hexToRgb = r.getRandomCode = r.toArray = r.deepClone = r.isFunction = r.debounce = r.throttle = r.arrForEach = r.forEach = r.replaceSpecialSymbol = r.replaceHtmlSymbol = r.getRandom = r.UA = void 0;
var S = n(2), b = function() {
function $() {
this._ua = navigator.userAgent;
var V = this._ua.match(/(Edge?)\/(\d+)/);
this.isOldEdge = !!(V && V[1] == "Edge" && (0, d.default)(V[2]) < 19), this.isFirefox = !!(/Firefox\/\d+/.test(this._ua) && !/Seamonkey\/\d+/.test(this._ua));
}
return $.prototype.isIE = function() {
return "ActiveXObject" in window;
}, $.prototype.isWebkit = function() {
return /webkit/i.test(this._ua);
}, $;
}();
r.UA = new b();
function A($) {
var V;
return $ === void 0 && ($ = ""), $ + (0, h.default)(V = Math.random().toString()).call(V, 2);
}
r.getRandom = A;
function w($) {
return $.replace(/</gm, "&lt;").replace(/>/gm, "&gt;").replace(/"/gm, "&quot;").replace(/(\r\n|\r|\n)/g, "<br/>");
}
r.replaceHtmlSymbol = w;
function m($) {
return $.replace(/&lt;/gm, "<").replace(/&gt;/gm, ">").replace(/&quot;/gm, '"');
}
r.replaceSpecialSymbol = m;
function y($, V) {
for (var z in $)
if (Object.prototype.hasOwnProperty.call($, z)) {
var H = V(z, $[z]);
if (H === !1)
break;
}
}
r.forEach = y;
function E($, V) {
var z, H, I, U = $.length || 0;
for (z = 0; z < U && (H = $[z], I = V.call($, H, z), I !== !1); z++)
;
}
r.arrForEach = E;
function x($, V) {
V === void 0 && (V = 200);
var z = !1;
return function() {
for (var H = this, I = [], U = 0; U < arguments.length; U++)
I[U] = arguments[U];
z || (z = !0, (0, p.default)(function() {
z = !1, $.call.apply($, S.__spreadArrays([H], I));
}, V));
};
}
r.throttle = x;
function k($, V) {
V === void 0 && (V = 200);
var z = 0;
return function() {
for (var H = this, I = [], U = 0; U < arguments.length; U++)
I[U] = arguments[U];
z && window.clearTimeout(z), z = (0, p.default)(function() {
z = 0, $.call.apply($, S.__spreadArrays([H], I));
}, V);
};
}
r.debounce = k;
function D($) {
return typeof $ == "function";
}
r.isFunction = D;
function P($) {
if ((0, s.default)($) !== "object" || typeof $ == "function" || $ === null)
return $;
var V;
(0, g.default)($) && (V = []), (0, g.default)($) || (V = {});
for (var z in $)
Object.prototype.hasOwnProperty.call($, z) && (V[z] = P($[z]));
return V;
}
r.deepClone = P;
function M($) {
return (0, h.default)(Array.prototype).call($);
}
r.toArray = M;
function B() {
var $;
return (0, h.default)($ = Math.random().toString(36)).call($, -5);
}
r.getRandomCode = B;
function T($) {
var V = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i.exec($);
if (V == null)
return null;
var z = (0, _.default)(V).call(V, function(F) {
return (0, d.default)(F, 16);
}), H = z[1], I = z[2], U = z[3];
return "rgb(" + H + ", " + I + ", " + U + ")";
}
r.hexToRgb = T;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 }), r.EMPTY_P_REGEX = r.EMPTY_P_LAST_REGEX = r.EMPTY_P = r.urlRegex = r.EMPTY_FN = void 0;
function u() {
}
r.EMPTY_FN = u, r.urlRegex = /(http|ftp|https):\/\/[\w\-_]+(\.[\w\-_]+)+([\w\-.,@?^=%&amp;:/~+#]*[\w\-@?^=%&amp;/~+#])?/g, r.EMPTY_P = '<p data-we-empty-p=""><br></p>', r.EMPTY_P_LAST_REGEX = /<p data-we-empty-p=""><br\/?><\/p>$/gim, r.EMPTY_P_REGEX = /<p data-we-empty-p="">/gim;
}, function(i, r, n) {
(function(a) {
var s = function(d) {
return d && d.Math == Math && d;
};
i.exports = s((typeof globalThis > "u" ? "undefined" : gn(globalThis)) == "object" && globalThis) || s((typeof window > "u" ? "undefined" : gn(window)) == "object" && window) || s((typeof self > "u" ? "undefined" : gn(self)) == "object" && self) || s(gn(a) == "object" && a) || Function("return this")();
}).call(this, n(145));
}, function(i, r) {
i.exports = {};
}, function(i, r, n) {
var a = n(8), s = n(74), u = n(16), d = n(64), h = n(76), p = n(106), g = s("wks"), _ = a.Symbol, S = p ? _ : _ && _.withoutSetter || d;
i.exports = function(b) {
return u(g, b) || (h && u(_, b) ? g[b] = _[b] : g[b] = S("Symbol." + b)), g[b];
};
}, function(i, r) {
i.exports = function(n) {
try {
return !!n();
} catch {
return !0;
}
};
}, function(i, r, n) {
var a = n(9), s = n(16), u = n(93), d = n(18).f;
i.exports = function(h) {
var p = a.Symbol || (a.Symbol = {});
s(p, h) || d(p, h, { value: u.f(h) });
};
}, function(i, r) {
i.exports = function(n) {
return gn(n) === "object" ? n !== null : typeof n == "function";
};
}, function(i, r, n) {
var a = n(11);
i.exports = !a(function() {
return Object.defineProperty({}, 1, { get: function() {
return 7;
} })[1] != 7;
});
}, function(i, r, n) {
var a = n(9);
i.exports = function(s) {
return a[s + "Prototype"];
};
}, function(i, r) {
var n = {}.hasOwnProperty;
i.exports = function(a, s) {
return n.call(a, s);
};
}, function(i, r, n) {
i.exports = n(192);
}, function(i, r, n) {
var a = n(14), s = n(100), u = n(25), d = n(60), h = Object.defineProperty;
r.f = a ? h : function(g, _, S) {
if (u(g), _ = d(_, !0), u(S), s)
try {
return h(g, _, S);
} catch {
}
if ("get" in S || "set" in S)
throw TypeError("Accessors not supported");
return "value" in S && (g[_] = S.value), g;
};
}, function(i, r, n) {
var a = n(14), s = n(18), u = n(48);
i.exports = a ? function(d, h, p) {
return s.f(d, h, u(1, p));
} : function(d, h, p) {
return d[h] = p, d;
};
}, function(i, r, n) {
var a = function() {
var E;
return function() {
return typeof E > "u" && (E = Boolean(window && document && document.all && !window.atob)), E;
};
}(), s = function() {
var E = {};
return function(k) {
if (typeof E[k] > "u") {
var D = document.querySelector(k);
if (window.HTMLIFrameElement && D instanceof window.HTMLIFrameElement)
try {
D = D.contentDocument.head;
} catch {
D = null;
}
E[k] = D;
}
return E[k];
};
}(), u = [];
function d(y) {
for (var E = -1, x = 0; x < u.length; x++)
if (u[x].identifier === y) {
E = x;
break;
}
return E;
}
function h(y, E) {
for (var x = {}, k = [], D = 0; D < y.length; D++) {
var P = y[D], M = E.base ? P[0] + E.base : P[0], B = x[M] || 0, T = "".concat(M, " ").concat(B);
x[M] = B + 1;
var $ = d(T), V = { css: P[1], media: P[2], sourceMap: P[3] };
$ !== -1 ? (u[$].references++, u[$].updater(V)) : u.push({ identifier: T, updater: m(V, E), references: 1 }), k.push(T);
}
return k;
}
function p(y) {
var E = document.createElement("style"), x = y.attributes || {};
if (typeof x.nonce > "u") {
var k = n.nc;
k && (x.nonce = k);
}
if (Object.keys(x).forEach(function(P) {
E.setAttribute(P, x[P]);
}), typeof y.insert == "function")
y.insert(E);
else {
var D = s(y.insert || "head");
if (!D)
throw new Error("Couldn't find a style target. This probably means that the value for the 'insert' parameter is invalid.");
D.appendChild(E);
}
return E;
}
function g(y) {
if (y.parentNode === null)
return !1;
y.parentNode.removeChild(y);
}
var _ = function() {
var E = [];
return function(k, D) {
return E[k] = D, E.filter(Boolean).join(`
`);
};
}();
function S(y, E, x, k) {
var D = x ? "" : k.media ? "@media ".concat(k.media, " {").concat(k.css, "}") : k.css;
if (y.styleSheet)
y.styleSheet.cssText = _(E, D);
else {
var P = document.createTextNode(D), M = y.childNodes;
M[E] && y.removeChild(M[E]), M.length ? y.insertBefore(P, M[E]) : y.appendChild(P);
}
}
function b(y, E, x) {
var k = x.css, D = x.media, P = x.sourceMap;
if (D ? y.setAttribute("media", D) : y.removeAttribute("media"), P && typeof btoa < "u" && (k += `
/*# sourceMappingURL=data:application/json;base64,`.concat(btoa(unescape(encodeURIComponent(JSON.stringify(P)))), " */")), y.styleSheet)
y.styleSheet.cssText = k;
else {
for (; y.firstChild; )
y.removeChild(y.firstChild);
y.appendChild(document.createTextNode(k));
}
}
var A = null, w = 0;
function m(y, E) {
var x, k, D;
if (E.singleton) {
var P = w++;
x = A || (A = p(E)), k = S.bind(null, x, P, !1), D = S.bind(null, x, P, !0);
} else
x = p(E), k = b.bind(null, x, E), D = function() {
g(x);
};
return k(y), function(B) {
if (B) {
if (B.css === y.css && B.media === y.media && B.sourceMap === y.sourceMap)
return;
k(y = B);
} else
D();
};
}
i.exports = function(y, E) {
E = E || {}, !E.singleton && typeof E.singleton != "boolean" && (E.singleton = a()), y = y || [];
var x = h(y, E);
return function(D) {
if (D = D || [], Object.prototype.toString.call(D) === "[object Array]") {
for (var P = 0; P < x.length; P++) {
var M = x[P], B = d(M);
u[B].references--;
}
for (var T = h(D, E), $ = 0; $ < x.length; $++) {
var V = x[$], z = d(V);
u[z].references === 0 && (u[z].updater(), u.splice(z, 1));
}
x = T;
}
};
};
}, function(i, r, n) {
i.exports = function(u) {
var d = [];
return d.toString = function() {
return this.map(function(p) {
var g = a(p, u);
return p[2] ? "@media ".concat(p[2], " {").concat(g, "}") : g;
}).join("");
}, d.i = function(h, p, g) {
typeof h == "string" && (h = [[null, h, ""]]);
var _ = {};
if (g)
for (var S = 0; S < this.length; S++) {
var b = this[S][0];
b != null && (_[b] = !0);
}
for (var A = 0; A < h.length; A++) {
var w = [].concat(h[A]);
g && _[w[0]] || (p && (w[2] ? w[2] = "".concat(p, " and ").concat(w[2]) : w[2] = p), d.push(w));
}
}, d;
};
function a(u, d) {
var h = u[1] || "", p = u[3];
if (!p)
return h;
if (d && typeof btoa == "function") {
var g = s(p), _ = p.sources.map(function(S) {
return "/*# sourceURL=".concat(p.sourceRoot || "").concat(S, " */");
});
return [h].concat(_).concat([g]).join(`
`);
}
return [h].join(`
`);
}
function s(u) {
var d = btoa(unescape(encodeURIComponent(JSON.stringify(u)))), h = "sourceMappingURL=data:application/json;charset=utf-8;base64,".concat(d);
return "/*# ".concat(h, " */");
}
}, function(i, r, n) {
var a = n(14), s = n(11), u = n(16), d = Object.defineProperty, h = {}, p = function(_) {
throw _;
};
i.exports = function(g, _) {
if (u(h, g))
return h[g];
_ || (_ = {});
var S = [][g], b = u(_, "ACCESSORS") ? _.ACCESSORS : !1, A = u(_, 0) ? _[0] : p, w = u(_, 1) ? _[1] : void 0;
return h[g] = !!S && !s(function() {
if (b && !a)
return !0;
var m = { length: -1 };
b ? d(m, 1, { enumerable: !0, get: p }) : m[1] = 1, S.call(m, A, w);
});
};
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(95)), h = function(p) {
u.__extends(g, p);
function g(_, S) {
return p.call(this, _, S) || this;
}
return g;
}(d.default);
r.default = h;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4)), d = a(n(46));
(0, s.default)(r, "__esModule", { value: !0 });
var h = n(2), p = h.__importDefault(n(3)), g = h.__importDefault(n(95)), _ = h.__importDefault(n(134)), S = function(b) {
h.__extends(A, b);
function A(w, m, y) {
var E = b.call(this, w, m) || this;
y.title = m.i18next.t("menus.dropListMenu." + y.title);
var x = m.config.lang === "zh-CN" ? "" : "w-e-drop-list-tl";
if (x !== "" && y.type === "list") {
var k;
(0, u.default)(k = y.list).call(k, function(P) {
var M = P.$elem, B = p.default(M.children());
if (B.length > 0) {
var T = B == null ? void 0 : B.getNodeName();
T && T === "I" && M.addClass(x);
}
});
}
var D = new _.default(E, y);
return E.dropList = D, w.on("click", function() {
var P;
m.selection.getRange() != null && (w.css("z-index", m.zIndex.get("menu")), (0, u.default)(P = m.txt.eventHooks.dropListMenuHoverEvents).call(P, function(M) {
return M();
}), D.show());
}).on("mouseleave", function() {
w.css("z-index", "auto"), D.hideTimeoutId = (0, d.default)(function() {
D.hide();
});
}), E;
}
return A;
}(g.default);
r.default = S;
}, function(i, r, n) {
var a = n(13);
i.exports = function(s) {
if (!a(s))
throw TypeError(String(s) + " is not an object");
return s;
};
}, function(i, r, n) {
i.exports = n(188);
}, function(i, r, n) {
i.exports = n(201);
}, function(i, r, n) {
i.exports = n(213);
}, function(i, r, n) {
i.exports = n(283);
}, function(i, r, n) {
var a = n(72), s = n(49);
i.exports = function(u) {
return a(s(u));
};
}, function(i, r, n) {
var a = n(49);
i.exports = function(s) {
return Object(a(s));
};
}, function(i, r, n) {
var a = n(40), s = n(72), u = n(31), d = n(35), h = n(88), p = [].push, g = function(S) {
var b = S == 1, A = S == 2, w = S == 3, m = S == 4, y = S == 6, E = S == 5 || y;
return function(x, k, D, P) {
for (var M = u(x), B = s(M), T = a(k, D, 3), $ = d(B.length), V = 0, z = P || h, H = b ? z(x, $) : A ? z(x, 0) : void 0, I, U; $ > V; V++)
if ((E || V in B) && (I = B[V], U = T(I, V, M), S)) {
if (b)
H[V] = U;
else if (U)
switch (S) {
case 3:
return !0;
case 5:
return I;
case 6:
return V;
case 2:
p.call(H, I);
}
else if (m)
return !1;
}
return y ? -1 : w || m ? m : H;
};
};
i.exports = {
forEach: g(0),
map: g(1),
filter: g(2),
some: g(3),
every: g(4),
find: g(5),
findIndex: g(6)
};
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4)), d = a(n(29)), h = a(n(132));
(0, s.default)(r, "__esModule", { value: !0 });
var p = n(2), g = p.__importDefault(n(3)), _ = n(7), S = function() {
function b(A, w) {
this.menu = A, this.conf = w, this.$container = g.default('<div class="w-e-panel-container"></div>');
var m = A.editor;
m.txt.eventHooks.clickEvents.push(b.hideCurAllPanels), m.txt.eventHooks.toolbarClickEvents.push(b.hideCurAllPanels), m.txt.eventHooks.dropListMenuHoverEvents.push(b.hideCurAllPanels);
}
return b.prototype.create = function() {
var A = this, w = this.menu;
if (!b.createdMenus.has(w)) {
var m = this.conf, y = this.$container, E = m.width || 300, x = w.editor.$toolbarElem.getBoundingClientRect(), k = w.$elem.getBoundingClientRect(), D = x.height + x.top - k.top, P = (x.width - E) / 2 + x.left - k.left, M = 300;
Math.abs(P) > M && (k.left < document.documentElement.clientWidth / 2 ? P = -k.width / 2 : P = -E + k.width / 2), y.css("width", E + "px").css("margin-top", D + "px").css("margin-left", P + "px").css("z-index", w.editor.zIndex.get("panel"));
var B = g.default('<i class="w-e-icon-close w-e-panel-close"></i>');
y.append(B), B.on("click", function() {
A.remove();
});
var T = g.default('<ul class="w-e-panel-tab-title"></ul>'), $ = g.default('<div class="w-e-panel-tab-content"></div>');
y.append(T).append($);
var V = m.height;
V && $.css("height", V + "px").css("overflow-y", "auto");
var z = m.tabs || [], H = [], I = [];
(0, u.default)(z).call(z, function(F, C) {
if (!!F) {
var q = F.title || "", X = F.tpl || "", Y = g.default('<li class="w-e-item">' + q + "</li>");
T.append(Y);
var ue = g.default(X);
$.append(ue), H.push(Y), I.push(ue), C === 0 ? (Y.data("active", !0), Y.addClass("w-e-active")) : ue.hide(), Y.on("click", function() {
Y.data("active") || ((0, u.default)(H).call(H, function(ee) {
ee.data("active", !1), ee.removeClass("w-e-active");
}), (0, u.default)(I).call(I, function(ee) {
ee.hide();
}), Y.data("active", !0), Y.addClass("w-e-active"), ue.show());
});
}
}), y.on("click", function(F) {
F.stopPropagation();
}), w.$elem.append(y), m.setLinkValue && m.setLinkValue(y, "text"), m.setLinkValue && m.setLinkValue(y, "link"), (0, u.default)(z).call(z, function(F, C) {
if (!!F) {
var q = F.events || [];
(0, u.default)(q).call(q, function(X) {
var Y, ue = X.selector, ee = X.type, pe = X.fn || _.EMPTY_FN, Te = I[C], ve = (Y = X.bindEnter) !== null && Y !== void 0 ? Y : !1, me = function(he) {
return p.__awaiter(A, void 0, void 0, function() {
var Se;
return p.__generator(this, function(xe) {
switch (xe.label) {
case 0:
return he.stopPropagation(), [
4,
pe(he)
];
case 1:
return Se = xe.sent(), Se && this.remove(), [2];
}
});
});
};
(0, d.default)(Te).call(Te, ue).on(ee, me), ve && ee === "click" && Te.on("keyup", function(we) {
we.keyCode == 13 && me(we);
});
});
}
});
var U = (0, d.default)(y).call(y, "input[type=text],textarea");
U.length && U.get(0).focus(), b.hideCurAllPanels(), w.setPanel(this), b.createdMenus.add(w);
}
}, b.prototype.remove = function() {
var A = this.menu, w = this.$container;
w && w.remove(), b.createdMenus.delete(A);
}, b.hideCurAllPanels = function() {
var A;
b.createdMenus.size !== 0 && (0, u.default)(A = b.createdMenus).call(A, function(w) {
var m = w.panel;
m && m.remove();
});
}, b.createdMenus = new h.default(), b;
}();
r.default = S;
}, function(i, r) {
var n = {}.toString;
i.exports = function(a) {
return n.call(a).slice(8, -1);
};
}, function(i, r, n) {
var a = n(62), s = Math.min;
i.exports = function(u) {
return u > 0 ? s(a(u), 9007199254740991) : 0;
};
}, function(i, r, n) {
var a = n(9), s = n(8), u = function(h) {
return typeof h == "function" ? h : void 0;
};
i.exports = function(d, h) {
return arguments.length < 2 ? u(a[d]) || u(s[d]) : a[d] && a[d][h] || s[d] && s[d][h];
};
}, function(i, r, n) {
var a = n(81), s = n(18).f, u = n(19), d = n(16), h = n(170), p = n(10), g = p("toStringTag");
i.exports = function(_, S, b, A) {
if (_) {
var w = b ? _ : _.prototype;
d(w, g) || s(w, g, { configurable: !0, value: S }), A && !a && u(w, "toString", h);
}
};
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(95)), h = function(p) {
u.__extends(g, p);
function g(_, S) {
return p.call(this, _, S) || this;
}
return g.prototype.setPanel = function(_) {
this.panel = _;
}, g;
}(d.default);
r.default = h;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4)), d = a(n(57));
(0, s.default)(r, "__esModule", { value: !0 });
var h = n(2), p = h.__importDefault(n(3)), g = function() {
function _(S, b, A) {
this.editor = S, this.$targetElem = b, this.conf = A, this._show = !1, this._isInsertTextContainer = !1;
var w = p.default("<div></div>");
w.addClass("w-e-tooltip"), this.$container = w;
}
return _.prototype.getPositionData = function() {
var S = this.$container, b = 0, A = 0, w = 20, m = document.documentElement.scrollTop, y = this.$targetElem.getBoundingClientRect(), E = this.editor.$textElem.getBoundingClientRect(), x = this.$targetElem.getOffsetData(), k = p.default(x.parent), D = this.editor.$textElem.elems[0].scrollTop;
if (this._isInsertTextContainer = k.equal(this.editor.$textContainerElem), this._isInsertTextContainer) {
var P = k.getBoundingClientRect().height, M = x.top, B = x.left, T = x.height, $ = M - D;
$ > w + 5 ? (b = $ - w - 15, S.addClass("w-e-tooltip-up")) : $ + T + w < P ? (b = $ + T + 10, S.addClass("w-e-tooltip-down")) : (b = ($ > 0 ? $ : 0) + w + 10, S.addClass("w-e-tooltip-down")), B < 0 ? A = 0 : A = B;
} else
y.top < w || y.top - E.top < w ? (b = y.bottom + m + 5, S.addClass("w-e-tooltip-down")) : (b = y.top + m - w - 15, S.addClass("w-e-tooltip-up")), y.left < 0 ? A = 0 : A = y.left;
return { top: b, left: A };
}, _.prototype.appendMenus = function() {
var S = this, b = this.conf, A = this.editor, w = this.$targetElem, m = this.$container;
(0, u.default)(b).call(b, function(y, E) {
var x = y.$elem, k = p.default("<div></div>");
k.addClass("w-e-tooltip-item-wrapper "), k.append(x), m.append(k), x.on("click", function(D) {
D.preventDefault();
var P = y.onClick(A, w);
P && S.remove();
});
});
}, _.prototype.create = function() {
var S, b, A = this.editor, w = this.$container;
this.appendMenus();
var m = this.getPositionData(), y = m.top, E = m.left;
w.css("top", y + "px"), w.css("left", E + "px"), w.css("z-index", A.zIndex.get("tooltip")), this._isInsertTextContainer ? this.editor.$textContainerElem.append(w) : p.default("body").append(w), this._show = !0, A.beforeDestroy((0, d.default)(S = this.remove).call(S, this)), A.txt.eventHooks.onBlurEvents.push((0, d.default)(b = this.remove).call(b, this));
}, _.prototype.remove = function() {
this.$container.remove(), this._show = !1;
}, (0, s.default)(_.prototype, "isShow", {
get: function() {
return this._show;
},
enumerable: !1,
configurable: !0
}), _;
}();
r.default = g;
}, function(i, r, n) {
var a = n(41);
i.exports = function(s, u, d) {
if (a(s), u === void 0)
return s;
switch (d) {
case 0:
return function() {
return s.call(u);
};
case 1:
return function(h) {
return s.call(u, h);
};
case 2:
return function(h, p) {
return s.call(u, h, p);
};
case 3:
return function(h, p, g) {
return s.call(u, h, p, g);
};
}
return function() {
return s.apply(u, arguments);
};
};
}, function(i, r) {
i.exports = function(n) {
if (typeof n != "function")
throw TypeError(String(n) + " is not a function");
return n;
};
}, function(i, r, n) {
var a = n(165), s = n(8), u = n(13), d = n(19), h = n(16), p = n(63), g = n(51), _ = s.WeakMap, S, b, A, w = function(M) {
return A(M) ? b(M) : S(M, {});
}, m = function(M) {
return function(B) {
var T;
if (!u(B) || (T = b(B)).type !== M)
throw TypeError("Incompatible receiver, " + M + " required");
return T;
};
};
if (a) {
var y = new _(), E = y.get, x = y.has, k = y.set;
S = function(M, B) {
return k.call(y, M, B), B;
}, b = function(M) {
return E.call(y, M) || {};
}, A = function(M) {
return x.call(y, M);
};
} else {
var D = p("state");
g[D] = !0, S = function(M, B) {
return d(M, D, B), B;
}, b = function(M) {
return h(M, D) ? M[D] : {};
}, A = function(M) {
return h(M, D);
};
}
i.exports = { set: S, get: b, has: A, enforce: w, getterFor: m };
}, function(i, r) {
i.exports = !0;
}, function(i, r) {
i.exports = {};
}, function(i, r, n) {
i.exports = n(261);
}, function(i, r, n) {
i.exports = n(265);
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 }), r.createElementFragment = r.createDocumentFragment = r.createElement = r.insertBefore = r.getEndPoint = r.getStartPoint = r.updateRange = r.filterSelectionNodes = void 0;
var d = n(2), h = n(137), p = d.__importDefault(n(3));
function g(E) {
var x = [];
return (0, u.default)(E).call(E, function(k) {
var D = k.getNodeName();
if (D !== h.ListType.OrderedList && D !== h.ListType.UnorderedList)
x.push(k);
else if (k.prior)
x.push(k.prior);
else {
var P = k.children();
P == null || (0, u.default)(P).call(P, function(M) {
x.push(p.default(M));
});
}
}), x;
}
r.filterSelectionNodes = g;
function _(E, x, k) {
var D = E.selection, P = document.createRange();
x.length > 1 ? (P.setStart(x.elems[0], 0), P.setEnd(x.elems[x.length - 1], x.elems[x.length - 1].childNodes.length)) : P.selectNodeContents(x.elems[0]), k && P.collapse(!1), D.saveRange(P), D.restoreSelection();
}
r.updateRange = _;
function S(E) {
var x;
return E.prior ? E.prior : p.default((x = E.children()) === null || x === void 0 ? void 0 : x.elems[0]);
}
r.getStartPoint = S;
function b(E) {
var x;
return E.prior ? E.prior : p.default((x = E.children()) === null || x === void 0 ? void 0 : x.last().elems[0]);
}
r.getEndPoint = b;
function A(E, x, k) {
k === void 0 && (k = null), E.parent().elems[0].insertBefore(x, k);
}
r.insertBefore = A;
function w(E) {
return document.createElement(E);
}
r.createElement = w;
function m() {
return document.createDocumentFragment();
}
r.createDocumentFragment = m;
function y(E, x, k) {
return k === void 0 && (k = "li"), (0, u.default)(E).call(E, function(D) {
var P = w(k);
P.innerHTML = D.html(), x.appendChild(P), D.remove();
}), x;
}
r.createElementFragment = y;
}, function(i, r) {
i.exports = function(n, a) {
return { enumerable: !(n & 1), configurable: !(n & 2), writable: !(n & 4), value: a };
};
}, function(i, r) {
i.exports = function(n) {
if (n == null)
throw TypeError("Can't call method on " + n);
return n;
};
}, function(i, r, n) {
var a = n(164).charAt, s = n(42), u = n(75), d = "String Iterator", h = s.set, p = s.getterFor(d);
u(String, "String", function(g) {
h(this, { type: d, string: String(g), index: 0 });
}, function() {
var _ = p(this), S = _.string, b = _.index, A;
return b >= S.length ? { value: void 0, done: !0 } : (A = a(S, b), _.index += A.length, { value: A, done: !1 });
});
}, function(i, r) {
i.exports = {};
}, function(i, r, n) {
var a = n(107), s = n(80);
i.exports = Object.keys || function(d) {
return a(d, s);
};
}, function(i, r, n) {
var a = n(19);
i.exports = function(s, u, d, h) {
h && h.enumerable ? s[u] = d : a(s, u, d);
};
}, function(i, r, n) {
n(173);
var a = n(174), s = n(8), u = n(65), d = n(19), h = n(44), p = n(10), g = p("toStringTag");
for (var _ in a) {
var S = s[_], b = S && S.prototype;
b && u(b) !== g && d(b, g, _), h[_] = h.Array;
}
}, function(i, r, n) {
var a = n(34);
i.exports = Array.isArray || function(u) {
return a(u) == "Array";
};
}, function(i, r, n) {
var a = n(11), s = n(10), u = n(86), d = s("species");
i.exports = function(h) {
return u >= 51 || !a(function() {
var p = [], g = p.constructor = {};
return g[d] = function() {
return { foo: 1 };
}, p[h](Boolean).foo !== 1;
});
};
}, function(i, r, n) {
i.exports = n(222);
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 }), r.ListHandle = void 0;
var u = n(2), d = u.__importDefault(n(373)), h = function() {
function p(g) {
this.options = g, this.selectionRangeElem = new d.default();
}
return p;
}();
r.ListHandle = h;
}, function(i, r, n) {
var a = {}.propertyIsEnumerable, s = Object.getOwnPropertyDescriptor, u = s && !a.call({ 1: 2 }, 1);
r.f = u ? function(h) {
var p = s(this, h);
return !!p && p.enumerable;
} : a;
}, function(i, r, n) {
var a = n(13);
i.exports = function(s, u) {
if (!a(s))
return s;
var d, h;
if (u && typeof (d = s.toString) == "function" && !a(h = d.call(s)) || typeof (d = s.valueOf) == "function" && !a(h = d.call(s)) || !u && typeof (d = s.toString) == "function" && !a(h = d.call(s)))
return h;
throw TypeError("Can't convert object to primitive value");
};
}, function(i, r) {
}, function(i, r) {
var n = Math.ceil, a = Math.floor;
i.exports = function(s) {
return isNaN(s = +s) ? 0 : (s > 0 ? a : n)(s);
};
}, function(i, r, n) {
var a = n(74), s = n(64), u = a("keys");
i.exports = function(d) {
return u[d] || (u[d] = s(d));
};
}, function(i, r) {
var n = 0, a = Math.random();
i.exports = function(s) {
return "Symbol(" + String(s === void 0 ? "" : s) + ")_" + (++n + a).toString(36);
};
}, function(i, r, n) {
var a = n(81), s = n(34), u = n(10), d = u("toStringTag"), h = s(function() {
return arguments;
}()) == "Arguments", p = function(_, S) {
try {
return _[S];
} catch {
}
};
i.exports = a ? s : function(g) {
var _, S, b;
return g === void 0 ? "Undefined" : g === null ? "Null" : typeof (S = p(_ = Object(g), d)) == "string" ? S : h ? s(_) : (b = s(_)) == "Object" && typeof _.callee == "function" ? "Arguments" : b;
};
}, function(i, r, n) {
var a = n(25), s = n(112), u = n(35), d = n(40), h = n(113), p = n(114), g = function(b, A) {
this.stopped = b, this.result = A;
}, _ = i.exports = function(S, b, A, w, m) {
var y = d(b, A, w ? 2 : 1), E, x, k, D, P, M, B;
if (m)
E = S;
else {
if (x = h(S), typeof x != "function")
throw TypeError("Target is not iterable");
if (s(x)) {
for (k = 0, D = u(S.length); D > k; k++)
if (P = w ? y(a(B = S[k])[0], B[1]) : y(S[k]), P && P instanceof g)
return P;
return new g(!1);
}
E = x.call(S);
}
for (M = E.next; !(B = M.call(E)).done; )
if (P = p(E, y, B.value, w), gn(P) == "object" && P && P instanceof g)
return P;
return new g(!1);
};
_.stop = function(S) {
return new g(!0, S);
};
}, function(i, r, n) {
var a = n(11);
i.exports = function(s, u) {
var d = [][s];
return !!d && a(function() {
d.call(null, u || function() {
throw 1;
}, 1);
});
};
}, function(i, r) {
i.exports = `
\v\f\r \xA0\u1680\u2000\u2001\u2002\u2003\u2004\u2005\u2006\u2007\u2008\u2009\u200A\u202F\u205F\u3000\u2028\u2029\uFEFF`;
}, function(i, r, n) {
var a = n(60), s = n(18), u = n(48);
i.exports = function(d, h, p) {
var g = a(h);
g in d ? s.f(d, g, u(0, p)) : d[g] = p;
};
}, function(i, r, n) {
i.exports = n(209);
}, function(i, r, n) {
var a = n(14), s = n(59), u = n(48), d = n(30), h = n(60), p = n(16), g = n(100), _ = Object.getOwnPropertyDescriptor;
r.f = a ? _ : function(b, A) {
if (b = d(b), A = h(A, !0), g)
try {
return _(b, A);
} catch {
}
if (p(b, A))
return u(!s.f.call(b, A), b[A]);
};
}, function(i, r, n) {
var a = n(11), s = n(34), u = "".split;
i.exports = a(function() {
return !Object("z").propertyIsEnumerable(0);
}) ? function(d) {
return s(d) == "String" ? u.call(d, "") : Object(d);
} : Object;
}, function(i, r, n) {
var a = n(8), s = n(13), u = a.document, d = s(u) && s(u.createElement);
i.exports = function(h) {
return d ? u.createElement(h) : {};
};
}, function(i, r, n) {
var a = n(43), s = n(103);
(i.exports = function(u, d) {
return s[u] || (s[u] = d !== void 0 ? d : {});
})("versions", []).push({ version: "3.6.4", mode: a ? "pure" : "global", copyright: "\xA9 2020 Denis Pushkarev (zloirock.ru)" });
}, function(i, r, n) {
var a = n(5), s = n(167), u = n(105), d = n(171), h = n(37), p = n(19), g = n(53), _ = n(10), S = n(43), b = n(44), A = n(104), w = A.IteratorPrototype, m = A.BUGGY_SAFARI_ITERATORS, y = _("iterator"), E = "keys", x = "values", k = "entries", D = function() {
return this;
};
i.exports = function(P, M, B, T, $, V, z) {
s(B, M, T);
var H = function(Te) {
if (Te === $ && q)
return q;
if (!m && Te in F)
return F[Te];
switch (Te) {
case E:
return function() {
return new B(this, Te);
};
case x:
return function() {
return new B(this, Te);
};
case k:
return function() {
return new B(this, Te);
};
}
return function() {
return new B(this);
};
}, I = M + " Iterator", U = !1, F = P.prototype, C = F[y] || F["@@iterator"] || $ && F[$], q = !m && C || H($), X = M == "Array" && F.entries || C, Y, ue, ee;
if (X && (Y = u(X.call(new P())), w !== Object.prototype && Y.next && (!S && u(Y) !== w && (d ? d(Y, w) : typeof Y[y] != "function" && p(Y, y, D)), h(Y, I, !0, !0), S && (b[I] = D))), $ == x && C && C.name !== x && (U = !0, q = function() {
return C.call(this);
}), (!S || z) && F[y] !== q && p(F, y, q), b[M] = q, $)
if (ue = { values: H(x), keys: V ? q : H(E), entries: H(k) }, z)
for (ee in ue)
(m || U || !(ee in F)) && g(F, ee, ue[ee]);
else
a({ target: M, proto: !0, forced: m || U }, ue);
return ue;
};
}, function(i, r, n) {
var a = n(11);
i.exports = !!Object.getOwnPropertySymbols && !a(function() {
return !String(Symbol());
});
}, function(i, r, n) {
var a = n(25), s = n(169), u = n(80), d = n(51), h = n(108), p = n(73), g = n(63), _ = ">", S = "<", b = "prototype", A = "script", w = g("IE_PROTO"), m = function() {
}, y = function(M) {
return S + A + _ + M + S + "/" + A + _;
}, E = function(M) {
M.write(y("")), M.close();
var B = M.parentWindow.Object;
return M = null, B;
}, x = function() {
var M = p("iframe"), B = "java" + A + ":", T;
return M.style.display = "none", h.appendChild(M), M.src = String(B), T = M.contentWindow.document, T.open(), T.write(y("document.F=Object")), T.close(), T.F;
}, k, D = function() {
try {
k = document.domain && new ActiveXObject("htmlfile");
} catch {
}
D = k ? E(k) : x();
for (var M = u.length; M--; )
delete D[b][u[M]];
return D();
};
d[w] = !0, i.exports = Object.create || function(M, B) {
var T;
return M !== null ? (m[b] = a(M), T = new m(), m[b] = null, T[w] = M) : T = D(), B === void 0 ? T : s(T, B);
};
}, function(i, r, n) {
var a = n(30), s = n(35), u = n(79), d = function(p) {
return function(g, _, S) {
var b = a(g), A = s(b.length), w = u(S, A), m;
if (p && _ != _) {
for (; A > w; )
if (m = b[w++], m != m)
return !0;
} else
for (; A > w; w++)
if ((p || w in b) && b[w] === _)
return p || w || 0;
return !p && -1;
};
};
i.exports = {
includes: d(!0),
indexOf: d(!1)
};
}, function(i, r, n) {
var a = n(62), s = Math.max, u = Math.min;
i.exports = function(d, h) {
var p = a(d);
return p < 0 ? s(p + h, 0) : u(p, h);
};
}, function(i, r) {
i.exports = ["constructor", "hasOwnProperty", "isPrototypeOf", "propertyIsEnumerable", "toLocaleString", "toString", "valueOf"];
}, function(i, r, n) {
var a = n(10), s = a("toStringTag"), u = {};
u[s] = "z", i.exports = String(u) === "[object z]";
}, function(i, r) {
i.exports = function() {
};
}, function(i, r) {
i.exports = function(n, a, s) {
if (!(n instanceof a))
throw TypeError("Incorrect " + (s ? s + " " : "") + "invocation");
return n;
};
}, function(i, r, n) {
var a = n(36);
i.exports = a("navigator", "userAgent") || "";
}, function(i, r, n) {
var a = n(41), s = function(d) {
var h, p;
this.promise = new d(function(g, _) {
if (h !== void 0 || p !== void 0)
throw TypeError("Bad Promise constructor");
h = g, p = _;
}), this.resolve = a(h), this.reject = a(p);
};
i.exports.f = function(u) {
return new s(u);
};
}, function(i, r, n) {
var a = n(8), s = n(84), u = a.process, d = u && u.versions, h = d && d.v8, p, g;
h ? (p = h.split("."), g = p[0] + p[1]) : s && (p = s.match(/Edge\/(\d+)/), (!p || p[1] >= 74) && (p = s.match(/Chrome\/(\d+)/), p && (g = p[1]))), i.exports = g && +g;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3)), p = n(6), g = d.__importDefault(n(267)), _ = d.__importDefault(n(280)), S = d.__importDefault(n(281)), b = d.__importDefault(n(282)), A = d.__importDefault(n(301)), w = d.__importStar(n(416)), m = d.__importDefault(n(417)), y = d.__importDefault(n(418)), E = d.__importDefault(n(419)), x = d.__importStar(n(420)), k = d.__importDefault(n(423)), D = d.__importDefault(n(424)), P = d.__importDefault(n(425)), M = d.__importDefault(n(427)), B = d.__importDefault(n(437)), T = d.__importDefault(n(440)), $ = d.__importStar(n(441)), V = d.__importDefault(n(23)), z = d.__importDefault(n(134)), H = d.__importDefault(n(24)), I = d.__importDefault(n(33)), U = d.__importDefault(n(38)), F = d.__importDefault(n(39)), C = 1, q = function() {
function X(Y, ue) {
this.pluginsFunctionList = {}, this.beforeDestroyHooks = [], this.id = "wangEditor-" + C++, this.toolbarSelector = Y, this.textSelector = ue, w.selectorValidator(this), this.config = p.deepClone(g.default), this.$toolbarElem = h.default("<div></div>"), this.$textContainerElem = h.default("<div></div>"), this.$textElem = h.default("<div></div>"), this.toolbarElemId = "", this.textElemId = "", this.isFocus = !1, this.isComposing = !1, this.isCompatibleMode = !1, this.selection = new _.default(this), this.cmd = new S.default(this), this.txt = new b.default(this), this.menus = new A.default(this), this.zIndex = new D.default(), this.change = new P.default(this), this.history = new M.default(this), this.onSelectionChange = new T.default(this);
var ee = B.default(this), pe = ee.disable, Te = ee.enable;
this.disable = pe, this.enable = Te, this.isEnable = !0;
}
return X.prototype.initSelection = function(Y) {
m.default(this, Y);
}, X.prototype.create = function() {
this.zIndex.init(this), this.isCompatibleMode = this.config.compatibleMode(), this.isCompatibleMode || (this.config.onchangeTimeout = 30), E.default(this), w.default(this), this.txt.init(), this.menus.init(), x.default(this), this.initSelection(!0), y.default(this), this.change.observe(), this.history.observe(), $.default(this);
}, X.prototype.beforeDestroy = function(Y) {
return this.beforeDestroyHooks.push(Y), this;
}, X.prototype.destroy = function() {
var Y, ue = this;
(0, u.default)(Y = this.beforeDestroyHooks).call(Y, function(ee) {
return ee.call(ue);
}), this.$toolbarElem.remove(), this.$textContainerElem.remove();
}, X.prototype.fullScreen = function() {
x.setFullScreen(this);
}, X.prototype.unFullScreen = function() {
x.setUnFullScreen(this);
}, X.prototype.scrollToHead = function(Y) {
k.default(this, Y);
}, X.registerMenu = function(Y, ue) {
!ue || typeof ue != "function" || (X.globalCustomMenuConstructorList[Y] = ue);
}, X.prototype.registerPlugin = function(Y, ue) {
$.registerPlugin(Y, ue, this.pluginsFunctionList);
}, X.registerPlugin = function(Y, ue) {
$.registerPlugin(Y, ue, X.globalPluginsFunctionList);
}, X.$ = h.default, X.BtnMenu = V.default, X.DropList = z.default, X.DropListMenu = H.default, X.Panel = I.default, X.PanelMenu = U.default, X.Tooltip = F.default, X.globalCustomMenuConstructorList = {}, X.globalPluginsFunctionList = {}, X;
}();
r.default = q;
}, function(i, r, n) {
var a = n(13), s = n(55), u = n(10), d = u("species");
i.exports = function(h, p) {
var g;
return s(h) && (g = h.constructor, typeof g == "function" && (g === Array || s(g.prototype)) ? g = void 0 : a(g) && (g = g[d], g === null && (g = void 0))), new (g === void 0 ? Array : g)(p === 0 ? 0 : p);
};
}, function(i, r, n) {
i.exports = n(185);
}, function(i, r, n) {
var a = n(49), s = n(68), u = "[" + s + "]", d = RegExp("^" + u + u + "*"), h = RegExp(u + u + "*$"), p = function(_) {
return function(S) {
var b = String(a(S));
return _ & 1 && (b = b.replace(d, "")), _ & 2 && (b = b.replace(h, "")), b;
};
};
i.exports = {
start: p(1),
end: p(2),
trim: p(3)
};
}, function(i, r, n) {
i.exports = n(205);
}, function(i, r, n) {
var a = n(227), s = n(230);
function u(d) {
return typeof s == "function" && typeof a == "symbol" ? i.exports = u = function(p) {
return typeof p;
} : i.exports = u = function(p) {
return p && typeof s == "function" && p.constructor === s && p !== s.prototype ? "symbol" : typeof p;
}, u(d);
}
i.exports = u;
}, function(i, r, n) {
var a = n(10);
r.f = a;
}, function(i, r, n) {
i.exports = n(306);
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(33)), p = function() {
function g(_, S) {
var b = this;
this.$elem = _, this.editor = S, this._active = !1, _.on("click", function(A) {
var w;
h.default.hideCurAllPanels(), (0, u.default)(w = S.txt.eventHooks.menuClickEvents).call(w, function(m) {
return m();
}), A.stopPropagation(), S.selection.getRange() != null && b.clickHandler(A);
});
}
return g.prototype.clickHandler = function(_) {
}, g.prototype.active = function() {
this._active = !0, this.$elem.addClass("w-e-active");
}, g.prototype.unActive = function() {
this._active = !1, this.$elem.removeClass("w-e-active");
}, (0, s.default)(g.prototype, "isActive", {
get: function() {
return this._active;
},
enumerable: !1,
configurable: !0
}), g;
}();
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(28));
(0, s.default)(r, "__esModule", { value: !0 }), r.getParentNodeA = r.EXTRA_TAG = void 0, r.EXTRA_TAG = ["B", "FONT", "I", "STRIKE"];
function d(p) {
for (var g = p.elems[0]; g && (0, u.default)(_ = r.EXTRA_TAG).call(_, g.nodeName); ) {
var _;
if (g = g.parentElement, g.nodeName === "A")
return g;
}
}
r.getParentNodeA = d;
function h(p) {
var g, _ = p.selection.getSelectionContainerElem();
if (!(!((g = _ == null ? void 0 : _.elems) === null || g === void 0) && g.length))
return !1;
if (_.getNodeName() === "A")
return !0;
var S = d(_);
return !!(S && S.nodeName === "A");
}
r.default = h;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(57)), d = a(n(4)), h = a(n(27));
(0, s.default)(r, "__esModule", { value: !0 });
var p = n(2), g = n(6), _ = p.__importDefault(n(135)), S = p.__importDefault(n(136)), b = function() {
function A(w) {
this.editor = w;
}
return A.prototype.insertImg = function(w, m, y) {
var E = this.editor, x = E.config, k = "validate.", D = function(V, z) {
return z === void 0 && (z = k), E.i18next.t(z + V);
}, P = w.replace(/</g, "&lt;").replace(/>/g, "&gt;");
P = P.replace("'", '"');
var M = "";
y && (M = y.replace("'", '"'), M = "data-href='" + encodeURIComponent(M) + "' ");
var B = "";
m && (B = m.replace(/</g, "&lt;").replace(/>/g, "&gt;"), B = B.replace("'", '"'), B = "alt='" + B + "' "), E.cmd.do("insertHTML", "<img src='" + P + "' " + B + M + 'style="max-width:100%;" contenteditable="false"/>'), x.linkImgCallback(w, m, y);
var T = document.createElement("img");
T.onload = function() {
T = null;
}, T.onerror = function() {
x.customAlert(D("\u63D2\u5165\u56FE\u7247\u9519\u8BEF"), "error", "wangEditor: " + D("\u63D2\u5165\u56FE\u7247\u9519\u8BEF") + "\uFF0C" + D("\u56FE\u7247\u94FE\u63A5") + ' "' + w + '"\uFF0C' + D("\u4E0B\u8F7D\u94FE\u63A5\u5931\u8D25")), T = null;
}, T.onabort = function() {
return T = null;
}, T.src = w;
}, A.prototype.uploadImg = function(w) {
var m = this;
if (!!w.length) {
var y = this.editor, E = y.config, x = "validate.", k = function(me) {
return y.i18next.t(x + me);
}, D = E.uploadImgServer, P = E.uploadImgShowBase64, M = E.uploadImgMaxSize, B = M / 1024 / 1024, T = E.uploadImgMaxLength, $ = E.uploadFileName, V = E.uploadImgParams, z = E.uploadImgParamsWithUrl, H = E.uploadImgHeaders, I = E.uploadImgHooks, U = E.uploadImgTimeout, F = E.withCredentials, C = E.customUploadImg;
if (!(!C && !D && !P)) {
var q = [], X = [];
if (g.arrForEach(w, function(ve) {
if (!!ve) {
var me = ve.name || ve.type.replace("/", "."), we = ve.size;
if (!(!me || !we)) {
var he = y.config.uploadImgAccept.join("|"), Se = ".(" + he + ")$", xe = new RegExp(Se, "i");
if (xe.test(me) === !1) {
X.push("\u3010" + me + "\u3011" + k("\u4E0D\u662F\u56FE\u7247"));
return;
}
if (M < we) {
X.push("\u3010" + me + "\u3011" + k("\u5927\u4E8E") + " " + B + "M");
return;
}
q.push(ve);
}
}
}), X.length) {
E.customAlert(k("\u56FE\u7247\u9A8C\u8BC1\u672A\u901A\u8FC7") + `:
` + X.join(`
`), "warning");
return;
}
if (q.length === 0) {
E.customAlert(k("\u4F20\u5165\u7684\u6587\u4EF6\u4E0D\u5408\u6CD5"), "warning");
return;
}
if (q.length > T) {
E.customAlert(k("\u4E00\u6B21\u6700\u591A\u4E0A\u4F20") + T + k("\u5F20\u56FE\u7247"), "warning");
return;
}
if (C && typeof C == "function") {
var Y;
C(q, (0, u.default)(Y = this.insertImg).call(Y, this));
return;
}
var ue = new FormData();
if ((0, d.default)(q).call(q, function(ve, me) {
var we = $ || ve.name;
q.length > 1 && (we = we + (me + 1)), ue.append(we, ve);
}), D) {
var ee = D.split("#");
D = ee[0];
var pe = ee[1] || "";
(0, d.default)(g).call(g, V, function(ve, me) {
z && ((0, h.default)(D).call(D, "?") > 0 ? D += "&" : D += "?", D = D + ve + "=" + me), ue.append(ve, me);
}), pe && (D += "#" + pe);
var Te = _.default(D, { timeout: U, formData: ue, headers: H, withCredentials: !!F, beforeSend: function(me) {
if (I.before)
return I.before(me, y, q);
}, onTimeout: function(me) {
E.customAlert(k("\u4E0A\u4F20\u56FE\u7247\u8D85\u65F6"), "error"), I.timeout && I.timeout(me, y);
}, onProgress: function(me, we) {
var he = new S.default(y);
we.lengthComputable && (me = we.loaded / we.total, he.show(me));
}, onError: function(me) {
E.customAlert(k("\u4E0A\u4F20\u56FE\u7247\u9519\u8BEF"), "error", k("\u4E0A\u4F20\u56FE\u7247\u9519\u8BEF") + "\uFF0C" + k("\u670D\u52A1\u5668\u8FD4\u56DE\u72B6\u6001") + ": " + me.status), I.error && I.error(me, y);
}, onFail: function(me, we) {
E.customAlert(k("\u4E0A\u4F20\u56FE\u7247\u5931\u8D25"), "error", k("\u4E0A\u4F20\u56FE\u7247\u8FD4\u56DE\u7ED3\u679C\u9519\u8BEF") + ("\uFF0C" + k("\u8FD4\u56DE\u7ED3\u679C") + ": ") + we), I.fail && I.fail(me, y, we);
}, onSuccess: function(me, we) {
if (I.customInsert) {
var he;
I.customInsert((0, u.default)(he = m.insertImg).call(he, m), we, y);
return;
}
if (we.errno != "0") {
E.customAlert(k("\u4E0A\u4F20\u56FE\u7247\u5931\u8D25"), "error", k("\u4E0A\u4F20\u56FE\u7247\u8FD4\u56DE\u7ED3\u679C\u9519\u8BEF") + "\uFF0C" + k("\u8FD4\u56DE\u7ED3\u679C") + " errno=" + we.errno), I.fail && I.fail(me, y, we);
return;
}
var Se = we.data;
(0, d.default)(Se).call(Se, function(xe) {
typeof xe == "string" ? m.insertImg(xe) : m.insertImg(xe.url, xe.alt, xe.href);
}), I.success && I.success(me, y, we);
} });
typeof Te == "string" && E.customAlert(Te, "error");
return;
}
P && g.arrForEach(w, function(ve) {
var me = m, we = new FileReader();
we.readAsDataURL(ve), we.onload = function() {
if (!!this.result) {
var he = this.result.toString();
me.insertImg(he, he);
}
};
});
}
}
}, A;
}();
r.default = b;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(410)), d = a(n(4)), h = a(n(45));
(0, s.default)(r, "__esModule", { value: !0 }), r.dealTextNode = r.isAllTodo = r.isTodo = r.getCursorNextNode = void 0;
function p(A) {
return A.length ? A.attr("class") === "w-e-todo" : !1;
}
r.isTodo = p;
function g(A) {
var w = A.selection.getSelectionRangeTopNodes();
if (w.length !== 0)
return (0, u.default)(w).call(w, function(m) {
return p(m);
});
}
r.isAllTodo = g;
function _(A, w, m) {
var y;
if (!!A.hasChildNodes()) {
var E = A.cloneNode(), x = !1;
w.nodeValue === "" && (x = !0);
var k = [];
return (0, d.default)(y = A.childNodes).call(y, function(D) {
if (!S(D, w) && x && (E.appendChild(D.cloneNode(!0)), D.nodeName !== "BR" && k.push(D)), S(D, w)) {
if (D.nodeType === 1) {
var P = _(D, w, m);
P && P.textContent !== "" && (E == null || E.appendChild(P));
}
if (D.nodeType === 3 && w.isEqualNode(D)) {
var M = b(D, m);
E.textContent = M;
}
x = !0;
}
}), (0, d.default)(k).call(k, function(D) {
var P = D;
P.remove();
}), E;
}
}
r.getCursorNextNode = _;
function S(A, w) {
return A.nodeType === 3 ? A.nodeValue === w.nodeValue : A.contains(w);
}
function b(A, w, m) {
m === void 0 && (m = !0);
var y = A.nodeValue, E = y == null ? void 0 : (0, h.default)(y).call(y, 0, w);
if (y = y == null ? void 0 : (0, h.default)(y).call(y, w), !m) {
var x = y;
y = E, E = x;
}
return A.nodeValue = E, y;
}
r.dealTextNode = b;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(430), d = function() {
function h(p) {
this.maxSize = p, this.isRe = !1, this.data = new u.CeilStack(p), this.revokeData = new u.CeilStack(p);
}
return (0, s.default)(h.prototype, "size", {
get: function() {
return [this.data.size, this.revokeData.size];
},
enumerable: !1,
configurable: !0
}), h.prototype.resetMaxSize = function(p) {
this.data.resetMax(p), this.revokeData.resetMax(p);
}, h.prototype.save = function(p) {
return this.isRe && (this.revokeData.clear(), this.isRe = !1), this.data.instack(p), this;
}, h.prototype.revoke = function(p) {
!this.isRe && (this.isRe = !0);
var g = this.data.outstack();
return g ? (this.revokeData.instack(g), p(g), !0) : !1;
}, h.prototype.restore = function(p) {
!this.isRe && (this.isRe = !0);
var g = this.revokeData.outstack();
return g ? (this.data.instack(g), p(g), !0) : !1;
}, h;
}();
r.default = d;
}, function(i, r, n) {
var a = n(14), s = n(11), u = n(73);
i.exports = !a && !s(function() {
return Object.defineProperty(u("div"), "a", { get: function() {
return 7;
} }).a != 7;
});
}, function(i, r, n) {
var a = n(11), s = /#|\.prototype\./, u = function(S, b) {
var A = h[d(S)];
return A == g ? !0 : A == p ? !1 : typeof b == "function" ? a(b) : !!b;
}, d = u.normalize = function(_) {
return String(_).replace(s, ".").toLowerCase();
}, h = u.data = {}, p = u.NATIVE = "N", g = u.POLYFILL = "P";
i.exports = u;
}, function(i, r, n) {
var a = n(103), s = Function.toString;
typeof a.inspectSource != "function" && (a.inspectSource = function(u) {
return s.call(u);
}), i.exports = a.inspectSource;
}, function(i, r, n) {
var a = n(8), s = n(166), u = "__core-js_shared__", d = a[u] || s(u, {});
i.exports = d;
}, function(i, r, n) {
var a = n(105), s = n(19), u = n(16), d = n(10), h = n(43), p = d("iterator"), g = !1, _ = function() {
return this;
}, S, b, A;
[].keys && (A = [].keys(), "next" in A ? (b = a(a(A)), b !== Object.prototype && (S = b)) : g = !0), S == null && (S = {}), !h && !u(S, p) && s(S, p, _), i.exports = { IteratorPrototype: S, BUGGY_SAFARI_ITERATORS: g };
}, function(i, r, n) {
var a = n(16), s = n(31), u = n(63), d = n(168), h = u("IE_PROTO"), p = Object.prototype;
i.exports = d ? Object.getPrototypeOf : function(g) {
return g = s(g), a(g, h) ? g[h] : typeof g.constructor == "function" && g instanceof g.constructor ? g.constructor.prototype : g instanceof Object ? p : null;
};
}, function(i, r, n) {
var a = n(76);
i.exports = a && !Symbol.sham && gn(Symbol.iterator) == "symbol";
}, function(i, r, n) {
var a = n(16), s = n(30), u = n(78).indexOf, d = n(51);
i.exports = function(h, p) {
var g = s(h), _ = 0, S = [], b;
for (b in g)
!a(d, b) && a(g, b) && S.push(b);
for (; p.length > _; )
a(g, b = p[_++]) && (~u(S, b) || S.push(b));
return S;
};
}, function(i, r, n) {
var a = n(36);
i.exports = a("document", "documentElement");
}, function(i, r, n) {
var a = n(8);
i.exports = a.Promise;
}, function(i, r, n) {
var a = n(53);
i.exports = function(s, u, d) {
for (var h in u)
d && d.unsafe && s[h] ? s[h] = u[h] : a(s, h, u[h], d);
return s;
};
}, function(i, r, n) {
var a = n(36), s = n(18), u = n(10), d = n(14), h = u("species");
i.exports = function(p) {
var g = a(p), _ = s.f;
d && g && !g[h] && _(g, h, { configurable: !0, get: function() {
return this;
} });
};
}, function(i, r, n) {
var a = n(10), s = n(44), u = a("iterator"), d = Array.prototype;
i.exports = function(h) {
return h !== void 0 && (s.Array === h || d[u] === h);
};
}, function(i, r, n) {
var a = n(65), s = n(44), u = n(10), d = u("iterator");
i.exports = function(h) {
if (h != null)
return h[d] || h["@@iterator"] || s[a(h)];
};
}, function(i, r, n) {
var a = n(25);
i.exports = function(s, u, d, h) {
try {
return h ? u(a(d)[0], d[1]) : u(d);
} catch (g) {
var p = s.return;
throw p !== void 0 && a(p.call(s)), g;
}
};
}, function(i, r, n) {
var a = n(10), s = a("iterator"), u = !1;
try {
var d = 0, h = { next: function() {
return { done: !!d++ };
}, return: function() {
u = !0;
} };
h[s] = function() {
return this;
}, Array.from(h, function() {
throw 2;
});
} catch {
}
i.exports = function(p, g) {
if (!g && !u)
return !1;
var _ = !1;
try {
var S = {};
S[s] = function() {
return { next: function() {
return { done: _ = !0 };
} };
}, p(S);
} catch {
}
return _;
};
}, function(i, r, n) {
var a = n(25), s = n(41), u = n(10), d = u("species");
i.exports = function(h, p) {
var g = a(h).constructor, _;
return g === void 0 || (_ = a(g)[d]) == null ? p : s(_);
};
}, function(i, r, n) {
var a = n(8), s = n(11), u = n(34), d = n(40), h = n(108), p = n(73), g = n(118), _ = a.location, S = a.setImmediate, b = a.clearImmediate, A = a.process, w = a.MessageChannel, m = a.Dispatch, y = 0, E = {}, x = "onreadystatechange", k, D, P, M = function(z) {
if (E.hasOwnProperty(z)) {
var H = E[z];
delete E[z], H();
}
}, B = function(z) {
return function() {
M(z);
};
}, T = function(z) {
M(z.data);
}, $ = function(z) {
a.postMessage(z + "", _.protocol + "//" + _.host);
};
(!S || !b) && (S = function(z) {
for (var H = [], I = 1; arguments.length > I; )
H.push(arguments[I++]);
return E[++y] = function() {
(typeof z == "function" ? z : Function(z)).apply(void 0, H);
}, k(y), y;
}, b = function(z) {
delete E[z];
}, u(A) == "process" ? k = function(z) {
A.nextTick(B(z));
} : m && m.now ? k = function(z) {
m.now(B(z));
} : w && !g ? (D = new w(), P = D.port2, D.port1.onmessage = T, k = d(P.postMessage, P, 1)) : a.addEventListener && typeof postMessage == "function" && !a.importScripts && !s($) && _.protocol !== "file:" ? (k = $, a.addEventListener("message", T, !1)) : x in p("script") ? k = function(z) {
h.appendChild(p("script"))[x] = function() {
h.removeChild(this), M(z);
};
} : k = function(z) {
setTimeout(B(z), 0);
}), i.exports = { set: S, clear: b };
}, function(i, r, n) {
var a = n(84);
i.exports = /(iphone|ipod|ipad).*applewebkit/i.test(a);
}, function(i, r, n) {
var a = n(25), s = n(13), u = n(85);
i.exports = function(d, h) {
if (a(d), s(h) && h.constructor === d)
return h;
var p = u.f(d), g = p.resolve;
return g(h), p.promise;
};
}, function(i, r) {
i.exports = function(n) {
try {
return { error: !1, value: n() };
} catch (a) {
return { error: !0, value: a };
}
};
}, function(i, r, n) {
i.exports = n(197);
}, function(i, r, n) {
var a = n(5), s = n(8), u = n(123), d = n(11), h = n(19), p = n(66), g = n(83), _ = n(13), S = n(37), b = n(18).f, A = n(32).forEach, w = n(14), m = n(42), y = m.set, E = m.getterFor;
i.exports = function(x, k, D) {
var P = x.indexOf("Map") !== -1, M = x.indexOf("Weak") !== -1, B = P ? "set" : "add", T = s[x], $ = T && T.prototype, V = {}, z;
if (!w || typeof T != "function" || !(M || $.forEach && !d(function() {
new T().entries().next();
})))
z = D.getConstructor(k, x, P, B), u.REQUIRED = !0;
else {
z = k(function(I, U) {
y(g(I, z, x), { type: x, collection: new T() }), U != null && p(U, I[B], I, P);
});
var H = E(x);
A(["add", "clear", "delete", "forEach", "get", "has", "set", "keys", "values", "entries"], function(I) {
var U = I == "add" || I == "set";
I in $ && !(M && I == "clear") && h(z.prototype, I, function(F, C) {
var q = H(this).collection;
if (!U && M && !_(F))
return I == "get" ? void 0 : !1;
var X = q[I](F === 0 ? 0 : F, C);
return U ? this : X;
});
}), M || b(z.prototype, "size", { configurable: !0, get: function() {
return H(this).collection.size;
} });
}
return S(z, x, !1, !0), V[x] = z, a({ global: !0, forced: !0 }, V), M || D.setStrong(z, x, P), z;
};
}, function(i, r, n) {
var a = n(51), s = n(13), u = n(16), d = n(18).f, h = n(64), p = n(200), g = h("meta"), _ = 0, S = Object.isExtensible || function() {
return !0;
}, b = function(x) {
d(x, g, { value: {
objectID: "O" + ++_,
weakData: {}
} });
}, A = function(x, k) {
if (!s(x))
return gn(x) == "symbol" ? x : (typeof x == "string" ? "S" : "P") + x;
if (!u(x, g)) {
if (!S(x))
return "F";
if (!k)
return "E";
b(x);
}
return x[g].objectID;
}, w = function(x, k) {
if (!u(x, g)) {
if (!S(x))
return !0;
if (!k)
return !1;
b(x);
}
return x[g].weakData;
}, m = function(x) {
return p && y.REQUIRED && S(x) && !u(x, g) && b(x), x;
}, y = i.exports = { REQUIRED: !1, fastKey: A, getWeakData: w, onFreeze: m };
a[g] = !0;
}, function(i, r, n) {
var a = n(18).f, s = n(77), u = n(110), d = n(40), h = n(83), p = n(66), g = n(75), _ = n(111), S = n(14), b = n(123).fastKey, A = n(42), w = A.set, m = A.getterFor;
i.exports = { getConstructor: function(E, x, k, D) {
var P = E(function($, V) {
h($, P, x), w($, { type: x, index: s(null), first: void 0, last: void 0, size: 0 }), S || ($.size = 0), V != null && p(V, $[D], $, k);
}), M = m(x), B = function(V, z, H) {
var I = M(V), U = T(V, z), F, C;
return U ? U.value = H : (I.last = U = { index: C = b(z, !0), key: z, value: H, previous: F = I.last, next: void 0, removed: !1 }, I.first || (I.first = U), F && (F.next = U), S ? I.size++ : V.size++, C !== "F" && (I.index[C] = U)), V;
}, T = function(V, z) {
var H = M(V), I = b(z), U;
if (I !== "F")
return H.index[I];
for (U = H.first; U; U = U.next)
if (U.key == z)
return U;
};
return u(P.prototype, {
clear: function() {
for (var V = this, z = M(V), H = z.index, I = z.first; I; )
I.removed = !0, I.previous && (I.previous = I.previous.next = void 0), delete H[I.index], I = I.next;
z.first = z.last = void 0, S ? z.size = 0 : V.size = 0;
},
delete: function(V) {
var z = this, H = M(z), I = T(z, V);
if (I) {
var U = I.next, F = I.previous;
delete H.index[I.index], I.removed = !0, F && (F.next = U), U && (U.previous = F), H.first == I && (H.first = U), H.last == I && (H.last = F), S ? H.size-- : z.size--;
}
return !!I;
},
forEach: function(V) {
for (var z = M(this), H = d(V, arguments.length > 1 ? arguments[1] : void 0, 3), I; I = I ? I.next : z.first; )
for (H(I.value, I.key, this); I && I.removed; )
I = I.previous;
},
has: function(V) {
return !!T(this, V);
}
}), u(P.prototype, k ? {
get: function(V) {
var z = T(this, V);
return z && z.value;
},
set: function(V, z) {
return B(this, V === 0 ? 0 : V, z);
}
} : {
add: function(V) {
return B(this, V = V === 0 ? 0 : V, V);
}
}), S && a(P.prototype, "size", { get: function() {
return M(this).size;
} }), P;
}, setStrong: function(E, x, k) {
var D = x + " Iterator", P = m(x), M = m(D);
g(E, x, function(B, T) {
w(this, { type: D, target: B, state: P(B), kind: T, last: void 0 });
}, function() {
for (var B = M(this), T = B.kind, $ = B.last; $ && $.removed; )
$ = $.previous;
return !B.target || !(B.last = $ = $ ? $.next : B.state.first) ? (B.target = void 0, { value: void 0, done: !0 }) : T == "keys" ? { value: $.key, done: !1 } : T == "values" ? { value: $.value, done: !1 } : { value: [$.key, $.value], done: !1 };
}, k ? "entries" : "values", !k, !0), _(x);
} };
}, function(i, r, n) {
var a = n(12);
a("iterator");
}, function(i, r, n) {
var a = n(107), s = n(80), u = s.concat("length", "prototype");
r.f = Object.getOwnPropertyNames || function(h) {
return a(h, u);
};
}, function(i, r) {
r.f = Object.getOwnPropertySymbols;
}, function(i, r, n) {
i.exports = n(268);
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 }), r.default = { zIndex: 1e4 };
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 }), r.default = { focus: !0, height: 300, placeholder: "\u8BF7\u8F93\u5165\u6B63\u6587", zIndexFullScreen: 10002, showFullScreen: !0 };
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 }), r.getPasteImgs = r.getPasteHtml = r.getPasteText = void 0;
var d = n(2), h = n(6), p = d.__importDefault(n(292));
function g(b) {
var A = b.clipboardData, w = "";
return A == null ? w = window.clipboardData && window.clipboardData.getData("text") : w = A.getData("text/plain"), h.replaceHtmlSymbol(w);
}
r.getPasteText = g;
function _(b, A, w) {
A === void 0 && (A = !0), w === void 0 && (w = !1);
var m = b.clipboardData, y = "";
if (m && (y = m.getData("text/html")), !y) {
var E = g(b);
if (!E)
return "";
y = "<p>" + E + "</p>";
}
return y = y.replace(/<(\d)/gm, function(x, k) {
return "&lt;" + k;
}), y = y.replace(/<(\/?meta.*?)>/gim, ""), y = p.default(y, A, w), y;
}
r.getPasteHtml = _;
function S(b) {
var A, w = [], m = g(b);
if (m)
return w;
var y = (A = b.clipboardData) === null || A === void 0 ? void 0 : A.items;
return y && (0, u.default)(h).call(h, y, function(E, x) {
var k = x.type;
/image/i.test(k) && w.push(x.getAsFile());
}), w;
}
r.getPasteImgs = S;
}, function(i, r, n) {
i.exports = n(294);
}, function(i, r, n) {
i.exports = n(310);
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4)), d = a(n(46));
(0, s.default)(r, "__esModule", { value: !0 });
var h = n(2), p = h.__importDefault(n(3)), g = n(7), _ = function() {
function S(b, A) {
var w = this;
this.hideTimeoutId = 0, this.menu = b, this.conf = A;
var m = p.default('<div class="w-e-droplist"></div>'), y = p.default("<p>" + A.title + "</p>");
y.addClass("w-e-dp-title"), m.append(y);
var E = A.list || [], x = A.type || "list", k = A.clickHandler || g.EMPTY_FN, D = p.default('<ul class="' + (x === "list" ? "w-e-list" : "w-e-block") + '"></ul>');
(0, u.default)(E).call(E, function(P) {
var M = P.$elem, B = P.value, T = p.default('<li class="w-e-item"></li>');
M && (T.append(M), D.append(T), T.on("click", function($) {
k(B), $.stopPropagation(), w.hideTimeoutId = (0, d.default)(function() {
w.hide();
});
}));
}), m.append(D), m.on("mouseleave", function() {
w.hideTimeoutId = (0, d.default)(function() {
w.hide();
});
}), this.$container = m, this.rendered = !1, this._show = !1;
}
return S.prototype.show = function() {
this.hideTimeoutId && clearTimeout(this.hideTimeoutId);
var b = this.menu, A = b.$elem, w = this.$container;
if (!this._show) {
if (this.rendered)
w.show();
else {
var m = A.getBoundingClientRect().height || 0, y = this.conf.width || 100;
w.css("margin-top", m + "px").css("width", y + "px"), A.append(w), this.rendered = !0;
}
this._show = !0;
}
}, S.prototype.hide = function() {
var b = this.$container;
!this._show || (b.hide(), this._show = !1);
}, (0, s.default)(S.prototype, "isShow", { get: function() {
return this._show;
}, enumerable: !1, configurable: !0 }), S;
}();
r.default = _;
}, function(i, r, n) {
var a = n(0), s = a(n(92)), u = a(n(1)), d = a(n(4));
(0, u.default)(r, "__esModule", { value: !0 });
var h = n(6);
function p(g, _) {
var S = new XMLHttpRequest();
if (S.open("POST", g), S.timeout = _.timeout || 10 * 1e3, S.ontimeout = function() {
console.error("wangEditor - \u8BF7\u6C42\u8D85\u65F6"), _.onTimeout && _.onTimeout(S);
}, S.upload && (S.upload.onprogress = function(A) {
var w = A.loaded / A.total;
_.onProgress && _.onProgress(w, A);
}), _.headers && (0, d.default)(h).call(h, _.headers, function(A, w) {
S.setRequestHeader(A, w);
}), S.withCredentials = !!_.withCredentials, _.beforeSend) {
var b = _.beforeSend(S);
if (b && (0, s.default)(b) === "object" && b.prevent)
return b.msg;
}
return S.onreadystatechange = function() {
if (S.readyState === 4) {
var A = S.status;
if (!(A < 200) && !(A >= 300 && A < 400)) {
if (A >= 400) {
console.error("wangEditor - XHR \u62A5\u9519\uFF0C\u72B6\u6001\u7801 " + A), _.onError && _.onError(S);
return;
}
var w = S.responseText, m;
if ((0, s.default)(w) !== "object")
try {
m = JSON.parse(w);
} catch {
console.error("wangEditor - \u8FD4\u56DE\u7ED3\u679C\u4E0D\u662F JSON \u683C\u5F0F", w), _.onFail && _.onFail(S, w);
return;
}
else
m = w;
_.onSuccess(S, m);
}
}
}, S.send(_.formData || null), S;
}
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(342)), d = a(n(46));
(0, s.default)(r, "__esModule", { value: !0 });
var h = n(2), p = h.__importDefault(n(3)), g = function() {
function _(S) {
this.editor = S, this.$textContainer = S.$textContainerElem, this.$bar = p.default('<div class="w-e-progress"></div>'), this.isShow = !1, this.time = 0, this.timeoutId = 0;
}
return _.prototype.show = function(S) {
var b = this;
if (!this.isShow) {
this.isShow = !0;
var A = this.$bar, w = this.$textContainer;
w.append(A), (0, u.default)() - this.time > 100 && S <= 1 && (A.css("width", S * 100 + "%"), this.time = (0, u.default)());
var m = this.timeoutId;
m && clearTimeout(m), this.timeoutId = (0, d.default)(function() {
b.hide();
}, 500);
}
}, _.prototype.hide = function() {
var S = this.$bar;
S.remove(), this.isShow = !1, this.time = 0, this.timeoutId = 0;
}, _;
}();
r.default = g;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 }), r.ListType = void 0;
var u = n(2), d = u.__importDefault(n(3)), h = u.__importDefault(n(24)), p = n(47), g = u.__importStar(n(371)), _;
(function(b) {
b.OrderedList = "OL", b.UnorderedList = "UL";
})(_ = r.ListType || (r.ListType = {}));
var S = function(b) {
u.__extends(A, b);
function A(w) {
var m = this, y = d.default(`<div class="w-e-menu" data-title="\u5E8F\u5217">
<i class="w-e-icon-list2"></i>
</div>`), E = { width: 130, title: "\u5E8F\u5217", type: "list", list: [{ $elem: d.default(`
<p>
<i class="w-e-icon-list2 w-e-drop-list-item"></i>
` + w.i18next.t("menus.dropListMenu.list.\u65E0\u5E8F\u5217\u8868") + `
<p>`), value: _.UnorderedList }, { $elem: d.default(`<p>
<i class="w-e-icon-list-numbered w-e-drop-list-item"></i>
` + w.i18next.t("menus.dropListMenu.list.\u6709\u5E8F\u5217\u8868") + `
<p>`), value: _.OrderedList }], clickHandler: function(k) {
m.command(k);
} };
return m = b.call(this, y, w, E) || this, m;
}
return A.prototype.command = function(w) {
var m = this.editor, y = m.selection.getSelectionContainerElem();
y !== void 0 && (this.handleSelectionRangeNodes(w), this.tryChangeActive());
}, A.prototype.validator = function(w, m, y) {
return !(!w.length || !m.length || y.equal(w) || y.equal(m));
}, A.prototype.handleSelectionRangeNodes = function(w) {
var m = this.editor, y = m.selection, E = w.toLowerCase(), x = y.getSelectionContainerElem(), k = y.getSelectionStartElem().getNodeTop(m), D = y.getSelectionEndElem().getNodeTop(m);
if (!!this.validator(k, D, m.$textElem)) {
var P = y.getRange(), M = P == null ? void 0 : P.collapsed;
m.$textElem.equal(x) || (x = x.getNodeTop(m));
var B = { editor: m, listType: w, listTarget: E, $selectionElem: x, $startElem: k, $endElem: D }, T;
this.isOrderElem(x) ? T = g.ClassType.Wrap : this.isOrderElem(k) && this.isOrderElem(D) ? T = g.ClassType.Join : this.isOrderElem(k) ? T = g.ClassType.StartJoin : this.isOrderElem(D) ? T = g.ClassType.EndJoin : T = g.ClassType.Other;
var $ = new g.default(g.createListHandle(T, B, P));
p.updateRange(m, $.getSelectionRangeElem(), !!M);
}
}, A.prototype.isOrderElem = function(w) {
var m = w.getNodeName();
return m === _.OrderedList || m === _.UnorderedList;
}, A.prototype.tryChangeActive = function() {
}, A;
}(h.default);
r.default = S;
}, function(i, r, n) {
i.exports = n(395);
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
function u(d) {
var h = d.selection.getSelectionContainerElem();
return h != null && h.length ? !!(h.getNodeName() == "CODE" || h.getNodeName() == "PRE" || h.parent().getNodeName() == "CODE" || h.parent().getNodeName() == "PRE" || /hljs/.test(h.parent().attr("class"))) : !1;
}
r.default = u;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(29));
(0, s.default)(r, "__esModule", { value: !0 }), r.todo = void 0;
var d = n(2), h = d.__importDefault(n(3)), p = function() {
function _(S) {
var b;
this.template = '<ul class="w-e-todo"><li><span contenteditable="false"><input type="checkbox"></span></li></ul>', this.checked = !1, this.$todo = h.default(this.template), this.$child = (b = S == null ? void 0 : S.childNodes()) === null || b === void 0 ? void 0 : b.clone(!0);
}
return _.prototype.init = function() {
var S = this.$child, b = this.getInputContainer();
S && S.insertAfter(b);
}, _.prototype.getInput = function() {
var S = this.$todo, b = (0, u.default)(S).call(S, "input");
return b;
}, _.prototype.getInputContainer = function() {
var S = this.getInput().parent();
return S;
}, _.prototype.getTodo = function() {
return this.$todo;
}, _;
}();
r.todo = p;
function g(_) {
var S = new p(_);
return S.init(), S;
}
r.default = g;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2);
n(146), n(148), n(152), n(154), n(156), n(158), n(160);
var d = u.__importDefault(n(87));
u.__exportStar(n(442), r);
try {
} catch {
throw new Error("\u8BF7\u5728\u6D4F\u89C8\u5668\u73AF\u5883\u4E0B\u8FD0\u884C");
}
r.default = d.default;
}, function(i, r, n) {
var a = n(143);
i.exports = a;
}, function(i, r, n) {
n(144);
var a = n(9), s = a.Object, u = i.exports = function(h, p, g) {
return s.defineProperty(h, p, g);
};
s.defineProperty.sham && (u.sham = !0);
}, function(i, r, n) {
var a = n(5), s = n(14), u = n(18);
a({ target: "Object", stat: !0, forced: !s, sham: !s }, { defineProperty: u.f });
}, function(i, r) {
var n;
n = function() {
return this;
}();
try {
n = n || new Function("return this")();
} catch {
(typeof window > "u" ? "undefined" : gn(window)) === "object" && (n = window);
}
i.exports = n;
}, function(i, r, n) {
var a = n(20), s = n(147);
s = s.__esModule ? s.default : s, typeof s == "string" && (s = [[i.i, s, ""]]);
var u = {};
u.insert = "head", u.singleton = !1, a(s, u), i.exports = s.locals || {};
}, function(i, r, n) {
var a = n(21);
r = a(!1), r.push([i.i, `.w-e-toolbar,
.w-e-text-container,
.w-e-menu-panel {
padding: 0;
margin: 0;
box-sizing: border-box;
background-color: #fff;
/*\u8868\u60C5\u83DC\u5355\u6837\u5F0F*/
/*\u5206\u5272\u7EBF\u6837\u5F0F*/
}
.w-e-toolbar h1,
.w-e-text-container h1,
.w-e-menu-panel h1 {
font-size: 32px !important;
}
.w-e-toolbar h2,
.w-e-text-container h2,
.w-e-menu-panel h2 {
font-size: 24px !important;
}
.w-e-toolbar h3,
.w-e-text-container h3,
.w-e-menu-panel h3 {
font-size: 18.72px !important;
}
.w-e-toolbar h4,
.w-e-text-container h4,
.w-e-menu-panel h4 {
font-size: 16px !important;
}
.w-e-toolbar h5,
.w-e-text-container h5,
.w-e-menu-panel h5 {
font-size: 13.28px !important;
}
.w-e-toolbar p,
.w-e-text-container p,
.w-e-menu-panel p {
font-size: 16px !important;
}
.w-e-toolbar .eleImg,
.w-e-text-container .eleImg,
.w-e-menu-panel .eleImg {
cursor: pointer;
display: inline-block;
font-size: 18px;
padding: 0 3px;
}
.w-e-toolbar *,
.w-e-text-container *,
.w-e-menu-panel * {
padding: 0;
margin: 0;
box-sizing: border-box;
}
.w-e-toolbar hr,
.w-e-text-container hr,
.w-e-menu-panel hr {
cursor: pointer;
display: block;
height: 0px;
border: 0;
border-top: 3px solid #ccc;
margin: 20px 0;
}
.w-e-clear-fix:after {
content: "";
display: table;
clear: both;
}
.w-e-drop-list-item {
position: relative;
top: 1px;
padding-right: 7px;
color: #333 !important;
}
.w-e-drop-list-tl {
padding-left: 10px;
text-align: left;
}
`, ""]), i.exports = r;
}, function(i, r, n) {
var a = n(20), s = n(149);
s = s.__esModule ? s.default : s, typeof s == "string" && (s = [[i.i, s, ""]]);
var u = {};
u.insert = "head", u.singleton = !1, a(s, u), i.exports = s.locals || {};
}, function(i, r, n) {
var a = n(21), s = n(150), u = n(151);
r = a(!1);
var d = s(u);
r.push([i.i, `@font-face {
font-family: 'w-e-icon';
src: url(` + d + `) format('truetype');
font-weight: normal;
font-style: normal;
}
[class^="w-e-icon-"],
[class*=" w-e-icon-"] {
/* use !important to prevent issues with browser extensions that change fonts */
font-family: 'w-e-icon' !important;
speak: none;
font-style: normal;
font-weight: normal;
font-variant: normal;
text-transform: none;
line-height: 1;
/* Better Font Rendering =========== */
-webkit-font-smoothing: antialiased;
-moz-osx-font-smoothing: grayscale;
}
.w-e-icon-close:before {
content: "\\f00d";
}
.w-e-icon-upload2:before {
content: "\\e9c6";
}
.w-e-icon-trash-o:before {
content: "\\f014";
}
.w-e-icon-header:before {
content: "\\f1dc";
}
.w-e-icon-pencil2:before {
content: "\\e906";
}
.w-e-icon-paint-brush:before {
content: "\\f1fc";
}
.w-e-icon-image:before {
content: "\\e90d";
}
.w-e-icon-play:before {
content: "\\e912";
}
.w-e-icon-location:before {
content: "\\e947";
}
.w-e-icon-undo:before {
content: "\\e965";
}
.w-e-icon-redo:before {
content: "\\e966";
}
.w-e-icon-quotes-left:before {
content: "\\e977";
}
.w-e-icon-list-numbered:before {
content: "\\e9b9";
}
.w-e-icon-list2:before {
content: "\\e9bb";
}
.w-e-icon-link:before {
content: "\\e9cb";
}
.w-e-icon-happy:before {
content: "\\e9df";
}
.w-e-icon-bold:before {
content: "\\ea62";
}
.w-e-icon-underline:before {
content: "\\ea63";
}
.w-e-icon-italic:before {
content: "\\ea64";
}
.w-e-icon-strikethrough:before {
content: "\\ea65";
}
.w-e-icon-table2:before {
content: "\\ea71";
}
.w-e-icon-paragraph-left:before {
content: "\\ea77";
}
.w-e-icon-paragraph-center:before {
content: "\\ea78";
}
.w-e-icon-paragraph-right:before {
content: "\\ea79";
}
.w-e-icon-paragraph-justify:before {
content: "\\ea7a";
}
.w-e-icon-terminal:before {
content: "\\f120";
}
.w-e-icon-page-break:before {
content: "\\ea68";
}
.w-e-icon-cancel-circle:before {
content: "\\ea0d";
}
.w-e-icon-font:before {
content: "\\ea5c";
}
.w-e-icon-text-heigh:before {
content: "\\ea5f";
}
.w-e-icon-paint-format:before {
content: "\\e90c";
}
.w-e-icon-indent-increase:before {
content: "\\ea7b";
}
.w-e-icon-indent-decrease:before {
content: "\\ea7c";
}
.w-e-icon-row-height:before {
content: "\\e9be";
}
.w-e-icon-fullscreen_exit:before {
content: "\\e900";
}
.w-e-icon-fullscreen:before {
content: "\\e901";
}
.w-e-icon-split-line:before {
content: "\\ea0b";
}
.w-e-icon-checkbox-checked:before {
content: "\\ea52";
}
`, ""]), i.exports = r;
}, function(i, r, n) {
i.exports = function(a, s) {
return s || (s = {}), a = a && a.__esModule ? a.default : a, typeof a != "string" ? a : (/^['"].*['"]$/.test(a) && (a = a.slice(1, -1)), s.hash && (a += s.hash), /["'() \t\n]/.test(a) || s.needQuotes ? '"'.concat(a.replace(/"/g, '\\"').replace(/\n/g, "\\n"), '"') : a);
};
}, function(i, r, n) {
n.r(r), r.default = "data:font/woff;base64,d09GRgABAAAAABskAAsAAAAAGtgAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAABPUy8yAAABCAAAAGAAAABgDxIPFWNtYXAAAAFoAAABHAAAARz2mfAgZ2FzcAAAAoQAAAAIAAAACAAAABBnbHlmAAACjAAAFXwAABV8IH7+mGhlYWQAABgIAAAANgAAADYb6gumaGhlYQAAGEAAAAAkAAAAJAkjBWlobXR4AAAYZAAAAKQAAACkmYcEbmxvY2EAABkIAAAAVAAAAFReAmKYbWF4cAAAGVwAAAAgAAAAIAA0ALZuYW1lAAAZfAAAAYYAAAGGmUoJ+3Bvc3QAABsEAAAAIAAAACAAAwAAAAMD7wGQAAUAAAKZAswAAACPApkCzAAAAesAMwEJAAAAAAAAAAAAAAAAAAAAARAAAAAAAAAAAAAAAAAAAAAAQAAA8fwDwP/AAEADwABAAAAAAQAAAAAAAAAAAAAAIAAAAAAAAwAAAAMAAAAcAAEAAwAAABwAAwABAAAAHAAEAQAAAAA8ACAABAAcAAEAIOkB6QbpDekS6UfpZul36bnpu+m+6cbpy+nf6gvqDepS6lzqX+pl6nHqfPAN8BTxIPHc8fz//f//AAAAAAAg6QDpBukM6RLpR+ll6Xfpuem76b7pxunL6d/qC+oN6lLqXOpf6mLqcep38A3wFPEg8dzx/P/9//8AAf/jFwQXABb7FvcWwxamFpYWVRZUFlIWSxZHFjQWCRYIFcQVuxW5FbcVrBWnEBcQEQ8GDksOLAADAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAQAB//8ADwABAAAAAAAAAAAAAgAANzkBAAAAAAEAAAAAAAAAAAACAAA3OQEAAAAAAQAAAAAAAAAAAAIAADc5AQAAAAAEAEEAAQO/A38ABQALABEAFwAAATMVIREzAxEhFSMVATUzESE1ETUhESM1Av/A/sJ+fgE+wP4Cfv7CAT5+Ar9+AT78ggE+fsACvsD+wn7+An7+wsAAAAAABABBAAEDvwN/AAUACwARABcAAAEhESM1IxM1MxEhNQERIRUjFREVMxUhEQKBAT5+wMB+/sL9wAE+wMD+wgN//sLA/X7A/sJ+AcIBPn7A/v7AfgE+AAAAAAIAAP/ABAADwAAEABMAAAE3AScBAy4BJxM3ASMBAyUBNQEHAYCAAcBA/kCfFzsyY4ABgMD+gMACgAGA/oBOAUBAAcBA/kD+nTI7FwERTgGA/oD9gMABgMD+gIAAAgAA/8AEAAOAACkALQAAAREjNTQmIyEiBh0BFBYzITI2PQEzESEVIyIGFREUFjsBMjY1ETQmKwE1ASE1IQQAwCYa/UAaJiYaAsAaJoD9wCANExMNgA0TEw0gAUD9QALAAYABgEAaJiYawBomJhpA/wCAEw3+wA0TEw0BQA0TQAGAQAAABAAAAAAEAAOAABAAIQAtADQAAAE4ATEROAExITgBMRE4ATEhNSEiBhURFBYzITI2NRE0JiMHFAYjIiY1NDYzMhYTITUTATM3A8D8gAOA/IAaJiYaA4AaJiYagDgoKDg4KCg4QP0A4AEAQOADQP0AAwBAJhr9ABomJhoDABom4Cg4OCgoODj9uIABgP7AwAAAAgAAAEAEAANAADgAPAAAASYnLgEnJiMiBw4BBwYHBgcOAQcGFRQXHgEXFhcWFx4BFxYzMjc+ATc2NzY3PgE3NjU0Jy4BJyYnARENAQPVNjg5djw9Pz89PHY5ODYLBwgLAwMDAwsIBws2ODl2PD0/Pz08djk4NgsHCAsDAwMDCwgHC/2rAUD+wAMgCAYGCAICAgIIBgYIKSoqWS0uLy8uLVkqKikIBgYIAgICAggGBggpKipZLS4vLy4tWSoqKf3gAYDAwAAAAAACAMD/wANAA8AAGwAnAAABIgcOAQcGFRQXHgEXFjEwNz4BNzY1NCcuAScmAyImNTQ2MzIWFRQGAgBCOzpXGRkyMngyMjIyeDIyGRlXOjtCUHBwUFBwcAPAGRlXOjtCeH19zEFBQUHMfX14Qjs6VxkZ/gBwUFBwcFBQcAAAAQAAAAAEAAOAACsAAAEiBw4BBwYHJxEhJz4BMzIXHgEXFhUUBw4BBwYHFzY3PgE3NjU0Jy4BJyYjAgA1MjJcKSkjlgGAkDWLUFBFRmkeHgkJIhgYHlUoICAtDAwoKIteXWoDgAoLJxscI5b+gJA0PB4eaUZFUCsoKUkgIRpgIysrYjY2OWpdXosoKAABAAAAAAQAA4AAKgAAExQXHgEXFhc3JicuAScmNTQ3PgE3NjMyFhcHIREHJicuAScmIyIHDgEHBgAMDC0gIChVHhgYIgkJHh5pRkVQUIs1kAGAliMpKVwyMjVqXV6LKCgBgDk2NmIrKyNgGiEgSSkoK1BFRmkeHjw0kAGAliMcGycLCigoi15dAAAAAAIAAABABAEDAAAmAE0AABMyFx4BFxYVFAcOAQcGIyInLgEnJjUnNDc+ATc2MxUiBgcOAQc+ASEyFx4BFxYVFAcOAQcGIyInLgEnJjUnNDc+ATc2MxUiBgcOAQc+AeEuKSk9ERISET0pKS4uKSk9ERIBIyN6UlFdQHUtCRAHCBICSS4pKT0REhIRPSkpLi4pKT0REgEjI3pSUV1AdS0JEAcIEgIAEhE9KSkuLikpPRESEhE9KSkuIF1RUnojI4AwLggTCgIBEhE9KSkuLikpPRESEhE9KSkuIF1RUnojI4AwLggTCgIBAAAGAED/wAQAA8AAAwAHAAsAEQAdACkAACUhFSERIRUhESEVIScRIzUjNRMVMxUjNTc1IzUzFRURIzUzNSM1MzUjNQGAAoD9gAKA/YACgP2AwEBAQIDAgIDAwICAgICAgAIAgAIAgMD/AMBA/fIyQJI8MkCS7v7AQEBAQEAABgAA/8AEAAPAAAMABwALABcAIwAvAAABIRUhESEVIREhFSEBNDYzMhYVFAYjIiYRNDYzMhYVFAYjIiYRNDYzMhYVFAYjIiYBgAKA/YACgP2AAoD9gP6ASzU1S0s1NUtLNTVLSzU1S0s1NUtLNTVLA4CA/wCA/wCAA0A1S0s1NUtL/rU1S0s1NUtL/rU1S0s1NUtLAAUAAABABWADAAADAAcACwAOABEAABMhFSEVIRUhFSEVIQEXNzUnBwADgPyAA4D8gAOA/IAD4MDAwMADAMBAwEDAAUDAwEDAwAAAAAADAAAAAAQAA6AAAwANABQAADchFSElFSE1EyEVITUhJQkBIxEjEQAEAPwABAD8AIABAAEAAQD9YAEgASDggEBAwEBAAQCAgMABIP7g/wABAAAAAAACAB7/zAPiA7QAMwBkAAABIiYnJicmNDc2PwE+ATMyFhcWFxYUBwYPAQYiJyY0PwE2NCcuASMiBg8BBhQXFhQHDgEjAyImJyYnJjQ3Nj8BNjIXFhQPAQYUFx4BMzI2PwE2NCcmNDc2MhcWFxYUBwYPAQ4BIwG4ChMIIxISEhIjwCNZMTFZIyMSEhISI1gPLA8PD1gpKRQzHBwzFMApKQ8PCBMKuDFZIyMSEhISI1gPLA8PD1gpKRQzHBwzFMApKQ8PDysQIxISEhIjwCNZMQFECAckLS1eLS0kwCIlJSIkLS1eLS0kVxAQDysPWCl0KRQVFRTAKXQpDysQBwj+iCUiJC0tXi0tJFcQEA8rD1gpdCkUFRUUwCl0KQ8rEA8PJC0tXi0tJMAiJQAAAAAFAAD/wAQAA8AAGwA3AFMAXwBrAAAFMjc+ATc2NTQnLgEnJiMiBw4BBwYVFBceARcWEzIXHgEXFhUUBw4BBwYjIicuAScmNTQ3PgE3NhMyNz4BNzY3BgcOAQcGIyInLgEnJicWFx4BFxYnNDYzMhYVFAYjIiYlNDYzMhYVFAYjIiYCAGpdXosoKCgoi15dampdXosoKCgoi15dalZMTHEgISEgcUxMVlZMTHEgISEgcUxMVisrKlEmJiMFHBtWODc/Pzc4VhscBSMmJlEqK9UlGxslJRsbJQGAJRsbJSUbGyVAKCiLXl1qal1eiygoKCiLXl1qal1eiygoA6AhIHFMTFZWTExxICEhIHFMTFZWTExxICH+CQYGFRAQFEM6OlYYGRkYVjo6QxQQEBUGBvcoODgoKDg4KCg4OCgoODgAAAEAAAFABAACQAAPAAATFRQWMyEyNj0BNCYjISIGABMNA8ANExMN/EANEwIgwA0TEw3ADRMTAAAAAwAA/8AEAAPAABsANwBDAAABIgcOAQcGFRQXHgEXFjMyNz4BNzY1NCcuAScmAyInLgEnJjU0Nz4BNzYzMhceARcWFRQHDgEHBhMHJwcXBxc3FzcnNwIAal1eiygoKCiLXl1qal1eiygoKCiLXl1qVkxMcSAhISBxTExWVkxMcSAhISBxTExKoKBgoKBgoKBgoKADwCgoi15dampdXosoKCgoi15dampdXosoKPxgISBxTExWVkxMcSAhISBxTExWVkxMcSAhAqCgoGCgoGCgoGCgoAACAAD/wAQAA8AADwAVAAABISIGFREUFjMhMjY1ETQmASc3FwEXA4D9ADVLSzUDADVLS/4L7VqTATNaA8BLNf0ANUtLNQMANUv85e5akgEyWgAAAAABAGX/wAObA8AAKQAAASImIyIHDgEHBhUUFjMuATU0NjcwBwYCBwYHFSETMzcjNx4BMzI2Nw4BAyBEaEZxU1RtGhtJSAYNZUoQEEs8PFkBPWzGLNc0LVUmLlAYHT0DsBAeHWE+P0FNOwsmN5lvA31+/sWPkCMZAgCA9gkPN2sJBwAAAAACAAAAAAQAA4AACQAXAAAlMwcnMxEjNxcjJREnIxEzFSE1MxEjBxEDgICgoICAoKCA/wBAwID+gIDAQMDAwAIAwMDA/wCA/UBAQALAgAEAAAMAwAAAA0ADgAAWAB8AKAAAAT4BNTQnLgEnJiMhESEyNz4BNzY1NCYBMzIWFRQGKwETIxEzMhYVFAYCxBwgFBRGLi81/sABgDUvLkYUFET+hGUqPDwpZp+fnyw+PgHbIlQvNS8uRhQU/IAUFEYuLzVGdAFGSzU1S/6AAQBLNTVLAAAAAAIAwAAAA0ADgAAfACMAAAEzERQHDgEHBiMiJy4BJyY1ETMRFBYXHgEzMjY3PgE1ASEVIQLAgBkZVzo7QkI7OlcZGYAbGBxJKChJHBgb/gACgP2AA4D+YDw0NU4WFxcWTjU0PAGg/mAeOBcYGxsYFzge/qCAAAAAAAEAgAAAA4ADgAALAAABFSMBMxUhNTMBIzUDgID+wID+QIABQIADgED9AEBAAwBAAAEAAAAABAADgAA9AAABFSMeARUUBgcOASMiJicuATUzFBYzMjY1NCYjITUhLgEnLgE1NDY3PgEzMhYXHgEVIzQmIyIGFRQWMzIWFwQA6xUWNTAscT4+cSwwNYByTk5yck7+AAEsAgQBMDU1MCxxPj5xLDA1gHJOTnJyTjtuKwHAQB1BIjViJCEkJCEkYjU0TEw0NExAAQMBJGI1NWIkISQkISRiNTRMTDQ0TCEfAAAACgAAAAAEAAOAAAMABwALAA8AEwAXABsAHwAjACcAABMRIREBNSEVHQEhNQEVITUjFSE1ESEVISUhFSERNSEVASEVISE1IRUABAD9gAEA/wABAP8AQP8AAQD/AAKAAQD/AAEA/IABAP8AAoABAAOA/IADgP3AwMBAwMACAMDAwMD/AMDAwAEAwMD+wMDAwAAABQAAAAAEAAOAAAMABwALAA8AEwAAEyEVIRUhFSERIRUhESEVIREhFSEABAD8AAKA/YACgP2ABAD8AAQA/AADgIBAgP8AgAFAgP8AgAAAAAAFAAAAAAQAA4AAAwAHAAsADwATAAATIRUhFyEVIREhFSEDIRUhESEVIQAEAPwAwAKA/YACgP2AwAQA/AAEAPwAA4CAQID/AIABQID/AIAAAAUAAAAABAADgAADAAcACwAPABMAABMhFSEFIRUhESEVIQEhFSERIRUhAAQA/AABgAKA/YACgP2A/oAEAPwABAD8AAOAgECA/wCAAUCA/wCAAAAAAAUAAAAABAADgAADAAcACwAPABMAABMhFSEVIRUhFSEVIRUhFSEVIRUhAAQA/AAEAPwABAD8AAQA/AAEAPwAA4CAQIBAgECAQIAAAAAGAAAAAAQAA4AAAwAHAAsADwATABYAABMhFSEFIRUhFSEVIRUhFSEFIRUhGQEFAAQA/AABgAKA/YACgP2AAoD9gP6ABAD8AAEAA4CAQIBAgECAQIABAAGAwAAAAAYAAAAABAADgAADAAcACwAPABMAFgAAEyEVIQUhFSEVIRUhFSEVIQUhFSEBESUABAD8AAGAAoD9gAKA/YACgP2A/oAEAPwAAQD/AAOAgECAQIBAgECAAoD+gMAAAQA/AD8C5gLmACwAACUUDwEGIyIvAQcGIyIvASY1ND8BJyY1ND8BNjMyHwE3NjMyHwEWFRQPARcWFQLmEE4QFxcQqKgQFxYQThAQqKgQEE4QFhcQqKgQFxcQThAQqKgQwxYQThAQqKgQEE4QFhcQqKgQFxcQThAQqKgQEE4QFxcQqKgQFwAAAAYAAAAAAyUDbgAUACgAPABNAFUAggAAAREUBwYrASInJjURNDc2OwEyFxYVMxEUBwYrASInJjURNDc2OwEyFxYXERQHBisBIicmNRE0NzY7ATIXFhMRIREUFxYXFjMhMjc2NzY1ASEnJicjBgcFFRQHBisBERQHBiMhIicmNREjIicmPQE0NzY7ATc2NzY7ATIXFh8BMzIXFhUBJQYFCCQIBQYGBQgkCAUGkgUFCCUIBQUFBQglCAUFkgUFCCUIBQUFBQglCAUFSf4ABAQFBAIB2wIEBAQE/oABABsEBrUGBAH3BgUINxobJv4lJhsbNwgFBQUFCLEoCBcWF7cXFhYJKLAIBQYCEv63CAUFBQUIAUkIBQYGBQj+twgFBQUFCAFJCAUGBgUI/rcIBQUFBQgBSQgFBgYF/lsCHf3jDQsKBQUFBQoLDQJmQwUCAgVVJAgGBf3jMCIjISIvAiAFBggkCAUFYBUPDw8PFWAFBQgAAgAHAEkDtwKvABoALgAACQEGIyIvASY1ND8BJyY1ND8BNjMyFwEWFRQHARUUBwYjISInJj0BNDc2MyEyFxYBTv72BgcIBR0GBuHhBgYdBQgHBgEKBgYCaQUFCP3bCAUFBQUIAiUIBQUBhf72BgYcBggHBuDhBgcHBh0FBf71BQgHBv77JQgFBQUFCCUIBQUFBQAAAAEAIwAAA90DbgCzAAAlIicmIyIHBiMiJyY1NDc2NzY3Njc2PQE0JyYjISIHBh0BFBcWFxYzFhcWFRQHBiMiJyYjIgcGIyInJjU0NzY3Njc2NzY9ARE0NTQ1NCc0JyYnJicmJyYnJiMiJyY1NDc2MzIXFjMyNzYzMhcWFRQHBiMGBwYHBh0BFBcWMyEyNzY9ATQnJicmJyY1NDc2MzIXFjMyNzYzMhcWFRQHBgciBwYHBhURFBcWFxYXMhcWFRQHBiMDwRkzMhoZMjMZDQgHCQoNDBEQChIBBxX+fhYHARUJEhMODgwLBwcOGzU1GhgxMRgNBwcJCQsMEA8JEgECAQIDBAQFCBIRDQ0KCwcHDho1NRoYMDEYDgcHCQoMDRAQCBQBBw8BkA4HARQKFxcPDgcHDhkzMhkZMTEZDgcHCgoNDRARCBQUCRERDg0KCwcHDgACAgICDAsPEQkJAQEDAwUMROAMBQMDBQzUUQ0GAQIBCAgSDwwNAgICAgwMDhEICQECAwMFDUUhAdACDQ0ICA4OCgoLCwcHAwYBAQgIEg8MDQICAgINDA8RCAgBAgEGDFC2DAcBAQcMtlAMBgEBBgcWDwwNAgICAg0MDxEICAEBAgYNT/3mRAwGAgIBCQgRDwwNAAACAAD/twP/A7cAEwA5AAABMhcWFRQHAgcGIyInJjU0NwE2MwEWFxYfARYHBiMiJyYnJicmNRYXFhcWFxYzMjc2NzY3Njc2NzY3A5soHh4avkw3RUg0NDUBbSEp/fgXJicvAQJMTHtHNjYhIRARBBMUEBASEQkXCA8SExUVHR0eHikDtxsaKCQz/plGNDU0SUkwAUsf/bErHx8NKHpNTBobLi86OkQDDw4LCwoKFiUbGhERCgsEBAIAAQAAAAAAAIWwaoFfDzz1AAsEAAAAAADbteOZAAAAANu145kAAP+3BWADwAAAAAgAAgAAAAAAAAABAAADwP/AAAAFgAAA//8FYAABAAAAAAAAAAAAAAAAAAAAKQQAAAAAAAAAAAAAAAIAAAAEAABBBAAAQQQAAAAEAAAABAAAAAQAAAAEAADABAAAAAQAAAAEAAAABAAAQAQAAAAFgAAABAAAAAQAAB4EAAAABAAAAAQAAAAEAAAABAAAZQQAAAAEAADABAAAwAQAAIAEAAAABAAAAAQAAAAEAAAABAAAAAQAAAAEAAAABAAAAAMlAD8DJQAAA74ABwQAACMD/wAAAAAAAAAKABQAHgBKAHYApADmAS4BkgHQAhYCXALQAw4DWAN+A6gEPgTeBPoFZAWOBdAF+AY6BnYGjgbmBy4HVgd+B6gHzgf8CCoIbgkmCXAKYgq+AAEAAAApALQACgAAAAAAAgAAAAAAAAAAAAAAAAAAAAAAAAAOAK4AAQAAAAAAAQAHAAAAAQAAAAAAAgAHAGAAAQAAAAAAAwAHADYAAQAAAAAABAAHAHUAAQAAAAAABQALABUAAQAAAAAABgAHAEsAAQAAAAAACgAaAIoAAwABBAkAAQAOAAcAAwABBAkAAgAOAGcAAwABBAkAAwAOAD0AAwABBAkABAAOAHwAAwABBAkABQAWACAAAwABBAkABgAOAFIAAwABBAkACgA0AKRpY29tb29uAGkAYwBvAG0AbwBvAG5WZXJzaW9uIDEuMABWAGUAcgBzAGkAbwBuACAAMQAuADBpY29tb29uAGkAYwBvAG0AbwBvAG5pY29tb29uAGkAYwBvAG0AbwBvAG5SZWd1bGFyAFIAZQBnAHUAbABhAHJpY29tb29uAGkAYwBvAG0AbwBvAG5Gb250IGdlbmVyYXRlZCBieSBJY29Nb29uLgBGAG8AbgB0ACAAZwBlAG4AZQByAGEAdABlAGQAIABiAHkAIABJAGMAbwBNAG8AbwBuAC4AAAADAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA";
}, function(i, r, n) {
var a = n(20), s = n(153);
s = s.__esModule ? s.default : s, typeof s == "string" && (s = [[i.i, s, ""]]);
var u = {};
u.insert = "head", u.singleton = !1, a(s, u), i.exports = s.locals || {};
}, function(i, r, n) {
var a = n(21);
r = a(!1), r.push([i.i, `.w-e-toolbar {
display: flex;
padding: 0 6px;
flex-wrap: wrap;
position: relative;
/* \u5355\u4E2A\u83DC\u5355 */
}
.w-e-toolbar .w-e-menu {
position: relative;
display: flex;
width: 40px;
height: 40px;
align-items: center;
justify-content: center;
text-align: center;
cursor: pointer;
}
.w-e-toolbar .w-e-menu i {
color: #999;
}
.w-e-toolbar .w-e-menu:hover {
background-color: #F6F6F6;
}
.w-e-toolbar .w-e-menu:hover i {
color: #333;
}
.w-e-toolbar .w-e-active i {
color: #1e88e5;
}
.w-e-toolbar .w-e-active:hover i {
color: #1e88e5;
}
.w-e-menu-tooltip {
position: absolute;
display: flex;
color: #f1f1f1;
background-color: rgba(0, 0, 0, 0.75);
box-shadow: 0 2px 8px 0 rgba(0, 0, 0, 0.15);
border-radius: 4px;
padding: 4px 5px 6px;
justify-content: center;
align-items: center;
}
.w-e-menu-tooltip-up::after {
content: "";
position: absolute;
top: 100%;
left: 50%;
margin-left: -5px;
border: 5px solid rgba(0, 0, 0, 0);
border-top-color: rgba(0, 0, 0, 0.73);
}
.w-e-menu-tooltip-down::after {
content: "";
position: absolute;
bottom: 100%;
left: 50%;
margin-left: -5px;
border: 5px solid rgba(0, 0, 0, 0);
border-bottom-color: rgba(0, 0, 0, 0.73);
}
.w-e-menu-tooltip-item-wrapper {
font-size: 14px;
margin: 0 5px;
}
`, ""]), i.exports = r;
}, function(i, r, n) {
var a = n(20), s = n(155);
s = s.__esModule ? s.default : s, typeof s == "string" && (s = [[i.i, s, ""]]);
var u = {};
u.insert = "head", u.singleton = !1, a(s, u), i.exports = s.locals || {};
}, function(i, r, n) {
var a = n(21);
r = a(!1), r.push([i.i, `.w-e-text-container {
position: relative;
height: 100%;
}
.w-e-text-container .w-e-progress {
position: absolute;
background-color: #1e88e5;
top: 0;
left: 0;
height: 1px;
}
.w-e-text-container .placeholder {
color: #D4D4D4;
position: absolute;
font-size: 11pt;
line-height: 22px;
left: 10px;
top: 10px;
-webkit-user-select: none;
-moz-user-select: none;
-ms-user-select: none;
user-select: none;
z-index: -1;
}
.w-e-text {
padding: 0 10px;
overflow-y: auto;
}
.w-e-text p,
.w-e-text h1,
.w-e-text h2,
.w-e-text h3,
.w-e-text h4,
.w-e-text h5,
.w-e-text table,
.w-e-text pre {
margin: 10px 0;
line-height: 1.5;
}
.w-e-text ul,
.w-e-text ol {
margin: 10px 0 10px 20px;
}
.w-e-text blockquote {
display: block;
border-left: 8px solid #d0e5f2;
padding: 5px 10px;
margin: 10px 0;
line-height: 1.4;
font-size: 100%;
background-color: #f1f1f1;
}
.w-e-text code {
display: inline-block;
background-color: #f1f1f1;
border-radius: 3px;
padding: 3px 5px;
margin: 0 3px;
}
.w-e-text pre code {
display: block;
}
.w-e-text table {
border-top: 1px solid #ccc;
border-left: 1px solid #ccc;
}
.w-e-text table td,
.w-e-text table th {
border-bottom: 1px solid #ccc;
border-right: 1px solid #ccc;
padding: 3px 5px;
min-height: 30px;
height: 30px;
}
.w-e-text table th {
border-bottom: 2px solid #ccc;
text-align: center;
background-color: #f1f1f1;
}
.w-e-text:focus {
outline: none;
}
.w-e-text img {
cursor: pointer;
}
.w-e-text img:hover {
box-shadow: 0 0 5px #333;
}
.w-e-text .w-e-todo {
margin: 0 0 0 20px;
}
.w-e-text .w-e-todo li {
list-style: none;
font-size: 1em;
}
.w-e-text .w-e-todo li span:nth-child(1) {
position: relative;
left: -18px;
}
.w-e-text .w-e-todo li span:nth-child(1) input {
position: absolute;
margin-right: 3px;
}
.w-e-text .w-e-todo li span:nth-child(1) input[type=checkbox] {
top: 50%;
margin-top: -6px;
}
.w-e-tooltip {
position: absolute;
display: flex;
color: #f1f1f1;
background-color: rgba(0, 0, 0, 0.75);
box-shadow: 0 2px 8px 0 rgba(0, 0, 0, 0.15);
border-radius: 4px;
padding: 4px 5px 6px;
justify-content: center;
align-items: center;
}
.w-e-tooltip-up::after {
content: "";
position: absolute;
top: 100%;
left: 50%;
margin-left: -5px;
border: 5px solid rgba(0, 0, 0, 0);
border-top-color: rgba(0, 0, 0, 0.73);
}
.w-e-tooltip-down::after {
content: "";
position: absolute;
bottom: 100%;
left: 50%;
margin-left: -5px;
border: 5px solid rgba(0, 0, 0, 0);
border-bottom-color: rgba(0, 0, 0, 0.73);
}
.w-e-tooltip-item-wrapper {
cursor: pointer;
font-size: 14px;
margin: 0 5px;
}
.w-e-tooltip-item-wrapper:hover {
color: #ccc;
text-decoration: underline;
}
`, ""]), i.exports = r;
}, function(i, r, n) {
var a = n(20), s = n(157);
s = s.__esModule ? s.default : s, typeof s == "string" && (s = [[i.i, s, ""]]);
var u = {};
u.insert = "head", u.singleton = !1, a(s, u), i.exports = s.locals || {};
}, function(i, r, n) {
var a = n(21);
r = a(!1), r.push([i.i, `.w-e-menu .w-e-panel-container {
position: absolute;
top: 0;
left: 50%;
border: 1px solid #ccc;
border-top: 0;
box-shadow: 1px 1px 2px #ccc;
color: #333;
background-color: #fff;
text-align: left;
/* \u4E3A emotion panel \u5B9A\u5236\u7684\u6837\u5F0F */
/* \u4E0A\u4F20\u56FE\u7247\u3001\u4E0A\u4F20\u89C6\u9891\u7684 panel \u5B9A\u5236\u6837\u5F0F */
}
.w-e-menu .w-e-panel-container .w-e-panel-close {
position: absolute;
right: 0;
top: 0;
padding: 5px;
margin: 2px 5px 0 0;
cursor: pointer;
color: #999;
}
.w-e-menu .w-e-panel-container .w-e-panel-close:hover {
color: #333;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-title {
list-style: none;
display: flex;
font-size: 14px;
margin: 2px 10px 0 10px;
border-bottom: 1px solid #f1f1f1;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-title .w-e-item {
padding: 3px 5px;
color: #999;
cursor: pointer;
margin: 0 3px;
position: relative;
top: 1px;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-title .w-e-active {
color: #333;
border-bottom: 1px solid #333;
cursor: default;
font-weight: 700;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-content {
padding: 10px 15px 10px 15px;
font-size: 16px;
/* \u8F93\u5165\u6846\u7684\u6837\u5F0F */
/* \u6309\u94AE\u7684\u6837\u5F0F */
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-content input:focus,
.w-e-menu .w-e-panel-container .w-e-panel-tab-content textarea:focus,
.w-e-menu .w-e-panel-container .w-e-panel-tab-content button:focus {
outline: none;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-content textarea {
width: 100%;
border: 1px solid #ccc;
padding: 5px;
margin-top: 10px;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-content textarea:focus {
border-color: #1e88e5;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-content input[type=text] {
border: none;
border-bottom: 1px solid #ccc;
font-size: 14px;
height: 20px;
color: #333;
text-align: left;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-content input[type=text].small {
width: 30px;
text-align: center;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-content input[type=text].block {
display: block;
width: 100%;
margin: 10px 0;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-content input[type=text]:focus {
border-bottom: 2px solid #1e88e5;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-content .w-e-button-container button {
font-size: 14px;
color: #1e88e5;
border: none;
padding: 5px 10px;
background-color: #fff;
cursor: pointer;
border-radius: 3px;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-content .w-e-button-container button.left {
float: left;
margin-right: 10px;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-content .w-e-button-container button.right {
float: right;
margin-left: 10px;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-content .w-e-button-container button.gray {
color: #999;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-content .w-e-button-container button.red {
color: #c24f4a;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-content .w-e-button-container button:hover {
background-color: #f1f1f1;
}
.w-e-menu .w-e-panel-container .w-e-panel-tab-content .w-e-button-container:after {
content: "";
display: table;
clear: both;
}
.w-e-menu .w-e-panel-container .w-e-emoticon-container .w-e-item {
cursor: pointer;
font-size: 18px;
padding: 0 3px;
display: inline-block;
}
.w-e-menu .w-e-panel-container .w-e-up-img-container,
.w-e-menu .w-e-panel-container .w-e-up-video-container {
text-align: center;
}
.w-e-menu .w-e-panel-container .w-e-up-img-container .w-e-up-btn,
.w-e-menu .w-e-panel-container .w-e-up-video-container .w-e-up-btn {
display: inline-block;
color: #999;
cursor: pointer;
font-size: 60px;
line-height: 1;
}
.w-e-menu .w-e-panel-container .w-e-up-img-container .w-e-up-btn:hover,
.w-e-menu .w-e-panel-container .w-e-up-video-container .w-e-up-btn:hover {
color: #333;
}
`, ""]), i.exports = r;
}, function(i, r, n) {
var a = n(20), s = n(159);
s = s.__esModule ? s.default : s, typeof s == "string" && (s = [[i.i, s, ""]]);
var u = {};
u.insert = "head", u.singleton = !1, a(s, u), i.exports = s.locals || {};
}, function(i, r, n) {
var a = n(21);
r = a(!1), r.push([i.i, `.w-e-toolbar .w-e-droplist {
position: absolute;
left: 0;
top: 0;
background-color: #fff;
border: 1px solid #f1f1f1;
border-right-color: #ccc;
border-bottom-color: #ccc;
}
.w-e-toolbar .w-e-droplist .w-e-dp-title {
text-align: center;
color: #999;
line-height: 2;
border-bottom: 1px solid #f1f1f1;
font-size: 13px;
}
.w-e-toolbar .w-e-droplist ul.w-e-list {
list-style: none;
line-height: 1;
}
.w-e-toolbar .w-e-droplist ul.w-e-list li.w-e-item {
color: #333;
padding: 5px 0;
}
.w-e-toolbar .w-e-droplist ul.w-e-list li.w-e-item:hover {
background-color: #f1f1f1;
}
.w-e-toolbar .w-e-droplist ul.w-e-block {
list-style: none;
text-align: left;
padding: 5px;
}
.w-e-toolbar .w-e-droplist ul.w-e-block li.w-e-item {
display: inline-block;
padding: 3px 5px;
}
.w-e-toolbar .w-e-droplist ul.w-e-block li.w-e-item:hover {
background-color: #f1f1f1;
}
`, ""]), i.exports = r;
}, function(i, r, n) {
var a = n(0), s = a(n(161));
Element.prototype.matches || (Element.prototype.matches = function(u) {
var d = this.ownerDocument.querySelectorAll(u), h = d.length;
for (h; h >= 0 && d.item(h) !== this; h--)
;
return h > -1;
}), s.default || (window.Promise = s.default);
}, function(i, r, n) {
i.exports = n(162);
}, function(i, r, n) {
var a = n(163);
i.exports = a;
}, function(i, r, n) {
n(61), n(50), n(54), n(175), n(178), n(179);
var a = n(9);
i.exports = a.Promise;
}, function(i, r, n) {
var a = n(62), s = n(49), u = function(h) {
return function(p, g) {
var _ = String(s(p)), S = a(g), b = _.length, A, w;
return S < 0 || S >= b ? h ? "" : void 0 : (A = _.charCodeAt(S), A < 55296 || A > 56319 || S + 1 === b || (w = _.charCodeAt(S + 1)) < 56320 || w > 57343 ? h ? _.charAt(S) : A : h ? _.slice(S, S + 2) : (A - 55296 << 10) + (w - 56320) + 65536);
};
};
i.exports = {
codeAt: u(!1),
charAt: u(!0)
};
}, function(i, r, n) {
var a = n(8), s = n(102), u = a.WeakMap;
i.exports = typeof u == "function" && /native code/.test(s(u));
}, function(i, r, n) {
var a = n(8), s = n(19);
i.exports = function(u, d) {
try {
s(a, u, d);
} catch {
a[u] = d;
}
return d;
};
}, function(i, r, n) {
var a = n(104).IteratorPrototype, s = n(77), u = n(48), d = n(37), h = n(44), p = function() {
return this;
};
i.exports = function(g, _, S) {
var b = _ + " Iterator";
return g.prototype = s(a, { next: u(1, S) }), d(g, b, !1, !0), h[b] = p, g;
};
}, function(i, r, n) {
var a = n(11);
i.exports = !a(function() {
function s() {
}
return s.prototype.constructor = null, Object.getPrototypeOf(new s()) !== s.prototype;
});
}, function(i, r, n) {
var a = n(14), s = n(18), u = n(25), d = n(52);
i.exports = a ? Object.defineProperties : function(p, g) {
u(p);
for (var _ = d(g), S = _.length, b = 0, A; S > b; )
s.f(p, A = _[b++], g[A]);
return p;
};
}, function(i, r, n) {
var a = n(81), s = n(65);
i.exports = a ? {}.toString : function() {
return "[object " + s(this) + "]";
};
}, function(i, r, n) {
var a = n(25), s = n(172);
i.exports = Object.setPrototypeOf || ("__proto__" in {} ? function() {
var u = !1, d = {}, h;
try {
h = Object.getOwnPropertyDescriptor(Object.prototype, "__proto__").set, h.call(d, []), u = d instanceof Array;
} catch {
}
return function(g, _) {
return a(g), s(_), u ? h.call(g, _) : g.__proto__ = _, g;
};
}() : void 0);
}, function(i, r, n) {
var a = n(13);
i.exports = function(s) {
if (!a(s) && s !== null)
throw TypeError("Can't set " + String(s) + " as a prototype");
return s;
};
}, function(i, r, n) {
var a = n(30), s = n(82), u = n(44), d = n(42), h = n(75), p = "Array Iterator", g = d.set, _ = d.getterFor(p);
i.exports = h(Array, "Array", function(S, b) {
g(this, {
type: p,
target: a(S),
index: 0,
kind: b
});
}, function() {
var S = _(this), b = S.target, A = S.kind, w = S.index++;
return !b || w >= b.length ? (S.target = void 0, { value: void 0, done: !0 }) : A == "keys" ? { value: w, done: !1 } : A == "values" ? { value: b[w], done: !1 } : { value: [w, b[w]], done: !1 };
}, "values"), u.Arguments = u.Array, s("keys"), s("values"), s("entries");
}, function(i, r) {
i.exports = { CSSRuleList: 0, CSSStyleDeclaration: 0, CSSValueList: 0, ClientRectList: 0, DOMRectList: 0, DOMStringList: 0, DOMTokenList: 1, DataTransferItemList: 0, FileList: 0, HTMLAllCollection: 0, HTMLCollection: 0, HTMLFormElement: 0, HTMLSelectElement: 0, MediaList: 0, MimeTypeArray: 0, NamedNodeMap: 0, NodeList: 1, PaintRequestList: 0, Plugin: 0, PluginArray: 0, SVGLengthList: 0, SVGNumberList: 0, SVGPathSegList: 0, SVGPointList: 0, SVGStringList: 0, SVGTransformList: 0, SourceBufferList: 0, StyleSheetList: 0, TextTrackCueList: 0, TextTrackList: 0, TouchList: 0 };
}, function(i, r, n) {
var a = n(5), s = n(43), u = n(8), d = n(36), h = n(109), p = n(53), g = n(110), _ = n(37), S = n(111), b = n(13), A = n(41), w = n(83), m = n(34), y = n(102), E = n(66), x = n(115), k = n(116), D = n(117).set, P = n(176), M = n(119), B = n(177), T = n(85), $ = n(120), V = n(42), z = n(101), H = n(10), I = n(86), U = H("species"), F = "Promise", C = V.get, q = V.set, X = V.getterFor(F), Y = h, ue = u.TypeError, ee = u.document, pe = u.process, Te = d("fetch"), ve = T.f, me = ve, we = m(pe) == "process", he = !!(ee && ee.createEvent && u.dispatchEvent), Se = "unhandledrejection", xe = "rejectionhandled", O = 0, K = 1, J = 2, ne = 1, re = 2, fe, Ae, Fe, Xe, Ze = z(F, function() {
var ft = y(Y) !== String(Y);
if (!ft && (I === 66 || !we && typeof PromiseRejectionEvent != "function") || s && !Y.prototype.finally)
return !0;
if (I >= 51 && /native code/.test(Y))
return !1;
var Be = Y.resolve(1), Je = function(Re) {
Re(function() {
}, function() {
});
}, ht = Be.constructor = {};
return ht[U] = Je, !(Be.then(function() {
}) instanceof Je);
}), be = Ze || !x(function(ft) {
Y.all(ft).catch(function() {
});
}), Le = function(Be) {
var Je;
return b(Be) && typeof (Je = Be.then) == "function" ? Je : !1;
}, ke = function(Be, Je, ht) {
if (!Je.notified) {
Je.notified = !0;
var We = Je.reactions;
P(function() {
for (var Re = Je.value, dt = Je.state == K, lt = 0; We.length > lt; ) {
var st = We[lt++], Ct = dt ? st.ok : st.fail, Fn = st.resolve, Gt = st.reject, Ut = st.domain, It, si, lr;
try {
Ct ? (dt || (Je.rejection === re && ze(Be, Je), Je.rejection = ne), Ct === !0 ? It = Re : (Ut && Ut.enter(), It = Ct(Re), Ut && (Ut.exit(), lr = !0)), It === st.promise ? Gt(ue("Promise-chain cycle")) : (si = Le(It)) ? si.call(It, Fn, Gt) : Fn(It)) : Gt(Re);
} catch (vi) {
Ut && !lr && Ut.exit(), Gt(vi);
}
}
Je.reactions = [], Je.notified = !1, ht && !Je.rejection && pt(Be, Je);
});
}
}, it = function(Be, Je, ht) {
var We, Re;
he ? (We = ee.createEvent("Event"), We.promise = Je, We.reason = ht, We.initEvent(Be, !1, !0), u.dispatchEvent(We)) : We = { promise: Je, reason: ht }, (Re = u["on" + Be]) ? Re(We) : Be === Se && B("Unhandled promise rejection", ht);
}, pt = function(Be, Je) {
D.call(u, function() {
var ht = Je.value, We = De(Je), Re;
if (We && (Re = $(function() {
we ? pe.emit("unhandledRejection", ht, Be) : it(Se, Be, ht);
}), Je.rejection = we || De(Je) ? re : ne, Re.error))
throw Re.value;
});
}, De = function(Be) {
return Be.rejection !== ne && !Be.parent;
}, ze = function(Be, Je) {
D.call(u, function() {
we ? pe.emit("rejectionHandled", Be) : it(xe, Be, Je.value);
});
}, at = function(Be, Je, ht, We) {
return function(Re) {
Be(Je, ht, Re, We);
};
}, He = function(Be, Je, ht, We) {
Je.done || (Je.done = !0, We && (Je = We), Je.value = ht, Je.state = J, ke(Be, Je, !0));
}, Rt = function ft(Be, Je, ht, We) {
if (!Je.done) {
Je.done = !0, We && (Je = We);
try {
if (Be === ht)
throw ue("Promise can't be resolved itself");
var Re = Le(ht);
Re ? P(function() {
var dt = { done: !1 };
try {
Re.call(ht, at(ft, Be, dt, Je), at(He, Be, dt, Je));
} catch (lt) {
He(Be, dt, lt, Je);
}
}) : (Je.value = ht, Je.state = K, ke(Be, Je, !1));
} catch (dt) {
He(Be, { done: !1 }, dt, Je);
}
}
};
Ze && (Y = function(Be) {
w(this, Y, F), A(Be), fe.call(this);
var Je = C(this);
try {
Be(at(Rt, this, Je), at(He, this, Je));
} catch (ht) {
He(this, Je, ht);
}
}, fe = function(Be) {
q(this, { type: F, done: !1, notified: !1, parent: !1, reactions: [], rejection: !1, state: O, value: void 0 });
}, fe.prototype = g(Y.prototype, {
then: function(Be, Je) {
var ht = X(this), We = ve(k(this, Y));
return We.ok = typeof Be == "function" ? Be : !0, We.fail = typeof Je == "function" && Je, We.domain = we ? pe.domain : void 0, ht.parent = !0, ht.reactions.push(We), ht.state != O && ke(this, ht, !1), We.promise;
},
catch: function(Be) {
return this.then(void 0, Be);
}
}), Ae = function() {
var Be = new fe(), Je = C(Be);
this.promise = Be, this.resolve = at(Rt, Be, Je), this.reject = at(He, Be, Je);
}, T.f = ve = function(Be) {
return Be === Y || Be === Fe ? new Ae(Be) : me(Be);
}, !s && typeof h == "function" && (Xe = h.prototype.then, p(h.prototype, "then", function(Be, Je) {
var ht = this;
return new Y(function(We, Re) {
Xe.call(ht, We, Re);
}).then(Be, Je);
}, { unsafe: !0 }), typeof Te == "function" && a({ global: !0, enumerable: !0, forced: !0 }, {
fetch: function(Be) {
return M(Y, Te.apply(u, arguments));
}
}))), a({ global: !0, wrap: !0, forced: Ze }, { Promise: Y }), _(Y, F, !1, !0), S(F), Fe = d(F), a({ target: F, stat: !0, forced: Ze }, {
reject: function(Be) {
var Je = ve(this);
return Je.reject.call(void 0, Be), Je.promise;
}
}), a({ target: F, stat: !0, forced: s || Ze }, {
resolve: function(Be) {
return M(s && this === Fe ? Y : this, Be);
}
}), a({ target: F, stat: !0, forced: be }, {
all: function(Be) {
var Je = this, ht = ve(Je), We = ht.resolve, Re = ht.reject, dt = $(function() {
var lt = A(Je.resolve), st = [], Ct = 0, Fn = 1;
E(Be, function(Gt) {
var Ut = Ct++, It = !1;
st.push(void 0), Fn++, lt.call(Je, Gt).then(function(si) {
It || (It = !0, st[Ut] = si, --Fn || We(st));
}, Re);
}), --Fn || We(st);
});
return dt.error && Re(dt.value), ht.promise;
},
race: function(Be) {
var Je = this, ht = ve(Je), We = ht.reject, Re = $(function() {
var dt = A(Je.resolve);
E(Be, function(lt) {
dt.call(Je, lt).then(ht.resolve, We);
});
});
return Re.error && We(Re.value), ht.promise;
}
});
}, function(i, r, n) {
var a = n(8), s = n(71).f, u = n(34), d = n(117).set, h = n(118), p = a.MutationObserver || a.WebKitMutationObserver, g = a.process, _ = a.Promise, S = u(g) == "process", b = s(a, "queueMicrotask"), A = b && b.value, w, m, y, E, x, k, D, P;
A || (w = function() {
var B, T;
for (S && (B = g.domain) && B.exit(); m; ) {
T = m.fn, m = m.next;
try {
T();
} catch ($) {
throw m ? E() : y = void 0, $;
}
}
y = void 0, B && B.enter();
}, S ? E = function() {
g.nextTick(w);
} : p && !h ? (x = !0, k = document.createTextNode(""), new p(w).observe(k, { characterData: !0 }), E = function() {
k.data = x = !x;
}) : _ && _.resolve ? (D = _.resolve(void 0), P = D.then, E = function() {
P.call(D, w);
}) : E = function() {
d.call(a, w);
}), i.exports = A || function(M) {
var B = { fn: M, next: void 0 };
y && (y.next = B), m || (m = B, E()), y = B;
};
}, function(i, r, n) {
var a = n(8);
i.exports = function(s, u) {
var d = a.console;
d && d.error && (arguments.length === 1 ? d.error(s) : d.error(s, u));
};
}, function(i, r, n) {
var a = n(5), s = n(41), u = n(85), d = n(120), h = n(66);
a({ target: "Promise", stat: !0 }, { allSettled: function(g) {
var _ = this, S = u.f(_), b = S.resolve, A = S.reject, w = d(function() {
var m = s(_.resolve), y = [], E = 0, x = 1;
h(g, function(k) {
var D = E++, P = !1;
y.push(void 0), x++, m.call(_, k).then(function(M) {
P || (P = !0, y[D] = { status: "fulfilled", value: M }, --x || b(y));
}, function(M) {
P || (P = !0, y[D] = { status: "rejected", reason: M }, --x || b(y));
});
}), --x || b(y);
});
return w.error && A(w.value), S.promise;
} });
}, function(i, r, n) {
var a = n(5), s = n(43), u = n(109), d = n(11), h = n(36), p = n(116), g = n(119), _ = n(53), S = !!u && d(function() {
u.prototype.finally.call({ then: function() {
} }, function() {
});
});
a({ target: "Promise", proto: !0, real: !0, forced: S }, { finally: function(A) {
var w = p(this, h("Promise")), m = typeof A == "function";
return this.then(m ? function(y) {
return g(w, A()).then(function() {
return y;
});
} : A, m ? function(y) {
return g(w, A()).then(function() {
throw y;
});
} : A);
} }), !s && typeof u == "function" && !u.prototype.finally && _(u.prototype, "finally", h("Promise").prototype.finally);
}, function(i, r, n) {
n(54);
var a = n(181), s = n(65), u = Array.prototype, d = { DOMTokenList: !0, NodeList: !0 };
i.exports = function(h) {
var p = h.forEach;
return h === u || h instanceof Array && p === u.forEach || d.hasOwnProperty(s(h)) ? a : p;
};
}, function(i, r, n) {
var a = n(182);
i.exports = a;
}, function(i, r, n) {
n(183);
var a = n(15);
i.exports = a("Array").forEach;
}, function(i, r, n) {
var a = n(5), s = n(184);
a({ target: "Array", proto: !0, forced: [].forEach != s }, { forEach: s });
}, function(i, r, n) {
var a = n(32).forEach, s = n(67), u = n(22), d = s("forEach"), h = u("forEach");
i.exports = !d || !h ? function(g) {
return a(this, g, arguments.length > 1 ? arguments[1] : void 0);
} : [].forEach;
}, function(i, r, n) {
var a = n(186);
i.exports = a;
}, function(i, r, n) {
n(187);
var a = n(9);
i.exports = a.Array.isArray;
}, function(i, r, n) {
var a = n(5), s = n(55);
a({ target: "Array", stat: !0 }, { isArray: s });
}, function(i, r, n) {
var a = n(189);
i.exports = a;
}, function(i, r, n) {
var a = n(190), s = Array.prototype;
i.exports = function(u) {
var d = u.map;
return u === s || u instanceof Array && d === s.map ? a : d;
};
}, function(i, r, n) {
n(191);
var a = n(15);
i.exports = a("Array").map;
}, function(i, r, n) {
var a = n(5), s = n(32).map, u = n(56), d = n(22), h = u("map"), p = d("map");
a({ target: "Array", proto: !0, forced: !h || !p }, { map: function(_) {
return s(this, _, arguments.length > 1 ? arguments[1] : void 0);
} });
}, function(i, r, n) {
var a = n(193);
i.exports = a;
}, function(i, r, n) {
var a = n(194), s = String.prototype;
i.exports = function(u) {
var d = u.trim;
return typeof u == "string" || u === s || u instanceof String && d === s.trim ? a : d;
};
}, function(i, r, n) {
n(195);
var a = n(15);
i.exports = a("String").trim;
}, function(i, r, n) {
var a = n(5), s = n(90).trim, u = n(196);
a({ target: "String", proto: !0, forced: u("trim") }, { trim: function() {
return s(this);
} });
}, function(i, r, n) {
var a = n(11), s = n(68), u = "\u200B\x85\u180E";
i.exports = function(d) {
return a(function() {
return !!s[d]() || u[d]() != u || s[d].name !== d;
});
};
}, function(i, r, n) {
var a = n(198);
i.exports = a;
}, function(i, r, n) {
n(199), n(61), n(50), n(54);
var a = n(9);
i.exports = a.Map;
}, function(i, r, n) {
var a = n(122), s = n(124);
i.exports = a("Map", function(u) {
return function() {
return u(this, arguments.length ? arguments[0] : void 0);
};
}, s);
}, function(i, r, n) {
var a = n(11);
i.exports = !a(function() {
return Object.isExtensible(Object.preventExtensions({}));
});
}, function(i, r, n) {
var a = n(202);
i.exports = a;
}, function(i, r, n) {
var a = n(203), s = Array.prototype;
i.exports = function(u) {
var d = u.indexOf;
return u === s || u instanceof Array && d === s.indexOf ? a : d;
};
}, function(i, r, n) {
n(204);
var a = n(15);
i.exports = a("Array").indexOf;
}, function(i, r, n) {
var a = n(5), s = n(78).indexOf, u = n(67), d = n(22), h = [].indexOf, p = !!h && 1 / [1].indexOf(1, -0) < 0, g = u("indexOf"), _ = d("indexOf", { ACCESSORS: !0, 1: 0 });
a({ target: "Array", proto: !0, forced: p || !g || !_ }, { indexOf: function(b) {
return p ? h.apply(this, arguments) || 0 : s(this, b, arguments.length > 1 ? arguments[1] : void 0);
} });
}, function(i, r, n) {
var a = n(206);
i.exports = a;
}, function(i, r, n) {
var a = n(207), s = Array.prototype;
i.exports = function(u) {
var d = u.splice;
return u === s || u instanceof Array && d === s.splice ? a : d;
};
}, function(i, r, n) {
n(208);
var a = n(15);
i.exports = a("Array").splice;
}, function(i, r, n) {
var a = n(5), s = n(79), u = n(62), d = n(35), h = n(31), p = n(88), g = n(69), _ = n(56), S = n(22), b = _("splice"), A = S("splice", { ACCESSORS: !0, 0: 0, 1: 2 }), w = Math.max, m = Math.min, y = 9007199254740991, E = "Maximum allowed length exceeded";
a({ target: "Array", proto: !0, forced: !b || !A }, { splice: function(k, D) {
var P = h(this), M = d(P.length), B = s(k, M), T = arguments.length, $, V, z, H, I, U;
if (T === 0 ? $ = V = 0 : T === 1 ? ($ = 0, V = M - B) : ($ = T - 2, V = m(w(u(D), 0), M - B)), M + $ - V > y)
throw TypeError(E);
for (z = p(P, V), H = 0; H < V; H++)
I = B + H, I in P && g(z, H, P[I]);
if (z.length = V, $ < V) {
for (H = B; H < M - V; H++)
I = H + V, U = H + $, I in P ? P[U] = P[I] : delete P[U];
for (H = M; H > M - V + $; H--)
delete P[H - 1];
} else if ($ > V)
for (H = M - V; H > B; H--)
I = H + V - 1, U = H + $ - 1, I in P ? P[U] = P[I] : delete P[U];
for (H = 0; H < $; H++)
P[H + B] = arguments[H + 2];
return P.length = M - V + $, z;
} });
}, function(i, r, n) {
var a = n(210);
i.exports = a;
}, function(i, r, n) {
var a = n(211), s = Array.prototype;
i.exports = function(u) {
var d = u.filter;
return u === s || u instanceof Array && d === s.filter ? a : d;
};
}, function(i, r, n) {
n(212);
var a = n(15);
i.exports = a("Array").filter;
}, function(i, r, n) {
var a = n(5), s = n(32).filter, u = n(56), d = n(22), h = u("filter"), p = d("filter");
a({ target: "Array", proto: !0, forced: !h || !p }, { filter: function(_) {
return s(this, _, arguments.length > 1 ? arguments[1] : void 0);
} });
}, function(i, r, n) {
var a = n(214);
i.exports = a;
}, function(i, r, n) {
var a = n(215), s = n(217), u = Array.prototype, d = String.prototype;
i.exports = function(h) {
var p = h.includes;
return h === u || h instanceof Array && p === u.includes ? a : typeof h == "string" || h === d || h instanceof String && p === d.includes ? s : p;
};
}, function(i, r, n) {
n(216);
var a = n(15);
i.exports = a("Array").includes;
}, function(i, r, n) {
var a = n(5), s = n(78).includes, u = n(82), d = n(22), h = d("indexOf", { ACCESSORS: !0, 1: 0 });
a({ target: "Array", proto: !0, forced: !h }, { includes: function(g) {
return s(this, g, arguments.length > 1 ? arguments[1] : void 0);
} }), u("includes");
}, function(i, r, n) {
n(218);
var a = n(15);
i.exports = a("String").includes;
}, function(i, r, n) {
var a = n(5), s = n(219), u = n(49), d = n(221);
a({ target: "String", proto: !0, forced: !d("includes") }, { includes: function(p) {
return !!~String(u(this)).indexOf(s(p), arguments.length > 1 ? arguments[1] : void 0);
} });
}, function(i, r, n) {
var a = n(220);
i.exports = function(s) {
if (a(s))
throw TypeError("The method doesn't accept regular expressions");
return s;
};
}, function(i, r, n) {
var a = n(13), s = n(34), u = n(10), d = u("match");
i.exports = function(h) {
var p;
return a(h) && ((p = h[d]) !== void 0 ? !!p : s(h) == "RegExp");
};
}, function(i, r, n) {
var a = n(10), s = a("match");
i.exports = function(u) {
var d = /./;
try {
"/./"[u](d);
} catch {
try {
return d[s] = !1, "/./"[u](d);
} catch {
}
}
return !1;
};
}, function(i, r, n) {
var a = n(223);
i.exports = a;
}, function(i, r, n) {
var a = n(224), s = Function.prototype;
i.exports = function(u) {
var d = u.bind;
return u === s || u instanceof Function && d === s.bind ? a : d;
};
}, function(i, r, n) {
n(225);
var a = n(15);
i.exports = a("Function").bind;
}, function(i, r, n) {
var a = n(5), s = n(226);
a({ target: "Function", proto: !0 }, { bind: s });
}, function(i, r, n) {
var a = n(41), s = n(13), u = [].slice, d = {}, h = function(g, _, S) {
if (!(_ in d)) {
for (var b = [], A = 0; A < _; A++)
b[A] = "a[" + A + "]";
d[_] = Function("C,a", "return new C(" + b.join(",") + ")");
}
return d[_](g, S);
};
i.exports = Function.bind || function(g) {
var _ = a(this), S = u.call(arguments, 1), b = function() {
var w = S.concat(u.call(arguments));
return this instanceof b ? h(_, w.length, w) : _.apply(g, w);
};
return s(_.prototype) && (b.prototype = _.prototype), b;
};
}, function(i, r, n) {
i.exports = n(228);
}, function(i, r, n) {
var a = n(229);
i.exports = a;
}, function(i, r, n) {
n(125), n(50), n(54);
var a = n(93);
i.exports = a.f("iterator");
}, function(i, r, n) {
i.exports = n(231);
}, function(i, r, n) {
var a = n(232);
n(251), n(252), n(253), n(254), n(255), i.exports = a;
}, function(i, r, n) {
n(233), n(61), n(234), n(236), n(237), n(238), n(239), n(125), n(240), n(241), n(242), n(243), n(244), n(245), n(246), n(247), n(248), n(249), n(250);
var a = n(9);
i.exports = a.Symbol;
}, function(i, r, n) {
var a = n(5), s = n(11), u = n(55), d = n(13), h = n(31), p = n(35), g = n(69), _ = n(88), S = n(56), b = n(10), A = n(86), w = b("isConcatSpreadable"), m = 9007199254740991, y = "Maximum allowed index exceeded", E = A >= 51 || !s(function() {
var P = [];
return P[w] = !1, P.concat()[0] !== P;
}), x = S("concat"), k = function(M) {
if (!d(M))
return !1;
var B = M[w];
return B !== void 0 ? !!B : u(M);
}, D = !E || !x;
a({ target: "Array", proto: !0, forced: D }, { concat: function(M) {
var B = h(this), T = _(B, 0), $ = 0, V, z, H, I, U;
for (V = -1, H = arguments.length; V < H; V++)
if (U = V === -1 ? B : arguments[V], k(U)) {
if (I = p(U.length), $ + I > m)
throw TypeError(y);
for (z = 0; z < I; z++, $++)
z in U && g(T, $, U[z]);
} else {
if ($ >= m)
throw TypeError(y);
g(T, $++, U);
}
return T.length = $, T;
} });
}, function(i, r, n) {
var a = n(5), s = n(8), u = n(36), d = n(43), h = n(14), p = n(76), g = n(106), _ = n(11), S = n(16), b = n(55), A = n(13), w = n(25), m = n(31), y = n(30), E = n(60), x = n(48), k = n(77), D = n(52), P = n(126), M = n(235), B = n(127), T = n(71), $ = n(18), V = n(59), z = n(19), H = n(53), I = n(74), U = n(63), F = n(51), C = n(64), q = n(10), X = n(93), Y = n(12), ue = n(37), ee = n(42), pe = n(32).forEach, Te = U("hidden"), ve = "Symbol", me = "prototype", we = q("toPrimitive"), he = ee.set, Se = ee.getterFor(ve), xe = Object[me], O = s.Symbol, K = u("JSON", "stringify"), J = T.f, ne = $.f, re = M.f, fe = V.f, Ae = I("symbols"), Fe = I("op-symbols"), Xe = I("string-to-symbol-registry"), Ze = I("symbol-to-string-registry"), be = I("wks"), Le = s.QObject, ke = !Le || !Le[me] || !Le[me].findChild, it = h && _(function() {
return k(ne({}, "a", { get: function() {
return ne(this, "a", { value: 7 }).a;
} })).a != 7;
}) ? function(We, Re, dt) {
var lt = J(xe, Re);
lt && delete xe[Re], ne(We, Re, dt), lt && We !== xe && ne(xe, Re, lt);
} : ne, pt = function(Re, dt) {
var lt = Ae[Re] = k(O[me]);
return he(lt, { type: ve, tag: Re, description: dt }), h || (lt.description = dt), lt;
}, De = g ? function(We) {
return gn(We) == "symbol";
} : function(We) {
return Object(We) instanceof O;
}, ze = function(Re, dt, lt) {
Re === xe && ze(Fe, dt, lt), w(Re);
var st = E(dt, !0);
return w(lt), S(Ae, st) ? (lt.enumerable ? (S(Re, Te) && Re[Te][st] && (Re[Te][st] = !1), lt = k(lt, { enumerable: x(0, !1) })) : (S(Re, Te) || ne(Re, Te, x(1, {})), Re[Te][st] = !0), it(Re, st, lt)) : ne(Re, st, lt);
}, at = function(Re, dt) {
w(Re);
var lt = y(dt), st = D(lt).concat(Je(lt));
return pe(st, function(Ct) {
(!h || Rt.call(lt, Ct)) && ze(Re, Ct, lt[Ct]);
}), Re;
}, He = function(Re, dt) {
return dt === void 0 ? k(Re) : at(k(Re), dt);
}, Rt = function(Re) {
var dt = E(Re, !0), lt = fe.call(this, dt);
return this === xe && S(Ae, dt) && !S(Fe, dt) ? !1 : lt || !S(this, dt) || !S(Ae, dt) || S(this, Te) && this[Te][dt] ? lt : !0;
}, ft = function(Re, dt) {
var lt = y(Re), st = E(dt, !0);
if (!(lt === xe && S(Ae, st) && !S(Fe, st))) {
var Ct = J(lt, st);
return Ct && S(Ae, st) && !(S(lt, Te) && lt[Te][st]) && (Ct.enumerable = !0), Ct;
}
}, Be = function(Re) {
var dt = re(y(Re)), lt = [];
return pe(dt, function(st) {
!S(Ae, st) && !S(F, st) && lt.push(st);
}), lt;
}, Je = function(Re) {
var dt = Re === xe, lt = re(dt ? Fe : y(Re)), st = [];
return pe(lt, function(Ct) {
S(Ae, Ct) && (!dt || S(xe, Ct)) && st.push(Ae[Ct]);
}), st;
};
if (p || (O = function() {
if (this instanceof O)
throw TypeError("Symbol is not a constructor");
var Re = !arguments.length || arguments[0] === void 0 ? void 0 : String(arguments[0]), dt = C(Re), lt = function st(Ct) {
this === xe && st.call(Fe, Ct), S(this, Te) && S(this[Te], dt) && (this[Te][dt] = !1), it(this, dt, x(1, Ct));
};
return h && ke && it(xe, dt, { configurable: !0, set: lt }), pt(dt, Re);
}, H(O[me], "toString", function() {
return Se(this).tag;
}), H(O, "withoutSetter", function(We) {
return pt(C(We), We);
}), V.f = Rt, $.f = ze, T.f = ft, P.f = M.f = Be, B.f = Je, X.f = function(We) {
return pt(q(We), We);
}, h && (ne(O[me], "description", { configurable: !0, get: function() {
return Se(this).description;
} }), d || H(xe, "propertyIsEnumerable", Rt, { unsafe: !0 }))), a({ global: !0, wrap: !0, forced: !p, sham: !p }, { Symbol: O }), pe(D(be), function(We) {
Y(We);
}), a({ target: ve, stat: !0, forced: !p }, {
for: function(Re) {
var dt = String(Re);
if (S(Xe, dt))
return Xe[dt];
var lt = O(dt);
return Xe[dt] = lt, Ze[lt] = dt, lt;
},
keyFor: function(Re) {
if (!De(Re))
throw TypeError(Re + " is not a symbol");
if (S(Ze, Re))
return Ze[Re];
},
useSetter: function() {
ke = !0;
},
useSimple: function() {
ke = !1;
}
}), a({ target: "Object", stat: !0, forced: !p, sham: !h }, {
create: He,
defineProperty: ze,
defineProperties: at,
getOwnPropertyDescriptor: ft
}), a({ target: "Object", stat: !0, forced: !p }, {
getOwnPropertyNames: Be,
getOwnPropertySymbols: Je
}), a({ target: "Object", stat: !0, forced: _(function() {
B.f(1);
}) }, { getOwnPropertySymbols: function(Re) {
return B.f(m(Re));
} }), K) {
var ht = !p || _(function() {
var We = O();
return K([We]) != "[null]" || K({ a: We }) != "{}" || K(Object(We)) != "{}";
});
a({ target: "JSON", stat: !0, forced: ht }, {
stringify: function(Re, dt, lt) {
for (var st = [Re], Ct = 1, Fn; arguments.length > Ct; )
st.push(arguments[Ct++]);
if (Fn = dt, !(!A(dt) && Re === void 0 || De(Re)))
return b(dt) || (dt = function(Ut, It) {
if (typeof Fn == "function" && (It = Fn.call(this, Ut, It)), !De(It))
return It;
}), st[1] = dt, K.apply(null, st);
}
});
}
O[me][we] || z(O[me], we, O[me].valueOf), ue(O, ve), F[Te] = !0;
}, function(i, r, n) {
var a = n(30), s = n(126).f, u = {}.toString, d = (typeof window > "u" ? "undefined" : gn(window)) == "object" && window && Object.getOwnPropertyNames ? Object.getOwnPropertyNames(window) : [], h = function(g) {
try {
return s(g);
} catch {
return d.slice();
}
};
i.exports.f = function(g) {
return d && u.call(g) == "[object Window]" ? h(g) : s(a(g));
};
}, function(i, r, n) {
var a = n(12);
a("asyncIterator");
}, function(i, r) {
}, function(i, r, n) {
var a = n(12);
a("hasInstance");
}, function(i, r, n) {
var a = n(12);
a("isConcatSpreadable");
}, function(i, r, n) {
var a = n(12);
a("match");
}, function(i, r, n) {
var a = n(12);
a("matchAll");
}, function(i, r, n) {
var a = n(12);
a("replace");
}, function(i, r, n) {
var a = n(12);
a("search");
}, function(i, r, n) {
var a = n(12);
a("species");
}, function(i, r, n) {
var a = n(12);
a("split");
}, function(i, r, n) {
var a = n(12);
a("toPrimitive");
}, function(i, r, n) {
var a = n(12);
a("toStringTag");
}, function(i, r, n) {
var a = n(12);
a("unscopables");
}, function(i, r, n) {
var a = n(37);
a(Math, "Math", !0);
}, function(i, r, n) {
var a = n(8), s = n(37);
s(a.JSON, "JSON", !0);
}, function(i, r, n) {
var a = n(12);
a("asyncDispose");
}, function(i, r, n) {
var a = n(12);
a("dispose");
}, function(i, r, n) {
var a = n(12);
a("observable");
}, function(i, r, n) {
var a = n(12);
a("patternMatch");
}, function(i, r, n) {
var a = n(12);
a("replaceAll");
}, function(i, r, n) {
i.exports = n(257);
}, function(i, r, n) {
var a = n(258);
i.exports = a;
}, function(i, r, n) {
n(259);
var a = n(9);
i.exports = a.parseInt;
}, function(i, r, n) {
var a = n(5), s = n(260);
a({ global: !0, forced: parseInt != s }, { parseInt: s });
}, function(i, r, n) {
var a = n(8), s = n(90).trim, u = n(68), d = a.parseInt, h = /^[+-]?0[Xx]/, p = d(u + "08") !== 8 || d(u + "0x16") !== 22;
i.exports = p ? function(_, S) {
var b = s(String(_));
return d(b, S >>> 0 || (h.test(b) ? 16 : 10));
} : d;
}, function(i, r, n) {
var a = n(262);
i.exports = a;
}, function(i, r, n) {
var a = n(263), s = Array.prototype;
i.exports = function(u) {
var d = u.slice;
return u === s || u instanceof Array && d === s.slice ? a : d;
};
}, function(i, r, n) {
n(264);
var a = n(15);
i.exports = a("Array").slice;
}, function(i, r, n) {
var a = n(5), s = n(13), u = n(55), d = n(79), h = n(35), p = n(30), g = n(69), _ = n(10), S = n(56), b = n(22), A = S("slice"), w = b("slice", { ACCESSORS: !0, 0: 0, 1: 2 }), m = _("species"), y = [].slice, E = Math.max;
a({ target: "Array", proto: !0, forced: !A || !w }, { slice: function(k, D) {
var P = p(this), M = h(P.length), B = d(k, M), T = d(D === void 0 ? M : D, M), $, V, z;
if (u(P) && ($ = P.constructor, typeof $ == "function" && ($ === Array || u($.prototype)) ? $ = void 0 : s($) && ($ = $[m], $ === null && ($ = void 0)), $ === Array || $ === void 0))
return y.call(P, B, T);
for (V = new ($ === void 0 ? Array : $)(E(T - B, 0)), z = 0; B < T; B++, z++)
B in P && g(V, z, P[B]);
return V.length = z, V;
} });
}, function(i, r, n) {
n(266);
var a = n(9);
i.exports = a.setTimeout;
}, function(i, r, n) {
var a = n(5), s = n(8), u = n(84), d = [].slice, h = /MSIE .\./.test(u), p = function(_) {
return function(S, b) {
var A = arguments.length > 2, w = A ? d.call(arguments, 2) : void 0;
return _(A ? function() {
(typeof S == "function" ? S : Function(S)).apply(this, w);
} : S, b);
};
};
a({ global: !0, bind: !0, forced: h }, {
setTimeout: p(s.setTimeout),
setInterval: p(s.setInterval)
});
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(128));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(272)), p = d.__importDefault(n(273)), g = d.__importDefault(n(129)), _ = d.__importDefault(n(274)), S = d.__importDefault(n(275)), b = d.__importDefault(n(276)), A = d.__importDefault(n(130)), w = d.__importDefault(n(277)), m = d.__importDefault(n(278)), y = d.__importDefault(n(279)), E = (0, u.default)(
{},
h.default,
p.default,
g.default,
S.default,
_.default,
b.default,
A.default,
w.default,
m.default,
y.default,
{ linkCheck: function(k, D) {
return !0;
} }
);
r.default = E;
}, function(i, r, n) {
var a = n(269);
i.exports = a;
}, function(i, r, n) {
n(270);
var a = n(9);
i.exports = a.Object.assign;
}, function(i, r, n) {
var a = n(5), s = n(271);
a({ target: "Object", stat: !0, forced: Object.assign !== s }, { assign: s });
}, function(i, r, n) {
var a = n(14), s = n(11), u = n(52), d = n(127), h = n(59), p = n(31), g = n(72), _ = Object.assign, S = Object.defineProperty;
i.exports = !_ || s(function() {
if (a && _({ b: 1 }, _(S({}, "a", { enumerable: !0, get: function() {
S(this, "b", { value: 3, enumerable: !1 });
} }), { b: 2 })).b !== 1)
return !0;
var b = {}, A = {}, w = Symbol(), m = "abcdefghijklmnopqrst";
return b[w] = 7, m.split("").forEach(function(y) {
A[y] = y;
}), _({}, b)[w] != 7 || u(_({}, A)).join("") != m;
}) ? function(A, w) {
for (var m = p(A), y = arguments.length, E = 1, x = d.f, k = h.f; y > E; )
for (var D = g(arguments[E++]), P = x ? u(D).concat(x(D)) : u(D), M = P.length, B = 0, T; M > B; )
T = P[B++], (!a || k.call(D, T)) && (m[T] = D[T]);
return m;
} : _;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 }), r.default = {
menus: [
"head",
"bold",
"fontSize",
"fontName",
"italic",
"underline",
"strikeThrough",
"indent",
"lineHeight",
"foreColor",
"backColor",
"link",
"list",
"todo",
"justify",
"quote",
"emoticon",
"image",
"video",
"table",
"code",
"splitLine",
"undo",
"redo"
],
fontNames: ["\u9ED1\u4F53", "\u4EFF\u5B8B", "\u6977\u4F53", "\u6807\u6977\u4F53", "\u534E\u6587\u4EFF\u5B8B", "\u534E\u6587\u6977\u4F53", "\u5B8B\u4F53", "\u5FAE\u8F6F\u96C5\u9ED1", "Arial", "Tahoma", "Verdana", "Times New Roman", "Courier New"],
fontSizes: { "x-small": { name: "10px", value: "1" }, small: { name: "13px", value: "2" }, normal: { name: "16px", value: "3" }, large: { name: "18px", value: "4" }, "x-large": { name: "24px", value: "5" }, "xx-large": { name: "32px", value: "6" }, "xxx-large": { name: "48px", value: "7" } },
colors: ["#000000", "#ffffff", "#eeece0", "#1c487f", "#4d80bf", "#c24f4a", "#8baa4a", "#7b5ba1", "#46acc8", "#f9963b"],
languageType: ["Bash", "C", "C#", "C++", "CSS", "Java", "JavaScript", "JSON", "TypeScript", "Plain text", "Html", "XML", "SQL", "Go", "Kotlin", "Lua", "Markdown", "PHP", "Python", "Shell Session", "Ruby"],
languageTab: "\u3000\u3000\u3000\u3000",
emotions: [{
title: "\u8868\u60C5",
type: "emoji",
content: "\u{1F600} \u{1F603} \u{1F604} \u{1F601} \u{1F606} \u{1F605} \u{1F602} \u{1F923} \u{1F60A} \u{1F607} \u{1F642} \u{1F643} \u{1F609} \u{1F60C} \u{1F60D} \u{1F618} \u{1F617} \u{1F619} \u{1F61A} \u{1F60B} \u{1F61B} \u{1F61D} \u{1F61C} \u{1F913} \u{1F60E} \u{1F60F} \u{1F612} \u{1F61E} \u{1F614} \u{1F61F} \u{1F615} \u{1F641} \u{1F623} \u{1F616} \u{1F62B} \u{1F629} \u{1F622} \u{1F62D} \u{1F624} \u{1F620} \u{1F621} \u{1F633} \u{1F631} \u{1F628} \u{1F917} \u{1F914} \u{1F636} \u{1F611} \u{1F62C} \u{1F644} \u{1F62F} \u{1F634} \u{1F637} \u{1F911} \u{1F608} \u{1F921} \u{1F4A9} \u{1F47B} \u{1F480} \u{1F440} \u{1F463}".split(/\s/)
}, {
title: "\u624B\u52BF",
type: "emoji",
content: "\u{1F450} \u{1F64C} \u{1F44F} \u{1F91D} \u{1F44D} \u{1F44E} \u{1F44A} \u270A \u{1F91B} \u{1F91C} \u{1F91E} \u270C\uFE0F \u{1F918} \u{1F44C} \u{1F448} \u{1F449} \u{1F446} \u{1F447} \u261D\uFE0F \u270B \u{1F91A} \u{1F590} \u{1F596} \u{1F44B} \u{1F919} \u{1F4AA} \u{1F595} \u270D\uFE0F \u{1F64F}".split(/\s/)
}],
lineHeights: ["1", "1.15", "1.6", "2", "2.5", "3"],
undoLimit: 20,
indentation: "2em",
showMenuTooltips: !0,
menuTooltipPosition: "up"
};
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(7);
function d(h, p, g) {
window.alert(h), g && console.error("wangEditor: " + g);
}
r.default = { onchangeTimeout: 200, onchange: null, onfocus: u.EMPTY_FN, onblur: u.EMPTY_FN, onCatalogChange: null, customAlert: d };
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 }), r.default = {
pasteFilterStyle: !0,
pasteIgnoreImg: !1,
pasteTextHandle: function(d) {
return d;
}
};
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 }), r.default = { styleWithCSS: !1 };
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(7);
r.default = {
linkImgCheck: function(h, p, g) {
return !0;
},
showLinkImg: !0,
showLinkImgAlt: !0,
showLinkImgHref: !0,
linkImgCallback: u.EMPTY_FN,
uploadImgAccept: ["jpg", "jpeg", "png", "gif", "bmp"],
uploadImgServer: "",
uploadImgShowBase64: !1,
uploadImgMaxSize: 5 * 1024 * 1024,
uploadImgMaxLength: 100,
uploadFileName: "",
uploadImgParams: {},
uploadImgParamsWithUrl: !1,
uploadImgHeaders: {},
uploadImgHooks: {},
uploadImgTimeout: 10 * 1e3,
withCredentials: !1,
customUploadImg: null,
uploadImgFromMedia: null
};
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 }), r.default = { lang: "zh-CN", languages: { "zh-CN": { wangEditor: { \u91CD\u7F6E: "\u91CD\u7F6E", \u63D2\u5165: "\u63D2\u5165", \u9ED8\u8BA4: "\u9ED8\u8BA4", \u521B\u5EFA: "\u521B\u5EFA", \u4FEE\u6539: "\u4FEE\u6539", \u5982: "\u5982", \u8BF7\u8F93\u5165\u6B63\u6587: "\u8BF7\u8F93\u5165\u6B63\u6587", menus: { title: { \u6807\u9898: "\u6807\u9898", \u52A0\u7C97: "\u52A0\u7C97", \u5B57\u53F7: "\u5B57\u53F7", \u5B57\u4F53: "\u5B57\u4F53", \u659C\u4F53: "\u659C\u4F53", \u4E0B\u5212\u7EBF: "\u4E0B\u5212\u7EBF", \u5220\u9664\u7EBF: "\u5220\u9664\u7EBF", \u7F29\u8FDB: "\u7F29\u8FDB", \u884C\u9AD8: "\u884C\u9AD8", \u6587\u5B57\u989C\u8272: "\u6587\u5B57\u989C\u8272", \u80CC\u666F\u8272: "\u80CC\u666F\u8272", \u94FE\u63A5: "\u94FE\u63A5", \u5E8F\u5217: "\u5E8F\u5217", \u5BF9\u9F50: "\u5BF9\u9F50", \u5F15\u7528: "\u5F15\u7528", \u8868\u60C5: "\u8868\u60C5", \u56FE\u7247: "\u56FE\u7247", \u89C6\u9891: "\u89C6\u9891", \u8868\u683C: "\u8868\u683C", \u4EE3\u7801: "\u4EE3\u7801", \u5206\u5272\u7EBF: "\u5206\u5272\u7EBF", \u6062\u590D: "\u6062\u590D", \u64A4\u9500: "\u64A4\u9500", \u5168\u5C4F: "\u5168\u5C4F", \u53D6\u6D88\u5168\u5C4F: "\u53D6\u6D88\u5168\u5C4F", \u5F85\u529E\u4E8B\u9879: "\u5F85\u529E\u4E8B\u9879" }, dropListMenu: { \u8BBE\u7F6E\u6807\u9898: "\u8BBE\u7F6E\u6807\u9898", \u80CC\u666F\u989C\u8272: "\u80CC\u666F\u989C\u8272", \u6587\u5B57\u989C\u8272: "\u6587\u5B57\u989C\u8272", \u8BBE\u7F6E\u5B57\u53F7: "\u8BBE\u7F6E\u5B57\u53F7", \u8BBE\u7F6E\u5B57\u4F53: "\u8BBE\u7F6E\u5B57\u4F53", \u8BBE\u7F6E\u7F29\u8FDB: "\u8BBE\u7F6E\u7F29\u8FDB", \u5BF9\u9F50\u65B9\u5F0F: "\u5BF9\u9F50\u65B9\u5F0F", \u8BBE\u7F6E\u884C\u9AD8: "\u8BBE\u7F6E\u884C\u9AD8", \u5E8F\u5217: "\u5E8F\u5217", head: { \u6B63\u6587: "\u6B63\u6587" }, indent: { \u589E\u52A0\u7F29\u8FDB: "\u589E\u52A0\u7F29\u8FDB", \u51CF\u5C11\u7F29\u8FDB: "\u51CF\u5C11\u7F29\u8FDB" }, justify: { \u9760\u5DE6: "\u9760\u5DE6", \u5C45\u4E2D: "\u5C45\u4E2D", \u9760\u53F3: "\u9760\u53F3", \u4E24\u7AEF: "\u4E24\u7AEF" }, list: { \u65E0\u5E8F\u5217\u8868: "\u65E0\u5E8F\u5217\u8868", \u6709\u5E8F\u5217\u8868: "\u6709\u5E8F\u5217\u8868" } }, panelMenus: { emoticon: { \u9ED8\u8BA4: "\u9ED8\u8BA4", \u65B0\u6D6A: "\u65B0\u6D6A", emoji: "emoji", \u624B\u52BF: "\u624B\u52BF" }, image: { \u4E0A\u4F20\u56FE\u7247: "\u4E0A\u4F20\u56FE\u7247", \u7F51\u7EDC\u56FE\u7247: "\u7F51\u7EDC\u56FE\u7247", \u56FE\u7247\u5730\u5740: "\u56FE\u7247\u5730\u5740", \u56FE\u7247\u6587\u5B57\u8BF4\u660E: "\u56FE\u7247\u6587\u5B57\u8BF4\u660E", \u8DF3\u8F6C\u94FE\u63A5: "\u8DF3\u8F6C\u94FE\u63A5" }, link: { \u94FE\u63A5: "\u94FE\u63A5", \u94FE\u63A5\u6587\u5B57: "\u94FE\u63A5\u6587\u5B57", \u53D6\u6D88\u94FE\u63A5: "\u53D6\u6D88\u94FE\u63A5", \u67E5\u770B\u94FE\u63A5: "\u67E5\u770B\u94FE\u63A5" }, video: { \u63D2\u5165\u89C6\u9891: "\u63D2\u5165\u89C6\u9891", \u4E0A\u4F20\u89C6\u9891: "\u4E0A\u4F20\u89C6\u9891" }, table: { \u884C: "\u884C", \u5217: "\u5217", \u7684: "\u7684", \u8868\u683C: "\u8868\u683C", \u6DFB\u52A0\u884C: "\u6DFB\u52A0\u884C", \u5220\u9664\u884C: "\u5220\u9664\u884C", \u6DFB\u52A0\u5217: "\u6DFB\u52A0\u5217", \u5220\u9664\u5217: "\u5220\u9664\u5217", \u8BBE\u7F6E\u8868\u5934: "\u8BBE\u7F6E\u8868\u5934", \u53D6\u6D88\u8868\u5934: "\u53D6\u6D88\u8868\u5934", \u63D2\u5165\u8868\u683C: "\u63D2\u5165\u8868\u683C", \u5220\u9664\u8868\u683C: "\u5220\u9664\u8868\u683C" }, code: { \u5220\u9664\u4EE3\u7801: "\u5220\u9664\u4EE3\u7801", \u4FEE\u6539\u4EE3\u7801: "\u4FEE\u6539\u4EE3\u7801", \u63D2\u5165\u4EE3\u7801: "\u63D2\u5165\u4EE3\u7801" } } }, validate: { \u5F20\u56FE\u7247: "\u5F20\u56FE\u7247", \u5927\u4E8E: "\u5927\u4E8E", \u56FE\u7247\u94FE\u63A5: "\u56FE\u7247\u94FE\u63A5", \u4E0D\u662F\u56FE\u7247: "\u4E0D\u662F\u56FE\u7247", \u8FD4\u56DE\u7ED3\u679C: "\u8FD4\u56DE\u7ED3\u679C", \u4E0A\u4F20\u56FE\u7247\u8D85\u65F6: "\u4E0A\u4F20\u56FE\u7247\u8D85\u65F6", \u4E0A\u4F20\u56FE\u7247\u9519\u8BEF: "\u4E0A\u4F20\u56FE\u7247\u9519\u8BEF", \u4E0A\u4F20\u56FE\u7247\u5931\u8D25: "\u4E0A\u4F20\u56FE\u7247\u5931\u8D25", \u63D2\u5165\u56FE\u7247\u9519\u8BEF: "\u63D2\u5165\u56FE\u7247\u9519\u8BEF", \u4E00\u6B21\u6700\u591A\u4E0A\u4F20: "\u4E00\u6B21\u6700\u591A\u4E0A\u4F20", \u4E0B\u8F7D\u94FE\u63A5\u5931\u8D25: "\u4E0B\u8F7D\u94FE\u63A5\u5931\u8D25", \u56FE\u7247\u9A8C\u8BC1\u672A\u901A\u8FC7: "\u56FE\u7247\u9A8C\u8BC1\u672A\u901A\u8FC7", \u670D\u52A1\u5668\u8FD4\u56DE\u72B6\u6001: "\u670D\u52A1\u5668\u8FD4\u56DE\u72B6\u6001", \u4E0A\u4F20\u56FE\u7247\u8FD4\u56DE\u7ED3\u679C\u9519\u8BEF: "\u4E0A\u4F20\u56FE\u7247\u8FD4\u56DE\u7ED3\u679C\u9519\u8BEF", \u8BF7\u66FF\u6362\u4E3A\u652F\u6301\u7684\u56FE\u7247\u7C7B\u578B: "\u8BF7\u66FF\u6362\u4E3A\u652F\u6301\u7684\u56FE\u7247\u7C7B\u578B", \u60A8\u63D2\u5165\u7684\u7F51\u7EDC\u56FE\u7247\u65E0\u6CD5\u8BC6\u522B: "\u60A8\u63D2\u5165\u7684\u7F51\u7EDC\u56FE\u7247\u65E0\u6CD5\u8BC6\u522B", \u60A8\u521A\u624D\u63D2\u5165\u7684\u56FE\u7247\u94FE\u63A5\u672A\u901A\u8FC7\u7F16\u8F91\u5668\u6821\u9A8C: "\u60A8\u521A\u624D\u63D2\u5165\u7684\u56FE\u7247\u94FE\u63A5\u672A\u901A\u8FC7\u7F16\u8F91\u5668\u6821\u9A8C", \u63D2\u5165\u89C6\u9891\u9519\u8BEF: "\u63D2\u5165\u89C6\u9891\u9519\u8BEF", \u89C6\u9891\u94FE\u63A5: "\u89C6\u9891\u94FE\u63A5", \u4E0D\u662F\u89C6\u9891: "\u4E0D\u662F\u89C6\u9891", \u89C6\u9891\u9A8C\u8BC1\u672A\u901A\u8FC7: "\u89C6\u9891\u9A8C\u8BC1\u672A\u901A\u8FC7", \u4E2A\u89C6\u9891: "\u4E2A\u89C6\u9891", \u4E0A\u4F20\u89C6\u9891\u8D85\u65F6: "\u4E0A\u4F20\u89C6\u9891\u8D85\u65F6", \u4E0A\u4F20\u89C6\u9891\u9519\u8BEF: "\u4E0A\u4F20\u89C6\u9891\u9519\u8BEF", \u4E0A\u4F20\u89C6\u9891\u5931\u8D25: "\u4E0A\u4F20\u89C6\u9891\u5931\u8D25", \u4E0A\u4F20\u89C6\u9891\u8FD4\u56DE\u7ED3\u679C\u9519\u8BEF: "\u4E0A\u4F20\u89C6\u9891\u8FD4\u56DE\u7ED3\u679C\u9519\u8BEF" } } }, en: { wangEditor: { \u91CD\u7F6E: "reset", \u63D2\u5165: "insert", \u9ED8\u8BA4: "default", \u521B\u5EFA: "create", \u4FEE\u6539: "edit", \u5982: "like", \u8BF7\u8F93\u5165\u6B63\u6587: "please enter the text", menus: { title: { \u6807\u9898: "head", \u52A0\u7C97: "bold", \u5B57\u53F7: "font size", \u5B57\u4F53: "font family", \u659C\u4F53: "italic", \u4E0B\u5212\u7EBF: "underline", \u5220\u9664\u7EBF: "strikethrough", \u7F29\u8FDB: "indent", \u884C\u9AD8: "line heihgt", \u6587\u5B57\u989C\u8272: "font color", \u80CC\u666F\u8272: "background", \u94FE\u63A5: "link", \u5E8F\u5217: "numbered list", \u5BF9\u9F50: "align", \u5F15\u7528: "quote", \u8868\u60C5: "emoticons", \u56FE\u7247: "image", \u89C6\u9891: "media", \u8868\u683C: "table", \u4EE3\u7801: "code", \u5206\u5272\u7EBF: "split line", \u6062\u590D: "redo", \u64A4\u9500: "undo", \u5168\u5C4F: "fullscreen", \u53D6\u6D88\u5168\u5C4F: "cancel fullscreen", \u5F85\u529E\u4E8B\u9879: "todo" }, dropListMenu: { \u8BBE\u7F6E\u6807\u9898: "title", \u80CC\u666F\u989C\u8272: "background", \u6587\u5B57\u989C\u8272: "font color", \u8BBE\u7F6E\u5B57\u53F7: "font size", \u8BBE\u7F6E\u5B57\u4F53: "font family", \u8BBE\u7F6E\u7F29\u8FDB: "indent", \u5BF9\u9F50\u65B9\u5F0F: "align", \u8BBE\u7F6E\u884C\u9AD8: "line heihgt", \u5E8F\u5217: "list", head: { \u6B63\u6587: "text" }, indent: { \u589E\u52A0\u7F29\u8FDB: "indent", \u51CF\u5C11\u7F29\u8FDB: "outdent" }, justify: { \u9760\u5DE6: "left", \u5C45\u4E2D: "center", \u9760\u53F3: "right", \u4E24\u7AEF: "justify" }, list: { \u65E0\u5E8F\u5217\u8868: "unordered", \u6709\u5E8F\u5217\u8868: "ordered" } }, panelMenus: { emoticon: { \u8868\u60C5: "emoji", \u624B\u52BF: "gesture" }, image: { \u4E0A\u4F20\u56FE\u7247: "upload image", \u7F51\u7EDC\u56FE\u7247: "network image", \u56FE\u7247\u5730\u5740: "image link", \u56FE\u7247\u6587\u5B57\u8BF4\u660E: "image alt", \u8DF3\u8F6C\u94FE\u63A5: "hyperlink" }, link: { \u94FE\u63A5: "link", \u94FE\u63A5\u6587\u5B57: "link text", \u53D6\u6D88\u94FE\u63A5: "unlink", \u67E5\u770B\u94FE\u63A5: "view links" }, video: { \u63D2\u5165\u89C6\u9891: "insert video", \u4E0A\u4F20\u89C6\u9891: "upload local video" }, table: { \u884C: "rows", \u5217: "columns", \u7684: " ", \u8868\u683C: "table", \u6DFB\u52A0\u884C: "insert row", \u5220\u9664\u884C: "delete row", \u6DFB\u52A0\u5217: "insert column", \u5220\u9664\u5217: "delete column", \u8BBE\u7F6E\u8868\u5934: "set header", \u53D6\u6D88\u8868\u5934: "cancel header", \u63D2\u5165\u8868\u683C: "insert table", \u5220\u9664\u8868\u683C: "delete table" }, code: { \u5220\u9664\u4EE3\u7801: "delete code", \u4FEE\u6539\u4EE3\u7801: "edit code", \u63D2\u5165\u4EE3\u7801: "insert code" } } }, validate: { \u5F20\u56FE\u7247: "images", \u5927\u4E8E: "greater than", \u56FE\u7247\u94FE\u63A5: "image link", \u4E0D\u662F\u56FE\u7247: "is not image", \u8FD4\u56DE\u7ED3\u679C: "return results", \u4E0A\u4F20\u56FE\u7247\u8D85\u65F6: "upload image timeout", \u4E0A\u4F20\u56FE\u7247\u9519\u8BEF: "upload image error", \u4E0A\u4F20\u56FE\u7247\u5931\u8D25: "upload image failed", \u63D2\u5165\u56FE\u7247\u9519\u8BEF: "insert image error", \u4E00\u6B21\u6700\u591A\u4E0A\u4F20: "once most at upload", \u4E0B\u8F7D\u94FE\u63A5\u5931\u8D25: "download link failed", \u56FE\u7247\u9A8C\u8BC1\u672A\u901A\u8FC7: "image validate failed", \u670D\u52A1\u5668\u8FD4\u56DE\u72B6\u6001: "server return status", \u4E0A\u4F20\u56FE\u7247\u8FD4\u56DE\u7ED3\u679C\u9519\u8BEF: "upload image return results error", \u8BF7\u66FF\u6362\u4E3A\u652F\u6301\u7684\u56FE\u7247\u7C7B\u578B: "please replace with a supported image type", \u60A8\u63D2\u5165\u7684\u7F51\u7EDC\u56FE\u7247\u65E0\u6CD5\u8BC6\u522B: "the network picture you inserted is not recognized", \u60A8\u521A\u624D\u63D2\u5165\u7684\u56FE\u7247\u94FE\u63A5\u672A\u901A\u8FC7\u7F16\u8F91\u5668\u6821\u9A8C: "the image link you just inserted did not pass the editor verification", \u63D2\u5165\u89C6\u9891\u9519\u8BEF: "insert video error", \u89C6\u9891\u94FE\u63A5: "video link", \u4E0D\u662F\u89C6\u9891: "is not video", \u89C6\u9891\u9A8C\u8BC1\u672A\u901A\u8FC7: "video validate failed", \u4E2A\u89C6\u9891: "videos", \u4E0A\u4F20\u89C6\u9891\u8D85\u65F6: "upload video timeout", \u4E0A\u4F20\u89C6\u9891\u9519\u8BEF: "upload video error", \u4E0A\u4F20\u89C6\u9891\u5931\u8D25: "upload video failed", \u4E0A\u4F20\u89C6\u9891\u8FD4\u56DE\u7ED3\u679C\u9519\u8BEF: "upload video return results error" } } } } };
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(6);
function d() {
return !!(u.UA.isIE() || u.UA.isOldEdge);
}
r.default = { compatibleMode: d, historyMaxSize: 30 };
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(7);
r.default = {
onlineVideoCheck: function(h) {
return !0;
},
onlineVideoCallback: u.EMPTY_FN,
showLinkVideo: !0,
uploadVideoAccept: ["mp4"],
uploadVideoServer: "",
uploadVideoMaxSize: 1 * 1024 * 1024 * 1024,
uploadVideoName: "",
uploadVideoParams: {},
uploadVideoParamsWithUrl: !1,
uploadVideoHeaders: {},
uploadVideoHooks: {},
uploadVideoTimeout: 1e3 * 60 * 60 * 2,
withVideoCredentials: !1,
customUploadVideo: null,
customInsertVideo: null
};
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(17));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3)), p = n(6), g = n(7), _ = function() {
function S(b) {
this._currentRange = null, this.editor = b;
}
return S.prototype.getRange = function() {
return this._currentRange;
}, S.prototype.saveRange = function(b) {
if (b) {
this._currentRange = b;
return;
}
var A = window.getSelection();
if (A.rangeCount !== 0) {
var w = A.getRangeAt(0), m = this.getSelectionContainerElem(w);
if (!!(m != null && m.length) && !(m.attr("contenteditable") === "false" || m.parentUntil("[contenteditable=false]"))) {
var y = this.editor, E = y.$textElem;
if (E.isContain(m)) {
if (E.elems[0] === m.elems[0]) {
var x;
if ((0, u.default)(x = E.html()).call(x) === g.EMPTY_P) {
var k = E.children(), D = k == null ? void 0 : k.last();
y.selection.createRangeByElem(D, !0, !0), y.selection.restoreSelection();
}
}
this._currentRange = w;
}
}
}
}, S.prototype.collapseRange = function(b) {
b === void 0 && (b = !1);
var A = this._currentRange;
A && A.collapse(b);
}, S.prototype.getSelectionText = function() {
var b = this._currentRange;
return b ? b.toString() : "";
}, S.prototype.getSelectionContainerElem = function(b) {
var A;
A = b || this._currentRange;
var w;
if (A)
return w = A.commonAncestorContainer, h.default(w.nodeType === 1 ? w : w.parentNode);
}, S.prototype.getSelectionStartElem = function(b) {
var A;
A = b || this._currentRange;
var w;
if (A)
return w = A.startContainer, h.default(w.nodeType === 1 ? w : w.parentNode);
}, S.prototype.getSelectionEndElem = function(b) {
var A;
A = b || this._currentRange;
var w;
if (A)
return w = A.endContainer, h.default(w.nodeType === 1 ? w : w.parentNode);
}, S.prototype.isSelectionEmpty = function() {
var b = this._currentRange;
return !!(b && b.startContainer && b.startContainer === b.endContainer && b.startOffset === b.endOffset);
}, S.prototype.restoreSelection = function() {
var b = window.getSelection(), A = this._currentRange;
b && A && (b.removeAllRanges(), b.addRange(A));
}, S.prototype.createEmptyRange = function() {
var b = this.editor, A = this.getRange(), w;
if (!!A && !!this.isSelectionEmpty())
try {
p.UA.isWebkit() ? (b.cmd.do("insertHTML", "&#8203;"), A.setEnd(A.endContainer, A.endOffset + 1), this.saveRange(A)) : (w = h.default("<strong>&#8203;</strong>"), b.cmd.do("insertElem", w), this.createRangeByElem(w, !0));
} catch {
}
}, S.prototype.createRangeByElems = function(b, A) {
var w = window.getSelection ? window.getSelection() : document.getSelection();
w == null || w.removeAllRanges();
var m = document.createRange();
m.setStart(b, 0), m.setEnd(A, A.childNodes.length || 1), this.saveRange(m), this.restoreSelection();
}, S.prototype.createRangeByElem = function(b, A, w) {
if (!!b.length) {
var m = b.elems[0], y = document.createRange();
w ? y.selectNodeContents(m) : y.selectNode(m), A != null && (y.collapse(A), A || (this.saveRange(y), this.editor.selection.moveCursor(m))), this.saveRange(y);
}
}, S.prototype.getSelectionRangeTopNodes = function() {
var b, A, w, m = (b = this.getSelectionStartElem()) === null || b === void 0 ? void 0 : b.getNodeTop(this.editor), y = (A = this.getSelectionEndElem()) === null || A === void 0 ? void 0 : A.getNodeTop(this.editor);
return w = this.recordSelectionNodes(h.default(m), h.default(y)), w;
}, S.prototype.moveCursor = function(b, A) {
var w, m = this.getRange(), y = b.nodeType === 3 ? (w = b.nodeValue) === null || w === void 0 ? void 0 : w.length : b.childNodes.length;
(p.UA.isFirefox || p.UA.isIE()) && y !== 0 && (b.nodeType === 3 || b.childNodes[y - 1].nodeName === "BR") && (y = y - 1);
var E = A != null ? A : y;
!m || b && (m.setStart(b, E), m.setEnd(b, E), this.restoreSelection());
}, S.prototype.getCursorPos = function() {
var b = window.getSelection();
return b == null ? void 0 : b.anchorOffset;
}, S.prototype.clearWindowSelectionRange = function() {
var b = window.getSelection();
b && b.removeAllRanges();
}, S.prototype.recordSelectionNodes = function(b, A) {
var w = [], m = !0;
try {
for (var y = b, E = this.editor.$textElem; m; ) {
var x = y == null ? void 0 : y.getNodeTop(this.editor);
x.getNodeName() === "BODY" && (m = !1), x.length > 0 && (w.push(h.default(y)), (A == null ? void 0 : A.equal(x)) || E.equal(x) ? m = !1 : y = x.getNextSibling());
}
} catch {
m = !1;
}
return w;
}, S.prototype.setRangeToElem = function(b) {
var A = this.getRange();
A == null || A.setStart(b, 0), A == null || A.setEnd(b, 0);
}, S;
}();
r.default = _;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(3)), h = function() {
function p(g) {
this.editor = g;
}
return p.prototype.do = function(g, _) {
var S = this.editor;
S.config.styleWithCSS && document.execCommand("styleWithCSS", !1, "true");
var b = S.selection;
if (!!b.getRange()) {
switch (b.restoreSelection(), g) {
case "insertHTML":
this.insertHTML(_);
break;
case "insertElem":
this.insertElem(_);
break;
default:
this.execCommand(g, _);
break;
}
S.menus.changeActive(), b.saveRange(), b.restoreSelection();
}
}, p.prototype.insertHTML = function(g) {
var _ = this.editor, S = _.selection.getRange();
if (S != null) {
if (this.queryCommandSupported("insertHTML"))
this.execCommand("insertHTML", g);
else if (S.insertNode) {
if (S.deleteContents(), d.default(g).elems.length > 0)
S.insertNode(d.default(g).elems[0]);
else {
var b = document.createElement("p");
b.appendChild(document.createTextNode(g)), S.insertNode(b);
}
_.selection.collapseRange();
}
}
}, p.prototype.insertElem = function(g) {
var _ = this.editor, S = _.selection.getRange();
S != null && S.insertNode && (S.deleteContents(), S.insertNode(g.elems[0]));
}, p.prototype.execCommand = function(g, _) {
document.execCommand(g, !1, _);
}, p.prototype.queryCommandValue = function(g) {
return document.queryCommandValue(g);
}, p.prototype.queryCommandState = function(g) {
return document.queryCommandState(g);
}, p.prototype.queryCommandSupported = function(g) {
return document.queryCommandSupported(g);
}, p;
}();
r.default = h;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(29)), d = a(n(4)), h = a(n(17)), p = a(n(27)), g = a(n(46));
(0, s.default)(r, "__esModule", { value: !0 });
var _ = n(2), S = _.__importDefault(n(3)), b = _.__importDefault(n(287)), A = n(6), w = _.__importDefault(n(299)), m = _.__importDefault(n(300)), y = n(7), E = function() {
function x(k) {
this.editor = k, this.eventHooks = { onBlurEvents: [], changeEvents: [], dropEvents: [], clickEvents: [], keydownEvents: [], keyupEvents: [], tabUpEvents: [], tabDownEvents: [], enterUpEvents: [], enterDownEvents: [], deleteUpEvents: [], deleteDownEvents: [], pasteEvents: [], linkClickEvents: [], codeClickEvents: [], textScrollEvents: [], toolbarClickEvents: [], imgClickEvents: [], imgDragBarMouseDownEvents: [], tableClickEvents: [], menuClickEvents: [], dropListMenuHoverEvents: [], splitLineEvents: [], videoClickEvents: [] };
}
return x.prototype.init = function() {
this._saveRange(), this._bindEventHooks(), b.default(this);
}, x.prototype.togglePlaceholder = function() {
var k, D = this.html(), P = (0, u.default)(k = this.editor.$textContainerElem).call(k, ".placeholder");
P.hide(), !this.editor.isComposing && (!D || D === " ") && P.show();
}, x.prototype.clear = function() {
this.html(y.EMPTY_P);
}, x.prototype.html = function(k) {
var D = this.editor, P = D.$textElem;
if (k == null) {
var M = P.html();
M = M.replace(/\u200b/gm, ""), M = M.replace(/<p><\/p>/gim, ""), M = M.replace(y.EMPTY_P_LAST_REGEX, ""), M = M.replace(y.EMPTY_P_REGEX, "<p>");
var B = M.match(/<(img|br|hr|input)[^>]*>/gi);
return B !== null && (0, d.default)(B).call(B, function(T) {
T.match(/\/>/) || (M = M.replace(T, T.substring(0, T.length - 1) + "/>"));
}), M;
}
k = (0, h.default)(k).call(k), k === "" && (k = y.EMPTY_P), (0, p.default)(k).call(k, "<") !== 0 && (k = "<p>" + k + "</p>"), P.html(k), D.initSelection();
}, x.prototype.setJSON = function(k) {
var D = m.default(k).children(), P = this.editor, M = P.$textElem;
!D || M.replaceChildAll(D);
}, x.prototype.getJSON = function() {
var k = this.editor, D = k.$textElem;
return w.default(D);
}, x.prototype.text = function(k) {
var D = this.editor, P = D.$textElem;
if (k == null) {
var M = P.text();
return M = M.replace(/\u200b/gm, ""), M;
}
P.text("<p>" + k + "</p>"), D.initSelection();
}, x.prototype.append = function(k) {
var D = this.editor;
(0, p.default)(k).call(k, "<") !== 0 && (k = "<p>" + k + "</p>"), this.html(this.html() + k), D.initSelection();
}, x.prototype._saveRange = function() {
var k = this.editor, D = k.$textElem, P = S.default(document);
function M() {
k.selection.saveRange(), k.menus.changeActive();
}
D.on("keyup", M);
function B() {
M(), D.off("click", B);
}
D.on("click", B);
function T() {
M(), P.off("mouseup", T);
}
function $() {
P.on("mouseup", T), D.off("mouseleave", $);
}
D.on("mousedown", function() {
D.on("mouseleave", $);
}), D.on("mouseup", function(V) {
D.off("mouseleave", $), (0, g.default)(function() {
var z = k.selection, H = z.getRange();
H !== null && M();
}, 0);
});
}, x.prototype._bindEventHooks = function() {
var k = this.editor, D = k.$textElem, P = this.eventHooks;
D.on("click", function(B) {
var T = P.clickEvents;
(0, d.default)(T).call(T, function($) {
return $(B);
});
}), D.on("keyup", function(B) {
if (B.keyCode === 13) {
var T = P.enterUpEvents;
(0, d.default)(T).call(T, function($) {
return $(B);
});
}
}), D.on("keyup", function(B) {
var T = P.keyupEvents;
(0, d.default)(T).call(T, function($) {
return $(B);
});
}), D.on("keydown", function(B) {
var T = P.keydownEvents;
(0, d.default)(T).call(T, function($) {
return $(B);
});
}), D.on("keyup", function(B) {
if (!(B.keyCode !== 8 && B.keyCode !== 46)) {
var T = P.deleteUpEvents;
(0, d.default)(T).call(T, function($) {
return $(B);
});
}
}), D.on("keydown", function(B) {
if (!(B.keyCode !== 8 && B.keyCode !== 46)) {
var T = P.deleteDownEvents;
(0, d.default)(T).call(T, function($) {
return $(B);
});
}
}), D.on("paste", function(B) {
if (!A.UA.isIE()) {
B.preventDefault();
var T = P.pasteEvents;
(0, d.default)(T).call(T, function($) {
return $(B);
});
}
}), D.on("keydown", function(B) {
(k.isFocus || k.isCompatibleMode) && (B.ctrlKey || B.metaKey) && B.keyCode === 90 && (B.preventDefault(), B.shiftKey ? k.history.restore() : k.history.revoke());
}), D.on("keyup", function(B) {
if (B.keyCode === 9) {
B.preventDefault();
var T = P.tabUpEvents;
(0, d.default)(T).call(T, function($) {
return $(B);
});
}
}), D.on("keydown", function(B) {
if (B.keyCode === 9) {
B.preventDefault();
var T = P.tabDownEvents;
(0, d.default)(T).call(T, function($) {
return $(B);
});
}
}), D.on(
"scroll",
A.throttle(function(B) {
var T = P.textScrollEvents;
(0, d.default)(T).call(T, function($) {
return $(B);
});
}, 100)
);
function M(B) {
B.preventDefault();
}
S.default(document).on("dragleave", M).on("drop", M).on("dragenter", M).on("dragover", M), k.beforeDestroy(function() {
S.default(document).off("dragleave", M).off("drop", M).off("dragenter", M).off("dragover", M);
}), D.on("drop", function(B) {
B.preventDefault();
var T = P.dropEvents;
(0, d.default)(T).call(T, function($) {
return $(B);
});
}), D.on("click", function(B) {
var T = null, $ = B.target, V = S.default($);
if (V.getNodeName() === "A")
T = V;
else {
var z = V.parentUntil("a");
z != null && (T = z);
}
if (!!T) {
var H = P.linkClickEvents;
(0, d.default)(H).call(H, function(I) {
return I(T);
});
}
}), D.on("click", function(B) {
var T = null, $ = B.target, V = S.default($);
if (V.getNodeName() === "IMG" && !V.elems[0].getAttribute("data-emoji") && (B.stopPropagation(), T = V), !!T) {
var z = P.imgClickEvents;
(0, d.default)(z).call(z, function(H) {
return H(T);
});
}
}), D.on("click", function(B) {
var T = null, $ = B.target, V = S.default($);
if (V.getNodeName() === "PRE")
T = V;
else {
var z = V.parentUntil("pre");
z !== null && (T = z);
}
if (!!T) {
var H = P.codeClickEvents;
(0, d.default)(H).call(H, function(I) {
return I(T);
});
}
}), D.on("click", function(B) {
var T = null, $ = B.target, V = S.default($);
if (V.getNodeName() === "HR" && (T = V), !!T) {
k.selection.createRangeByElem(T), k.selection.restoreSelection();
var z = P.splitLineEvents;
(0, d.default)(z).call(z, function(H) {
return H(T);
});
}
}), k.$toolbarElem.on("click", function(B) {
var T = P.toolbarClickEvents;
(0, d.default)(T).call(T, function($) {
return $(B);
});
}), k.$textContainerElem.on("mousedown", function(B) {
var T = B.target, $ = S.default(T);
if ($.hasClass("w-e-img-drag-rb")) {
var V = P.imgDragBarMouseDownEvents;
(0, d.default)(V).call(V, function(z) {
return z();
});
}
}), D.on("click", function(B) {
var T = null, $ = B.target;
if (T = S.default($).parentUntilEditor("TABLE", k, $), !!T) {
var V = P.tableClickEvents;
(0, d.default)(V).call(V, function(z) {
return z(T, B);
});
}
}), D.on("keydown", function(B) {
if (B.keyCode === 13) {
var T = P.enterDownEvents;
(0, d.default)(T).call(T, function($) {
return $(B);
});
}
}), D.on("click", function(B) {
var T = null, $ = B.target, V = S.default($);
if (V.getNodeName() === "VIDEO" && (B.stopPropagation(), T = V), !!T) {
var z = P.videoClickEvents;
(0, d.default)(z).call(z, function(H) {
return H(T);
});
}
});
}, x;
}();
r.default = E;
}, function(i, r, n) {
var a = n(284);
i.exports = a;
}, function(i, r, n) {
var a = n(285), s = Array.prototype;
i.exports = function(u) {
var d = u.find;
return u === s || u instanceof Array && d === s.find ? a : d;
};
}, function(i, r, n) {
n(286);
var a = n(15);
i.exports = a("Array").find;
}, function(i, r, n) {
var a = n(5), s = n(32).find, u = n(82), d = n(22), h = "find", p = !0, g = d(h);
h in [] && Array(1)[h](function() {
p = !1;
}), a({ target: "Array", proto: !0, forced: p || !g }, { find: function(S) {
return s(this, S, arguments.length > 1 ? arguments[1] : void 0);
} }), u(h);
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(288)), h = u.__importStar(n(289)), p = u.__importDefault(n(290)), g = u.__importDefault(n(291)), _ = u.__importDefault(n(298));
function S(b) {
var A = b.editor, w = b.eventHooks;
d.default(A, w.enterUpEvents, w.enterDownEvents), h.default(A, w.deleteUpEvents, w.deleteDownEvents), h.cutToKeepP(A, w.keyupEvents), p.default(A, w.tabDownEvents), g.default(A, w.pasteEvents), _.default(A, w.imgClickEvents);
}
r.default = S;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(27));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = n(7), p = d.__importDefault(n(3));
function g(_, S, b) {
function A(y) {
var E, x = p.default(h.EMPTY_P);
if (x.insertBefore(y), (0, u.default)(E = y.html()).call(E, "<img") >= 0) {
x.remove();
return;
}
_.selection.createRangeByElem(x, !0, !0), _.selection.restoreSelection(), y.remove();
}
function w() {
var y = _.$textElem, E = _.selection.getSelectionContainerElem(), x = E.parent();
if (x.html() === "<code><br></code>") {
A(x);
return;
}
if (E.getNodeName() === "FONT" && E.text() === "" && E.attr("face") === "monospace") {
A(x);
return;
}
if (!!x.equal(y)) {
var k = E.getNodeName();
k === "P" && E.attr("data-we-empty-p") === null || E.text() || A(E);
}
}
S.push(w);
function m(y) {
var E;
_.selection.saveRange((E = getSelection()) === null || E === void 0 ? void 0 : E.getRangeAt(0));
var x = _.selection.getSelectionContainerElem();
x.id === _.textElemId && (y.preventDefault(), _.cmd.do("insertHTML", "<p><br></p>"));
}
b.push(m);
}
r.default = g;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(17)), d = a(n(28));
(0, s.default)(r, "__esModule", { value: !0 }), r.cutToKeepP = void 0;
var h = n(2), p = n(7), g = h.__importDefault(n(3));
function _(b, A, w) {
function m() {
var E = b.$textElem, x = b.$textElem.html(), k = b.$textElem.text(), D = (0, u.default)(x).call(x), P = ["<p><br></p>", "<br>", '<p data-we-empty-p=""></p>', p.EMPTY_P];
if (/^\s*$/.test(k) && (!D || (0, d.default)(P).call(P, D))) {
E.html(p.EMPTY_P);
var M = E.getNode();
b.selection.createRangeByElems(M.childNodes[0], M.childNodes[0]);
var B = b.selection.getSelectionContainerElem();
b.selection.restoreSelection(), b.selection.moveCursor(B.getNode(), 0);
}
}
A.push(m);
function y(E) {
var x, k = b.$textElem, D = (0, u.default)(x = k.html().toLowerCase()).call(x);
if (D === p.EMPTY_P) {
E.preventDefault();
return;
}
}
w.push(y);
}
function S(b, A) {
function w(m) {
var y;
if (m.keyCode === 88) {
var E = b.$textElem, x = (0, u.default)(y = E.html().toLowerCase()).call(y);
if (!x || x === "<br>") {
var k = g.default(p.EMPTY_P);
E.html(" "), E.append(k), b.selection.createRangeByElem(k, !1, !0), b.selection.restoreSelection(), b.selection.moveCursor(k.getNode(), 0);
}
}
}
A.push(w);
}
r.cutToKeepP = S, r.default = _;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
function u(d, h) {
function p() {
if (!!d.cmd.queryCommandSupported("insertHTML")) {
var g = d.selection.getSelectionContainerElem();
if (!!g) {
var _ = g.parent(), S = g.getNodeName(), b = _.getNodeName();
S == "CODE" || b === "CODE" || b === "PRE" || /hljs/.test(b) ? d.cmd.do("insertHTML", d.config.languageTab) : d.cmd.do("insertHTML", "&nbsp;&nbsp;&nbsp;&nbsp;");
}
}
}
h.push(p);
}
r.default = u;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(17)), d = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var h = n(131), p = n(6), g = n(7);
function _(m) {
var y, E = (0, u.default)(y = m.replace(/<div>/gim, "<p>").replace(/<\/div>/gim, "</p>")).call(y), x = document.createElement("div");
return x.innerHTML = E, x.innerHTML.replace(/<p><\/p>/gim, "");
}
function S(m) {
var y = m.replace(/<br>|<br\/>/gm, `
`).replace(/<[^>]+>/gm, "");
return y;
}
function b(m) {
var y;
if (m === "")
return !1;
var E = document.createElement("div");
return E.innerHTML = m, ((y = E.firstChild) === null || y === void 0 ? void 0 : y.nodeName) === "P";
}
function A(m) {
if (!(m != null && m.length))
return !1;
var y = m.elems[0];
return y.nodeName === "P" && y.innerHTML === "<br>";
}
function w(m, y) {
function E(x) {
var k = m.config, D = k.pasteFilterStyle, P = k.pasteIgnoreImg, M = k.pasteTextHandle, B = h.getPasteHtml(x, D, P), T = h.getPasteText(x);
T = T.replace(/\n/gm, "<br>");
var $ = m.selection.getSelectionContainerElem();
if (!!$) {
var V = $ == null ? void 0 : $.getNodeName(), z = $ == null ? void 0 : $.getNodeTop(m), H = "";
if (z.elems[0] && (H = z == null ? void 0 : z.getNodeName()), V === "CODE" || H === "PRE") {
M && p.isFunction(M) && (T = "" + (M(T) || "")), m.cmd.do("insertHTML", S(T));
return;
}
if (g.urlRegex.test(T) && D) {
M && p.isFunction(M) && (T = "" + (M(T) || ""));
var I = T.replace(g.urlRegex, function(ee) {
return '<a href="' + ee + '" target="_blank">' + ee + "</a>";
}), U = m.selection.getRange(), F = document.createElement("div"), C = document.createDocumentFragment();
if (F.innerHTML = I, U == null)
return;
for (; F.childNodes.length; )
C.append(F.childNodes[0]);
var q = C.querySelectorAll("a");
(0, d.default)(q).call(q, function(ee) {
ee.innerText = ee.href;
}), U.insertNode && (U.deleteContents(), U.insertNode(C)), m.selection.clearWindowSelectionRange();
return;
}
if (!!B)
try {
M && p.isFunction(M) && (B = "" + (M(B) || ""));
var X = /[\.\#\@]?\w+[ ]+\{[^}]*\}/.test(B);
if (X && D)
m.cmd.do("insertHTML", "" + _(T));
else {
var Y = _(B);
if (b(Y)) {
var ue = m.$textElem;
if (m.cmd.do("insertHTML", Y), ue.equal($)) {
m.selection.createEmptyRange();
return;
}
A(z) && z.remove();
} else
m.cmd.do("insertHTML", Y);
}
} catch {
M && p.isFunction(M) && (T = "" + (M(T) || "")), m.cmd.do("insertHTML", "" + _(T));
}
}
}
y.push(E);
}
r.default = w;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(17)), d = a(n(4)), h = a(n(28));
(0, s.default)(r, "__esModule", { value: !0 });
var p = n(2), g = n(293), _ = p.__importDefault(n(297));
function S(y) {
var E = /<span>.*?<\/span>/gi, x = /<span>(.*?)<\/span>/;
return y.replace(E, function(k) {
var D = k.match(x);
return D == null ? "" : D[1];
});
}
function b(y, E) {
var x;
return y = (0, u.default)(x = y.toLowerCase()).call(x), !!(g.IGNORE_TAGS.has(y) || E && y === "img");
}
function A(y, E) {
var x = "";
x = "<" + y;
var k = [];
(0, d.default)(E).call(E, function(P) {
k.push(P.name + '="' + P.value + '"');
}), k.length > 0 && (x = x + " " + k.join(" "));
var D = g.EMPTY_TAGS.has(y);
return x = x + (D ? "/" : "") + ">", x;
}
function w(y) {
return "</" + y + ">";
}
function m(y, E, x) {
E === void 0 && (E = !0), x === void 0 && (x = !1);
var k = [], D = "";
function P($) {
$ = (0, u.default)($).call($), $ && (g.EMPTY_TAGS.has($) || (D = $));
}
function M() {
D = "";
}
var B = new _.default();
B.parse(y, { startElement: function(V, z) {
if (P(V), !b(V, x)) {
var H = g.NECESSARY_ATTRS.get(V) || [], I = [];
(0, d.default)(z).call(z, function(F) {
var C = F.name;
if (C === "style") {
E || I.push(F);
return;
}
(0, h.default)(H).call(H, C) !== !1 && I.push(F);
});
var U = A(V, I);
k.push(U);
}
}, characters: function(V) {
!V || b(D, x) || k.push(V);
}, endElement: function(V) {
if (!b(V, x)) {
var z = w(V);
k.push(z), M();
}
}, comment: function(V) {
P(V);
} });
var T = k.join("");
return T = S(T), T;
}
r.default = m;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(132)), d = a(n(121));
(0, s.default)(r, "__esModule", { value: !0 }), r.TOP_LEVEL_TAGS = r.EMPTY_TAGS = r.NECESSARY_ATTRS = r.IGNORE_TAGS = void 0, r.IGNORE_TAGS = new u.default(["doctype", "!doctype", "html", "head", "meta", "body", "script", "style", "link", "frame", "iframe", "title", "svg", "center", "o:p"]), r.NECESSARY_ATTRS = new d.default([["img", ["src", "alt"]], ["a", ["href", "target"]], ["td", ["colspan", "rowspan"]], ["th", ["colspan", "rowspan"]]]), r.EMPTY_TAGS = new u.default(["area", "base", "basefont", "br", "col", "hr", "img", "input", "isindex", "embed"]), r.TOP_LEVEL_TAGS = new u.default(["h1", "h2", "h3", "h4", "h5", "p", "ul", "ol", "table", "blockquote", "pre", "hr", "form"]);
}, function(i, r, n) {
var a = n(295);
i.exports = a;
}, function(i, r, n) {
n(296), n(61), n(50), n(54);
var a = n(9);
i.exports = a.Set;
}, function(i, r, n) {
var a = n(122), s = n(124);
i.exports = a("Set", function(u) {
return function() {
return u(this, arguments.length ? arguments[0] : void 0);
};
}, s);
}, function(i, r) {
function n() {
}
n.prototype = {
handler: null,
startTagRe: /^<([^>\s\/]+)((\s+[^=>\s]+(\s*=\s*((\"[^"]*\")|(\'[^']*\')|[^>\s]+))?)*)\s*\/?\s*>/m,
endTagRe: /^<\/([^>\s]+)[^>]*>/m,
attrRe: /([^=\s]+)(\s*=\s*((\"([^"]*)\")|(\'([^']*)\')|[^>\s]+))?/gm,
parse: function(s, u) {
u && (this.contentHandler = u);
for (var d, h, p, g = !1, _ = this; s.length > 0; )
s.substring(0, 4) == "<!--" ? (p = s.indexOf("-->"), p != -1 ? (this.contentHandler.comment(s.substring(4, p)), s = s.substring(p + 3), g = !1) : g = !0) : s.substring(0, 2) == "</" ? this.endTagRe.test(s) ? (d = RegExp.lastMatch, h = RegExp.rightContext, d.replace(this.endTagRe, function() {
return _.parseEndTag.apply(_, arguments);
}), s = h, g = !1) : g = !0 : s.charAt(0) == "<" && (this.startTagRe.test(s) ? (d = RegExp.lastMatch, h = RegExp.rightContext, d.replace(this.startTagRe, function() {
return _.parseStartTag.apply(_, arguments);
}), s = h, g = !1) : g = !0), g && (p = s.indexOf("<"), p == -1 ? (this.contentHandler.characters(s), s = "") : (this.contentHandler.characters(s.substring(0, p)), s = s.substring(p))), g = !0;
},
parseStartTag: function(s, u, d) {
var h = this.parseAttributes(u, d);
this.contentHandler.startElement(u, h);
},
parseEndTag: function(s, u) {
this.contentHandler.endElement(u);
},
parseAttributes: function(s, u) {
var d = this, h = [];
return u.replace(this.attrRe, function(p, g, _, S, b, A, w, m) {
h.push(d.parseAttribute(s, p, g, _, S, b, A, w, m));
}), h;
},
parseAttribute: function(s, u, d) {
var h = "";
arguments[7] ? h = arguments[8] : arguments[5] ? h = arguments[6] : arguments[3] && (h = arguments[4]);
var p = !h && !arguments[3];
return { name: d, value: p ? null : h };
}
}, i.exports = n;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
function u(d, h) {
function p(g) {
d.selection.createRangeByElem(g), d.selection.restoreSelection();
}
h.push(p);
}
r.default = u;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = n(6), p = d.__importDefault(n(3));
function g(_) {
var S = [], b = _.childNodes() || [];
return (0, u.default)(b).call(b, function(A) {
var w, m = A.nodeType;
if (m === 3 && (w = A.textContent || "", w = h.replaceHtmlSymbol(w)), m === 1) {
w = {}, w = w, w.tag = A.nodeName.toLowerCase();
for (var y = [], E = A.attributes, x = E.length || 0, k = 0; k < x; k++) {
var D = E[k];
y.push({ name: D.name, value: D.value });
}
w.attrs = y, w.children = g(p.default(A));
}
w && S.push(w);
}), S;
}
r.default = g;
}, function(i, r, n) {
var a = n(0), s = a(n(92)), u = a(n(1)), d = a(n(4));
(0, u.default)(r, "__esModule", { value: !0 });
var h = n(2), p = h.__importDefault(n(3));
function g(_, S) {
S === void 0 && (S = document.createElement("div"));
var b = S;
return (0, d.default)(_).call(_, function(A) {
var w;
if (typeof A == "string" && (w = document.createTextNode(A)), (0, s.default)(A) === "object") {
var m;
w = document.createElement(A.tag), (0, d.default)(m = A.attrs).call(m, function(y) {
p.default(w).attr(y.name, y.value);
}), A.children && A.children.length > 0 && g(A.children, w.getRootNode());
}
w && b.appendChild(w);
}), p.default(b);
}
r.default = g;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(89)), d = a(n(70)), h = a(n(28)), p = a(n(302)), g = a(n(4)), _ = a(n(94)), S = a(n(133)), b = a(n(46)), A = a(n(57));
(0, s.default)(r, "__esModule", { value: !0 });
var w = n(2), m = w.__importDefault(n(87)), y = w.__importDefault(n(314)), E = w.__importDefault(n(3)), x = function() {
function k(D) {
this.editor = D, this.menuList = [], this.constructorList = y.default;
}
return k.prototype.extend = function(D, P) {
!P || typeof P != "function" || (this.constructorList[D] = P);
}, k.prototype.init = function() {
var D, P, M = this, B = this.editor.config, T = B.excludeMenus;
(0, u.default)(T) === !1 && (T = []), B.menus = (0, d.default)(D = B.menus).call(D, function(C) {
return (0, h.default)(T).call(T, C) === !1;
});
var $ = (0, p.default)(m.default.globalCustomMenuConstructorList);
$ = (0, d.default)($).call($, function(C) {
return (0, h.default)(T).call(T, C);
}), (0, g.default)($).call($, function(C) {
delete m.default.globalCustomMenuConstructorList[C];
}), (0, g.default)(P = B.menus).call(P, function(C) {
var q = M.constructorList[C];
M._initMenuList(C, q);
});
for (var V = 0, z = (0, _.default)(m.default.globalCustomMenuConstructorList); V < z.length; V++) {
var H = z[V], I = H[0], U = H[1], F = U;
this._initMenuList(I, F);
}
this._addToToolbar(), B.showMenuTooltips && this._bindMenuTooltips();
}, k.prototype._initMenuList = function(D, P) {
var M;
if (!(P == null || typeof P != "function"))
if ((0, S.default)(M = this.menuList).call(M, function(T) {
return T.key === D;
}))
console.warn("\u83DC\u5355\u540D\u79F0\u91CD\u590D:" + D);
else {
var B = new P(this.editor);
B.key = D, this.menuList.push(B);
}
}, k.prototype._bindMenuTooltips = function() {
var D = this.editor, P = D.$toolbarElem, M = D.config, B = M.menuTooltipPosition, T = E.default('<div class="w-e-menu-tooltip w-e-menu-tooltip-' + B + `">
<div class="w-e-menu-tooltip-item-wrapper">
<div></div>
</div>
</div>`);
T.css("visibility", "hidden"), P.append(T), T.css("z-index", D.zIndex.get("tooltip"));
var $ = 0;
function V() {
$ && clearTimeout($);
}
function z() {
V(), T.css("visibility", "hidden");
}
P.on("mouseover", function(H) {
var I = H.target, U = E.default(I), F, C;
if (U.isContain(P)) {
z();
return;
}
if (U.parentUntil(".w-e-droplist") != null)
z();
else if (U.attr("data-title"))
F = U.attr("data-title"), C = U;
else {
var q = U.parentUntil(".w-e-menu");
q != null && (F = q.attr("data-title"), C = q);
}
if (F && C) {
V();
var X = C.getOffsetData();
T.text(D.i18next.t("menus.title." + F));
var Y = T.getOffsetData(), ue = X.left + X.width / 2 - Y.width / 2;
T.css("left", ue + "px"), B === "up" ? T.css("top", X.top - Y.height - 8 + "px") : B === "down" && T.css("top", X.top + X.height + 8 + "px"), $ = (0, b.default)(function() {
T.css("visibility", "visible");
}, 200);
} else
z();
}).on("mouseleave", function() {
z();
});
}, k.prototype._addToToolbar = function() {
var D, P = this.editor, M = P.$toolbarElem;
(0, g.default)(D = this.menuList).call(D, function(B) {
var T = B.$elem;
T && M.append(T);
});
}, k.prototype.menuFind = function(D) {
for (var P = this.menuList, M = 0, B = P.length; M < B; M++)
if (P[M].key === D)
return P[M];
return P[0];
}, k.prototype.changeActive = function() {
var D;
(0, g.default)(D = this.menuList).call(D, function(P) {
var M;
(0, b.default)((0, A.default)(M = P.tryChangeActive).call(M, P), 100);
});
}, k;
}();
r.default = x;
}, function(i, r, n) {
i.exports = n(303);
}, function(i, r, n) {
var a = n(304);
i.exports = a;
}, function(i, r, n) {
n(305);
var a = n(9);
i.exports = a.Object.keys;
}, function(i, r, n) {
var a = n(5), s = n(31), u = n(52), d = n(11), h = d(function() {
u(1);
});
a({ target: "Object", stat: !0, forced: h }, { keys: function(g) {
return u(s(g));
} });
}, function(i, r, n) {
var a = n(307);
i.exports = a;
}, function(i, r, n) {
n(308);
var a = n(9);
i.exports = a.Object.entries;
}, function(i, r, n) {
var a = n(5), s = n(309).entries;
a({ target: "Object", stat: !0 }, { entries: function(d) {
return s(d);
} });
}, function(i, r, n) {
var a = n(14), s = n(52), u = n(30), d = n(59).f, h = function(g) {
return function(_) {
for (var S = u(_), b = s(S), A = b.length, w = 0, m = [], y; A > w; )
y = b[w++], (!a || d.call(S, y)) && m.push(g ? [y, S[y]] : S[y]);
return m;
};
};
i.exports = {
entries: h(!0),
values: h(!1)
};
}, function(i, r, n) {
var a = n(311);
i.exports = a;
}, function(i, r, n) {
var a = n(312), s = Array.prototype;
i.exports = function(u) {
var d = u.some;
return u === s || u instanceof Array && d === s.some ? a : d;
};
}, function(i, r, n) {
n(313);
var a = n(15);
i.exports = a("Array").some;
}, function(i, r, n) {
var a = n(5), s = n(32).some, u = n(67), d = n(22), h = u("some"), p = d("some");
a({ target: "Array", proto: !0, forced: !h || !p }, { some: function(_) {
return s(this, _, arguments.length > 1 ? arguments[1] : void 0);
} });
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(315)), h = u.__importDefault(n(316)), p = u.__importDefault(n(321)), g = u.__importDefault(n(326)), _ = u.__importDefault(n(327)), S = u.__importDefault(n(328)), b = u.__importDefault(n(329)), A = u.__importDefault(n(331)), w = u.__importDefault(n(333)), m = u.__importDefault(n(334)), y = u.__importDefault(n(337)), E = u.__importDefault(n(338)), x = u.__importDefault(n(339)), k = u.__importDefault(n(350)), D = u.__importDefault(n(365)), P = u.__importDefault(n(369)), M = u.__importDefault(n(137)), B = u.__importDefault(n(378)), T = u.__importDefault(n(380)), $ = u.__importDefault(n(381)), V = u.__importDefault(n(382)), z = u.__importDefault(n(401)), H = u.__importDefault(n(406)), I = u.__importDefault(n(409));
r.default = { bold: d.default, head: h.default, italic: g.default, link: p.default, underline: _.default, strikeThrough: S.default, fontName: b.default, fontSize: A.default, justify: w.default, quote: m.default, backColor: y.default, foreColor: E.default, video: x.default, image: k.default, indent: D.default, emoticon: P.default, list: M.default, lineHeight: B.default, undo: T.default, redo: $.default, table: V.default, code: z.default, splitLine: H.default, todo: I.default };
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(23)), h = u.__importDefault(n(3)), p = function(g) {
u.__extends(_, g);
function _(S) {
var b = this, A = h.default(`<div class="w-e-menu" data-title="\u52A0\u7C97">
<i class="w-e-icon-bold"></i>
</div>`);
return b = g.call(this, A, S) || this, b;
}
return _.prototype.clickHandler = function() {
var S = this.editor, b = S.selection.isSelectionEmpty();
b && S.selection.createEmptyRange(), S.cmd.do("bold"), b && (S.selection.collapseRange(), S.selection.restoreSelection());
}, _.prototype.tryChangeActive = function() {
var S = this.editor;
S.cmd.queryCommandState("bold") ? this.active() : this.unActive();
}, _;
}(d.default);
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(27)), d = a(n(29)), h = a(n(4)), p = a(n(317)), g = a(n(28));
(0, s.default)(r, "__esModule", { value: !0 });
var _ = n(2), S = _.__importDefault(n(24)), b = _.__importDefault(n(3)), A = n(6), w = n(7), m = function(y) {
_.__extends(E, y);
function E(x) {
var k = this, D = b.default('<div class="w-e-menu" data-title="\u6807\u9898"><i class="w-e-icon-header"></i></div>'), P = { width: 100, title: "\u8BBE\u7F6E\u6807\u9898", type: "list", list: [{ $elem: b.default("<h1>H1</h1>"), value: "<h1>" }, { $elem: b.default("<h2>H2</h2>"), value: "<h2>" }, { $elem: b.default("<h3>H3</h3>"), value: "<h3>" }, { $elem: b.default("<h4>H4</h4>"), value: "<h4>" }, { $elem: b.default("<h5>H5</h5>"), value: "<h5>" }, { $elem: b.default("<p>" + x.i18next.t("menus.dropListMenu.head.\u6B63\u6587") + "</p>"), value: "<p>" }], clickHandler: function(T) {
k.command(T);
} };
k = y.call(this, D, x, P) || this;
var M = x.config.onCatalogChange;
return M && (k.oldCatalogs = [], k.addListenerCatalog(), k.getCatalogs()), k;
}
return E.prototype.command = function(x) {
var k = this.editor, D = k.selection.getSelectionContainerElem();
if (D && k.$textElem.equal(D))
this.setMultilineHead(x);
else {
var P;
if ((0, u.default)(P = ["OL", "UL", "LI", "TABLE", "TH", "TR", "CODE", "HR"]).call(P, b.default(D).getNodeName()) > -1)
return;
k.cmd.do("formatBlock", x);
}
x !== "<p>" && this.addUidForSelectionElem();
}, E.prototype.addUidForSelectionElem = function() {
var x = this.editor, k = x.selection.getSelectionContainerElem(), D = A.getRandomCode();
b.default(k).attr("id", D);
}, E.prototype.addListenerCatalog = function() {
var x = this, k = this.editor;
k.txt.eventHooks.changeEvents.push(function() {
x.getCatalogs();
});
}, E.prototype.getCatalogs = function() {
var x = this.editor, k = this.editor.$textElem, D = x.config.onCatalogChange, P = (0, d.default)(k).call(k, "h1,h2,h3,h4,h5"), M = [];
(0, h.default)(P).call(P, function(B, T) {
var $ = b.default(B), V = $.attr("id"), z = $.getNodeName(), H = $.text();
V || (V = A.getRandomCode(), $.attr("id", V)), H && M.push({ tag: z, id: V, text: H });
}), (0, p.default)(this.oldCatalogs) !== (0, p.default)(M) && (this.oldCatalogs = M, D && D(M));
}, E.prototype.setMultilineHead = function(x) {
var k = this, D, P, M = this.editor, B = M.selection, T = (D = B.getSelectionContainerElem()) === null || D === void 0 ? void 0 : D.elems[0], $ = ["IMG", "VIDEO", "TABLE", "TH", "TR", "UL", "OL", "PRE", "HR", "BLOCKQUOTE"], V = b.default(B.getSelectionStartElem()), z = b.default(B.getSelectionEndElem());
z.elems[0].outerHTML === b.default(w.EMPTY_P).elems[0].outerHTML && !z.elems[0].nextSibling && (z = z.prev());
var H = [];
H.push(V.getNodeTop(M));
var I = [], U = (P = B.getRange()) === null || P === void 0 ? void 0 : P.commonAncestorContainer.childNodes;
U == null || (0, h.default)(U).call(U, function(q, X) {
q === H[0].getNode() && I.push(X), q === z.getNodeTop(M).getNode() && I.push(X);
});
for (var F = 0; H[F].getNode() !== z.getNodeTop(M).getNode(); ) {
if (!H[F].elems[0])
return;
var C = b.default(H[F].next().getNode());
H.push(C), F++;
}
H == null || (0, h.default)(H).call(H, function(q, X) {
if (!k.hasTag(q, $)) {
var Y = b.default(x), ue = q.parent().getNode();
Y.html("" + q.html()), ue.insertBefore(Y.getNode(), q.getNode()), q.remove();
}
}), B.createRangeByElems(T.children[I[0]], T.children[I[1]]);
}, E.prototype.hasTag = function(x, k) {
var D = this, P;
if (!x)
return !1;
if ((0, g.default)(k).call(k, x == null ? void 0 : x.getNodeName()))
return !0;
var M = !1;
return (P = x.children()) === null || P === void 0 || (0, h.default)(P).call(P, function(B) {
M = D.hasTag(b.default(B), k);
}), M;
}, E.prototype.tryChangeActive = function() {
var x = this.editor, k = /^h/i, D = x.cmd.queryCommandValue("formatBlock");
k.test(D) ? this.active() : this.unActive();
}, E;
}(S.default);
r.default = m;
}, function(i, r, n) {
i.exports = n(318);
}, function(i, r, n) {
var a = n(319);
i.exports = a;
}, function(i, r, n) {
n(320);
var a = n(9);
a.JSON || (a.JSON = { stringify: JSON.stringify }), i.exports = function(u, d, h) {
return a.JSON.stringify.apply(null, arguments);
};
}, function(i, r, n) {
var a = n(5), s = n(36), u = n(11), d = s("JSON", "stringify"), h = /[\uD800-\uDFFF]/g, p = /^[\uD800-\uDBFF]$/, g = /^[\uDC00-\uDFFF]$/, _ = function(A, w, m) {
var y = m.charAt(w - 1), E = m.charAt(w + 1);
return p.test(A) && !g.test(E) || g.test(A) && !p.test(y) ? "\\u" + A.charCodeAt(0).toString(16) : A;
}, S = u(function() {
return d("\uDF06\uD834") !== '"\\udf06\\ud834"' || d("\uDEAD") !== '"\\udead"';
});
d && a({ target: "JSON", stat: !0, forced: S }, {
stringify: function(A, w, m) {
var y = d.apply(null, arguments);
return typeof y == "string" ? y.replace(h, _) : y;
}
});
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(17));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(38)), p = d.__importDefault(n(3)), g = d.__importDefault(n(322)), _ = d.__importStar(n(96)), S = d.__importDefault(n(33)), b = d.__importDefault(n(324)), A = n(7), w = function(m) {
d.__extends(y, m);
function y(E) {
var x = this, k = p.default('<div class="w-e-menu" data-title="\u94FE\u63A5"><i class="w-e-icon-link"></i></div>');
return x = m.call(this, k, E) || this, b.default(E), x;
}
return y.prototype.clickHandler = function() {
var E = this.editor, x, k = E.selection.getSelectionContainerElem(), D = E.$textElem, P = D.html(), M = (0, u.default)(P).call(P);
if (M === A.EMPTY_P) {
var B = D.children();
E.selection.createRangeByElem(B, !0, !0), k = E.selection.getSelectionContainerElem();
}
if (!(k && E.$textElem.equal(k)))
if (this.isActive) {
var T = "", $ = "";
if (x = E.selection.getSelectionContainerElem(), !x)
return;
if (x.getNodeName() !== "A") {
var V = _.getParentNodeA(x);
x = p.default(V);
}
T = x.elems[0].innerText, $ = x.attr("href"), this.createPanel(T, $);
} else
E.selection.isSelectionEmpty() ? this.createPanel("", "") : this.createPanel(E.selection.getSelectionText(), "");
}, y.prototype.createPanel = function(E, x) {
var k = g.default(this.editor, E, x), D = new S.default(this, k);
D.create();
}, y.prototype.tryChangeActive = function() {
var E = this.editor;
_.default(E) ? this.active() : this.unActive();
}, y;
}(h.default);
r.default = w;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(28)), d = a(n(17)), h = a(n(29));
(0, s.default)(r, "__esModule", { value: !0 });
var p = n(2), g = n(6), _ = p.__importDefault(n(3)), S = p.__importStar(n(96)), b = n(323);
function A(w, m, y) {
var E = g.getRandom("input-link"), x = g.getRandom("input-text"), k = g.getRandom("btn-ok"), D = g.getRandom("btn-del"), P = S.default(w) ? "inline-block" : "none", M;
function B() {
if (!!S.default(w)) {
var H = w.selection.getSelectionContainerElem();
!H || (w.selection.createRangeByElem(H), w.selection.restoreSelection(), M = H);
}
}
function T(H, I) {
var U = H.replace(/</g, "&lt;").replace(/>/g, "&gt;"), F = _.default('<a target="_blank">' + U + "</a>"), C = F.elems[0];
C.innerText = H, C.href = I, S.default(w) && B(), w.cmd.do("insertElem", F);
}
function $() {
if (!!S.default(w))
if (B(), M.getNodeName() === "A") {
var H, I = M.elems[0], U = I.parentElement;
U && (0, u.default)(H = S.EXTRA_TAG).call(H, U.nodeName) ? U.innerHTML = I.innerHTML : w.cmd.do("insertHTML", "<span>" + I.innerHTML + "</span>");
} else {
var F = S.getParentNodeA(M), C = F.innerHTML;
w.cmd.do("insertHTML", "<span>" + C + "</span>");
}
}
function V(H, I) {
var U = w.config.linkCheck(H, I);
if (U !== void 0) {
if (U === !0)
return !0;
w.config.customAlert(U, "warning");
}
return !1;
}
var z = {
width: 300,
height: 0,
tabs: [{
title: w.i18next.t("menus.panelMenus.link.\u94FE\u63A5"),
tpl: `<div>
<input
id="` + x + `"
type="text"
class="block"
placeholder="` + w.i18next.t("menus.panelMenus.link.\u94FE\u63A5\u6587\u5B57") + `"/>
</td>
<input
id="` + E + `"
type="text"
class="block"
placeholder="` + w.i18next.t("\u5982") + ` https://..."/>
</td>
<div class="w-e-button-container">
<button type="button" id="` + k + `" class="right">
` + w.i18next.t("\u63D2\u5165") + `
</button>
<button type="button" id="` + D + '" class="gray right" style="display:' + P + `">
` + w.i18next.t("menus.panelMenus.link.\u53D6\u6D88\u94FE\u63A5") + `
</button>
</div>
</div>`,
events: [
{ selector: "#" + k, type: "click", fn: function() {
var I, U, F, C, q, X = w.selection.getSelectionContainerElem(), Y = X == null ? void 0 : X.elems[0];
w.selection.restoreSelection();
var ue = w.selection.getSelectionRangeTopNodes()[0].getNode(), ee = window.getSelection(), pe = _.default("#" + E), Te = _.default("#" + x), ve = (0, d.default)(I = pe.val()).call(I), me = (0, d.default)(U = Te.val()).call(U), we = "";
ee && !(ee != null && ee.isCollapsed) && (we = (C = b.insertHtml(ee, ue)) === null || C === void 0 ? void 0 : (0, d.default)(C).call(C));
var he = we == null ? void 0 : we.replace(/<.*?>/g, ""), Se = (q = he == null ? void 0 : he.length) !== null && q !== void 0 ? q : 0;
if (Se <= me.length) {
var xe = me.substring(0, Se), O = me.substring(Se);
he === xe && (me = he + O);
}
if (!!ve && (me || (me = ve), !!V(me, ve))) {
if ((Y == null ? void 0 : Y.nodeName) === "A")
return Y.setAttribute("href", ve), Y.innerText = me, !0;
if ((Y == null ? void 0 : Y.nodeName) !== "A" && (0, u.default)(F = S.EXTRA_TAG).call(F, Y.nodeName)) {
var K = S.getParentNodeA(X);
if (K)
return K.setAttribute("href", ve), Y.innerText = me, !0;
}
return T(me, ve), !0;
}
}, bindEnter: !0 },
{ selector: "#" + D, type: "click", fn: function() {
return $(), !0;
} }
]
}],
setLinkValue: function(I, U) {
var F = "", C = "", q;
U === "text" && (F = "#" + x, C = m), U === "link" && (F = "#" + E, C = y), q = (0, h.default)(I).call(I, F).elems[0], q.value = C;
}
};
return z;
}
r.default = A;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 }), r.insertHtml = r.createPartHtml = r.makeHtmlString = r.getTopNode = void 0;
function d(b, A) {
var w = b, m = b;
do {
if (w.textContent === A)
break;
m = w, w.parentNode && (w = w == null ? void 0 : w.parentNode);
} while ((w == null ? void 0 : w.nodeName) !== "P");
return m;
}
r.getTopNode = d;
function h(b, A) {
var w = b.nodeName, m = "";
if (b.nodeType === 3 || /^(h|H)[1-6]$/.test(w))
return A;
if (b.nodeType === 1) {
var y = b.getAttribute("style"), E = b.getAttribute("face"), x = b.getAttribute("color");
y && (m = m + (' style="' + y + '"')), E && (m = m + (' face="' + E + '"')), x && (m = m + (' color="' + x + '"'));
}
return w = w.toLowerCase(), "<" + w + m + ">" + A + "</" + w + ">";
}
r.makeHtmlString = h;
function p(b, A, w, m) {
var y, E = (y = A.textContent) === null || y === void 0 ? void 0 : y.substring(w, m), x = A, k = "";
do
k = h(x, E != null ? E : ""), E = k, x = x == null ? void 0 : x.parentElement;
while (x && x.textContent !== b);
return k;
}
r.createPartHtml = p;
function g(b, A) {
var w, m, y, E, x, k = b.anchorNode, D = b.focusNode, P = b.anchorOffset, M = b.focusOffset, B = (w = A.textContent) !== null && w !== void 0 ? w : "", T = _(A), $ = "", V = "", z = "", H = "", I = k, U = D, F = k;
if (k != null && k.isEqualNode(D != null ? D : null)) {
var C = p(B, k, P, M);
return C = S(T, C), C;
}
for (k && (V = p(B, k, P != null ? P : 0)), D && (H = p(B, D, 0, M)), k && (I = d(k, B)), D && (U = d(D, B)), F = (m = I == null ? void 0 : I.nextSibling) !== null && m !== void 0 ? m : k; !(F != null && F.isEqualNode(U != null ? U : null)); ) {
var q = F == null ? void 0 : F.nodeName;
if (q === "#text")
z = z + (F == null ? void 0 : F.textContent);
else {
var X = (E = (y = F == null ? void 0 : F.firstChild) === null || y === void 0 ? void 0 : y.parentElement) === null || E === void 0 ? void 0 : E.innerHTML;
F && (z = z + h(F, X != null ? X : ""));
}
var Y = (x = F == null ? void 0 : F.nextSibling) !== null && x !== void 0 ? x : F;
if (Y === F)
break;
F = Y;
}
return $ = "" + V + z + H, $ = S(T, $), $;
}
r.insertHtml = g;
function _(b) {
for (var A, w = (A = b.textContent) !== null && A !== void 0 ? A : "", m = []; (b == null ? void 0 : b.textContent) === w; )
b.nodeName !== "P" && b.nodeName !== "TABLE" && m.push(b), b = b.childNodes[0];
return m;
}
function S(b, A) {
return (0, u.default)(b).call(b, function(w) {
A = h(w, A);
}), A;
}
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(325));
function h(p) {
d.default(p);
}
r.default = h;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(28));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3)), p = d.__importDefault(n(39)), g = n(96);
function _(b) {
var A;
function w(y) {
var E = [{ $elem: h.default("<span>" + b.i18next.t("menus.panelMenus.link.\u67E5\u770B\u94FE\u63A5") + "</span>"), onClick: function(k, D) {
var P = D.attr("href");
return window.open(P, "_target"), !0;
} }, { $elem: h.default("<span>" + b.i18next.t("menus.panelMenus.link.\u53D6\u6D88\u94FE\u63A5") + "</span>"), onClick: function(k, D) {
var P, M;
k.selection.createRangeByElem(D), k.selection.restoreSelection();
var B = D.childNodes();
if ((B == null ? void 0 : B.getNodeName()) === "IMG") {
var T = (M = (P = k.selection.getSelectionContainerElem()) === null || P === void 0 ? void 0 : P.children()) === null || M === void 0 ? void 0 : M.elems[0].children[0];
k.cmd.do("insertHTML", `<img
src=` + (T == null ? void 0 : T.getAttribute("src")) + `
style=` + (T == null ? void 0 : T.getAttribute("style")) + ">");
} else {
var $, V = D.elems[0], z = V.innerHTML, H = V.parentElement;
H && (0, u.default)($ = g.EXTRA_TAG).call($, H.nodeName) ? H.innerHTML = z : k.cmd.do("insertHTML", "<span>" + z + "</span>");
}
return !0;
} }];
A = new p.default(b, y, E), A.create();
}
function m() {
A && (A.remove(), A = null);
}
return { showLinkTooltip: w, hideLinkTooltip: m };
}
function S(b) {
var A = _(b), w = A.showLinkTooltip, m = A.hideLinkTooltip;
b.txt.eventHooks.linkClickEvents.push(w), b.txt.eventHooks.clickEvents.push(m), b.txt.eventHooks.keyupEvents.push(m), b.txt.eventHooks.toolbarClickEvents.push(m), b.txt.eventHooks.menuClickEvents.push(m), b.txt.eventHooks.textScrollEvents.push(m);
}
r.default = S;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(23)), h = u.__importDefault(n(3)), p = function(g) {
u.__extends(_, g);
function _(S) {
var b = this, A = h.default(`<div class="w-e-menu" data-title="\u659C\u4F53">
<i class="w-e-icon-italic"></i>
</div>`);
return b = g.call(this, A, S) || this, b;
}
return _.prototype.clickHandler = function() {
var S = this.editor, b = S.selection.isSelectionEmpty();
b && S.selection.createEmptyRange(), S.cmd.do("italic"), b && (S.selection.collapseRange(), S.selection.restoreSelection());
}, _.prototype.tryChangeActive = function() {
var S = this.editor;
S.cmd.queryCommandState("italic") ? this.active() : this.unActive();
}, _;
}(d.default);
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(23)), h = u.__importDefault(n(3)), p = function(g) {
u.__extends(_, g);
function _(S) {
var b = this, A = h.default(`<div class="w-e-menu" data-title="\u4E0B\u5212\u7EBF">
<i class="w-e-icon-underline"></i>
</div>`);
return b = g.call(this, A, S) || this, b;
}
return _.prototype.clickHandler = function() {
var S = this.editor, b = S.selection.isSelectionEmpty();
b && S.selection.createEmptyRange(), S.cmd.do("underline"), b && (S.selection.collapseRange(), S.selection.restoreSelection());
}, _.prototype.tryChangeActive = function() {
var S = this.editor;
S.cmd.queryCommandState("underline") ? this.active() : this.unActive();
}, _;
}(d.default);
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(23)), h = u.__importDefault(n(3)), p = function(g) {
u.__extends(_, g);
function _(S) {
var b = this, A = h.default(`<div class="w-e-menu" data-title="\u5220\u9664\u7EBF">
<i class="w-e-icon-strikethrough"></i>
</div>`);
return b = g.call(this, A, S) || this, b;
}
return _.prototype.clickHandler = function() {
var S = this.editor, b = S.selection.isSelectionEmpty();
b && S.selection.createEmptyRange(), S.cmd.do("strikeThrough"), b && (S.selection.collapseRange(), S.selection.restoreSelection());
}, _.prototype.tryChangeActive = function() {
var S = this.editor;
S.cmd.queryCommandState("strikeThrough") ? this.active() : this.unActive();
}, _;
}(d.default);
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(24)), h = u.__importDefault(n(3)), p = u.__importDefault(n(330)), g = function(_) {
u.__extends(S, _);
function S(b) {
var A = this, w = h.default(`<div class="w-e-menu" data-title="\u5B57\u4F53">
<i class="w-e-icon-font"></i>
</div>`), m = new p.default(b.config.fontNames), y = { width: 100, title: "\u8BBE\u7F6E\u5B57\u4F53", type: "list", list: m.getItemList(), clickHandler: function(x) {
A.command(x);
} };
return A = _.call(this, w, b, y) || this, A;
}
return S.prototype.command = function(b) {
var A, w = this.editor, m = w.selection.isSelectionEmpty(), y = (A = w.selection.getSelectionContainerElem()) === null || A === void 0 ? void 0 : A.elems[0];
if (y != null) {
var E = (y == null ? void 0 : y.nodeName.toLowerCase()) !== "p", x = (y == null ? void 0 : y.getAttribute("face")) === b;
if (m) {
if (E && !x) {
var k = w.selection.getSelectionRangeTopNodes();
w.selection.createRangeByElem(k[0]), w.selection.moveCursor(k[0].elems[0]);
}
w.selection.setRangeToElem(y), w.selection.createEmptyRange();
}
w.cmd.do("fontName", b), m && (w.selection.collapseRange(), w.selection.restoreSelection());
}
}, S.prototype.tryChangeActive = function() {
}, S;
}(d.default);
r.default = g;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3)), p = function() {
function g(_) {
var S = this;
this.itemList = [], (0, u.default)(_).call(_, function(b) {
var A = typeof b == "string" ? b : b.value, w = typeof b == "string" ? b : b.name;
S.itemList.push({ $elem: h.default(`<p style="font-family:'` + A + `'">` + w + "</p>"), value: w });
});
}
return g.prototype.getItemList = function() {
return this.itemList;
}, g;
}();
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(24)), h = u.__importDefault(n(3)), p = u.__importDefault(n(332)), g = function(_) {
u.__extends(S, _);
function S(b) {
var A = this, w = h.default(`<div class="w-e-menu" data-title="\u5B57\u53F7">
<i class="w-e-icon-text-heigh"></i>
</div>`), m = new p.default(b.config.fontSizes), y = { width: 160, title: "\u8BBE\u7F6E\u5B57\u53F7", type: "list", list: m.getItemList(), clickHandler: function(x) {
A.command(x);
} };
return A = _.call(this, w, b, y) || this, A;
}
return S.prototype.command = function(b) {
var A, w = this.editor, m = w.selection.isSelectionEmpty(), y = (A = w.selection.getSelectionContainerElem()) === null || A === void 0 ? void 0 : A.elems[0];
y != null && (w.cmd.do("fontSize", b), m && (w.selection.collapseRange(), w.selection.restoreSelection()));
}, S.prototype.tryChangeActive = function() {
}, S;
}(d.default);
r.default = g;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(3)), h = function() {
function p(g) {
this.itemList = [];
for (var _ in g) {
var S = g[_];
this.itemList.push({ $elem: d.default('<p style="font-size:' + _ + '">' + S.name + "</p>"), value: S.value });
}
}
return p.prototype.getItemList = function() {
return this.itemList;
}, p;
}();
r.default = h;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4)), d = a(n(27));
(0, s.default)(r, "__esModule", { value: !0 });
var h = n(2), p = h.__importDefault(n(24)), g = h.__importDefault(n(3)), _ = ["LI"], S = ["BLOCKQUOTE"], b = function(A) {
h.__extends(w, A);
function w(m) {
var y = this, E = g.default('<div class="w-e-menu" data-title="\u5BF9\u9F50"><i class="w-e-icon-paragraph-left"></i></div>'), x = { width: 100, title: "\u5BF9\u9F50\u65B9\u5F0F", type: "list", list: [{ $elem: g.default(`<p>
<i class="w-e-icon-paragraph-left w-e-drop-list-item"></i>
` + m.i18next.t("menus.dropListMenu.justify.\u9760\u5DE6") + `
</p>`), value: "left" }, { $elem: g.default(`<p>
<i class="w-e-icon-paragraph-center w-e-drop-list-item"></i>
` + m.i18next.t("menus.dropListMenu.justify.\u5C45\u4E2D") + `
</p>`), value: "center" }, { $elem: g.default(`<p>
<i class="w-e-icon-paragraph-right w-e-drop-list-item"></i>
` + m.i18next.t("menus.dropListMenu.justify.\u9760\u53F3") + `
</p>`), value: "right" }, { $elem: g.default(`<p>
<i class="w-e-icon-paragraph-justify w-e-drop-list-item"></i>
` + m.i18next.t("menus.dropListMenu.justify.\u4E24\u7AEF") + `
</p>`), value: "justify" }], clickHandler: function(D) {
y.command(D);
} };
return y = A.call(this, E, m, x) || this, y;
}
return w.prototype.command = function(m) {
var y = this.editor, E = y.selection, x = E.getSelectionContainerElem();
E.saveRange();
var k = y.selection.getSelectionRangeTopNodes();
if (x != null && x.length)
if (this.isSpecialNode(x, k[0]) || this.isSpecialTopNode(k[0])) {
var D = this.getSpecialNodeUntilTop(x, k[0]);
if (D == null)
return;
g.default(D).css("text-align", m);
} else
(0, u.default)(k).call(k, function(P) {
P.css("text-align", m);
});
E.restoreSelection();
}, w.prototype.getSpecialNodeUntilTop = function(m, y) {
for (var E = m.elems[0], x = y.elems[0]; E != null; ) {
if ((0, d.default)(_).call(_, E == null ? void 0 : E.nodeName) !== -1 || E.parentNode === x)
return E;
E = E.parentNode;
}
return E;
}, w.prototype.isSpecialNode = function(m, y) {
var E = this.getSpecialNodeUntilTop(m, y);
return E == null ? !1 : (0, d.default)(_).call(_, E.nodeName) !== -1;
}, w.prototype.isSpecialTopNode = function(m) {
var y;
return m == null ? !1 : (0, d.default)(S).call(S, (y = m.elems[0]) === null || y === void 0 ? void 0 : y.nodeName) !== -1;
}, w.prototype.tryChangeActive = function() {
}, w;
}(p.default);
r.default = b;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3)), p = d.__importDefault(n(23)), g = d.__importDefault(n(335)), _ = d.__importDefault(n(336)), S = n(7), b = function(A) {
d.__extends(w, A);
function w(m) {
var y = this, E = h.default(`<div class="w-e-menu" data-title="\u5F15\u7528">
<i class="w-e-icon-quotes-left"></i>
</div>`);
return y = A.call(this, E, m) || this, g.default(m), y;
}
return w.prototype.clickHandler = function() {
var m, y, E = this.editor, x = E.selection.isSelectionEmpty(), k = E.selection.getSelectionRangeTopNodes(), D = k[k.length - 1], P = this.getTopNodeName();
if (P === "BLOCKQUOTE") {
var M = h.default(D.childNodes()), B = M.length, T = D;
(0, u.default)(M).call(M, function(H) {
var I = h.default(H);
I.insertAfter(T), T = I;
}), D.remove(), E.selection.moveCursor(M.elems[B - 1]), this.tryChangeActive();
} else {
var $ = _.default(k);
if (E.$textElem.equal(D)) {
var V = (m = E.selection.getSelectionContainerElem()) === null || m === void 0 ? void 0 : m.elems[0];
E.selection.createRangeByElems(V.children[0], V.children[0]), k = E.selection.getSelectionRangeTopNodes(), $ = _.default(k), D.append($);
} else
$.insertAfter(D);
this.delSelectNode(k);
var z = (y = $.childNodes()) === null || y === void 0 ? void 0 : y.last().getNode();
if (z == null)
return;
z.textContent ? E.selection.moveCursor(z) : E.selection.moveCursor(z, 0), this.tryChangeActive(), h.default(S.EMPTY_P).insertAfter($);
return;
}
x && (E.selection.collapseRange(), E.selection.restoreSelection());
}, w.prototype.tryChangeActive = function() {
var m, y = this.editor, E = (m = y.selection.getSelectionRangeTopNodes()[0]) === null || m === void 0 ? void 0 : m.getNodeName();
E === "BLOCKQUOTE" ? this.active() : this.unActive();
}, w.prototype.getTopNodeName = function() {
var m = this.editor, y = m.selection.getSelectionRangeTopNodes()[0], E = y == null ? void 0 : y.getNodeName();
return E;
}, w.prototype.delSelectNode = function(m) {
(0, u.default)(m).call(m, function(y) {
y.remove();
});
}, w;
}(p.default);
r.default = b;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = n(7), h = u.__importDefault(n(3));
function p(g) {
function _(S) {
var b, A = g.selection.getSelectionContainerElem(), w = g.selection.getSelectionRangeTopNodes()[0];
if ((w == null ? void 0 : w.getNodeName()) === "BLOCKQUOTE") {
if (A.getNodeName() === "BLOCKQUOTE") {
var m = (b = A.childNodes()) === null || b === void 0 ? void 0 : b.getNode();
g.selection.moveCursor(m);
}
if (A.text() === "") {
S.preventDefault(), A.remove();
var y = h.default(d.EMPTY_P);
y.insertAfter(w), g.selection.moveCursor(y.getNode(), 0);
}
w.text() === "" && w.remove();
}
}
g.txt.eventHooks.enterDownEvents.push(_);
}
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3));
function p(g) {
var _ = h.default("<blockquote></blockquote>");
return (0, u.default)(g).call(g, function(S) {
_.append(S.clone(!0));
}), _;
}
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(26));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(24)), p = d.__importDefault(n(3)), g = n(6), _ = function(S) {
d.__extends(b, S);
function b(A) {
var w, m = this, y = p.default(`<div class="w-e-menu" data-title="\u80CC\u666F\u8272">
<i class="w-e-icon-paint-brush"></i>
</div>`), E = {
width: 120,
title: "\u80CC\u666F\u989C\u8272",
type: "inline-block",
list: (0, u.default)(w = A.config.colors).call(w, function(x) {
return { $elem: p.default('<i style="color:' + x + ';" class="w-e-icon-paint-brush"></i>'), value: x };
}),
clickHandler: function(k) {
m.command(k);
}
};
return m = S.call(this, y, A, E) || this, m;
}
return b.prototype.command = function(A) {
var w, m = this.editor, y = m.selection.isSelectionEmpty(), E = (w = m.selection.getSelectionContainerElem()) === null || w === void 0 ? void 0 : w.elems[0];
if (E != null) {
var x = (E == null ? void 0 : E.nodeName.toLowerCase()) !== "p", k = E == null ? void 0 : E.style.backgroundColor, D = g.hexToRgb(A) === k;
if (y) {
if (x && !D) {
var P = m.selection.getSelectionRangeTopNodes();
m.selection.createRangeByElem(P[0]), m.selection.moveCursor(P[0].elems[0]);
}
m.selection.createEmptyRange();
}
m.cmd.do("backColor", A), y && (m.selection.collapseRange(), m.selection.restoreSelection());
}
}, b.prototype.tryChangeActive = function() {
}, b;
}(h.default);
r.default = _;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(26));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(24)), p = d.__importDefault(n(3)), g = function(_) {
d.__extends(S, _);
function S(b) {
var A, w = this, m = p.default(`<div class="w-e-menu" data-title="\u6587\u5B57\u989C\u8272">
<i class="w-e-icon-pencil2"></i>
</div>`), y = {
width: 120,
title: "\u6587\u5B57\u989C\u8272",
type: "inline-block",
list: (0, u.default)(A = b.config.colors).call(A, function(E) {
return { $elem: p.default('<i style="color:' + E + ';" class="w-e-icon-pencil2"></i>'), value: E };
}),
clickHandler: function(x) {
w.command(x);
}
};
return w = _.call(this, m, b, y) || this, w;
}
return S.prototype.command = function(b) {
var A, w = this.editor, m = w.selection.isSelectionEmpty(), y = (A = w.selection.getSelectionContainerElem()) === null || A === void 0 ? void 0 : A.elems[0];
if (y != null) {
var E = w.selection.getSelectionText();
if (y.nodeName === "A" && y.textContent === E) {
var x = p.default("<span>&#8203;</span>").getNode();
y.appendChild(x);
}
w.cmd.do("foreColor", b), m && (w.selection.collapseRange(), w.selection.restoreSelection());
}
}, S.prototype.tryChangeActive = function() {
}, S;
}(h.default);
r.default = g;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(3)), h = u.__importDefault(n(33)), p = u.__importDefault(n(38)), g = u.__importDefault(n(340)), _ = u.__importDefault(n(346)), S = function(b) {
u.__extends(A, b);
function A(w) {
var m = this, y = d.default(`<div class="w-e-menu" data-title="\u89C6\u9891">
<i class="w-e-icon-play"></i>
</div>`);
return m = b.call(this, y, w) || this, _.default(w), m;
}
return A.prototype.clickHandler = function() {
this.createPanel("");
}, A.prototype.createPanel = function(w) {
var m = g.default(this.editor, w), y = new h.default(this, m);
y.create();
}, A.prototype.tryChangeActive = function() {
}, A;
}(p.default);
r.default = S;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(17));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = n(6), p = d.__importDefault(n(3)), g = d.__importDefault(n(341)), _ = n(7);
function S(b, A) {
var w = b.config, m = new g.default(b), y = h.getRandom("input-iframe"), E = h.getRandom("btn-ok"), x = h.getRandom("input-upload"), k = h.getRandom("btn-local-ok");
function D(T) {
b.cmd.do("insertHTML", T + _.EMPTY_P), b.config.onlineVideoCallback(T);
}
function P(T) {
var $ = b.config.onlineVideoCheck(T);
return $ === !0 ? !0 : (typeof $ == "string" && b.config.customAlert($, "error"), !1);
}
var M = [{
title: b.i18next.t("menus.panelMenus.video.\u4E0A\u4F20\u89C6\u9891"),
tpl: `<div class="w-e-up-video-container">
<div id="` + k + `" class="w-e-up-btn">
<i class="w-e-icon-upload2"></i>
</div>
<div style="display:none;">
<input id="` + x + `" type="file" accept="video/*"/>
</div>
</div>`,
events: [
{ selector: "#" + k, type: "click", fn: function() {
var $ = p.default("#" + x), V = $.elems[0];
if (V)
V.click();
else
return !0;
} },
{ selector: "#" + x, type: "change", fn: function() {
var $ = p.default("#" + x), V = $.elems[0];
if (!V)
return !0;
var z = V.files;
return z.length && m.uploadVideo(z), !0;
} }
]
}, {
title: b.i18next.t("menus.panelMenus.video.\u63D2\u5165\u89C6\u9891"),
tpl: `<div>
<input
id="` + y + `"
type="text"
class="block"
placeholder="` + b.i18next.t("\u5982") + `\uFF1A<iframe src=... ></iframe>"/>
</td>
<div class="w-e-button-container">
<button type="button" id="` + E + `" class="right">
` + b.i18next.t("\u63D2\u5165") + `
</button>
</div>
</div>`,
events: [
{ selector: "#" + E, type: "click", fn: function() {
var $, V = p.default("#" + y), z = (0, u.default)($ = V.val()).call($);
if (!!z && !!P(z))
return D(z), !0;
}, bindEnter: !0 }
]
}], B = {
width: 300,
height: 0,
tabs: []
};
return window.FileReader && (w.uploadVideoServer || w.customUploadVideo) && B.tabs.push(M[0]), w.showLinkVideo && B.tabs.push(M[1]), B;
}
r.default = S;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(133)), d = a(n(57)), h = a(n(4)), p = a(n(27));
(0, s.default)(r, "__esModule", { value: !0 });
var g = n(2), _ = n(6), S = g.__importDefault(n(135)), b = g.__importDefault(n(136)), A = n(7), w = n(6), m = function() {
function y(E) {
this.editor = E;
}
return y.prototype.uploadVideo = function(E) {
var x = this;
if (!!E.length) {
var k = this.editor, D = k.config, P = "validate.", M = function(he) {
return k.i18next.t(P + he);
}, B = D.uploadVideoServer, T = D.uploadVideoMaxSize, $ = T / 1024, V = D.uploadVideoName, z = D.uploadVideoParams, H = D.uploadVideoParamsWithUrl, I = D.uploadVideoHeaders, U = D.uploadVideoHooks, F = D.uploadVideoTimeout, C = D.withVideoCredentials, q = D.customUploadVideo, X = D.uploadVideoAccept, Y = [], ue = [];
if (_.arrForEach(E, function(we) {
var he = we.name, Se = we.size / 1024 / 1024;
if (!(!he || !Se)) {
if (!(X instanceof Array)) {
ue.push("\u3010" + X + "\u3011" + M("uploadVideoAccept \u4E0D\u662FArray"));
return;
}
if (!(0, u.default)(X).call(X, function(xe) {
return xe === he.split(".")[he.split(".").length - 1];
})) {
ue.push("\u3010" + he + "\u3011" + M("\u4E0D\u662F\u89C6\u9891"));
return;
}
if ($ < Se) {
ue.push("\u3010" + he + "\u3011" + M("\u5927\u4E8E") + " " + $ + "M");
return;
}
Y.push(we);
}
}), ue.length) {
D.customAlert(M("\u89C6\u9891\u9A8C\u8BC1\u672A\u901A\u8FC7") + `:
` + ue.join(`
`), "warning");
return;
}
if (Y.length === 0) {
D.customAlert(M("\u4F20\u5165\u7684\u6587\u4EF6\u4E0D\u5408\u6CD5"), "warning");
return;
}
if (q && typeof q == "function") {
var ee;
q(Y, (0, d.default)(ee = this.insertVideo).call(ee, this));
return;
}
var pe = new FormData();
if ((0, h.default)(Y).call(Y, function(we, he) {
var Se = V || we.name;
Y.length > 1 && (Se = Se + (he + 1)), pe.append(Se, we);
}), B) {
var Te = B.split("#");
B = Te[0];
var ve = Te[1] || "";
(0, h.default)(_).call(_, z, function(we, he) {
H && ((0, p.default)(B).call(B, "?") > 0 ? B += "&" : B += "?", B = B + we + "=" + he), pe.append(we, he);
}), ve && (B += "#" + ve);
var me = S.default(B, { timeout: F, formData: pe, headers: I, withCredentials: !!C, beforeSend: function(he) {
if (U.before)
return U.before(he, k, Y);
}, onTimeout: function(he) {
D.customAlert(M("\u4E0A\u4F20\u89C6\u9891\u8D85\u65F6"), "error"), U.timeout && U.timeout(he, k);
}, onProgress: function(he, Se) {
var xe = new b.default(k);
Se.lengthComputable && (he = Se.loaded / Se.total, xe.show(he));
}, onError: function(he) {
D.customAlert(M("\u4E0A\u4F20\u89C6\u9891\u9519\u8BEF"), "error", M("\u4E0A\u4F20\u89C6\u9891\u9519\u8BEF") + "\uFF0C" + M("\u670D\u52A1\u5668\u8FD4\u56DE\u72B6\u6001") + ": " + he.status), U.error && U.error(he, k);
}, onFail: function(he, Se) {
D.customAlert(M("\u4E0A\u4F20\u89C6\u9891\u5931\u8D25"), "error", M("\u4E0A\u4F20\u89C6\u9891\u8FD4\u56DE\u7ED3\u679C\u9519\u8BEF") + ("\uFF0C" + M("\u8FD4\u56DE\u7ED3\u679C") + ": ") + Se), U.fail && U.fail(he, k, Se);
}, onSuccess: function(he, Se) {
if (U.customInsert) {
var xe;
U.customInsert((0, d.default)(xe = x.insertVideo).call(xe, x), Se, k);
return;
}
if (Se.errno != "0") {
D.customAlert(M("\u4E0A\u4F20\u89C6\u9891\u5931\u8D25"), "error", M("\u4E0A\u4F20\u89C6\u9891\u8FD4\u56DE\u7ED3\u679C\u9519\u8BEF") + "\uFF0C" + M("\u8FD4\u56DE\u7ED3\u679C") + " errno=" + Se.errno), U.fail && U.fail(he, k, Se);
return;
}
var O = Se.data;
x.insertVideo(O.url), U.success && U.success(he, k, Se);
} });
typeof me == "string" && D.customAlert(me, "error");
}
}
}, y.prototype.insertVideo = function(E) {
var x = this.editor, k = x.config, D = "validate.", P = function(T, $) {
return $ === void 0 && ($ = D), x.i18next.t($ + T);
};
if (!k.customInsertVideo)
w.UA.isFirefox ? x.cmd.do("insertHTML", '<p data-we-video-p="true"><video src="' + E + '" controls="controls" style="max-width:100%"></video></p><p>&#8203</p>') : x.cmd.do("insertHTML", '<video src="' + E + '" controls="controls" style="max-width:100%"></video>' + A.EMPTY_P);
else {
k.customInsertVideo(E);
return;
}
var M = document.createElement("video");
M.onload = function() {
M = null;
}, M.onerror = function() {
k.customAlert(P("\u63D2\u5165\u89C6\u9891\u9519\u8BEF"), "error", "wangEditor: " + P("\u63D2\u5165\u89C6\u9891\u9519\u8BEF") + "\uFF0C" + P("\u89C6\u9891\u94FE\u63A5") + ' "' + E + '"\uFF0C' + P("\u4E0B\u8F7D\u94FE\u63A5\u5931\u8D25")), M = null;
}, M.onabort = function() {
return M = null;
}, M.src = E;
}, y;
}();
r.default = m;
}, function(i, r, n) {
i.exports = n(343);
}, function(i, r, n) {
var a = n(344);
i.exports = a;
}, function(i, r, n) {
n(345);
var a = n(9);
i.exports = a.Date.now;
}, function(i, r, n) {
var a = n(5);
a({ target: "Date", stat: !0 }, { now: function() {
return new Date().getTime();
} });
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(347)), h = u.__importDefault(n(349));
function p(g) {
d.default(g), h.default(g);
}
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 }), r.createShowHideFn = void 0;
var u = n(2), d = u.__importDefault(n(3)), h = u.__importDefault(n(39)), p = u.__importDefault(n(348));
function g(S) {
var b, A = function(E, x) {
return x === void 0 && (x = ""), S.i18next.t(x + E);
};
function w(y) {
var E = [{ $elem: d.default("<span class='w-e-icon-trash-o'></span>"), onClick: function(k, D) {
return D.remove(), !0;
} }, { $elem: d.default("<span>100%</span>"), onClick: function(k, D) {
return D.attr("width", "100%"), D.removeAttr("height"), !0;
} }, { $elem: d.default("<span>50%</span>"), onClick: function(k, D) {
return D.attr("width", "50%"), D.removeAttr("height"), !0;
} }, { $elem: d.default("<span>30%</span>"), onClick: function(k, D) {
return D.attr("width", "30%"), D.removeAttr("height"), !0;
} }, { $elem: d.default("<span>" + A("\u91CD\u7F6E") + "</span>"), onClick: function(k, D) {
return D.removeAttr("width"), D.removeAttr("height"), !0;
} }, { $elem: d.default("<span>" + A("menus.justify.\u9760\u5DE6") + "</span>"), onClick: function(k, D) {
return p.default(D, "left"), !0;
} }, { $elem: d.default("<span>" + A("menus.justify.\u5C45\u4E2D") + "</span>"), onClick: function(k, D) {
return p.default(D, "center"), !0;
} }, { $elem: d.default("<span>" + A("menus.justify.\u9760\u53F3") + "</span>"), onClick: function(k, D) {
return p.default(D, "right"), !0;
} }];
b = new h.default(S, y, E), b.create();
}
function m() {
b && (b.remove(), b = null);
}
return { showVideoTooltip: w, hideVideoTooltip: m };
}
r.createShowHideFn = g;
function _(S) {
var b = g(S), A = b.showVideoTooltip, w = b.hideVideoTooltip;
S.txt.eventHooks.videoClickEvents.push(A), S.txt.eventHooks.clickEvents.push(w), S.txt.eventHooks.keyupEvents.push(w), S.txt.eventHooks.toolbarClickEvents.push(w), S.txt.eventHooks.menuClickEvents.push(w), S.txt.eventHooks.textScrollEvents.push(w), S.txt.eventHooks.changeEvents.push(w);
}
r.default = _;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(28));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3));
function p(_, S) {
var b = ["P"], A = g(_, b);
A && h.default(A).css("text-align", S);
}
r.default = p;
function g(_, S) {
for (var b, A = _.elems[0]; A != null; ) {
if ((0, u.default)(S).call(S, A == null ? void 0 : A.nodeName))
return A;
if (((b = A == null ? void 0 : A.parentNode) === null || b === void 0 ? void 0 : b.nodeName) === "BODY")
return null;
A = A.parentNode;
}
return A;
}
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(6);
function d(h) {
if (!!u.UA.isFirefox) {
var p = h.txt, g = h.selection, _ = p.eventHooks.keydownEvents;
_.push(function(S) {
var b = g.getSelectionContainerElem();
if (b) {
var A = b.getNodeTop(h), w = A.length && A.prev().length ? A.prev() : null;
w && w.attr("data-we-video-p") && g.getCursorPos() === 0 && S.keyCode === 8 && w.remove();
}
});
}
}
r.default = d;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(26));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = n(7), p = d.__importDefault(n(3)), g = d.__importDefault(n(33)), _ = d.__importDefault(n(38)), S = d.__importDefault(n(351)), b = d.__importDefault(n(364)), A = function(w) {
d.__extends(m, w);
function m(y) {
var E = this, x = p.default('<div class="w-e-menu" data-title="\u56FE\u7247"><i class="w-e-icon-image"></i></div>'), k = b.default(y);
if (k.onlyUploadConf) {
var D;
x = k.onlyUploadConf.$elem, (0, u.default)(D = k.onlyUploadConf.events).call(D, function(P) {
var M = P.type, B = P.fn || h.EMPTY_FN;
x.on(M, function(T) {
T.stopPropagation(), B(T);
});
});
}
return E = w.call(this, x, y) || this, E.imgPanelConfig = k, S.default(y), E;
}
return m.prototype.clickHandler = function() {
this.imgPanelConfig.onlyUploadConf || this.createPanel();
}, m.prototype.createPanel = function() {
var y = this.imgPanelConfig, E = new g.default(this, y);
this.setPanel(E), E.create();
}, m.prototype.tryChangeActive = function() {
}, m;
}(_.default);
r.default = A;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(352)), h = u.__importDefault(n(353)), p = u.__importDefault(n(354)), g = u.__importDefault(n(362)), _ = u.__importDefault(n(363));
function S(b) {
d.default(b), h.default(b), p.default(b), g.default(b), _.default(b);
}
r.default = S;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = n(131), h = u.__importDefault(n(97));
function p(b, A) {
var w = b.config, m = w.pasteFilterStyle, y = w.pasteIgnoreImg, E = d.getPasteHtml(A, m, y);
if (E)
return !0;
var x = d.getPasteText(A);
return !!x;
}
function g(b, A) {
for (var w, m = ((w = A.clipboardData) === null || w === void 0 ? void 0 : w.types) || [], y = 0; y < m.length; y++) {
var E = m[y];
if (E === "Files")
return !0;
}
return !1;
}
function _(b, A) {
if (!(!g(A, b) && p(A, b))) {
var w = d.getPasteImgs(b);
if (!!w.length) {
var m = new h.default(A);
m.uploadImg(w);
}
}
}
function S(b) {
b.txt.eventHooks.pasteEvents.unshift(function(A) {
_(A, b);
});
}
r.default = S;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(97));
function h(p) {
function g(_) {
var S = _.dataTransfer && _.dataTransfer.files;
if (!(!S || !S.length)) {
var b = new d.default(p);
b.uploadImg(S);
}
}
p.txt.eventHooks.dropEvents.push(g);
}
r.default = h;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(29)), d = a(n(355));
(0, s.default)(r, "__esModule", { value: !0 }), r.createShowHideFn = void 0;
var h = n(2), p = h.__importDefault(n(3));
n(360);
var g = n(6);
function _(m, y, E, x, k) {
m.attr("style", "width:" + y + "px; height:" + E + "px; left:" + x + "px; top:" + k + "px;");
}
function S(m, y) {
var E = p.default(`<div class="w-e-img-drag-mask">
<div class="w-e-img-drag-show-size"></div>
<div class="w-e-img-drag-rb"></div>
</div>`);
return E.hide(), y.append(E), E;
}
function b(m, y, E) {
var x = m.getBoundingClientRect(), k = E.getBoundingClientRect(), D = k.width.toFixed(2), P = k.height.toFixed(2);
(0, u.default)(y).call(y, ".w-e-img-drag-show-size").text(D + "px * " + P + "px"), _(y, (0, d.default)(D), (0, d.default)(P), k.left - x.left, k.top - x.top), y.show();
}
function A(m) {
var y = m.$textContainerElem, E, x = S(m, y);
function k(M, B) {
M.on("click", function(T) {
T.stopPropagation();
}), M.on("mousedown", ".w-e-img-drag-rb", function(T) {
if (T.preventDefault(), !E)
return;
var $ = T.clientX, V = T.clientY, z = B.getBoundingClientRect(), H = E.getBoundingClientRect(), I = H.width, U = H.height, F = H.left - z.left, C = H.top - z.top, q = I / U, X = I, Y = U, ue = p.default(document);
function ee() {
ue.off("mousemove", pe), ue.off("mouseup", Te);
}
function pe(ve) {
ve.stopPropagation(), ve.preventDefault(), X = I + (ve.clientX - $), Y = U + (ve.clientY - V), X / Y != q && (Y = X / q), X = (0, d.default)(X.toFixed(2)), Y = (0, d.default)(Y.toFixed(2)), (0, u.default)(M).call(M, ".w-e-img-drag-show-size").text(X.toFixed(2).replace(".00", "") + "px * " + Y.toFixed(2).replace(".00", "") + "px"), _(M, X, Y, F, C);
}
ue.on("mousemove", pe);
function Te() {
E.attr("width", X + ""), E.attr("height", Y + "");
var ve = E.getBoundingClientRect();
_(M, X, Y, ve.left - z.left, ve.top - z.top), ee();
}
ue.on("mouseup", Te), ue.on("mouseleave", ee);
});
}
function D(M) {
if (g.UA.isIE())
return !1;
M && (E = M, b(y, x, E));
}
function P() {
(0, u.default)(y).call(y, ".w-e-img-drag-mask").hide();
}
return k(x, y), p.default(document).on("click", P), m.beforeDestroy(function() {
p.default(document).off("click", P);
}), { showDrag: D, hideDrag: P };
}
r.createShowHideFn = A;
function w(m) {
var y = A(m), E = y.showDrag, x = y.hideDrag;
m.txt.eventHooks.imgClickEvents.push(E), m.txt.eventHooks.textScrollEvents.push(x), m.txt.eventHooks.keyupEvents.push(x), m.txt.eventHooks.toolbarClickEvents.push(x), m.txt.eventHooks.menuClickEvents.push(x), m.txt.eventHooks.changeEvents.push(x);
}
r.default = w;
}, function(i, r, n) {
i.exports = n(356);
}, function(i, r, n) {
var a = n(357);
i.exports = a;
}, function(i, r, n) {
n(358);
var a = n(9);
i.exports = a.parseFloat;
}, function(i, r, n) {
var a = n(5), s = n(359);
a({ global: !0, forced: parseFloat != s }, { parseFloat: s });
}, function(i, r, n) {
var a = n(8), s = n(90).trim, u = n(68), d = a.parseFloat, h = 1 / d(u + "-0") !== -1 / 0;
i.exports = h ? function(g) {
var _ = s(String(g)), S = d(_);
return S === 0 && _.charAt(0) == "-" ? -0 : S;
} : d;
}, function(i, r, n) {
var a = n(20), s = n(361);
s = s.__esModule ? s.default : s, typeof s == "string" && (s = [[i.i, s, ""]]);
var u = {};
u.insert = "head", u.singleton = !1, a(s, u), i.exports = s.locals || {};
}, function(i, r, n) {
var a = n(21);
r = a(!1), r.push([i.i, `.w-e-text-container {
overflow: hidden;
}
.w-e-img-drag-mask {
position: absolute;
z-index: 1;
border: 1px dashed #ccc;
box-sizing: border-box;
}
.w-e-img-drag-mask .w-e-img-drag-rb {
position: absolute;
right: -5px;
bottom: -5px;
width: 16px;
height: 16px;
border-radius: 50%;
background: #ccc;
cursor: se-resize;
}
.w-e-img-drag-mask .w-e-img-drag-show-size {
min-width: 110px;
height: 22px;
line-height: 22px;
font-size: 14px;
color: #999;
position: absolute;
left: 0;
top: 0;
background-color: #999;
color: #fff;
border-radius: 2px;
padding: 0 5px;
}
`, ""]), i.exports = r;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 }), r.createShowHideFn = void 0;
var u = n(2), d = u.__importDefault(n(3)), h = u.__importDefault(n(39));
function p(_) {
var S, b = function(y, E) {
return E === void 0 && (E = ""), _.i18next.t(E + y);
};
function A(m) {
var y = [{ $elem: d.default("<span class='w-e-icon-trash-o'></span>"), onClick: function(x, k) {
return x.selection.createRangeByElem(k), x.selection.restoreSelection(), x.cmd.do("delete"), !0;
} }, { $elem: d.default("<span>30%</span>"), onClick: function(x, k) {
return k.attr("width", "30%"), k.removeAttr("height"), !0;
} }, { $elem: d.default("<span>50%</span>"), onClick: function(x, k) {
return k.attr("width", "50%"), k.removeAttr("height"), !0;
} }, { $elem: d.default("<span>100%</span>"), onClick: function(x, k) {
return k.attr("width", "100%"), k.removeAttr("height"), !0;
} }];
y.push({ $elem: d.default("<span>" + b("\u91CD\u7F6E") + "</span>"), onClick: function(x, k) {
return k.removeAttr("width"), k.removeAttr("height"), !0;
} }), m.attr("data-href") && y.push({ $elem: d.default("<span>" + b("\u67E5\u770B\u94FE\u63A5") + "</span>"), onClick: function(x, k) {
var D = k.attr("data-href");
return D && (D = decodeURIComponent(D), window.open(D, "_target")), !0;
} }), S = new h.default(_, m, y), S.create();
}
function w() {
S && (S.remove(), S = null);
}
return { showImgTooltip: A, hideImgTooltip: w };
}
r.createShowHideFn = p;
function g(_) {
var S = p(_), b = S.showImgTooltip, A = S.hideImgTooltip;
_.txt.eventHooks.imgClickEvents.push(b), _.txt.eventHooks.clickEvents.push(A), _.txt.eventHooks.keyupEvents.push(A), _.txt.eventHooks.toolbarClickEvents.push(A), _.txt.eventHooks.menuClickEvents.push(A), _.txt.eventHooks.textScrollEvents.push(A), _.txt.eventHooks.imgDragBarMouseDownEvents.push(A), _.txt.eventHooks.changeEvents.push(A);
}
r.default = g;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
function u(d) {
var h = d.txt, p = d.selection, g = h.eventHooks.keydownEvents;
g.push(function(_) {
var S = p.getSelectionContainerElem(), b = p.getRange();
if (!(!b || !S || _.keyCode !== 8 || !p.isSelectionEmpty())) {
var A = b.startContainer, w = b.startOffset, m = null;
if (w === 0)
for (; A !== S.elems[0] && S.elems[0].contains(A) && A.parentNode && !m; ) {
if (A.previousSibling) {
m = A.previousSibling;
break;
}
A = A.parentNode;
}
else
A.nodeType !== 3 && (m = A.childNodes[w - 1]);
if (!!m) {
for (var y = m; y.childNodes.length; )
y = y.childNodes[y.childNodes.length - 1];
y instanceof HTMLElement && y.tagName === "IMG" && (y.remove(), _.preventDefault());
}
}
});
}
r.default = u;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(26)), d = a(n(17));
(0, s.default)(r, "__esModule", { value: !0 });
var h = n(2), p = h.__importDefault(n(3)), g = n(6), _ = h.__importDefault(n(97));
function S(b) {
var A, w = b.config, m = new _.default(b), y = g.getRandom("up-trigger-id"), E = g.getRandom("up-file-id"), x = g.getRandom("input-link-url"), k = g.getRandom("input-link-url-alt"), D = g.getRandom("input-link-url-href"), P = g.getRandom("btn-link"), M = "menus.panelMenus.image.", B = function(q, X) {
return X === void 0 && (X = M), b.i18next.t(X + q);
};
function T(C, q, X) {
var Y = w.linkImgCheck(C);
return Y === !0 ? !0 : (typeof Y == "string" && w.customAlert(Y, "error"), !1);
}
var $ = w.uploadImgMaxLength === 1 ? "" : 'multiple="multiple"', V = (0, u.default)(A = w.uploadImgAccept).call(A, function(C) {
return "image/" + C;
}).join(","), z = function(q, X, Y) {
return '<div class="' + q + '" data-title="' + Y + `">
<div id="` + y + `" class="w-e-up-btn">
<i class="` + X + `"></i>
</div>
<div style="display:none;">
<input id="` + E + '" type="file" ' + $ + ' accept="' + V + `"/>
</div>
</div>`;
}, H = [
{ selector: "#" + y, type: "click", fn: function() {
var q = w.uploadImgFromMedia;
if (q && typeof q == "function")
return q(), !0;
var X = p.default("#" + E), Y = X.elems[0];
if (Y)
Y.click();
else
return !0;
} },
{ selector: "#" + E, type: "change", fn: function() {
var q = p.default("#" + E), X = q.elems[0];
if (!X)
return !0;
var Y = X.files;
return Y != null && Y.length && m.uploadImg(Y), X && (X.value = ""), !0;
} }
], I = [`<input
id="` + x + `"
type="text"
class="block"
placeholder="` + B("\u56FE\u7247\u5730\u5740") + '"/>'];
w.showLinkImgAlt && I.push(`
<input
id="` + k + `"
type="text"
class="block"
placeholder="` + B("\u56FE\u7247\u6587\u5B57\u8BF4\u660E") + '"/>'), w.showLinkImgHref && I.push(`
<input
id="` + D + `"
type="text"
class="block"
placeholder="` + B("\u8DF3\u8F6C\u94FE\u63A5") + '"/>');
var U = [
{
title: B("\u4E0A\u4F20\u56FE\u7247"),
tpl: z("w-e-up-img-container", "w-e-icon-upload2", ""),
events: H
},
{ title: B("\u7F51\u7EDC\u56FE\u7247"), tpl: `<div>
` + I.join("") + `
<div class="w-e-button-container">
<button type="button" id="` + P + '" class="right">' + B("\u63D2\u5165", "") + `</button>
</div>
</div>`, events: [{ selector: "#" + P, type: "click", fn: function() {
var q, X = p.default("#" + x), Y = (0, d.default)(q = X.val()).call(q);
if (!!Y) {
var ue;
if (w.showLinkImgAlt) {
var ee;
ue = (0, d.default)(ee = p.default("#" + k).val()).call(ee);
}
var pe;
if (w.showLinkImgHref) {
var Te;
pe = (0, d.default)(Te = p.default("#" + D).val()).call(Te);
}
if (!!T(Y))
return m.insertImg(Y, ue, pe), !0;
}
}, bindEnter: !0 }] }
], F = { width: 300, height: 0, tabs: [], onlyUploadConf: { $elem: p.default(z("w-e-menu", "w-e-icon-image", "\u56FE\u7247")), events: H } };
return window.FileReader && (w.uploadImgShowBase64 || w.uploadImgServer || w.customUploadImg || w.uploadImgFromMedia) && F.tabs.push(U[0]), w.showLinkImg && (F.tabs.push(U[1]), F.onlyUploadConf = void 0), F;
}
r.default = S;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3)), p = d.__importDefault(n(24)), g = d.__importDefault(n(366)), _ = function(S) {
d.__extends(b, S);
function b(A) {
var w = this, m = h.default(`<div class="w-e-menu" data-title="\u7F29\u8FDB">
<i class="w-e-icon-indent-increase"></i>
</div>`), y = { width: 130, title: "\u8BBE\u7F6E\u7F29\u8FDB", type: "list", list: [{ $elem: h.default(`<p>
<i class="w-e-icon-indent-increase w-e-drop-list-item"></i>
` + A.i18next.t("menus.dropListMenu.indent.\u589E\u52A0\u7F29\u8FDB") + `
<p>`), value: "increase" }, { $elem: h.default(`<p>
<i class="w-e-icon-indent-decrease w-e-drop-list-item"></i>
` + A.i18next.t("menus.dropListMenu.indent.\u51CF\u5C11\u7F29\u8FDB") + `
<p>`), value: "decrease" }], clickHandler: function(x) {
w.command(x);
} };
return w = S.call(this, m, A, y) || this, w;
}
return b.prototype.command = function(A) {
var w = this.editor, m = w.selection.getSelectionContainerElem();
if (m && w.$textElem.equal(m)) {
var y = w.selection.getSelectionRangeTopNodes();
y.length > 0 && (0, u.default)(y).call(y, function(E) {
g.default(h.default(E), A, w);
});
} else
m && m.length > 0 && (0, u.default)(m).call(m, function(E) {
g.default(h.default(E), A, w);
});
w.selection.restoreSelection(), this.tryChangeActive();
}, b.prototype.tryChangeActive = function() {
var A = this.editor, w = A.selection.getSelectionStartElem(), m = h.default(w).getNodeTop(A);
m.length <= 0 || (m.elems[0].style.paddingLeft != "" ? this.active() : this.unActive());
}, b;
}(p.default);
r.default = _;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(45)), d = a(n(17));
(0, s.default)(r, "__esModule", { value: !0 });
var h = n(2), p = h.__importDefault(n(367)), g = h.__importDefault(n(368)), _ = /^(\d+)(\w+)$/, S = /^(\d+)%$/;
function b(w) {
var m = w.config.indentation;
if (typeof m == "string") {
if (_.test(m)) {
var y, E = (0, u.default)(y = (0, d.default)(m).call(m).match(_)).call(y, 1, 3), x = E[0], k = E[1];
return { value: Number(x), unit: k };
} else if (S.test(m))
return { value: Number((0, d.default)(m).call(m).match(S)[1]), unit: "%" };
} else if (m.value !== void 0 && m.unit)
return m;
return { value: 2, unit: "em" };
}
function A(w, m, y) {
var E = w.getNodeTop(y), x = /^(P|H[0-9]*)$/;
x.test(E.getNodeName()) && (m === "increase" ? p.default(E, b(y)) : m === "decrease" && g.default(E, b(y)));
}
r.default = A;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(45));
(0, s.default)(r, "__esModule", { value: !0 });
function d(h, p) {
var g = h.elems[0];
if (g.style.paddingLeft === "")
h.css("padding-left", p.value + p.unit);
else {
var _ = g.style.paddingLeft, S = (0, u.default)(_).call(_, 0, _.length - p.unit.length), b = Number(S) + p.value;
h.css("padding-left", "" + b + p.unit);
}
}
r.default = d;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(45));
(0, s.default)(r, "__esModule", { value: !0 });
function d(h, p) {
var g = h.elems[0];
if (g.style.paddingLeft !== "") {
var _ = g.style.paddingLeft, S = (0, u.default)(_).call(_, 0, _.length - p.unit.length), b = Number(S) - p.value;
b > 0 ? h.css("padding-left", "" + b + p.unit) : h.css("padding-left", "");
}
}
r.default = d;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(3)), h = u.__importDefault(n(38)), p = u.__importDefault(n(33)), g = u.__importDefault(n(370)), _ = function(S) {
u.__extends(b, S);
function b(A) {
var w = this, m = d.default(`<div class="w-e-menu" data-title="\u8868\u60C5">
<i class="w-e-icon-happy"></i>
</div>`);
return w = S.call(this, m, A) || this, w;
}
return b.prototype.createPanel = function() {
var A = g.default(this.editor), w = new p.default(this, A);
w.create();
}, b.prototype.clickHandler = function() {
this.createPanel();
}, b.prototype.tryChangeActive = function() {
}, b;
}(h.default);
r.default = _;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(26)), d = a(n(70)), h = a(n(17));
(0, s.default)(r, "__esModule", { value: !0 });
var p = n(2), g = p.__importDefault(n(3));
function _(S) {
var b = S.config.emotions;
function A(y) {
var E = [];
if (y.type == "image") {
var x;
E = (0, u.default)(x = y.content).call(x, function(D) {
return typeof D == "string" ? "" : '<span title="' + D.alt + `">
<img class="eleImg" data-emoji="` + D.alt + '" style src="' + D.src + '" alt="[' + D.alt + `]">
</span>`;
}), E = (0, d.default)(E).call(E, function(D) {
return D !== "";
});
} else {
var k;
E = (0, u.default)(k = y.content).call(k, function(D) {
return '<span class="eleImg" title="' + D + '">' + D + "</span>";
});
}
return E.join("").replace(/&nbsp;/g, "");
}
var w = (0, u.default)(b).call(b, function(y) {
return {
title: S.i18next.t("menus.panelMenus.emoticon." + y.title),
tpl: "<div>" + A(y) + "</div>",
events: [{ selector: ".eleImg", type: "click", fn: function(x) {
var k = g.default(x.target), D = k.getNodeName(), P;
if (D === "IMG") {
var M;
P = (0, h.default)(M = k.parent().html()).call(M);
} else
P = "<span>" + k.html() + "</span>";
return S.cmd.do("insertHTML", P), !0;
} }]
};
}), m = { width: 300, height: 230, tabs: w };
return m;
}
r.default = _;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 }), r.createListHandle = r.ClassType = void 0;
var u = n(2), d = u.__importDefault(n(3)), h = u.__importDefault(n(372)), p = u.__importDefault(n(374)), g = u.__importDefault(n(375)), _ = u.__importDefault(n(376)), S = u.__importDefault(n(377)), b;
(function(y) {
y.Wrap = "WrapListHandle", y.Join = "JoinListHandle", y.StartJoin = "StartJoinListHandle", y.EndJoin = "EndJoinListHandle", y.Other = "OtherListHandle";
})(b = r.ClassType || (r.ClassType = {}));
var A = { WrapListHandle: h.default, JoinListHandle: p.default, StartJoinListHandle: g.default, EndJoinListHandle: _.default, OtherListHandle: S.default };
function w(y, E, x) {
if (y === b.Other && x === void 0)
throw new Error("other \u7C7B\u9700\u8981\u4F20\u5165 range");
return y !== b.Other ? new A[y](E) : new A[y](E, x);
}
r.createListHandle = w;
var m = function() {
function y(E) {
this.handle = E, this.handle.exec();
}
return y.prototype.getSelectionRangeElem = function() {
return d.default(this.handle.selectionRangeElem.get());
}, y;
}();
r.default = m;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3)), p = n(58), g = n(47), _ = function(S) {
d.__extends(b, S);
function b(A) {
return S.call(this, A) || this;
}
return b.prototype.exec = function() {
var A = this.options, w = A.listType, m = A.listTarget, y = A.$selectionElem, E = A.$startElem, x = A.$endElem, k, D = [], P = y == null ? void 0 : y.getNodeName(), M = E.prior, B = x.prior;
if (!E.prior && !x.prior || !(M != null && M.prev().length) && !(B != null && B.next().length)) {
var T;
(0, u.default)(T = y == null ? void 0 : y.children()).call(T, function(F) {
D.push(h.default(F));
}), P === w ? k = g.createElementFragment(
D,
g.createDocumentFragment(),
"p"
) : (k = g.createElement(m), (0, u.default)(D).call(D, function(F) {
k.appendChild(F.elems[0]);
})), this.selectionRangeElem.set(k), g.insertBefore(y, k, y.elems[0]), y.remove();
} else {
for (var $ = M; $.length; )
D.push($), B != null && B.equal($) ? $ = h.default(void 0) : $ = $.next();
var V = M.prev(), z = B.next();
if (P === w ? k = g.createElementFragment(
D,
g.createDocumentFragment(),
"p"
) : (k = g.createElement(m), (0, u.default)(D).call(D, function(F) {
k.append(F.elems[0]);
})), V.length && z.length) {
for (var H = []; z.length; )
H.push(z), z = z.next();
var I = g.createElement(P);
(0, u.default)(H).call(H, function(F) {
I.append(F.elems[0]);
}), h.default(I).insertAfter(y), this.selectionRangeElem.set(k);
var U = y.next();
U.length ? g.insertBefore(y, k, U.elems[0]) : y.parent().elems[0].append(k);
} else if (!V.length)
this.selectionRangeElem.set(k), g.insertBefore(y, k, y.elems[0]);
else {
this.selectionRangeElem.set(k);
var U = y.next();
U.length ? g.insertBefore(y, k, U.elems[0]) : y.parent().elems[0].append(k);
}
}
}, b;
}(p.ListHandle);
r.default = _;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var d = function() {
function h() {
this._element = null;
}
return h.prototype.set = function(p) {
if (p instanceof DocumentFragment) {
var g, _ = [];
(0, u.default)(g = p.childNodes).call(g, function(S) {
_.push(S);
}), p = _;
}
this._element = p;
}, h.prototype.get = function() {
return this._element;
}, h.prototype.clear = function() {
this._element = null;
}, h;
}();
r.default = d;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3)), p = n(58), g = n(47), _ = function(S) {
d.__extends(b, S);
function b(A) {
return S.call(this, A) || this;
}
return b.prototype.exec = function() {
var A, w, m, y, E, x, k, D = this.options, P = D.editor, M = D.listType, B = D.listTarget, T = D.$startElem, $ = D.$endElem, V, z = P.selection.getSelectionRangeTopNodes(), H = T == null ? void 0 : T.getNodeName(), I = $ == null ? void 0 : $.getNodeName();
if (H === I)
if (z.length > 2)
if (z.shift(), z.pop(), V = g.createElementFragment(
g.filterSelectionNodes(z),
g.createDocumentFragment()
), H === M)
(A = $.children()) === null || A === void 0 || (0, u.default)(A).call(A, function(ve) {
V.append(ve);
}), $.remove(), this.selectionRangeElem.set(V), T.elems[0].append(V);
else {
for (var U = document.createDocumentFragment(), F = document.createDocumentFragment(), C = g.getStartPoint(T); C.length; ) {
var q = C.elems[0];
C = C.next(), U.append(q);
}
for (var X = g.getEndPoint($), Y = []; X.length; )
Y.unshift(X.elems[0]), X = X.prev();
(0, u.default)(Y).call(Y, function(ve) {
F.append(ve);
});
var ue = g.createElement(B);
ue.append(U), ue.append(V), ue.append(F), V = ue, this.selectionRangeElem.set(V), h.default(ue).insertAfter(T), !(!((w = T.children()) === null || w === void 0) && w.length) && T.remove(), !(!((m = $.children()) === null || m === void 0) && m.length) && $.remove();
}
else {
z.length = 0;
for (var C = g.getStartPoint(T); C.length; )
z.push(C), C = C.next();
for (var X = g.getEndPoint($), Y = []; X.length; )
Y.unshift(X), X = X.prev();
z.push.apply(z, Y), H === M ? (V = g.createElementFragment(z, g.createDocumentFragment(), "p"), this.selectionRangeElem.set(V), g.insertBefore(T, V, $.elems[0])) : (V = g.createElement(B), (0, u.default)(z).call(z, function(he) {
V.append(he.elems[0]);
}), this.selectionRangeElem.set(V), h.default(V).insertAfter(T)), !(!((y = T.children()) === null || y === void 0) && y.length) && $.remove(), !(!((E = $.children()) === null || E === void 0) && E.length) && $.remove();
}
else {
for (var ee = [], X = g.getEndPoint($); X.length; )
ee.unshift(X), X = X.prev();
for (var pe = [], C = g.getStartPoint(T); C.length; )
pe.push(C), C = C.next();
if (V = g.createDocumentFragment(), z.shift(), z.pop(), (0, u.default)(pe).call(pe, function(we) {
return V.append(we.elems[0]);
}), V = g.createElementFragment(
g.filterSelectionNodes(z),
V
), (0, u.default)(ee).call(ee, function(we) {
return V.append(we.elems[0]);
}), this.selectionRangeElem.set(V), H === M)
T.elems[0].append(V), !(!((x = $.children()) === null || x === void 0) && x.length) && $.remove();
else if (!((k = $.children()) === null || k === void 0) && k.length) {
var Te = $.children();
g.insertBefore(Te, V, Te.elems[0]);
} else
$.elems[0].append(V);
}
}, b;
}(p.ListHandle);
r.default = _;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3)), p = n(58), g = n(47), _ = function(S) {
d.__extends(b, S);
function b(A) {
return S.call(this, A) || this;
}
return b.prototype.exec = function() {
var A, w = this.options, m = w.editor, y = w.listType, E = w.listTarget, x = w.$startElem, k, D = m.selection.getSelectionRangeTopNodes(), P = x == null ? void 0 : x.getNodeName();
D.shift();
for (var M = [], B = g.getStartPoint(x); B.length; )
M.push(B), B = B.next();
P === y ? (k = g.createDocumentFragment(), (0, u.default)(M).call(M, function(T) {
return k.append(T.elems[0]);
}), k = g.createElementFragment(
g.filterSelectionNodes(D),
k
), this.selectionRangeElem.set(k), x.elems[0].append(k)) : (k = g.createElement(E), (0, u.default)(M).call(M, function(T) {
return k.append(T.elems[0]);
}), k = g.createElementFragment(
g.filterSelectionNodes(D),
k
), this.selectionRangeElem.set(k), h.default(k).insertAfter(x), !(!((A = x.children()) === null || A === void 0) && A.length) && x.remove());
}, b;
}(p.ListHandle);
r.default = _;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3)), p = n(58), g = n(47), _ = function(S) {
d.__extends(b, S);
function b(A) {
return S.call(this, A) || this;
}
return b.prototype.exec = function() {
var A, w, m = this.options, y = m.editor, E = m.listType, x = m.listTarget, k = m.$endElem, D, P = y.selection.getSelectionRangeTopNodes(), M = k == null ? void 0 : k.getNodeName();
P.pop();
for (var B = [], T = g.getEndPoint(k); T.length; )
B.unshift(T), T = T.prev();
if (M === E)
if (D = g.createElementFragment(
g.filterSelectionNodes(P),
g.createDocumentFragment()
), (0, u.default)(B).call(B, function(z) {
return D.append(z.elems[0]);
}), this.selectionRangeElem.set(D), !((A = k.children()) === null || A === void 0) && A.length) {
var $ = k.children();
g.insertBefore($, D, $.elems[0]);
} else
k.elems[0].append(D);
else {
var V = g.filterSelectionNodes(P);
V.push.apply(V, B), D = g.createElementFragment(
V,
g.createElement(x)
), this.selectionRangeElem.set(D), h.default(D).insertBefore(k), !(!((w = k.children()) === null || w === void 0) && w.length) && k.remove();
}
}, b;
}(p.ListHandle);
r.default = _;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = n(58), h = n(47), p = function(g) {
u.__extends(_, g);
function _(S, b) {
var A = g.call(this, S) || this;
return A.range = b, A;
}
return _.prototype.exec = function() {
var S = this.options, b = S.editor, A = S.listTarget, w = b.selection.getSelectionRangeTopNodes(), m = h.createElementFragment(
h.filterSelectionNodes(w),
h.createElement(A)
);
this.selectionRangeElem.set(m), this.range.insertNode(m);
}, _;
}(d.ListHandle);
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4)), d = a(n(27));
(0, s.default)(r, "__esModule", { value: !0 });
var h = n(2), p = h.__importDefault(n(24)), g = h.__importDefault(n(3)), _ = h.__importDefault(n(379)), S = function(b) {
h.__extends(A, b);
function A(w) {
var m = this, y = g.default(`<div class="w-e-menu" data-title="\u884C\u9AD8">
<i class="w-e-icon-row-height"></i>
</div>`), E = new _.default(w, w.config.lineHeights), x = { width: 100, title: "\u8BBE\u7F6E\u884C\u9AD8", type: "list", list: E.getItemList(), clickHandler: function(D) {
w.selection.saveRange(), m.command(D);
} };
return m = b.call(this, y, w, x) || this, m;
}
return A.prototype.command = function(w) {
var m = this.editor;
m.selection.restoreSelection();
var y = g.default(m.selection.getSelectionContainerElem());
if (!!y.elems.length) {
if (y && m.$textElem.equal(y)) {
for (var E = !1, x = g.default(m.selection.getSelectionStartElem()).elems[0], k = g.default(m.selection.getSelectionEndElem()).elems[0], D = this.getDom(x), P = this.getDom(k), M = y.elems[0].children, B = 0; B < M.length; B++) {
var T = M[B];
if (g.default(T).getNodeName() === "P" && (T === D && (E = !0), E && (g.default(T).css("line-height", w), T === P))) {
E = !1;
return;
}
}
m.selection.createRangeByElems(x, k);
return;
}
var $ = y.elems[0], V = this.getDom($);
g.default(V).getNodeName() === "P" && (g.default(V).css("line-height", w), m.selection.createRangeByElems(V, V));
}
}, A.prototype.getDom = function(w) {
var m = g.default(w).elems[0];
if (!m.parentNode)
return m;
function y(E, x) {
var k = g.default(E.parentNode);
return x.$textElem.equal(k) ? E : y(k.elems[0], x);
}
return m = y(m, this.editor), m;
}, A.prototype.styleProcessing = function(w) {
var m = "";
return (0, u.default)(w).call(w, function(y) {
y !== "" && (0, d.default)(y).call(y, "line-height") === -1 && (m = m + y + ";");
}), m;
}, A.prototype.setRange = function(w, m) {
var y = this.editor, E = window.getSelection ? window.getSelection() : document.getSelection();
E == null || E.removeAllRanges();
var x = document.createRange(), k = w, D = m;
x.setStart(k, 0), x.setEnd(D, 1), E == null || E.addRange(x), y.selection.saveRange(), E == null || E.removeAllRanges(), y.selection.restoreSelection();
}, A.prototype.tryChangeActive = function() {
var w = this.editor, m = w.selection.getSelectionContainerElem();
if (!(m && w.$textElem.equal(m))) {
var y = g.default(w.selection.getSelectionStartElem());
if (y.length !== 0) {
y = this.getDom(y.elems[0]);
var E = y.getAttribute("style") ? y.getAttribute("style") : "";
E && (0, d.default)(E).call(E, "line-height") !== -1 ? this.active() : this.unActive();
}
}
}, A;
}(p.default);
r.default = S;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3)), p = function() {
function g(_, S) {
var b = this;
this.itemList = [{ $elem: h.default("<span>" + _.i18next.t("\u9ED8\u8BA4") + "</span>"), value: "" }], (0, u.default)(S).call(S, function(A) {
b.itemList.push({ $elem: h.default("<span>" + A + "</span>"), value: A });
});
}
return g.prototype.getItemList = function() {
return this.itemList;
}, g;
}();
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(3)), h = u.__importDefault(n(23)), p = function(g) {
u.__extends(_, g);
function _(S) {
var b = this, A = d.default(`<div class="w-e-menu" data-title="\u64A4\u9500">
<i class="w-e-icon-undo"></i>
</div>`);
return b = g.call(this, A, S) || this, b;
}
return _.prototype.clickHandler = function() {
var S = this.editor;
S.history.revoke();
var b = S.$textElem.children();
if (!!(b != null && b.length)) {
var A = b.last();
S.selection.createRangeByElem(A, !1, !0), S.selection.restoreSelection();
}
}, _.prototype.tryChangeActive = function() {
this.editor.isCompatibleMode || (this.editor.history.size[0] ? this.active() : this.unActive());
}, _;
}(h.default);
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(3)), h = u.__importDefault(n(23)), p = function(g) {
u.__extends(_, g);
function _(S) {
var b = this, A = d.default(`<div class="w-e-menu" data-title="\u6062\u590D">
<i class="w-e-icon-redo"></i>
</div>`);
return b = g.call(this, A, S) || this, b;
}
return _.prototype.clickHandler = function() {
var S = this.editor;
S.history.restore();
var b = S.$textElem.children();
if (!!(b != null && b.length)) {
var A = b.last();
S.selection.createRangeByElem(A, !1, !0), S.selection.restoreSelection();
}
}, _.prototype.tryChangeActive = function() {
this.editor.isCompatibleMode || (this.editor.history.size[1] ? this.active() : this.unActive());
}, _;
}(h.default);
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(38)), h = u.__importDefault(n(3)), p = u.__importDefault(n(383)), g = u.__importDefault(n(33)), _ = u.__importDefault(n(392)), S = function(b) {
u.__extends(A, b);
function A(w) {
var m = this, y = h.default('<div class="w-e-menu" data-title="\u8868\u683C"><i class="w-e-icon-table2"></i></div>');
return m = b.call(this, y, w) || this, _.default(w), m;
}
return A.prototype.clickHandler = function() {
this.createPanel();
}, A.prototype.createPanel = function() {
var w = p.default(this.editor), m = new g.default(this, w);
m.create();
}, A.prototype.tryChangeActive = function() {
}, A;
}(d.default);
r.default = S;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(384));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = n(6), p = d.__importDefault(n(3));
n(389);
var g = d.__importDefault(n(391));
function _(b) {
return b > 0 && (0, u.default)(b);
}
function S(b) {
var A = new g.default(b), w = h.getRandom("w-col-id"), m = h.getRandom("w-row-id"), y = h.getRandom("btn-link"), E = "menus.panelMenus.table.", x = function(M) {
return b.i18next.t(M);
}, k = [{ title: x(E + "\u63D2\u5165\u8868\u683C"), tpl: `<div>
<div class="w-e-table">
<span>` + x("\u521B\u5EFA") + `</span>
<input id="` + m + `" type="text" class="w-e-table-input" value="5"/></td>
<span>` + x(E + "\u884C") + `</span>
<input id="` + w + `" type="text" class="w-e-table-input" value="5"/></td>
<span>` + (x(E + "\u5217") + x(E + "\u7684") + x(E + "\u8868\u683C")) + `</span>
</div>
<div class="w-e-button-container">
<button type="button" id="` + y + '" class="right">' + x("\u63D2\u5165") + `</button>
</div>
</div>`, events: [{ selector: "#" + y, type: "click", fn: function() {
var M = Number(p.default("#" + w).val()), B = Number(p.default("#" + m).val());
return _(B) && _(M) ? (A.createAction(B, M), !0) : (b.config.customAlert("\u8868\u683C\u884C\u5217\u8BF7\u8F93\u5165\u6B63\u6574\u6570", "warning"), !1);
}, bindEnter: !0 }] }], D = { width: 330, height: 0, tabs: [] };
return D.tabs.push(k[0]), D;
}
r.default = S;
}, function(i, r, n) {
i.exports = n(385);
}, function(i, r, n) {
var a = n(386);
i.exports = a;
}, function(i, r, n) {
n(387);
var a = n(9);
i.exports = a.Number.isInteger;
}, function(i, r, n) {
var a = n(5), s = n(388);
a({ target: "Number", stat: !0 }, { isInteger: s });
}, function(i, r, n) {
var a = n(13), s = Math.floor;
i.exports = function(d) {
return !a(d) && isFinite(d) && s(d) === d;
};
}, function(i, r, n) {
var a = n(20), s = n(390);
s = s.__esModule ? s.default : s, typeof s == "string" && (s = [[i.i, s, ""]]);
var u = {};
u.insert = "head", u.singleton = !1, a(s, u), i.exports = s.locals || {};
}, function(i, r, n) {
var a = n(21);
r = a(!1), r.push([i.i, `.w-e-table {
display: flex;
}
.w-e-table .w-e-table-input {
width: 40px;
text-align: center!important;
margin: 0 5px;
}
`, ""]), i.exports = r;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = n(7), h = u.__importDefault(n(3)), p = function() {
function g(_) {
this.editor = _;
}
return g.prototype.createAction = function(_, S) {
var b = this.editor, A = h.default(b.selection.getSelectionContainerElem()), w = h.default(A.elems[0]).parentUntilEditor("UL", b), m = h.default(A.elems[0]).parentUntilEditor("OL", b);
if (!(w || m)) {
var y = this.createTableHtml(_, S);
b.cmd.do("insertHTML", y);
}
}, g.prototype.createTableHtml = function(_, S) {
for (var b = "", A = "", w = 0; w < _; w++) {
A = "";
for (var m = 0; m < S; m++)
w === 0 ? A = A + "<th></th>" : A = A + "<td></td>";
b = b + "<tr>" + A + "</tr>";
}
var y = '<table border="0" width="100%" cellpadding="0" cellspacing="0"><tbody>' + b + ("</tbody></table>" + d.EMPTY_P);
return y;
}, g;
}();
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(393)), h = n(400);
function p(g) {
d.default(g), h.bindEventKeyboardEvent(g), h.bindClickEvent(g);
}
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(3)), h = u.__importDefault(n(39)), p = u.__importDefault(n(394)), g = u.__importDefault(n(399)), _ = n(7);
function S(m) {
var y;
function E(k) {
var D = new g.default(m), P = "menus.panelMenus.table.", M = function($, V) {
return V === void 0 && (V = P), m.i18next.t(V + $);
}, B = [{
$elem: d.default("<span>" + M("\u5220\u9664\u8868\u683C") + "</span>"),
onClick: function($, V) {
return $.selection.createRangeByElem(V), $.selection.restoreSelection(), $.cmd.do("insertHTML", _.EMPTY_P), !0;
}
}, { $elem: d.default("<span>" + M("\u6DFB\u52A0\u884C") + "</span>"), onClick: function($, V) {
var z = b($);
if (z)
return !0;
var H = d.default($.selection.getSelectionStartElem()), I = D.getRowNode(H.elems[0]);
if (!I)
return !0;
var U = Number(D.getCurrentRowIndex(V.elems[0], I)), F = D.getTableHtml(V.elems[0]), C = D.getTableHtml(p.default.ProcessingRow(d.default(F), U).elems[0]);
return C = w(V, C), $.selection.createRangeByElem(V), $.selection.restoreSelection(), $.cmd.do("insertHTML", C), !0;
} }, { $elem: d.default("<span>" + M("\u5220\u9664\u884C") + "</span>"), onClick: function($, V) {
var z = b($);
if (z)
return !0;
var H = d.default($.selection.getSelectionStartElem()), I = D.getRowNode(H.elems[0]);
if (!I)
return !0;
var U = Number(D.getCurrentRowIndex(V.elems[0], I)), F = D.getTableHtml(V.elems[0]), C = p.default.DeleteRow(d.default(F), U).elems[0].children[0].children.length, q = "";
return $.selection.createRangeByElem(V), $.selection.restoreSelection(), C === 0 ? q = _.EMPTY_P : q = D.getTableHtml(p.default.DeleteRow(d.default(F), U).elems[0]), q = w(V, q), $.cmd.do("insertHTML", q), !0;
} }, { $elem: d.default("<span>" + M("\u6DFB\u52A0\u5217") + "</span>"), onClick: function($, V) {
var z = b($);
if (z)
return !0;
var H = d.default($.selection.getSelectionStartElem()), I = D.getCurrentColIndex(H.elems[0]), U = D.getTableHtml(V.elems[0]), F = D.getTableHtml(p.default.ProcessingCol(d.default(U), I).elems[0]);
return F = w(V, F), $.selection.createRangeByElem(V), $.selection.restoreSelection(), $.cmd.do("insertHTML", F), !0;
} }, { $elem: d.default("<span>" + M("\u5220\u9664\u5217") + "</span>"), onClick: function($, V) {
var z = b($);
if (z)
return !0;
var H = d.default($.selection.getSelectionStartElem()), I = D.getCurrentColIndex(H.elems[0]), U = D.getTableHtml(V.elems[0]), F = p.default.DeleteCol(d.default(U), I), C = F.elems[0].children[0].children[0].children.length, q = "";
return $.selection.createRangeByElem(V), $.selection.restoreSelection(), C === 0 ? q = _.EMPTY_P : q = D.getTableHtml(F.elems[0]), q = w(V, q), $.cmd.do("insertHTML", q), !0;
} }, { $elem: d.default("<span>" + M("\u8BBE\u7F6E\u8868\u5934") + "</span>"), onClick: function($, V) {
var z = b($);
if (z)
return !0;
var H = d.default($.selection.getSelectionStartElem()), I = D.getRowNode(H.elems[0]);
if (!I)
return !0;
var U = Number(D.getCurrentRowIndex(V.elems[0], I));
U !== 0 && (U = 0);
var F = D.getTableHtml(V.elems[0]), C = D.getTableHtml(p.default.setTheHeader(d.default(F), U, "th").elems[0]);
return C = w(V, C), $.selection.createRangeByElem(V), $.selection.restoreSelection(), $.cmd.do("insertHTML", C), !0;
} }, { $elem: d.default("<span>" + M("\u53D6\u6D88\u8868\u5934") + "</span>"), onClick: function($, V) {
var z = d.default($.selection.getSelectionStartElem()), H = D.getRowNode(z.elems[0]);
if (!H)
return !0;
var I = Number(D.getCurrentRowIndex(V.elems[0], H));
I !== 0 && (I = 0);
var U = D.getTableHtml(V.elems[0]), F = D.getTableHtml(p.default.setTheHeader(d.default(U), I, "td").elems[0]);
return F = w(V, F), $.selection.createRangeByElem(V), $.selection.restoreSelection(), $.cmd.do("insertHTML", F), !0;
} }];
y = new h.default(m, k, B), y.create();
}
function x() {
y && (y.remove(), y = null);
}
return { showTableTooltip: E, hideTableTooltip: x };
}
function b(m) {
var y = m.selection.getSelectionStartElem(), E = m.selection.getSelectionEndElem();
return (y == null ? void 0 : y.elems[0]) !== (E == null ? void 0 : E.elems[0]);
}
function A(m) {
var y = S(m), E = y.showTableTooltip, x = y.hideTableTooltip;
m.txt.eventHooks.tableClickEvents.push(E), m.txt.eventHooks.clickEvents.push(x), m.txt.eventHooks.keyupEvents.push(x), m.txt.eventHooks.toolbarClickEvents.push(x), m.txt.eventHooks.menuClickEvents.push(x), m.txt.eventHooks.textScrollEvents.push(x);
}
r.default = A;
function w(m, y) {
var E = m.elems[0].nextSibling;
return (!E || E.innerHTML === "<br>") && (y += "" + _.EMPTY_P), y;
}
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(45)), d = a(n(91)), h = a(n(4)), p = a(n(138));
(0, s.default)(r, "__esModule", { value: !0 });
var g = n(2), _ = g.__importDefault(n(3));
function S(x, k) {
for (var D = E(x), P = (0, u.default)(Array.prototype).apply(D.children), M = P[0].children.length, B = document.createElement("tr"), T = 0; T < M; T++) {
var $ = document.createElement("td");
B.appendChild($);
}
return (0, d.default)(P).call(P, k + 1, 0, B), y(D, P), _.default(D.parentNode);
}
function b(x, k) {
for (var D = E(x), P = (0, u.default)(Array.prototype).apply(D.children), M = function($) {
var V, z = [];
for ((0, h.default)(V = (0, p.default)(P[$].children)).call(V, function(U) {
z.push(U);
}); P[$].children.length !== 0; )
P[$].removeChild(P[$].children[0]);
var H = _.default(z[0]).getNodeName() !== "TH" ? document.createElement("td") : document.createElement("th");
(0, d.default)(z).call(z, k + 1, 0, H);
for (var I = 0; I < z.length; I++)
P[$].appendChild(z[I]);
}, B = 0; B < P.length; B++)
M(B);
return y(D, P), _.default(D.parentNode);
}
function A(x, k) {
var D = E(x), P = (0, u.default)(Array.prototype).apply(D.children);
return (0, d.default)(P).call(P, k, 1), y(D, P), _.default(D.parentNode);
}
function w(x, k) {
for (var D = E(x), P = (0, u.default)(Array.prototype).apply(D.children), M = function($) {
var V, z = [];
for ((0, h.default)(V = (0, p.default)(P[$].children)).call(V, function(I) {
z.push(I);
}); P[$].children.length !== 0; )
P[$].removeChild(P[$].children[0]);
(0, d.default)(z).call(z, k, 1);
for (var H = 0; H < z.length; H++)
P[$].appendChild(z[H]);
}, B = 0; B < P.length; B++)
M(B);
return y(D, P), _.default(D.parentNode);
}
function m(x, k, D) {
for (var P = E(x), M = (0, u.default)(Array.prototype).apply(P.children), B = M[k].children, T = document.createElement("tr"), $ = function(H) {
var I, U = document.createElement(D), F = B[H];
(0, h.default)(I = (0, p.default)(F.childNodes)).call(I, function(C) {
U.appendChild(C);
}), T.appendChild(U);
}, V = 0; V < B.length; V++)
$(V);
return (0, d.default)(M).call(M, k, 1, T), y(P, M), _.default(P.parentNode);
}
function y(x, k) {
for (; x.children.length !== 0; )
x.removeChild(x.children[0]);
for (var D = 0; D < k.length; D++)
x.appendChild(k[D]);
}
function E(x) {
var k = x.elems[0].children[0];
return k.nodeName === "COLGROUP" && (k = x.elems[0].children[x.elems[0].children.length - 1]), k;
}
r.default = { ProcessingRow: S, ProcessingCol: b, DeleteRow: A, DeleteCol: w, setTheHeader: m };
}, function(i, r, n) {
var a = n(396);
i.exports = a;
}, function(i, r, n) {
n(50), n(397);
var a = n(9);
i.exports = a.Array.from;
}, function(i, r, n) {
var a = n(5), s = n(398), u = n(115), d = !u(function(h) {
Array.from(h);
});
a({ target: "Array", stat: !0, forced: d }, { from: s });
}, function(i, r, n) {
var a = n(40), s = n(31), u = n(114), d = n(112), h = n(35), p = n(69), g = n(113);
i.exports = function(S) {
var b = s(S), A = typeof this == "function" ? this : Array, w = arguments.length, m = w > 1 ? arguments[1] : void 0, y = m !== void 0, E = g(b), x = 0, k, D, P, M, B, T;
if (y && (m = a(m, w > 2 ? arguments[2] : void 0, 2)), E != null && !(A == Array && d(E)))
for (M = E.call(b), B = M.next, D = new A(); !(P = B.call(M)).done; x++)
T = y ? u(M, m, [P.value, x], !0) : P.value, p(D, x, T);
else
for (k = h(b.length), D = new A(k); k > x; x++)
T = y ? m(b[x], x) : b[x], p(D, x, T);
return D.length = x, D;
};
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4)), d = a(n(138));
(0, s.default)(r, "__esModule", { value: !0 });
var h = n(2), p = h.__importDefault(n(3)), g = function() {
function _(S) {
this.editor = S;
}
return _.prototype.getRowNode = function(S) {
var b, A = p.default(S).elems[0];
return A.parentNode && (A = (b = p.default(A).parentUntil("TR", A)) === null || b === void 0 ? void 0 : b.elems[0]), A;
}, _.prototype.getCurrentRowIndex = function(S, b) {
var A, w = 0, m = S.children[0];
return m.nodeName === "COLGROUP" && (m = S.children[S.children.length - 1]), (0, u.default)(A = (0, d.default)(m.children)).call(A, function(y, E) {
y === b && (w = E);
}), w;
}, _.prototype.getCurrentColIndex = function(S) {
var b, A, w = 0, m = p.default(S).getNodeName() === "TD" || p.default(S).getNodeName() === "TH" ? S : (A = p.default(S).parentUntil("TD", S)) === null || A === void 0 ? void 0 : A.elems[0], y = p.default(m).parent();
return (0, u.default)(b = (0, d.default)(y.elems[0].children)).call(b, function(E, x) {
E === m && (w = x);
}), w;
}, _.prototype.getTableHtml = function(S) {
var b = '<table border="0" width="100%" cellpadding="0" cellspacing="0">' + p.default(S).html() + "</table>";
return b;
}, _;
}();
r.default = g;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 }), r.bindEventKeyboardEvent = r.bindClickEvent = void 0;
var u = n(2), d = u.__importDefault(n(3));
function h(_) {
if (!_.length)
return !1;
var S = _.elems[0];
return S.nodeName === "P" && S.innerHTML === "<br>";
}
function p(_) {
function S(b, A) {
if (A.detail >= 3) {
var w = window.getSelection();
if (w) {
var m = w.focusNode, y = w.anchorNode, E = d.default(y == null ? void 0 : y.parentElement);
if (!b.isContain(d.default(m))) {
var x = E.elems[0].tagName === "TD" ? E : E.parentUntilEditor("td", _);
if (x) {
var k = _.selection.getRange();
k == null || k.setEnd(x.elems[0], x.elems[0].childNodes.length), _.selection.restoreSelection();
}
}
}
}
}
_.txt.eventHooks.tableClickEvents.push(S);
}
r.bindClickEvent = p;
function g(_) {
var S = _.txt, b = _.selection, A = S.eventHooks.keydownEvents;
A.push(function(w) {
_.selection.saveRange();
var m = b.getSelectionContainerElem();
if (m) {
var y = m.getNodeTop(_), E = y.length && y.prev().length ? y.prev() : null;
if (E && E.getNodeName() === "TABLE" && b.isSelectionEmpty() && b.getCursorPos() === 0 && w.keyCode === 8) {
var x = y.next(), k = !!x.length;
k && h(y) && (y.remove(), _.selection.setRangeToElem(x.elems[0])), w.preventDefault();
}
}
});
}
r.bindEventKeyboardEvent = g;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(26));
(0, s.default)(r, "__esModule", { value: !0 }), r.formatCodeHtml = void 0;
var d = n(2), h = d.__importDefault(n(38)), p = d.__importDefault(n(3)), g = n(6), _ = d.__importDefault(n(402)), S = d.__importDefault(n(139)), b = d.__importDefault(n(33)), A = d.__importDefault(n(403));
function w(y, E) {
if (!E)
return E;
return E = k(E), E = x(E), E = g.replaceSpecialSymbol(E), E;
function x(D) {
var P = D.match(/<pre[\s|\S]+?\/pre>/g);
return P === null || (0, u.default)(P).call(P, function(M) {
D = D.replace(M, M.replace(/<\/code><code>/g, `
`).replace(/<br>/g, ""));
}), D;
}
function k(D) {
var P, M = D.match(/<span\sclass="hljs[\s|\S]+?\/span>/gm);
if (!M || !M.length)
return D;
for (var B = (0, u.default)(P = g.deepClone(M)).call(P, function($) {
return $ = $.replace(/<span\sclass="hljs[^>]+>/, ""), $.replace(/<\/span>/, "");
}), T = 0; T < M.length; T++)
D = D.replace(M[T], B[T]);
return k(D);
}
}
r.formatCodeHtml = w;
var m = function(y) {
d.__extends(E, y);
function E(x) {
var k = this, D = p.default('<div class="w-e-menu" data-title="\u4EE3\u7801"><i class="w-e-icon-terminal"></i></div>');
return k = y.call(this, D, x) || this, A.default(x), k;
}
return E.prototype.insertLineCode = function(x) {
var k = this.editor, D = p.default("<code>" + x + "</code>");
k.cmd.do("insertElem", D), k.selection.createRangeByElem(D, !1), k.selection.restoreSelection();
}, E.prototype.clickHandler = function() {
var x = this.editor, k = x.selection.getSelectionText();
this.isActive || (x.selection.isSelectionEmpty() ? this.createPanel("", "") : this.insertLineCode(k));
}, E.prototype.createPanel = function(x, k) {
var D = _.default(this.editor, x, k), P = new b.default(this, D);
P.create();
}, E.prototype.tryChangeActive = function() {
var x = this.editor;
S.default(x) ? this.active() : this.unActive();
}, E;
}(h.default);
r.default = m;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(26));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = n(6), p = d.__importDefault(n(3)), g = d.__importDefault(n(139)), _ = n(7);
function S(b, A, w) {
var m, y = h.getRandom("input-iframe"), E = h.getRandom("select"), x = h.getRandom("btn-ok");
function k(B, T) {
var $, V = g.default(b);
V && D();
var z = ($ = b.selection.getSelectionStartElem()) === null || $ === void 0 ? void 0 : $.elems[0].innerHTML;
z && b.cmd.do("insertHTML", _.EMPTY_P);
var H = T.replace(/</g, "&lt;").replace(/>/g, "&gt;");
b.highlight && (H = b.highlight.highlightAuto(H).value), b.cmd.do("insertHTML", '<pre><code class="' + B + '">' + H + "</code></pre>");
var I = b.selection.getSelectionStartElem(), U = I == null ? void 0 : I.getNodeTop(b);
(U == null ? void 0 : U.getNextSibling().elems.length) === 0 && p.default(_.EMPTY_P).insertAfter(U);
}
function D() {
if (!!g.default(b)) {
var B = b.selection.getSelectionStartElem(), T = B == null ? void 0 : B.getNodeTop(b);
!T || (b.selection.createRangeByElem(T), b.selection.restoreSelection());
}
}
var P = function(T) {
return b.i18next.t(T);
}, M = {
width: 500,
height: 0,
tabs: [{
title: P("menus.panelMenus.code.\u63D2\u5165\u4EE3\u7801"),
tpl: `<div>
<select name="" id="` + E + `">
` + (0, u.default)(m = b.config.languageType).call(m, function(B) {
return "<option " + (w == B ? "selected" : "") + ' value ="' + B + '">' + B + "</option>";
}) + `
</select>
<textarea id="` + y + '" type="text" class="wang-code-textarea" placeholder="" style="height: 160px">' + A.replace(/&quot;/g, '"') + `</textarea>
<div class="w-e-button-container">
<button type="button" id="` + x + '" class="right">' + (g.default(b) ? P("\u4FEE\u6539") : P("\u63D2\u5165")) + `</button>
</div>
</div>`,
events: [
{ selector: "#" + x, type: "click", fn: function() {
var T = document.getElementById(y), $ = p.default("#" + E), V = $.val(), z = T.value;
if (!!z)
return g.default(b) ? !1 : (k(V, z), !0);
} }
]
}]
};
return M;
}
r.default = S;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(404)), h = u.__importDefault(n(405));
function p(g) {
d.default(g), h.default(g);
}
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 }), r.createShowHideFn = void 0;
var u = n(2), d = u.__importDefault(n(3)), h = u.__importDefault(n(39));
function p(_) {
var S;
function b(w) {
var m = "menus.panelMenus.code.", y = function(k, D) {
return D === void 0 && (D = m), _.i18next.t(D + k);
}, E = [{ $elem: d.default("<span>" + y("\u5220\u9664\u4EE3\u7801") + "</span>"), onClick: function(k, D) {
return D.remove(), !0;
} }];
S = new h.default(_, w, E), S.create();
}
function A() {
S && (S.remove(), S = null);
}
return { showCodeTooltip: b, hideCodeTooltip: A };
}
r.createShowHideFn = p;
function g(_) {
var S = p(_), b = S.showCodeTooltip, A = S.hideCodeTooltip;
_.txt.eventHooks.codeClickEvents.push(b), _.txt.eventHooks.clickEvents.push(A), _.txt.eventHooks.toolbarClickEvents.push(A), _.txt.eventHooks.menuClickEvents.push(A), _.txt.eventHooks.textScrollEvents.push(A);
}
r.default = g;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = n(7), h = u.__importDefault(n(3));
function p(g) {
var _ = g.$textElem, S = g.selection, b = g.txt, A = b.eventHooks.keydownEvents;
A.push(function(w) {
var m;
if (w.keyCode === 40) {
var y = S.getSelectionContainerElem(), E = (m = _.children()) === null || m === void 0 ? void 0 : m.last();
if ((y == null ? void 0 : y.elems[0].tagName) === "XMP" && (E == null ? void 0 : E.elems[0].tagName) === "PRE") {
var x = h.default(d.EMPTY_P);
_.append(x);
}
}
}), A.push(function(w) {
g.selection.saveRange();
var m = S.getSelectionContainerElem();
if (m) {
var y = m.getNodeTop(g), E = y == null ? void 0 : y.prev(), x = y == null ? void 0 : y.getNextSibling();
if (E.length && (E == null ? void 0 : E.getNodeName()) === "PRE" && x.length === 0 && S.getCursorPos() === 0 && w.keyCode === 8) {
var k = h.default(d.EMPTY_P);
_.append(k);
}
}
});
}
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(23)), h = u.__importDefault(n(3)), p = u.__importDefault(n(407)), g = n(6), _ = n(7), S = function(b) {
u.__extends(A, b);
function A(w) {
var m = this, y = h.default('<div class="w-e-menu" data-title="\u5206\u5272\u7EBF"><i class="w-e-icon-split-line"></i></div>');
return m = b.call(this, y, w) || this, p.default(w), m;
}
return A.prototype.clickHandler = function() {
var w = this.editor, m = w.selection.getRange(), y = w.selection.getSelectionContainerElem();
if (!!(y != null && y.length)) {
var E = h.default(y.elems[0]), x = E.parentUntil("TABLE", y.elems[0]), k = E.children();
E.getNodeName() !== "CODE" && (x && h.default(x.elems[0]).getNodeName() === "TABLE" || k && k.length !== 0 && h.default(k.elems[0]).getNodeName() === "IMG" && !(m != null && m.collapsed) || this.createSplitLine());
}
}, A.prototype.createSplitLine = function() {
var w = "<hr/>" + _.EMPTY_P;
g.UA.isFirefox && (w = "<hr/><p></p>"), this.editor.cmd.do("insertHTML", w);
}, A.prototype.tryChangeActive = function() {
}, A;
}(d.default);
r.default = S;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(408));
function h(p) {
d.default(p);
}
r.default = h;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(3)), h = u.__importDefault(n(39));
function p(_) {
var S;
function b(w) {
var m = [{ $elem: d.default("<span>" + _.i18next.t("menus.panelMenus.\u5220\u9664") + "</span>"), onClick: function(E, x) {
return E.selection.createRangeByElem(x), E.selection.restoreSelection(), E.cmd.do("delete"), !0;
} }];
S = new h.default(_, w, m), S.create();
}
function A() {
S && (S.remove(), S = null);
}
return { showSplitLineTooltip: b, hideSplitLineTooltip: A };
}
function g(_) {
var S = p(_), b = S.showSplitLineTooltip, A = S.hideSplitLineTooltip;
_.txt.eventHooks.splitLineEvents.push(b), _.txt.eventHooks.clickEvents.push(A), _.txt.eventHooks.keyupEvents.push(A), _.txt.eventHooks.toolbarClickEvents.push(A), _.txt.eventHooks.menuClickEvents.push(A), _.txt.eventHooks.textScrollEvents.push(A);
}
r.default = g;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3)), p = d.__importDefault(n(23)), g = n(98), _ = d.__importDefault(n(415)), S = d.__importDefault(n(140)), b = function(A) {
d.__extends(w, A);
function w(m) {
var y = this, E = h.default(`<div class="w-e-menu" data-title="\u5F85\u529E\u4E8B\u9879">
<i class="w-e-icon-checkbox-checked"></i>
</div>`);
return y = A.call(this, E, m) || this, _.default(m), y;
}
return w.prototype.clickHandler = function() {
var m = this.editor;
g.isAllTodo(m) ? (this.cancelTodo(), this.tryChangeActive()) : this.setTodo();
}, w.prototype.tryChangeActive = function() {
g.isAllTodo(this.editor) ? this.active() : this.unActive();
}, w.prototype.setTodo = function() {
var m = this.editor, y = m.selection.getSelectionRangeTopNodes();
(0, u.default)(y).call(y, function(E) {
var x, k = E == null ? void 0 : E.getNodeName();
if (k === "P") {
var D = S.default(E), P = D.getTodo(), M = (x = P.children()) === null || x === void 0 ? void 0 : x.getNode();
P.insertAfter(E), m.selection.moveCursor(M), E.remove();
}
}), this.tryChangeActive();
}, w.prototype.cancelTodo = function() {
var m = this.editor, y = m.selection.getSelectionRangeTopNodes();
(0, u.default)(y).call(y, function(E) {
var x, k, D, P = (k = (x = E.childNodes()) === null || x === void 0 ? void 0 : x.childNodes()) === null || k === void 0 ? void 0 : k.clone(!0), M = h.default("<p></p>");
M.append(P), M.insertAfter(E), (D = M.childNodes()) === null || D === void 0 || D.get(0).remove(), m.selection.moveCursor(M.getNode()), E.remove();
});
}, w;
}(p.default);
r.default = b;
}, function(i, r, n) {
i.exports = n(411);
}, function(i, r, n) {
var a = n(412);
i.exports = a;
}, function(i, r, n) {
var a = n(413), s = Array.prototype;
i.exports = function(u) {
var d = u.every;
return u === s || u instanceof Array && d === s.every ? a : d;
};
}, function(i, r, n) {
n(414);
var a = n(15);
i.exports = a("Array").every;
}, function(i, r, n) {
var a = n(5), s = n(32).every, u = n(67), d = n(22), h = u("every"), p = d("every");
a({ target: "Array", proto: !0, forced: !h || !p }, { every: function(_) {
return s(this, _, arguments.length > 1 ? arguments[1] : void 0);
} });
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3)), p = n(98), g = d.__importDefault(n(140)), _ = n(98), S = n(7);
function b(A) {
function w(x) {
var k, D;
if (p.isAllTodo(A)) {
x.preventDefault();
var P = A.selection, M = P.getSelectionRangeTopNodes()[0], B = (k = M.childNodes()) === null || k === void 0 ? void 0 : k.get(0), T = (D = window.getSelection()) === null || D === void 0 ? void 0 : D.anchorNode, $ = P.getRange();
if (!($ != null && $.collapsed)) {
var V = $ == null ? void 0 : $.commonAncestorContainer.childNodes, z = $ == null ? void 0 : $.startContainer, H = $ == null ? void 0 : $.endContainer, I = $ == null ? void 0 : $.startOffset, U = $ == null ? void 0 : $.endOffset, F = 0, C = 0, q = [];
V == null || (0, u.default)(V).call(V, function(he, Se) {
he.contains(z) && (F = Se), he.contains(H) && (C = Se);
}), C - F > 1 && (V == null || (0, u.default)(V).call(V, function(he, Se) {
Se <= F || Se >= C || q.push(he);
}), (0, u.default)(q).call(q, function(he) {
he.remove();
})), _.dealTextNode(z, I), _.dealTextNode(H, U, !1), A.selection.moveCursor(H, 0);
}
if (M.text() === "") {
var X = h.default(S.EMPTY_P);
X.insertAfter(M), P.moveCursor(X.getNode()), M.remove();
return;
}
var Y = P.getCursorPos(), ue = p.getCursorNextNode(B == null ? void 0 : B.getNode(), T, Y), ee = g.default(h.default(ue)), pe = ee.getInputContainer(), Te = pe.parent().getNode(), ve = ee.getTodo(), me = pe.getNode().nextSibling;
if ((B == null ? void 0 : B.text()) === "" && (B == null || B.append(h.default("<br>"))), ve.insertAfter(M), !me || (me == null ? void 0 : me.textContent) === "") {
if ((me == null ? void 0 : me.nodeName) !== "BR") {
var we = h.default("<br>");
we.insertAfter(pe);
}
P.moveCursor(Te, 1);
} else
P.moveCursor(Te);
}
}
function m(x) {
var k, D;
if (p.isAllTodo(A)) {
var P = A.selection, M = P.getSelectionRangeTopNodes()[0], B = (k = M.childNodes()) === null || k === void 0 ? void 0 : k.getNode(), T = h.default("<p></p>"), $ = T.getNode(), V = (D = window.getSelection()) === null || D === void 0 ? void 0 : D.anchorNode, z = P.getCursorPos(), H = V.previousSibling;
if (M.text() === "") {
x.preventDefault();
var I = h.default(S.EMPTY_P);
I.insertAfter(M), M.remove(), P.moveCursor(I.getNode(), 0);
return;
}
if ((H == null ? void 0 : H.nodeName) === "SPAN" && H.childNodes[0].nodeName === "INPUT" && z === 0) {
var U;
x.preventDefault(), B == null || (0, u.default)(U = B.childNodes).call(U, function(F, C) {
C !== 0 && $.appendChild(F.cloneNode(!0));
}), T.insertAfter(M), M.remove();
}
}
}
function y() {
var x = A.selection, k = x.getSelectionRangeTopNodes()[0];
k && _.isTodo(k) && k.text() === "" && (h.default(S.EMPTY_P).insertAfter(k), k.remove());
}
function E(x) {
x && x.target instanceof HTMLInputElement && x.target.type === "checkbox" && (x.target.checked ? x.target.setAttribute("checked", "true") : x.target.removeAttribute("checked"));
}
A.txt.eventHooks.enterDownEvents.push(w), A.txt.eventHooks.deleteUpEvents.push(y), A.txt.eventHooks.deleteDownEvents.push(m), A.txt.eventHooks.clickEvents.push(E);
}
r.default = b;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 }), r.selectorValidator = void 0;
var u = n(2), d = u.__importDefault(n(3)), h = n(6), p = n(7), g = u.__importDefault(n(130)), _ = { border: "1px solid #c9d8db", toolbarBgColor: "#FFF", toolbarBottomBorder: "1px solid #EEE" };
function S(A) {
var w = A.toolbarSelector, m = d.default(w), y = A.textSelector, E = A.config, x = E.height, k = A.i18next, D = d.default("<div></div>"), P = d.default("<div></div>"), M, B, T = null;
y == null ? (B = m.children(), m.append(D).append(P), D.css("background-color", _.toolbarBgColor).css("border", _.border).css("border-bottom", _.toolbarBottomBorder), P.css("border", _.border).css("border-top", "none").css("height", x + "px")) : (m.append(D), T = d.default(y).children(), d.default(y).append(P), B = P.children()), M = d.default("<div></div>"), M.attr("contenteditable", "true").css("width", "100%").css("height", "100%");
var $, V = A.config.placeholder;
V !== g.default.placeholder ? $ = d.default("<div>" + V + "</div>") : $ = d.default("<div>" + k.t(V) + "</div>"), $.addClass("placeholder"), B && B.length ? (M.append(B), $.hide()) : M.append(d.default(p.EMPTY_P)), T && T.length && (M.append(T), $.hide()), P.append(M), P.append($), D.addClass("w-e-toolbar").css("z-index", A.zIndex.get("toolbar")), P.addClass("w-e-text-container"), P.css("z-index", A.zIndex.get()), M.addClass("w-e-text");
var z = h.getRandom("toolbar-elem");
D.attr("id", z);
var H = h.getRandom("text-elem");
M.attr("id", H);
var I = P.getBoundingClientRect().height, U = M.getBoundingClientRect().height;
I !== U && M.css("min-height", I + "px"), A.$toolbarElem = D, A.$textContainerElem = P, A.$textElem = M, A.toolbarElemId = z, A.textElemId = H;
}
r.default = S;
function b(A) {
var w = "data-we-id", m = /^wangEditor-\d+$/, y = A.textSelector, E = A.toolbarSelector, x = { bar: d.default("<div></div>"), text: d.default("<div></div>") };
if (E == null)
throw new Error("\u9519\u8BEF\uFF1A\u521D\u59CB\u5316\u7F16\u8F91\u5668\u65F6\u5019\u672A\u4F20\u5165\u4EFB\u4F55\u53C2\u6570\uFF0C\u8BF7\u67E5\u9605\u6587\u6863");
if (x.bar = d.default(E), !x.bar.elems.length)
throw new Error("\u65E0\u6548\u7684\u8282\u70B9\u9009\u62E9\u5668\uFF1A" + E);
if (m.test(x.bar.attr(w)))
throw new Error("\u521D\u59CB\u5316\u8282\u70B9\u5DF2\u5B58\u5728\u7F16\u8F91\u5668\u5B9E\u4F8B\uFF0C\u65E0\u6CD5\u91CD\u590D\u521B\u5EFA\u7F16\u8F91\u5668");
if (y) {
if (x.text = d.default(y), !x.text.elems.length)
throw new Error("\u65E0\u6548\u7684\u8282\u70B9\u9009\u62E9\u5668\uFF1A" + y);
if (m.test(x.text.attr(w)))
throw new Error("\u521D\u59CB\u5316\u8282\u70B9\u5DF2\u5B58\u5728\u7F16\u8F91\u5668\u5B9E\u4F8B\uFF0C\u65E0\u6CD5\u91CD\u590D\u521B\u5EFA\u7F16\u8F91\u5668");
}
x.bar.attr(w, A.id), x.text.attr(w, A.id), A.beforeDestroy(function() {
x.bar.removeAttr(w), x.text.removeAttr(w);
});
}
r.selectorValidator = b;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(3)), h = n(7);
function p(g, _) {
var S = g.$textElem, b = S.children();
if (!b || !b.length) {
S.append(d.default(h.EMPTY_P)), p(g);
return;
}
var A = b.last();
if (_) {
var w = A.html().toLowerCase(), m = A.getNodeName();
if (w !== "<br>" && w !== "<br/>" || m !== "P") {
S.append(d.default(h.EMPTY_P)), p(g);
return;
}
}
g.selection.createRangeByElem(A, !1, !0), g.config.focus ? g.selection.restoreSelection() : g.selection.clearWindowSelectionRange();
}
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3));
function p(w) {
g(w), _(w), S(w);
}
function g(w) {
w.txt.eventHooks.changeEvents.push(function() {
var m = w.config.onchange;
if (m) {
var y = w.txt.html() || "";
w.isFocus = !0, m(y);
}
w.txt.togglePlaceholder();
});
}
function _(w) {
w.isFocus = !1;
function m(y) {
var E = y.target, x = h.default(E), k = w.$textElem, D = w.$toolbarElem, P = k.isContain(x), M = D.isContain(x), B = D.elems[0] == y.target;
if (P)
w.isFocus || A(w), w.isFocus = !0;
else {
if (M && !B || !w.isFocus)
return;
b(w), w.isFocus = !1;
}
}
document.activeElement === w.$textElem.elems[0] && w.config.focus && (A(w), w.isFocus = !0), h.default(document).on("click", m), w.beforeDestroy(function() {
h.default(document).off("click", m);
});
}
function S(w) {
w.$textElem.on("compositionstart", function() {
w.isComposing = !0, w.txt.togglePlaceholder();
}).on("compositionend", function() {
w.isComposing = !1, w.txt.togglePlaceholder();
});
}
function b(w) {
var m, y = w.config, E = y.onblur, x = w.txt.html() || "";
(0, u.default)(m = w.txt.eventHooks.onBlurEvents).call(m, function(k) {
return k();
}), E(x);
}
function A(w) {
var m = w.config, y = m.onfocus, E = w.txt.html() || "";
y(E);
}
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
function u(d) {
var h = d.config, p = h.lang, g = h.languages;
if (d.i18next != null) {
try {
d.i18next.init({ ns: "wangEditor", lng: p, defaultNS: "wangEditor", resources: g });
} catch (_) {
throw new Error("i18next:" + _);
}
return;
}
d.i18next = { t: function(S) {
var b = S.split(".");
return b[b.length - 1];
} };
}
r.default = u;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(29));
(0, s.default)(r, "__esModule", { value: !0 }), r.setUnFullScreen = r.setFullScreen = void 0;
var d = n(2), h = d.__importDefault(n(3));
n(421);
var p = "w-e-icon-fullscreen", g = "w-e-icon-fullscreen_exit", _ = "w-e-full-screen-editor";
r.setFullScreen = function(b) {
var A = h.default(b.toolbarSelector), w = b.$textContainerElem, m = b.$toolbarElem, y = (0, u.default)(m).call(m, "i." + p), E = b.config;
y.removeClass(p), y.addClass(g), A.addClass(_), A.css("z-index", E.zIndexFullScreen);
var x = m.getBoundingClientRect();
w.css("height", "calc(100% - " + x.height + "px)");
}, r.setUnFullScreen = function(b) {
var A = h.default(b.toolbarSelector), w = b.$textContainerElem, m = b.$toolbarElem, y = (0, u.default)(m).call(m, "i." + g), E = b.config;
y.removeClass(g), y.addClass(p), A.removeClass(_), A.css("z-index", "auto"), w.css("height", E.height + "px");
};
var S = function(A) {
if (!A.textSelector && !!A.config.showFullScreen) {
var w = A.$toolbarElem, m = h.default(`<div class="w-e-menu" data-title="\u5168\u5C4F">
<i class="` + p + `"></i>
</div>`);
m.on("click", function(y) {
var E, x = (0, u.default)(E = h.default(y.currentTarget)).call(E, "i");
x.hasClass(p) ? (m.attr("data-title", "\u53D6\u6D88\u5168\u5C4F"), r.setFullScreen(A)) : (m.attr("data-title", "\u5168\u5C4F"), r.setUnFullScreen(A));
}), w.append(m);
}
};
r.default = S;
}, function(i, r, n) {
var a = n(20), s = n(422);
s = s.__esModule ? s.default : s, typeof s == "string" && (s = [[i.i, s, ""]]);
var u = {};
u.insert = "head", u.singleton = !1, a(s, u), i.exports = s.locals || {};
}, function(i, r, n) {
var a = n(21);
r = a(!1), r.push([i.i, `.w-e-full-screen-editor {
position: fixed;
width: 100%!important;
height: 100%!important;
left: 0;
top: 0;
}
`, ""]), i.exports = r;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(29));
(0, s.default)(r, "__esModule", { value: !0 });
var d = function(p, g) {
var _, S = p.isEnable ? p.$textElem : (0, u.default)(_ = p.$textContainerElem).call(_, ".w-e-content-mantle"), b = (0, u.default)(S).call(S, "[id='" + g + "']"), A = b.getOffsetData().top;
S.scrollTop(A);
};
r.default = d;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(129)), h = { menu: 2, panel: 2, toolbar: 1, tooltip: 1, textContainer: 1 }, p = function() {
function g() {
this.tier = h, this.baseZIndex = d.default.zIndex;
}
return g.prototype.get = function(_) {
return _ && this.tier[_] ? this.baseZIndex + this.tier[_] : this.baseZIndex;
}, g.prototype.init = function(_) {
this.baseZIndex == d.default.zIndex && (this.baseZIndex = _.config.zIndex);
}, g;
}();
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(70)), d = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 });
var h = n(2), p = h.__importDefault(n(426)), g = n(6), _ = n(7);
function S(A, w) {
return (0, u.default)(A).call(A, function(m) {
var y = m.type, E = m.target, x = m.attributeName;
return y != "attributes" || y == "attributes" && (x == "contenteditable" || E != w);
});
}
var b = function(A) {
h.__extends(w, A);
function w(m) {
var y = A.call(this, function(E, x) {
var k;
if (E = S(E, x.target), (k = y.data).push.apply(k, E), m.isCompatibleMode)
y.asyncSave();
else if (!m.isComposing)
return y.asyncSave();
}) || this;
return y.editor = m, y.data = [], y.asyncSave = _.EMPTY_FN, y;
}
return w.prototype.save = function() {
this.data.length && (this.editor.history.save(this.data), this.data.length = 0, this.emit());
}, w.prototype.emit = function() {
var m;
(0, d.default)(m = this.editor.txt.eventHooks.changeEvents).call(m, function(y) {
return y();
});
}, w.prototype.observe = function() {
var m = this;
A.prototype.observe.call(this, this.editor.$textElem.elems[0]);
var y = this.editor.config.onchangeTimeout;
this.asyncSave = g.debounce(function() {
m.save();
}, y), this.editor.isCompatibleMode || this.editor.$textElem.on("compositionend", function() {
m.asyncSave();
});
}, w;
}(p.default);
r.default = b;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = function() {
function d(h, p) {
var g = this;
this.options = { subtree: !0, childList: !0, attributes: !0, attributeOldValue: !0, characterData: !0, characterDataOldValue: !0 }, this.callback = function(_) {
h(_, g);
}, this.observer = new MutationObserver(this.callback), p && (this.options = p);
}
return (0, s.default)(d.prototype, "target", { get: function() {
return this.node;
}, enumerable: !1, configurable: !0 }), d.prototype.observe = function(h) {
this.node instanceof Node || (this.node = h, this.connect());
}, d.prototype.connect = function() {
if (this.node)
return this.observer.observe(this.node, this.options), this;
throw new Error("\u8FD8\u672A\u521D\u59CB\u5316\u7ED1\u5B9A\uFF0C\u8BF7\u60A8\u5148\u7ED1\u5B9A\u6709\u6548\u7684 Node \u8282\u70B9");
}, d.prototype.disconnect = function() {
var h = this.observer.takeRecords();
h.length && this.callback(h), this.observer.disconnect();
}, d;
}();
r.default = u;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(428)), h = u.__importDefault(n(435)), p = u.__importDefault(n(436)), g = function() {
function _(S) {
this.editor = S, this.content = new d.default(S), this.scroll = new h.default(S), this.range = new p.default(S);
}
return (0, s.default)(_.prototype, "size", {
get: function() {
return this.scroll.size;
},
enumerable: !1,
configurable: !0
}), _.prototype.observe = function() {
this.content.observe(), this.scroll.observe(), !this.editor.isCompatibleMode && this.range.observe();
}, _.prototype.save = function(S) {
S.length && (this.content.save(S), this.scroll.save(), !this.editor.isCompatibleMode && this.range.save());
}, _.prototype.revoke = function() {
this.editor.change.disconnect();
var S = this.content.revoke();
S && (this.scroll.revoke(), this.editor.isCompatibleMode || (this.range.revoke(), this.editor.$textElem.focus())), this.editor.change.connect(), S && this.editor.change.emit();
}, _.prototype.restore = function() {
this.editor.change.disconnect();
var S = this.content.restore();
S && (this.scroll.restore(), this.editor.isCompatibleMode || (this.range.restore(), this.editor.$textElem.focus())), this.editor.change.connect(), S && this.editor.change.emit();
}, _;
}();
r.default = g;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(429)), h = u.__importDefault(n(433)), p = function() {
function g(_) {
this.editor = _;
}
return g.prototype.observe = function() {
this.editor.isCompatibleMode ? this.cache = new h.default(this.editor) : this.cache = new d.default(this.editor), this.cache.observe();
}, g.prototype.save = function(_) {
this.editor.isCompatibleMode ? this.cache.save() : this.cache.compile(_);
}, g.prototype.revoke = function() {
var _;
return (_ = this.cache) === null || _ === void 0 ? void 0 : _.revoke();
}, g.prototype.restore = function() {
var _;
return (_ = this.cache) === null || _ === void 0 ? void 0 : _.restore();
}, g;
}();
r.default = p;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(99)), h = u.__importDefault(n(431)), p = n(432), g = function(_) {
u.__extends(S, _);
function S(b) {
var A = _.call(this, b.config.historyMaxSize) || this;
return A.editor = b, A;
}
return S.prototype.observe = function() {
this.resetMaxSize(this.editor.config.historyMaxSize);
}, S.prototype.compile = function(b) {
return this.save(h.default(b)), this;
}, S.prototype.revoke = function() {
return _.prototype.revoke.call(this, function(b) {
p.revoke(b);
});
}, S.prototype.restore = function() {
return _.prototype.restore.call(this, function(b) {
p.restore(b);
});
}, S;
}(d.default);
r.default = g;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 }), r.CeilStack = void 0;
var u = function() {
function d(h) {
h === void 0 && (h = 0), this.data = [], this.max = 0, this.reset = !1, h = Math.abs(h), h && (this.max = h);
}
return d.prototype.resetMax = function(h) {
h = Math.abs(h), !this.reset && !isNaN(h) && (this.max = h, this.reset = !0);
}, (0, s.default)(d.prototype, "size", {
get: function() {
return this.data.length;
},
enumerable: !1,
configurable: !0
}), d.prototype.instack = function(h) {
return this.data.unshift(h), this.max && this.size > this.max && (this.data.length = this.max), this;
}, d.prototype.outstack = function() {
return this.data.shift();
}, d.prototype.clear = function() {
return this.data.length = 0, this;
}, d;
}();
r.CeilStack = u;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4)), d = a(n(27));
(0, s.default)(r, "__esModule", { value: !0 }), r.compliePosition = r.complieNodes = r.compileValue = r.compileType = void 0;
var h = n(6);
function p(m) {
switch (m) {
case "childList":
return "node";
case "attributes":
return "attr";
default:
return "text";
}
}
r.compileType = p;
function g(m) {
switch (m.type) {
case "attributes":
return m.target.getAttribute(m.attributeName) || "";
case "characterData":
return m.target.textContent;
default:
return "";
}
}
r.compileValue = g;
function _(m) {
var y = {};
return m.addedNodes.length && (y.add = h.toArray(m.addedNodes)), m.removedNodes.length && (y.remove = h.toArray(m.removedNodes)), y;
}
r.complieNodes = _;
function S(m) {
var y;
return m.previousSibling ? y = { type: "before", target: m.previousSibling } : m.nextSibling ? y = { type: "after", target: m.nextSibling } : y = { type: "parent", target: m.target }, y;
}
r.compliePosition = S;
var b = ["UL", "OL", "H1", "H2", "H3", "H4", "H5", "H6"];
function A(m) {
var y = [], E = !1, x = [];
return (0, u.default)(m).call(m, function(k, D) {
var P = { type: p(k.type), target: k.target, attr: k.attributeName || "", value: g(k) || "", oldValue: k.oldValue || "", nodes: _(k), position: S(k) };
if (y.push(P), !!h.UA.isFirefox) {
if (E && k.addedNodes.length && k.addedNodes[0].nodeType == 1) {
var M = k.addedNodes[0], B = { type: "node", target: M, attr: "", value: "", oldValue: "", nodes: { add: [E] }, position: { type: "parent", target: M } };
(0, d.default)(b).call(b, M.nodeName) != -1 ? (B.nodes.add = h.toArray(M.childNodes), y.push(B)) : E.nodeType == 3 ? (w(M, x) && (B.nodes.add = h.toArray(M.childNodes)), y.push(B)) : (0, d.default)(b).call(b, k.target.nodeName) == -1 && w(M, x) && (B.nodes.add = h.toArray(M.childNodes), y.push(B));
}
P.type == "node" && k.removedNodes.length == 1 ? (E = k.removedNodes[0], x.push(E)) : (E = !1, x.length = 0);
}
}), y;
}
r.default = A;
function w(m, y) {
for (var E = 0, x = y.length - 1; x > 0 && m.contains(y[x]); x--)
E++;
return E;
}
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(4)), d = a(n(94));
(0, s.default)(r, "__esModule", { value: !0 }), r.restore = r.revoke = void 0;
function h(x, k) {
var D = x.position.target;
switch (x.position.type) {
case "before":
D.nextSibling ? (D = D.nextSibling, (0, u.default)(k).call(k, function(P) {
x.target.insertBefore(P, D);
})) : (0, u.default)(k).call(k, function(P) {
x.target.appendChild(P);
});
break;
case "after":
(0, u.default)(k).call(k, function(P) {
x.target.insertBefore(P, D);
});
break;
default:
(0, u.default)(k).call(k, function(P) {
D.appendChild(P);
});
break;
}
}
function p(x) {
for (var k = 0, D = (0, d.default)(x.nodes); k < D.length; k++) {
var P = D[k], M = P[0], B = P[1];
switch (M) {
case "add":
(0, u.default)(B).call(B, function(T) {
x.target.removeChild(T);
});
break;
default: {
h(x, B);
break;
}
}
}
}
function g(x) {
var k = x.target;
x.oldValue == null ? k.removeAttribute(x.attr) : k.setAttribute(x.attr, x.oldValue);
}
function _(x) {
x.target.textContent = x.oldValue;
}
var S = { node: p, text: _, attr: g };
function b(x) {
for (var k = x.length - 1; k > -1; k--) {
var D = x[k];
S[D.type](D);
}
}
r.revoke = b;
function A(x) {
for (var k = 0, D = (0, d.default)(x.nodes); k < D.length; k++) {
var P = D[k], M = P[0], B = P[1];
switch (M) {
case "add": {
h(x, B);
break;
}
default: {
(0, u.default)(B).call(B, function(T) {
T.parentNode.removeChild(T);
});
break;
}
}
}
}
function w(x) {
x.target.textContent = x.value;
}
function m(x) {
x.target.setAttribute(x.attr, x.value);
}
var y = { node: A, text: w, attr: m };
function E(x) {
for (var k = 0, D = x; k < D.length; k++) {
var P = D[k];
y[P.type](P);
}
}
r.restore = E;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(434), d = function() {
function h(p) {
this.editor = p, this.data = new u.TailChain();
}
return h.prototype.observe = function() {
this.data.resetMax(this.editor.config.historyMaxSize), this.data.insertLast(this.editor.$textElem.html());
}, h.prototype.save = function() {
return this.data.insertLast(this.editor.$textElem.html()), this;
}, h.prototype.revoke = function() {
var p = this.data.prev();
return p ? (this.editor.$textElem.html(p), !0) : !1;
}, h.prototype.restore = function() {
var p = this.data.next();
return p ? (this.editor.$textElem.html(p), !0) : !1;
}, h;
}();
r.default = d;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(91));
(0, s.default)(r, "__esModule", { value: !0 }), r.TailChain = void 0;
var d = function() {
function h() {
this.data = [], this.max = 0, this.point = 0, this.isRe = !1;
}
return h.prototype.resetMax = function(p) {
p = Math.abs(p), p && (this.max = p);
}, (0, s.default)(h.prototype, "size", {
get: function() {
return this.data.length;
},
enumerable: !1,
configurable: !0
}), h.prototype.insertLast = function(p) {
if (this.isRe) {
var g;
(0, u.default)(g = this.data).call(g, this.point + 1), this.isRe = !1;
}
for (this.data.push(p); this.max && this.size > this.max; )
this.data.shift();
return this.point = this.size - 1, this;
}, h.prototype.current = function() {
return this.data[this.point];
}, h.prototype.prev = function() {
if (!this.isRe && (this.isRe = !0), this.point--, this.point < 0) {
this.point = 0;
return;
}
return this.current();
}, h.prototype.next = function() {
if (!this.isRe && (this.isRe = !0), this.point++, this.point >= this.size) {
this.point = this.size - 1;
return;
}
return this.current();
}, h;
}();
r.TailChain = d;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(99)), h = function(p) {
u.__extends(g, p);
function g(_) {
var S = p.call(this, _.config.historyMaxSize) || this;
return S.editor = _, S.last = 0, S.target = _.$textElem.elems[0], S;
}
return g.prototype.observe = function() {
var _ = this;
this.target = this.editor.$textElem.elems[0], this.editor.$textElem.on("scroll", function() {
_.last = _.target.scrollTop;
}), this.resetMaxSize(this.editor.config.historyMaxSize);
}, g.prototype.save = function() {
return p.prototype.save.call(this, [this.last, this.target.scrollTop]), this;
}, g.prototype.revoke = function() {
var _ = this;
return p.prototype.revoke.call(this, function(S) {
_.target.scrollTop = S[0];
});
}, g.prototype.restore = function() {
var _ = this;
return p.prototype.restore.call(this, function(S) {
_.target.scrollTop = S[1];
});
}, g;
}(d.default);
r.default = h;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = n(2), d = u.__importDefault(n(99)), h = u.__importDefault(n(3)), p = n(6);
function g(S) {
return { start: [S.startContainer, S.startOffset], end: [S.endContainer, S.endOffset], root: S.commonAncestorContainer, collapsed: S.collapsed };
}
var _ = function(S) {
u.__extends(b, S);
function b(A) {
var w = S.call(this, A.config.historyMaxSize) || this;
return w.editor = A, w.lastRange = g(document.createRange()), w.root = A.$textElem.elems[0], w.updateLastRange = p.debounce(function() {
w.lastRange = g(w.rangeHandle);
}, A.config.onchangeTimeout), w;
}
return (0, s.default)(b.prototype, "rangeHandle", {
get: function() {
var w = document.getSelection();
return w && w.rangeCount ? w.getRangeAt(0) : document.createRange();
},
enumerable: !1,
configurable: !0
}), b.prototype.observe = function() {
var A = this;
this.root = this.editor.$textElem.elems[0], this.resetMaxSize(this.editor.config.historyMaxSize);
function w() {
var y = A.rangeHandle;
(A.root === y.commonAncestorContainer || A.root.contains(y.commonAncestorContainer)) && (A.editor.isComposing || A.updateLastRange());
}
function m(y) {
(y.key == "Backspace" || y.key == "Delete") && A.updateLastRange();
}
h.default(document).on("selectionchange", w), this.editor.beforeDestroy(function() {
h.default(document).off("selectionchange", w);
}), A.editor.$textElem.on("keydown", m);
}, b.prototype.save = function() {
var A = g(this.rangeHandle);
return S.prototype.save.call(this, [this.lastRange, A]), this.lastRange = A, this;
}, b.prototype.set = function(A) {
try {
if (A) {
var w = this.rangeHandle;
return w.setStart.apply(w, A.start), w.setEnd.apply(w, A.end), this.editor.menus.changeActive(), !0;
}
} catch {
return !1;
}
return !1;
}, b.prototype.revoke = function() {
var A = this;
return S.prototype.revoke.call(this, function(w) {
A.set(w[0]);
});
}, b.prototype.restore = function() {
var A = this;
return S.prototype.restore.call(this, function(w) {
A.set(w[1]);
});
}, b;
}(d.default);
r.default = _;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(29));
(0, s.default)(r, "__esModule", { value: !0 });
var d = n(2), h = d.__importDefault(n(3));
n(438);
function p(g) {
var _ = !1, S, b;
g.txt.eventHooks.changeEvents.push(function() {
_ && (0, u.default)(S).call(S, ".w-e-content-preview").html(g.$textElem.html());
});
function A() {
if (!_) {
g.$textElem.hide();
var m = g.zIndex.get("textContainer"), y = g.txt.html();
S = h.default('<div class="w-e-content-mantle" style="z-index:' + m + `">
<div class="w-e-content-preview w-e-text">` + y + `</div>
</div>`), g.$textContainerElem.append(S);
var E = g.zIndex.get("menu");
b = h.default('<div class="w-e-menue-mantle" style="z-index:' + E + '"></div>'), g.$toolbarElem.append(b), _ = !0, g.isEnable = !1;
}
}
function w() {
!_ || (S.remove(), b.remove(), g.$textElem.show(), _ = !1, g.isEnable = !0);
}
return { disable: A, enable: w };
}
r.default = p;
}, function(i, r, n) {
var a = n(20), s = n(439);
s = s.__esModule ? s.default : s, typeof s == "string" && (s = [[i.i, s, ""]]);
var u = {};
u.insert = "head", u.singleton = !1, a(s, u), i.exports = s.locals || {};
}, function(i, r, n) {
var a = n(21);
r = a(!1), r.push([i.i, `.w-e-content-mantle {
width: 100%;
height: 100%;
overflow-y: auto;
}
.w-e-content-mantle .w-e-content-preview {
width: 100%;
min-height: 100%;
padding: 0 10px;
line-height: 1.5;
}
.w-e-content-mantle .w-e-content-preview img {
cursor: default;
}
.w-e-content-mantle .w-e-content-preview img:hover {
box-shadow: none;
}
.w-e-menue-mantle {
position: absolute;
height: 100%;
width: 100%;
top: 0;
left: 0;
}
`, ""]), i.exports = r;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
var u = function() {
function d(h) {
var p = this;
this.editor = h;
var g = function() {
var S = document.activeElement;
S === h.$textElem.elems[0] && p.emit();
};
window.document.addEventListener("selectionchange", g), this.editor.beforeDestroy(function() {
window.document.removeEventListener("selectionchange", g);
});
}
return d.prototype.emit = function() {
var h, p = this.editor.config.onSelectionChange;
if (p) {
var g = this.editor.selection;
g.saveRange(), g.isSelectionEmpty() || p({
text: g.getSelectionText(),
html: (h = g.getSelectionContainerElem()) === null || h === void 0 ? void 0 : h.elems[0].innerHTML,
selection: g
});
}
}, d;
}();
r.default = u;
}, function(i, r, n) {
var a = n(0), s = a(n(1)), u = a(n(128)), d = a(n(94)), h = a(n(4));
(0, s.default)(r, "__esModule", { value: !0 }), r.registerPlugin = void 0;
var p = n(2), g = p.__importDefault(n(87)), _ = n(6);
function S(A, w, m) {
if (!A)
throw new TypeError("name is not define");
if (!w)
throw new TypeError("options is not define");
if (!w.intention)
throw new TypeError("options.intention is not define");
if (w.intention && typeof w.intention != "function")
throw new TypeError("options.intention is not function");
m[A] && console.warn("plugin " + A + " \u5DF2\u5B58\u5728\uFF0C\u5DF2\u8986\u76D6\u3002"), m[A] = w;
}
r.registerPlugin = S;
function b(A) {
var w = (0, u.default)({}, _.deepClone(g.default.globalPluginsFunctionList), _.deepClone(A.pluginsFunctionList)), m = (0, d.default)(w);
(0, h.default)(m).call(m, function(y) {
var E = y[0], x = y[1];
console.info("plugin " + E + " initializing");
var k = x.intention, D = x.config;
k(A, D), console.info("plugin " + E + " initialization complete");
});
}
r.default = b;
}, function(i, r, n) {
var a = n(0), s = a(n(1));
(0, s.default)(r, "__esModule", { value: !0 });
}]).default;
});
})(bb);
var r6 = /* @__PURE__ */ i6(bb.exports), o6 = "fcEditor", a6 = 1, l6 = Object.assign || function(e) {
for (var t, i = 1; i < arguments.length; i++)
for (var r in t = arguments[i], t)
Object.prototype.hasOwnProperty.call(t, r) && (e[r] = t[r]);
return e;
}, s6 = Ve({
name: o6,
props: {
modelValue: String,
init: Function,
disabled: Boolean,
config: Object
},
inheritAttrs: !1,
emits: ["update:modelValue"],
data: function() {
return {
editor: {},
uni: a6++
};
},
watch: {
disabled: function() {
this.enable();
},
modelValue: function(t) {
t !== this.editor.txt.html() && this.editor.txt.html(t || "");
}
},
methods: {
enable: function() {
this.disabled ? this.editor.disable() : this.editor.enable();
},
result: function() {
this.$emit("update:modelValue", this.editor.txt.html());
}
},
mounted: function() {
var t = this;
this.$nextTick(function() {
t.editor = new r6("#editor".concat(t.uni)), t.editor.config.zIndex = 2, t.editor.config.focus = !1, t.editor.config.autoFocus = !1, t.config && l6(t.editor.config, t.config), t.init && t.init(t.editor), t.editor.create(), t.enable(), t.editor.txt.html(t.modelValue);
});
},
render: function() {
var t = t6({}, this.$attrs);
return delete t.id, G("div", dn(t, {
onInput: this.result,
id: "editor".concat(this.uni),
style: "line-height: normal;"
}), null);
},
beforeDestroy: function() {
this.editor && this.editor.destroy(), this.editor = null;
}
});
(function(e, t) {
(function(i) {
i(Ko());
})(function(i) {
i.defineSimpleMode = function(_, S) {
i.defineMode(_, function(b) {
return i.simpleMode(b, S);
});
}, i.simpleMode = function(_, S) {
r(S, "start");
var b = {}, A = S.meta || {}, w = !1;
for (var m in S)
if (m != A && S.hasOwnProperty(m))
for (var y = b[m] = [], E = S[m], x = 0; x < E.length; x++) {
var k = E[x];
y.push(new s(k, S)), (k.indent || k.dedent) && (w = !0);
}
var D = {
startState: function() {
return {
state: "start",
pending: null,
local: null,
localState: null,
indent: w ? [] : null
};
},
copyState: function(M) {
var B = {
state: M.state,
pending: M.pending,
local: M.local,
localState: null,
indent: M.indent && M.indent.slice(0)
};
M.localState && (B.localState = i.copyState(M.local.mode, M.localState)), M.stack && (B.stack = M.stack.slice(0));
for (var T = M.persistentStates; T; T = T.next)
B.persistentStates = {
mode: T.mode,
spec: T.spec,
state: T.state == M.localState ? B.localState : i.copyState(T.mode, T.state),
next: B.persistentStates
};
return B;
},
token: u(b, _),
innerMode: function(M) {
return M.local && { mode: M.local.mode, state: M.localState };
},
indent: g(b, A)
};
if (A)
for (var P in A)
A.hasOwnProperty(P) && (D[P] = A[P]);
return D;
};
function r(_, S) {
if (!_.hasOwnProperty(S))
throw new Error("Undefined state " + S + " in simple mode");
}
function n(_, S) {
if (!_)
return /(?:)/;
var b = "";
return _ instanceof RegExp ? (_.ignoreCase && (b = "i"), _.unicode && (b += "u"), _ = _.source) : _ = String(_), new RegExp((S === !1 ? "" : "^") + "(?:" + _ + ")", b);
}
function a(_) {
if (!_)
return null;
if (_.apply)
return _;
if (typeof _ == "string")
return _.replace(/\./g, " ");
for (var S = [], b = 0; b < _.length; b++)
S.push(_[b] && _[b].replace(/\./g, " "));
return S;
}
function s(_, S) {
(_.next || _.push) && r(S, _.next || _.push), this.regex = n(_.regex), this.token = a(_.token), this.data = _;
}
function u(_, S) {
return function(b, A) {
if (A.pending) {
var w = A.pending.shift();
return A.pending.length == 0 && (A.pending = null), b.pos += w.text.length, w.token;
}
if (A.local)
if (A.local.end && b.match(A.local.end)) {
var m = A.local.endToken || null;
return A.local = A.localState = null, m;
} else {
var m = A.local.mode.token(b, A.localState), y;
return A.local.endScan && (y = A.local.endScan.exec(b.current())) && (b.pos = b.start + y.index), m;
}
for (var E = _[A.state], x = 0; x < E.length; x++) {
var k = E[x], D = (!k.data.sol || b.sol()) && b.match(k.regex);
if (D) {
k.data.next ? A.state = k.data.next : k.data.push ? ((A.stack || (A.stack = [])).push(A.state), A.state = k.data.push) : k.data.pop && A.stack && A.stack.length && (A.state = A.stack.pop()), k.data.mode && h(S, A, k.data.mode, k.token), k.data.indent && A.indent.push(b.indentation() + S.indentUnit), k.data.dedent && A.indent.pop();
var P = k.token;
if (P && P.apply && (P = P(D)), D.length > 2 && k.token && typeof k.token != "string") {
for (var M = 2; M < D.length; M++)
D[M] && (A.pending || (A.pending = [])).push({ text: D[M], token: k.token[M - 1] });
return b.backUp(D[0].length - (D[1] ? D[1].length : 0)), P[0];
} else
return P && P.join ? P[0] : P;
}
}
return b.next(), null;
};
}
function d(_, S) {
if (_ === S)
return !0;
if (!_ || typeof _ != "object" || !S || typeof S != "object")
return !1;
var b = 0;
for (var A in _)
if (_.hasOwnProperty(A)) {
if (!S.hasOwnProperty(A) || !d(_[A], S[A]))
return !1;
b++;
}
for (var A in S)
S.hasOwnProperty(A) && b--;
return b == 0;
}
function h(_, S, b, A) {
var w;
if (b.persistent)
for (var m = S.persistentStates; m && !w; m = m.next)
(b.spec ? d(b.spec, m.spec) : b.mode == m.mode) && (w = m);
var y = w ? w.mode : b.mode || i.getMode(_, b.spec), E = w ? w.state : i.startState(y);
b.persistent && !w && (S.persistentStates = { mode: y, spec: b.spec, state: E, next: S.persistentStates }), S.localState = E, S.local = {
mode: y,
end: b.end && n(b.end),
endScan: b.end && b.forceEnd !== !1 && n(b.end, !1),
endToken: A && A.join ? A[A.length - 1] : A
};
}
function p(_, S) {
for (var b = 0; b < S.length; b++)
if (S[b] === _)
return !0;
}
function g(_, S) {
return function(b, A, w) {
if (b.local && b.local.mode.indent)
return b.local.mode.indent(b.localState, A, w);
if (b.indent == null || b.local || S.dontIndentStates && p(b.state, S.dontIndentStates) > -1)
return i.Pass;
var m = b.indent.length - 1, y = _[b.state];
e:
for (; ; ) {
for (var E = 0; E < y.length; E++) {
var x = y[E];
if (x.data.dedent && x.data.dedentIfLineStart !== !1) {
var k = x.regex.exec(A);
if (k && k[0]) {
m--, (x.next || x.push) && (y = _[x.next || x.push]), A = A.slice(k[0].length);
continue e;
}
}
}
break;
}
return m < 0 ? 0 : b.indent[m];
};
}
});
})();
nr.defineSimpleMode("fcComputedMode", {
start: [
{ regex: /[a-zA-Z_]\w*/, token: "keyword" },
{ regex: /[a-z]+/, token: "def" },
{ regex: /\/\/.*/, token: "comment" },
{ regex: /\/\*/, token: "comment", next: "comment" },
{ regex: /[-+]?(\d*\.)?\d+/, token: "number" },
{ regex: /"(?:[^\\]|\\.)*?(?:"|$)/, token: "string" },
{ regex: /[\(\),]/, token: "bracket" },
{ regex: /==/, token: "operator" },
{ regex: /=/, token: "operator" },
{ regex: /[!<>]=?/, token: "operator" },
{ regex: /&&|\|\|/, token: "operator" },
{ regex: /[\+\-\*\%\/]/, token: "builtin" }
],
comment: [
{ regex: /.*?\*\//, token: "comment", next: "start" },
{ regex: /.*/, token: "comment" }
]
});
const jt = (e, t, i) => {
tt.component(e, i || t), Qn.component(e, t);
};
tt.component("draggable", Go);
tt.component("DragTool", xy);
tt.component("DragBox", Oy);
tt.component("Validate", I3);
tt.component("Struct", ty);
tt.component("HtmlEditor", zI);
tt.component("FnEditor", ar);
tt.component("ComputedConfig", T0);
tt.component("Required", L3);
tt.component("TableOptions", Y0);
tt.component("TreeOptions", Y3);
tt.component("TableFormColumn", Iy);
tt.component("TableFormColumn2", Iy);
tt.component("EventConfig", k0);
tt.component("FetchConfig", nF);
tt.component("TableColumnConfig", cF);
tt.component("TableButtonConfig", _F);
tt.component("SizeInput", Yo);
tt.component("PatternInput", Dc);
tt.component("StyleConfig", Z0);
tt.component("GlobalFetchConfig", K0);
tt.component("GlobalFetchSelect", LF);
tt.component("GlobalEventConfig", G0);
tt.component("GlobalClassConfig", q0);
tt.component("GlobalClassSelect", UF);
tt.component("GlobalVariableConfig", ey);
tt.component("FetchTable", QF);
tt.component("VariableConfig", al);
tt.component("ColorInput", Qo);
tt.component("ConfigItem", li);
tt.component("ConfigTitle", H0);
tt.component("FieldInput", KI);
tt.component("PromptInput", JI);
tt.component("ValueInput", nu);
tt.component("StepFormItem", zM);
tt.component("FcRow", AP);
tt.component("FnConfig", OF);
tt.component("FnInput", ky);
tt.component("RuleSelect", $c);
tt.component("HideConfig", EP);
tt.component("SpanInput", kP);
tt.component("LanguageInput", Gc);
jt("FcSlot", p3, h3);
jt("FcJson", m3, v3);
jt("DataTable", Ty);
jt("FcEditor", s6);
jt("fcInlineForm", Ry);
jt("FcCell", vP, bP);
jt("TableForm", RM, $y);
jt("TableFormPro", FM, $y);
jt("StepForm", Z3, nM);
jt("FcValue", c3, s3);
jt("FcTable", r3, t3);
jt("NestedTableForm", yM, mM);
jt("InfiniteTableForm", TM, SM);
jt("FcDialog", Fy, XM);
jt("FcDrawer", cP, lP);
jt("AudioBox", VP);
jt("VideoBox", HP);
jt("BarCodeBox", k4);
jt("IframeBox", $4);
jt("QrCodeBox", L4);
jt("SignaturePad", NV);
jt("FcEcharts", e6);
jt("FcTitle", H4);
jt("FcCity", j4);
jt("FcId", MP);
jt("FcMarkdown", OV);
jt("fcDataSelect", JV, HV);
const u6 = function(e) {
(Array.isArray(e) ? e : [e]).forEach((i) => {
un[i.name] = i.handle, oc[i.name] = i.example, Us.value.formula[i.name] = i.info, b0.forEach((r) => {
r.key === i.menu && r.children.push(i.name), Qn.setFormula(i.name, i.handle), tt.setFormula(i.name, i.handle);
});
});
}, d6 = function(e) {
(Array.isArray(e) ? e : [e]).forEach((i) => {
Rc[i.name] = i.handle, w0[i.name] = i.rule, Us.value.behavior[i.name] = {
info: i.info,
name: i.label
}, _0.forEach((r) => {
r.key === i.menu && r.children.push(i.name);
});
});
}, f6 = function(e) {
e.component("FcDesigner", nn);
};
nn.install = f6;
nn.makeOptionsRule = Qr;
nn.formCreate = Qn;
nn.designerForm = tt;
nn.component = jt;
nn.setFormula = u6;
nn.setBehavior = d6;
nn.useLocale = E0;
nn.copyTextToClipboard = er;
nn.getInjectArg = In;
nn.localeOptions = gt;
nn.localeProps = Ke;
nn.makeRequiredRule = Hg;
nn.makeTreeOptions = zi;
nn.makeTreeOptionsRule = il;
nn.makeTitleRule = Wg;
nn.makeDataRule = Si;
nn.toJSON = ai;
nn.loadjs = Rn;
nn.t = ac;
nn.utils = {
copyTextToClipboard: er,
getInjectArg: In,
localeOptions: gt,
localeProps: Ke,
makeTitleRule: Wg,
makeOptionsRule: Qr,
makeRequiredRule: Hg,
makeTreeOptions: zi,
makeTreeOptionsRule: il,
makeDataRule: Si,
toJSON: ai
};
const Vg = "3.2.22";
P_(Vg, Qn.version) === 1 && console.error("Please use FormCreate version " + Vg + " or greater, see https://github.com/xaboy/form-create.");
export {
er as copyTextToClipboard,
nn as default,
tt as designerForm,
Qn as formCreate,
In as getInjectArg,
f6 as install,
Rn as loadjs,
gt as localeOptions,
Ke as localeProps,
Si as makeDataRule,
Qr as makeOptionsRule,
Hg as makeRequiredRule,
Wg as makeTitleRule,
zi as makeTreeOptions,
il as makeTreeOptionsRule,
ac as t,
ai as toJSON
};
Reference in New Issue View Git Blame Copy Permalink