From 9269665e0a456c28b0f994a9b10721b111264170 Mon Sep 17 00:00:00 2001
From: limengnan <420004014@qq.com>
Date: Tue, 27 May 2025 15:27:24 +0800
Subject: [PATCH] =?UTF-8?q?=E6=9B=B4=E6=96=B0formcreat?=
MIME-Version: 1.0
Content-Type: text/plain; charset=UTF-8
Content-Transfer-Encoding: 8bit
---
core/core-backend/pom.xml | 2 +-
.../src/fcDesignerPro/index.es.js | 18053 ++++++++--------
.../src/fcDesignerPro/index.umd.js | 258 +-
.../src/fcDesignerPro/pc/index.es.js | 2049 +-
.../src/fcDesignerPro/pc/index.umd.js | 124 +-
core/core-frontend/src/pages/index/main.ts | 5 +-
.../src/viewsnew/common/FormCreate.vue | 4 +-
.../viewsnew/common/FormCreateDesigner.vue | 2 +-
8 files changed, 10270 insertions(+), 10227 deletions(-)
diff --git a/core/core-backend/pom.xml b/core/core-backend/pom.xml
index e1ce6ac..f738ba5 100644
--- a/core/core-backend/pom.xml
+++ b/core/core-backend/pom.xml
@@ -3,7 +3,7 @@
xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
xsi:schemaLocation="http://maven.apache.org/POM/4.0.0 http://maven.apache.org/xsd/maven-4.0.0.xsd">
- core
+ gisbi
io.gisbi
1.0.0
diff --git a/core/core-frontend/src/fcDesignerPro/index.es.js b/core/core-frontend/src/fcDesignerPro/index.es.js
index 1433209..5d172bd 100644
--- a/core/core-frontend/src/fcDesignerPro/index.es.js
+++ b/core/core-frontend/src/fcDesignerPro/index.es.js
@@ -5,14 +5,14 @@
* license 仅限于被授权主体（个人、企业或组织）使用
*/
(function(){"use strict";try{if(typeof document!="undefined"){var e=document.createElement("style");e.appendChild(document.createTextNode('._fc-step-form .van-step{line-height:1.4;text-align:left}._fc-popup.van-popup{display:flex;height:100%;padding-bottom:110px;padding-top:50px}._fc-popup-title{color:#333;font-size:16px;left:0;position:absolute;text-align:center;top:16px;width:100%}._fc-popup-content{display:flex;flex:1;overflow:auto}._fc-popup-footer{bottom:0;left:0;padding:10px;position:absolute;right:0}._fc-data-table{width:100%}._fc-data-table .el-table{--el-table-header-bg-color:#e8eefc}._fc-data-table .el-pagination{display:flex;margin-top:10px}._fc-data-table .el-pagination.left{justify-content:flex-start}._fc-data-table .el-pagination.center{justify-content:center}._fc-data-table .el-pagination.right{justify-content:flex-end}._fc-data-table ._fc-data-table-img-list .el-image{height:60px;max-width:150px}._fc-table{overflow:auto}._fc-table>table{border-bottom:1px solid #ebeef5;border-right:1px solid #ebeef5;border-color:#ebeef5 currentcolor currentcolor #ebeef5;border-style:solid none none solid;border-width:1px 0 0 1px;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fc-table td,._fc-table tr{min-height:50px}._fc-table td{border-bottom:0;border-right:0;border-color:currentcolor #ebeef5 #ebeef5 currentcolor;border-style:none solid solid none;border-width:0 1px 1px 0;box-sizing:border-box;min-width:80px;overflow:hidden;overflow-wrap:break-word;padding:5px;position:relative}._fc-table.is-mini td{min-height:12px;padding:0}._fc-table.is-mini .el-form-item{margin:0;padding:0}._fc-table-form{color:var(--fc-text-color-2);overflow:auto}._fc-table-form .form-create td .el-form-item{margin-bottom:1px}._fc-table-form .form-create td .el-form-item.is-error{margin-bottom:22px}._fc-table-form .el-form-item__label,._fc-table-form .van-field__label{display:none!important}._fc-table-form .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fc-tf-head-idx,._fc-tf-idx{font-weight:500;min-width:40px;text-align:center;width:40px}._fc-tf-btn,._fc-tf-edit{min-width:70px;text-align:center;width:70px}._fc-tf-btn .fc-icon{cursor:pointer}._fc-table-form._fc-disabled ._fc-tf-btn .fc-icon,._fc-table-form._fc-disabled>.el-button{cursor:not-allowed}._fc-tf-table{border:1px solid #ebeef5;border-bottom:0;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fc-table-form ._fc-tf-table>thead>tr>th{border:0;border-bottom:1px solid #ebeef5;font-weight:500;height:40px}._fc-table-form ._fc-tf-table>thead>tr>th+th{border-left:1px solid #ebeef5}._fc-table-form tr{min-height:50px}._fc-table-form ._fc-read-view{text-align:center;width:100%}._fc-table-form td{border:0;border-bottom:1px solid #ebeef5;box-sizing:border-box;min-height:50px;min-width:80px;overflow:hidden;overflow-wrap:break-word;padding:5px;position:relative}._fc-table-form td+td{border-left:1px solid #ebeef5}._fc-tf-table .el-cascader,._fc-tf-table .el-date-editor,._fc-tf-table .el-input-number,._fc-tf-table .el-select,._fc-tf-table .el-slider{width:100%}._fc-tf-head-required:before{color:#f56c6c;content:"*";margin-right:4px}._fc-table-form-v2{color:var(--fc-text-color-2);overflow:auto;width:100%}._fc-table-form-v2 .is-required:before{color:#f56c6c;content:"*";margin-right:4px}._fc-table-form-v2 .form-create td .el-form-item{margin-bottom:1px}._fc-table-form-v2 .form-create td .el-form-item.is-error{margin-bottom:22px}._fc-table-form-v2 .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fc-table-form-v2 .el-form-item__label{display:none!important}._fc-tf-pro-handle{align-items:center;display:flex;flex-direction:row;justify-content:space-between;margin-top:12px}._fc-table-form-v2 .el-cascader,._fc-table-form-v2 .el-date-editor,._fc-table-form-v2 .el-input-number,._fc-table-form-v2 .el-select,._fc-table-form-v2 .el-slider{width:100%}._fc-infinite-table-form{color:var(--fc-text-color-2);overflow:auto}._fc-infinite-table-form .form-create .el-form-item{margin-bottom:1px}._fc-infinite-table-form .form-create .el-form-item.is-error{margin-bottom:22px}._fc-infinite-table-form .el-form-item__label,._fc-infinite-table-form .van-field__label{display:none!important}._fc-infinite-table-form .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fc-itf-table ._fc-itf-head-idx,._fc-itf-table ._fc-itf-idx{font-weight:500;min-width:40px;padding:0;text-align:center;width:40px}._fc-itf-idx div{border:1px solid #bfbfbf;border-radius:6px;cursor:pointer;display:inline-flex;height:18px;justify-content:center;line-height:16px;width:18px}._fc-itf-sub-idx{width:30px}._fc-itf-btn,._fc-itf-edit{min-width:70px;text-align:center;width:70px}._fc-itf-btn .fc-icon{cursor:pointer}._fc-infinite-table-form._fc-disabled ._fc-itf-btn .fc-icon,._fc-infinite-table-form._fc-disabled>.el-button{cursor:not-allowed}._fc-itf-table{border:1px solid #ebeef5;border-bottom:0;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fc-itf-table>thead>tr>th{border:0;border-bottom:1px solid #ebeef5;font-weight:500;height:40px}._fc-itf-table ._fc-itf-table>thead{display:none}._fc-itf-table ._fc-itf-table{border-right:0}._fc-itf-table>thead>tr>th+th{border-left:1px solid #ebeef5}._fc-itf-table tr{min-height:50px}._fc-itf-table ._fc-read-view{text-align:center;width:100%}._fc-itf-table td{border:0;border-bottom:1px solid #ebeef5;box-sizing:border-box;min-height:50px;min-width:80px;overflow:hidden;overflow-wrap:break-word;padding:10px;position:relative}._fc-itf-table td+td{border-left:1px solid #ebeef5}._fc-itf-table .el-cascader,._fc-itf-table .el-date-editor,._fc-itf-table .el-input-number,._fc-itf-table .el-select,._fc-itf-table .el-slider{width:100%}._fc-infinite-table-form ._fc-itf-sub{padding:5px 0 5px 10px}._fc-itf-sub ._fc-table-form{background-color:var(--fc-bg-color-1)}._fc-itf-sub ._fc-tf-table{border:0}._fc-itf-idx+._fc-itf-idx,._fc-itf-sub-idx+._fc-itf-head-idx{border-left:0}._fc-itf-head-required:before{color:#f56c6c;content:"*";margin-right:4px}._fc-nested-table-form{color:var(--fc-text-color-2);overflow:auto}._fc-nested-table-form .form-create .el-form-item{margin-bottom:1px}._fc-nested-table-form .form-create .el-form-item.is-error{margin-bottom:22px}._fc-nested-table-form .el-form-item__label,._fc-nested-table-form .van-field__label{display:none!important}._fc-nested-table-form .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fc-ntf-table ._fc-ntf-head-idx,._fc-ntf-table ._fc-ntf-idx{font-weight:500;min-width:40px;padding:0;text-align:center;width:40px}._fc-ntf-idx div{border:1px solid #bfbfbf;border-radius:6px;cursor:pointer;display:inline-flex;height:18px;justify-content:center;line-height:16px;width:18px}._fc-ntf-sub-idx{width:30px}._fc-ntf-btn,._fc-ntf-edit{min-width:70px;text-align:center;width:70px}._fc-ntf-btn .fc-icon{cursor:pointer}._fc-nested-table-form._fc-disabled ._fc-ntf-btn .fc-icon,._fc-nested-table-form._fc-disabled>.el-button{cursor:not-allowed}._fc-ntf-table{border:1px solid #ebeef5;border-bottom:0;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fc-ntf-table>thead>tr>th{border:0;border-bottom:1px solid #ebeef5;font-weight:500;height:40px}._fc-ntf-table>thead>tr>th+th{border-left:1px solid #ebeef5}._fc-ntf-table tr{min-height:50px}._fc-ntf-table ._fc-read-view{text-align:center;width:100%}._fc-ntf-table td{border:0;border-bottom:1px solid #ebeef5;box-sizing:border-box;min-height:50px;min-width:80px;overflow:hidden;overflow-wrap:break-word;padding:10px;position:relative}._fc-ntf-table td+td{border-left:1px solid #ebeef5}._fc-ntf-table .el-cascader,._fc-ntf-table .el-date-editor,._fc-ntf-table .el-input-number,._fc-ntf-table .el-select,._fc-ntf-table .el-slider{width:100%}._fc-nested-table-form ._fc-ntf-sub{background-color:#fafafa}._fc-ntf-sub ._fc-table-form{background-color:var(--fc-bg-color-1)}._fc-ntf-sub ._fc-tf-table{border:0}._fc-ntf-idx+._fc-ntf-idx,._fc-ntf-sub-idx+._fc-ntf-head-idx{border-left:0}._fc-ntf-head-required:before{color:#f56c6c;content:"*";margin-right:4px}._fc-cell{display:inline-block}._fc-cell .el-cascader,._fc-cell .el-date-editor,._fc-cell .el-input-number,._fc-cell .el-select,._fc-cell .el-slider,._fc-city-m{width:100%}._fc-city-m .van-cell{padding:0}._fc-line-form{align-items:flex-start;display:flex;flex-flow:wrap;width:100%}.form-create-m ._fc-line-form{display:flex;flex-wrap:wrap}.form-create ._fc-line-form ._fc-line-form,.form-create ._fc-line-form ._fd-drag-item,.form-create ._fc-line-form ._fd-drag-tool,.form-create ._fc-line-form .el-col-24{display:inline-flex;flex:initial;flex:unset!important;flex-wrap:wrap;max-width:100%;width:auto!important}._fc-m-con .form-create ._fc-line-form>.el-col-24{width:100%!important}._fc-line-form .el-form-item{display:inline-flex;vertical-align:middle}._fc-line-form .el-select,._fc-line-form .el-slider{width:220px}._fc-echarts{height:300px;width:100%}._fc-m-signature{width:100%}._fc-m-signature-btn,._fc-m-signature-preview{background:#fff;border:1px dashed #d4d7e0;border-radius:4px;box-sizing:border-box;color:#c9ccd8;font-size:14px;height:88px;line-height:88px;min-width:160px;position:relative;text-align:center;width:100%}._fc-m-signature-btn{cursor:pointer}._fc-m-signature-preview>img{display:inline-block;height:88px}._fc-m-signature-preview .icon-delete2{cursor:pointer;display:inline-block;font-size:14px;line-height:14px;position:absolute;right:9px;top:9px}._fc-m-signature-btn i{font-size:14px}._fc-m-signature-dialog .van-dialog__header{padding:15px 0;position:relative}._fc-m-signature-dialog .icon-add2{color:var(--fc-text-color-3);display:inline-block;position:absolute;right:18px;transform:rotate(45deg)}._fc-m-signature-pad{background-image:linear-gradient(#fff 14px,transparent 0),linear-gradient(90deg,#fff 14px,#d4d7e0 0);background-size:15px 15px;border:1px dashed #d4d7e0;border-radius:4px;box-sizing:border-box;width:100%}._fc-title{font-size:16px;font-weight:600;margin-bottom:16px;margin-top:1em;width:100%}._fc-title.h1,._fc-title.h2{border-bottom:1px solid #eee;padding-bottom:.3em}._fc-title.h1{font-size:32px;line-height:1.2}._fc-title.h2{font-size:24px;line-height:1.225}._fc-title.h3{font-size:20px;line-height:1.43}._fc-title.h4{font-size:16px}._fc-title.h5{font-size:14px}._fc-title.h6{font-size:12px}._fc-markdown{-ms-text-size-adjust:100%;-webkit-text-size-adjust:100%;word-wrap:break-word;color-scheme:light;font-size:16px;line-height:1.5;margin:0;width:100%}._fc-markdown details,._fc-markdown figcaption,._fc-markdown figure{display:block}._fc-markdown summary{display:list-item}._fc-markdown [hidden]{display:none!important}._fc-markdown a{background-color:transparent;color:#0969da;text-decoration:none}._fc-markdown abbr[title]{border-bottom:none;-webkit-text-decoration:underline dotted;text-decoration:underline dotted}._fc-markdown b,._fc-markdown strong{font-weight:600}._fc-markdown dfn{font-style:italic}._fc-markdown h1{border-bottom:1px solid #d1d9e0b3;font-size:2em;font-weight:600;margin:.67em 0;padding-bottom:.3em}._fc-markdown mark{background-color:#fff8c5;color:#1f2328}._fc-markdown small{font-size:90%}._fc-markdown sub,._fc-markdown sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}._fc-markdown sub{bottom:-.25em}._fc-markdown sup{top:-.5em}._fc-markdown img{border-style:none;box-sizing:content-box;max-width:100%}._fc-markdown code,._fc-markdown kbd,._fc-markdown pre,._fc-markdown samp{font-family:monospace;font-size:1em}._fc-markdown figure{margin:1em 2.5rem}._fc-markdown hr{background:transparent;background-color:#d1d9e0;border:0;box-sizing:content-box;height:.25em;margin:1.5rem 0;overflow:hidden;padding:0}._fc-markdown input{font:inherit;font-family:inherit;font-size:inherit;line-height:inherit;margin:0;overflow:visible}._fc-markdown [type=button],._fc-markdown [type=reset],._fc-markdown [type=submit]{-webkit-appearance:button;appearance:button}._fc-markdown [type=checkbox],._fc-markdown [type=radio]{box-sizing:border-box;padding:0}._fc-markdown [type=number]::-webkit-inner-spin-button,._fc-markdown [type=number]::-webkit-outer-spin-button{height:auto}._fc-markdown [type=search]::-webkit-search-cancel-button,._fc-markdown [type=search]::-webkit-search-decoration{-webkit-appearance:none;appearance:none}._fc-markdown ::-webkit-input-placeholder{color:inherit;opacity:.54}._fc-markdown ::-webkit-file-upload-button{-webkit-appearance:button;appearance:button;font:inherit}._fc-markdown a:hover{text-decoration:underline}._fc-markdown ::placeholder{color:#59636e;opacity:1}._fc-markdown hr:after,._fc-markdown hr:before{content:"";display:table}._fc-markdown hr:after{clear:both}._fc-markdown table{border-collapse:collapse;border-spacing:0;display:block;font-variant:tabular-nums;max-width:100%;overflow:auto;width:max-content}._fc-markdown td,._fc-markdown th{padding:0}._fc-markdown details summary{cursor:pointer}._fc-markdown [role=button]:focus,._fc-markdown a:focus,._fc-markdown input[type=checkbox]:focus,._fc-markdown input[type=radio]:focus{box-shadow:none;outline:2px solid #0969da;outline-offset:-2px}._fc-markdown [role=button]:focus:not(:focus-visible),._fc-markdown a:focus:not(:focus-visible),._fc-markdown input[type=checkbox]:focus:not(:focus-visible),._fc-markdown input[type=radio]:focus:not(:focus-visible){outline:1px solid transparent}._fc-markdown [role=button]:focus-visible,._fc-markdown a:focus-visible,._fc-markdown input[type=checkbox]:focus-visible,._fc-markdown input[type=radio]:focus-visible{box-shadow:none;outline:2px solid #0969da;outline-offset:-2px}._fc-markdown a:not([class]):focus,._fc-markdown a:not([class]):focus-visible,._fc-markdown input[type=checkbox]:focus,._fc-markdown input[type=checkbox]:focus-visible,._fc-markdown input[type=radio]:focus,._fc-markdown input[type=radio]:focus-visible{outline-offset:0}._fc-markdown kbd{background-color:#f6f8fa;border:1px solid #d1d9e0b3;border-radius:6px;box-shadow:inset 0 -1px #d1d9e0b3;color:#1f2328;display:inline-block;font:11px ui-monospace,SFMono-Regular,SF Mono,Menlo,Consolas,Liberation Mono,monospace;line-height:10px;padding:.25rem;vertical-align:middle}._fc-markdown h1,._fc-markdown h2,._fc-markdown h3,._fc-markdown h4,._fc-markdown h5,._fc-markdown h6{font-weight:600;line-height:1.25;margin-bottom:1rem;margin-top:1.5rem}._fc-markdown h2{border-bottom:1px solid #d1d9e0b3;font-size:1.5em;font-weight:600;padding-bottom:.3em}._fc-markdown h3{font-size:1.25em;font-weight:600}._fc-markdown h4{font-size:1em;font-weight:600}._fc-markdown h5{font-size:.875em;font-weight:600}._fc-markdown h6{color:#59636e;font-size:.85em;font-weight:600}._fc-markdown p{margin-bottom:10px;margin-top:0}._fc-markdown blockquote{border-left:.25em solid #d1d9e0;color:#59636e;margin:0;padding:0 1em}._fc-markdown ol,._fc-markdown ul{margin-bottom:0;margin-top:0;padding-left:2em}._fc-markdown ol ol,._fc-markdown ul ol{list-style-type:lower-roman}._fc-markdown ol ol ol,._fc-markdown ol ul ol,._fc-markdown ul ol ol,._fc-markdown ul ul ol{list-style-type:lower-alpha}._fc-markdown dd{margin-left:0}._fc-markdown code,._fc-markdown pre,._fc-markdown samp,._fc-markdown tt{font-family:ui-monospace,SFMono-Regular,SF Mono,Menlo,Consolas,Liberation Mono,monospace;font-size:12px}._fc-markdown pre{word-wrap:normal;margin-bottom:0;margin-top:0}._fc-markdown input::-webkit-inner-spin-button,._fc-markdown input::-webkit-outer-spin-button{appearance:none;margin:0}._fc-markdown:after,._fc-markdown:before{content:"";display:table}._fc-markdown:after{clear:both}._fc-markdown>:first-child{margin-top:0!important}._fc-markdown>:last-child{margin-bottom:0!important}._fc-markdown a:not([href]){color:inherit;text-decoration:none}._fc-markdown blockquote,._fc-markdown details,._fc-markdown dl,._fc-markdown ol,._fc-markdown p,._fc-markdown pre,._fc-markdown table,._fc-markdown ul{margin-bottom:1rem;margin-top:0}._fc-markdown blockquote>:first-child{margin-top:0}._fc-markdown blockquote>:last-child{margin-bottom:0}._fc-markdown h1:hover .anchor,._fc-markdown h2:hover .anchor,._fc-markdown h3:hover .anchor,._fc-markdown h4:hover .anchor,._fc-markdown h5:hover .anchor,._fc-markdown h6:hover .anchor{text-decoration:none}._fc-markdown h1 code,._fc-markdown h1 tt,._fc-markdown h2 code,._fc-markdown h2 tt,._fc-markdown h3 code,._fc-markdown h3 tt,._fc-markdown h4 code,._fc-markdown h4 tt,._fc-markdown h5 code,._fc-markdown h5 tt,._fc-markdown h6 code,._fc-markdown h6 tt{font-size:inherit;padding:0 .2em}._fc-markdown summary h1,._fc-markdown summary h2,._fc-markdown summary h3,._fc-markdown summary h4,._fc-markdown summary h5,._fc-markdown summary h6{display:inline-block}._fc-markdown summary h1,._fc-markdown summary h2{border-bottom:0;padding-bottom:0}._fc-markdown ol.no-list,._fc-markdown ul.no-list{list-style-type:none;padding:0}._fc-markdown ol[type="a s"]{list-style-type:lower-alpha}._fc-markdown ol[type="A s"]{list-style-type:upper-alpha}._fc-markdown ol[type="i s"]{list-style-type:lower-roman}._fc-markdown ol[type="I s"]{list-style-type:upper-roman}._fc-markdown div>ol:not([type]),._fc-markdown ol[type="1"]{list-style-type:decimal}._fc-markdown ol ol,._fc-markdown ol ul,._fc-markdown ul ol,._fc-markdown ul ul{margin-bottom:0;margin-top:0}._fc-markdown li>p{margin-top:1rem}._fc-markdown li+li{margin-top:.25em}._fc-markdown dl{padding:0}._fc-markdown dl dt{font-size:1em;font-style:italic;font-weight:600;margin-top:1rem;padding:0}._fc-markdown dl dd{margin-bottom:1rem;padding:0 1rem}._fc-markdown table th{font-weight:600}._fc-markdown table td,._fc-markdown table th{border:1px solid #d1d9e0;padding:6px 13px}._fc-markdown table td>:last-child{margin-bottom:0}._fc-markdown table tr{background-color:#fff;border-top:1px solid #d1d9e0b3}._fc-markdown table tr:nth-child(2n){background-color:#f6f8fa}._fc-markdown table img{background-color:transparent}._fc-markdown img[align=right]{padding-left:20px}._fc-markdown img[align=left]{padding-right:20px}._fc-markdown .emoji{background-color:transparent;max-width:none;vertical-align:text-top}._fc-markdown span.frame{display:block;overflow:hidden}._fc-markdown span.frame>span{border:1px solid #d1d9e0;display:block;float:left;margin:13px 0 0;overflow:hidden;padding:7px;width:auto}._fc-markdown span.frame span img{display:block;float:left}._fc-markdown span.frame span span{clear:both;color:#1f2328;display:block;padding:5px 0 0}._fc-markdown span.align-center{clear:both;display:block;overflow:hidden}._fc-markdown span.align-center>span{display:block;margin:13px auto 0;overflow:hidden;text-align:center}._fc-markdown span.align-center span img{margin:0 auto;text-align:center}._fc-markdown span.align-right{clear:both;display:block;overflow:hidden}._fc-markdown span.align-right>span{display:block;margin:13px 0 0;overflow:hidden;text-align:right}._fc-markdown span.align-right span img{margin:0;text-align:right}._fc-markdown span.float-left{display:block;float:left;margin-right:13px;overflow:hidden}._fc-markdown span.float-left span{margin:13px 0 0}._fc-markdown span.float-right{display:block;float:right;margin-left:13px;overflow:hidden}._fc-markdown span.float-right>span{display:block;margin:13px auto 0;overflow:hidden;text-align:right}._fc-markdown code,._fc-markdown tt{background-color:#818b981f;border-radius:6px;font-size:85%;margin:0;padding:.2em .4em;white-space:break-spaces}._fc-markdown code br,._fc-markdown tt br{display:none}._fc-markdown del code{text-decoration:inherit}._fc-markdown samp{font-size:85%}._fc-markdown pre code{font-size:100%}._fc-markdown pre>code{background:transparent;border:0;margin:0;padding:0;white-space:pre;word-break:normal}._fc-markdown .highlight{margin-bottom:1rem}._fc-markdown .highlight pre{margin-bottom:0;word-break:normal}._fc-markdown .highlight pre,._fc-markdown pre{background-color:#f6f8fa;border-radius:6px;color:#1f2328;font-size:85%;line-height:1.45;overflow:auto;padding:1rem}._fc-markdown pre code,._fc-markdown pre tt{word-wrap:normal;background-color:transparent;border:0;display:inline;line-height:inherit;margin:0;max-width:auto;overflow:visible;padding:0}._fc-markdown [data-footnote-ref]:before{content:"["}._fc-markdown [data-footnote-ref]:after{content:"]"}._fc-markdown [role=button]:focus:not(:focus-visible),._fc-markdown [role=tabpanel][tabindex="0"]:focus:not(:focus-visible),._fc-markdown a:focus:not(:focus-visible),._fc-markdown button:focus:not(:focus-visible),._fc-markdown summary:focus:not(:focus-visible){box-shadow:none;outline:none}._fc-markdown [tabindex="0"]:focus:not(:focus-visible),._fc-markdown details-dialog:focus:not(:focus-visible){outline:none}._fc-markdown g-emoji{display:inline-block;font-family:Apple Color Emoji,Segoe UI Emoji,Segoe UI Symbol;font-size:1em;font-style:normal!important;font-weight:400;line-height:1;min-width:1ch;vertical-align:-.075em}._fc-markdown g-emoji img{height:1em;width:1em}._fc-markdown .task-list-item{list-style-type:none}._fc-markdown .task-list-item label{font-weight:400}._fc-markdown .task-list-item.enabled label{cursor:pointer}._fc-markdown .task-list-item+.task-list-item{margin-top:.25rem}._fc-markdown .task-list-item .handle{display:none}._fc-markdown .task-list-item-checkbox{margin:0 .2em .25em -1.4em;vertical-align:middle}._fc-markdown ul:dir(rtl) .task-list-item-checkbox{margin:0 -1.6em .25em .2em}._fc-markdown ol:dir(rtl) .task-list-item-checkbox{margin:0 -1.6em .25em .2em}._fc-dialog .el-dialog__headerbtn{align-items:center;color:var(--el-color-info);display:flex;justify-content:center}._fc-dialog .el-dialog__headerbtn:hover .fc-icon{color:var(--el-color-primary)}._fc-data-select-pop{display:none!important}._fc-data-select,._fc-iframe-box,._fc-video-box{width:100%}.form-create-m .van-checkbox--horizontal,.form-create-m .van-radio--horizontal{margin-bottom:5px}.form-create-m .el-input__wrapper,.form-create-m .el-select__wrapper{border-radius:0;box-shadow:none;padding-right:0}.form-create-m .el-input__wrapper:before,.form-create-m .el-select__wrapper:before{border-bottom:1px solid var(--van-cell-border-color);bottom:0;box-sizing:border-box;content:" ";left:var(--van-padding-md);pointer-events:none;position:absolute;right:var(--van-padding-md);transform:scaleY(.5)}.form-create-m .el-select__suffix{display:none}.form-create-m .el-input__wrapper:after,.form-create-m .el-select__wrapper:after{color:var(--van-cell-right-icon-color);content:"\\e660";font:normal normal normal 14px/1 var(--van-icon-font-family,"vant-icon")}.form-create-m .el-date-editor.el-input,.form-create-m .el-date-editor.el-input__wrapper,.form-create-m .el-tree{width:100%}.form-create-m .el-upload--picture-card,.form-create-m .el-upload-list{--el-upload-list-picture-card-size:64px;--el-upload-picture-card-size:64px}.form-create-m.is-preview ._fc-upload .el-icon--close,.form-create-m.is-preview ._fc-upload .el-icon--close-tip,.form-create-m.is-preview ._fc-upload .el-upload{display:none!important}@font-face{font-family:fc-icon;src:url(data:font/woff;base64,d09GRgABAAAAAFEEAAsAAAAAoPAAAQAAAAAAAAAAAAAAAAAAAAAAAAAAAABHU1VCAAABCAAAADsAAABUIIslek9TLzIAAAFEAAAARAAAAGA8FUuIY21hcAAAAYgAAAP7AAAKGJ2RrB1nbHlmAAAFhAAAQ/kAAIgow5ZWYGhlYWQAAEmAAAAALwAAADYrnfY1aGhlYQAASbAAAAAeAAAAJAfeBJ5obXR4AABJ0AAAAF0AAAJ4jxAAAGxvY2EAAEowAAABPgAAAT5fhjx4bWF4cAAAS3AAAAAfAAAAIAHCAPxuYW1lAABLkAAAAUUAAAJb1Yvg7HBvc3QAAEzYAAAELAAABq340wMHeJxjYGRgYOBiMGCwY2BycfMJYeDLSSzJY5BiYGGAAJA8MpsxJzM9kYEDxgPKsYBpDiBmg4gCACY7BUgAeJxjYGFRZZzAwMrAwNTJdIaBgaEfQjO+ZjBi5ACKMrAyM2AFAWmuKQwHnjG8mMzc8L+BgYH5DgOQZGBEUcQEAICVDRp4nO3WZXOVVxiF4fsAhUpq1N3d3agBJQ3u7u7u7u7BIfVSo+7u7u58XMO/oGtndforemauTN53MnNmdp61ng0cAjS0y60RNNhHxb9R2eu3lfr3DTm8/n2jymw/V3EoDWgk1FLV2n+g9uBB8FNztVJNnv77VPzXVRxD00qz+m8Zx3gmMJFJTGaKv3kq05jODGYyi9nMYS7zmM8CFrKIxSxhKctYzgpWsorVnMsazmMt61jPBjayic3Ucg7ncwFb2MqFnM02LmI7O9jJLnazhzqu5Cqu5hrO4Fqu42Ku5wZu5CZu5hZu5RJuoxm3cwd3chd3cynNaUFL7qEV1dxLDa1pQ1va0Z4OdKQTl9GZLj6VrnSjOz3oSS9604e+9KM/AxjIIAYzhKEMYzgjGMkVjGI0YxjLWZzJyZzCqZzG6ZzECZxIE47jeJ/pYT7lxhzh8zqSozjap3YsTctJl/9CpTH/f6rKjyZj/32qK1MXZX7VPDxjqEV42jyl4blDrcITiKrDs4hqwlOJWofnE7WJkhG1Dc8saheeXtQ+PMeoQ3iiUcfwbKNO4SlHncPzjrqEJx91DWcAdQunAXUP5wL1CCcE9QxnBfUKpwb1DucH9QknCfUNZwr1C6cL9Q/nDA0IJw4NDGcPDQqnEA0O5xENCScTDQ1nFA0LpxUND+cWjQgnGI0MZxmNCqcajQ7nG40JJx2NDWcejQunH40P9wCaEG4ENDHcDWhSuCXQ5HBfoCnh5kBTwx2CpoXbBE0P9wqaEW4YNDPcNWhWuHXQ7HD/oDnhJkJzw52E5kX9DM8P9xRaEG4stDDcXWhRuMXQ4nCfoSXhZkNLwx2HloXbDi0P9x5aEW5AtDLchWhVuBXR6nA/ojXhpkRrw52J1oXbE60P9yjaEG5UtDHcrWhTuGXR5nDfotpw86It4Q5GW8NtjLYFJd/bg5LvHUHJ985wa6NdQcn67qBkfU+401FdUHJ/X1Byf39Qcv9AUHL/YFBy/1BQcv9wUHL/SFBy/2hQcr83vDfQY0HpgMeD0gFPRNnBejIoffBUUPpgX1D64Omg9MEzQemDZ4PSB88FpQ+eD0ofvBCUPngxKH3wUlD64OWg9MErQemDV4PSB68FpQ9eD0ofvBGUPngzKH3wVlD64O2g9ME7QemDd8MbE70XlG54Pyjd8EFQuuHDoHTDR+Ediz4Ob1v0SXjvok/DGxh9Ft7F6PPwVkZfhPcz+jK8qdFX4Z2Nvg5vb/RNeI+jb8MbHX0X3u3o+/CWRz+E9z36Mcr9Sj+F7wDo5/BtAP0SZfvp1/ANAf0Wviug38O3BvRH+P6A/gzfJNBf4TsF+jt8u0D7o9z9DtQGlX8AZj1A2gB4nL29CWAbxdkwvDOr1UoraXWuVrJ1ryXZli1bt287sU3iXE6AhBzk5ko4c5T7PgqlXC2EQikBCg3QchYCoQVajtK3tNCWu/SjLUc52r6F9oWWt402/zOzK1ly4tjt1/+zR3PP7M75nDPLGBj4Y6/ATzNuRmF6mHGGQdkQkpweESnRWBoVnPkBlOOiMSPEeXPRbBFiElwYDaKc7OSVZMGOlA4kgc9Zime9QYj22pEx1oESxV5UyBfx35tHm8GoLs1Ff1ZdSiajoD+DrY7whx/Kt5tMnXyBb4Zfp8mEzhVdPmRgi4jDRcyyXjd+qnmkWd0FFhi0EqyhjKLuorWsVDJLuSef5EzqsybTHWcaDGfeAVX0mZBb/AixhmGMh7HxI9HNMDaG2fcpewVrZTxME3MIM4c5jDmcWcesZ05kTmLOZM5iLp3Uenzg1iezIRxESiGfUPSUXiQpenacc/eirJTxpFCskMkXagOlXIYElAwJ9KKpAmxLQ7qxMd2gDnuaAnbwoyfUYbvHY0dPiB7P7SRyyGNXhyEgZrPueKPD0Rh3Px75KELMLcRcF41EokdG4G8V8eHToBZ1GCySEz0BlVdrQE/YPa+S6GyWBMmThuyBJg96gtRc/jmp5DJi3Rmp+YNpY6j2J8vwjIWxM4w7KtF/5FTo/3bWt/dD8sPrL7jrAryUWOu1GNZHpp4AdbzJXs4mmCRTYIrMIMzAiVGhoxFE8I4pVMhli/1I63KI0rscQRSMkAyDUYTh8ZJhiSLF480W84mYUc56YXiMUCYBY1OEkXRG4zAiUAGMCJSVagNsJJgJBDJBRXFIkqP8Q2IrihZ37EjYi67xhkfUq9CufKgtHG4L2b3hsFc9hdjoAojfqj7je8NXNXh1IBP4EH4jXvuHdi+1RvSowZdJqZefUf8MLlR2NFT0LK2ozxseVd97w8f5wBylOQxjrva1zMSZDqaT6WP6mTFmHrMMekmCPuHpBJWi1WkIfYfJTMZK1Enarc1dvnY+SlMGMKO+bnNj6PkW9fXKDMOHVnzqLrRSfR81wIT5TeS4yCSD3h1y2tSXRM8sOttayIRFLcRfvo/UwPpmlTfDix0qeq4mc+kbVYvOqTfYU9lmxspITB7WKINiIvKEUHYA5dOIjyXyxazXY2RjIpY8shf+S8Xa/0I+jdlEEv4LMDPIavbwRt6Ig6mxVGpsGbFSsHEcAnvH6Lnr8yuGjskl7C4p0BgNKYGI3GCz59efN5LPzGktzDnrq2fOLbbM7cQnpeYeMdbaOnbE3NT/ZEezYNC9hXXnjV520erFLV6z1e6RAyElnkplssUSVFso80p6ZGztuvnnzpt37vx1a8dG0kxDdQztsNt6mAiMYh5m/SxmCbMUxnEDs5E5mTmFOZs5h/kSczlzPfM15nbmDuYB5kHmCbIW6ueyrEi5ZO30jU+XYfoayBRw0ingzPfiiYRaP19boq64uzZQWwR92xMMetS9UjAoffb++9cLeQEMXkrC6l6SBrE7hJwARv30QHlRRGgTwFxbcdoFMNcKPxTAXCv8QABTn8ZaK3UjgxScVanoKweMVX9XeSQyeIJDlXf5iqDeKwjoMEF7gGa+qtX/Ve1p6ntCSagaxlgdYwJPm2CEe5iRGcJUAhycFAQ481EoQLc9p6w4c9rcPyggLZdD8IesxZVFMNdcs3RpfCgeH2KtdQXAmgWQs1rskpD6AJRaHCqsOmFVAV3Rp/4pPrhgMF6z35B2JJlmfabOZhbNsDWwFc0Q3B28XWfiN8rNK+PwdxaxzibWNK26b2hPvOaPqYNVpD1dMx0TXjZ6w4hPJHkRJ9N4AHll3hgCt1RMI+NBX/znJSEZx/Z8pNeS7gslslzz3AUNN3Bmfyzm44yN+fQ0jdguJkYsqCS2vRVsEU1C36LhsCM42xnzm81+Z0NabKCwU2uTBDAhwWSZHMDPIWYB7CRbD4TJ4P3ah6ZEVeoCiCI8dD5CVRWQW4HDGlzG1wFSQbGMCpAgWEsFwfCoX4h8GCFmJzVriMFOkhWKPUcgRGN743PPiZIkPgeFJiMsdTgPqVB9iOA1Z0Wi0chZBHKgNpLxOaiE4C7PQcFZHrFSHVPTV5V1mQH4OQDw8whm1b+xPukErgRkSIGugAB0hOz1EPQ3kR9ExSyXk5Rplm0wFAp+GAoGQ7cTX9ZkGjT5nMRSL7333pku34q7I/h4KPR40GTym4ZMTp950OzpY3QcnyULwQpQB9wSNIqsvygd3WI2jLweHhnhxdMY3rtkRnwJbYngX0ci5XgE/dOq2C6xWtWzzdZbBY/diPxYQLer17jPQCePkd7HP7dav2hTrOo5JjaKjaLbcpdoRiPqdRf40Unk8Rz0/1/ZL7M2Jga9vhB2kSMAWyTwqFQM4xJAo1JOg07wDh2INyaSBEShCSgP63AyiK8B8Mkqyvd1m/tOUTT880WHlbO5BdPHDsc/fiyGWDf6QmpJf9TrUQJNjQGvHGiIBxS3HB1Y3FZqGUqNLZ+XGmrpmpcaaGsbSKF33Tb1kZWANly/CVmsLuwS1bfNdu4Mk/n6E0x2J4fOt7lRa6x/SapUSKdiEdltt7vlSKytvVCCx8TU1kR2/LD2BW1tC9oPG89+P5wiFWv9oM1DMhYKrNgFk0dDR9sOtmy5ASR7s6UBFMKA2sSSsBfxIkqjTyLod5GICuPRra8sDeHSkLfyfWTxEKzLU/6v3qtGs6uKBrvDZsTcnBtGYl35AC9LxgJZUfh1iuQNQwUTlMAsjTbQqJC/bkQb5o4ZeWy2O4zr12fCoU6L0eYDOkCjJ9/T4UYKcNUcU5rpCnMq7km/g6+e/z311JsXLz4tkxnPZtPz5uH3CJ24WacTryd0Yjambqb5r49l16jb0RX1v/1hQxLed8YQjpM8XlgveSB2Dw4NyisJzYMGfJZbBOEWi2+6hT3r/NdsNtPxRp/xeJNNXz9vsruATvLA+s0yvcxc8pZkXVD0NkYQ3jxZHLKOLhN/nsTyGioB7YBWyDGjtlDYoldW0gjoBmUAYWbbhrVdPT1daze8X/FsW3vHmjV3/ODQxR2dnR2LD12XIvjvMmKlkl1di7q6ksc+2rskd/n1l+eW9D7KJuoKU8/omjuevGMNKfxDUktXamwpwb7BGiqNl8Cov0brDu/q6+s6fB0ZB0znTj9+gq4Nxk1WhZOuCmf+2Z2ob+dO9dmd+HFikxAdt3fwMWyIIfSRwHihRyYov9rdGgfGUn0pMA2kMfjVEPGnnu9U/Z2d6INOKI9o/66F/m2g/Yq8Iu5AsB0RVJmsLVwsoSJmZAdqsaNQyvELoNp+IQQCHt4kAG3DJpzq645UCNl/Wb6Z0HF44y8FE+8JBCDVqdX/Eh0/OruATvUYAZgCMdML61ZkAafAJaBhByGNF1lANVivDGF2HVmzvyHW5bmrbvzi4VLnCVd//YLFvNPGiRIyrfn69+67qN931G177hmU2ISWNeDp6bYsPP9r156Ydx164ULW6kHIa1+98xhf34UPPnrTOnH4kCsAKLK0v2/H/8WYoL8d8F5srhSVc6zCunNu5Mw50UX/3NaL3L3b/nFm27GGY5F4Av5xeesd38LXqCeisPo2+mp5K76K0cYL6tqGf0T9NsYP/ZigaykPGMks2PEZdy1x4axDL/6NlCs7juwAo2xXwCDv1CH8ow51bTqNbusoP67AHx45eJghPTFNWxYxKwFrOPZgbfrPplzZkYa/DmVUAfOTNIQ60gcMpDsgqAX+1Ybv1xGmKfuhvt3R2kAdRhmtb8MHHWCgfuqqa5V9Chh0m+ZOvG79a2hjYtjvXer3B2ctCL2yA1/W0VE+vUPBtypKed1+XVGZr1vxrw8+X6sUrLOOjv43Uq7ObMxmN2Y0G4nZDdmqgVAlAWz8Zua3GTDqlZqLth08TGEDtOUd/AiFX+2A1x4xQwgmIl4qlqScU2cdkB1J4wwAXMgBcqUBFx5204JCiB6AG0sTsxJgyjsSs+LxWQl8fHkHbKchfDzY5Q8dCW+yIY3u80WjvrflaFT+QrIDNSNvSnJYvK02P7rrNNM8m68d74ay6n1aHehQcIdTIfU+UhM6NJQ62iEb2y3yO6ihKyqr75OKUIMcnZdrCQbdzS6LIwAIiuLKiA2DLfrc+EBv/2LmyJliG4BqSp4chPIKAYu5bEk2KjECSCmLSYkVSBB24azMA0Tx6BxIduVBukAdSrgRNjlCJ+XnLip1SLFcd6Rfzm68eMlQRGoINjSlB6wtdj9q8Phc03TCt441WVhLOnTMrJOGHI2Nspy++MiFx4yG/K2BppLPEXSnkk6D6KS0+pPsn9hhoANbmFFmKbOa2cKczZzHfFnnDUpV3qDeF9Fq/2QKWm8omSRpcwq2fc3VYJNTIW6O1SAW4RxBDxDOEZ8r5eRcSZFyxdIALuQTScqj0NENmDIpVEjKSimb04JJpYC/oS6nbbtLXa71ID5eazuJ9RIOaVMTsW+wS5K9tZXY42QiqY+TCbA2eUjCPuZoXjV3ICbYJKvbYRUtTsEh++0mwWR0x3b4Mz9xc2bBarbZfHi33pfDlb6t9PWw1ru/kMJSWQQLDP4rWOoHUflteJz8jhxd9Ehr6yOPIITsXpvdb+Akn9uK8bGc1WlFqLNveBxZHOBDLRUe9n+zV7NuphHoygHA6I9iToIROAv6/2oK7WVAE+UoXWMiTkaNFK8vUhKasG2BCEElIleIQgcCEs4rRJxSAFOKhhGvdCDFjpTkIIpmKbpnR4Qa0tZmCkEuwsjzErookeTpmGQp7ueeNGoEY0V3ukMstCLX2k1Q+/IdhLLuaXnxRasLovFRFjd2WNUfxjJshOP6uHb4cajHsJDLGGxjNq6DW8ghQ8olWFgDNhgNBrNgD9idGzhufabTYrZK/y21/CTVaRGMJusVTll2qq8RGzWqnyIr6w5Il8IDulvV0ylPGJFXwOtaemY7reVvWNwsgl69EnKwWeUZLsHdy4FJcOwbvKGlxcC/wfrtraKBRayB48QWp8/Icm9wF3Ugg9FpM/cNHZHgDF5IflB2rnX4fI61Trk0i+71gNs9BbjX/ryscYDjJ/7HOVp1EqD4AIJBpCjkIAJSrcTGKCs6Vf4LxalT2F7+S7xQiGM72OVx1rz37+uak8nmi5PNzcmLiG88cl44fF5E/YO5QbjhBt5pt7C8cdUqs4FjE6m5qfInYIHBDrBG8/HyJ/F8Po4d8fxjo8+SSio/9eRwJBJeJrCmM8/iWN7mtBvHxnivhSF0Ww0NNMyMwD66BPaRmcIRSlx4ZQoziE1JjkRSAbqDzMka4CzVBg4uG9xqDkckKRI2z+XlBpmfWx+8I4LWAbF7a6TiTkNTvWi3mhpjDWab3WqzWe02c0Os0WS1W0TRchLhYVyui7V0vPhb+CMmwHRT+QppU4UhS1sU1aipHCxc2BplnVurRKdPVLTEXgRUl+oMmcdNdrPZbho3h2IhU/kDLYT9ptArrqAZ5bWw+jNzUAkRRzSDgejQr6EsjmjJ5d+R0uY5WmiOOYQ/ctrNdviJLpdIPXYgT5x2k90FP2fVo75RTa4W0ObCm+wL+62X/8AqYZX0ovb2RWnVmF6YBoPU8r7m7u5mjMAuH8aye8vrqrN+5nOb0fnud+uySBNQyRITJTiiU0HkNyW++tVMBv8+my3fq2FfqE3DyVirLre8KKNuz2TQFZmKS+nUff9gf4g/h/lBOBtkMw4hEScmCEad/ycjuvMOaGLMaKHiI1wu7OYspsuNHGdzuvhxT0AaF4Ie4XLBrl4keswOl8OMnzE73HYBKD38OcL85bwLvJxxsXopZYKesVjwBIUvWVCZ9dghqxnMbbdp7jM2IPn0uQz9skvnNwUmYc0cFQ/Gk1wWQLjz6uvQyuuuU3ddx8rh0lhSPQWhr0jNYSdr3QGRkLjjOXV7cqwURiuQM9wsoSu0vniT/SHMlQ5thtRzJAoEh9DwCcrDo+w7KpyD+QCIBU8glAydhzoQleUWccPWjRoTYePvN6zr6vaIJ5PWzjcX84ce/v1FC1rbjJmO8SVrREkyip4dNqvQYLvLInomMSC2UTJ4zYJ5zS3WfHbxoY+PL2pPe4Keb3vE3xU5f6OV62fdls8Ja5j20ZvsL6ENPiYGex/j1tCl3CR8yY+SVPYM45igCFF1T5DIsPej6tqGZj/f1Ywsn6kGbb6jf8Bk3wVzvQs/3d0rerYLZJiE7fCO27UR2+5BH6lXx/OjlblO5v7HaOvn+fjKlfG8utkjbiezQthOugPKwwTZTl9fn/tP6GNMaJkgmftTz/l4ZVU4dHLkbG3yq/5sFr8PC+K0yZN+h7YatPH+jH2WRfCULMPEc0XC/krE7MhJuC6SMwm2B5ATbtLML2q4CK9gr9HCXy54AsK4FPAsFgJk0qtftXsEu5vMeegSh437CzZdTpLG0emEh69eNk5KXC7s9YjPaH13662EF/mM1UPZRu4q/LIxMpMGLGyQmQ+Y2HJmBXM0czHzFeZmZifzbeY7zKPMHuZZghdTyTgVZ7QgDT8rFtiKoENPqTBfiaCD7HAE/edqAVgdhVuqCgFgA2Q1EiKZINxsoDQ0RDpLNosk2RpiJJZsHNB9OvkxCKsgEZ+ZgJ69YkKejl8vb3ba8DLRE5uG7XurH630+9VdfvSEf6MfzEa/z+dvCieSIZffaUeszcL7XOFEIuzy2Z1Gg9Pml0yikectAB1s1tstViv18Tb1Xv+9Pt+9/lobDX1UeexHH1HtAby7Tiqjs5ErYpkTfX7yeL8v69/o8230q+c297XYLTaErbzB3tzfDMCJM4hmR1pgjZyJNyO7R7R5bYLNYhDm++FvPik9j1gwBywaP4uNMyEmzKSYNqYL4PcocxvzFvM+83FFm2R/vR19kdejKVP2fLxIkG/Cf4e5P0CHkBKSgCOEkCzB7ieJECPCpIJ8ZOhhCsCORwdc2+hg/BPETRYS+VJhAJF6iL5USeYlL2wmfIYniyhDZRsSVXAgG2umVCA7ailTIhznDLw3lE5m9M1WJhOOTLIqjxd/u4VwwBV1G8GBdu/WMCNnBC0EfOmhSOSX1KwlBm2xBgVA6C02i9GAhaC1WbRyCLts2C5hlsWSHdtcGHFWsdkWtCCOs9qsQBhYgrYEyWh0OScyOl1GknG4yZAIIIxRIGGIIiMvJ2WeVwzxIIkLxg2K0SQlvTxfDLe19be1hQRRlESRbWoeafnxj5UsvLZDycwiqNwn0Iz7ibjvAYKiUetynoXXNZhMBgM2s0aZD9kxZ7R5MJZE1hmFt/FghCQbZ8T2EC/zBnhnkptDgoH3ktyOINBv8LYOxQGvDv6gnbWHTCEPslgDKQOy+mzI0Bq0WpAbGTmnk+PdlRS/FUigAEkxcnY7ZxxtGyDinawo2e2SSPZjij9+UI+LIH3XjdZOszq+FYq//DKSXn5ZPUzBL8Vi5bRScfE3y4/jkfLjMUWJ4S8psZjCVHhiL+EfMWZdnwSeQYhMBYjLeNWH6h6xabMUfjmM2jZ5wVGDMdYUi+39PIYTYa96NdriDe8EsvgT7JDC8DT4q8LHH+qyh9JM5Q5UrFginBRdHTBfD9tLPT2ldUTMsHbthJhBfU4ICFvfJqjQPwSy4c9AsKA+LAhb3yHI0P8KUCJQkelo70xwWCKFmhn2ylK2hgWBDWSaBoWrGOgE7plX7753vOXJlvF7t85h50yDqJ6v9m3dip5V//Dcc5RX8An7IDtEZfYtTCtThB4dZtYypzHnz0xmTzBsd63EOVobYOs5d7AL5QoKRbvyiZwGZoqlnERBk+KlzK8EX9k5WJdOmX4c6Wn3+dp7IthZ/jiRh63EqdGmlr2fPU+mH0qTqfhxpht2sVAp4LFG8g67/Zc3CJl2Z6j0fHtfvl1OWnE8nDa3W5fnBnoKjbFodzTKWqB6VQHC19fWG0ZvhXvb/KOFuKoQAhi9FS+cN4oGlM2x2GZFs9WLB3PxREPOZ/XGXc4Wb4s/EnZFF+V6V3Z73FxbX9thq8dGFyeaepVYb5zyYmDCnssK+/F15xJJax13Wp5ZAFGaFnkJPWvRN/ASUXTEC0OfhsOfhgZDu8Ph3aE5oZPC4ZNCszXdQHWnAWgsFrk5syxzf/+nwWMxWM3cyehM9Yv4mVA4HNpNFHYervrwoSZBMJWXWmWzYMHHlm8UBIw5GTaZ/up8/r4+n49mrpyh/gpdqSImoAKwDIqI8FKOcqQAJ2cJoCJMO0Kwy2Q2DCKegCUijid6AEV3lsrdwU+WMVQmeaFcBachRA5BcGDmBDRexgF5Gm83yRKLjKID6EvBZrVYsZErWBzYaR0Z4tsDBqVgYq2yxPM2p0k09A1bYFe2LrGzbq+v0+yENpnsRpvbnO4wY+S2GR3meJOZxmTaTBi5pll+A43+pMkuIJNosvq8nhZekpBo4awudW8wgTCbjlklo0WyeByWzxASBc7qRN3CrEBEfcVsamuzsQi5Gs3FksliFF2s2Nmpx/TkaAzDuHT9iui08qLjmO06BXZA/JGdEjLUrfe6SVyqW/x1eEptypYoOheA/oVRvCpyXjR6XmRfBJ0bjaoXRirubwlYLf8IkiDDrSRwa/SuSOSuKKJqxPjZiuav+pluE0WBrZE9ETDqjSTuyGoAko6MPhqJPBrV5+4n7E2shXHoekp07hKZdA30INsV1fSogSB1rCJx857jj9/z2uqV+WIxv3L1CasWLmhrb29bsHB3xaO+F0Wz4dWehG3m+D2v7tlcLKxY/caRKwvFWe1t8xftXji/LZ1um79w96L5be3qK+QtJ3SQydqqjF+8Rj+IqXuLOhwxXrP6uChh5NJ1h6pyZxiBXG0AHRVDwVhMfTf2WYzlAfD+bwy/A/NVfYbM3Lzq7IiZUD9Qe+8R0HslsdgE2WivIl5U/q0+x6OjapOSY/NxtJVUVqmUuEyFf/O9uvZkKXU+o5bI2haibSA5GqDat1RfbIOCAoqivqd8pmgNUPC7ZEd/Fpb934AgC3o85+mknOfAr36/R1TfpQyMIFU3f1ejf0lI13N4g71Lf/cA4E3dk6WNk0VVChFUA3EZrXC7YWsj2AbZs3YUfloAg+8hIvnnifX973y7/BbGl/FmM18+3cp9zWD4msHEJgrqsfk8urEAaNCxUjgsoRuJHval6Izyuyw7TzDGefM8nmNPZC3sCSzWZaNP4if20yebGZ4xSdH2gH42PBWfGCBy+cF8Af7yL9c5+PFWfTDARX3gjgBwfZYC1754YbCgfl4oIFNhskt55J/iP1IeAtGlIPhkEOgowv3LUH2TGt0KrupjZxiH1s5r60+l+tvQFfPABv/n00bgp0KUMAhrjnor0aFKpcKaA0GNbNAcpooP147JDOWANRyx6foc/Rr6LD7jftbh9kswnx2A7Y0xmyj2rInEiN5Wnu59xsrmBwutWNn+0ojoa1cyFkqUqV6bpyhPk45T2zas27Jl3Ybfb1y7devajVsXXlFolj0eublwxU3g9UqSF7yoKHr0TAhLja6adI84dRKbaPAfcdwR/gbdGW2QXZIrBD+5ocarPuUR81quPGdzYk9gIkfQ8+HBEjWdoH2fwt5shZ40E14rkO9I5pMlfMYDatsD+Nj7l9+/nPhT38XHPHDE/UdU6ZW7YJW2AuZP6BXCYFRyysS496MBTKZGQaqfG3E54+WRMZlJlFARvWlzIZcNPUeIUfSJkkGERW4iQgZHC1Exa8HHyLKsEktGN3nxp8jd4NLo1ozyY5PdZHaY8I91eQQhYkU9O6CTN8k6rrob/+GAeEM9nuCcMlBHTpZqoc3NEfw6gPSWSNVFCwA6PhxBv4ggHnz/G3mWAvE/UNB/IqGw0VgFzF8cUT+HEqbIpL0uxaSpjvFSgsvMZH0hhVeAnFIAZ+SUQk4TYfIwV3kqFqbCygJMeIWQKCmgV7KcJnYvUXaZrBBuMVkiHooa5IwHXaOq/zBHdklxST4QCCH7cSe3Oi0Wo8XpEuyNdld3l91kt1usPrNfzHbZkaMhme2KBFLdjXbUyZptfquXt0cyNp7rME6zxNUX0u++u2zFimXv+uwtVmhKY7PDx7FH9RtMkpM3pIwhc+5032BXbySYkLyixW4RpIUJp8kVp/PzdXY77AkpoPyWUwkC+R+k5zM0hQtArpOUT96BnITH5CUrmmgUEwQeUlnKgyLrnHfSjCzsAYS9RNhRGnspYeRxyKW0DcxpirvMFsSJzoY1D7OiuHud3ykaEbKanNHmQwY641ajw2TpnjM014IsYfOhN3710LQdWeYOzelpXmawcrIBGU4zWA0vgevlrAY24mzyK1YeIYtJPdXg9gVDJ8/DBsP8k0NBn8eArjAJCCHeqjQ0W43LhEzAZ0Tqd0MJ4cjhgWWdLQiNI84fyKhfOBYqdEPFV3HI8AdwoaxB08WD+bYHzwEYxLjTsFS9shlpyq4INrsLzEbO6ZVNaDlabvJ6HUajSb3cpljRP01e2WHkTepdkGA0OrxekmDTeeRQ5/dxGLAjASAbgWoLCUzjFXfOrc1NZ+3cFFHd5DzI3IxVJyaynSLNPmHu8aPxRBId+6VrSz4R6B1ZtplDTkleMN9t9XgsVmvMNTzfjTbHCrPmp5p6FigeNGgUnCPNrbNcZn7AhJoHUFp9aetpp21F6Yi76LTwpnjea/cYDJcs5oSAbOZ6+BbL8K3hw8fGU/FsICBZ3aVjcl6rnNFh4Jv4d4yPaWd66PmpLAUKHmOFX6NBHYpzi9gT0lSJ8YTyxoSuaM3BK5w/bMlYf/fwSPfA2OI7Fo8NdI8Md/ePLTlscHb/sX39x/XNPntW/3H9fcf2zx6ksr0jF6bbF6UbyUHGIrHw75oiXYWzjj2z2BVVlGhX8cxjzyp0RZpGGxuWHbXsqCMaAoGGI8CzrKFxKy1NrVG9NFh6234E+3oAMJIxbeUQNqtGu0KTZGihojURSNgw0hIJxwPyUUYvtFzrDsnDJ4kiOSKbC3jjxaysSfGSgDuieHZkGTRn1kBXbymb6Zk9d+zQxWP9PSNrf5VxSdAoX6vY6RuOty9qD3/p8MXz+npmpzON0BGzh1ye3k51rxAQ8Bm6cK98mYCvyLadUUhthFbKUiKbbgg2RaEzcoM7Du8UW31QoeTKBMLQcYnhv9N+yvfP7Uwn20h34B6bTxDKlxpdLhvH8fh0IajLqL9PxzkJ8OJgo0xU6Kvn52oHGEv6mPb0w5gumQtjOrunb97iw2MDHQ3aGCxqr4xgw5Qj+GhDx0AsfYABq667K3Bax+e1M29MnZ6cMqEOqysXSTl0oLibMsdlwFxJjm8dRw5rrZg3D68inuNIFAm1Zz7PgAl6PicxYA29iRpqQ1U94wfws4yd6hFqQkrYT7UDpFwVdt3gd33ssi5nWbTM5d/7kd+Fn3L50d9ud/lty7Hf1aeoVzkbGpxoK0NgJOAppx7gfMnMcdADix7qaOC3NbxDHdBV3J9WB6h6w9OAoqilCJoPUH13JPJ8NPo8wG4/EPYfTKcWcTJBAR7UGOsaQVzR5f1tdcyisJekYTeZxyxi1jAbJulGRg8wVu4ptSJnOtpXdqxPp9d3oDvcjY3uDcQ6/JBDvgoxEK/+Kb0hDeZiEr3e09joOeyQQ3CBeNbrOdExmpppwP0hifnQHej/GTLrKqhnaC6Nphn6foZMtSEdb/8O5beFofW9Bx5HFKUs1SihcpJUiterL7RSJYWGWJtG/qphzUUnqK9QGrgNaOaNbxDvG5QOPl+9hcavp6H9OVvlnxESO+h53BOQqAwYPJq2QIWP8QwboXMwV6PFcyJzzkz5hZMHov6QF1c7Nes0lOPTlGSbDoK0nRDt6IjujKbT0Z07TTabaafZZlMjynKlatBbkY6OyE6aj6SaST42Qnrkb3r3CDrj72+U8SfE81vS0QIpVYime6zmAqm4YLZaiQKw+jmx59A0mqtHSyO5dPrhJZ3XOjyznmMlgtvS00lOGHByXl1SKFOL8k9ybG6CQUr6oY5B+sh/2z1WE2cwS2478Zo5lpfd0/A1y09brTxnMSmoVXFbbIC0WnhFfU1xVc6LfMo+q991QE6KH0rbgWfEMZbSiHCGAYZAEwpFrzyA47oWU52AkU2Ee9p9U8lItg4P9Ha0XHnzOYHIvKal6ebk/Bv6/evPV99vaPP72xqSXV1Jm9vd4HazVn9bT0RNaD2D3gSLyAQSFNd+M1541+9rO2F4jrhu3hFdgaB1jivaMXx013UNbbk2f9eirkFSR4NbPyPztRq+V3BaLYihws4CGDSuuWp8dBQ/ni9/ks9jR77ibt77MMNUzuDsqK9/ak34JNT/UJ5Um0dvatVfMWXt2n5zDdRNZHky00jovwqni0gNNW5XRXPjrzsJL2snenwn8agS1LsTfpeFvepKb5iMQtiLdnnDO/c+zC4g9RM6+j32QdgbgnQvowx/Po2pSDpENBPlyikXimiTaMCNSjQJ8FESk0QdypEblgYyzr45Iw3bQl6pd/Hi4KqOVaktpywNBlvQttZt2w4PRVq312TbHpSk3vHx0KoO9JoSNWebO8PNZtm/Pbh4cY8khY7sOLI1GDp8y5ZWtC0VCR++bVvL9rps44t7PR7IVoXb30ffrDkfVIGMJzfjvc3NZUMzuo0qhLlof/6cjpWNEaE/A1TaVmK6mFHmEHrHxHqAZOS8PeyNbqWKIQHSyx0khP5/yPnSuBRvjUvUQrvqAou9TakmL7XK3/xPZsOvS3q0pJvJXvW6//scOv73C/SLunH4F/r75albUxs4f9o3qeBot9I7NJphT1zIHMOcxnyZuUnbGYneD5444NyL+EkgTInXHoOu3jxSn2n/mvCBa0LT1nQj0ZEmejP36cej70f3Ec2Z+ymG8E39bpj7tGPX991H1KGIpS6qK0c89QX1ApPLsVaiq3N/tYx2hJqWuV+/yuN+eAnyHvVJ6k6av6L6Q2uoLamXgOeR8jUpjHYnz5tA0xHdAoXpoOcal9J1eTbzJRiZO5mHptA3cPPaoWCqhpNM2JGuFg8Z4oRDokUnS4qkJ0ChuCLp4kySS9FiaYpb06qXpRykcCSQK1ApJ/nxUk4vE9VYMjE9NwD8JF+tfrDqQi4crh6p/H1F6aFkQaLHLWKbR7IjS++llnjUxHX2OFjJimys1WNw9HRyfKzpxR+wPCvmOqzcoKWsPmkd4GzpnAhxCD2JMMfa5syxsRx+yNqREw1G9gfIMqheDxHoScxjSHyeG7BCRqPBWuxEC8kzbaz2TI/bk0ze7+jOGOAxAmuVfmSANEtTjIf3OJCqRfk8xBYTigHFE10GZPKzNpeBi3s4U2vabE63mjhPwmBw2V5w5bJOg7PRxI8fZTQeNc6bGiGYzbncrc1uJJgxuEgmkb72di+/cXwWSXCk223YbJ7HL9po8qbbZdYVrHkYi/jTOE+cg+pZ8ihTImvWH6/pPL7JngzzpnKXCqFR9rsjhdx7g6ZknbIlcq6k/BGxMbjwezCHo7lc+be5issmIEcTzfF/5GhXuYn15LLZXNmfzeWy2nvcyi5g1/1fvYfdryh+NUJs9Ds1gn5Xfq+I/lQsqp5ixWXXKf69e0gOdq5f6du7h724CH977yF2BX94muKsccBZ11dlrLp2KnmNQaSf6qHqmOQFeYWSXiUd5lcUAzDFDotxgstXTi4ABkIE/b2Y4sJG9DVNbvcWECJEQ9lEtpG3NOXNvf8rep7mnYRbYXzmXqoIuI+zOSVWIvGaFvPT90A88tghweFhE1TT+S26PzHkuOreh4HIoeF9EMZoxCPe+zTPcTaXy/g0OfvqwR4rYkTPs3UJViNN2MeQzYWcuX2W/RXbT3F4b04mqgtSjnKGqFISUdmVclk9VLmxjJc8mp6eJkIMwk4AbSdYEG5C6GzOyC//o4273mC4nrP9cTlmsYE92yAYIMG0/I8YsWbDDo7bYbT94QiTkTubFdhudL3R+sflPIS0fFABIvm0Ov6ESCUsYidSoXoW6brVT1M+8RiVYsCA1Usx8mTgpKRci9PjHEcuc6gZywlFXFTMot+LLo8NvVwhvgToeTNCFdKMqOXgbwmCevrEwFFxLrpMCLAJJDW6UYUKeVmAkmanGb9cwf4JOSAIQSjtoGPktu3TtHXvgeKMxtvdp7IP4X8ABGYqqGaU7u+EfKTEI1AdUZkqVZIhKSVKKA9j4oD+PRmduWzenNY2X8Q3eOIs9fITBGxmrVHLfTaMbfhPJo6zSxJ/clvrnHnL3iHnjt6ZdeLg8ULIwlks0By3TeObGRi8G/BsG+PUV2q0skaJbhW7ya/s/VTx4+vKJ+Dr9r7G/nDvEN6t+Mt7sQFWntrV2qfJmFT22yxmQgC1hrQzIgRpqODsIgB9QKCVqpRaGzaiWSQ7ISFKsziLJXIShIpJbmk+RPbNSX6bSJsejOSsg9Zc5Lsk8J3vCHar2fCd7naIQfd9m4/kLS35hziz1c7ipnC4Kd9U/mtTHidCoQTON2GxKT9gt5T/arZjBYchDlLKb0dYbDdj0WLX94onYV65AB9LT2j0SUoxjcmLD2BOIuQrjIamo1HIeeitNzkRxwuE0IXRwvI2osQ3ig45++ZvnNc0P3LaTeqntz7gDaFvbSWa+yOHnLXzG+c2LYB4ZIH4sAZfti255qiEsn5s/PRZy+4aCXn3lAUCG7dCdDy2Ye74abOX3TUa9u6h+ry6Xj5PNdqJvlw7k2EKTDdgb7MYpkReEl6HiJW0q0FyhOrWJCg8grSS/ovrv+ik3/ODmxtQ36bTtqxf1z9gY0dZ5Jw798StF6r7Rskfu2C0vGETioHZrNmnrxgtbNo5ypYKq448ZdMm8bzNx/YNsOiIzZv3bNr02KZNhc2bx0erfxWa5S38EuMleC9ZhXIIi5gn+n3QoQPYTZTnK1rzWaJNn8SGgZMXO3tW5w3d63vUYHZ5ty02N8MvOutVS8hyRqsQlizDlrBwrcWCf5k7ss846+jtG3rZ9OKjVg/b5mybrf7YArks3hDkslwrhC1Vmej3KZ4VZAanwqkSFcIeMBwpR6UcXqlyBphsnZULWBLYs40McncXlQ4Tz9qNJzl9vpjfZ5rX0lz0+vNtacngLok2VLRZvG2WhkUHRDC+i+QmUgzdlm4dywZjnc1Bv9GdCQfCDkfA63YnbUq6f+7EOYendJ5GETDFMcAVZ8TV2F8XNU6cyjkdCgLqeFtsjGhATilkHIY9bu1ackDhNCFgOU1ALUKARARJRBB+alm5Kha7SpmOtaEeJZBynoBwmkU4XQg8XB/s11Vw9TPeV7FRqjda0qUfOl8KH+SuSk7T2/NorSZtlclMo9JU/eaSWBJ2W0A4qV7jAJLx5y0jzXJLKaQ6QqUWuXmkBX2iOnQheDarniwIc+YI7kbzWjOYxs/qg0cBQMdF7G2gto2NEH61I1RsleXWYoiKwYcqMnJS3+tCgzB3rrnRLawRaB2TwsciLNnUC2wO1mtD50HdOp/zeZ0/V+G1LwGc5wvMJXV3Rk5JW8lTCs1nUnpG1Ntt2r2R3wsQJ/C975GDzd9zSNIVMTRXUdQ9sQ/J2KpnT5EN3R/sDIL5nu5oCWCxCRLUs4N3VHJUCq0lmrl3xNRHYzE0FlNn6Tn0/CNaxST3yJQpE+cftT0rrcG2/XYtIhu0A6wIkWOObBp1AJrB7q/wPdVGNie/qsfIdXYUbWMZ9Nvk7ASrDCYyovvkp4Ww0HqGJeSlG9fwgTe4sczSfNZmO3T9EG6evWikjeM6hg9Tn7JYoKRE98VhS0ij999kX6U8NQLrvUwDQOsYk4AWOaMAKaJOpcDKfFKBXxx+uQJYTvi5ndqVmewr5dWjuOG4L5/R8s1NJ7V8Dd1wc8uO6N0t5+9s+QJbXo3Xlt/HDfic8up7jsUNI6r59JbbTmy5PgOZ/gSZkA2yofmQ7/bR8vuV/etGdjalFWQmzCSJXrqbSB61PkvSJcqjEirJdpbcsZt0k0NC4Mq6+4Ej5cBH2O3HONrs5bsdji+P46HF5R9t6Tyl2LVpU1fu5E1/jA0OxkLDg3/2tbX5pI421monOdugCCnZZk8tLv9gMTrrlMwpV27q7j5uw2A3XjsYiw32JmIb2mRfW0ujT5fBfxWfS05WucnA1gjg4S23WJus/4PurIjfe62KTf3Yih63Wj9Fd5o5jsree2025LSSowoUlv8PeyvLVO+K1bicYf2WKDIitMuTRLmn5gfj04G0X7KSh71l76f4BXL1zOn3xO7J7YrdGd0ZuyVxi7Lzyjtjd155S+yWL96p7MKZ8jU4o4roryyz91PWOljeegdk/8Eu5c5f7lRueQGyqY0QaAJPBFy8CvKfMqiK5H2ddecH9j8zfiRzHLMJ9ptTmQtnfi52aq39OpVeogNY8fNTJZTqoFX0YFpri8mJ8ueJLiZqp3vO5bF5MTDfP5DzPWVMAYP/QrRf4rq06te69kucYP3o11RLvz9G9PN1o46R6snv3DqPvga/s18/LvtP9BpLT45Wzlv3InpxB2s9iCZ6eYnWF0QltY28p/cok8HstqgPadRsuVXwBP/Vti8+mve6LYhK4VKAEzBVHdzvQrtl/Ra0UZg1WyawlQmYvf8JD3e0ALO8EEWZEj0XVoMgyrmsvH8sISoOlLfIesLaQY6wGq/40K+rbcnnz9j7ESuTX/n1Pg6xLGc3dnRyDoHr43iDkZthHJsgFZc/qTxCIwTrpFWqOqJ+bwSV+g02zsBxnZ2cxc71G1C5PoIr93FWI2s0dnQYLXYjPAvpeh+34tNh1wgzbUQjGFXO1OtH7aEHqa5KRd4an1qP5a7hrbNnbx1WXx/eMgyG3G+cOTwDBrVkiat+a4QkXEpTacpGYuHTZm/9IikJ1lDm8KNIHFhDB4ytvWs8pZ9CPIQ5lDmMWcusY05gtjPnMpcR7aP6caeXXO83PXpZp9YUQkjWnUyZ+oxiXQCRm1+I2E67AYb0SNWHbn6uejpU/Kh6fHPi/OhzF0VM5GIA98rIiZEDGvV2FFV/S6hr4mp3EFR9+KceceIA6qz6urX7pMs3QwHIjGeL7gs1zcOKdRFVSZwz5G50XTSL3k9wwZDJ7hLNNfcoegGekztXlk1w8Q92epevWSdpJGKvtlC4Ax8Hbjn4edo7NvDYyJr9poULjXaHxWAwbuAtnAWhA53N1fjrU52F/ekG3ms2mKAmjjNY7Q5ugwmhPZPP0066x3SE2cgcxZwC+8o5MKMun+GeOunouqghsUqVNeimJIN+o4FOItGtlWJ3pZlNuoPf7LFGdGW1mZKlswtQP7eYca8xmxXFaDDYHE6johAaQFEIZQF2w4bI7ZFJZhrNlsUuMUM1diuPcjW6M6JLfUEgNRqdDivHGSce4Abb/Csy7d4g1qn0OpCJ+5wdTBRwR+1U8YHOr0y+dbHuJsIqyMLM5j2bN+95dfUKcoplxerjV9y4YsWNDy2cT06wzF+4MhNsDoJxkoez1s17Xnl0M8n22uoVheKs5V//7o0rSLaHSf5bpWCwJRjcql37X5X5P1l3Z/PMoWwdPhE5yNHH8jhr2vv5hbGHY2AItE0R8pZqyVLyNp+okLeJ/FWj6rv0tKrGf/ipjgcUZ6iNQqTUPD0/TbVAw4htP8iLnWIOStisviFEhS8asdHuchpPmEaHYqeAXQGLeqcVWe/l3U4LNpq+rNOXB8b91szszYmc3j3D3ZleGCwinZD0HhSXUzeNjp4feyY2yaj/6Dca+zmbhecttmmanNr7IV5AEKCdVQsd0290GfsNLGcxnskLHK7wi3ZDHwSBAtxUoap1prISj5EhKZaIajLRqSRnhlhRkxGkEcE+9O02hYxJJUZVhw7y+YaoTlBjgIDoiUBH4O14iS01q2fYxBtcNpsruAi2nmarpREZ7bzg4rpMfpHfgbbxbje/D7M44EPnExq4fDWxYzGNtMVbgp0BRzAp/QYvgl336a7kl1J9Jtsd7lzeHWQb0Y+T3ewokCn/xbMmvmBixSh/i998gdmPUPOvzdI6r/3PhCr+M6GXO4N/1gj1P0vJoGNk0j3vlXtuZ7zayH9c/0bGDO6NpTfRtMzaM2uaHe8fQ+cO/UYdJhdvoyf0u18q94NPfrspcM8SRUAUciNctDDNnd5frF4LPO113a9qFwqTq4Nn6WfuqF7oT2Zy9mHKKyXrAnXyte1R/Fo0Wm6NRi+JRC6JopbIFyNgwL2ERJXvq6Tjn9DTjK/XfttEfYPgHTrt8qIuYySjXGJ6mfnaN3Imy/dgBz1AHNrvsJqU2/+bJJDvXXLmTKUfBUFB9X+Q7W4a0UMjHlFXol2ojfgvIdapxxyjfXrkbXpSzbEPyHW0IQRhmj3sDY3sY3mS7g2FSDg8ug+N1IfPr89OhkOk7f2BTrPUU7xHMquZzczxzOkzo2Dq9VmnDLB1qh7yQUJsJNLT5vO19UTKf6n46ig7dWsMuRRF/XNssrupIPqCPpFahSn8MyBg7iBw7JaJPbNBJGUDflH03yMSe7JXl1GTO38leg5pEHrycIaJV88c9aOcVMFM2bq7SagP9g6iVQhTppCDn0ysXEHhciXiU/gkTSkRf4HdVdn0R7XXXTGx75MrhcRl+fyyvK+70H0nauhPsNlV4dCqLPveVSt3BDVIEQySlgbxVyb8JEV9cenSt1avfiv13e+m3nrkkbe++c23Hkm+1foQzBe5Zg+MA40zcd/OMcxWZhtzHnM+cwVzzQHu3tFuhKqinkQyHdWUZyWCNRE40YFQlp65KGgTgMAMgCo18mvtGq147Xwq1J1pndm3DYiaXrIO+akNZGqRN3KV2QTLpoGQPEdTqgQwSbyEBt2NbgiU7z9I2tWVS9orLurfH7V9c9asjsiaaHRNJBf5UYSYiG6zVqjnaI1kusTqwogESf00sPfDg6U+Sio4vnrZ3XFVy6u+rtCvKBiJDnikecIwzKRvgdTqth/+b2i3c1NiQhN07sFB4scR1AAd934ENWu7u2avorj+dBerk/Y9R3uA0pay+pzWWain8p0EfA20swZ7rnx9im5F4OMVDdfXMRhNVaxOS//ssXPmzTtnbP78rrVdYOZvmF9aXwIzf76esKNyEg9fM3bOdeeMDXWtO2Vd15Du0KhPtNsIzTUwXNPB72XmwEpbWcHJaN9rX8fSWQh83YWv+gYdrQOidQGZ6JTKJbmULCX5kiIn+TCuDcmVz5Ft3Eig+cbn1NcpVK/5MFQFvGpmdGhI/WnQ7Q4Gmq1NxiZOsTafWB/EdwM+pu7SvkKGVgJOQLCIXZUPj610xwP28hXalwjIMGXLC1CHpChSkI85k0lnjA/WhSr6L49V78efSsI53e34tZwi14SEs+LZuobcVvPkYdptNYetm3vGnDlnXE2sOfmVhcLKTcSawZU1K+accQ0pBdZoftVxq/L5lZtX5pnabxEQGWczUJsz+iIdwSXjOi6ZTJIFQARu+5HdVw6h7MQngZJeIpDbb4kM7f0D60WEJ1g9C7IL/1U/U1Cis28V5WNtAoxg27/Ac5h0wEM6QNz+pwik3MR5cnnijLnpYHfzXEPQnMcIcvPQffdRh1j33X03WlAbuk7/jNtDBfIFtrawxvddqdOyu3S+70pKy+6KF0ph72aCb232hnvWnhz2biLVbCKBG2sDqKR90c2rOfoZ5l+xf2dT+plDel1kuKJlHdY+NUAYUtrHVzRql94JRn52qopP9GEwIbdwMlEcxMk0SuLDHKZ1nGR7zS6bectNZhOOY4svJP7A0mB9Ugz5LBA2CV+38GbZ/ppVMq4ztxqWiJ2h3Rd53CwKf9Nf9JtvD3N2F3/RI41pkY3wzqesdhzG7mDQcr3Zb3vFHnBh/igeDFDJ9ldsfvP1lmDQDVns1qc84uo7GhWu4Xx3vtG8e6kNWwxLdzcWPPz5DYawr8IDf4f9gG0B7OcIOl+2MmcxFzMMF0sqiWT1v0RuFq9840Xy0mPBCV4kbQZfzlsiBzDJ2s3J3hJducmCXpQe05S1+9hkLwtrt5jGxpLHCysYpgl4YC2TmVProTMIm+ISm8k0xwM+JzvbbEo2XX7EmtXHrTyk0+/C/tH28VQy6BU4TkCmptsM24JGk+AMDwCIcge8ja5Ot83b2j9/2aJFc7eEFKOx2+7xhqLNtwdTgMW1hnpCLSEwN8APhVLBuzU3tDTcEgy2BkMGY6M35g94jEedsH7V0nMDYbtzrGtpe87IXjOagrnNea0Bi6/dvmjMPSxAzXl3M4dZxJudnSehZHJ+Z69obfAdMzx/yeoVbtkTcMmoF5oeaoXfF4H2hmcEBz2hEDiziRMK3QwOPLtC1z+p8zZm+l0WyvrTlbU0ye7BOUTvC0Hh8cd1Tb9XIPCqMA1X4l1BeOIJcl7S5eRfEQQoU9ENJvgzkdoqNV89XAN45Y3MN5mHK++v0asHutNv5pc2szLRdCEbTyknSyEqxydHsmVeSepXNNJ5RrUpIYtXO3RKJie9308/W+qh4CZfmjglUwojkl/i9e+kFkp0+6q2P66Lms4kfLUj629+vs4o2BcHjHEOGb2c8SuRNOISRski2q2uqNfqTi1McwkOG0ySzSQarVYpZPU2f5CSQyF5GbFSnoaGFr//Sm42F+e4ZsMIcehQEBqTPLxCIGiny0afrrsu+gLu4gZHQ6vCcZxBEi22SzguFuU4URDsvMHECfaueFPEyFmMZsxZedbIGniTPRxoQr7A8UGfL3h8wNcW6YuASbDbtnDckxw+dRtxavj3Fcp6huesOGfOKUuKE4gecuLKSWgggHxAGPGEOCocHHX8eddr1/687wj4odMe2A5/06CLx6g59ELmevVva2LXI2FNrEtt6rsX9Z/Vx1T5rbfVwOrJN45MAa3NSEYsks0YHKt+otMVLLV6yZHOSR+/e6S9PH8heiCtjiMrcRZPB77L2/DudHk+mo8ehNzqp+iBdnUxpe0n5CW1d1MdxWxnvsBcwFzIXDUzCcoM7z91V3h6/1ZV00leprjJNKtzoGZcShPK7KBCGXB1htYOUgKsw7XrSaFeLTegrO2NOypV7yBoam3uynWmMDc8M+rvq5mbmG8wdzF3M7v/3/f9lJoFtTWh2s8oOf+DI6Tuqhw0QSsJ5q/RAR51p/86P5jf+Ef9YMZJd5bvJffjhfYQ858crxWV8WrWHoaYkPr7YBA1gkM+yFfROdT0Fzw131icKW1R913Aic5GWWyYlra4nvCbPozdrii3x2ZAURwd+zwG5nNdYZDbj2bv+TdodXlmFLnaXaHIX6AXy8MWRXY0jRRBf4Ydrm6HuoCQdN01hDcz+fsDFR7DwhneMFPHA6rjCdNrDqEgPcUYmuYTqh9H0DnQjIsiEXJ1XQTzVtMSo2DAhiUGq4WfBlSo+wjFfjYhWtWrl5isvMUK5bBBoDTdX9kXWcLlJndpDdS2KsmTowYEYUnWtY3eSFAi6uEHaCO7NFqKgvnJoD3lmP1cpBjFka4oXlne5Q2GpJ+7xJ4Bi934shQKqSaq9KO+HGNt0a6o2gwWGrCz4qxwPoJ+C6FDwpLaLIVt/f0WHJbQG96QqmoXzE7gX+FJfJ9TmXOZS5lrmPv1lvjRfwQB03At7bofj3ZJh363lYZteQEH1e/2KMkaJrX/pceQQnEtySPn4FVkiV6l049I7ty/gnp9pSnNGjoNiOWdomABJDq13GuxGDIGZDB5LWYjsqQija2vGiCP4ZFMZ+eGTCbjpicO7zb4Oc6PELKZOYPcZBMkg0HSP9XxMTIj036I1+ejzzTX/KlnBJsMBqPRZBKMZj4oB5vc5gaRM1g4E+JYCy+Y/HJjstfwdwOYnv7DensP68805hvBHGnoMMQMR/Iw85oM5DpL9wkQ7jBU7+J4FWj5ijxjUPtS1P4X6h04rubYjEafU04sSyhXom8EYCVXkfoVYMaeRqhlSobffeONuJt4HiNREFJ/yaIBjAcwf4OB5w03sBsggNBEGP8lLJUvpR/SO0MKj5TvxDdPjpAhuwH3syzbZDREDLyCWfUBGjeA9ThjE2Y1nspv2ZfZKOzhaco/Y8yoOltlRK/ERcV8nDLKyF2v9KSN9qUPRKbfAXhEOaomf4/6fHtGLZcWetxAuJcaO92ITZZ53u2xIVb0mFFR4HlBLZs9jR6z+rzA/0rpicV6RokVsxOwZPfFYuhZVEwuLKllKK8+n4S62MTJ+2weNyn7vFa2TCpCRbNHfFcvD9aIozHcaI91xvSx/QL+DFZtA9DbROPoMIZxT1BtifyEbi7Aq+qFStqp75r7lRL5OCIZNX9dwldONzqdNpiZpwuNHtxLbAEst7n8IrpOS+LVE3UP8tbEQSb1MxQiBdS3zQE3ug6FeKeTaGCo75DKtpwO1J/V6TKebnY3lt84XXA3QtWeRgGquZY3GGxOp1E9wah7PqqJg/xWFCZZoSZ3AF2LwrQqJ0/DjI773q5/d71WjreYyrUIH+vUuq8yTuZH1X1BSZ5hXD3qNPWl3xFyN81Gep3N+DheRb9+vp1+ofxC9TIEfUAiXqcRYfWPSNovoryJ4keoH7b7Z6ou+f75Rr3qvvEv1wZ2BqUN5Hlg9S7eqT8cknvH8VBI5QAF+ic4BAVCLaTmKh70fI0+Y+WrrtPKAglfMgo/pGs1sqnK5dLlv1TlbUSUR1gBVMlh+yiaM4LmaHcXsAtmIJwbreRVHyNqhpru99vsW6ynTr7cQ/Q36mTLdUoaztoROxDiIVPJXMzIS7qsSqYbHtk/Cvqul1zRhbPd3eUXuy7M7clm9+TIaVH8lXAuDEa9P5wPhfLhuxzycXYvlh3Hue2cs+L3iKyHoIKql5wtRX/IqXIuhz7K7WNqiqIlEDhmv5JGrUadD/7Tmjsq6ttbdzftedVLE14gUA/dRWAPOpfEkBRG511+wt5A7+5tP6Dek9YjNbK7XEVul8CWzY9t3vwYVV4iV/GeILouIF8kOt/d6L6ACKUucE++qPdnJLLRfX5NNl0u8xTeR9vkYXyTv5hcc2n7F5pg62/aW25CW17fmPtjfsPrV68wLJ8fb2qK44fLL1x5Jc6pu/72N32/vAFggqMer/+X7yWuOz1SaTFpSrGw8sgTVi7S7hxe9PAiTcVrkfr7iHZJceRtKs6LbH7slcc2k8y0A4bqMhNPWn2ZZLyNFCFF9Xf/BD9SN7frbzqJ132Ts663El1busCgZs1VQ01sbzy+90dNeH2Xel9XFzq06/Au1Qief3SpnwCKFGeY/w8acz5TAAAAeJxjYGRgYADifx656fH8Nl8ZuFkYQOCJfaQMgv6/gIWBOQHI5WBgAokCABA7CQsAeJxjYGRgYG7438AQw1LPAAQsDAyMDKhgHgBUCwOGAAB4nGNhYGBgwYYdcIgTwjB99gTUOCCpdcAijgtjMwNdHF2NPQ47bNDU2BBwHyE3GhPpB3si1GBzBwgb4PAXrvBFjwd7PHGDbFY9FrvtcahFdy8DA6Y/0dQBAAt/GYkAAAAAAAAAAHYBHgFAAdQCSAK2A6gEDAR0BN4FdAXyBjQGuAcoB4IH1AhGCF4IhAi0CP4JJAmKCg4KVAp8CuILYgviDKINcg4EDooPCg9kD5oP8BAgEIIQ4hEYEWQSZhOqE94UEhRsFLgVaBXUFqIXMheCF+oYSBicGQQZZhmwGlAaahq+GxIbuhxKHHQc6B1WHdweMB56HqQfCh+MH+YgiiDsIWYhliHEIfQiViJsIzAjdiRAJVwloCXkJm4mzic4J3gnnCf6KE4osCj0KVYp1CpaKworbiu2LAwsNCyMLTAtrC5SLqwvXC/YMJAw5jE0MYoyDDKcMu4zPDOONAY0rjUeNhI2hjbQN2Q3yDgQOLI5Ljn4Ok47PDueO/Q8rD2QPew+RD6yPw4/9kByQORBckIUQmxC6EMQQ1JDfEPaRBQAAHicY2BkYGCYx/CBQYoBBJiAmAsIGRj+g/kMADK6Ar8AeJxdkc1OwkAUhc/IjxESF5q4cDVuiImhBZbsDAnsWeC6lCk/aTvNdCBh5dP4BD6BT+AT6Ev4Ah7K1QTazJ3vnLn3zk0L4AbfUDg+t1xHVrikOvIF+V64Rn4QrpMfhRtoIxRu0h8Kt/CEZ+E2O6bsoOpXVB28Citc4034gvwuXCN/CNfJn8IN3OFLuEn/R7iFmVLCbXTUy8iZyJuFnu/1OrZ5YnOfxN0DTs1ym0ZOlGwz48q1zXU/6IkzMblxfy3K3XLgfaITZzM9Zi+TplYXzm5M7IOV98UwDBPxg9hmGMHBIIJnXEBjjj3jGjEsciRV9NxjdP/dKXOX2PJDRaw+PTtVM2Y6lNQHpdFHgN5ZzoQ5eZV3PkWJHe8Z0D1MoLkcKzLSWOYynCElaxTV2YZOTD/Aqqoq+JNDvslZflDdnf0CPF1o6QAAAHicbVSHlts2ELw5kRQlnc9xzum9Vyax7PTee+89ELGi4AMJGgClU3rvvVfnV7OgpOT8XvSeCAK7AGZnZ7i2vrb49df+/3cU6+ggQowEXaTooY8BNrAHm9iL47APx2ML+3ECTsRJOBmn4FSchtNxBs7EWTgb5+BcnIfzcQEuxEW4GJfgUlyGy5HhClyJq3AAQxzEIVyNa3AtrsP1uAE34ibcjFtwK27D7bgDd+Iu3I17cC/uw/14AA/iITyMR/AoHsPjeAJP4ik8jWfwLJ7D83gBL+IlvIxX8Cpeg8AIOSQIYxSYQOEwtqFRooJBjSOwcPBoMMUMO5jjdbyBN/EW3sY7eBfv4X18gA/xET7GJ/gUn+FzfIEv8RW+xjf4Ft/he/yAH/ETfsYv+BW/4Xf8gT/xF47i77W0FHZbmlk1kMKLzJGm3PcKq2SmVUVxbVXlo1z5eapNLrwyVXLE5kZSqqq68ZmSiRpbUVIsGqlMf2xsmZUc17FXXlPkVFF1hZSWnOs5z0c4r/LuSLSnxFMlySRiyrfbrmtcTZXszoStVFVEjieppTHvnQzXhermRjdldXA5HlqOw+V4INFibhrfc1SUVHmS3TAw5t4CrBdFx4vRRm6qsSoymnKUMVGdBdiJ0wzGJlIJbYqtww0DHc8zV4uchDVNJZOm1kbIKDf1vO9VSZkVVUGpF2474xr3H7NnRH5GVCWqrI31A75YU3vRwcESwEg4Ol5oZkh5Kl3mvCWfT3YvjTXtMAtxPqF8OxKNN2kuNK8IuyrD+bmmvcuJkFNR5SRXwdqa2m1yO8hTliubaxruOWaaLGb7pbLceyYrs2ZmmRvraEMqVzOpLYxIWlHsWa2MWA/bUVBNTFL5YRSeodEZN2NrlaWqIKM2d4VwytXxNoqC7DaPTezQnHr8z3JtHHVrhqFoNgi3ZxWjEnUyNpqbNGh1tiig14ZDMAqrvTYU2IsUXxmrUhS0b9WZkMsqtH5ztZIHpdi9/7Zu0YOY4WwP41JVjYtZRc0wKo2lKLymmrve8KmdWsikNCOlKa15npVih9Omq5mqUi4hCwpbr/MoLHaXck6skKpxAyemLAqlNcn0SEOudZjLrdE6DKr2XUfet27g1MRNBPOWToVVQU+dObmNxRpTyJmhI9QPj6U2uRta1I53zhTXxR4bBYIGXCYt/R5zSxo2sCbLXhdWpq3aRmaHteZyEUwxarw3Vb/9SrRKjgu2RN2VKjjYRoHXDUkLyFyDiya+1EkQhbFxa78oUMrMODczVsaBANNhrSWL3keWQccM19hkgSs67JiMqilHZOPWUv3/TLTLT8MoeDHijCr1tMPdJdH1xmiv6shp41PPXLgxWXZ/0ZvxPTZ896LAQdye02uFO1FaRvw27PBja5cLg1EDxn6b1qpu367wQkJra/8AhSEfTQ==) format("woff")}.fc-icon{-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;font-family:fc-icon!important;font-size:16px;font-style:normal}.icon-data-select:before{content:"\\e6dd"}.icon-markdown:before{content:"\\e893"}.icon-grid-line:before{content:"\\e600"}.icon-print:before{content:"\\e6de"}.icon-city:before{content:"\\e64b"}.icon-location:before{content:"\\e6d4"}.icon-qrcode:before{content:"\\e6ce"}.icon-input-id:before{content:"\\e6d1"}.icon-iframe:before{content:"\\e6d2"}.icon-audio:before{content:"\\e6d3"}.icon-form-model:before{content:"\\e6d5"}.icon-title:before{content:"\\e6d6"}.icon-sign:before{content:"\\e6d7"}.icon-address:before{content:"\\e6d8"}.icon-statistic:before{content:"\\e6d9"}.icon-barcode:before{content:"\\e6da"}.icon-video:before{content:"\\e6db"}.icon-avatar:before{content:"\\e6dc"}.icon-suspend:before{content:"\\e6cf"}.icon-warning:before{content:"\\e6d0"}.icon-send:before{content:"\\e6cc"}.icon-refresh2:before{content:"\\e6cd"}.icon-ai:before{content:"\\e6cb"}.icon-ai.bright{-webkit-text-fill-color:transparent;background:linear-gradient(90deg,#328ff7,#62e3a3);-webkit-background-clip:text}.icon-column4:before{content:"\\e6c7"}.icon-column3:before{content:"\\e6c6"}.icon-column2:before{content:"\\e6c8"}.icon-column1:before{content:"\\e6c9"}.icon-layout:before{content:"\\e6ca"}.icon-segmented:before{content:"\\e682"}.icon-mention:before{content:"\\e6c5"}.icon-input-tag:before{content:"\\e6c4"}.icon-up:before{content:"\\e697";display:inline-block;transform:rotate(180deg)}.icon-alignitems-flexstart:before{content:"\\e67f";display:inline-block;transform:rotate(180deg)}.icon-align-center:before{content:"\\e6a5";display:inline-block;transform:rotate(90deg)}.icon-align-flexstart:before{content:"\\e6a4";display:inline-block;transform:rotate(90deg)}.icon-align-spacearound:before{content:"\\e670";display:inline-block;transform:rotate(-90deg)}.icon-align-spacebetween:before{content:"\\e695";display:inline-block;transform:rotate(-90deg)}.icon-align-stretch:before{content:"\\e6a7";display:inline-block;transform:rotate(-90deg)}.icon-align-flexend:before{content:"\\e6a4";display:inline-block;transform:rotate(-90deg)}.icon-justify-flexend:before{content:"\\e6a4";display:inline-block;transform:rotate(180deg)}.icon-direction-row:before{content:"\\e68b";display:inline-block;transform:rotate(180deg)}.icon-direction-column:before{content:"\\e68b";display:inline-block;transform:rotate(-90deg)}.icon-direction-columnreverse:before{content:"\\e68b";display:inline-block;transform:rotate(90deg)}.icon-arrow:before{content:"\\e697";display:inline-block;transform:rotate(180deg)}.icon-cell:before{content:"\\e654"}.icon-table:before{content:"\\eb0a"}.icon-next-step:before{content:"\\e6b4";display:inline-block;transform:rotateY(180deg)}.icon-grid:before{content:"\\e65c";display:inline-block;transform:rotate(90deg)}.icon-alignitems-stretch:before{content:"\\e67e"}.icon-alignitems-flexend:before{content:"\\e67f"}.icon-check:before{content:"\\e680"}.icon-auto:before{content:"\\e681"}.icon-config-event:before{content:"\\e66e"}.icon-calendar:before{content:"\\e683"}.icon-config-style:before{content:"\\e684"}.icon-copy:before{content:"\\e676"}.icon-config-advanced:before{content:"\\e686"}.icon-config-props:before{content:"\\e687"}.icon-delete-circle2:before{content:"\\e688"}.icon-delete-circle:before,.icon-delete2:before{content:"\\e689"}.icon-delete:before{content:"\\e68a"}.icon-direction-rowreverse:before{content:"\\e68b"}.icon-display-flex:before{content:"\\e68c"}.icon-dialog:before{content:"\\e66f"}.icon-drag:before{content:"\\e68e"}.icon-display-block:before{content:"\\e68f"}.icon-data:before{content:"\\e690"}.icon-edit2:before{content:"\\e691"}.icon-edit:before{content:"\\e692"}.icon-add-col:before{content:"\\e693"}.icon-display-inlineblock:before{content:"\\e694"}.icon-config-base:before{content:"\\e6bf"}.icon-config-validate:before{content:"\\e696"}.icon-down:before{content:"\\e697"}.icon-display-inline:before{content:"\\e698"}.icon-eye:before{content:"\\e699"}.icon-eye-close:before{content:"\\e69a"}.icon-import:before{content:"\\e6a6"}.icon-preview:before{content:"\\e69b"}.icon-flex-nowrap:before{content:"\\e69c"}.icon-folder:before{content:"\\e69d"}.icon-form-circle:before{content:"\\e69e"}.icon-flex-wrap:before{content:"\\e69f"}.icon-form:before{content:"\\e6a0"}.icon-form-item:before{content:"\\e6a1"}.icon-icon:before{content:"\\e6a2"}.icon-image:before{content:"\\e6a3"}.icon-justify-flexstart:before{content:"\\e6a4"}.icon-justify-center:before{content:"\\e6a5"}.icon-justify-spacearound:before{content:"\\e670"}.icon-justify-stretch:before{content:"\\e6a7"}.icon-link2:before{content:"\\e6a8"}.icon-justify-spacebetween:before{content:"\\e695"}.icon-minus:before{content:"\\e6aa"}.icon-menu2:before{content:"\\e6ab"}.icon-more:before{content:"\\e6ac"}.icon-menu:before{content:"\\e6ad"}.icon-language:before{content:"\\e6ae"}.icon-pad:before{content:"\\e6af"}.icon-mobile:before{content:"\\e6b0"}.icon-page-max:before{content:"\\e6b1"}.icon-move:before{content:"\\e6b2"}.icon-page-min:before{content:"\\e6b3"}.icon-pre-step:before{content:"\\e6b4"}.icon-pc:before{content:"\\e6b5"}.icon-page:before{content:"\\e6b6"}.icon-refresh:before{content:"\\e6b7"}.icon-radius:before{content:"\\e6b8"}.icon-save-filled:before{content:"\\e6b9"}.icon-question:before{content:"\\e6ba"}.icon-scroll:before{content:"\\e6bb"}.icon-script:before{content:"\\e6bc"}.icon-setting:before{content:"\\e6bd"}.icon-save-online:before,.icon-save:before{content:"\\e6be"}.icon-task-add:before{content:"\\e68d"}.icon-shadow:before{content:"\\e6c0"}.icon-variable:before{content:"\\e6c1"}.icon-yes:before{content:"\\e6c2"}.icon-shadow-inset:before{content:"\\e6c3"}.icon-date:before{content:"\\e642"}.icon-date-range:before{content:"\\e643"}.icon-collapse:before{content:"\\e644"}.icon-slider:before{content:"\\e665"}.icon-switch:before{content:"\\e646"}.icon-subform:before{content:"\\e647"}.icon-time-range:before{content:"\\e685"}.icon-tree-select:before{content:"\\e649"}.icon-value:before{content:"\\e64a"}.icon-table-form3:before{content:"\\e6a9"}.icon-alert:before{content:"\\e64c"}.icon-card:before{content:"\\e64d"}.icon-checkbox:before{content:"\\e64e"}.icon-cascader:before{content:"\\e64f"}.icon-button:before{content:"\\e650"}.icon-data-table:before{content:"\\e651"}.icon-group:before{content:"\\e652"}.icon-divider:before{content:"\\e653"}.icon-flex:before{content:"\\e654"}.icon-descriptions:before{content:"\\e655"}.icon-html:before{content:"\\e656"}.icon-editor:before{content:"\\e657"}.icon-input:before{content:"\\e658"}.icon-link:before{content:"\\e659"}.icon-password:before{content:"\\e65a"}.icon-radio:before{content:"\\e65b"}.icon-row:before{content:"\\e65c"}.icon-inline:before{content:"\\e65d"}.icon-rate:before{content:"\\e65e"}.icon-color:before{content:"\\e65f"}.icon-select:before{content:"\\e660"}.icon-json:before{content:"\\e661"}.icon-number:before{content:"\\e662"}.icon-space:before{content:"\\e664"}.icon-step-form:before{content:"\\e663"}.icon-table-form:before{content:"\\e666"}.icon-table-form2:before{content:"\\e667"}.icon-time:before{content:"\\e668"}.icon-span:before{content:"\\e669"}.icon-textarea:before{content:"\\e66a"}.icon-tooltip:before{content:"\\e66b"}.icon-slot:before{content:"\\e66c"}.icon-transfer:before{content:"\\e66d"}.icon-upload:before{content:"\\e673"}.icon-tag:before{content:"\\e671"}.icon-watermark:before{content:"\\e672"}.icon-tab:before{content:"\\e674"}.icon-tree:before{content:"\\e675"}.icon-table:before{content:"\\e677"}.icon-add-child:before{content:"\\e678"}.icon-add2:before{content:"\\e679"}.icon-add:before{content:"\\e67a"}.icon-alignitems-baseline:before{content:"\\e67b"}.icon-add-circle:before{content:"\\e67c"}.icon-alignitems-center:before{content:"\\e67d"}._fd-step-form .van-step{cursor:pointer;line-height:1.4;text-align:left}._fd-popup.van-popup{background:var(--fc-bg-color-1);margin:10px;overflow:auto;padding-top:50px;position:relative;width:calc(100% - 20px)}._fd-popup-content{display:flex;flex:1;height:calc(var(--fc-dialog-height) - 152px);margin-bottom:5px;overflow:auto;padding:1px}._fd-popup-content>._fd-drag-box{align-content:flex-start;align-items:flex-start;box-sizing:border-box;display:flex;flex-wrap:wrap;height:calc(var(--fc-dialog-height) - 105px);justify-content:flex-start;outline:1px dashed var(--fc-tool-border-color);overflow:auto;position:relative}._fd-popup-content ._fd-drag-box{outline:1px dashed var(--fc-line-color-3)}._fd-popup-title{color:#333;font-size:16px;left:0;position:absolute;text-align:center;top:16px;width:100%}.CodeMirror{color:#000;direction:ltr;font-family:monospace;height:300px}.CodeMirror-lines{padding:4px 0}.CodeMirror pre.CodeMirror-line,.CodeMirror pre.CodeMirror-line-like{padding:0 4px}.CodeMirror-gutter-filler,.CodeMirror-scrollbar-filler{background-color:#fff}.CodeMirror-gutters{background-color:#f7f7f7;border-right:1px solid #ddd;white-space:nowrap}.CodeMirror-linenumber{color:#999;min-width:20px;padding:0 3px 0 5px;text-align:right;white-space:nowrap}.CodeMirror-guttermarker{color:#000}.CodeMirror-guttermarker-subtle{color:#999}.CodeMirror-cursor{border-left:1px solid #000;border-right:none;width:0}.CodeMirror div.CodeMirror-secondarycursor{border-left:1px solid silver}.cm-fat-cursor .CodeMirror-cursor{background:#7e7;border:0!important;width:auto}.cm-fat-cursor div.CodeMirror-cursors{z-index:1}.cm-fat-cursor .CodeMirror-line::selection,.cm-fat-cursor .CodeMirror-line>span::selection,.cm-fat-cursor .CodeMirror-line>span>span::selection{background:transparent}.cm-fat-cursor .CodeMirror-line::-moz-selection,.cm-fat-cursor .CodeMirror-line>span::-moz-selection,.cm-fat-cursor .CodeMirror-line>span>span::-moz-selection{background:transparent}.cm-fat-cursor{caret-color:transparent}.cm-tab{display:inline-block;text-decoration:inherit}.CodeMirror-rulers{bottom:0;left:0;overflow:hidden;position:absolute;right:0;top:-50px}.CodeMirror-ruler{border-left:1px solid #ccc;bottom:0;position:absolute;top:0}.cm-s-default .cm-header{color:#00f}.cm-s-default .cm-quote{color:#090}.cm-negative{color:#d44}.cm-positive{color:#292}.cm-header,.cm-strong{font-weight:700}.cm-em{font-style:italic}.cm-link{text-decoration:underline}.cm-strikethrough{text-decoration:line-through}.cm-s-default .cm-keyword{color:#708}.cm-s-default .cm-atom{color:#219}.cm-s-default .cm-number{color:#164}.cm-s-default .cm-def{color:#00f}.cm-s-default .cm-variable-2{color:#05a}.cm-s-default .cm-type,.cm-s-default .cm-variable-3{color:#085}.cm-s-default .cm-comment{color:#a50}.cm-s-default .cm-string{color:#a11}.cm-s-default .cm-string-2{color:#f50}.cm-s-default .cm-meta,.cm-s-default .cm-qualifier{color:#555}.cm-s-default .cm-builtin{color:#30a}.cm-s-default .cm-bracket{color:#997}.cm-s-default .cm-tag{color:#170}.cm-s-default .cm-attribute{color:#00c}.cm-s-default .cm-hr{color:#999}.cm-s-default .cm-link{color:#00c}.cm-invalidchar,.cm-s-default .cm-error{color:red}.CodeMirror-composing{border-bottom:2px solid}div.CodeMirror span.CodeMirror-matchingbracket{color:#0b0}div.CodeMirror span.CodeMirror-nonmatchingbracket{color:#a22}.CodeMirror-matchingtag{background:rgba(255,150,0,.3)}.CodeMirror-activeline-background{background:#e8f2ff}.CodeMirror{background:#fff;overflow:hidden;position:relative}.CodeMirror-scroll{height:100%;margin-bottom:-50px;margin-right:-50px;outline:none;overflow:scroll!important;padding-bottom:50px;position:relative;z-index:0}.CodeMirror-sizer{border-right:50px solid transparent;position:relative}.CodeMirror-gutter-filler,.CodeMirror-hscrollbar,.CodeMirror-scrollbar-filler,.CodeMirror-vscrollbar{display:none;outline:none;position:absolute;z-index:5}.CodeMirror-vscrollbar{overflow-x:hidden;overflow-y:scroll;right:0;top:0}.CodeMirror-hscrollbar{bottom:0;left:0;overflow-x:scroll;overflow-y:hidden}.CodeMirror-scrollbar-filler{bottom:0;right:0}.CodeMirror-gutter-filler{bottom:0;left:0}.CodeMirror-gutters{left:0;min-height:100%;position:absolute;top:0;z-index:3}.CodeMirror-gutter{display:inline-block;height:100%;margin-bottom:-50px;vertical-align:top;white-space:normal}.CodeMirror-gutter-wrapper{background:none!important;border:none!important;position:absolute;z-index:4}.CodeMirror-gutter-background{bottom:0;position:absolute;top:0;z-index:4}.CodeMirror-gutter-elt{cursor:default;position:absolute;z-index:4}.CodeMirror-gutter-wrapper ::selection{background-color:transparent}.CodeMirror-gutter-wrapper ::-moz-selection{background-color:transparent}.CodeMirror-lines{cursor:text;min-height:1px}.CodeMirror pre.CodeMirror-line,.CodeMirror pre.CodeMirror-line-like{word-wrap:normal;-webkit-tap-highlight-color:transparent;background:transparent;border-radius:0;border-width:0;color:inherit;font-family:inherit;font-size:inherit;font-variant-ligatures:contextual;line-height:inherit;margin:0;overflow:visible;position:relative;white-space:pre;z-index:2}.CodeMirror-wrap pre.CodeMirror-line,.CodeMirror-wrap pre.CodeMirror-line-like{word-wrap:break-word;white-space:pre-wrap;word-break:normal}.CodeMirror-linebackground{bottom:0;left:0;position:absolute;right:0;top:0;z-index:0}.CodeMirror-linewidget{padding:.1px;position:relative;z-index:2}.CodeMirror-rtl pre{direction:rtl}.CodeMirror-code{outline:none}.CodeMirror-gutter,.CodeMirror-gutters,.CodeMirror-linenumber,.CodeMirror-scroll,.CodeMirror-sizer{box-sizing:content-box}.CodeMirror-measure{height:0;overflow:hidden;position:absolute;visibility:hidden;width:100%}.CodeMirror-cursor{pointer-events:none;position:absolute}.CodeMirror-measure pre{position:static}div.CodeMirror-cursors{position:relative;visibility:hidden;z-index:3}.CodeMirror-focused div.CodeMirror-cursors,div.CodeMirror-dragcursors{visibility:visible}.CodeMirror-selected{background:#d9d9d9}.CodeMirror-focused .CodeMirror-selected{background:#d7d4f0}.CodeMirror-crosshair{cursor:crosshair}.CodeMirror-line::selection,.CodeMirror-line>span::selection,.CodeMirror-line>span>span::selection{background:#d7d4f0}.CodeMirror-line::-moz-selection,.CodeMirror-line>span::-moz-selection,.CodeMirror-line>span>span::-moz-selection{background:#d7d4f0}.cm-searching{background-color:#ffa;background-color:#ff06}.cm-force-border{padding-right:.1px}@media print{.CodeMirror div.CodeMirror-cursors{visibility:hidden}}.cm-tab-wrap-hack:after{content:""}span.CodeMirror-selectedtext{background:none}.CodeMirror-hints{background:#fff;border:1px solid silver;border-radius:3px;box-shadow:2px 3px 5px #0003;font-family:monospace;font-size:90%;list-style:none;margin:0;max-height:20em;overflow:hidden;overflow-y:auto;padding:2px;position:absolute;z-index:1}.CodeMirror-hint{border-radius:2px;color:#000;cursor:pointer;margin:0;padding:0 4px;white-space:pre}li.CodeMirror-hint-active{background:#08f;color:#fff}._fd-fn{display:flex;flex-direction:column;height:100%;position:relative;width:100%}._fd-fn .el-button{bottom:3px;box-shadow:0 6px 16px #00000014,0 3px 6px -4px #0000001f,0 9px 28px 8px #0000000d;position:absolute;right:5px}._fd-fn-editor{display:flex;flex:1;overflow:auto;width:100%}._fd-fn-editor .CodeMirror{height:100%;width:100%}._fd-fn-tip{background:var(--fc-bg-color-2);color:var(--fc-text-color-1);direction:ltr;font-family:monospace}._fd-fn-tip .cm-keyword{color:#708;line-height:24px;overflow-x:auto;white-space:nowrap}._fd-fn-tip .cm-keyword::-webkit-scrollbar{background-color:transparent;height:0;width:0}._fd-fn-ind{background-color:var(--fc-bg-color-3);border-right:1px solid var(--fc-line-color-2);display:inline-block;float:left;height:24px;margin-right:4px;width:29px}._fd-fn-arg{cursor:pointer;text-decoration:underline}._fd-fn-arg i{color:var(--fc-style-color-1);font-size:12px}._fd-cdi-input>div{width:100%}._fd-pattern-input{width:100%}._fd-pattern-input .el-input-group__append{padding:0 10px}._fd-pattern-input .fc-icon{cursor:pointer}._fd-pattern-popper .el-dropdown__list{height:350px;overflow:auto}.el-tree._fd-rule-select{min-width:200px}._fd-rule-select .el-tree-node:has(._fd-rule-select-node){border-bottom-style:solid;border-bottom:1px dashed var(--fc-line-color-3);padding-bottom:5px}._fd-rule-select .el-tree-node:has(._fd-rule-select-node)>.el-tree-node__content>.el-checkbox{display:none}._fd-rule-select .el-tree-node:has(._fd-rule-select-node)>.el-tree-node__content>.el-select-dropdown__item{padding-right:20px}._fd-rule-select-node{display:flex;justify-content:space-between}._fd-rule-select-node>div{color:#61affe}._fd-rule-select-node>span{font-size:12px}._fd-value-input .el-input__validateIcon{display:none}._fd-value-input .el-select,._fd-value-input .el-select__wrapper{height:100%}._fd-warning-pop{max-width:400px}._fd-warning-text{cursor:help;text-decoration:underline;text-decoration-style:dashed}._fd-variable-btn{align-items:center;background:var(--fc-style-bg-color-1);border-radius:5px;color:var(--fc-style-color-1);cursor:pointer;display:flex;font-size:12px;margin-left:6px;padding:2px 6px}._fd-variable-con .el-main{padding:0}._fd-variable-l,._fd-variable-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-variable-r{margin-left:10px}._fd-variable-l .el-header,._fd-variable-r .el-header{align-items:center;background:var(--fc-bg-color-3);color:var(--fc-text-color-1);display:flex;font-size:13px;height:40px}._fd-variable-r .el-header .fc-icon{color:var(--fc-style-color-1);cursor:pointer;font-size:13px;margin-left:2px}._fd-variable-r .el-main{padding:10px}._fd-variable-info{background:hsla(0,0%,67%,.1);border-radius:6px;color:var(--fc-text-color-2);display:flex;font-size:12px;line-height:18px;margin-bottom:6px;padding:8px 13px;position:relative}._fd-variable-node{align-items:center;color:var(--fc-text-color-1);display:flex;font-size:13px;height:26px;justify-content:space-between;line-height:26px;padding-right:5px;width:100%}._fd-variable-node>span{color:var(--fc-text-color-3);font-size:12px}._fd-variable-item{align-items:center;border-bottom:1px solid var(--fc-line-color-3);display:flex;min-height:40px;padding:0 20px}._fd-variable-top ._fd-variable-item-label{color:#fca130}._fd-variable-item-label{font-size:13px;margin-right:18px;width:198px}._fd-variable-item .el-input{display:flex;flex:1;font-size:13px;margin-top:4px}._fd-variable-item.active,._fd-variable-item.active ._fd-variable-item-label,._fd-variable-item.active input{color:var(--fc-style-color-1)}._fd-variable-item.active .el-input{--el-input-icon-color:var(--fc-style-color-1)}._fd-variable-item input{text-align:center}._fd-variable-item .el-input .el-input__wrapper{box-shadow:none}._fd-variable-pop.el-popover.el-popper{height:400px;padding:0}._fd-variable-pop-header .fc-icon{color:var(--fc-style-color-1);cursor:pointer;margin-left:4px}._fd-variable-pop .el-header{align-items:center;background-color:var(--fc-bg-color-2);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:0 10px}._fd-variable-pop .el-main{padding:10px}._fd-variable-pop .el-tree-node__content>.el-tree-node__expand-icon{padding:3px}._fd-variable-pop .el-input-group__append{background:var(--fc-style-color-1);color:#fff;cursor:pointer;padding:0;width:60px}._fd-variable-pop .el-input-group__append div{text-align:center;width:100%}._fd-variable-pop-node{align-items:center;display:flex;font-size:13px;height:26px;justify-content:space-between;line-height:26px;padding-right:5px;width:100%}._fd-variable-pop-node>span{color:var(--fc-text-color-3);font-size:12px}._fd-cdg-input{display:flex;flex-direction:column}._fd-cdg-btns{margin-left:30px;margin-top:10px}._fd-cdg-btns .el-button{color:var(--fc-text-color-2)}._fd-cdg-item{display:flex}._fd-cdg-item .el-select{background-color:var(--fc-bg-color-2)}._fd-cdg-and{display:flex;flex-shrink:0;position:relative;width:100px}._fd-cdg-and>.el-select{left:-5px;margin-top:-16px;position:absolute;top:50%;width:80px;z-index:1}._fd-cdg-and:before{background-color:var(--fc-line-color-2);bottom:1px;content:"";left:30px;margin-bottom:16px;margin-top:14px;position:absolute;top:1px;width:1px}._fd-cdg-options{display:flex;flex-direction:column}._fd-cdg-option{align-items:center;display:flex;position:relative}._fd-cdg-field{width:208px}._fd-cdg-variable{height:32px;width:208px}._fd-cdg-term{width:104px}._fd-cdg-option>._fd-cfg-value{align-items:center;display:flex;width:208px}._fd-cdg-option>.fc-icon{color:var(--fc-text-color-2);cursor:pointer;margin-left:10px}._fd-cdg-option>.fc-icon.disabled{cursor:not-allowed}._fd-cdg-option>._fd-cfg-value>div{width:100%}._fd-cdg-option>.el-input+.el-select,._fd-cdg-option>.el-select+.el-input,._fd-cdg-option>.el-select+.el-select,._fd-cfg-value,._fd-cfg-value .el-checkbox{margin-left:10px}._fd-cdg-option:before{background-color:var(--fc-line-color-2);content:"";height:1px;left:-70px;margin-top:-1px;position:absolute;top:50%;width:105px}._fd-cdg-option.is-group{border:1px dashed #ccd3db;padding:14px}._fd-cdg-option.is-group>.fc-icon{font-size:18px;position:absolute;right:-10px;top:-10px;transform:rotate(45deg);z-index:1}._fd-cdg-option.is-group:before{margin-top:-17px}._fd-cdg-option+._fd-cdg-option{margin-top:16px}._fd-computed,._fd-computed .el-badge{width:100%}._fd-computed .el-button{font-weight:400;width:100%}._fd-comp-con,._fd-comp-condition{height:500px}._fd-comp-condition .el-main{padding:20px 5px}._fd-comp-con .el-tree>.el-tree-node{color:var(--fc-text-color-1);font-size:13px;font-weight:500;margin:1px;padding:14px}._fd-comp-con .el-tree>.el-tree-node+.el-tree-node{border-top:1px solid var(--fc-line-color-3)}._fd-comp-con .el-tree-node{font-weight:400}._fd-comp-con .el-tree-node__content{margin-top:5px}._fd-comp-dialog .el-dialog__body{padding:0 10px}._fd-comp-dialog .el-tabs__header{margin-bottom:0}._fd-comp-con .el-main{padding:0}._fd-comp-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-comp-head{align-items:center;border-bottom:1px solid var(--fc-line-color-3);color:var(--fc-text-color-1);display:flex;font-size:13px;font-weight:500;height:38px;padding:5px 15px}._fd-comp-r>.el-main,._fd-comp-script{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-comp-script{width:100%}._fd-comp-r>.el-main{flex-direction:column}._fd-comp-info{background:var(--fc-bg-color-2);border-radius:6px;color:var(--fc-text-color-2);height:90px;line-height:20px;margin:10px;padding:15px}._fd-comp-con .CodeMirror{height:100%;width:100%}._fd-comp-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-comp-node{align-items:center;display:flex;font-size:13px;height:26px;justify-content:space-between;line-height:26px;padding-right:5px;width:100%}._fd-comp-node ._group{color:#61affe;font-weight:700;margin-right:5px}._fd-comp-node ._subform{color:#fca130;font-weight:700;margin-right:5px}._fd-comp-node.disabled{color:var(--fc-text-color-3);cursor:not-allowed}._fd-comp-node.disabled ._fd-comp-id{background-color:#999}._fd-comp-id{background-color:var(--fc-style-color-1);border-radius:5px;color:#fff;font-weight:500;height:20px;line-height:20px;text-align:center;width:20px}._fd-comp-dialog .el-aside{border:1px solid var(--fc-line-color-3);border-right:0;width:300px}._fd-comp-title{color:var(--fc-text-color-1);font-weight:500;margin-bottom:15px;padding-left:5px;position:relative}._fd-comp-title:before{background-color:var(--fc-style-color-1);content:" ";display:inline-block;height:1em;left:-5px;position:absolute;top:3px;width:3px}._fd-comp-script .CodeMirror pre.CodeMirror-line{line-height:26px}._fd-comp-linkage{align-items:center;display:flex;font-size:12px}._fd-comp-linkage>._fd-rule-select{display:inline-block;margin:0 6px;width:120px}._fd-event .el-button{font-weight:400;width:100%}._fd-event .el-badge,._fd-menu{width:100%}._fd-menu{box-sizing:border-box;display:flex;flex-direction:column}._fd-menu-item{border:1px solid transparent;border-bottom:1px dashed var(--fc-line-color-3);padding:0 15px}._fd-menu-item.is-active{border:1px solid var(--fc-style-color-1)}._fd-menu-item.is-active ._fd-event-title i{color:var(--fc-style-color-1)}._fd-event-dialog .el-tabs__header{margin:0}._fd-event-select{align-items:center;display:flex;margin-left:15px;margin-top:15px}._fd-event-select .el-select{width:240px}._fd-event-con .el-main{padding:0}._fd-event-l,._fd-event-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-event-dropdown .el-dropdown-menu{max-height:500px;overflow:auto}._fd-event-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-event-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-event-r{border-left:0}._fd-event-r ._fd-event-head{justify-content:flex-end}._fd-event-l>.el-main,._fd-event-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-event-r>.el-main{flex-direction:column}._fd-event-r>.el-main.is-behavior{flex-direction:unset}._fd-event-item{display:flex;flex-direction:column;font-size:14px;justify-content:center;max-width:250px;overflow:hidden;white-space:pre-wrap}._fd-event-item ._fd-label{color:var(--fc-text-color-3);font-size:12px}._fd-event-l .el-menu-item.is-active ._fd-event-title i{color:var(--fc-style-color-1)}._fd-event-method{color:#9d238c;display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;overflow:hidden;white-space:pre-wrap;width:225px}._fd-event-method ._fd-label{color:var(--fc-text-color-3);font-size:12px;margin-top:4px}._fd-event-method>span:first-child,._fd-fn-list-method>span:first-child{color:#9d238c}._fd-event-method>span:first-child>span,._fd-fn-list-method>span:first-child>span{color:var(--fc-text-color-1);margin-left:10px}._fd-event-title{align-items:center;cursor:pointer;display:flex;justify-content:space-between;padding:12px 0;width:100%}._fd-event-title .fc-icon{color:var(--fc-text-color-2);font-size:18px;margin-right:6px}._fd-event-title .el-input{width:200px}._fd-event-title .el-input__wrapper{box-shadow:none}._fd-event-con .CodeMirror{height:100%;width:100%}._fd-event-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-event-behaviors{width:100%}._fd-event-behavior{background:var(--fc-bg-color-3);border-radius:5px;box-sizing:border-box;cursor:pointer;font-size:12px;margin-bottom:12px;padding:12px;width:100%}._fd-event-behavior.is-active{background:var(--fc-style-color-1)}._fd-event-behavior.is-active ._fd-event-behavior-info,._fd-event-behavior.is-active ._fd-event-behavior-label{color:#fff}._fd-event-behavior-label{color:var(--fc-text-color-2);display:flex;justify-content:space-between}._fd-event-behavior-label>div{display:flex}._fd-event-behavior-info{color:var(--fc-text-color-3);margin-left:16px}._fd-event-behavior-list{border-right:1px solid var(--fc-line-color-3);height:100%;padding:15px}._fd-event-behavior-list .el-menu-item,._fd-event-behavior-list .el-sub-menu__title{height:30px}._fd-event-behavior-list .el-menu{border-right:0}._fd-event-behavior-list .el-menu-item.is-active{background:var(--fc-style-color-1);color:#fff}._fd-event-behavior-list .el-menu-item,._fd-event-behavior-list .el-sub-menu__title{border-radius:6px!important;margin-bottom:4px}._fd-event-con ._fd-event-behavior-con{padding:15px}._fd-event-con .form-create .form-create .el-form-item{margin-bottom:18px}._fd-event-con .el-form ._fd-form-item-warning{color:var(--fc-text-color-3);font-size:12px;font-weight:400;line-height:17px;margin-top:6px}._fd-event-behavior-title{color:var(--fc-text-color-1);font-size:13px;font-weight:500;margin-bottom:12px}._fd-event-behavior-title>div{color:var(--fc-text-color-3);font-size:12px;font-weight:400}._fd-config-item{color:var(--fc-text-color-2);display:flex;flex-direction:column;font-size:12px;margin-bottom:10px;width:100%}._fd-ci-head{justify-content:space-between}._fd-ci-head,._fd-ci-label{align-items:center;display:flex}._fd-ci-label{color:var(--fc-text-color-1);font-size:12px}._fd-ci-con{align-items:center;display:flex;justify-content:flex-end;min-width:150px}._fd-ci-label.is-arrow{cursor:pointer}._fd-ci-append{background:var(--fc-bg-color-2);display:flex;flex-direction:column;margin:5px 3px 3px;padding:4px}._fd-ci-label i{font-size:12px;font-weight:600}._fd-ci-label i.down{transform:rotate(-180deg)}._fd-ci-info{font-size:12px;padding-right:5px}._fd-page-item{align-items:center;border-bottom:1px solid var(--fc-line-color-3);box-sizing:content-box;cursor:pointer;display:flex;flex-direction:row;font-size:12px;height:30px;justify-content:space-between;margin:0 12px;padding:12px 0}._fd-page-item.active ._fd-page-label{color:var(--fc-style-color-1)}._fd-page-btns{display:flex}._fd-page-label{color:var(--fc-text-color-1);font-weight:600}._fd-page-label .fc-icon{font-size:12px;margin-left:5px}._fd-page-id{align-items:center;color:var(--fc-text-color-3);display:flex;font-weight:400}._fd-page-id .fc-icon{margin-left:5px}._fd-page-id .fc-icon:hover,._fd-page-input .el-button{color:var(--fc-style-color-1)}._fd-page-input .el-button{font-size:12px;font-weight:400;margin-left:12px;margin-top:12px}._fd-page-input .el-button .fc-icon{font-size:12px;margin-left:5px}._fd-page-del{align-items:center;background-color:var(--fc-style-bg-color-3);border-radius:25px;display:flex;height:24px;justify-content:center;margin-left:4px;width:24px}._fd-page-del .fc-icon{color:var(--fc-style-color-3);font-size:14px}._fd-page-copy{align-items:center;background-color:var(--fc-style-bg-color-1);border-radius:25px;display:flex;height:24px;justify-content:center;width:24px}._fd-page-copy .fc-icon{color:var(--fc-style-color-1);font-size:14px}._fc-sublist ._fc-r-title{align-items:center;display:flex;justify-content:space-between}._fc-sublist .fc-icon{cursor:pointer}._fc-sublist ._fd-config-item+._fd-config-item{margin-top:8px}._fc-r-tools-bar{height:30px}._fc-r-tools-close{color:var(--fc-text-color-2);position:absolute;right:5px;transform:rotate(45deg)}._fc-r-tools{border-top:1px solid var(--fc-line-color-3);left:0;padding:0 10px;position:absolute;right:0}._fc-r-tool,._fc-r-tools{align-items:center;display:flex}._fc-r-tool{cursor:pointer;height:28px;justify-content:center;width:28px}._fc-r-tool:hover{color:var(--fc-style-color-1)}._fc-r-tool .fc-icon{font-size:22px}._fc-r-tools-close .fc-icon{font-size:18px}._fd-config-title{align-items:center;display:flex;font-size:14px;margin:26px 0 16px;padding-left:10px;position:relative}._fd-config-title:before{background-color:var(--fc-style-color-1);content:" ";display:block;height:20px;left:0;position:absolute;width:2px}._fd-type-select{cursor:pointer}._fd-type-select.is-disabled{cursor:default}._fd-type-select .fc-icon{font-size:14px}._fd-type-select-pop{max-height:500px;overflow:auto}._fd-type-select-pop .fc-icon{font-size:14px}._fc-field-tree .el-tree-node__content{color:var(--fc-text-color-1);display:flex;flex:1}._fc-field-tree .el-tree-node__content:hover{background-color:var(--fc-style-bg-color-1);color:var(--fc-style-color-1)}._fc-field-tree ._fc-field-drag{display:flex;flex:1;flex-direction:column}._fc-field-tree .fc-icon{font-size:18px;margin-right:5px}._fc-field-tree .icon-folder{color:var(--fc-style-color-1)}._fc-field-node-label{align-items:center;display:flex;user-select:none}._fc-l ._fc-form-tree .el-tree-node__content{color:var(--fc-text-color-1);display:flex;flex:1;height:auto;padding:5px 0}._fc-form-tree .el-tree-node__content:hover{background-color:var(--fc-style-bg-color-1);color:var(--fc-style-color-1)}._fc-form-tree .fc-icon{color:var(--fc-style-color-1);font-size:18px;margin-right:5px}._fc-form-tree .icon-folder{color:#ffba00}._fc-form-node{display:flex;flex-direction:row;justify-content:space-between;padding-right:12px;width:100%}._fc-form-node-label{align-items:flex-start;display:flex;user-select:none;white-space:normal}._fc-form-node-info{color:var(--fc-text-color-2);font-size:12px}._fd-gec,._fd-gec .el-badge{width:100%}._fd-gec .el-button{font-weight:400;width:100%}._fd-gec-con .el-main{padding:0}._fd-gec-l,._fd-gec-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-gec-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-gec-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-gec-r{border-left:0}._fd-gec-r ._fd-gec-head{justify-content:flex-end}._fd-gec-l>.el-main,._fd-gec-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-gec-r>.el-main{flex-direction:column}._fd-gec-l .el-menu{border-right:0;border-top:0;overflow:auto;padding:0 10px 5px;width:100%}._fd-gec-l .el-menu-item.is-active{background:var(--fc-bg-color-3);color:var(--fc-text-color-2)}._fd-gec-l .el-menu-item{border:1px solid var(--fc-line-color-3);border-radius:5px;height:auto;line-height:1em;margin-top:5px;padding:0}._fd-gec-method{color:#9d238c;display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;overflow:hidden;white-space:pre-wrap;width:225px}._fd-gec-method ._fd-label{color:var(--fc-text-color-3);font-size:12px;margin-top:4px}._fd-gec-title{align-items:center;display:flex;justify-content:space-between;padding:10px 0;width:100%}._fd-gec-title .el-input{width:200px}._fd-gec-title .fc-icon{color:var(--fc-text-color-2);font-size:18px;margin-right:6px}._fd-gec-title .el-input__wrapper{box-shadow:none}._fd-gec-con .el-menu-item.is-active i{color:var(--fc-text-color-2)}._fd-gec-con .CodeMirror{height:100%;width:100%}._fd-gec-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-struct-editor{flex:1;width:100%}._fd-struct-editor>div{height:100%}._fd-gfc,._fd-gfc .el-badge{width:100%}._fd-gfc .el-button{font-weight:400;width:100%}._fd-gfc-dialog .el-tabs__header{margin-bottom:0}._fd-gfc-dialog .form-create{margin-top:15px}._fd-gfc-dialog ._fc-tabs{display:flex;height:100%}._fd-gfc-dialog ._fc-tabs .el-tabs__content{display:flex;flex:1;overflow:auto}._fd-gfc-info{background:hsla(0,0%,67%,.1);border-radius:6px;color:var(--fc-text-color-2);display:flex;font-size:12px;line-height:18px;margin-left:15px;margin-top:8px;padding:8px 13px;position:relative}._fd-gfc-con .el-main{padding:0}._fd-gfc-l,._fd-gfc-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-gfc-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-gfc-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-gfc-r{border-left:0}._fd-gfc-r ._fd-gfc-head{justify-content:flex-end}._fd-gfc-l>.el-main,._fd-gfc-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-gfc-r>.el-main{flex-direction:column}._fd-gfc-l .el-menu{border-right:0;border-top:0;overflow:auto;padding:0 10px 5px;width:100%}._fd-gfc-l .el-menu-item.is-active{background:var(--fc-bg-color-3);color:var(--fc-text-color-2)}._fd-gfc-l .el-menu-item{border:1px solid var(--fc-line-color-3);border-radius:5px;height:auto;line-height:1em;margin-top:5px;padding:0}._fd-gfc-method{color:#702c71;display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;overflow:hidden;white-space:pre-wrap;width:100%}._fd-gfc-method ._fd-label{color:var(--fc-text-color-3);font-size:12px;margin-top:4px}._fd-gfc-title{align-items:center;display:flex;justify-content:space-between;padding:10px 0;width:100%}._fd-gfc-title .el-input{width:200px}._fd-gfc-title .fc-icon{color:var(--fc-text-color-2);font-size:18px;margin-right:6px}._fd-gfc-title .el-input__wrapper{box-shadow:none}._fd-gfc-title .el-menu-item.is-active i{color:var(--fc-text-color-2)}._fd-gfc-con .CodeMirror{height:100%;width:100%}._fd-gfc-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-size-input{align-items:center;display:flex}._fd-size-input .el-input-number--small{width:122px}._fd-size-input .el-button{font-size:12px;margin-left:3px;padding:5px;width:25px}._fd-box-size-input .el-form{grid-column-gap:10px;display:grid;grid-template-columns:repeat(2,1fr);width:100%}._fd-box-size-input .el-radio-group{width:100%}._fd-box-size-input .el-radio-button__inner{padding:4px;width:100%}._fd-box-size-input .el-radio-button{flex:1}._fd-box-size-input ._fd-size-input .el-input-number--small{width:100%}._fd-color-input{width:150px}._fd-color-input .el-input .el-color-picker{margin:0}._fd-color-input .el-input .el-input-group__append{padding:0;width:24px}._fd-color-input .el-input .el-color-picker__trigger{border-left:0;border-radius:0 3px 3px 0}._fd-border-input{display:flex;height:110px;justify-content:center;width:100%}._fd-border-input ._fd-bi-left{align-items:center;display:flex;flex-direction:column;height:115px;justify-content:center;width:115px}._fd-border-input ._fd-bi-right{display:flex;flex-direction:column;justify-content:space-around;padding:5px;width:140px}._fd-border-input ._fd-bi-right ._fd-color-input{width:140px}._fd-bi-opt{align-items:center;display:flex;height:100%;width:100%}._fd-bi-opt ._line{width:100%}._fd-bi-opt .solid{border:1px solid #000}._fd-bi-opt .dashed{border:1px dashed #000}._fd-bi-opt .dotted{border:1px dotted #000}._fd-bi-opt .double{border:1px double #000}._fd-border-input ._fd-bil-row{display:flex;height:38px;justify-content:center}._fd-border-input ._fd-bil-col{align-items:center;cursor:pointer;display:flex;font-size:16px;height:22px;justify-content:center;margin:8px;width:22px}._fd-border-input ._fd-bil-col.active{color:var(--fc-style-color-1);outline:1px dashed var(--fc-style-color-1)}.line-box{box-sizing:border-box;height:20px;padding:1px;width:150px}.line-box-con{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABAAAAAQCAYAAAAf8/9hAAAAAXNSR0IArs4c6QAAAD5JREFUOE9jZGBg+M+AChjR+HjlQYqHgQFoXibNS+gBBjKMpDAZHAaQ5GQGBgYUV4+mA7QAgaYokgJ14NMBAK1TIAlUJpxYAAAAAElFTkSuQmCC);height:100%;opacity:.3;width:100%}._fd-radius-input{display:flex;flex-direction:column;width:100%}._fd-radius-con{display:flex;flex-wrap:wrap}._fd-radius-item{box-sizing:border-box;padding:5px 0;width:50%}._fd-radius-item,._fd-radius-item ._fd-radius-icon{align-items:center;display:flex;justify-content:center}._fd-radius-item ._fd-radius-icon{height:24px;width:24px}._fd-radius-item ._fd-size-input .el-input-number--small{width:70px}._fd-font-input{display:flex;justify-content:center;padding:0 5px}._fd-fi-box{overflow:hidden;width:150px}._fd-font-input .el-form{grid-column-gap:10px;display:grid;grid-template-columns:repeat(2,1fr);width:100%}._fd-font-input .el-form--inline .el-form-item{margin:0;padding:0}._fd-font-input ._fd-size-input .el-input-number--small{width:100%}._fd-display-input{display:flex;flex-direction:column}._fd-display-input .el-radio-button__inner{padding:4px;width:100%}._fd-display-input .el-radio-button{flex:1}._fd-display-input .is-active i{color:#fff}._fd-display-input .el-radio-button__inner{color:var(--fc-text-color-1)}._fd-display-con{display:flex;flex-wrap:wrap}._fd-display-con.rotate-flag .rotate{display:inline-block;transform:rotate(-90deg)}._fd-display-con.column .icon-justify-flexstart:before{display:inline-block;transform:rotate(180deg)}._fd-display-con.column .icon-justify-flexend:before{display:inline-block;transform:rotate(0)}._fd-display-con.row-reverse .icon-justify-flexstart:before{display:inline-block;transform:rotate(180deg)}._fd-display-con.column-reverse .icon-justify-flexstart:before,._fd-display-con.row-reverse .icon-justify-flexend:before{display:inline-block;transform:rotate(0)}._fd-display-con.column-reverse .icon-justify-flexend:before{display:inline-block;transform:rotate(180deg)}._fd-display-raw{display:flex;flex-direction:column;margin-bottom:5px;width:100%}._fd-shadow-content{align-items:center;display:flex;flex-direction:column;justify-content:space-between;padding:0 5px}._fd-sc-form .fc-icon{font-size:12px}._fd-shadow-content .el-form{grid-column-gap:10px;display:grid;grid-template-columns:repeat(2,1fr);width:100%}._fd-shadow-content .el-form-item{display:grid!important;margin:0!important}._fd-shadow-content .el-input__wrapper{flex:1}._fd-shadow-content ._fd-sc-box{border:1px solid #ccc;border-radius:5px;cursor:pointer;height:250px;overflow:hidden;position:relative;width:250px}._fd-shadow-content ._fd-sc-box .spot{border-radius:100%;height:0;position:absolute;width:0}._fd-shadow-content ._fd-sc-box .spot-id{background:#1989fa;border-radius:100%;height:10px;left:-5px;position:absolute;top:-5px;width:10px;z-index:1}._fd-shadow-content ._fd-sc-box.down .spot-id{box-shadow:1px 1px 10px 2px #1989fa}._fd-shadow-content ._fd-sc-box .center-spot{background:#1989fa;border-radius:100%;height:0;left:125px;position:absolute;top:125px;width:0}._fd-shadow-content ._fd-sc-box .x-hr{background:#ccc;height:1px;position:absolute;top:125px;width:100%}._fd-shadow-content ._fd-sc-box .y-hr{background:#ccc;height:100%;left:125px;position:absolute;width:1px}._fd-shadow-content .el-select__placeholder{text-align:center}._fd-shadow-content .el-input-group__append{padding:0;width:55px}._fd-shadow-content ._fd-color-input,._fd-shadow-content .el-input{width:100%}._fd-shadow-content ._fd-sc-right{margin-top:10px}._fd-shadow-content ._fd-sc-radio{width:100%}._fd-shadow-content ._fd-sc-radio .el-radio-button{display:flex;flex:1}._fd-shadow-content ._fd-sc-radio .el-radio-button__inner{width:100%}._fd-shadow-input ._fd-ci-con{width:150px}._fd-shadow-input :focus-visible{outline:0 none}._fd-si-input .el-input-group__append{display:inline-flex;padding:0;width:24px}._fd-si-input .el-input__wrapper{flex:1}._fd-shadow-input ._fd-ci-con .fc-icon{cursor:pointer}._td-table-opt{width:100%}._td-table-opt .icon-delete{cursor:pointer}._td-table-opt .el-table{z-index:1}._td-table-opt-handle{align-items:center;display:flex;justify-content:space-between;padding-right:5px}._fd-box-space-input{color:#000}._fd-box-space-input ._margin,._fd-box-space-input ._padding{background-color:#f2cea5;box-sizing:border-box;height:180px;padding:40px 55px;position:relative;width:100%}._fd-box-space-input ._margin,html.dark ._fd-box-space-input ._padding{background-color:#a9855c}._fd-box-space-input ._margin{background-color:#c6cf92;height:100px;width:100%}._fd-box-space-input ._fd-input{background-color:unset;border:0;display:inline-block;font-size:12px;height:20px;margin:0;max-width:40px;outline:0 none;padding:0;text-align:center;text-decoration:underline;width:30%}._fd-box-space-input ._fd-input:focus,._fd-box-space-input ._fd-input:hover{background-color:var(--fc-bg-color-3);color:var(--fc-text-color-1);opacity:.9}._fd-box-space-input ._fd-left,._fd-box-space-input ._fd-right{left:7px;margin-top:-10px;position:absolute;top:50%}._fd-box-space-input ._fd-bottom,._fd-box-space-input ._fd-top{left:50%;margin-left:-20px;position:absolute;top:5px}._fd-box-space-input ._fd-bottom{bottom:15px;top:unset}._fd-box-space-input ._fd-right{left:unset;right:2px}._fd-box-space-input ._box{align-items:center;background-color:#94b5c0;display:flex;height:100%;justify-content:center;width:100%}._fd-box-space-input ._margin-title,._fd-box-space-input ._padding-title{left:4px;position:absolute;top:2px}._fd-box-space-input ._fd-help{align-items:center;color:var(--fc-text-color-3);display:flex;position:absolute;right:5px;top:5px}._fd-box-space-input ._padding .fc-icon{color:var(--fc-text-color-1);cursor:pointer;font-size:12px}._fd-box-space-input ._padding .fc-icon+.fc-icon{margin-left:2px}._fd-box-space-input .fc-icon.active{color:var(--fc-style-color-1)}._fd-box-space-input ._fd-x{margin:0 5px}._fd-style-config{display:flex;flex-direction:column;width:100%}._fd-opacity-input ._fd-ci-con{align-items:center;display:flex;justify-content:space-between;width:150px}._fd-opacity-input ._fd-ci-con>span{width:32px}._fd-opacity-input .el-slider{flex:1;margin-right:15px}._fd-style-editor{flex:1;width:100%}._fd-style-editor .CodeMirror,._fd-style-editor>div{height:100%}._fd-gcc,._fd-gcc .el-badge{width:100%}._fd-gcc .el-button{font-weight:400;width:100%}._fd-gcc-con .el-main{padding:0}._fd-gcc-l,._fd-gcc-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-gcc-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-gcc-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-gcc-r{border-left:0}._fd-gcc-r ._fd-gcc-head{justify-content:flex-end}._fd-gcc-l>.el-main,._fd-gcc-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-gcc-r>.el-main{flex-direction:column;padding:20px}._fd-gcc-r>.el-main._fd-gcc-style{padding:0}._fd-gcc-r .el-form-item{margin-bottom:10px!important}._fd-gcc-l .el-menu{border-right:0;border-top:0;overflow:auto;padding:0 10px 5px;width:100%}._fd-gcc-l .el-menu-item.is-active{background:var(--fc-bg-color-3);color:var(--fc-style-color-1)}._fd-gcc-l .el-menu-item{border:1px solid var(--fc-line-color-3);border-radius:5px;height:auto;line-height:1em;margin-top:5px;padding:0}._fd-gcc-default.is-active ._fd-label{color:var(--fc-style-color-1);margin-top:0}._fd-gcc-method{color:#923b76;display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;overflow:hidden;white-space:pre-wrap;width:175px}._fd-gcc-method ._fd-label{color:var(--fc-text-color-3);font-size:12px}._fd-gcc-method span+._fd-label{margin-top:4px}._fd-gcc-title{align-items:center;display:flex;justify-content:space-between;padding:10px 0;width:100%}._fd-gcc-title .el-input{width:160px}._fd-gcc-title .fc-icon{color:var(--fc-text-color-2);font-size:18px;margin-right:6px}._fd-gcc-title .el-input__wrapper{box-shadow:none}._fd-gcc-con .el-menu-item.is-active i{color:var(--fc-text-color-2)}._fd-gvc,._fd-gvc .el-badge{width:100%}._fd-gvc .el-button{font-weight:400;width:100%}._fd-gvc-con .el-main{padding:0}._fd-gvc-l,._fd-gvc-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-gvc-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-gvc-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-gvc-r{border-left:0}._fd-gvc-r ._fd-gvc-head{justify-content:flex-end}._fd-gvc-l>.el-main,._fd-gvc-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-gvc-r>.el-main{flex-direction:column;padding:0}._fd-gvc-l .el-menu{border-right:0;border-top:0;overflow:auto;padding:0 10px 5px;width:100%}._fd-gvc-l .el-menu-item.is-active{background:var(--fc-bg-color-3);color:var(--fc-text-color-2)}._fd-gvc-l .el-menu-item{border:1px solid var(--fc-line-color-3);border-radius:5px;height:auto;line-height:1em;margin-top:5px;padding:0}._fd-gvc-method{color:#923b76;display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;overflow:hidden;white-space:pre-wrap;width:175px}._fd-gvc-method ._fd-label{color:var(--fc-text-color-3);font-size:12px;margin-top:4px}._fd-gvc-title{align-items:center;display:flex;justify-content:space-between;padding:10px 0;width:100%}._fd-gvc-title .el-input{width:160px}._fd-gvc-title .fc-icon{color:var(--fc-text-color-2);font-size:18px;margin-right:6px}._fd-gvc-title .el-input__wrapper{box-shadow:none}._fd-gvc-con .el-menu-item.is-active i{color:var(--fc-text-color-2)}._fc-json-preview{color:var(--fc-text-color-1);display:flex;width:100%}._fc-json-preview .CodeMirror{font-size:12px;height:100%}._fd-struct,._fd-struct .el-badge{width:100%}._fd-struct .el-button{font-weight:400;width:100%}._fd-struct-dialog .CodeMirror{height:500px}._fd-struct-dialog .el-dialog__body{padding:0}._fd-props-input{flex:1;text-align:right}._fd-props-input .fc-icon{cursor:pointer}._fd-lc-body,._fd-lc-header{padding:0 12px}._fd-lc-body{overflow:auto}._fd-lc-header{display:flex;justify-content:flex-end;margin-bottom:12px}._fd-language-config .el-table__cell{height:34px}._fd-lc-handle{align-items:center;cursor:pointer;display:flex;justify-content:space-between}._fd-slots-config .el-input{margin-left:5px;min-width:170px;width:170px}._fd-slots-config .el-select{width:60px}._fd-slots-config .el-select input,._fd-slots-config .fc-icon{cursor:pointer}._fd-slots-config .el-input-group__append{padding:0 5px}._fd-slots-icons{grid-gap:10px;display:grid;grid-template-columns:repeat(13,1fr);width:100%}._fd-slots-icon{color:var(--fc-text-color-1);cursor:pointer;text-align:center}._fd-slots-config-pop{max-height:320px;overflow:auto}._fd-quick-layout-content{grid-column-gap:10px;display:grid;grid-template-columns:repeat(4,1fr);width:100%}._fd-quick-layout-content>div{cursor:pointer;display:flex;flex-direction:column;font-size:12px;text-align:center}._fd-quick-layout-content>div:hover{color:var(--fc-style-color-1)}._fd-quick-layout-content i{font-size:24px}._fd-print .el-button{font-weight:400;width:100%}._fd-print-con .el-main{padding:0}._fd-print-l,._fd-print-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-print-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-print-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-print-r{border-left:0}._fd-print-r ._fd-print-head{justify-content:flex-end}._fd-print-l>.el-main,._fd-print-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:column;min-width:0;padding:10px;width:100%}._fd-print-l .el-form .el-radio-button__inner,._fd-print-l .el-form .el-radio-group{width:100%}._fd-print-l .el-form .el-radio-button{flex:1}._fd-print-r>.el-main{flex-direction:column;padding:20px;position:relative}._fd-print-form{box-sizing:border-box;padding:2px}._fd-print-form .el-input__wrapper,._fd-print-form .el-select__wrapper,._fd-print-form .el-textarea__inner{border:1px solid var(--el-input-border-color,var(--el-border-color));box-shadow:none!important}._fd-print-form .el-select__placeholder{position:unset!important;top:unset!important;transform:unset!important}._fd-print-form .is-disabled .el-input__wrapper{background-color:unset!important}._fd-print-form .is-disabled .el-input__inner{color:unset!important}._fd-print-form-word .el-input__wrapper,._fd-print-form-word .el-select__wrapper,._fd-print-form-word .el-textarea__inner{border:none!important;border-color:inherit!important;border-radius:0!important}._fd-print-form-word .el-input-number__decrease,._fd-print-form-word .el-input-number__increase{display:none!important}._fd-print-form-word ._fc-read-view{border-bottom:1px solid var(--el-input-border-color,var(--el-border-color))!important;border-color:inherit!important;display:block;height:1.5em;line-height:1.5em;padding:0 4px;width:100%}._fd-print-page-line{border-bottom:1px dashed var(--fc-line-color-3);box-sizing:border-box;color:var(--fc-text-color-3);font-size:12px;height:1px;left:0;line-height:2em;padding-left:4px;position:absolute;right:0;z-index:1}._fd-ai-chat{box-sizing:border-box;display:flex;flex-direction:column;font-size:12px;height:100%;padding:12px}._fd-ai-chat-header{border:1px solid var(--fc-line-color-3);border-radius:6px}._fd-ai-chat-prompt{display:flex;justify-content:space-between;padding:8px 12px 10px}._fd-ai-chat-prompt .fc-icon{font-size:12px;margin-right:2px}._fd-ai-chat-refresh{color:var(--fc-style-color-1);cursor:pointer}._fd-ai-chat-question{align-items:center;background:var(--fc-bg-color-2);border-radius:6px;color:var(--fc-text-color-2);cursor:pointer;display:flex;justify-content:space-between;margin:0 12px 12px;padding:7px 10px}._fd-ai-chat-question+._fd-ai-chat-question{margin-top:6px}._fd-ai-chat-question .fc-icon{margin-left:12px}._fd-ai-chat-question .icon-down:before{display:inline-block;transform:rotate(-90deg)}._fd-ai-chat-history{display:flex;flex:1;flex-direction:column;margin-top:12px;overflow:auto}._fd-ai-chat-history-chat{align-items:flex-end;display:flex;flex-direction:column;margin-bottom:10px}._fd-ai-chat-history-chat>div{background:var(--fc-style-bg-color-1);border-radius:6px 0 6px 6px;color:var(--fc-style-color-1);max-width:70%;padding:10px;white-space:pre-wrap}._fd-ai-chat-history-status{align-items:flex-start;display:flex;flex-direction:column;margin-bottom:10px}._fd-ai-chat-history-status>div{background:var(--fc-bg-color-2);border-radius:0 6px 6px;color:var(--fc-text-color-2);max-width:70%;overflow:hidden;padding:10px;position:relative}._fd-ai-chat-history-status>div>div{align-items:center;display:flex;position:relative;z-index:1}._fd-ai-chat-history-status.loading>div:after{animation:b 3s linear infinite;background:linear-gradient(0deg,var(--fc-style-color-1) 0,var(--fc-style-color-4) 100%);bottom:-2px;content:"";filter:blur(5px);left:-2px;padding:1px;position:absolute;right:-2px;top:-2px}._fd-ai-chat-history-status.loading>div{border-radius:0 6px 6px;padding:1px}._fd-ai-chat-history-status.loading>div>div{background-color:var(--fc-bg-color-1);border-radius:0 6px 6px;padding:7px 10px}._fd-ai-chat-history-status.success>div{background:var(--fc-style-bg-color-2);color:var(--fc-style-color-2)}._fd-ai-chat-history-status .fc-icon{background:var(--fc-style-color-2);border-radius:15px;color:#fff;font-size:14px;height:15px;margin-right:5px;text-align:center;width:15px}._fd-ai-chat-history-status.fail>div{background:var(--fc-style-bg-color-3);color:var(--fc-style-color-3)}._fd-ai-chat-history-status.fail .fc-icon{background:var(--fc-style-color-3)}._fd-ai-chat-input{border-radius:6px;margin-top:12px;position:relative;width:100%}._fd-ai-chat-clear{margin-bottom:6px;text-align:right}._fd-ai-chat-clear .el-button{margin-right:2px;padding:0}._fd-ai-chat-clear .fc-icon{font-size:13px}._fd-ai-chat-input .el-textarea{box-sizing:border-box;height:120px;padding:1px;position:relative}._fd-ai-chat-input .el-textarea:before{background:linear-gradient(135deg,var(--fc-style-color-1),var(--fc-style-color-4));border-radius:6px;bottom:0;content:"";left:0;position:absolute;right:0;top:0}._fd-ai-chat-input .el-textarea__inner{background:var(--fc-bg-color-1);border-radius:6px;box-shadow:none;height:100%;resize:none}._fd-ai-chat-input>.fc-icon{align-items:center;background:var(--fc-style-color-1);border-radius:15px;bottom:12px;color:#fff;cursor:pointer;display:flex;font-size:14px;height:20px;justify-content:center;position:absolute;right:12px;text-align:center;width:20px}._fd-ai-chat-input .icon-suspend{background:linear-gradient(90deg,var(--fc-style-color-1) 0,var(--fc-style-color-4) 100%)}._fd-ai-chat-input .disabled{background:var(--fc-text-color-3)}@keyframes b{0%{transform:rotate(0)}to{transform:rotate(1turn)}}.m-title{align-items:center;color:#1f2329;flex-direction:row;font-weight:500;height:28px;justify-content:space-between;padding-top:8px;width:100%}.m-title,.tree-row-item{display:flex;font-size:12px;font-style:normal;line-height:20px}.tree-row-item{font-weight:400;overflow-x:hidden;padding-right:11px;text-overflow:ellipsis;white-space:nowrap;word-break:break-all}._fd-drag-tool{word-wrap:break-word;box-sizing:border-box;display:block;min-height:20px;min-width:0;outline:1px dashed var(--fc-tool-border-color);overflow:hidden;padding:2px;position:relative;word-break:break-all;z-index:0}._fd-drag-tool ._fd-drag-tool{margin:2px;max-height:calc(100% - 7px);max-width:calc(100% - 4px)}._fd-drag-tool.is-inline{display:inline-block}._fd-drag-tool.is-inside{height:inherit;width:inherit}._fd-drag-tool:hover{outline-color:var(--fc-style-color-1);outline-style:solid;z-index:1}._fd-drag-tool:has(._fd-drag-tool:hover){outline-style:dashed}._fd-drag-tool:not(.active):hover>div>._fd-drag-btn{display:flex!important;opacity:.7}._fd-drag-tool:has(._fd-drag-tool:not(.active):hover,._fd-drag-tool.active:hover)>div>._fd-drag-btn{display:none!important}._fd-drag-tool:has(._fd-drag-tool){padding:2px}._fd-drag-tool+._fd-drag-tool{margin-top:5px}._fd-drag-tool.active{min-height:36px;min-width:80px;outline:2px solid var(--fc-style-color-1)!important;z-index:2}._fd-drag-tool.active>div>._fd-drag-btn{display:flex}._fd-drag-tool._fd-drop-hover ._fd-drag-box{padding-bottom:15px!important;padding-top:15px!important}._fd-drag-tool._fd-drop-hover:hover{outline:1px dashed var(--fc-tool-border-color)}._fd-drag-tool ._fd-drag-btn{display:none}._fd-drag-r{padding:0 2px 2px 0;right:0;top:calc(100% - 20px)}._fd-drag-l,._fd-drag-r{position:absolute;z-index:4}._fd-drag-l{left:0;top:0}._fd-drag-btn{align-items:center;background-color:var(--fc-style-color-1);color:#fff;cursor:pointer;float:left;height:18px;justify-content:center;line-height:20px;padding-bottom:1px;width:18px}._fd-drag-btn .el-dropdown{color:#fff}._fd-drag-btn+._fd-drag-btn{margin-left:2px}._fd-drag-danger{background-color:var(--fc-style-color-3)}._fd-drag-btn i{font-size:14px}._fd-drag-hidden,._fd-drag-mask{bottom:0;left:0;position:absolute;right:0;top:0;z-index:3}._fd-drag-hidden{align-items:center;background:rgba(51,51,51,.7);color:#fff;display:flex;font-size:14px;justify-content:center}._fd-drag-tool.active ._fd-drag-hidden,._fd-drag-tool:has(._fd-drag-tool.active) ._fd-drag-hidden,._fd-drag-tool:hover ._fd-drag-hidden{display:none}._fd-drag-hidden .fc-icon{margin-right:5px}._fd-html-editor{width:100%}._fd-html-editor>.el-button{font-weight:400;width:100%}._fd-html-editor-con .CodeMirror{height:450px}._fd-html-editor-con .CodeMirror-line{font-size:13px!important;line-height:16px!important}._fd-html-editor-con .CodeMirror-lint-tooltip{z-index:1!important}._fd-html-editor-con .el-dialog__body{padding:0 20px}._fd-field-input{position:relative;width:100%}._fd-field-input>.fc-icon{color:#a8abb2;cursor:pointer;height:24px;position:absolute;right:28px;text-align:center;top:1px;width:24px;z-index:1}._fd-field-input .el-input-group__append{color:var(--fc-text-color-3);cursor:pointer;margin:0;padding:0;width:25px}._fd-field-popper .el-tree-node__content{color:#333;padding:2px 0}._fd-field-popper .el-select-dropdown__list>.el-select-dropdown__item{border-bottom:1px solid var(--fc-line-color-3);box-sizing:border-box;height:26px;padding-left:15px}._fd-list-input{width:100%}._fd-list-input .el-input-group__append{padding:0 10px}._fd-list-input .fc-icon{cursor:pointer}._fd-fetch-config,._fd-fetch-config .el-badge{width:100%}._fd-fetch-config .el-button{font-weight:400;width:100%}._fd-fetch-dialog .el-tabs__header{margin-bottom:0}._fd-fetch-dialog .form-create{margin-top:15px}._fd-fetch-dialog ._fc-tabs{display:flex}._fd-fetch-dialog ._fc-tabs .el-tabs__content{display:flex;flex:1;overflow:auto}._fd-fetch-info{background:hsla(0,0%,67%,.1);border-radius:6px;color:var(--fc-text-color-2);display:flex;font-size:12px;line-height:18px;margin-left:15px;margin-top:8px;padding:8px 13px;position:relative}._fd-fetch-con .el-main{padding:0}._fd-fetch-con .CodeMirror{height:100%;width:100%}._fd-fetch-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-table-column-config,._fd-table-column-config .el-badge{width:100%}._fd-table-column-config .el-button{font-weight:400;width:100%}._fd-tcc-dialog .flex{display:flex;width:100%}._fd-tcc-dialog .el-dialog__body{height:500px;overflow:auto}._fd-tcc-dialog ._fd-fn{height:100%}._fd-tcc-table .fc-icon{cursor:pointer}._fd-tcc-table .fc-icon+.fc-icon{margin-left:4px}._fd-tcc-table .cell{align-items:center;display:flex;flex-direction:row}._fd-tcc-table .el-table__indent{padding-left:8px!important}._fd-table-button-config,._fd-table-button-config .el-badge{width:100%}._fd-table-button-config .el-button{font-weight:400;width:100%}._fd-tcb-dialog .el-dialog__body{height:500px;overflow:auto}._fd-tcb-btn{cursor:pointer;display:flex}._fd-fn-list,._fd-fn-list .el-badge{width:100%}._fd-fn-list .el-button{font-weight:400;width:100%}._fd-fn-list-con .el-main{padding:0}._fd-fn-list-l,._fd-fn-list-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-fn-list-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-fn-list-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-fn-list-r{border-left:0}._fd-fn-list-r ._fd-fn-list-head{justify-content:flex-end}._fd-fn-list-l>.el-main,._fd-fn-list-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-fn-list-r>.el-main{flex-direction:column}._fd-fn-list-l .el-menu{border-right:0;border-top:0;overflow:auto;padding:0 10px 5px;width:100%}._fd-fn-list-l .el-menu-item.is-active{background:var(--fc-bg-color-3);color:var(--fc-text-color-2)}._fd-fn-list-l .el-menu-item{border:1px solid var(--fc-line-color-3);border-radius:5px;height:auto;line-height:1em;margin-top:5px;padding:0}._fd-fn-list-method{display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;line-height:1em;overflow:hidden;padding:10px 20px 10px 0;position:relative;white-space:pre-wrap;width:100%}._fd-fn-list-method ._fd-label{color:var(--fc-text-color-3);font-size:12px;margin-top:4px}._fd-fn-list-method ._fd-dot{background:#00c050;border-radius:15px;display:block;height:6px;margin-top:-3px;position:absolute;right:16px;top:50%;width:6px}._fd-fn-list-method-info>span:first-child,._fd-fn-list-method>span:first-child{color:#9d238c}._fd-fn-list-method-info>span:first-child>span,._fd-fn-list-method>span:first-child>span{color:var(--fc-text-color-1);margin-left:10px}._fd-fn-list-con .CodeMirror{height:100%;width:100%}._fd-fn-list-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-fn-input,._fd-fn-input .el-badge{width:100%}._fd-fn-input .el-button{font-weight:400;width:100%}._fd-fn-input-dialog .CodeMirror-lint-tooltip{z-index:1!important}._fd-fn-input-dialog .el-dialog__body{height:500px;padding:0}._fd-gfs{align-items:center;display:flex;width:100%}._fd-gfs .el-select{width:190px}._fd-gfs-handle{display:inline-flex;height:14px;line-height:14px}._fd-gfs-handle .fc-icon{color:var(--fc-style-color-1);cursor:pointer;margin-left:4px}._fd-gfs-handle .icon-refresh.disabled{color:#a9abb2;cursor:not-allowed}._fd-gfs-handle ._fc-manage-text{border-left:1px solid var(--fc-line-color-3);padding-left:4px}._fd-gcs{align-items:center;display:flex;width:100%}._fd-gcs .el-select{width:190px}._fd-gcs-handle{display:inline-flex;height:14px;line-height:14px}._fd-gcs-handle ._fc-manage-text{border-left:1px solid var(--fc-line-color-3);padding-left:4px}._fd-fetch-table{width:100%}._fd-fetch-table .el-button>span{font-size:12px;font-weight:400}._fd-fetch-table-con{border:1px solid var(--fc-line-color-3);border-bottom:0;display:flex;flex:1;flex-direction:column;height:100%}._fd-fetch-table-con .el-header{align-items:center;background:var(--fc-bg-color-3);color:var(--fc-text-color-1);display:flex;height:30px;padding-left:12px}._fd-fetch-table-row{align-items:center;border-bottom:1px solid var(--fc-line-color-3);display:flex;min-height:34px;padding:0 10px 4px}._fd-fetch-table-row>.fc-icon{align-items:center;color:var(--fc-text-color-2);cursor:pointer;display:flex;font-size:18px;height:24px;justify-content:center;margin-left:12px;margin-top:4px;width:24px}._fd-fetch-table-row .el-input{display:flex;flex:1;font-size:13px;margin-top:4px}._fd-fetch-table-key{margin-right:15px;width:calc(40% - 20px)}._fd-table-view{overflow:auto}._fd-table-view-cell{background:var(--fc-bg-color-1);border:1px inset rgba(0,0,0,.1);height:100%;min-height:50px}._fd-table-view-cell>._fd-drag-tool{border:0;height:100%;margin:0;max-height:100%;max-width:100%;min-width:unset;width:100%}._fd-table-view-btn{flex-direction:column;padding:0}._fd-table-view-btn .fc-icon{color:#fff;font-size:16px;width:18px}._fd-table-view-icon{color:#fff;display:flex;height:100%;justify-content:center;margin-top:1px;width:100%}._fd-table-view>table{border-bottom:1px solid #ebeef5;border-right:1px solid #ebeef5;border-color:#ebeef5 currentcolor currentcolor #ebeef5;border-style:solid none none solid;border-width:1px 0 0 1px;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fd-table-view tr{min-height:50px}._fd-table-view td{border-bottom:0;border-right:0;border-color:currentcolor #ebeef5 #ebeef5 currentcolor;border-style:none solid solid none;border-width:0 1px 1px 0;box-sizing:border-box;min-height:50px;min-width:80px;overflow-wrap:break-word;padding:0;position:relative;white-space:nowrap}._fd-tableCell-drag{height:100%}._fd-table-view.is-mini td{min-height:12px;padding:0}._fd-table-view.is-mini .el-form-item{margin:0;padding:0}._fd-value{color:var(--fc-text-color-3);white-space:nowrap}._fd-json-container{--fc-json-mask:" ";display:flex;flex:1;flex-direction:column;flex-wrap:wrap;justify-content:center;min-height:20px;position:relative}._fd-json-container ._fd-dialog,._fd-json-container ._fd-drawer,._fd-json-container ._fd-popup{display:none}._fd-language-list{max-height:320px;overflow:auto;padding-top:70px}._fd-language-input .el-input-group__append{color:var(--fc-text-color-3);cursor:pointer;margin:0;padding:0;width:25px}._fd-language-input.is-variable input{color:var(--fc-style-color-1)}._fd-language-header,._fd-language-item{border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:0 12px}._fd-language-header{background-color:var(--fc-bg-color-1);color:var(--fc-text-color-1);flex-direction:column;font-weight:500;left:0;overflow:auto;padding-top:10px;position:absolute;right:0;top:0}._fd-language-item>div,._fd-language-name>div{flex:1;font-size:12px;min-width:70px;padding:5px}._fd-language-title{margin:6px 0}._fd-language-title .fc-icon{color:var(--fc-style-color-1);cursor:pointer;font-size:14px}._fd-language-name{display:flex}._fd-language-name>div{color:var(--fc-text-color-3);overflow:hidden;text-overflow:ellipsis;white-space:nowrap}._fd-language-item{cursor:pointer}._fd-language-item:hover{background-color:var(--fc-style-bg-color-1);color:var(--fc-style-color-1)}._fd-language-popover{padding:0!important}._fd-validate{display:flex;flex-direction:column;width:100%}._fd-validate-btn{font-weight:400;width:100%}._fd-validate-pop .el-dropdown-menu__item{width:248px}._fd-validate-item{border-bottom:1px dashed var(--fc-line-color-3);margin-bottom:10px}._fd-validate-item .el-col-12:first-child{padding-right:5px}._fd-validate-item .el-col-12+.el-col-12{padding-left:5px}._fd-validate-item .el-input-number{width:100%}._fd-validate-title{display:flex;flex-direction:row;justify-content:space-between;margin-bottom:10px}._fd-validate-title>div{align-items:center;display:flex}._fd-validate-title>div>span{background:var(--fc-bg-color-3);border-radius:15px;font-size:12px;height:16px;line-height:16px;margin-right:5px;text-align:center;width:16px}._fd-validate-title i{cursor:pointer}._fd-validate-title i:hover{color:var(--fc-style-color-3)}._fd-validate .append-msg{cursor:pointer}._fd-validate .el-input-group__append{padding:0 10px}._fd-required{align-items:center;display:flex;width:100%}._fd-required .el-input{margin-left:15px}._fd-required .el-switch{height:28px}._fd-tree-opt ._fd-tree-opt-btn{background-color:var(--fc-style-color-1);color:#fff;cursor:pointer;float:left;height:19px;justify-content:center;line-height:20px;padding-bottom:1px;text-align:center;width:18px}._fd-tree-opt-node{align-items:center;display:flex}._fd-tree-opt-first{margin-right:5px;width:60px}._fd-tree-opt-last{width:165px}._fd-tree-opt-last._label{width:175px}._fd-tree-opt-last._label .el-input-group__append{width:65px}._fd-tree-opt ._fd-tree-opt-danger{background-color:var(--fc-style-color-3);border-radius:0 2px 2px 0}._fd-tree-opt .el-tree-node__content{height:28px;margin-bottom:3px}._fd-tree-opt .el-input__inner{border-right:0}._fd-tree-opt .el-input-group__append{background:var(--fc-bg-color-1);padding-left:1px;padding-right:2px;width:90px}._fc-step-form{width:100%}._fc-step-form>.el-steps{margin-bottom:20px}._fc-step-form .el-step .el-step__head{line-height:1.4}._fd-step-form{width:100%}._fd-step-form .el-step{cursor:pointer}._fd-step-form>.el-steps{margin-bottom:20px}._fd-step-form .el-step .el-step__head{line-height:1.4}._fd-table-form{background:var(--fc-bg-color-1);border:1px solid var(--fc-line-color-3);width:100%}._fc-child-empty,._fd-table-form{min-height:130px}._fd-tf-wrap{display:flex;overflow:auto}._fd-tf-wrap>._fd-drag-tool{display:flex;flex-shrink:0;height:auto;margin:2px;overflow:auto}._fd-ntable-form{background:var(--fc-bg-color-1);border:1px solid var(--fc-line-color-3);min-height:130px;width:100%}._fd-ntable-sub .el-form-item__label,._fd-ntable-sub .van-field__label{display:none}._fd-ntable-form ._fc-child-empty{min-height:130px}._fd-ntf-wrap{display:flex;overflow:auto}._fd-ntf-wrap>._fd-drag-tool{display:flex;flex-shrink:0;height:auto;margin:2px}._fd-ntable-sub ._title{background-color:var(--fc-bg-color-3);border-radius:8px 8px 0 0;color:#65676b;display:inline-block;font-size:12px;height:20px;line-height:1em;margin-left:2px;padding:6px 8px 0;text-align:center}._fd-ntable-sub>._fd-drag-tool{margin-top:0}._fd-itable-form{background:var(--fc-bg-color-1);border:1px solid var(--fc-line-color-3);min-height:130px;width:100%}._fd-itable-form ._fc-child-empty{min-height:130px}._fd-itf-wrap{display:flex;overflow:auto}._fd-itf-wrap>._fd-drag-tool{display:flex;flex-shrink:0;height:auto;margin:2px}._fd-tf-col ._fd-tf-con .el-form-item{margin-bottom:1px!important}._fd-tf-col{display:flex;flex-direction:column;flex-shrink:0;flex-wrap:wrap;width:180px}._fd-tf-con .el-form-item__label,._fd-tf-con .van-field__label{display:none!important}._fd-tf-con{display:flex;flex:1;width:100%}._fd-tf-con .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fd-tf-title{align-items:center;border-bottom:1px solid #ebeef5;display:flex;height:40px;margin-bottom:0;padding-left:5px}._fd-tf-required{color:#f56c6c;margin-right:4px}._fd-tf-con ._fc-l-item{display:flex;flex-shrink:0;margin-top:4px;width:100%}._fd-tf-con ._fc-l-item>*{display:none!important}._fd-tf-con .el-cascader,._fd-tf-con .el-date-editor,._fd-tf-con .el-input-number,._fd-tf-con .el-select,._fd-tf-con .el-slider{width:100%}._fd-tf-col:has(._fd-tf-col){width:auto!important}._fd-tf-con>._fd-tableFormColumn2-drag:has(._fd-tf-col){display:flex!important;flex-direction:row!important;flex-wrap:nowrap!important}._fd-tf-con>._fd-tableFormColumn2-drag:has(._fd-tf-col)>._fd-drag-item{flex:unset}._fd-step-form-item>._fd-drag-tool{min-height:200px}._fd-dialog.el-dialog{margin:10px;width:calc(100% - 20px)}._fd-dialog .el-dialog__headerbtn{align-items:center;color:var(--el-color-info);display:flex;justify-content:center}._fd-dialog .el-dialog__headerbtn:hover .fc-icon{color:var(--el-color-primary)}._fd-dialog .el-dialog__body>._fd-drag-box{align-content:flex-start;align-items:flex-start;box-sizing:border-box;display:flex;flex-wrap:wrap;height:calc(var(--fc-dialog-height) - 125px);justify-content:flex-start;outline:1px dashed var(--fc-tool-border-color);overflow:auto;position:relative}._fd-drawer.el-drawer{box-shadow:unset;width:100%}._fd-drawer .el-drawer__header{border-bottom:1px solid var(--fc-line-color-3);color:#333;font-size:15px;font-weight:600;margin-bottom:0;padding:14px 24px 14px 20px}._fd-drawer .el-drawer__body{padding:12px}._fd-drawer .el-drawer__close-btn{color:#909399;font-size:14px}._fd-drawer .el-drawer__footer{box-shadow:0 -2px 4px #0000000d;padding:10px 0;text-align:center}._fd-drawer .el-drawer__body>._fd-drag-box{align-content:flex-start;align-items:flex-start;box-sizing:border-box;display:flex;flex-wrap:wrap;height:calc(var(--fc-drawer-height) - 105px);justify-content:flex-start;outline:1px dashed var(--fc-tool-border-color);overflow:auto;position:relative}._fc-drawer .el-drawer__header{border-bottom:1px solid var(--fc-line-color-3);color:#333;font-size:15px;font-weight:600;margin-bottom:0;padding:14px 24px 14px 20px}._fc-drawer .el-drawer__body{padding:10px 24px 50px}._fc-drawer .el-drawer__close-btn{color:#909399;font-size:14px}._fc-drawer .el-drawer__footer{background:var(--fc-bg-color-1);bottom:0;box-shadow:0 -2px 4px #0000000d;left:0;padding:10px 0;position:absolute;right:0;text-align:center;width:100%;z-index:1}._fd-cell{display:inline-block}._fd-cell.is-new{width:100%!important}._fd-cell>div{box-sizing:border-box}._fd-cell>div>._fd-drag-tool.is-inline,._fd-cell>div>._fd-drag-tool>._fd-drag-box{align-content:var(--fc-cell-alignContent)!important;align-items:var(--fc-cell-alignItems)!important;display:var(--fc-cell-display)!important;flex-direction:var(--fc-cell-flexDirection)!important;flex-wrap:var(--fc-cell-flexWrap)!important;justify-content:var(--fc-cell-justifyContent)!important}._fd-cell>div>._fd-drag-item:has(>._fd-drag-tool>.el-col-24,>.el-col-24),._fd-cell>div>._fd-drag-tool>._fd-drag-box>._fd-drag-item:has(>._fd-drag-tool>.el-col-24,>.el-col-24){flex:none}._fd-cell .el-cascader,._fd-cell .el-date-editor,._fd-cell .el-input-number,._fd-cell .el-select,._fd-cell .el-slider,._fd-row{width:100%}._fd-hide-config{align-items:center;color:var(--fc-text-color-2);cursor:pointer;display:flex}._fd-hide-config .fc-icon{margin-right:3px}._fd-hide-config.active{color:var(--fc-style-color-1)}._fd-hide-config.disabled{color:var(--fc-text-color-3);cursor:not-allowed}._fd-span-input{width:100%}._fd-span-input .el-radio-button__inner{line-height:16px;padding:4px;width:100%}._fd-span-input .el-radio-button{flex:1}._fc-city .el-select{width:150px}.form-create-m ._fc-city,.form-create-m ._fc-city .el-select{width:100%}.form-create ._fc-city .el-select+.el-select{margin-left:12px}._fc-signature{width:100%}._fc-signature-btn,._fc-signature-preview{background:#fff;border:1px dashed #d4d7e0;border-radius:4px;box-sizing:border-box;color:#c9ccd8;font-size:14px;height:88px;line-height:88px;min-width:160px;position:relative;text-align:center;width:100%}._fc-signature-btn{cursor:pointer}._fc-signature-preview>img{display:inline-block;height:88px}._fc-signature-preview .icon-delete2{cursor:pointer;display:inline-block;font-size:14px;line-height:14px;position:absolute;right:9px;top:9px}._fc-signature-btn i{font-size:14px}._fc-signature-dialog .el-dialog__body{text-align:center}._fc-signature-pad{background-image:linear-gradient(#fff 14px,transparent 0),linear-gradient(90deg,#fff 14px,#d4d7e0 0);background-size:15px 15px;border:1px dashed #d4d7e0;border-radius:4px}._fd-data-select{width:100%}._fd-data-select>.el-dialog{margin:10px;width:calc(100% - 20px)}:root{--fc-drag-empty:"\\62d6\\62fd\\5de6\\4fa7\\5217\\8868\\4e2d\\7684\\7ec4\\4ef6\\5230\\6b64\\5904";--fc-child-empty:"\\70b9\\51fb\\53f3\\4e0b\\89d2 \\e789 \\6309\\94ae\\6dfb\\52a0\\4e00\\5217";--fc-text-color-1:#262626;--fc-text-color-2:#666;--fc-text-color-3:#aaa;--fc-bg-color-1:#fff;--fc-bg-color-2:#f5f5f5;--fc-bg-color-3:#ececec;--fc-line-color-1:#ddd;--fc-line-color-2:#d9d9d9;--fc-line-color-3:#ececec;--fc-style-color-1:#2e73ff;--fc-style-bg-color-1:rgba(46,115,255,.05);--fc-style-color-2:#00c050;--fc-style-bg-color-2:rgba(0,192,80,.05);--fc-style-color-3:#ff2e2e;--fc-style-bg-color-3:rgba(255,46,46,.05);--fc-style-color-4:#4efdb7;--fc-style-bg-color-4:rgba(78,253,183,.05);--fc-grid-line-color:rgba(0,0,0,.05)}html.dark{--fc-text-color-1:#e5eaf3;--fc-text-color-2:#cfd3dc;--fc-text-color-3:#6c6e72;--fc-bg-color-1:#0a0a0a;--fc-bg-color-2:#191919;--fc-bg-color-3:#2b2b2c;--fc-line-color-1:#393a3c;--fc-line-color-2:#636466;--fc-line-color-3:#2b2b2c;--fc-grid-line-color:hsla(0,0%,100%,.15)}._fc-designer,._fd-config-dialog{--el-color-primary:#2e73ff;--el-color-primary-light-3:#69f;--el-color-primary-light-5:#9bf;--el-color-primary-light-7:#ccdfff;--el-color-primary-light-8:#e0ebff;--el-color-primary-light-9:#ccdfff;--el-color-primary-dark-2:#265fcc;--el-color-success:#00c050;--el-color-success-light-3:#4ddb82;--el-color-success-light-5:#80e6a3;--el-color-success-light-7:#b3f1c5;--el-color-success-light-8:#ccf6d5;--el-color-success-light-9:#e6fae6;--el-color-success-dark-2:#00a046;--el-color-danger:#ff2e2e;--el-color-danger-light-3:#f66;--el-color-danger-light-5:#f99;--el-color-danger-light-7:#fcc;--el-color-danger-light-8:#ffd9d9;--el-color-danger-light-9:#ffe6e6;--el-color-danger-dark-2:#cc2626;--el-menu-hover-bg-color:var(--el-color-primary-light-9)}._fc-designer .el-button--primary,._fd-config-dialog .el-button--primary{--el-button-bg-color:var(--el-color-primary);--el-button-text-color:var(--el-color-white);--el-button-border-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-color-primary-light-3);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-border-color:var(--el-color-primary-light-3);--el-button-active-bg-color:var(--el-color-primary-dark-2);--el-button-active-border-color:var(--el-color-primary-dark-2)}._fc-designer .el-button--primary.is-plain,._fd-config-dialog .el-button--primary.is-plain{--el-button-bg-color:var(--el-color-primary-light-8);--el-button-text-color:var(--el-color-primary);--el-button-border-color:var(--el-color-primary-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-primary);--el-button-hover-border-color:var(--el-color-primary);--el-button-active-bg-color:var(--el-color-primary-dark-2);--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:var(--el-color-primary-dark-2)}._fc-designer .el-button--primary.is-link,._fd-config-dialog .el-button--primary.is-link{--el-button-text-color:var(--el-color-primary)}._fc-designer .el-button--success,._fd-config-dialog .el-button--success{--el-button-bg-color:var(--el-color-success);--el-button-text-color:var(--el-color-white);--el-button-border-color:var(--el-color-success);--el-button-hover-bg-color:var(--el-color-success-light-3);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-border-color:var(--el-color-success-light-3);--el-button-active-bg-color:var(--el-color-success-dark-2);--el-button-active-border-color:var(--el-color-success-dark-2)}._fc-designer .el-button--success.is-plain,._fd-config-dialog .el-button--success.is-plain{--el-button-bg-color:var(--el-color-success-light-8);--el-button-text-color:var(--el-color-success);--el-button-border-color:var(--el-color-success-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-success);--el-button-hover-border-color:var(--el-color-success);--el-button-active-bg-color:var(--el-color-success-dark-2);--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:var(--el-color-primary-dark-2)}._fc-designer .el-button--success.is-link,._fd-config-dialog .el-button--success.is-link{--el-button-text-color:var(--el-color-success)}._fc-designer .el-button--danger,._fd-config-dialog .el-button--danger{--el-button-bg-color:var(--el-color-danger);--el-button-text-color:var(--el-color-white);--el-button-border-color:var(--el-color-danger);--el-button-hover-bg-color:var(--el-color-danger-light-3);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-border-color:var(--el-color-danger-light-3);--el-button-active-bg-color:var(--el-color-danger-dark-2);--el-button-active-border-color:var(--el-color-danger-dark-2)}._fc-designer .el-button--danger.is-plain,._fd-config-dialog .el-button--danger.is-plain{--el-button-bg-color:var(--el-color-danger-light-8);--el-button-text-color:var(--el-color-danger);--el-button-border-color:var(--el-color-danger-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-danger);--el-button-hover-border-color:var(--el-color-danger);--el-button-active-bg-color:var(--el-color-danger-dark-2);--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:var(--el-color-primary-dark-2)}._fc-designer .el-button--danger.is-link,._fd-config-dialog .el-button--danger.is-link{--el-button-text-color:var(--el-color-danger)}._fd-plain-button{border-color:var(--fc-style-color-1);color:var(--fc-style-color-1)}._fc-designer .CodeMirror-gutters,._fd-config-dialog .CodeMirror-gutters{background-color:var(--fc-bg-color-3);border-right-color:var(--fc-line-color-2)}._fc-designer .CodeMirror-scroll,._fd-config-dialog .CodeMirror-scroll{background-color:var(--fc-bg-color-2);caret-color:var(--fc-text-color-1);color:var(--fc-text-color-1)}._fd-config-dialog .CodeMirror-scroll{background-color:var(--el-bg-color)}._fc-designer{--fc-tool-border-color:var(--fc-line-color-1);background-color:var(--fc-bg-color-1);cursor:default;height:100%;min-height:500px;overflow:hidden;position:relative}._fc-designer>.el-main{bottom:0;left:0;padding:0;position:absolute;right:0;top:0}._fc-l-menu{border-right:1px solid var(--fc-line-color-3);border-top:1px solid var(--fc-line-color-3);flex-direction:column}._fc-l-menu,._fc-l-menu-item{align-items:center;display:flex}._fc-l-menu-item{box-sizing:border-box;cursor:pointer;height:40px;justify-content:center;width:100%}._fc-l-menu-item.active{color:var(--fc-style-color-1)}._fc-l-menu-form{border-bottom:1px solid var(--fc-line-color-3)}._fc-l-menu-item i{font-size:22px}._fc-l-menu-item i:hover{color:var(--fc-style-color-1)}._fc-l-menu-item .el-badge__content{--el-badge-size:15px;--el-badge-padding:4px;background-color:var(--fc-style-color-1)}._fc-l-label{color:var(--fc-text-color-1);font-size:14px;font-weight:500;line-height:17px;margin-top:5px;padding:10px 12px}._fc-l-info{color:var(--fc-text-color-3);font-size:12px;font-style:normal;font-weight:400;line-height:17px;text-align:left}._fc-l-global,._fc-l-info{padding:0 12px}._fc-l-global ._fc-l-label{font-size:12px;font-weight:400;margin-bottom:8px;margin-top:14px;padding:0}._fc-m .form-create>.el-row>._fd-drag-box{align-content:flex-start;align-items:flex-start;box-sizing:border-box;display:flex;flex-wrap:wrap;justify-content:flex-start;position:relative;width:100%}._fc-m .form-create .el-col-24._fd-drag-box{align-content:flex-start;display:flex;flex-direction:row;flex-wrap:wrap}._fc-m .form-create ._fc-field-node,._fc-m .form-create ._fc-l-item,._fc-m .form-create-m ._fc-field-node,._fc-m .form-create-m ._fc-l-item{align-items:center;background:var(--fc-bg-color-2);border:1px dashed #000;border-radius:4px;color:var(--fc-text-color-1);display:flex!important;height:30px;justify-content:center;margin:5px 0;overflow:hidden;padding-bottom:0;transition:all .3s ease;width:calc(100% - 2px)}._fc-m .form-create ._fc-l-item.is-inline,._fc-m .form-create-m ._fc-l-item.is-inline{box-sizing:border-box;display:inline-flex!important;vertical-align:top;width:100px}._fc-m .form-create ._fc-field-node .fc-icon,._fc-m .form-create ._fc-l-item ._fc-l-icon,._fc-m .form-create-m ._fc-field-node .fc-icon,._fc-m .form-create-m ._fc-l-item ._fc-l-icon{display:inline-block!important;font-size:21px;padding:0 4px}._fc-m .form-create ._fc-field-node ._fc-field-node-label>span,._fc-m .form-create ._fc-l-item ._fc-l-name,._fc-m .form-create-m ._fc-field-node ._fc-field-node-label>span,._fc-m .form-create-m ._fc-l-item ._fc-l-name{display:inline-block!important;font-size:12px}._fc-m .form-create ._fc-field-node ._fc-field-node-label,._fc-m .form-create-m ._fc-field-node ._fc-field-node-label{align-items:center;display:flex!important}._fc-l,._fc-m,._fc-r{border-top:1px solid var(--fc-line-color-3);box-sizing:border-box;overflow:unset;position:relative}._fc-l-close,._fc-l-open,._fc-r-close,._fc-r-open{align-items:center;background:var(--fc-bg-color-1);border-radius:0 5px 5px 0;cursor:pointer;display:flex;height:46px;justify-content:center;position:absolute;right:-12px;top:50%;width:12px;z-index:1}._fc-l-open{left:0;right:unset}._fc-r-close{left:-12px;right:unset}._fc-r-close,._fc-r-open{border-radius:5px 0 0 5px}._fc-r-open{right:0}._fc-l-close>i,._fc-r-open>i{display:block;font-size:9px;transform:rotate(-90deg)}._fc-l-open>i,._fc-r-close>i{display:block;font-size:9px;transform:rotate(90deg)}._fc-r-tab-props{padding:0 20px}._fc-r-title{color:var(--fc-text-color-1);font-size:12px;margin:15px 0 5px}._fc-r-config{display:grid;grid-template-areas:"a" "b" "c" "d" "e" "f" "g";grid-template-columns:280px}._fc-r-name-input .el-input-group__append{color:var(--fc-text-color-3);cursor:pointer;margin:0;padding:0;width:25px}._fc-r-name-input .icon-group{cursor:pointer}._fc-r-name-input .icon-group:hover{color:var(--fc-style-color-1)}._fc-r .el-main{padding-bottom:100px}._fc-l>.el-container{height:100%}._fc-l .el-main{padding:0}._fc-l .el-tree-node__label{color:#333;font-weight:400;padding:3px}._fc-l .el-tree-node__content{height:30px;margin:5px 5px 0}._fc-l .el-tree-node__content>.el-tree-node__expand-icon{color:#333}._fc-l .el-tree-node__expand-icon.is-leaf{color:transparent}@keyframes a{0%{transform:rotate(0)}to{transform:rotate(1turn)}}._fc-loading{animation:a 2s linear infinite}._fc-struct-tree{color:var(--fc-text-color-1)}._fc-tree-node{align-items:center;display:flex;height:26px;justify-content:space-between;line-height:26px;padding-right:5px;width:100%}._fc-struct-tree .el-tree-node__content:hover{background-color:var(--fc-style-bg-color-1);color:var(--fc-style-color-1)!important}._fc-tree-node.active,._fc-tree-node.active .icon-more{color:var(--fc-style-color-1)}._fc-tree-label{align-items:center;display:flex}._fc-tree-label>i{font-weight:400;margin-right:2px}._fc-tree-more{align-items:center;display:flex;padding:0 15px}._fc-tree-more .icon-more{font-weight:700}._fc-l-tabs,._fc-r-tabs{border-bottom:1px solid var(--fc-line-color-3);padding:0 10px;position:relative;width:100%}._fc-l-tab,._fc-r-tab{box-sizing:border-box;color:var(--fc-text-color-1);cursor:pointer;display:inline-block;font-size:14px;font-weight:400;height:40px;line-height:40px;list-style:none;margin:0 10px;position:relative;text-align:center}._fc-l ._fc-l-tab.active{border-bottom:2px solid var(--fc-style-color-1);color:var(--fc-style-color-1)}._fc-l-group{border:1px solid var(--fc-line-color-2);margin:12px;padding:0;user-select:none}._fc-l-group ._fc-l-list{align-items:stretch;display:grid;grid-template-columns:repeat(3,1fr)}._fc-l-group.is-template ._fc-l-list{grid-column-gap:5px;align-items:stretch;display:grid;grid-template-columns:repeat(2,1fr);padding:0 7px}._fc-l-group.is-template ._fc-l-item{background:var(--fc-bg-color-2);height:30px;line-height:28px;margin-bottom:5px;overflow:hidden;padding-bottom:0;text-overflow:ellipsis;white-space:nowrap}._fc-l-group.is-template ._fc-l-item:hover{background:var(--fc-style-color-1)}._fc-l-title{align-items:center;cursor:pointer;display:flex;font-weight:600;justify-content:space-between;margin:0;padding:12px}._fc-l-title,._fc-l-title i{font-size:14px}._fc-l-title i.down{transform:rotate(90deg)}._fc-l-item{background:var(--fc-bg-color-1);color:var(--fc-text-color-1);cursor:pointer;display:inline-block;line-height:1;padding-bottom:10px;text-align:center;transition:all .2s ease}._fc-l-item i{display:inline-block;font-size:21px}._fc-l-item ._fc-l-name{font-size:12px}._fc-l-item ._fc-l-icon{padding:10px 5px 12px}._fc-l-item:hover{background:var(--fc-style-color-1);color:#fff}._fc-m-tools{border:1px solid var(--fc-line-color-3);border-top:0;height:40px;justify-content:space-between;padding:0 10px;white-space:nowrap}._fc-m-tools,._fc-m-tools-l,._fc-m-tools-r{align-items:center;display:flex}._fc-m-tools-r{overflow:auto}._fc-m-menus{display:flex;flex-direction:row}._fc-m-menus .fc-icon{cursor:pointer;width:18px}._fc-m-menus .fc-icon.active{color:var(--fc-style-color-1)}._fc-m-menus>*+*{margin-left:5px}._fc-m-tools .line{background:var(--fc-line-color-3);height:24px;margin:0 10px;width:1px}._fc-m-tools .el-button{align-items:center;border-radius:5px;display:flex;padding:5px 10px}._fc-m-tools .el-button>span{align-items:center;display:inline-flex;justify-content:center}._fc-m-tools .el-button+.el-button,._fc-m-tools .el-dropdown{margin-left:10px}._fc-m-tools ._fd-m-extend{background-color:var(--fc-bg-color-3);border-color:var(--fc-line-color-1);border-radius:5px;color:#666;padding:5px}._fc-m-tools ._fd-m-extend .fc-icon{margin-right:0}._fc-m-tools ._fd-input-btn{align-items:center;display:flex;font-size:12px;justify-content:space-between}._fc-m-tools ._fd-input-btn .icon-check{color:#67c23a;font-size:18px}._fc-m-tools-r .fc-icon{font-size:14px;margin-right:2px}._fc-m-tools-l .fc-icon{cursor:pointer;font-size:18px}._fc-m-tools-l .fc-icon+.fc-icon{margin-left:10px}._fc-m-tools-l .fc-icon.disabled{color:var(--fc-text-color-3);cursor:not-allowed}._fc-r .el-tabs__nav-wrap:after{background-color:var(--fc-bg-color-3);height:1px}._fc-r .el-button,._fc-r .el-checkbox,._fc-r .el-radio-button__inner,._fc-r .el-table__cell .cell{font-weight:400}._fc-r ._fc-r-tab.active{border-bottom:2px solid var(--fc-style-color-1);color:var(--fc-style-color-1)}._fc-m-con{background:var(--fc-bg-color-2);padding:20px;position:relative}._fc-m-drag.mobile,._fc-m-drag.pad{border:10px solid #000;border-radius:25px}._fc-m-drag{box-sizing:border-box;margin:0 auto;overflow:auto;padding:2px}._fc-m-drag._fc-grid-line{--van-cell-background:transparent;background-image:linear-gradient(to right,var(--fc-grid-line-color) 1px,transparent 1px),linear-gradient(to bottom,var(--fc-grid-line-color) 1px,transparent 1px);background-repeat:repeat;background-size:16px 16px}._fc-m-input{padding:5px 5px 80px}._fc-m-input-handle{background:var(--fc-bg-color-1);bottom:0;box-shadow:0 2px 10px #0000000d;left:0;margin:20px;padding:12px;position:absolute;right:0;text-align:center;z-index:3}._fc-m-input-handle>.el-button{font-size:13px}._fc-m-drag.mobile{width:400px}._fc-m-drag.pad{width:770px}._fc-m-drag,.draggable-drag{background-color:var(--fc-bg-color-1);height:100%;position:relative}._fc-m-drag>form,._fc-m-drag>form>.el-row,._fc-m-drag>form>.van-row{height:100%}._fc-m-drag>form>.el-row>._fd-drag-tool,._fc-m-drag>form>.van-row>._fd-drag-tool{width:100%}._fd-fcDialog-drag,._fd-fcDrawer-drag{padding:3px}._fc-m-drag>form>.van-row{flex-direction:column}._fc-m-drag .el-tree{width:100%}._fd-drag-box{height:100%;min-height:80px;transition:padding-bottom,padding-top .3s ease;width:100%}._fd-drag-box ._fd-drag-box{outline:1px dashed var(--fc-line-color-1)}._fd-drag-tool>._fd-drag-box{outline:none}._fd-drag-box>div[data-draggable]{margin-bottom:1px}._fc-r ._fc-group-container+._fc-group-container{margin-top:20px}._fc-r ._fc-group-container{margin:0;padding:10px}._fc-r ._fc-group-handle{right:15px}._fc-r .el-form-item{margin-bottom:10px!important}._fc-r .el-form-item__label{color:var(--fc-text-color-1)}.cm-fc-field,.cm-fc-id{background-color:var(--fc-style-color-1);border-radius:5px;color:#fff;display:inline-block;line-height:1.5em;padding:0 8px}.cm-fc-id{background-color:#df2121}.CodeMirror-widget+.CodeMirror-widget{margin-left:5px}._fc-tabs .el-tabs__item{font-weight:400}._fc-tabs .el-tabs__nav-scroll{padding:0 15px}._fc-tabs .el-tab-pane{width:100%}._fc-tabs .el-tabs__nav-wrap:after{height:1px}.form-create .fc-none{display:none}._fc-child-empty,._fd-draggable-drag.drag-holder,._fd-elCard-drag.drag-holder,._fd-elCollapseItem-drag.drag-holder,._fd-elTabPane-drag.drag-holder,._fd-elTooltip-drag.drag-holder,._fd-fcDialog-drag.drag-holder,._fd-fcDrawer-drag.drag-holder,._fd-fcInlineForm-drag.drag-holder,._fd-group-drag.drag-holder,._fd-stepFormItem-drag.drag-holder,._fd-subForm-drag.drag-holder,._fd-tableFormColumn-drag.drag-holder,._fd-tableFormColumn2-drag.drag-holder{background:var(--fc-bg-color-2) url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAOYAAAAMCAMAAABBazFtAAAA1VBMVEX///8uLi5wcHBDQ0P7+/v4+PhaWlpNTU3x8fHR0dH9/f1dXV0jIyPb29ucnJxSUlJLS0s7Ozvm5ubOzs5hYWH19fXIyMh9fX0+Pj5WVlbu7u6vr69ra2s1NTXj4+O8vLx0dHTX19fDw8OOjo6Hh4d5eXlISEg4ODi5ubkyMjLU1NSjo6Ofn5/r6+u0tLSLi4sWFharq6uEhITFxcXAwMCnp6eBgYGxsbFmZmbz8/OXl5eTk5MAAAANDQ23t7ccHBzd3d3Hx8cqKiro6OjKysrf39+QkJAsSMNaAAAFiElEQVRIx+WV17aaUBRFF016BymiiFLECrZrN5ry/58UjrnGkfKSPOQl0+E+e6Asz9SN4Gc+sCCEZOlx+AmX+7WTAFYAuOaJ8JmC38HiRyT2cVQCrNdBTiLl15TZ7HUW+8r7NRXhHr+hI7/TYQVB0DtNkcDbEMZFPJZEXe/Uuq7TIGgaqa9O3fJVfGHHDjBKAZgcCOP82zZ1vfUlCAIPwN4E1yUGu9aDISCrjrVwyvMNoBB/+fLlCMROFc/pbmW9UhrcdrvtBU1JAKzoj48XvI9d9hj51RHDGqzO8xcgXQBYvgGIed5LeF7Hk4+2vTsMI9u27Ip5UInCiSonueddOVfVFmknDH1gEUW+GUVbsBRFVVVTZupUsZDlbQcfD7Td71d0fxVT1PlKNUxs+Va04mRcADikjeGcbF4kjHSgVJ04mH+QwO7v+9rcbCqg25nBr20WrxQAn6PdKYrMIjqAw4C2DLBA8LnrUvW46WZlHJrq4gC4+fRdczr9yNwysu0ndts5LqL2J9g77AMJcMSOA9Q+TVccO1gsUkaWKUBcrfr91coG3CH5NSMO4Zj6FGKoOdiUyjCO75fYAkSF+xZMT7UWwxsFwFGz5rjJIvEIy54O3AfBfIgG7XpSViYsHSjqWmXQ8EohWKpyU/1a5VCwD81jjeBGWfxzTCd9TFIAXPjUVHzmdvXPL03F68qB712hThJPTpJkqg5LPqvp0Yji1G7a/vRGTS4cGenjsSksYNw0bS0Dq+Zb7vjq+9CqajlWJbil0kxld9xo+mFr/UEtgN0SlxnonTRbE1ZEs5Ll41nhKxX1KYHpbr4A3aNzKAyGObxSCAYd5RGTlTbo20PTsBDo8uZ85u+TgSF/yAWo/HZgGAnDXO9MwKqiuKtFZj3DEwp5Mk+bZZAFVZZRfDaQBJ8dp90oZdd0L+wOla0vrmTZP518WR7caJ73/TtPt5GdWnuxuDlApzjw3ax/Zmemo8/nc15sNJ1Ri7nyETayZN05SLKGqR4EMoimovZG29z1wRXnPDkeCwtgMD8w6AzxSiEYg2aamSNtI86IZmgC/EAV+FzgLaALOjcMw22692uzl9EnJzO72eSluZKlgblRACnX0KNcIA7OLY+/Mv4n0XP6ZkzVugi4/Hab74F9r+eUjNPr7Ve6efHC9lCZLMtICq+Wt8Hmra13Oh2DaM6Y1of0zRE5DrsaW5Z10W8DXaLpVrQ5meyyA4ZTqvfRvfYB7qwzE59ovlLkqhIMuk/TO4e3wZVEczgFCrpKnEnWAsnbM9a6hZemtaXqGdfzjBpP7jsB0upCNNcRUz78XQZ0QovpGhh48839YAiw+JGmxXkP4LaZpi09DlvLdNeBt+RDMrS4lAEa2mTclEazlfqtD7PTHE2KIUEbAuhHi4VCNNUWZy7X8ak5laWAN8UXsHIAmETzlUIwBNmetVTaBrRRo7lxAQrmaCmcLkRuE4o+FZJu/vmhOUuZbTE3tsrgdW2OHigA+3lIpSXdiHxUZDmhJ3kbGA4FtThW1lpZQdOaT18PqC+km5YrwHQBjMnQphi39GIjAe0MAN1oRp+44Is+NS3Y58kkjU4keTweJxB1aAvONFdUEOzJlg/FbNMN0w7wmSeaz5Sn5jI3mN7Obm4th2BeNLeWxIAZ1XxQfsD+5IxpqnvgwJ1l96GJQaYy86Vq4jvl4gEFUQmOAthJGSLxenHY71xYrjBtxtlOl9OeRf6mgd5soDadBiSfAIZoJjtcyvUotyFkW+CTB4lnBNg0sBuqGC0Q01stTkYevsHfp5h+5vwsF6GlQGHpjewm3QrAm0Y0XymElvCoSvi5/44mviGP6A3aAdxJbL6x7iIHOwXeNf1+MWf6Cv4M6W/eIuGfIr0vz/Xx+J/4CrqNrFdzXxZoAAAAAElFTkSuQmCC);background-size:0;min-height:90px;position:relative}._fc-child-empty:after,._fd-draggable-drag.drag-holder:after,._fd-elCard-drag.drag-holder:after,._fd-elCollapseItem-drag.drag-holder:after,._fd-elTabPane-drag.drag-holder:after,._fd-elTooltip-drag.drag-holder:after,._fd-fcDialog-drag.drag-holder:after,._fd-fcDrawer-drag.drag-holder:after,._fd-fcInlineForm-drag.drag-holder:after,._fd-group-drag.drag-holder:after,._fd-stepFormItem-drag.drag-holder:after,._fd-subForm-drag.drag-holder:after,._fd-tableFormColumn-drag.drag-holder:after,._fd-tableFormColumn2-drag.drag-holder:after{align-items:center;bottom:0;color:var(--fc-text-color-3);content:var(--fc-drag-empty);display:flex;font-size:12px;justify-content:center;left:0;position:absolute;right:0;top:0}._fc-designer ._fc-m-drag ._fd-draggable-drag{overflow:auto;padding:2px 2px 100px}._fc-m-drag._fd-drop-hover ._fd-draggable-drag{padding-top:20px}._fd-draggable-drag.drag-holder{background-color:var(--fc-bg-color-1)}._fd-draggable-drag.drag-holder:after{font-size:16px}._fd-drag-item{width:100%}._fd-drag-item.is-inline{display:inline;vertical-align:top;width:auto}._fd-drag-item.is-inline>div{vertical-align:top}._fc-child-empty:after{content:var(--fc-child-empty);font-family:fc-icon!important}.fc-configured{color:var(--fc-text-color-3);margin-left:5px}._fc-manage-text{color:var(--fc-style-color-1);cursor:pointer;margin-left:4px}._fc-message-tip{background-color:var(--fc-bg-color-1);border-color:#fff;border-radius:8px;box-shadow:0 6px 16px #00000014,0 3px 6px -4px #0000001f,0 9px 28px 8px #0000000d;padding:9px 13px;top:16px;z-index:4}._fc-message-tip>.el-icon{font-size:18px}._fc-message-tip .el-message__content{color:var(--fc-text-color-1);font-size:14px}._fd-preview-copy{align-items:center;background:var(--fc-style-bg-color-1);border-radius:10px;color:var(--fc-style-color-1);cursor:pointer;display:flex;height:28px;justify-content:center;position:absolute;right:35px;top:65px;width:28px}._fd-preview-dialog{border-radius:6px;min-height:40%;padding-top:0}._fd-preview-dialog>.el-dialog__header{float:right;position:absolute;right:0;top:0;z-index:2}._fd-preview-code{margin-top:0;max-height:510px;overflow:auto}._fd-preview-tabs .el-tabs__nav-wrap:after{background-color:var(--fc-line-color-3);height:1px}._fd-preview-tabs .el-tabs__item{height:46px}._fd-preview-code>code{white-space:pre-wrap}._fd-preview-device{align-items:center;display:flex;position:absolute;right:50px;top:9px}._fd-preview-device>div{align-items:center;border-radius:3px;cursor:pointer;height:28px;margin-right:10px;width:76px}._fd-preview-device>div,._fd-preview-mobile{display:flex;justify-content:center}._fd-preview-mobile>div{border:6px solid #000;border-radius:24px;box-sizing:border-box;height:70vh;overflow:auto;width:350px}._fd-preview-device>div.active{background:var(--fc-style-bg-color-1);color:var(--fc-style-color-1)}._fd-row-line{background:var(--fc-line-color-3);height:1px;margin:10px 0;width:100%}.CodeMirror-hints{z-index:5}.fc-wrap-right .el-form-item__label{justify-content:flex-end}.fc-wrap-left .el-form-item__label{justify-content:flex-start}.fc-wrap-top.el-form-item{display:block}.fc-wrap-top.el-form-item .el-form-item__label{display:block;height:auto;line-height:22px;margin-bottom:8px;text-align:left}.el-form--large .fc-wrap-top.el-form-item .el-form-item__label{line-height:22px;margin-bottom:12px}.el-form--default .fc-wrap-top.el-form-item .el-form-item__label{line-height:22px;margin-bottom:8px}.el-form--small .fc-wrap-top.el-form-item .el-form-item__label{line-height:20px;margin-bottom:4px}._fd-slot-empty{align-items:center;background:var(--fc-bg-color-2);color:var(--fc-text-color-3);display:flex;flex-direction:row;font-size:12px;justify-content:center;min-height:90px;position:relative;width:100%}.form-create-m ._fd-slot-empty{flex-direction:column}._fd-slot-empty>span{color:var(--fc-text-color-2)}._fd-drag-item:has(>._fd-drag-tool>.el-col,>.el-col){transition:all .3s}._fd-drag-item:has(>._fd-drag-tool>.el-col-1,>.el-col-1){flex:0 0 4.1666666667%;max-width:4.1666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-2,>.el-col-2){flex:0 0 8.3333333333%;max-width:8.3333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-3,>.el-col-3){flex:0 0 12.5%;max-width:12.5%}._fd-drag-item:has(>._fd-drag-tool>.el-col-4,>.el-col-4){flex:0 0 16.6666666667%;max-width:16.6666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-5,>.el-col-5){flex:0 0 20.8333333333%;max-width:20.8333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-6,>.el-col-6){flex:0 0 25%;max-width:25%}._fd-drag-item:has(>._fd-drag-tool>.el-col-7,>.el-col-7){flex:0 0 29.1666666667%;max-width:29.1666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-8,>.el-col-8){flex:0 0 33.3333333333%;max-width:33.3333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-9,>.el-col-9){flex:0 0 37.5%;max-width:37.5%}._fd-drag-item:has(>._fd-drag-tool>.el-col-10,>.el-col-10){flex:0 0 41.6666666667%;max-width:41.6666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-11,>.el-col-11){flex:0 0 45.8333333333%;max-width:45.8333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-12,>.el-col-12){flex:0 0 50%;max-width:50%}._fd-drag-item:has(>._fd-drag-tool>.el-col-13,>.el-col-13){flex:0 0 54.1666666667%;max-width:54.1666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-14,>.el-col-14){flex:0 0 58.3333333333%;max-width:58.3333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-15,>.el-col-15){flex:0 0 62.5%;max-width:62.5%}._fd-drag-item:has(>._fd-drag-tool>.el-col-16,>.el-col-16){flex:0 0 66.6666666667%;max-width:66.6666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-17,>.el-col-17){flex:0 0 70.8333333333%;max-width:70.8333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-18,>.el-col-18){flex:0 0 75%;max-width:75%}._fd-drag-item:has(>._fd-drag-tool>.el-col-19,>.el-col-19){flex:0 0 79.1666666667%;max-width:79.1666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-20,>.el-col-20){flex:0 0 83.3333333333%;max-width:83.3333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-21,>.el-col-21){flex:0 0 87.5%;max-width:87.5%}._fd-drag-item:has(>._fd-drag-tool>.el-col-22,>.el-col-22){flex:0 0 91.6666666667%;max-width:91.6666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-23,>.el-col-23){flex:0 0 95.8333333333%;max-width:95.8333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-24,>.el-col-24){flex:0 0 100%;max-width:100%}._fd-drag-item>._fd-drag-tool>.el-col,._fd-drag-item>.el-col{flex:0 0 100%;max-width:100%}.fc-icon[class*=icon-chart-]{background-color:var(--fc-bg-color-2);background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAXAAAABsCAYAAAEEfdn9AAAAAXNSR0IArs4c6QAAAERlWElmTU0AKgAAAAgAAYdpAAQAAAABAAAAGgAAAAAAA6ABAAMAAAABAAEAAKACAAQAAAABAAABcKADAAQAAAABAAAAbAAAAACUwJ3TAAA5qklEQVR4Ae1dB5wURdavnpkNwLLkICAZFpaogpKUoBgQUBARRMCACUVPBfXUO/XzPM/Tk/PEjApyEhRFEeEIShZUQFhWYBElSFxQCcKmmenv/3qmmu6e7p7pCTu7ULW/2a7w6lXVv1+/elVdVc1YOXUS1bvDg3JLJ/Xf9JK0Pdl5XGYV9jM2ThsvSyyPfto4o98s3ciH8nBe/Grks2ng4M3GOJ5v08BBah08nIgYSTLL4mHtdXO/G/Jq/HLpQ/Vz7tBGK5XALftQZmyoNq9ZhXlG4sX9Lr/7aNsF05VgztU3zEn7o97MDnM/abdpwODcdotmtud0WlCo8h3mzslSK05EPJJn4Nf2X8wayP3aK1U2Z8CQVe0/n52lzStJ7F4msVNMZhX9aBXCW5FvO+W14iW7i7Ozlk+cRZVs/8UnXXL6D9rKngMXjWv/+RyKmEVRpqKioVW8hCD/adN+vvBv3VHpHjs7P9+JUNCmUaUprDSCsZHaNDNePD+BIfnZ7zys8NBKgsz+SnEq4pQBxAp/tOYVxRP8ZwzztKbfPrGa/E2+e2Qdj6OrVmy08dxvxY+nm12NPNWKmxFHE0caxyqfXZrTPBGJihVTbbz2AdLGJ8qvIk5yh0Iy8PtDcrFCyNnb2kJRsddxu+42xKkawngrtXSJ8OsQx4N0Mz1Msp+lmxTWB49yG208VZb/gg3XJifUr6u4WUl5PR+6juJRwedlmb2hpSHx0HYK2rRE+1VRoScdaC+hAlFB0ruKy1r+r4+D3ndR+XeD/sBFYg9XPtzxdwpAvy7WpYnAGYaAZGXllQUL0AprqlvIw2nUDvQA8p+REeJ/MMbZhUF/AedFVyNt7lUjX87rfZ/OPCAav8SG0lWrCJSHk5iQWqNEo+PWXIhx5GKroevbmOZ1sXv8/oAdRA8954ky1sMKVCsMnjxJZ+BpDTYiwIP/DC4fqsTwqFqFIilDu7lzJmkJQirME/2sOy8A1y2wc7J5EvqBK6GhWqJAH1mH2spb8dMaVZUPdbqZ8+JXAoisQ+50FeeR2qtRdHglTtXYUpEK45XX5gFEyogKdXZThwZLUUVdy4/z0uVFoOk3j68xxlFYKxVKxXmEttU8oxXzir9mnyIaszycH+ehvVrx09IY/Wb8wiJuZBIuHE8L0K4sABAfB7GoHh9OkXFREVdkz8UqMT87aXY7XR6W6fey4xq2f0GeFaBdHkz7TZOWcK+COFWaHiLI0i1UIsza1rzknP5DVtITbag0JT9Dlfb4WYbXy0Zz+tK6KhXHv1fw5H/GC4U6U40s2eWrDaNLpyKJjhpD1/XXDlpP19J2qqi4XOw9FP4eKunTVsJMawTTb6drhWPNH3Z72EbZq80l/JYIoHMrn1NwVi0q68ahKuJWDYgkHs/pXCMdFJTp5JeR7mwLRwQ4N4sUpWmCUDTgyi72vTpJRwa1xEai733C7WedYX1ruzldiUh3l7jY2GDketTpax2BIcCVtiFaCZpZQJSQM+C6b2TJX9WYJ3N/l5FN1j3yrTGewsDoO/SEmeQnvmR6kp+cVi/rAOeVs6pIIHvofy3zlKKa72QvfPufoVT6GIxAzuMxKHctyuwC/TZtx0V/684nJHk6XflN9wNhNIwmfcZQr4j4CygdcVvBQ5mioDB3OQMGca/u2mDjfV1q7Omti6MAtUXypeW0mz+zq0umYgPOJ7FGuQMGLUK6DkCezsGmsORhjc77bE5nngYBUp0OcDUWHg6i9u5o07X+9vPmPKUNQ3qH8zCAncH92ivxr7H3ssG/NljySc3dVww40mhhHiTe2+HzObqZMp4HDbqX+/k1GLcdT0dD5N2I+BDAqf78ZvF8dMV9U+aCtHHk17YX7ZgP06cWaDu7ZbZbm2bMpw37fWxRYNAakHZtmg5w3IhRkLa6qDzLzO80qiTtaF0ihqE4B/ea5kJNnRWopsTBSF75BhvuUcbn9TfdZTpO5zxsnzrU184BMHXUaEdnTEO7+mmE05isC9vWT0cpAqWKgHIDrebfrGpSmqaXVR3KazyetlAHFdKP6z26QpdVC6WKPYZ30pwThb0eFmId8PQz4RoCuOxjEqb5JlKHRADgeg/00/V2jeU3R0uTM2Do/3jHq40nPwea9B78WygMiyATN/oVl1f/DteYt7yHdZ0m+p5zZTe71tBR0A1IQ0PHmXU+HNSUU7U8rZe8NRt5fyEA2837UDc1aQSKaAhw/JS5XTKd0LsbijbmKv9hHeAKWNQmL2sF4FUzjICGWrn9tFV6uuHc2jgdE2oKadOMfn7DzPgYac+EsA5wapAixW6AZjClYCLpXovH0niSbJ5fC7TZE8TpxFUgEBUCis4sy2bhmVY3PMXClSYCITrcaeGwLsgySdXl82MySmJ/18WJgIJARIBzO9usUwPY7UKwdKFTlMMDzk1Dnh/hFfDX0XaqPE17pfqY1UVLQ37ib4zThu3KOdRidr1DWbOmSX7P4XbzZwzT5rPy8/L4DKXbW2FV2/nTb9PSRwS4NoPRb1dpI602zCuH6xTwuJmHw/HjNz9S0LVlav14AgfTJJ2Z46YqpckubwMe1lpUxny8/tp4n6eghzZMfh3gPFO4RmuZYJXMbIRVlWK1+ESbh8rBk3ExGpxP/mB4IsK6tYDaPBxoY5ydpFM7UL+Qt1HEA/U0XcqkA1diF2H80UrysakUTz8z0Dlu2rpxf07/ofPbz/uwHw/rAOeRTq5Y4x2qUsIw4De0oOr2ChWOtlRtcspWmLkzPf14k0I7FjTtgNHv67hpPn4jrIBH/XT87fgGhef0nLjMvgHY31AeAprfDDselGZ4+aB7e2UJOGdudke1BYZL19Jq/Tn9r1+Kx7Uezy97iqScfsO2uYsqf9524fvjtbTkD4I82SWxMRTG9W6zdRCUpnWcvzbOys+FB5pmMW5mX6KDUeCiNz+QYqXc3KuHT2v7xYyQRXlanj4X+46HuXDxsCXgnCDcFRUaCjAwNg11WHvxNdZP7Dam0GNOYFc61nI83Vh3caVFvtSTl4cDh4PN+dFNgH8yfmOgjixfMvCngOezehqM5ZOqANjKEwLgJiOdygpxBKqFWvnRSBwz4GhoHUiaqUNDO0JSQgCnx5w3btOAQf+IBGzTAgKRiuTZpEedZJROO0YAvBvo1RfaCOe4/KGzrHrAse4bS0j3kLjSCp/UE+fsoUIA2mKAesxsLs9KWpTKAXEzx8GmNKt3mMZ8ThpvzGtbRyNxlGGA+yuyqv0F6mvqdIBjguozrhtaLn9BXUMGwLfh8RVOIFD+EFDktixPEJU/SO1rDPUmXGkiYAk4RljX4HdlaVYGbz/etTCvSrUaiSzMFHCyW9FwN1YdtTDasPGqDPjPw+91zg+d+lRYQt1jsUY4r7J81QGOBtfhAMNieY5XnMfxcLgrwBtOI0crOpJi0NRBeh8aycHcnIZflzMdbMJDBzhMv0P4rQuO4JThtELkYUvpauawGt8N1dNAmwakZ9AwfVvve00HJS4fOw8juM4EMGi3AvwLya/cWGwn0/I60/w6wIOSPEXbSAIfG056W0n5piuGTznUaqZEQ3ySXMqLp6MWDW5aLZ00GZNM3bX8yI8bpGzKIj/Sh2klm+/do7Qz0ekAVxoo6xfXQ/poBGXqTtbaVMnnLrzwUPNZSyCxWIjCniVCv5ut4uBj/kM5C0HLQFEpwZuDgdb32rQz3R8COADeg0YX8IaDYAT5sRD+HR7Hr5UOdzippHnTldkxdLJVKAwem91upq6P5vRmV5q84jOTZulnWpxuaO+B1YBH3Iuf6rD8rCJAL9KqATURHu28COiUGTtI+xCoIeFMENABTmADtAoAeYmWFtbLW9pwzH5MkuExyCc+NEnmKayq+NGBLkaU8tTEXEYZZaADnOqIzrEA/9QNj4moN02Scb7GSTIeL64CAYGAQEAgEA4BdfTtdIY2HGNjOj+vQZRjRMY+LHCzx8cqleMGG1A4gcCZi0CIER5tU2nK0F+sbASi+ccirITRHQJix5dPutjR8DTtLBePi/aKOtbDfMV+u/yYuRuLtV1zMCF0wI4u0jSaVsUgZG+k9FZ0wGw60pQ971Y0dvHxxNGunHik8TOGtPM/Nff0HVh/41jblbpUdtwEvMSL0x2C/QFJNryWq6Di0ehYeEA4cpA/DfM9tJy5GDdbtzaSAPX5AkvVaEoJQk578mdEWyZtw1Q3qGEYD34lmNawXLQaSTmo841OFIOB5ypDOKJgXq8Hh2DdpzIbbJVBkj2H2ix4r7fbmxGxgjPywjT/OtjOlXk87gUth1LX+1D8kYaL5+LHUgqrv5e96J1/cFrj1VrAJXY1bkJdygAgdwNQ3VyWkVEs4dLSJpAt9TiT4Nu8+hDgj0lQIHTjMLM8HvGNgoAeQPt7OW0X5v668+l/aOtU8LzTuOgSNCngOy7Fx972uZntImG78ksLN6xE/AG46GQlpaDWa9X39v64+r4e+ftafdDhRK0NT8rukhay5K2T22/kFqq33dEyZu3CPbgK9+jf6sDQjMgQV5L+2y15fe49kPXVpKmGJCWoq7SWADf+JXpsNE73BGniY/Zqux4js0iPujHmMwsDwEy06VLFRCDVjNNSSDNAwNdi8vkVaq+/hHWHuXXELH9EcRI7HzfpfIUWHqNDWVUgmMcovsSNbcaM5aO3m+Xzspqu1MBJeqjfSmM+q7AddmZ5Uk7WfjX7yzf/Y5ZmjCuqtDdt26XjqLdTXOaBLiPo/HI8uPNQx5fpCB6siy5u9M2jqSk4Hccr4UUpdvLyB+J4vbXTcMr8ARzY3ivIwvZCwm1HUDdveB/TdD/1xebOUsDNyU8fEcTTta96eFxcr/7Ibflw5SoaLwgFDrRajQOtalL9Ed+F54Vwqy63341TsEGnK0XE1E4JSxMYu4j4KDoD//BA8dMUa+PGjoOwMGh7Ml8cvYSgnQu+tBMDiHckLlLhJl5a4ab200OIvqcthLg/pfNF/5KbNcM4ZTVwfBvw/pOWQmOnxQIs/m8qS75z8nrfPzxr6ctRm3hKWehla29XTiCmoOqgMAqxZLmDGmHwaG6nIaUUgzEJj8N6YnPTQtlV0phnIw2YUljt/exF7yq25a6OL3U41nDlhzy9xu7Lrm2w6Z6IhQ4CSrsxwjqig5wfg7kyjRNDONyIuwLhiM3B4Lac8TR45XysrhDMvVZppvF41aqNV3o2+XTvRqYdpYOv2ruj/g9TXPM1T1/3Y7fHlUUFhZX2PoCo8AIu46xuSf9VAOJl51xu1snssA2ep0wIOGkwXiEnV7zj3gNw1deidnk39x/2od9VpDzpmfu6D2+yfvwGosfeqOkl6b+PgqCP4vmxj3UZ9rHeycOJukKgq2gfCAgHubWBi7P/0P6DwuUAf0cDf7tNKeDVXOkM/eyqQLekL50O3rbLr6cOhMBzMHq2VuAX/p7iqF7QZ2O4buvKhIDb1tAmEV0ino3IXLt5M0P7N2TFxr8biQMEfGu7hbPauIpSI+ZpVrJiBpklJDgOqv/LcEVAeOLmwGqH0lZIWTwd2G3D4F7pEbDYsRlmtB5HL9cBZf0Kwf8C15edlGcp4FY3ysqciGVaMOq8cbxhaJd6VLoTAMsKLYRXmbkoK/WJRz2wufcnqLBbIR8BF8X9VvNyHuIqEBAICAQEAuUEAdWCEougnN0xvpjHWS5BXdoICBMlDOKYCnuHT4eFIRXJZRABRwKOgYyyURa70gZTW2h6D/Ovd5fBdoWtEure044IQj0lKNg9MHpXXwTZ5RFpZQ8By1kUbVWxUGgsFgy5zeY7Mf/qweA2MI/tUk4ZWq7NG0d/fwhlE9ThVbyYjWoqT3kdnhLYJkq2WXBQfiNmjNbzeiKOdp1fSGE8/RfioT7GCTmNuJYfBCwFHNqrK25uJ6UpwXVheClxBcItSLyQ/hyE5Cho/qs218/aI6k9hV0pWC1XEm4aPpATi5M8XnyQGzzn0tdxVH7wkBZFOXSE5DzqbvJ6/2lEYcbuvxJNvc139Ki186rD5Ld1EpsJwT0PdSKppsU8ryv0OEIB8dNRBhawsfXwK1t3aQsvfU0RYeHKOQKmAk7nZ0CYW0CgluImp6GNtPbYzFXlb+Jo3tztY+kQlpZYIdcSL3lvQYaIds9iIp9239KXMFUH7xZoUjrg7A3EK7tkKfHcTXfM+bH74xBwqZgLN8ykG/FG06qOJNTDIMChTsbXPOgjEx62DeV1BhidfDI7QVum8aDq3q4q9QvlIGLKOAKmAk4mAASV9tf3pvpDiOmFKOk/S0cCAds84CAtEKiIXgsbV8O1Xvafdml/nFsTPQPnRq/MJ6I+L+A6sMJv2Qxfn9at4bYVbl6l4LqJYFD92goWCsn4U96cRb2AmTMV1zKHgKmAUy1JaCCnihaDsL3JNbVZC0D3tTYeJsd2CE1Ubl/Lme2arJuwHrZ9PxjB/TweNjV4CEVfDcNUjT8mr/EBs3pTG1MhInPSELAUcKoRhHoThLsDXZVX9x7WFsKmaPVgugeatQ6WKz4KDd4NcYEtVDJbSOl2DvmeQnpLK4GC2XEMD0oBzKUC4oPyO9JVOIGAEwTsBVxmKyDctPgln6YDsf5XRw/h9yJtn2KvBmY3vobibhVJBSCwT9nRwT45At6TIxum2nESaWczAjqBNQUiOMCDyULfVrB2QZMENNusiZKXovRAJsVb9SBiUGkCVjmMwn0UTiAgEBAICAQEAgIBgYBAQCAgEChFBNRxo1gu6wx1vlxW4Fa2cRODTGf3R1CXMwSEgJezGyaq6wwBIeDO8BLU5QyB8C96EtwgvAXtibelD0VSDF7WDIyETtAIBDgCcRNwvOmsyJnitf4p7g93xdEAo/HKX1nNF46WNizEdG6gtgBa2x5mzYyybJixVXiwaJ1NzA4HFbXGIrKIT8myKxBrecIeHWyZX2YbMLsw3DK9jCXQ6bz52R/WO5g14yuqmttbcUXb+R/cHkk14yLgtP7E72KnV/u52GdYgLUnkgokhUZifVDn/0DgPsLC7yfM6gABugBCEFhjLrE/42F4zowu0jjgQ0eMdcUBPY3xQC+INF8i6NC2l/DQRu3yet83srjC4av9nqI2kt+d7/Kl59bacc3zdX4csj9qppqMOLPd7fWw5cC8FkW7XfpvyPk8py6hVaDN1vylU8bh809osoZ4k26D42ZHvAxbTteflRfSmggicHO74t4qO3pQ9vUAoJ0xG2goPSDcjBXHQbh7knBTOdhQ0Rw3r6qxTMdhCQIQpcN6f+XMQCfZfZ4/3DkDrl9BglVY+Zcn/J7C87CTJBUHbDbwpfxx5cHWHyylNDpD3AlfE9oeXjc2uwSF2yRdjfqp6zPr1ICFJ+kCDk1yO350wmvYn8fLjlq0I6JoPEm4KWxKkFg5WBIH3M0mjcEZQPhz4e8TDC9BvUIeAE4byRUPy1UQbmUbH6d3ebGTKEYHk/DFGFlEnH1np+cvpDO/6ezvcJnogHyc3PtNODqzdNyLRsDrHbM0q7jcfiPetkqjeFMThWxPPOW3aDI6KlSTr8x4IbitsL58plIhif0IAekPMDcjnBrUGNdgG5J66CN2Mw2D1H/vpAHYnN0FvcKPMM9+pXzK6QM+Vt+UhwR8ZfaeaVpkkdtJKURGGj0VCTed863lIPlSfqx8+Pyn628bsem3+qtq/9Zg6XUlFQ6P5TQ4lroqnRHu9PBNaNtFnEekVzJX7GhNBRyzGgMgEA/zjBgYbYNwrObheF5/7vZkzz+qbTOdRXHJruNt58+4KdbyIHR1sDtIEV7Y1buhUZXzrUk7Q8gDg7XTwu2DIdQGG48BgUPnZxnIdSNmhmizSAGMrwpWHPAAZWCA3QZ1+cGKJlx87lU3vu93+RyZO+2/mBXxTJQ/rdilE25ZKunw+SdtqV5QgkPJ1Kl3dHj1uluHv4yol/N6PnBDYZVd/6fUGztdc66+YQ7KG6SEw/0jLJwjHo6ruQYPmyuOBKeqbR8tu4tNNRFMirg4CNshPKRTIeQ0c3K5linie2GwuUyJk9laPACjTxssWkpnfjxUocIt4ZMwMjvIOeH01D6kPGhfKB62lhiItoG59DFPD3d1FVX+zpeRf284umjTcy+/UZm1UPJjcwsJN2TwbvRQU4HRTorHVx0Ok52LmbP5Wcsn9tvZ+fmfjp+z9gNKw33Npq9EpJ1sUERhOwccHqWNvFau5i+XEm7cdLQiC4mnup0VDkL+dwhRT97Y/e0mNyc/eqYDAPZFpN2mCDcnCF5zrxo+1RAVVRDlDAD/IaiHTqPh4RoLob8HgtMXZlM9J8zrbL9JZzo4yRsJLX2dgdORuUGfLEEbXqdpYD5QVfADEerej0xb+sSJ5EtTP3uS1+shRdg5H8urZD3WwSkNL6acrFHpnG1DTxh/tbcMtZ25cSTgO3o+MoBGyvz3c+dnYp8fll3xUtSW2BkTDrR6r8nhJl98QdNdlIabQwOVVVq6I02/rEHt9KUUdsnr+dB12jQbf4pJmoQHiAS4UTCtPoREOVjIhNZRVI29FzsadLtLMr6ItAD67Ainlfyen8nv94V+vQJCrZxyptCSyedi1dp/MfN6nhdaPLJBumTzOUcoJnzy8Tuzn3IqAi/M5Gpqg5vQKVF+hk5U6yTooxhdpBP2MRajZj/UYna9/JZz/0cRNN11uNGiBbV2X35EJYBnW5977ijK2K+OCxpuunW+Nt3GPwyIdIFAF0KgV8C+LkD4mhB6nJwF4PbCjLHVPiH5TCKsttyZkDqKKqmY349nyDjc8f8wVhkL8+kZCLTqIMyj0MZxiPiEIiEctEn9S3gvpbATB7afAbMHneSJhNaRgEfCsCzTQJhr0nytto77O7y+GgKujgHw8aSlmNtVTAVorj3t533UV0sfkV9m6bhhl9vZlOAzGEIzGaZRIeeJhyE7moEWBK0B52F1RS+11yrNLN4nlbRCXZSp1Lo7BtGpCmu0wo223Yv0cdCgf9e+yQBdQLiDec14m8b52Zvg6UzAYf+HwyvpAk52HQZbjk0daAof7MAPTcEyiTzR8OsqJMyBJOl4h7mfdCYThMKbBg7e2GzNExdrXxykn2rwbNaSV943YRW3KGi8MdBak3BjL8ID0Tlaxhig6ex6Mz7g/4pZvFVch3mzbeuDepPmpi/DTQPvEOd0ilBhIOHziTKO6YvQ4b0ImS62LukCDuHuCJBq2tYyxsSTtTZV+rnjC98G2LgKOsz9WLl5bZa90+aHXrf9gNtUQSvcTTdOuLDynm7HYiw2ouzQ2gmbBYmoAtESyYGlGJAvmhWNi0MvMwa90fcQ8orhGNKkAIQ77PgtjPyHK6Z8pFc63OGk25cOAZeKIdwdea09x6t7M/d3u5GHaV0F2bSlJdy83PJ4hdbuS7941x1Cfh56tJV2fPFE0VTvKjsanpZ0DY4nEe88Eu/wNTVlxsRYEh0Tl3vlqM89voq7Wi1+Y5Ix3UkYbRnthD5etO5S/sJavOptxYc0uZLmYndCNq6BRq+H32ZMqf6DXoy5rTKaxJsKOAr4DF2F6vhbzJbLX/hse88JanzTb59QbFo8ybrDfpB/j0oUziOzzzVFhaNOSHrb/70/PiGMS4kpxiNbSqmo0i0GA0/I1ptqoVEYQ6YCTgxJyFXGGg8JuSaoeo1CriYIj0AgiQgkW3kmsemi6LMBASHgZ8NdFm0UCAgEBAICAYFAuUMAY8OAEyc0cSQiu/KTrSKjFlTJQkDY4MlCXpRbKggIAQ8Ds3a/ZhhSkVwGERACbnNT8Io1jfZr4qXX7TZkIqkMI+BYwPEyqQO1Bxkr4ManluG2xVQ1Em68Gg7sTBEnasWEZTIzOxJwCPQoVPYSXmGsArxTWcPMI8rTlTa5Wjj6oK0q3Pi4MtaYDLAgFdFlHIGIBJy0GTT3OAh0FWN7cJDNpRB8dUWeMb0MhlvSTnqs3/iEjgQz1o96JhzMsykYvw3CHfEudCMvEU4+AmEFHALcEWJwh11VIfg16AFI5IBMecDwKUO7eoRLg2C/jd/nKp1bf2QDCTcOn9lI6VjFtgXCHbrdTM0sPOUBAVsBx0E2o2GC6HZYIDyINCCWLIbkLaEd4hJrEq+GYzX7hVQH4geTYQ/OEVH2RtIGBidlUA9EdUYexbzCTqAH4JdRVzda8S7x0go3Un4AzSCKF658I2C5mpA0pm6/hAuDLhyzxptbLLENEIQPEP6dx9EVwtQf0rIXZ2fM0cbb+aEtb8bevgyUp1uPjUMXH0Lv0Bp5pypLeFEpvs0MIq9sO7Pjy9NUexrb3CDodLaH3+NjC5UZEpl1h6BfhofpVYUewg275fROcc5EXMslApYCDo0W2MMnsdoQiOcgzD2MLYQ2HwHhWAMhXA+N/hP2V67Cp76PO97E5EIOGX9G52c3hBjJKo2cqXrDeGBv/xXtOQ9kj+IhVRxtdwLvUQi+jwhFuOHfDLohOA6pPtqhCjna9YHkZb8Fcor/5QkB3E8TB5sbGrUvDomoAeH4ChQhwq3mkllXCPoFEI75EPQMaO/e+N1Jh8CoNGE80M7vQ8QDGhS0NGglkyJoVuhyu70VVlFE+omGTysJmA1BPRvqiAwBVGQWoh41RJOR8g0eUGV7FMrKgVkyhGjwyfLKWlqlXdoI4S83CJhrcJxD6PMpx2S1gvDuh/A2CtOidMWkwT/uIFSaEI8NvdKhOoWZux7zFFde2GbhlMcUCpk9ySkheA9A606kMBj2bLt4+l34fn0JT4eQHvb4WaHuSAM1MbwHD9cYlDEdJlV5mgkK3zBBoSBgrmU1B0JCuMMe1g7BU45fUDGl8yoicHl97h9VWOXnv2P7UIY37dh1OQOGLKdsEDj1rBDMSX8ZjMvDw/YWtGsuhLKFyl5m+RDu42rYxIMe4RrwVHoEumKc0F1LhgdICLcWkDPIby7gmgbCRFEOf9FEhXghILqToaBqFUENITREFGbsCWjsYDzOwqtLXmjTDtDMT2EvaH+YHzn46WY0MLPyloGVCAoETBEwN1FACuHaBU3XmHJBi+dITH+IO8VbOeQ9YJWmjXd50zcGvhSgjQ34MfORiZmNi/AE/oiYFQaKRYZwVEE6uvlEzRz1Yamxt/fgBhvu+yEqZiJTmUTAUoNDoE8LlYvNQO23W7UApkMBT3M5OFe73fwZwzDdd4rnbbDhwYvI75VZVRwIlIqeoBqFodF/RS9xF7yYncRpVjF+L4d4kvOmnNKdrV3sOa4LB6jE//KMgKUGh2lyjDcM57/S4YqfwNZWjuvi8RDsGnhCNoL2U2j5QJoU2fdfyBaG0GbhCDWavtM5j8SOIv0AhPkEdR9BtxT07XhAXAUCkSBgqcEpMwTYh5ctS8iPgZw6L0xhchDsX/Eq/1zye2Qcig6HI3Yj+sARCTfRWzmkz4ZwL7RKF/ECgUgQsBVwmAlfYw54KwS9CoStvhVDKNnraSYDJyxtxlxyRNODVrxEvEAgnghYmihUCARWWXiElyH14Fc0uVXh/hJQudkyq/RkxuMU0nlYIag6DIJXU6DZ6ifn/dT9aTWen9QF84g+8KQ6TEvuUQPCU64Q0Nx263qTFrdODaTgzWeZdcpreZOTutzeDJ/ZSV3BXmhbmW2QqFjECNiaKBFzEYQCgTKKgBDwMnpjRLUEAgIBgYBAQCAgEBAICAQEAgIBgYBAQCAgEBAICAQEAqWFAFYz6V2iz5jVlxb/kPHMV9Ge+GMcC0dxf2JBL/F5xf1JPMaxlGC8P+ItTyxoirwCAYGAQCCJCAgFnkTwRdECAYGAQCAWBIQCjwU9kVcgIBAQCCQRgYi2OiSxfqVSNPbuvI2CLol3YT43uwj7iI7Gm29Z44czxTK8LvZHWatXWawPtogNxAk/KcmoG86lKMFLr7nJKPtsKvNQi9n1DraePlfye/Jdfs/+lMLqK6sc7PFV3S3Dfok3DmVKgeNstWoQsKHKYSiGluIEoAKcrP8BtjKrh68YSKIOYje1G0cDxN1JhTigtkwhjCb62RXAeSK2zm7Fbzg2mhZH03DAVR35X0DeHiXYp4j79j2GczfhlKiwR6BFU57TPNhw2x6K8hLI0skUL5uBzlQ9B9Apr3jSA7dG2At5bzx5RsoLZb8asmoh0syC7jQCKSxFLmZdoJP6Qm90wfNUB5u306GfOivnR7rwn8mVZVdJZZ+rpJkvY9/Fhc1nPXaoOR3+y/xQ6FOzvnr5Bdore5ppdL6ypV78rA4UtOkX27DhuQKsvFqwIvZE19SzOxcE7WJo2ddx4gG3/triCJDNeKifgLR9FAk6yreMPOw25HsQvHTby8HnPEjj8xjNTEjmkSGQn25oywXoSFjwww0Z6GBux1dBvkLnlfTj+HCY1es4kP5WYFgxEszjSFPgSsH9L4kjxzCsCjN3pu+64MURxRWP9JfdxdlhyHXJki91S+qpmvMarx//QfrxJsnvfPHFGogUfSuhhWKiwFohESPLRXvyhq4R5gFXSfpvt+T2G3kLHQHfetFbd8SiyMuWAjdvcMJjYaVNxY3IxL0w7TyiqoCfrXV7DIftRsUotkywQjtBwCajfRVMOUnsb4gfC8U7GNa47is0nB6y2g5K52X64IUSB6A07heMYO7nylGfpKFKoBf2Dgxu1gedFH3lxtThHvdBQlsYArNxSFvMlo9pIRFEKiMUGVhK7M8RkMeTZJLuOP14ctbwOth6RoP8pp9OgsK2vBcacksvKfyiyvuz83o9+DARQaFvrf3ztffW3Tp8r2WmBCTguegKTf0OWOsMlngU5fMU9IAiz625p++19TeO1Z88H2EBQoEDKCio5bhJyyPELDKyZGgybc3wiS1Yo1OgvPUfYZHZVnQs98OangILoh5lUa4yW4vr26j2ixRH89olHvYsEq800XZeKPsXoYTeI1pikAwHrY1qsqtQfuMIq1DbncLuhqL/FPUvVUWgw8eHT6mlsC2od6lJCXD6LpGFbe854ZqCzB34hEViJg2pQzjU4sMvDzX/0FvhePPHzI7p0mEchwCMn4/w/LRP8F1yHWm4eK67uPpl0cyRO1XgPdAjUW9k6vBAXRvJ2W6mmUVkXBCAYmrhd7NpYEbvE7RuJw6NvIlGBfj2C7neEEz60tazSoj+Sex23N8RUCxuTDuk4Wp0KzCXPEF5MWtgbiSMRxh1uYxb1SjuCJTQNphB2/EtGx86l4GwZus4LQdHHlPNB6HT/gnNUz626pRHrPQ425DOpf02Vj5O8qO9CXGKxd3849n4JItygL9ZIS5/6saMQ+e/0OS7R9aZpRvjdnZ+vtMfdTZM8LuKOxrTcPc8BVV2/BPfOPpz7R3XDUmURQ7ZWATl3Sik/ARFHGk890ko8DFO2TtS4Jisr2HyUKtl4mts1WksW95cbr8Rb/s8py6Jpt4pBTXfyl789r+iyRvvPDRHLXuggKG8Nbz3oVMdgftyAMpb5yCgs3FP50JJTsdtC3xQwDg3i4+IYfrhQShOReFAeSfF4YGqiTr2gBLvgQ4qZqsfo4pmwOQufAB4ZrJWCuX2u3EyhtEXJxJQzLOubDt/umPFEEmdtl8yfnBB1Z+eM6OVZNfRyge6jG2ybsJ6bTo633RgvgFxm3A/h1Ma7ukkTMP1Rfhi6Jf8oKK/gdJ2dnrhghPnrH1Nlvy6L65Qh0EW+fFa6//ccsWL9FGOuDkYDveDWakpb6q4z1MY2llF0CLDIx1BjjORRFJUQnQtc8V/biy6isCAJssOH6RD/qdgqdyF8AJY27vxcFg6WOz0qaMhENquIKLRFalH6Gz2BuJfwUvjGMCxLDbhCaj7ecCA2nQclvpshENehCE+xeVlI9HAfZgVTwFO9K1jar/qELcVHZ3tcfgqsUNPxd+z3j9Ra2NCFXjFoy2mOaxWROR5ve+9ubDyvj+bEacfb/Rk1rJ/z+RpkKUH0VkOALADMYI7gXuhe6GJ0cG93DAE3lVAT0bFx4j/T7ADuCiv15+GFWbufprz5FfqQFCXzKylk6bwuJivMrtaGac5ZCSnwHDCx93r5A3dh5/tR2scsrYkT6gCP9xkQa0D2VPfxIA8ZKgr+VL2NFv719sq/pqtflfNspYiwTkCMnsjOFWiy7u/3eTmRxotmOYqqbS67cL3x/NEKKk18GfD0q2OB+w3nRbjRJqrP63Yta37uHtKMvLHItrlKc78pM3/ppo+0JpsCfXi4ac5/Svwq6QpqCqUxxi0Kw9KYrEm/rTXF3g5C6VRqq7pmidX5PS/frfs8ibE2oNd8kvTr59eHu9G5Tf+rA6U96NmfDP3dxnZZN0j3wYNgim4Jy/BCHgJ2L+EUY+lw4vouli9dBD34Bjkryd+9HLqHoTvQ0c7kjqEnZ2e//l4vbUhHRLVBXVaUHvXNYcsC3CQgLrXUMp3kIdIMT23KBrF73Zj+SEUv8PiFPKEKvDfG37VTXYXtTGrGOJrHmz2yXlNf81WPpBjRlNacRV/bzn1j2rbMlGeo1UoLtl1vMqBznNKq56xlHOw1fSG+S3m/FeWvEpn6ks7MWDTgEFXZe7vPrLJ+vE0pFUcBPc37je77rzwH51P1Fk3EUPYWtp0b+rxwTlXD81qu+S/Q1xFqTCi4uJugvJtgYd7F6aBdqNTOQjGejUrsYqo8+UorYFdiaDJwsOVhY5qMXjk2dGWZlr6icav4hPftyWizPQT505JBN/8Vh9PAN8QHUfTiaS8qcygQZBluFuh1ZHZMEzjPYWPfg2Csj6oI/Ar69Zf5cYE8d7S9/a3SiocuUNHh+KoTlDgqkFiSHcUhMxtQl26O8oULbHMdkervKnIhCrwaNtU2vmCVsry0i63NMrLbzq37sHs9/8ru3znhpSHF0LH66+ekVt3/frWSyeNdJ+qYWoknWj4dZXdbV59wZdyqmcID8aK0o81fjZr+cRZJmmxRkEPYO5bxk9inUhzc60BPwwlNRhxOcjUF7wupuWEyJT0XbLB1RSfRdyAMkDodxe0N6tGtf09PqZ44DsWneRgbGwZjM7X1LKE0r4dyn28cgdl9iUU5lYznrjPtGGM+H4AOZhMZeQ3+9SowJnfUxh4h2PGxGEc3iX9Ddb/AofZoiOX2TPOpfh0UUKBn8bijPIdabys+v62r0FxlzTTNoxeLlU83vxvJ6v8+Ax0YAVK87kLL8i9bMyWSr+3HN985fOfc/q8PveOLqy072EIWIicuL2VFjbZ8MBjlQ5ekJQt9NEob94uKI50KJmboBwOQHF8Cl7ajisFSr4N5l/PAz1NxazFLyFz4Gp9gh4ovXHGuGjCqDttOEmYa//FRzTisXTA9DVg+hqUd4gDtmMQOUFrmWOT1SvoUE0dWPwG2t488ZwfRu/CL6Hzy5CNn/ES6FbstHyXl5uIK+TvL7D2V8bCO+TBjIVZuc2LFyyYZ2tcmvXHjdsFwVSVZbzKPlHn28ydnV6cIrtL9FNXsuuP6vsuvuXcDX/KCZb1+ZbLb328JP33Ubzsk9W2v5jTfwjewEsy5mUb8nh+xdkO+6vt736/hgdPKpdXKIdz8LDejQ5qL+5FXTRCeR4QL1ziEKAXy6edjfV9mqj0fXg+V6MD6oZ5+dlQtMp+iXjVAvxOoJO9HiOKnbHyFAocCMIqcGktglhBjSQ/lYkbGFd3su76jF3nT3xLr7ylwsxDnW5v8s1jytyktsDsRe8+ixfNbx1o+84cPqcdMtWChLSCuhOzlk2cLHnT4lxjbW2S6Jft58+TWLMzrmjI/G203BUrf2rgTcnvviTuig0HLl6+/goasv5boaN/HcIfkyLHyOQ4+NyHToEWDMTFCQUeFxjLBhOazmg3f8awgqrbK/zU9emX8XJ2etO1Ty6zq12tnVcdxq9HXp/7R+Fl2uOc1u2r8HXdrbeNr/nzpSTEyXEyjiKQlIcoOeVTqVQH4eKKAC13xYvJI1De5cJhRLYNctCbRmYYqXeHEn4Icqkf4Vq1BC8pYc1PhPJeoIzs4mwCOVLg6D0P2pWPN8mHtOkpRVUPFlg1DPHpBXX1y37oSFKLuTBigzkp23SbomyTMAe30SezNNwYyFXiHW6mj8q0mveLtQYVjrYsaLvgg5AXPXZ8cTra+1D8Hx1s+UnbJt8++p0dbWmlQeAfKu2RUWm1zaycRM9dm5Up4pwhQFMryLHaiVzieU+Yc6TAUelv8FBZvkAw1rPJ2se/Qc0t6Y2tovMpwN/6BUyCdgHSZhc8PLud3BRj3Z2EqSc2W6PthEciaEnxlxXlnYj2CZ4CgTMNgXIyiDnTYBftEQgIBAQCsSMgFHjsGAoOAgGBgEAgKQgIBZ4U2EWhAgGBgEBAICAQEAgIBAQCAgGBgEBAICAQEAiULwRoQYTOdXhQbqmLKGeBTS9J27VVFu3RopF8v/H+JL9GogYCgfKLgJgDL7/3TtRcICAQOMsREAr8LBeAWJuPnWlpOBbgHexMc7RxKNZyRX6BgEBA+Z5v6cCATToVeUl0FgL3i2v5RIAUN06QeRe7Y+lwrB7YxPUQFHkerteVzxaJWgsEyh8CznZiOmwfPeT42sSlPj9rxlLYPpePfUIsEJeOTZVjXG521FfEFtCHdh2yFuRJQoC+aejzsNdx7EA3wxbhPHTLo3Hcwu9JqpooViBw1iGQEAWOc0U6ujysG05ZdkN5Wzp8gqiq5GHDiQQKYSsOIlkGpZ+gDfOW1TgrEqgzhbVMX1IZid8+dKLXOvkSiPIxWg97w+tRvjOpxWwbvnM4WvkwsPEsBS2V8AsEBAJxRyBuChzWWB2cpnwlpkcyoYwZro4c8reG5m6NQ57oI7tf4aCnHx0xKCPEfpfyPb3LYYlWxJTCKkwdJffzXRIbCb06AfckTQNRfZ+PfQeL+QXUc7ImPsSLlyQVfBJ7E4r7Im0i7tdWv4fdTIo7WV+q19ZH+AUCZyMCMSlwsuqgcC/Dtakyq22ntGV2MQ5I9+Ms3E/tgMaXMFKRfmXwl+/BMYxWn2Wy45OsNCjEC6HcapIxCuXXEx3Zdjo+szTrgxFNTyjs51BmDZNyixFHGJObgE5mFGp3LTpN3bcwFcXN2FtQ3hcGSAP/0ZAtGCndjOsxfNFdOIGAQCCJCESlwGmKxBOcIoHytnYu1hIKrRcIUoMqrB8UxvN47tcgnIv4IuvMSkptL+ZVMVcuY7j/PTTiGnQANpMyYbiFSaYXrbKHNYHSPQIFqD/q1iyvxJai+coh7zhmsj+NGtDewLm/RE/YpBVJ23o9cHdRxYO3IaKy5Evdji93/6Xx9w9sNGMZQ1xLYPsS8rcIeUMss3UYGUzANwr3E38A+CDad2ewrDrofNfA/wrqO4kUNzrMt9EXdw6mBy4y+wHvKm6maRe7W67LIwICAYFAQhGISoHjuyw7MLddDKV1LpTGuVBcyrcVlZpKrAGU2GVQChlBpR3SACiYrkjvirzFUJqLoBB2hRAFIzBvewxz6b+A10Go+xR0BeGUvhUr23jUoxYOmB+mdA+kAXFeN+JW2mWCpX0dPs7azy2zDVZTPpuvGP2x7C5SD3+X3cUtj527YlZe1V1PZS19eYYdf0dpEisBfQM1j8z2ANfxUMibKA7KW3WIe0nysWnorD6l0QIlgHYc7sk4k0FULvLeQqMgKG/mKmEVij266RiFL3gWQB4Scm/UiguPQEAgoEMgYgUO68vtL8aaXxc75aUPK8hsCzhtgbImZZeF8L/ga6FwDzEBldiQf8ibCqXRXyGX2VoogL9Cgfyis7KDigdTNfQZDwlpmVIKO+nz6j5EG8LbaQTadTjFB8vTzRrCWv0VytvqSzQtUede+KVguudrKLf/EgRWzlOS8V2JRoEH6XwZv2dtsMoTVTy+rwccO0LRdgZGygcZ7G4DtRedVXe0YyzKw3cw9Q5t2uzBh10VxR1khLhW3hTWF7fC1AG3z/AZqj2miSJSICAQiDsCEStwUphQoD1hsTXX1sLtYi5Mo9yFZ9zqudaSW/sl1gV8JkKJvwelURMdQkYIMSZfoeB/lLzsfyFpcYiA8i4Em+1QQiEOyqkhlPp8UtxKIrQZ6nofKW+MJEYgz7qQTIjIXjT5OVye29vh1dbFFY7UqXyga26t3Zfrlk2Cx3X41UMnlQulutSMT6RxXHlHSo9O9DUo8xm4zkEdzsF93ASYb8M02QncB+EEAgKBMoxAxAqc2gALdWWxS6/AMZVC6m4JFNvlsbYT87L7ocQbW/GhuXCphK2AwomLkz1F0g+XjXnFl/pH31CG0okqe3vc3njDg99TGpR3Z1V5G4jRqXVHlKLAQUfz6I8h7noN2cF6G+95DAp/mSZO9UJPfqzoSpOOQyWKwAMFfC4w/Ds6lGpGcijow4h/EPULWacdjOuF3pE+Kud0AZGxKBEWCAgESgkBR6qQpk6QQVFohvpth3KIabkclI8fVt8OA19dEDTroLxP6SJjCGy+4qaF5sqbmMqVjzVYOXPHxY/0oxApWfx7GF7tPC+pvBcxB/5ykKY5vrb9vUF5U1JdzOW/C4z+Q4GEORc7HxhdiNFLC+MP8d2gmbPtyi7t1TJ2dRFpAgGBQHgEHFngxA5zvmtgpbWFpRyYSgiWgSmEJVBQDRE8/UIzmBbJBRYiKW+Td2iB3FCAhXhR+K1iqUbCMAyNN/M3j+z2nROGjHnTTjTiNLBUP4P/M3ofgJpWpGkGKErVYcqhsRow9zQxj05e7N7zJmUXpxwNsdjTCmvn18+5o1yuxU8emqJkgUDpIuBYgWOlhg9b4r/GnHBPbVUx+pfxNw9DeO3UgZbE1g/lb/+lZ6wIgfUf4yTD6Sp4jlf3Zu7rNvp4/dUfINZ0JOL2pa9uteS113kuUtyYMhpT4lXXUeOtKtsTVOwMndASjBCeBg5P8jya615MQQ3HKKbMuO09J1xTUGXHP80qdAKRRen5tzb99onVZukiTiAgEEg+Ao4VOFUZyjsH89EdaCs8bwJewPl9xezf2EL/BMVhuC7JKWwErOZsvBTLhKFaBdMNmZheqAIrmvwVeV5cj+Hl2z/oRSHmiQeCr9HQzkfENg19LN4e6CyegJKd2mT9+Bls/fjWh7I+rH+03srLvanHW0uy+1TaH/VXNv72kWVub4ZuRFDiwxy8rEyh8I0wVNECbWWgzKcjTD8Gi9yFdqmdTllS3to6C79AQCBQPhGISoFTU2Fpr8BlYNBf4C9k09zBNdpQ4plQXjdCeadAwR2ABjtAdFCapy9BP0VAaf+sXLEEDfleQx5alVFXIaZ/MspCZDwcRhA/Q8kuwuqZjaif4urkDd2H33vh+AeV8RRdVVT1HJpbq7xDU0WMQEAgIBCIDYGoFbjsZbtp+gD2ZSqOn5rtCu61hD7rgA0flzipFubTm0KJ01LEGVB6x5D3Iyjw5rhehXj6wk6gA3DC1IIWc/j7kfQSV94WZCJaICAQEAiUeQSiVuDUMijqebBkceZgYMoE18GIVraWO2158KXoKMwhfwMl+y2mindgzvm1khLmgRIXLgIEgNMp4GjpMHWkW8Hj9qXqwsaMLm9FXTo6vRLztwXBnD6ki3tlhFGEBQIJQyAmBa4o72DVgkvQAuuZY6muZkqCNg9BKenmoWNhfabnxXuHxdCfWVbtRD+rc81WPbsYEZb0OmIE8J7jJ1xeMcarYaG8VSiERyBQGgiUoTURpdFcUYZAQCAgEDhzEBAK/My5l6IlAgGBwFmGgFDgZ9kNF80VCAgEBAICAYGAQEAgIBAQCAgEBAICAYGAQCAaBP4f7gEVmIzBYlQAAAAASUVORK5CYII=);background-repeat:no-repeat;background-size:164px;border-radius:3px;display:inline-block;height:21px;width:21px}.fc-icon.icon-chart-bar{background-position:-2px -2px}.fc-icon.icon-chart-stripe{background-position:-25px -2px}.fc-icon.icon-chart-line{background-position:-48px -2px}.fc-icon.icon-chart-area{background-position:-71px -2px}.fc-icon.icon-chart-funnel{background-position:-95px -2px}.fc-icon.icon-chart-gauge{background-position:-118px -2px}.fc-icon.icon-chart-pie{background-position:-141px -2px}.fc-icon.icon-chart-radar{background-position:-2px -25px}.fc-icon.icon-chart-scatter{background-position:-25px -25px}.fc-icon.icon-chart-custom{background-position:-48px -25px}.fd-theme-purple,.fd-theme-purple ._fc-designer,.fd-theme-purple ._fd-config-dialog{--fc-style-color-1:#884cff;--fc-style-bg-color-1:rgba(136,76,255,.05);--el-color-primary:#884cff;--el-color-primary-light-3:#a47fff;--el-color-primary-light-5:#b599ff;--el-color-primary-light-7:#c6b3ff;--el-color-primary-light-8:#d1c2ff;--el-color-primary-light-9:#e1d6ff;--el-color-primary-dark-2:#6e3acc;--fc-style-color-4:#e000ff;--fc-style-bg-color-4:rgba(224,0,255,.05)}.fd-theme-orange,.fd-theme-orange ._fc-designer,.fd-theme-orange ._fd-config-dialog{--fc-style-color-1:#f27024;--fc-style-bg-color-1:rgba(242,112,36,.05);--el-color-primary:#f27024;--el-color-primary-light-3:#ff9a59;--el-color-primary-light-5:#ffb380;--el-color-primary-light-7:#fc9;--el-color-primary-light-8:#ffd6b3;--el-color-primary-light-9:#ffe6cc;--el-color-primary-dark-2:#c25a1d;--fc-style-color-4:#ffb600;--fc-style-bg-color-4:rgba(255,182,0,.05)}.fd-theme-pink,.fd-theme-pink ._fc-designer,.fd-theme-pink ._fd-config-dialog{--fc-style-color-1:#fe679a;--fc-style-bg-color-1:rgba(254,103,154,.05);--el-color-primary:#fe679a;--el-color-primary-light-3:#ff96b3;--el-color-primary-light-5:#ffb3c8;--el-color-primary-light-7:#ffd1dc;--el-color-primary-light-8:#ffdce5;--el-color-primary-light-9:#ffe6ed;--el-color-primary-dark-2:#cb517a;--fc-style-color-4:#bd2bff;--fc-style-bg-color-4:rgba(189,43,255,.05)}.fd-theme-green,.fd-theme-green ._fc-designer,.fd-theme-green ._fd-config-dialog{--fc-style-color-1:#18bf82;--fc-style-bg-color-1:rgba(24,191,130,.05);--el-color-primary:#18bf82;--el-color-primary-light-3:#4fd8a1;--el-color-primary-light-5:#80e6bb;--el-color-primary-light-7:#b3f1d6;--el-color-primary-light-8:#c6f5e0;--el-color-primary-light-9:#d9f9eb;--el-color-primary-dark-2:#149566;--fc-style-color-4:#e2ff00;--fc-style-bg-color-4:rgba(226,255,0,.05)}.fd-theme-green ._fc-designer .el-button--success.is-plain,.fd-theme-green ._fd-config-dialog .el-button--success.is-plain{--el-button-bg-color:#fef1e9;--el-button-text-color:#f27024;--el-button-border-color:#f9b892;--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:#f27024;--el-button-hover-border-color:#f27024;--el-button-active-bg-color:#c65e21;--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:#c65e21}._fc-upload-preview{border-radius:5px;display:inline-block;height:120px;overflow:hidden;width:120px}.form-create.is-preview ._fc-upload .el-icon--close,.form-create.is-preview ._fc-upload .el-icon--close-tip,.form-create.is-preview ._fc-upload .el-upload{display:none!important}pre code.hljs{display:block;overflow-x:auto;padding:1em}code.hljs{padding:3px 5px}.hljs{background:#fff;color:#000}.hljs-subst,.hljs-title{color:#000;font-weight:400}.hljs-title.function_{color:#7a7a43}.hljs-code,.hljs-comment,.hljs-quote{color:#8c8c8c;font-style:italic}.hljs-meta{color:#9e880d}.hljs-section{color:#871094}.hljs-built_in,.hljs-keyword,.hljs-literal,.hljs-meta .hljs-keyword,.hljs-name,.hljs-selector-attr,.hljs-selector-class,.hljs-selector-id,.hljs-selector-pseudo,.hljs-selector-tag,.hljs-symbol,.hljs-template-tag,.hljs-type,.hljs-variable.language_{color:#0033b3}.hljs-attr,.hljs-property{color:#871094}.hljs-attribute{color:#174ad4}.hljs-number{color:#1750eb}.hljs-regexp{color:#264eff}.hljs-link{color:#006dcc;text-decoration:underline}.hljs-meta .hljs-string,.hljs-string{color:#067d17}.hljs-char.escape_{color:#0037a6}.hljs-doctag{text-decoration:underline}.hljs-template-variable{color:#248f8f}.hljs-addition{background:#bee6be}.hljs-deletion{background:#d6d6d6}.hljs-emphasis{font-style:italic}.hljs-strong{font-weight:700}')),document.head.appendChild(e)}}catch(o){console.error("vite-plugin-css-injected-by-js",o)}})();
-var iw = Object.defineProperty;
-var rw = (e, t, i) => t in e ? iw(e, t, { enumerable: !0, configurable: !0, writable: !0, value: i }) : e[t] = i;
-var Wt = (e, t, i) => (rw(e, typeof t != "symbol" ? t + "" : t, i), i);
-import { computed as Cn, isRef as ny, unref as iy, ref as Bs, resolveComponent as ee, TransitionGroup as ow, defineComponent as Be, h as on, nextTick as Yn, toRef as Ei, createVNode as z, mergeProps as jt, openBlock as H, createElementBlock as ae, createElementVNode as J, reactive as vi, markRaw as Gt, withCtx as N, Fragment as Me, renderList as ze, createBlock as me, createTextVNode as be, toDisplayString as le, resolveDynamicComponent as ar, createCommentVNode as Te, onUnmounted as ou, withDirectives as bn, resolveDirective as aw, normalizeClass as qe, normalizeStyle as wn, renderSlot as kt, createSlots as Qn, shallowRef as Vs, withModifiers as vt, vShow as Sn, withKeys as al, normalizeProps as Sr, guardReactiveProps as Er, toRefs as zm, getCurrentInstance as lw, provide as Wm, watch as xo } from "vue";
-import { ElMessage as $c, ElLoading as sw } from "element-plus";
+var ow = Object.defineProperty;
+var aw = (e, t, i) => t in e ? ow(e, t, { enumerable: !0, configurable: !0, writable: !0, value: i }) : e[t] = i;
+var Wt = (e, t, i) => (aw(e, typeof t != "symbol" ? t + "" : t, i), i);
+import { computed as Cn, isRef as ry, unref as oy, ref as Bs, resolveComponent as ee, TransitionGroup as lw, defineComponent as Be, h as on, nextTick as Yn, toRef as Ei, createVNode as z, mergeProps as jt, openBlock as H, createElementBlock as ae, createElementVNode as J, reactive as vi, markRaw as Gt, withCtx as N, Fragment as Me, renderList as ze, createBlock as me, createTextVNode as be, toDisplayString as le, resolveDynamicComponent as ar, createCommentVNode as Te, onUnmounted as ou, withDirectives as bn, resolveDirective as sw, normalizeClass as qe, normalizeStyle as wn, renderSlot as kt, createSlots as Qn, shallowRef as Vs, withModifiers as vt, vShow as Sn, withKeys as al, normalizeProps as Sr, guardReactiveProps as Er, toRefs as Wm, getCurrentInstance as uw, provide as Gm, watch as Eo } from "vue";
+import { ElMessage as Rc, ElLoading as dw } from "element-plus";
import au from "@form-create/element-ui";
import Bt from "@form-create/vant";
-import { showNotify as uw } from "vant";
+import { showNotify as fw } from "vant";
const St = {
type(e, t) {
return Object.prototype.toString.call(e) === "[object " + t + "]";
@@ -46,10 +46,10 @@ const St = {
function Vi(e, t) {
return {}.hasOwnProperty.call(e, t);
}
-function Mo(e, t, i) {
+function Po(e, t, i) {
e[t] = i;
}
-function Rc(e, t = {}, i) {
+function Dc(e, t = {}, i) {
let r = !1;
for (let n in t)
if (Object.prototype.hasOwnProperty.call(t, n)) {
@@ -57,43 +57,43 @@ function Rc(e, t = {}, i) {
if ((r = Array.isArray(a)) || St.Object(a)) {
let s = e[n] === void 0;
if (r)
- r = !1, s && Mo(e, n, []);
+ r = !1, s && Po(e, n, []);
else if (a._clone && i !== void 0)
if (i)
- a = a.getRule(), s && Mo(e, n, {});
+ a = a.getRule(), s && Po(e, n, {});
else {
- Mo(e, n, a._clone());
+ Po(e, n, a._clone());
continue;
}
else
- s && Mo(e, n, {});
- e[n] = Rc(e[n], a, i);
+ s && Po(e, n, {});
+ e[n] = Dc(e[n], a, i);
} else
- Mo(e, n, a), St.Undef(a) || (St.Undef(a.__json) || (e[n].__json = a.__json), St.Undef(a.__origin) || (e[n].__origin = a.__origin));
+ Po(e, n, a), St.Undef(a) || (St.Undef(a.__json) || (e[n].__json = a.__json), St.Undef(a.__origin) || (e[n].__origin = a.__origin));
}
return i !== void 0 && Array.isArray(e) ? e.filter((n) => !n || !n.__ctrl) : e;
}
function gt(e) {
- return Rc({}, { value: e }).value;
+ return Dc({}, { value: e }).value;
}
-function dw(e, t, i) {
+function cw(e, t, i) {
return `[form-create ${e}]: ${t}` + (i ? `
rule: ` + JSON.stringify(i.getRule ? i.getRule() : i) : "");
}
-function fw(e, t) {
- console.error(dw("err", e, t));
+function pw(e, t) {
+ console.error(cw("err", e, t));
}
-const Gm = "[[FORM-CREATE-PREFIX-", Km = "-FORM-CREATE-SUFFIX]]";
+const Km = "[[FORM-CREATE-PREFIX-", Ym = "-FORM-CREATE-SUFFIX]]";
function xd(e) {
return new Function("return " + e)();
}
-function Ho(e, t) {
+function Uo(e, t) {
if (e && St.String(e) && e.length > 4) {
let i = e.trim(), r = !1;
try {
- if (i.indexOf(Km) > 0 && i.indexOf(Gm) === 0)
- i = i.replace(Km, "").replace(Gm, ""), r = !0;
+ if (i.indexOf(Ym) > 0 && i.indexOf(Km) === 0)
+ i = i.replace(Ym, "").replace(Km, ""), r = !0;
else if (i.indexOf("$FN:") === 0)
i = i.substring(4), r = !0;
else if (i.indexOf("$EXEC:") === 0)
@@ -120,7 +120,7 @@ function Ho(e, t) {
}
return n.__json = e, n;
} catch (n) {
- fw(`\u89E3\u6790\u5931\u8D25:${i}
+ pw(`\u89E3\u6790\u5931\u8D25:${i}
err: ${n}`);
return;
@@ -128,7 +128,7 @@ err: ${n}`);
}
return e;
}
-function Dc(e) {
+function Ic(e) {
const t = e.replace(/(-[a-z])/g, function(i) {
return i.replace("-", "").toLocaleUpperCase();
});
@@ -137,7 +137,7 @@ function Dc(e) {
function js(e) {
return e.replace(e[0], e[0].toLowerCase());
}
-const ry = {
+const ay = {
name: "zh-cn",
form: {
field: "\u5B57\u6BB5 ID",
@@ -1926,21 +1926,21 @@ const ry = {
col4: "\u56DB\u5217\u6805\u683C",
table43: "4x3\u8868\u683C"
}
-}, Ic = (e, t) => $c({
+}, Fc = (e, t) => Rc({
message: e,
type: t || "info",
customClass: "_fc-message-tip"
-}), In = (e) => Ic(e, "error"), xs = function(e, t, i, r) {
+}), In = (e) => Fc(e, "error"), xs = function(e, t, i, r) {
const n = r || {};
return t.forEach((a) => {
e.indexOf(a[i || "id"]) > -1 && e.splice(e.indexOf(a[i || "id"]), 1, a[n.label || "label"]), St.trueArray(a[n.children || "children"]) && xs(e, a[n.children || "children"], i, r);
}), e;
-}, cw = function(e, t) {
+}, hw = function(e, t) {
return t.forEach((i) => {
e.indexOf(i.value) > -1 && (e[e.indexOf(i.value)] = i.label);
}), e;
};
-function To(e) {
+function xo(e) {
if (e) {
if (!Array.isArray(e))
return [e];
@@ -1948,30 +1948,30 @@ function To(e) {
return [];
return e;
}
-function pw(e, t) {
+function mw(e, t) {
let i = t.rule.value;
const r = t.$render.vNode.h, n = t.type, a = t.$handle.subForm[t.id], s = t.prop.readMode;
if (t.prop.title.title && t.prop.title.title.trim() && (t.prop.title.title += "\uFF1A"), s === !1 || s === "custom" || !t.input || t.rule.subForm || (Array.isArray(a) ? a.length : a) || ["fcGroup", "fcSubForm", "tableForm", "tableFormPro", "fcJson", "stepForm", "nestedTableForm", "infiniteTableForm", "fcUpload", "fcDialog", "fcDrawer", "fcPopup"].indexOf(t.trueType) > -1)
return t.trueType === "fcUpload" && (t.prop.props.disabled = !0), t.parser.render(e, t);
if (["radio", "select", "checkbox"].indexOf(n) > -1)
- i = cw([...To(i)], t.prop.props.options || t.prop.props.formCreateInject.options || []).join(", ");
+ i = hw([...xo(i)], t.prop.props.options || t.prop.props.formCreateInject.options || []).join(", ");
else if (["timePicker", "datePicker", "slider"].indexOf(n) > -1)
i = Array.isArray(i) ? i.join(" - ") : i;
else if (n === "cascader")
- i = [...To(i)], Array.isArray(i[0]) || (i = [i]), i = i.map((u) => xs(u, t.prop.props.options || t.prop.props.formCreateInject.options || [], "value", t.prop.props.props).join("/")).join(", ");
+ i = [...xo(i)], Array.isArray(i[0]) || (i = [i]), i = i.map((u) => xs(u, t.prop.props.options || t.prop.props.formCreateInject.options || [], "value", t.prop.props.props).join("/")).join(", ");
else if (n === "elTransfer") {
- const u = [...To(i)];
+ const u = [...xo(i)];
i = xs(u, t.prop.props.data || t.prop.props.formCreateInject.options || [], "key").join(", ");
} else if (n === "fcDataSelect")
- i = [...To(i)].map((d) => d[t.prop.props.labelKey || "label"]).join(", ");
+ i = [...xo(i)].map((d) => d[t.prop.props.labelKey || "label"]).join(", ");
else if (["tree", "elTreeSelect"].indexOf(n) > -1) {
const u = t.prop.props.data || t.prop.props.formCreateInject.options || [];
- i = xs([...To(i)], u, n === "elTreeSelect" ? "value" : "id").join(", ");
+ i = xs([...xo(i)], u, n === "elTreeSelect" ? "value" : "id").join(", ");
} else {
if (n === "fcEditor" || s === "html")
return r("div", { innerHTML: i });
if (s === "image")
- return i = To(i), r("div", { class: "_fc-upload" }, i.map(function(u) {
+ return i = xo(i), r("div", { class: "_fc-upload" }, i.map(function(u) {
return r("div", { class: "_fc-upload-preview" }, [
r("el-image", { src: (u == null ? void 0 : u.url) || u, previewSrcList: i.map((d) => (d == null ? void 0 : d.url) || d), previewTeleported: !0, fit: "cover" })
]);
@@ -1986,7 +1986,7 @@ function pw(e, t) {
}
return r("span", { class: "_fc-read-view" }, ["" + (i == null ? "" : i)]);
}
-function hw(e, t) {
+function vw(e, t) {
return `
`;
}
-function mw(e, t) {
+function gw(e, t) {
return `
{
}
<\/script>`;
}
-function vw(e, t) {
+function yw(e, t) {
return `
`;
}
-function gw(e, t) {
+function bw(e, t) {
return `
{
}
<\/script>`;
}
-function oy() {
+function ly() {
return {
type: "Required",
field: "formCreate$required",
@@ -2120,7 +2120,7 @@ function Wi(e, t, i, r = []) {
}
return r;
}
-function ay(e) {
+function sy(e) {
return [
{
type: "ConfigItem",
@@ -2216,7 +2216,7 @@ function Jr(e, t, i, r) {
rule: [
{
type: "TableOptions",
- field: "formCreate" + zo(t).replace(".", ">"),
+ field: "formCreate" + Ho(t).replace(".", ">"),
title: e("props.options"),
_fc_important_prop: !0,
wrap: { show: !1 },
@@ -2275,7 +2275,7 @@ function Ti(e, t, i) {
rule: [
{
type: "Struct",
- field: "formCreate" + zo(t).replace(".", ">"),
+ field: "formCreate" + Ho(t).replace(".", ">"),
title: i || e("props.options"),
_fc_important_prop: !0,
wrap: { show: !1 }
@@ -2330,7 +2330,7 @@ function ll(e, t, i, r) {
rule: [
{
type: "TreeOptions",
- field: "formCreate" + zo(t).replace(".", ">"),
+ field: "formCreate" + Ho(t).replace(".", ">"),
title: e("props.options"),
_fc_important_prop: !0,
wrap: { show: !1 },
@@ -2357,13 +2357,13 @@ function ll(e, t, i, r) {
control: a
};
}
-function zo(e) {
+function Ho(e) {
return e.replace(e[0], e[0].toLocaleUpperCase());
}
const ai = function(e) {
const t = /object ([a-zA-Z]*)/.exec(Object.prototype.toString.call(e));
- return t && Ym[t[1].toLowerCase()] ? Ym[t[1].toLowerCase()](e) : e;
-}, Ym = {
+ return t && Qm[t[1].toLowerCase()] ? Qm[t[1].toLowerCase()](e) : e;
+}, Qm = {
object: function(e) {
var t = [];
for (var i in e)
@@ -2393,38 +2393,38 @@ const ai = function(e) {
}
return '"' + t.join("") + '"';
}
-}, ly = function(e) {
+}, uy = function(e) {
if (e && typeof e == "object") {
for (let t in e)
if (Object.prototype.hasOwnProperty.call(e, t)) {
let i = e[t];
- (Array.isArray(i) || St.Object(i)) && ly(i), St.String(i) && (e[t] = Ho(i));
+ (Array.isArray(i) || St.Object(i)) && uy(i), St.String(i) && (e[t] = Uo(i));
}
}
return e;
};
-function Wo(e, t, i) {
+function zo(e, t, i) {
t = (t || "").split(".");
let r = 0, n = t.length;
for (; e != null && r < n; )
e = e[t[r++]];
return r && r === n && e !== void 0 ? e : i;
}
-const yw = (e) => (t, i) => bw(t, i, iy(e)), bw = (e, t, i) => Wo(i, e, "").replace(
+const _w = (e) => (t, i) => ww(t, i, oy(e)), ww = (e, t, i) => zo(i, e, "").replace(
/\{(\w+)\}/g,
(r, n) => {
var a;
return `${(a = t == null ? void 0 : t[n]) != null ? a : `{${n}}`}`;
}
-), _w = (e) => {
- const t = Cn(() => iy(e).name), i = Cn(() => zo(Dc(t.value || ""))), r = ny(e) ? e : Bs(e);
+), Aw = (e) => {
+ const t = Cn(() => oy(e).name), i = Cn(() => Ho(Ic(t.value || ""))), r = ry(e) ? e : Bs(e);
return {
lang: t,
name: i,
locale: r,
- t: yw(e)
+ t: _w(e)
};
-}, oc = (e) => _w(Cn(() => (ny(e) ? e.value : e) || ry)), yt = (e, t, i) => t.map((r) => (r.label = e((i || "props") + "." + (r.label || r.value)) || r.label, r)), Ke = (e, t, i) => i.map((r) => (r.field === "formCreate$required" ? r.title = e("validate.required") || r.title : r.field && r.field !== "_optionType" && (r.title = e("com." + t + "." + r.field) || r.title), r.type === "template" && St.trueArray(r.children) && (r.children = Ke(e, t, r.children)), r)), ac = (e) => {
+}, ac = (e) => Aw(Cn(() => (ry(e) ? e.value : e) || ay)), yt = (e, t, i) => t.map((r) => (r.label = e((i || "props") + "." + (r.label || r.value)) || r.label, r)), Ke = (e, t, i) => i.map((r) => (r.field === "formCreate$required" ? r.title = e("validate.required") || r.title : r.field && r.field !== "_optionType" && (r.title = e("com." + t + "." + r.field) || r.title), r.type === "template" && St.trueArray(r.children) && (r.children = Ke(e, t, r.children)), r)), lc = (e) => {
const t = [];
return e && e.forEach((i) => {
if (!i._fc_drag_skip)
@@ -2432,13 +2432,13 @@ const yw = (e) => (t, i) => bw(t, i, iy(e)), bw = (e, t, i) => Wo(i, e, "").repl
const r = {
id: i.__fc__.id,
rule: i,
- children: ac(i.children)
+ children: lc(i.children)
};
r.children.length || delete r.children, t.push(r);
} else
- t.push(...ac(i.children));
+ t.push(...lc(i.children));
}), t;
-}, Qm = (e) => {
+}, Jm = (e) => {
const t = (i) => {
const r = [];
return i && i.forEach((n) => {
@@ -2446,7 +2446,7 @@ const yw = (e) => (t, i) => bw(t, i, iy(e)), bw = (e, t, i) => Wo(i, e, "").repl
}), r;
};
return t(e);
-}, Jm = (e) => {
+}, Xm = (e) => {
const t = (i) => {
const r = [];
return i && i.forEach((n) => {
@@ -2485,10 +2485,10 @@ function Fn(e) {
function ji(e) {
return ["", null, void 0].indexOf(e) !== -1;
}
-function sy(e) {
+function dy(e) {
return e.replace(/[\ .*+?^${}()|[\]\\]/g, "\\$&");
}
-function ww(e, t) {
+function Cw(e, t) {
const i = e.split("."), r = t.split("."), n = Math.min(i.length, r.length);
for (var a = 0; a < n; a++) {
var s = parseInt(i[a], 10) - parseInt(r[a], 10);
@@ -2507,17 +2507,17 @@ function tr(e) {
} catch {
console.log("Oops, unable to copy");
}
- Ic("\u5DF2\u590D\u5236!", "success"), document.body.removeChild(t);
+ Fc("\u5DF2\u590D\u5236!", "success"), document.body.removeChild(t);
}
function Us(e) {
return e.filter((t, i) => e.indexOf(t) === i);
}
-let Aw = 0;
+let Sw = 0;
function rt() {
- const e = 370 + ++Aw;
+ const e = 370 + ++Sw;
return "F" + Math.random().toString(36).substr(3, 3) + Number(`${Date.now()}`).toString(36) + e.toString(36) + "c";
}
-function Cw(e, t) {
+function Ew(e, t) {
return function(i, r, n) {
const a = { ...i || {} };
Object.keys(a).forEach((s) => {
@@ -2525,7 +2525,7 @@ function Cw(e, t) {
}), n.getRule(e).props.info = Object.keys(a).length > 0 ? t("struct.configured") : "";
};
}
-function Xm({ t: e }) {
+function Zm({ t: e }) {
const t = rt();
return [
{
@@ -2635,7 +2635,7 @@ function Xm({ t: e }) {
wrap: { show: !1 },
value: {},
slot: "append",
- update: Cw(t, e)
+ update: Ew(t, e)
}]
},
{
@@ -2819,7 +2819,7 @@ function Fa({ t: e }) {
}
];
}
-function Zm({ t: e }) {
+function qm({ t: e }) {
return [
{
type: "input",
@@ -2845,7 +2845,7 @@ function Zm({ t: e }) {
}
];
}
-function qm({ t: e }) {
+function ev({ t: e }) {
return [
{
type: "ComputedConfig",
@@ -2900,7 +2900,7 @@ function qm({ t: e }) {
}
];
}
-function ev({ t: e }) {
+function tv({ t: e }) {
return [
{
type: "Required",
@@ -2915,7 +2915,7 @@ function ev({ t: e }) {
}
];
}
-function Sw(e) {
+function xw(e) {
e = e || /* @__PURE__ */ new Map();
const t = {
$on(i, r) {
@@ -2939,10 +2939,10 @@ function Sw(e) {
};
return t;
}
-const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
+const Tw = "\u5355\u9009\u6846", Td = "radio", kw = {
menu: "main",
icon: "icon-radio",
- label: Ew,
+ label: Tw,
name: Td,
input: !0,
event: ["change"],
@@ -2994,10 +2994,10 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
}
]);
}
-}, Tw = "\u591A\u9009\u6846", kd = "checkbox", kw = {
+}, Ow = "\u591A\u9009\u6846", kd = "checkbox", $w = {
menu: "main",
icon: "icon-checkbox",
- label: Tw,
+ label: Ow,
name: kd,
input: !0,
event: ["change"],
@@ -3069,10 +3069,10 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
}
]);
}
-}, Ow = "\u8F93\u5165\u6846", Od = "input", $w = {
+}, Rw = "\u8F93\u5165\u6846", Od = "input", Dw = {
menu: "main",
icon: "icon-input",
- label: Ow,
+ label: Rw,
name: Od,
input: !0,
easySlots: ["prefix", "suffix", "prepend", "append"],
@@ -3125,11 +3125,11 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
}
]);
}
-}, Rw = "\u591A\u884C\u8F93\u5165\u6846", tv = "textarea", Dw = {
+}, Iw = "\u591A\u884C\u8F93\u5165\u6846", nv = "textarea", Fw = {
menu: "main",
icon: "icon-textarea",
- label: Rw,
- name: tv,
+ label: Iw,
+ name: nv,
input: !0,
event: ["blur", "focus", "change", "input"],
validate: ["string"],
@@ -3146,7 +3146,7 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
};
},
props(e, { t }) {
- return Ke(t, tv + ".props", [
+ return Ke(t, nv + ".props", [
{
type: "switch",
field: "disabled"
@@ -3181,11 +3181,11 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
}
]);
}
-}, Iw = "\u5BC6\u7801\u8F93\u5165\u6846", nv = "password", Fw = {
+}, Pw = "\u5BC6\u7801\u8F93\u5165\u6846", iv = "password", Mw = {
menu: "main",
icon: "icon-password",
- label: Iw,
- name: nv,
+ label: Pw,
+ name: iv,
input: !0,
easySlots: ["prefix", "suffix", "prepend", "append"],
event: ["blur", "focus", "change", "input", "clear"],
@@ -3203,7 +3203,7 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
};
},
props(e, { t }) {
- return Ke(t, nv + ".props", [
+ return Ke(t, iv + ".props", [
{
type: "switch",
field: "disabled"
@@ -3227,10 +3227,10 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
}
]);
}
-}, Pw = "\u8BA1\u6570\u5668", $d = "inputNumber", Mw = {
+}, Lw = "\u8BA1\u6570\u5668", $d = "inputNumber", Nw = {
menu: "main",
icon: "icon-number",
- label: Pw,
+ label: Lw,
name: $d,
input: !0,
easySlots: ["prefix", "suffix"],
@@ -3271,10 +3271,10 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
options: yt(t, [{ label: "default", value: "" }, { label: "right", value: "right" }])
}, { type: "input", field: "placeholder" }]);
}
-}, Lw = "\u9009\u62E9\u5668", Rd = "select", Nw = {
+}, Bw = "\u9009\u62E9\u5668", Rd = "select", Vw = {
menu: "main",
icon: "icon-select",
- label: Lw,
+ label: Bw,
name: Rd,
input: !0,
event: ["change", "visibleChange", "removeTag", "clear", "blur", "focus"],
@@ -3362,10 +3362,10 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
{ type: "switch", field: "defaultFirstOption" }
]);
}
-}, Bw = "\u5F00\u5173", Dd = "switch", Vw = {
+}, jw = "\u5F00\u5173", Dd = "switch", Uw = {
menu: "main",
icon: "icon-switch",
- label: Bw,
+ label: jw,
name: Dd,
input: !0,
easySlots: ["active-action", "inactive-action"],
@@ -3413,10 +3413,10 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
field: "inactiveColor"
}]);
}
-}, jw = "\u6ED1\u5757", Id = "slider", Uw = {
+}, Hw = "\u6ED1\u5757", Id = "slider", zw = {
menu: "main",
icon: "icon-slider",
- label: jw,
+ label: Hw,
name: Id,
input: !0,
event: ["change", "input"],
@@ -3460,10 +3460,10 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
field: "height"
}]);
}
-}, Hw = "\u65F6\u95F4", Pa = "timePicker", uy = {
+}, Ww = "\u65F6\u95F4", Pa = "timePicker", fy = {
menu: "main",
icon: "icon-time",
- label: Hw,
+ label: Ww,
name: Pa,
input: !0,
event: ["change", "blur", "focus", "visibleChange"],
@@ -3539,14 +3539,14 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
}])
}]);
}
-}, zw = "\u65F6\u95F4\u533A\u95F4", Ww = "timeRange", Gw = {
+}, Gw = "\u65F6\u95F4\u533A\u95F4", Kw = "timeRange", Yw = {
menu: "main",
icon: "icon-time-range",
- label: zw,
- name: Ww,
+ label: Gw,
+ name: Kw,
input: !0,
event: ["change", "blur", "focus", "visibleChange"],
- sfc: uy.sfc,
+ sfc: fy.sfc,
rule({ t: e }) {
return {
type: "timePicker",
@@ -3609,7 +3609,7 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
}])
}]);
}
-}, Kw = "\u65E5\u671F", Fd = "datePicker", iv = {
+}, Qw = "\u65E5\u671F", Fd = "datePicker", rv = {
date: "YYYY-MM-DD",
month: "YYYY-MM",
datetime: "YYYY-MM-DD HH:mm:ss",
@@ -3618,15 +3618,15 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
monthrange: "YYYY-MM",
datetimerange: "YYYY-MM-DD HH:mm:ss",
year: "YYYY"
-}, dy = {
+}, cy = {
menu: "main",
icon: "icon-date",
- label: Kw,
+ label: Qw,
name: Fd,
input: !0,
event: ["change", "blur", "focus", "calendarChange", "panelChange", "visibleChange"],
sfc(e) {
- e.props.valueFormat || (e.props.valueFormat = iv[e.props.type] || iv.date);
+ e.props.valueFormat || (e.props.valueFormat = rv[e.props.type] || rv.date);
},
rule({ t: e }) {
return {
@@ -3684,14 +3684,14 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
field: "unlinkPanels"
}]);
}
-}, Yw = "\u65E5\u671F\u533A\u95F4", Qw = "dateRange", Jw = {
+}, Jw = "\u65E5\u671F\u533A\u95F4", Xw = "dateRange", Zw = {
menu: "main",
icon: "icon-date-range",
- label: Yw,
- name: Qw,
+ label: Jw,
+ name: Xw,
input: !0,
event: ["change", "blur", "focus", "calendarChange", "panelChange", "visibleChange"],
- sfc: dy.sfc,
+ sfc: cy.sfc,
rule({ t: e }) {
return {
type: "datePicker",
@@ -3742,10 +3742,10 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
field: "unlinkPanels"
}]);
}
-}, Xw = "\u8BC4\u5206", Pd = "rate", Zw = {
+}, qw = "\u8BC4\u5206", Pd = "rate", eA = {
menu: "main",
icon: "icon-rate",
- label: Xw,
+ label: qw,
name: Pd,
input: !0,
event: ["change"],
@@ -3790,10 +3790,10 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
}
]);
}
-}, qw = "\u989C\u8272\u9009\u62E9\u5668", Md = "colorPicker", eA = {
+}, tA = "\u989C\u8272\u9009\u62E9\u5668", Md = "colorPicker", nA = {
menu: "main",
icon: "icon-color",
- label: qw,
+ label: tA,
name: Md,
input: !0,
event: ["change", "activeChange", "focus", "blur"],
@@ -3868,10 +3868,10 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
}
]);
}
-}, tA = "\u6805\u683C\u5E03\u5C40", Ld = "fcRow", nA = {
+}, iA = "\u6805\u683C\u5E03\u5C40", Ld = "fcRow", rA = {
menu: "layout",
icon: "icon-row",
- label: tA,
+ label: iA,
name: Ld,
mask: !1,
children: "col",
@@ -3927,13 +3927,13 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
}]
}]);
}
-}, Nd = "col", rv = {
+}, Nd = "col", ov = {
xs: "<768px",
sm: "\u2265768px",
md: "\u2265992px",
lg: "\u22651200px",
xl: "\u22651920px"
-}, iA = {
+}, oA = {
name: Nd,
label: "\u683C\u5B50",
drag: !0,
@@ -3966,10 +3966,10 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
width: "100%"
},
slot: "append",
- children: Object.keys(rv).map((i) => ({
+ children: Object.keys(ov).map((i) => ({
type: "elTabPane",
props: {
- label: rv[i]
+ label: ov[i]
},
style: "padding:0 10px;",
children: [
@@ -4005,8 +4005,8 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
}
]);
}
-}, rA = "\u9009\u9879\u5361", Bd = "elTabPane", oA = {
- label: rA,
+}, aA = "\u9009\u9879\u5361", Bd = "elTabPane", lA = {
+ label: aA,
name: Bd,
inside: !0,
drag: !0,
@@ -4030,10 +4030,10 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
field: "lazy"
}]);
}
-}, aA = "\u5206\u5272\u7EBF", Vd = "elDivider", lA = {
+}, sA = "\u5206\u5272\u7EBF", Vd = "elDivider", uA = {
menu: "aide",
icon: "icon-divider",
- label: aA,
+ label: sA,
name: Vd,
rule({ t: e }) {
return {
@@ -4059,10 +4059,10 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
}])
}]);
}
-}, sA = "\u7EA7\u8054\u9009\u62E9\u5668", Zl = "cascader", uA = {
+}, dA = "\u7EA7\u8054\u9009\u62E9\u5668", Zl = "cascader", fA = {
menu: "main",
icon: "icon-cascader",
- label: sA,
+ label: dA,
name: Zl,
input: !0,
event: ["change", "expandChange", "blur", "focus", "visibleChange", "removeTag"],
@@ -4179,10 +4179,10 @@ const Ew = "\u5355\u9009\u6846", Td = "radio", xw = {
}
]);
}
-}, dA = "\u4E0A\u4F20", jd = "upload", fA = {
+}, cA = "\u4E0A\u4F20", jd = "upload", pA = {
menu: "main",
icon: "icon-upload",
- label: dA,
+ label: cA,
name: jd,
input: !0,
easySlots: [{ value: "tip", type: "text" }],
@@ -4321,10 +4321,10 @@ file.url = res.data.url;`
}
]);
}
-}, cA = "\u7A7F\u68AD\u6846", Ud = "elTransfer", pA = {
+}, hA = "\u7A7F\u68AD\u6846", Ud = "elTransfer", mA = {
menu: "main",
icon: "icon-transfer",
- label: cA,
+ label: hA,
name: Ud,
input: !0,
event: ["change", "leftCheckChange", "rightCheckChange"],
@@ -4387,10 +4387,10 @@ file.url = res.data.url;`
}
]);
}
-}, hA = "\u6811\u5F62\u63A7\u4EF6", Hd = "tree", mA = {
+}, vA = "\u6811\u5F62\u63A7\u4EF6", Hd = "tree", gA = {
menu: "main",
icon: "icon-tree",
- label: hA,
+ label: vA,
name: Hd,
input: !0,
event: ["nodeClick", "nodeContextmenu", "checkChange", "check", "currentChange", "nodeExpand", "nodeCollapse", "nodeDragStart", "nodeDragEnter", "nodeDragLeave", "nodeDragOver", "nodeDragEnd", "nodeDrop"],
@@ -4477,10 +4477,10 @@ file.url = res.data.url;`
}
]);
}
-}, vA = "\u63D0\u793A", zd = "elAlert", gA = {
+}, yA = "\u63D0\u793A", zd = "elAlert", bA = {
menu: "aide",
icon: "icon-alert",
- label: vA,
+ label: yA,
name: zd,
event: ["close"],
rule({ t: e }) {
@@ -4516,11 +4516,11 @@ file.url = res.data.url;`
options: [{ label: "light", value: "light" }, { label: "dark", value: "dark" }]
}]);
}
-}, yA = "\u6587\u5B57", ov = "text", bA = {
+}, _A = "\u6587\u5B57", av = "text", wA = {
menu: "aide",
icon: "icon-span",
- label: yA,
- name: ov,
+ label: _A,
+ name: av,
inline: !0,
rule({ t: e }) {
return {
@@ -4533,7 +4533,7 @@ file.url = res.data.url;`
};
},
props(e, { t }) {
- return Ke(t, ov + ".props", [
+ return Ke(t, av + ".props", [
{
type: "input",
field: "formCreateChild",
@@ -4543,11 +4543,11 @@ file.url = res.data.url;`
}
]);
}
-}, _A = "\u95F4\u8DDD", wA = "space", AA = {
+}, AA = "\u95F4\u8DDD", CA = "space", SA = {
menu: "layout",
icon: "icon-space",
- label: _A,
- name: wA,
+ label: AA,
+ name: CA,
rule() {
return {
type: "div",
@@ -4565,10 +4565,10 @@ file.url = res.data.url;`
props() {
return [];
}
-}, CA = "\u6807\u7B7E\u9875", Wd = "elTabs", SA = {
+}, EA = "\u6807\u7B7E\u9875", Wd = "elTabs", xA = {
menu: "layout",
icon: "icon-tab",
- label: CA,
+ label: EA,
name: Wd,
mask: !1,
event: ["tabClick", "tabChange", "tabRemove", "tabAdd", "edit"],
@@ -4615,10 +4615,10 @@ file.url = res.data.url;`
}])
}, { type: "switch", field: "stretch" }]);
}
-}, EA = "\u6309\u94AE", Gd = "elButton", xA = {
+}, TA = "\u6309\u94AE", Gd = "elButton", kA = {
menu: "aide",
icon: "icon-button",
- label: EA,
+ label: TA,
name: Gd,
mask: !0,
inline: !0,
@@ -4660,10 +4660,10 @@ file.url = res.data.url;`
field: "loading"
}, { type: "switch", field: "disabled" }]);
}
-}, TA = "\u5BCC\u6587\u672C\u6846", Kd = "fcEditor", kA = {
+}, OA = "\u5BCC\u6587\u672C\u6846", Kd = "fcEditor", $A = {
menu: "main",
icon: "icon-editor",
- label: TA,
+ label: OA,
name: Kd,
input: !0,
event: ["change"],
@@ -4684,11 +4684,11 @@ file.url = res.data.url;`
field: "disabled"
}]);
}
-}, OA = "\u5B50\u8868\u5355", av = "group", $A = {
+}, RA = "\u5B50\u8868\u5355", lv = "group", DA = {
menu: "subform",
icon: "icon-subform",
- label: OA,
- name: av,
+ label: RA,
+ name: lv,
input: !0,
inside: !1,
drag: !0,
@@ -4715,7 +4715,7 @@ file.url = res.data.url;`
};
},
props(e, { t }) {
- return Ke(t, av + ".props", [
+ return Ke(t, lv + ".props", [
{
type: "switch",
field: "disabled"
@@ -4727,11 +4727,11 @@ file.url = res.data.url;`
{ type: "inputNumber", field: "max" }
]);
}
-}, RA = "\u5206\u7EC4", lv = "subForm", DA = {
+}, IA = "\u5206\u7EC4", sv = "subForm", FA = {
menu: "subform",
icon: "icon-group",
- label: RA,
- name: lv,
+ label: IA,
+ name: sv,
input: !0,
inside: !1,
drag: !0,
@@ -4780,17 +4780,17 @@ file.url = res.data.url;`
};
},
props(e, { t }) {
- return Ke(t, lv + ".props", [
+ return Ke(t, sv + ".props", [
{
type: "switch",
field: "disabled"
}
]);
}
-}, IA = "\u5361\u7247", Yd = "elCard", FA = {
+}, PA = "\u5361\u7247", Yd = "elCard", MA = {
menu: "layout",
icon: "icon-card",
- label: IA,
+ label: PA,
name: Yd,
drag: !0,
inside: !1,
@@ -4821,10 +4821,10 @@ file.url = res.data.url;`
}])
}]);
}
-}, PA = "\u6298\u53E0\u9762\u677F", Qd = "elCollapse", MA = {
+}, LA = "\u6298\u53E0\u9762\u677F", Qd = "elCollapse", NA = {
menu: "layout",
icon: "icon-collapse",
- label: PA,
+ label: LA,
name: Qd,
mask: !1,
children: "elCollapseItem",
@@ -4862,9 +4862,9 @@ file.url = res.data.url;`
field: "accordion"
}]);
}
-}, LA = "\u9762\u677F", Jd = "elCollapseItem", NA = {
+}, BA = "\u9762\u677F", Jd = "elCollapseItem", VA = {
icon: "icon-cell",
- label: LA,
+ label: BA,
name: Jd,
drag: !0,
dragBtn: !1,
@@ -4894,10 +4894,10 @@ file.url = res.data.url;`
field: "disabled"
}]);
}
-}, BA = "\u6811\u5F62\u9009\u62E9", Xd = "elTreeSelect", VA = {
+}, jA = "\u6811\u5F62\u9009\u62E9", Xd = "elTreeSelect", UA = {
menu: "main",
icon: "icon-tree-select",
- label: BA,
+ label: jA,
name: Xd,
input: !0,
event: ["change", "visibleChange", "removeTag", "clear", "blur", "focus"],
@@ -4988,10 +4988,10 @@ file.url = res.data.url;`
}
]);
}
-}, jA = "\u6807\u7B7E", Zd = "elTag", UA = {
+}, HA = "\u6807\u7B7E", Zd = "elTag", zA = {
menu: "aide",
icon: "icon-tag",
- label: jA,
+ label: HA,
name: Zd,
mask: !0,
inline: !0,
@@ -5058,9 +5058,9 @@ file.url = res.data.url;`
}
]);
}
-}, HA = "\u63CF\u8FF0\u683C\u5B50", qd = "elDescriptionsItem", zA = {
+}, WA = "\u63CF\u8FF0\u683C\u5B50", qd = "elDescriptionsItem", GA = {
icon: "icon-cell",
- label: HA,
+ label: WA,
name: qd,
dragBtn: !1,
inside: !0,
@@ -5123,10 +5123,10 @@ file.url = res.data.url;`
{ type: "input", field: "className" }
]);
}
-}, WA = "\u63CF\u8FF0\u5217\u8868", ef = "elDescriptions", GA = {
+}, KA = "\u63CF\u8FF0\u5217\u8868", ef = "elDescriptions", YA = {
menu: "layout",
icon: "icon-descriptions",
- label: WA,
+ label: KA,
name: ef,
mask: !1,
rule() {
@@ -5190,10 +5190,10 @@ file.url = res.data.url;`
}])
}]);
}
-}, KA = "\u5206\u6B65\u8868\u5355", tf = "stepForm", YA = {
+}, QA = "\u5206\u6B65\u8868\u5355", tf = "stepForm", JA = {
menu: "subform",
icon: "icon-step-form",
- label: KA,
+ label: QA,
name: tf,
input: !0,
mask: !1,
@@ -5259,9 +5259,9 @@ file.url = res.data.url;`
}
]);
}
-}, QA = "\u6B65\u9AA4\u6761", nf = "stepFormItem", JA = {
+}, XA = "\u6B65\u9AA4\u6761", nf = "stepFormItem", ZA = {
icon: "icon-cell",
- label: QA,
+ label: XA,
name: nf,
aide: !0,
drag: !0,
@@ -5295,10 +5295,10 @@ file.url = res.data.url;`
}
]);
}
-}, XA = "HTML", rf = "html", ZA = {
+}, qA = "HTML", rf = "html", eC = {
menu: "aide",
icon: "icon-html",
- label: XA,
+ label: qA,
name: rf,
sfc(e) {
e.type = "div";
@@ -5322,10 +5322,10 @@ file.url = res.data.url;`
}
]);
}
-}, qA = "\u8868\u683C\u5E03\u5C40", of = "fcTable", eC = {
+}, tC = "\u8868\u683C\u5E03\u5C40", of = "fcTable", nC = {
menu: "layout",
icon: "icon-table",
- label: qA,
+ label: tC,
name: of,
inside: !1,
mask: !1,
@@ -5443,10 +5443,10 @@ border-bottom: 1px solid #EBEEF5;
{ type: "input", field: "borderWidth" }
]);
}
-}, tC = "\u8868\u683C\u8868\u5355", af = "tableForm", nC = {
+}, iC = "\u8868\u683C\u8868\u5355", af = "tableForm", rC = {
menu: "subform",
icon: "icon-table-form",
- label: tC,
+ label: iC,
name: af,
input: !0,
mask: !1,
@@ -5539,10 +5539,10 @@ border-bottom: 1px solid #EBEEF5;
}
]);
}
-}, iC = "\u8868\u683C\u8868\u5355Pro", rC = "tableFormPro", fy = (e) => e.map((t) => {
+}, oC = "\u8868\u683C\u8868\u5355Pro", aC = "tableFormPro", py = (e) => e.map((t) => {
let i = t.children || [];
const r = i.filter((n) => n._fc_drag_tag === "tableFormColumn2");
- return r.length > 0 && (i = fy(r)), {
+ return r.length > 0 && (i = py(r)), {
header: t.props.header,
label: t.props.label,
fixed: t.props.fixed,
@@ -5554,7 +5554,7 @@ border-bottom: 1px solid #EBEEF5;
},
[r.length ? "children" : "rule"]: i
};
-}), cy = (e) => e.map((t) => ({
+}), hy = (e) => e.map((t) => ({
type: "tableFormColumn",
_fc_drag_tag: "tableFormColumn2",
props: {
@@ -5566,12 +5566,12 @@ border-bottom: 1px solid #EBEEF5;
width: t.style.width || "",
color: t.style.color || ""
},
- children: t.children ? cy(t.children) : t.rule || []
-})), oC = {
+ children: t.children ? hy(t.children) : t.rule || []
+})), lC = {
menu: "subform",
icon: "icon-table-form",
- label: iC,
- name: rC,
+ label: oC,
+ name: aC,
input: !0,
mask: !1,
subForm: "array",
@@ -5593,10 +5593,10 @@ border-bottom: 1px solid #EBEEF5;
];
},
loadRule(e) {
- e.props || (e.props = {}), e.children = cy(e.props.columns || []), delete e.props.columns;
+ e.props || (e.props = {}), e.children = hy(e.props.columns || []), delete e.props.columns;
},
parseRule(e) {
- e.props.columns = fy(e.children || []), e.children = [];
+ e.props.columns = py(e.children || []), e.children = [];
},
sfc: !1,
rule({ t: e }) {
@@ -5778,10 +5778,10 @@ border-bottom: 1px solid #EBEEF5;
}
]);
}
-}, aC = "\u65E0\u9650\u7EA7\u8868\u5355", ql = "infiniteTableForm", lC = {
+}, sC = "\u65E0\u9650\u7EA7\u8868\u5355", ql = "infiniteTableForm", uC = {
menu: "subform",
icon: "icon-table-form3",
- label: aC,
+ label: sC,
name: ql,
input: !0,
mask: !1,
@@ -5864,7 +5864,7 @@ border-bottom: 1px solid #EBEEF5;
}
]);
}
-}, sC = "\u5D4C\u5957\u8868\u5355", es = "nestedTableForm", uC = (e) => e.map((t) => ({
+}, dC = "\u5D4C\u5957\u8868\u5355", es = "nestedTableForm", fC = (e) => e.map((t) => ({
type: "tableFormColumn",
_fc_drag_tag: "tableFormColumn",
props: {
@@ -5874,10 +5874,10 @@ border-bottom: 1px solid #EBEEF5;
color: t.style.color || ""
},
children: t.rule || []
-})), dC = {
+})), cC = {
menu: "subform",
icon: "icon-table-form2",
- label: sC,
+ label: dC,
name: es,
input: !0,
mask: !1,
@@ -5906,7 +5906,7 @@ border-bottom: 1px solid #EBEEF5;
loadRule(e) {
e.props || (e.props = {});
const t = e.props.columns || [], i = e.props.nested || [];
- e.children = uC(t), e.children.push({
+ e.children = fC(t), e.children.push({
type: "TableForm",
_fc_drag_tag: "nestedSubTableForm",
field: e.props.nestedField,
@@ -5963,10 +5963,10 @@ border-bottom: 1px solid #EBEEF5;
}
]);
}
-}, fC = "\u5B50\u8868\u683C\u8868\u5355", cC = "nestedSubTableForm", pC = {
+}, pC = "\u5B50\u8868\u683C\u8868\u5355", hC = "nestedSubTableForm", mC = {
icon: "icon-table-form",
- label: fC,
- name: cC,
+ label: pC,
+ name: hC,
aide: !0,
mask: !1,
validate: !1,
@@ -6030,7 +6030,7 @@ border-bottom: 1px solid #EBEEF5;
props() {
return [];
}
-}, lf = "tableFormColumn", hC = {
+}, lf = "tableFormColumn", vC = {
icon: "icon-cell",
name: lf,
aide: !0,
@@ -6070,9 +6070,9 @@ border-bottom: 1px solid #EBEEF5;
}
]);
}
-}, sv = "tableFormColumn2", mC = {
+}, uv = "tableFormColumn2", gC = {
icon: "icon-cell",
- name: sv,
+ name: uv,
aide: !0,
drag: !0,
dragBtn: !1,
@@ -6087,7 +6087,7 @@ border-bottom: 1px solid #EBEEF5;
},
rule({ t: e }) {
return {
- type: sv,
+ type: uv,
props: {
label: e("com.tableFormColumn.label"),
width: "auto"
@@ -6124,10 +6124,10 @@ border-bottom: 1px solid #EBEEF5;
}
]);
}
-}, vC = "\u76D2\u5B50\u5E03\u5C40", gC = "fcFlex", yC = {
+}, yC = "\u76D2\u5B50\u5E03\u5C40", bC = "fcFlex", _C = {
icon: "icon-flex",
- label: vC,
- name: gC,
+ label: yC,
+ name: bC,
mask: !1,
children: "fcCell",
childrenLen: 2,
@@ -6168,8 +6168,8 @@ border-bottom: 1px solid #EBEEF5;
props() {
return [];
}
-}, uv = "fcCell", bC = {
- name: uv,
+}, dv = "fcCell", wC = {
+ name: dv,
label: "\u683C\u5B50",
drag: !0,
dragBtn: !1,
@@ -6181,7 +6181,7 @@ border-bottom: 1px solid #EBEEF5;
},
rule() {
return {
- type: uv,
+ type: dv,
style: {
display: "block",
width: "50%",
@@ -6197,11 +6197,11 @@ border-bottom: 1px solid #EBEEF5;
title: t("style.width")
}];
}
-}, _C = "\u8BA1\u7B97\u516C\u5F0F", dv = "fcValue", wC = {
+}, AC = "\u8BA1\u7B97\u516C\u5F0F", fv = "fcValue", CC = {
menu: "main",
icon: "icon-value",
- label: _C,
- name: dv,
+ label: AC,
+ name: fv,
input: !0,
event: ["change"],
validate: !1,
@@ -6210,7 +6210,7 @@ border-bottom: 1px solid #EBEEF5;
},
rule({ t: e }) {
return {
- type: dv,
+ type: fv,
field: rt(),
title: e("com.fcValue.name"),
info: "",
@@ -6220,10 +6220,10 @@ border-bottom: 1px solid #EBEEF5;
props() {
return [];
}
-}, AC = "\u94FE\u63A5", sf = "elLink", CC = {
+}, SC = "\u94FE\u63A5", sf = "elLink", EC = {
menu: "aide",
icon: "icon-link",
- label: AC,
+ label: SC,
name: sf,
inline: !0,
easySlots: [{ value: "icon", type: "icon" }],
@@ -6277,10 +6277,10 @@ border-bottom: 1px solid #EBEEF5;
}
]);
}
-}, SC = "\u6587\u5B57\u63D0\u793A", ts = "elTooltip", EC = {
+}, xC = "\u6587\u5B57\u63D0\u793A", ts = "elTooltip", TC = {
menu: "aide",
icon: "icon-tooltip",
- label: SC,
+ label: xC,
name: ts,
drag: !0,
dragBtn: !0,
@@ -6378,10 +6378,10 @@ border-bottom: 1px solid #EBEEF5;
}
]);
}
-}, xC = "\u6C34\u5370", ns = "elWatermark", TC = {
+}, kC = "\u6C34\u5370", ns = "elWatermark", OC = {
menu: "aide",
icon: "icon-watermark",
- label: xC,
+ label: kC,
name: ns,
drag: !0,
dragBtn: !0,
@@ -6449,10 +6449,10 @@ border-bottom: 1px solid #EBEEF5;
}
]);
}
-}, kC = "\u91D1\u989D", OC = {
+}, $C = "\u91D1\u989D", RC = {
menu: "template",
name: "chineseAmount",
- label: kC,
+ label: $C,
autoField: !0,
template: [
{
@@ -6481,10 +6481,10 @@ border-bottom: 1px solid #EBEEF5;
}
}
]
-}, $C = "\u65F6\u957F", RC = {
+}, DC = "\u65F6\u957F", IC = {
menu: "template",
name: "duration",
- label: $C,
+ label: DC,
autoField: !0,
template: [
{
@@ -6668,53 +6668,53 @@ callback()}-FORM-CREATE-SUFFIX]]`,
}
}
]
-}, DC = "\u4E09\u5217\u6805\u683C", IC = {
+}, FC = "\u4E09\u5217\u6805\u683C", PC = {
menu: "template",
name: "col3",
- label: DC,
- autoField: !1,
- template: [
- {
- type: "fcRow",
- children: [
- {
- type: "col",
- props: {
- span: 8
- },
- display: !0,
- hidden: !1,
- _fc_drag_tag: "col"
- },
- {
- type: "col",
- props: {
- span: 8
- },
- display: !0,
- hidden: !1,
- _fc_drag_tag: "col"
- },
- {
- type: "col",
- props: {
- span: 8
- },
- display: !0,
- hidden: !1,
- _fc_drag_tag: "col"
- }
- ],
- display: !0,
- hidden: !1,
- _fc_drag_tag: "fcRow"
- }
- ]
-}, FC = "\u56DB\u5217\u6805\u683C", PC = {
- menu: "template",
- name: "col4",
label: FC,
autoField: !1,
+ template: [
+ {
+ type: "fcRow",
+ children: [
+ {
+ type: "col",
+ props: {
+ span: 8
+ },
+ display: !0,
+ hidden: !1,
+ _fc_drag_tag: "col"
+ },
+ {
+ type: "col",
+ props: {
+ span: 8
+ },
+ display: !0,
+ hidden: !1,
+ _fc_drag_tag: "col"
+ },
+ {
+ type: "col",
+ props: {
+ span: 8
+ },
+ display: !0,
+ hidden: !1,
+ _fc_drag_tag: "col"
+ }
+ ],
+ display: !0,
+ hidden: !1,
+ _fc_drag_tag: "fcRow"
+ }
+ ]
+}, MC = "\u56DB\u5217\u6805\u683C", LC = {
+ menu: "template",
+ name: "col4",
+ label: MC,
+ autoField: !1,
template: [
{
type: "fcRow",
@@ -6761,10 +6761,10 @@ callback()}-FORM-CREATE-SUFFIX]]`,
_fc_drag_tag: "fcRow"
}
]
-}, MC = "\u56DB\u884C\u4E09\u5217\u8868\u683C", LC = {
+}, NC = "\u56DB\u884C\u4E09\u5217\u8868\u683C", BC = {
menu: "template",
name: "table43",
- label: MC,
+ label: NC,
autoField: !1,
template: [
{
@@ -6783,7 +6783,7 @@ callback()}-FORM-CREATE-SUFFIX]]`,
_fc_drag_tag: "fcTable"
}
]
-}, NC = "\u6570\u636E\u8868\u683C", is = "dataTable", BC = () => {
+}, VC = "\u6570\u636E\u8868\u683C", is = "dataTable", jC = () => {
const e = [];
for (let t = 0; t < 30; t++)
e.push({
@@ -6795,7 +6795,7 @@ callback()}-FORM-CREATE-SUFFIX]]`,
zip: "CA 90036"
});
return e;
-}, VC = (e) => {
+}, UC = (e) => {
if (e.format === "tag")
return {
type: "elTag",
@@ -6837,10 +6837,10 @@ callback()}-FORM-CREATE-SUFFIX]]`,
}
]
};
-}, jC = {
+}, HC = {
menu: "main",
icon: "icon-data-table",
- label: NC,
+ label: VC,
name: is,
languageKey: ["operation"],
event: ["cellMouseEnter", "cellMouseLeave", "handleClick", "rowClick", "rowDblclick", "headerClick", "filterChange", "expandChange", "sortChange", "selectionChange"],
@@ -6873,7 +6873,7 @@ height: 60px;
["column", "button", "index", "globalDataKey", "fetch", "page"].forEach((p) => {
delete e.props[p];
}), t.forEach((p) => {
- const h = VC(p), g = {
+ const h = UC(p), g = {
type: "elTableColumn",
props: {
label: p.label,
@@ -6975,7 +6975,7 @@ height: 60px;
props: {
height: "500px",
button: {},
- data: BC(),
+ data: jC(),
column: [{
format: "default",
prop: "date",
@@ -7223,7 +7223,7 @@ height: 60px;
field: "defaultExpandAll"
}]);
}
-}, rs = "fcDialog", UC = {
+}, rs = "fcDialog", zC = {
name: rs,
icon: "icon-dialog",
label: "\u5F39\u51FA\u6846",
@@ -7308,7 +7308,7 @@ height: 60px;
}
]);
}
-}, os = "fcDrawer", HC = {
+}, os = "fcDrawer", WC = {
name: os,
icon: "icon-dialog",
label: "\u62BD\u5C49",
@@ -7398,10 +7398,10 @@ height: 60px;
}
]);
}
-}, zC = "\u63D2\u69FD\u533A\u57DF", uf = "fcSlot", WC = {
+}, GC = "\u63D2\u69FD\u533A\u57DF", uf = "fcSlot", KC = {
menu: "container",
icon: "icon-slot",
- label: zC,
+ label: GC,
name: uf,
input: !0,
mask: !0,
@@ -7423,10 +7423,10 @@ height: 60px;
props(e, { t }) {
return Ke(t, uf + ".props", [{ type: "input", field: "name" }]);
}
-}, GC = "\u52A8\u6001\u533A\u57DF", df = "fcJson", KC = {
+}, YC = "\u52A8\u6001\u533A\u57DF", df = "fcJson", QC = {
menu: "container",
icon: "icon-json",
- label: GC,
+ label: YC,
name: df,
input: !0,
mask: !0,
@@ -7547,11 +7547,11 @@ height: 60px;
]
}]);
}
-}, YC = "\u5185\u8054\u5E03\u5C40", fv = "fcInlineForm", QC = {
+}, JC = "\u5185\u8054\u5E03\u5C40", cv = "fcInlineForm", XC = {
menu: "layout",
icon: "icon-inline",
- label: YC,
- name: fv,
+ label: JC,
+ name: cv,
denyDrag: {
menu: ["subform", "layout"]
},
@@ -7576,17 +7576,17 @@ width: 220px;
},
rule() {
return {
- type: fv,
+ type: cv,
props: {}
};
},
props() {
return [];
}
-}, JC = "\u56FE\u7247", ff = "elImage", XC = {
+}, ZC = "\u56FE\u7247", ff = "elImage", qC = {
menu: "aide",
icon: "icon-image",
- label: JC,
+ label: ZC,
name: ff,
inline: !0,
rule() {
@@ -7618,11 +7618,11 @@ width: 220px;
}
]);
}
-}, ZC = "\u76D2\u5B50\u5E03\u5C40", qC = "fcFlex2", eS = {
+}, eS = "\u76D2\u5B50\u5E03\u5C40", tS = "fcFlex2", nS = {
menu: "layout",
icon: "icon-flex",
- name: qC,
- label: ZC,
+ name: tS,
+ label: eS,
drag: !0,
inside: !0,
inline: !0,
@@ -7684,10 +7684,10 @@ width: 220px;
title: t("style.height")
}];
}
-}, tS = "\u8868\u5355\u9879", cf = "elFormItem", nS = {
+}, iS = "\u8868\u5355\u9879", cf = "elFormItem", rS = {
menu: "container",
icon: "icon-form-item",
- label: tS,
+ label: iS,
name: cf,
drag: !0,
mask: !1,
@@ -7726,10 +7726,10 @@ width: 220px;
}
]);
}
-}, iS = "\u97F3\u9891\u64AD\u653E\u5668", pf = "audioBox", rS = {
+}, oS = "\u97F3\u9891\u64AD\u653E\u5668", pf = "audioBox", aS = {
menu: "aide",
icon: "icon-audio",
- label: iS,
+ label: oS,
name: pf,
mask: !1,
event: ["pause", "play", "ended"],
@@ -7830,10 +7830,10 @@ width: 220px;
}
]);
}
-}, oS = "\u89C6\u9891\u64AD\u653E\u5668", hf = "videoBox", aS = {
+}, lS = "\u89C6\u9891\u64AD\u653E\u5668", hf = "videoBox", sS = {
menu: "aide",
icon: "icon-video",
- label: oS,
+ label: lS,
name: hf,
mask: !1,
event: ["pause", "play", "ended", "error"],
@@ -7902,17 +7902,17 @@ width: 220px;
}
]);
}
-}, lS = "\u5934\u50CF\u6846", cv = "elAvatar", sS = {
+}, uS = "\u5934\u50CF\u6846", pv = "elAvatar", dS = {
menu: "aide",
icon: "icon-avatar",
- label: lS,
- name: cv,
+ label: uS,
+ name: pv,
mask: !0,
inline: !0,
event: [],
rule() {
return {
- type: cv,
+ type: pv,
props: {
fit: "cover",
src: "https://static.form-create.com/example.png"
@@ -7944,17 +7944,17 @@ width: 220px;
}
]);
}
-}, uS = "\u6761\u5F62\u7801", pv = "barCodeBox", dS = {
+}, fS = "\u6761\u5F62\u7801", hv = "barCodeBox", cS = {
menu: "aide",
icon: "icon-barcode",
- label: uS,
- name: pv,
+ label: fS,
+ name: hv,
mask: !0,
inline: !0,
event: [],
rule() {
return {
- type: pv,
+ type: hv,
props: {
value: "12345670",
format: "CODE128"
@@ -8033,16 +8033,16 @@ width: 220px;
}
]);
}
-}, fS = "\u5185\u5D4C\u7F51\u9875", hv = "iframeBox", cS = {
+}, pS = "\u5185\u5D4C\u7F51\u9875", mv = "iframeBox", hS = {
menu: "aide",
icon: "icon-iframe",
- label: fS,
- name: hv,
+ label: pS,
+ name: mv,
mask: !0,
event: ["load"],
rule() {
return {
- type: hv,
+ type: mv,
props: {
src: "https://github.com/xaboy/form-create"
}
@@ -8065,10 +8065,10 @@ width: 220px;
}
]);
}
-}, pS = "\u4E8C\u7EF4\u7801", mf = "qrCodeBox", hS = {
+}, mS = "\u4E8C\u7EF4\u7801", mf = "qrCodeBox", vS = {
menu: "aide",
icon: "icon-qrcode",
- label: pS,
+ label: mS,
name: mf,
mask: !0,
inline: !0,
@@ -8116,10 +8116,10 @@ width: 220px;
}
]);
}
-}, mS = "\u624B\u5199\u7B7E\u540D", vf = "signaturePad", vS = {
+}, gS = "\u624B\u5199\u7B7E\u540D", vf = "signaturePad", yS = {
menu: "main",
icon: "icon-sign",
- label: mS,
+ label: gS,
name: vf,
input: !0,
mask: !0,
@@ -8143,10 +8143,10 @@ width: 220px;
}
]);
}
-}, gS = "\u63D0\u53CA", gf = "elMention", yS = {
+}, bS = "\u63D0\u53CA", gf = "elMention", _S = {
menu: "main",
icon: "icon-mention",
- label: gS,
+ label: bS,
name: gf,
input: !0,
event: ["search", "select", "blur", "focus", "change", "input", "clear"],
@@ -8231,10 +8231,10 @@ width: 220px;
}
]);
}
-}, bS = "\u5206\u6BB5\u63A7\u5236\u5668", yf = "elSegmented", _S = {
+}, wS = "\u5206\u6BB5\u63A7\u5236\u5668", yf = "elSegmented", AS = {
menu: "main",
icon: "icon-segmented",
- label: bS,
+ label: wS,
name: yf,
input: !0,
event: ["change"],
@@ -8279,11 +8279,11 @@ width: 220px;
}
]);
}
-}, wS = "\u6807\u9898", mv = "fcTitle", AS = {
+}, CS = "\u6807\u9898", vv = "fcTitle", SS = {
menu: "aide",
icon: "icon-title",
- label: wS,
- name: mv,
+ label: CS,
+ name: vv,
event: [],
rule({ t: e }) {
return {
@@ -8294,7 +8294,7 @@ width: 220px;
};
},
props(e, { t }) {
- return Ke(t, mv + ".props", [{ type: "input", field: "title" }, {
+ return Ke(t, vv + ".props", [{ type: "input", field: "title" }, {
type: "select",
field: "size",
value: "H2",
@@ -8308,10 +8308,10 @@ width: 220px;
}])
}]);
}
-}, CS = "\u552F\u4E00\u503C", bf = "fcId", SS = {
+}, ES = "\u552F\u4E00\u503C", bf = "fcId", xS = {
menu: "main",
icon: "icon-input-id",
- label: CS,
+ label: ES,
name: bf,
input: !0,
validate: !1,
@@ -8333,10 +8333,10 @@ width: 220px;
}
]);
}
-}, ES = "\u7701\u5E02\u533A\u9009\u62E9\u5668", _f = "fcCity", xS = {
+}, TS = "\u7701\u5E02\u533A\u9009\u62E9\u5668", _f = "fcCity", kS = {
menu: "main",
icon: "icon-city",
- label: ES,
+ label: TS,
name: _f,
input: !0,
event: ["change"],
@@ -8388,11 +8388,11 @@ width: 220px;
}
]);
}
-}, TS = "Markdown", kS = "markdown", OS = {
+}, OS = "Markdown", $S = "markdown", RS = {
menu: "aide",
icon: "icon-markdown",
- label: TS,
- name: kS,
+ label: OS,
+ name: $S,
rule() {
return {
type: "FcMarkdown",
@@ -8538,10 +8538,10 @@ function hello() {
}
];
}
-}, $S = "\u7EDF\u8BA1\u680F", as = "elStatistic", RS = {
+}, DS = "\u7EDF\u8BA1\u680F", as = "elStatistic", IS = {
menu: "aide",
icon: "icon-statistic",
- label: $S,
+ label: DS,
name: as,
inline: !0,
easySlots: ["prefix", "suffix"],
@@ -8562,11 +8562,11 @@ function hello() {
{ type: "input", field: "suffix" }
]);
}
-}, DS = "\u6298\u7EBF\u56FE", IS = "lineChart", FS = {
+}, FS = "\u6298\u7EBF\u56FE", PS = "lineChart", MS = {
menu: "chart",
icon: "icon-chart-line",
- label: DS,
- name: IS,
+ label: FS,
+ name: PS,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
@@ -8637,11 +8637,11 @@ function hello() {
}
]);
}
-}, PS = "\u4F53\u79EF\u56FE", MS = "areaChart", LS = {
+}, LS = "\u4F53\u79EF\u56FE", NS = "areaChart", BS = {
menu: "chart",
icon: "icon-chart-area",
- label: PS,
- name: MS,
+ label: LS,
+ name: NS,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
@@ -8712,11 +8712,11 @@ function hello() {
}
]);
}
-}, NS = "\u67F1\u72B6\u56FE", BS = "barChart", VS = {
+}, VS = "\u67F1\u72B6\u56FE", jS = "barChart", US = {
menu: "chart",
icon: "icon-chart-bar",
- label: NS,
- name: BS,
+ label: VS,
+ name: jS,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
@@ -8771,11 +8771,11 @@ function hello() {
}
]);
}
-}, jS = "\u6761\u5F62\u56FE", US = "stripeChart", HS = {
+}, HS = "\u6761\u5F62\u56FE", zS = "stripeChart", WS = {
menu: "chart",
icon: "icon-chart-stripe",
- label: jS,
- name: US,
+ label: HS,
+ name: zS,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
@@ -8835,11 +8835,11 @@ function hello() {
}
]);
}
-}, zS = "\u997C\u56FE", WS = "pieChart", GS = {
+}, GS = "\u997C\u56FE", KS = "pieChart", YS = {
menu: "chart",
icon: "icon-chart-pie",
- label: zS,
- name: WS,
+ label: GS,
+ name: KS,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
@@ -8884,11 +8884,11 @@ function hello() {
}
]);
}
-}, KS = "\u6F0F\u6597\u56FE", YS = "funnelChart", QS = {
+}, QS = "\u6F0F\u6597\u56FE", JS = "funnelChart", XS = {
menu: "chart",
icon: "icon-chart-funnel",
- label: KS,
- name: YS,
+ label: QS,
+ name: JS,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
@@ -8933,11 +8933,11 @@ function hello() {
}
]);
}
-}, JS = "\u4EEA\u8868\u76D8", XS = "gaugeChart", ZS = {
+}, ZS = "\u4EEA\u8868\u76D8", qS = "gaugeChart", eE = {
menu: "chart",
icon: "icon-chart-gauge",
- label: JS,
- name: XS,
+ label: ZS,
+ name: qS,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
@@ -8973,11 +8973,11 @@ function hello() {
}
]);
}
-}, qS = "\u96F7\u8FBE\u56FE", eE = "radarChart", tE = {
+}, tE = "\u96F7\u8FBE\u56FE", nE = "radarChart", iE = {
menu: "chart",
icon: "icon-chart-radar",
- label: qS,
- name: eE,
+ label: tE,
+ name: nE,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
@@ -9035,11 +9035,11 @@ function hello() {
}
]);
}
-}, nE = "\u6563\u70B9\u56FE", iE = "scatterChart", rE = {
+}, rE = "\u6563\u70B9\u56FE", oE = "scatterChart", aE = {
menu: "chart",
icon: "icon-chart-scatter",
- label: nE,
- name: iE,
+ label: rE,
+ name: oE,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
@@ -9089,11 +9089,11 @@ function hello() {
}
]);
}
-}, oE = "\u81EA\u5B9A\u4E49\u56FE\u8868", aE = "customChart", lE = {
+}, lE = "\u81EA\u5B9A\u4E49\u56FE\u8868", sE = "customChart", uE = {
menu: "chart",
icon: "icon-chart-custom",
- label: oE,
- name: aE,
+ label: lE,
+ name: sE,
mask: !1,
event: ["beforeLoad", "loaded", "click"],
rule() {
@@ -9358,11 +9358,11 @@ value: themeJson[key]
}
]);
}
-}, sE = "\u5B50\u8868\u5355\u9009\u62E9\u5668", uE = "fcDataSelect", dE = {
+}, dE = "\u5B50\u8868\u5355\u9009\u62E9\u5668", fE = "fcDataSelect", cE = {
menu: "main",
icon: "icon-data-select",
- label: sE,
- name: uE,
+ label: dE,
+ name: fE,
drag: !0,
input: !0,
mask: !1,
@@ -9418,103 +9418,103 @@ value: themeJson[key]
{ type: "input", field: "placeholder" }
]);
}
-}, vv = [
- $w,
+}, gv = [
Dw,
Fw,
- yS,
- _S,
Mw,
- xw,
- kw,
+ _S,
+ AS,
Nw,
+ kw,
+ $w,
Vw,
- Zw,
- uy,
- Gw,
Uw,
- dy,
- Jw,
eA,
- uA,
+ fy,
+ Yw,
+ zw,
+ cy,
+ Zw,
+ nA,
fA,
pA,
mA,
- VA,
- xS,
- kA,
- jC,
- SS,
- vS,
- wC,
- dE,
- $A,
- DA,
- YA,
- nC,
- oC,
- hC,
- mC,
- dC,
- pC,
- lC,
- WC,
- KC,
- nS,
gA,
- xA,
UA,
- AS,
- bA,
- ZA,
- RS,
- lA,
+ kS,
+ $A,
+ HC,
+ xS,
+ yS,
CC,
+ cE,
+ DA,
+ FA,
+ JA,
+ rC,
+ lC,
+ vC,
+ gC,
+ cC,
+ mC,
+ uC,
+ KC,
+ QC,
+ rS,
+ bA,
+ kA,
+ zA,
+ SS,
+ wA,
+ eC,
+ IS,
+ uA,
EC,
TC,
- XC,
- rS,
+ OC,
+ qC,
aS,
sS,
dS,
cS,
hS,
- OS,
- FS,
- LS,
- VS,
- HS,
- GS,
- QS,
- ZS,
- tE,
- rE,
- lE,
- nA,
- eC,
- QC,
- eS,
- yC,
- bC,
+ vS,
+ RS,
+ MS,
+ BS,
+ US,
+ WS,
+ YS,
+ XS,
+ eE,
+ iE,
+ aE,
+ uE,
+ rA,
+ nC,
+ XC,
+ nS,
+ _C,
+ wC,
+ xA,
SA,
- AA,
- FA,
MA,
- GA,
- UC,
- HC,
- IC,
+ NA,
+ YA,
+ zC,
+ WC,
PC,
LC,
- OC,
+ BC,
RC,
- iA,
+ IC,
oA,
- NA,
- zA,
- JA
+ lA,
+ VA,
+ GA,
+ ZA
];
-function fE(e) {
+function pE(e) {
return {
icon: e.field ? "icon-input" : "icon-cell",
label: e.field || e.type,
@@ -9535,7 +9535,7 @@ function fE(e) {
* @author owenm
* @license MIT
*/
-function gv(e, t) {
+function yv(e, t) {
var i = Object.keys(e);
if (Object.getOwnPropertySymbols) {
var r = Object.getOwnPropertySymbols(e);
@@ -9548,9 +9548,9 @@ function gv(e, t) {
function zi(e) {
for (var t = 1; t < arguments.length; t++) {
var i = arguments[t] != null ? arguments[t] : {};
- t % 2 ? gv(Object(i), !0).forEach(function(r) {
- cE(e, r, i[r]);
- }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(e, Object.getOwnPropertyDescriptors(i)) : gv(Object(i)).forEach(function(r) {
+ t % 2 ? yv(Object(i), !0).forEach(function(r) {
+ hE(e, r, i[r]);
+ }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(e, Object.getOwnPropertyDescriptors(i)) : yv(Object(i)).forEach(function(r) {
Object.defineProperty(e, r, Object.getOwnPropertyDescriptor(i, r));
});
}
@@ -9563,7 +9563,7 @@ function Ts(e) {
return t && typeof Symbol == "function" && t.constructor === Symbol && t !== Symbol.prototype ? "symbol" : typeof t;
}, Ts(e);
}
-function cE(e, t, i) {
+function hE(e, t, i) {
return t in e ? Object.defineProperty(e, t, {
value: i,
enumerable: !0,
@@ -9581,7 +9581,7 @@ function or() {
return e;
}, or.apply(this, arguments);
}
-function pE(e, t) {
+function mE(e, t) {
if (e == null)
return {};
var i = {}, r = Object.keys(e), n, a;
@@ -9589,10 +9589,10 @@ function pE(e, t) {
n = r[a], !(t.indexOf(n) >= 0) && (i[n] = e[n]);
return i;
}
-function hE(e, t) {
+function vE(e, t) {
if (e == null)
return {};
- var i = pE(e, t), r, n;
+ var i = mE(e, t), r, n;
if (Object.getOwnPropertySymbols) {
var a = Object.getOwnPropertySymbols(e);
for (n = 0; n < a.length; n++)
@@ -9600,20 +9600,20 @@ function hE(e, t) {
}
return i;
}
-var mE = "1.14.0";
+var gE = "1.14.0";
function nr(e) {
if (typeof window < "u" && window.navigator)
return !!/* @__PURE__ */ navigator.userAgent.match(e);
}
-var lr = nr(/(?:Trident.*rv[ :]?11\.|msie|iemobile|Windows Phone)/i), sl = nr(/Edge/i), yv = nr(/firefox/i), Ya = nr(/safari/i) && !nr(/chrome/i) && !nr(/android/i), py = nr(/iP(ad|od|hone)/i), vE = nr(/chrome/i) && nr(/android/i), hy = {
+var lr = nr(/(?:Trident.*rv[ :]?11\.|msie|iemobile|Windows Phone)/i), sl = nr(/Edge/i), bv = nr(/firefox/i), Ya = nr(/safari/i) && !nr(/chrome/i) && !nr(/android/i), my = nr(/iP(ad|od|hone)/i), yE = nr(/chrome/i) && nr(/android/i), vy = {
capture: !1,
passive: !1
};
function Mt(e, t, i) {
- e.addEventListener(t, i, !lr && hy);
+ e.addEventListener(t, i, !lr && vy);
}
function Dt(e, t, i) {
- e.removeEventListener(t, i, !lr && hy);
+ e.removeEventListener(t, i, !lr && vy);
}
function Hs(e, t) {
if (!!t) {
@@ -9631,7 +9631,7 @@ function Hs(e, t) {
return !1;
}
}
-function gE(e) {
+function bE(e) {
return e.host && e !== document && e.host.nodeType ? e.host : e.parentNode;
}
function Bi(e, t, i, r) {
@@ -9642,18 +9642,18 @@ function Bi(e, t, i, r) {
return e;
if (e === i)
break;
- } while (e = gE(e));
+ } while (e = bE(e));
}
return null;
}
-var bv = /\s+/g;
+var _v = /\s+/g;
function ni(e, t, i) {
if (e && t)
if (e.classList)
e.classList[i ? "add" : "remove"](t);
else {
- var r = (" " + e.className + " ").replace(bv, " ").replace(" " + t + " ", " ");
- e.className = (r + (i ? " " + t : "")).replace(bv, " ");
+ var r = (" " + e.className + " ").replace(_v, " ").replace(" " + t + " ", " ");
+ e.className = (r + (i ? " " + t : "")).replace(_v, " ");
}
}
function wt(e, t, i) {
@@ -9664,7 +9664,7 @@ function wt(e, t, i) {
!(t in r) && t.indexOf("webkit") === -1 && (t = "-webkit-" + t), r[t] = i + (typeof i == "string" ? "" : "px");
}
}
-function Vo(e, t) {
+function Bo(e, t) {
var i = "";
if (typeof e == "string")
i = e;
@@ -9676,7 +9676,7 @@ function Vo(e, t) {
var n = window.DOMMatrix || window.WebKitCSSMatrix || window.CSSMatrix || window.MSCSSMatrix;
return n && new n(i);
}
-function my(e, t, i) {
+function gy(e, t, i) {
if (e) {
var r = e.getElementsByTagName(t), n = 0, a = r.length;
if (i)
@@ -9702,7 +9702,7 @@ function _n(e, t, i, r, n) {
}
while (n = n.parentNode);
if (r && e !== window) {
- var S = Vo(n || e), b = S && S.a, A = S && S.d;
+ var S = Bo(n || e), b = S && S.a, A = S && S.d;
S && (s /= A, u /= b, g /= b, h /= A, d = s + h, p = u + g);
}
return {
@@ -9715,7 +9715,7 @@ function _n(e, t, i, r, n) {
};
}
}
-function _v(e, t, i) {
+function wv(e, t, i) {
for (var r = Or(e, !0), n = _n(e)[t]; r; ) {
var a = _n(r)[i], s = void 0;
if (i === "top" || i === "left" ? s = n >= a : s = n <= a, !s)
@@ -9726,7 +9726,7 @@ function _v(e, t, i) {
}
return !1;
}
-function Go(e, t, i, r) {
+function Wo(e, t, i, r) {
for (var n = 0, a = 0, s = e.children; a < s.length; ) {
if (s[a].style.display !== "none" && s[a] !== At.ghost && (r || s[a] !== At.dragged) && Bi(s[a], i.draggable, e, !1)) {
if (n === t)
@@ -9737,7 +9737,7 @@ function Go(e, t, i, r) {
}
return null;
}
-function Fc(e, t) {
+function Pc(e, t) {
for (var i = e.lastElementChild; i && (i === At.ghost || wt(i, "display") === "none" || t && !Hs(i, t)); )
i = i.previousElementSibling;
return i || null;
@@ -9750,16 +9750,16 @@ function ci(e, t) {
e.nodeName.toUpperCase() !== "TEMPLATE" && e !== At.clone && (!t || Hs(e, t)) && i++;
return i;
}
-function wv(e) {
+function Av(e) {
var t = 0, i = 0, r = Hi();
if (e)
do {
- var n = Vo(e), a = n.a, s = n.d;
+ var n = Bo(e), a = n.a, s = n.d;
t += e.scrollLeft * a, i += e.scrollTop * s;
} while (e !== r && (e = e.parentNode));
return [t, i];
}
-function yE(e, t) {
+function _E(e, t) {
for (var i in e)
if (!!e.hasOwnProperty(i)) {
for (var r in t)
@@ -9786,7 +9786,7 @@ function Or(e, t) {
while (i = i.parentNode);
return Hi();
}
-function bE(e, t) {
+function wE(e, t) {
if (e && t)
for (var i in t)
t.hasOwnProperty(i) && (e[i] = t[i]);
@@ -9796,7 +9796,7 @@ function wf(e, t) {
return Math.round(e.top) === Math.round(t.top) && Math.round(e.left) === Math.round(t.left) && Math.round(e.height) === Math.round(t.height) && Math.round(e.width) === Math.round(t.width);
}
var Qa;
-function vy(e, t) {
+function yy(e, t) {
return function() {
if (!Qa) {
var i = arguments, r = this;
@@ -9806,18 +9806,18 @@ function vy(e, t) {
}
};
}
-function _E() {
+function AE() {
clearTimeout(Qa), Qa = void 0;
}
-function gy(e, t, i) {
+function by(e, t, i) {
e.scrollLeft += t, e.scrollTop += i;
}
-function yy(e) {
+function _y(e) {
var t = window.Polymer, i = window.jQuery || window.Zepto;
return t && t.dom ? t.dom(e).cloneNode(!0) : i ? i(e).clone(!0)[0] : e.cloneNode(!0);
}
var ri = "Sortable" + new Date().getTime();
-function wE() {
+function CE() {
var e = [], t;
return {
captureAnimationState: function() {
@@ -9831,7 +9831,7 @@ function wE() {
});
var a = zi({}, e[e.length - 1].rect);
if (n.thisAnimationDuration) {
- var s = Vo(n, !0);
+ var s = Bo(n, !0);
s && (a.top -= s.f, a.left -= s.e);
}
n.fromRect = a;
@@ -9843,7 +9843,7 @@ function wE() {
e.push(r);
},
removeAnimationState: function(r) {
- e.splice(yE(e, {
+ e.splice(_E(e, {
target: r
}), 1);
},
@@ -9855,8 +9855,8 @@ function wE() {
}
var a = !1, s = 0;
e.forEach(function(u) {
- var d = 0, p = u.target, h = p.fromRect, g = _n(p), _ = p.prevFromRect, S = p.prevToRect, b = u.rect, A = Vo(p, !0);
- A && (g.top -= A.f, g.left -= A.e), p.toRect = g, p.thisAnimationDuration && wf(_, g) && !wf(h, g) && (b.top - g.top) / (b.left - g.left) === (h.top - g.top) / (h.left - g.left) && (d = CE(b, _, S, n.options)), wf(g, h) || (p.prevFromRect = h, p.prevToRect = g, d || (d = n.options.animation), n.animate(p, b, g, d)), d && (a = !0, s = Math.max(s, d), clearTimeout(p.animationResetTimer), p.animationResetTimer = setTimeout(function() {
+ var d = 0, p = u.target, h = p.fromRect, g = _n(p), _ = p.prevFromRect, S = p.prevToRect, b = u.rect, A = Bo(p, !0);
+ A && (g.top -= A.f, g.left -= A.e), p.toRect = g, p.thisAnimationDuration && wf(_, g) && !wf(h, g) && (b.top - g.top) / (b.left - g.left) === (h.top - g.top) / (h.left - g.left) && (d = EE(b, _, S, n.options)), wf(g, h) || (p.prevFromRect = h, p.prevToRect = g, d || (d = n.options.animation), n.animate(p, b, g, d)), d && (a = !0, s = Math.max(s, d), clearTimeout(p.animationResetTimer), p.animationResetTimer = setTimeout(function() {
p.animationTime = 0, p.prevFromRect = null, p.fromRect = null, p.prevToRect = null, p.thisAnimationDuration = null;
}, d), p.thisAnimationDuration = d);
}), clearTimeout(t), a ? t = setTimeout(function() {
@@ -9866,30 +9866,30 @@ function wE() {
animate: function(r, n, a, s) {
if (s) {
wt(r, "transition", ""), wt(r, "transform", "");
- var u = Vo(this.el), d = u && u.a, p = u && u.d, h = (n.left - a.left) / (d || 1), g = (n.top - a.top) / (p || 1);
- r.animatingX = !!h, r.animatingY = !!g, wt(r, "transform", "translate3d(" + h + "px," + g + "px,0)"), this.forRepaintDummy = AE(r), wt(r, "transition", "transform " + s + "ms" + (this.options.easing ? " " + this.options.easing : "")), wt(r, "transform", "translate3d(0,0,0)"), typeof r.animated == "number" && clearTimeout(r.animated), r.animated = setTimeout(function() {
+ var u = Bo(this.el), d = u && u.a, p = u && u.d, h = (n.left - a.left) / (d || 1), g = (n.top - a.top) / (p || 1);
+ r.animatingX = !!h, r.animatingY = !!g, wt(r, "transform", "translate3d(" + h + "px," + g + "px,0)"), this.forRepaintDummy = SE(r), wt(r, "transition", "transform " + s + "ms" + (this.options.easing ? " " + this.options.easing : "")), wt(r, "transform", "translate3d(0,0,0)"), typeof r.animated == "number" && clearTimeout(r.animated), r.animated = setTimeout(function() {
wt(r, "transition", ""), wt(r, "transform", ""), r.animated = !1, r.animatingX = !1, r.animatingY = !1;
}, s);
}
}
};
}
-function AE(e) {
+function SE(e) {
return e.offsetWidth;
}
-function CE(e, t, i, r) {
+function EE(e, t, i, r) {
return Math.sqrt(Math.pow(t.top - e.top, 2) + Math.pow(t.left - e.left, 2)) / Math.sqrt(Math.pow(t.top - i.top, 2) + Math.pow(t.left - i.left, 2)) * r.animation;
}
-var ko = [], Af = {
+var To = [], Af = {
initializeByDefault: !0
}, ul = {
mount: function(t) {
for (var i in Af)
Af.hasOwnProperty(i) && !(i in t) && (t[i] = Af[i]);
- ko.forEach(function(r) {
+ To.forEach(function(r) {
if (r.pluginName === t.pluginName)
throw "Sortable: Cannot mount plugin ".concat(t.pluginName, " more than once");
- }), ko.push(t);
+ }), To.push(t);
},
pluginEvent: function(t, i, r) {
var n = this;
@@ -9897,7 +9897,7 @@ var ko = [], Af = {
n.eventCanceled = !0;
};
var a = t + "Global";
- ko.forEach(function(s) {
+ To.forEach(function(s) {
!i[s.pluginName] || (i[s.pluginName][a] && i[s.pluginName][a](zi({
sortable: i
}, r)), i.options[s.pluginName] && i[s.pluginName][t] && i[s.pluginName][t](zi({
@@ -9906,7 +9906,7 @@ var ko = [], Af = {
});
},
initializePlugins: function(t, i, r, n) {
- ko.forEach(function(u) {
+ To.forEach(function(u) {
var d = u.pluginName;
if (!(!t.options[d] && !u.initializeByDefault)) {
var p = new u(t, i, t.options);
@@ -9921,18 +9921,18 @@ var ko = [], Af = {
},
getEventProperties: function(t, i) {
var r = {};
- return ko.forEach(function(n) {
+ return To.forEach(function(n) {
typeof n.eventProperties == "function" && or(r, n.eventProperties.call(i[n.pluginName], t));
}), r;
},
modifyOption: function(t, i, r) {
var n;
- return ko.forEach(function(a) {
+ return To.forEach(function(a) {
!t[a.pluginName] || a.optionListeners && typeof a.optionListeners[i] == "function" && (n = a.optionListeners[i].call(t[a.pluginName], r));
}), n;
}
};
-function SE(e) {
+function xE(e) {
var t = e.sortable, i = e.rootEl, r = e.name, n = e.targetEl, a = e.cloneEl, s = e.toEl, u = e.fromEl, d = e.oldIndex, p = e.newIndex, h = e.oldDraggableIndex, g = e.newDraggableIndex, _ = e.originalEvent, S = e.putSortable, b = e.extraEventProperties;
if (t = t || i && i[ri], !!t) {
var A, y = t.options, m = "on" + r.charAt(0).toUpperCase() + r.substr(1);
@@ -9946,8 +9946,8 @@ function SE(e) {
i && i.dispatchEvent(A), y[m] && y[m].call(t, A);
}
}
-var EE = ["evt"], Kn = function(t, i) {
- var r = arguments.length > 2 && arguments[2] !== void 0 ? arguments[2] : {}, n = r.evt, a = hE(r, EE);
+var TE = ["evt"], Kn = function(t, i) {
+ var r = arguments.length > 2 && arguments[2] !== void 0 ? arguments[2] : {}, n = r.evt, a = vE(r, TE);
ul.pluginEvent.bind(At)(t, i, zi({
dragEl: et,
parentEl: tn,
@@ -9961,12 +9961,12 @@ var EE = ["evt"], Kn = function(t, i) {
putSortable: Tn,
activeSortable: At.active,
originalEvent: n,
- oldIndex: No,
+ oldIndex: Lo,
oldDraggableIndex: Ja,
newIndex: ii,
newDraggableIndex: xr,
- hideGhostForTarget: Ay,
- unhideGhostForTarget: Cy,
+ hideGhostForTarget: Sy,
+ unhideGhostForTarget: Ey,
cloneNowHidden: function() {
Tr = !0;
},
@@ -9983,26 +9983,26 @@ var EE = ["evt"], Kn = function(t, i) {
}, a));
};
function Un(e) {
- SE(zi({
+ xE(zi({
putSortable: Tn,
cloneEl: nn,
targetEl: et,
rootEl: Xt,
- oldIndex: No,
+ oldIndex: Lo,
oldDraggableIndex: Ja,
newIndex: ii,
newDraggableIndex: xr
}, e));
}
-var et, tn, xt, Xt, zr, ks, nn, Tr, No, ii, Ja, xr, ls, Tn, Lo = !1, zs = !1, Ws = [], Ur, Si, Cf, Sf, Av, Cv, za, Oo, Xa, Za = !1, ss = !1, Os, Rn, Ef = [], lc = !1, Gs = [], lu = typeof document < "u", us = py, Sv = sl || lr ? "cssFloat" : "float", xE = lu && !vE && !py && "draggable" in document.createElement("div"), by = function() {
+var et, tn, xt, Xt, zr, ks, nn, Tr, Lo, ii, Ja, xr, ls, Tn, Mo = !1, zs = !1, Ws = [], Ur, Si, Cf, Sf, Cv, Sv, za, ko, Xa, Za = !1, ss = !1, Os, Rn, Ef = [], sc = !1, Gs = [], lu = typeof document < "u", us = my, Ev = sl || lr ? "cssFloat" : "float", kE = lu && !yE && !my && "draggable" in document.createElement("div"), wy = function() {
if (!!lu) {
if (lr)
return !1;
var e = document.createElement("x");
return e.style.cssText = "pointer-events:auto", e.style.pointerEvents === "auto";
}
-}(), _y = function(t, i) {
- var r = wt(t), n = parseInt(r.width) - parseInt(r.paddingLeft) - parseInt(r.paddingRight) - parseInt(r.borderLeftWidth) - parseInt(r.borderRightWidth), a = Go(t, 0, i), s = Go(t, 1, i), u = a && wt(a), d = s && wt(s), p = u && parseInt(u.marginLeft) + parseInt(u.marginRight) + _n(a).width, h = d && parseInt(d.marginLeft) + parseInt(d.marginRight) + _n(s).width;
+}(), Ay = function(t, i) {
+ var r = wt(t), n = parseInt(r.width) - parseInt(r.paddingLeft) - parseInt(r.paddingRight) - parseInt(r.borderLeftWidth) - parseInt(r.borderRightWidth), a = Wo(t, 0, i), s = Wo(t, 1, i), u = a && wt(a), d = s && wt(s), p = u && parseInt(u.marginLeft) + parseInt(u.marginRight) + _n(a).width, h = d && parseInt(d.marginLeft) + parseInt(d.marginRight) + _n(s).width;
if (r.display === "flex")
return r.flexDirection === "column" || r.flexDirection === "column-reverse" ? "vertical" : "horizontal";
if (r.display === "grid")
@@ -10011,21 +10011,21 @@ var et, tn, xt, Xt, zr, ks, nn, Tr, No, ii, Ja, xr, ls, Tn, Lo = !1, zs = !1, Ws
var g = u.float === "left" ? "left" : "right";
return s && (d.clear === "both" || d.clear === g) ? "vertical" : "horizontal";
}
- return a && (u.display === "block" || u.display === "flex" || u.display === "table" || u.display === "grid" || p >= n && r[Sv] === "none" || s && r[Sv] === "none" && p + h > n) ? "vertical" : "horizontal";
-}, TE = function(t, i, r) {
+ return a && (u.display === "block" || u.display === "flex" || u.display === "table" || u.display === "grid" || p >= n && r[Ev] === "none" || s && r[Ev] === "none" && p + h > n) ? "vertical" : "horizontal";
+}, OE = function(t, i, r) {
var n = r ? t.left : t.top, a = r ? t.right : t.bottom, s = r ? t.width : t.height, u = r ? i.left : i.top, d = r ? i.right : i.bottom, p = r ? i.width : i.height;
return n === u || a === d || n + s / 2 === u + p / 2;
-}, kE = function(t, i) {
+}, $E = function(t, i) {
var r;
return Ws.some(function(n) {
var a = n[ri].options.emptyInsertThreshold;
- if (!(!a || Fc(n))) {
+ if (!(!a || Pc(n))) {
var s = _n(n), u = t >= s.left - a && t <= s.right + a, d = i >= s.top - a && i <= s.bottom + a;
if (u && d)
return r = n;
}
}), r;
-}, wy = function(t) {
+}, Cy = function(t) {
function i(a, s) {
return function(u, d, p, h) {
var g = u.options.group.name && d.options.group.name && u.options.group.name === d.options.group.name;
@@ -10045,10 +10045,10 @@ var et, tn, xt, Xt, zr, ks, nn, Tr, No, ii, Ja, xr, ls, Tn, Lo = !1, zs = !1, Ws
(!n || Ts(n) != "object") && (n = {
name: n
}), r.name = n.name, r.checkPull = i(n.pull, !0), r.checkPut = i(n.put), r.revertClone = n.revertClone, t.group = r;
-}, Ay = function() {
- !by && xt && wt(xt, "display", "none");
-}, Cy = function() {
- !by && xt && wt(xt, "display", "");
+}, Sy = function() {
+ !wy && xt && wt(xt, "display", "none");
+}, Ey = function() {
+ !wy && xt && wt(xt, "display", "");
};
lu && document.addEventListener("click", function(e) {
if (zs)
@@ -10057,7 +10057,7 @@ lu && document.addEventListener("click", function(e) {
var Hr = function(t) {
if (et) {
t = t.touches ? t.touches[0] : t;
- var i = kE(t.clientX, t.clientY);
+ var i = $E(t.clientX, t.clientY);
if (i) {
var r = {};
for (var n in t)
@@ -10065,7 +10065,7 @@ var Hr = function(t) {
r.target = r.rootEl = i, r.preventDefault = void 0, r.stopPropagation = void 0, i[ri]._onDragOver(r);
}
}
-}, OE = function(t) {
+}, RE = function(t) {
et && et.parentNode[ri]._isOutsideThisEl(t.target);
};
function At(e, t) {
@@ -10084,7 +10084,7 @@ function At(e, t) {
invertedSwapThreshold: null,
removeCloneOnHide: !0,
direction: function() {
- return _y(e, this.options);
+ return Ay(e, this.options);
},
ghostClass: "sortable-ghost",
chosenClass: "sortable-chosen",
@@ -10117,15 +10117,15 @@ function At(e, t) {
ul.initializePlugins(this, e, i);
for (var r in i)
!(r in t) && (t[r] = i[r]);
- wy(t);
+ Cy(t);
for (var n in this)
n.charAt(0) === "_" && typeof this[n] == "function" && (this[n] = this[n].bind(this));
- this.nativeDraggable = t.forceFallback ? !1 : xE, this.nativeDraggable && (this.options.touchStartThreshold = 1), t.supportPointer ? Mt(e, "pointerdown", this._onTapStart) : (Mt(e, "mousedown", this._onTapStart), Mt(e, "touchstart", this._onTapStart)), this.nativeDraggable && (Mt(e, "dragover", this), Mt(e, "dragenter", this)), Ws.push(this.el), t.store && t.store.get && this.sort(t.store.get(this) || []), or(this, wE());
+ this.nativeDraggable = t.forceFallback ? !1 : kE, this.nativeDraggable && (this.options.touchStartThreshold = 1), t.supportPointer ? Mt(e, "pointerdown", this._onTapStart) : (Mt(e, "mousedown", this._onTapStart), Mt(e, "touchstart", this._onTapStart)), this.nativeDraggable && (Mt(e, "dragover", this), Mt(e, "dragenter", this)), Ws.push(this.el), t.store && t.store.get && this.sort(t.store.get(this) || []), or(this, CE());
}
At.prototype = {
constructor: At,
_isOutsideThisEl: function(t) {
- !this.el.contains(t) && t !== this.el && (Oo = null);
+ !this.el.contains(t) && t !== this.el && (ko = null);
},
_getDirection: function(t, i) {
return typeof this.options.direction == "function" ? this.options.direction.call(this, t, i, et) : this.options.direction;
@@ -10133,8 +10133,8 @@ At.prototype = {
_onTapStart: function(t) {
if (!!t.cancelable) {
var i = this, r = this.el, n = this.options, a = n.preventOnFilter, s = t.type, u = t.touches && t.touches[0] || t.pointerType && t.pointerType === "touch" && t, d = (u || t).target, p = t.target.shadowRoot && (t.path && t.path[0] || t.composedPath && t.composedPath()[0]) || d, h = n.filter;
- if (LE(r), !et && !(/mousedown|pointerdown/.test(s) && t.button !== 0 || n.disabled) && !p.isContentEditable && !(!this.nativeDraggable && Ya && d && d.tagName.toUpperCase() === "SELECT") && (d = Bi(d, n.draggable, r, !1), !(d && d.animated) && ks !== d)) {
- if (No = ci(d), Ja = ci(d, n.draggable), typeof h == "function") {
+ if (BE(r), !et && !(/mousedown|pointerdown/.test(s) && t.button !== 0 || n.disabled) && !p.isContentEditable && !(!this.nativeDraggable && Ya && d && d.tagName.toUpperCase() === "SELECT") && (d = Bi(d, n.draggable, r, !1), !(d && d.animated) && ks !== d)) {
+ if (Lo = ci(d), Ja = ci(d, n.draggable), typeof h == "function") {
if (h.call(this, t, d, this)) {
Un({
sortable: i,
@@ -10176,21 +10176,21 @@ At.prototype = {
target: et,
clientX: (i || t).clientX,
clientY: (i || t).clientY
- }, Av = Ur.clientX - p.left, Cv = Ur.clientY - p.top, this._lastX = (i || t).clientX, this._lastY = (i || t).clientY, et.style["will-change"] = "all", d = function() {
+ }, Cv = Ur.clientX - p.left, Sv = Ur.clientY - p.top, this._lastX = (i || t).clientX, this._lastY = (i || t).clientY, et.style["will-change"] = "all", d = function() {
if (Kn("delayEnded", n, {
evt: t
}), At.eventCanceled) {
n._onDrop();
return;
}
- n._disableDelayedDragEvents(), !yv && n.nativeDraggable && (et.draggable = !0), n._triggerDragStart(t, i), Un({
+ n._disableDelayedDragEvents(), !bv && n.nativeDraggable && (et.draggable = !0), n._triggerDragStart(t, i), Un({
sortable: n,
name: "choose",
originalEvent: t
}), ni(et, s.chosenClass, !0);
}, s.ignore.split(",").forEach(function(h) {
- my(et, h.trim(), xf);
- }), Mt(u, "dragover", Hr), Mt(u, "mousemove", Hr), Mt(u, "touchmove", Hr), Mt(u, "mouseup", n._onDrop), Mt(u, "touchend", n._onDrop), Mt(u, "touchcancel", n._onDrop), yv && this.nativeDraggable && (this.options.touchStartThreshold = 4, et.draggable = !0), Kn("delayStart", this, {
+ gy(et, h.trim(), xf);
+ }), Mt(u, "dragover", Hr), Mt(u, "mousemove", Hr), Mt(u, "touchmove", Hr), Mt(u, "mouseup", n._onDrop), Mt(u, "touchend", n._onDrop), Mt(u, "touchcancel", n._onDrop), bv && this.nativeDraggable && (this.options.touchStartThreshold = 4, et.draggable = !0), Kn("delayStart", this, {
evt: t
}), s.delay && (!s.delayOnTouchOnly || i) && (!this.nativeDraggable || !(sl || lr))) {
if (At.eventCanceled) {
@@ -10223,10 +10223,10 @@ At.prototype = {
}
},
_dragStarted: function(t, i) {
- if (Lo = !1, Xt && et) {
+ if (Mo = !1, Xt && et) {
Kn("dragStarted", this, {
evt: i
- }), this.nativeDraggable && Mt(document, "dragover", OE);
+ }), this.nativeDraggable && Mt(document, "dragover", RE);
var r = this.options;
!t && ni(et, r.dragClass, !1), ni(et, r.ghostClass, !0), At.active = this, t && this._appendGhost(), Un({
sortable: this,
@@ -10238,7 +10238,7 @@ At.prototype = {
},
_emulateDragOver: function() {
if (Si) {
- this._lastX = Si.clientX, this._lastY = Si.clientY, Ay();
+ this._lastX = Si.clientX, this._lastY = Si.clientY, Sy();
for (var t = document.elementFromPoint(Si.clientX, Si.clientY), i = t; t && t.shadowRoot && (t = t.shadowRoot.elementFromPoint(Si.clientX, Si.clientY), t !== i); )
i = t;
if (et.parentNode[ri]._isOutsideThisEl(t), i)
@@ -10255,13 +10255,13 @@ At.prototype = {
}
t = i;
} while (i = i.parentNode);
- Cy();
+ Ey();
}
},
_onTouchMove: function(t) {
if (Ur) {
- var i = this.options, r = i.fallbackTolerance, n = i.fallbackOffset, a = t.touches ? t.touches[0] : t, s = xt && Vo(xt, !0), u = xt && s && s.a, d = xt && s && s.d, p = us && Rn && wv(Rn), h = (a.clientX - Ur.clientX + n.x) / (u || 1) + (p ? p[0] - Ef[0] : 0) / (u || 1), g = (a.clientY - Ur.clientY + n.y) / (d || 1) + (p ? p[1] - Ef[1] : 0) / (d || 1);
- if (!At.active && !Lo) {
+ var i = this.options, r = i.fallbackTolerance, n = i.fallbackOffset, a = t.touches ? t.touches[0] : t, s = xt && Bo(xt, !0), u = xt && s && s.a, d = xt && s && s.d, p = us && Rn && Av(Rn), h = (a.clientX - Ur.clientX + n.x) / (u || 1) + (p ? p[0] - Ef[0] : 0) / (u || 1), g = (a.clientY - Ur.clientY + n.y) / (d || 1) + (p ? p[1] - Ef[1] : 0) / (d || 1);
+ if (!At.active && !Mo) {
if (r && Math.max(Math.abs(a.clientX - this._lastX), Math.abs(a.clientY - this._lastY)) < r)
return;
this._onDragStart(t, !0);
@@ -10287,9 +10287,9 @@ At.prototype = {
if (us) {
for (Rn = t; wt(Rn, "position") === "static" && wt(Rn, "transform") === "none" && Rn !== document; )
Rn = Rn.parentNode;
- Rn !== document.body && Rn !== document.documentElement ? (Rn === document && (Rn = Hi()), i.top += Rn.scrollTop, i.left += Rn.scrollLeft) : Rn = Hi(), Ef = wv(Rn);
+ Rn !== document.body && Rn !== document.documentElement ? (Rn === document && (Rn = Hi()), i.top += Rn.scrollTop, i.left += Rn.scrollLeft) : Rn = Hi(), Ef = Av(Rn);
}
- xt = et.cloneNode(!0), ni(xt, r.ghostClass, !1), ni(xt, r.fallbackClass, !0), ni(xt, r.dragClass, !0), wt(xt, "transition", ""), wt(xt, "transform", ""), wt(xt, "box-sizing", "border-box"), wt(xt, "margin", 0), wt(xt, "top", i.top), wt(xt, "left", i.left), wt(xt, "width", i.width), wt(xt, "height", i.height), wt(xt, "opacity", "0.8"), wt(xt, "position", us ? "absolute" : "fixed"), wt(xt, "zIndex", "100000"), wt(xt, "pointerEvents", "none"), At.ghost = xt, t.appendChild(xt), wt(xt, "transform-origin", Av / parseInt(xt.style.width) * 100 + "% " + Cv / parseInt(xt.style.height) * 100 + "%");
+ xt = et.cloneNode(!0), ni(xt, r.ghostClass, !1), ni(xt, r.fallbackClass, !0), ni(xt, r.dragClass, !0), wt(xt, "transition", ""), wt(xt, "transform", ""), wt(xt, "box-sizing", "border-box"), wt(xt, "margin", 0), wt(xt, "top", i.top), wt(xt, "left", i.left), wt(xt, "width", i.width), wt(xt, "height", i.height), wt(xt, "opacity", "0.8"), wt(xt, "position", us ? "absolute" : "fixed"), wt(xt, "zIndex", "100000"), wt(xt, "pointerEvents", "none"), At.ghost = xt, t.appendChild(xt), wt(xt, "transform-origin", Cv / parseInt(xt.style.width) * 100 + "% " + Sv / parseInt(xt.style.height) * 100 + "%");
}
},
_onDragStart: function(t, i) {
@@ -10300,16 +10300,16 @@ At.prototype = {
this._onDrop();
return;
}
- Kn("setupClone", this), At.eventCanceled || (nn = yy(et), nn.draggable = !1, nn.style["will-change"] = "", this._hideClone(), ni(nn, this.options.chosenClass, !1), At.clone = nn), r.cloneId = $s(function() {
+ Kn("setupClone", this), At.eventCanceled || (nn = _y(et), nn.draggable = !1, nn.style["will-change"] = "", this._hideClone(), ni(nn, this.options.chosenClass, !1), At.clone = nn), r.cloneId = $s(function() {
Kn("clone", r), !At.eventCanceled && (r.options.removeCloneOnHide || Xt.insertBefore(nn, et), r._hideClone(), Un({
sortable: r,
name: "clone"
}));
- }), !i && ni(et, a.dragClass, !0), i ? (zs = !0, r._loopId = setInterval(r._emulateDragOver, 50)) : (Dt(document, "mouseup", r._onDrop), Dt(document, "touchend", r._onDrop), Dt(document, "touchcancel", r._onDrop), n && (n.effectAllowed = "move", a.setData && a.setData.call(r, n, et)), Mt(document, "drop", r), wt(et, "transform", "translateZ(0)")), Lo = !0, r._dragStartId = $s(r._dragStarted.bind(r, i, t)), Mt(document, "selectstart", r), za = !0, Ya && wt(document.body, "user-select", "none");
+ }), !i && ni(et, a.dragClass, !0), i ? (zs = !0, r._loopId = setInterval(r._emulateDragOver, 50)) : (Dt(document, "mouseup", r._onDrop), Dt(document, "touchend", r._onDrop), Dt(document, "touchcancel", r._onDrop), n && (n.effectAllowed = "move", a.setData && a.setData.call(r, n, et)), Mt(document, "drop", r), wt(et, "transform", "translateZ(0)")), Mo = !0, r._dragStartId = $s(r._dragStarted.bind(r, i, t)), Mt(document, "selectstart", r), za = !0, Ya && wt(document.body, "user-select", "none");
},
_onDragOver: function(t) {
var i = this.el, r = t.target, n, a, s, u = this.options, d = u.group, p = At.active, h = ls === d, g = u.sort, _ = Tn || p, S, b = this, A = !1;
- if (lc)
+ if (sc)
return;
function y(C, q) {
Kn(C, b, zi({
@@ -10337,7 +10337,7 @@ At.prototype = {
insertion: C
}), C && (h ? p._hideClone() : p._showClone(b), b !== _ && (ni(et, Tn ? Tn.options.ghostClass : p.options.ghostClass, !1), ni(et, u.ghostClass, !0)), Tn !== b && b !== At.active ? Tn = b : b === At.active && Tn && (Tn = null), _ === b && (b._ignoreWhileAnimating = r), b.animateAll(function() {
y("dragOverAnimationComplete"), b._ignoreWhileAnimating = null;
- }), b !== _ && (_.animateAll(), _._ignoreWhileAnimating = null)), (r === et && !et.animated || r === i && !r.animated) && (Oo = null), !u.dragoverBubble && !t.rootEl && r !== document && (et.parentNode[ri]._isOutsideThisEl(t.target), !C && Hr(t)), !u.dragoverBubble && t.stopPropagation && t.stopPropagation(), A = !0;
+ }), b !== _ && (_.animateAll(), _._ignoreWhileAnimating = null)), (r === et && !et.animated || r === i && !r.animated) && (ko = null), !u.dragoverBubble && !t.rootEl && r !== document && (et.parentNode[ri]._isOutsideThisEl(t.target), !C && Hr(t)), !u.dragoverBubble && t.stopPropagation && t.stopPropagation(), A = !0;
}
function E() {
ii = ci(et), xr = ci(et, u.draggable), Un({
@@ -10358,22 +10358,22 @@ At.prototype = {
return A;
if (s)
return tn = Xt, m(), this._hideClone(), y("revert"), At.eventCanceled || (zr ? Xt.insertBefore(et, zr) : Xt.appendChild(et)), w(!0);
- var x = Fc(i, u.draggable);
- if (!x || IE(t, S, this) && !x.animated) {
+ var x = Pc(i, u.draggable);
+ if (!x || PE(t, S, this) && !x.animated) {
if (x === et)
return w(!1);
if (x && i === t.target && (r = x), r && (a = _n(r)), ds(Xt, i, et, n, r, a, t, !!r) !== !1)
return m(), i.appendChild(et), tn = i, E(), w(!0);
- } else if (x && DE(t, S, this)) {
- var k = Go(i, 0, u, !0);
+ } else if (x && FE(t, S, this)) {
+ var k = Wo(i, 0, u, !0);
if (k === et)
return w(!1);
if (r = k, a = _n(r), ds(Xt, i, et, n, r, a, t, !1) !== !1)
return m(), i.insertBefore(et, k), tn = i, E(), w(!0);
} else if (r.parentNode === i) {
a = _n(r);
- var R = 0, M, P = et.parentNode !== i, B = !TE(et.animated && et.toRect || n, r.animated && r.toRect || a, S), T = S ? "top" : "left", D = _v(r, "top", "top") || _v(et, "top", "top"), V = D ? D.scrollTop : void 0;
- Oo !== r && (M = a[T], Za = !1, ss = !B && u.invertSwap || P), R = FE(t, r, a, S, B ? 1 : u.swapThreshold, u.invertedSwapThreshold == null ? u.swapThreshold : u.invertedSwapThreshold, ss, Oo === r);
+ var R = 0, M, P = et.parentNode !== i, B = !OE(et.animated && et.toRect || n, r.animated && r.toRect || a, S), T = S ? "top" : "left", D = wv(r, "top", "top") || wv(et, "top", "top"), V = D ? D.scrollTop : void 0;
+ ko !== r && (M = a[T], Za = !1, ss = !B && u.invertSwap || P), R = ME(t, r, a, S, B ? 1 : u.swapThreshold, u.invertedSwapThreshold == null ? u.swapThreshold : u.invertedSwapThreshold, ss, ko === r);
var W;
if (R !== 0) {
var G = ci(et);
@@ -10383,12 +10383,12 @@ At.prototype = {
}
if (R === 0 || W === r)
return w(!1);
- Oo = r, Xa = R;
+ ko = r, Xa = R;
var I = r.nextElementSibling, U = !1;
U = R === 1;
var F = ds(Xt, i, et, n, r, a, t, U);
if (F !== !1)
- return (F === 1 || F === -1) && (U = F === 1), lc = !0, setTimeout(RE, 30), m(), U && !I ? i.appendChild(et) : r.parentNode.insertBefore(et, U ? I : r), D && gy(D, 0, V - D.scrollTop), tn = et.parentNode, M !== void 0 && !ss && (Os = Math.abs(M - _n(r)[T])), E(), w(!0);
+ return (F === 1 || F === -1) && (U = F === 1), sc = !0, setTimeout(IE, 30), m(), U && !I ? i.appendChild(et) : r.parentNode.insertBefore(et, U ? I : r), D && by(D, 0, V - D.scrollTop), tn = et.parentNode, M !== void 0 && !ss && (Os = Math.abs(M - _n(r)[T])), E(), w(!0);
}
if (i.contains(et))
return w(!1);
@@ -10411,7 +10411,7 @@ At.prototype = {
this._nulling();
return;
}
- Lo = !1, ss = !1, Za = !1, clearInterval(this._loopId), clearTimeout(this._dragStartTimer), sc(this.cloneId), sc(this._dragStartId), this.nativeDraggable && (Dt(document, "drop", this), Dt(i, "dragstart", this._onDragStart)), this._offMoveEvents(), this._offUpEvents(), Ya && wt(document.body, "user-select", ""), wt(et, "transform", ""), t && (za && (t.cancelable && t.preventDefault(), !r.dropBubble && t.stopPropagation()), xt && xt.parentNode && xt.parentNode.removeChild(xt), (Xt === tn || Tn && Tn.lastPutMode !== "clone") && nn && nn.parentNode && nn.parentNode.removeChild(nn), et && (this.nativeDraggable && Dt(et, "dragend", this), xf(et), et.style["will-change"] = "", za && !Lo && ni(et, Tn ? Tn.options.ghostClass : this.options.ghostClass, !1), ni(et, this.options.chosenClass, !1), Un({
+ Mo = !1, ss = !1, Za = !1, clearInterval(this._loopId), clearTimeout(this._dragStartTimer), uc(this.cloneId), uc(this._dragStartId), this.nativeDraggable && (Dt(document, "drop", this), Dt(i, "dragstart", this._onDragStart)), this._offMoveEvents(), this._offUpEvents(), Ya && wt(document.body, "user-select", ""), wt(et, "transform", ""), t && (za && (t.cancelable && t.preventDefault(), !r.dropBubble && t.stopPropagation()), xt && xt.parentNode && xt.parentNode.removeChild(xt), (Xt === tn || Tn && Tn.lastPutMode !== "clone") && nn && nn.parentNode && nn.parentNode.removeChild(nn), et && (this.nativeDraggable && Dt(et, "dragend", this), xf(et), et.style["will-change"] = "", za && !Mo && ni(et, Tn ? Tn.options.ghostClass : this.options.ghostClass, !1), ni(et, this.options.chosenClass, !1), Un({
sortable: this,
name: "unchoose",
toEl: tn,
@@ -10440,7 +10440,7 @@ At.prototype = {
name: "sort",
toEl: tn,
originalEvent: t
- })), Tn && Tn.save()) : ii !== No && ii >= 0 && (Un({
+ })), Tn && Tn.save()) : ii !== Lo && ii >= 0 && (Un({
sortable: this,
name: "update",
toEl: tn,
@@ -10450,7 +10450,7 @@ At.prototype = {
name: "sort",
toEl: tn,
originalEvent: t
- })), At.active && ((ii == null || ii === -1) && (ii = No, xr = Ja), Un({
+ })), At.active && ((ii == null || ii === -1) && (ii = Lo, xr = Ja), Un({
sortable: this,
name: "end",
toEl: tn,
@@ -10458,7 +10458,7 @@ At.prototype = {
}), this.save()))), this._nulling();
},
_nulling: function() {
- Kn("nulling", this), Xt = et = tn = xt = zr = nn = ks = Tr = Ur = Si = za = ii = xr = No = Ja = Oo = Xa = Tn = ls = At.dragged = At.ghost = At.clone = At.active = null, Gs.forEach(function(t) {
+ Kn("nulling", this), Xt = et = tn = xt = zr = nn = ks = Tr = Ur = Si = za = ii = xr = Lo = Ja = ko = Xa = Tn = ls = At.dragged = At.ghost = At.clone = At.active = null, Gs.forEach(function(t) {
t.checked = !0;
}), Gs.length = Cf = Sf = 0;
},
@@ -10470,7 +10470,7 @@ At.prototype = {
break;
case "dragenter":
case "dragover":
- et && (this._onDragOver(t), $E(t));
+ et && (this._onDragOver(t), DE(t));
break;
case "selectstart":
t.preventDefault();
@@ -10479,7 +10479,7 @@ At.prototype = {
},
toArray: function() {
for (var t = [], i, r = this.el.children, n = 0, a = r.length, s = this.options; n < a; n++)
- i = r[n], Bi(i, s.draggable, this.el, !1) && t.push(i.getAttribute(s.dataIdAttr) || ME(i));
+ i = r[n], Bi(i, s.draggable, this.el, !1) && t.push(i.getAttribute(s.dataIdAttr) || NE(i));
return t;
},
sort: function(t, i) {
@@ -10503,7 +10503,7 @@ At.prototype = {
if (i === void 0)
return r[t];
var n = ul.modifyOption(this, t, i);
- typeof n < "u" ? r[t] = n : r[t] = i, t === "group" && wy(r);
+ typeof n < "u" ? r[t] = n : r[t] = i, t === "group" && Cy(r);
},
destroy: function() {
Kn("destroy", this);
@@ -10531,7 +10531,7 @@ At.prototype = {
}
}
};
-function $E(e) {
+function DE(e) {
e.dataTransfer && (e.dataTransfer.dropEffect = "move"), e.cancelable && e.preventDefault();
}
function ds(e, t, i, r, n, a, s, u) {
@@ -10544,18 +10544,18 @@ function ds(e, t, i, r, n, a, s, u) {
function xf(e) {
e.draggable = !1;
}
-function RE() {
- lc = !1;
+function IE() {
+ sc = !1;
}
-function DE(e, t, i) {
- var r = _n(Go(i.el, 0, i.options, !0)), n = 10;
+function FE(e, t, i) {
+ var r = _n(Wo(i.el, 0, i.options, !0)), n = 10;
return t ? e.clientX < r.left - n || e.clientY < r.top && e.clientX < r.right : e.clientY < r.top - n || e.clientY < r.bottom && e.clientX < r.left;
}
-function IE(e, t, i) {
- var r = _n(Fc(i.el, i.options.draggable)), n = 10;
+function PE(e, t, i) {
+ var r = _n(Pc(i.el, i.options.draggable)), n = 10;
return t ? e.clientX > r.right + n || e.clientX <= r.right && e.clientY > r.bottom && e.clientX >= r.left : e.clientX > r.right && e.clientY > r.top || e.clientX <= r.right && e.clientY > r.bottom + n;
}
-function FE(e, t, i, r, n, a, s, u) {
+function ME(e, t, i, r, n, a, s, u) {
var d = r ? e.clientY : e.clientX, p = r ? i.height : i.width, h = r ? i.top : i.left, g = r ? i.bottom : i.right, _ = !1;
if (!s) {
if (u && Os < p * n) {
@@ -10564,19 +10564,19 @@ function FE(e, t, i, r, n, a, s, u) {
else if (Xa === 1 ? d < h + Os : d > g - Os)
return -Xa;
} else if (d > h + p * (1 - n) / 2 && d < g - p * (1 - n) / 2)
- return PE(t);
+ return LE(t);
}
return _ = _ || s, _ && (d < h + p * a / 2 || d > g - p * a / 2) ? d > h + p / 2 ? 1 : -1 : 0;
}
-function PE(e) {
+function LE(e) {
return ci(et) < ci(e) ? 1 : -1;
}
-function ME(e) {
+function NE(e) {
for (var t = e.tagName + e.className + e.src + e.href + e.textContent, i = t.length, r = 0; i--; )
r += t.charCodeAt(i);
return r.toString(36);
}
-function LE(e) {
+function BE(e) {
Gs.length = 0;
for (var t = e.getElementsByTagName("input"), i = t.length; i--; ) {
var r = t[i];
@@ -10586,30 +10586,30 @@ function LE(e) {
function $s(e) {
return setTimeout(e, 0);
}
-function sc(e) {
+function uc(e) {
return clearTimeout(e);
}
lu && Mt(document, "touchmove", function(e) {
- (At.active || Lo) && e.cancelable && e.preventDefault();
+ (At.active || Mo) && e.cancelable && e.preventDefault();
});
At.utils = {
on: Mt,
off: Dt,
css: wt,
- find: my,
+ find: gy,
is: function(t, i) {
return !!Bi(t, i, t, !1);
},
- extend: bE,
- throttle: vy,
+ extend: wE,
+ throttle: yy,
closest: Bi,
toggleClass: ni,
- clone: yy,
+ clone: _y,
index: ci,
nextTick: $s,
- cancelNextTick: sc,
- detectDirection: _y,
- getChild: Go
+ cancelNextTick: uc,
+ detectDirection: Ay,
+ getChild: Wo
};
At.get = function(e) {
return e[ri];
@@ -10626,9 +10626,9 @@ At.mount = function() {
At.create = function(e, t) {
return new At(e, t);
};
-At.version = mE;
-var fn = [], Wa, uc, dc = !1, Tf, kf, Ks, Ga;
-function NE() {
+At.version = gE;
+var fn = [], Wa, dc, fc = !1, Tf, kf, Ks, Ga;
+function VE() {
function e() {
this.defaults = {
scroll: !0,
@@ -10650,10 +10650,10 @@ function NE() {
!this.options.dragOverBubble && !r.rootEl && this._handleAutoScroll(r);
},
drop: function() {
- this.sortable.nativeDraggable ? Dt(document, "dragover", this._handleAutoScroll) : (Dt(document, "pointermove", this._handleFallbackAutoScroll), Dt(document, "touchmove", this._handleFallbackAutoScroll), Dt(document, "mousemove", this._handleFallbackAutoScroll)), Ev(), Rs(), _E();
+ this.sortable.nativeDraggable ? Dt(document, "dragover", this._handleAutoScroll) : (Dt(document, "pointermove", this._handleFallbackAutoScroll), Dt(document, "touchmove", this._handleFallbackAutoScroll), Dt(document, "mousemove", this._handleFallbackAutoScroll)), xv(), Rs(), AE();
},
nulling: function() {
- Ks = uc = Wa = dc = Ga = Tf = kf = null, fn.length = 0;
+ Ks = dc = Wa = fc = Ga = Tf = kf = null, fn.length = 0;
},
_handleFallbackAutoScroll: function(i) {
this._handleAutoScroll(i, !0);
@@ -10663,7 +10663,7 @@ function NE() {
if (Ks = i, r || this.options.forceAutoScrollFallback || sl || lr || Ya) {
Of(i, this.options, u, r);
var d = Or(u, !0);
- dc && (!Ga || a !== Tf || s !== kf) && (Ga && Ev(), Ga = setInterval(function() {
+ fc && (!Ga || a !== Tf || s !== kf) && (Ga && xv(), Ga = setInterval(function() {
var p = Or(document.elementFromPoint(a, s), !0);
p !== d && (d = p, Rs()), Of(i, n.options, p, r);
}, 10), Tf = a, kf = s);
@@ -10685,13 +10685,13 @@ function Rs() {
clearInterval(e.pid);
}), fn = [];
}
-function Ev() {
+function xv() {
clearInterval(Ga);
}
-var Of = vy(function(e, t, i, r) {
+var Of = yy(function(e, t, i, r) {
if (!!t.scroll) {
var n = (e.touches ? e.touches[0] : e).clientX, a = (e.touches ? e.touches[0] : e).clientY, s = t.scrollSensitivity, u = t.scrollSpeed, d = Hi(), p = !1, h;
- uc !== i && (uc = i, Rs(), Wa = t.scroll, h = t.scrollFn, Wa === !0 && (Wa = Or(i, !0)));
+ dc !== i && (dc = i, Rs(), Wa = t.scroll, h = t.scrollFn, Wa === !0 && (Wa = Or(i, !0)));
var g = 0, _ = Wa;
do {
var S = _, b = _n(S), A = b.top, y = b.bottom, m = b.left, w = b.right, E = b.width, x = b.height, k = void 0, R = void 0, M = S.scrollWidth, P = S.scrollHeight, B = wt(S), T = S.scrollLeft, D = S.scrollTop;
@@ -10703,14 +10703,14 @@ var Of = vy(function(e, t, i, r) {
(fn[g].vx != V || fn[g].vy != W || fn[g].el !== S) && (fn[g].el = S, fn[g].vx = V, fn[g].vy = W, clearInterval(fn[g].pid), (V != 0 || W != 0) && (p = !0, fn[g].pid = setInterval(function() {
r && this.layer === 0 && At.active._onTouchMove(Ks);
var I = fn[this.layer].vy ? fn[this.layer].vy * u : 0, U = fn[this.layer].vx ? fn[this.layer].vx * u : 0;
- typeof h == "function" && h.call(At.dragged.parentNode[ri], U, I, e, Ks, fn[this.layer].el) !== "continue" || gy(fn[this.layer].el, U, I);
+ typeof h == "function" && h.call(At.dragged.parentNode[ri], U, I, e, Ks, fn[this.layer].el) !== "continue" || by(fn[this.layer].el, U, I);
}.bind({
layer: g
}), 24))), g++;
} while (t.bubbleScroll && _ !== d && (_ = Or(_, !1)));
- dc = p;
+ fc = p;
}
-}, 30), Sy = function(t) {
+}, 30), xy = function(t) {
var i = t.originalEvent, r = t.putSortable, n = t.dragEl, a = t.activeSortable, s = t.dispatchSortableEvent, u = t.hideGhostForTarget, d = t.unhideGhostForTarget;
if (!!i) {
var p = r || a;
@@ -10722,9 +10722,9 @@ var Of = vy(function(e, t, i, r) {
}));
}
};
-function Pc() {
+function Mc() {
}
-Pc.prototype = {
+Mc.prototype = {
startIndex: null,
dragStart: function(t) {
var i = t.oldDraggableIndex;
@@ -10733,54 +10733,54 @@ Pc.prototype = {
onSpill: function(t) {
var i = t.dragEl, r = t.putSortable;
this.sortable.captureAnimationState(), r && r.captureAnimationState();
- var n = Go(this.sortable.el, this.startIndex, this.options);
+ var n = Wo(this.sortable.el, this.startIndex, this.options);
n ? this.sortable.el.insertBefore(i, n) : this.sortable.el.appendChild(i), this.sortable.animateAll(), r && r.animateAll();
},
- drop: Sy
+ drop: xy
};
-or(Pc, {
+or(Mc, {
pluginName: "revertOnSpill"
});
-function Mc() {
+function Lc() {
}
-Mc.prototype = {
+Lc.prototype = {
onSpill: function(t) {
var i = t.dragEl, r = t.putSortable, n = r || this.sortable;
n.captureAnimationState(), i.parentNode && i.parentNode.removeChild(i), n.animateAll();
},
- drop: Sy
+ drop: xy
};
-or(Mc, {
+or(Lc, {
pluginName: "removeOnSpill"
});
-At.mount(new NE());
-At.mount(Mc, Pc);
+At.mount(new VE());
+At.mount(Lc, Mc);
function $f(e) {
e.parentElement !== null && e.parentElement.removeChild(e);
}
-function xv(e, t, i) {
+function Tv(e, t, i) {
const r = i === 0 ? e.children[0] : e.children[i - 1].nextSibling;
e.insertBefore(t, r);
}
-function BE() {
+function jE() {
return typeof window < "u" ? window.console : global.console;
}
-const VE = BE();
-function jE(e) {
+const UE = jE();
+function HE(e) {
const t = /* @__PURE__ */ Object.create(null);
return function(r) {
return t[r] || (t[r] = e(r));
};
}
-const UE = /-(\w)/g, HE = jE((e) => e.replace(UE, (t, i) => i.toUpperCase())), Ey = ["Start", "Add", "Remove", "Update", "End"], xy = ["Choose", "Unchoose", "Sort", "Filter", "Clone"], Ty = ["Move"], zE = [Ty, Ey, xy].flatMap((e) => e).map((e) => `on${e}`), fc = {
- manage: Ty,
- manageAndEmit: Ey,
- emit: xy
+const zE = /-(\w)/g, WE = HE((e) => e.replace(zE, (t, i) => i.toUpperCase())), Ty = ["Start", "Add", "Remove", "Update", "End"], ky = ["Choose", "Unchoose", "Sort", "Filter", "Clone"], Oy = ["Move"], GE = [Oy, Ty, ky].flatMap((e) => e).map((e) => `on${e}`), cc = {
+ manage: Oy,
+ manageAndEmit: Ty,
+ emit: ky
};
-function WE(e) {
- return zE.indexOf(e) !== -1;
+function KE(e) {
+ return GE.indexOf(e) !== -1;
}
-const GE = [
+const YE = [
"a",
"abbr",
"address",
@@ -10899,30 +10899,30 @@ const GE = [
"video",
"wbr"
];
-function KE(e) {
- return GE.includes(e);
+function QE(e) {
+ return YE.includes(e);
}
-function YE(e) {
+function JE(e) {
return ["transition-group", "TransitionGroup"].includes(e);
}
-function ky(e) {
+function $y(e) {
return ["id", "class", "role", "style"].includes(e) || e.startsWith("data-") || e.startsWith("aria-") || e.startsWith("on");
}
-function Oy(e) {
+function Ry(e) {
return e.reduce((t, [i, r]) => (t[i] = r, t), {});
}
-function QE({ $attrs: e, componentData: t = {} }) {
+function XE({ $attrs: e, componentData: t = {} }) {
return {
- ...Oy(
- Object.entries(e).filter(([r, n]) => ky(r))
+ ...Ry(
+ Object.entries(e).filter(([r, n]) => $y(r))
),
...t
};
}
-function JE({ $attrs: e, callBackBuilder: t }) {
- const i = Oy($y(e));
+function ZE({ $attrs: e, callBackBuilder: t }) {
+ const i = Ry(Dy(e));
Object.entries(t).forEach(([n, a]) => {
- fc[n].forEach((s) => {
+ cc[n].forEach((s) => {
i[`on${s}`] = a(s);
});
});
@@ -10932,11 +10932,11 @@ function JE({ $attrs: e, callBackBuilder: t }) {
draggable: r
};
}
-function $y(e) {
- return Object.entries(e).filter(([t, i]) => !ky(t)).map(([t, i]) => [HE(t), i]).filter(([t, i]) => !WE(t));
+function Dy(e) {
+ return Object.entries(e).filter(([t, i]) => !$y(t)).map(([t, i]) => [WE(t), i]).filter(([t, i]) => !KE(t));
}
-const Tv = ({ el: e }) => e, XE = (e, t) => e.__draggable_context = t, kv = (e) => e.__draggable_context;
-class ZE {
+const kv = ({ el: e }) => e, qE = (e, t) => e.__draggable_context = t, Ov = (e) => e.__draggable_context;
+class e2 {
constructor({
nodes: { header: t, default: i, footer: r },
root: n,
@@ -10954,37 +10954,37 @@ class ZE {
updated() {
const { defaultNodes: t, realList: i } = this;
t.forEach((r, n) => {
- XE(Tv(r), {
+ qE(kv(r), {
element: i[n],
index: n
});
});
}
getUnderlyingVm(t) {
- return kv(t);
+ return Ov(t);
}
getVmIndexFromDomIndex(t, i) {
const { defaultNodes: r } = this, { length: n } = r, a = i.children, s = a.item(t);
if (s === null)
return n;
- const u = kv(s);
+ const u = Ov(s);
if (u)
return u.index;
if (n === 0)
return 0;
- const d = Tv(r[0]), p = [...a].findIndex(
+ const d = kv(r[0]), p = [...a].findIndex(
(h) => h === d
);
return t < p ? 0 : n;
}
}
-function qE(e, t) {
+function t2(e, t) {
const i = e[t];
return i ? i() : [];
}
-function e2({ $slots: e, realList: t, getKey: i }) {
+function n2({ $slots: e, realList: t, getKey: i }) {
const r = t || [], [n, a] = ["header", "footer"].map(
- (d) => qE(e, d)
+ (d) => t2(e, d)
), { item: s } = e;
if (!s)
throw new Error("draggable element must have an item slot");
@@ -10999,35 +10999,35 @@ function e2({ $slots: e, realList: t, getKey: i }) {
default: u
};
}
-function t2(e) {
- const t = YE(e), i = !KE(e) && !t;
+function i2(e) {
+ const t = JE(e), i = !QE(e) && !t;
return {
transition: t,
externalComponent: i,
- tag: i ? ee(e) : t ? ow : e
+ tag: i ? ee(e) : t ? lw : e
};
}
-function n2({ $slots: e, tag: t, realList: i, getKey: r }) {
- const n = e2({ $slots: e, realList: i, getKey: r }), a = t2(t);
- return new ZE({ nodes: n, root: a, realList: i });
+function r2({ $slots: e, tag: t, realList: i, getKey: r }) {
+ const n = n2({ $slots: e, realList: i, getKey: r }), a = i2(t);
+ return new e2({ nodes: n, root: a, realList: i });
}
-function Ry(e, t) {
+function Iy(e, t) {
Yn(() => this.$emit(e.toLowerCase(), t));
}
-function Dy(e) {
+function Fy(e) {
return (t, i) => {
if (this.realList !== null)
return this[`onDrag${e}`](t, i);
};
}
-function i2(e) {
- const t = Dy.call(this, e);
+function o2(e) {
+ const t = Fy.call(this, e);
return (i, r) => {
- t.call(this, i, r), Ry.call(this, e, i);
+ t.call(this, i, r), Iy.call(this, e, i);
};
}
let Rf = null;
-const r2 = {
+const a2 = {
list: {
type: Array,
required: !1,
@@ -11059,15 +11059,15 @@ const r2 = {
required: !1,
default: null
}
-}, o2 = [
+}, l2 = [
"update:modelValue",
"change",
- ...[...fc.manageAndEmit, ...fc.emit].map((e) => e.toLowerCase())
-], Yo = Be({
+ ...[...cc.manageAndEmit, ...cc.emit].map((e) => e.toLowerCase())
+], Ko = Be({
name: "draggable",
inheritAttrs: !1,
- props: r2,
- emits: o2,
+ props: a2,
+ emits: l2,
data() {
return {
error: !1
@@ -11076,21 +11076,21 @@ const r2 = {
render() {
try {
this.error = !1;
- const { $slots: e, $attrs: t, tag: i, componentData: r, realList: n, getKey: a } = this, s = n2({
+ const { $slots: e, $attrs: t, tag: i, componentData: r, realList: n, getKey: a } = this, s = r2({
$slots: e,
tag: i,
realList: n,
getKey: a
});
this.componentStructure = s;
- const u = QE({ $attrs: t, componentData: r });
+ const u = XE({ $attrs: t, componentData: r });
return s.render(on, u);
} catch (e) {
return this.error = !0, on("pre", { style: { color: "red" } }, e.stack);
}
},
created() {
- this.list !== null && this.modelValue !== null && VE.error(
+ this.list !== null && this.modelValue !== null && UE.error(
"modelValue and list props are mutually exclusive! Please set one or another."
);
},
@@ -11099,12 +11099,12 @@ const r2 = {
return;
const { $attrs: e, $el: t, componentStructure: i } = this;
i.updated();
- const r = JE({
+ const r = ZE({
$attrs: e,
callBackBuilder: {
- manageAndEmit: (a) => i2.call(this, a),
- emit: (a) => Ry.bind(this, a),
- manage: (a) => Dy.call(this, a)
+ manageAndEmit: (a) => o2.call(this, a),
+ emit: (a) => Iy.bind(this, a),
+ manage: (a) => Fy.call(this, a)
}
}), n = t.nodeType === 1 ? t : t.parentElement;
this._sortable = new At(n, r), this.targetDomElement = n, n.__draggable_component__ = this;
@@ -11129,7 +11129,7 @@ const r2 = {
$attrs: {
handler(e) {
const { _sortable: t } = this;
- !t || $y(e).forEach(([i, r]) => {
+ !t || Dy(e).forEach(([i, r]) => {
t.option(i, r);
});
},
@@ -11189,7 +11189,7 @@ const r2 = {
this.emitChanges({ added: r });
},
onDragRemove(e) {
- if (xv(this.$el, e.item, e.oldIndex), e.pullMode === "clone") {
+ if (Tv(this.$el, e.item, e.oldIndex), e.pullMode === "clone") {
$f(e.clone);
return;
}
@@ -11199,7 +11199,7 @@ const r2 = {
this.emitChanges({ removed: r });
},
onDragUpdate(e) {
- $f(e.item), xv(e.from, e.item, e.oldIndex);
+ $f(e.item), Tv(e.from, e.item, e.oldIndex);
const t = this.context.index, i = this.getVmIndexFromDomIndex(e.newIndex);
this.updatePosition(t, i);
const r = { element: this.context.element, oldIndex: t, newIndex: i };
@@ -11234,7 +11234,7 @@ const r2 = {
}
}
});
-function a2() {
+function s2() {
return [
{
name: "template",
@@ -11273,15 +11273,15 @@ function a2() {
}
];
}
-var Lc = typeof globalThis < "u" ? globalThis : typeof window < "u" ? window : typeof global < "u" ? global : typeof self < "u" ? self : {};
-function l2(e) {
+var Nc = typeof globalThis < "u" ? globalThis : typeof window < "u" ? window : typeof global < "u" ? global : typeof self < "u" ? self : {};
+function u2(e) {
return e && e.__esModule && Object.prototype.hasOwnProperty.call(e, "default") ? e.default : e;
}
-var Iy = { exports: {} };
+var Py = { exports: {} };
(function(e, t) {
(function(i, r) {
e.exports = r();
- })(Lc, function() {
+ })(Nc, function() {
var i = 1e3, r = 6e4, n = 36e5, a = "millisecond", s = "second", u = "minute", d = "hour", p = "day", h = "week", g = "month", _ = "quarter", S = "year", b = "date", A = "Invalid Date", y = /^(\d{4})[-/]?(\d{1,2})?[-/]?(\d{0,2})[Tt\s]*(\d{1,2})?:?(\d{1,2})?:?(\d{1,2})?[.:]?(\d+)?$/, m = /\[([^\]]+)]|Y{1,4}|M{1,4}|D{1,2}|d{1,4}|H{1,2}|h{1,2}|a|A|m{1,2}|s{1,2}|Z{1,2}|SSS/g, w = { name: "en", weekdays: "Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"), months: "January_February_March_April_May_June_July_August_September_October_November_December".split("_"), ordinal: function(G) {
var I = ["th", "st", "nd", "rd"], U = G % 100;
return "[" + G + (I[(U - 20) % 10] || I[U] || I[0]) + "]";
@@ -11566,8 +11566,8 @@ var Iy = { exports: {} };
return T(1e3 * G);
}, T.en = R[k], T.Ls = R, T.p = {}, T;
});
-})(Iy);
-const s2 = Iy.exports, $o = {
+})(Py);
+const d2 = Py.exports, Oo = {
Add: (e, t) => {
let i, r, n;
try {
@@ -11623,21 +11623,21 @@ const s2 = Iy.exports, $o = {
let n = Number(e.toString().replace(".", "")), a = Number(t.toString().replace(".", ""));
return n / a * Math.pow(10, r - i);
}
-}, u2 = "YYYY-MM-DD HH:mm:ss", Cr = (e, t) => e == null ? t : e, rn = {
+}, f2 = "YYYY-MM-DD HH:mm:ss", Cr = (e, t) => e == null ? t : e, rn = {
ADD: function(e, t) {
- return $o.Add(Cr(e, "0"), Cr(t, "0"));
+ return Oo.Add(Cr(e, "0"), Cr(t, "0"));
},
SUB: function(e, t) {
- return $o.Sub(Cr(e, "0"), Cr(t, "0"));
+ return Oo.Sub(Cr(e, "0"), Cr(t, "0"));
},
MUL: function(e, t) {
- return $o.Mul(Cr(e, "0"), Cr(t, "0"));
+ return Oo.Mul(Cr(e, "0"), Cr(t, "0"));
},
DIV: function(e, t) {
- return $o.Div(Cr(e, "0"), Cr(t, "0"));
+ return Oo.Div(Cr(e, "0"), Cr(t, "0"));
},
SUM: function(...e) {
- return (e || []).reduce((t, i) => $o.Add(t, Array.isArray(i) ? rn.SUM(...i) : i || 0), 0);
+ return (e || []).reduce((t, i) => Oo.Add(t, Array.isArray(i) ? rn.SUM(...i) : i || 0), 0);
},
MAX: function(...e) {
const t = Array.isArray(e[0]) ? e[0] : e;
@@ -11652,7 +11652,7 @@ const s2 = Iy.exports, $o = {
},
AVG: function(...e) {
const t = Array.isArray(e[0]) ? e[0] : e;
- return t.length ? $o.Div(rn.SUM(t), t.length) : 0;
+ return t.length ? Oo.Div(rn.SUM(t), t.length) : 0;
},
POWER: function(e, t) {
return Math.pow(parseFloat(e), parseFloat(t));
@@ -11688,8 +11688,8 @@ const s2 = Iy.exports, $o = {
MODIFYDATE: function(e, t, i, r) {
if (!e)
return null;
- let n = s2(e);
- return t > 0 ? n = n.add(t, i) : t < 0 && (n = n.subtract(-1 * t, i)), n.format(r || u2);
+ let n = d2(e);
+ return t > 0 ? n = n.add(t, i) : t < 0 && (n = n.subtract(-1 * t, i)), n.format(r || f2);
},
ADDYEAR: function(e, t, i) {
return rn.MODIFYDATE(e, Math.max(t, 0), "y", i);
@@ -11914,7 +11914,7 @@ const s2 = Iy.exports, $o = {
NE: function(e, t) {
return e !== t;
}
-}, cc = {
+}, pc = {
ADD: "ADD(1, 2) = 3",
SUB: "SUB(10, 1) = 9",
MUL: "MUL(2, 2) = 4",
@@ -11995,7 +11995,7 @@ const s2 = Iy.exports, $o = {
LE: "LE(100, 90) = false, LE(100, 100) = true, LE(100, 110) = true",
LT: "LT(100, 90) = false, LT(100, 100) = false, LT(100, 110) = true",
NE: 'NE(100, 90) = true, NE(100, 100) = false, NE(100, "100") = true'
-}, Fy = [
+}, My = [
{
key: "math",
children: ["TONUMBER", "ADD", "SUB", "MUL", "DIV", "SUM", "MAX", "MIN", "ABS", "AVG", "MOD", "SQRT", "POWER", "RAND", "PI", "ROUND", "FLOOR", "CEIL", "FIXED", "TOCHINSESAMOUNT"]
@@ -12016,7 +12016,7 @@ const s2 = Iy.exports, $o = {
key: "condition",
children: ["IF", "AND", "OR", "CASE", "NOT", "EQ", "NE", "GE", "GT", "LE", "LT", "TRUE", "FALSE", "DEFAULT", "EMPTY", "NOTEMPTY", "ISNUMBER"]
}
-], d2 = (e, t) => {
+], c2 = (e, t) => {
let i = [e];
const r = t.split(".");
let n = 1;
@@ -12037,12 +12037,12 @@ const s2 = Iy.exports, $o = {
let n = [e.$handle];
e.$handle !== r && n.push(r);
let a = t;
- t.indexOf(".") > -1 && ([n, a] = d2(r, t)), n.forEach((s) => {
+ t.indexOf(".") > -1 && ([n, a] = c2(r, t)), n.forEach((s) => {
Object.values(s.ctxs).forEach((u) => {
u.rule._fc_id === a && i(u.rule, s.api);
});
});
-}, Nc = {
+}, Bc = {
openModel(e, t) {
t.api.open(e.model);
},
@@ -12113,9 +12113,9 @@ const s2 = Iy.exports, $o = {
return e.callback && e.callback(t);
},
message(e) {
- $c(e || {});
+ Rc(e || {});
}
-}, Py = [
+}, Ly = [
{
key: "model",
children: ["openModel", "closeModel", "message"]
@@ -12128,7 +12128,7 @@ const s2 = Iy.exports, $o = {
key: "other",
children: ["fetch", "copy", "callback"]
}
-], My = {
+], Ny = {
openModel(e) {
return [
{
@@ -12138,7 +12138,7 @@ const s2 = Iy.exports, $o = {
options: e.pageData.filter((t) => !t.default).map((t) => {
const i = t.main._menu;
return {
- label: Wo(t.main, t.config.labelField, "") || e.t("com." + i.name + ".name") || i.label,
+ label: zo(t.main, t.config.labelField, "") || e.t("com." + i.name + ".name") || i.label,
value: t.main.name
};
})
@@ -12440,10 +12440,10 @@ const s2 = Iy.exports, $o = {
}];
}
};
-function f2(e, t) {
+function p2(e, t) {
return e.reduce((i, r) => i.then(() => r(t)), Promise.resolve());
}
-const Ly = function(e) {
+const By = function(e) {
return {
name: "behavior",
load(t, i) {
@@ -12463,7 +12463,7 @@ const Ly = function(e) {
};
let m;
try {
- m = Nc[p](h || {}, b, e);
+ m = Bc[p](h || {}, b, e);
} catch (w) {
console.error(w), S !== !1 && y();
return;
@@ -12474,7 +12474,7 @@ const Ly = function(e) {
}));
}), u.length) {
const d = e.$handle.inject(i, function(p) {
- f2(u, p);
+ p2(u, p);
}, i.inject || e.$handle.options.injectEvent);
s.indexOf("hook_") > -1 ? a[s.replace("hook_", "")] = d : n[s] = d;
}
@@ -12498,21 +12498,21 @@ const Ly = function(e) {
}
};
nl.watch = nl.load;
-const c2 = Object.assign || function(e) {
+const h2 = Object.assign || function(e) {
for (let t, i = 1; i < arguments.length; i++)
for (let r in t = arguments[i], t)
- Object.prototype.hasOwnProperty.call(t, r) && Mo(e, r, t[r]);
+ Object.prototype.hasOwnProperty.call(t, r) && Po(e, r, t[r]);
return e;
};
function su() {
- return c2.apply(this, arguments);
+ return h2.apply(this, arguments);
}
-function p2(e) {
+function m2(e) {
return typeof e != "object" || e === null ? e : e instanceof Array ? [...e] : { ...e };
}
-function Bc(e) {
+function Vc(e) {
e.__proto__.setBehavior = (t) => {
- su(Nc, t);
+ su(Bc, t);
}, e.extendApi((t) => ({
open(i, ...r) {
(t.el(i) || t.top.el(i)).open(...r);
@@ -12522,23 +12522,23 @@ function Bc(e) {
}
}));
}
-function Ny(e) {
+function Vy(e) {
e.extendApi((t) => ({
message(i) {
- return $c(i || {});
+ return Rc(i || {});
}
}));
}
-au.parser().preview = pw;
+au.parser().preview = mw;
Object.keys(rn).forEach((e) => {
au.setFormula(e, rn[e]);
});
const li = au, tt = au.factory();
-Bc(li);
-Ny(li);
-Bc(tt);
-Ny(tt);
-li.register("behavior", Ly);
+Vc(li);
+Vy(li);
+Vc(tt);
+Vy(tt);
+li.register("behavior", By);
li.register("easySlots", nl);
tt.register("easySlots", nl);
/*!
@@ -12547,7 +12547,7 @@ tt.register("easySlots", nl);
* Github https://github.com/xaboy/form-create with select
* Released under the MIT License.
*/
-function Ov(e, t) {
+function $v(e, t) {
var i = Object.keys(e);
if (Object.getOwnPropertySymbols) {
var r = Object.getOwnPropertySymbols(e);
@@ -12557,12 +12557,12 @@ function Ov(e, t) {
}
return i;
}
-function h2(e) {
+function v2(e) {
for (var t = 1; t < arguments.length; t++) {
var i = arguments[t] != null ? arguments[t] : {};
- t % 2 ? Ov(Object(i), !0).forEach(function(r) {
- m2(e, r, i[r]);
- }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(e, Object.getOwnPropertyDescriptors(i)) : Ov(Object(i)).forEach(function(r) {
+ t % 2 ? $v(Object(i), !0).forEach(function(r) {
+ g2(e, r, i[r]);
+ }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(e, Object.getOwnPropertyDescriptors(i)) : $v(Object(i)).forEach(function(r) {
Object.defineProperty(e, r, Object.getOwnPropertyDescriptor(i, r));
});
}
@@ -12575,7 +12575,7 @@ function Ds(e) {
return t && typeof Symbol == "function" && t.constructor === Symbol && t !== Symbol.prototype ? "symbol" : typeof t;
}, Ds(e);
}
-function m2(e, t, i) {
+function g2(e, t, i) {
return t in e ? Object.defineProperty(e, t, {
value: i,
enumerable: !0,
@@ -12583,7 +12583,7 @@ function m2(e, t, i) {
writable: !0
}) : e[t] = i, e;
}
-function v2(e, t) {
+function y2(e, t) {
return Object.keys(e).reduce(function(i, r) {
return (!t || t.indexOf(r) === -1) && (i[r] = e[r]), i;
}, {});
@@ -12618,11 +12618,11 @@ var Ys = {
return Ys.type(t, e);
};
});
-function g2(e, t) {
+function b2(e, t) {
return {}.hasOwnProperty.call(e, t);
}
-var y2 = "fcSelect", b2 = Be({
- name: y2,
+var _2 = "fcSelect", w2 = Be({
+ name: _2,
inheritAttrs: !1,
props: {
formCreateInject: Object,
@@ -12665,13 +12665,13 @@ var y2 = "fcSelect", b2 = Be({
return t.$emit("update:modelValue", d);
},
ref: "el"
- }), h2({
+ }), v2({
default: function() {
return [s.map(function(d, p) {
- return g2(d || "", "options") ? a(d, p) : n(d, p);
+ return b2(d || "", "options") ? a(d, p) : n(d, p);
}), (i = (r = t.$slots).default) === null || i === void 0 ? void 0 : i.call(r)];
}
- }, v2(this.$slots, ["default"])));
+ }, y2(this.$slots, ["default"])));
},
mounted: function() {
this.$emit("fc.el", this.$refs.el);
@@ -12683,11 +12683,11 @@ var y2 = "fcSelect", b2 = Be({
* Github https://github.com/xaboy/form-create with tree
* Released under the MIT License.
*/
-function _2(e) {
+function A2(e) {
return Array.isArray(e) ? e : [null, void 0, ""].indexOf(e) > -1 ? [] : [e];
}
-var w2 = "fcTree", A2 = Be({
- name: w2,
+var C2 = "fcTree", S2 = Be({
+ name: C2,
inheritAttrs: !1,
formCreateParser: {
mergeProp: function(t) {
@@ -12722,7 +12722,7 @@ var w2 = "fcTree", A2 = Be({
setValue: function() {
if (!!this.$refs.tree) {
var t = this.type;
- t === "selected" ? this.$refs.tree.setCurrentKey(this.modelValue) : this.$refs.tree.setCheckedKeys(_2(this.modelValue));
+ t === "selected" ? this.$refs.tree.setCurrentKey(this.modelValue) : this.$refs.tree.setCheckedKeys(A2(this.modelValue));
}
}
},
@@ -12743,7 +12743,7 @@ var w2 = "fcTree", A2 = Be({
* Github https://github.com/xaboy/form-create with upload
* Released under the MIT License.
*/
-function $v(e, t) {
+function Rv(e, t) {
var i = Object.keys(e);
if (Object.getOwnPropertySymbols) {
var r = Object.getOwnPropertySymbols(e);
@@ -12753,12 +12753,12 @@ function $v(e, t) {
}
return i;
}
-function pc(e) {
+function hc(e) {
for (var t = 1; t < arguments.length; t++) {
var i = arguments[t] != null ? arguments[t] : {};
- t % 2 ? $v(Object(i), !0).forEach(function(r) {
- C2(e, r, i[r]);
- }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(e, Object.getOwnPropertyDescriptors(i)) : $v(Object(i)).forEach(function(r) {
+ t % 2 ? Rv(Object(i), !0).forEach(function(r) {
+ E2(e, r, i[r]);
+ }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(e, Object.getOwnPropertyDescriptors(i)) : Rv(Object(i)).forEach(function(r) {
Object.defineProperty(e, r, Object.getOwnPropertyDescriptor(i, r));
});
}
@@ -12771,7 +12771,7 @@ function Is(e) {
return t && typeof Symbol == "function" && t.constructor === Symbol && t !== Symbol.prototype ? "symbol" : typeof t;
}, Is(e);
}
-function C2(e, t, i) {
+function E2(e, t, i) {
return t in e ? Object.defineProperty(e, t, {
value: i,
enumerable: !0,
@@ -12782,12 +12782,12 @@ function C2(e, t, i) {
function cs(e) {
return Array.isArray(e) ? e : [null, void 0, ""].indexOf(e) > -1 ? [] : [e];
}
-function S2(e, t) {
+function x2(e, t) {
return Object.keys(e).reduce(function(i, r) {
return (!t || t.indexOf(r) === -1) && (i[r] = e[r]), i;
}, {});
}
-function E2(e, t) {
+function T2(e, t) {
t === void 0 && (t = {});
var i = t.insertAt;
if (!(!e || typeof document > "u")) {
@@ -12795,41 +12795,41 @@ function E2(e, t) {
n.type = "text/css", i === "top" && r.firstChild ? r.insertBefore(n, r.firstChild) : r.appendChild(n), n.styleSheet ? n.styleSheet.cssText = e : n.appendChild(document.createTextNode(e));
}
}
-var x2 = "._fc-upload{width:100%}._fc-exceed .el-upload{display:none}.el-upload-list.is-disabled .el-upload{cursor:not-allowed!important}";
-E2(x2);
-var By = {
+var k2 = "._fc-upload{width:100%}._fc-exceed .el-upload{display:none}.el-upload-list.is-disabled .el-upload{cursor:not-allowed!important}";
+T2(k2);
+var jy = {
name: "IconUpload"
-}, T2 = {
+}, O2 = {
class: "icon",
viewBox: "0 0 1024 1024",
xmlns: "http://www.w3.org/2000/svg"
-}, k2 = /* @__PURE__ */ J("path", {
+}, $2 = /* @__PURE__ */ J("path", {
fill: "currentColor",
d: "M160 832h704a32 32 0 110 64H160a32 32 0 110-64zm384-578.304V704h-64V247.296L237.248 490.048 192 444.8 508.8 128l316.8 316.8-45.312 45.248L544 253.696z"
-}, null, -1), O2 = [k2];
-function $2(e, t, i, r, n, a) {
- return H(), ae("svg", T2, O2);
+}, null, -1), R2 = [$2];
+function D2(e, t, i, r, n, a) {
+ return H(), ae("svg", O2, R2);
}
-By.render = $2;
-function Rv(e, t) {
+jy.render = D2;
+function Dv(e, t) {
return Is(e) === "object" ? e : {
url: e,
is_string: !0,
- name: R2(e),
+ name: I2(e),
uid: t
};
}
-function Dv(e) {
- return pc(pc({}, e), {}, {
+function Iv(e) {
+ return hc(hc({}, e), {}, {
file: e,
value: e
});
}
-function R2(e) {
+function I2(e) {
return ("" + e).split("/").pop();
}
-var D2 = "fcUpload", I2 = Be({
- name: D2,
+var F2 = "fcUpload", P2 = Be({
+ name: F2,
inheritAttrs: !1,
formCreateParser: {
toFormValue: function(t) {
@@ -12857,11 +12857,11 @@ var D2 = "fcUpload", I2 = Be({
};
},
created: function() {
- this.fileList = cs(this.modelValue).map(Rv).map(Dv);
+ this.fileList = cs(this.modelValue).map(Dv).map(Iv);
},
watch: {
modelValue: function(t) {
- this.fileList = cs(t).map(Rv).map(Dv);
+ this.fileList = cs(t).map(Dv).map(Iv);
}
},
methods: {
@@ -12908,11 +12908,11 @@ var D2 = "fcUpload", I2 = Be({
httpRequest: this.doHttpRequest,
fileList: this.fileList,
ref: "upload"
- }), pc({
+ }), hc({
default: function() {
return [((t = (i = r.$slots).default) === null || t === void 0 ? void 0 : t.call(i)) || (["text", "picture"].indexOf(r.listType) === -1 ? z(ee("ElIcon"), null, {
default: function() {
- return [z(By, null, null)];
+ return [z(jy, null, null)];
}
}) : z(ee("ElButton"), {
type: "primary"
@@ -12922,7 +12922,7 @@ var D2 = "fcUpload", I2 = Be({
}
}))];
}
- }, S2(this.$slots, ["default"]))), z(ee("ElDialog"), {
+ }, x2(this.$slots, ["default"]))), z(ee("ElDialog"), {
appendToBody: !0,
modal: this.previewMask,
title: this.modalTitle,
@@ -12946,12 +12946,12 @@ const Ve = (e, t) => {
for (const [r, n] of t)
i[r] = n;
return i;
-}, Vy = (e) => {
+}, Uy = (e) => {
const t = [];
return e.forEach((i) => {
- i.field && t.push(i.field), i.children && t.push(...Vy(i.children));
+ i.field && t.push(i.field), i.children && t.push(...Uy(i.children));
}), t;
-}, F2 = Be({
+}, M2 = Be({
name: "StepForm",
props: {
stepsProps: Object,
@@ -13006,7 +13006,7 @@ const Ve = (e, t) => {
},
validate() {
return new Promise((e, t) => {
- const i = Vy(this.cacheRule[this.active].children);
+ const i = Uy(this.cacheRule[this.active].children);
i.length > 0 ? Promise.all(i.map((r) => this.subApi.validateField(r))).then(() => {
e();
}).catch((r) => {
@@ -13043,10 +13043,10 @@ const Ve = (e, t) => {
created() {
this.init();
}
-}), P2 = { class: "_fc-step-form" };
-function M2(e, t, i, r, n, a) {
+}), L2 = { class: "_fc-step-form" };
+function N2(e, t, i, r, n, a) {
const s = ee("van-step"), u = ee("van-steps"), d = ee("van-button"), p = ee("van-col"), h = ee("van-row");
- return H(), ae("div", P2, [
+ return H(), ae("div", L2, [
z(u, jt({ active: e.active }, e.stepsProps), {
default: N(() => [
(H(!0), ae(Me, null, ze(e.steps, (g) => (H(), me(s, jt({ ref_for: !0 }, g.props), {
@@ -13119,8 +13119,8 @@ function M2(e, t, i, r, n, a) {
})
]);
}
-const L2 = /* @__PURE__ */ Ve(F2, [["render", M2]]);
-const N2 = Be({
+const B2 = /* @__PURE__ */ Ve(M2, [["render", N2]]);
+const V2 = Be({
name: "FcPopup",
emits: ["confirm", "submit", "validateFail", "update:modelValue"],
props: {
@@ -13186,8 +13186,8 @@ const N2 = Be({
this.formCreateInject.api.top.bus.$off("fc.closeDialog", this.close);
});
}
-}), B2 = { class: "_fc-popup-title" }, V2 = { class: "_fc-popup-content" }, j2 = { class: "_fc-popup-footer" };
-function U2(e, t, i, r, n, a) {
+}), j2 = { class: "_fc-popup-title" }, U2 = { class: "_fc-popup-content" }, H2 = { class: "_fc-popup-footer" };
+function z2(e, t, i, r, n, a) {
const s = ee("van-button"), u = ee("van-popup");
return H(), me(u, jt({
class: "_fc-popup",
@@ -13197,8 +13197,8 @@ function U2(e, t, i, r, n, a) {
"onUpdate:show": t[1] || (t[1] = (d) => e.visible = d)
}), {
default: N(() => [
- J("div", B2, le(e.title), 1),
- J("div", V2, [
+ J("div", j2, le(e.title), 1),
+ J("div", U2, [
(H(), me(ar(e.Form), {
option: e.formOptions,
rule: e.formRule,
@@ -13211,7 +13211,7 @@ function U2(e, t, i, r, n, a) {
onEmitEvent: e.$emit
}, null, 40, ["option", "rule", "api", "model-value", "onChange", "onEmitEvent"]))
]),
- J("div", j2, [
+ J("div", H2, [
e.footer !== !1 ? (H(), ae(Me, { key: 0 }, [
z(s, {
block: "",
@@ -13243,8 +13243,8 @@ function U2(e, t, i, r, n, a) {
_: 1
}, 16, ["show"]);
}
-const H2 = /* @__PURE__ */ Ve(N2, [["render", U2]]);
-const Vc = Be({
+const W2 = /* @__PURE__ */ Ve(V2, [["render", z2]]);
+const jc = Be({
name: "DataTable",
emits: ["sortChange", "handleClick"],
props: {
@@ -13342,7 +13342,7 @@ const Vc = Be({
}),
this.makePage()
]), [
- [aw("loading"), this.loading]
+ [sw("loading"), this.loading]
]);
},
methods: {
@@ -13371,7 +13371,7 @@ const Vc = Be({
disabled: i.indexOf("disabled") > -1,
onClick: (a) => {
a.stopPropagation();
- const s = Ho(e.click);
+ const s = Uo(e.click);
try {
s && s(t, this.formCreateInject.api);
} catch (u) {
@@ -13379,7 +13379,7 @@ const Vc = Be({
}
this.$emit("handleClick", { name: e.name, key: e.key, scope: t, column: t.row });
}
- }, n = Ho(e.handle);
+ }, n = Uo(e.handle);
try {
const a = n && n(r, t, this.formCreateInject.api);
typeof a == "boolean" && (r.disabled = a);
@@ -13515,7 +13515,7 @@ const Vc = Be({
});
}
});
-const z2 = {
+const G2 = {
name: "FcTable",
props: {
mini: Boolean,
@@ -13607,7 +13607,7 @@ const z2 = {
}
}
};
-function W2(e, t, i, r, n, a) {
+function K2(e, t, i, r, n, a) {
const s = ee("el-col");
return H(), me(s, { span: 24 }, {
default: N(() => [
@@ -13643,8 +13643,8 @@ function W2(e, t, i, r, n, a) {
_: 3
});
}
-const jy = /* @__PURE__ */ Ve(z2, [["render", W2]]);
-const G2 = {
+const Hy = /* @__PURE__ */ Ve(G2, [["render", K2]]);
+const Y2 = {
name: "TableForm",
emits: ["change", "add", "delete", "update:modelValue"],
props: {
@@ -13869,7 +13869,7 @@ const G2 = {
this.updateTable();
}
};
-function K2(e, t, i, r, n, a) {
+function Q2(e, t, i, r, n, a) {
const s = ee("el-button");
return H(), ae("div", {
class: qe(["_fc-table-form", { "_fc-disabled": i.disabled }])
@@ -13902,8 +13902,8 @@ function K2(e, t, i, r, n, a) {
})) : Te("", !0)
], 2);
}
-const Uy = /* @__PURE__ */ Ve(G2, [["render", K2]]);
-const Y2 = {
+const zy = /* @__PURE__ */ Ve(Y2, [["render", Q2]]);
+const J2 = {
name: "TableFormPro",
emits: ["change", "add", "delete", "update:modelValue", "handleClick"],
props: {
@@ -14064,7 +14064,7 @@ const Y2 = {
this.delRaw(t.$index);
return;
}
- const s = Ho(e.click);
+ const s = Uo(e.click);
try {
s && s(i, this.formCreateInject.api);
} catch (u) {
@@ -14075,7 +14075,7 @@ const Y2 = {
};
try {
if (!this.disabled) {
- const a = Ho(e.handle), s = a && a(n, i, this.formCreateInject.api);
+ const a = Uo(e.handle), s = a && a(n, i, this.formCreateInject.api);
typeof s == "boolean" && (n.disabled = s);
}
} catch (a) {
@@ -14178,8 +14178,8 @@ const Y2 = {
});
}, { immediate: !0 });
}
-}, Q2 = { class: "_fc-tf-pro-handle" };
-function J2(e, t, i, r, n, a) {
+}, X2 = { class: "_fc-tf-pro-handle" };
+function Z2(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-pagination");
return H(), ae("div", {
class: qe(["_fc-table-form-v2", { "_fc-disabled": i.disabled }])
@@ -14194,7 +14194,7 @@ function J2(e, t, i, r, n, a) {
"onUpdate:api": t[0] || (t[0] = (d) => n.fapi = d),
onEmitEvent: e.$emit
}, null, 40, ["option", "rule", "disabled", "onChange", "api", "onEmitEvent"])),
- J("div", Q2, [
+ J("div", X2, [
J("div", null, [
(!i.max || i.max > a.total) && i.addable !== !1 && i.disabled !== !0 ? (H(), me(s, {
key: 0,
@@ -14223,8 +14223,8 @@ function J2(e, t, i, r, n, a) {
])
], 2);
}
-const Hy = /* @__PURE__ */ Ve(Y2, [["render", J2]]);
-const X2 = {
+const Wy = /* @__PURE__ */ Ve(J2, [["render", Z2]]);
+const q2 = {
name: "InfiniteTableForm",
emits: ["change", "add", "delete", "update:modelValue"],
props: {
@@ -14468,7 +14468,7 @@ const X2 = {
this.updateTable();
}
};
-function Z2(e, t, i, r, n, a) {
+function ex(e, t, i, r, n, a) {
const s = ee("el-button");
return H(), ae("div", {
class: qe(["_fc-infinite-table-form", { "_fc-disabled": i.disabled }])
@@ -14501,8 +14501,8 @@ function Z2(e, t, i, r, n, a) {
})) : Te("", !0)
], 2);
}
-const zy = /* @__PURE__ */ Ve(X2, [["render", Z2]]);
-const q2 = {
+const Gy = /* @__PURE__ */ Ve(q2, [["render", ex]]);
+const tx = {
name: "NestedTableForm",
emits: ["change", "add", "delete", "update:modelValue"],
props: {
@@ -14740,7 +14740,7 @@ const q2 = {
this.updateTable();
}
};
-function ex(e, t, i, r, n, a) {
+function nx(e, t, i, r, n, a) {
const s = ee("el-button");
return H(), ae("div", {
class: qe(["_fc-nested-table-form", { "_fc-disabled": i.disabled }])
@@ -14773,19 +14773,19 @@ function ex(e, t, i, r, n, a) {
})) : Te("", !0)
], 2);
}
-const Wy = /* @__PURE__ */ Ve(q2, [["render", ex]]);
-const tx = Be({
+const Ky = /* @__PURE__ */ Ve(tx, [["render", nx]]);
+const ix = Be({
name: "FcCell"
-}), nx = {
+}), rx = {
ref: "cell",
class: "_fc-cell"
};
-function ix(e, t, i, r, n, a) {
- return H(), ae("div", nx, [
+function ox(e, t, i, r, n, a) {
+ return H(), ae("div", rx, [
kt(e.$slots, "default")
], 512);
}
-const Gy = /* @__PURE__ */ Ve(tx, [["render", ix]]), rx = Be({
+const Yy = /* @__PURE__ */ Ve(ix, [["render", ox]]), ax = Be({
name: "FcValue",
props: ["modelValue"],
watch: {
@@ -14793,12 +14793,12 @@ const Gy = /* @__PURE__ */ Ve(tx, [["render", ix]]), rx = Be({
this.$emit("change", e);
}
}
-}), ox = { class: "_fc-value" };
-function ax(e, t, i, r, n, a) {
- return H(), ae("div", ox, le(e.modelValue), 1);
+}), lx = { class: "_fc-value" };
+function sx(e, t, i, r, n, a) {
+ return H(), ae("div", lx, le(e.modelValue), 1);
}
-const Ky = /* @__PURE__ */ Ve(rx, [["render", ax]]);
-const lx = Be({
+const Qy = /* @__PURE__ */ Ve(ax, [["render", sx]]);
+const ux = Be({
name: "FcCity",
props: {
modelValue: Array,
@@ -14882,10 +14882,10 @@ const lx = Be({
});
});
}
-}), sx = { class: "_fc-city-m" };
-function ux(e, t, i, r, n, a) {
+}), dx = { class: "_fc-city-m" };
+function fx(e, t, i, r, n, a) {
const s = ee("van-field"), u = ee("van-cascader"), d = ee("van-popup");
- return H(), ae("div", sx, [
+ return H(), ae("div", dx, [
z(s, {
ref: "el",
placeholder: e.placeholder,
@@ -14925,7 +14925,7 @@ function ux(e, t, i, r, n, a) {
}, 8, ["show"])
]);
}
-const dx = /* @__PURE__ */ Ve(lx, [["render", ux]]), Yy = Be({
+const cx = /* @__PURE__ */ Ve(ux, [["render", fx]]), Jy = Be({
name: "FcSlot",
inheritAttrs: !1,
inject: ["parentFC"],
@@ -14963,7 +14963,7 @@ const dx = /* @__PURE__ */ Ve(lx, [["render", ux]]), Yy = Be({
return e(this.parentFC);
}
}
-}), Qy = Be({
+}), Xy = Be({
name: "FcJson",
inheritAttrs: !1,
props: {
@@ -15064,15 +15064,15 @@ const dx = /* @__PURE__ */ Ve(lx, [["render", ux]]), Yy = Be({
this.rule && this.loadRule();
}
});
-const fx = Be({
+const px = Be({
name: "fcInlineForm"
-}), cx = { class: "_fc-line-form" };
-function px(e, t, i, r, n, a) {
- return H(), ae("div", cx, [
+}), hx = { class: "_fc-line-form" };
+function mx(e, t, i, r, n, a) {
+ return H(), ae("div", hx, [
kt(e.$slots, "default")
]);
}
-const jc = /* @__PURE__ */ Ve(fx, [["render", px]]), kn = function() {
+const Uc = /* @__PURE__ */ Ve(px, [["render", mx]]), kn = function() {
var e = function() {
}, t = {}, i = {}, r = {};
function n(h, g) {
@@ -15204,7 +15204,7 @@ function Qs(e, t) {
i !== null && clearTimeout(i), i = setTimeout(() => e.call(this, ...r), t);
};
}
-const hx = Be({
+const vx = Be({
name: "FcEcharts",
data() {
return {
@@ -15553,14 +15553,14 @@ const hx = Be({
unmounted() {
window.removeEventListener("resize", this.debounceResize);
}
-}), mx = {
+}), gx = {
class: "_fc-echarts",
ref: "chart"
};
-function vx(e, t, i, r, n, a) {
- return H(), ae("div", mx, null, 512);
+function yx(e, t, i, r, n, a) {
+ return H(), ae("div", gx, null, 512);
}
-const Jy = /* @__PURE__ */ Ve(hx, [["render", vx]]);
+const Zy = /* @__PURE__ */ Ve(vx, [["render", yx]]);
/*!
* Signature Pad v5.0.7 | https://github.com/szimek/signature_pad
* (c) 2025 Szymon Nowak | Released under the MIT license
@@ -15581,10 +15581,10 @@ class Js {
return this.time !== t.time ? this.distanceTo(t) / (this.time - t.time) : 0;
}
}
-class Uc {
+class Hc {
static fromPoints(t, i) {
const r = this.calculateControlPoints(t[0], t[1], t[2]).c2, n = this.calculateControlPoints(t[1], t[2], t[3]).c1;
- return new Uc(t[1], r, n, t[2], i.start, i.end);
+ return new Hc(t[1], r, n, t[2], i.start, i.end);
}
static calculateControlPoints(t, i, r) {
const n = t.x - i.x, a = t.y - i.y, s = i.x - r.x, u = i.y - r.y, d = { x: (t.x + i.x) / 2, y: (t.y + i.y) / 2 }, p = { x: (i.x + r.x) / 2, y: (i.y + r.y) / 2 }, h = Math.sqrt(n * n + a * a), g = Math.sqrt(s * s + u * u), _ = d.x - p.x, S = d.y - p.y, b = h + g == 0 ? 0 : g / (h + g), A = { x: p.x + _ * b, y: p.y + S * b }, y = i.x - A.x, m = i.y - A.y;
@@ -15612,7 +15612,7 @@ class Uc {
return i * (1 - t) * (1 - t) * (1 - t) + 3 * r * (1 - t) * (1 - t) * t + 3 * n * (1 - t) * t * t + a * t * t * t;
}
}
-class gx {
+class bx {
constructor() {
try {
this._et = new EventTarget();
@@ -15630,7 +15630,7 @@ class gx {
this._et.removeEventListener(t, i, r);
}
}
-function yx(e, t = 250) {
+function _x(e, t = 250) {
let i = 0, r = null, n, a, s;
const u = () => {
i = Date.now(), r = null, n = e.apply(a, s), r || (a = null, s = []);
@@ -15640,7 +15640,7 @@ function yx(e, t = 250) {
return a = this, s = p, g <= 0 || g > t ? (r && (clearTimeout(r), r = null), i = h, n = e.apply(a, s), r || (a = null, s = [])) : r || (r = window.setTimeout(u, g)), n;
};
}
-class il extends gx {
+class il extends bx {
constructor(t, i = {}) {
var r, n, a;
super(), this.canvas = t, this._drawingStroke = !1, this._isEmpty = !0, this._lastPoints = [], this._data = [], this._lastVelocity = 0, this._lastWidth = 0, this._handleMouseDown = (s) => {
@@ -15677,7 +15677,7 @@ class il extends gx {
}
}, this._handlePointerUp = (s) => {
!s.isPrimary || this._isLeftButtonPressed(s) || (s.preventDefault(), this._strokeEnd(this._pointerEventToSignatureEvent(s)));
- }, this.velocityFilterWeight = i.velocityFilterWeight || 0.7, this.minWidth = i.minWidth || 0.5, this.maxWidth = i.maxWidth || 2.5, this.throttle = (r = i.throttle) !== null && r !== void 0 ? r : 16, this.minDistance = (n = i.minDistance) !== null && n !== void 0 ? n : 5, this.dotSize = i.dotSize || 0, this.penColor = i.penColor || "black", this.backgroundColor = i.backgroundColor || "rgba(0,0,0,0)", this.compositeOperation = i.compositeOperation || "source-over", this.canvasContextOptions = (a = i.canvasContextOptions) !== null && a !== void 0 ? a : {}, this._strokeMoveUpdate = this.throttle ? yx(il.prototype._strokeUpdate, this.throttle) : il.prototype._strokeUpdate, this._ctx = t.getContext("2d", this.canvasContextOptions), this.clear(), this.on();
+ }, this.velocityFilterWeight = i.velocityFilterWeight || 0.7, this.minWidth = i.minWidth || 0.5, this.maxWidth = i.maxWidth || 2.5, this.throttle = (r = i.throttle) !== null && r !== void 0 ? r : 16, this.minDistance = (n = i.minDistance) !== null && n !== void 0 ? n : 5, this.dotSize = i.dotSize || 0, this.penColor = i.penColor || "black", this.backgroundColor = i.backgroundColor || "rgba(0,0,0,0)", this.compositeOperation = i.compositeOperation || "source-over", this.canvasContextOptions = (a = i.canvasContextOptions) !== null && a !== void 0 ? a : {}, this._strokeMoveUpdate = this.throttle ? _x(il.prototype._strokeUpdate, this.throttle) : il.prototype._strokeUpdate, this._ctx = t.getContext("2d", this.canvasContextOptions), this.clear(), this.on();
}
clear() {
const { _ctx: t, canvas: i } = this;
@@ -15824,7 +15824,7 @@ class il extends gx {
const { _lastPoints: r } = this;
if (r.push(t), r.length > 2) {
r.length === 3 && r.unshift(r[0]);
- const n = this._calculateCurveWidths(r[1], r[2], i), a = Uc.fromPoints(r, n);
+ const n = this._calculateCurveWidths(r[1], r[2], i), a = Hc.fromPoints(r, n);
return r.shift(), a;
}
return null;
@@ -15893,7 +15893,7 @@ class il extends gx {
}), d.outerHTML;
}
}
-const bx = Be({
+const wx = Be({
name: "SignaturePad",
emits: ["update:modelValue", "change", "remove"],
data() {
@@ -15934,19 +15934,19 @@ const bx = Be({
this.updateValue(""), this.$emit("remove");
}
}
-}), _x = { class: "_fc-m-signature" }, wx = {
+}), Ax = { class: "_fc-m-signature" }, Cx = {
key: 0,
class: "_fc-m-signature-preview"
-}, Ax = ["src"], Cx = {
+}, Sx = ["src"], Ex = {
class: "_fc-m-signature-pad",
ref: "pad",
width: "320px",
height: "145px"
};
-function Sx(e, t, i, r, n, a) {
+function xx(e, t, i, r, n, a) {
const s = ee("van-dialog");
- return H(), ae("div", _x, [
- e.modelValue ? (H(), ae("div", wx, [
+ return H(), ae("div", Ax, [
+ e.modelValue ? (H(), ae("div", Cx, [
J("i", {
class: "fc-icon icon-delete2",
onClick: t[0] || (t[0] = (...u) => e.remove && e.remove(...u))
@@ -15954,7 +15954,7 @@ function Sx(e, t, i, r, n, a) {
J("img", {
src: e.modelValue,
alt: "signature"
- }, null, 8, Ax)
+ }, null, 8, Sx)
])) : (H(), ae("div", {
key: 1,
class: "_fc-m-signature-btn",
@@ -15981,30 +15981,30 @@ function Sx(e, t, i, r, n, a) {
})
]),
default: N(() => [
- J("canvas", Cx, null, 512)
+ J("canvas", Ex, null, 512)
]),
_: 1
}, 8, ["show", "onConfirm", "onCancel", "confirm-button-text", "cancel-button-text", "confirm-button-disabled"])
]);
}
-const Ex = /* @__PURE__ */ Ve(bx, [["render", Sx]]);
-function hc(e, t, i) {
+const Tx = /* @__PURE__ */ Ve(wx, [["render", xx]]);
+function mc(e, t, i) {
for (var r = [], n = Math.max(e.length, t.length), a = 0, s = 0; s < n || a; ) {
var u = s < e.length ? e[s] : 0, d = s < t.length ? t[s] : 0, p = a + u + d;
r.push(p % i), a = Math.floor(p / i), s++;
}
return r;
}
-function Iv(e, t, i) {
+function Fv(e, t, i) {
if (e < 0)
return null;
if (e == 0)
return [];
- for (var r = [], n = t; e & 1 && (r = hc(r, n, i)), e = e >> 1, e !== 0; )
- n = hc(n, n, i);
+ for (var r = [], n = t; e & 1 && (r = mc(r, n, i)), e = e >> 1, e !== 0; )
+ n = mc(n, n, i);
return r;
}
-function xx(e, t) {
+function kx(e, t) {
for (var i = e.split(""), r = [], n = i.length - 1; n >= 0; n--) {
var a = parseInt(i[n], t);
if (isNaN(a))
@@ -16013,24 +16013,24 @@ function xx(e, t) {
}
return r;
}
-function Tx(e, t, i) {
- var r = xx(e, t);
+function Ox(e, t, i) {
+ var r = kx(e, t);
if (r === null)
return null;
for (var n = [], a = [1], s = 0; s < r.length; s++)
- r[s] && (n = hc(
+ r[s] && (n = mc(
n,
- Iv(r[s], a, i),
+ Fv(r[s], a, i),
i
- )), a = Iv(t, a, i);
+ )), a = Fv(t, a, i);
for (var u = "", s = n.length - 1; s >= 0; s--)
u += n[s].toString(i);
return u;
}
-function kx(e) {
- return e.substring(0, 2) === "0x" && (e = e.substring(2)), e = e.toLowerCase(), Tx(e, 16, 10);
+function $x(e) {
+ return e.substring(0, 2) === "0x" && (e = e.substring(2)), e = e.toLowerCase(), Ox(e, 16, 10);
}
-class Ox {
+class Rx {
constructor(t) {
t = t || {}, this.seq = 0, this.mid = (t.mid || 1) % 1023, this.offset = t.offset || 0, this.lastTime = 0;
}
@@ -16046,10 +16046,10 @@ class Ox {
let s = "";
for (let u = a.length; u > 0; u -= 4)
s = parseInt(a.substring(u - 4, u), 2).toString(16) + s;
- return kx(s);
+ return $x(s);
}
}
-const $x = Be({
+const Dx = Be({
name: "FcId",
props: ["modelValue", "prefix"],
emits: ["update:modelValue"],
@@ -16067,7 +16067,7 @@ const $x = Be({
modelValue: {
handler: function(e) {
if (!e) {
- const t = new Ox({
+ const t = new Rx({
mid: 42,
offset: 173448e7
});
@@ -16078,7 +16078,7 @@ const $x = Be({
}
}
});
-function Rx(e, t, i, r, n, a) {
+function Ix(e, t, i, r, n, a) {
const s = ee("el-input");
return H(), me(s, {
modelValue: e.designer ? "" + (e.prefix || "") + e.preview : e.modelValue,
@@ -16086,8 +16086,8 @@ function Rx(e, t, i, r, n, a) {
disabled: ""
}, null, 8, ["modelValue"]);
}
-const Xy = /* @__PURE__ */ Ve($x, [["render", Rx]]);
-const Dx = Be({
+const qy = /* @__PURE__ */ Ve(Dx, [["render", Ix]]);
+const Fx = Be({
name: "FcTitle",
data() {
return {};
@@ -16105,14 +16105,14 @@ const Dx = Be({
}
}
});
-function Ix(e, t, i, r, n, a) {
+function Px(e, t, i, r, n, a) {
return H(), ae("div", {
class: qe(["_fc-title", e.size || "h2"]),
style: wn(e.textStyle)
}, le(e.title), 7);
}
-const Zy = /* @__PURE__ */ Ve(Dx, [["render", Ix]]);
-function Hc() {
+const e0 = /* @__PURE__ */ Ve(Fx, [["render", Px]]);
+function zc() {
return {
async: !1,
breaks: !1,
@@ -16126,8 +16126,8 @@ function Hc() {
walkTokens: null
};
}
-let Xr = Hc();
-function qy(e) {
+let Xr = zc();
+function t0(e) {
Xr = e;
}
const qa = { exec: () => null };
@@ -16199,95 +16199,95 @@ const Hn = {
fencesBeginRegex: (e) => new RegExp(`^ {0,${Math.min(3, e - 1)}}(?:\`\`\`|~~~)`),
headingBeginRegex: (e) => new RegExp(`^ {0,${Math.min(3, e - 1)}}#`),
htmlBeginRegex: (e) => new RegExp(`^ {0,${Math.min(3, e - 1)}}<(?:[a-z].*>|!--)`, "i")
-}, Fx = /^(?:[ \t]*(?:\n|$))+/, Px = /^((?: {4}| {0,3}\t)[^\n]+(?:\n(?:[ \t]*(?:\n|$))*)?)+/, Mx = /^ {0,3}(`{3,}(?=[^`\n]*(?:\n|$))|~{3,})([^\n]*)(?:\n|$)(?:|([\s\S]*?)(?:\n|$))(?: {0,3}\1[~`]* *(?=\n|$)|$)/, dl = /^ {0,3}((?:-[\t ]*){3,}|(?:_[ \t]*){3,}|(?:\*[ \t]*){3,})(?:\n+|$)/, Lx = /^ {0,3}(#{1,6})(?=\s|$)(.*)(?:\n+|$)/, zc = /(?:[*+-]|\d{1,9}[.)])/, e0 = /^(?!bull |blockCode|fences|blockquote|heading|html|table)((?:.|\n(?!\s*?\n|bull |blockCode|fences|blockquote|heading|html|table))+?)\n {0,3}(=+|-+) *(?:\n+|$)/, t0 = Nt(e0).replace(/bull/g, zc).replace(/blockCode/g, /(?: {4}| {0,3}\t)/).replace(/fences/g, / {0,3}(?:`{3,}|~{3,})/).replace(/blockquote/g, / {0,3}>/).replace(/heading/g, / {0,3}#{1,6}/).replace(/html/g, / {0,3}<[^\n>]+>\n/).replace(/\|table/g, "").getRegex(), Nx = Nt(e0).replace(/bull/g, zc).replace(/blockCode/g, /(?: {4}| {0,3}\t)/).replace(/fences/g, / {0,3}(?:`{3,}|~{3,})/).replace(/blockquote/g, / {0,3}>/).replace(/heading/g, / {0,3}#{1,6}/).replace(/html/g, / {0,3}<[^\n>]+>\n/).replace(/table/g, / {0,3}\|?(?:[:\- ]*\|)+[\:\- ]*\n/).getRegex(), Wc = /^([^\n]+(?:\n(?!hr|heading|lheading|blockquote|fences|list|html|table| +\n)[^\n]+)*)/, Bx = /^[^\n]+/, Gc = /(?!\s*\])(?:\\.|[^\[\]\\])+/, Vx = Nt(/^ {0,3}\[(label)\]: *(?:\n[ \t]*)?([^<\s][^\s]*|<.*?>)(?:(?: +(?:\n[ \t]*)?| *\n[ \t]*)(title))? *(?:\n+|$)/).replace("label", Gc).replace("title", /(?:"(?:\\"?|[^"\\])*"|'[^'\n]*(?:\n[^'\n]+)*\n?'|\([^()]*\))/).getRegex(), jx = Nt(/^( {0,3}bull)([ \t][^\n]+?)?(?:\n|$)/).replace(/bull/g, zc).getRegex(), uu = "address|article|aside|base|basefont|blockquote|body|caption|center|col|colgroup|dd|details|dialog|dir|div|dl|dt|fieldset|figcaption|figure|footer|form|frame|frameset|h[1-6]|head|header|hr|html|iframe|legend|li|link|main|menu|menuitem|meta|nav|noframes|ol|optgroup|option|p|param|search|section|summary|table|tbody|td|tfoot|th|thead|title|tr|track|ul", Kc = /|$))/, Ux = Nt("^ {0,3}(?:<(script|pre|style|textarea)[\\s>][\\s\\S]*?(?:[^\\n]*\\n+|$)|comment[^\\n]*(\\n+|$)|<\\?[\\s\\S]*?(?:\\?>\\n*|$)|\\n*|$)|\\n*|$)|)[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$)|<(?!script|pre|style|textarea)([a-z][\\w-]*)(?:attribute)*? */?>(?=[ \\t]*(?:\\n|$))[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$)|(?=[ \\t]*(?:\\n|$))[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$))", "i").replace("comment", Kc).replace("tag", uu).replace("attribute", / +[a-zA-Z:_][\w.:-]*(?: *= *"[^"\n]*"| *= *'[^'\n]*'| *= *[^\s"'=<>`]+)?/).getRegex(), n0 = Nt(Wc).replace("hr", dl).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("|lheading", "").replace("|table", "").replace("blockquote", " {0,3}>").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", ")|<(?:script|pre|style|textarea|!--)").replace("tag", uu).getRegex(), Hx = Nt(/^( {0,3}> ?(paragraph|[^\n]*)(?:\n|$))+/).replace("paragraph", n0).getRegex(), Yc = {
- blockquote: Hx,
- code: Px,
- def: Vx,
- fences: Mx,
- heading: Lx,
+}, Mx = /^(?:[ \t]*(?:\n|$))+/, Lx = /^((?: {4}| {0,3}\t)[^\n]+(?:\n(?:[ \t]*(?:\n|$))*)?)+/, Nx = /^ {0,3}(`{3,}(?=[^`\n]*(?:\n|$))|~{3,})([^\n]*)(?:\n|$)(?:|([\s\S]*?)(?:\n|$))(?: {0,3}\1[~`]* *(?=\n|$)|$)/, dl = /^ {0,3}((?:-[\t ]*){3,}|(?:_[ \t]*){3,}|(?:\*[ \t]*){3,})(?:\n+|$)/, Bx = /^ {0,3}(#{1,6})(?=\s|$)(.*)(?:\n+|$)/, Wc = /(?:[*+-]|\d{1,9}[.)])/, n0 = /^(?!bull |blockCode|fences|blockquote|heading|html|table)((?:.|\n(?!\s*?\n|bull |blockCode|fences|blockquote|heading|html|table))+?)\n {0,3}(=+|-+) *(?:\n+|$)/, i0 = Nt(n0).replace(/bull/g, Wc).replace(/blockCode/g, /(?: {4}| {0,3}\t)/).replace(/fences/g, / {0,3}(?:`{3,}|~{3,})/).replace(/blockquote/g, / {0,3}>/).replace(/heading/g, / {0,3}#{1,6}/).replace(/html/g, / {0,3}<[^\n>]+>\n/).replace(/\|table/g, "").getRegex(), Vx = Nt(n0).replace(/bull/g, Wc).replace(/blockCode/g, /(?: {4}| {0,3}\t)/).replace(/fences/g, / {0,3}(?:`{3,}|~{3,})/).replace(/blockquote/g, / {0,3}>/).replace(/heading/g, / {0,3}#{1,6}/).replace(/html/g, / {0,3}<[^\n>]+>\n/).replace(/table/g, / {0,3}\|?(?:[:\- ]*\|)+[\:\- ]*\n/).getRegex(), Gc = /^([^\n]+(?:\n(?!hr|heading|lheading|blockquote|fences|list|html|table| +\n)[^\n]+)*)/, jx = /^[^\n]+/, Kc = /(?!\s*\])(?:\\.|[^\[\]\\])+/, Ux = Nt(/^ {0,3}\[(label)\]: *(?:\n[ \t]*)?([^<\s][^\s]*|<.*?>)(?:(?: +(?:\n[ \t]*)?| *\n[ \t]*)(title))? *(?:\n+|$)/).replace("label", Kc).replace("title", /(?:"(?:\\"?|[^"\\])*"|'[^'\n]*(?:\n[^'\n]+)*\n?'|\([^()]*\))/).getRegex(), Hx = Nt(/^( {0,3}bull)([ \t][^\n]+?)?(?:\n|$)/).replace(/bull/g, Wc).getRegex(), uu = "address|article|aside|base|basefont|blockquote|body|caption|center|col|colgroup|dd|details|dialog|dir|div|dl|dt|fieldset|figcaption|figure|footer|form|frame|frameset|h[1-6]|head|header|hr|html|iframe|legend|li|link|main|menu|menuitem|meta|nav|noframes|ol|optgroup|option|p|param|search|section|summary|table|tbody|td|tfoot|th|thead|title|tr|track|ul", Yc = /|$))/, zx = Nt("^ {0,3}(?:<(script|pre|style|textarea)[\\s>][\\s\\S]*?(?:[^\\n]*\\n+|$)|comment[^\\n]*(\\n+|$)|<\\?[\\s\\S]*?(?:\\?>\\n*|$)|\\n*|$)|\\n*|$)|)[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$)|<(?!script|pre|style|textarea)([a-z][\\w-]*)(?:attribute)*? */?>(?=[ \\t]*(?:\\n|$))[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$)|(?=[ \\t]*(?:\\n|$))[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$))", "i").replace("comment", Yc).replace("tag", uu).replace("attribute", / +[a-zA-Z:_][\w.:-]*(?: *= *"[^"\n]*"| *= *'[^'\n]*'| *= *[^\s"'=<>`]+)?/).getRegex(), r0 = Nt(Gc).replace("hr", dl).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("|lheading", "").replace("|table", "").replace("blockquote", " {0,3}>").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", ")|<(?:script|pre|style|textarea|!--)").replace("tag", uu).getRegex(), Wx = Nt(/^( {0,3}> ?(paragraph|[^\n]*)(?:\n|$))+/).replace("paragraph", r0).getRegex(), Qc = {
+ blockquote: Wx,
+ code: Lx,
+ def: Ux,
+ fences: Nx,
+ heading: Bx,
hr: dl,
- html: Ux,
- lheading: t0,
- list: jx,
- newline: Fx,
- paragraph: n0,
+ html: zx,
+ lheading: i0,
+ list: Hx,
+ newline: Mx,
+ paragraph: r0,
table: qa,
- text: Bx
-}, Fv = Nt("^ *([^\\n ].*)\\n {0,3}((?:\\| *)?:?-+:? *(?:\\| *:?-+:? *)*(?:\\| *)?)(?:\\n((?:(?! *\\n|hr|heading|blockquote|code|fences|list|html).*(?:\\n|$))*)\\n*|$)").replace("hr", dl).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("blockquote", " {0,3}>").replace("code", "(?: {4}| {0,3} )[^\\n]").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", ")|<(?:script|pre|style|textarea|!--)").replace("tag", uu).getRegex(), zx = {
- ...Yc,
- lheading: Nx,
- table: Fv,
- paragraph: Nt(Wc).replace("hr", dl).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("|lheading", "").replace("table", Fv).replace("blockquote", " {0,3}>").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", ")|<(?:script|pre|style|textarea|!--)").replace("tag", uu).getRegex()
-}, Wx = {
- ...Yc,
- html: Nt(`^ *(?:comment *(?:\\n|\\s*$)|<(tag)[\\s\\S]+? *(?:\\n{2,}|\\s*$)|\\s]*)*?/?> *(?:\\n{2,}|\\s*$))`).replace("comment", Kc).replace(/tag/g, "(?!(?:a|em|strong|small|s|cite|q|dfn|abbr|data|time|code|var|samp|kbd|sub|sup|i|b|u|mark|ruby|rt|rp|bdi|bdo|span|br|wbr|ins|del|img)\\b)\\w+(?!:|[^\\w\\s@]*@)\\b").getRegex(),
+ text: jx
+}, Pv = Nt("^ *([^\\n ].*)\\n {0,3}((?:\\| *)?:?-+:? *(?:\\| *:?-+:? *)*(?:\\| *)?)(?:\\n((?:(?! *\\n|hr|heading|blockquote|code|fences|list|html).*(?:\\n|$))*)\\n*|$)").replace("hr", dl).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("blockquote", " {0,3}>").replace("code", "(?: {4}| {0,3} )[^\\n]").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", ")|<(?:script|pre|style|textarea|!--)").replace("tag", uu).getRegex(), Gx = {
+ ...Qc,
+ lheading: Vx,
+ table: Pv,
+ paragraph: Nt(Gc).replace("hr", dl).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("|lheading", "").replace("table", Pv).replace("blockquote", " {0,3}>").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", ")|<(?:script|pre|style|textarea|!--)").replace("tag", uu).getRegex()
+}, Kx = {
+ ...Qc,
+ html: Nt(`^ *(?:comment *(?:\\n|\\s*$)|<(tag)[\\s\\S]+? *(?:\\n{2,}|\\s*$)|\\s]*)*?/?> *(?:\\n{2,}|\\s*$))`).replace("comment", Yc).replace(/tag/g, "(?!(?:a|em|strong|small|s|cite|q|dfn|abbr|data|time|code|var|samp|kbd|sub|sup|i|b|u|mark|ruby|rt|rp|bdi|bdo|span|br|wbr|ins|del|img)\\b)\\w+(?!:|[^\\w\\s@]*@)\\b").getRegex(),
def: /^ *\[([^\]]+)\]: *]+)>?(?: +(["(][^\n]+[")]))? *(?:\n+|$)/,
heading: /^(#{1,6})(.*)(?:\n+|$)/,
fences: qa,
lheading: /^(.+?)\n {0,3}(=+|-+) *(?:\n+|$)/,
- paragraph: Nt(Wc).replace("hr", dl).replace("heading", ` *#{1,6} *[^
-]`).replace("lheading", t0).replace("|table", "").replace("blockquote", " {0,3}>").replace("|fences", "").replace("|list", "").replace("|html", "").replace("|tag", "").getRegex()
-}, Gx = /^\\([!"#$%&'()*+,\-./:;<=>?@\[\]\\^_`{|}~])/, Kx = /^(`+)([^`]|[^`][\s\S]*?[^`])\1(?!`)/, i0 = /^( {2,}|\\)\n(?!\s*$)/, Yx = /^(`+|[^`])(?:(?= {2,}\n)|[\s\S]*?(?:(?=[\\]*?>/g, a0 = /^(?:\*+(?:((?!\*)punct)|[^\s*]))|^_+(?:((?!_)punct)|([^\s_]))/, qx = Nt(a0, "u").replace(/punct/g, du).getRegex(), eT = Nt(a0, "u").replace(/punct/g, o0).getRegex(), l0 = "^[^_*]*?__[^_*]*?\\*[^_*]*?(?=__)|[^*]+(?=[^*])|(?!\\*)punct(\\*+)(?=[\\s]|$)|notPunctSpace(\\*+)(?!\\*)(?=punctSpace|$)|(?!\\*)punctSpace(\\*+)(?=notPunctSpace)|[\\s](\\*+)(?!\\*)(?=punct)|(?!\\*)punct(\\*+)(?!\\*)(?=punct)|notPunctSpace(\\*+)(?=notPunctSpace)", tT = Nt(l0, "gu").replace(/notPunctSpace/g, r0).replace(/punctSpace/g, Qc).replace(/punct/g, du).getRegex(), nT = Nt(l0, "gu").replace(/notPunctSpace/g, Xx).replace(/punctSpace/g, Jx).replace(/punct/g, o0).getRegex(), iT = Nt("^[^_*]*?\\*\\*[^_*]*?_[^_*]*?(?=\\*\\*)|[^_]+(?=[^_])|(?!_)punct(_+)(?=[\\s]|$)|notPunctSpace(_+)(?!_)(?=punctSpace|$)|(?!_)punctSpace(_+)(?=notPunctSpace)|[\\s](_+)(?!_)(?=punct)|(?!_)punct(_+)(?!_)(?=punct)", "gu").replace(/notPunctSpace/g, r0).replace(/punctSpace/g, Qc).replace(/punct/g, du).getRegex(), rT = Nt(/\\(punct)/, "gu").replace(/punct/g, du).getRegex(), oT = Nt(/^<(scheme:[^\s\x00-\x1f<>]*|email)>/).replace("scheme", /[a-zA-Z][a-zA-Z0-9+.-]{1,31}/).replace("email", /[a-zA-Z0-9.!#$%&'*+/=?^_`{|}~-]+(@)[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)+(?![-_])/).getRegex(), aT = Nt(Kc).replace("(?:-->|$)", "-->").getRegex(), lT = Nt("^comment|^|^<[a-zA-Z][\\w-]*(?:attribute)*?\\s*/?>|^<\\?[\\s\\S]*?\\?>|^|^").replace("comment", aT).replace("attribute", /\s+[a-zA-Z:_][\w.:-]*(?:\s*=\s*"[^"]*"|\s*=\s*'[^']*'|\s*=\s*[^\s"'=<>`]+)?/).getRegex(), Xs = /(?:\[(?:\\.|[^\[\]\\])*\]|\\.|`[^`]*`|[^\[\]\\`])*?/, sT = Nt(/^!?\[(label)\]\(\s*(href)(?:(?:[ \t]*(?:\n[ \t]*)?)(title))?\s*\)/).replace("label", Xs).replace("href", /<(?:\\.|[^\n<>\\])+>|[^ \t\n\x00-\x1f]*/).replace("title", /"(?:\\"?|[^"\\])*"|'(?:\\'?|[^'\\])*'|\((?:\\\)?|[^)\\])*\)/).getRegex(), s0 = Nt(/^!?\[(label)\]\[(ref)\]/).replace("label", Xs).replace("ref", Gc).getRegex(), u0 = Nt(/^!?\[(ref)\](?:\[\])?/).replace("ref", Gc).getRegex(), uT = Nt("reflink|nolink(?!\\()", "g").replace("reflink", s0).replace("nolink", u0).getRegex(), Jc = {
+ paragraph: Nt(Gc).replace("hr", dl).replace("heading", ` *#{1,6} *[^
+]`).replace("lheading", i0).replace("|table", "").replace("blockquote", " {0,3}>").replace("|fences", "").replace("|list", "").replace("|html", "").replace("|tag", "").getRegex()
+}, Yx = /^\\([!"#$%&'()*+,\-./:;<=>?@\[\]\\^_`{|}~])/, Qx = /^(`+)([^`]|[^`][\s\S]*?[^`])\1(?!`)/, o0 = /^( {2,}|\\)\n(?!\s*$)/, Jx = /^(`+|[^`])(?:(?= {2,}\n)|[\s\S]*?(?:(?=[\\]*?>/g, s0 = /^(?:\*+(?:((?!\*)punct)|[^\s*]))|^_+(?:((?!_)punct)|([^\s_]))/, tT = Nt(s0, "u").replace(/punct/g, du).getRegex(), nT = Nt(s0, "u").replace(/punct/g, l0).getRegex(), u0 = "^[^_*]*?__[^_*]*?\\*[^_*]*?(?=__)|[^*]+(?=[^*])|(?!\\*)punct(\\*+)(?=[\\s]|$)|notPunctSpace(\\*+)(?!\\*)(?=punctSpace|$)|(?!\\*)punctSpace(\\*+)(?=notPunctSpace)|[\\s](\\*+)(?!\\*)(?=punct)|(?!\\*)punct(\\*+)(?!\\*)(?=punct)|notPunctSpace(\\*+)(?=notPunctSpace)", iT = Nt(u0, "gu").replace(/notPunctSpace/g, a0).replace(/punctSpace/g, Jc).replace(/punct/g, du).getRegex(), rT = Nt(u0, "gu").replace(/notPunctSpace/g, qx).replace(/punctSpace/g, Zx).replace(/punct/g, l0).getRegex(), oT = Nt("^[^_*]*?\\*\\*[^_*]*?_[^_*]*?(?=\\*\\*)|[^_]+(?=[^_])|(?!_)punct(_+)(?=[\\s]|$)|notPunctSpace(_+)(?!_)(?=punctSpace|$)|(?!_)punctSpace(_+)(?=notPunctSpace)|[\\s](_+)(?!_)(?=punct)|(?!_)punct(_+)(?!_)(?=punct)", "gu").replace(/notPunctSpace/g, a0).replace(/punctSpace/g, Jc).replace(/punct/g, du).getRegex(), aT = Nt(/\\(punct)/, "gu").replace(/punct/g, du).getRegex(), lT = Nt(/^<(scheme:[^\s\x00-\x1f<>]*|email)>/).replace("scheme", /[a-zA-Z][a-zA-Z0-9+.-]{1,31}/).replace("email", /[a-zA-Z0-9.!#$%&'*+/=?^_`{|}~-]+(@)[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)+(?![-_])/).getRegex(), sT = Nt(Yc).replace("(?:-->|$)", "-->").getRegex(), uT = Nt("^comment|^|^<[a-zA-Z][\\w-]*(?:attribute)*?\\s*/?>|^<\\?[\\s\\S]*?\\?>|^|^").replace("comment", sT).replace("attribute", /\s+[a-zA-Z:_][\w.:-]*(?:\s*=\s*"[^"]*"|\s*=\s*'[^']*'|\s*=\s*[^\s"'=<>`]+)?/).getRegex(), Xs = /(?:\[(?:\\.|[^\[\]\\])*\]|\\.|`[^`]*`|[^\[\]\\`])*?/, dT = Nt(/^!?\[(label)\]\(\s*(href)(?:(?:[ \t]*(?:\n[ \t]*)?)(title))?\s*\)/).replace("label", Xs).replace("href", /<(?:\\.|[^\n<>\\])+>|[^ \t\n\x00-\x1f]*/).replace("title", /"(?:\\"?|[^"\\])*"|'(?:\\'?|[^'\\])*'|\((?:\\\)?|[^)\\])*\)/).getRegex(), d0 = Nt(/^!?\[(label)\]\[(ref)\]/).replace("label", Xs).replace("ref", Kc).getRegex(), f0 = Nt(/^!?\[(ref)\](?:\[\])?/).replace("ref", Kc).getRegex(), fT = Nt("reflink|nolink(?!\\()", "g").replace("reflink", d0).replace("nolink", f0).getRegex(), Xc = {
_backpedal: qa,
- anyPunctuation: rT,
- autolink: oT,
- blockSkip: Zx,
- br: i0,
- code: Kx,
+ anyPunctuation: aT,
+ autolink: lT,
+ blockSkip: eT,
+ br: o0,
+ code: Qx,
del: qa,
- emStrongLDelim: qx,
- emStrongRDelimAst: tT,
- emStrongRDelimUnd: iT,
- escape: Gx,
- link: sT,
- nolink: u0,
- punctuation: Qx,
- reflink: s0,
- reflinkSearch: uT,
- tag: lT,
- text: Yx,
+ emStrongLDelim: tT,
+ emStrongRDelimAst: iT,
+ emStrongRDelimUnd: oT,
+ escape: Yx,
+ link: dT,
+ nolink: f0,
+ punctuation: Xx,
+ reflink: d0,
+ reflinkSearch: fT,
+ tag: uT,
+ text: Jx,
url: qa
-}, dT = {
- ...Jc,
+}, cT = {
+ ...Xc,
link: Nt(/^!?\[(label)\]\((.*?)\)/).replace("label", Xs).getRegex(),
reflink: Nt(/^!?\[(label)\]\s*\[([^\]]*)\]/).replace("label", Xs).getRegex()
-}, mc = {
- ...Jc,
- emStrongRDelimAst: nT,
- emStrongLDelim: eT,
+}, vc = {
+ ...Xc,
+ emStrongRDelimAst: rT,
+ emStrongLDelim: nT,
url: Nt(/^((?:ftp|https?):\/\/|www\.)(?:[a-zA-Z0-9\-]+\.?)+[^\s<]*|^email/, "i").replace("email", /[A-Za-z0-9._+-]+(@)[a-zA-Z0-9-_]+(?:\.[a-zA-Z0-9-_]*[a-zA-Z0-9])+(?![-_])/).getRegex(),
_backpedal: /(?:[^?!.,:;*_'"~()&]+|\([^)]*\)|&(?![a-zA-Z0-9]+;$)|[?!.,:;*_'"~)]+(?!$))+/,
del: /^(~~?)(?=[^\s~])((?:\\.|[^\\])*?(?:\\.|[^\s~\\]))\1(?=[^~]|$)/,
text: /^([`~]+|[^`~])(?:(?= {2,}\n)|(?=[a-zA-Z0-9.!#$%&'*+\/=?_`{\|}~-]+@)|[\s\S]*?(?:(?=[\\": ">",
'"': """,
"'": "'"
-}, Pv = (e) => cT[e];
+}, Mv = (e) => hT[e];
function Ni(e, t) {
if (t) {
if (Hn.escapeTest.test(e))
- return e.replace(Hn.escapeReplace, Pv);
+ return e.replace(Hn.escapeReplace, Mv);
} else if (Hn.escapeTestNoEncode.test(e))
- return e.replace(Hn.escapeReplaceNoEncode, Pv);
+ return e.replace(Hn.escapeReplaceNoEncode, Mv);
return e;
}
-function Mv(e) {
+function Lv(e) {
try {
e = encodeURI(e).replace(Hn.percentDecode, "%");
} catch {
@@ -16295,7 +16295,7 @@ function Mv(e) {
}
return e;
}
-function Lv(e, t) {
+function Nv(e, t) {
var a;
const i = e.replace(Hn.findPipe, (s, u, d) => {
let p = !1, h = u;
@@ -16323,7 +16323,7 @@ function La(e, t, i) {
n++;
return e.slice(0, r - n);
}
-function pT(e, t) {
+function mT(e, t) {
if (e.indexOf(t[1]) === -1)
return -1;
let i = 0;
@@ -16336,7 +16336,7 @@ function pT(e, t) {
return r;
return i > 0 ? -2 : -1;
}
-function Nv(e, t, i, r, n) {
+function Bv(e, t, i, r, n) {
const a = t.href, s = t.title || null, u = e[1].replace(n.other.outputLinkReplace, "$1");
r.state.inLink = !0;
const d = {
@@ -16349,7 +16349,7 @@ function Nv(e, t, i, r, n) {
};
return r.state.inLink = !1, d;
}
-function hT(e, t, i) {
+function vT(e, t, i) {
const r = e.match(i.other.indentCodeCompensation);
if (r === null)
return t;
@@ -16395,7 +16395,7 @@ class Zs {
fences(t) {
const i = this.rules.block.fences.exec(t);
if (i) {
- const r = i[0], n = hT(r, i[3] || "", this.rules);
+ const r = i[0], n = vT(r, i[3] || "", this.rules);
return {
type: "code",
raw: r,
@@ -16587,7 +16587,7 @@ ${g}` : g;
const i = this.rules.block.table.exec(t);
if (!i || !this.rules.other.tableDelimiter.test(i[2]))
return;
- const r = Lv(i[1]), n = i[2].replace(this.rules.other.tableAlignChars, "").split("|"), a = (u = i[3]) != null && u.trim() ? i[3].replace(this.rules.other.tableRowBlankLine, "").split(`
+ const r = Nv(i[1]), n = i[2].replace(this.rules.other.tableAlignChars, "").split("|"), a = (u = i[3]) != null && u.trim() ? i[3].replace(this.rules.other.tableRowBlankLine, "").split(`
`) : [], s = {
type: "table",
raw: i[0],
@@ -16606,7 +16606,7 @@ ${g}` : g;
align: s.align[d]
});
for (const d of a)
- s.rows.push(Lv(d, s.header.length).map((p, h) => ({
+ s.rows.push(Nv(d, s.header.length).map((p, h) => ({
text: p,
tokens: this.lexer.inline(p),
header: !1,
@@ -16681,7 +16681,7 @@ ${g}` : g;
if ((r.length - s.length) % 2 === 0)
return;
} else {
- const s = pT(i[2], "()");
+ const s = mT(i[2], "()");
if (s === -2)
return;
if (s > -1) {
@@ -16695,7 +16695,7 @@ ${g}` : g;
s && (n = s[1], a = s[3]);
} else
a = i[3] ? i[3].slice(1, -1) : "";
- return n = n.trim(), this.rules.other.startAngleBracket.test(n) && (this.options.pedantic && !this.rules.other.endAngleBracket.test(r) ? n = n.slice(1) : n = n.slice(1, -1)), Nv(i, {
+ return n = n.trim(), this.rules.other.startAngleBracket.test(n) && (this.options.pedantic && !this.rules.other.endAngleBracket.test(r) ? n = n.slice(1) : n = n.slice(1, -1)), Bv(i, {
href: n && n.replace(this.rules.inline.anyPunctuation, "$1"),
title: a && a.replace(this.rules.inline.anyPunctuation, "$1")
}, i[0], this.lexer, this.rules);
@@ -16713,7 +16713,7 @@ ${g}` : g;
text: s
};
}
- return Nv(r, a, r[0], this.lexer, this.rules);
+ return Bv(r, a, r[0], this.lexer, this.rules);
}
}
emStrong(t, i, r = "") {
@@ -17190,7 +17190,7 @@ ${t}
return `${this.parser.parseInline(t)}`;
}
link({ href: t, title: i, tokens: r }) {
- const n = this.parser.parseInline(r), a = Mv(t);
+ const n = this.parser.parseInline(r), a = Lv(t);
if (a === null)
return n;
t = a;
@@ -17199,7 +17199,7 @@ ${t}
}
image({ href: t, title: i, text: r, tokens: n }) {
n && (r = this.parser.parseInline(n, this.parser.textRenderer));
- const a = Mv(t);
+ const a = Lv(t);
if (a === null)
return Ni(r);
t = a;
@@ -17210,7 +17210,7 @@ ${t}
return "tokens" in t && t.tokens ? this.parser.parseInline(t.tokens) : "escaped" in t && t.escaped ? t.text : Ni(t.text);
}
}
-class Xc {
+class Zc {
strong({ text: t }) {
return t;
}
@@ -17244,7 +17244,7 @@ class mi {
Wt(this, "options");
Wt(this, "renderer");
Wt(this, "textRenderer");
- this.options = t || Xr, this.options.renderer = this.options.renderer || new qs(), this.renderer = this.options.renderer, this.renderer.options = this.options, this.renderer.parser = this, this.textRenderer = new Xc();
+ this.options = t || Xr, this.options.renderer = this.options.renderer || new qs(), this.renderer = this.options.renderer, this.renderer.options = this.options, this.renderer.parser = this, this.textRenderer = new Zc();
}
static parse(t, i) {
return new mi(i).parse(t);
@@ -17417,15 +17417,15 @@ Wt(el, "passThroughHooks", /* @__PURE__ */ new Set([
"postprocess",
"processAllTokens"
]));
-class d0 {
+class c0 {
constructor(...t) {
- Wt(this, "defaults", Hc());
+ Wt(this, "defaults", zc());
Wt(this, "options", this.setOptions);
Wt(this, "parse", this.parseMarkdown(!0));
Wt(this, "parseInline", this.parseMarkdown(!1));
Wt(this, "Parser", mi);
Wt(this, "Renderer", qs);
- Wt(this, "TextRenderer", Xc);
+ Wt(this, "TextRenderer", Zc);
Wt(this, "Lexer", hi);
Wt(this, "Tokenizer", Zs);
Wt(this, "Hooks", el);
@@ -17587,17 +17587,17 @@ Please report this to https://github.com/markedjs/marked.`, t) {
};
}
}
-const Yr = new d0();
+const Yr = new c0();
function Ut(e, t) {
return Yr.parse(e, t);
}
Ut.options = Ut.setOptions = function(e) {
- return Yr.setOptions(e), Ut.defaults = Yr.defaults, qy(Ut.defaults), Ut;
+ return Yr.setOptions(e), Ut.defaults = Yr.defaults, t0(Ut.defaults), Ut;
};
-Ut.getDefaults = Hc;
+Ut.getDefaults = zc;
Ut.defaults = Xr;
Ut.use = function(...e) {
- return Yr.use(...e), Ut.defaults = Yr.defaults, qy(Ut.defaults), Ut;
+ return Yr.use(...e), Ut.defaults = Yr.defaults, t0(Ut.defaults), Ut;
};
Ut.walkTokens = function(e, t) {
return Yr.walkTokens(e, t);
@@ -17606,7 +17606,7 @@ Ut.parseInline = Yr.parseInline;
Ut.Parser = mi;
Ut.parser = mi.parse;
Ut.Renderer = qs;
-Ut.TextRenderer = Xc;
+Ut.TextRenderer = Zc;
Ut.Lexer = hi;
Ut.lexer = hi.lex;
Ut.Tokenizer = Zs;
@@ -17619,11 +17619,11 @@ Ut.walkTokens;
Ut.parseInline;
mi.parse;
hi.lex;
-const mT = Be({
+const gT = Be({
name: "FcMarkdown",
data() {
return {
- marked: Gt(new d0()),
+ marked: Gt(new c0()),
html: ""
};
},
@@ -17638,15 +17638,15 @@ const mT = Be({
immediate: !0
}
}
-}), vT = ["innerHTML"];
-function gT(e, t, i, r, n, a) {
+}), yT = ["innerHTML"];
+function bT(e, t, i, r, n, a) {
return H(), ae("div", {
class: "_fc-markdown",
innerHTML: e.html
- }, null, 8, vT);
+ }, null, 8, yT);
}
-const f0 = /* @__PURE__ */ Ve(mT, [["render", gT]]);
-const yT = Be({
+const p0 = /* @__PURE__ */ Ve(gT, [["render", bT]]);
+const _T = Be({
name: "FcDialog",
emits: ["confirm", "submit", "validateFail", "update:modelValue"],
props: {
@@ -17712,13 +17712,13 @@ const yT = Be({
this.formCreateInject.api.top.bus.$off("fc.closeDialog", this.close);
});
}
-}), bT = {
+}), wT = {
key: 0,
class: "el-dialog__headerbtn",
type: "button",
style: { right: "36px" }
};
-function _T(e, t, i, r, n, a) {
+function AT(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-dialog");
return H(), me(u, jt({ class: "_fc-dialog" }, e.$attrs, {
fullscreen: e.max,
@@ -17727,7 +17727,7 @@ function _T(e, t, i, r, n, a) {
destroyOnClose: ""
}), Qn({
default: N(() => [
- e.$attrs.fullscreen ? Te("", !0) : (H(), ae("button", bT, [
+ e.$attrs.fullscreen ? Te("", !0) : (H(), ae("button", wT, [
e.max ? (H(), ae("i", {
key: 0,
class: "fc-icon icon-page-min",
@@ -17775,23 +17775,23 @@ function _T(e, t, i, r, n, a) {
} : void 0
]), 1040, ["fullscreen", "modelValue"]);
}
-const c0 = /* @__PURE__ */ Ve(yT, [["render", _T]]), wT = (e) => e !== null && typeof e == "object", AT = (e) => e != null;
-function vc(e) {
- if (!AT(e))
+const h0 = /* @__PURE__ */ Ve(_T, [["render", AT]]), CT = (e) => e !== null && typeof e == "object", ST = (e) => e != null;
+function gc(e) {
+ if (!ST(e))
return e;
if (Array.isArray(e))
- return e.map((t) => vc(t));
- if (wT(e)) {
+ return e.map((t) => gc(t));
+ if (CT(e)) {
const t = {};
return Object.keys(e).forEach((i) => {
- t[i] = vc(e[i]);
+ t[i] = gc(e[i]);
}), t;
}
return e;
}
-const CT = Be({
+const ET = Be({
name: "FcDataSelect",
- components: { FcDialog: c0 },
+ components: { FcDialog: h0 },
emits: ["update:modelValue", "change", "clear"],
props: {
title: String,
@@ -17871,7 +17871,7 @@ const CT = Be({
this.$emit("update:modelValue", this.multiple ? e : e[0]), this.$emit("change", this.multiple ? e : e[0]);
},
getFormRule() {
- const e = vc([
+ const e = gc([
this.searchRule,
this.tableRule
]);
@@ -17887,10 +17887,10 @@ const CT = Be({
this.disabled || !e || (this.visible = !0, this.formRule = this.getFormRule(), this.$refs.dialog.open());
}
}
-}), ST = { class: "_fc-data-select" };
-function ET(e, t, i, r, n, a) {
+}), xT = { class: "_fc-data-select" };
+function TT(e, t, i, r, n, a) {
const s = ee("el-option"), u = ee("el-select"), d = ee("FcDialog");
- return H(), ae("div", ST, [
+ return H(), ae("div", xT, [
z(u, {
disabled: e.disabled,
placeholder: e.placeholder,
@@ -17924,7 +17924,7 @@ function ET(e, t, i, r, n, a) {
}, null, 8, ["formCreateInject", "rule", "onUpdate:modelValue", "footer", "title", "onConfirm"])
]);
}
-const p0 = /* @__PURE__ */ Ve(CT, [["render", ET]]), xT = Be({
+const m0 = /* @__PURE__ */ Ve(ET, [["render", TT]]), kT = Be({
name: "AudioBox",
emits: ["pause", "play", "ended"],
data() {
@@ -17945,8 +17945,8 @@ const p0 = /* @__PURE__ */ Ve(CT, [["render", ET]]), xT = Be({
},
muted: Boolean
}
-}), TT = ["controls", "autoplay", "loop", "preload", "muted"], kT = ["src", "type"];
-function OT(e, t, i, r, n, a) {
+}), OT = ["controls", "autoplay", "loop", "preload", "muted"], $T = ["src", "type"];
+function RT(e, t, i, r, n, a) {
return H(), ae("audio", {
key: e.src,
controls: e.controls,
@@ -17961,12 +17961,12 @@ function OT(e, t, i, r, n, a) {
J("source", {
src: e.src,
type: e.type
- }, null, 8, kT),
+ }, null, 8, $T),
t[3] || (t[3] = be(" Your browser does not support the audio element. "))
- ], 40, TT);
+ ], 40, OT);
}
-const h0 = /* @__PURE__ */ Ve(xT, [["render", OT]]);
-const $T = Be({
+const v0 = /* @__PURE__ */ Ve(kT, [["render", RT]]);
+const DT = Be({
name: "IframeBox",
emits: ["load"],
data() {
@@ -17976,33 +17976,33 @@ const $T = Be({
src: String,
loading: String
}
-}), RT = ["src"];
-function DT(e, t, i, r, n, a) {
+}), IT = ["src"];
+function FT(e, t, i, r, n, a) {
return H(), ae("iframe", {
class: "_fc-iframe-box",
src: e.src,
frameborder: "0",
onLoad: t[0] || (t[0] = (s) => e.$emit("load", s))
- }, null, 40, RT);
+ }, null, 40, IT);
}
-const m0 = /* @__PURE__ */ Ve($T, [["render", DT]]);
-var Zc = {}, fu = {}, Zn = {};
+const g0 = /* @__PURE__ */ Ve(DT, [["render", FT]]);
+var qc = {}, fu = {}, Zn = {};
Object.defineProperty(Zn, "__esModule", {
value: !0
});
-function IT(e, t) {
+function PT(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-var FT = function e(t, i) {
- IT(this, e), this.data = t, this.text = i.text || t, this.options = i;
+var MT = function e(t, i) {
+ PT(this, e), this.data = t, this.text = i.text || t, this.options = i;
};
-Zn.default = FT;
+Zn.default = MT;
Object.defineProperty(fu, "__esModule", {
value: !0
});
fu.CODE39 = void 0;
-var PT = function() {
+var LT = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -18012,30 +18012,30 @@ var PT = function() {
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
-}(), MT = Zn, LT = NT(MT);
-function NT(e) {
+}(), NT = Zn, BT = VT(NT);
+function VT(e) {
return e && e.__esModule ? e : { default: e };
}
-function BT(e, t) {
+function jT(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function VT(e, t) {
+function UT(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function jT(e, t) {
+function HT(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var UT = function(e) {
- jT(t, e);
+var zT = function(e) {
+ HT(t, e);
function t(i, r) {
- return BT(this, t), i = i.toUpperCase(), r.mod43 && (i += WT(GT(i))), VT(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
+ return jT(this, t), i = i.toUpperCase(), r.mod43 && (i += KT(YT(i))), UT(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
- return PT(t, [{
+ return LT(t, [{
key: "encode",
value: function() {
for (var r = Df("*"), n = 0; n < this.data.length; n++)
@@ -18051,26 +18051,26 @@ var UT = function(e) {
return this.data.search(/^[0-9A-Z\-\.\ \$\/\+\%]+$/) !== -1;
}
}]), t;
-}(LT.default), v0 = ["0", "1", "2", "3", "4", "5", "6", "7", "8", "9", "A", "B", "C", "D", "E", "F", "G", "H", "I", "J", "K", "L", "M", "N", "O", "P", "Q", "R", "S", "T", "U", "V", "W", "X", "Y", "Z", "-", ".", " ", "$", "/", "+", "%", "*"], HT = [20957, 29783, 23639, 30485, 20951, 29813, 23669, 20855, 29789, 23645, 29975, 23831, 30533, 22295, 30149, 24005, 21623, 29981, 23837, 22301, 30023, 23879, 30545, 22343, 30161, 24017, 21959, 30065, 23921, 22385, 29015, 18263, 29141, 17879, 29045, 18293, 17783, 29021, 18269, 17477, 17489, 17681, 20753, 35770];
+}(BT.default), y0 = ["0", "1", "2", "3", "4", "5", "6", "7", "8", "9", "A", "B", "C", "D", "E", "F", "G", "H", "I", "J", "K", "L", "M", "N", "O", "P", "Q", "R", "S", "T", "U", "V", "W", "X", "Y", "Z", "-", ".", " ", "$", "/", "+", "%", "*"], WT = [20957, 29783, 23639, 30485, 20951, 29813, 23669, 20855, 29789, 23645, 29975, 23831, 30533, 22295, 30149, 24005, 21623, 29981, 23837, 22301, 30023, 23879, 30545, 22343, 30161, 24017, 21959, 30065, 23921, 22385, 29015, 18263, 29141, 17879, 29045, 18293, 17783, 29021, 18269, 17477, 17489, 17681, 20753, 35770];
function Df(e) {
- return zT(g0(e));
-}
-function zT(e) {
- return HT[e].toString(2);
-}
-function WT(e) {
- return v0[e];
-}
-function g0(e) {
- return v0.indexOf(e);
+ return GT(b0(e));
}
function GT(e) {
+ return WT[e].toString(2);
+}
+function KT(e) {
+ return y0[e];
+}
+function b0(e) {
+ return y0.indexOf(e);
+}
+function YT(e) {
for (var t = 0, i = 0; i < e.length; i++)
- t += g0(e[i]);
+ t += b0(e[i]);
return t = t % 43, t;
}
-fu.CODE39 = UT;
-var Ui = {}, qc = {}, Qo = {}, Yt = {};
+fu.CODE39 = zT;
+var Ui = {}, ep = {}, Yo = {}, Yt = {};
Object.defineProperty(Yt, "__esModule", {
value: !0
});
@@ -18078,17 +18078,17 @@ var Na;
function If(e, t, i) {
return t in e ? Object.defineProperty(e, t, { value: i, enumerable: !0, configurable: !0, writable: !0 }) : e[t] = i, e;
}
-var y0 = Yt.SET_A = 0, b0 = Yt.SET_B = 1, _0 = Yt.SET_C = 2;
+var _0 = Yt.SET_A = 0, w0 = Yt.SET_B = 1, A0 = Yt.SET_C = 2;
Yt.SHIFT = 98;
-var KT = Yt.START_A = 103, YT = Yt.START_B = 104, QT = Yt.START_C = 105;
+var QT = Yt.START_A = 103, JT = Yt.START_B = 104, XT = Yt.START_C = 105;
Yt.MODULO = 103;
Yt.STOP = 106;
Yt.FNC1 = 207;
-Yt.SET_BY_CODE = (Na = {}, If(Na, KT, y0), If(Na, YT, b0), If(Na, QT, _0), Na);
+Yt.SET_BY_CODE = (Na = {}, If(Na, QT, _0), If(Na, JT, w0), If(Na, XT, A0), Na);
Yt.SWAP = {
- 101: y0,
- 100: b0,
- 99: _0
+ 101: _0,
+ 100: w0,
+ 99: A0
};
Yt.A_START_CHAR = String.fromCharCode(208);
Yt.B_START_CHAR = String.fromCharCode(209);
@@ -18097,10 +18097,10 @@ Yt.A_CHARS = "[\0-_\xC8-\xCF]";
Yt.B_CHARS = "[ -\x7F\xC8-\xCF]";
Yt.C_CHARS = "(\xCF*[0-9]{2}\xCF*)";
Yt.BARS = [11011001100, 11001101100, 11001100110, 10010011e3, 10010001100, 10001001100, 10011001e3, 10011000100, 10001100100, 11001001e3, 11001000100, 11000100100, 10110011100, 10011011100, 10011001110, 10111001100, 10011101100, 10011100110, 11001110010, 11001011100, 11001001110, 11011100100, 11001110100, 11101101110, 11101001100, 11100101100, 11100100110, 11101100100, 11100110100, 11100110010, 11011011e3, 11011000110, 11000110110, 10100011e3, 10001011e3, 10001000110, 10110001e3, 10001101e3, 10001100010, 11010001e3, 11000101e3, 11000100010, 10110111e3, 10110001110, 10001101110, 10111011e3, 10111000110, 10001110110, 11101110110, 11010001110, 11000101110, 11011101e3, 11011100010, 11011101110, 11101011e3, 11101000110, 11100010110, 11101101e3, 11101100010, 11100011010, 11101111010, 11001000010, 11110001010, 1010011e4, 10100001100, 1001011e4, 10010000110, 10000101100, 10000100110, 1011001e4, 10110000100, 1001101e4, 10011000010, 10000110100, 10000110010, 11000010010, 1100101e4, 11110111010, 11000010100, 10001111010, 10100111100, 10010111100, 10010011110, 10111100100, 10011110100, 10011110010, 11110100100, 11110010100, 11110010010, 11011011110, 11011110110, 11110110110, 10101111e3, 10100011110, 10001011110, 10111101e3, 10111100010, 11110101e3, 11110100010, 10111011110, 10111101110, 11101011110, 11110101110, 11010000100, 1101001e4, 11010011100, 1100011101011];
-Object.defineProperty(Qo, "__esModule", {
+Object.defineProperty(Yo, "__esModule", {
value: !0
});
-var JT = function() {
+var ZT = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -18110,34 +18110,34 @@ var JT = function() {
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
-}(), XT = Zn, ZT = qT(XT), ti = Yt;
-function qT(e) {
+}(), qT = Zn, ek = tk(qT), ti = Yt;
+function tk(e) {
return e && e.__esModule ? e : { default: e };
}
-function ek(e, t) {
+function nk(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function tk(e, t) {
+function ik(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function nk(e, t) {
+function rk(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var ik = function(e) {
- nk(t, e);
+var ok = function(e) {
+ rk(t, e);
function t(i, r) {
- ek(this, t);
- var n = tk(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i.substring(1), r));
+ nk(this, t);
+ var n = ik(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i.substring(1), r));
return n.bytes = i.split("").map(function(a) {
return a.charCodeAt(0);
}), n;
}
- return JT(t, [{
+ return ZT(t, [{
key: "valid",
value: function() {
return /^[\x00-\x7F\xC8-\xD3]+$/.test(this.data);
@@ -18194,41 +18194,41 @@ var ik = function(e) {
};
}
}]), t;
-}(ZT.default);
-Qo.default = ik;
-var ep = {};
-Object.defineProperty(ep, "__esModule", {
+}(ek.default);
+Yo.default = ok;
+var tp = {};
+Object.defineProperty(tp, "__esModule", {
value: !0
});
-var $r = Yt, w0 = function(t) {
+var $r = Yt, C0 = function(t) {
return t.match(new RegExp("^" + $r.A_CHARS + "*"))[0].length;
-}, A0 = function(t) {
+}, S0 = function(t) {
return t.match(new RegExp("^" + $r.B_CHARS + "*"))[0].length;
-}, C0 = function(t) {
+}, E0 = function(t) {
return t.match(new RegExp("^" + $r.C_CHARS + "*"))[0];
};
-function tp(e, t) {
+function np(e, t) {
var i = t ? $r.A_CHARS : $r.B_CHARS, r = e.match(new RegExp("^(" + i + "+?)(([0-9]{2}){2,})([^0-9]|$)"));
if (r)
- return r[1] + String.fromCharCode(204) + S0(e.substring(r[1].length));
+ return r[1] + String.fromCharCode(204) + x0(e.substring(r[1].length));
var n = e.match(new RegExp("^" + i + "+"))[0];
- return n.length === e.length ? e : n + String.fromCharCode(t ? 205 : 206) + tp(e.substring(n.length), !t);
+ return n.length === e.length ? e : n + String.fromCharCode(t ? 205 : 206) + np(e.substring(n.length), !t);
}
-function S0(e) {
- var t = C0(e), i = t.length;
+function x0(e) {
+ var t = E0(e), i = t.length;
if (i === e.length)
return e;
e = e.substring(i);
- var r = w0(e) >= A0(e);
- return t + String.fromCharCode(r ? 206 : 205) + tp(e, r);
+ var r = C0(e) >= S0(e);
+ return t + String.fromCharCode(r ? 206 : 205) + np(e, r);
}
-ep.default = function(e) {
- var t = void 0, i = C0(e).length;
+tp.default = function(e) {
+ var t = void 0, i = E0(e).length;
if (i >= 2)
- t = $r.C_START_CHAR + S0(e);
+ t = $r.C_START_CHAR + x0(e);
else {
- var r = w0(e) > A0(e);
- t = (r ? $r.A_START_CHAR : $r.B_START_CHAR) + tp(e, r);
+ var r = C0(e) > S0(e);
+ t = (r ? $r.A_START_CHAR : $r.B_START_CHAR) + np(e, r);
}
return t.replace(
/[\xCD\xCE]([^])[\xCD\xCE]/,
@@ -18237,14 +18237,14 @@ ep.default = function(e) {
}
);
};
-Object.defineProperty(qc, "__esModule", {
+Object.defineProperty(ep, "__esModule", {
value: !0
});
-var rk = Qo, ok = E0(rk), ak = ep, lk = E0(ak);
-function E0(e) {
+var ak = Yo, lk = T0(ak), sk = tp, uk = T0(sk);
+function T0(e) {
return e && e.__esModule ? e : { default: e };
}
-function sk(e, t) {
+function dk(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
@@ -18253,73 +18253,28 @@ function Ff(e, t) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function uk(e, t) {
+function fk(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var dk = function(e) {
- uk(t, e);
+var ck = function(e) {
+ fk(t, e);
function t(i, r) {
- if (sk(this, t), /^[\x00-\x7F\xC8-\xD3]+$/.test(i))
- var n = Ff(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, (0, lk.default)(i), r));
+ if (dk(this, t), /^[\x00-\x7F\xC8-\xD3]+$/.test(i))
+ var n = Ff(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, (0, uk.default)(i), r));
else
var n = Ff(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
return Ff(n);
}
return t;
-}(ok.default);
-qc.default = dk;
-var np = {};
-Object.defineProperty(np, "__esModule", {
- value: !0
-});
-var fk = function() {
- function e(t, i) {
- for (var r = 0; r < i.length; r++) {
- var n = i[r];
- n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
- }
- }
- return function(t, i, r) {
- return i && e(t.prototype, i), r && e(t, r), t;
- };
-}(), ck = Qo, pk = hk(ck), Bv = Yt;
-function hk(e) {
- return e && e.__esModule ? e : { default: e };
-}
-function mk(e, t) {
- if (!(e instanceof t))
- throw new TypeError("Cannot call a class as a function");
-}
-function vk(e, t) {
- if (!e)
- throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
- return t && (typeof t == "object" || typeof t == "function") ? t : e;
-}
-function gk(e, t) {
- if (typeof t != "function" && t !== null)
- throw new TypeError("Super expression must either be null or a function, not " + typeof t);
- e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
-}
-var yk = function(e) {
- gk(t, e);
- function t(i, r) {
- return mk(this, t), vk(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, Bv.A_START_CHAR + i, r));
- }
- return fk(t, [{
- key: "valid",
- value: function() {
- return new RegExp("^" + Bv.A_CHARS + "+$").test(this.data);
- }
- }]), t;
-}(pk.default);
-np.default = yk;
+}(lk.default);
+ep.default = ck;
var ip = {};
Object.defineProperty(ip, "__esModule", {
value: !0
});
-var bk = function() {
+var pk = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -18329,42 +18284,42 @@ var bk = function() {
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
-}(), _k = Qo, wk = Ak(_k), Vv = Yt;
-function Ak(e) {
+}(), hk = Yo, mk = vk(hk), Vv = Yt;
+function vk(e) {
return e && e.__esModule ? e : { default: e };
}
-function Ck(e, t) {
+function gk(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function Sk(e, t) {
+function yk(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function Ek(e, t) {
+function bk(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var xk = function(e) {
- Ek(t, e);
+var _k = function(e) {
+ bk(t, e);
function t(i, r) {
- return Ck(this, t), Sk(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, Vv.B_START_CHAR + i, r));
+ return gk(this, t), yk(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, Vv.A_START_CHAR + i, r));
}
- return bk(t, [{
+ return pk(t, [{
key: "valid",
value: function() {
- return new RegExp("^" + Vv.B_CHARS + "+$").test(this.data);
+ return new RegExp("^" + Vv.A_CHARS + "+$").test(this.data);
}
}]), t;
-}(wk.default);
-ip.default = xk;
+}(mk.default);
+ip.default = _k;
var rp = {};
Object.defineProperty(rp, "__esModule", {
value: !0
});
-var Tk = function() {
+var wk = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -18374,50 +18329,95 @@ var Tk = function() {
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
-}(), kk = Qo, Ok = $k(kk), jv = Yt;
-function $k(e) {
+}(), Ak = Yo, Ck = Sk(Ak), jv = Yt;
+function Sk(e) {
return e && e.__esModule ? e : { default: e };
}
-function Rk(e, t) {
+function Ek(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function Dk(e, t) {
+function xk(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function Ik(e, t) {
+function Tk(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var Fk = function(e) {
- Ik(t, e);
+var kk = function(e) {
+ Tk(t, e);
function t(i, r) {
- return Rk(this, t), Dk(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, jv.C_START_CHAR + i, r));
+ return Ek(this, t), xk(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, jv.B_START_CHAR + i, r));
}
- return Tk(t, [{
+ return wk(t, [{
key: "valid",
value: function() {
- return new RegExp("^" + jv.C_CHARS + "+$").test(this.data);
+ return new RegExp("^" + jv.B_CHARS + "+$").test(this.data);
}
}]), t;
-}(Ok.default);
-rp.default = Fk;
+}(Ck.default);
+rp.default = kk;
+var op = {};
+Object.defineProperty(op, "__esModule", {
+ value: !0
+});
+var Ok = function() {
+ function e(t, i) {
+ for (var r = 0; r < i.length; r++) {
+ var n = i[r];
+ n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n);
+ }
+ }
+ return function(t, i, r) {
+ return i && e(t.prototype, i), r && e(t, r), t;
+ };
+}(), $k = Yo, Rk = Dk($k), Uv = Yt;
+function Dk(e) {
+ return e && e.__esModule ? e : { default: e };
+}
+function Ik(e, t) {
+ if (!(e instanceof t))
+ throw new TypeError("Cannot call a class as a function");
+}
+function Fk(e, t) {
+ if (!e)
+ throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
+ return t && (typeof t == "object" || typeof t == "function") ? t : e;
+}
+function Pk(e, t) {
+ if (typeof t != "function" && t !== null)
+ throw new TypeError("Super expression must either be null or a function, not " + typeof t);
+ e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
+}
+var Mk = function(e) {
+ Pk(t, e);
+ function t(i, r) {
+ return Ik(this, t), Fk(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, Uv.C_START_CHAR + i, r));
+ }
+ return Ok(t, [{
+ key: "valid",
+ value: function() {
+ return new RegExp("^" + Uv.C_CHARS + "+$").test(this.data);
+ }
+ }]), t;
+}(Rk.default);
+op.default = Mk;
Object.defineProperty(Ui, "__esModule", {
value: !0
});
Ui.CODE128C = Ui.CODE128B = Ui.CODE128A = Ui.CODE128 = void 0;
-var Pk = qc, Mk = cu(Pk), Lk = np, Nk = cu(Lk), Bk = ip, Vk = cu(Bk), jk = rp, Uk = cu(jk);
+var Lk = ep, Nk = cu(Lk), Bk = ip, Vk = cu(Bk), jk = rp, Uk = cu(jk), Hk = op, zk = cu(Hk);
function cu(e) {
return e && e.__esModule ? e : { default: e };
}
-Ui.CODE128 = Mk.default;
-Ui.CODE128A = Nk.default;
-Ui.CODE128B = Vk.default;
-Ui.CODE128C = Uk.default;
-var Jn = {}, op = {}, gi = {};
+Ui.CODE128 = Nk.default;
+Ui.CODE128A = Vk.default;
+Ui.CODE128B = Uk.default;
+Ui.CODE128C = zk.default;
+var Jn = {}, ap = {}, gi = {};
Object.defineProperty(gi, "__esModule", {
value: !0
});
@@ -18492,9 +18492,9 @@ var pu = {}, Zr = {};
Object.defineProperty(Zr, "__esModule", {
value: !0
});
-var Hk = gi, zk = function(t, i, r) {
+var Wk = gi, Gk = function(t, i, r) {
var n = t.split("").map(function(s, u) {
- return Hk.BINARIES[i[u]];
+ return Wk.BINARIES[i[u]];
}).map(function(s, u) {
return s ? s[t[u]] : "";
});
@@ -18506,11 +18506,11 @@ var Hk = gi, zk = function(t, i, r) {
}
return n.join("");
};
-Zr.default = zk;
+Zr.default = Gk;
Object.defineProperty(pu, "__esModule", {
value: !0
});
-var Wk = function() {
+var Kk = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -18520,32 +18520,32 @@ var Wk = function() {
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
-}(), Ro = gi, Gk = Zr, Uv = x0(Gk), Kk = Zn, Yk = x0(Kk);
-function x0(e) {
+}(), $o = gi, Yk = Zr, Hv = k0(Yk), Qk = Zn, Jk = k0(Qk);
+function k0(e) {
return e && e.__esModule ? e : { default: e };
}
-function Qk(e, t) {
+function Xk(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function Jk(e, t) {
+function Zk(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function Xk(e, t) {
+function qk(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var Zk = function(e) {
- Xk(t, e);
+var eO = function(e) {
+ qk(t, e);
function t(i, r) {
- Qk(this, t);
- var n = Jk(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
+ Xk(this, t);
+ var n = Zk(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
return n.fontSize = !r.flat && r.fontSize > r.width * 10 ? r.width * 10 : r.fontSize, n.guardHeight = r.height + n.fontSize / 2 + r.textMargin, n;
}
- return Wk(t, [{
+ return Kk(t, [{
key: "encode",
value: function() {
return this.options.flat ? this.encodeFlat() : this.encodeGuarded();
@@ -18558,7 +18558,7 @@ var Zk = function(e) {
}, {
key: "leftEncode",
value: function(r, n) {
- return (0, Uv.default)(r, n);
+ return (0, Hv.default)(r, n);
}
}, {
key: "rightText",
@@ -18568,30 +18568,30 @@ var Zk = function(e) {
}, {
key: "rightEncode",
value: function(r, n) {
- return (0, Uv.default)(r, n);
+ return (0, Hv.default)(r, n);
}
}, {
key: "encodeGuarded",
value: function() {
var r = { fontSize: this.fontSize }, n = { height: this.guardHeight };
- return [{ data: Ro.SIDE_BIN, options: n }, { data: this.leftEncode(), text: this.leftText(), options: r }, { data: Ro.MIDDLE_BIN, options: n }, { data: this.rightEncode(), text: this.rightText(), options: r }, { data: Ro.SIDE_BIN, options: n }];
+ return [{ data: $o.SIDE_BIN, options: n }, { data: this.leftEncode(), text: this.leftText(), options: r }, { data: $o.MIDDLE_BIN, options: n }, { data: this.rightEncode(), text: this.rightText(), options: r }, { data: $o.SIDE_BIN, options: n }];
}
}, {
key: "encodeFlat",
value: function() {
- var r = [Ro.SIDE_BIN, this.leftEncode(), Ro.MIDDLE_BIN, this.rightEncode(), Ro.SIDE_BIN];
+ var r = [$o.SIDE_BIN, this.leftEncode(), $o.MIDDLE_BIN, this.rightEncode(), $o.SIDE_BIN];
return {
data: r.join(""),
text: this.text
};
}
}]), t;
-}(Yk.default);
-pu.default = Zk;
-Object.defineProperty(op, "__esModule", {
+}(Jk.default);
+pu.default = eO;
+Object.defineProperty(ap, "__esModule", {
value: !0
});
-var qk = function() {
+var tO = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -18613,42 +18613,42 @@ var qk = function() {
var s = n.get;
return s === void 0 ? void 0 : s.call(r);
}
-}, eO = gi, tO = pu, nO = iO(tO);
-function iO(e) {
+}, nO = gi, iO = pu, rO = oO(iO);
+function oO(e) {
return e && e.__esModule ? e : { default: e };
}
-function rO(e, t) {
+function aO(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function oO(e, t) {
+function lO(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function aO(e, t) {
+function sO(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var Hv = function(t) {
+var zv = function(t) {
var i = t.substr(0, 12).split("").map(function(r) {
return +r;
}).reduce(function(r, n, a) {
return a % 2 ? r + n * 3 : r + n;
}, 0);
return (10 - i % 10) % 10;
-}, lO = function(e) {
- aO(t, e);
+}, uO = function(e) {
+ sO(t, e);
function t(i, r) {
- rO(this, t), i.search(/^[0-9]{12}$/) !== -1 && (i += Hv(i));
- var n = oO(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
+ aO(this, t), i.search(/^[0-9]{12}$/) !== -1 && (i += zv(i));
+ var n = lO(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
return n.lastChar = r.lastChar, n;
}
- return qk(t, [{
+ return tO(t, [{
key: "valid",
value: function() {
- return this.data.search(/^[0-9]{13}$/) !== -1 && +this.data[12] === Hv(this.data);
+ return this.data.search(/^[0-9]{13}$/) !== -1 && +this.data[12] === zv(this.data);
}
}, {
key: "leftText",
@@ -18658,7 +18658,7 @@ var Hv = function(t) {
}, {
key: "leftEncode",
value: function() {
- var r = this.data.substr(1, 6), n = eO.EAN13_STRUCTURE[this.data[0]];
+ var r = this.data.substr(1, 6), n = nO.EAN13_STRUCTURE[this.data[0]];
return Ba(t.prototype.__proto__ || Object.getPrototypeOf(t.prototype), "leftEncode", this).call(this, r, n);
}
}, {
@@ -18689,13 +18689,13 @@ var Hv = function(t) {
}))), r;
}
}]), t;
-}(nO.default);
-op.default = lO;
-var ap = {};
-Object.defineProperty(ap, "__esModule", {
+}(rO.default);
+ap.default = uO;
+var lp = {};
+Object.defineProperty(lp, "__esModule", {
value: !0
});
-var sO = function() {
+var dO = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -18717,40 +18717,40 @@ var sO = function() {
var s = n.get;
return s === void 0 ? void 0 : s.call(r);
}
-}, uO = pu, dO = fO(uO);
-function fO(e) {
+}, fO = pu, cO = pO(fO);
+function pO(e) {
return e && e.__esModule ? e : { default: e };
}
-function cO(e, t) {
+function hO(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function pO(e, t) {
+function mO(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function hO(e, t) {
+function vO(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var zv = function(t) {
+var Wv = function(t) {
var i = t.substr(0, 7).split("").map(function(r) {
return +r;
}).reduce(function(r, n, a) {
return a % 2 ? r + n : r + n * 3;
}, 0);
return (10 - i % 10) % 10;
-}, mO = function(e) {
- hO(t, e);
+}, gO = function(e) {
+ vO(t, e);
function t(i, r) {
- return cO(this, t), i.search(/^[0-9]{7}$/) !== -1 && (i += zv(i)), pO(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
+ return hO(this, t), i.search(/^[0-9]{7}$/) !== -1 && (i += Wv(i)), mO(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
- return sO(t, [{
+ return dO(t, [{
key: "valid",
value: function() {
- return this.data.search(/^[0-9]{8}$/) !== -1 && +this.data[7] === zv(this.data);
+ return this.data.search(/^[0-9]{8}$/) !== -1 && +this.data[7] === Wv(this.data);
}
}, {
key: "leftText",
@@ -18775,13 +18775,13 @@ var zv = function(t) {
return hs(t.prototype.__proto__ || Object.getPrototypeOf(t.prototype), "rightEncode", this).call(this, r, "RRRR");
}
}]), t;
-}(dO.default);
-ap.default = mO;
-var lp = {};
-Object.defineProperty(lp, "__esModule", {
+}(cO.default);
+lp.default = gO;
+var sp = {};
+Object.defineProperty(sp, "__esModule", {
value: !0
});
-var vO = function() {
+var yO = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -18791,37 +18791,37 @@ var vO = function() {
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
-}(), gO = gi, yO = Zr, bO = T0(yO), _O = Zn, wO = T0(_O);
-function T0(e) {
+}(), bO = gi, _O = Zr, wO = O0(_O), AO = Zn, CO = O0(AO);
+function O0(e) {
return e && e.__esModule ? e : { default: e };
}
-function AO(e, t) {
+function SO(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function CO(e, t) {
+function EO(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function SO(e, t) {
+function xO(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var EO = function(t) {
+var TO = function(t) {
var i = t.split("").map(function(r) {
return +r;
}).reduce(function(r, n, a) {
return a % 2 ? r + n * 9 : r + n * 3;
}, 0);
return i % 10;
-}, xO = function(e) {
- SO(t, e);
+}, kO = function(e) {
+ xO(t, e);
function t(i, r) {
- return AO(this, t), CO(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
+ return SO(this, t), EO(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
- return vO(t, [{
+ return yO(t, [{
key: "valid",
value: function() {
return this.data.search(/^[0-9]{5}$/) !== -1;
@@ -18829,20 +18829,20 @@ var EO = function(t) {
}, {
key: "encode",
value: function() {
- var r = gO.EAN5_STRUCTURE[EO(this.data)];
+ var r = bO.EAN5_STRUCTURE[TO(this.data)];
return {
- data: "1011" + (0, bO.default)(this.data, r, "01"),
+ data: "1011" + (0, wO.default)(this.data, r, "01"),
text: this.text
};
}
}]), t;
-}(wO.default);
-lp.default = xO;
-var sp = {};
-Object.defineProperty(sp, "__esModule", {
+}(CO.default);
+sp.default = kO;
+var up = {};
+Object.defineProperty(up, "__esModule", {
value: !0
});
-var TO = function() {
+var OO = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -18852,30 +18852,30 @@ var TO = function() {
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
-}(), kO = gi, OO = Zr, $O = k0(OO), RO = Zn, DO = k0(RO);
-function k0(e) {
+}(), $O = gi, RO = Zr, DO = $0(RO), IO = Zn, FO = $0(IO);
+function $0(e) {
return e && e.__esModule ? e : { default: e };
}
-function IO(e, t) {
+function PO(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function FO(e, t) {
+function MO(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function PO(e, t) {
+function LO(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var MO = function(e) {
- PO(t, e);
+var NO = function(e) {
+ LO(t, e);
function t(i, r) {
- return IO(this, t), FO(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
+ return PO(this, t), MO(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
- return TO(t, [{
+ return OO(t, [{
key: "valid",
value: function() {
return this.data.search(/^[0-9]{2}$/) !== -1;
@@ -18883,20 +18883,20 @@ var MO = function(e) {
}, {
key: "encode",
value: function() {
- var r = kO.EAN2_STRUCTURE[parseInt(this.data) % 4];
+ var r = $O.EAN2_STRUCTURE[parseInt(this.data) % 4];
return {
- data: "1011" + (0, $O.default)(this.data, r, "01"),
+ data: "1011" + (0, DO.default)(this.data, r, "01"),
text: this.text
};
}
}]), t;
-}(DO.default);
-sp.default = MO;
+}(FO.default);
+up.default = NO;
var fl = {};
Object.defineProperty(fl, "__esModule", {
value: !0
});
-var LO = function() {
+var BO = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -18907,36 +18907,36 @@ var LO = function() {
return i && e(t.prototype, i), r && e(t, r), t;
};
}();
-fl.checksum = gc;
-var NO = Zr, Do = O0(NO), BO = Zn, VO = O0(BO);
-function O0(e) {
+fl.checksum = yc;
+var VO = Zr, Ro = R0(VO), jO = Zn, UO = R0(jO);
+function R0(e) {
return e && e.__esModule ? e : { default: e };
}
-function jO(e, t) {
+function HO(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function UO(e, t) {
+function zO(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function HO(e, t) {
+function WO(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var zO = function(e) {
- HO(t, e);
+var GO = function(e) {
+ WO(t, e);
function t(i, r) {
- jO(this, t), i.search(/^[0-9]{11}$/) !== -1 && (i += gc(i));
- var n = UO(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
+ HO(this, t), i.search(/^[0-9]{11}$/) !== -1 && (i += yc(i));
+ var n = zO(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
return n.displayValue = r.displayValue, r.fontSize > r.width * 10 ? n.fontSize = r.width * 10 : n.fontSize = r.fontSize, n.guardHeight = r.height + n.fontSize / 2 + r.textMargin, n;
}
- return LO(t, [{
+ return BO(t, [{
key: "valid",
value: function() {
- return this.data.search(/^[0-9]{12}$/) !== -1 && this.data[11] == gc(this.data);
+ return this.data.search(/^[0-9]{12}$/) !== -1 && this.data[11] == yc(this.data);
}
}, {
key: "encode",
@@ -18947,7 +18947,7 @@ var zO = function(e) {
key: "flatEncoding",
value: function() {
var r = "";
- return r += "101", r += (0, Do.default)(this.data.substr(0, 6), "LLLLLL"), r += "01010", r += (0, Do.default)(this.data.substr(6, 6), "RRRRRR"), r += "101", {
+ return r += "101", r += (0, Ro.default)(this.data.substr(0, 6), "LLLLLL"), r += "01010", r += (0, Ro.default)(this.data.substr(6, 6), "RRRRRR"), r += "101", {
data: r,
text: this.text
};
@@ -18961,21 +18961,21 @@ var zO = function(e) {
text: this.text.substr(0, 1),
options: { textAlign: "left", fontSize: this.fontSize }
}), r.push({
- data: "101" + (0, Do.default)(this.data[0], "L"),
+ data: "101" + (0, Ro.default)(this.data[0], "L"),
options: { height: this.guardHeight }
}), r.push({
- data: (0, Do.default)(this.data.substr(1, 5), "LLLLL"),
+ data: (0, Ro.default)(this.data.substr(1, 5), "LLLLL"),
text: this.text.substr(1, 5),
options: { fontSize: this.fontSize }
}), r.push({
data: "01010",
options: { height: this.guardHeight }
}), r.push({
- data: (0, Do.default)(this.data.substr(6, 5), "RRRRR"),
+ data: (0, Ro.default)(this.data.substr(6, 5), "RRRRR"),
text: this.text.substr(6, 5),
options: { fontSize: this.fontSize }
}), r.push({
- data: (0, Do.default)(this.data[11], "R") + "101",
+ data: (0, Ro.default)(this.data[11], "R") + "101",
options: { height: this.guardHeight }
}), this.displayValue && r.push({
data: "00000000",
@@ -18984,8 +18984,8 @@ var zO = function(e) {
}), r;
}
}]), t;
-}(VO.default);
-function gc(e) {
+}(UO.default);
+function yc(e) {
var t = 0, i;
for (i = 1; i < 11; i += 2)
t += parseInt(e[i]);
@@ -18993,12 +18993,12 @@ function gc(e) {
t += parseInt(e[i]) * 3;
return (10 - t % 10) % 10;
}
-fl.default = zO;
-var up = {};
-Object.defineProperty(up, "__esModule", {
+fl.default = GO;
+var dp = {};
+Object.defineProperty(dp, "__esModule", {
value: !0
});
-var WO = function() {
+var KO = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -19008,11 +19008,11 @@ var WO = function() {
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
-}(), GO = Zr, KO = $0(GO), YO = Zn, QO = $0(YO), JO = fl;
-function $0(e) {
+}(), YO = Zr, QO = D0(YO), JO = Zn, XO = D0(JO), ZO = fl;
+function D0(e) {
return e && e.__esModule ? e : { default: e };
}
-function XO(e, t) {
+function qO(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
@@ -19021,20 +19021,20 @@ function Pf(e, t) {
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function ZO(e, t) {
+function e$(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var qO = ["XX00000XXX", "XX10000XXX", "XX20000XXX", "XXX00000XX", "XXXX00000X", "XXXXX00005", "XXXXX00006", "XXXXX00007", "XXXXX00008", "XXXXX00009"], e$ = [["EEEOOO", "OOOEEE"], ["EEOEOO", "OOEOEE"], ["EEOOEO", "OOEEOE"], ["EEOOOE", "OOEEEO"], ["EOEEOO", "OEOOEE"], ["EOOEEO", "OEEOOE"], ["EOOOEE", "OEEEOO"], ["EOEOEO", "OEOEOE"], ["EOEOOE", "OEOEEO"], ["EOOEOE", "OEEOEO"]], t$ = function(e) {
- ZO(t, e);
+var t$ = ["XX00000XXX", "XX10000XXX", "XX20000XXX", "XXX00000XX", "XXXX00000X", "XXXXX00005", "XXXXX00006", "XXXXX00007", "XXXXX00008", "XXXXX00009"], n$ = [["EEEOOO", "OOOEEE"], ["EEOEOO", "OOEOEE"], ["EEOOEO", "OOEEOE"], ["EEOOOE", "OOEEEO"], ["EOEEOO", "OEOOEE"], ["EOOEEO", "OEEOOE"], ["EOOOEE", "OEEEOO"], ["EOEOEO", "OEOEOE"], ["EOEOOE", "OEOEEO"], ["EOOEOE", "OEEOEO"]], i$ = function(e) {
+ e$(t, e);
function t(i, r) {
- XO(this, t);
+ qO(this, t);
var n = Pf(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
if (n.isValid = !1, i.search(/^[0-9]{6}$/) !== -1)
- n.middleDigits = i, n.upcA = Wv(i, "0"), n.text = r.text || "" + n.upcA[0] + i + n.upcA[n.upcA.length - 1], n.isValid = !0;
+ n.middleDigits = i, n.upcA = Gv(i, "0"), n.text = r.text || "" + n.upcA[0] + i + n.upcA[n.upcA.length - 1], n.isValid = !0;
else if (i.search(/^[01][0-9]{7}$/) !== -1)
- if (n.middleDigits = i.substring(1, i.length - 1), n.upcA = Wv(n.middleDigits, i[0]), n.upcA[n.upcA.length - 1] === i[i.length - 1])
+ if (n.middleDigits = i.substring(1, i.length - 1), n.upcA = Gv(n.middleDigits, i[0]), n.upcA[n.upcA.length - 1] === i[i.length - 1])
n.isValid = !0;
else
return Pf(n);
@@ -19042,7 +19042,7 @@ var qO = ["XX00000XXX", "XX10000XXX", "XX20000XXX", "XXX00000XX", "XXXX00000X",
return Pf(n);
return n.displayValue = r.displayValue, r.fontSize > r.width * 10 ? n.fontSize = r.width * 10 : n.fontSize = r.fontSize, n.guardHeight = r.height + n.fontSize / 2 + r.textMargin, n;
}
- return WO(t, [{
+ return KO(t, [{
key: "valid",
value: function() {
return this.isValid;
@@ -19088,34 +19088,34 @@ var qO = ["XX00000XXX", "XX10000XXX", "XX20000XXX", "XXX00000XX", "XXXX00000X",
}, {
key: "encodeMiddleDigits",
value: function() {
- var r = this.upcA[0], n = this.upcA[this.upcA.length - 1], a = e$[parseInt(n)][parseInt(r)];
- return (0, KO.default)(this.middleDigits, a);
+ var r = this.upcA[0], n = this.upcA[this.upcA.length - 1], a = n$[parseInt(n)][parseInt(r)];
+ return (0, QO.default)(this.middleDigits, a);
}
}]), t;
-}(QO.default);
-function Wv(e, t) {
- for (var i = parseInt(e[e.length - 1]), r = qO[i], n = "", a = 0, s = 0; s < r.length; s++) {
+}(XO.default);
+function Gv(e, t) {
+ for (var i = parseInt(e[e.length - 1]), r = t$[i], n = "", a = 0, s = 0; s < r.length; s++) {
var u = r[s];
u === "X" ? n += e[a++] : n += u;
}
- return n = "" + t + n, "" + n + (0, JO.checksum)(n);
+ return n = "" + t + n, "" + n + (0, ZO.checksum)(n);
}
-up.default = t$;
+dp.default = i$;
Object.defineProperty(Jn, "__esModule", {
value: !0
});
Jn.UPCE = Jn.UPC = Jn.EAN2 = Jn.EAN5 = Jn.EAN8 = Jn.EAN13 = void 0;
-var n$ = op, i$ = Jo(n$), r$ = ap, o$ = Jo(r$), a$ = lp, l$ = Jo(a$), s$ = sp, u$ = Jo(s$), d$ = fl, f$ = Jo(d$), c$ = up, p$ = Jo(c$);
-function Jo(e) {
+var r$ = ap, o$ = Qo(r$), a$ = lp, l$ = Qo(a$), s$ = sp, u$ = Qo(s$), d$ = up, f$ = Qo(d$), c$ = fl, p$ = Qo(c$), h$ = dp, m$ = Qo(h$);
+function Qo(e) {
return e && e.__esModule ? e : { default: e };
}
-Jn.EAN13 = i$.default;
-Jn.EAN8 = o$.default;
-Jn.EAN5 = l$.default;
-Jn.EAN2 = u$.default;
-Jn.UPC = f$.default;
-Jn.UPCE = p$.default;
-var Ko = {}, hu = {}, cl = {};
+Jn.EAN13 = o$.default;
+Jn.EAN8 = l$.default;
+Jn.EAN5 = u$.default;
+Jn.EAN2 = f$.default;
+Jn.UPC = p$.default;
+Jn.UPCE = m$.default;
+var Go = {}, hu = {}, cl = {};
Object.defineProperty(cl, "__esModule", {
value: !0
});
@@ -19125,7 +19125,7 @@ cl.BINARIES = ["00110", "10001", "01001", "11000", "00101", "10100", "01100", "0
Object.defineProperty(hu, "__esModule", {
value: !0
});
-var h$ = function() {
+var v$ = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -19135,30 +19135,30 @@ var h$ = function() {
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
-}(), ms = cl, m$ = Zn, v$ = g$(m$);
-function g$(e) {
+}(), ms = cl, g$ = Zn, y$ = b$(g$);
+function b$(e) {
return e && e.__esModule ? e : { default: e };
}
-function y$(e, t) {
+function _$(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function b$(e, t) {
+function w$(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function _$(e, t) {
+function A$(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var w$ = function(e) {
- _$(t, e);
+var C$ = function(e) {
+ A$(t, e);
function t() {
- return y$(this, t), b$(this, (t.__proto__ || Object.getPrototypeOf(t)).apply(this, arguments));
+ return _$(this, t), w$(this, (t.__proto__ || Object.getPrototypeOf(t)).apply(this, arguments));
}
- return h$(t, [{
+ return v$(t, [{
key: "valid",
value: function() {
return this.data.search(/^([0-9]{2})+$/) !== -1;
@@ -19183,13 +19183,13 @@ var w$ = function(e) {
}).join("");
}
}]), t;
-}(v$.default);
-hu.default = w$;
-var dp = {};
-Object.defineProperty(dp, "__esModule", {
+}(y$.default);
+hu.default = C$;
+var fp = {};
+Object.defineProperty(fp, "__esModule", {
value: !0
});
-var A$ = function() {
+var S$ = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -19199,59 +19199,59 @@ var A$ = function() {
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
-}(), C$ = hu, S$ = E$(C$);
-function E$(e) {
+}(), E$ = hu, x$ = T$(E$);
+function T$(e) {
return e && e.__esModule ? e : { default: e };
}
-function x$(e, t) {
+function k$(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function T$(e, t) {
+function O$(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function k$(e, t) {
+function $$(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var Gv = function(t) {
+var Kv = function(t) {
var i = t.substr(0, 13).split("").map(function(r) {
return parseInt(r, 10);
}).reduce(function(r, n, a) {
return r + n * (3 - a % 2 * 2);
}, 0);
return Math.ceil(i / 10) * 10 - i;
-}, O$ = function(e) {
- k$(t, e);
+}, R$ = function(e) {
+ $$(t, e);
function t(i, r) {
- return x$(this, t), i.search(/^[0-9]{13}$/) !== -1 && (i += Gv(i)), T$(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
+ return k$(this, t), i.search(/^[0-9]{13}$/) !== -1 && (i += Kv(i)), O$(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
- return A$(t, [{
+ return S$(t, [{
key: "valid",
value: function() {
- return this.data.search(/^[0-9]{14}$/) !== -1 && +this.data[13] === Gv(this.data);
+ return this.data.search(/^[0-9]{14}$/) !== -1 && +this.data[13] === Kv(this.data);
}
}]), t;
-}(S$.default);
-dp.default = O$;
-Object.defineProperty(Ko, "__esModule", {
+}(x$.default);
+fp.default = R$;
+Object.defineProperty(Go, "__esModule", {
value: !0
});
-Ko.ITF14 = Ko.ITF = void 0;
-var $$ = hu, R$ = R0($$), D$ = dp, I$ = R0(D$);
-function R0(e) {
+Go.ITF14 = Go.ITF = void 0;
+var D$ = hu, I$ = I0(D$), F$ = fp, P$ = I0(F$);
+function I0(e) {
return e && e.__esModule ? e : { default: e };
}
-Ko.ITF = R$.default;
-Ko.ITF14 = I$.default;
+Go.ITF = I$.default;
+Go.ITF14 = P$.default;
var pi = {}, qr = {};
Object.defineProperty(qr, "__esModule", {
value: !0
});
-var F$ = function() {
+var M$ = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -19261,35 +19261,35 @@ var F$ = function() {
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
-}(), P$ = Zn, M$ = L$(P$);
-function L$(e) {
+}(), L$ = Zn, N$ = B$(L$);
+function B$(e) {
return e && e.__esModule ? e : { default: e };
}
-function N$(e, t) {
+function V$(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function B$(e, t) {
+function j$(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function V$(e, t) {
+function U$(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var j$ = function(e) {
- V$(t, e);
+var H$ = function(e) {
+ U$(t, e);
function t(i, r) {
- return N$(this, t), B$(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
+ return V$(this, t), j$(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
- return F$(t, [{
+ return M$(t, [{
key: "encode",
value: function() {
for (var r = "110", n = 0; n < this.data.length; n++) {
var a = parseInt(this.data[n]), s = a.toString(2);
- s = U$(s, 4 - s.length);
+ s = z$(s, 4 - s.length);
for (var u = 0; u < s.length; u++)
r += s[u] == "0" ? "100" : "110";
}
@@ -19304,171 +19304,171 @@ var j$ = function(e) {
return this.data.search(/^[0-9]+$/) !== -1;
}
}]), t;
-}(M$.default);
-function U$(e, t) {
+}(N$.default);
+function z$(e, t) {
for (var i = 0; i < t; i++)
e = "0" + e;
return e;
}
-qr.default = j$;
-var fp = {}, eo = {};
+qr.default = H$;
+var cp = {}, eo = {};
Object.defineProperty(eo, "__esModule", {
value: !0
});
-eo.mod10 = H$;
-eo.mod11 = z$;
-function H$(e) {
+eo.mod10 = W$;
+eo.mod11 = G$;
+function W$(e) {
for (var t = 0, i = 0; i < e.length; i++) {
var r = parseInt(e[i]);
(i + e.length) % 2 === 0 ? t += r : t += r * 2 % 10 + Math.floor(r * 2 / 10);
}
return (10 - t % 10) % 10;
}
-function z$(e) {
+function G$(e) {
for (var t = 0, i = [2, 3, 4, 5, 6, 7], r = 0; r < e.length; r++) {
var n = parseInt(e[e.length - 1 - r]);
t += i[r % i.length] * n;
}
return (11 - t % 11) % 11;
}
-Object.defineProperty(fp, "__esModule", {
- value: !0
-});
-var W$ = qr, G$ = Y$(W$), K$ = eo;
-function Y$(e) {
- return e && e.__esModule ? e : { default: e };
-}
-function Q$(e, t) {
- if (!(e instanceof t))
- throw new TypeError("Cannot call a class as a function");
-}
-function J$(e, t) {
- if (!e)
- throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
- return t && (typeof t == "object" || typeof t == "function") ? t : e;
-}
-function X$(e, t) {
- if (typeof t != "function" && t !== null)
- throw new TypeError("Super expression must either be null or a function, not " + typeof t);
- e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
-}
-var Z$ = function(e) {
- X$(t, e);
- function t(i, r) {
- return Q$(this, t), J$(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i + (0, K$.mod10)(i), r));
- }
- return t;
-}(G$.default);
-fp.default = Z$;
-var cp = {};
Object.defineProperty(cp, "__esModule", {
value: !0
});
-var q$ = qr, eR = nR(q$), tR = eo;
-function nR(e) {
+var K$ = qr, Y$ = J$(K$), Q$ = eo;
+function J$(e) {
return e && e.__esModule ? e : { default: e };
}
-function iR(e, t) {
+function X$(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function rR(e, t) {
+function Z$(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function oR(e, t) {
+function q$(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var aR = function(e) {
- oR(t, e);
+var eR = function(e) {
+ q$(t, e);
function t(i, r) {
- return iR(this, t), rR(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i + (0, tR.mod11)(i), r));
+ return X$(this, t), Z$(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i + (0, Q$.mod10)(i), r));
}
return t;
-}(eR.default);
-cp.default = aR;
+}(Y$.default);
+cp.default = eR;
var pp = {};
Object.defineProperty(pp, "__esModule", {
value: !0
});
-var lR = qr, sR = uR(lR), Kv = eo;
-function uR(e) {
+var tR = qr, nR = rR(tR), iR = eo;
+function rR(e) {
return e && e.__esModule ? e : { default: e };
}
-function dR(e, t) {
+function oR(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function fR(e, t) {
+function aR(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function cR(e, t) {
+function lR(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var pR = function(e) {
- cR(t, e);
+var sR = function(e) {
+ lR(t, e);
function t(i, r) {
- return dR(this, t), i += (0, Kv.mod10)(i), i += (0, Kv.mod10)(i), fR(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
+ return oR(this, t), aR(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i + (0, iR.mod11)(i), r));
}
return t;
-}(sR.default);
-pp.default = pR;
+}(nR.default);
+pp.default = sR;
var hp = {};
Object.defineProperty(hp, "__esModule", {
value: !0
});
-var hR = qr, mR = vR(hR), Yv = eo;
-function vR(e) {
+var uR = qr, dR = fR(uR), Yv = eo;
+function fR(e) {
return e && e.__esModule ? e : { default: e };
}
-function gR(e, t) {
+function cR(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function yR(e, t) {
+function pR(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function bR(e, t) {
+function hR(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var _R = function(e) {
- bR(t, e);
+var mR = function(e) {
+ hR(t, e);
function t(i, r) {
- return gR(this, t), i += (0, Yv.mod11)(i), i += (0, Yv.mod10)(i), yR(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
+ return cR(this, t), i += (0, Yv.mod10)(i), i += (0, Yv.mod10)(i), pR(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
return t;
-}(mR.default);
-hp.default = _R;
+}(dR.default);
+hp.default = mR;
+var mp = {};
+Object.defineProperty(mp, "__esModule", {
+ value: !0
+});
+var vR = qr, gR = yR(vR), Qv = eo;
+function yR(e) {
+ return e && e.__esModule ? e : { default: e };
+}
+function bR(e, t) {
+ if (!(e instanceof t))
+ throw new TypeError("Cannot call a class as a function");
+}
+function _R(e, t) {
+ if (!e)
+ throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
+ return t && (typeof t == "object" || typeof t == "function") ? t : e;
+}
+function wR(e, t) {
+ if (typeof t != "function" && t !== null)
+ throw new TypeError("Super expression must either be null or a function, not " + typeof t);
+ e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
+}
+var AR = function(e) {
+ wR(t, e);
+ function t(i, r) {
+ return bR(this, t), i += (0, Qv.mod11)(i), i += (0, Qv.mod10)(i), _R(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
+ }
+ return t;
+}(gR.default);
+mp.default = AR;
Object.defineProperty(pi, "__esModule", {
value: !0
});
pi.MSI1110 = pi.MSI1010 = pi.MSI11 = pi.MSI10 = pi.MSI = void 0;
-var wR = qr, AR = pl(wR), CR = fp, SR = pl(CR), ER = cp, xR = pl(ER), TR = pp, kR = pl(TR), OR = hp, $R = pl(OR);
+var CR = qr, SR = pl(CR), ER = cp, xR = pl(ER), TR = pp, kR = pl(TR), OR = hp, $R = pl(OR), RR = mp, DR = pl(RR);
function pl(e) {
return e && e.__esModule ? e : { default: e };
}
-pi.MSI = AR.default;
-pi.MSI10 = SR.default;
-pi.MSI11 = xR.default;
-pi.MSI1010 = kR.default;
-pi.MSI1110 = $R.default;
+pi.MSI = SR.default;
+pi.MSI10 = xR.default;
+pi.MSI11 = kR.default;
+pi.MSI1010 = $R.default;
+pi.MSI1110 = DR.default;
var mu = {};
Object.defineProperty(mu, "__esModule", {
value: !0
});
mu.pharmacode = void 0;
-var RR = function() {
+var IR = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -19478,32 +19478,32 @@ var RR = function() {
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
-}(), DR = Zn, IR = FR(DR);
-function FR(e) {
+}(), FR = Zn, PR = MR(FR);
+function MR(e) {
return e && e.__esModule ? e : { default: e };
}
-function PR(e, t) {
+function LR(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function MR(e, t) {
+function NR(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function LR(e, t) {
+function BR(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var NR = function(e) {
- LR(t, e);
+var VR = function(e) {
+ BR(t, e);
function t(i, r) {
- PR(this, t);
- var n = MR(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
+ LR(this, t);
+ var n = NR(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
return n.number = parseInt(i, 10), n;
}
- return RR(t, [{
+ return IR(t, [{
key: "encode",
value: function() {
for (var r = this.number, n = ""; !isNaN(r) && r != 0; )
@@ -19519,14 +19519,14 @@ var NR = function(e) {
return this.number >= 3 && this.number <= 131070;
}
}]), t;
-}(IR.default);
-mu.pharmacode = NR;
+}(PR.default);
+mu.pharmacode = VR;
var vu = {};
Object.defineProperty(vu, "__esModule", {
value: !0
});
vu.codabar = void 0;
-var BR = function() {
+var jR = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -19536,32 +19536,32 @@ var BR = function() {
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
-}(), VR = Zn, jR = UR(VR);
-function UR(e) {
+}(), UR = Zn, HR = zR(UR);
+function zR(e) {
return e && e.__esModule ? e : { default: e };
}
-function HR(e, t) {
+function WR(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function zR(e, t) {
+function GR(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function WR(e, t) {
+function KR(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var GR = function(e) {
- WR(t, e);
+var YR = function(e) {
+ KR(t, e);
function t(i, r) {
- HR(this, t), i.search(/^[0-9\-\$\:\.\+\/]+$/) === 0 && (i = "A" + i + "A");
- var n = zR(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i.toUpperCase(), r));
+ WR(this, t), i.search(/^[0-9\-\$\:\.\+\/]+$/) === 0 && (i = "A" + i + "A");
+ var n = GR(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i.toUpperCase(), r));
return n.text = n.options.text || n.text.replace(/[A-D]/g, ""), n;
}
- return BR(t, [{
+ return jR(t, [{
key: "valid",
value: function() {
return this.data.search(/^[A-D][0-9\-\$\:\.\+\/]+[A-D]$/) !== -1;
@@ -19603,14 +19603,14 @@ var GR = function(e) {
};
}
}]), t;
-}(jR.default);
-vu.codabar = GR;
+}(HR.default);
+vu.codabar = YR;
var gu = {};
Object.defineProperty(gu, "__esModule", {
value: !0
});
gu.GenericBarcode = void 0;
-var KR = function() {
+var QR = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -19620,30 +19620,30 @@ var KR = function() {
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
-}(), YR = Zn, QR = JR(YR);
-function JR(e) {
+}(), JR = Zn, XR = ZR(JR);
+function ZR(e) {
return e && e.__esModule ? e : { default: e };
}
-function XR(e, t) {
+function qR(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function ZR(e, t) {
+function eD(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function qR(e, t) {
+function tD(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var eD = function(e) {
- qR(t, e);
+var nD = function(e) {
+ tD(t, e);
function t(i, r) {
- return XR(this, t), ZR(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
+ return qR(this, t), eD(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this, i, r));
}
- return KR(t, [{
+ return QR(t, [{
key: "encode",
value: function() {
return {
@@ -19657,40 +19657,40 @@ var eD = function(e) {
return !0;
}
}]), t;
-}(QR.default);
-gu.GenericBarcode = eD;
-Object.defineProperty(Zc, "__esModule", {
+}(XR.default);
+gu.GenericBarcode = nD;
+Object.defineProperty(qc, "__esModule", {
value: !0
});
-var tD = fu, vs = Ui, Io = Jn, Qv = Ko, Va = pi, nD = mu, iD = vu, rD = gu;
-Zc.default = {
- CODE39: tD.CODE39,
+var iD = fu, vs = Ui, Do = Jn, Jv = Go, Va = pi, rD = mu, oD = vu, aD = gu;
+qc.default = {
+ CODE39: iD.CODE39,
CODE128: vs.CODE128,
CODE128A: vs.CODE128A,
CODE128B: vs.CODE128B,
CODE128C: vs.CODE128C,
- EAN13: Io.EAN13,
- EAN8: Io.EAN8,
- EAN5: Io.EAN5,
- EAN2: Io.EAN2,
- UPC: Io.UPC,
- UPCE: Io.UPCE,
- ITF14: Qv.ITF14,
- ITF: Qv.ITF,
+ EAN13: Do.EAN13,
+ EAN8: Do.EAN8,
+ EAN5: Do.EAN5,
+ EAN2: Do.EAN2,
+ UPC: Do.UPC,
+ UPCE: Do.UPCE,
+ ITF14: Jv.ITF14,
+ ITF: Jv.ITF,
MSI: Va.MSI,
MSI10: Va.MSI10,
MSI11: Va.MSI11,
MSI1010: Va.MSI1010,
MSI1110: Va.MSI1110,
- pharmacode: nD.pharmacode,
- codabar: iD.codabar,
- GenericBarcode: rD.GenericBarcode
+ pharmacode: rD.pharmacode,
+ codabar: oD.codabar,
+ GenericBarcode: aD.GenericBarcode
};
-var Xo = {};
-Object.defineProperty(Xo, "__esModule", {
+var Jo = {};
+Object.defineProperty(Jo, "__esModule", {
value: !0
});
-var oD = Object.assign || function(e) {
+var lD = Object.assign || function(e) {
for (var t = 1; t < arguments.length; t++) {
var i = arguments[t];
for (var r in i)
@@ -19698,15 +19698,15 @@ var oD = Object.assign || function(e) {
}
return e;
};
-Xo.default = function(e, t) {
- return oD({}, e, t);
+Jo.default = function(e, t) {
+ return lD({}, e, t);
};
-var mp = {};
-Object.defineProperty(mp, "__esModule", {
+var vp = {};
+Object.defineProperty(vp, "__esModule", {
value: !0
});
-mp.default = aD;
-function aD(e) {
+vp.default = sD;
+function sD(e) {
var t = [];
function i(r) {
if (Array.isArray(r))
@@ -19717,20 +19717,20 @@ function aD(e) {
}
return i(e), t;
}
-var vp = {};
-Object.defineProperty(vp, "__esModule", {
+var gp = {};
+Object.defineProperty(gp, "__esModule", {
value: !0
});
-vp.default = lD;
-function lD(e) {
+gp.default = uD;
+function uD(e) {
return e.marginTop = e.marginTop || e.margin, e.marginBottom = e.marginBottom || e.margin, e.marginRight = e.marginRight || e.margin, e.marginLeft = e.marginLeft || e.margin, e;
}
-var gp = {}, yp = {}, yu = {};
+var yp = {}, bp = {}, yu = {};
Object.defineProperty(yu, "__esModule", {
value: !0
});
-yu.default = sD;
-function sD(e) {
+yu.default = dD;
+function dD(e) {
var t = ["width", "height", "textMargin", "fontSize", "margin", "marginTop", "marginBottom", "marginLeft", "marginRight"];
for (var i in t)
t.hasOwnProperty(i) && (i = t[i], typeof e[i] == "string" && (e[i] = parseInt(e[i], 10)));
@@ -19740,7 +19740,7 @@ var bu = {};
Object.defineProperty(bu, "__esModule", {
value: !0
});
-var uD = {
+var fD = {
width: 2,
height: 100,
format: "auto",
@@ -19762,34 +19762,34 @@ var uD = {
valid: function() {
}
};
-bu.default = uD;
-Object.defineProperty(yp, "__esModule", {
+bu.default = fD;
+Object.defineProperty(bp, "__esModule", {
value: !0
});
-var dD = yu, fD = D0(dD), cD = bu, Jv = D0(cD);
-function D0(e) {
+var cD = yu, pD = F0(cD), hD = bu, Xv = F0(hD);
+function F0(e) {
return e && e.__esModule ? e : { default: e };
}
-function pD(e) {
+function mD(e) {
var t = {};
- for (var i in Jv.default)
- Jv.default.hasOwnProperty(i) && (e.hasAttribute("jsbarcode-" + i.toLowerCase()) && (t[i] = e.getAttribute("jsbarcode-" + i.toLowerCase())), e.hasAttribute("data-" + i.toLowerCase()) && (t[i] = e.getAttribute("data-" + i.toLowerCase())));
- return t.value = e.getAttribute("jsbarcode-value") || e.getAttribute("data-value"), t = (0, fD.default)(t), t;
+ for (var i in Xv.default)
+ Xv.default.hasOwnProperty(i) && (e.hasAttribute("jsbarcode-" + i.toLowerCase()) && (t[i] = e.getAttribute("jsbarcode-" + i.toLowerCase())), e.hasAttribute("data-" + i.toLowerCase()) && (t[i] = e.getAttribute("data-" + i.toLowerCase())));
+ return t.value = e.getAttribute("jsbarcode-value") || e.getAttribute("data-value"), t = (0, pD.default)(t), t;
}
-yp.default = pD;
-var bp = {}, _p = {}, oi = {};
+bp.default = mD;
+var _p = {}, wp = {}, oi = {};
Object.defineProperty(oi, "__esModule", {
value: !0
});
oi.getTotalWidthOfEncodings = oi.calculateEncodingAttributes = oi.getBarcodePadding = oi.getEncodingHeight = oi.getMaximumHeightOfEncodings = void 0;
-var hD = Xo, mD = vD(hD);
-function vD(e) {
+var vD = Jo, gD = yD(vD);
+function yD(e) {
return e && e.__esModule ? e : { default: e };
}
-function I0(e, t) {
+function P0(e, t) {
return t.height + (t.displayValue && e.text.length > 0 ? t.fontSize + t.textMargin : 0) + t.marginTop + t.marginBottom;
}
-function F0(e, t, i) {
+function M0(e, t, i) {
if (i.displayValue && t < e) {
if (i.textAlign == "center")
return Math.floor((e - t) / 2);
@@ -19800,25 +19800,25 @@ function F0(e, t, i) {
}
return 0;
}
-function gD(e, t, i) {
+function bD(e, t, i) {
for (var r = 0; r < e.length; r++) {
- var n = e[r], a = (0, mD.default)(t, n.options), s;
- a.displayValue ? s = _D(n.text, a, i) : s = 0;
+ var n = e[r], a = (0, gD.default)(t, n.options), s;
+ a.displayValue ? s = AD(n.text, a, i) : s = 0;
var u = n.data.length * a.width;
- n.width = Math.ceil(Math.max(s, u)), n.height = I0(n, a), n.barcodePadding = F0(s, u, a);
+ n.width = Math.ceil(Math.max(s, u)), n.height = P0(n, a), n.barcodePadding = M0(s, u, a);
}
}
-function yD(e) {
+function _D(e) {
for (var t = 0, i = 0; i < e.length; i++)
t += e[i].width;
return t;
}
-function bD(e) {
+function wD(e) {
for (var t = 0, i = 0; i < e.length; i++)
e[i].height > t && (t = e[i].height);
return t;
}
-function _D(e, t, i) {
+function AD(e, t, i) {
var r;
if (i)
r = i;
@@ -19833,15 +19833,15 @@ function _D(e, t, i) {
var a = n.width;
return a;
}
-oi.getMaximumHeightOfEncodings = bD;
-oi.getEncodingHeight = I0;
-oi.getBarcodePadding = F0;
-oi.calculateEncodingAttributes = gD;
-oi.getTotalWidthOfEncodings = yD;
-Object.defineProperty(_p, "__esModule", {
+oi.getMaximumHeightOfEncodings = wD;
+oi.getEncodingHeight = P0;
+oi.getBarcodePadding = M0;
+oi.calculateEncodingAttributes = bD;
+oi.getTotalWidthOfEncodings = _D;
+Object.defineProperty(wp, "__esModule", {
value: !0
});
-var wD = function() {
+var CD = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -19851,26 +19851,26 @@ var wD = function() {
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
-}(), AD = Xo, CD = SD(AD), Mf = oi;
-function SD(e) {
+}(), SD = Jo, ED = xD(SD), Mf = oi;
+function xD(e) {
return e && e.__esModule ? e : { default: e };
}
-function ED(e, t) {
+function TD(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-var xD = function() {
+var kD = function() {
function e(t, i, r) {
- ED(this, e), this.canvas = t, this.encodings = i, this.options = r;
+ TD(this, e), this.canvas = t, this.encodings = i, this.options = r;
}
- return wD(e, [{
+ return CD(e, [{
key: "render",
value: function() {
if (!this.canvas.getContext)
throw new Error("The browser does not support canvas.");
this.prepareCanvas();
for (var i = 0; i < this.encodings.length; i++) {
- var r = (0, CD.default)(this.options, this.encodings[i].options);
+ var r = (0, ED.default)(this.options, this.encodings[i].options);
this.drawCanvasBarcode(r, this.encodings[i]), this.drawCanvasText(r, this.encodings[i]), this.moveCanvasDrawing(this.encodings[i]);
}
this.restoreCanvas();
@@ -19916,12 +19916,12 @@ var xD = function() {
}
}]), e;
}();
-_p.default = xD;
-var wp = {};
-Object.defineProperty(wp, "__esModule", {
+wp.default = kD;
+var Ap = {};
+Object.defineProperty(Ap, "__esModule", {
value: !0
});
-var TD = function() {
+var OD = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -19931,25 +19931,25 @@ var TD = function() {
return function(t, i, r) {
return i && e(t.prototype, i), r && e(t, r), t;
};
-}(), kD = Xo, OD = $D(kD), Lf = oi;
-function $D(e) {
+}(), $D = Jo, RD = DD($D), Lf = oi;
+function DD(e) {
return e && e.__esModule ? e : { default: e };
}
-function RD(e, t) {
+function ID(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-var gs = "http://www.w3.org/2000/svg", DD = function() {
+var gs = "http://www.w3.org/2000/svg", FD = function() {
function e(t, i, r) {
- RD(this, e), this.svg = t, this.encodings = i, this.options = r, this.document = r.xmlDocument || document;
+ ID(this, e), this.svg = t, this.encodings = i, this.options = r, this.document = r.xmlDocument || document;
}
- return TD(e, [{
+ return OD(e, [{
key: "render",
value: function() {
var i = this.options.marginLeft;
this.prepareSVG();
for (var r = 0; r < this.encodings.length; r++) {
- var n = this.encodings[r], a = (0, OD.default)(this.options, n.options), s = this.createGroup(i, a.marginTop, this.svg);
+ var n = this.encodings[r], a = (0, RD.default)(this.options, n.options), s = this.createGroup(i, a.marginTop, this.svg);
this.setGroupOptions(s, a), this.drawSvgBarcode(s, a, n), this.drawSVGText(s, a, n), i += n.width;
}
}
@@ -20005,12 +20005,12 @@ var gs = "http://www.w3.org/2000/svg", DD = function() {
}
}]), e;
}();
-wp.default = DD;
-var Ap = {};
-Object.defineProperty(Ap, "__esModule", {
+Ap.default = FD;
+var Cp = {};
+Object.defineProperty(Cp, "__esModule", {
value: !0
});
-var ID = function() {
+var PD = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -20021,107 +20021,107 @@ var ID = function() {
return i && e(t.prototype, i), r && e(t, r), t;
};
}();
-function FD(e, t) {
+function MD(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-var PD = function() {
+var LD = function() {
function e(t, i, r) {
- FD(this, e), this.object = t, this.encodings = i, this.options = r;
+ MD(this, e), this.object = t, this.encodings = i, this.options = r;
}
- return ID(e, [{
+ return PD(e, [{
key: "render",
value: function() {
this.object.encodings = this.encodings;
}
}]), e;
}();
-Ap.default = PD;
-Object.defineProperty(bp, "__esModule", {
+Cp.default = LD;
+Object.defineProperty(_p, "__esModule", {
value: !0
});
-var MD = _p, LD = Cp(MD), ND = wp, BD = Cp(ND), VD = Ap, jD = Cp(VD);
-function Cp(e) {
+var ND = wp, BD = Sp(ND), VD = Ap, jD = Sp(VD), UD = Cp, HD = Sp(UD);
+function Sp(e) {
return e && e.__esModule ? e : { default: e };
}
-bp.default = { CanvasRenderer: LD.default, SVGRenderer: BD.default, ObjectRenderer: jD.default };
-var Zo = {};
-Object.defineProperty(Zo, "__esModule", {
+_p.default = { CanvasRenderer: BD.default, SVGRenderer: jD.default, ObjectRenderer: HD.default };
+var Xo = {};
+Object.defineProperty(Xo, "__esModule", {
value: !0
});
-function Sp(e, t) {
+function Ep(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-function Ep(e, t) {
+function xp(e, t) {
if (!e)
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
return t && (typeof t == "object" || typeof t == "function") ? t : e;
}
-function xp(e, t) {
+function Tp(e, t) {
if (typeof t != "function" && t !== null)
throw new TypeError("Super expression must either be null or a function, not " + typeof t);
e.prototype = Object.create(t && t.prototype, { constructor: { value: e, enumerable: !1, writable: !0, configurable: !0 } }), t && (Object.setPrototypeOf ? Object.setPrototypeOf(e, t) : e.__proto__ = t);
}
-var UD = function(e) {
- xp(t, e);
+var zD = function(e) {
+ Tp(t, e);
function t(i, r) {
- Sp(this, t);
- var n = Ep(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this));
+ Ep(this, t);
+ var n = xp(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this));
return n.name = "InvalidInputException", n.symbology = i, n.input = r, n.message = '"' + n.input + '" is not a valid input for ' + n.symbology, n;
}
return t;
-}(Error), HD = function(e) {
- xp(t, e);
+}(Error), WD = function(e) {
+ Tp(t, e);
function t() {
- Sp(this, t);
- var i = Ep(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this));
+ Ep(this, t);
+ var i = xp(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this));
return i.name = "InvalidElementException", i.message = "Not supported type to render on", i;
}
return t;
-}(Error), zD = function(e) {
- xp(t, e);
+}(Error), GD = function(e) {
+ Tp(t, e);
function t() {
- Sp(this, t);
- var i = Ep(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this));
+ Ep(this, t);
+ var i = xp(this, (t.__proto__ || Object.getPrototypeOf(t)).call(this));
return i.name = "NoElementException", i.message = "No element to render on.", i;
}
return t;
}(Error);
-Zo.InvalidInputException = UD;
-Zo.InvalidElementException = HD;
-Zo.NoElementException = zD;
-Object.defineProperty(gp, "__esModule", {
+Xo.InvalidInputException = zD;
+Xo.InvalidElementException = WD;
+Xo.NoElementException = GD;
+Object.defineProperty(yp, "__esModule", {
value: !0
});
-var WD = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(e) {
+var KD = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(e) {
return typeof e;
} : function(e) {
return e && typeof Symbol == "function" && e.constructor === Symbol && e !== Symbol.prototype ? "symbol" : typeof e;
-}, GD = yp, yc = P0(GD), KD = bp, Ka = P0(KD), YD = Zo;
-function P0(e) {
+}, YD = bp, bc = L0(YD), QD = _p, Ka = L0(QD), JD = Xo;
+function L0(e) {
return e && e.__esModule ? e : { default: e };
}
-function Tp(e) {
+function kp(e) {
if (typeof e == "string")
- return QD(e);
+ return XD(e);
if (Array.isArray(e)) {
for (var t = [], i = 0; i < e.length; i++)
- t.push(Tp(e[i]));
+ t.push(kp(e[i]));
return t;
} else {
if (typeof HTMLCanvasElement < "u" && e instanceof HTMLImageElement)
- return JD(e);
+ return ZD(e);
if (e && e.nodeName && e.nodeName.toLowerCase() === "svg" || typeof SVGElement < "u" && e instanceof SVGElement)
return {
element: e,
- options: (0, yc.default)(e),
+ options: (0, bc.default)(e),
renderer: Ka.default.SVGRenderer
};
if (typeof HTMLCanvasElement < "u" && e instanceof HTMLCanvasElement)
return {
element: e,
- options: (0, yc.default)(e),
+ options: (0, bc.default)(e),
renderer: Ka.default.CanvasRenderer
};
if (e && e.getContext)
@@ -20129,39 +20129,39 @@ function Tp(e) {
element: e,
renderer: Ka.default.CanvasRenderer
};
- if (e && (typeof e > "u" ? "undefined" : WD(e)) === "object" && !e.nodeName)
+ if (e && (typeof e > "u" ? "undefined" : KD(e)) === "object" && !e.nodeName)
return {
element: e,
renderer: Ka.default.ObjectRenderer
};
- throw new YD.InvalidElementException();
+ throw new JD.InvalidElementException();
}
}
-function QD(e) {
+function XD(e) {
var t = document.querySelectorAll(e);
if (t.length !== 0) {
for (var i = [], r = 0; r < t.length; r++)
- i.push(Tp(t[r]));
+ i.push(kp(t[r]));
return i;
}
}
-function JD(e) {
+function ZD(e) {
var t = document.createElement("canvas");
return {
element: t,
- options: (0, yc.default)(e),
+ options: (0, bc.default)(e),
renderer: Ka.default.CanvasRenderer,
afterRender: function() {
e.setAttribute("src", t.toDataURL());
}
};
}
-gp.default = Tp;
-var kp = {};
-Object.defineProperty(kp, "__esModule", {
+yp.default = kp;
+var Op = {};
+Object.defineProperty(Op, "__esModule", {
value: !0
});
-var XD = function() {
+var qD = function() {
function e(t, i) {
for (var r = 0; r < i.length; r++) {
var n = i[r];
@@ -20172,15 +20172,15 @@ var XD = function() {
return i && e(t.prototype, i), r && e(t, r), t;
};
}();
-function ZD(e, t) {
+function eI(e, t) {
if (!(e instanceof t))
throw new TypeError("Cannot call a class as a function");
}
-var qD = function() {
+var tI = function() {
function e(t) {
- ZD(this, e), this.api = t;
+ eI(this, e), this.api = t;
}
- return XD(e, [{
+ return qD(e, [{
key: "handleCatch",
value: function(i) {
if (i.name === "InvalidInputException")
@@ -20205,8 +20205,8 @@ var qD = function() {
}
}]), e;
}();
-kp.default = qD;
-var eI = Zc, Kr = Rr(eI), tI = Xo, hl = Rr(tI), nI = mp, M0 = Rr(nI), iI = vp, Xv = Rr(iI), rI = gp, oI = Rr(rI), aI = yu, lI = Rr(aI), sI = kp, uI = Rr(sI), L0 = Zo, dI = bu, N0 = Rr(dI);
+Op.default = tI;
+var nI = qc, Kr = Rr(nI), iI = Jo, hl = Rr(iI), rI = vp, N0 = Rr(rI), oI = gp, Zv = Rr(oI), aI = yp, lI = Rr(aI), sI = yu, uI = Rr(sI), dI = Op, fI = Rr(dI), B0 = Xo, cI = bu, V0 = Rr(cI);
function Rr(e) {
return e && e.__esModule ? e : { default: e };
}
@@ -20215,37 +20215,37 @@ var ir = function() {
var n = new ir();
if (typeof t > "u")
throw Error("No element to render on was provided.");
- return n._renderProperties = (0, oI.default)(t), n._encodings = [], n._options = N0.default, n._errorHandler = new uI.default(n), typeof i < "u" && (r = r || {}, r.format || (r.format = V0()), n.options(r)[r.format](i, r).render()), n;
+ return n._renderProperties = (0, lI.default)(t), n._encodings = [], n._options = V0.default, n._errorHandler = new fI.default(n), typeof i < "u" && (r = r || {}, r.format || (r.format = U0()), n.options(r)[r.format](i, r).render()), n;
};
_u.getModule = function(e) {
return Kr.default[e];
};
-for (var Zv in Kr.default)
- Kr.default.hasOwnProperty(Zv) && fI(Kr.default, Zv);
-function fI(e, t) {
+for (var qv in Kr.default)
+ Kr.default.hasOwnProperty(qv) && pI(Kr.default, qv);
+function pI(e, t) {
ir.prototype[t] = ir.prototype[t.toUpperCase()] = ir.prototype[t.toLowerCase()] = function(i, r) {
var n = this;
return n._errorHandler.wrapBarcodeCall(function() {
r.text = typeof r.text > "u" ? void 0 : "" + r.text;
var a = (0, hl.default)(n._options, r);
- a = (0, lI.default)(a);
- var s = e[t], u = B0(i, s, a);
+ a = (0, uI.default)(a);
+ var s = e[t], u = j0(i, s, a);
return n._encodings.push(u), n;
});
};
}
-function B0(e, t, i) {
+function j0(e, t, i) {
e = "" + e;
var r = new t(e, i);
if (!r.valid())
- throw new L0.InvalidInputException(r.constructor.name, e);
+ throw new B0.InvalidInputException(r.constructor.name, e);
var n = r.encode();
- n = (0, M0.default)(n);
+ n = (0, N0.default)(n);
for (var a = 0; a < n.length; a++)
n[a].options = (0, hl.default)(i, n[a].options);
return n;
}
-function V0() {
+function U0() {
return Kr.default.CODE128 ? "CODE128" : Object.keys(Kr.default)[0];
}
ir.prototype.options = function(e) {
@@ -20262,29 +20262,29 @@ ir.prototype.init = function() {
for (var t in this._renderProperties) {
e = this._renderProperties[t];
var i = (0, hl.default)(this._options, e.options);
- i.format == "auto" && (i.format = V0()), this._errorHandler.wrapBarcodeCall(function() {
- var r = i.value, n = Kr.default[i.format.toUpperCase()], a = B0(r, n, i);
- bc(e, a, i);
+ i.format == "auto" && (i.format = U0()), this._errorHandler.wrapBarcodeCall(function() {
+ var r = i.value, n = Kr.default[i.format.toUpperCase()], a = j0(r, n, i);
+ _c(e, a, i);
});
}
}
};
ir.prototype.render = function() {
if (!this._renderProperties)
- throw new L0.NoElementException();
+ throw new B0.NoElementException();
if (Array.isArray(this._renderProperties))
for (var e = 0; e < this._renderProperties.length; e++)
- bc(this._renderProperties[e], this._encodings, this._options);
+ _c(this._renderProperties[e], this._encodings, this._options);
else
- bc(this._renderProperties, this._encodings, this._options);
+ _c(this._renderProperties, this._encodings, this._options);
return this;
};
-ir.prototype._defaults = N0.default;
-function bc(e, t, i) {
- t = (0, M0.default)(t);
+ir.prototype._defaults = V0.default;
+function _c(e, t, i) {
+ t = (0, N0.default)(t);
for (var r = 0; r < t.length; r++)
- t[r].options = (0, hl.default)(i, t[r].options), (0, Xv.default)(t[r].options);
- (0, Xv.default)(i);
+ t[r].options = (0, hl.default)(i, t[r].options), (0, Zv.default)(t[r].options);
+ (0, Zv.default)(i);
var n = e.renderer, a = new n(e.element, t, i);
a.render(), e.afterRender && e.afterRender();
}
@@ -20295,8 +20295,8 @@ typeof jQuery < "u" && (jQuery.fn.JsBarcode = function(e, t) {
i.push(this);
}), _u(i, e, t);
});
-var cI = _u;
-const pI = Be({
+var hI = _u;
+const mI = Be({
name: "BarCodeBox",
data() {
return {};
@@ -20333,22 +20333,22 @@ const pI = Be({
Object.keys(this.$props).forEach((i) => {
this.$props[i] != null && this.$props[i] !== "" && (t[i] = this.$props[i]);
}), delete t.value, delete t.formCreateInject, this.$nextTick(() => {
- cI(this.$refs.bar, e || "", t);
+ hI(this.$refs.bar, e || "", t);
});
},
deep: !0,
immediate: !0
}
}
-}), hI = {
+}), vI = {
class: "_fc-barcode",
ref: "bar"
};
-function mI(e, t, i, r, n, a) {
- return H(), ae("img", hI, null, 512);
+function gI(e, t, i, r, n, a) {
+ return H(), ae("img", vI, null, 512);
}
-const j0 = /* @__PURE__ */ Ve(pI, [["render", mI]]);
-const vI = Be({
+const H0 = /* @__PURE__ */ Ve(mI, [["render", gI]]);
+const yI = Be({
name: "VideoBox",
emits: ["pause", "play", "ended", "error"],
data() {
@@ -20392,8 +20392,8 @@ const vI = Be({
created() {
window.mpegts ? kn.done("mpegts") : kn.isDefined("mpegts") || kn.loadNpm("mpegts.js@1.8.0/dist/mpegts.js", "mpegts");
}
-}), gI = ["controls", "loop"];
-function yI(e, t, i, r, n, a) {
+}), bI = ["controls", "loop"];
+function _I(e, t, i, r, n, a) {
return H(), ae("video", {
ref: "video",
class: "_fc-video-box",
@@ -20402,14 +20402,14 @@ function yI(e, t, i, r, n, a) {
onPause: t[0] || (t[0] = (s) => e.$emit("pause", s)),
onPlay: t[1] || (t[1] = (s) => e.$emit("play", s)),
onEnded: t[2] || (t[2] = (s) => e.$emit("ended", s))
- }, null, 40, gI);
+ }, null, 40, bI);
}
-const U0 = /* @__PURE__ */ Ve(vI, [["render", yI]]);
-var H0 = { exports: {} };
+const z0 = /* @__PURE__ */ Ve(yI, [["render", _I]]);
+var W0 = { exports: {} };
(function(e, t) {
(function(i, r) {
e.exports = r();
- })(Lc, () => (() => {
+ })(Nc, () => (() => {
var i = { 873: (s, u) => {
var d, p, h = function() {
var g = function(G, I) {
@@ -21683,8 +21683,8 @@ ${new this._window.XMLSerializer().serializeToString(C)}`;
const I = G;
})(), a.default;
})());
-})(H0);
-const bI = /* @__PURE__ */ l2(H0.exports), _I = Be({
+})(W0);
+const wI = /* @__PURE__ */ u2(W0.exports), AI = Be({
name: "QrCodeBox",
data() {
return {
@@ -21711,22 +21711,22 @@ const bI = /* @__PURE__ */ l2(H0.exports), _I = Be({
Object.keys(this.$props).forEach((t) => {
this.$props[t] != null && this.$props[t] !== "" && (e[t] = this.$props[t]);
}), delete e.formCreateInject, e.circleType && (e.dotsOptions.type = e.circleType), e.circleColor && (e.dotsOptions.color = e.circleColor), delete e.circleColor, delete e.circleType, this.$nextTick(() => {
- this.qrcode ? this.qrcode.update(e) : (this.qrcode = Gt(new bI(e)), this.qrcode.append(this.$refs.qr));
+ this.qrcode ? this.qrcode.update(e) : (this.qrcode = Gt(new wI(e)), this.qrcode.append(this.$refs.qr));
});
},
deep: !0,
immediate: !0
}
}
-}), wI = {
+}), CI = {
class: "_fc-qrcode",
ref: "qr"
};
-function AI(e, t, i, r, n, a) {
- return H(), ae("div", wI, null, 512);
+function SI(e, t, i, r, n, a) {
+ return H(), ae("div", CI, null, 512);
}
-const z0 = /* @__PURE__ */ Ve(_I, [["render", AI]]);
-const qv = {
+const G0 = /* @__PURE__ */ Ve(AI, [["render", SI]]);
+const eg = {
date: "YYYY-MM-DD",
month: "YYYY-MM",
datetime: "YYYY-MM-DD HH:mm:ss",
@@ -21736,19 +21736,19 @@ const qv = {
datetimerange: "YYYY-MM-DD HH:mm:ss",
year: "YYYY"
};
-function CI(e) {
+function EI(e) {
return e / 20 + "em";
}
-function SI(e) {
+function xI(e) {
var t;
!((t = e.wrap) != null && t.class) || (e.wrap.class === "fc-wrap-top" ? (e.wrap.labelAlign = "top", delete e.wrap.class) : e.wrap.class === "fc-wrap-left" ? (e.wrap.labelAlign = "left", delete e.wrap.class) : e.wrap.class === "fc-wrap-right" && (e.wrap.labelAlign = "right", delete e.wrap.class));
}
-const W0 = function(e, t, i, r) {
+const K0 = function(e, t, i, r) {
const n = r || {};
return t.forEach((a) => {
- e.indexOf(a[i || "id"]) > -1 && e.splice(e.indexOf(a[i || "id"]), 1, a[n.label || "label"] || a.text), St.trueArray(a[n.children || "children"]) && W0(e, a[n.children || "children"], i, r);
+ e.indexOf(a[i || "id"]) > -1 && e.splice(e.indexOf(a[i || "id"]), 1, a[n.label || "label"] || a.text), St.trueArray(a[n.children || "children"]) && K0(e, a[n.children || "children"], i, r);
}), e;
-}, EI = function(e, t) {
+}, TI = function(e, t) {
return t.forEach((i) => {
e.indexOf(i.value) > -1 && (e[e.indexOf(i.value)] = i.label || i.text);
}), e;
@@ -21761,12 +21761,12 @@ function Nf(e) {
return [];
return e;
}
-function G0(e) {
+function Y0(e) {
Object.keys(rn).forEach((t) => {
e.setFormula(t, rn[t]);
- }), Bc(e), e.register("behavior", Ly), e.register("easySlots", nl), e.extendApi((t) => ({
+ }), Vc(e), e.register("behavior", By), e.register("easySlots", nl), e.extendApi((t) => ({
message(i) {
- uw({
+ fw({
type: "warning",
...i || {}
});
@@ -21778,11 +21778,11 @@ function G0(e) {
if (u === !1 || u === "custom" || !t.input || t.rule.subForm || (Array.isArray(s) ? s.length : s) || ["fcGroup", "fcSubForm", "tableForm", "stepForm", "nestedTableForm", "infiniteTableForm", "upload", "fcDialog", "fcDrawer", "fcPopup"].indexOf(t.trueType) > -1)
return t.parser.render(i, t);
if (["radio", "select", "checkbox"].indexOf(a) > -1)
- r = EI([...Nf(r)], t.prop.props.options || t.prop.props.formCreateInject.options || []).join(", ");
+ r = TI([...Nf(r)], t.prop.props.options || t.prop.props.formCreateInject.options || []).join(", ");
else if (["timePicker", "datePicker", "slider"].indexOf(a) > -1)
r = Array.isArray(r) ? r.join(" - ") : r;
else if (a === "cascader")
- r = [...Nf(r)], Array.isArray(r[0]) || (r = [r]), r = r.map((d) => W0(d, t.prop.props.options || t.prop.props.formCreateInject.options || [], "value").join("/")).join(", ");
+ r = [...Nf(r)], Array.isArray(r[0]) || (r = [r]), r = r.map((d) => K0(d, t.prop.props.options || t.prop.props.formCreateInject.options || [], "value").join("/")).join(", ");
else {
if (a === "fcEditor" || u === "html")
return n("div", { innerHTML: r });
@@ -21803,11 +21803,11 @@ function G0(e) {
let i = (n = (r = t.prop) == null ? void 0 : r.wrap) == null ? void 0 : n.style;
t.prop.col && t.prop.col.span && (t.prop.col.span = 24), i && (i = Array.isArray(i) ? i : [i], i.forEach((a) => {
delete a.marginBottom;
- })), SI(t.prop);
+ })), xI(t.prop);
},
updateOptions(t) {
var i, r, n;
- ((i = t.form) == null ? void 0 : i.labelWidth) && t.form.labelWidth.indexOf("px") > -1 && (t.form.labelWidth = CI(parseInt(t.form.labelWidth))), (r = t.form) != null && r.labelPosition && (t.form.labelAlign = t.form.labelPosition, delete t.form.labelPosition), (n = t.form) != null && n.hideRequiredAsterisk && (t.form.colon = t.form.hideRequiredAsterisk, delete t.form.hideRequiredAsterisk);
+ ((i = t.form) == null ? void 0 : i.labelWidth) && t.form.labelWidth.indexOf("px") > -1 && (t.form.labelWidth = EI(parseInt(t.form.labelWidth))), (r = t.form) != null && r.labelPosition && (t.form.labelAlign = t.form.labelPosition, delete t.form.labelPosition), (n = t.form) != null && n.hideRequiredAsterisk && (t.form.colon = t.form.hideRequiredAsterisk, delete t.form.hideRequiredAsterisk);
},
parsers: {
inputNumber: {
@@ -21829,7 +21829,7 @@ function G0(e) {
},
select: {
mergeProp(t) {
- t.prop.props.multiple === !0 ? t.prop.component = b2 : (t.prop.options && (t.prop.props.options = t.prop.options), t.prop.props.options = (t.prop.props.options || []).map((i) => ({
+ t.prop.props.multiple === !0 ? t.prop.component = w2 : (t.prop.options && (t.prop.props.options = t.prop.options), t.prop.props.options = (t.prop.props.options || []).map((i) => ({
text: i.label,
value: i.value
})));
@@ -21851,7 +21851,7 @@ function G0(e) {
mergeProp(t) {
t.prop.component = "elDatePicker";
const i = t.prop.props;
- i.valueFormat || (i.valueFormat = qv[i.type] || qv.date);
+ i.valueFormat || (i.valueFormat = eg[i.type] || eg.date);
}
},
colorPicker: {
@@ -21871,12 +21871,12 @@ function G0(e) {
},
upload: {
mergeProp(t) {
- t.prop.component = I2;
+ t.prop.component = P2;
}
},
tree: {
mergeProp(t) {
- t.prop.component = A2;
+ t.prop.component = S2;
}
},
row: {
@@ -21902,34 +21902,34 @@ function G0(e) {
}
});
}
-G0(Bt);
-Bt.component("FcSlot", Yy);
-Bt.component("FcJson", Qy);
-Bt.component("StepForm", L2);
-Bt.component("FcPopup", H2);
-Bt.component("FcTable", jy);
-Bt.component("FcCell", Gy);
-Bt.component("FcInlineForm", jc);
-Bt.component("TableForm", Uy);
-Bt.component("TableFormPro", Hy);
-Bt.component("NestedTableForm", Wy);
-Bt.component("InfiniteTableForm", zy);
-Bt.component("DataTable", Vc);
-Bt.component("FcValue", Ky);
-Bt.component("FcCity", dx);
-Bt.component("AudioBox", h0);
-Bt.component("VideoBox", U0);
-Bt.component("BarCodeBox", j0);
-Bt.component("IframeBox", m0);
-Bt.component("QrCodeBox", z0);
-Bt.component("SignaturePad", Ex);
-Bt.component("FcEcharts", Jy);
-Bt.component("FcTitle", Zy);
-Bt.component("FcDataSelect", p0);
-Bt.component("FcMarkdown", f0);
-Bt.component("FcId", Xy);
+Y0(Bt);
+Bt.component("FcSlot", Jy);
+Bt.component("FcJson", Xy);
+Bt.component("StepForm", B2);
+Bt.component("FcPopup", W2);
+Bt.component("FcTable", Hy);
+Bt.component("FcCell", Yy);
+Bt.component("FcInlineForm", Uc);
+Bt.component("TableForm", zy);
+Bt.component("TableFormPro", Wy);
+Bt.component("NestedTableForm", Ky);
+Bt.component("InfiniteTableForm", Gy);
+Bt.component("DataTable", jc);
+Bt.component("FcValue", Qy);
+Bt.component("FcCity", cx);
+Bt.component("AudioBox", v0);
+Bt.component("VideoBox", z0);
+Bt.component("BarCodeBox", H0);
+Bt.component("IframeBox", g0);
+Bt.component("QrCodeBox", G0);
+Bt.component("SignaturePad", Tx);
+Bt.component("FcEcharts", Zy);
+Bt.component("FcTitle", e0);
+Bt.component("FcDataSelect", m0);
+Bt.component("FcMarkdown", p0);
+Bt.component("FcId", qy);
Bt.loadjs = kn;
-const xI = Be({
+const kI = Be({
name: "StepFormView",
props: {
stepsProps: Object,
@@ -21978,10 +21978,10 @@ const xI = Be({
this.activeRef && (this.active = this.formCreateInject.children.indexOf(this.activeRef));
});
}
-}), TI = { class: "_fd-step-form" };
-function kI(e, t, i, r, n, a) {
+}), OI = { class: "_fd-step-form" };
+function $I(e, t, i, r, n, a) {
const s = ee("van-step"), u = ee("van-steps"), d = ee("van-button"), p = ee("van-col"), h = ee("van-row");
- return H(), ae("div", TI, [
+ return H(), ae("div", OI, [
z(u, jt({ active: e.active }, e.stepsProps), {
default: N(() => [
(H(!0), ae(Me, null, ze(e.stepItemRef, (g, _) => (H(), me(s, {
@@ -22035,8 +22035,8 @@ function kI(e, t, i, r, n, a) {
})
]);
}
-const K0 = /* @__PURE__ */ Ve(xI, [["render", kI]]);
-const OI = Be({
+const Q0 = /* @__PURE__ */ Ve(kI, [["render", $I]]);
+const RI = Be({
name: "StepFormItemView",
props: {
title: String,
@@ -22055,9 +22055,9 @@ const OI = Be({
this.stepForm.stepItemRef.splice(this.stepForm.stepItemRef.indexOf(this), 1);
},
methods: {}
-}), $I = { class: "_fd-step-form-item" };
-function RI(e, t, i, r, n, a) {
- return H(), ae("div", $I, [
+}), DI = { class: "_fd-step-form-item" };
+function II(e, t, i, r, n, a) {
+ return H(), ae("div", DI, [
bn(J("div", null, [
kt(e.$slots, "default")
], 512), [
@@ -22065,8 +22065,8 @@ function RI(e, t, i, r, n, a) {
])
]);
}
-const Y0 = /* @__PURE__ */ Ve(OI, [["render", RI]]);
-const DI = Be({
+const J0 = /* @__PURE__ */ Ve(RI, [["render", II]]);
+const FI = Be({
name: "FcPopup",
inject: ["designer"],
inheritAttrs: !1,
@@ -22085,19 +22085,19 @@ const DI = Be({
return this.designer.setupState.t;
}
}
-}), II = { class: "_fd-popup-title" }, FI = { class: "_fd-popup-content" }, PI = { class: "_fd-popup-footer" };
-function MI(e, t, i, r, n, a) {
+}), PI = { class: "_fd-popup-title" }, MI = { class: "_fd-popup-content" }, LI = { class: "_fd-popup-footer" };
+function NI(e, t, i, r, n, a) {
const s = ee("van-button");
return H(), ae("div", {
class: "van-popup van-popup--bottom _fd-popup",
style: wn(`--fc-dialog-height:${e.dragConHeight - 23}px;`)
}, [
t[0] || (t[0] = J("i", { class: "van-badge__wrapper van-icon van-icon-cross van-popup__close-icon van-popup__close-icon--top-right van-haptics-feedback" }, null, -1)),
- J("div", II, le(e.title), 1),
- J("div", FI, [
+ J("div", PI, le(e.title), 1),
+ J("div", MI, [
kt(e.$slots, "default")
]),
- J("div", PI, [
+ J("div", LI, [
e.footer !== !1 ? (H(), ae(Me, { key: 0 }, [
z(s, {
block: "",
@@ -22125,6132 +22125,6134 @@ function MI(e, t, i, r, n, a) {
])
], 4);
}
-const _c = /* @__PURE__ */ Ve(DI, [["render", MI]]), LI = Bt, qo = Bt.factory();
-G0(qo);
-qo.setDriver("elm", {
+const wc = /* @__PURE__ */ Ve(FI, [["render", NI]]), BI = Bt, Zo = Bt.factory();
+Y0(Zo);
+Zo.setDriver("elm", {
parsers: {
stepForm: {
mergeProp(e) {
- e.prop.component = K0;
+ e.prop.component = Q0;
}
},
stepFormItem: {
mergeProp(e) {
- e.prop.component = Y0;
+ e.prop.component = J0;
}
},
fcDialog: {
mergeProp(e) {
- e.prop.component = _c;
+ e.prop.component = wc;
}
},
fcDrawer: {
mergeProp(e) {
- e.prop.component = _c;
+ e.prop.component = wc;
}
}
}
});
-qo.component("MStepForm", K0);
-qo.component("MStepFormItemView", Y0);
-qo.component("PopupView", _c);
-let Q0 = null, eu = Bs(null);
-function wc(...e) {
- return Q0(...e);
+Zo.component("MStepForm", Q0);
+Zo.component("MStepFormItemView", J0);
+Zo.component("PopupView", wc);
+let X0 = null, eu = Bs(null);
+function Ac(...e) {
+ return X0(...e);
}
-const J0 = (e) => {
- eu.value = e || ry;
- const t = oc(eu);
- return Q0 = t.t, t;
+const Z0 = (e) => {
+ eu.value = e || ay;
+ const t = ac(eu);
+ return X0 = t.t, t;
};
-J0();
-var to = { exports: {} };
-(function(e, t) {
- (function(i, r) {
- e.exports = r();
- })(Lc, function() {
- var i = navigator.userAgent, r = navigator.platform, n = /gecko\/\d/i.test(i), a = /MSIE \d/.test(i), s = /Trident\/(?:[7-9]|\d{2,})\..*rv:(\d+)/.exec(i), u = /Edge\/(\d+)/.exec(i), d = a || s || u, p = d && (a ? document.documentMode || 6 : +(u || s)[1]), h = !u && /WebKit\//.test(i), g = h && /Qt\/\d+\.\d+/.test(i), _ = !u && /Chrome\/(\d+)/.exec(i), S = _ && +_[1], b = /Opera\//.test(i), A = /Apple Computer/.test(navigator.vendor), y = /Mac OS X 1\d\D([8-9]|\d\d)\D/.test(i), m = /PhantomJS/.test(i), w = A && (/Mobile\/\w+/.test(i) || navigator.maxTouchPoints > 2), E = /Android/.test(i), x = w || E || /webOS|BlackBerry|Opera Mini|Opera Mobi|IEMobile/i.test(i), k = w || /Mac/.test(r), R = /\bCrOS\b/.test(i), M = /win/i.test(r), P = b && i.match(/Version\/(\d*\.\d*)/);
- P && (P = Number(P[1])), P && P >= 15 && (b = !1, h = !0);
- var B = k && (g || b && (P == null || P < 12.11)), T = n || d && p >= 9;
- function D(o) {
- return new RegExp("(^|\\s)" + o + "(?:$|\\s)\\s*");
- }
- var V = function(o, l) {
- var c = o.className, f = D(l).exec(c);
- if (f) {
- var v = c.slice(f.index + f[0].length);
- o.className = c.slice(0, f.index) + (v ? f[1] + v : "");
+Z0();
+var Bf = { exports: {} }, tg;
+function qo() {
+ return tg || (tg = 1, function(e, t) {
+ (function(i, r) {
+ e.exports = r();
+ })(Nc, function() {
+ var i = navigator.userAgent, r = navigator.platform, n = /gecko\/\d/i.test(i), a = /MSIE \d/.test(i), s = /Trident\/(?:[7-9]|\d{2,})\..*rv:(\d+)/.exec(i), u = /Edge\/(\d+)/.exec(i), d = a || s || u, p = d && (a ? document.documentMode || 6 : +(u || s)[1]), h = !u && /WebKit\//.test(i), g = h && /Qt\/\d+\.\d+/.test(i), _ = !u && /Chrome\/(\d+)/.exec(i), S = _ && +_[1], b = /Opera\//.test(i), A = /Apple Computer/.test(navigator.vendor), y = /Mac OS X 1\d\D([8-9]|\d\d)\D/.test(i), m = /PhantomJS/.test(i), w = A && (/Mobile\/\w+/.test(i) || navigator.maxTouchPoints > 2), E = /Android/.test(i), x = w || E || /webOS|BlackBerry|Opera Mini|Opera Mobi|IEMobile/i.test(i), k = w || /Mac/.test(r), R = /\bCrOS\b/.test(i), M = /win/i.test(r), P = b && i.match(/Version\/(\d*\.\d*)/);
+ P && (P = Number(P[1])), P && P >= 15 && (b = !1, h = !0);
+ var B = k && (g || b && (P == null || P < 12.11)), T = n || d && p >= 9;
+ function D(o) {
+ return new RegExp("(^|\\s)" + o + "(?:$|\\s)\\s*");
}
- };
- function W(o) {
- for (var l = o.childNodes.length; l > 0; --l)
- o.removeChild(o.firstChild);
- return o;
- }
- function G(o, l) {
- return W(o).appendChild(l);
- }
- function I(o, l, c, f) {
- var v = document.createElement(o);
- if (c && (v.className = c), f && (v.style.cssText = f), typeof l == "string")
- v.appendChild(document.createTextNode(l));
- else if (l)
- for (var O = 0; O < l.length; ++O)
- v.appendChild(l[O]);
- return v;
- }
- function U(o, l, c, f) {
- var v = I(o, l, c, f);
- return v.setAttribute("role", "presentation"), v;
- }
- var F;
- document.createRange ? F = function(o, l, c, f) {
- var v = document.createRange();
- return v.setEnd(f || o, c), v.setStart(o, l), v;
- } : F = function(o, l, c) {
- var f = document.body.createTextRange();
- try {
- f.moveToElementText(o.parentNode);
- } catch {
- return f;
- }
- return f.collapse(!0), f.moveEnd("character", c), f.moveStart("character", l), f;
- };
- function C(o, l) {
- if (l.nodeType == 3 && (l = l.parentNode), o.contains)
- return o.contains(l);
- do
- if (l.nodeType == 11 && (l = l.host), l == o)
- return !0;
- while (l = l.parentNode);
- }
- function q(o) {
- var l;
- try {
- l = o.activeElement;
- } catch {
- l = o.body || null;
- }
- for (; l && l.shadowRoot && l.shadowRoot.activeElement; )
- l = l.shadowRoot.activeElement;
- return l;
- }
- function Z(o, l) {
- var c = o.className;
- D(l).test(c) || (o.className += (c ? " " : "") + l);
- }
- function Y(o, l) {
- for (var c = o.split(" "), f = 0; f < c.length; f++)
- c[f] && !D(c[f]).test(l) && (l += " " + c[f]);
- return l;
- }
- var ue = function(o) {
- o.select();
- };
- w ? ue = function(o) {
- o.selectionStart = 0, o.selectionEnd = o.value.length;
- } : d && (ue = function(o) {
- try {
- o.select();
- } catch {
- }
- });
- function te(o) {
- return o.display.wrapper.ownerDocument;
- }
- function pe(o) {
- return te(o).defaultView;
- }
- function ke(o) {
- var l = Array.prototype.slice.call(arguments, 1);
- return function() {
- return o.apply(null, l);
+ var V = function(o, l) {
+ var c = o.className, f = D(l).exec(c);
+ if (f) {
+ var v = c.slice(f.index + f[0].length);
+ o.className = c.slice(0, f.index) + (v ? f[1] + v : "");
+ }
};
- }
- function ge(o, l, c) {
- l || (l = {});
- for (var f in o)
- o.hasOwnProperty(f) && (c !== !1 || !l.hasOwnProperty(f)) && (l[f] = o[f]);
- return l;
- }
- function ve(o, l, c, f, v) {
- l == null && (l = o.search(/[^\s\u00a0]/), l == -1 && (l = o.length));
- for (var O = f || 0, L = v || 0; ; ) {
- var j = o.indexOf(" ", O);
- if (j < 0 || j >= l)
- return L + (l - O);
- L += j - O, L += c - L % c, O = j + 1;
+ function W(o) {
+ for (var l = o.childNodes.length; l > 0; --l)
+ o.removeChild(o.firstChild);
+ return o;
}
- }
- var we = function() {
- this.id = null, this.f = null, this.time = 0, this.handler = ke(this.onTimeout, this);
- };
- we.prototype.onTimeout = function(o) {
- o.id = 0, o.time <= +new Date() ? o.f() : setTimeout(o.handler, o.time - +new Date());
- }, we.prototype.set = function(o, l) {
- this.f = l;
- var c = +new Date() + o;
- (!this.id || c < this.time) && (clearTimeout(this.id), this.id = setTimeout(this.handler, o), this.time = c);
- };
- function he(o, l) {
- for (var c = 0; c < o.length; ++c)
- if (o[c] == l)
- return c;
- return -1;
- }
- var Se = 50, xe = { toString: function() {
- return "CodeMirror.Pass";
- } }, $ = { scroll: !1 }, K = { origin: "*mouse" }, X = { origin: "+move" };
- function ie(o, l, c) {
- for (var f = 0, v = 0; ; ) {
- var O = o.indexOf(" ", f);
- O == -1 && (O = o.length);
- var L = O - f;
- if (O == o.length || v + L >= l)
- return f + Math.min(L, l - v);
- if (v += O - f, v += c - v % c, f = O + 1, v >= l)
+ function G(o, l) {
+ return W(o).appendChild(l);
+ }
+ function I(o, l, c, f) {
+ var v = document.createElement(o);
+ if (c && (v.className = c), f && (v.style.cssText = f), typeof l == "string")
+ v.appendChild(document.createTextNode(l));
+ else if (l)
+ for (var O = 0; O < l.length; ++O)
+ v.appendChild(l[O]);
+ return v;
+ }
+ function U(o, l, c, f) {
+ var v = I(o, l, c, f);
+ return v.setAttribute("role", "presentation"), v;
+ }
+ var F;
+ document.createRange ? F = function(o, l, c, f) {
+ var v = document.createRange();
+ return v.setEnd(f || o, c), v.setStart(o, l), v;
+ } : F = function(o, l, c) {
+ var f = document.body.createTextRange();
+ try {
+ f.moveToElementText(o.parentNode);
+ } catch {
return f;
- }
- }
- var re = [""];
- function fe(o) {
- for (; re.length <= o; )
- re.push(Ae(re) + " ");
- return re[o];
- }
- function Ae(o) {
- return o[o.length - 1];
- }
- function Fe(o, l) {
- for (var c = [], f = 0; f < o.length; f++)
- c[f] = l(o[f], f);
- return c;
- }
- function Xe(o, l, c) {
- for (var f = 0, v = c(l); f < o.length && c(o[f]) <= v; )
- f++;
- o.splice(f, 0, l);
- }
- function Ze() {
- }
- function _e(o, l) {
- var c;
- return Object.create ? c = Object.create(o) : (Ze.prototype = o, c = new Ze()), l && ge(l, c), c;
- }
- var Le = /[\u00df\u0587\u0590-\u05f4\u0600-\u06ff\u3040-\u309f\u30a0-\u30ff\u3400-\u4db5\u4e00-\u9fcc\uac00-\ud7af]/;
- function Oe(o) {
- return /\w/.test(o) || o > "\x80" && (o.toUpperCase() != o.toLowerCase() || Le.test(o));
- }
- function it(o, l) {
- return l ? l.source.indexOf("\\w") > -1 && Oe(o) ? !0 : l.test(o) : Oe(o);
- }
- function pt(o) {
- for (var l in o)
- if (o.hasOwnProperty(l) && o[l])
- return !1;
- return !0;
- }
- var Re = /[\u0300-\u036f\u0483-\u0489\u0591-\u05bd\u05bf\u05c1\u05c2\u05c4\u05c5\u05c7\u0610-\u061a\u064b-\u065e\u0670\u06d6-\u06dc\u06de-\u06e4\u06e7\u06e8\u06ea-\u06ed\u0711\u0730-\u074a\u07a6-\u07b0\u07eb-\u07f3\u0816-\u0819\u081b-\u0823\u0825-\u0827\u0829-\u082d\u0900-\u0902\u093c\u0941-\u0948\u094d\u0951-\u0955\u0962\u0963\u0981\u09bc\u09be\u09c1-\u09c4\u09cd\u09d7\u09e2\u09e3\u0a01\u0a02\u0a3c\u0a41\u0a42\u0a47\u0a48\u0a4b-\u0a4d\u0a51\u0a70\u0a71\u0a75\u0a81\u0a82\u0abc\u0ac1-\u0ac5\u0ac7\u0ac8\u0acd\u0ae2\u0ae3\u0b01\u0b3c\u0b3e\u0b3f\u0b41-\u0b44\u0b4d\u0b56\u0b57\u0b62\u0b63\u0b82\u0bbe\u0bc0\u0bcd\u0bd7\u0c3e-\u0c40\u0c46-\u0c48\u0c4a-\u0c4d\u0c55\u0c56\u0c62\u0c63\u0cbc\u0cbf\u0cc2\u0cc6\u0ccc\u0ccd\u0cd5\u0cd6\u0ce2\u0ce3\u0d3e\u0d41-\u0d44\u0d4d\u0d57\u0d62\u0d63\u0dca\u0dcf\u0dd2-\u0dd4\u0dd6\u0ddf\u0e31\u0e34-\u0e3a\u0e47-\u0e4e\u0eb1\u0eb4-\u0eb9\u0ebb\u0ebc\u0ec8-\u0ecd\u0f18\u0f19\u0f35\u0f37\u0f39\u0f71-\u0f7e\u0f80-\u0f84\u0f86\u0f87\u0f90-\u0f97\u0f99-\u0fbc\u0fc6\u102d-\u1030\u1032-\u1037\u1039\u103a\u103d\u103e\u1058\u1059\u105e-\u1060\u1071-\u1074\u1082\u1085\u1086\u108d\u109d\u135f\u1712-\u1714\u1732-\u1734\u1752\u1753\u1772\u1773\u17b7-\u17bd\u17c6\u17c9-\u17d3\u17dd\u180b-\u180d\u18a9\u1920-\u1922\u1927\u1928\u1932\u1939-\u193b\u1a17\u1a18\u1a56\u1a58-\u1a5e\u1a60\u1a62\u1a65-\u1a6c\u1a73-\u1a7c\u1a7f\u1b00-\u1b03\u1b34\u1b36-\u1b3a\u1b3c\u1b42\u1b6b-\u1b73\u1b80\u1b81\u1ba2-\u1ba5\u1ba8\u1ba9\u1c2c-\u1c33\u1c36\u1c37\u1cd0-\u1cd2\u1cd4-\u1ce0\u1ce2-\u1ce8\u1ced\u1dc0-\u1de6\u1dfd-\u1dff\u200c\u200d\u20d0-\u20f0\u2cef-\u2cf1\u2de0-\u2dff\u302a-\u302f\u3099\u309a\ua66f-\ua672\ua67c\ua67d\ua6f0\ua6f1\ua802\ua806\ua80b\ua825\ua826\ua8c4\ua8e0-\ua8f1\ua926-\ua92d\ua947-\ua951\ua980-\ua982\ua9b3\ua9b6-\ua9b9\ua9bc\uaa29-\uaa2e\uaa31\uaa32\uaa35\uaa36\uaa43\uaa4c\uaab0\uaab2-\uaab4\uaab7\uaab8\uaabe\uaabf\uaac1\uabe5\uabe8\uabed\udc00-\udfff\ufb1e\ufe00-\ufe0f\ufe20-\ufe26\uff9e\uff9f]/;
- function He(o) {
- return o.charCodeAt(0) >= 768 && Re.test(o);
- }
- function at(o, l, c) {
- for (; (c < 0 ? l > 0 : l < o.length) && He(o.charAt(l)); )
- l += c;
- return l;
- }
- function We(o, l, c) {
- for (var f = l > c ? -1 : 1; ; ) {
- if (l == c)
- return l;
- var v = (l + c) / 2, O = f < 0 ? Math.ceil(v) : Math.floor(v);
- if (O == l)
- return o(O) ? l : c;
- o(O) ? c = O : l = O + f;
- }
- }
- function $t(o, l, c, f) {
- if (!o)
- return f(l, c, "ltr", 0);
- for (var v = !1, O = 0; O < o.length; ++O) {
- var L = o[O];
- (L.from < c && L.to > l || l == c && L.to == l) && (f(Math.max(L.from, l), Math.min(L.to, c), L.level == 1 ? "rtl" : "ltr", O), v = !0);
- }
- v || f(l, c, "ltr");
- }
- var ft = null;
- function je(o, l, c) {
- var f;
- ft = null;
- for (var v = 0; v < o.length; ++v) {
- var O = o[v];
- if (O.from < l && O.to > l)
- return v;
- O.to == l && (O.from != O.to && c == "before" ? f = v : ft = v), O.from == l && (O.from != O.to && c != "before" ? f = v : ft = v);
- }
- return f != null ? f : ft;
- }
- var Je = function() {
- var o = "bbbbbbbbbtstwsbbbbbbbbbbbbbbssstwNN%%%NNNNNN,N,N1111111111NNNNNNNLLLLLLLLLLLLLLLLLLLLLLLLLLNNNNNNLLLLLLLLLLLLLLLLLLLLLLLLLLNNNNbbbbbbsbbbbbbbbbbbbbbbbbbbbbbbbbb,N%%%%NNNNLNNNNN%%11NLNNN1LNNNNNLLLLLLLLLLLLLLLLLLLLLLLNLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLN", l = "nnnnnnNNr%%r,rNNmmmmmmmmmmmrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrmmmmmmmmmmmmmmmmmmmmmnnnnnnnnnn%nnrrrmrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrmmmmmmmnNmmmmmmrrmmNmmmmrr1111111111";
- function c(ne) {
- return ne <= 247 ? o.charAt(ne) : 1424 <= ne && ne <= 1524 ? "R" : 1536 <= ne && ne <= 1785 ? l.charAt(ne - 1536) : 1774 <= ne && ne <= 2220 ? "r" : 8192 <= ne && ne <= 8203 ? "w" : ne == 8204 ? "b" : "L";
- }
- var f = /[\u0590-\u05f4\u0600-\u06ff\u0700-\u08ac]/, v = /[stwN]/, O = /[LRr]/, L = /[Lb1n]/, j = /[1n]/;
- function Q(ne, se, de) {
- this.level = ne, this.from = se, this.to = de;
- }
- return function(ne, se) {
- var de = se == "ltr" ? "L" : "R";
- if (ne.length == 0 || se == "ltr" && !f.test(ne))
- return !1;
- for (var Ee = ne.length, Ce = [], Ie = 0; Ie < Ee; ++Ie)
- Ce.push(c(ne.charCodeAt(Ie)));
- for (var Ne = 0, Ue = de; Ne < Ee; ++Ne) {
- var Ye = Ce[Ne];
- Ye == "m" ? Ce[Ne] = Ue : Ue = Ye;
}
- for (var nt = 0, Qe = de; nt < Ee; ++nt) {
- var ot = Ce[nt];
- ot == "1" && Qe == "r" ? Ce[nt] = "n" : O.test(ot) && (Qe = ot, ot == "r" && (Ce[nt] = "R"));
- }
- for (var mt = 1, ct = Ce[0]; mt < Ee - 1; ++mt) {
- var Et = Ce[mt];
- Et == "+" && ct == "1" && Ce[mt + 1] == "1" ? Ce[mt] = "1" : Et == "," && ct == Ce[mt + 1] && (ct == "1" || ct == "n") && (Ce[mt] = ct), ct = Et;
- }
- for (var Vt = 0; Vt < Ee; ++Vt) {
- var vn = Ce[Vt];
- if (vn == ",")
- Ce[Vt] = "N";
- else if (vn == "%") {
- var Jt = void 0;
- for (Jt = Vt + 1; Jt < Ee && Ce[Jt] == "%"; ++Jt)
- ;
- for (var Gn = Vt && Ce[Vt - 1] == "!" || Jt < Ee && Ce[Jt] == "1" ? "1" : "N", Bn = Vt; Bn < Jt; ++Bn)
- Ce[Bn] = Gn;
- Vt = Jt - 1;
- }
- }
- for (var ln = 0, Vn = de; ln < Ee; ++ln) {
- var An = Ce[ln];
- Vn == "L" && An == "1" ? Ce[ln] = "L" : O.test(An) && (Vn = An);
- }
- for (var dn = 0; dn < Ee; ++dn)
- if (v.test(Ce[dn])) {
- var sn = void 0;
- for (sn = dn + 1; sn < Ee && v.test(Ce[sn]); ++sn)
- ;
- for (var qt = (dn ? Ce[dn - 1] : de) == "L", jn = (sn < Ee ? Ce[sn] : de) == "L", So = qt == jn ? qt ? "L" : "R" : de, Ar = dn; Ar < sn; ++Ar)
- Ce[Ar] = So;
- dn = sn - 1;
- }
- for (var xn = [], Mi, gn = 0; gn < Ee; )
- if (L.test(Ce[gn])) {
- var Sd = gn;
- for (++gn; gn < Ee && L.test(Ce[gn]); ++gn)
- ;
- xn.push(new Q(0, Sd, gn));
- } else {
- var er = gn, Vr = xn.length, jr = se == "rtl" ? 1 : 0;
- for (++gn; gn < Ee && Ce[gn] != "L"; ++gn)
- ;
- for (var $n = er; $n < gn; )
- if (j.test(Ce[$n])) {
- er < $n && (xn.splice(Vr, 0, new Q(1, er, $n)), Vr += jr);
- var Eo = $n;
- for (++$n; $n < gn && j.test(Ce[$n]); ++$n)
- ;
- xn.splice(Vr, 0, new Q(2, Eo, $n)), Vr += jr, er = $n;
- } else
- ++$n;
- er < gn && xn.splice(Vr, 0, new Q(1, er, gn));
- }
- return se == "ltr" && (xn[0].level == 1 && (Mi = ne.match(/^\s+/)) && (xn[0].from = Mi[0].length, xn.unshift(new Q(0, 0, Mi[0].length))), Ae(xn).level == 1 && (Mi = ne.match(/\s+$/)) && (Ae(xn).to -= Mi[0].length, xn.push(new Q(0, Ee - Mi[0].length, Ee)))), se == "rtl" ? xn.reverse() : xn;
+ return f.collapse(!0), f.moveEnd("character", c), f.moveStart("character", l), f;
};
- }();
- function ht(o, l) {
- var c = o.order;
- return c == null && (c = o.order = Je(o.text, l)), c;
- }
- var Ge = [], $e = function(o, l, c) {
- if (o.addEventListener)
- o.addEventListener(l, c, !1);
- else if (o.attachEvent)
- o.attachEvent("on" + l, c);
- else {
- var f = o._handlers || (o._handlers = {});
- f[l] = (f[l] || Ge).concat(c);
+ function C(o, l) {
+ if (l.nodeType == 3 && (l = l.parentNode), o.contains)
+ return o.contains(l);
+ do
+ if (l.nodeType == 11 && (l = l.host), l == o)
+ return !0;
+ while (l = l.parentNode);
}
- };
- function dt(o, l) {
- return o._handlers && o._handlers[l] || Ge;
- }
- function lt(o, l, c) {
- if (o.removeEventListener)
- o.removeEventListener(l, c, !1);
- else if (o.detachEvent)
- o.detachEvent("on" + l, c);
- else {
- var f = o._handlers, v = f && f[l];
- if (v) {
- var O = he(v, c);
- O > -1 && (f[l] = v.slice(0, O).concat(v.slice(O + 1)));
+ function q(o) {
+ var l;
+ try {
+ l = o.activeElement;
+ } catch {
+ l = o.body || null;
}
- }
- }
- function st(o, l) {
- var c = dt(o, l);
- if (!!c.length)
- for (var f = Array.prototype.slice.call(arguments, 2), v = 0; v < c.length; ++v)
- c[v].apply(null, f);
- }
- function Ct(o, l, c) {
- return typeof l == "string" && (l = { type: l, preventDefault: function() {
- this.defaultPrevented = !0;
- } }), st(o, c || l.type, o, l), ur(l) || l.codemirrorIgnore;
- }
- function Pn(o) {
- var l = o._handlers && o._handlers.cursorActivity;
- if (!!l)
- for (var c = o.curOp.cursorActivityHandlers || (o.curOp.cursorActivityHandlers = []), f = 0; f < l.length; ++f)
- he(c, l[f]) == -1 && c.push(l[f]);
- }
- function Qt(o, l) {
- return dt(o, l).length > 0;
- }
- function zt(o) {
- o.prototype.on = function(l, c) {
- $e(this, l, c);
- }, o.prototype.off = function(l, c) {
- lt(this, l, c);
- };
- }
- function It(o) {
- o.preventDefault ? o.preventDefault() : o.returnValue = !1;
- }
- function ui(o) {
- o.stopPropagation ? o.stopPropagation() : o.cancelBubble = !0;
- }
- function ur(o) {
- return o.defaultPrevented != null ? o.defaultPrevented : o.returnValue == !1;
- }
- function yi(o) {
- It(o), ui(o);
- }
- function Mn(o) {
- return o.target || o.srcElement;
- }
- function ra(o) {
- var l = o.which;
- return l == null && (o.button & 1 ? l = 1 : o.button & 2 ? l = 3 : o.button & 4 && (l = 2)), k && o.ctrlKey && l == 1 && (l = 3), l;
- }
- var Du = function() {
- if (d && p < 9)
- return !1;
- var o = I("div");
- return "draggable" in o || "dragDrop" in o;
- }(), di;
- function Iu(o) {
- if (di == null) {
- var l = I("span", "\u200B");
- G(o, I("span", [l, document.createTextNode("x")])), o.firstChild.offsetHeight != 0 && (di = l.offsetWidth <= 1 && l.offsetHeight > 2 && !(d && p < 8));
- }
- var c = di ? I("span", "\u200B") : I("span", "\xA0", null, "display: inline-block; width: 1px; margin-right: -1px");
- return c.setAttribute("cm-text", ""), c;
- }
- var io;
- function yl(o) {
- if (io != null)
- return io;
- var l = G(o, document.createTextNode("A\u062EA")), c = F(l, 0, 1).getBoundingClientRect(), f = F(l, 1, 2).getBoundingClientRect();
- return W(o), !c || c.left == c.right ? !1 : io = f.right - c.right < 3;
- }
- var oa = `
-
-b`.split(/\n/).length != 3 ? function(o) {
- for (var l = 0, c = [], f = o.length; l <= f; ) {
- var v = o.indexOf(`
-`, l);
- v == -1 && (v = o.length);
- var O = o.slice(l, o.charAt(v - 1) == "\r" ? v - 1 : v), L = O.indexOf("\r");
- L != -1 ? (c.push(O.slice(0, L)), l += L + 1) : (c.push(O), l = v + 1);
- }
- return c;
- } : function(o) {
- return o.split(/\r\n?|\n/);
- }, dr = window.getSelection ? function(o) {
- try {
- return o.selectionStart != o.selectionEnd;
- } catch {
- return !1;
- }
- } : function(o) {
- var l;
- try {
- l = o.ownerDocument.selection.createRange();
- } catch {
- }
- return !l || l.parentElement() != o ? !1 : l.compareEndPoints("StartToEnd", l) != 0;
- }, $i = function() {
- var o = I("div");
- return "oncopy" in o ? !0 : (o.setAttribute("oncopy", "return;"), typeof o.oncopy == "function");
- }(), Ri = null;
- function bl(o) {
- if (Ri != null)
- return Ri;
- var l = G(o, I("span", "x")), c = l.getBoundingClientRect(), f = F(l, 0, 1).getBoundingClientRect();
- return Ri = Math.abs(c.left - f.left) > 1;
- }
- var bi = {}, fr = {};
- function _l(o, l) {
- arguments.length > 2 && (l.dependencies = Array.prototype.slice.call(arguments, 2)), bi[o] = l;
- }
- function ro(o, l) {
- fr[o] = l;
- }
- function zn(o) {
- if (typeof o == "string" && fr.hasOwnProperty(o))
- o = fr[o];
- else if (o && typeof o.name == "string" && fr.hasOwnProperty(o.name)) {
- var l = fr[o.name];
- typeof l == "string" && (l = { name: l }), o = _e(l, o), o.name = l.name;
- } else {
- if (typeof o == "string" && /^[\w\-]+\/[\w\-]+\+xml$/.test(o))
- return zn("application/xml");
- if (typeof o == "string" && /^[\w\-]+\/[\w\-]+\+json$/.test(o))
- return zn("application/json");
- }
- return typeof o == "string" ? { name: o } : o || { name: "null" };
- }
- function Gi(o, l) {
- l = zn(l);
- var c = bi[l.name];
- if (!c)
- return Gi(o, "text/plain");
- var f = c(o, l);
- if (cr.hasOwnProperty(l.name)) {
- var v = cr[l.name];
- for (var O in v)
- !v.hasOwnProperty(O) || (f.hasOwnProperty(O) && (f["_" + O] = f[O]), f[O] = v[O]);
- }
- if (f.name = l.name, l.helperType && (f.helperType = l.helperType), l.modeProps)
- for (var L in l.modeProps)
- f[L] = l.modeProps[L];
- return f;
- }
- var cr = {};
- function wl(o, l) {
- var c = cr.hasOwnProperty(o) ? cr[o] : cr[o] = {};
- ge(l, c);
- }
- function Ki(o, l) {
- if (l === !0)
+ for (; l && l.shadowRoot && l.shadowRoot.activeElement; )
+ l = l.shadowRoot.activeElement;
return l;
- if (o.copyState)
- return o.copyState(l);
- var c = {};
- for (var f in l) {
- var v = l[f];
- v instanceof Array && (v = v.concat([])), c[f] = v;
}
- return c;
- }
- function pr(o, l) {
- for (var c; o.innerMode && (c = o.innerMode(l), !(!c || c.mode == o)); )
- l = c.state, o = c.mode;
- return c || { mode: o, state: l };
- }
- function aa(o, l, c) {
- return o.startState ? o.startState(l, c) : !0;
- }
- var Zt = function(o, l, c) {
- this.pos = this.start = 0, this.string = o, this.tabSize = l || 8, this.lastColumnPos = this.lastColumnValue = 0, this.lineStart = 0, this.lineOracle = c;
- };
- Zt.prototype.eol = function() {
- return this.pos >= this.string.length;
- }, Zt.prototype.sol = function() {
- return this.pos == this.lineStart;
- }, Zt.prototype.peek = function() {
- return this.string.charAt(this.pos) || void 0;
- }, Zt.prototype.next = function() {
- if (this.pos < this.string.length)
- return this.string.charAt(this.pos++);
- }, Zt.prototype.eat = function(o) {
- var l = this.string.charAt(this.pos), c;
- if (typeof o == "string" ? c = l == o : c = l && (o.test ? o.test(l) : o(l)), c)
- return ++this.pos, l;
- }, Zt.prototype.eatWhile = function(o) {
- for (var l = this.pos; this.eat(o); )
- ;
- return this.pos > l;
- }, Zt.prototype.eatSpace = function() {
- for (var o = this.pos; /[\s\u00a0]/.test(this.string.charAt(this.pos)); )
- ++this.pos;
- return this.pos > o;
- }, Zt.prototype.skipToEnd = function() {
- this.pos = this.string.length;
- }, Zt.prototype.skipTo = function(o) {
- var l = this.string.indexOf(o, this.pos);
- if (l > -1)
- return this.pos = l, !0;
- }, Zt.prototype.backUp = function(o) {
- this.pos -= o;
- }, Zt.prototype.column = function() {
- return this.lastColumnPos < this.start && (this.lastColumnValue = ve(this.string, this.start, this.tabSize, this.lastColumnPos, this.lastColumnValue), this.lastColumnPos = this.start), this.lastColumnValue - (this.lineStart ? ve(this.string, this.lineStart, this.tabSize) : 0);
- }, Zt.prototype.indentation = function() {
- return ve(this.string, null, this.tabSize) - (this.lineStart ? ve(this.string, this.lineStart, this.tabSize) : 0);
- }, Zt.prototype.match = function(o, l, c) {
- if (typeof o == "string") {
- var f = function(L) {
- return c ? L.toLowerCase() : L;
- }, v = this.string.substr(this.pos, o.length);
- if (f(v) == f(o))
- return l !== !1 && (this.pos += o.length), !0;
- } else {
- var O = this.string.slice(this.pos).match(o);
- return O && O.index > 0 ? null : (O && l !== !1 && (this.pos += O[0].length), O);
+ function Z(o, l) {
+ var c = o.className;
+ D(l).test(c) || (o.className += (c ? " " : "") + l);
}
- }, Zt.prototype.current = function() {
- return this.string.slice(this.start, this.pos);
- }, Zt.prototype.hideFirstChars = function(o, l) {
- this.lineStart += o;
- try {
- return l();
- } finally {
- this.lineStart -= o;
+ function Y(o, l) {
+ for (var c = o.split(" "), f = 0; f < c.length; f++)
+ c[f] && !D(c[f]).test(l) && (l += " " + c[f]);
+ return l;
}
- }, Zt.prototype.lookAhead = function(o) {
- var l = this.lineOracle;
- return l && l.lookAhead(o);
- }, Zt.prototype.baseToken = function() {
- var o = this.lineOracle;
- return o && o.baseToken(this.pos);
- };
- function ut(o, l) {
- if (l -= o.first, l < 0 || l >= o.size)
- throw new Error("There is no line " + (l + o.first) + " in the document.");
- for (var c = o; !c.lines; )
- for (var f = 0; ; ++f) {
- var v = c.children[f], O = v.chunkSize();
- if (l < O) {
- c = v;
- break;
- }
- l -= O;
- }
- return c.lines[l];
- }
- function Yi(o, l, c) {
- var f = [], v = l.line;
- return o.iter(l.line, c.line + 1, function(O) {
- var L = O.text;
- v == c.line && (L = L.slice(0, c.ch)), v == l.line && (L = L.slice(l.ch)), f.push(L), ++v;
- }), f;
- }
- function oo(o, l, c) {
- var f = [];
- return o.iter(l, c, function(v) {
- f.push(v.text);
- }), f;
- }
- function fi(o, l) {
- var c = l - o.height;
- if (c)
- for (var f = o; f; f = f.parent)
- f.height += c;
- }
- function Ft(o) {
- if (o.parent == null)
- return null;
- for (var l = o.parent, c = he(l.lines, o), f = l.parent; f; l = f, f = f.parent)
- for (var v = 0; f.children[v] != l; ++v)
- c += f.children[v].chunkSize();
- return c + l.first;
- }
- function Di(o, l) {
- var c = o.first;
- e:
- do {
- for (var f = 0; f < o.children.length; ++f) {
- var v = o.children[f], O = v.height;
- if (l < O) {
- o = v;
- continue e;
- }
- l -= O, c += v.chunkSize();
- }
- return c;
- } while (!o.lines);
- for (var L = 0; L < o.lines.length; ++L) {
- var j = o.lines[L], Q = j.height;
- if (l < Q)
- break;
- l -= Q;
- }
- return c + L;
- }
- function oe(o, l) {
- return l >= o.first && l < o.first + o.size;
- }
- function ce(o, l) {
- return String(o.lineNumberFormatter(l + o.firstLineNumber));
- }
- function ye(o, l, c) {
- if (c === void 0 && (c = null), !(this instanceof ye))
- return new ye(o, l, c);
- this.line = o, this.ch = l, this.sticky = c;
- }
- function De(o, l) {
- return o.line - l.line || o.ch - l.ch;
- }
- function bt(o, l) {
- return o.sticky == l.sticky && De(o, l) == 0;
- }
- function Ot(o) {
- return ye(o.line, o.ch);
- }
- function Rt(o, l) {
- return De(o, l) < 0 ? l : o;
- }
- function un(o, l) {
- return De(o, l) < 0 ? o : l;
- }
- function qn(o, l) {
- return Math.max(o.first, Math.min(l, o.first + o.size - 1));
- }
- function _t(o, l) {
- if (l.line < o.first)
- return ye(o.first, 0);
- var c = o.first + o.size - 1;
- return l.line > c ? ye(c, ut(o, c).text.length) : r1(l, ut(o, l.line).text.length);
- }
- function r1(o, l) {
- var c = o.ch;
- return c == null || c > l ? ye(o.line, l) : c < 0 ? ye(o.line, 0) : o;
- }
- function Wp(o, l) {
- for (var c = [], f = 0; f < l.length; f++)
- c[f] = _t(o, l[f]);
- return c;
- }
- var Al = function(o, l) {
- this.state = o, this.lookAhead = l;
- }, Ii = function(o, l, c, f) {
- this.state = l, this.doc = o, this.line = c, this.maxLookAhead = f || 0, this.baseTokens = null, this.baseTokenPos = 1;
- };
- Ii.prototype.lookAhead = function(o) {
- var l = this.doc.getLine(this.line + o);
- return l != null && o > this.maxLookAhead && (this.maxLookAhead = o), l;
- }, Ii.prototype.baseToken = function(o) {
- if (!this.baseTokens)
- return null;
- for (; this.baseTokens[this.baseTokenPos] <= o; )
- this.baseTokenPos += 2;
- var l = this.baseTokens[this.baseTokenPos + 1];
- return {
- type: l && l.replace(/( |^)overlay .*/, ""),
- size: this.baseTokens[this.baseTokenPos] - o
+ var ue = function(o) {
+ o.select();
};
- }, Ii.prototype.nextLine = function() {
- this.line++, this.maxLookAhead > 0 && this.maxLookAhead--;
- }, Ii.fromSaved = function(o, l, c) {
- return l instanceof Al ? new Ii(o, Ki(o.mode, l.state), c, l.lookAhead) : new Ii(o, Ki(o.mode, l), c);
- }, Ii.prototype.save = function(o) {
- var l = o !== !1 ? Ki(this.doc.mode, this.state) : this.state;
- return this.maxLookAhead > 0 ? new Al(l, this.maxLookAhead) : l;
- };
- function Gp(o, l, c, f) {
- var v = [o.state.modeGen], O = {};
- Zp(
- o,
- l.text,
- o.doc.mode,
- c,
- function(ne, se) {
- return v.push(ne, se);
- },
- O,
- f
- );
- for (var L = c.state, j = function(ne) {
- c.baseTokens = v;
- var se = o.state.overlays[ne], de = 1, Ee = 0;
- c.state = !0, Zp(o, l.text, se.mode, c, function(Ce, Ie) {
- for (var Ne = de; Ee < Ce; ) {
- var Ue = v[de];
- Ue > Ce && v.splice(de, 1, Ce, v[de + 1], Ue), de += 2, Ee = Math.min(Ce, Ue);
- }
- if (!!Ie)
- if (se.opaque)
- v.splice(Ne, de - Ne, Ce, "overlay " + Ie), de = Ne + 2;
- else
- for (; Ne < de; Ne += 2) {
- var Ye = v[Ne + 1];
- v[Ne + 1] = (Ye ? Ye + " " : "") + "overlay " + Ie;
- }
- }, O), c.state = L, c.baseTokens = null, c.baseTokenPos = 1;
- }, Q = 0; Q < o.state.overlays.length; ++Q)
- j(Q);
- return { styles: v, classes: O.bgClass || O.textClass ? O : null };
- }
- function Kp(o, l, c) {
- if (!l.styles || l.styles[0] != o.state.modeGen) {
- var f = la(o, Ft(l)), v = l.text.length > o.options.maxHighlightLength && Ki(o.doc.mode, f.state), O = Gp(o, l, f);
- v && (f.state = v), l.stateAfter = f.save(!v), l.styles = O.styles, O.classes ? l.styleClasses = O.classes : l.styleClasses && (l.styleClasses = null), c === o.doc.highlightFrontier && (o.doc.modeFrontier = Math.max(o.doc.modeFrontier, ++o.doc.highlightFrontier));
- }
- return l.styles;
- }
- function la(o, l, c) {
- var f = o.doc, v = o.display;
- if (!f.mode.startState)
- return new Ii(f, !0, l);
- var O = o1(o, l, c), L = O > f.first && ut(f, O - 1).stateAfter, j = L ? Ii.fromSaved(f, L, O) : new Ii(f, aa(f.mode), O);
- return f.iter(O, l, function(Q) {
- Fu(o, Q.text, j);
- var ne = j.line;
- Q.stateAfter = ne == l - 1 || ne % 5 == 0 || ne >= v.viewFrom && ne < v.viewTo ? j.save() : null, j.nextLine();
- }), c && (f.modeFrontier = j.line), j;
- }
- function Fu(o, l, c, f) {
- var v = o.doc.mode, O = new Zt(l, o.options.tabSize, c);
- for (O.start = O.pos = f || 0, l == "" && Yp(v, c.state); !O.eol(); )
- Pu(v, O, c.state), O.start = O.pos;
- }
- function Yp(o, l) {
- if (o.blankLine)
- return o.blankLine(l);
- if (!!o.innerMode) {
- var c = pr(o, l);
- if (c.mode.blankLine)
- return c.mode.blankLine(c.state);
- }
- }
- function Pu(o, l, c, f) {
- for (var v = 0; v < 10; v++) {
- f && (f[0] = pr(o, c).mode);
- var O = o.token(l, c);
- if (l.pos > l.start)
- return O;
- }
- throw new Error("Mode " + o.name + " failed to advance stream.");
- }
- var Qp = function(o, l, c) {
- this.start = o.start, this.end = o.pos, this.string = o.current(), this.type = l || null, this.state = c;
- };
- function Jp(o, l, c, f) {
- var v = o.doc, O = v.mode, L;
- l = _t(v, l);
- var j = ut(v, l.line), Q = la(o, l.line, c), ne = new Zt(j.text, o.options.tabSize, Q), se;
- for (f && (se = []); (f || ne.pos < l.ch) && !ne.eol(); )
- ne.start = ne.pos, L = Pu(O, ne, Q.state), f && se.push(new Qp(ne, L, Ki(v.mode, Q.state)));
- return f ? se : new Qp(ne, L, Q.state);
- }
- function Xp(o, l) {
- if (o)
- for (; ; ) {
- var c = o.match(/(?:^|\s+)line-(background-)?(\S+)/);
- if (!c)
- break;
- o = o.slice(0, c.index) + o.slice(c.index + c[0].length);
- var f = c[1] ? "bgClass" : "textClass";
- l[f] == null ? l[f] = c[2] : new RegExp("(?:^|\\s)" + c[2] + "(?:$|\\s)").test(l[f]) || (l[f] += " " + c[2]);
+ w ? ue = function(o) {
+ o.selectionStart = 0, o.selectionEnd = o.value.length;
+ } : d && (ue = function(o) {
+ try {
+ o.select();
+ } catch {
}
- return o;
- }
- function Zp(o, l, c, f, v, O, L) {
- var j = c.flattenSpans;
- j == null && (j = o.options.flattenSpans);
- var Q = 0, ne = null, se = new Zt(l, o.options.tabSize, f), de, Ee = o.options.addModeClass && [null];
- for (l == "" && Xp(Yp(c, f.state), O); !se.eol(); ) {
- if (se.pos > o.options.maxHighlightLength ? (j = !1, L && Fu(o, l, f, se.pos), se.pos = l.length, de = null) : de = Xp(Pu(c, se, f.state, Ee), O), Ee) {
- var Ce = Ee[0].name;
- Ce && (de = "m-" + (de ? Ce + " " + de : Ce));
+ });
+ function te(o) {
+ return o.display.wrapper.ownerDocument;
+ }
+ function pe(o) {
+ return te(o).defaultView;
+ }
+ function ke(o) {
+ var l = Array.prototype.slice.call(arguments, 1);
+ return function() {
+ return o.apply(null, l);
+ };
+ }
+ function ge(o, l, c) {
+ l || (l = {});
+ for (var f in o)
+ o.hasOwnProperty(f) && (c !== !1 || !l.hasOwnProperty(f)) && (l[f] = o[f]);
+ return l;
+ }
+ function ve(o, l, c, f, v) {
+ l == null && (l = o.search(/[^\s\u00a0]/), l == -1 && (l = o.length));
+ for (var O = f || 0, L = v || 0; ; ) {
+ var j = o.indexOf(" ", O);
+ if (j < 0 || j >= l)
+ return L + (l - O);
+ L += j - O, L += c - L % c, O = j + 1;
}
- if (!j || ne != de) {
- for (; Q < se.start; )
- Q = Math.min(se.start, Q + 5e3), v(Q, ne);
- ne = de;
- }
- se.start = se.pos;
}
- for (; Q < se.pos; ) {
- var Ie = Math.min(se.pos, Q + 5e3);
- v(Ie, ne), Q = Ie;
+ var we = function() {
+ this.id = null, this.f = null, this.time = 0, this.handler = ke(this.onTimeout, this);
+ };
+ we.prototype.onTimeout = function(o) {
+ o.id = 0, o.time <= +new Date() ? o.f() : setTimeout(o.handler, o.time - +new Date());
+ }, we.prototype.set = function(o, l) {
+ this.f = l;
+ var c = +new Date() + o;
+ (!this.id || c < this.time) && (clearTimeout(this.id), this.id = setTimeout(this.handler, o), this.time = c);
+ };
+ function he(o, l) {
+ for (var c = 0; c < o.length; ++c)
+ if (o[c] == l)
+ return c;
+ return -1;
}
- }
- function o1(o, l, c) {
- for (var f, v, O = o.doc, L = c ? -1 : l - (o.doc.mode.innerMode ? 1e3 : 100), j = l; j > L; --j) {
- if (j <= O.first)
- return O.first;
- var Q = ut(O, j - 1), ne = Q.stateAfter;
- if (ne && (!c || j + (ne instanceof Al ? ne.lookAhead : 0) <= O.modeFrontier))
- return j;
- var se = ve(Q.text, null, o.options.tabSize);
- (v == null || f > se) && (v = j - 1, f = se);
- }
- return v;
- }
- function a1(o, l) {
- if (o.modeFrontier = Math.min(o.modeFrontier, l), !(o.highlightFrontier < l - 10)) {
- for (var c = o.first, f = l - 1; f > c; f--) {
- var v = ut(o, f).stateAfter;
- if (v && (!(v instanceof Al) || f + v.lookAhead < l)) {
- c = f + 1;
- break;
- }
- }
- o.highlightFrontier = Math.min(o.highlightFrontier, c);
- }
- }
- var qp = !1, Qi = !1;
- function l1() {
- qp = !0;
- }
- function s1() {
- Qi = !0;
- }
- function Cl(o, l, c) {
- this.marker = o, this.from = l, this.to = c;
- }
- function sa(o, l) {
- if (o)
- for (var c = 0; c < o.length; ++c) {
- var f = o[c];
- if (f.marker == l)
+ var Se = 50, xe = { toString: function() {
+ return "CodeMirror.Pass";
+ } }, $ = { scroll: !1 }, K = { origin: "*mouse" }, X = { origin: "+move" };
+ function ie(o, l, c) {
+ for (var f = 0, v = 0; ; ) {
+ var O = o.indexOf(" ", f);
+ O == -1 && (O = o.length);
+ var L = O - f;
+ if (O == o.length || v + L >= l)
+ return f + Math.min(L, l - v);
+ if (v += O - f, v += c - v % c, f = O + 1, v >= l)
return f;
}
- }
- function u1(o, l) {
- for (var c, f = 0; f < o.length; ++f)
- o[f] != l && (c || (c = [])).push(o[f]);
- return c;
- }
- function d1(o, l, c) {
- var f = c && window.WeakSet && (c.markedSpans || (c.markedSpans = /* @__PURE__ */ new WeakSet()));
- f && o.markedSpans && f.has(o.markedSpans) ? o.markedSpans.push(l) : (o.markedSpans = o.markedSpans ? o.markedSpans.concat([l]) : [l], f && f.add(o.markedSpans)), l.marker.attachLine(o);
- }
- function f1(o, l, c) {
- var f;
- if (o)
- for (var v = 0; v < o.length; ++v) {
- var O = o[v], L = O.marker, j = O.from == null || (L.inclusiveLeft ? O.from <= l : O.from < l);
- if (j || O.from == l && L.type == "bookmark" && (!c || !O.marker.insertLeft)) {
- var Q = O.to == null || (L.inclusiveRight ? O.to >= l : O.to > l);
- (f || (f = [])).push(new Cl(L, O.from, Q ? null : O.to));
- }
- }
- return f;
- }
- function c1(o, l, c) {
- var f;
- if (o)
- for (var v = 0; v < o.length; ++v) {
- var O = o[v], L = O.marker, j = O.to == null || (L.inclusiveRight ? O.to >= l : O.to > l);
- if (j || O.from == l && L.type == "bookmark" && (!c || O.marker.insertLeft)) {
- var Q = O.from == null || (L.inclusiveLeft ? O.from <= l : O.from < l);
- (f || (f = [])).push(new Cl(
- L,
- Q ? null : O.from - l,
- O.to == null ? null : O.to - l
- ));
- }
- }
- return f;
- }
- function Mu(o, l) {
- if (l.full)
- return null;
- var c = oe(o, l.from.line) && ut(o, l.from.line).markedSpans, f = oe(o, l.to.line) && ut(o, l.to.line).markedSpans;
- if (!c && !f)
- return null;
- var v = l.from.ch, O = l.to.ch, L = De(l.from, l.to) == 0, j = f1(c, v, L), Q = c1(f, O, L), ne = l.text.length == 1, se = Ae(l.text).length + (ne ? v : 0);
- if (j)
- for (var de = 0; de < j.length; ++de) {
- var Ee = j[de];
- if (Ee.to == null) {
- var Ce = sa(Q, Ee.marker);
- Ce ? ne && (Ee.to = Ce.to == null ? null : Ce.to + se) : Ee.to = v;
- }
- }
- if (Q)
- for (var Ie = 0; Ie < Q.length; ++Ie) {
- var Ne = Q[Ie];
- if (Ne.to != null && (Ne.to += se), Ne.from == null) {
- var Ue = sa(j, Ne.marker);
- Ue || (Ne.from = se, ne && (j || (j = [])).push(Ne));
- } else
- Ne.from += se, ne && (j || (j = [])).push(Ne);
- }
- j && (j = eh(j)), Q && Q != j && (Q = eh(Q));
- var Ye = [j];
- if (!ne) {
- var nt = l.text.length - 2, Qe;
- if (nt > 0 && j)
- for (var ot = 0; ot < j.length; ++ot)
- j[ot].to == null && (Qe || (Qe = [])).push(new Cl(j[ot].marker, null, null));
- for (var mt = 0; mt < nt; ++mt)
- Ye.push(Qe);
- Ye.push(Q);
}
- return Ye;
- }
- function eh(o) {
- for (var l = 0; l < o.length; ++l) {
- var c = o[l];
- c.from != null && c.from == c.to && c.marker.clearWhenEmpty !== !1 && o.splice(l--, 1);
+ var re = [""];
+ function fe(o) {
+ for (; re.length <= o; )
+ re.push(Ae(re) + " ");
+ return re[o];
}
- return o.length ? o : null;
- }
- function p1(o, l, c) {
- var f = null;
- if (o.iter(l.line, c.line + 1, function(Ce) {
- if (Ce.markedSpans)
- for (var Ie = 0; Ie < Ce.markedSpans.length; ++Ie) {
- var Ne = Ce.markedSpans[Ie].marker;
- Ne.readOnly && (!f || he(f, Ne) == -1) && (f || (f = [])).push(Ne);
- }
- }), !f)
- return null;
- for (var v = [{ from: l, to: c }], O = 0; O < f.length; ++O)
- for (var L = f[O], j = L.find(0), Q = 0; Q < v.length; ++Q) {
- var ne = v[Q];
- if (!(De(ne.to, j.from) < 0 || De(ne.from, j.to) > 0)) {
- var se = [Q, 1], de = De(ne.from, j.from), Ee = De(ne.to, j.to);
- (de < 0 || !L.inclusiveLeft && !de) && se.push({ from: ne.from, to: j.from }), (Ee > 0 || !L.inclusiveRight && !Ee) && se.push({ from: j.to, to: ne.to }), v.splice.apply(v, se), Q += se.length - 3;
- }
- }
- return v;
- }
- function th(o) {
- var l = o.markedSpans;
- if (!!l) {
- for (var c = 0; c < l.length; ++c)
- l[c].marker.detachLine(o);
- o.markedSpans = null;
+ function Ae(o) {
+ return o[o.length - 1];
}
- }
- function nh(o, l) {
- if (!!l) {
- for (var c = 0; c < l.length; ++c)
- l[c].marker.attachLine(o);
- o.markedSpans = l;
- }
- }
- function Sl(o) {
- return o.inclusiveLeft ? -1 : 0;
- }
- function El(o) {
- return o.inclusiveRight ? 1 : 0;
- }
- function Lu(o, l) {
- var c = o.lines.length - l.lines.length;
- if (c != 0)
+ function Fe(o, l) {
+ for (var c = [], f = 0; f < o.length; f++)
+ c[f] = l(o[f], f);
return c;
- var f = o.find(), v = l.find(), O = De(f.from, v.from) || Sl(o) - Sl(l);
- if (O)
- return -O;
- var L = De(f.to, v.to) || El(o) - El(l);
- return L || l.id - o.id;
- }
- function ih(o, l) {
- var c = Qi && o.markedSpans, f;
- if (c)
- for (var v = void 0, O = 0; O < c.length; ++O)
- v = c[O], v.marker.collapsed && (l ? v.from : v.to) == null && (!f || Lu(f, v.marker) < 0) && (f = v.marker);
- return f;
- }
- function rh(o) {
- return ih(o, !0);
- }
- function xl(o) {
- return ih(o, !1);
- }
- function h1(o, l) {
- var c = Qi && o.markedSpans, f;
- if (c)
- for (var v = 0; v < c.length; ++v) {
- var O = c[v];
- O.marker.collapsed && (O.from == null || O.from < l) && (O.to == null || O.to > l) && (!f || Lu(f, O.marker) < 0) && (f = O.marker);
- }
- return f;
- }
- function oh(o, l, c, f, v) {
- var O = ut(o, l), L = Qi && O.markedSpans;
- if (L)
- for (var j = 0; j < L.length; ++j) {
- var Q = L[j];
- if (!!Q.marker.collapsed) {
- var ne = Q.marker.find(0), se = De(ne.from, c) || Sl(Q.marker) - Sl(v), de = De(ne.to, f) || El(Q.marker) - El(v);
- if (!(se >= 0 && de <= 0 || se <= 0 && de >= 0) && (se <= 0 && (Q.marker.inclusiveRight && v.inclusiveLeft ? De(ne.to, c) >= 0 : De(ne.to, c) > 0) || se >= 0 && (Q.marker.inclusiveRight && v.inclusiveLeft ? De(ne.from, f) <= 0 : De(ne.from, f) < 0)))
- return !0;
- }
- }
- }
- function _i(o) {
- for (var l; l = rh(o); )
- o = l.find(-1, !0).line;
- return o;
- }
- function m1(o) {
- for (var l; l = xl(o); )
- o = l.find(1, !0).line;
- return o;
- }
- function v1(o) {
- for (var l, c; l = xl(o); )
- o = l.find(1, !0).line, (c || (c = [])).push(o);
- return c;
- }
- function Nu(o, l) {
- var c = ut(o, l), f = _i(c);
- return c == f ? l : Ft(f);
- }
- function ah(o, l) {
- if (l > o.lastLine())
- return l;
- var c = ut(o, l), f;
- if (!hr(o, c))
- return l;
- for (; f = xl(c); )
- c = f.find(1, !0).line;
- return Ft(c) + 1;
- }
- function hr(o, l) {
- var c = Qi && l.markedSpans;
- if (c) {
- for (var f = void 0, v = 0; v < c.length; ++v)
- if (f = c[v], !!f.marker.collapsed) {
- if (f.from == null)
- return !0;
- if (!f.marker.widgetNode && f.from == 0 && f.marker.inclusiveLeft && Bu(o, l, f))
- return !0;
- }
}
- }
- function Bu(o, l, c) {
- if (c.to == null) {
- var f = c.marker.find(1, !0);
- return Bu(o, f.line, sa(f.line.markedSpans, c.marker));
+ function Xe(o, l, c) {
+ for (var f = 0, v = c(l); f < o.length && c(o[f]) <= v; )
+ f++;
+ o.splice(f, 0, l);
}
- if (c.marker.inclusiveRight && c.to == l.text.length)
+ function Ze() {
+ }
+ function _e(o, l) {
+ var c;
+ return Object.create ? c = Object.create(o) : (Ze.prototype = o, c = new Ze()), l && ge(l, c), c;
+ }
+ var Le = /[\u00df\u0587\u0590-\u05f4\u0600-\u06ff\u3040-\u309f\u30a0-\u30ff\u3400-\u4db5\u4e00-\u9fcc\uac00-\ud7af]/;
+ function Oe(o) {
+ return /\w/.test(o) || o > "\x80" && (o.toUpperCase() != o.toLowerCase() || Le.test(o));
+ }
+ function it(o, l) {
+ return l ? l.source.indexOf("\\w") > -1 && Oe(o) ? !0 : l.test(o) : Oe(o);
+ }
+ function pt(o) {
+ for (var l in o)
+ if (o.hasOwnProperty(l) && o[l])
+ return !1;
return !0;
- for (var v = void 0, O = 0; O < l.markedSpans.length; ++O)
- if (v = l.markedSpans[O], v.marker.collapsed && !v.marker.widgetNode && v.from == c.to && (v.to == null || v.to != c.from) && (v.marker.inclusiveLeft || c.marker.inclusiveRight) && Bu(o, l, v))
- return !0;
- }
- function Ji(o) {
- o = _i(o);
- for (var l = 0, c = o.parent, f = 0; f < c.lines.length; ++f) {
- var v = c.lines[f];
- if (v == o)
- break;
- l += v.height;
}
- for (var O = c.parent; O; c = O, O = c.parent)
- for (var L = 0; L < O.children.length; ++L) {
- var j = O.children[L];
- if (j == c)
- break;
- l += j.height;
+ var Re = /[\u0300-\u036f\u0483-\u0489\u0591-\u05bd\u05bf\u05c1\u05c2\u05c4\u05c5\u05c7\u0610-\u061a\u064b-\u065e\u0670\u06d6-\u06dc\u06de-\u06e4\u06e7\u06e8\u06ea-\u06ed\u0711\u0730-\u074a\u07a6-\u07b0\u07eb-\u07f3\u0816-\u0819\u081b-\u0823\u0825-\u0827\u0829-\u082d\u0900-\u0902\u093c\u0941-\u0948\u094d\u0951-\u0955\u0962\u0963\u0981\u09bc\u09be\u09c1-\u09c4\u09cd\u09d7\u09e2\u09e3\u0a01\u0a02\u0a3c\u0a41\u0a42\u0a47\u0a48\u0a4b-\u0a4d\u0a51\u0a70\u0a71\u0a75\u0a81\u0a82\u0abc\u0ac1-\u0ac5\u0ac7\u0ac8\u0acd\u0ae2\u0ae3\u0b01\u0b3c\u0b3e\u0b3f\u0b41-\u0b44\u0b4d\u0b56\u0b57\u0b62\u0b63\u0b82\u0bbe\u0bc0\u0bcd\u0bd7\u0c3e-\u0c40\u0c46-\u0c48\u0c4a-\u0c4d\u0c55\u0c56\u0c62\u0c63\u0cbc\u0cbf\u0cc2\u0cc6\u0ccc\u0ccd\u0cd5\u0cd6\u0ce2\u0ce3\u0d3e\u0d41-\u0d44\u0d4d\u0d57\u0d62\u0d63\u0dca\u0dcf\u0dd2-\u0dd4\u0dd6\u0ddf\u0e31\u0e34-\u0e3a\u0e47-\u0e4e\u0eb1\u0eb4-\u0eb9\u0ebb\u0ebc\u0ec8-\u0ecd\u0f18\u0f19\u0f35\u0f37\u0f39\u0f71-\u0f7e\u0f80-\u0f84\u0f86\u0f87\u0f90-\u0f97\u0f99-\u0fbc\u0fc6\u102d-\u1030\u1032-\u1037\u1039\u103a\u103d\u103e\u1058\u1059\u105e-\u1060\u1071-\u1074\u1082\u1085\u1086\u108d\u109d\u135f\u1712-\u1714\u1732-\u1734\u1752\u1753\u1772\u1773\u17b7-\u17bd\u17c6\u17c9-\u17d3\u17dd\u180b-\u180d\u18a9\u1920-\u1922\u1927\u1928\u1932\u1939-\u193b\u1a17\u1a18\u1a56\u1a58-\u1a5e\u1a60\u1a62\u1a65-\u1a6c\u1a73-\u1a7c\u1a7f\u1b00-\u1b03\u1b34\u1b36-\u1b3a\u1b3c\u1b42\u1b6b-\u1b73\u1b80\u1b81\u1ba2-\u1ba5\u1ba8\u1ba9\u1c2c-\u1c33\u1c36\u1c37\u1cd0-\u1cd2\u1cd4-\u1ce0\u1ce2-\u1ce8\u1ced\u1dc0-\u1de6\u1dfd-\u1dff\u200c\u200d\u20d0-\u20f0\u2cef-\u2cf1\u2de0-\u2dff\u302a-\u302f\u3099\u309a\ua66f-\ua672\ua67c\ua67d\ua6f0\ua6f1\ua802\ua806\ua80b\ua825\ua826\ua8c4\ua8e0-\ua8f1\ua926-\ua92d\ua947-\ua951\ua980-\ua982\ua9b3\ua9b6-\ua9b9\ua9bc\uaa29-\uaa2e\uaa31\uaa32\uaa35\uaa36\uaa43\uaa4c\uaab0\uaab2-\uaab4\uaab7\uaab8\uaabe\uaabf\uaac1\uabe5\uabe8\uabed\udc00-\udfff\ufb1e\ufe00-\ufe0f\ufe20-\ufe26\uff9e\uff9f]/;
+ function He(o) {
+ return o.charCodeAt(0) >= 768 && Re.test(o);
+ }
+ function at(o, l, c) {
+ for (; (c < 0 ? l > 0 : l < o.length) && He(o.charAt(l)); )
+ l += c;
+ return l;
+ }
+ function We(o, l, c) {
+ for (var f = l > c ? -1 : 1; ; ) {
+ if (l == c)
+ return l;
+ var v = (l + c) / 2, O = f < 0 ? Math.ceil(v) : Math.floor(v);
+ if (O == l)
+ return o(O) ? l : c;
+ o(O) ? c = O : l = O + f;
}
- return l;
- }
- function Tl(o) {
- if (o.height == 0)
- return 0;
- for (var l = o.text.length, c, f = o; c = rh(f); ) {
- var v = c.find(0, !0);
- f = v.from.line, l += v.from.ch - v.to.ch;
}
- for (f = o; c = xl(f); ) {
- var O = c.find(0, !0);
- l -= f.text.length - O.from.ch, f = O.to.line, l += f.text.length - O.to.ch;
+ function $t(o, l, c, f) {
+ if (!o)
+ return f(l, c, "ltr", 0);
+ for (var v = !1, O = 0; O < o.length; ++O) {
+ var L = o[O];
+ (L.from < c && L.to > l || l == c && L.to == l) && (f(Math.max(L.from, l), Math.min(L.to, c), L.level == 1 ? "rtl" : "ltr", O), v = !0);
+ }
+ v || f(l, c, "ltr");
}
- return l;
- }
- function Vu(o) {
- var l = o.display, c = o.doc;
- l.maxLine = ut(c, c.first), l.maxLineLength = Tl(l.maxLine), l.maxLineChanged = !0, c.iter(function(f) {
- var v = Tl(f);
- v > l.maxLineLength && (l.maxLineLength = v, l.maxLine = f);
- });
- }
- var ao = function(o, l, c) {
- this.text = o, nh(this, l), this.height = c ? c(this) : 1;
- };
- ao.prototype.lineNo = function() {
- return Ft(this);
- }, zt(ao);
- function g1(o, l, c, f) {
- o.text = l, o.stateAfter && (o.stateAfter = null), o.styles && (o.styles = null), o.order != null && (o.order = null), th(o), nh(o, c);
- var v = f ? f(o) : 1;
- v != o.height && fi(o, v);
- }
- function y1(o) {
- o.parent = null, th(o);
- }
- var b1 = {}, _1 = {};
- function lh(o, l) {
- if (!o || /^\s*$/.test(o))
- return null;
- var c = l.addModeClass ? _1 : b1;
- return c[o] || (c[o] = o.replace(/\S+/g, "cm-$&"));
- }
- function sh(o, l) {
- var c = U("span", null, null, h ? "padding-right: .1px" : null), f = {
- pre: U("pre", [c], "CodeMirror-line"),
- content: c,
- col: 0,
- pos: 0,
- cm: o,
- trailingSpace: !1,
- splitSpaces: o.getOption("lineWrapping")
- };
- l.measure = {};
- for (var v = 0; v <= (l.rest ? l.rest.length : 0); v++) {
- var O = v ? l.rest[v - 1] : l.line, L = void 0;
- f.pos = 0, f.addToken = A1, yl(o.display.measure) && (L = ht(O, o.doc.direction)) && (f.addToken = S1(f.addToken, L)), f.map = [];
- var j = l != o.display.externalMeasured && Ft(O);
- E1(O, f, Kp(o, O, j)), O.styleClasses && (O.styleClasses.bgClass && (f.bgClass = Y(O.styleClasses.bgClass, f.bgClass || "")), O.styleClasses.textClass && (f.textClass = Y(O.styleClasses.textClass, f.textClass || ""))), f.map.length == 0 && f.map.push(0, 0, f.content.appendChild(Iu(o.display.measure))), v == 0 ? (l.measure.map = f.map, l.measure.cache = {}) : ((l.measure.maps || (l.measure.maps = [])).push(f.map), (l.measure.caches || (l.measure.caches = [])).push({}));
+ var ft = null;
+ function je(o, l, c) {
+ var f;
+ ft = null;
+ for (var v = 0; v < o.length; ++v) {
+ var O = o[v];
+ if (O.from < l && O.to > l)
+ return v;
+ O.to == l && (O.from != O.to && c == "before" ? f = v : ft = v), O.from == l && (O.from != O.to && c != "before" ? f = v : ft = v);
+ }
+ return f != null ? f : ft;
}
- if (h) {
- var Q = f.content.lastChild;
- (/\bcm-tab\b/.test(Q.className) || Q.querySelector && Q.querySelector(".cm-tab")) && (f.content.className = "cm-tab-wrap-hack");
+ var Je = function() {
+ var o = "bbbbbbbbbtstwsbbbbbbbbbbbbbbssstwNN%%%NNNNNN,N,N1111111111NNNNNNNLLLLLLLLLLLLLLLLLLLLLLLLLLNNNNNNLLLLLLLLLLLLLLLLLLLLLLLLLLNNNNbbbbbbsbbbbbbbbbbbbbbbbbbbbbbbbbb,N%%%%NNNNLNNNNN%%11NLNNN1LNNNNNLLLLLLLLLLLLLLLLLLLLLLLNLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLN", l = "nnnnnnNNr%%r,rNNmmmmmmmmmmmrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrmmmmmmmmmmmmmmmmmmmmmnnnnnnnnnn%nnrrrmrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrmmmmmmmnNmmmmmmrrmmNmmmmrr1111111111";
+ function c(ne) {
+ return ne <= 247 ? o.charAt(ne) : 1424 <= ne && ne <= 1524 ? "R" : 1536 <= ne && ne <= 1785 ? l.charAt(ne - 1536) : 1774 <= ne && ne <= 2220 ? "r" : 8192 <= ne && ne <= 8203 ? "w" : ne == 8204 ? "b" : "L";
+ }
+ var f = /[\u0590-\u05f4\u0600-\u06ff\u0700-\u08ac]/, v = /[stwN]/, O = /[LRr]/, L = /[Lb1n]/, j = /[1n]/;
+ function Q(ne, se, de) {
+ this.level = ne, this.from = se, this.to = de;
+ }
+ return function(ne, se) {
+ var de = se == "ltr" ? "L" : "R";
+ if (ne.length == 0 || se == "ltr" && !f.test(ne))
+ return !1;
+ for (var Ee = ne.length, Ce = [], Ie = 0; Ie < Ee; ++Ie)
+ Ce.push(c(ne.charCodeAt(Ie)));
+ for (var Ne = 0, Ue = de; Ne < Ee; ++Ne) {
+ var Ye = Ce[Ne];
+ Ye == "m" ? Ce[Ne] = Ue : Ue = Ye;
+ }
+ for (var nt = 0, Qe = de; nt < Ee; ++nt) {
+ var ot = Ce[nt];
+ ot == "1" && Qe == "r" ? Ce[nt] = "n" : O.test(ot) && (Qe = ot, ot == "r" && (Ce[nt] = "R"));
+ }
+ for (var mt = 1, ct = Ce[0]; mt < Ee - 1; ++mt) {
+ var Et = Ce[mt];
+ Et == "+" && ct == "1" && Ce[mt + 1] == "1" ? Ce[mt] = "1" : Et == "," && ct == Ce[mt + 1] && (ct == "1" || ct == "n") && (Ce[mt] = ct), ct = Et;
+ }
+ for (var Vt = 0; Vt < Ee; ++Vt) {
+ var vn = Ce[Vt];
+ if (vn == ",")
+ Ce[Vt] = "N";
+ else if (vn == "%") {
+ var Jt = void 0;
+ for (Jt = Vt + 1; Jt < Ee && Ce[Jt] == "%"; ++Jt)
+ ;
+ for (var Gn = Vt && Ce[Vt - 1] == "!" || Jt < Ee && Ce[Jt] == "1" ? "1" : "N", Bn = Vt; Bn < Jt; ++Bn)
+ Ce[Bn] = Gn;
+ Vt = Jt - 1;
+ }
+ }
+ for (var ln = 0, Vn = de; ln < Ee; ++ln) {
+ var An = Ce[ln];
+ Vn == "L" && An == "1" ? Ce[ln] = "L" : O.test(An) && (Vn = An);
+ }
+ for (var dn = 0; dn < Ee; ++dn)
+ if (v.test(Ce[dn])) {
+ var sn = void 0;
+ for (sn = dn + 1; sn < Ee && v.test(Ce[sn]); ++sn)
+ ;
+ for (var qt = (dn ? Ce[dn - 1] : de) == "L", jn = (sn < Ee ? Ce[sn] : de) == "L", Co = qt == jn ? qt ? "L" : "R" : de, Ar = dn; Ar < sn; ++Ar)
+ Ce[Ar] = Co;
+ dn = sn - 1;
+ }
+ for (var xn = [], Mi, gn = 0; gn < Ee; )
+ if (L.test(Ce[gn])) {
+ var Sd = gn;
+ for (++gn; gn < Ee && L.test(Ce[gn]); ++gn)
+ ;
+ xn.push(new Q(0, Sd, gn));
+ } else {
+ var er = gn, Vr = xn.length, jr = se == "rtl" ? 1 : 0;
+ for (++gn; gn < Ee && Ce[gn] != "L"; ++gn)
+ ;
+ for (var $n = er; $n < gn; )
+ if (j.test(Ce[$n])) {
+ er < $n && (xn.splice(Vr, 0, new Q(1, er, $n)), Vr += jr);
+ var So = $n;
+ for (++$n; $n < gn && j.test(Ce[$n]); ++$n)
+ ;
+ xn.splice(Vr, 0, new Q(2, So, $n)), Vr += jr, er = $n;
+ } else
+ ++$n;
+ er < gn && xn.splice(Vr, 0, new Q(1, er, gn));
+ }
+ return se == "ltr" && (xn[0].level == 1 && (Mi = ne.match(/^\s+/)) && (xn[0].from = Mi[0].length, xn.unshift(new Q(0, 0, Mi[0].length))), Ae(xn).level == 1 && (Mi = ne.match(/\s+$/)) && (Ae(xn).to -= Mi[0].length, xn.push(new Q(0, Ee - Mi[0].length, Ee)))), se == "rtl" ? xn.reverse() : xn;
+ };
+ }();
+ function ht(o, l) {
+ var c = o.order;
+ return c == null && (c = o.order = Je(o.text, l)), c;
}
- return st(o, "renderLine", o, l.line, f.pre), f.pre.className && (f.textClass = Y(f.pre.className, f.textClass || "")), f;
- }
- function w1(o) {
- var l = I("span", "\u2022", "cm-invalidchar");
- return l.title = "\\u" + o.charCodeAt(0).toString(16), l.setAttribute("aria-label", l.title), l;
- }
- function A1(o, l, c, f, v, O, L) {
- if (!!l) {
- var j = o.splitSpaces ? C1(l, o.trailingSpace) : l, Q = o.cm.state.specialChars, ne = !1, se;
- if (!Q.test(l))
- o.col += l.length, se = document.createTextNode(j), o.map.push(o.pos, o.pos + l.length, se), d && p < 9 && (ne = !0), o.pos += l.length;
+ var Ge = [], $e = function(o, l, c) {
+ if (o.addEventListener)
+ o.addEventListener(l, c, !1);
+ else if (o.attachEvent)
+ o.attachEvent("on" + l, c);
else {
- se = document.createDocumentFragment();
- for (var de = 0; ; ) {
- Q.lastIndex = de;
- var Ee = Q.exec(l), Ce = Ee ? Ee.index - de : l.length - de;
- if (Ce) {
- var Ie = document.createTextNode(j.slice(de, de + Ce));
- d && p < 9 ? se.appendChild(I("span", [Ie])) : se.appendChild(Ie), o.map.push(o.pos, o.pos + Ce, Ie), o.col += Ce, o.pos += Ce;
- }
- if (!Ee)
- break;
- de += Ce + 1;
- var Ne = void 0;
- if (Ee[0] == " ") {
- var Ue = o.cm.options.tabSize, Ye = Ue - o.col % Ue;
- Ne = se.appendChild(I("span", fe(Ye), "cm-tab")), Ne.setAttribute("role", "presentation"), Ne.setAttribute("cm-text", " "), o.col += Ye;
- } else
- Ee[0] == "\r" || Ee[0] == `
-` ? (Ne = se.appendChild(I("span", Ee[0] == "\r" ? "\u240D" : "\u2424", "cm-invalidchar")), Ne.setAttribute("cm-text", Ee[0]), o.col += 1) : (Ne = o.cm.options.specialCharPlaceholder(Ee[0]), Ne.setAttribute("cm-text", Ee[0]), d && p < 9 ? se.appendChild(I("span", [Ne])) : se.appendChild(Ne), o.col += 1);
- o.map.push(o.pos, o.pos + 1, Ne), o.pos++;
- }
- }
- if (o.trailingSpace = j.charCodeAt(l.length - 1) == 32, c || f || v || ne || O || L) {
- var nt = c || "";
- f && (nt += f), v && (nt += v);
- var Qe = I("span", [se], nt, O);
- if (L)
- for (var ot in L)
- L.hasOwnProperty(ot) && ot != "style" && ot != "class" && Qe.setAttribute(ot, L[ot]);
- return o.content.appendChild(Qe);
- }
- o.content.appendChild(se);
- }
- }
- function C1(o, l) {
- if (o.length > 1 && !/ /.test(o))
- return o;
- for (var c = l, f = "", v = 0; v < o.length; v++) {
- var O = o.charAt(v);
- O == " " && c && (v == o.length - 1 || o.charCodeAt(v + 1) == 32) && (O = "\xA0"), f += O, c = O == " ";
- }
- return f;
- }
- function S1(o, l) {
- return function(c, f, v, O, L, j, Q) {
- v = v ? v + " cm-force-border" : "cm-force-border";
- for (var ne = c.pos, se = ne + f.length; ; ) {
- for (var de = void 0, Ee = 0; Ee < l.length && (de = l[Ee], !(de.to > ne && de.from <= ne)); Ee++)
- ;
- if (de.to >= se)
- return o(c, f, v, O, L, j, Q);
- o(c, f.slice(0, de.to - ne), v, O, null, j, Q), O = null, f = f.slice(de.to - ne), ne = de.to;
+ var f = o._handlers || (o._handlers = {});
+ f[l] = (f[l] || Ge).concat(c);
}
};
- }
- function uh(o, l, c, f) {
- var v = !f && c.widgetNode;
- v && o.map.push(o.pos, o.pos + l, v), !f && o.cm.display.input.needsContentAttribute && (v || (v = o.content.appendChild(document.createElement("span"))), v.setAttribute("cm-marker", c.id)), v && (o.cm.display.input.setUneditable(v), o.content.appendChild(v)), o.pos += l, o.trailingSpace = !1;
- }
- function E1(o, l, c) {
- var f = o.markedSpans, v = o.text, O = 0;
- if (!f) {
- for (var L = 1; L < c.length; L += 2)
- l.addToken(l, v.slice(O, O = c[L]), lh(c[L + 1], l.cm.options));
- return;
+ function dt(o, l) {
+ return o._handlers && o._handlers[l] || Ge;
}
- for (var j = v.length, Q = 0, ne = 1, se = "", de, Ee, Ce = 0, Ie, Ne, Ue, Ye, nt; ; ) {
- if (Ce == Q) {
- Ie = Ne = Ue = Ee = "", nt = null, Ye = null, Ce = 1 / 0;
- for (var Qe = [], ot = void 0, mt = 0; mt < f.length; ++mt) {
- var ct = f[mt], Et = ct.marker;
- if (Et.type == "bookmark" && ct.from == Q && Et.widgetNode)
- Qe.push(Et);
- else if (ct.from <= Q && (ct.to == null || ct.to > Q || Et.collapsed && ct.to == Q && ct.from == Q)) {
- if (ct.to != null && ct.to != Q && Ce > ct.to && (Ce = ct.to, Ne = ""), Et.className && (Ie += " " + Et.className), Et.css && (Ee = (Ee ? Ee + ";" : "") + Et.css), Et.startStyle && ct.from == Q && (Ue += " " + Et.startStyle), Et.endStyle && ct.to == Ce && (ot || (ot = [])).push(Et.endStyle, ct.to), Et.title && ((nt || (nt = {})).title = Et.title), Et.attributes)
- for (var Vt in Et.attributes)
- (nt || (nt = {}))[Vt] = Et.attributes[Vt];
- Et.collapsed && (!Ye || Lu(Ye.marker, Et) < 0) && (Ye = ct);
- } else
- ct.from > Q && Ce > ct.from && (Ce = ct.from);
- }
- if (ot)
- for (var vn = 0; vn < ot.length; vn += 2)
- ot[vn + 1] == Ce && (Ne += " " + ot[vn]);
- if (!Ye || Ye.from == Q)
- for (var Jt = 0; Jt < Qe.length; ++Jt)
- uh(l, 0, Qe[Jt]);
- if (Ye && (Ye.from || 0) == Q) {
- if (uh(
- l,
- (Ye.to == null ? j + 1 : Ye.to) - Q,
- Ye.marker,
- Ye.from == null
- ), Ye.to == null)
- return;
- Ye.to == Q && (Ye = !1);
+ function lt(o, l, c) {
+ if (o.removeEventListener)
+ o.removeEventListener(l, c, !1);
+ else if (o.detachEvent)
+ o.detachEvent("on" + l, c);
+ else {
+ var f = o._handlers, v = f && f[l];
+ if (v) {
+ var O = he(v, c);
+ O > -1 && (f[l] = v.slice(0, O).concat(v.slice(O + 1)));
}
}
- if (Q >= j)
- break;
- for (var Gn = Math.min(j, Ce); ; ) {
- if (se) {
- var Bn = Q + se.length;
- if (!Ye) {
- var ln = Bn > Gn ? se.slice(0, Gn - Q) : se;
- l.addToken(
- l,
- ln,
- de ? de + Ie : Ie,
- Ue,
- Q + ln.length == Ce ? Ne : "",
- Ee,
- nt
- );
- }
- if (Bn >= Gn) {
- se = se.slice(Gn - Q), Q = Gn;
- break;
- }
- Q = Bn, Ue = "";
- }
- se = v.slice(O, O = c[ne++]), de = lh(c[ne++], l.cm.options);
- }
}
- }
- function dh(o, l, c) {
- this.line = l, this.rest = v1(l), this.size = this.rest ? Ft(Ae(this.rest)) - c + 1 : 1, this.node = this.text = null, this.hidden = hr(o, l);
- }
- function kl(o, l, c) {
- for (var f = [], v, O = l; O < c; O = v) {
- var L = new dh(o.doc, ut(o.doc, O), O);
- v = O + L.size, f.push(L);
+ function st(o, l) {
+ var c = dt(o, l);
+ if (!!c.length)
+ for (var f = Array.prototype.slice.call(arguments, 2), v = 0; v < c.length; ++v)
+ c[v].apply(null, f);
}
- return f;
- }
- var lo = null;
- function x1(o) {
- lo ? lo.ops.push(o) : o.ownsGroup = lo = {
- ops: [o],
- delayedCallbacks: []
- };
- }
- function T1(o) {
- var l = o.delayedCallbacks, c = 0;
- do {
- for (; c < l.length; c++)
- l[c].call(null);
- for (var f = 0; f < o.ops.length; f++) {
- var v = o.ops[f];
- if (v.cursorActivityHandlers)
- for (; v.cursorActivityCalled < v.cursorActivityHandlers.length; )
- v.cursorActivityHandlers[v.cursorActivityCalled++].call(null, v.cm);
+ function Ct(o, l, c) {
+ return typeof l == "string" && (l = { type: l, preventDefault: function() {
+ this.defaultPrevented = !0;
+ } }), st(o, c || l.type, o, l), ur(l) || l.codemirrorIgnore;
+ }
+ function Pn(o) {
+ var l = o._handlers && o._handlers.cursorActivity;
+ if (!!l)
+ for (var c = o.curOp.cursorActivityHandlers || (o.curOp.cursorActivityHandlers = []), f = 0; f < l.length; ++f)
+ he(c, l[f]) == -1 && c.push(l[f]);
+ }
+ function Qt(o, l) {
+ return dt(o, l).length > 0;
+ }
+ function zt(o) {
+ o.prototype.on = function(l, c) {
+ $e(this, l, c);
+ }, o.prototype.off = function(l, c) {
+ lt(this, l, c);
+ };
+ }
+ function It(o) {
+ o.preventDefault ? o.preventDefault() : o.returnValue = !1;
+ }
+ function ui(o) {
+ o.stopPropagation ? o.stopPropagation() : o.cancelBubble = !0;
+ }
+ function ur(o) {
+ return o.defaultPrevented != null ? o.defaultPrevented : o.returnValue == !1;
+ }
+ function yi(o) {
+ It(o), ui(o);
+ }
+ function Mn(o) {
+ return o.target || o.srcElement;
+ }
+ function ra(o) {
+ var l = o.which;
+ return l == null && (o.button & 1 ? l = 1 : o.button & 2 ? l = 3 : o.button & 4 && (l = 2)), k && o.ctrlKey && l == 1 && (l = 3), l;
+ }
+ var Du = function() {
+ if (d && p < 9)
+ return !1;
+ var o = I("div");
+ return "draggable" in o || "dragDrop" in o;
+ }(), di;
+ function Iu(o) {
+ if (di == null) {
+ var l = I("span", "\u200B");
+ G(o, I("span", [l, document.createTextNode("x")])), o.firstChild.offsetHeight != 0 && (di = l.offsetWidth <= 1 && l.offsetHeight > 2 && !(d && p < 8));
}
- } while (c < l.length);
- }
- function k1(o, l) {
- var c = o.ownsGroup;
- if (!!c)
+ var c = di ? I("span", "\u200B") : I("span", "\xA0", null, "display: inline-block; width: 1px; margin-right: -1px");
+ return c.setAttribute("cm-text", ""), c;
+ }
+ var no;
+ function yl(o) {
+ if (no != null)
+ return no;
+ var l = G(o, document.createTextNode("A\u062EA")), c = F(l, 0, 1).getBoundingClientRect(), f = F(l, 1, 2).getBoundingClientRect();
+ return W(o), !c || c.left == c.right ? !1 : no = f.right - c.right < 3;
+ }
+ var oa = `
+
+b`.split(/\n/).length != 3 ? function(o) {
+ for (var l = 0, c = [], f = o.length; l <= f; ) {
+ var v = o.indexOf(`
+`, l);
+ v == -1 && (v = o.length);
+ var O = o.slice(l, o.charAt(v - 1) == "\r" ? v - 1 : v), L = O.indexOf("\r");
+ L != -1 ? (c.push(O.slice(0, L)), l += L + 1) : (c.push(O), l = v + 1);
+ }
+ return c;
+ } : function(o) {
+ return o.split(/\r\n?|\n/);
+ }, dr = window.getSelection ? function(o) {
try {
- T1(c);
+ return o.selectionStart != o.selectionEnd;
+ } catch {
+ return !1;
+ }
+ } : function(o) {
+ var l;
+ try {
+ l = o.ownerDocument.selection.createRange();
+ } catch {
+ }
+ return !l || l.parentElement() != o ? !1 : l.compareEndPoints("StartToEnd", l) != 0;
+ }, $i = function() {
+ var o = I("div");
+ return "oncopy" in o ? !0 : (o.setAttribute("oncopy", "return;"), typeof o.oncopy == "function");
+ }(), Ri = null;
+ function bl(o) {
+ if (Ri != null)
+ return Ri;
+ var l = G(o, I("span", "x")), c = l.getBoundingClientRect(), f = F(l, 0, 1).getBoundingClientRect();
+ return Ri = Math.abs(c.left - f.left) > 1;
+ }
+ var bi = {}, fr = {};
+ function _l(o, l) {
+ arguments.length > 2 && (l.dependencies = Array.prototype.slice.call(arguments, 2)), bi[o] = l;
+ }
+ function io(o, l) {
+ fr[o] = l;
+ }
+ function zn(o) {
+ if (typeof o == "string" && fr.hasOwnProperty(o))
+ o = fr[o];
+ else if (o && typeof o.name == "string" && fr.hasOwnProperty(o.name)) {
+ var l = fr[o.name];
+ typeof l == "string" && (l = { name: l }), o = _e(l, o), o.name = l.name;
+ } else {
+ if (typeof o == "string" && /^[\w\-]+\/[\w\-]+\+xml$/.test(o))
+ return zn("application/xml");
+ if (typeof o == "string" && /^[\w\-]+\/[\w\-]+\+json$/.test(o))
+ return zn("application/json");
+ }
+ return typeof o == "string" ? { name: o } : o || { name: "null" };
+ }
+ function Gi(o, l) {
+ l = zn(l);
+ var c = bi[l.name];
+ if (!c)
+ return Gi(o, "text/plain");
+ var f = c(o, l);
+ if (cr.hasOwnProperty(l.name)) {
+ var v = cr[l.name];
+ for (var O in v)
+ !v.hasOwnProperty(O) || (f.hasOwnProperty(O) && (f["_" + O] = f[O]), f[O] = v[O]);
+ }
+ if (f.name = l.name, l.helperType && (f.helperType = l.helperType), l.modeProps)
+ for (var L in l.modeProps)
+ f[L] = l.modeProps[L];
+ return f;
+ }
+ var cr = {};
+ function wl(o, l) {
+ var c = cr.hasOwnProperty(o) ? cr[o] : cr[o] = {};
+ ge(l, c);
+ }
+ function Ki(o, l) {
+ if (l === !0)
+ return l;
+ if (o.copyState)
+ return o.copyState(l);
+ var c = {};
+ for (var f in l) {
+ var v = l[f];
+ v instanceof Array && (v = v.concat([])), c[f] = v;
+ }
+ return c;
+ }
+ function pr(o, l) {
+ for (var c; o.innerMode && (c = o.innerMode(l), !(!c || c.mode == o)); )
+ l = c.state, o = c.mode;
+ return c || { mode: o, state: l };
+ }
+ function aa(o, l, c) {
+ return o.startState ? o.startState(l, c) : !0;
+ }
+ var Zt = function(o, l, c) {
+ this.pos = this.start = 0, this.string = o, this.tabSize = l || 8, this.lastColumnPos = this.lastColumnValue = 0, this.lineStart = 0, this.lineOracle = c;
+ };
+ Zt.prototype.eol = function() {
+ return this.pos >= this.string.length;
+ }, Zt.prototype.sol = function() {
+ return this.pos == this.lineStart;
+ }, Zt.prototype.peek = function() {
+ return this.string.charAt(this.pos) || void 0;
+ }, Zt.prototype.next = function() {
+ if (this.pos < this.string.length)
+ return this.string.charAt(this.pos++);
+ }, Zt.prototype.eat = function(o) {
+ var l = this.string.charAt(this.pos), c;
+ if (typeof o == "string" ? c = l == o : c = l && (o.test ? o.test(l) : o(l)), c)
+ return ++this.pos, l;
+ }, Zt.prototype.eatWhile = function(o) {
+ for (var l = this.pos; this.eat(o); )
+ ;
+ return this.pos > l;
+ }, Zt.prototype.eatSpace = function() {
+ for (var o = this.pos; /[\s\u00a0]/.test(this.string.charAt(this.pos)); )
+ ++this.pos;
+ return this.pos > o;
+ }, Zt.prototype.skipToEnd = function() {
+ this.pos = this.string.length;
+ }, Zt.prototype.skipTo = function(o) {
+ var l = this.string.indexOf(o, this.pos);
+ if (l > -1)
+ return this.pos = l, !0;
+ }, Zt.prototype.backUp = function(o) {
+ this.pos -= o;
+ }, Zt.prototype.column = function() {
+ return this.lastColumnPos < this.start && (this.lastColumnValue = ve(this.string, this.start, this.tabSize, this.lastColumnPos, this.lastColumnValue), this.lastColumnPos = this.start), this.lastColumnValue - (this.lineStart ? ve(this.string, this.lineStart, this.tabSize) : 0);
+ }, Zt.prototype.indentation = function() {
+ return ve(this.string, null, this.tabSize) - (this.lineStart ? ve(this.string, this.lineStart, this.tabSize) : 0);
+ }, Zt.prototype.match = function(o, l, c) {
+ if (typeof o == "string") {
+ var f = function(L) {
+ return c ? L.toLowerCase() : L;
+ }, v = this.string.substr(this.pos, o.length);
+ if (f(v) == f(o))
+ return l !== !1 && (this.pos += o.length), !0;
+ } else {
+ var O = this.string.slice(this.pos).match(o);
+ return O && O.index > 0 ? null : (O && l !== !1 && (this.pos += O[0].length), O);
+ }
+ }, Zt.prototype.current = function() {
+ return this.string.slice(this.start, this.pos);
+ }, Zt.prototype.hideFirstChars = function(o, l) {
+ this.lineStart += o;
+ try {
+ return l();
} finally {
- lo = null, l(c);
+ this.lineStart -= o;
}
- }
- var ua = null;
- function pn(o, l) {
- var c = dt(o, l);
- if (!!c.length) {
- var f = Array.prototype.slice.call(arguments, 2), v;
- lo ? v = lo.delayedCallbacks : ua ? v = ua : (v = ua = [], setTimeout(O1, 0));
- for (var O = function(j) {
- v.push(function() {
- return c[j].apply(null, f);
- });
- }, L = 0; L < c.length; ++L)
- O(L);
- }
- }
- function O1() {
- var o = ua;
- ua = null;
- for (var l = 0; l < o.length; ++l)
- o[l]();
- }
- function fh(o, l, c, f) {
- for (var v = 0; v < l.changes.length; v++) {
- var O = l.changes[v];
- O == "text" ? R1(o, l) : O == "gutter" ? ph(o, l, c, f) : O == "class" ? ju(o, l) : O == "widget" && D1(o, l, f);
- }
- l.changes = null;
- }
- function da(o) {
- return o.node == o.text && (o.node = I("div", null, null, "position: relative"), o.text.parentNode && o.text.parentNode.replaceChild(o.node, o.text), o.node.appendChild(o.text), d && p < 8 && (o.node.style.zIndex = 2)), o.node;
- }
- function $1(o, l) {
- var c = l.bgClass ? l.bgClass + " " + (l.line.bgClass || "") : l.line.bgClass;
- if (c && (c += " CodeMirror-linebackground"), l.background)
- c ? l.background.className = c : (l.background.parentNode.removeChild(l.background), l.background = null);
- else if (c) {
- var f = da(l);
- l.background = f.insertBefore(I("div", null, c), f.firstChild), o.display.input.setUneditable(l.background);
- }
- }
- function ch(o, l) {
- var c = o.display.externalMeasured;
- return c && c.line == l.line ? (o.display.externalMeasured = null, l.measure = c.measure, c.built) : sh(o, l);
- }
- function R1(o, l) {
- var c = l.text.className, f = ch(o, l);
- l.text == l.node && (l.node = f.pre), l.text.parentNode.replaceChild(f.pre, l.text), l.text = f.pre, f.bgClass != l.bgClass || f.textClass != l.textClass ? (l.bgClass = f.bgClass, l.textClass = f.textClass, ju(o, l)) : c && (l.text.className = c);
- }
- function ju(o, l) {
- $1(o, l), l.line.wrapClass ? da(l).className = l.line.wrapClass : l.node != l.text && (l.node.className = "");
- var c = l.textClass ? l.textClass + " " + (l.line.textClass || "") : l.line.textClass;
- l.text.className = c || "";
- }
- function ph(o, l, c, f) {
- if (l.gutter && (l.node.removeChild(l.gutter), l.gutter = null), l.gutterBackground && (l.node.removeChild(l.gutterBackground), l.gutterBackground = null), l.line.gutterClass) {
- var v = da(l);
- l.gutterBackground = I(
- "div",
- null,
- "CodeMirror-gutter-background " + l.line.gutterClass,
- "left: " + (o.options.fixedGutter ? f.fixedPos : -f.gutterTotalWidth) + "px; width: " + f.gutterTotalWidth + "px"
- ), o.display.input.setUneditable(l.gutterBackground), v.insertBefore(l.gutterBackground, l.text);
- }
- var O = l.line.gutterMarkers;
- if (o.options.lineNumbers || O) {
- var L = da(l), j = l.gutter = I("div", null, "CodeMirror-gutter-wrapper", "left: " + (o.options.fixedGutter ? f.fixedPos : -f.gutterTotalWidth) + "px");
- if (j.setAttribute("aria-hidden", "true"), o.display.input.setUneditable(j), L.insertBefore(j, l.text), l.line.gutterClass && (j.className += " " + l.line.gutterClass), o.options.lineNumbers && (!O || !O["CodeMirror-linenumbers"]) && (l.lineNumber = j.appendChild(
- I(
- "div",
- ce(o.options, c),
- "CodeMirror-linenumber CodeMirror-gutter-elt",
- "left: " + f.gutterLeft["CodeMirror-linenumbers"] + "px; width: " + o.display.lineNumInnerWidth + "px"
- )
- )), O)
- for (var Q = 0; Q < o.display.gutterSpecs.length; ++Q) {
- var ne = o.display.gutterSpecs[Q].className, se = O.hasOwnProperty(ne) && O[ne];
- se && j.appendChild(I(
- "div",
- [se],
- "CodeMirror-gutter-elt",
- "left: " + f.gutterLeft[ne] + "px; width: " + f.gutterWidth[ne] + "px"
- ));
- }
- }
- }
- function D1(o, l, c) {
- l.alignable && (l.alignable = null);
- for (var f = D("CodeMirror-linewidget"), v = l.node.firstChild, O = void 0; v; v = O)
- O = v.nextSibling, f.test(v.className) && l.node.removeChild(v);
- hh(o, l, c);
- }
- function I1(o, l, c, f) {
- var v = ch(o, l);
- return l.text = l.node = v.pre, v.bgClass && (l.bgClass = v.bgClass), v.textClass && (l.textClass = v.textClass), ju(o, l), ph(o, l, c, f), hh(o, l, f), l.node;
- }
- function hh(o, l, c) {
- if (mh(o, l.line, l, c, !0), l.rest)
- for (var f = 0; f < l.rest.length; f++)
- mh(o, l.rest[f], l, c, !1);
- }
- function mh(o, l, c, f, v) {
- if (!!l.widgets)
- for (var O = da(c), L = 0, j = l.widgets; L < j.length; ++L) {
- var Q = j[L], ne = I("div", [Q.node], "CodeMirror-linewidget" + (Q.className ? " " + Q.className : ""));
- Q.handleMouseEvents || ne.setAttribute("cm-ignore-events", "true"), F1(Q, ne, c, f), o.display.input.setUneditable(ne), v && Q.above ? O.insertBefore(ne, c.gutter || c.text) : O.appendChild(ne), pn(Q, "redraw");
- }
- }
- function F1(o, l, c, f) {
- if (o.noHScroll) {
- (c.alignable || (c.alignable = [])).push(l);
- var v = f.wrapperWidth;
- l.style.left = f.fixedPos + "px", o.coverGutter || (v -= f.gutterTotalWidth, l.style.paddingLeft = f.gutterTotalWidth + "px"), l.style.width = v + "px";
- }
- o.coverGutter && (l.style.zIndex = 5, l.style.position = "relative", o.noHScroll || (l.style.marginLeft = -f.gutterTotalWidth + "px"));
- }
- function fa(o) {
- if (o.height != null)
- return o.height;
- var l = o.doc.cm;
- if (!l)
- return 0;
- if (!C(document.body, o.node)) {
- var c = "position: relative;";
- o.coverGutter && (c += "margin-left: -" + l.display.gutters.offsetWidth + "px;"), o.noHScroll && (c += "width: " + l.display.wrapper.clientWidth + "px;"), G(l.display.measure, I("div", [o.node], null, c));
- }
- return o.height = o.node.parentNode.offsetHeight;
- }
- function Xi(o, l) {
- for (var c = Mn(l); c != o.wrapper; c = c.parentNode)
- if (!c || c.nodeType == 1 && c.getAttribute("cm-ignore-events") == "true" || c.parentNode == o.sizer && c != o.mover)
- return !0;
- }
- function Ol(o) {
- return o.lineSpace.offsetTop;
- }
- function Uu(o) {
- return o.mover.offsetHeight - o.lineSpace.offsetHeight;
- }
- function vh(o) {
- if (o.cachedPaddingH)
- return o.cachedPaddingH;
- var l = G(o.measure, I("pre", "x", "CodeMirror-line-like")), c = window.getComputedStyle ? window.getComputedStyle(l) : l.currentStyle, f = { left: parseInt(c.paddingLeft), right: parseInt(c.paddingRight) };
- return !isNaN(f.left) && !isNaN(f.right) && (o.cachedPaddingH = f), f;
- }
- function Fi(o) {
- return Se - o.display.nativeBarWidth;
- }
- function Dr(o) {
- return o.display.scroller.clientWidth - Fi(o) - o.display.barWidth;
- }
- function Hu(o) {
- return o.display.scroller.clientHeight - Fi(o) - o.display.barHeight;
- }
- function P1(o, l, c) {
- var f = o.options.lineWrapping, v = f && Dr(o);
- if (!l.measure.heights || f && l.measure.width != v) {
- var O = l.measure.heights = [];
- if (f) {
- l.measure.width = v;
- for (var L = l.text.firstChild.getClientRects(), j = 0; j < L.length - 1; j++) {
- var Q = L[j], ne = L[j + 1];
- Math.abs(Q.bottom - ne.bottom) > 2 && O.push((Q.bottom + ne.top) / 2 - c.top);
- }
- }
- O.push(c.bottom - c.top);
- }
- }
- function gh(o, l, c) {
- if (o.line == l)
- return { map: o.measure.map, cache: o.measure.cache };
- if (o.rest) {
- for (var f = 0; f < o.rest.length; f++)
- if (o.rest[f] == l)
- return { map: o.measure.maps[f], cache: o.measure.caches[f] };
- for (var v = 0; v < o.rest.length; v++)
- if (Ft(o.rest[v]) > c)
- return { map: o.measure.maps[v], cache: o.measure.caches[v], before: !0 };
- }
- }
- function M1(o, l) {
- l = _i(l);
- var c = Ft(l), f = o.display.externalMeasured = new dh(o.doc, l, c);
- f.lineN = c;
- var v = f.built = sh(o, f);
- return f.text = v.pre, G(o.display.lineMeasure, v.pre), f;
- }
- function yh(o, l, c, f) {
- return Pi(o, so(o, l), c, f);
- }
- function zu(o, l) {
- if (l >= o.display.viewFrom && l < o.display.viewTo)
- return o.display.view[Pr(o, l)];
- var c = o.display.externalMeasured;
- if (c && l >= c.lineN && l < c.lineN + c.size)
- return c;
- }
- function so(o, l) {
- var c = Ft(l), f = zu(o, c);
- f && !f.text ? f = null : f && f.changes && (fh(o, f, c, Qu(o)), o.curOp.forceUpdate = !0), f || (f = M1(o, l));
- var v = gh(f, l, c);
- return {
- line: l,
- view: f,
- rect: null,
- map: v.map,
- cache: v.cache,
- before: v.before,
- hasHeights: !1
+ }, Zt.prototype.lookAhead = function(o) {
+ var l = this.lineOracle;
+ return l && l.lookAhead(o);
+ }, Zt.prototype.baseToken = function() {
+ var o = this.lineOracle;
+ return o && o.baseToken(this.pos);
};
- }
- function Pi(o, l, c, f, v) {
- l.before && (c = -1);
- var O = c + (f || ""), L;
- return l.cache.hasOwnProperty(O) ? L = l.cache[O] : (l.rect || (l.rect = l.view.text.getBoundingClientRect()), l.hasHeights || (P1(o, l.view, l.rect), l.hasHeights = !0), L = N1(o, l, c, f), L.bogus || (l.cache[O] = L)), {
- left: L.left,
- right: L.right,
- top: v ? L.rtop : L.top,
- bottom: v ? L.rbottom : L.bottom
- };
- }
- var bh = { left: 0, right: 0, top: 0, bottom: 0 };
- function _h(o, l, c) {
- for (var f, v, O, L, j, Q, ne = 0; ne < o.length; ne += 3)
- if (j = o[ne], Q = o[ne + 1], l < j ? (v = 0, O = 1, L = "left") : l < Q ? (v = l - j, O = v + 1) : (ne == o.length - 3 || l == Q && o[ne + 3] > l) && (O = Q - j, v = O - 1, l >= Q && (L = "right")), v != null) {
- if (f = o[ne + 2], j == Q && c == (f.insertLeft ? "left" : "right") && (L = c), c == "left" && v == 0)
- for (; ne && o[ne - 2] == o[ne - 3] && o[ne - 1].insertLeft; )
- f = o[(ne -= 3) + 2], L = "left";
- if (c == "right" && v == Q - j)
- for (; ne < o.length - 3 && o[ne + 3] == o[ne + 4] && !o[ne + 5].insertLeft; )
- f = o[(ne += 3) + 2], L = "right";
- break;
- }
- return { node: f, start: v, end: O, collapse: L, coverStart: j, coverEnd: Q };
- }
- function L1(o, l) {
- var c = bh;
- if (l == "left")
- for (var f = 0; f < o.length && (c = o[f]).left == c.right; f++)
- ;
- else
- for (var v = o.length - 1; v >= 0 && (c = o[v]).left == c.right; v--)
- ;
- return c;
- }
- function N1(o, l, c, f) {
- var v = _h(l.map, c, f), O = v.node, L = v.start, j = v.end, Q = v.collapse, ne;
- if (O.nodeType == 3) {
- for (var se = 0; se < 4; se++) {
- for (; L && He(l.line.text.charAt(v.coverStart + L)); )
- --L;
- for (; v.coverStart + j < v.coverEnd && He(l.line.text.charAt(v.coverStart + j)); )
- ++j;
- if (d && p < 9 && L == 0 && j == v.coverEnd - v.coverStart ? ne = O.parentNode.getBoundingClientRect() : ne = L1(F(O, L, j).getClientRects(), f), ne.left || ne.right || L == 0)
+ function ut(o, l) {
+ if (l -= o.first, l < 0 || l >= o.size)
+ throw new Error("There is no line " + (l + o.first) + " in the document.");
+ for (var c = o; !c.lines; )
+ for (var f = 0; ; ++f) {
+ var v = c.children[f], O = v.chunkSize();
+ if (l < O) {
+ c = v;
+ break;
+ }
+ l -= O;
+ }
+ return c.lines[l];
+ }
+ function Yi(o, l, c) {
+ var f = [], v = l.line;
+ return o.iter(l.line, c.line + 1, function(O) {
+ var L = O.text;
+ v == c.line && (L = L.slice(0, c.ch)), v == l.line && (L = L.slice(l.ch)), f.push(L), ++v;
+ }), f;
+ }
+ function ro(o, l, c) {
+ var f = [];
+ return o.iter(l, c, function(v) {
+ f.push(v.text);
+ }), f;
+ }
+ function fi(o, l) {
+ var c = l - o.height;
+ if (c)
+ for (var f = o; f; f = f.parent)
+ f.height += c;
+ }
+ function Ft(o) {
+ if (o.parent == null)
+ return null;
+ for (var l = o.parent, c = he(l.lines, o), f = l.parent; f; l = f, f = f.parent)
+ for (var v = 0; f.children[v] != l; ++v)
+ c += f.children[v].chunkSize();
+ return c + l.first;
+ }
+ function Di(o, l) {
+ var c = o.first;
+ e:
+ do {
+ for (var f = 0; f < o.children.length; ++f) {
+ var v = o.children[f], O = v.height;
+ if (l < O) {
+ o = v;
+ continue e;
+ }
+ l -= O, c += v.chunkSize();
+ }
+ return c;
+ } while (!o.lines);
+ for (var L = 0; L < o.lines.length; ++L) {
+ var j = o.lines[L], Q = j.height;
+ if (l < Q)
break;
- j = L, L = L - 1, Q = "right";
+ l -= Q;
}
- d && p < 11 && (ne = B1(o.display.measure, ne));
- } else {
- L > 0 && (Q = f = "right");
- var de;
- o.options.lineWrapping && (de = O.getClientRects()).length > 1 ? ne = de[f == "right" ? de.length - 1 : 0] : ne = O.getBoundingClientRect();
+ return c + L;
}
- if (d && p < 9 && !L && (!ne || !ne.left && !ne.right)) {
- var Ee = O.parentNode.getClientRects()[0];
- Ee ? ne = { left: Ee.left, right: Ee.left + fo(o.display), top: Ee.top, bottom: Ee.bottom } : ne = bh;
+ function oe(o, l) {
+ return l >= o.first && l < o.first + o.size;
}
- for (var Ce = ne.top - l.rect.top, Ie = ne.bottom - l.rect.top, Ne = (Ce + Ie) / 2, Ue = l.view.measure.heights, Ye = 0; Ye < Ue.length - 1 && !(Ne < Ue[Ye]); Ye++)
- ;
- var nt = Ye ? Ue[Ye - 1] : 0, Qe = Ue[Ye], ot = {
- left: (Q == "right" ? ne.right : ne.left) - l.rect.left,
- right: (Q == "left" ? ne.left : ne.right) - l.rect.left,
- top: nt,
- bottom: Qe
- };
- return !ne.left && !ne.right && (ot.bogus = !0), o.options.singleCursorHeightPerLine || (ot.rtop = Ce, ot.rbottom = Ie), ot;
- }
- function B1(o, l) {
- if (!window.screen || screen.logicalXDPI == null || screen.logicalXDPI == screen.deviceXDPI || !bl(o))
- return l;
- var c = screen.logicalXDPI / screen.deviceXDPI, f = screen.logicalYDPI / screen.deviceYDPI;
- return {
- left: l.left * c,
- right: l.right * c,
- top: l.top * f,
- bottom: l.bottom * f
- };
- }
- function wh(o) {
- if (o.measure && (o.measure.cache = {}, o.measure.heights = null, o.rest))
- for (var l = 0; l < o.rest.length; l++)
- o.measure.caches[l] = {};
- }
- function Ah(o) {
- o.display.externalMeasure = null, W(o.display.lineMeasure);
- for (var l = 0; l < o.display.view.length; l++)
- wh(o.display.view[l]);
- }
- function ca(o) {
- Ah(o), o.display.cachedCharWidth = o.display.cachedTextHeight = o.display.cachedPaddingH = null, o.options.lineWrapping || (o.display.maxLineChanged = !0), o.display.lineNumChars = null;
- }
- function Ch(o) {
- return _ && E ? -(o.body.getBoundingClientRect().left - parseInt(getComputedStyle(o.body).marginLeft)) : o.defaultView.pageXOffset || (o.documentElement || o.body).scrollLeft;
- }
- function Sh(o) {
- return _ && E ? -(o.body.getBoundingClientRect().top - parseInt(getComputedStyle(o.body).marginTop)) : o.defaultView.pageYOffset || (o.documentElement || o.body).scrollTop;
- }
- function Wu(o) {
- var l = _i(o), c = l.widgets, f = 0;
- if (c)
- for (var v = 0; v < c.length; ++v)
- c[v].above && (f += fa(c[v]));
- return f;
- }
- function $l(o, l, c, f, v) {
- if (!v) {
- var O = Wu(l);
- c.top += O, c.bottom += O;
+ function ce(o, l) {
+ return String(o.lineNumberFormatter(l + o.firstLineNumber));
}
- if (f == "line")
+ function ye(o, l, c) {
+ if (c === void 0 && (c = null), !(this instanceof ye))
+ return new ye(o, l, c);
+ this.line = o, this.ch = l, this.sticky = c;
+ }
+ function De(o, l) {
+ return o.line - l.line || o.ch - l.ch;
+ }
+ function bt(o, l) {
+ return o.sticky == l.sticky && De(o, l) == 0;
+ }
+ function Ot(o) {
+ return ye(o.line, o.ch);
+ }
+ function Rt(o, l) {
+ return De(o, l) < 0 ? l : o;
+ }
+ function un(o, l) {
+ return De(o, l) < 0 ? o : l;
+ }
+ function qn(o, l) {
+ return Math.max(o.first, Math.min(l, o.first + o.size - 1));
+ }
+ function _t(o, l) {
+ if (l.line < o.first)
+ return ye(o.first, 0);
+ var c = o.first + o.size - 1;
+ return l.line > c ? ye(c, ut(o, c).text.length) : a1(l, ut(o, l.line).text.length);
+ }
+ function a1(o, l) {
+ var c = o.ch;
+ return c == null || c > l ? ye(o.line, l) : c < 0 ? ye(o.line, 0) : o;
+ }
+ function Gp(o, l) {
+ for (var c = [], f = 0; f < l.length; f++)
+ c[f] = _t(o, l[f]);
return c;
- f || (f = "local");
- var L = Ji(l);
- if (f == "local" ? L += Ol(o.display) : L -= o.display.viewOffset, f == "page" || f == "window") {
- var j = o.display.lineSpace.getBoundingClientRect();
- L += j.top + (f == "window" ? 0 : Sh(te(o)));
- var Q = j.left + (f == "window" ? 0 : Ch(te(o)));
- c.left += Q, c.right += Q;
}
- return c.top += L, c.bottom += L, c;
- }
- function Eh(o, l, c) {
- if (c == "div")
- return l;
- var f = l.left, v = l.top;
- if (c == "page")
- f -= Ch(te(o)), v -= Sh(te(o));
- else if (c == "local" || !c) {
- var O = o.display.sizer.getBoundingClientRect();
- f += O.left, v += O.top;
- }
- var L = o.display.lineSpace.getBoundingClientRect();
- return { left: f - L.left, top: v - L.top };
- }
- function Rl(o, l, c, f, v) {
- return f || (f = ut(o.doc, l.line)), $l(o, f, yh(o, f, l.ch, v), c);
- }
- function wi(o, l, c, f, v, O) {
- f = f || ut(o.doc, l.line), v || (v = so(o, f));
- function L(Ie, Ne) {
- var Ue = Pi(o, v, Ie, Ne ? "right" : "left", O);
- return Ne ? Ue.left = Ue.right : Ue.right = Ue.left, $l(o, f, Ue, c);
- }
- var j = ht(f, o.doc.direction), Q = l.ch, ne = l.sticky;
- if (Q >= f.text.length ? (Q = f.text.length, ne = "before") : Q <= 0 && (Q = 0, ne = "after"), !j)
- return L(ne == "before" ? Q - 1 : Q, ne == "before");
- function se(Ie, Ne, Ue) {
- var Ye = j[Ne], nt = Ye.level == 1;
- return L(Ue ? Ie - 1 : Ie, nt != Ue);
- }
- var de = je(j, Q, ne), Ee = ft, Ce = se(Q, de, ne == "before");
- return Ee != null && (Ce.other = se(Q, Ee, ne != "before")), Ce;
- }
- function xh(o, l) {
- var c = 0;
- l = _t(o.doc, l), o.options.lineWrapping || (c = fo(o.display) * l.ch);
- var f = ut(o.doc, l.line), v = Ji(f) + Ol(o.display);
- return { left: c, right: c, top: v, bottom: v + f.height };
- }
- function Gu(o, l, c, f, v) {
- var O = ye(o, l, c);
- return O.xRel = v, f && (O.outside = f), O;
- }
- function Ku(o, l, c) {
- var f = o.doc;
- if (c += o.display.viewOffset, c < 0)
- return Gu(f.first, 0, null, -1, -1);
- var v = Di(f, c), O = f.first + f.size - 1;
- if (v > O)
- return Gu(f.first + f.size - 1, ut(f, O).text.length, null, 1, 1);
- l < 0 && (l = 0);
- for (var L = ut(f, v); ; ) {
- var j = V1(o, L, v, l, c), Q = h1(L, j.ch + (j.xRel > 0 || j.outside > 0 ? 1 : 0));
- if (!Q)
- return j;
- var ne = Q.find(1);
- if (ne.line == v)
- return ne;
- L = ut(f, v = ne.line);
- }
- }
- function Th(o, l, c, f) {
- f -= Wu(l);
- var v = l.text.length, O = We(function(L) {
- return Pi(o, c, L - 1).bottom <= f;
- }, v, 0);
- return v = We(function(L) {
- return Pi(o, c, L).top > f;
- }, O, v), { begin: O, end: v };
- }
- function kh(o, l, c, f) {
- c || (c = so(o, l));
- var v = $l(o, l, Pi(o, c, f), "line").top;
- return Th(o, l, c, v);
- }
- function Yu(o, l, c, f) {
- return o.bottom <= c ? !1 : o.top > c ? !0 : (f ? o.left : o.right) > l;
- }
- function V1(o, l, c, f, v) {
- v -= Ji(l);
- var O = so(o, l), L = Wu(l), j = 0, Q = l.text.length, ne = !0, se = ht(l, o.doc.direction);
- if (se) {
- var de = (o.options.lineWrapping ? U1 : j1)(o, l, c, O, se, f, v);
- ne = de.level != 1, j = ne ? de.from : de.to - 1, Q = ne ? de.to : de.from - 1;
- }
- var Ee = null, Ce = null, Ie = We(function(mt) {
- var ct = Pi(o, O, mt);
- return ct.top += L, ct.bottom += L, Yu(ct, f, v, !1) ? (ct.top <= v && ct.left <= f && (Ee = mt, Ce = ct), !0) : !1;
- }, j, Q), Ne, Ue, Ye = !1;
- if (Ce) {
- var nt = f - Ce.left < Ce.right - f, Qe = nt == ne;
- Ie = Ee + (Qe ? 0 : 1), Ue = Qe ? "after" : "before", Ne = nt ? Ce.left : Ce.right;
- } else {
- !ne && (Ie == Q || Ie == j) && Ie++, Ue = Ie == 0 ? "after" : Ie == l.text.length ? "before" : Pi(o, O, Ie - (ne ? 1 : 0)).bottom + L <= v == ne ? "after" : "before";
- var ot = wi(o, ye(c, Ie, Ue), "line", l, O);
- Ne = ot.left, Ye = v < ot.top ? -1 : v >= ot.bottom ? 1 : 0;
- }
- return Ie = at(l.text, Ie, 1), Gu(c, Ie, Ue, Ye, f - Ne);
- }
- function j1(o, l, c, f, v, O, L) {
- var j = We(function(de) {
- var Ee = v[de], Ce = Ee.level != 1;
- return Yu(wi(
+ var Al = function(o, l) {
+ this.state = o, this.lookAhead = l;
+ }, Ii = function(o, l, c, f) {
+ this.state = l, this.doc = o, this.line = c, this.maxLookAhead = f || 0, this.baseTokens = null, this.baseTokenPos = 1;
+ };
+ Ii.prototype.lookAhead = function(o) {
+ var l = this.doc.getLine(this.line + o);
+ return l != null && o > this.maxLookAhead && (this.maxLookAhead = o), l;
+ }, Ii.prototype.baseToken = function(o) {
+ if (!this.baseTokens)
+ return null;
+ for (; this.baseTokens[this.baseTokenPos] <= o; )
+ this.baseTokenPos += 2;
+ var l = this.baseTokens[this.baseTokenPos + 1];
+ return {
+ type: l && l.replace(/( |^)overlay .*/, ""),
+ size: this.baseTokens[this.baseTokenPos] - o
+ };
+ }, Ii.prototype.nextLine = function() {
+ this.line++, this.maxLookAhead > 0 && this.maxLookAhead--;
+ }, Ii.fromSaved = function(o, l, c) {
+ return l instanceof Al ? new Ii(o, Ki(o.mode, l.state), c, l.lookAhead) : new Ii(o, Ki(o.mode, l), c);
+ }, Ii.prototype.save = function(o) {
+ var l = o !== !1 ? Ki(this.doc.mode, this.state) : this.state;
+ return this.maxLookAhead > 0 ? new Al(l, this.maxLookAhead) : l;
+ };
+ function Kp(o, l, c, f) {
+ var v = [o.state.modeGen], O = {};
+ qp(
o,
- ye(c, Ce ? Ee.to : Ee.from, Ce ? "before" : "after"),
- "line",
- l,
- f
- ), O, L, !0);
- }, 0, v.length - 1), Q = v[j];
- if (j > 0) {
- var ne = Q.level != 1, se = wi(
- o,
- ye(c, ne ? Q.from : Q.to, ne ? "after" : "before"),
- "line",
- l,
+ l.text,
+ o.doc.mode,
+ c,
+ function(ne, se) {
+ return v.push(ne, se);
+ },
+ O,
f
);
- Yu(se, O, L, !0) && se.top > L && (Q = v[j - 1]);
+ for (var L = c.state, j = function(ne) {
+ c.baseTokens = v;
+ var se = o.state.overlays[ne], de = 1, Ee = 0;
+ c.state = !0, qp(o, l.text, se.mode, c, function(Ce, Ie) {
+ for (var Ne = de; Ee < Ce; ) {
+ var Ue = v[de];
+ Ue > Ce && v.splice(de, 1, Ce, v[de + 1], Ue), de += 2, Ee = Math.min(Ce, Ue);
+ }
+ if (!!Ie)
+ if (se.opaque)
+ v.splice(Ne, de - Ne, Ce, "overlay " + Ie), de = Ne + 2;
+ else
+ for (; Ne < de; Ne += 2) {
+ var Ye = v[Ne + 1];
+ v[Ne + 1] = (Ye ? Ye + " " : "") + "overlay " + Ie;
+ }
+ }, O), c.state = L, c.baseTokens = null, c.baseTokenPos = 1;
+ }, Q = 0; Q < o.state.overlays.length; ++Q)
+ j(Q);
+ return { styles: v, classes: O.bgClass || O.textClass ? O : null };
}
- return Q;
- }
- function U1(o, l, c, f, v, O, L) {
- var j = Th(o, l, f, L), Q = j.begin, ne = j.end;
- /\s/.test(l.text.charAt(ne - 1)) && ne--;
- for (var se = null, de = null, Ee = 0; Ee < v.length; Ee++) {
- var Ce = v[Ee];
- if (!(Ce.from >= ne || Ce.to <= Q)) {
- var Ie = Ce.level != 1, Ne = Pi(o, f, Ie ? Math.min(ne, Ce.to) - 1 : Math.max(Q, Ce.from)).right, Ue = Ne < O ? O - Ne + 1e9 : Ne - O;
- (!se || de > Ue) && (se = Ce, de = Ue);
+ function Yp(o, l, c) {
+ if (!l.styles || l.styles[0] != o.state.modeGen) {
+ var f = la(o, Ft(l)), v = l.text.length > o.options.maxHighlightLength && Ki(o.doc.mode, f.state), O = Kp(o, l, f);
+ v && (f.state = v), l.stateAfter = f.save(!v), l.styles = O.styles, O.classes ? l.styleClasses = O.classes : l.styleClasses && (l.styleClasses = null), c === o.doc.highlightFrontier && (o.doc.modeFrontier = Math.max(o.doc.modeFrontier, ++o.doc.highlightFrontier));
+ }
+ return l.styles;
+ }
+ function la(o, l, c) {
+ var f = o.doc, v = o.display;
+ if (!f.mode.startState)
+ return new Ii(f, !0, l);
+ var O = l1(o, l, c), L = O > f.first && ut(f, O - 1).stateAfter, j = L ? Ii.fromSaved(f, L, O) : new Ii(f, aa(f.mode), O);
+ return f.iter(O, l, function(Q) {
+ Fu(o, Q.text, j);
+ var ne = j.line;
+ Q.stateAfter = ne == l - 1 || ne % 5 == 0 || ne >= v.viewFrom && ne < v.viewTo ? j.save() : null, j.nextLine();
+ }), c && (f.modeFrontier = j.line), j;
+ }
+ function Fu(o, l, c, f) {
+ var v = o.doc.mode, O = new Zt(l, o.options.tabSize, c);
+ for (O.start = O.pos = f || 0, l == "" && Qp(v, c.state); !O.eol(); )
+ Pu(v, O, c.state), O.start = O.pos;
+ }
+ function Qp(o, l) {
+ if (o.blankLine)
+ return o.blankLine(l);
+ if (!!o.innerMode) {
+ var c = pr(o, l);
+ if (c.mode.blankLine)
+ return c.mode.blankLine(c.state);
}
}
- return se || (se = v[v.length - 1]), se.from < Q && (se = { from: Q, to: se.to, level: se.level }), se.to > ne && (se = { from: se.from, to: ne, level: se.level }), se;
- }
- var Ir;
- function uo(o) {
- if (o.cachedTextHeight != null)
- return o.cachedTextHeight;
- if (Ir == null) {
- Ir = I("pre", null, "CodeMirror-line-like");
- for (var l = 0; l < 49; ++l)
- Ir.appendChild(document.createTextNode("x")), Ir.appendChild(I("br"));
- Ir.appendChild(document.createTextNode("x"));
+ function Pu(o, l, c, f) {
+ for (var v = 0; v < 10; v++) {
+ f && (f[0] = pr(o, c).mode);
+ var O = o.token(l, c);
+ if (l.pos > l.start)
+ return O;
+ }
+ throw new Error("Mode " + o.name + " failed to advance stream.");
}
- G(o.measure, Ir);
- var c = Ir.offsetHeight / 50;
- return c > 3 && (o.cachedTextHeight = c), W(o.measure), c || 1;
- }
- function fo(o) {
- if (o.cachedCharWidth != null)
- return o.cachedCharWidth;
- var l = I("span", "xxxxxxxxxx"), c = I("pre", [l], "CodeMirror-line-like");
- G(o.measure, c);
- var f = l.getBoundingClientRect(), v = (f.right - f.left) / 10;
- return v > 2 && (o.cachedCharWidth = v), v || 10;
- }
- function Qu(o) {
- for (var l = o.display, c = {}, f = {}, v = l.gutters.clientLeft, O = l.gutters.firstChild, L = 0; O; O = O.nextSibling, ++L) {
- var j = o.display.gutterSpecs[L].className;
- c[j] = O.offsetLeft + O.clientLeft + v, f[j] = O.clientWidth;
- }
- return {
- fixedPos: Ju(l),
- gutterTotalWidth: l.gutters.offsetWidth,
- gutterLeft: c,
- gutterWidth: f,
- wrapperWidth: l.wrapper.clientWidth
+ var Jp = function(o, l, c) {
+ this.start = o.start, this.end = o.pos, this.string = o.current(), this.type = l || null, this.state = c;
};
- }
- function Ju(o) {
- return o.scroller.getBoundingClientRect().left - o.sizer.getBoundingClientRect().left;
- }
- function Oh(o) {
- var l = uo(o.display), c = o.options.lineWrapping, f = c && Math.max(5, o.display.scroller.clientWidth / fo(o.display) - 3);
- return function(v) {
- if (hr(o.doc, v))
- return 0;
- var O = 0;
- if (v.widgets)
- for (var L = 0; L < v.widgets.length; L++)
- v.widgets[L].height && (O += v.widgets[L].height);
- return c ? O + (Math.ceil(v.text.length / f) || 1) * l : O + l;
- };
- }
- function Xu(o) {
- var l = o.doc, c = Oh(o);
- l.iter(function(f) {
- var v = c(f);
- v != f.height && fi(f, v);
- });
- }
- function Fr(o, l, c, f) {
- var v = o.display;
- if (!c && Mn(l).getAttribute("cm-not-content") == "true")
- return null;
- var O, L, j = v.lineSpace.getBoundingClientRect();
- try {
- O = l.clientX - j.left, L = l.clientY - j.top;
- } catch {
- return null;
+ function Xp(o, l, c, f) {
+ var v = o.doc, O = v.mode, L;
+ l = _t(v, l);
+ var j = ut(v, l.line), Q = la(o, l.line, c), ne = new Zt(j.text, o.options.tabSize, Q), se;
+ for (f && (se = []); (f || ne.pos < l.ch) && !ne.eol(); )
+ ne.start = ne.pos, L = Pu(O, ne, Q.state), f && se.push(new Jp(ne, L, Ki(v.mode, Q.state)));
+ return f ? se : new Jp(ne, L, Q.state);
}
- var Q = Ku(o, O, L), ne;
- if (f && Q.xRel > 0 && (ne = ut(o.doc, Q.line).text).length == Q.ch) {
- var se = ve(ne, ne.length, o.options.tabSize) - ne.length;
- Q = ye(Q.line, Math.max(0, Math.round((O - vh(o.display).left) / fo(o.display)) - se));
+ function Zp(o, l) {
+ if (o)
+ for (; ; ) {
+ var c = o.match(/(?:^|\s+)line-(background-)?(\S+)/);
+ if (!c)
+ break;
+ o = o.slice(0, c.index) + o.slice(c.index + c[0].length);
+ var f = c[1] ? "bgClass" : "textClass";
+ l[f] == null ? l[f] = c[2] : new RegExp("(?:^|\\s)" + c[2] + "(?:$|\\s)").test(l[f]) || (l[f] += " " + c[2]);
+ }
+ return o;
}
- return Q;
- }
- function Pr(o, l) {
- if (l >= o.display.viewTo || (l -= o.display.viewFrom, l < 0))
- return null;
- for (var c = o.display.view, f = 0; f < c.length; f++)
- if (l -= c[f].size, l < 0)
- return f;
- }
- function Ln(o, l, c, f) {
- l == null && (l = o.doc.first), c == null && (c = o.doc.first + o.doc.size), f || (f = 0);
- var v = o.display;
- if (f && c < v.viewTo && (v.updateLineNumbers == null || v.updateLineNumbers > l) && (v.updateLineNumbers = l), o.curOp.viewChanged = !0, l >= v.viewTo)
- Qi && Nu(o.doc, l) < v.viewTo && vr(o);
- else if (c <= v.viewFrom)
- Qi && ah(o.doc, c + f) > v.viewFrom ? vr(o) : (v.viewFrom += f, v.viewTo += f);
- else if (l <= v.viewFrom && c >= v.viewTo)
- vr(o);
- else if (l <= v.viewFrom) {
- var O = Dl(o, c, c + f, 1);
- O ? (v.view = v.view.slice(O.index), v.viewFrom = O.lineN, v.viewTo += f) : vr(o);
- } else if (c >= v.viewTo) {
- var L = Dl(o, l, l, -1);
- L ? (v.view = v.view.slice(0, L.index), v.viewTo = L.lineN) : vr(o);
- } else {
- var j = Dl(o, l, l, -1), Q = Dl(o, c, c + f, 1);
- j && Q ? (v.view = v.view.slice(0, j.index).concat(kl(o, j.lineN, Q.lineN)).concat(v.view.slice(Q.index)), v.viewTo += f) : vr(o);
- }
- var ne = v.externalMeasured;
- ne && (c < ne.lineN ? ne.lineN += f : l < ne.lineN + ne.size && (v.externalMeasured = null));
- }
- function mr(o, l, c) {
- o.curOp.viewChanged = !0;
- var f = o.display, v = o.display.externalMeasured;
- if (v && l >= v.lineN && l < v.lineN + v.size && (f.externalMeasured = null), !(l < f.viewFrom || l >= f.viewTo)) {
- var O = f.view[Pr(o, l)];
- if (O.node != null) {
- var L = O.changes || (O.changes = []);
- he(L, c) == -1 && L.push(c);
+ function qp(o, l, c, f, v, O, L) {
+ var j = c.flattenSpans;
+ j == null && (j = o.options.flattenSpans);
+ var Q = 0, ne = null, se = new Zt(l, o.options.tabSize, f), de, Ee = o.options.addModeClass && [null];
+ for (l == "" && Zp(Qp(c, f.state), O); !se.eol(); ) {
+ if (se.pos > o.options.maxHighlightLength ? (j = !1, L && Fu(o, l, f, se.pos), se.pos = l.length, de = null) : de = Zp(Pu(c, se, f.state, Ee), O), Ee) {
+ var Ce = Ee[0].name;
+ Ce && (de = "m-" + (de ? Ce + " " + de : Ce));
+ }
+ if (!j || ne != de) {
+ for (; Q < se.start; )
+ Q = Math.min(se.start, Q + 5e3), v(Q, ne);
+ ne = de;
+ }
+ se.start = se.pos;
+ }
+ for (; Q < se.pos; ) {
+ var Ie = Math.min(se.pos, Q + 5e3);
+ v(Ie, ne), Q = Ie;
}
}
- }
- function vr(o) {
- o.display.viewFrom = o.display.viewTo = o.doc.first, o.display.view = [], o.display.viewOffset = 0;
- }
- function Dl(o, l, c, f) {
- var v = Pr(o, l), O, L = o.display.view;
- if (!Qi || c == o.doc.first + o.doc.size)
- return { index: v, lineN: c };
- for (var j = o.display.viewFrom, Q = 0; Q < v; Q++)
- j += L[Q].size;
- if (j != l) {
- if (f > 0) {
- if (v == L.length - 1)
- return null;
- O = j + L[v].size - l, v++;
- } else
- O = j - l;
- l += O, c += O;
+ function l1(o, l, c) {
+ for (var f, v, O = o.doc, L = c ? -1 : l - (o.doc.mode.innerMode ? 1e3 : 100), j = l; j > L; --j) {
+ if (j <= O.first)
+ return O.first;
+ var Q = ut(O, j - 1), ne = Q.stateAfter;
+ if (ne && (!c || j + (ne instanceof Al ? ne.lookAhead : 0) <= O.modeFrontier))
+ return j;
+ var se = ve(Q.text, null, o.options.tabSize);
+ (v == null || f > se) && (v = j - 1, f = se);
+ }
+ return v;
}
- for (; Nu(o.doc, c) != c; ) {
- if (v == (f < 0 ? 0 : L.length - 1))
+ function s1(o, l) {
+ if (o.modeFrontier = Math.min(o.modeFrontier, l), !(o.highlightFrontier < l - 10)) {
+ for (var c = o.first, f = l - 1; f > c; f--) {
+ var v = ut(o, f).stateAfter;
+ if (v && (!(v instanceof Al) || f + v.lookAhead < l)) {
+ c = f + 1;
+ break;
+ }
+ }
+ o.highlightFrontier = Math.min(o.highlightFrontier, c);
+ }
+ }
+ var eh = !1, Qi = !1;
+ function u1() {
+ eh = !0;
+ }
+ function d1() {
+ Qi = !0;
+ }
+ function Cl(o, l, c) {
+ this.marker = o, this.from = l, this.to = c;
+ }
+ function sa(o, l) {
+ if (o)
+ for (var c = 0; c < o.length; ++c) {
+ var f = o[c];
+ if (f.marker == l)
+ return f;
+ }
+ }
+ function f1(o, l) {
+ for (var c, f = 0; f < o.length; ++f)
+ o[f] != l && (c || (c = [])).push(o[f]);
+ return c;
+ }
+ function c1(o, l, c) {
+ var f = c && window.WeakSet && (c.markedSpans || (c.markedSpans = /* @__PURE__ */ new WeakSet()));
+ f && o.markedSpans && f.has(o.markedSpans) ? o.markedSpans.push(l) : (o.markedSpans = o.markedSpans ? o.markedSpans.concat([l]) : [l], f && f.add(o.markedSpans)), l.marker.attachLine(o);
+ }
+ function p1(o, l, c) {
+ var f;
+ if (o)
+ for (var v = 0; v < o.length; ++v) {
+ var O = o[v], L = O.marker, j = O.from == null || (L.inclusiveLeft ? O.from <= l : O.from < l);
+ if (j || O.from == l && L.type == "bookmark" && (!c || !O.marker.insertLeft)) {
+ var Q = O.to == null || (L.inclusiveRight ? O.to >= l : O.to > l);
+ (f || (f = [])).push(new Cl(L, O.from, Q ? null : O.to));
+ }
+ }
+ return f;
+ }
+ function h1(o, l, c) {
+ var f;
+ if (o)
+ for (var v = 0; v < o.length; ++v) {
+ var O = o[v], L = O.marker, j = O.to == null || (L.inclusiveRight ? O.to >= l : O.to > l);
+ if (j || O.from == l && L.type == "bookmark" && (!c || O.marker.insertLeft)) {
+ var Q = O.from == null || (L.inclusiveLeft ? O.from <= l : O.from < l);
+ (f || (f = [])).push(new Cl(
+ L,
+ Q ? null : O.from - l,
+ O.to == null ? null : O.to - l
+ ));
+ }
+ }
+ return f;
+ }
+ function Mu(o, l) {
+ if (l.full)
return null;
- c += f * L[v - (f < 0 ? 1 : 0)].size, v += f;
- }
- return { index: v, lineN: c };
- }
- function H1(o, l, c) {
- var f = o.display, v = f.view;
- v.length == 0 || l >= f.viewTo || c <= f.viewFrom ? (f.view = kl(o, l, c), f.viewFrom = l) : (f.viewFrom > l ? f.view = kl(o, l, f.viewFrom).concat(f.view) : f.viewFrom < l && (f.view = f.view.slice(Pr(o, l))), f.viewFrom = l, f.viewTo < c ? f.view = f.view.concat(kl(o, f.viewTo, c)) : f.viewTo > c && (f.view = f.view.slice(0, Pr(o, c)))), f.viewTo = c;
- }
- function $h(o) {
- for (var l = o.display.view, c = 0, f = 0; f < l.length; f++) {
- var v = l[f];
- !v.hidden && (!v.node || v.changes) && ++c;
- }
- return c;
- }
- function pa(o) {
- o.display.input.showSelection(o.display.input.prepareSelection());
- }
- function Rh(o, l) {
- l === void 0 && (l = !0);
- var c = o.doc, f = {}, v = f.cursors = document.createDocumentFragment(), O = f.selection = document.createDocumentFragment(), L = o.options.$customCursor;
- L && (l = !0);
- for (var j = 0; j < c.sel.ranges.length; j++)
- if (!(!l && j == c.sel.primIndex)) {
- var Q = c.sel.ranges[j];
- if (!(Q.from().line >= o.display.viewTo || Q.to().line < o.display.viewFrom)) {
- var ne = Q.empty();
- if (L) {
- var se = L(o, Q);
- se && Zu(o, se, v);
+ var c = oe(o, l.from.line) && ut(o, l.from.line).markedSpans, f = oe(o, l.to.line) && ut(o, l.to.line).markedSpans;
+ if (!c && !f)
+ return null;
+ var v = l.from.ch, O = l.to.ch, L = De(l.from, l.to) == 0, j = p1(c, v, L), Q = h1(f, O, L), ne = l.text.length == 1, se = Ae(l.text).length + (ne ? v : 0);
+ if (j)
+ for (var de = 0; de < j.length; ++de) {
+ var Ee = j[de];
+ if (Ee.to == null) {
+ var Ce = sa(Q, Ee.marker);
+ Ce ? ne && (Ee.to = Ce.to == null ? null : Ce.to + se) : Ee.to = v;
+ }
+ }
+ if (Q)
+ for (var Ie = 0; Ie < Q.length; ++Ie) {
+ var Ne = Q[Ie];
+ if (Ne.to != null && (Ne.to += se), Ne.from == null) {
+ var Ue = sa(j, Ne.marker);
+ Ue || (Ne.from = se, ne && (j || (j = [])).push(Ne));
} else
- (ne || o.options.showCursorWhenSelecting) && Zu(o, Q.head, v);
- ne || z1(o, Q, O);
+ Ne.from += se, ne && (j || (j = [])).push(Ne);
+ }
+ j && (j = th(j)), Q && Q != j && (Q = th(Q));
+ var Ye = [j];
+ if (!ne) {
+ var nt = l.text.length - 2, Qe;
+ if (nt > 0 && j)
+ for (var ot = 0; ot < j.length; ++ot)
+ j[ot].to == null && (Qe || (Qe = [])).push(new Cl(j[ot].marker, null, null));
+ for (var mt = 0; mt < nt; ++mt)
+ Ye.push(Qe);
+ Ye.push(Q);
+ }
+ return Ye;
+ }
+ function th(o) {
+ for (var l = 0; l < o.length; ++l) {
+ var c = o[l];
+ c.from != null && c.from == c.to && c.marker.clearWhenEmpty !== !1 && o.splice(l--, 1);
+ }
+ return o.length ? o : null;
+ }
+ function m1(o, l, c) {
+ var f = null;
+ if (o.iter(l.line, c.line + 1, function(Ce) {
+ if (Ce.markedSpans)
+ for (var Ie = 0; Ie < Ce.markedSpans.length; ++Ie) {
+ var Ne = Ce.markedSpans[Ie].marker;
+ Ne.readOnly && (!f || he(f, Ne) == -1) && (f || (f = [])).push(Ne);
+ }
+ }), !f)
+ return null;
+ for (var v = [{ from: l, to: c }], O = 0; O < f.length; ++O)
+ for (var L = f[O], j = L.find(0), Q = 0; Q < v.length; ++Q) {
+ var ne = v[Q];
+ if (!(De(ne.to, j.from) < 0 || De(ne.from, j.to) > 0)) {
+ var se = [Q, 1], de = De(ne.from, j.from), Ee = De(ne.to, j.to);
+ (de < 0 || !L.inclusiveLeft && !de) && se.push({ from: ne.from, to: j.from }), (Ee > 0 || !L.inclusiveRight && !Ee) && se.push({ from: j.to, to: ne.to }), v.splice.apply(v, se), Q += se.length - 3;
+ }
+ }
+ return v;
+ }
+ function nh(o) {
+ var l = o.markedSpans;
+ if (!!l) {
+ for (var c = 0; c < l.length; ++c)
+ l[c].marker.detachLine(o);
+ o.markedSpans = null;
+ }
+ }
+ function ih(o, l) {
+ if (!!l) {
+ for (var c = 0; c < l.length; ++c)
+ l[c].marker.attachLine(o);
+ o.markedSpans = l;
+ }
+ }
+ function Sl(o) {
+ return o.inclusiveLeft ? -1 : 0;
+ }
+ function El(o) {
+ return o.inclusiveRight ? 1 : 0;
+ }
+ function Lu(o, l) {
+ var c = o.lines.length - l.lines.length;
+ if (c != 0)
+ return c;
+ var f = o.find(), v = l.find(), O = De(f.from, v.from) || Sl(o) - Sl(l);
+ if (O)
+ return -O;
+ var L = De(f.to, v.to) || El(o) - El(l);
+ return L || l.id - o.id;
+ }
+ function rh(o, l) {
+ var c = Qi && o.markedSpans, f;
+ if (c)
+ for (var v = void 0, O = 0; O < c.length; ++O)
+ v = c[O], v.marker.collapsed && (l ? v.from : v.to) == null && (!f || Lu(f, v.marker) < 0) && (f = v.marker);
+ return f;
+ }
+ function oh(o) {
+ return rh(o, !0);
+ }
+ function xl(o) {
+ return rh(o, !1);
+ }
+ function v1(o, l) {
+ var c = Qi && o.markedSpans, f;
+ if (c)
+ for (var v = 0; v < c.length; ++v) {
+ var O = c[v];
+ O.marker.collapsed && (O.from == null || O.from < l) && (O.to == null || O.to > l) && (!f || Lu(f, O.marker) < 0) && (f = O.marker);
+ }
+ return f;
+ }
+ function ah(o, l, c, f, v) {
+ var O = ut(o, l), L = Qi && O.markedSpans;
+ if (L)
+ for (var j = 0; j < L.length; ++j) {
+ var Q = L[j];
+ if (!!Q.marker.collapsed) {
+ var ne = Q.marker.find(0), se = De(ne.from, c) || Sl(Q.marker) - Sl(v), de = De(ne.to, f) || El(Q.marker) - El(v);
+ if (!(se >= 0 && de <= 0 || se <= 0 && de >= 0) && (se <= 0 && (Q.marker.inclusiveRight && v.inclusiveLeft ? De(ne.to, c) >= 0 : De(ne.to, c) > 0) || se >= 0 && (Q.marker.inclusiveRight && v.inclusiveLeft ? De(ne.from, f) <= 0 : De(ne.from, f) < 0)))
+ return !0;
+ }
+ }
+ }
+ function _i(o) {
+ for (var l; l = oh(o); )
+ o = l.find(-1, !0).line;
+ return o;
+ }
+ function g1(o) {
+ for (var l; l = xl(o); )
+ o = l.find(1, !0).line;
+ return o;
+ }
+ function y1(o) {
+ for (var l, c; l = xl(o); )
+ o = l.find(1, !0).line, (c || (c = [])).push(o);
+ return c;
+ }
+ function Nu(o, l) {
+ var c = ut(o, l), f = _i(c);
+ return c == f ? l : Ft(f);
+ }
+ function lh(o, l) {
+ if (l > o.lastLine())
+ return l;
+ var c = ut(o, l), f;
+ if (!hr(o, c))
+ return l;
+ for (; f = xl(c); )
+ c = f.find(1, !0).line;
+ return Ft(c) + 1;
+ }
+ function hr(o, l) {
+ var c = Qi && l.markedSpans;
+ if (c) {
+ for (var f = void 0, v = 0; v < c.length; ++v)
+ if (f = c[v], !!f.marker.collapsed) {
+ if (f.from == null)
+ return !0;
+ if (!f.marker.widgetNode && f.from == 0 && f.marker.inclusiveLeft && Bu(o, l, f))
+ return !0;
+ }
+ }
+ }
+ function Bu(o, l, c) {
+ if (c.to == null) {
+ var f = c.marker.find(1, !0);
+ return Bu(o, f.line, sa(f.line.markedSpans, c.marker));
+ }
+ if (c.marker.inclusiveRight && c.to == l.text.length)
+ return !0;
+ for (var v = void 0, O = 0; O < l.markedSpans.length; ++O)
+ if (v = l.markedSpans[O], v.marker.collapsed && !v.marker.widgetNode && v.from == c.to && (v.to == null || v.to != c.from) && (v.marker.inclusiveLeft || c.marker.inclusiveRight) && Bu(o, l, v))
+ return !0;
+ }
+ function Ji(o) {
+ o = _i(o);
+ for (var l = 0, c = o.parent, f = 0; f < c.lines.length; ++f) {
+ var v = c.lines[f];
+ if (v == o)
+ break;
+ l += v.height;
+ }
+ for (var O = c.parent; O; c = O, O = c.parent)
+ for (var L = 0; L < O.children.length; ++L) {
+ var j = O.children[L];
+ if (j == c)
+ break;
+ l += j.height;
+ }
+ return l;
+ }
+ function Tl(o) {
+ if (o.height == 0)
+ return 0;
+ for (var l = o.text.length, c, f = o; c = oh(f); ) {
+ var v = c.find(0, !0);
+ f = v.from.line, l += v.from.ch - v.to.ch;
+ }
+ for (f = o; c = xl(f); ) {
+ var O = c.find(0, !0);
+ l -= f.text.length - O.from.ch, f = O.to.line, l += f.text.length - O.to.ch;
+ }
+ return l;
+ }
+ function Vu(o) {
+ var l = o.display, c = o.doc;
+ l.maxLine = ut(c, c.first), l.maxLineLength = Tl(l.maxLine), l.maxLineChanged = !0, c.iter(function(f) {
+ var v = Tl(f);
+ v > l.maxLineLength && (l.maxLineLength = v, l.maxLine = f);
+ });
+ }
+ var oo = function(o, l, c) {
+ this.text = o, ih(this, l), this.height = c ? c(this) : 1;
+ };
+ oo.prototype.lineNo = function() {
+ return Ft(this);
+ }, zt(oo);
+ function b1(o, l, c, f) {
+ o.text = l, o.stateAfter && (o.stateAfter = null), o.styles && (o.styles = null), o.order != null && (o.order = null), nh(o), ih(o, c);
+ var v = f ? f(o) : 1;
+ v != o.height && fi(o, v);
+ }
+ function _1(o) {
+ o.parent = null, nh(o);
+ }
+ var w1 = {}, A1 = {};
+ function sh(o, l) {
+ if (!o || /^\s*$/.test(o))
+ return null;
+ var c = l.addModeClass ? A1 : w1;
+ return c[o] || (c[o] = o.replace(/\S+/g, "cm-$&"));
+ }
+ function uh(o, l) {
+ var c = U("span", null, null, h ? "padding-right: .1px" : null), f = {
+ pre: U("pre", [c], "CodeMirror-line"),
+ content: c,
+ col: 0,
+ pos: 0,
+ cm: o,
+ trailingSpace: !1,
+ splitSpaces: o.getOption("lineWrapping")
+ };
+ l.measure = {};
+ for (var v = 0; v <= (l.rest ? l.rest.length : 0); v++) {
+ var O = v ? l.rest[v - 1] : l.line, L = void 0;
+ f.pos = 0, f.addToken = S1, yl(o.display.measure) && (L = ht(O, o.doc.direction)) && (f.addToken = x1(f.addToken, L)), f.map = [];
+ var j = l != o.display.externalMeasured && Ft(O);
+ T1(O, f, Yp(o, O, j)), O.styleClasses && (O.styleClasses.bgClass && (f.bgClass = Y(O.styleClasses.bgClass, f.bgClass || "")), O.styleClasses.textClass && (f.textClass = Y(O.styleClasses.textClass, f.textClass || ""))), f.map.length == 0 && f.map.push(0, 0, f.content.appendChild(Iu(o.display.measure))), v == 0 ? (l.measure.map = f.map, l.measure.cache = {}) : ((l.measure.maps || (l.measure.maps = [])).push(f.map), (l.measure.caches || (l.measure.caches = [])).push({}));
+ }
+ if (h) {
+ var Q = f.content.lastChild;
+ (/\bcm-tab\b/.test(Q.className) || Q.querySelector && Q.querySelector(".cm-tab")) && (f.content.className = "cm-tab-wrap-hack");
+ }
+ return st(o, "renderLine", o, l.line, f.pre), f.pre.className && (f.textClass = Y(f.pre.className, f.textClass || "")), f;
+ }
+ function C1(o) {
+ var l = I("span", "\u2022", "cm-invalidchar");
+ return l.title = "\\u" + o.charCodeAt(0).toString(16), l.setAttribute("aria-label", l.title), l;
+ }
+ function S1(o, l, c, f, v, O, L) {
+ if (!!l) {
+ var j = o.splitSpaces ? E1(l, o.trailingSpace) : l, Q = o.cm.state.specialChars, ne = !1, se;
+ if (!Q.test(l))
+ o.col += l.length, se = document.createTextNode(j), o.map.push(o.pos, o.pos + l.length, se), d && p < 9 && (ne = !0), o.pos += l.length;
+ else {
+ se = document.createDocumentFragment();
+ for (var de = 0; ; ) {
+ Q.lastIndex = de;
+ var Ee = Q.exec(l), Ce = Ee ? Ee.index - de : l.length - de;
+ if (Ce) {
+ var Ie = document.createTextNode(j.slice(de, de + Ce));
+ d && p < 9 ? se.appendChild(I("span", [Ie])) : se.appendChild(Ie), o.map.push(o.pos, o.pos + Ce, Ie), o.col += Ce, o.pos += Ce;
+ }
+ if (!Ee)
+ break;
+ de += Ce + 1;
+ var Ne = void 0;
+ if (Ee[0] == " ") {
+ var Ue = o.cm.options.tabSize, Ye = Ue - o.col % Ue;
+ Ne = se.appendChild(I("span", fe(Ye), "cm-tab")), Ne.setAttribute("role", "presentation"), Ne.setAttribute("cm-text", " "), o.col += Ye;
+ } else
+ Ee[0] == "\r" || Ee[0] == `
+` ? (Ne = se.appendChild(I("span", Ee[0] == "\r" ? "\u240D" : "\u2424", "cm-invalidchar")), Ne.setAttribute("cm-text", Ee[0]), o.col += 1) : (Ne = o.cm.options.specialCharPlaceholder(Ee[0]), Ne.setAttribute("cm-text", Ee[0]), d && p < 9 ? se.appendChild(I("span", [Ne])) : se.appendChild(Ne), o.col += 1);
+ o.map.push(o.pos, o.pos + 1, Ne), o.pos++;
+ }
+ }
+ if (o.trailingSpace = j.charCodeAt(l.length - 1) == 32, c || f || v || ne || O || L) {
+ var nt = c || "";
+ f && (nt += f), v && (nt += v);
+ var Qe = I("span", [se], nt, O);
+ if (L)
+ for (var ot in L)
+ L.hasOwnProperty(ot) && ot != "style" && ot != "class" && Qe.setAttribute(ot, L[ot]);
+ return o.content.appendChild(Qe);
+ }
+ o.content.appendChild(se);
+ }
+ }
+ function E1(o, l) {
+ if (o.length > 1 && !/ /.test(o))
+ return o;
+ for (var c = l, f = "", v = 0; v < o.length; v++) {
+ var O = o.charAt(v);
+ O == " " && c && (v == o.length - 1 || o.charCodeAt(v + 1) == 32) && (O = "\xA0"), f += O, c = O == " ";
+ }
+ return f;
+ }
+ function x1(o, l) {
+ return function(c, f, v, O, L, j, Q) {
+ v = v ? v + " cm-force-border" : "cm-force-border";
+ for (var ne = c.pos, se = ne + f.length; ; ) {
+ for (var de = void 0, Ee = 0; Ee < l.length && (de = l[Ee], !(de.to > ne && de.from <= ne)); Ee++)
+ ;
+ if (de.to >= se)
+ return o(c, f, v, O, L, j, Q);
+ o(c, f.slice(0, de.to - ne), v, O, null, j, Q), O = null, f = f.slice(de.to - ne), ne = de.to;
+ }
+ };
+ }
+ function dh(o, l, c, f) {
+ var v = !f && c.widgetNode;
+ v && o.map.push(o.pos, o.pos + l, v), !f && o.cm.display.input.needsContentAttribute && (v || (v = o.content.appendChild(document.createElement("span"))), v.setAttribute("cm-marker", c.id)), v && (o.cm.display.input.setUneditable(v), o.content.appendChild(v)), o.pos += l, o.trailingSpace = !1;
+ }
+ function T1(o, l, c) {
+ var f = o.markedSpans, v = o.text, O = 0;
+ if (!f) {
+ for (var L = 1; L < c.length; L += 2)
+ l.addToken(l, v.slice(O, O = c[L]), sh(c[L + 1], l.cm.options));
+ return;
+ }
+ for (var j = v.length, Q = 0, ne = 1, se = "", de, Ee, Ce = 0, Ie, Ne, Ue, Ye, nt; ; ) {
+ if (Ce == Q) {
+ Ie = Ne = Ue = Ee = "", nt = null, Ye = null, Ce = 1 / 0;
+ for (var Qe = [], ot = void 0, mt = 0; mt < f.length; ++mt) {
+ var ct = f[mt], Et = ct.marker;
+ if (Et.type == "bookmark" && ct.from == Q && Et.widgetNode)
+ Qe.push(Et);
+ else if (ct.from <= Q && (ct.to == null || ct.to > Q || Et.collapsed && ct.to == Q && ct.from == Q)) {
+ if (ct.to != null && ct.to != Q && Ce > ct.to && (Ce = ct.to, Ne = ""), Et.className && (Ie += " " + Et.className), Et.css && (Ee = (Ee ? Ee + ";" : "") + Et.css), Et.startStyle && ct.from == Q && (Ue += " " + Et.startStyle), Et.endStyle && ct.to == Ce && (ot || (ot = [])).push(Et.endStyle, ct.to), Et.title && ((nt || (nt = {})).title = Et.title), Et.attributes)
+ for (var Vt in Et.attributes)
+ (nt || (nt = {}))[Vt] = Et.attributes[Vt];
+ Et.collapsed && (!Ye || Lu(Ye.marker, Et) < 0) && (Ye = ct);
+ } else
+ ct.from > Q && Ce > ct.from && (Ce = ct.from);
+ }
+ if (ot)
+ for (var vn = 0; vn < ot.length; vn += 2)
+ ot[vn + 1] == Ce && (Ne += " " + ot[vn]);
+ if (!Ye || Ye.from == Q)
+ for (var Jt = 0; Jt < Qe.length; ++Jt)
+ dh(l, 0, Qe[Jt]);
+ if (Ye && (Ye.from || 0) == Q) {
+ if (dh(
+ l,
+ (Ye.to == null ? j + 1 : Ye.to) - Q,
+ Ye.marker,
+ Ye.from == null
+ ), Ye.to == null)
+ return;
+ Ye.to == Q && (Ye = !1);
+ }
+ }
+ if (Q >= j)
+ break;
+ for (var Gn = Math.min(j, Ce); ; ) {
+ if (se) {
+ var Bn = Q + se.length;
+ if (!Ye) {
+ var ln = Bn > Gn ? se.slice(0, Gn - Q) : se;
+ l.addToken(
+ l,
+ ln,
+ de ? de + Ie : Ie,
+ Ue,
+ Q + ln.length == Ce ? Ne : "",
+ Ee,
+ nt
+ );
+ }
+ if (Bn >= Gn) {
+ se = se.slice(Gn - Q), Q = Gn;
+ break;
+ }
+ Q = Bn, Ue = "";
+ }
+ se = v.slice(O, O = c[ne++]), de = sh(c[ne++], l.cm.options);
}
}
- return f;
- }
- function Zu(o, l, c) {
- var f = wi(o, l, "div", null, null, !o.options.singleCursorHeightPerLine), v = c.appendChild(I("div", "\xA0", "CodeMirror-cursor"));
- if (v.style.left = f.left + "px", v.style.top = f.top + "px", v.style.height = Math.max(0, f.bottom - f.top) * o.options.cursorHeight + "px", /\bcm-fat-cursor\b/.test(o.getWrapperElement().className)) {
- var O = Rl(o, l, "div", null, null), L = O.right - O.left;
- v.style.width = (L > 0 ? L : o.defaultCharWidth()) + "px";
}
- if (f.other) {
- var j = c.appendChild(I("div", "\xA0", "CodeMirror-cursor CodeMirror-secondarycursor"));
- j.style.display = "", j.style.left = f.other.left + "px", j.style.top = f.other.top + "px", j.style.height = (f.other.bottom - f.other.top) * 0.85 + "px";
+ function fh(o, l, c) {
+ this.line = l, this.rest = y1(l), this.size = this.rest ? Ft(Ae(this.rest)) - c + 1 : 1, this.node = this.text = null, this.hidden = hr(o, l);
}
- }
- function Il(o, l) {
- return o.top - l.top || o.left - l.left;
- }
- function z1(o, l, c) {
- var f = o.display, v = o.doc, O = document.createDocumentFragment(), L = vh(o.display), j = L.left, Q = Math.max(f.sizerWidth, Dr(o) - f.sizer.offsetLeft) - L.right, ne = v.direction == "ltr";
- function se(Qe, ot, mt, ct) {
- ot < 0 && (ot = 0), ot = Math.round(ot), ct = Math.round(ct), O.appendChild(I("div", null, "CodeMirror-selected", "position: absolute; left: " + Qe + `px;
+ function kl(o, l, c) {
+ for (var f = [], v, O = l; O < c; O = v) {
+ var L = new fh(o.doc, ut(o.doc, O), O);
+ v = O + L.size, f.push(L);
+ }
+ return f;
+ }
+ var ao = null;
+ function k1(o) {
+ ao ? ao.ops.push(o) : o.ownsGroup = ao = {
+ ops: [o],
+ delayedCallbacks: []
+ };
+ }
+ function O1(o) {
+ var l = o.delayedCallbacks, c = 0;
+ do {
+ for (; c < l.length; c++)
+ l[c].call(null);
+ for (var f = 0; f < o.ops.length; f++) {
+ var v = o.ops[f];
+ if (v.cursorActivityHandlers)
+ for (; v.cursorActivityCalled < v.cursorActivityHandlers.length; )
+ v.cursorActivityHandlers[v.cursorActivityCalled++].call(null, v.cm);
+ }
+ } while (c < l.length);
+ }
+ function $1(o, l) {
+ var c = o.ownsGroup;
+ if (!!c)
+ try {
+ O1(c);
+ } finally {
+ ao = null, l(c);
+ }
+ }
+ var ua = null;
+ function pn(o, l) {
+ var c = dt(o, l);
+ if (!!c.length) {
+ var f = Array.prototype.slice.call(arguments, 2), v;
+ ao ? v = ao.delayedCallbacks : ua ? v = ua : (v = ua = [], setTimeout(R1, 0));
+ for (var O = function(j) {
+ v.push(function() {
+ return c[j].apply(null, f);
+ });
+ }, L = 0; L < c.length; ++L)
+ O(L);
+ }
+ }
+ function R1() {
+ var o = ua;
+ ua = null;
+ for (var l = 0; l < o.length; ++l)
+ o[l]();
+ }
+ function ch(o, l, c, f) {
+ for (var v = 0; v < l.changes.length; v++) {
+ var O = l.changes[v];
+ O == "text" ? I1(o, l) : O == "gutter" ? hh(o, l, c, f) : O == "class" ? ju(o, l) : O == "widget" && F1(o, l, f);
+ }
+ l.changes = null;
+ }
+ function da(o) {
+ return o.node == o.text && (o.node = I("div", null, null, "position: relative"), o.text.parentNode && o.text.parentNode.replaceChild(o.node, o.text), o.node.appendChild(o.text), d && p < 8 && (o.node.style.zIndex = 2)), o.node;
+ }
+ function D1(o, l) {
+ var c = l.bgClass ? l.bgClass + " " + (l.line.bgClass || "") : l.line.bgClass;
+ if (c && (c += " CodeMirror-linebackground"), l.background)
+ c ? l.background.className = c : (l.background.parentNode.removeChild(l.background), l.background = null);
+ else if (c) {
+ var f = da(l);
+ l.background = f.insertBefore(I("div", null, c), f.firstChild), o.display.input.setUneditable(l.background);
+ }
+ }
+ function ph(o, l) {
+ var c = o.display.externalMeasured;
+ return c && c.line == l.line ? (o.display.externalMeasured = null, l.measure = c.measure, c.built) : uh(o, l);
+ }
+ function I1(o, l) {
+ var c = l.text.className, f = ph(o, l);
+ l.text == l.node && (l.node = f.pre), l.text.parentNode.replaceChild(f.pre, l.text), l.text = f.pre, f.bgClass != l.bgClass || f.textClass != l.textClass ? (l.bgClass = f.bgClass, l.textClass = f.textClass, ju(o, l)) : c && (l.text.className = c);
+ }
+ function ju(o, l) {
+ D1(o, l), l.line.wrapClass ? da(l).className = l.line.wrapClass : l.node != l.text && (l.node.className = "");
+ var c = l.textClass ? l.textClass + " " + (l.line.textClass || "") : l.line.textClass;
+ l.text.className = c || "";
+ }
+ function hh(o, l, c, f) {
+ if (l.gutter && (l.node.removeChild(l.gutter), l.gutter = null), l.gutterBackground && (l.node.removeChild(l.gutterBackground), l.gutterBackground = null), l.line.gutterClass) {
+ var v = da(l);
+ l.gutterBackground = I(
+ "div",
+ null,
+ "CodeMirror-gutter-background " + l.line.gutterClass,
+ "left: " + (o.options.fixedGutter ? f.fixedPos : -f.gutterTotalWidth) + "px; width: " + f.gutterTotalWidth + "px"
+ ), o.display.input.setUneditable(l.gutterBackground), v.insertBefore(l.gutterBackground, l.text);
+ }
+ var O = l.line.gutterMarkers;
+ if (o.options.lineNumbers || O) {
+ var L = da(l), j = l.gutter = I("div", null, "CodeMirror-gutter-wrapper", "left: " + (o.options.fixedGutter ? f.fixedPos : -f.gutterTotalWidth) + "px");
+ if (j.setAttribute("aria-hidden", "true"), o.display.input.setUneditable(j), L.insertBefore(j, l.text), l.line.gutterClass && (j.className += " " + l.line.gutterClass), o.options.lineNumbers && (!O || !O["CodeMirror-linenumbers"]) && (l.lineNumber = j.appendChild(
+ I(
+ "div",
+ ce(o.options, c),
+ "CodeMirror-linenumber CodeMirror-gutter-elt",
+ "left: " + f.gutterLeft["CodeMirror-linenumbers"] + "px; width: " + o.display.lineNumInnerWidth + "px"
+ )
+ )), O)
+ for (var Q = 0; Q < o.display.gutterSpecs.length; ++Q) {
+ var ne = o.display.gutterSpecs[Q].className, se = O.hasOwnProperty(ne) && O[ne];
+ se && j.appendChild(I(
+ "div",
+ [se],
+ "CodeMirror-gutter-elt",
+ "left: " + f.gutterLeft[ne] + "px; width: " + f.gutterWidth[ne] + "px"
+ ));
+ }
+ }
+ }
+ function F1(o, l, c) {
+ l.alignable && (l.alignable = null);
+ for (var f = D("CodeMirror-linewidget"), v = l.node.firstChild, O = void 0; v; v = O)
+ O = v.nextSibling, f.test(v.className) && l.node.removeChild(v);
+ mh(o, l, c);
+ }
+ function P1(o, l, c, f) {
+ var v = ph(o, l);
+ return l.text = l.node = v.pre, v.bgClass && (l.bgClass = v.bgClass), v.textClass && (l.textClass = v.textClass), ju(o, l), hh(o, l, c, f), mh(o, l, f), l.node;
+ }
+ function mh(o, l, c) {
+ if (vh(o, l.line, l, c, !0), l.rest)
+ for (var f = 0; f < l.rest.length; f++)
+ vh(o, l.rest[f], l, c, !1);
+ }
+ function vh(o, l, c, f, v) {
+ if (!!l.widgets)
+ for (var O = da(c), L = 0, j = l.widgets; L < j.length; ++L) {
+ var Q = j[L], ne = I("div", [Q.node], "CodeMirror-linewidget" + (Q.className ? " " + Q.className : ""));
+ Q.handleMouseEvents || ne.setAttribute("cm-ignore-events", "true"), M1(Q, ne, c, f), o.display.input.setUneditable(ne), v && Q.above ? O.insertBefore(ne, c.gutter || c.text) : O.appendChild(ne), pn(Q, "redraw");
+ }
+ }
+ function M1(o, l, c, f) {
+ if (o.noHScroll) {
+ (c.alignable || (c.alignable = [])).push(l);
+ var v = f.wrapperWidth;
+ l.style.left = f.fixedPos + "px", o.coverGutter || (v -= f.gutterTotalWidth, l.style.paddingLeft = f.gutterTotalWidth + "px"), l.style.width = v + "px";
+ }
+ o.coverGutter && (l.style.zIndex = 5, l.style.position = "relative", o.noHScroll || (l.style.marginLeft = -f.gutterTotalWidth + "px"));
+ }
+ function fa(o) {
+ if (o.height != null)
+ return o.height;
+ var l = o.doc.cm;
+ if (!l)
+ return 0;
+ if (!C(document.body, o.node)) {
+ var c = "position: relative;";
+ o.coverGutter && (c += "margin-left: -" + l.display.gutters.offsetWidth + "px;"), o.noHScroll && (c += "width: " + l.display.wrapper.clientWidth + "px;"), G(l.display.measure, I("div", [o.node], null, c));
+ }
+ return o.height = o.node.parentNode.offsetHeight;
+ }
+ function Xi(o, l) {
+ for (var c = Mn(l); c != o.wrapper; c = c.parentNode)
+ if (!c || c.nodeType == 1 && c.getAttribute("cm-ignore-events") == "true" || c.parentNode == o.sizer && c != o.mover)
+ return !0;
+ }
+ function Ol(o) {
+ return o.lineSpace.offsetTop;
+ }
+ function Uu(o) {
+ return o.mover.offsetHeight - o.lineSpace.offsetHeight;
+ }
+ function gh(o) {
+ if (o.cachedPaddingH)
+ return o.cachedPaddingH;
+ var l = G(o.measure, I("pre", "x", "CodeMirror-line-like")), c = window.getComputedStyle ? window.getComputedStyle(l) : l.currentStyle, f = { left: parseInt(c.paddingLeft), right: parseInt(c.paddingRight) };
+ return !isNaN(f.left) && !isNaN(f.right) && (o.cachedPaddingH = f), f;
+ }
+ function Fi(o) {
+ return Se - o.display.nativeBarWidth;
+ }
+ function Dr(o) {
+ return o.display.scroller.clientWidth - Fi(o) - o.display.barWidth;
+ }
+ function Hu(o) {
+ return o.display.scroller.clientHeight - Fi(o) - o.display.barHeight;
+ }
+ function L1(o, l, c) {
+ var f = o.options.lineWrapping, v = f && Dr(o);
+ if (!l.measure.heights || f && l.measure.width != v) {
+ var O = l.measure.heights = [];
+ if (f) {
+ l.measure.width = v;
+ for (var L = l.text.firstChild.getClientRects(), j = 0; j < L.length - 1; j++) {
+ var Q = L[j], ne = L[j + 1];
+ Math.abs(Q.bottom - ne.bottom) > 2 && O.push((Q.bottom + ne.top) / 2 - c.top);
+ }
+ }
+ O.push(c.bottom - c.top);
+ }
+ }
+ function yh(o, l, c) {
+ if (o.line == l)
+ return { map: o.measure.map, cache: o.measure.cache };
+ if (o.rest) {
+ for (var f = 0; f < o.rest.length; f++)
+ if (o.rest[f] == l)
+ return { map: o.measure.maps[f], cache: o.measure.caches[f] };
+ for (var v = 0; v < o.rest.length; v++)
+ if (Ft(o.rest[v]) > c)
+ return { map: o.measure.maps[v], cache: o.measure.caches[v], before: !0 };
+ }
+ }
+ function N1(o, l) {
+ l = _i(l);
+ var c = Ft(l), f = o.display.externalMeasured = new fh(o.doc, l, c);
+ f.lineN = c;
+ var v = f.built = uh(o, f);
+ return f.text = v.pre, G(o.display.lineMeasure, v.pre), f;
+ }
+ function bh(o, l, c, f) {
+ return Pi(o, lo(o, l), c, f);
+ }
+ function zu(o, l) {
+ if (l >= o.display.viewFrom && l < o.display.viewTo)
+ return o.display.view[Pr(o, l)];
+ var c = o.display.externalMeasured;
+ if (c && l >= c.lineN && l < c.lineN + c.size)
+ return c;
+ }
+ function lo(o, l) {
+ var c = Ft(l), f = zu(o, c);
+ f && !f.text ? f = null : f && f.changes && (ch(o, f, c, Qu(o)), o.curOp.forceUpdate = !0), f || (f = N1(o, l));
+ var v = yh(f, l, c);
+ return {
+ line: l,
+ view: f,
+ rect: null,
+ map: v.map,
+ cache: v.cache,
+ before: v.before,
+ hasHeights: !1
+ };
+ }
+ function Pi(o, l, c, f, v) {
+ l.before && (c = -1);
+ var O = c + (f || ""), L;
+ return l.cache.hasOwnProperty(O) ? L = l.cache[O] : (l.rect || (l.rect = l.view.text.getBoundingClientRect()), l.hasHeights || (L1(o, l.view, l.rect), l.hasHeights = !0), L = V1(o, l, c, f), L.bogus || (l.cache[O] = L)), {
+ left: L.left,
+ right: L.right,
+ top: v ? L.rtop : L.top,
+ bottom: v ? L.rbottom : L.bottom
+ };
+ }
+ var _h = { left: 0, right: 0, top: 0, bottom: 0 };
+ function wh(o, l, c) {
+ for (var f, v, O, L, j, Q, ne = 0; ne < o.length; ne += 3)
+ if (j = o[ne], Q = o[ne + 1], l < j ? (v = 0, O = 1, L = "left") : l < Q ? (v = l - j, O = v + 1) : (ne == o.length - 3 || l == Q && o[ne + 3] > l) && (O = Q - j, v = O - 1, l >= Q && (L = "right")), v != null) {
+ if (f = o[ne + 2], j == Q && c == (f.insertLeft ? "left" : "right") && (L = c), c == "left" && v == 0)
+ for (; ne && o[ne - 2] == o[ne - 3] && o[ne - 1].insertLeft; )
+ f = o[(ne -= 3) + 2], L = "left";
+ if (c == "right" && v == Q - j)
+ for (; ne < o.length - 3 && o[ne + 3] == o[ne + 4] && !o[ne + 5].insertLeft; )
+ f = o[(ne += 3) + 2], L = "right";
+ break;
+ }
+ return { node: f, start: v, end: O, collapse: L, coverStart: j, coverEnd: Q };
+ }
+ function B1(o, l) {
+ var c = _h;
+ if (l == "left")
+ for (var f = 0; f < o.length && (c = o[f]).left == c.right; f++)
+ ;
+ else
+ for (var v = o.length - 1; v >= 0 && (c = o[v]).left == c.right; v--)
+ ;
+ return c;
+ }
+ function V1(o, l, c, f) {
+ var v = wh(l.map, c, f), O = v.node, L = v.start, j = v.end, Q = v.collapse, ne;
+ if (O.nodeType == 3) {
+ for (var se = 0; se < 4; se++) {
+ for (; L && He(l.line.text.charAt(v.coverStart + L)); )
+ --L;
+ for (; v.coverStart + j < v.coverEnd && He(l.line.text.charAt(v.coverStart + j)); )
+ ++j;
+ if (d && p < 9 && L == 0 && j == v.coverEnd - v.coverStart ? ne = O.parentNode.getBoundingClientRect() : ne = B1(F(O, L, j).getClientRects(), f), ne.left || ne.right || L == 0)
+ break;
+ j = L, L = L - 1, Q = "right";
+ }
+ d && p < 11 && (ne = j1(o.display.measure, ne));
+ } else {
+ L > 0 && (Q = f = "right");
+ var de;
+ o.options.lineWrapping && (de = O.getClientRects()).length > 1 ? ne = de[f == "right" ? de.length - 1 : 0] : ne = O.getBoundingClientRect();
+ }
+ if (d && p < 9 && !L && (!ne || !ne.left && !ne.right)) {
+ var Ee = O.parentNode.getClientRects()[0];
+ Ee ? ne = { left: Ee.left, right: Ee.left + uo(o.display), top: Ee.top, bottom: Ee.bottom } : ne = _h;
+ }
+ for (var Ce = ne.top - l.rect.top, Ie = ne.bottom - l.rect.top, Ne = (Ce + Ie) / 2, Ue = l.view.measure.heights, Ye = 0; Ye < Ue.length - 1 && !(Ne < Ue[Ye]); Ye++)
+ ;
+ var nt = Ye ? Ue[Ye - 1] : 0, Qe = Ue[Ye], ot = {
+ left: (Q == "right" ? ne.right : ne.left) - l.rect.left,
+ right: (Q == "left" ? ne.left : ne.right) - l.rect.left,
+ top: nt,
+ bottom: Qe
+ };
+ return !ne.left && !ne.right && (ot.bogus = !0), o.options.singleCursorHeightPerLine || (ot.rtop = Ce, ot.rbottom = Ie), ot;
+ }
+ function j1(o, l) {
+ if (!window.screen || screen.logicalXDPI == null || screen.logicalXDPI == screen.deviceXDPI || !bl(o))
+ return l;
+ var c = screen.logicalXDPI / screen.deviceXDPI, f = screen.logicalYDPI / screen.deviceYDPI;
+ return {
+ left: l.left * c,
+ right: l.right * c,
+ top: l.top * f,
+ bottom: l.bottom * f
+ };
+ }
+ function Ah(o) {
+ if (o.measure && (o.measure.cache = {}, o.measure.heights = null, o.rest))
+ for (var l = 0; l < o.rest.length; l++)
+ o.measure.caches[l] = {};
+ }
+ function Ch(o) {
+ o.display.externalMeasure = null, W(o.display.lineMeasure);
+ for (var l = 0; l < o.display.view.length; l++)
+ Ah(o.display.view[l]);
+ }
+ function ca(o) {
+ Ch(o), o.display.cachedCharWidth = o.display.cachedTextHeight = o.display.cachedPaddingH = null, o.options.lineWrapping || (o.display.maxLineChanged = !0), o.display.lineNumChars = null;
+ }
+ function Sh(o) {
+ return _ && E ? -(o.body.getBoundingClientRect().left - parseInt(getComputedStyle(o.body).marginLeft)) : o.defaultView.pageXOffset || (o.documentElement || o.body).scrollLeft;
+ }
+ function Eh(o) {
+ return _ && E ? -(o.body.getBoundingClientRect().top - parseInt(getComputedStyle(o.body).marginTop)) : o.defaultView.pageYOffset || (o.documentElement || o.body).scrollTop;
+ }
+ function Wu(o) {
+ var l = _i(o), c = l.widgets, f = 0;
+ if (c)
+ for (var v = 0; v < c.length; ++v)
+ c[v].above && (f += fa(c[v]));
+ return f;
+ }
+ function $l(o, l, c, f, v) {
+ if (!v) {
+ var O = Wu(l);
+ c.top += O, c.bottom += O;
+ }
+ if (f == "line")
+ return c;
+ f || (f = "local");
+ var L = Ji(l);
+ if (f == "local" ? L += Ol(o.display) : L -= o.display.viewOffset, f == "page" || f == "window") {
+ var j = o.display.lineSpace.getBoundingClientRect();
+ L += j.top + (f == "window" ? 0 : Eh(te(o)));
+ var Q = j.left + (f == "window" ? 0 : Sh(te(o)));
+ c.left += Q, c.right += Q;
+ }
+ return c.top += L, c.bottom += L, c;
+ }
+ function xh(o, l, c) {
+ if (c == "div")
+ return l;
+ var f = l.left, v = l.top;
+ if (c == "page")
+ f -= Sh(te(o)), v -= Eh(te(o));
+ else if (c == "local" || !c) {
+ var O = o.display.sizer.getBoundingClientRect();
+ f += O.left, v += O.top;
+ }
+ var L = o.display.lineSpace.getBoundingClientRect();
+ return { left: f - L.left, top: v - L.top };
+ }
+ function Rl(o, l, c, f, v) {
+ return f || (f = ut(o.doc, l.line)), $l(o, f, bh(o, f, l.ch, v), c);
+ }
+ function wi(o, l, c, f, v, O) {
+ f = f || ut(o.doc, l.line), v || (v = lo(o, f));
+ function L(Ie, Ne) {
+ var Ue = Pi(o, v, Ie, Ne ? "right" : "left", O);
+ return Ne ? Ue.left = Ue.right : Ue.right = Ue.left, $l(o, f, Ue, c);
+ }
+ var j = ht(f, o.doc.direction), Q = l.ch, ne = l.sticky;
+ if (Q >= f.text.length ? (Q = f.text.length, ne = "before") : Q <= 0 && (Q = 0, ne = "after"), !j)
+ return L(ne == "before" ? Q - 1 : Q, ne == "before");
+ function se(Ie, Ne, Ue) {
+ var Ye = j[Ne], nt = Ye.level == 1;
+ return L(Ue ? Ie - 1 : Ie, nt != Ue);
+ }
+ var de = je(j, Q, ne), Ee = ft, Ce = se(Q, de, ne == "before");
+ return Ee != null && (Ce.other = se(Q, Ee, ne != "before")), Ce;
+ }
+ function Th(o, l) {
+ var c = 0;
+ l = _t(o.doc, l), o.options.lineWrapping || (c = uo(o.display) * l.ch);
+ var f = ut(o.doc, l.line), v = Ji(f) + Ol(o.display);
+ return { left: c, right: c, top: v, bottom: v + f.height };
+ }
+ function Gu(o, l, c, f, v) {
+ var O = ye(o, l, c);
+ return O.xRel = v, f && (O.outside = f), O;
+ }
+ function Ku(o, l, c) {
+ var f = o.doc;
+ if (c += o.display.viewOffset, c < 0)
+ return Gu(f.first, 0, null, -1, -1);
+ var v = Di(f, c), O = f.first + f.size - 1;
+ if (v > O)
+ return Gu(f.first + f.size - 1, ut(f, O).text.length, null, 1, 1);
+ l < 0 && (l = 0);
+ for (var L = ut(f, v); ; ) {
+ var j = U1(o, L, v, l, c), Q = v1(L, j.ch + (j.xRel > 0 || j.outside > 0 ? 1 : 0));
+ if (!Q)
+ return j;
+ var ne = Q.find(1);
+ if (ne.line == v)
+ return ne;
+ L = ut(f, v = ne.line);
+ }
+ }
+ function kh(o, l, c, f) {
+ f -= Wu(l);
+ var v = l.text.length, O = We(function(L) {
+ return Pi(o, c, L - 1).bottom <= f;
+ }, v, 0);
+ return v = We(function(L) {
+ return Pi(o, c, L).top > f;
+ }, O, v), { begin: O, end: v };
+ }
+ function Oh(o, l, c, f) {
+ c || (c = lo(o, l));
+ var v = $l(o, l, Pi(o, c, f), "line").top;
+ return kh(o, l, c, v);
+ }
+ function Yu(o, l, c, f) {
+ return o.bottom <= c ? !1 : o.top > c ? !0 : (f ? o.left : o.right) > l;
+ }
+ function U1(o, l, c, f, v) {
+ v -= Ji(l);
+ var O = lo(o, l), L = Wu(l), j = 0, Q = l.text.length, ne = !0, se = ht(l, o.doc.direction);
+ if (se) {
+ var de = (o.options.lineWrapping ? z1 : H1)(o, l, c, O, se, f, v);
+ ne = de.level != 1, j = ne ? de.from : de.to - 1, Q = ne ? de.to : de.from - 1;
+ }
+ var Ee = null, Ce = null, Ie = We(function(mt) {
+ var ct = Pi(o, O, mt);
+ return ct.top += L, ct.bottom += L, Yu(ct, f, v, !1) ? (ct.top <= v && ct.left <= f && (Ee = mt, Ce = ct), !0) : !1;
+ }, j, Q), Ne, Ue, Ye = !1;
+ if (Ce) {
+ var nt = f - Ce.left < Ce.right - f, Qe = nt == ne;
+ Ie = Ee + (Qe ? 0 : 1), Ue = Qe ? "after" : "before", Ne = nt ? Ce.left : Ce.right;
+ } else {
+ !ne && (Ie == Q || Ie == j) && Ie++, Ue = Ie == 0 ? "after" : Ie == l.text.length ? "before" : Pi(o, O, Ie - (ne ? 1 : 0)).bottom + L <= v == ne ? "after" : "before";
+ var ot = wi(o, ye(c, Ie, Ue), "line", l, O);
+ Ne = ot.left, Ye = v < ot.top ? -1 : v >= ot.bottom ? 1 : 0;
+ }
+ return Ie = at(l.text, Ie, 1), Gu(c, Ie, Ue, Ye, f - Ne);
+ }
+ function H1(o, l, c, f, v, O, L) {
+ var j = We(function(de) {
+ var Ee = v[de], Ce = Ee.level != 1;
+ return Yu(wi(
+ o,
+ ye(c, Ce ? Ee.to : Ee.from, Ce ? "before" : "after"),
+ "line",
+ l,
+ f
+ ), O, L, !0);
+ }, 0, v.length - 1), Q = v[j];
+ if (j > 0) {
+ var ne = Q.level != 1, se = wi(
+ o,
+ ye(c, ne ? Q.from : Q.to, ne ? "after" : "before"),
+ "line",
+ l,
+ f
+ );
+ Yu(se, O, L, !0) && se.top > L && (Q = v[j - 1]);
+ }
+ return Q;
+ }
+ function z1(o, l, c, f, v, O, L) {
+ var j = kh(o, l, f, L), Q = j.begin, ne = j.end;
+ /\s/.test(l.text.charAt(ne - 1)) && ne--;
+ for (var se = null, de = null, Ee = 0; Ee < v.length; Ee++) {
+ var Ce = v[Ee];
+ if (!(Ce.from >= ne || Ce.to <= Q)) {
+ var Ie = Ce.level != 1, Ne = Pi(o, f, Ie ? Math.min(ne, Ce.to) - 1 : Math.max(Q, Ce.from)).right, Ue = Ne < O ? O - Ne + 1e9 : Ne - O;
+ (!se || de > Ue) && (se = Ce, de = Ue);
+ }
+ }
+ return se || (se = v[v.length - 1]), se.from < Q && (se = { from: Q, to: se.to, level: se.level }), se.to > ne && (se = { from: se.from, to: ne, level: se.level }), se;
+ }
+ var Ir;
+ function so(o) {
+ if (o.cachedTextHeight != null)
+ return o.cachedTextHeight;
+ if (Ir == null) {
+ Ir = I("pre", null, "CodeMirror-line-like");
+ for (var l = 0; l < 49; ++l)
+ Ir.appendChild(document.createTextNode("x")), Ir.appendChild(I("br"));
+ Ir.appendChild(document.createTextNode("x"));
+ }
+ G(o.measure, Ir);
+ var c = Ir.offsetHeight / 50;
+ return c > 3 && (o.cachedTextHeight = c), W(o.measure), c || 1;
+ }
+ function uo(o) {
+ if (o.cachedCharWidth != null)
+ return o.cachedCharWidth;
+ var l = I("span", "xxxxxxxxxx"), c = I("pre", [l], "CodeMirror-line-like");
+ G(o.measure, c);
+ var f = l.getBoundingClientRect(), v = (f.right - f.left) / 10;
+ return v > 2 && (o.cachedCharWidth = v), v || 10;
+ }
+ function Qu(o) {
+ for (var l = o.display, c = {}, f = {}, v = l.gutters.clientLeft, O = l.gutters.firstChild, L = 0; O; O = O.nextSibling, ++L) {
+ var j = o.display.gutterSpecs[L].className;
+ c[j] = O.offsetLeft + O.clientLeft + v, f[j] = O.clientWidth;
+ }
+ return {
+ fixedPos: Ju(l),
+ gutterTotalWidth: l.gutters.offsetWidth,
+ gutterLeft: c,
+ gutterWidth: f,
+ wrapperWidth: l.wrapper.clientWidth
+ };
+ }
+ function Ju(o) {
+ return o.scroller.getBoundingClientRect().left - o.sizer.getBoundingClientRect().left;
+ }
+ function $h(o) {
+ var l = so(o.display), c = o.options.lineWrapping, f = c && Math.max(5, o.display.scroller.clientWidth / uo(o.display) - 3);
+ return function(v) {
+ if (hr(o.doc, v))
+ return 0;
+ var O = 0;
+ if (v.widgets)
+ for (var L = 0; L < v.widgets.length; L++)
+ v.widgets[L].height && (O += v.widgets[L].height);
+ return c ? O + (Math.ceil(v.text.length / f) || 1) * l : O + l;
+ };
+ }
+ function Xu(o) {
+ var l = o.doc, c = $h(o);
+ l.iter(function(f) {
+ var v = c(f);
+ v != f.height && fi(f, v);
+ });
+ }
+ function Fr(o, l, c, f) {
+ var v = o.display;
+ if (!c && Mn(l).getAttribute("cm-not-content") == "true")
+ return null;
+ var O, L, j = v.lineSpace.getBoundingClientRect();
+ try {
+ O = l.clientX - j.left, L = l.clientY - j.top;
+ } catch {
+ return null;
+ }
+ var Q = Ku(o, O, L), ne;
+ if (f && Q.xRel > 0 && (ne = ut(o.doc, Q.line).text).length == Q.ch) {
+ var se = ve(ne, ne.length, o.options.tabSize) - ne.length;
+ Q = ye(Q.line, Math.max(0, Math.round((O - gh(o.display).left) / uo(o.display)) - se));
+ }
+ return Q;
+ }
+ function Pr(o, l) {
+ if (l >= o.display.viewTo || (l -= o.display.viewFrom, l < 0))
+ return null;
+ for (var c = o.display.view, f = 0; f < c.length; f++)
+ if (l -= c[f].size, l < 0)
+ return f;
+ }
+ function Ln(o, l, c, f) {
+ l == null && (l = o.doc.first), c == null && (c = o.doc.first + o.doc.size), f || (f = 0);
+ var v = o.display;
+ if (f && c < v.viewTo && (v.updateLineNumbers == null || v.updateLineNumbers > l) && (v.updateLineNumbers = l), o.curOp.viewChanged = !0, l >= v.viewTo)
+ Qi && Nu(o.doc, l) < v.viewTo && vr(o);
+ else if (c <= v.viewFrom)
+ Qi && lh(o.doc, c + f) > v.viewFrom ? vr(o) : (v.viewFrom += f, v.viewTo += f);
+ else if (l <= v.viewFrom && c >= v.viewTo)
+ vr(o);
+ else if (l <= v.viewFrom) {
+ var O = Dl(o, c, c + f, 1);
+ O ? (v.view = v.view.slice(O.index), v.viewFrom = O.lineN, v.viewTo += f) : vr(o);
+ } else if (c >= v.viewTo) {
+ var L = Dl(o, l, l, -1);
+ L ? (v.view = v.view.slice(0, L.index), v.viewTo = L.lineN) : vr(o);
+ } else {
+ var j = Dl(o, l, l, -1), Q = Dl(o, c, c + f, 1);
+ j && Q ? (v.view = v.view.slice(0, j.index).concat(kl(o, j.lineN, Q.lineN)).concat(v.view.slice(Q.index)), v.viewTo += f) : vr(o);
+ }
+ var ne = v.externalMeasured;
+ ne && (c < ne.lineN ? ne.lineN += f : l < ne.lineN + ne.size && (v.externalMeasured = null));
+ }
+ function mr(o, l, c) {
+ o.curOp.viewChanged = !0;
+ var f = o.display, v = o.display.externalMeasured;
+ if (v && l >= v.lineN && l < v.lineN + v.size && (f.externalMeasured = null), !(l < f.viewFrom || l >= f.viewTo)) {
+ var O = f.view[Pr(o, l)];
+ if (O.node != null) {
+ var L = O.changes || (O.changes = []);
+ he(L, c) == -1 && L.push(c);
+ }
+ }
+ }
+ function vr(o) {
+ o.display.viewFrom = o.display.viewTo = o.doc.first, o.display.view = [], o.display.viewOffset = 0;
+ }
+ function Dl(o, l, c, f) {
+ var v = Pr(o, l), O, L = o.display.view;
+ if (!Qi || c == o.doc.first + o.doc.size)
+ return { index: v, lineN: c };
+ for (var j = o.display.viewFrom, Q = 0; Q < v; Q++)
+ j += L[Q].size;
+ if (j != l) {
+ if (f > 0) {
+ if (v == L.length - 1)
+ return null;
+ O = j + L[v].size - l, v++;
+ } else
+ O = j - l;
+ l += O, c += O;
+ }
+ for (; Nu(o.doc, c) != c; ) {
+ if (v == (f < 0 ? 0 : L.length - 1))
+ return null;
+ c += f * L[v - (f < 0 ? 1 : 0)].size, v += f;
+ }
+ return { index: v, lineN: c };
+ }
+ function W1(o, l, c) {
+ var f = o.display, v = f.view;
+ v.length == 0 || l >= f.viewTo || c <= f.viewFrom ? (f.view = kl(o, l, c), f.viewFrom = l) : (f.viewFrom > l ? f.view = kl(o, l, f.viewFrom).concat(f.view) : f.viewFrom < l && (f.view = f.view.slice(Pr(o, l))), f.viewFrom = l, f.viewTo < c ? f.view = f.view.concat(kl(o, f.viewTo, c)) : f.viewTo > c && (f.view = f.view.slice(0, Pr(o, c)))), f.viewTo = c;
+ }
+ function Rh(o) {
+ for (var l = o.display.view, c = 0, f = 0; f < l.length; f++) {
+ var v = l[f];
+ !v.hidden && (!v.node || v.changes) && ++c;
+ }
+ return c;
+ }
+ function pa(o) {
+ o.display.input.showSelection(o.display.input.prepareSelection());
+ }
+ function Dh(o, l) {
+ l === void 0 && (l = !0);
+ var c = o.doc, f = {}, v = f.cursors = document.createDocumentFragment(), O = f.selection = document.createDocumentFragment(), L = o.options.$customCursor;
+ L && (l = !0);
+ for (var j = 0; j < c.sel.ranges.length; j++)
+ if (!(!l && j == c.sel.primIndex)) {
+ var Q = c.sel.ranges[j];
+ if (!(Q.from().line >= o.display.viewTo || Q.to().line < o.display.viewFrom)) {
+ var ne = Q.empty();
+ if (L) {
+ var se = L(o, Q);
+ se && Zu(o, se, v);
+ } else
+ (ne || o.options.showCursorWhenSelecting) && Zu(o, Q.head, v);
+ ne || G1(o, Q, O);
+ }
+ }
+ return f;
+ }
+ function Zu(o, l, c) {
+ var f = wi(o, l, "div", null, null, !o.options.singleCursorHeightPerLine), v = c.appendChild(I("div", "\xA0", "CodeMirror-cursor"));
+ if (v.style.left = f.left + "px", v.style.top = f.top + "px", v.style.height = Math.max(0, f.bottom - f.top) * o.options.cursorHeight + "px", /\bcm-fat-cursor\b/.test(o.getWrapperElement().className)) {
+ var O = Rl(o, l, "div", null, null), L = O.right - O.left;
+ v.style.width = (L > 0 ? L : o.defaultCharWidth()) + "px";
+ }
+ if (f.other) {
+ var j = c.appendChild(I("div", "\xA0", "CodeMirror-cursor CodeMirror-secondarycursor"));
+ j.style.display = "", j.style.left = f.other.left + "px", j.style.top = f.other.top + "px", j.style.height = (f.other.bottom - f.other.top) * 0.85 + "px";
+ }
+ }
+ function Il(o, l) {
+ return o.top - l.top || o.left - l.left;
+ }
+ function G1(o, l, c) {
+ var f = o.display, v = o.doc, O = document.createDocumentFragment(), L = gh(o.display), j = L.left, Q = Math.max(f.sizerWidth, Dr(o) - f.sizer.offsetLeft) - L.right, ne = v.direction == "ltr";
+ function se(Qe, ot, mt, ct) {
+ ot < 0 && (ot = 0), ot = Math.round(ot), ct = Math.round(ct), O.appendChild(I("div", null, "CodeMirror-selected", "position: absolute; left: " + Qe + `px;
top: ` + ot + "px; width: " + (mt == null ? Q - Qe : mt) + `px;
height: ` + (ct - ot) + "px"));
- }
- function de(Qe, ot, mt) {
- var ct = ut(v, Qe), Et = ct.text.length, Vt, vn;
- function Jt(ln, Vn) {
- return Rl(o, ye(Qe, ln), "div", ct, Vn);
}
- function Gn(ln, Vn, An) {
- var dn = kh(o, ct, null, ln), sn = Vn == "ltr" == (An == "after") ? "left" : "right", qt = An == "after" ? dn.begin : dn.end - (/\s/.test(ct.text.charAt(dn.end - 1)) ? 2 : 1);
- return Jt(qt, sn)[sn];
+ function de(Qe, ot, mt) {
+ var ct = ut(v, Qe), Et = ct.text.length, Vt, vn;
+ function Jt(ln, Vn) {
+ return Rl(o, ye(Qe, ln), "div", ct, Vn);
+ }
+ function Gn(ln, Vn, An) {
+ var dn = Oh(o, ct, null, ln), sn = Vn == "ltr" == (An == "after") ? "left" : "right", qt = An == "after" ? dn.begin : dn.end - (/\s/.test(ct.text.charAt(dn.end - 1)) ? 2 : 1);
+ return Jt(qt, sn)[sn];
+ }
+ var Bn = ht(ct, v.direction);
+ return $t(Bn, ot || 0, mt == null ? Et : mt, function(ln, Vn, An, dn) {
+ var sn = An == "ltr", qt = Jt(ln, sn ? "left" : "right"), jn = Jt(Vn - 1, sn ? "right" : "left"), Co = ot == null && ln == 0, Ar = mt == null && Vn == Et, xn = dn == 0, Mi = !Bn || dn == Bn.length - 1;
+ if (jn.top - qt.top <= 3) {
+ var gn = (ne ? Co : Ar) && xn, Sd = (ne ? Ar : Co) && Mi, er = gn ? j : (sn ? qt : jn).left, Vr = Sd ? Q : (sn ? jn : qt).right;
+ se(er, qt.top, Vr - er, qt.bottom);
+ } else {
+ var jr, $n, So, Ed;
+ sn ? (jr = ne && Co && xn ? j : qt.left, $n = ne ? Q : Gn(ln, An, "before"), So = ne ? j : Gn(Vn, An, "after"), Ed = ne && Ar && Mi ? Q : jn.right) : (jr = ne ? Gn(ln, An, "before") : j, $n = !ne && Co && xn ? Q : qt.right, So = !ne && Ar && Mi ? j : jn.left, Ed = ne ? Gn(Vn, An, "after") : Q), se(jr, qt.top, $n - jr, qt.bottom), qt.bottom < jn.top && se(j, qt.bottom, null, jn.top), se(So, jn.top, Ed - So, jn.bottom);
+ }
+ (!Vt || Il(qt, Vt) < 0) && (Vt = qt), Il(jn, Vt) < 0 && (Vt = jn), (!vn || Il(qt, vn) < 0) && (vn = qt), Il(jn, vn) < 0 && (vn = jn);
+ }), { start: Vt, end: vn };
}
- var Bn = ht(ct, v.direction);
- return $t(Bn, ot || 0, mt == null ? Et : mt, function(ln, Vn, An, dn) {
- var sn = An == "ltr", qt = Jt(ln, sn ? "left" : "right"), jn = Jt(Vn - 1, sn ? "right" : "left"), So = ot == null && ln == 0, Ar = mt == null && Vn == Et, xn = dn == 0, Mi = !Bn || dn == Bn.length - 1;
- if (jn.top - qt.top <= 3) {
- var gn = (ne ? So : Ar) && xn, Sd = (ne ? Ar : So) && Mi, er = gn ? j : (sn ? qt : jn).left, Vr = Sd ? Q : (sn ? jn : qt).right;
- se(er, qt.top, Vr - er, qt.bottom);
- } else {
- var jr, $n, Eo, Ed;
- sn ? (jr = ne && So && xn ? j : qt.left, $n = ne ? Q : Gn(ln, An, "before"), Eo = ne ? j : Gn(Vn, An, "after"), Ed = ne && Ar && Mi ? Q : jn.right) : (jr = ne ? Gn(ln, An, "before") : j, $n = !ne && So && xn ? Q : qt.right, Eo = !ne && Ar && Mi ? j : jn.left, Ed = ne ? Gn(Vn, An, "after") : Q), se(jr, qt.top, $n - jr, qt.bottom), qt.bottom < jn.top && se(j, qt.bottom, null, jn.top), se(Eo, jn.top, Ed - Eo, jn.bottom);
- }
- (!Vt || Il(qt, Vt) < 0) && (Vt = qt), Il(jn, Vt) < 0 && (Vt = jn), (!vn || Il(qt, vn) < 0) && (vn = qt), Il(jn, vn) < 0 && (vn = jn);
- }), { start: Vt, end: vn };
+ var Ee = l.from(), Ce = l.to();
+ if (Ee.line == Ce.line)
+ de(Ee.line, Ee.ch, Ce.ch);
+ else {
+ var Ie = ut(v, Ee.line), Ne = ut(v, Ce.line), Ue = _i(Ie) == _i(Ne), Ye = de(Ee.line, Ee.ch, Ue ? Ie.text.length + 1 : null).end, nt = de(Ce.line, Ue ? 0 : null, Ce.ch).start;
+ Ue && (Ye.top < nt.top - 2 ? (se(Ye.right, Ye.top, null, Ye.bottom), se(j, nt.top, nt.left, nt.bottom)) : se(Ye.right, Ye.top, nt.left - Ye.right, Ye.bottom)), Ye.bottom < nt.top && se(j, Ye.bottom, null, nt.top);
+ }
+ c.appendChild(O);
}
- var Ee = l.from(), Ce = l.to();
- if (Ee.line == Ce.line)
- de(Ee.line, Ee.ch, Ce.ch);
- else {
- var Ie = ut(v, Ee.line), Ne = ut(v, Ce.line), Ue = _i(Ie) == _i(Ne), Ye = de(Ee.line, Ee.ch, Ue ? Ie.text.length + 1 : null).end, nt = de(Ce.line, Ue ? 0 : null, Ce.ch).start;
- Ue && (Ye.top < nt.top - 2 ? (se(Ye.right, Ye.top, null, Ye.bottom), se(j, nt.top, nt.left, nt.bottom)) : se(Ye.right, Ye.top, nt.left - Ye.right, Ye.bottom)), Ye.bottom < nt.top && se(j, Ye.bottom, null, nt.top);
+ function qu(o) {
+ if (!!o.state.focused) {
+ var l = o.display;
+ clearInterval(l.blinker);
+ var c = !0;
+ l.cursorDiv.style.visibility = "", o.options.cursorBlinkRate > 0 ? l.blinker = setInterval(function() {
+ o.hasFocus() || fo(o), l.cursorDiv.style.visibility = (c = !c) ? "" : "hidden";
+ }, o.options.cursorBlinkRate) : o.options.cursorBlinkRate < 0 && (l.cursorDiv.style.visibility = "hidden");
+ }
}
- c.appendChild(O);
- }
- function qu(o) {
- if (!!o.state.focused) {
- var l = o.display;
- clearInterval(l.blinker);
- var c = !0;
- l.cursorDiv.style.visibility = "", o.options.cursorBlinkRate > 0 ? l.blinker = setInterval(function() {
- o.hasFocus() || co(o), l.cursorDiv.style.visibility = (c = !c) ? "" : "hidden";
- }, o.options.cursorBlinkRate) : o.options.cursorBlinkRate < 0 && (l.cursorDiv.style.visibility = "hidden");
+ function Ih(o) {
+ o.hasFocus() || (o.display.input.focus(), o.state.focused || td(o));
}
- }
- function Dh(o) {
- o.hasFocus() || (o.display.input.focus(), o.state.focused || td(o));
- }
- function ed(o) {
- o.state.delayingBlurEvent = !0, setTimeout(function() {
- o.state.delayingBlurEvent && (o.state.delayingBlurEvent = !1, o.state.focused && co(o));
- }, 100);
- }
- function td(o, l) {
- o.state.delayingBlurEvent && !o.state.draggingText && (o.state.delayingBlurEvent = !1), o.options.readOnly != "nocursor" && (o.state.focused || (st(o, "focus", o, l), o.state.focused = !0, Z(o.display.wrapper, "CodeMirror-focused"), !o.curOp && o.display.selForContextMenu != o.doc.sel && (o.display.input.reset(), h && setTimeout(function() {
- return o.display.input.reset(!0);
- }, 20)), o.display.input.receivedFocus()), qu(o));
- }
- function co(o, l) {
- o.state.delayingBlurEvent || (o.state.focused && (st(o, "blur", o, l), o.state.focused = !1, V(o.display.wrapper, "CodeMirror-focused")), clearInterval(o.display.blinker), setTimeout(function() {
- o.state.focused || (o.display.shift = !1);
- }, 150));
- }
- function Fl(o) {
- for (var l = o.display, c = l.lineDiv.offsetTop, f = Math.max(0, l.scroller.getBoundingClientRect().top), v = l.lineDiv.getBoundingClientRect().top, O = 0, L = 0; L < l.view.length; L++) {
- var j = l.view[L], Q = o.options.lineWrapping, ne = void 0, se = 0;
- if (!j.hidden) {
- if (v += j.line.height, d && p < 8) {
- var de = j.node.offsetTop + j.node.offsetHeight;
- ne = de - c, c = de;
- } else {
- var Ee = j.node.getBoundingClientRect();
- ne = Ee.bottom - Ee.top, !Q && j.text.firstChild && (se = j.text.firstChild.getBoundingClientRect().right - Ee.left - 1);
- }
- var Ce = j.line.height - ne;
- if ((Ce > 5e-3 || Ce < -5e-3) && (v < f && (O -= Ce), fi(j.line, ne), Ih(j.line), j.rest))
- for (var Ie = 0; Ie < j.rest.length; Ie++)
- Ih(j.rest[Ie]);
- if (se > o.display.sizerWidth) {
- var Ne = Math.ceil(se / fo(o.display));
- Ne > o.display.maxLineLength && (o.display.maxLineLength = Ne, o.display.maxLine = j.line, o.display.maxLineChanged = !0);
+ function ed(o) {
+ o.state.delayingBlurEvent = !0, setTimeout(function() {
+ o.state.delayingBlurEvent && (o.state.delayingBlurEvent = !1, o.state.focused && fo(o));
+ }, 100);
+ }
+ function td(o, l) {
+ o.state.delayingBlurEvent && !o.state.draggingText && (o.state.delayingBlurEvent = !1), o.options.readOnly != "nocursor" && (o.state.focused || (st(o, "focus", o, l), o.state.focused = !0, Z(o.display.wrapper, "CodeMirror-focused"), !o.curOp && o.display.selForContextMenu != o.doc.sel && (o.display.input.reset(), h && setTimeout(function() {
+ return o.display.input.reset(!0);
+ }, 20)), o.display.input.receivedFocus()), qu(o));
+ }
+ function fo(o, l) {
+ o.state.delayingBlurEvent || (o.state.focused && (st(o, "blur", o, l), o.state.focused = !1, V(o.display.wrapper, "CodeMirror-focused")), clearInterval(o.display.blinker), setTimeout(function() {
+ o.state.focused || (o.display.shift = !1);
+ }, 150));
+ }
+ function Fl(o) {
+ for (var l = o.display, c = l.lineDiv.offsetTop, f = Math.max(0, l.scroller.getBoundingClientRect().top), v = l.lineDiv.getBoundingClientRect().top, O = 0, L = 0; L < l.view.length; L++) {
+ var j = l.view[L], Q = o.options.lineWrapping, ne = void 0, se = 0;
+ if (!j.hidden) {
+ if (v += j.line.height, d && p < 8) {
+ var de = j.node.offsetTop + j.node.offsetHeight;
+ ne = de - c, c = de;
+ } else {
+ var Ee = j.node.getBoundingClientRect();
+ ne = Ee.bottom - Ee.top, !Q && j.text.firstChild && (se = j.text.firstChild.getBoundingClientRect().right - Ee.left - 1);
+ }
+ var Ce = j.line.height - ne;
+ if ((Ce > 5e-3 || Ce < -5e-3) && (v < f && (O -= Ce), fi(j.line, ne), Fh(j.line), j.rest))
+ for (var Ie = 0; Ie < j.rest.length; Ie++)
+ Fh(j.rest[Ie]);
+ if (se > o.display.sizerWidth) {
+ var Ne = Math.ceil(se / uo(o.display));
+ Ne > o.display.maxLineLength && (o.display.maxLineLength = Ne, o.display.maxLine = j.line, o.display.maxLineChanged = !0);
+ }
}
}
+ Math.abs(O) > 2 && (l.scroller.scrollTop += O);
}
- Math.abs(O) > 2 && (l.scroller.scrollTop += O);
- }
- function Ih(o) {
- if (o.widgets)
- for (var l = 0; l < o.widgets.length; ++l) {
- var c = o.widgets[l], f = c.node.parentNode;
- f && (c.height = f.offsetHeight);
+ function Fh(o) {
+ if (o.widgets)
+ for (var l = 0; l < o.widgets.length; ++l) {
+ var c = o.widgets[l], f = c.node.parentNode;
+ f && (c.height = f.offsetHeight);
+ }
+ }
+ function Pl(o, l, c) {
+ var f = c && c.top != null ? Math.max(0, c.top) : o.scroller.scrollTop;
+ f = Math.floor(f - Ol(o));
+ var v = c && c.bottom != null ? c.bottom : f + o.wrapper.clientHeight, O = Di(l, f), L = Di(l, v);
+ if (c && c.ensure) {
+ var j = c.ensure.from.line, Q = c.ensure.to.line;
+ j < O ? (O = j, L = Di(l, Ji(ut(l, j)) + o.wrapper.clientHeight)) : Math.min(Q, l.lastLine()) >= L && (O = Di(l, Ji(ut(l, Q)) - o.wrapper.clientHeight), L = Q);
}
- }
- function Pl(o, l, c) {
- var f = c && c.top != null ? Math.max(0, c.top) : o.scroller.scrollTop;
- f = Math.floor(f - Ol(o));
- var v = c && c.bottom != null ? c.bottom : f + o.wrapper.clientHeight, O = Di(l, f), L = Di(l, v);
- if (c && c.ensure) {
- var j = c.ensure.from.line, Q = c.ensure.to.line;
- j < O ? (O = j, L = Di(l, Ji(ut(l, j)) + o.wrapper.clientHeight)) : Math.min(Q, l.lastLine()) >= L && (O = Di(l, Ji(ut(l, Q)) - o.wrapper.clientHeight), L = Q);
+ return { from: O, to: Math.max(L, O + 1) };
}
- return { from: O, to: Math.max(L, O + 1) };
- }
- function W1(o, l) {
- if (!Ct(o, "scrollCursorIntoView")) {
- var c = o.display, f = c.sizer.getBoundingClientRect(), v = null, O = c.wrapper.ownerDocument;
- if (l.top + f.top < 0 ? v = !0 : l.bottom + f.top > (O.defaultView.innerHeight || O.documentElement.clientHeight) && (v = !1), v != null && !m) {
- var L = I("div", "\u200B", null, `position: absolute;
+ function K1(o, l) {
+ if (!Ct(o, "scrollCursorIntoView")) {
+ var c = o.display, f = c.sizer.getBoundingClientRect(), v = null, O = c.wrapper.ownerDocument;
+ if (l.top + f.top < 0 ? v = !0 : l.bottom + f.top > (O.defaultView.innerHeight || O.documentElement.clientHeight) && (v = !1), v != null && !m) {
+ var L = I("div", "\u200B", null, `position: absolute;
top: ` + (l.top - c.viewOffset - Ol(o.display)) + `px;
height: ` + (l.bottom - l.top + Fi(o) + c.barHeight) + `px;
left: ` + l.left + "px; width: " + Math.max(2, l.right - l.left) + "px;");
- o.display.lineSpace.appendChild(L), L.scrollIntoView(v), o.display.lineSpace.removeChild(L);
+ o.display.lineSpace.appendChild(L), L.scrollIntoView(v), o.display.lineSpace.removeChild(L);
+ }
}
}
- }
- function G1(o, l, c, f) {
- f == null && (f = 0);
- var v;
- !o.options.lineWrapping && l == c && (c = l.sticky == "before" ? ye(l.line, l.ch + 1, "before") : l, l = l.ch ? ye(l.line, l.sticky == "before" ? l.ch - 1 : l.ch, "after") : l);
- for (var O = 0; O < 5; O++) {
- var L = !1, j = wi(o, l), Q = !c || c == l ? j : wi(o, c);
- v = {
- left: Math.min(j.left, Q.left),
- top: Math.min(j.top, Q.top) - f,
- right: Math.max(j.left, Q.left),
- bottom: Math.max(j.bottom, Q.bottom) + f
+ function Y1(o, l, c, f) {
+ f == null && (f = 0);
+ var v;
+ !o.options.lineWrapping && l == c && (c = l.sticky == "before" ? ye(l.line, l.ch + 1, "before") : l, l = l.ch ? ye(l.line, l.sticky == "before" ? l.ch - 1 : l.ch, "after") : l);
+ for (var O = 0; O < 5; O++) {
+ var L = !1, j = wi(o, l), Q = !c || c == l ? j : wi(o, c);
+ v = {
+ left: Math.min(j.left, Q.left),
+ top: Math.min(j.top, Q.top) - f,
+ right: Math.max(j.left, Q.left),
+ bottom: Math.max(j.bottom, Q.bottom) + f
+ };
+ var ne = nd(o, v), se = o.doc.scrollTop, de = o.doc.scrollLeft;
+ if (ne.scrollTop != null && (ma(o, ne.scrollTop), Math.abs(o.doc.scrollTop - se) > 1 && (L = !0)), ne.scrollLeft != null && (Mr(o, ne.scrollLeft), Math.abs(o.doc.scrollLeft - de) > 1 && (L = !0)), !L)
+ break;
+ }
+ return v;
+ }
+ function Q1(o, l) {
+ var c = nd(o, l);
+ c.scrollTop != null && ma(o, c.scrollTop), c.scrollLeft != null && Mr(o, c.scrollLeft);
+ }
+ function nd(o, l) {
+ var c = o.display, f = so(o.display);
+ l.top < 0 && (l.top = 0);
+ var v = o.curOp && o.curOp.scrollTop != null ? o.curOp.scrollTop : c.scroller.scrollTop, O = Hu(o), L = {};
+ l.bottom - l.top > O && (l.bottom = l.top + O);
+ var j = o.doc.height + Uu(c), Q = l.top < f, ne = l.bottom > j - f;
+ if (l.top < v)
+ L.scrollTop = Q ? 0 : l.top;
+ else if (l.bottom > v + O) {
+ var se = Math.min(l.top, (ne ? j : l.bottom) - O);
+ se != v && (L.scrollTop = se);
+ }
+ var de = o.options.fixedGutter ? 0 : c.gutters.offsetWidth, Ee = o.curOp && o.curOp.scrollLeft != null ? o.curOp.scrollLeft : c.scroller.scrollLeft - de, Ce = Dr(o) - c.gutters.offsetWidth, Ie = l.right - l.left > Ce;
+ return Ie && (l.right = l.left + Ce), l.left < 10 ? L.scrollLeft = 0 : l.left < Ee ? L.scrollLeft = Math.max(0, l.left + de - (Ie ? 0 : 10)) : l.right > Ce + Ee - 3 && (L.scrollLeft = l.right + (Ie ? 0 : 10) - Ce), L;
+ }
+ function id(o, l) {
+ l != null && (Ml(o), o.curOp.scrollTop = (o.curOp.scrollTop == null ? o.doc.scrollTop : o.curOp.scrollTop) + l);
+ }
+ function co(o) {
+ Ml(o);
+ var l = o.getCursor();
+ o.curOp.scrollToPos = { from: l, to: l, margin: o.options.cursorScrollMargin };
+ }
+ function ha(o, l, c) {
+ (l != null || c != null) && Ml(o), l != null && (o.curOp.scrollLeft = l), c != null && (o.curOp.scrollTop = c);
+ }
+ function J1(o, l) {
+ Ml(o), o.curOp.scrollToPos = l;
+ }
+ function Ml(o) {
+ var l = o.curOp.scrollToPos;
+ if (l) {
+ o.curOp.scrollToPos = null;
+ var c = Th(o, l.from), f = Th(o, l.to);
+ Ph(o, c, f, l.margin);
+ }
+ }
+ function Ph(o, l, c, f) {
+ var v = nd(o, {
+ left: Math.min(l.left, c.left),
+ top: Math.min(l.top, c.top) - f,
+ right: Math.max(l.right, c.right),
+ bottom: Math.max(l.bottom, c.bottom) + f
+ });
+ ha(o, v.scrollLeft, v.scrollTop);
+ }
+ function ma(o, l) {
+ Math.abs(o.doc.scrollTop - l) < 2 || (n || od(o, { top: l }), Mh(o, l, !0), n && od(o), ya(o, 100));
+ }
+ function Mh(o, l, c) {
+ l = Math.max(0, Math.min(o.display.scroller.scrollHeight - o.display.scroller.clientHeight, l)), !(o.display.scroller.scrollTop == l && !c) && (o.doc.scrollTop = l, o.display.scrollbars.setScrollTop(l), o.display.scroller.scrollTop != l && (o.display.scroller.scrollTop = l));
+ }
+ function Mr(o, l, c, f) {
+ l = Math.max(0, Math.min(l, o.display.scroller.scrollWidth - o.display.scroller.clientWidth)), !((c ? l == o.doc.scrollLeft : Math.abs(o.doc.scrollLeft - l) < 2) && !f) && (o.doc.scrollLeft = l, jh(o), o.display.scroller.scrollLeft != l && (o.display.scroller.scrollLeft = l), o.display.scrollbars.setScrollLeft(l));
+ }
+ function va(o) {
+ var l = o.display, c = l.gutters.offsetWidth, f = Math.round(o.doc.height + Uu(o.display));
+ return {
+ clientHeight: l.scroller.clientHeight,
+ viewHeight: l.wrapper.clientHeight,
+ scrollWidth: l.scroller.scrollWidth,
+ clientWidth: l.scroller.clientWidth,
+ viewWidth: l.wrapper.clientWidth,
+ barLeft: o.options.fixedGutter ? c : 0,
+ docHeight: f,
+ scrollHeight: f + Fi(o) + l.barHeight,
+ nativeBarWidth: l.nativeBarWidth,
+ gutterWidth: c
};
- var ne = nd(o, v), se = o.doc.scrollTop, de = o.doc.scrollLeft;
- if (ne.scrollTop != null && (ma(o, ne.scrollTop), Math.abs(o.doc.scrollTop - se) > 1 && (L = !0)), ne.scrollLeft != null && (Mr(o, ne.scrollLeft), Math.abs(o.doc.scrollLeft - de) > 1 && (L = !0)), !L)
- break;
}
- return v;
- }
- function K1(o, l) {
- var c = nd(o, l);
- c.scrollTop != null && ma(o, c.scrollTop), c.scrollLeft != null && Mr(o, c.scrollLeft);
- }
- function nd(o, l) {
- var c = o.display, f = uo(o.display);
- l.top < 0 && (l.top = 0);
- var v = o.curOp && o.curOp.scrollTop != null ? o.curOp.scrollTop : c.scroller.scrollTop, O = Hu(o), L = {};
- l.bottom - l.top > O && (l.bottom = l.top + O);
- var j = o.doc.height + Uu(c), Q = l.top < f, ne = l.bottom > j - f;
- if (l.top < v)
- L.scrollTop = Q ? 0 : l.top;
- else if (l.bottom > v + O) {
- var se = Math.min(l.top, (ne ? j : l.bottom) - O);
- se != v && (L.scrollTop = se);
- }
- var de = o.options.fixedGutter ? 0 : c.gutters.offsetWidth, Ee = o.curOp && o.curOp.scrollLeft != null ? o.curOp.scrollLeft : c.scroller.scrollLeft - de, Ce = Dr(o) - c.gutters.offsetWidth, Ie = l.right - l.left > Ce;
- return Ie && (l.right = l.left + Ce), l.left < 10 ? L.scrollLeft = 0 : l.left < Ee ? L.scrollLeft = Math.max(0, l.left + de - (Ie ? 0 : 10)) : l.right > Ce + Ee - 3 && (L.scrollLeft = l.right + (Ie ? 0 : 10) - Ce), L;
- }
- function id(o, l) {
- l != null && (Ml(o), o.curOp.scrollTop = (o.curOp.scrollTop == null ? o.doc.scrollTop : o.curOp.scrollTop) + l);
- }
- function po(o) {
- Ml(o);
- var l = o.getCursor();
- o.curOp.scrollToPos = { from: l, to: l, margin: o.options.cursorScrollMargin };
- }
- function ha(o, l, c) {
- (l != null || c != null) && Ml(o), l != null && (o.curOp.scrollLeft = l), c != null && (o.curOp.scrollTop = c);
- }
- function Y1(o, l) {
- Ml(o), o.curOp.scrollToPos = l;
- }
- function Ml(o) {
- var l = o.curOp.scrollToPos;
- if (l) {
- o.curOp.scrollToPos = null;
- var c = xh(o, l.from), f = xh(o, l.to);
- Fh(o, c, f, l.margin);
- }
- }
- function Fh(o, l, c, f) {
- var v = nd(o, {
- left: Math.min(l.left, c.left),
- top: Math.min(l.top, c.top) - f,
- right: Math.max(l.right, c.right),
- bottom: Math.max(l.bottom, c.bottom) + f
- });
- ha(o, v.scrollLeft, v.scrollTop);
- }
- function ma(o, l) {
- Math.abs(o.doc.scrollTop - l) < 2 || (n || od(o, { top: l }), Ph(o, l, !0), n && od(o), ya(o, 100));
- }
- function Ph(o, l, c) {
- l = Math.max(0, Math.min(o.display.scroller.scrollHeight - o.display.scroller.clientHeight, l)), !(o.display.scroller.scrollTop == l && !c) && (o.doc.scrollTop = l, o.display.scrollbars.setScrollTop(l), o.display.scroller.scrollTop != l && (o.display.scroller.scrollTop = l));
- }
- function Mr(o, l, c, f) {
- l = Math.max(0, Math.min(l, o.display.scroller.scrollWidth - o.display.scroller.clientWidth)), !((c ? l == o.doc.scrollLeft : Math.abs(o.doc.scrollLeft - l) < 2) && !f) && (o.doc.scrollLeft = l, Vh(o), o.display.scroller.scrollLeft != l && (o.display.scroller.scrollLeft = l), o.display.scrollbars.setScrollLeft(l));
- }
- function va(o) {
- var l = o.display, c = l.gutters.offsetWidth, f = Math.round(o.doc.height + Uu(o.display));
- return {
- clientHeight: l.scroller.clientHeight,
- viewHeight: l.wrapper.clientHeight,
- scrollWidth: l.scroller.scrollWidth,
- clientWidth: l.scroller.clientWidth,
- viewWidth: l.wrapper.clientWidth,
- barLeft: o.options.fixedGutter ? c : 0,
- docHeight: f,
- scrollHeight: f + Fi(o) + l.barHeight,
- nativeBarWidth: l.nativeBarWidth,
- gutterWidth: c
+ var Lr = function(o, l, c) {
+ this.cm = c;
+ var f = this.vert = I("div", [I("div", null, null, "min-width: 1px")], "CodeMirror-vscrollbar"), v = this.horiz = I("div", [I("div", null, null, "height: 100%; min-height: 1px")], "CodeMirror-hscrollbar");
+ f.tabIndex = v.tabIndex = -1, o(f), o(v), $e(f, "scroll", function() {
+ f.clientHeight && l(f.scrollTop, "vertical");
+ }), $e(v, "scroll", function() {
+ v.clientWidth && l(v.scrollLeft, "horizontal");
+ }), this.checkedZeroWidth = !1, d && p < 8 && (this.horiz.style.minHeight = this.vert.style.minWidth = "18px");
};
- }
- var Lr = function(o, l, c) {
- this.cm = c;
- var f = this.vert = I("div", [I("div", null, null, "min-width: 1px")], "CodeMirror-vscrollbar"), v = this.horiz = I("div", [I("div", null, null, "height: 100%; min-height: 1px")], "CodeMirror-hscrollbar");
- f.tabIndex = v.tabIndex = -1, o(f), o(v), $e(f, "scroll", function() {
- f.clientHeight && l(f.scrollTop, "vertical");
- }), $e(v, "scroll", function() {
- v.clientWidth && l(v.scrollLeft, "horizontal");
- }), this.checkedZeroWidth = !1, d && p < 8 && (this.horiz.style.minHeight = this.vert.style.minWidth = "18px");
- };
- Lr.prototype.update = function(o) {
- var l = o.scrollWidth > o.clientWidth + 1, c = o.scrollHeight > o.clientHeight + 1, f = o.nativeBarWidth;
- if (c) {
- this.vert.style.display = "block", this.vert.style.bottom = l ? f + "px" : "0";
- var v = o.viewHeight - (l ? f : 0);
- this.vert.firstChild.style.height = Math.max(0, o.scrollHeight - o.clientHeight + v) + "px";
- } else
- this.vert.scrollTop = 0, this.vert.style.display = "", this.vert.firstChild.style.height = "0";
- if (l) {
- this.horiz.style.display = "block", this.horiz.style.right = c ? f + "px" : "0", this.horiz.style.left = o.barLeft + "px";
- var O = o.viewWidth - o.barLeft - (c ? f : 0);
- this.horiz.firstChild.style.width = Math.max(0, o.scrollWidth - o.clientWidth + O) + "px";
- } else
- this.horiz.style.display = "", this.horiz.firstChild.style.width = "0";
- return !this.checkedZeroWidth && o.clientHeight > 0 && (f == 0 && this.zeroWidthHack(), this.checkedZeroWidth = !0), { right: c ? f : 0, bottom: l ? f : 0 };
- }, Lr.prototype.setScrollLeft = function(o) {
- this.horiz.scrollLeft != o && (this.horiz.scrollLeft = o), this.disableHoriz && this.enableZeroWidthBar(this.horiz, this.disableHoriz, "horiz");
- }, Lr.prototype.setScrollTop = function(o) {
- this.vert.scrollTop != o && (this.vert.scrollTop = o), this.disableVert && this.enableZeroWidthBar(this.vert, this.disableVert, "vert");
- }, Lr.prototype.zeroWidthHack = function() {
- var o = k && !y ? "12px" : "18px";
- this.horiz.style.height = this.vert.style.width = o, this.horiz.style.visibility = this.vert.style.visibility = "hidden", this.disableHoriz = new we(), this.disableVert = new we();
- }, Lr.prototype.enableZeroWidthBar = function(o, l, c) {
- o.style.visibility = "";
- function f() {
- var v = o.getBoundingClientRect(), O = c == "vert" ? document.elementFromPoint(v.right - 1, (v.top + v.bottom) / 2) : document.elementFromPoint((v.right + v.left) / 2, v.bottom - 1);
- O != o ? o.style.visibility = "hidden" : l.set(1e3, f);
+ Lr.prototype.update = function(o) {
+ var l = o.scrollWidth > o.clientWidth + 1, c = o.scrollHeight > o.clientHeight + 1, f = o.nativeBarWidth;
+ if (c) {
+ this.vert.style.display = "block", this.vert.style.bottom = l ? f + "px" : "0";
+ var v = o.viewHeight - (l ? f : 0);
+ this.vert.firstChild.style.height = Math.max(0, o.scrollHeight - o.clientHeight + v) + "px";
+ } else
+ this.vert.scrollTop = 0, this.vert.style.display = "", this.vert.firstChild.style.height = "0";
+ if (l) {
+ this.horiz.style.display = "block", this.horiz.style.right = c ? f + "px" : "0", this.horiz.style.left = o.barLeft + "px";
+ var O = o.viewWidth - o.barLeft - (c ? f : 0);
+ this.horiz.firstChild.style.width = Math.max(0, o.scrollWidth - o.clientWidth + O) + "px";
+ } else
+ this.horiz.style.display = "", this.horiz.firstChild.style.width = "0";
+ return !this.checkedZeroWidth && o.clientHeight > 0 && (f == 0 && this.zeroWidthHack(), this.checkedZeroWidth = !0), { right: c ? f : 0, bottom: l ? f : 0 };
+ }, Lr.prototype.setScrollLeft = function(o) {
+ this.horiz.scrollLeft != o && (this.horiz.scrollLeft = o), this.disableHoriz && this.enableZeroWidthBar(this.horiz, this.disableHoriz, "horiz");
+ }, Lr.prototype.setScrollTop = function(o) {
+ this.vert.scrollTop != o && (this.vert.scrollTop = o), this.disableVert && this.enableZeroWidthBar(this.vert, this.disableVert, "vert");
+ }, Lr.prototype.zeroWidthHack = function() {
+ var o = k && !y ? "12px" : "18px";
+ this.horiz.style.height = this.vert.style.width = o, this.horiz.style.visibility = this.vert.style.visibility = "hidden", this.disableHoriz = new we(), this.disableVert = new we();
+ }, Lr.prototype.enableZeroWidthBar = function(o, l, c) {
+ o.style.visibility = "";
+ function f() {
+ var v = o.getBoundingClientRect(), O = c == "vert" ? document.elementFromPoint(v.right - 1, (v.top + v.bottom) / 2) : document.elementFromPoint((v.right + v.left) / 2, v.bottom - 1);
+ O != o ? o.style.visibility = "hidden" : l.set(1e3, f);
+ }
+ l.set(1e3, f);
+ }, Lr.prototype.clear = function() {
+ var o = this.horiz.parentNode;
+ o.removeChild(this.horiz), o.removeChild(this.vert);
+ };
+ var ga = function() {
+ };
+ ga.prototype.update = function() {
+ return { bottom: 0, right: 0 };
+ }, ga.prototype.setScrollLeft = function() {
+ }, ga.prototype.setScrollTop = function() {
+ }, ga.prototype.clear = function() {
+ };
+ function po(o, l) {
+ l || (l = va(o));
+ var c = o.display.barWidth, f = o.display.barHeight;
+ Lh(o, l);
+ for (var v = 0; v < 4 && c != o.display.barWidth || f != o.display.barHeight; v++)
+ c != o.display.barWidth && o.options.lineWrapping && Fl(o), Lh(o, va(o)), c = o.display.barWidth, f = o.display.barHeight;
}
- l.set(1e3, f);
- }, Lr.prototype.clear = function() {
- var o = this.horiz.parentNode;
- o.removeChild(this.horiz), o.removeChild(this.vert);
- };
- var ga = function() {
- };
- ga.prototype.update = function() {
- return { bottom: 0, right: 0 };
- }, ga.prototype.setScrollLeft = function() {
- }, ga.prototype.setScrollTop = function() {
- }, ga.prototype.clear = function() {
- };
- function ho(o, l) {
- l || (l = va(o));
- var c = o.display.barWidth, f = o.display.barHeight;
- Mh(o, l);
- for (var v = 0; v < 4 && c != o.display.barWidth || f != o.display.barHeight; v++)
- c != o.display.barWidth && o.options.lineWrapping && Fl(o), Mh(o, va(o)), c = o.display.barWidth, f = o.display.barHeight;
- }
- function Mh(o, l) {
- var c = o.display, f = c.scrollbars.update(l);
- c.sizer.style.paddingRight = (c.barWidth = f.right) + "px", c.sizer.style.paddingBottom = (c.barHeight = f.bottom) + "px", c.heightForcer.style.borderBottom = f.bottom + "px solid transparent", f.right && f.bottom ? (c.scrollbarFiller.style.display = "block", c.scrollbarFiller.style.height = f.bottom + "px", c.scrollbarFiller.style.width = f.right + "px") : c.scrollbarFiller.style.display = "", f.bottom && o.options.coverGutterNextToScrollbar && o.options.fixedGutter ? (c.gutterFiller.style.display = "block", c.gutterFiller.style.height = f.bottom + "px", c.gutterFiller.style.width = l.gutterWidth + "px") : c.gutterFiller.style.display = "";
- }
- var Lh = { native: Lr, null: ga };
- function Nh(o) {
- o.display.scrollbars && (o.display.scrollbars.clear(), o.display.scrollbars.addClass && V(o.display.wrapper, o.display.scrollbars.addClass)), o.display.scrollbars = new Lh[o.options.scrollbarStyle](function(l) {
- o.display.wrapper.insertBefore(l, o.display.scrollbarFiller), $e(l, "mousedown", function() {
- o.state.focused && setTimeout(function() {
- return o.display.input.focus();
- }, 0);
- }), l.setAttribute("cm-not-content", "true");
- }, function(l, c) {
- c == "horizontal" ? Mr(o, l) : ma(o, l);
- }, o), o.display.scrollbars.addClass && Z(o.display.wrapper, o.display.scrollbars.addClass);
- }
- var Q1 = 0;
- function Nr(o) {
- o.curOp = {
- cm: o,
- viewChanged: !1,
- startHeight: o.doc.height,
- forceUpdate: !1,
- updateInput: 0,
- typing: !1,
- changeObjs: null,
- cursorActivityHandlers: null,
- cursorActivityCalled: 0,
- selectionChanged: !1,
- updateMaxLine: !1,
- scrollLeft: null,
- scrollTop: null,
- scrollToPos: null,
- focus: !1,
- id: ++Q1,
- markArrays: null
- }, x1(o.curOp);
- }
- function Br(o) {
- var l = o.curOp;
- l && k1(l, function(c) {
- for (var f = 0; f < c.ops.length; f++)
- c.ops[f].cm.curOp = null;
- J1(c);
- });
- }
- function J1(o) {
- for (var l = o.ops, c = 0; c < l.length; c++)
- X1(l[c]);
- for (var f = 0; f < l.length; f++)
- Z1(l[f]);
- for (var v = 0; v < l.length; v++)
- q1(l[v]);
- for (var O = 0; O < l.length; O++)
- e_(l[O]);
- for (var L = 0; L < l.length; L++)
- t_(l[L]);
- }
- function X1(o) {
- var l = o.cm, c = l.display;
- i_(l), o.updateMaxLine && Vu(l), o.mustUpdate = o.viewChanged || o.forceUpdate || o.scrollTop != null || o.scrollToPos && (o.scrollToPos.from.line < c.viewFrom || o.scrollToPos.to.line >= c.viewTo) || c.maxLineChanged && l.options.lineWrapping, o.update = o.mustUpdate && new Ll(l, o.mustUpdate && { top: o.scrollTop, ensure: o.scrollToPos }, o.forceUpdate);
- }
- function Z1(o) {
- o.updatedDisplay = o.mustUpdate && rd(o.cm, o.update);
- }
- function q1(o) {
- var l = o.cm, c = l.display;
- o.updatedDisplay && Fl(l), o.barMeasure = va(l), c.maxLineChanged && !l.options.lineWrapping && (o.adjustWidthTo = yh(l, c.maxLine, c.maxLine.text.length).left + 3, l.display.sizerWidth = o.adjustWidthTo, o.barMeasure.scrollWidth = Math.max(c.scroller.clientWidth, c.sizer.offsetLeft + o.adjustWidthTo + Fi(l) + l.display.barWidth), o.maxScrollLeft = Math.max(0, c.sizer.offsetLeft + o.adjustWidthTo - Dr(l))), (o.updatedDisplay || o.selectionChanged) && (o.preparedSelection = c.input.prepareSelection());
- }
- function e_(o) {
- var l = o.cm;
- o.adjustWidthTo != null && (l.display.sizer.style.minWidth = o.adjustWidthTo + "px", o.maxScrollLeft < l.doc.scrollLeft && Mr(l, Math.min(l.display.scroller.scrollLeft, o.maxScrollLeft), !0), l.display.maxLineChanged = !1);
- var c = o.focus && o.focus == q(te(l));
- o.preparedSelection && l.display.input.showSelection(o.preparedSelection, c), (o.updatedDisplay || o.startHeight != l.doc.height) && ho(l, o.barMeasure), o.updatedDisplay && ld(l, o.barMeasure), o.selectionChanged && qu(l), l.state.focused && o.updateInput && l.display.input.reset(o.typing), c && Dh(o.cm);
- }
- function t_(o) {
- var l = o.cm, c = l.display, f = l.doc;
- if (o.updatedDisplay && Bh(l, o.update), c.wheelStartX != null && (o.scrollTop != null || o.scrollLeft != null || o.scrollToPos) && (c.wheelStartX = c.wheelStartY = null), o.scrollTop != null && Ph(l, o.scrollTop, o.forceScroll), o.scrollLeft != null && Mr(l, o.scrollLeft, !0, !0), o.scrollToPos) {
- var v = G1(
- l,
- _t(f, o.scrollToPos.from),
- _t(f, o.scrollToPos.to),
- o.scrollToPos.margin
- );
- W1(l, v);
+ function Lh(o, l) {
+ var c = o.display, f = c.scrollbars.update(l);
+ c.sizer.style.paddingRight = (c.barWidth = f.right) + "px", c.sizer.style.paddingBottom = (c.barHeight = f.bottom) + "px", c.heightForcer.style.borderBottom = f.bottom + "px solid transparent", f.right && f.bottom ? (c.scrollbarFiller.style.display = "block", c.scrollbarFiller.style.height = f.bottom + "px", c.scrollbarFiller.style.width = f.right + "px") : c.scrollbarFiller.style.display = "", f.bottom && o.options.coverGutterNextToScrollbar && o.options.fixedGutter ? (c.gutterFiller.style.display = "block", c.gutterFiller.style.height = f.bottom + "px", c.gutterFiller.style.width = l.gutterWidth + "px") : c.gutterFiller.style.display = "";
}
- var O = o.maybeHiddenMarkers, L = o.maybeUnhiddenMarkers;
- if (O)
- for (var j = 0; j < O.length; ++j)
- O[j].lines.length || st(O[j], "hide");
- if (L)
- for (var Q = 0; Q < L.length; ++Q)
- L[Q].lines.length && st(L[Q], "unhide");
- c.wrapper.offsetHeight && (f.scrollTop = l.display.scroller.scrollTop), o.changeObjs && st(l, "changes", l, o.changeObjs), o.update && o.update.finish();
- }
- function Wn(o, l) {
- if (o.curOp)
- return l();
- Nr(o);
- try {
- return l();
- } finally {
- Br(o);
+ var Nh = { native: Lr, null: ga };
+ function Bh(o) {
+ o.display.scrollbars && (o.display.scrollbars.clear(), o.display.scrollbars.addClass && V(o.display.wrapper, o.display.scrollbars.addClass)), o.display.scrollbars = new Nh[o.options.scrollbarStyle](function(l) {
+ o.display.wrapper.insertBefore(l, o.display.scrollbarFiller), $e(l, "mousedown", function() {
+ o.state.focused && setTimeout(function() {
+ return o.display.input.focus();
+ }, 0);
+ }), l.setAttribute("cm-not-content", "true");
+ }, function(l, c) {
+ c == "horizontal" ? Mr(o, l) : ma(o, l);
+ }, o), o.display.scrollbars.addClass && Z(o.display.wrapper, o.display.scrollbars.addClass);
}
- }
- function hn(o, l) {
- return function() {
+ var X1 = 0;
+ function Nr(o) {
+ o.curOp = {
+ cm: o,
+ viewChanged: !1,
+ startHeight: o.doc.height,
+ forceUpdate: !1,
+ updateInput: 0,
+ typing: !1,
+ changeObjs: null,
+ cursorActivityHandlers: null,
+ cursorActivityCalled: 0,
+ selectionChanged: !1,
+ updateMaxLine: !1,
+ scrollLeft: null,
+ scrollTop: null,
+ scrollToPos: null,
+ focus: !1,
+ id: ++X1,
+ markArrays: null
+ }, k1(o.curOp);
+ }
+ function Br(o) {
+ var l = o.curOp;
+ l && $1(l, function(c) {
+ for (var f = 0; f < c.ops.length; f++)
+ c.ops[f].cm.curOp = null;
+ Z1(c);
+ });
+ }
+ function Z1(o) {
+ for (var l = o.ops, c = 0; c < l.length; c++)
+ q1(l[c]);
+ for (var f = 0; f < l.length; f++)
+ e_(l[f]);
+ for (var v = 0; v < l.length; v++)
+ t_(l[v]);
+ for (var O = 0; O < l.length; O++)
+ n_(l[O]);
+ for (var L = 0; L < l.length; L++)
+ i_(l[L]);
+ }
+ function q1(o) {
+ var l = o.cm, c = l.display;
+ o_(l), o.updateMaxLine && Vu(l), o.mustUpdate = o.viewChanged || o.forceUpdate || o.scrollTop != null || o.scrollToPos && (o.scrollToPos.from.line < c.viewFrom || o.scrollToPos.to.line >= c.viewTo) || c.maxLineChanged && l.options.lineWrapping, o.update = o.mustUpdate && new Ll(l, o.mustUpdate && { top: o.scrollTop, ensure: o.scrollToPos }, o.forceUpdate);
+ }
+ function e_(o) {
+ o.updatedDisplay = o.mustUpdate && rd(o.cm, o.update);
+ }
+ function t_(o) {
+ var l = o.cm, c = l.display;
+ o.updatedDisplay && Fl(l), o.barMeasure = va(l), c.maxLineChanged && !l.options.lineWrapping && (o.adjustWidthTo = bh(l, c.maxLine, c.maxLine.text.length).left + 3, l.display.sizerWidth = o.adjustWidthTo, o.barMeasure.scrollWidth = Math.max(c.scroller.clientWidth, c.sizer.offsetLeft + o.adjustWidthTo + Fi(l) + l.display.barWidth), o.maxScrollLeft = Math.max(0, c.sizer.offsetLeft + o.adjustWidthTo - Dr(l))), (o.updatedDisplay || o.selectionChanged) && (o.preparedSelection = c.input.prepareSelection());
+ }
+ function n_(o) {
+ var l = o.cm;
+ o.adjustWidthTo != null && (l.display.sizer.style.minWidth = o.adjustWidthTo + "px", o.maxScrollLeft < l.doc.scrollLeft && Mr(l, Math.min(l.display.scroller.scrollLeft, o.maxScrollLeft), !0), l.display.maxLineChanged = !1);
+ var c = o.focus && o.focus == q(te(l));
+ o.preparedSelection && l.display.input.showSelection(o.preparedSelection, c), (o.updatedDisplay || o.startHeight != l.doc.height) && po(l, o.barMeasure), o.updatedDisplay && ld(l, o.barMeasure), o.selectionChanged && qu(l), l.state.focused && o.updateInput && l.display.input.reset(o.typing), c && Ih(o.cm);
+ }
+ function i_(o) {
+ var l = o.cm, c = l.display, f = l.doc;
+ if (o.updatedDisplay && Vh(l, o.update), c.wheelStartX != null && (o.scrollTop != null || o.scrollLeft != null || o.scrollToPos) && (c.wheelStartX = c.wheelStartY = null), o.scrollTop != null && Mh(l, o.scrollTop, o.forceScroll), o.scrollLeft != null && Mr(l, o.scrollLeft, !0, !0), o.scrollToPos) {
+ var v = Y1(
+ l,
+ _t(f, o.scrollToPos.from),
+ _t(f, o.scrollToPos.to),
+ o.scrollToPos.margin
+ );
+ K1(l, v);
+ }
+ var O = o.maybeHiddenMarkers, L = o.maybeUnhiddenMarkers;
+ if (O)
+ for (var j = 0; j < O.length; ++j)
+ O[j].lines.length || st(O[j], "hide");
+ if (L)
+ for (var Q = 0; Q < L.length; ++Q)
+ L[Q].lines.length && st(L[Q], "unhide");
+ c.wrapper.offsetHeight && (f.scrollTop = l.display.scroller.scrollTop), o.changeObjs && st(l, "changes", l, o.changeObjs), o.update && o.update.finish();
+ }
+ function Wn(o, l) {
if (o.curOp)
- return l.apply(o, arguments);
+ return l();
Nr(o);
try {
- return l.apply(o, arguments);
+ return l();
} finally {
Br(o);
}
- };
- }
- function On(o) {
- return function() {
- if (this.curOp)
- return o.apply(this, arguments);
- Nr(this);
- try {
- return o.apply(this, arguments);
- } finally {
- Br(this);
+ }
+ function hn(o, l) {
+ return function() {
+ if (o.curOp)
+ return l.apply(o, arguments);
+ Nr(o);
+ try {
+ return l.apply(o, arguments);
+ } finally {
+ Br(o);
+ }
+ };
+ }
+ function On(o) {
+ return function() {
+ if (this.curOp)
+ return o.apply(this, arguments);
+ Nr(this);
+ try {
+ return o.apply(this, arguments);
+ } finally {
+ Br(this);
+ }
+ };
+ }
+ function mn(o) {
+ return function() {
+ var l = this.cm;
+ if (!l || l.curOp)
+ return o.apply(this, arguments);
+ Nr(l);
+ try {
+ return o.apply(this, arguments);
+ } finally {
+ Br(l);
+ }
+ };
+ }
+ function ya(o, l) {
+ o.doc.highlightFrontier < o.display.viewTo && o.state.highlight.set(l, ke(r_, o));
+ }
+ function r_(o) {
+ var l = o.doc;
+ if (!(l.highlightFrontier >= o.display.viewTo)) {
+ var c = +new Date() + o.options.workTime, f = la(o, l.highlightFrontier), v = [];
+ l.iter(f.line, Math.min(l.first + l.size, o.display.viewTo + 500), function(O) {
+ if (f.line >= o.display.viewFrom) {
+ var L = O.styles, j = O.text.length > o.options.maxHighlightLength ? Ki(l.mode, f.state) : null, Q = Kp(o, O, f, !0);
+ j && (f.state = j), O.styles = Q.styles;
+ var ne = O.styleClasses, se = Q.classes;
+ se ? O.styleClasses = se : ne && (O.styleClasses = null);
+ for (var de = !L || L.length != O.styles.length || ne != se && (!ne || !se || ne.bgClass != se.bgClass || ne.textClass != se.textClass), Ee = 0; !de && Ee < L.length; ++Ee)
+ de = L[Ee] != O.styles[Ee];
+ de && v.push(f.line), O.stateAfter = f.save(), f.nextLine();
+ } else
+ O.text.length <= o.options.maxHighlightLength && Fu(o, O.text, f), O.stateAfter = f.line % 5 == 0 ? f.save() : null, f.nextLine();
+ if (+new Date() > c)
+ return ya(o, o.options.workDelay), !0;
+ }), l.highlightFrontier = f.line, l.modeFrontier = Math.max(l.modeFrontier, f.line), v.length && Wn(o, function() {
+ for (var O = 0; O < v.length; O++)
+ mr(o, v[O], "text");
+ });
}
+ }
+ var Ll = function(o, l, c) {
+ var f = o.display;
+ this.viewport = l, this.visible = Pl(f, o.doc, l), this.editorIsHidden = !f.wrapper.offsetWidth, this.wrapperHeight = f.wrapper.clientHeight, this.wrapperWidth = f.wrapper.clientWidth, this.oldDisplayWidth = Dr(o), this.force = c, this.dims = Qu(o), this.events = [];
};
- }
- function mn(o) {
- return function() {
- var l = this.cm;
- if (!l || l.curOp)
- return o.apply(this, arguments);
- Nr(l);
- try {
- return o.apply(this, arguments);
- } finally {
- Br(l);
+ Ll.prototype.signal = function(o, l) {
+ Qt(o, l) && this.events.push(arguments);
+ }, Ll.prototype.finish = function() {
+ for (var o = 0; o < this.events.length; o++)
+ st.apply(null, this.events[o]);
+ };
+ function o_(o) {
+ var l = o.display;
+ !l.scrollbarsClipped && l.scroller.offsetWidth && (l.nativeBarWidth = l.scroller.offsetWidth - l.scroller.clientWidth, l.heightForcer.style.height = Fi(o) + "px", l.sizer.style.marginBottom = -l.nativeBarWidth + "px", l.sizer.style.borderRightWidth = Fi(o) + "px", l.scrollbarsClipped = !0);
+ }
+ function a_(o) {
+ if (o.hasFocus())
+ return null;
+ var l = q(te(o));
+ if (!l || !C(o.display.lineDiv, l))
+ return null;
+ var c = { activeElt: l };
+ if (window.getSelection) {
+ var f = pe(o).getSelection();
+ f.anchorNode && f.extend && C(o.display.lineDiv, f.anchorNode) && (c.anchorNode = f.anchorNode, c.anchorOffset = f.anchorOffset, c.focusNode = f.focusNode, c.focusOffset = f.focusOffset);
}
- };
- }
- function ya(o, l) {
- o.doc.highlightFrontier < o.display.viewTo && o.state.highlight.set(l, ke(n_, o));
- }
- function n_(o) {
- var l = o.doc;
- if (!(l.highlightFrontier >= o.display.viewTo)) {
- var c = +new Date() + o.options.workTime, f = la(o, l.highlightFrontier), v = [];
- l.iter(f.line, Math.min(l.first + l.size, o.display.viewTo + 500), function(O) {
- if (f.line >= o.display.viewFrom) {
- var L = O.styles, j = O.text.length > o.options.maxHighlightLength ? Ki(l.mode, f.state) : null, Q = Gp(o, O, f, !0);
- j && (f.state = j), O.styles = Q.styles;
- var ne = O.styleClasses, se = Q.classes;
- se ? O.styleClasses = se : ne && (O.styleClasses = null);
- for (var de = !L || L.length != O.styles.length || ne != se && (!ne || !se || ne.bgClass != se.bgClass || ne.textClass != se.textClass), Ee = 0; !de && Ee < L.length; ++Ee)
- de = L[Ee] != O.styles[Ee];
- de && v.push(f.line), O.stateAfter = f.save(), f.nextLine();
+ return c;
+ }
+ function l_(o) {
+ if (!(!o || !o.activeElt || o.activeElt == q(o.activeElt.ownerDocument)) && (o.activeElt.focus(), !/^(INPUT|TEXTAREA)$/.test(o.activeElt.nodeName) && o.anchorNode && C(document.body, o.anchorNode) && C(document.body, o.focusNode))) {
+ var l = o.activeElt.ownerDocument, c = l.defaultView.getSelection(), f = l.createRange();
+ f.setEnd(o.anchorNode, o.anchorOffset), f.collapse(!1), c.removeAllRanges(), c.addRange(f), c.extend(o.focusNode, o.focusOffset);
+ }
+ }
+ function rd(o, l) {
+ var c = o.display, f = o.doc;
+ if (l.editorIsHidden)
+ return vr(o), !1;
+ if (!l.force && l.visible.from >= c.viewFrom && l.visible.to <= c.viewTo && (c.updateLineNumbers == null || c.updateLineNumbers >= c.viewTo) && c.renderedView == c.view && Rh(o) == 0)
+ return !1;
+ Uh(o) && (vr(o), l.dims = Qu(o));
+ var v = f.first + f.size, O = Math.max(l.visible.from - o.options.viewportMargin, f.first), L = Math.min(v, l.visible.to + o.options.viewportMargin);
+ c.viewFrom < O && O - c.viewFrom < 20 && (O = Math.max(f.first, c.viewFrom)), c.viewTo > L && c.viewTo - L < 20 && (L = Math.min(v, c.viewTo)), Qi && (O = Nu(o.doc, O), L = lh(o.doc, L));
+ var j = O != c.viewFrom || L != c.viewTo || c.lastWrapHeight != l.wrapperHeight || c.lastWrapWidth != l.wrapperWidth;
+ W1(o, O, L), c.viewOffset = Ji(ut(o.doc, c.viewFrom)), o.display.mover.style.top = c.viewOffset + "px";
+ var Q = Rh(o);
+ if (!j && Q == 0 && !l.force && c.renderedView == c.view && (c.updateLineNumbers == null || c.updateLineNumbers >= c.viewTo))
+ return !1;
+ var ne = a_(o);
+ return Q > 4 && (c.lineDiv.style.display = "none"), s_(o, c.updateLineNumbers, l.dims), Q > 4 && (c.lineDiv.style.display = ""), c.renderedView = c.view, l_(ne), W(c.cursorDiv), W(c.selectionDiv), c.gutters.style.height = c.sizer.style.minHeight = 0, j && (c.lastWrapHeight = l.wrapperHeight, c.lastWrapWidth = l.wrapperWidth, ya(o, 400)), c.updateLineNumbers = null, !0;
+ }
+ function Vh(o, l) {
+ for (var c = l.viewport, f = !0; ; f = !1) {
+ if (!f || !o.options.lineWrapping || l.oldDisplayWidth == Dr(o)) {
+ if (c && c.top != null && (c = { top: Math.min(o.doc.height + Uu(o.display) - Hu(o), c.top) }), l.visible = Pl(o.display, o.doc, c), l.visible.from >= o.display.viewFrom && l.visible.to <= o.display.viewTo)
+ break;
} else
- O.text.length <= o.options.maxHighlightLength && Fu(o, O.text, f), O.stateAfter = f.line % 5 == 0 ? f.save() : null, f.nextLine();
- if (+new Date() > c)
- return ya(o, o.options.workDelay), !0;
- }), l.highlightFrontier = f.line, l.modeFrontier = Math.max(l.modeFrontier, f.line), v.length && Wn(o, function() {
- for (var O = 0; O < v.length; O++)
- mr(o, v[O], "text");
+ f && (l.visible = Pl(o.display, o.doc, c));
+ if (!rd(o, l))
+ break;
+ Fl(o);
+ var v = va(o);
+ pa(o), po(o, v), ld(o, v), l.force = !1;
+ }
+ l.signal(o, "update", o), (o.display.viewFrom != o.display.reportedViewFrom || o.display.viewTo != o.display.reportedViewTo) && (l.signal(o, "viewportChange", o, o.display.viewFrom, o.display.viewTo), o.display.reportedViewFrom = o.display.viewFrom, o.display.reportedViewTo = o.display.viewTo);
+ }
+ function od(o, l) {
+ var c = new Ll(o, l);
+ if (rd(o, c)) {
+ Fl(o), Vh(o, c);
+ var f = va(o);
+ pa(o), po(o, f), ld(o, f), c.finish();
+ }
+ }
+ function s_(o, l, c) {
+ var f = o.display, v = o.options.lineNumbers, O = f.lineDiv, L = O.firstChild;
+ function j(Ie) {
+ var Ne = Ie.nextSibling;
+ return h && k && o.display.currentWheelTarget == Ie ? Ie.style.display = "none" : Ie.parentNode.removeChild(Ie), Ne;
+ }
+ for (var Q = f.view, ne = f.viewFrom, se = 0; se < Q.length; se++) {
+ var de = Q[se];
+ if (!de.hidden)
+ if (!de.node || de.node.parentNode != O) {
+ var Ee = P1(o, de, ne, c);
+ O.insertBefore(Ee, L);
+ } else {
+ for (; L != de.node; )
+ L = j(L);
+ var Ce = v && l != null && l <= ne && de.lineNumber;
+ de.changes && (he(de.changes, "gutter") > -1 && (Ce = !1), ch(o, de, ne, c)), Ce && (W(de.lineNumber), de.lineNumber.appendChild(document.createTextNode(ce(o.options, ne)))), L = de.node.nextSibling;
+ }
+ ne += de.size;
+ }
+ for (; L; )
+ L = j(L);
+ }
+ function ad(o) {
+ var l = o.gutters.offsetWidth;
+ o.sizer.style.marginLeft = l + "px", pn(o, "gutterChanged", o);
+ }
+ function ld(o, l) {
+ o.display.sizer.style.minHeight = l.docHeight + "px", o.display.heightForcer.style.top = l.docHeight + "px", o.display.gutters.style.height = l.docHeight + o.display.barHeight + Fi(o) + "px";
+ }
+ function jh(o) {
+ var l = o.display, c = l.view;
+ if (!(!l.alignWidgets && (!l.gutters.firstChild || !o.options.fixedGutter))) {
+ for (var f = Ju(l) - l.scroller.scrollLeft + o.doc.scrollLeft, v = l.gutters.offsetWidth, O = f + "px", L = 0; L < c.length; L++)
+ if (!c[L].hidden) {
+ o.options.fixedGutter && (c[L].gutter && (c[L].gutter.style.left = O), c[L].gutterBackground && (c[L].gutterBackground.style.left = O));
+ var j = c[L].alignable;
+ if (j)
+ for (var Q = 0; Q < j.length; Q++)
+ j[Q].style.left = O;
+ }
+ o.options.fixedGutter && (l.gutters.style.left = f + v + "px");
+ }
+ }
+ function Uh(o) {
+ if (!o.options.lineNumbers)
+ return !1;
+ var l = o.doc, c = ce(o.options, l.first + l.size - 1), f = o.display;
+ if (c.length != f.lineNumChars) {
+ var v = f.measure.appendChild(I(
+ "div",
+ [I("div", c)],
+ "CodeMirror-linenumber CodeMirror-gutter-elt"
+ )), O = v.firstChild.offsetWidth, L = v.offsetWidth - O;
+ return f.lineGutter.style.width = "", f.lineNumInnerWidth = Math.max(O, f.lineGutter.offsetWidth - L) + 1, f.lineNumWidth = f.lineNumInnerWidth + L, f.lineNumChars = f.lineNumInnerWidth ? c.length : -1, f.lineGutter.style.width = f.lineNumWidth + "px", ad(o.display), !0;
+ }
+ return !1;
+ }
+ function sd(o, l) {
+ for (var c = [], f = !1, v = 0; v < o.length; v++) {
+ var O = o[v], L = null;
+ if (typeof O != "string" && (L = O.style, O = O.className), O == "CodeMirror-linenumbers")
+ if (l)
+ f = !0;
+ else
+ continue;
+ c.push({ className: O, style: L });
+ }
+ return l && !f && c.push({ className: "CodeMirror-linenumbers", style: null }), c;
+ }
+ function Hh(o) {
+ var l = o.gutters, c = o.gutterSpecs;
+ W(l), o.lineGutter = null;
+ for (var f = 0; f < c.length; ++f) {
+ var v = c[f], O = v.className, L = v.style, j = l.appendChild(I("div", null, "CodeMirror-gutter " + O));
+ L && (j.style.cssText = L), O == "CodeMirror-linenumbers" && (o.lineGutter = j, j.style.width = (o.lineNumWidth || 1) + "px");
+ }
+ l.style.display = c.length ? "" : "none", ad(o);
+ }
+ function ba(o) {
+ Hh(o.display), Ln(o), jh(o);
+ }
+ function u_(o, l, c, f) {
+ var v = this;
+ this.input = c, v.scrollbarFiller = I("div", null, "CodeMirror-scrollbar-filler"), v.scrollbarFiller.setAttribute("cm-not-content", "true"), v.gutterFiller = I("div", null, "CodeMirror-gutter-filler"), v.gutterFiller.setAttribute("cm-not-content", "true"), v.lineDiv = U("div", null, "CodeMirror-code"), v.selectionDiv = I("div", null, null, "position: relative; z-index: 1"), v.cursorDiv = I("div", null, "CodeMirror-cursors"), v.measure = I("div", null, "CodeMirror-measure"), v.lineMeasure = I("div", null, "CodeMirror-measure"), v.lineSpace = U(
+ "div",
+ [v.measure, v.lineMeasure, v.selectionDiv, v.cursorDiv, v.lineDiv],
+ null,
+ "position: relative; outline: none"
+ );
+ var O = U("div", [v.lineSpace], "CodeMirror-lines");
+ v.mover = I("div", [O], null, "position: relative"), v.sizer = I("div", [v.mover], "CodeMirror-sizer"), v.sizerWidth = null, v.heightForcer = I("div", null, null, "position: absolute; height: " + Se + "px; width: 1px;"), v.gutters = I("div", null, "CodeMirror-gutters"), v.lineGutter = null, v.scroller = I("div", [v.sizer, v.heightForcer, v.gutters], "CodeMirror-scroll"), v.scroller.setAttribute("tabIndex", "-1"), v.wrapper = I("div", [v.scrollbarFiller, v.gutterFiller, v.scroller], "CodeMirror"), v.wrapper.setAttribute("translate", "no"), d && p < 8 && (v.gutters.style.zIndex = -1, v.scroller.style.paddingRight = 0), !h && !(n && x) && (v.scroller.draggable = !0), o && (o.appendChild ? o.appendChild(v.wrapper) : o(v.wrapper)), v.viewFrom = v.viewTo = l.first, v.reportedViewFrom = v.reportedViewTo = l.first, v.view = [], v.renderedView = null, v.externalMeasured = null, v.viewOffset = 0, v.lastWrapHeight = v.lastWrapWidth = 0, v.updateLineNumbers = null, v.nativeBarWidth = v.barHeight = v.barWidth = 0, v.scrollbarsClipped = !1, v.lineNumWidth = v.lineNumInnerWidth = v.lineNumChars = null, v.alignWidgets = !1, v.cachedCharWidth = v.cachedTextHeight = v.cachedPaddingH = null, v.maxLine = null, v.maxLineLength = 0, v.maxLineChanged = !1, v.wheelDX = v.wheelDY = v.wheelStartX = v.wheelStartY = null, v.shift = !1, v.selForContextMenu = null, v.activeTouch = null, v.gutterSpecs = sd(f.gutters, f.lineNumbers), Hh(v), c.init(v);
+ }
+ var Nl = 0, Zi = null;
+ d ? Zi = -0.53 : n ? Zi = 15 : _ ? Zi = -0.7 : A && (Zi = -1 / 3);
+ function zh(o) {
+ var l = o.wheelDeltaX, c = o.wheelDeltaY;
+ return l == null && o.detail && o.axis == o.HORIZONTAL_AXIS && (l = o.detail), c == null && o.detail && o.axis == o.VERTICAL_AXIS ? c = o.detail : c == null && (c = o.wheelDelta), { x: l, y: c };
+ }
+ function d_(o) {
+ var l = zh(o);
+ return l.x *= Zi, l.y *= Zi, l;
+ }
+ function Wh(o, l) {
+ _ && S == 102 && (o.display.chromeScrollHack == null ? o.display.sizer.style.pointerEvents = "none" : clearTimeout(o.display.chromeScrollHack), o.display.chromeScrollHack = setTimeout(function() {
+ o.display.chromeScrollHack = null, o.display.sizer.style.pointerEvents = "";
+ }, 100));
+ var c = zh(l), f = c.x, v = c.y, O = Zi;
+ l.deltaMode === 0 && (f = l.deltaX, v = l.deltaY, O = 1);
+ var L = o.display, j = L.scroller, Q = j.scrollWidth > j.clientWidth, ne = j.scrollHeight > j.clientHeight;
+ if (!!(f && Q || v && ne)) {
+ if (v && k && h) {
+ e:
+ for (var se = l.target, de = L.view; se != j; se = se.parentNode)
+ for (var Ee = 0; Ee < de.length; Ee++)
+ if (de[Ee].node == se) {
+ o.display.currentWheelTarget = se;
+ break e;
+ }
+ }
+ if (f && !n && !b && O != null) {
+ v && ne && ma(o, Math.max(0, j.scrollTop + v * O)), Mr(o, Math.max(0, j.scrollLeft + f * O)), (!v || v && ne) && It(l), L.wheelStartX = null;
+ return;
+ }
+ if (v && O != null) {
+ var Ce = v * O, Ie = o.doc.scrollTop, Ne = Ie + L.wrapper.clientHeight;
+ Ce < 0 ? Ie = Math.max(0, Ie + Ce - 50) : Ne = Math.min(o.doc.height, Ne + Ce + 50), od(o, { top: Ie, bottom: Ne });
+ }
+ Nl < 20 && l.deltaMode !== 0 && (L.wheelStartX == null ? (L.wheelStartX = j.scrollLeft, L.wheelStartY = j.scrollTop, L.wheelDX = f, L.wheelDY = v, setTimeout(function() {
+ if (L.wheelStartX != null) {
+ var Ue = j.scrollLeft - L.wheelStartX, Ye = j.scrollTop - L.wheelStartY, nt = Ye && L.wheelDY && Ye / L.wheelDY || Ue && L.wheelDX && Ue / L.wheelDX;
+ L.wheelStartX = L.wheelStartY = null, nt && (Zi = (Zi * Nl + nt) / (Nl + 1), ++Nl);
+ }
+ }, 200)) : (L.wheelDX += f, L.wheelDY += v));
+ }
+ }
+ var ei = function(o, l) {
+ this.ranges = o, this.primIndex = l;
+ };
+ ei.prototype.primary = function() {
+ return this.ranges[this.primIndex];
+ }, ei.prototype.equals = function(o) {
+ if (o == this)
+ return !0;
+ if (o.primIndex != this.primIndex || o.ranges.length != this.ranges.length)
+ return !1;
+ for (var l = 0; l < this.ranges.length; l++) {
+ var c = this.ranges[l], f = o.ranges[l];
+ if (!bt(c.anchor, f.anchor) || !bt(c.head, f.head))
+ return !1;
+ }
+ return !0;
+ }, ei.prototype.deepCopy = function() {
+ for (var o = [], l = 0; l < this.ranges.length; l++)
+ o[l] = new Pt(Ot(this.ranges[l].anchor), Ot(this.ranges[l].head));
+ return new ei(o, this.primIndex);
+ }, ei.prototype.somethingSelected = function() {
+ for (var o = 0; o < this.ranges.length; o++)
+ if (!this.ranges[o].empty())
+ return !0;
+ return !1;
+ }, ei.prototype.contains = function(o, l) {
+ l || (l = o);
+ for (var c = 0; c < this.ranges.length; c++) {
+ var f = this.ranges[c];
+ if (De(l, f.from()) >= 0 && De(o, f.to()) <= 0)
+ return c;
+ }
+ return -1;
+ };
+ var Pt = function(o, l) {
+ this.anchor = o, this.head = l;
+ };
+ Pt.prototype.from = function() {
+ return un(this.anchor, this.head);
+ }, Pt.prototype.to = function() {
+ return Rt(this.anchor, this.head);
+ }, Pt.prototype.empty = function() {
+ return this.head.line == this.anchor.line && this.head.ch == this.anchor.ch;
+ };
+ function Ai(o, l, c) {
+ var f = o && o.options.selectionsMayTouch, v = l[c];
+ l.sort(function(Ee, Ce) {
+ return De(Ee.from(), Ce.from());
+ }), c = he(l, v);
+ for (var O = 1; O < l.length; O++) {
+ var L = l[O], j = l[O - 1], Q = De(j.to(), L.from());
+ if (f && !L.empty() ? Q > 0 : Q >= 0) {
+ var ne = un(j.from(), L.from()), se = Rt(j.to(), L.to()), de = j.empty() ? L.from() == L.head : j.from() == j.head;
+ O <= c && --c, l.splice(--O, 2, new Pt(de ? se : ne, de ? ne : se));
+ }
+ }
+ return new ei(l, c);
+ }
+ function gr(o, l) {
+ return new ei([new Pt(o, l || o)], 0);
+ }
+ function yr(o) {
+ return o.text ? ye(
+ o.from.line + o.text.length - 1,
+ Ae(o.text).length + (o.text.length == 1 ? o.from.ch : 0)
+ ) : o.to;
+ }
+ function Gh(o, l) {
+ if (De(o, l.from) < 0)
+ return o;
+ if (De(o, l.to) <= 0)
+ return yr(l);
+ var c = o.line + l.text.length - (l.to.line - l.from.line) - 1, f = o.ch;
+ return o.line == l.to.line && (f += yr(l).ch - l.to.ch), ye(c, f);
+ }
+ function ud(o, l) {
+ for (var c = [], f = 0; f < o.sel.ranges.length; f++) {
+ var v = o.sel.ranges[f];
+ c.push(new Pt(
+ Gh(v.anchor, l),
+ Gh(v.head, l)
+ ));
+ }
+ return Ai(o.cm, c, o.sel.primIndex);
+ }
+ function Kh(o, l, c) {
+ return o.line == l.line ? ye(c.line, o.ch - l.ch + c.ch) : ye(c.line + (o.line - l.line), o.ch);
+ }
+ function f_(o, l, c) {
+ for (var f = [], v = ye(o.first, 0), O = v, L = 0; L < l.length; L++) {
+ var j = l[L], Q = Kh(j.from, v, O), ne = Kh(yr(j), v, O);
+ if (v = j.to, O = ne, c == "around") {
+ var se = o.sel.ranges[L], de = De(se.head, se.anchor) < 0;
+ f[L] = new Pt(de ? ne : Q, de ? Q : ne);
+ } else
+ f[L] = new Pt(Q, Q);
+ }
+ return new ei(f, o.sel.primIndex);
+ }
+ function dd(o) {
+ o.doc.mode = Gi(o.options, o.doc.modeOption), _a(o);
+ }
+ function _a(o) {
+ o.doc.iter(function(l) {
+ l.stateAfter && (l.stateAfter = null), l.styles && (l.styles = null);
+ }), o.doc.modeFrontier = o.doc.highlightFrontier = o.doc.first, ya(o, 100), o.state.modeGen++, o.curOp && Ln(o);
+ }
+ function Yh(o, l) {
+ return l.from.ch == 0 && l.to.ch == 0 && Ae(l.text) == "" && (!o.cm || o.cm.options.wholeLineUpdateBefore);
+ }
+ function fd(o, l, c, f) {
+ function v(nt) {
+ return c ? c[nt] : null;
+ }
+ function O(nt, Qe, ot) {
+ b1(nt, Qe, ot, f), pn(nt, "change", nt, l);
+ }
+ function L(nt, Qe) {
+ for (var ot = [], mt = nt; mt < Qe; ++mt)
+ ot.push(new oo(ne[mt], v(mt), f));
+ return ot;
+ }
+ var j = l.from, Q = l.to, ne = l.text, se = ut(o, j.line), de = ut(o, Q.line), Ee = Ae(ne), Ce = v(ne.length - 1), Ie = Q.line - j.line;
+ if (l.full)
+ o.insert(0, L(0, ne.length)), o.remove(ne.length, o.size - ne.length);
+ else if (Yh(o, l)) {
+ var Ne = L(0, ne.length - 1);
+ O(de, de.text, Ce), Ie && o.remove(j.line, Ie), Ne.length && o.insert(j.line, Ne);
+ } else if (se == de)
+ if (ne.length == 1)
+ O(se, se.text.slice(0, j.ch) + Ee + se.text.slice(Q.ch), Ce);
+ else {
+ var Ue = L(1, ne.length - 1);
+ Ue.push(new oo(Ee + se.text.slice(Q.ch), Ce, f)), O(se, se.text.slice(0, j.ch) + ne[0], v(0)), o.insert(j.line + 1, Ue);
+ }
+ else if (ne.length == 1)
+ O(se, se.text.slice(0, j.ch) + ne[0] + de.text.slice(Q.ch), v(0)), o.remove(j.line + 1, Ie);
+ else {
+ O(se, se.text.slice(0, j.ch) + ne[0], v(0)), O(de, Ee + de.text.slice(Q.ch), Ce);
+ var Ye = L(1, ne.length - 1);
+ Ie > 1 && o.remove(j.line + 1, Ie - 1), o.insert(j.line + 1, Ye);
+ }
+ pn(o, "change", o, l);
+ }
+ function br(o, l, c) {
+ function f(v, O, L) {
+ if (v.linked)
+ for (var j = 0; j < v.linked.length; ++j) {
+ var Q = v.linked[j];
+ if (Q.doc != O) {
+ var ne = L && Q.sharedHist;
+ c && !ne || (l(Q.doc, ne), f(Q.doc, v, ne));
+ }
+ }
+ }
+ f(o, null, !0);
+ }
+ function Qh(o, l) {
+ if (l.cm)
+ throw new Error("This document is already in use.");
+ o.doc = l, l.cm = o, Xu(o), dd(o), Jh(o), o.options.direction = l.direction, o.options.lineWrapping || Vu(o), o.options.mode = l.modeOption, Ln(o);
+ }
+ function Jh(o) {
+ (o.doc.direction == "rtl" ? Z : V)(o.display.lineDiv, "CodeMirror-rtl");
+ }
+ function c_(o) {
+ Wn(o, function() {
+ Jh(o), Ln(o);
});
}
- }
- var Ll = function(o, l, c) {
- var f = o.display;
- this.viewport = l, this.visible = Pl(f, o.doc, l), this.editorIsHidden = !f.wrapper.offsetWidth, this.wrapperHeight = f.wrapper.clientHeight, this.wrapperWidth = f.wrapper.clientWidth, this.oldDisplayWidth = Dr(o), this.force = c, this.dims = Qu(o), this.events = [];
- };
- Ll.prototype.signal = function(o, l) {
- Qt(o, l) && this.events.push(arguments);
- }, Ll.prototype.finish = function() {
- for (var o = 0; o < this.events.length; o++)
- st.apply(null, this.events[o]);
- };
- function i_(o) {
- var l = o.display;
- !l.scrollbarsClipped && l.scroller.offsetWidth && (l.nativeBarWidth = l.scroller.offsetWidth - l.scroller.clientWidth, l.heightForcer.style.height = Fi(o) + "px", l.sizer.style.marginBottom = -l.nativeBarWidth + "px", l.sizer.style.borderRightWidth = Fi(o) + "px", l.scrollbarsClipped = !0);
- }
- function r_(o) {
- if (o.hasFocus())
- return null;
- var l = q(te(o));
- if (!l || !C(o.display.lineDiv, l))
- return null;
- var c = { activeElt: l };
- if (window.getSelection) {
- var f = pe(o).getSelection();
- f.anchorNode && f.extend && C(o.display.lineDiv, f.anchorNode) && (c.anchorNode = f.anchorNode, c.anchorOffset = f.anchorOffset, c.focusNode = f.focusNode, c.focusOffset = f.focusOffset);
+ function Bl(o) {
+ this.done = [], this.undone = [], this.undoDepth = o ? o.undoDepth : 1 / 0, this.lastModTime = this.lastSelTime = 0, this.lastOp = this.lastSelOp = null, this.lastOrigin = this.lastSelOrigin = null, this.generation = this.maxGeneration = o ? o.maxGeneration : 1;
}
- return c;
- }
- function o_(o) {
- if (!(!o || !o.activeElt || o.activeElt == q(o.activeElt.ownerDocument)) && (o.activeElt.focus(), !/^(INPUT|TEXTAREA)$/.test(o.activeElt.nodeName) && o.anchorNode && C(document.body, o.anchorNode) && C(document.body, o.focusNode))) {
- var l = o.activeElt.ownerDocument, c = l.defaultView.getSelection(), f = l.createRange();
- f.setEnd(o.anchorNode, o.anchorOffset), f.collapse(!1), c.removeAllRanges(), c.addRange(f), c.extend(o.focusNode, o.focusOffset);
+ function cd(o, l) {
+ var c = { from: Ot(l.from), to: yr(l), text: Yi(o, l.from, l.to) };
+ return qh(o, c, l.from.line, l.to.line + 1), br(o, function(f) {
+ return qh(f, c, l.from.line, l.to.line + 1);
+ }, !0), c;
}
- }
- function rd(o, l) {
- var c = o.display, f = o.doc;
- if (l.editorIsHidden)
- return vr(o), !1;
- if (!l.force && l.visible.from >= c.viewFrom && l.visible.to <= c.viewTo && (c.updateLineNumbers == null || c.updateLineNumbers >= c.viewTo) && c.renderedView == c.view && $h(o) == 0)
- return !1;
- jh(o) && (vr(o), l.dims = Qu(o));
- var v = f.first + f.size, O = Math.max(l.visible.from - o.options.viewportMargin, f.first), L = Math.min(v, l.visible.to + o.options.viewportMargin);
- c.viewFrom < O && O - c.viewFrom < 20 && (O = Math.max(f.first, c.viewFrom)), c.viewTo > L && c.viewTo - L < 20 && (L = Math.min(v, c.viewTo)), Qi && (O = Nu(o.doc, O), L = ah(o.doc, L));
- var j = O != c.viewFrom || L != c.viewTo || c.lastWrapHeight != l.wrapperHeight || c.lastWrapWidth != l.wrapperWidth;
- H1(o, O, L), c.viewOffset = Ji(ut(o.doc, c.viewFrom)), o.display.mover.style.top = c.viewOffset + "px";
- var Q = $h(o);
- if (!j && Q == 0 && !l.force && c.renderedView == c.view && (c.updateLineNumbers == null || c.updateLineNumbers >= c.viewTo))
- return !1;
- var ne = r_(o);
- return Q > 4 && (c.lineDiv.style.display = "none"), a_(o, c.updateLineNumbers, l.dims), Q > 4 && (c.lineDiv.style.display = ""), c.renderedView = c.view, o_(ne), W(c.cursorDiv), W(c.selectionDiv), c.gutters.style.height = c.sizer.style.minHeight = 0, j && (c.lastWrapHeight = l.wrapperHeight, c.lastWrapWidth = l.wrapperWidth, ya(o, 400)), c.updateLineNumbers = null, !0;
- }
- function Bh(o, l) {
- for (var c = l.viewport, f = !0; ; f = !1) {
- if (!f || !o.options.lineWrapping || l.oldDisplayWidth == Dr(o)) {
- if (c && c.top != null && (c = { top: Math.min(o.doc.height + Uu(o.display) - Hu(o), c.top) }), l.visible = Pl(o.display, o.doc, c), l.visible.from >= o.display.viewFrom && l.visible.to <= o.display.viewTo)
- break;
- } else
- f && (l.visible = Pl(o.display, o.doc, c));
- if (!rd(o, l))
- break;
- Fl(o);
- var v = va(o);
- pa(o), ho(o, v), ld(o, v), l.force = !1;
- }
- l.signal(o, "update", o), (o.display.viewFrom != o.display.reportedViewFrom || o.display.viewTo != o.display.reportedViewTo) && (l.signal(o, "viewportChange", o, o.display.viewFrom, o.display.viewTo), o.display.reportedViewFrom = o.display.viewFrom, o.display.reportedViewTo = o.display.viewTo);
- }
- function od(o, l) {
- var c = new Ll(o, l);
- if (rd(o, c)) {
- Fl(o), Bh(o, c);
- var f = va(o);
- pa(o), ho(o, f), ld(o, f), c.finish();
- }
- }
- function a_(o, l, c) {
- var f = o.display, v = o.options.lineNumbers, O = f.lineDiv, L = O.firstChild;
- function j(Ie) {
- var Ne = Ie.nextSibling;
- return h && k && o.display.currentWheelTarget == Ie ? Ie.style.display = "none" : Ie.parentNode.removeChild(Ie), Ne;
- }
- for (var Q = f.view, ne = f.viewFrom, se = 0; se < Q.length; se++) {
- var de = Q[se];
- if (!de.hidden)
- if (!de.node || de.node.parentNode != O) {
- var Ee = I1(o, de, ne, c);
- O.insertBefore(Ee, L);
- } else {
- for (; L != de.node; )
- L = j(L);
- var Ce = v && l != null && l <= ne && de.lineNumber;
- de.changes && (he(de.changes, "gutter") > -1 && (Ce = !1), fh(o, de, ne, c)), Ce && (W(de.lineNumber), de.lineNumber.appendChild(document.createTextNode(ce(o.options, ne)))), L = de.node.nextSibling;
- }
- ne += de.size;
- }
- for (; L; )
- L = j(L);
- }
- function ad(o) {
- var l = o.gutters.offsetWidth;
- o.sizer.style.marginLeft = l + "px", pn(o, "gutterChanged", o);
- }
- function ld(o, l) {
- o.display.sizer.style.minHeight = l.docHeight + "px", o.display.heightForcer.style.top = l.docHeight + "px", o.display.gutters.style.height = l.docHeight + o.display.barHeight + Fi(o) + "px";
- }
- function Vh(o) {
- var l = o.display, c = l.view;
- if (!(!l.alignWidgets && (!l.gutters.firstChild || !o.options.fixedGutter))) {
- for (var f = Ju(l) - l.scroller.scrollLeft + o.doc.scrollLeft, v = l.gutters.offsetWidth, O = f + "px", L = 0; L < c.length; L++)
- if (!c[L].hidden) {
- o.options.fixedGutter && (c[L].gutter && (c[L].gutter.style.left = O), c[L].gutterBackground && (c[L].gutterBackground.style.left = O));
- var j = c[L].alignable;
- if (j)
- for (var Q = 0; Q < j.length; Q++)
- j[Q].style.left = O;
- }
- o.options.fixedGutter && (l.gutters.style.left = f + v + "px");
- }
- }
- function jh(o) {
- if (!o.options.lineNumbers)
- return !1;
- var l = o.doc, c = ce(o.options, l.first + l.size - 1), f = o.display;
- if (c.length != f.lineNumChars) {
- var v = f.measure.appendChild(I(
- "div",
- [I("div", c)],
- "CodeMirror-linenumber CodeMirror-gutter-elt"
- )), O = v.firstChild.offsetWidth, L = v.offsetWidth - O;
- return f.lineGutter.style.width = "", f.lineNumInnerWidth = Math.max(O, f.lineGutter.offsetWidth - L) + 1, f.lineNumWidth = f.lineNumInnerWidth + L, f.lineNumChars = f.lineNumInnerWidth ? c.length : -1, f.lineGutter.style.width = f.lineNumWidth + "px", ad(o.display), !0;
- }
- return !1;
- }
- function sd(o, l) {
- for (var c = [], f = !1, v = 0; v < o.length; v++) {
- var O = o[v], L = null;
- if (typeof O != "string" && (L = O.style, O = O.className), O == "CodeMirror-linenumbers")
- if (l)
- f = !0;
+ function Xh(o) {
+ for (; o.length; ) {
+ var l = Ae(o);
+ if (l.ranges)
+ o.pop();
else
- continue;
- c.push({ className: O, style: L });
- }
- return l && !f && c.push({ className: "CodeMirror-linenumbers", style: null }), c;
- }
- function Uh(o) {
- var l = o.gutters, c = o.gutterSpecs;
- W(l), o.lineGutter = null;
- for (var f = 0; f < c.length; ++f) {
- var v = c[f], O = v.className, L = v.style, j = l.appendChild(I("div", null, "CodeMirror-gutter " + O));
- L && (j.style.cssText = L), O == "CodeMirror-linenumbers" && (o.lineGutter = j, j.style.width = (o.lineNumWidth || 1) + "px");
- }
- l.style.display = c.length ? "" : "none", ad(o);
- }
- function ba(o) {
- Uh(o.display), Ln(o), Vh(o);
- }
- function l_(o, l, c, f) {
- var v = this;
- this.input = c, v.scrollbarFiller = I("div", null, "CodeMirror-scrollbar-filler"), v.scrollbarFiller.setAttribute("cm-not-content", "true"), v.gutterFiller = I("div", null, "CodeMirror-gutter-filler"), v.gutterFiller.setAttribute("cm-not-content", "true"), v.lineDiv = U("div", null, "CodeMirror-code"), v.selectionDiv = I("div", null, null, "position: relative; z-index: 1"), v.cursorDiv = I("div", null, "CodeMirror-cursors"), v.measure = I("div", null, "CodeMirror-measure"), v.lineMeasure = I("div", null, "CodeMirror-measure"), v.lineSpace = U(
- "div",
- [v.measure, v.lineMeasure, v.selectionDiv, v.cursorDiv, v.lineDiv],
- null,
- "position: relative; outline: none"
- );
- var O = U("div", [v.lineSpace], "CodeMirror-lines");
- v.mover = I("div", [O], null, "position: relative"), v.sizer = I("div", [v.mover], "CodeMirror-sizer"), v.sizerWidth = null, v.heightForcer = I("div", null, null, "position: absolute; height: " + Se + "px; width: 1px;"), v.gutters = I("div", null, "CodeMirror-gutters"), v.lineGutter = null, v.scroller = I("div", [v.sizer, v.heightForcer, v.gutters], "CodeMirror-scroll"), v.scroller.setAttribute("tabIndex", "-1"), v.wrapper = I("div", [v.scrollbarFiller, v.gutterFiller, v.scroller], "CodeMirror"), v.wrapper.setAttribute("translate", "no"), d && p < 8 && (v.gutters.style.zIndex = -1, v.scroller.style.paddingRight = 0), !h && !(n && x) && (v.scroller.draggable = !0), o && (o.appendChild ? o.appendChild(v.wrapper) : o(v.wrapper)), v.viewFrom = v.viewTo = l.first, v.reportedViewFrom = v.reportedViewTo = l.first, v.view = [], v.renderedView = null, v.externalMeasured = null, v.viewOffset = 0, v.lastWrapHeight = v.lastWrapWidth = 0, v.updateLineNumbers = null, v.nativeBarWidth = v.barHeight = v.barWidth = 0, v.scrollbarsClipped = !1, v.lineNumWidth = v.lineNumInnerWidth = v.lineNumChars = null, v.alignWidgets = !1, v.cachedCharWidth = v.cachedTextHeight = v.cachedPaddingH = null, v.maxLine = null, v.maxLineLength = 0, v.maxLineChanged = !1, v.wheelDX = v.wheelDY = v.wheelStartX = v.wheelStartY = null, v.shift = !1, v.selForContextMenu = null, v.activeTouch = null, v.gutterSpecs = sd(f.gutters, f.lineNumbers), Uh(v), c.init(v);
- }
- var Nl = 0, Zi = null;
- d ? Zi = -0.53 : n ? Zi = 15 : _ ? Zi = -0.7 : A && (Zi = -1 / 3);
- function Hh(o) {
- var l = o.wheelDeltaX, c = o.wheelDeltaY;
- return l == null && o.detail && o.axis == o.HORIZONTAL_AXIS && (l = o.detail), c == null && o.detail && o.axis == o.VERTICAL_AXIS ? c = o.detail : c == null && (c = o.wheelDelta), { x: l, y: c };
- }
- function s_(o) {
- var l = Hh(o);
- return l.x *= Zi, l.y *= Zi, l;
- }
- function zh(o, l) {
- _ && S == 102 && (o.display.chromeScrollHack == null ? o.display.sizer.style.pointerEvents = "none" : clearTimeout(o.display.chromeScrollHack), o.display.chromeScrollHack = setTimeout(function() {
- o.display.chromeScrollHack = null, o.display.sizer.style.pointerEvents = "";
- }, 100));
- var c = Hh(l), f = c.x, v = c.y, O = Zi;
- l.deltaMode === 0 && (f = l.deltaX, v = l.deltaY, O = 1);
- var L = o.display, j = L.scroller, Q = j.scrollWidth > j.clientWidth, ne = j.scrollHeight > j.clientHeight;
- if (!!(f && Q || v && ne)) {
- if (v && k && h) {
- e:
- for (var se = l.target, de = L.view; se != j; se = se.parentNode)
- for (var Ee = 0; Ee < de.length; Ee++)
- if (de[Ee].node == se) {
- o.display.currentWheelTarget = se;
- break e;
- }
- }
- if (f && !n && !b && O != null) {
- v && ne && ma(o, Math.max(0, j.scrollTop + v * O)), Mr(o, Math.max(0, j.scrollLeft + f * O)), (!v || v && ne) && It(l), L.wheelStartX = null;
- return;
- }
- if (v && O != null) {
- var Ce = v * O, Ie = o.doc.scrollTop, Ne = Ie + L.wrapper.clientHeight;
- Ce < 0 ? Ie = Math.max(0, Ie + Ce - 50) : Ne = Math.min(o.doc.height, Ne + Ce + 50), od(o, { top: Ie, bottom: Ne });
- }
- Nl < 20 && l.deltaMode !== 0 && (L.wheelStartX == null ? (L.wheelStartX = j.scrollLeft, L.wheelStartY = j.scrollTop, L.wheelDX = f, L.wheelDY = v, setTimeout(function() {
- if (L.wheelStartX != null) {
- var Ue = j.scrollLeft - L.wheelStartX, Ye = j.scrollTop - L.wheelStartY, nt = Ye && L.wheelDY && Ye / L.wheelDY || Ue && L.wheelDX && Ue / L.wheelDX;
- L.wheelStartX = L.wheelStartY = null, nt && (Zi = (Zi * Nl + nt) / (Nl + 1), ++Nl);
- }
- }, 200)) : (L.wheelDX += f, L.wheelDY += v));
- }
- }
- var ei = function(o, l) {
- this.ranges = o, this.primIndex = l;
- };
- ei.prototype.primary = function() {
- return this.ranges[this.primIndex];
- }, ei.prototype.equals = function(o) {
- if (o == this)
- return !0;
- if (o.primIndex != this.primIndex || o.ranges.length != this.ranges.length)
- return !1;
- for (var l = 0; l < this.ranges.length; l++) {
- var c = this.ranges[l], f = o.ranges[l];
- if (!bt(c.anchor, f.anchor) || !bt(c.head, f.head))
- return !1;
- }
- return !0;
- }, ei.prototype.deepCopy = function() {
- for (var o = [], l = 0; l < this.ranges.length; l++)
- o[l] = new Pt(Ot(this.ranges[l].anchor), Ot(this.ranges[l].head));
- return new ei(o, this.primIndex);
- }, ei.prototype.somethingSelected = function() {
- for (var o = 0; o < this.ranges.length; o++)
- if (!this.ranges[o].empty())
- return !0;
- return !1;
- }, ei.prototype.contains = function(o, l) {
- l || (l = o);
- for (var c = 0; c < this.ranges.length; c++) {
- var f = this.ranges[c];
- if (De(l, f.from()) >= 0 && De(o, f.to()) <= 0)
- return c;
- }
- return -1;
- };
- var Pt = function(o, l) {
- this.anchor = o, this.head = l;
- };
- Pt.prototype.from = function() {
- return un(this.anchor, this.head);
- }, Pt.prototype.to = function() {
- return Rt(this.anchor, this.head);
- }, Pt.prototype.empty = function() {
- return this.head.line == this.anchor.line && this.head.ch == this.anchor.ch;
- };
- function Ai(o, l, c) {
- var f = o && o.options.selectionsMayTouch, v = l[c];
- l.sort(function(Ee, Ce) {
- return De(Ee.from(), Ce.from());
- }), c = he(l, v);
- for (var O = 1; O < l.length; O++) {
- var L = l[O], j = l[O - 1], Q = De(j.to(), L.from());
- if (f && !L.empty() ? Q > 0 : Q >= 0) {
- var ne = un(j.from(), L.from()), se = Rt(j.to(), L.to()), de = j.empty() ? L.from() == L.head : j.from() == j.head;
- O <= c && --c, l.splice(--O, 2, new Pt(de ? se : ne, de ? ne : se));
+ break;
}
}
- return new ei(l, c);
- }
- function gr(o, l) {
- return new ei([new Pt(o, l || o)], 0);
- }
- function yr(o) {
- return o.text ? ye(
- o.from.line + o.text.length - 1,
- Ae(o.text).length + (o.text.length == 1 ? o.from.ch : 0)
- ) : o.to;
- }
- function Wh(o, l) {
- if (De(o, l.from) < 0)
- return o;
- if (De(o, l.to) <= 0)
- return yr(l);
- var c = o.line + l.text.length - (l.to.line - l.from.line) - 1, f = o.ch;
- return o.line == l.to.line && (f += yr(l).ch - l.to.ch), ye(c, f);
- }
- function ud(o, l) {
- for (var c = [], f = 0; f < o.sel.ranges.length; f++) {
- var v = o.sel.ranges[f];
- c.push(new Pt(
- Wh(v.anchor, l),
- Wh(v.head, l)
- ));
+ function p_(o, l) {
+ if (l)
+ return Xh(o.done), Ae(o.done);
+ if (o.done.length && !Ae(o.done).ranges)
+ return Ae(o.done);
+ if (o.done.length > 1 && !o.done[o.done.length - 2].ranges)
+ return o.done.pop(), Ae(o.done);
}
- return Ai(o.cm, c, o.sel.primIndex);
- }
- function Gh(o, l, c) {
- return o.line == l.line ? ye(c.line, o.ch - l.ch + c.ch) : ye(c.line + (o.line - l.line), o.ch);
- }
- function u_(o, l, c) {
- for (var f = [], v = ye(o.first, 0), O = v, L = 0; L < l.length; L++) {
- var j = l[L], Q = Gh(j.from, v, O), ne = Gh(yr(j), v, O);
- if (v = j.to, O = ne, c == "around") {
- var se = o.sel.ranges[L], de = De(se.head, se.anchor) < 0;
- f[L] = new Pt(de ? ne : Q, de ? Q : ne);
- } else
- f[L] = new Pt(Q, Q);
- }
- return new ei(f, o.sel.primIndex);
- }
- function dd(o) {
- o.doc.mode = Gi(o.options, o.doc.modeOption), _a(o);
- }
- function _a(o) {
- o.doc.iter(function(l) {
- l.stateAfter && (l.stateAfter = null), l.styles && (l.styles = null);
- }), o.doc.modeFrontier = o.doc.highlightFrontier = o.doc.first, ya(o, 100), o.state.modeGen++, o.curOp && Ln(o);
- }
- function Kh(o, l) {
- return l.from.ch == 0 && l.to.ch == 0 && Ae(l.text) == "" && (!o.cm || o.cm.options.wholeLineUpdateBefore);
- }
- function fd(o, l, c, f) {
- function v(nt) {
- return c ? c[nt] : null;
- }
- function O(nt, Qe, ot) {
- g1(nt, Qe, ot, f), pn(nt, "change", nt, l);
- }
- function L(nt, Qe) {
- for (var ot = [], mt = nt; mt < Qe; ++mt)
- ot.push(new ao(ne[mt], v(mt), f));
- return ot;
- }
- var j = l.from, Q = l.to, ne = l.text, se = ut(o, j.line), de = ut(o, Q.line), Ee = Ae(ne), Ce = v(ne.length - 1), Ie = Q.line - j.line;
- if (l.full)
- o.insert(0, L(0, ne.length)), o.remove(ne.length, o.size - ne.length);
- else if (Kh(o, l)) {
- var Ne = L(0, ne.length - 1);
- O(de, de.text, Ce), Ie && o.remove(j.line, Ie), Ne.length && o.insert(j.line, Ne);
- } else if (se == de)
- if (ne.length == 1)
- O(se, se.text.slice(0, j.ch) + Ee + se.text.slice(Q.ch), Ce);
+ function Zh(o, l, c, f) {
+ var v = o.history;
+ v.undone.length = 0;
+ var O = +new Date(), L, j;
+ if ((v.lastOp == f || v.lastOrigin == l.origin && l.origin && (l.origin.charAt(0) == "+" && v.lastModTime > O - (o.cm ? o.cm.options.historyEventDelay : 500) || l.origin.charAt(0) == "*")) && (L = p_(v, v.lastOp == f)))
+ j = Ae(L.changes), De(l.from, l.to) == 0 && De(l.from, j.to) == 0 ? j.to = yr(l) : L.changes.push(cd(o, l));
else {
- var Ue = L(1, ne.length - 1);
- Ue.push(new ao(Ee + se.text.slice(Q.ch), Ce, f)), O(se, se.text.slice(0, j.ch) + ne[0], v(0)), o.insert(j.line + 1, Ue);
+ var Q = Ae(v.done);
+ for ((!Q || !Q.ranges) && Vl(o.sel, v.done), L = {
+ changes: [cd(o, l)],
+ generation: v.generation
+ }, v.done.push(L); v.done.length > v.undoDepth; )
+ v.done.shift(), v.done[0].ranges || v.done.shift();
}
- else if (ne.length == 1)
- O(se, se.text.slice(0, j.ch) + ne[0] + de.text.slice(Q.ch), v(0)), o.remove(j.line + 1, Ie);
- else {
- O(se, se.text.slice(0, j.ch) + ne[0], v(0)), O(de, Ee + de.text.slice(Q.ch), Ce);
- var Ye = L(1, ne.length - 1);
- Ie > 1 && o.remove(j.line + 1, Ie - 1), o.insert(j.line + 1, Ye);
+ v.done.push(c), v.generation = ++v.maxGeneration, v.lastModTime = v.lastSelTime = O, v.lastOp = v.lastSelOp = f, v.lastOrigin = v.lastSelOrigin = l.origin, j || st(o, "historyAdded");
}
- pn(o, "change", o, l);
- }
- function br(o, l, c) {
- function f(v, O, L) {
- if (v.linked)
- for (var j = 0; j < v.linked.length; ++j) {
- var Q = v.linked[j];
- if (Q.doc != O) {
- var ne = L && Q.sharedHist;
- c && !ne || (l(Q.doc, ne), f(Q.doc, v, ne));
+ function h_(o, l, c, f) {
+ var v = l.charAt(0);
+ return v == "*" || v == "+" && c.ranges.length == f.ranges.length && c.somethingSelected() == f.somethingSelected() && new Date() - o.history.lastSelTime <= (o.cm ? o.cm.options.historyEventDelay : 500);
+ }
+ function m_(o, l, c, f) {
+ var v = o.history, O = f && f.origin;
+ c == v.lastSelOp || O && v.lastSelOrigin == O && (v.lastModTime == v.lastSelTime && v.lastOrigin == O || h_(o, O, Ae(v.done), l)) ? v.done[v.done.length - 1] = l : Vl(l, v.done), v.lastSelTime = +new Date(), v.lastSelOrigin = O, v.lastSelOp = c, f && f.clearRedo !== !1 && Xh(v.undone);
+ }
+ function Vl(o, l) {
+ var c = Ae(l);
+ c && c.ranges && c.equals(o) || l.push(o);
+ }
+ function qh(o, l, c, f) {
+ var v = l["spans_" + o.id], O = 0;
+ o.iter(Math.max(o.first, c), Math.min(o.first + o.size, f), function(L) {
+ L.markedSpans && ((v || (v = l["spans_" + o.id] = {}))[O] = L.markedSpans), ++O;
+ });
+ }
+ function v_(o) {
+ if (!o)
+ return null;
+ for (var l, c = 0; c < o.length; ++c)
+ o[c].marker.explicitlyCleared ? l || (l = o.slice(0, c)) : l && l.push(o[c]);
+ return l ? l.length ? l : null : o;
+ }
+ function g_(o, l) {
+ var c = l["spans_" + o.id];
+ if (!c)
+ return null;
+ for (var f = [], v = 0; v < l.text.length; ++v)
+ f.push(v_(c[v]));
+ return f;
+ }
+ function em(o, l) {
+ var c = g_(o, l), f = Mu(o, l);
+ if (!c)
+ return f;
+ if (!f)
+ return c;
+ for (var v = 0; v < c.length; ++v) {
+ var O = c[v], L = f[v];
+ if (O && L) {
+ e:
+ for (var j = 0; j < L.length; ++j) {
+ for (var Q = L[j], ne = 0; ne < O.length; ++ne)
+ if (O[ne].marker == Q.marker)
+ continue e;
+ O.push(Q);
+ }
+ } else
+ L && (c[v] = L);
+ }
+ return c;
+ }
+ function ho(o, l, c) {
+ for (var f = [], v = 0; v < o.length; ++v) {
+ var O = o[v];
+ if (O.ranges) {
+ f.push(c ? ei.prototype.deepCopy.call(O) : O);
+ continue;
+ }
+ var L = O.changes, j = [];
+ f.push({ changes: j });
+ for (var Q = 0; Q < L.length; ++Q) {
+ var ne = L[Q], se = void 0;
+ if (j.push({ from: ne.from, to: ne.to, text: ne.text }), l)
+ for (var de in ne)
+ (se = de.match(/^spans_(\d+)$/)) && he(l, Number(se[1])) > -1 && (Ae(j)[de] = ne[de], delete ne[de]);
+ }
+ }
+ return f;
+ }
+ function pd(o, l, c, f) {
+ if (f) {
+ var v = o.anchor;
+ if (c) {
+ var O = De(l, v) < 0;
+ O != De(c, v) < 0 ? (v = l, l = c) : O != De(l, c) < 0 && (l = c);
+ }
+ return new Pt(v, l);
+ } else
+ return new Pt(c || l, l);
+ }
+ function jl(o, l, c, f, v) {
+ v == null && (v = o.cm && (o.cm.display.shift || o.extend)), En(o, new ei([pd(o.sel.primary(), l, c, v)], 0), f);
+ }
+ function tm(o, l, c) {
+ for (var f = [], v = o.cm && (o.cm.display.shift || o.extend), O = 0; O < o.sel.ranges.length; O++)
+ f[O] = pd(o.sel.ranges[O], l[O], null, v);
+ var L = Ai(o.cm, f, o.sel.primIndex);
+ En(o, L, c);
+ }
+ function hd(o, l, c, f) {
+ var v = o.sel.ranges.slice(0);
+ v[l] = c, En(o, Ai(o.cm, v, o.sel.primIndex), f);
+ }
+ function nm(o, l, c, f) {
+ En(o, gr(l, c), f);
+ }
+ function y_(o, l, c) {
+ var f = {
+ ranges: l.ranges,
+ update: function(v) {
+ this.ranges = [];
+ for (var O = 0; O < v.length; O++)
+ this.ranges[O] = new Pt(
+ _t(o, v[O].anchor),
+ _t(o, v[O].head)
+ );
+ },
+ origin: c && c.origin
+ };
+ return st(o, "beforeSelectionChange", o, f), o.cm && st(o.cm, "beforeSelectionChange", o.cm, f), f.ranges != l.ranges ? Ai(o.cm, f.ranges, f.ranges.length - 1) : l;
+ }
+ function im(o, l, c) {
+ var f = o.history.done, v = Ae(f);
+ v && v.ranges ? (f[f.length - 1] = l, Ul(o, l, c)) : En(o, l, c);
+ }
+ function En(o, l, c) {
+ Ul(o, l, c), m_(o, o.sel, o.cm ? o.cm.curOp.id : NaN, c);
+ }
+ function Ul(o, l, c) {
+ (Qt(o, "beforeSelectionChange") || o.cm && Qt(o.cm, "beforeSelectionChange")) && (l = y_(o, l, c));
+ var f = c && c.bias || (De(l.primary().head, o.sel.primary().head) < 0 ? -1 : 1);
+ rm(o, am(o, l, f, !0)), !(c && c.scroll === !1) && o.cm && o.cm.getOption("readOnly") != "nocursor" && co(o.cm);
+ }
+ function rm(o, l) {
+ l.equals(o.sel) || (o.sel = l, o.cm && (o.cm.curOp.updateInput = 1, o.cm.curOp.selectionChanged = !0, Pn(o.cm)), pn(o, "cursorActivity", o));
+ }
+ function om(o) {
+ rm(o, am(o, o.sel, null, !1));
+ }
+ function am(o, l, c, f) {
+ for (var v, O = 0; O < l.ranges.length; O++) {
+ var L = l.ranges[O], j = l.ranges.length == o.sel.ranges.length && o.sel.ranges[O], Q = Hl(o, L.anchor, j && j.anchor, c, f), ne = L.head == L.anchor ? Q : Hl(o, L.head, j && j.head, c, f);
+ (v || Q != L.anchor || ne != L.head) && (v || (v = l.ranges.slice(0, O)), v[O] = new Pt(Q, ne));
+ }
+ return v ? Ai(o.cm, v, l.primIndex) : l;
+ }
+ function mo(o, l, c, f, v) {
+ var O = ut(o, l.line);
+ if (O.markedSpans)
+ for (var L = 0; L < O.markedSpans.length; ++L) {
+ var j = O.markedSpans[L], Q = j.marker, ne = "selectLeft" in Q ? !Q.selectLeft : Q.inclusiveLeft, se = "selectRight" in Q ? !Q.selectRight : Q.inclusiveRight;
+ if ((j.from == null || (ne ? j.from <= l.ch : j.from < l.ch)) && (j.to == null || (se ? j.to >= l.ch : j.to > l.ch))) {
+ if (v && (st(Q, "beforeCursorEnter"), Q.explicitlyCleared))
+ if (O.markedSpans) {
+ --L;
+ continue;
+ } else
+ break;
+ if (!Q.atomic)
+ continue;
+ if (c) {
+ var de = Q.find(f < 0 ? 1 : -1), Ee = void 0;
+ if ((f < 0 ? se : ne) && (de = lm(o, de, -f, de && de.line == l.line ? O : null)), de && de.line == l.line && (Ee = De(de, c)) && (f < 0 ? Ee < 0 : Ee > 0))
+ return mo(o, de, l, f, v);
+ }
+ var Ce = Q.find(f < 0 ? -1 : 1);
+ return (f < 0 ? ne : se) && (Ce = lm(o, Ce, f, Ce.line == l.line ? O : null)), Ce ? mo(o, Ce, l, f, v) : null;
}
}
+ return l;
}
- f(o, null, !0);
- }
- function Yh(o, l) {
- if (l.cm)
- throw new Error("This document is already in use.");
- o.doc = l, l.cm = o, Xu(o), dd(o), Qh(o), o.options.direction = l.direction, o.options.lineWrapping || Vu(o), o.options.mode = l.modeOption, Ln(o);
- }
- function Qh(o) {
- (o.doc.direction == "rtl" ? Z : V)(o.display.lineDiv, "CodeMirror-rtl");
- }
- function d_(o) {
- Wn(o, function() {
- Qh(o), Ln(o);
- });
- }
- function Bl(o) {
- this.done = [], this.undone = [], this.undoDepth = o ? o.undoDepth : 1 / 0, this.lastModTime = this.lastSelTime = 0, this.lastOp = this.lastSelOp = null, this.lastOrigin = this.lastSelOrigin = null, this.generation = this.maxGeneration = o ? o.maxGeneration : 1;
- }
- function cd(o, l) {
- var c = { from: Ot(l.from), to: yr(l), text: Yi(o, l.from, l.to) };
- return Zh(o, c, l.from.line, l.to.line + 1), br(o, function(f) {
- return Zh(f, c, l.from.line, l.to.line + 1);
- }, !0), c;
- }
- function Jh(o) {
- for (; o.length; ) {
- var l = Ae(o);
- if (l.ranges)
- o.pop();
- else
- break;
+ function Hl(o, l, c, f, v) {
+ var O = f || 1, L = mo(o, l, c, O, v) || !v && mo(o, l, c, O, !0) || mo(o, l, c, -O, v) || !v && mo(o, l, c, -O, !0);
+ return L || (o.cantEdit = !0, ye(o.first, 0));
}
- }
- function f_(o, l) {
- if (l)
- return Jh(o.done), Ae(o.done);
- if (o.done.length && !Ae(o.done).ranges)
- return Ae(o.done);
- if (o.done.length > 1 && !o.done[o.done.length - 2].ranges)
- return o.done.pop(), Ae(o.done);
- }
- function Xh(o, l, c, f) {
- var v = o.history;
- v.undone.length = 0;
- var O = +new Date(), L, j;
- if ((v.lastOp == f || v.lastOrigin == l.origin && l.origin && (l.origin.charAt(0) == "+" && v.lastModTime > O - (o.cm ? o.cm.options.historyEventDelay : 500) || l.origin.charAt(0) == "*")) && (L = f_(v, v.lastOp == f)))
- j = Ae(L.changes), De(l.from, l.to) == 0 && De(l.from, j.to) == 0 ? j.to = yr(l) : L.changes.push(cd(o, l));
- else {
- var Q = Ae(v.done);
- for ((!Q || !Q.ranges) && Vl(o.sel, v.done), L = {
- changes: [cd(o, l)],
- generation: v.generation
- }, v.done.push(L); v.done.length > v.undoDepth; )
- v.done.shift(), v.done[0].ranges || v.done.shift();
+ function lm(o, l, c, f) {
+ return c < 0 && l.ch == 0 ? l.line > o.first ? _t(o, ye(l.line - 1)) : null : c > 0 && l.ch == (f || ut(o, l.line)).text.length ? l.line < o.first + o.size - 1 ? ye(l.line + 1, 0) : null : new ye(l.line, l.ch + c);
}
- v.done.push(c), v.generation = ++v.maxGeneration, v.lastModTime = v.lastSelTime = O, v.lastOp = v.lastSelOp = f, v.lastOrigin = v.lastSelOrigin = l.origin, j || st(o, "historyAdded");
- }
- function c_(o, l, c, f) {
- var v = l.charAt(0);
- return v == "*" || v == "+" && c.ranges.length == f.ranges.length && c.somethingSelected() == f.somethingSelected() && new Date() - o.history.lastSelTime <= (o.cm ? o.cm.options.historyEventDelay : 500);
- }
- function p_(o, l, c, f) {
- var v = o.history, O = f && f.origin;
- c == v.lastSelOp || O && v.lastSelOrigin == O && (v.lastModTime == v.lastSelTime && v.lastOrigin == O || c_(o, O, Ae(v.done), l)) ? v.done[v.done.length - 1] = l : Vl(l, v.done), v.lastSelTime = +new Date(), v.lastSelOrigin = O, v.lastSelOp = c, f && f.clearRedo !== !1 && Jh(v.undone);
- }
- function Vl(o, l) {
- var c = Ae(l);
- c && c.ranges && c.equals(o) || l.push(o);
- }
- function Zh(o, l, c, f) {
- var v = l["spans_" + o.id], O = 0;
- o.iter(Math.max(o.first, c), Math.min(o.first + o.size, f), function(L) {
- L.markedSpans && ((v || (v = l["spans_" + o.id] = {}))[O] = L.markedSpans), ++O;
- });
- }
- function h_(o) {
- if (!o)
- return null;
- for (var l, c = 0; c < o.length; ++c)
- o[c].marker.explicitlyCleared ? l || (l = o.slice(0, c)) : l && l.push(o[c]);
- return l ? l.length ? l : null : o;
- }
- function m_(o, l) {
- var c = l["spans_" + o.id];
- if (!c)
- return null;
- for (var f = [], v = 0; v < l.text.length; ++v)
- f.push(h_(c[v]));
- return f;
- }
- function qh(o, l) {
- var c = m_(o, l), f = Mu(o, l);
- if (!c)
- return f;
- if (!f)
- return c;
- for (var v = 0; v < c.length; ++v) {
- var O = c[v], L = f[v];
- if (O && L) {
- e:
- for (var j = 0; j < L.length; ++j) {
- for (var Q = L[j], ne = 0; ne < O.length; ++ne)
- if (O[ne].marker == Q.marker)
- continue e;
- O.push(Q);
- }
- } else
- L && (c[v] = L);
+ function sm(o) {
+ o.setSelection(ye(o.firstLine(), 0), ye(o.lastLine()), $);
}
- return c;
- }
- function mo(o, l, c) {
- for (var f = [], v = 0; v < o.length; ++v) {
- var O = o[v];
- if (O.ranges) {
- f.push(c ? ei.prototype.deepCopy.call(O) : O);
- continue;
+ function um(o, l, c) {
+ var f = {
+ canceled: !1,
+ from: l.from,
+ to: l.to,
+ text: l.text,
+ origin: l.origin,
+ cancel: function() {
+ return f.canceled = !0;
+ }
+ };
+ return c && (f.update = function(v, O, L, j) {
+ v && (f.from = _t(o, v)), O && (f.to = _t(o, O)), L && (f.text = L), j !== void 0 && (f.origin = j);
+ }), st(o, "beforeChange", o, f), o.cm && st(o.cm, "beforeChange", o.cm, f), f.canceled ? (o.cm && (o.cm.curOp.updateInput = 2), null) : { from: f.from, to: f.to, text: f.text, origin: f.origin };
+ }
+ function vo(o, l, c) {
+ if (o.cm) {
+ if (!o.cm.curOp)
+ return hn(o.cm, vo)(o, l, c);
+ if (o.cm.state.suppressEdits)
+ return;
}
- var L = O.changes, j = [];
- f.push({ changes: j });
- for (var Q = 0; Q < L.length; ++Q) {
- var ne = L[Q], se = void 0;
- if (j.push({ from: ne.from, to: ne.to, text: ne.text }), l)
- for (var de in ne)
- (se = de.match(/^spans_(\d+)$/)) && he(l, Number(se[1])) > -1 && (Ae(j)[de] = ne[de], delete ne[de]);
+ if (!((Qt(o, "beforeChange") || o.cm && Qt(o.cm, "beforeChange")) && (l = um(o, l, !0), !l))) {
+ var f = eh && !c && m1(o, l.from, l.to);
+ if (f)
+ for (var v = f.length - 1; v >= 0; --v)
+ dm(o, { from: f[v].from, to: f[v].to, text: v ? [""] : l.text, origin: l.origin });
+ else
+ dm(o, l);
}
}
- return f;
- }
- function pd(o, l, c, f) {
- if (f) {
- var v = o.anchor;
- if (c) {
- var O = De(l, v) < 0;
- O != De(c, v) < 0 ? (v = l, l = c) : O != De(l, c) < 0 && (l = c);
+ function dm(o, l) {
+ if (!(l.text.length == 1 && l.text[0] == "" && De(l.from, l.to) == 0)) {
+ var c = ud(o, l);
+ Zh(o, l, c, o.cm ? o.cm.curOp.id : NaN), wa(o, l, c, Mu(o, l));
+ var f = [];
+ br(o, function(v, O) {
+ !O && he(f, v.history) == -1 && (hm(v.history, l), f.push(v.history)), wa(v, l, null, Mu(v, l));
+ });
}
- return new Pt(v, l);
- } else
- return new Pt(c || l, l);
- }
- function jl(o, l, c, f, v) {
- v == null && (v = o.cm && (o.cm.display.shift || o.extend)), En(o, new ei([pd(o.sel.primary(), l, c, v)], 0), f);
- }
- function em(o, l, c) {
- for (var f = [], v = o.cm && (o.cm.display.shift || o.extend), O = 0; O < o.sel.ranges.length; O++)
- f[O] = pd(o.sel.ranges[O], l[O], null, v);
- var L = Ai(o.cm, f, o.sel.primIndex);
- En(o, L, c);
- }
- function hd(o, l, c, f) {
- var v = o.sel.ranges.slice(0);
- v[l] = c, En(o, Ai(o.cm, v, o.sel.primIndex), f);
- }
- function tm(o, l, c, f) {
- En(o, gr(l, c), f);
- }
- function v_(o, l, c) {
- var f = {
- ranges: l.ranges,
- update: function(v) {
- this.ranges = [];
- for (var O = 0; O < v.length; O++)
- this.ranges[O] = new Pt(
- _t(o, v[O].anchor),
- _t(o, v[O].head)
- );
- },
- origin: c && c.origin
- };
- return st(o, "beforeSelectionChange", o, f), o.cm && st(o.cm, "beforeSelectionChange", o.cm, f), f.ranges != l.ranges ? Ai(o.cm, f.ranges, f.ranges.length - 1) : l;
- }
- function nm(o, l, c) {
- var f = o.history.done, v = Ae(f);
- v && v.ranges ? (f[f.length - 1] = l, Ul(o, l, c)) : En(o, l, c);
- }
- function En(o, l, c) {
- Ul(o, l, c), p_(o, o.sel, o.cm ? o.cm.curOp.id : NaN, c);
- }
- function Ul(o, l, c) {
- (Qt(o, "beforeSelectionChange") || o.cm && Qt(o.cm, "beforeSelectionChange")) && (l = v_(o, l, c));
- var f = c && c.bias || (De(l.primary().head, o.sel.primary().head) < 0 ? -1 : 1);
- im(o, om(o, l, f, !0)), !(c && c.scroll === !1) && o.cm && o.cm.getOption("readOnly") != "nocursor" && po(o.cm);
- }
- function im(o, l) {
- l.equals(o.sel) || (o.sel = l, o.cm && (o.cm.curOp.updateInput = 1, o.cm.curOp.selectionChanged = !0, Pn(o.cm)), pn(o, "cursorActivity", o));
- }
- function rm(o) {
- im(o, om(o, o.sel, null, !1));
- }
- function om(o, l, c, f) {
- for (var v, O = 0; O < l.ranges.length; O++) {
- var L = l.ranges[O], j = l.ranges.length == o.sel.ranges.length && o.sel.ranges[O], Q = Hl(o, L.anchor, j && j.anchor, c, f), ne = L.head == L.anchor ? Q : Hl(o, L.head, j && j.head, c, f);
- (v || Q != L.anchor || ne != L.head) && (v || (v = l.ranges.slice(0, O)), v[O] = new Pt(Q, ne));
}
- return v ? Ai(o.cm, v, l.primIndex) : l;
- }
- function vo(o, l, c, f, v) {
- var O = ut(o, l.line);
- if (O.markedSpans)
- for (var L = 0; L < O.markedSpans.length; ++L) {
- var j = O.markedSpans[L], Q = j.marker, ne = "selectLeft" in Q ? !Q.selectLeft : Q.inclusiveLeft, se = "selectRight" in Q ? !Q.selectRight : Q.inclusiveRight;
- if ((j.from == null || (ne ? j.from <= l.ch : j.from < l.ch)) && (j.to == null || (se ? j.to >= l.ch : j.to > l.ch))) {
- if (v && (st(Q, "beforeCursorEnter"), Q.explicitlyCleared))
- if (O.markedSpans) {
- --L;
- continue;
+ function zl(o, l, c) {
+ var f = o.cm && o.cm.state.suppressEdits;
+ if (!(f && !c)) {
+ for (var v = o.history, O, L = o.sel, j = l == "undo" ? v.done : v.undone, Q = l == "undo" ? v.undone : v.done, ne = 0; ne < j.length && (O = j[ne], !(c ? O.ranges && !O.equals(o.sel) : !O.ranges)); ne++)
+ ;
+ if (ne != j.length) {
+ for (v.lastOrigin = v.lastSelOrigin = null; ; )
+ if (O = j.pop(), O.ranges) {
+ if (Vl(O, Q), c && !O.equals(o.sel)) {
+ En(o, O, { clearRedo: !1 });
+ return;
+ }
+ L = O;
+ } else if (f) {
+ j.push(O);
+ return;
} else
break;
- if (!Q.atomic)
- continue;
- if (c) {
- var de = Q.find(f < 0 ? 1 : -1), Ee = void 0;
- if ((f < 0 ? se : ne) && (de = am(o, de, -f, de && de.line == l.line ? O : null)), de && de.line == l.line && (Ee = De(de, c)) && (f < 0 ? Ee < 0 : Ee > 0))
- return vo(o, de, l, f, v);
+ var se = [];
+ Vl(L, Q), Q.push({ changes: se, generation: v.generation }), v.generation = O.generation || ++v.maxGeneration;
+ for (var de = Qt(o, "beforeChange") || o.cm && Qt(o.cm, "beforeChange"), Ee = function(Ne) {
+ var Ue = O.changes[Ne];
+ if (Ue.origin = l, de && !um(o, Ue, !1))
+ return j.length = 0, {};
+ se.push(cd(o, Ue));
+ var Ye = Ne ? ud(o, Ue) : Ae(j);
+ wa(o, Ue, Ye, em(o, Ue)), !Ne && o.cm && o.cm.scrollIntoView({ from: Ue.from, to: yr(Ue) });
+ var nt = [];
+ br(o, function(Qe, ot) {
+ !ot && he(nt, Qe.history) == -1 && (hm(Qe.history, Ue), nt.push(Qe.history)), wa(Qe, Ue, null, em(Qe, Ue));
+ });
+ }, Ce = O.changes.length - 1; Ce >= 0; --Ce) {
+ var Ie = Ee(Ce);
+ if (Ie)
+ return Ie.v;
}
- var Ce = Q.find(f < 0 ? -1 : 1);
- return (f < 0 ? ne : se) && (Ce = am(o, Ce, f, Ce.line == l.line ? O : null)), Ce ? vo(o, Ce, l, f, v) : null;
}
}
- return l;
- }
- function Hl(o, l, c, f, v) {
- var O = f || 1, L = vo(o, l, c, O, v) || !v && vo(o, l, c, O, !0) || vo(o, l, c, -O, v) || !v && vo(o, l, c, -O, !0);
- return L || (o.cantEdit = !0, ye(o.first, 0));
- }
- function am(o, l, c, f) {
- return c < 0 && l.ch == 0 ? l.line > o.first ? _t(o, ye(l.line - 1)) : null : c > 0 && l.ch == (f || ut(o, l.line)).text.length ? l.line < o.first + o.size - 1 ? ye(l.line + 1, 0) : null : new ye(l.line, l.ch + c);
- }
- function lm(o) {
- o.setSelection(ye(o.firstLine(), 0), ye(o.lastLine()), $);
- }
- function sm(o, l, c) {
- var f = {
- canceled: !1,
- from: l.from,
- to: l.to,
- text: l.text,
- origin: l.origin,
- cancel: function() {
- return f.canceled = !0;
+ }
+ function fm(o, l) {
+ if (l != 0 && (o.first += l, o.sel = new ei(Fe(o.sel.ranges, function(v) {
+ return new Pt(
+ ye(v.anchor.line + l, v.anchor.ch),
+ ye(v.head.line + l, v.head.ch)
+ );
+ }), o.sel.primIndex), o.cm)) {
+ Ln(o.cm, o.first, o.first - l, l);
+ for (var c = o.cm.display, f = c.viewFrom; f < c.viewTo; f++)
+ mr(o.cm, f, "gutter");
}
- };
- return c && (f.update = function(v, O, L, j) {
- v && (f.from = _t(o, v)), O && (f.to = _t(o, O)), L && (f.text = L), j !== void 0 && (f.origin = j);
- }), st(o, "beforeChange", o, f), o.cm && st(o.cm, "beforeChange", o.cm, f), f.canceled ? (o.cm && (o.cm.curOp.updateInput = 2), null) : { from: f.from, to: f.to, text: f.text, origin: f.origin };
- }
- function go(o, l, c) {
- if (o.cm) {
- if (!o.cm.curOp)
- return hn(o.cm, go)(o, l, c);
- if (o.cm.state.suppressEdits)
+ }
+ function wa(o, l, c, f) {
+ if (o.cm && !o.cm.curOp)
+ return hn(o.cm, wa)(o, l, c, f);
+ if (l.to.line < o.first) {
+ fm(o, l.text.length - 1 - (l.to.line - l.from.line));
return;
- }
- if (!((Qt(o, "beforeChange") || o.cm && Qt(o.cm, "beforeChange")) && (l = sm(o, l, !0), !l))) {
- var f = qp && !c && p1(o, l.from, l.to);
- if (f)
- for (var v = f.length - 1; v >= 0; --v)
- um(o, { from: f[v].from, to: f[v].to, text: v ? [""] : l.text, origin: l.origin });
- else
- um(o, l);
- }
- }
- function um(o, l) {
- if (!(l.text.length == 1 && l.text[0] == "" && De(l.from, l.to) == 0)) {
- var c = ud(o, l);
- Xh(o, l, c, o.cm ? o.cm.curOp.id : NaN), wa(o, l, c, Mu(o, l));
- var f = [];
- br(o, function(v, O) {
- !O && he(f, v.history) == -1 && (pm(v.history, l), f.push(v.history)), wa(v, l, null, Mu(v, l));
- });
- }
- }
- function zl(o, l, c) {
- var f = o.cm && o.cm.state.suppressEdits;
- if (!(f && !c)) {
- for (var v = o.history, O, L = o.sel, j = l == "undo" ? v.done : v.undone, Q = l == "undo" ? v.undone : v.done, ne = 0; ne < j.length && (O = j[ne], !(c ? O.ranges && !O.equals(o.sel) : !O.ranges)); ne++)
- ;
- if (ne != j.length) {
- for (v.lastOrigin = v.lastSelOrigin = null; ; )
- if (O = j.pop(), O.ranges) {
- if (Vl(O, Q), c && !O.equals(o.sel)) {
- En(o, O, { clearRedo: !1 });
- return;
- }
- L = O;
- } else if (f) {
- j.push(O);
- return;
- } else
- break;
- var se = [];
- Vl(L, Q), Q.push({ changes: se, generation: v.generation }), v.generation = O.generation || ++v.maxGeneration;
- for (var de = Qt(o, "beforeChange") || o.cm && Qt(o.cm, "beforeChange"), Ee = function(Ne) {
- var Ue = O.changes[Ne];
- if (Ue.origin = l, de && !sm(o, Ue, !1))
- return j.length = 0, {};
- se.push(cd(o, Ue));
- var Ye = Ne ? ud(o, Ue) : Ae(j);
- wa(o, Ue, Ye, qh(o, Ue)), !Ne && o.cm && o.cm.scrollIntoView({ from: Ue.from, to: yr(Ue) });
- var nt = [];
- br(o, function(Qe, ot) {
- !ot && he(nt, Qe.history) == -1 && (pm(Qe.history, Ue), nt.push(Qe.history)), wa(Qe, Ue, null, qh(Qe, Ue));
- });
- }, Ce = O.changes.length - 1; Ce >= 0; --Ce) {
- var Ie = Ee(Ce);
- if (Ie)
- return Ie.v;
+ }
+ if (!(l.from.line > o.lastLine())) {
+ if (l.from.line < o.first) {
+ var v = l.text.length - 1 - (o.first - l.from.line);
+ fm(o, v), l = {
+ from: ye(o.first, 0),
+ to: ye(l.to.line + v, l.to.ch),
+ text: [Ae(l.text)],
+ origin: l.origin
+ };
}
+ var O = o.lastLine();
+ l.to.line > O && (l = {
+ from: l.from,
+ to: ye(O, ut(o, O).text.length),
+ text: [l.text[0]],
+ origin: l.origin
+ }), l.removed = Yi(o, l.from, l.to), c || (c = ud(o, l)), o.cm ? b_(o.cm, l, f) : fd(o, l, f), Ul(o, c, $), o.cantEdit && Hl(o, ye(o.firstLine(), 0)) && (o.cantEdit = !1);
}
}
- }
- function dm(o, l) {
- if (l != 0 && (o.first += l, o.sel = new ei(Fe(o.sel.ranges, function(v) {
- return new Pt(
- ye(v.anchor.line + l, v.anchor.ch),
- ye(v.head.line + l, v.head.ch)
- );
- }), o.sel.primIndex), o.cm)) {
- Ln(o.cm, o.first, o.first - l, l);
- for (var c = o.cm.display, f = c.viewFrom; f < c.viewTo; f++)
- mr(o.cm, f, "gutter");
- }
- }
- function wa(o, l, c, f) {
- if (o.cm && !o.cm.curOp)
- return hn(o.cm, wa)(o, l, c, f);
- if (l.to.line < o.first) {
- dm(o, l.text.length - 1 - (l.to.line - l.from.line));
- return;
- }
- if (!(l.from.line > o.lastLine())) {
- if (l.from.line < o.first) {
- var v = l.text.length - 1 - (o.first - l.from.line);
- dm(o, v), l = {
- from: ye(o.first, 0),
- to: ye(l.to.line + v, l.to.ch),
- text: [Ae(l.text)],
+ function b_(o, l, c) {
+ var f = o.doc, v = o.display, O = l.from, L = l.to, j = !1, Q = O.line;
+ o.options.lineWrapping || (Q = Ft(_i(ut(f, O.line))), f.iter(Q, L.line + 1, function(Ce) {
+ if (Ce == v.maxLine)
+ return j = !0, !0;
+ })), f.sel.contains(l.from, l.to) > -1 && Pn(o), fd(f, l, c, $h(o)), o.options.lineWrapping || (f.iter(Q, O.line + l.text.length, function(Ce) {
+ var Ie = Tl(Ce);
+ Ie > v.maxLineLength && (v.maxLine = Ce, v.maxLineLength = Ie, v.maxLineChanged = !0, j = !1);
+ }), j && (o.curOp.updateMaxLine = !0)), s1(f, O.line), ya(o, 400);
+ var ne = l.text.length - (L.line - O.line) - 1;
+ l.full ? Ln(o) : O.line == L.line && l.text.length == 1 && !Yh(o.doc, l) ? mr(o, O.line, "text") : Ln(o, O.line, L.line + 1, ne);
+ var se = Qt(o, "changes"), de = Qt(o, "change");
+ if (de || se) {
+ var Ee = {
+ from: O,
+ to: L,
+ text: l.text,
+ removed: l.removed,
origin: l.origin
};
+ de && pn(o, "change", o, Ee), se && (o.curOp.changeObjs || (o.curOp.changeObjs = [])).push(Ee);
}
- var O = o.lastLine();
- l.to.line > O && (l = {
- from: l.from,
- to: ye(O, ut(o, O).text.length),
- text: [l.text[0]],
- origin: l.origin
- }), l.removed = Yi(o, l.from, l.to), c || (c = ud(o, l)), o.cm ? g_(o.cm, l, f) : fd(o, l, f), Ul(o, c, $), o.cantEdit && Hl(o, ye(o.firstLine(), 0)) && (o.cantEdit = !1);
+ o.display.selForContextMenu = null;
}
- }
- function g_(o, l, c) {
- var f = o.doc, v = o.display, O = l.from, L = l.to, j = !1, Q = O.line;
- o.options.lineWrapping || (Q = Ft(_i(ut(f, O.line))), f.iter(Q, L.line + 1, function(Ce) {
- if (Ce == v.maxLine)
- return j = !0, !0;
- })), f.sel.contains(l.from, l.to) > -1 && Pn(o), fd(f, l, c, Oh(o)), o.options.lineWrapping || (f.iter(Q, O.line + l.text.length, function(Ce) {
- var Ie = Tl(Ce);
- Ie > v.maxLineLength && (v.maxLine = Ce, v.maxLineLength = Ie, v.maxLineChanged = !0, j = !1);
- }), j && (o.curOp.updateMaxLine = !0)), a1(f, O.line), ya(o, 400);
- var ne = l.text.length - (L.line - O.line) - 1;
- l.full ? Ln(o) : O.line == L.line && l.text.length == 1 && !Kh(o.doc, l) ? mr(o, O.line, "text") : Ln(o, O.line, L.line + 1, ne);
- var se = Qt(o, "changes"), de = Qt(o, "change");
- if (de || se) {
- var Ee = {
- from: O,
- to: L,
- text: l.text,
- removed: l.removed,
- origin: l.origin
- };
- de && pn(o, "change", o, Ee), se && (o.curOp.changeObjs || (o.curOp.changeObjs = [])).push(Ee);
+ function go(o, l, c, f, v) {
+ var O;
+ f || (f = c), De(f, c) < 0 && (O = [f, c], c = O[0], f = O[1]), typeof l == "string" && (l = o.splitLines(l)), vo(o, { from: c, to: f, text: l, origin: v });
}
- o.display.selForContextMenu = null;
- }
- function yo(o, l, c, f, v) {
- var O;
- f || (f = c), De(f, c) < 0 && (O = [f, c], c = O[0], f = O[1]), typeof l == "string" && (l = o.splitLines(l)), go(o, { from: c, to: f, text: l, origin: v });
- }
- function fm(o, l, c, f) {
- c < o.line ? o.line += f : l < o.line && (o.line = l, o.ch = 0);
- }
- function cm(o, l, c, f) {
- for (var v = 0; v < o.length; ++v) {
- var O = o[v], L = !0;
- if (O.ranges) {
- O.copied || (O = o[v] = O.deepCopy(), O.copied = !0);
- for (var j = 0; j < O.ranges.length; j++)
- fm(O.ranges[j].anchor, l, c, f), fm(O.ranges[j].head, l, c, f);
- continue;
- }
- for (var Q = 0; Q < O.changes.length; ++Q) {
- var ne = O.changes[Q];
- if (c < ne.from.line)
- ne.from = ye(ne.from.line + f, ne.from.ch), ne.to = ye(ne.to.line + f, ne.to.ch);
- else if (l <= ne.to.line) {
- L = !1;
- break;
+ function cm(o, l, c, f) {
+ c < o.line ? o.line += f : l < o.line && (o.line = l, o.ch = 0);
+ }
+ function pm(o, l, c, f) {
+ for (var v = 0; v < o.length; ++v) {
+ var O = o[v], L = !0;
+ if (O.ranges) {
+ O.copied || (O = o[v] = O.deepCopy(), O.copied = !0);
+ for (var j = 0; j < O.ranges.length; j++)
+ cm(O.ranges[j].anchor, l, c, f), cm(O.ranges[j].head, l, c, f);
+ continue;
}
- }
- L || (o.splice(0, v + 1), v = 0);
- }
- }
- function pm(o, l) {
- var c = l.from.line, f = l.to.line, v = l.text.length - (f - c) - 1;
- cm(o.done, c, f, v), cm(o.undone, c, f, v);
- }
- function Aa(o, l, c, f) {
- var v = l, O = l;
- return typeof l == "number" ? O = ut(o, qn(o, l)) : v = Ft(l), v == null ? null : (f(O, v) && o.cm && mr(o.cm, v, c), O);
- }
- function Ca(o) {
- this.lines = o, this.parent = null;
- for (var l = 0, c = 0; c < o.length; ++c)
- o[c].parent = this, l += o[c].height;
- this.height = l;
- }
- Ca.prototype = {
- chunkSize: function() {
- return this.lines.length;
- },
- removeInner: function(o, l) {
- for (var c = o, f = o + l; c < f; ++c) {
- var v = this.lines[c];
- this.height -= v.height, y1(v), pn(v, "delete");
- }
- this.lines.splice(o, l);
- },
- collapse: function(o) {
- o.push.apply(o, this.lines);
- },
- insertInner: function(o, l, c) {
- this.height += c, this.lines = this.lines.slice(0, o).concat(l).concat(this.lines.slice(o));
- for (var f = 0; f < l.length; ++f)
- l[f].parent = this;
- },
- iterN: function(o, l, c) {
- for (var f = o + l; o < f; ++o)
- if (c(this.lines[o]))
- return !0;
- }
- };
- function Sa(o) {
- this.children = o;
- for (var l = 0, c = 0, f = 0; f < o.length; ++f) {
- var v = o[f];
- l += v.chunkSize(), c += v.height, v.parent = this;
- }
- this.size = l, this.height = c, this.parent = null;
- }
- Sa.prototype = {
- chunkSize: function() {
- return this.size;
- },
- removeInner: function(o, l) {
- this.size -= l;
- for (var c = 0; c < this.children.length; ++c) {
- var f = this.children[c], v = f.chunkSize();
- if (o < v) {
- var O = Math.min(l, v - o), L = f.height;
- if (f.removeInner(o, O), this.height -= L - f.height, v == O && (this.children.splice(c--, 1), f.parent = null), (l -= O) == 0)
+ for (var Q = 0; Q < O.changes.length; ++Q) {
+ var ne = O.changes[Q];
+ if (c < ne.from.line)
+ ne.from = ye(ne.from.line + f, ne.from.ch), ne.to = ye(ne.to.line + f, ne.to.ch);
+ else if (l <= ne.to.line) {
+ L = !1;
break;
- o = 0;
- } else
- o -= v;
- }
- if (this.size - l < 25 && (this.children.length > 1 || !(this.children[0] instanceof Ca))) {
- var j = [];
- this.collapse(j), this.children = [new Ca(j)], this.children[0].parent = this;
- }
- },
- collapse: function(o) {
- for (var l = 0; l < this.children.length; ++l)
- this.children[l].collapse(o);
- },
- insertInner: function(o, l, c) {
- this.size += l.length, this.height += c;
- for (var f = 0; f < this.children.length; ++f) {
- var v = this.children[f], O = v.chunkSize();
- if (o <= O) {
- if (v.insertInner(o, l, c), v.lines && v.lines.length > 50) {
- for (var L = v.lines.length % 25 + 25, j = L; j < v.lines.length; ) {
- var Q = new Ca(v.lines.slice(j, j += 25));
- v.height -= Q.height, this.children.splice(++f, 0, Q), Q.parent = this;
- }
- v.lines = v.lines.slice(0, L), this.maybeSpill();
}
- break;
}
- o -= O;
+ L || (o.splice(0, v + 1), v = 0);
}
- },
- maybeSpill: function() {
- if (!(this.children.length <= 10)) {
- var o = this;
- do {
- var l = o.children.splice(o.children.length - 5, 5), c = new Sa(l);
- if (o.parent) {
- o.size -= c.size, o.height -= c.height;
- var v = he(o.parent.children, o);
- o.parent.children.splice(v + 1, 0, c);
- } else {
- var f = new Sa(o.children);
- f.parent = o, o.children = [f, c], o = f;
- }
- c.parent = o.parent;
- } while (o.children.length > 10);
- o.parent.maybeSpill();
- }
- },
- iterN: function(o, l, c) {
- for (var f = 0; f < this.children.length; ++f) {
- var v = this.children[f], O = v.chunkSize();
- if (o < O) {
- var L = Math.min(l, O - o);
- if (v.iterN(o, L, c))
+ }
+ function hm(o, l) {
+ var c = l.from.line, f = l.to.line, v = l.text.length - (f - c) - 1;
+ pm(o.done, c, f, v), pm(o.undone, c, f, v);
+ }
+ function Aa(o, l, c, f) {
+ var v = l, O = l;
+ return typeof l == "number" ? O = ut(o, qn(o, l)) : v = Ft(l), v == null ? null : (f(O, v) && o.cm && mr(o.cm, v, c), O);
+ }
+ function Ca(o) {
+ this.lines = o, this.parent = null;
+ for (var l = 0, c = 0; c < o.length; ++c)
+ o[c].parent = this, l += o[c].height;
+ this.height = l;
+ }
+ Ca.prototype = {
+ chunkSize: function() {
+ return this.lines.length;
+ },
+ removeInner: function(o, l) {
+ for (var c = o, f = o + l; c < f; ++c) {
+ var v = this.lines[c];
+ this.height -= v.height, _1(v), pn(v, "delete");
+ }
+ this.lines.splice(o, l);
+ },
+ collapse: function(o) {
+ o.push.apply(o, this.lines);
+ },
+ insertInner: function(o, l, c) {
+ this.height += c, this.lines = this.lines.slice(0, o).concat(l).concat(this.lines.slice(o));
+ for (var f = 0; f < l.length; ++f)
+ l[f].parent = this;
+ },
+ iterN: function(o, l, c) {
+ for (var f = o + l; o < f; ++o)
+ if (c(this.lines[o]))
return !0;
- if ((l -= L) == 0)
- break;
- o = 0;
- } else
- o -= O;
}
+ };
+ function Sa(o) {
+ this.children = o;
+ for (var l = 0, c = 0, f = 0; f < o.length; ++f) {
+ var v = o[f];
+ l += v.chunkSize(), c += v.height, v.parent = this;
+ }
+ this.size = l, this.height = c, this.parent = null;
}
- };
- var Ea = function(o, l, c) {
- if (c)
- for (var f in c)
- c.hasOwnProperty(f) && (this[f] = c[f]);
- this.doc = o, this.node = l;
- };
- Ea.prototype.clear = function() {
- var o = this.doc.cm, l = this.line.widgets, c = this.line, f = Ft(c);
- if (!(f == null || !l)) {
- for (var v = 0; v < l.length; ++v)
- l[v] == this && l.splice(v--, 1);
- l.length || (c.widgets = null);
- var O = fa(this);
- fi(c, Math.max(0, c.height - O)), o && (Wn(o, function() {
- hm(o, c, -O), mr(o, f, "widget");
- }), pn(o, "lineWidgetCleared", o, this, f));
- }
- }, Ea.prototype.changed = function() {
- var o = this, l = this.height, c = this.doc.cm, f = this.line;
- this.height = null;
- var v = fa(this) - l;
- !v || (hr(this.doc, f) || fi(f, f.height + v), c && Wn(c, function() {
- c.curOp.forceUpdate = !0, hm(c, f, v), pn(c, "lineWidgetChanged", c, o, Ft(f));
- }));
- }, zt(Ea);
- function hm(o, l, c) {
- Ji(l) < (o.curOp && o.curOp.scrollTop || o.doc.scrollTop) && id(o, c);
- }
- function y_(o, l, c, f) {
- var v = new Ea(o, c, f), O = o.cm;
- return O && v.noHScroll && (O.display.alignWidgets = !0), Aa(o, l, "widget", function(L) {
- var j = L.widgets || (L.widgets = []);
- if (v.insertAt == null ? j.push(v) : j.splice(Math.min(j.length, Math.max(0, v.insertAt)), 0, v), v.line = L, O && !hr(o, L)) {
- var Q = Ji(L) < o.scrollTop;
- fi(L, L.height + fa(v)), Q && id(O, v.height), O.curOp.forceUpdate = !0;
- }
- return !0;
- }), O && pn(O, "lineWidgetAdded", O, v, typeof l == "number" ? l : Ft(l)), v;
- }
- var mm = 0, _r = function(o, l) {
- this.lines = [], this.type = l, this.doc = o, this.id = ++mm;
- };
- _r.prototype.clear = function() {
- if (!this.explicitlyCleared) {
- var o = this.doc.cm, l = o && !o.curOp;
- if (l && Nr(o), Qt(this, "clear")) {
- var c = this.find();
- c && pn(this, "clear", c.from, c.to);
- }
- for (var f = null, v = null, O = 0; O < this.lines.length; ++O) {
- var L = this.lines[O], j = sa(L.markedSpans, this);
- o && !this.collapsed ? mr(o, Ft(L), "text") : o && (j.to != null && (v = Ft(L)), j.from != null && (f = Ft(L))), L.markedSpans = u1(L.markedSpans, j), j.from == null && this.collapsed && !hr(this.doc, L) && o && fi(L, uo(o.display));
- }
- if (o && this.collapsed && !o.options.lineWrapping)
- for (var Q = 0; Q < this.lines.length; ++Q) {
- var ne = _i(this.lines[Q]), se = Tl(ne);
- se > o.display.maxLineLength && (o.display.maxLine = ne, o.display.maxLineLength = se, o.display.maxLineChanged = !0);
+ Sa.prototype = {
+ chunkSize: function() {
+ return this.size;
+ },
+ removeInner: function(o, l) {
+ this.size -= l;
+ for (var c = 0; c < this.children.length; ++c) {
+ var f = this.children[c], v = f.chunkSize();
+ if (o < v) {
+ var O = Math.min(l, v - o), L = f.height;
+ if (f.removeInner(o, O), this.height -= L - f.height, v == O && (this.children.splice(c--, 1), f.parent = null), (l -= O) == 0)
+ break;
+ o = 0;
+ } else
+ o -= v;
}
- f != null && o && this.collapsed && Ln(o, f, v + 1), this.lines.length = 0, this.explicitlyCleared = !0, this.atomic && this.doc.cantEdit && (this.doc.cantEdit = !1, o && rm(o.doc)), o && pn(o, "markerCleared", o, this, f, v), l && Br(o), this.parent && this.parent.clear();
- }
- }, _r.prototype.find = function(o, l) {
- o == null && this.type == "bookmark" && (o = 1);
- for (var c, f, v = 0; v < this.lines.length; ++v) {
- var O = this.lines[v], L = sa(O.markedSpans, this);
- if (L.from != null && (c = ye(l ? O : Ft(O), L.from), o == -1))
- return c;
- if (L.to != null && (f = ye(l ? O : Ft(O), L.to), o == 1))
- return f;
- }
- return c && { from: c, to: f };
- }, _r.prototype.changed = function() {
- var o = this, l = this.find(-1, !0), c = this, f = this.doc.cm;
- !l || !f || Wn(f, function() {
- var v = l.line, O = Ft(l.line), L = zu(f, O);
- if (L && (wh(L), f.curOp.selectionChanged = f.curOp.forceUpdate = !0), f.curOp.updateMaxLine = !0, !hr(c.doc, v) && c.height != null) {
- var j = c.height;
- c.height = null;
- var Q = fa(c) - j;
- Q && fi(v, v.height + Q);
- }
- pn(f, "markerChanged", f, o);
- });
- }, _r.prototype.attachLine = function(o) {
- if (!this.lines.length && this.doc.cm) {
- var l = this.doc.cm.curOp;
- (!l.maybeHiddenMarkers || he(l.maybeHiddenMarkers, this) == -1) && (l.maybeUnhiddenMarkers || (l.maybeUnhiddenMarkers = [])).push(this);
- }
- this.lines.push(o);
- }, _r.prototype.detachLine = function(o) {
- if (this.lines.splice(he(this.lines, o), 1), !this.lines.length && this.doc.cm) {
- var l = this.doc.cm.curOp;
- (l.maybeHiddenMarkers || (l.maybeHiddenMarkers = [])).push(this);
- }
- }, zt(_r);
- function bo(o, l, c, f, v) {
- if (f && f.shared)
- return b_(o, l, c, f, v);
- if (o.cm && !o.cm.curOp)
- return hn(o.cm, bo)(o, l, c, f, v);
- var O = new _r(o, v), L = De(l, c);
- if (f && ge(f, O, !1), L > 0 || L == 0 && O.clearWhenEmpty !== !1)
- return O;
- if (O.replacedWith && (O.collapsed = !0, O.widgetNode = U("span", [O.replacedWith], "CodeMirror-widget"), f.handleMouseEvents || O.widgetNode.setAttribute("cm-ignore-events", "true"), f.insertLeft && (O.widgetNode.insertLeft = !0)), O.collapsed) {
- if (oh(o, l.line, l, c, O) || l.line != c.line && oh(o, c.line, l, c, O))
- throw new Error("Inserting collapsed marker partially overlapping an existing one");
- s1();
- }
- O.addToHistory && Xh(o, { from: l, to: c, origin: "markText" }, o.sel, NaN);
- var j = l.line, Q = o.cm, ne;
- if (o.iter(j, c.line + 1, function(de) {
- Q && O.collapsed && !Q.options.lineWrapping && _i(de) == Q.display.maxLine && (ne = !0), O.collapsed && j != l.line && fi(de, 0), d1(de, new Cl(
- O,
- j == l.line ? l.ch : null,
- j == c.line ? c.ch : null
- ), o.cm && o.cm.curOp), ++j;
- }), O.collapsed && o.iter(l.line, c.line + 1, function(de) {
- hr(o, de) && fi(de, 0);
- }), O.clearOnEnter && $e(O, "beforeCursorEnter", function() {
- return O.clear();
- }), O.readOnly && (l1(), (o.history.done.length || o.history.undone.length) && o.clearHistory()), O.collapsed && (O.id = ++mm, O.atomic = !0), Q) {
- if (ne && (Q.curOp.updateMaxLine = !0), O.collapsed)
- Ln(Q, l.line, c.line + 1);
- else if (O.className || O.startStyle || O.endStyle || O.css || O.attributes || O.title)
- for (var se = l.line; se <= c.line; se++)
- mr(Q, se, "text");
- O.atomic && rm(Q.doc), pn(Q, "markerAdded", Q, O);
- }
- return O;
- }
- var xa = function(o, l) {
- this.markers = o, this.primary = l;
- for (var c = 0; c < o.length; ++c)
- o[c].parent = this;
- };
- xa.prototype.clear = function() {
- if (!this.explicitlyCleared) {
- this.explicitlyCleared = !0;
- for (var o = 0; o < this.markers.length; ++o)
- this.markers[o].clear();
- pn(this, "clear");
- }
- }, xa.prototype.find = function(o, l) {
- return this.primary.find(o, l);
- }, zt(xa);
- function b_(o, l, c, f, v) {
- f = ge(f), f.shared = !1;
- var O = [bo(o, l, c, f, v)], L = O[0], j = f.widgetNode;
- return br(o, function(Q) {
- j && (f.widgetNode = j.cloneNode(!0)), O.push(bo(Q, _t(Q, l), _t(Q, c), f, v));
- for (var ne = 0; ne < Q.linked.length; ++ne)
- if (Q.linked[ne].isParent)
- return;
- L = Ae(O);
- }), new xa(O, L);
- }
- function vm(o) {
- return o.findMarks(ye(o.first, 0), o.clipPos(ye(o.lastLine())), function(l) {
- return l.parent;
- });
- }
- function __(o, l) {
- for (var c = 0; c < l.length; c++) {
- var f = l[c], v = f.find(), O = o.clipPos(v.from), L = o.clipPos(v.to);
- if (De(O, L)) {
- var j = bo(o, O, L, f.primary, f.primary.type);
- f.markers.push(j), j.parent = f;
- }
- }
- }
- function w_(o) {
- for (var l = function(f) {
- var v = o[f], O = [v.primary.doc];
- br(v.primary.doc, function(Q) {
- return O.push(Q);
- });
- for (var L = 0; L < v.markers.length; L++) {
- var j = v.markers[L];
- he(O, j.doc) == -1 && (j.parent = null, v.markers.splice(L--, 1));
- }
- }, c = 0; c < o.length; c++)
- l(c);
- }
- var A_ = 0, Nn = function(o, l, c, f, v) {
- if (!(this instanceof Nn))
- return new Nn(o, l, c, f, v);
- c == null && (c = 0), Sa.call(this, [new Ca([new ao("", null)])]), this.first = c, this.scrollTop = this.scrollLeft = 0, this.cantEdit = !1, this.cleanGeneration = 1, this.modeFrontier = this.highlightFrontier = c;
- var O = ye(c, 0);
- this.sel = gr(O), this.history = new Bl(null), this.id = ++A_, this.modeOption = l, this.lineSep = f, this.direction = v == "rtl" ? "rtl" : "ltr", this.extend = !1, typeof o == "string" && (o = this.splitLines(o)), fd(this, { from: O, to: O, text: o }), En(this, gr(O), $);
- };
- Nn.prototype = _e(Sa.prototype, {
- constructor: Nn,
- iter: function(o, l, c) {
- c ? this.iterN(o - this.first, l - o, c) : this.iterN(this.first, this.first + this.size, o);
- },
- insert: function(o, l) {
- for (var c = 0, f = 0; f < l.length; ++f)
- c += l[f].height;
- this.insertInner(o - this.first, l, c);
- },
- remove: function(o, l) {
- this.removeInner(o - this.first, l);
- },
- getValue: function(o) {
- var l = oo(this, this.first, this.first + this.size);
- return o === !1 ? l : l.join(o || this.lineSeparator());
- },
- setValue: mn(function(o) {
- var l = ye(this.first, 0), c = this.first + this.size - 1;
- go(this, {
- from: l,
- to: ye(c, ut(this, c).text.length),
- text: this.splitLines(o),
- origin: "setValue",
- full: !0
- }, !0), this.cm && ha(this.cm, 0, 0), En(this, gr(l), $);
- }),
- replaceRange: function(o, l, c, f) {
- l = _t(this, l), c = c ? _t(this, c) : l, yo(this, o, l, c, f);
- },
- getRange: function(o, l, c) {
- var f = Yi(this, _t(this, o), _t(this, l));
- return c === !1 ? f : c === "" ? f.join("") : f.join(c || this.lineSeparator());
- },
- getLine: function(o) {
- var l = this.getLineHandle(o);
- return l && l.text;
- },
- getLineHandle: function(o) {
- if (oe(this, o))
- return ut(this, o);
- },
- getLineNumber: function(o) {
- return Ft(o);
- },
- getLineHandleVisualStart: function(o) {
- return typeof o == "number" && (o = ut(this, o)), _i(o);
- },
- lineCount: function() {
- return this.size;
- },
- firstLine: function() {
- return this.first;
- },
- lastLine: function() {
- return this.first + this.size - 1;
- },
- clipPos: function(o) {
- return _t(this, o);
- },
- getCursor: function(o) {
- var l = this.sel.primary(), c;
- return o == null || o == "head" ? c = l.head : o == "anchor" ? c = l.anchor : o == "end" || o == "to" || o === !1 ? c = l.to() : c = l.from(), c;
- },
- listSelections: function() {
- return this.sel.ranges;
- },
- somethingSelected: function() {
- return this.sel.somethingSelected();
- },
- setCursor: mn(function(o, l, c) {
- tm(this, _t(this, typeof o == "number" ? ye(o, l || 0) : o), null, c);
- }),
- setSelection: mn(function(o, l, c) {
- tm(this, _t(this, o), _t(this, l || o), c);
- }),
- extendSelection: mn(function(o, l, c) {
- jl(this, _t(this, o), l && _t(this, l), c);
- }),
- extendSelections: mn(function(o, l) {
- em(this, Wp(this, o), l);
- }),
- extendSelectionsBy: mn(function(o, l) {
- var c = Fe(this.sel.ranges, o);
- em(this, Wp(this, c), l);
- }),
- setSelections: mn(function(o, l, c) {
- if (!!o.length) {
- for (var f = [], v = 0; v < o.length; v++)
- f[v] = new Pt(
- _t(this, o[v].anchor),
- _t(this, o[v].head || o[v].anchor)
- );
- l == null && (l = Math.min(o.length - 1, this.sel.primIndex)), En(this, Ai(this.cm, f, l), c);
- }
- }),
- addSelection: mn(function(o, l, c) {
- var f = this.sel.ranges.slice(0);
- f.push(new Pt(_t(this, o), _t(this, l || o))), En(this, Ai(this.cm, f, f.length - 1), c);
- }),
- getSelection: function(o) {
- for (var l = this.sel.ranges, c, f = 0; f < l.length; f++) {
- var v = Yi(this, l[f].from(), l[f].to());
- c = c ? c.concat(v) : v;
- }
- return o === !1 ? c : c.join(o || this.lineSeparator());
- },
- getSelections: function(o) {
- for (var l = [], c = this.sel.ranges, f = 0; f < c.length; f++) {
- var v = Yi(this, c[f].from(), c[f].to());
- o !== !1 && (v = v.join(o || this.lineSeparator())), l[f] = v;
- }
- return l;
- },
- replaceSelection: function(o, l, c) {
- for (var f = [], v = 0; v < this.sel.ranges.length; v++)
- f[v] = o;
- this.replaceSelections(f, l, c || "+input");
- },
- replaceSelections: mn(function(o, l, c) {
- for (var f = [], v = this.sel, O = 0; O < v.ranges.length; O++) {
- var L = v.ranges[O];
- f[O] = { from: L.from(), to: L.to(), text: this.splitLines(o[O]), origin: c };
- }
- for (var j = l && l != "end" && u_(this, f, l), Q = f.length - 1; Q >= 0; Q--)
- go(this, f[Q]);
- j ? nm(this, j) : this.cm && po(this.cm);
- }),
- undo: mn(function() {
- zl(this, "undo");
- }),
- redo: mn(function() {
- zl(this, "redo");
- }),
- undoSelection: mn(function() {
- zl(this, "undo", !0);
- }),
- redoSelection: mn(function() {
- zl(this, "redo", !0);
- }),
- setExtending: function(o) {
- this.extend = o;
- },
- getExtending: function() {
- return this.extend;
- },
- historySize: function() {
- for (var o = this.history, l = 0, c = 0, f = 0; f < o.done.length; f++)
- o.done[f].ranges || ++l;
- for (var v = 0; v < o.undone.length; v++)
- o.undone[v].ranges || ++c;
- return { undo: l, redo: c };
- },
- clearHistory: function() {
- var o = this;
- this.history = new Bl(this.history), br(this, function(l) {
- return l.history = o.history;
- }, !0);
- },
- markClean: function() {
- this.cleanGeneration = this.changeGeneration(!0);
- },
- changeGeneration: function(o) {
- return o && (this.history.lastOp = this.history.lastSelOp = this.history.lastOrigin = null), this.history.generation;
- },
- isClean: function(o) {
- return this.history.generation == (o || this.cleanGeneration);
- },
- getHistory: function() {
- return {
- done: mo(this.history.done),
- undone: mo(this.history.undone)
- };
- },
- setHistory: function(o) {
- var l = this.history = new Bl(this.history);
- l.done = mo(o.done.slice(0), null, !0), l.undone = mo(o.undone.slice(0), null, !0);
- },
- setGutterMarker: mn(function(o, l, c) {
- return Aa(this, o, "gutter", function(f) {
- var v = f.gutterMarkers || (f.gutterMarkers = {});
- return v[l] = c, !c && pt(v) && (f.gutterMarkers = null), !0;
- });
- }),
- clearGutter: mn(function(o) {
- var l = this;
- this.iter(function(c) {
- c.gutterMarkers && c.gutterMarkers[o] && Aa(l, c, "gutter", function() {
- return c.gutterMarkers[o] = null, pt(c.gutterMarkers) && (c.gutterMarkers = null), !0;
- });
- });
- }),
- lineInfo: function(o) {
- var l;
- if (typeof o == "number") {
- if (!oe(this, o) || (l = o, o = ut(this, o), !o))
- return null;
- } else if (l = Ft(o), l == null)
- return null;
- return {
- line: l,
- handle: o,
- text: o.text,
- gutterMarkers: o.gutterMarkers,
- textClass: o.textClass,
- bgClass: o.bgClass,
- wrapClass: o.wrapClass,
- widgets: o.widgets
- };
- },
- addLineClass: mn(function(o, l, c) {
- return Aa(this, o, l == "gutter" ? "gutter" : "class", function(f) {
- var v = l == "text" ? "textClass" : l == "background" ? "bgClass" : l == "gutter" ? "gutterClass" : "wrapClass";
- if (!f[v])
- f[v] = c;
- else {
- if (D(c).test(f[v]))
- return !1;
- f[v] += " " + c;
+ if (this.size - l < 25 && (this.children.length > 1 || !(this.children[0] instanceof Ca))) {
+ var j = [];
+ this.collapse(j), this.children = [new Ca(j)], this.children[0].parent = this;
}
- return !0;
- });
- }),
- removeLineClass: mn(function(o, l, c) {
- return Aa(this, o, l == "gutter" ? "gutter" : "class", function(f) {
- var v = l == "text" ? "textClass" : l == "background" ? "bgClass" : l == "gutter" ? "gutterClass" : "wrapClass", O = f[v];
- if (O)
- if (c == null)
- f[v] = null;
- else {
- var L = O.match(D(c));
- if (!L)
- return !1;
- var j = L.index + L[0].length;
- f[v] = O.slice(0, L.index) + (!L.index || j == O.length ? "" : " ") + O.slice(j) || null;
- }
- else
- return !1;
- return !0;
- });
- }),
- addLineWidget: mn(function(o, l, c) {
- return y_(this, o, l, c);
- }),
- removeLineWidget: function(o) {
- o.clear();
- },
- markText: function(o, l, c) {
- return bo(this, _t(this, o), _t(this, l), c, c && c.type || "range");
- },
- setBookmark: function(o, l) {
- var c = {
- replacedWith: l && (l.nodeType == null ? l.widget : l),
- insertLeft: l && l.insertLeft,
- clearWhenEmpty: !1,
- shared: l && l.shared,
- handleMouseEvents: l && l.handleMouseEvents
- };
- return o = _t(this, o), bo(this, o, o, c, "bookmark");
- },
- findMarksAt: function(o) {
- o = _t(this, o);
- var l = [], c = ut(this, o.line).markedSpans;
- if (c)
- for (var f = 0; f < c.length; ++f) {
- var v = c[f];
- (v.from == null || v.from <= o.ch) && (v.to == null || v.to >= o.ch) && l.push(v.marker.parent || v.marker);
- }
- return l;
- },
- findMarks: function(o, l, c) {
- o = _t(this, o), l = _t(this, l);
- var f = [], v = o.line;
- return this.iter(o.line, l.line + 1, function(O) {
- var L = O.markedSpans;
- if (L)
- for (var j = 0; j < L.length; j++) {
- var Q = L[j];
- !(Q.to != null && v == o.line && o.ch >= Q.to || Q.from == null && v != o.line || Q.from != null && v == l.line && Q.from >= l.ch) && (!c || c(Q.marker)) && f.push(Q.marker.parent || Q.marker);
- }
- ++v;
- }), f;
- },
- getAllMarks: function() {
- var o = [];
- return this.iter(function(l) {
- var c = l.markedSpans;
- if (c)
- for (var f = 0; f < c.length; ++f)
- c[f].from != null && o.push(c[f].marker);
- }), o;
- },
- posFromIndex: function(o) {
- var l, c = this.first, f = this.lineSeparator().length;
- return this.iter(function(v) {
- var O = v.text.length + f;
- if (O > o)
- return l = o, !0;
- o -= O, ++c;
- }), _t(this, ye(c, l));
- },
- indexFromPos: function(o) {
- o = _t(this, o);
- var l = o.ch;
- if (o.line < this.first || o.ch < 0)
- return 0;
- var c = this.lineSeparator().length;
- return this.iter(this.first, o.line, function(f) {
- l += f.text.length + c;
- }), l;
- },
- copy: function(o) {
- var l = new Nn(
- oo(this, this.first, this.first + this.size),
- this.modeOption,
- this.first,
- this.lineSep,
- this.direction
- );
- return l.scrollTop = this.scrollTop, l.scrollLeft = this.scrollLeft, l.sel = this.sel, l.extend = !1, o && (l.history.undoDepth = this.history.undoDepth, l.setHistory(this.getHistory())), l;
- },
- linkedDoc: function(o) {
- o || (o = {});
- var l = this.first, c = this.first + this.size;
- o.from != null && o.from > l && (l = o.from), o.to != null && o.to < c && (c = o.to);
- var f = new Nn(oo(this, l, c), o.mode || this.modeOption, l, this.lineSep, this.direction);
- return o.sharedHist && (f.history = this.history), (this.linked || (this.linked = [])).push({ doc: f, sharedHist: o.sharedHist }), f.linked = [{ doc: this, isParent: !0, sharedHist: o.sharedHist }], __(f, vm(this)), f;
- },
- unlinkDoc: function(o) {
- if (o instanceof Kt && (o = o.doc), this.linked)
- for (var l = 0; l < this.linked.length; ++l) {
- var c = this.linked[l];
- if (c.doc == o) {
- this.linked.splice(l, 1), o.unlinkDoc(this), w_(vm(this));
- break;
- }
- }
- if (o.history == this.history) {
- var f = [o.id];
- br(o, function(v) {
- return f.push(v.id);
- }, !0), o.history = new Bl(null), o.history.done = mo(this.history.done, f), o.history.undone = mo(this.history.undone, f);
- }
- },
- iterLinkedDocs: function(o) {
- br(this, o);
- },
- getMode: function() {
- return this.mode;
- },
- getEditor: function() {
- return this.cm;
- },
- splitLines: function(o) {
- return this.lineSep ? o.split(this.lineSep) : oa(o);
- },
- lineSeparator: function() {
- return this.lineSep || `
-`;
- },
- setDirection: mn(function(o) {
- o != "rtl" && (o = "ltr"), o != this.direction && (this.direction = o, this.iter(function(l) {
- return l.order = null;
- }), this.cm && d_(this.cm));
- })
- }), Nn.prototype.eachLine = Nn.prototype.iter;
- var gm = 0;
- function C_(o) {
- var l = this;
- if (ym(l), !(Ct(l, o) || Xi(l.display, o))) {
- It(o), d && (gm = +new Date());
- var c = Fr(l, o, !0), f = o.dataTransfer.files;
- if (!(!c || l.isReadOnly()))
- if (f && f.length && window.FileReader && window.File)
- for (var v = f.length, O = Array(v), L = 0, j = function() {
- ++L == v && hn(l, function() {
- c = _t(l.doc, c);
- var Ce = {
- from: c,
- to: c,
- text: l.doc.splitLines(
- O.filter(function(Ie) {
- return Ie != null;
- }).join(l.doc.lineSeparator())
- ),
- origin: "paste"
- };
- go(l.doc, Ce), nm(l.doc, gr(_t(l.doc, c), _t(l.doc, yr(Ce))));
- })();
- }, Q = function(Ce, Ie) {
- if (l.options.allowDropFileTypes && he(l.options.allowDropFileTypes, Ce.type) == -1) {
- j();
- return;
+ },
+ collapse: function(o) {
+ for (var l = 0; l < this.children.length; ++l)
+ this.children[l].collapse(o);
+ },
+ insertInner: function(o, l, c) {
+ this.size += l.length, this.height += c;
+ for (var f = 0; f < this.children.length; ++f) {
+ var v = this.children[f], O = v.chunkSize();
+ if (o <= O) {
+ if (v.insertInner(o, l, c), v.lines && v.lines.length > 50) {
+ for (var L = v.lines.length % 25 + 25, j = L; j < v.lines.length; ) {
+ var Q = new Ca(v.lines.slice(j, j += 25));
+ v.height -= Q.height, this.children.splice(++f, 0, Q), Q.parent = this;
+ }
+ v.lines = v.lines.slice(0, L), this.maybeSpill();
}
- var Ne = new FileReader();
- Ne.onerror = function() {
- return j();
- }, Ne.onload = function() {
- var Ue = Ne.result;
- if (/[\x00-\x08\x0e-\x1f]{2}/.test(Ue)) {
+ break;
+ }
+ o -= O;
+ }
+ },
+ maybeSpill: function() {
+ if (!(this.children.length <= 10)) {
+ var o = this;
+ do {
+ var l = o.children.splice(o.children.length - 5, 5), c = new Sa(l);
+ if (o.parent) {
+ o.size -= c.size, o.height -= c.height;
+ var v = he(o.parent.children, o);
+ o.parent.children.splice(v + 1, 0, c);
+ } else {
+ var f = new Sa(o.children);
+ f.parent = o, o.children = [f, c], o = f;
+ }
+ c.parent = o.parent;
+ } while (o.children.length > 10);
+ o.parent.maybeSpill();
+ }
+ },
+ iterN: function(o, l, c) {
+ for (var f = 0; f < this.children.length; ++f) {
+ var v = this.children[f], O = v.chunkSize();
+ if (o < O) {
+ var L = Math.min(l, O - o);
+ if (v.iterN(o, L, c))
+ return !0;
+ if ((l -= L) == 0)
+ break;
+ o = 0;
+ } else
+ o -= O;
+ }
+ }
+ };
+ var Ea = function(o, l, c) {
+ if (c)
+ for (var f in c)
+ c.hasOwnProperty(f) && (this[f] = c[f]);
+ this.doc = o, this.node = l;
+ };
+ Ea.prototype.clear = function() {
+ var o = this.doc.cm, l = this.line.widgets, c = this.line, f = Ft(c);
+ if (!(f == null || !l)) {
+ for (var v = 0; v < l.length; ++v)
+ l[v] == this && l.splice(v--, 1);
+ l.length || (c.widgets = null);
+ var O = fa(this);
+ fi(c, Math.max(0, c.height - O)), o && (Wn(o, function() {
+ mm(o, c, -O), mr(o, f, "widget");
+ }), pn(o, "lineWidgetCleared", o, this, f));
+ }
+ }, Ea.prototype.changed = function() {
+ var o = this, l = this.height, c = this.doc.cm, f = this.line;
+ this.height = null;
+ var v = fa(this) - l;
+ !v || (hr(this.doc, f) || fi(f, f.height + v), c && Wn(c, function() {
+ c.curOp.forceUpdate = !0, mm(c, f, v), pn(c, "lineWidgetChanged", c, o, Ft(f));
+ }));
+ }, zt(Ea);
+ function mm(o, l, c) {
+ Ji(l) < (o.curOp && o.curOp.scrollTop || o.doc.scrollTop) && id(o, c);
+ }
+ function __(o, l, c, f) {
+ var v = new Ea(o, c, f), O = o.cm;
+ return O && v.noHScroll && (O.display.alignWidgets = !0), Aa(o, l, "widget", function(L) {
+ var j = L.widgets || (L.widgets = []);
+ if (v.insertAt == null ? j.push(v) : j.splice(Math.min(j.length, Math.max(0, v.insertAt)), 0, v), v.line = L, O && !hr(o, L)) {
+ var Q = Ji(L) < o.scrollTop;
+ fi(L, L.height + fa(v)), Q && id(O, v.height), O.curOp.forceUpdate = !0;
+ }
+ return !0;
+ }), O && pn(O, "lineWidgetAdded", O, v, typeof l == "number" ? l : Ft(l)), v;
+ }
+ var vm = 0, _r = function(o, l) {
+ this.lines = [], this.type = l, this.doc = o, this.id = ++vm;
+ };
+ _r.prototype.clear = function() {
+ if (!this.explicitlyCleared) {
+ var o = this.doc.cm, l = o && !o.curOp;
+ if (l && Nr(o), Qt(this, "clear")) {
+ var c = this.find();
+ c && pn(this, "clear", c.from, c.to);
+ }
+ for (var f = null, v = null, O = 0; O < this.lines.length; ++O) {
+ var L = this.lines[O], j = sa(L.markedSpans, this);
+ o && !this.collapsed ? mr(o, Ft(L), "text") : o && (j.to != null && (v = Ft(L)), j.from != null && (f = Ft(L))), L.markedSpans = f1(L.markedSpans, j), j.from == null && this.collapsed && !hr(this.doc, L) && o && fi(L, so(o.display));
+ }
+ if (o && this.collapsed && !o.options.lineWrapping)
+ for (var Q = 0; Q < this.lines.length; ++Q) {
+ var ne = _i(this.lines[Q]), se = Tl(ne);
+ se > o.display.maxLineLength && (o.display.maxLine = ne, o.display.maxLineLength = se, o.display.maxLineChanged = !0);
+ }
+ f != null && o && this.collapsed && Ln(o, f, v + 1), this.lines.length = 0, this.explicitlyCleared = !0, this.atomic && this.doc.cantEdit && (this.doc.cantEdit = !1, o && om(o.doc)), o && pn(o, "markerCleared", o, this, f, v), l && Br(o), this.parent && this.parent.clear();
+ }
+ }, _r.prototype.find = function(o, l) {
+ o == null && this.type == "bookmark" && (o = 1);
+ for (var c, f, v = 0; v < this.lines.length; ++v) {
+ var O = this.lines[v], L = sa(O.markedSpans, this);
+ if (L.from != null && (c = ye(l ? O : Ft(O), L.from), o == -1))
+ return c;
+ if (L.to != null && (f = ye(l ? O : Ft(O), L.to), o == 1))
+ return f;
+ }
+ return c && { from: c, to: f };
+ }, _r.prototype.changed = function() {
+ var o = this, l = this.find(-1, !0), c = this, f = this.doc.cm;
+ !l || !f || Wn(f, function() {
+ var v = l.line, O = Ft(l.line), L = zu(f, O);
+ if (L && (Ah(L), f.curOp.selectionChanged = f.curOp.forceUpdate = !0), f.curOp.updateMaxLine = !0, !hr(c.doc, v) && c.height != null) {
+ var j = c.height;
+ c.height = null;
+ var Q = fa(c) - j;
+ Q && fi(v, v.height + Q);
+ }
+ pn(f, "markerChanged", f, o);
+ });
+ }, _r.prototype.attachLine = function(o) {
+ if (!this.lines.length && this.doc.cm) {
+ var l = this.doc.cm.curOp;
+ (!l.maybeHiddenMarkers || he(l.maybeHiddenMarkers, this) == -1) && (l.maybeUnhiddenMarkers || (l.maybeUnhiddenMarkers = [])).push(this);
+ }
+ this.lines.push(o);
+ }, _r.prototype.detachLine = function(o) {
+ if (this.lines.splice(he(this.lines, o), 1), !this.lines.length && this.doc.cm) {
+ var l = this.doc.cm.curOp;
+ (l.maybeHiddenMarkers || (l.maybeHiddenMarkers = [])).push(this);
+ }
+ }, zt(_r);
+ function yo(o, l, c, f, v) {
+ if (f && f.shared)
+ return w_(o, l, c, f, v);
+ if (o.cm && !o.cm.curOp)
+ return hn(o.cm, yo)(o, l, c, f, v);
+ var O = new _r(o, v), L = De(l, c);
+ if (f && ge(f, O, !1), L > 0 || L == 0 && O.clearWhenEmpty !== !1)
+ return O;
+ if (O.replacedWith && (O.collapsed = !0, O.widgetNode = U("span", [O.replacedWith], "CodeMirror-widget"), f.handleMouseEvents || O.widgetNode.setAttribute("cm-ignore-events", "true"), f.insertLeft && (O.widgetNode.insertLeft = !0)), O.collapsed) {
+ if (ah(o, l.line, l, c, O) || l.line != c.line && ah(o, c.line, l, c, O))
+ throw new Error("Inserting collapsed marker partially overlapping an existing one");
+ d1();
+ }
+ O.addToHistory && Zh(o, { from: l, to: c, origin: "markText" }, o.sel, NaN);
+ var j = l.line, Q = o.cm, ne;
+ if (o.iter(j, c.line + 1, function(de) {
+ Q && O.collapsed && !Q.options.lineWrapping && _i(de) == Q.display.maxLine && (ne = !0), O.collapsed && j != l.line && fi(de, 0), c1(de, new Cl(
+ O,
+ j == l.line ? l.ch : null,
+ j == c.line ? c.ch : null
+ ), o.cm && o.cm.curOp), ++j;
+ }), O.collapsed && o.iter(l.line, c.line + 1, function(de) {
+ hr(o, de) && fi(de, 0);
+ }), O.clearOnEnter && $e(O, "beforeCursorEnter", function() {
+ return O.clear();
+ }), O.readOnly && (u1(), (o.history.done.length || o.history.undone.length) && o.clearHistory()), O.collapsed && (O.id = ++vm, O.atomic = !0), Q) {
+ if (ne && (Q.curOp.updateMaxLine = !0), O.collapsed)
+ Ln(Q, l.line, c.line + 1);
+ else if (O.className || O.startStyle || O.endStyle || O.css || O.attributes || O.title)
+ for (var se = l.line; se <= c.line; se++)
+ mr(Q, se, "text");
+ O.atomic && om(Q.doc), pn(Q, "markerAdded", Q, O);
+ }
+ return O;
+ }
+ var xa = function(o, l) {
+ this.markers = o, this.primary = l;
+ for (var c = 0; c < o.length; ++c)
+ o[c].parent = this;
+ };
+ xa.prototype.clear = function() {
+ if (!this.explicitlyCleared) {
+ this.explicitlyCleared = !0;
+ for (var o = 0; o < this.markers.length; ++o)
+ this.markers[o].clear();
+ pn(this, "clear");
+ }
+ }, xa.prototype.find = function(o, l) {
+ return this.primary.find(o, l);
+ }, zt(xa);
+ function w_(o, l, c, f, v) {
+ f = ge(f), f.shared = !1;
+ var O = [yo(o, l, c, f, v)], L = O[0], j = f.widgetNode;
+ return br(o, function(Q) {
+ j && (f.widgetNode = j.cloneNode(!0)), O.push(yo(Q, _t(Q, l), _t(Q, c), f, v));
+ for (var ne = 0; ne < Q.linked.length; ++ne)
+ if (Q.linked[ne].isParent)
+ return;
+ L = Ae(O);
+ }), new xa(O, L);
+ }
+ function gm(o) {
+ return o.findMarks(ye(o.first, 0), o.clipPos(ye(o.lastLine())), function(l) {
+ return l.parent;
+ });
+ }
+ function A_(o, l) {
+ for (var c = 0; c < l.length; c++) {
+ var f = l[c], v = f.find(), O = o.clipPos(v.from), L = o.clipPos(v.to);
+ if (De(O, L)) {
+ var j = yo(o, O, L, f.primary, f.primary.type);
+ f.markers.push(j), j.parent = f;
+ }
+ }
+ }
+ function C_(o) {
+ for (var l = function(f) {
+ var v = o[f], O = [v.primary.doc];
+ br(v.primary.doc, function(Q) {
+ return O.push(Q);
+ });
+ for (var L = 0; L < v.markers.length; L++) {
+ var j = v.markers[L];
+ he(O, j.doc) == -1 && (j.parent = null, v.markers.splice(L--, 1));
+ }
+ }, c = 0; c < o.length; c++)
+ l(c);
+ }
+ var S_ = 0, Nn = function(o, l, c, f, v) {
+ if (!(this instanceof Nn))
+ return new Nn(o, l, c, f, v);
+ c == null && (c = 0), Sa.call(this, [new Ca([new oo("", null)])]), this.first = c, this.scrollTop = this.scrollLeft = 0, this.cantEdit = !1, this.cleanGeneration = 1, this.modeFrontier = this.highlightFrontier = c;
+ var O = ye(c, 0);
+ this.sel = gr(O), this.history = new Bl(null), this.id = ++S_, this.modeOption = l, this.lineSep = f, this.direction = v == "rtl" ? "rtl" : "ltr", this.extend = !1, typeof o == "string" && (o = this.splitLines(o)), fd(this, { from: O, to: O, text: o }), En(this, gr(O), $);
+ };
+ Nn.prototype = _e(Sa.prototype, {
+ constructor: Nn,
+ iter: function(o, l, c) {
+ c ? this.iterN(o - this.first, l - o, c) : this.iterN(this.first, this.first + this.size, o);
+ },
+ insert: function(o, l) {
+ for (var c = 0, f = 0; f < l.length; ++f)
+ c += l[f].height;
+ this.insertInner(o - this.first, l, c);
+ },
+ remove: function(o, l) {
+ this.removeInner(o - this.first, l);
+ },
+ getValue: function(o) {
+ var l = ro(this, this.first, this.first + this.size);
+ return o === !1 ? l : l.join(o || this.lineSeparator());
+ },
+ setValue: mn(function(o) {
+ var l = ye(this.first, 0), c = this.first + this.size - 1;
+ vo(this, {
+ from: l,
+ to: ye(c, ut(this, c).text.length),
+ text: this.splitLines(o),
+ origin: "setValue",
+ full: !0
+ }, !0), this.cm && ha(this.cm, 0, 0), En(this, gr(l), $);
+ }),
+ replaceRange: function(o, l, c, f) {
+ l = _t(this, l), c = c ? _t(this, c) : l, go(this, o, l, c, f);
+ },
+ getRange: function(o, l, c) {
+ var f = Yi(this, _t(this, o), _t(this, l));
+ return c === !1 ? f : c === "" ? f.join("") : f.join(c || this.lineSeparator());
+ },
+ getLine: function(o) {
+ var l = this.getLineHandle(o);
+ return l && l.text;
+ },
+ getLineHandle: function(o) {
+ if (oe(this, o))
+ return ut(this, o);
+ },
+ getLineNumber: function(o) {
+ return Ft(o);
+ },
+ getLineHandleVisualStart: function(o) {
+ return typeof o == "number" && (o = ut(this, o)), _i(o);
+ },
+ lineCount: function() {
+ return this.size;
+ },
+ firstLine: function() {
+ return this.first;
+ },
+ lastLine: function() {
+ return this.first + this.size - 1;
+ },
+ clipPos: function(o) {
+ return _t(this, o);
+ },
+ getCursor: function(o) {
+ var l = this.sel.primary(), c;
+ return o == null || o == "head" ? c = l.head : o == "anchor" ? c = l.anchor : o == "end" || o == "to" || o === !1 ? c = l.to() : c = l.from(), c;
+ },
+ listSelections: function() {
+ return this.sel.ranges;
+ },
+ somethingSelected: function() {
+ return this.sel.somethingSelected();
+ },
+ setCursor: mn(function(o, l, c) {
+ nm(this, _t(this, typeof o == "number" ? ye(o, l || 0) : o), null, c);
+ }),
+ setSelection: mn(function(o, l, c) {
+ nm(this, _t(this, o), _t(this, l || o), c);
+ }),
+ extendSelection: mn(function(o, l, c) {
+ jl(this, _t(this, o), l && _t(this, l), c);
+ }),
+ extendSelections: mn(function(o, l) {
+ tm(this, Gp(this, o), l);
+ }),
+ extendSelectionsBy: mn(function(o, l) {
+ var c = Fe(this.sel.ranges, o);
+ tm(this, Gp(this, c), l);
+ }),
+ setSelections: mn(function(o, l, c) {
+ if (!!o.length) {
+ for (var f = [], v = 0; v < o.length; v++)
+ f[v] = new Pt(
+ _t(this, o[v].anchor),
+ _t(this, o[v].head || o[v].anchor)
+ );
+ l == null && (l = Math.min(o.length - 1, this.sel.primIndex)), En(this, Ai(this.cm, f, l), c);
+ }
+ }),
+ addSelection: mn(function(o, l, c) {
+ var f = this.sel.ranges.slice(0);
+ f.push(new Pt(_t(this, o), _t(this, l || o))), En(this, Ai(this.cm, f, f.length - 1), c);
+ }),
+ getSelection: function(o) {
+ for (var l = this.sel.ranges, c, f = 0; f < l.length; f++) {
+ var v = Yi(this, l[f].from(), l[f].to());
+ c = c ? c.concat(v) : v;
+ }
+ return o === !1 ? c : c.join(o || this.lineSeparator());
+ },
+ getSelections: function(o) {
+ for (var l = [], c = this.sel.ranges, f = 0; f < c.length; f++) {
+ var v = Yi(this, c[f].from(), c[f].to());
+ o !== !1 && (v = v.join(o || this.lineSeparator())), l[f] = v;
+ }
+ return l;
+ },
+ replaceSelection: function(o, l, c) {
+ for (var f = [], v = 0; v < this.sel.ranges.length; v++)
+ f[v] = o;
+ this.replaceSelections(f, l, c || "+input");
+ },
+ replaceSelections: mn(function(o, l, c) {
+ for (var f = [], v = this.sel, O = 0; O < v.ranges.length; O++) {
+ var L = v.ranges[O];
+ f[O] = { from: L.from(), to: L.to(), text: this.splitLines(o[O]), origin: c };
+ }
+ for (var j = l && l != "end" && f_(this, f, l), Q = f.length - 1; Q >= 0; Q--)
+ vo(this, f[Q]);
+ j ? im(this, j) : this.cm && co(this.cm);
+ }),
+ undo: mn(function() {
+ zl(this, "undo");
+ }),
+ redo: mn(function() {
+ zl(this, "redo");
+ }),
+ undoSelection: mn(function() {
+ zl(this, "undo", !0);
+ }),
+ redoSelection: mn(function() {
+ zl(this, "redo", !0);
+ }),
+ setExtending: function(o) {
+ this.extend = o;
+ },
+ getExtending: function() {
+ return this.extend;
+ },
+ historySize: function() {
+ for (var o = this.history, l = 0, c = 0, f = 0; f < o.done.length; f++)
+ o.done[f].ranges || ++l;
+ for (var v = 0; v < o.undone.length; v++)
+ o.undone[v].ranges || ++c;
+ return { undo: l, redo: c };
+ },
+ clearHistory: function() {
+ var o = this;
+ this.history = new Bl(this.history), br(this, function(l) {
+ return l.history = o.history;
+ }, !0);
+ },
+ markClean: function() {
+ this.cleanGeneration = this.changeGeneration(!0);
+ },
+ changeGeneration: function(o) {
+ return o && (this.history.lastOp = this.history.lastSelOp = this.history.lastOrigin = null), this.history.generation;
+ },
+ isClean: function(o) {
+ return this.history.generation == (o || this.cleanGeneration);
+ },
+ getHistory: function() {
+ return {
+ done: ho(this.history.done),
+ undone: ho(this.history.undone)
+ };
+ },
+ setHistory: function(o) {
+ var l = this.history = new Bl(this.history);
+ l.done = ho(o.done.slice(0), null, !0), l.undone = ho(o.undone.slice(0), null, !0);
+ },
+ setGutterMarker: mn(function(o, l, c) {
+ return Aa(this, o, "gutter", function(f) {
+ var v = f.gutterMarkers || (f.gutterMarkers = {});
+ return v[l] = c, !c && pt(v) && (f.gutterMarkers = null), !0;
+ });
+ }),
+ clearGutter: mn(function(o) {
+ var l = this;
+ this.iter(function(c) {
+ c.gutterMarkers && c.gutterMarkers[o] && Aa(l, c, "gutter", function() {
+ return c.gutterMarkers[o] = null, pt(c.gutterMarkers) && (c.gutterMarkers = null), !0;
+ });
+ });
+ }),
+ lineInfo: function(o) {
+ var l;
+ if (typeof o == "number") {
+ if (!oe(this, o) || (l = o, o = ut(this, o), !o))
+ return null;
+ } else if (l = Ft(o), l == null)
+ return null;
+ return {
+ line: l,
+ handle: o,
+ text: o.text,
+ gutterMarkers: o.gutterMarkers,
+ textClass: o.textClass,
+ bgClass: o.bgClass,
+ wrapClass: o.wrapClass,
+ widgets: o.widgets
+ };
+ },
+ addLineClass: mn(function(o, l, c) {
+ return Aa(this, o, l == "gutter" ? "gutter" : "class", function(f) {
+ var v = l == "text" ? "textClass" : l == "background" ? "bgClass" : l == "gutter" ? "gutterClass" : "wrapClass";
+ if (!f[v])
+ f[v] = c;
+ else {
+ if (D(c).test(f[v]))
+ return !1;
+ f[v] += " " + c;
+ }
+ return !0;
+ });
+ }),
+ removeLineClass: mn(function(o, l, c) {
+ return Aa(this, o, l == "gutter" ? "gutter" : "class", function(f) {
+ var v = l == "text" ? "textClass" : l == "background" ? "bgClass" : l == "gutter" ? "gutterClass" : "wrapClass", O = f[v];
+ if (O)
+ if (c == null)
+ f[v] = null;
+ else {
+ var L = O.match(D(c));
+ if (!L)
+ return !1;
+ var j = L.index + L[0].length;
+ f[v] = O.slice(0, L.index) + (!L.index || j == O.length ? "" : " ") + O.slice(j) || null;
+ }
+ else
+ return !1;
+ return !0;
+ });
+ }),
+ addLineWidget: mn(function(o, l, c) {
+ return __(this, o, l, c);
+ }),
+ removeLineWidget: function(o) {
+ o.clear();
+ },
+ markText: function(o, l, c) {
+ return yo(this, _t(this, o), _t(this, l), c, c && c.type || "range");
+ },
+ setBookmark: function(o, l) {
+ var c = {
+ replacedWith: l && (l.nodeType == null ? l.widget : l),
+ insertLeft: l && l.insertLeft,
+ clearWhenEmpty: !1,
+ shared: l && l.shared,
+ handleMouseEvents: l && l.handleMouseEvents
+ };
+ return o = _t(this, o), yo(this, o, o, c, "bookmark");
+ },
+ findMarksAt: function(o) {
+ o = _t(this, o);
+ var l = [], c = ut(this, o.line).markedSpans;
+ if (c)
+ for (var f = 0; f < c.length; ++f) {
+ var v = c[f];
+ (v.from == null || v.from <= o.ch) && (v.to == null || v.to >= o.ch) && l.push(v.marker.parent || v.marker);
+ }
+ return l;
+ },
+ findMarks: function(o, l, c) {
+ o = _t(this, o), l = _t(this, l);
+ var f = [], v = o.line;
+ return this.iter(o.line, l.line + 1, function(O) {
+ var L = O.markedSpans;
+ if (L)
+ for (var j = 0; j < L.length; j++) {
+ var Q = L[j];
+ !(Q.to != null && v == o.line && o.ch >= Q.to || Q.from == null && v != o.line || Q.from != null && v == l.line && Q.from >= l.ch) && (!c || c(Q.marker)) && f.push(Q.marker.parent || Q.marker);
+ }
+ ++v;
+ }), f;
+ },
+ getAllMarks: function() {
+ var o = [];
+ return this.iter(function(l) {
+ var c = l.markedSpans;
+ if (c)
+ for (var f = 0; f < c.length; ++f)
+ c[f].from != null && o.push(c[f].marker);
+ }), o;
+ },
+ posFromIndex: function(o) {
+ var l, c = this.first, f = this.lineSeparator().length;
+ return this.iter(function(v) {
+ var O = v.text.length + f;
+ if (O > o)
+ return l = o, !0;
+ o -= O, ++c;
+ }), _t(this, ye(c, l));
+ },
+ indexFromPos: function(o) {
+ o = _t(this, o);
+ var l = o.ch;
+ if (o.line < this.first || o.ch < 0)
+ return 0;
+ var c = this.lineSeparator().length;
+ return this.iter(this.first, o.line, function(f) {
+ l += f.text.length + c;
+ }), l;
+ },
+ copy: function(o) {
+ var l = new Nn(
+ ro(this, this.first, this.first + this.size),
+ this.modeOption,
+ this.first,
+ this.lineSep,
+ this.direction
+ );
+ return l.scrollTop = this.scrollTop, l.scrollLeft = this.scrollLeft, l.sel = this.sel, l.extend = !1, o && (l.history.undoDepth = this.history.undoDepth, l.setHistory(this.getHistory())), l;
+ },
+ linkedDoc: function(o) {
+ o || (o = {});
+ var l = this.first, c = this.first + this.size;
+ o.from != null && o.from > l && (l = o.from), o.to != null && o.to < c && (c = o.to);
+ var f = new Nn(ro(this, l, c), o.mode || this.modeOption, l, this.lineSep, this.direction);
+ return o.sharedHist && (f.history = this.history), (this.linked || (this.linked = [])).push({ doc: f, sharedHist: o.sharedHist }), f.linked = [{ doc: this, isParent: !0, sharedHist: o.sharedHist }], A_(f, gm(this)), f;
+ },
+ unlinkDoc: function(o) {
+ if (o instanceof Kt && (o = o.doc), this.linked)
+ for (var l = 0; l < this.linked.length; ++l) {
+ var c = this.linked[l];
+ if (c.doc == o) {
+ this.linked.splice(l, 1), o.unlinkDoc(this), C_(gm(this));
+ break;
+ }
+ }
+ if (o.history == this.history) {
+ var f = [o.id];
+ br(o, function(v) {
+ return f.push(v.id);
+ }, !0), o.history = new Bl(null), o.history.done = ho(this.history.done, f), o.history.undone = ho(this.history.undone, f);
+ }
+ },
+ iterLinkedDocs: function(o) {
+ br(this, o);
+ },
+ getMode: function() {
+ return this.mode;
+ },
+ getEditor: function() {
+ return this.cm;
+ },
+ splitLines: function(o) {
+ return this.lineSep ? o.split(this.lineSep) : oa(o);
+ },
+ lineSeparator: function() {
+ return this.lineSep || `
+`;
+ },
+ setDirection: mn(function(o) {
+ o != "rtl" && (o = "ltr"), o != this.direction && (this.direction = o, this.iter(function(l) {
+ return l.order = null;
+ }), this.cm && c_(this.cm));
+ })
+ }), Nn.prototype.eachLine = Nn.prototype.iter;
+ var ym = 0;
+ function E_(o) {
+ var l = this;
+ if (bm(l), !(Ct(l, o) || Xi(l.display, o))) {
+ It(o), d && (ym = +new Date());
+ var c = Fr(l, o, !0), f = o.dataTransfer.files;
+ if (!(!c || l.isReadOnly()))
+ if (f && f.length && window.FileReader && window.File)
+ for (var v = f.length, O = Array(v), L = 0, j = function() {
+ ++L == v && hn(l, function() {
+ c = _t(l.doc, c);
+ var Ce = {
+ from: c,
+ to: c,
+ text: l.doc.splitLines(
+ O.filter(function(Ie) {
+ return Ie != null;
+ }).join(l.doc.lineSeparator())
+ ),
+ origin: "paste"
+ };
+ vo(l.doc, Ce), im(l.doc, gr(_t(l.doc, c), _t(l.doc, yr(Ce))));
+ })();
+ }, Q = function(Ce, Ie) {
+ if (l.options.allowDropFileTypes && he(l.options.allowDropFileTypes, Ce.type) == -1) {
j();
return;
}
- O[Ie] = Ue, j();
- }, Ne.readAsText(Ce);
- }, ne = 0; ne < f.length; ne++)
- Q(f[ne], ne);
- else {
- if (l.state.draggingText && l.doc.sel.contains(c) > -1) {
- l.state.draggingText(o), setTimeout(function() {
- return l.display.input.focus();
- }, 20);
- return;
- }
- try {
- var se = o.dataTransfer.getData("Text");
- if (se) {
- var de;
- if (l.state.draggingText && !l.state.draggingText.copy && (de = l.listSelections()), Ul(l.doc, gr(c, c)), de)
- for (var Ee = 0; Ee < de.length; ++Ee)
- yo(l.doc, "", de[Ee].anchor, de[Ee].head, "drag");
- l.replaceSelection(se, "around", "paste"), l.display.input.focus();
+ var Ne = new FileReader();
+ Ne.onerror = function() {
+ return j();
+ }, Ne.onload = function() {
+ var Ue = Ne.result;
+ if (/[\x00-\x08\x0e-\x1f]{2}/.test(Ue)) {
+ j();
+ return;
+ }
+ O[Ie] = Ue, j();
+ }, Ne.readAsText(Ce);
+ }, ne = 0; ne < f.length; ne++)
+ Q(f[ne], ne);
+ else {
+ if (l.state.draggingText && l.doc.sel.contains(c) > -1) {
+ l.state.draggingText(o), setTimeout(function() {
+ return l.display.input.focus();
+ }, 20);
+ return;
+ }
+ try {
+ var se = o.dataTransfer.getData("Text");
+ if (se) {
+ var de;
+ if (l.state.draggingText && !l.state.draggingText.copy && (de = l.listSelections()), Ul(l.doc, gr(c, c)), de)
+ for (var Ee = 0; Ee < de.length; ++Ee)
+ go(l.doc, "", de[Ee].anchor, de[Ee].head, "drag");
+ l.replaceSelection(se, "around", "paste"), l.display.input.focus();
+ }
+ } catch {
}
- } catch {
}
- }
- }
- }
- function S_(o, l) {
- if (d && (!o.state.draggingText || +new Date() - gm < 100)) {
- yi(l);
- return;
- }
- if (!(Ct(o, l) || Xi(o.display, l)) && (l.dataTransfer.setData("Text", o.getSelection()), l.dataTransfer.effectAllowed = "copyMove", l.dataTransfer.setDragImage && !A)) {
- var c = I("img", null, null, "position: fixed; left: 0; top: 0;");
- c.src = "data:image/gif;base64,R0lGODlhAQABAAAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==", b && (c.width = c.height = 1, o.display.wrapper.appendChild(c), c._top = c.offsetTop), l.dataTransfer.setDragImage(c, 0, 0), b && c.parentNode.removeChild(c);
- }
- }
- function E_(o, l) {
- var c = Fr(o, l);
- if (!!c) {
- var f = document.createDocumentFragment();
- Zu(o, c, f), o.display.dragCursor || (o.display.dragCursor = I("div", null, "CodeMirror-cursors CodeMirror-dragcursors"), o.display.lineSpace.insertBefore(o.display.dragCursor, o.display.cursorDiv)), G(o.display.dragCursor, f);
- }
- }
- function ym(o) {
- o.display.dragCursor && (o.display.lineSpace.removeChild(o.display.dragCursor), o.display.dragCursor = null);
- }
- function bm(o) {
- if (!!document.getElementsByClassName) {
- for (var l = document.getElementsByClassName("CodeMirror"), c = [], f = 0; f < l.length; f++) {
- var v = l[f].CodeMirror;
- v && c.push(v);
}
- c.length && c[0].operation(function() {
- for (var O = 0; O < c.length; O++)
- o(c[O]);
+ }
+ function x_(o, l) {
+ if (d && (!o.state.draggingText || +new Date() - ym < 100)) {
+ yi(l);
+ return;
+ }
+ if (!(Ct(o, l) || Xi(o.display, l)) && (l.dataTransfer.setData("Text", o.getSelection()), l.dataTransfer.effectAllowed = "copyMove", l.dataTransfer.setDragImage && !A)) {
+ var c = I("img", null, null, "position: fixed; left: 0; top: 0;");
+ c.src = "data:image/gif;base64,R0lGODlhAQABAAAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==", b && (c.width = c.height = 1, o.display.wrapper.appendChild(c), c._top = c.offsetTop), l.dataTransfer.setDragImage(c, 0, 0), b && c.parentNode.removeChild(c);
+ }
+ }
+ function T_(o, l) {
+ var c = Fr(o, l);
+ if (!!c) {
+ var f = document.createDocumentFragment();
+ Zu(o, c, f), o.display.dragCursor || (o.display.dragCursor = I("div", null, "CodeMirror-cursors CodeMirror-dragcursors"), o.display.lineSpace.insertBefore(o.display.dragCursor, o.display.cursorDiv)), G(o.display.dragCursor, f);
+ }
+ }
+ function bm(o) {
+ o.display.dragCursor && (o.display.lineSpace.removeChild(o.display.dragCursor), o.display.dragCursor = null);
+ }
+ function _m(o) {
+ if (!!document.getElementsByClassName) {
+ for (var l = document.getElementsByClassName("CodeMirror"), c = [], f = 0; f < l.length; f++) {
+ var v = l[f].CodeMirror;
+ v && c.push(v);
+ }
+ c.length && c[0].operation(function() {
+ for (var O = 0; O < c.length; O++)
+ o(c[O]);
+ });
+ }
+ }
+ var wm = !1;
+ function k_() {
+ wm || (O_(), wm = !0);
+ }
+ function O_() {
+ var o;
+ $e(window, "resize", function() {
+ o == null && (o = setTimeout(function() {
+ o = null, _m($_);
+ }, 100));
+ }), $e(window, "blur", function() {
+ return _m(fo);
});
}
- }
- var _m = !1;
- function x_() {
- _m || (T_(), _m = !0);
- }
- function T_() {
- var o;
- $e(window, "resize", function() {
- o == null && (o = setTimeout(function() {
- o = null, bm(k_);
- }, 100));
- }), $e(window, "blur", function() {
- return bm(co);
- });
- }
- function k_(o) {
- var l = o.display;
- l.cachedCharWidth = l.cachedTextHeight = l.cachedPaddingH = null, l.scrollbarsClipped = !1, o.setSize();
- }
- for (var wr = {
- 3: "Pause",
- 8: "Backspace",
- 9: "Tab",
- 13: "Enter",
- 16: "Shift",
- 17: "Ctrl",
- 18: "Alt",
- 19: "Pause",
- 20: "CapsLock",
- 27: "Esc",
- 32: "Space",
- 33: "PageUp",
- 34: "PageDown",
- 35: "End",
- 36: "Home",
- 37: "Left",
- 38: "Up",
- 39: "Right",
- 40: "Down",
- 44: "PrintScrn",
- 45: "Insert",
- 46: "Delete",
- 59: ";",
- 61: "=",
- 91: "Mod",
- 92: "Mod",
- 93: "Mod",
- 106: "*",
- 107: "=",
- 109: "-",
- 110: ".",
- 111: "/",
- 145: "ScrollLock",
- 173: "-",
- 186: ";",
- 187: "=",
- 188: ",",
- 189: "-",
- 190: ".",
- 191: "/",
- 192: "`",
- 219: "[",
- 220: "\\",
- 221: "]",
- 222: "'",
- 224: "Mod",
- 63232: "Up",
- 63233: "Down",
- 63234: "Left",
- 63235: "Right",
- 63272: "Delete",
- 63273: "Home",
- 63275: "End",
- 63276: "PageUp",
- 63277: "PageDown",
- 63302: "Insert"
- }, Ta = 0; Ta < 10; Ta++)
- wr[Ta + 48] = wr[Ta + 96] = String(Ta);
- for (var Wl = 65; Wl <= 90; Wl++)
- wr[Wl] = String.fromCharCode(Wl);
- for (var ka = 1; ka <= 12; ka++)
- wr[ka + 111] = wr[ka + 63235] = "F" + ka;
- var qi = {};
- qi.basic = {
- Left: "goCharLeft",
- Right: "goCharRight",
- Up: "goLineUp",
- Down: "goLineDown",
- End: "goLineEnd",
- Home: "goLineStartSmart",
- PageUp: "goPageUp",
- PageDown: "goPageDown",
- Delete: "delCharAfter",
- Backspace: "delCharBefore",
- "Shift-Backspace": "delCharBefore",
- Tab: "defaultTab",
- "Shift-Tab": "indentAuto",
- Enter: "newlineAndIndent",
- Insert: "toggleOverwrite",
- Esc: "singleSelection"
- }, qi.pcDefault = {
- "Ctrl-A": "selectAll",
- "Ctrl-D": "deleteLine",
- "Ctrl-Z": "undo",
- "Shift-Ctrl-Z": "redo",
- "Ctrl-Y": "redo",
- "Ctrl-Home": "goDocStart",
- "Ctrl-End": "goDocEnd",
- "Ctrl-Up": "goLineUp",
- "Ctrl-Down": "goLineDown",
- "Ctrl-Left": "goGroupLeft",
- "Ctrl-Right": "goGroupRight",
- "Alt-Left": "goLineStart",
- "Alt-Right": "goLineEnd",
- "Ctrl-Backspace": "delGroupBefore",
- "Ctrl-Delete": "delGroupAfter",
- "Ctrl-S": "save",
- "Ctrl-F": "find",
- "Ctrl-G": "findNext",
- "Shift-Ctrl-G": "findPrev",
- "Shift-Ctrl-F": "replace",
- "Shift-Ctrl-R": "replaceAll",
- "Ctrl-[": "indentLess",
- "Ctrl-]": "indentMore",
- "Ctrl-U": "undoSelection",
- "Shift-Ctrl-U": "redoSelection",
- "Alt-U": "redoSelection",
- fallthrough: "basic"
- }, qi.emacsy = {
- "Ctrl-F": "goCharRight",
- "Ctrl-B": "goCharLeft",
- "Ctrl-P": "goLineUp",
- "Ctrl-N": "goLineDown",
- "Ctrl-A": "goLineStart",
- "Ctrl-E": "goLineEnd",
- "Ctrl-V": "goPageDown",
- "Shift-Ctrl-V": "goPageUp",
- "Ctrl-D": "delCharAfter",
- "Ctrl-H": "delCharBefore",
- "Alt-Backspace": "delWordBefore",
- "Ctrl-K": "killLine",
- "Ctrl-T": "transposeChars",
- "Ctrl-O": "openLine"
- }, qi.macDefault = {
- "Cmd-A": "selectAll",
- "Cmd-D": "deleteLine",
- "Cmd-Z": "undo",
- "Shift-Cmd-Z": "redo",
- "Cmd-Y": "redo",
- "Cmd-Home": "goDocStart",
- "Cmd-Up": "goDocStart",
- "Cmd-End": "goDocEnd",
- "Cmd-Down": "goDocEnd",
- "Alt-Left": "goGroupLeft",
- "Alt-Right": "goGroupRight",
- "Cmd-Left": "goLineLeft",
- "Cmd-Right": "goLineRight",
- "Alt-Backspace": "delGroupBefore",
- "Ctrl-Alt-Backspace": "delGroupAfter",
- "Alt-Delete": "delGroupAfter",
- "Cmd-S": "save",
- "Cmd-F": "find",
- "Cmd-G": "findNext",
- "Shift-Cmd-G": "findPrev",
- "Cmd-Alt-F": "replace",
- "Shift-Cmd-Alt-F": "replaceAll",
- "Cmd-[": "indentLess",
- "Cmd-]": "indentMore",
- "Cmd-Backspace": "delWrappedLineLeft",
- "Cmd-Delete": "delWrappedLineRight",
- "Cmd-U": "undoSelection",
- "Shift-Cmd-U": "redoSelection",
- "Ctrl-Up": "goDocStart",
- "Ctrl-Down": "goDocEnd",
- fallthrough: ["basic", "emacsy"]
- }, qi.default = k ? qi.macDefault : qi.pcDefault;
- function O_(o) {
- var l = o.split(/-(?!$)/);
- o = l[l.length - 1];
- for (var c, f, v, O, L = 0; L < l.length - 1; L++) {
- var j = l[L];
- if (/^(cmd|meta|m)$/i.test(j))
- O = !0;
- else if (/^a(lt)?$/i.test(j))
- c = !0;
- else if (/^(c|ctrl|control)$/i.test(j))
- f = !0;
- else if (/^s(hift)?$/i.test(j))
- v = !0;
- else
- throw new Error("Unrecognized modifier name: " + j);
+ function $_(o) {
+ var l = o.display;
+ l.cachedCharWidth = l.cachedTextHeight = l.cachedPaddingH = null, l.scrollbarsClipped = !1, o.setSize();
}
- return c && (o = "Alt-" + o), f && (o = "Ctrl-" + o), O && (o = "Cmd-" + o), v && (o = "Shift-" + o), o;
- }
- function $_(o) {
- var l = {};
- for (var c in o)
- if (o.hasOwnProperty(c)) {
- var f = o[c];
- if (/^(name|fallthrough|(de|at)tach)$/.test(c))
- continue;
- if (f == "...") {
+ for (var wr = {
+ 3: "Pause",
+ 8: "Backspace",
+ 9: "Tab",
+ 13: "Enter",
+ 16: "Shift",
+ 17: "Ctrl",
+ 18: "Alt",
+ 19: "Pause",
+ 20: "CapsLock",
+ 27: "Esc",
+ 32: "Space",
+ 33: "PageUp",
+ 34: "PageDown",
+ 35: "End",
+ 36: "Home",
+ 37: "Left",
+ 38: "Up",
+ 39: "Right",
+ 40: "Down",
+ 44: "PrintScrn",
+ 45: "Insert",
+ 46: "Delete",
+ 59: ";",
+ 61: "=",
+ 91: "Mod",
+ 92: "Mod",
+ 93: "Mod",
+ 106: "*",
+ 107: "=",
+ 109: "-",
+ 110: ".",
+ 111: "/",
+ 145: "ScrollLock",
+ 173: "-",
+ 186: ";",
+ 187: "=",
+ 188: ",",
+ 189: "-",
+ 190: ".",
+ 191: "/",
+ 192: "`",
+ 219: "[",
+ 220: "\\",
+ 221: "]",
+ 222: "'",
+ 224: "Mod",
+ 63232: "Up",
+ 63233: "Down",
+ 63234: "Left",
+ 63235: "Right",
+ 63272: "Delete",
+ 63273: "Home",
+ 63275: "End",
+ 63276: "PageUp",
+ 63277: "PageDown",
+ 63302: "Insert"
+ }, Ta = 0; Ta < 10; Ta++)
+ wr[Ta + 48] = wr[Ta + 96] = String(Ta);
+ for (var Wl = 65; Wl <= 90; Wl++)
+ wr[Wl] = String.fromCharCode(Wl);
+ for (var ka = 1; ka <= 12; ka++)
+ wr[ka + 111] = wr[ka + 63235] = "F" + ka;
+ var qi = {};
+ qi.basic = {
+ Left: "goCharLeft",
+ Right: "goCharRight",
+ Up: "goLineUp",
+ Down: "goLineDown",
+ End: "goLineEnd",
+ Home: "goLineStartSmart",
+ PageUp: "goPageUp",
+ PageDown: "goPageDown",
+ Delete: "delCharAfter",
+ Backspace: "delCharBefore",
+ "Shift-Backspace": "delCharBefore",
+ Tab: "defaultTab",
+ "Shift-Tab": "indentAuto",
+ Enter: "newlineAndIndent",
+ Insert: "toggleOverwrite",
+ Esc: "singleSelection"
+ }, qi.pcDefault = {
+ "Ctrl-A": "selectAll",
+ "Ctrl-D": "deleteLine",
+ "Ctrl-Z": "undo",
+ "Shift-Ctrl-Z": "redo",
+ "Ctrl-Y": "redo",
+ "Ctrl-Home": "goDocStart",
+ "Ctrl-End": "goDocEnd",
+ "Ctrl-Up": "goLineUp",
+ "Ctrl-Down": "goLineDown",
+ "Ctrl-Left": "goGroupLeft",
+ "Ctrl-Right": "goGroupRight",
+ "Alt-Left": "goLineStart",
+ "Alt-Right": "goLineEnd",
+ "Ctrl-Backspace": "delGroupBefore",
+ "Ctrl-Delete": "delGroupAfter",
+ "Ctrl-S": "save",
+ "Ctrl-F": "find",
+ "Ctrl-G": "findNext",
+ "Shift-Ctrl-G": "findPrev",
+ "Shift-Ctrl-F": "replace",
+ "Shift-Ctrl-R": "replaceAll",
+ "Ctrl-[": "indentLess",
+ "Ctrl-]": "indentMore",
+ "Ctrl-U": "undoSelection",
+ "Shift-Ctrl-U": "redoSelection",
+ "Alt-U": "redoSelection",
+ fallthrough: "basic"
+ }, qi.emacsy = {
+ "Ctrl-F": "goCharRight",
+ "Ctrl-B": "goCharLeft",
+ "Ctrl-P": "goLineUp",
+ "Ctrl-N": "goLineDown",
+ "Ctrl-A": "goLineStart",
+ "Ctrl-E": "goLineEnd",
+ "Ctrl-V": "goPageDown",
+ "Shift-Ctrl-V": "goPageUp",
+ "Ctrl-D": "delCharAfter",
+ "Ctrl-H": "delCharBefore",
+ "Alt-Backspace": "delWordBefore",
+ "Ctrl-K": "killLine",
+ "Ctrl-T": "transposeChars",
+ "Ctrl-O": "openLine"
+ }, qi.macDefault = {
+ "Cmd-A": "selectAll",
+ "Cmd-D": "deleteLine",
+ "Cmd-Z": "undo",
+ "Shift-Cmd-Z": "redo",
+ "Cmd-Y": "redo",
+ "Cmd-Home": "goDocStart",
+ "Cmd-Up": "goDocStart",
+ "Cmd-End": "goDocEnd",
+ "Cmd-Down": "goDocEnd",
+ "Alt-Left": "goGroupLeft",
+ "Alt-Right": "goGroupRight",
+ "Cmd-Left": "goLineLeft",
+ "Cmd-Right": "goLineRight",
+ "Alt-Backspace": "delGroupBefore",
+ "Ctrl-Alt-Backspace": "delGroupAfter",
+ "Alt-Delete": "delGroupAfter",
+ "Cmd-S": "save",
+ "Cmd-F": "find",
+ "Cmd-G": "findNext",
+ "Shift-Cmd-G": "findPrev",
+ "Cmd-Alt-F": "replace",
+ "Shift-Cmd-Alt-F": "replaceAll",
+ "Cmd-[": "indentLess",
+ "Cmd-]": "indentMore",
+ "Cmd-Backspace": "delWrappedLineLeft",
+ "Cmd-Delete": "delWrappedLineRight",
+ "Cmd-U": "undoSelection",
+ "Shift-Cmd-U": "redoSelection",
+ "Ctrl-Up": "goDocStart",
+ "Ctrl-Down": "goDocEnd",
+ fallthrough: ["basic", "emacsy"]
+ }, qi.default = k ? qi.macDefault : qi.pcDefault;
+ function R_(o) {
+ var l = o.split(/-(?!$)/);
+ o = l[l.length - 1];
+ for (var c, f, v, O, L = 0; L < l.length - 1; L++) {
+ var j = l[L];
+ if (/^(cmd|meta|m)$/i.test(j))
+ O = !0;
+ else if (/^a(lt)?$/i.test(j))
+ c = !0;
+ else if (/^(c|ctrl|control)$/i.test(j))
+ f = !0;
+ else if (/^s(hift)?$/i.test(j))
+ v = !0;
+ else
+ throw new Error("Unrecognized modifier name: " + j);
+ }
+ return c && (o = "Alt-" + o), f && (o = "Ctrl-" + o), O && (o = "Cmd-" + o), v && (o = "Shift-" + o), o;
+ }
+ function D_(o) {
+ var l = {};
+ for (var c in o)
+ if (o.hasOwnProperty(c)) {
+ var f = o[c];
+ if (/^(name|fallthrough|(de|at)tach)$/.test(c))
+ continue;
+ if (f == "...") {
+ delete o[c];
+ continue;
+ }
+ for (var v = Fe(c.split(" "), R_), O = 0; O < v.length; O++) {
+ var L = void 0, j = void 0;
+ O == v.length - 1 ? (j = v.join(" "), L = f) : (j = v.slice(0, O + 1).join(" "), L = "...");
+ var Q = l[j];
+ if (!Q)
+ l[j] = L;
+ else if (Q != L)
+ throw new Error("Inconsistent bindings for " + j);
+ }
delete o[c];
- continue;
}
- for (var v = Fe(c.split(" "), O_), O = 0; O < v.length; O++) {
- var L = void 0, j = void 0;
- O == v.length - 1 ? (j = v.join(" "), L = f) : (j = v.slice(0, O + 1).join(" "), L = "...");
- var Q = l[j];
- if (!Q)
- l[j] = L;
- else if (Q != L)
- throw new Error("Inconsistent bindings for " + j);
+ for (var ne in l)
+ o[ne] = l[ne];
+ return o;
+ }
+ function bo(o, l, c, f) {
+ l = Gl(l);
+ var v = l.call ? l.call(o, f) : l[o];
+ if (v === !1)
+ return "nothing";
+ if (v === "...")
+ return "multi";
+ if (v != null && c(v))
+ return "handled";
+ if (l.fallthrough) {
+ if (Object.prototype.toString.call(l.fallthrough) != "[object Array]")
+ return bo(o, l.fallthrough, c, f);
+ for (var O = 0; O < l.fallthrough.length; O++) {
+ var L = bo(o, l.fallthrough[O], c, f);
+ if (L)
+ return L;
}
- delete o[c];
- }
- for (var ne in l)
- o[ne] = l[ne];
- return o;
- }
- function _o(o, l, c, f) {
- l = Gl(l);
- var v = l.call ? l.call(o, f) : l[o];
- if (v === !1)
- return "nothing";
- if (v === "...")
- return "multi";
- if (v != null && c(v))
- return "handled";
- if (l.fallthrough) {
- if (Object.prototype.toString.call(l.fallthrough) != "[object Array]")
- return _o(o, l.fallthrough, c, f);
- for (var O = 0; O < l.fallthrough.length; O++) {
- var L = _o(o, l.fallthrough[O], c, f);
- if (L)
- return L;
}
}
- }
- function wm(o) {
- var l = typeof o == "string" ? o : wr[o.keyCode];
- return l == "Ctrl" || l == "Alt" || l == "Shift" || l == "Mod";
- }
- function Am(o, l, c) {
- var f = o;
- return l.altKey && f != "Alt" && (o = "Alt-" + o), (B ? l.metaKey : l.ctrlKey) && f != "Ctrl" && (o = "Ctrl-" + o), (B ? l.ctrlKey : l.metaKey) && f != "Mod" && (o = "Cmd-" + o), !c && l.shiftKey && f != "Shift" && (o = "Shift-" + o), o;
- }
- function Cm(o, l) {
- if (b && o.keyCode == 34 && o.char)
- return !1;
- var c = wr[o.keyCode];
- return c == null || o.altGraphKey ? !1 : (o.keyCode == 3 && o.code && (c = o.code), Am(c, o, l));
- }
- function Gl(o) {
- return typeof o == "string" ? qi[o] : o;
- }
- function wo(o, l) {
- for (var c = o.doc.sel.ranges, f = [], v = 0; v < c.length; v++) {
- for (var O = l(c[v]); f.length && De(O.from, Ae(f).to) <= 0; ) {
- var L = f.pop();
- if (De(L.from, O.from) < 0) {
- O.from = L.from;
+ function Am(o) {
+ var l = typeof o == "string" ? o : wr[o.keyCode];
+ return l == "Ctrl" || l == "Alt" || l == "Shift" || l == "Mod";
+ }
+ function Cm(o, l, c) {
+ var f = o;
+ return l.altKey && f != "Alt" && (o = "Alt-" + o), (B ? l.metaKey : l.ctrlKey) && f != "Ctrl" && (o = "Ctrl-" + o), (B ? l.ctrlKey : l.metaKey) && f != "Mod" && (o = "Cmd-" + o), !c && l.shiftKey && f != "Shift" && (o = "Shift-" + o), o;
+ }
+ function Sm(o, l) {
+ if (b && o.keyCode == 34 && o.char)
+ return !1;
+ var c = wr[o.keyCode];
+ return c == null || o.altGraphKey ? !1 : (o.keyCode == 3 && o.code && (c = o.code), Cm(c, o, l));
+ }
+ function Gl(o) {
+ return typeof o == "string" ? qi[o] : o;
+ }
+ function _o(o, l) {
+ for (var c = o.doc.sel.ranges, f = [], v = 0; v < c.length; v++) {
+ for (var O = l(c[v]); f.length && De(O.from, Ae(f).to) <= 0; ) {
+ var L = f.pop();
+ if (De(L.from, O.from) < 0) {
+ O.from = L.from;
+ break;
+ }
+ }
+ f.push(O);
+ }
+ Wn(o, function() {
+ for (var j = f.length - 1; j >= 0; j--)
+ go(o.doc, "", f[j].from, f[j].to, "+delete");
+ co(o);
+ });
+ }
+ function md(o, l, c) {
+ var f = at(o.text, l + c, c);
+ return f < 0 || f > o.text.length ? null : f;
+ }
+ function vd(o, l, c) {
+ var f = md(o, l.ch, c);
+ return f == null ? null : new ye(l.line, f, c < 0 ? "after" : "before");
+ }
+ function gd(o, l, c, f, v) {
+ if (o) {
+ l.doc.direction == "rtl" && (v = -v);
+ var O = ht(c, l.doc.direction);
+ if (O) {
+ var L = v < 0 ? Ae(O) : O[0], j = v < 0 == (L.level == 1), Q = j ? "after" : "before", ne;
+ if (L.level > 0 || l.doc.direction == "rtl") {
+ var se = lo(l, c);
+ ne = v < 0 ? c.text.length - 1 : 0;
+ var de = Pi(l, se, ne).top;
+ ne = We(function(Ee) {
+ return Pi(l, se, Ee).top == de;
+ }, v < 0 == (L.level == 1) ? L.from : L.to - 1, ne), Q == "before" && (ne = md(c, ne, 1));
+ } else
+ ne = v < 0 ? L.to : L.from;
+ return new ye(f, ne, Q);
+ }
+ }
+ return new ye(f, v < 0 ? c.text.length : 0, v < 0 ? "before" : "after");
+ }
+ function I_(o, l, c, f) {
+ var v = ht(l, o.doc.direction);
+ if (!v)
+ return vd(l, c, f);
+ c.ch >= l.text.length ? (c.ch = l.text.length, c.sticky = "before") : c.ch <= 0 && (c.ch = 0, c.sticky = "after");
+ var O = je(v, c.ch, c.sticky), L = v[O];
+ if (o.doc.direction == "ltr" && L.level % 2 == 0 && (f > 0 ? L.to > c.ch : L.from < c.ch))
+ return vd(l, c, f);
+ var j = function(Ye, nt) {
+ return md(l, Ye instanceof ye ? Ye.ch : Ye, nt);
+ }, Q, ne = function(Ye) {
+ return o.options.lineWrapping ? (Q = Q || lo(o, l), Oh(o, l, Q, Ye)) : { begin: 0, end: l.text.length };
+ }, se = ne(c.sticky == "before" ? j(c, -1) : c.ch);
+ if (o.doc.direction == "rtl" || L.level == 1) {
+ var de = L.level == 1 == f < 0, Ee = j(c, de ? 1 : -1);
+ if (Ee != null && (de ? Ee <= L.to && Ee <= se.end : Ee >= L.from && Ee >= se.begin)) {
+ var Ce = de ? "before" : "after";
+ return new ye(c.line, Ee, Ce);
+ }
+ }
+ var Ie = function(Ye, nt, Qe) {
+ for (var ot = function(Vt, vn) {
+ return vn ? new ye(c.line, j(Vt, 1), "before") : new ye(c.line, Vt, "after");
+ }; Ye >= 0 && Ye < v.length; Ye += nt) {
+ var mt = v[Ye], ct = nt > 0 == (mt.level != 1), Et = ct ? Qe.begin : j(Qe.end, -1);
+ if (mt.from <= Et && Et < mt.to || (Et = ct ? mt.from : j(mt.to, -1), Qe.begin <= Et && Et < Qe.end))
+ return ot(Et, ct);
+ }
+ }, Ne = Ie(O + f, f, se);
+ if (Ne)
+ return Ne;
+ var Ue = f > 0 ? se.end : j(se.begin, -1);
+ return Ue != null && !(f > 0 && Ue == l.text.length) && (Ne = Ie(f > 0 ? 0 : v.length - 1, f, ne(Ue)), Ne) ? Ne : null;
+ }
+ var Oa = {
+ selectAll: sm,
+ singleSelection: function(o) {
+ return o.setSelection(o.getCursor("anchor"), o.getCursor("head"), $);
+ },
+ killLine: function(o) {
+ return _o(o, function(l) {
+ if (l.empty()) {
+ var c = ut(o.doc, l.head.line).text.length;
+ return l.head.ch == c && l.head.line < o.lastLine() ? { from: l.head, to: ye(l.head.line + 1, 0) } : { from: l.head, to: ye(l.head.line, c) };
+ } else
+ return { from: l.from(), to: l.to() };
+ });
+ },
+ deleteLine: function(o) {
+ return _o(o, function(l) {
+ return {
+ from: ye(l.from().line, 0),
+ to: _t(o.doc, ye(l.to().line + 1, 0))
+ };
+ });
+ },
+ delLineLeft: function(o) {
+ return _o(o, function(l) {
+ return {
+ from: ye(l.from().line, 0),
+ to: l.from()
+ };
+ });
+ },
+ delWrappedLineLeft: function(o) {
+ return _o(o, function(l) {
+ var c = o.charCoords(l.head, "div").top + 5, f = o.coordsChar({ left: 0, top: c }, "div");
+ return { from: f, to: l.from() };
+ });
+ },
+ delWrappedLineRight: function(o) {
+ return _o(o, function(l) {
+ var c = o.charCoords(l.head, "div").top + 5, f = o.coordsChar({ left: o.display.lineDiv.offsetWidth + 100, top: c }, "div");
+ return { from: l.from(), to: f };
+ });
+ },
+ undo: function(o) {
+ return o.undo();
+ },
+ redo: function(o) {
+ return o.redo();
+ },
+ undoSelection: function(o) {
+ return o.undoSelection();
+ },
+ redoSelection: function(o) {
+ return o.redoSelection();
+ },
+ goDocStart: function(o) {
+ return o.extendSelection(ye(o.firstLine(), 0));
+ },
+ goDocEnd: function(o) {
+ return o.extendSelection(ye(o.lastLine()));
+ },
+ goLineStart: function(o) {
+ return o.extendSelectionsBy(
+ function(l) {
+ return Em(o, l.head.line);
+ },
+ { origin: "+move", bias: 1 }
+ );
+ },
+ goLineStartSmart: function(o) {
+ return o.extendSelectionsBy(
+ function(l) {
+ return xm(o, l.head);
+ },
+ { origin: "+move", bias: 1 }
+ );
+ },
+ goLineEnd: function(o) {
+ return o.extendSelectionsBy(
+ function(l) {
+ return F_(o, l.head.line);
+ },
+ { origin: "+move", bias: -1 }
+ );
+ },
+ goLineRight: function(o) {
+ return o.extendSelectionsBy(function(l) {
+ var c = o.cursorCoords(l.head, "div").top + 5;
+ return o.coordsChar({ left: o.display.lineDiv.offsetWidth + 100, top: c }, "div");
+ }, X);
+ },
+ goLineLeft: function(o) {
+ return o.extendSelectionsBy(function(l) {
+ var c = o.cursorCoords(l.head, "div").top + 5;
+ return o.coordsChar({ left: 0, top: c }, "div");
+ }, X);
+ },
+ goLineLeftSmart: function(o) {
+ return o.extendSelectionsBy(function(l) {
+ var c = o.cursorCoords(l.head, "div").top + 5, f = o.coordsChar({ left: 0, top: c }, "div");
+ return f.ch < o.getLine(f.line).search(/\S/) ? xm(o, l.head) : f;
+ }, X);
+ },
+ goLineUp: function(o) {
+ return o.moveV(-1, "line");
+ },
+ goLineDown: function(o) {
+ return o.moveV(1, "line");
+ },
+ goPageUp: function(o) {
+ return o.moveV(-1, "page");
+ },
+ goPageDown: function(o) {
+ return o.moveV(1, "page");
+ },
+ goCharLeft: function(o) {
+ return o.moveH(-1, "char");
+ },
+ goCharRight: function(o) {
+ return o.moveH(1, "char");
+ },
+ goColumnLeft: function(o) {
+ return o.moveH(-1, "column");
+ },
+ goColumnRight: function(o) {
+ return o.moveH(1, "column");
+ },
+ goWordLeft: function(o) {
+ return o.moveH(-1, "word");
+ },
+ goGroupRight: function(o) {
+ return o.moveH(1, "group");
+ },
+ goGroupLeft: function(o) {
+ return o.moveH(-1, "group");
+ },
+ goWordRight: function(o) {
+ return o.moveH(1, "word");
+ },
+ delCharBefore: function(o) {
+ return o.deleteH(-1, "codepoint");
+ },
+ delCharAfter: function(o) {
+ return o.deleteH(1, "char");
+ },
+ delWordBefore: function(o) {
+ return o.deleteH(-1, "word");
+ },
+ delWordAfter: function(o) {
+ return o.deleteH(1, "word");
+ },
+ delGroupBefore: function(o) {
+ return o.deleteH(-1, "group");
+ },
+ delGroupAfter: function(o) {
+ return o.deleteH(1, "group");
+ },
+ indentAuto: function(o) {
+ return o.indentSelection("smart");
+ },
+ indentMore: function(o) {
+ return o.indentSelection("add");
+ },
+ indentLess: function(o) {
+ return o.indentSelection("subtract");
+ },
+ insertTab: function(o) {
+ return o.replaceSelection(" ");
+ },
+ insertSoftTab: function(o) {
+ for (var l = [], c = o.listSelections(), f = o.options.tabSize, v = 0; v < c.length; v++) {
+ var O = c[v].from(), L = ve(o.getLine(O.line), O.ch, f);
+ l.push(fe(f - L % f));
+ }
+ o.replaceSelections(l);
+ },
+ defaultTab: function(o) {
+ o.somethingSelected() ? o.indentSelection("add") : o.execCommand("insertTab");
+ },
+ transposeChars: function(o) {
+ return Wn(o, function() {
+ for (var l = o.listSelections(), c = [], f = 0; f < l.length; f++)
+ if (!!l[f].empty()) {
+ var v = l[f].head, O = ut(o.doc, v.line).text;
+ if (O) {
+ if (v.ch == O.length && (v = new ye(v.line, v.ch - 1)), v.ch > 0)
+ v = new ye(v.line, v.ch + 1), o.replaceRange(
+ O.charAt(v.ch - 1) + O.charAt(v.ch - 2),
+ ye(v.line, v.ch - 2),
+ v,
+ "+transpose"
+ );
+ else if (v.line > o.doc.first) {
+ var L = ut(o.doc, v.line - 1).text;
+ L && (v = new ye(v.line, 1), o.replaceRange(
+ O.charAt(0) + o.doc.lineSeparator() + L.charAt(L.length - 1),
+ ye(v.line - 1, L.length - 1),
+ v,
+ "+transpose"
+ ));
+ }
+ }
+ c.push(new Pt(v, v));
+ }
+ o.setSelections(c);
+ });
+ },
+ newlineAndIndent: function(o) {
+ return Wn(o, function() {
+ for (var l = o.listSelections(), c = l.length - 1; c >= 0; c--)
+ o.replaceRange(o.doc.lineSeparator(), l[c].anchor, l[c].head, "+input");
+ l = o.listSelections();
+ for (var f = 0; f < l.length; f++)
+ o.indentLine(l[f].from().line, null, !0);
+ co(o);
+ });
+ },
+ openLine: function(o) {
+ return o.replaceSelection(`
+`, "start");
+ },
+ toggleOverwrite: function(o) {
+ return o.toggleOverwrite();
+ }
+ };
+ function Em(o, l) {
+ var c = ut(o.doc, l), f = _i(c);
+ return f != c && (l = Ft(f)), gd(!0, o, f, l, 1);
+ }
+ function F_(o, l) {
+ var c = ut(o.doc, l), f = g1(c);
+ return f != c && (l = Ft(f)), gd(!0, o, c, l, -1);
+ }
+ function xm(o, l) {
+ var c = Em(o, l.line), f = ut(o.doc, c.line), v = ht(f, o.doc.direction);
+ if (!v || v[0].level == 0) {
+ var O = Math.max(c.ch, f.text.search(/\S/)), L = l.line == c.line && l.ch <= O && l.ch;
+ return ye(c.line, L ? 0 : O, c.sticky);
+ }
+ return c;
+ }
+ function Kl(o, l, c) {
+ if (typeof l == "string" && (l = Oa[l], !l))
+ return !1;
+ o.display.input.ensurePolled();
+ var f = o.display.shift, v = !1;
+ try {
+ o.isReadOnly() && (o.state.suppressEdits = !0), c && (o.display.shift = !1), v = l(o) != xe;
+ } finally {
+ o.display.shift = f, o.state.suppressEdits = !1;
+ }
+ return v;
+ }
+ function P_(o, l, c) {
+ for (var f = 0; f < o.state.keyMaps.length; f++) {
+ var v = bo(l, o.state.keyMaps[f], c, o);
+ if (v)
+ return v;
+ }
+ return o.options.extraKeys && bo(l, o.options.extraKeys, c, o) || bo(l, o.options.keyMap, c, o);
+ }
+ var M_ = new we();
+ function $a(o, l, c, f) {
+ var v = o.state.keySeq;
+ if (v) {
+ if (Am(l))
+ return "handled";
+ if (/\'$/.test(l) ? o.state.keySeq = null : M_.set(50, function() {
+ o.state.keySeq == v && (o.state.keySeq = null, o.display.input.reset());
+ }), Tm(o, v + " " + l, c, f))
+ return !0;
+ }
+ return Tm(o, l, c, f);
+ }
+ function Tm(o, l, c, f) {
+ var v = P_(o, l, f);
+ return v == "multi" && (o.state.keySeq = l), v == "handled" && pn(o, "keyHandled", o, l, c), (v == "handled" || v == "multi") && (It(c), qu(o)), !!v;
+ }
+ function km(o, l) {
+ var c = Sm(l, !0);
+ return c ? l.shiftKey && !o.state.keySeq ? $a(o, "Shift-" + c, l, function(f) {
+ return Kl(o, f, !0);
+ }) || $a(o, c, l, function(f) {
+ if (typeof f == "string" ? /^go[A-Z]/.test(f) : f.motion)
+ return Kl(o, f);
+ }) : $a(o, c, l, function(f) {
+ return Kl(o, f);
+ }) : !1;
+ }
+ function L_(o, l, c) {
+ return $a(o, "'" + c + "'", l, function(f) {
+ return Kl(o, f, !0);
+ });
+ }
+ var yd = null;
+ function Om(o) {
+ var l = this;
+ if (!(o.target && o.target != l.display.input.getField()) && (l.curOp.focus = q(te(l)), !Ct(l, o))) {
+ d && p < 11 && o.keyCode == 27 && (o.returnValue = !1);
+ var c = o.keyCode;
+ l.display.shift = c == 16 || o.shiftKey;
+ var f = km(l, o);
+ b && (yd = f ? c : null, !f && c == 88 && !$i && (k ? o.metaKey : o.ctrlKey) && l.replaceSelection("", null, "cut")), n && !k && !f && c == 46 && o.shiftKey && !o.ctrlKey && document.execCommand && document.execCommand("cut"), c == 18 && !/\bCodeMirror-crosshair\b/.test(l.display.lineDiv.className) && N_(l);
+ }
+ }
+ function N_(o) {
+ var l = o.display.lineDiv;
+ Z(l, "CodeMirror-crosshair");
+ function c(f) {
+ (f.keyCode == 18 || !f.altKey) && (V(l, "CodeMirror-crosshair"), lt(document, "keyup", c), lt(document, "mouseover", c));
+ }
+ $e(document, "keyup", c), $e(document, "mouseover", c);
+ }
+ function $m(o) {
+ o.keyCode == 16 && (this.doc.sel.shift = !1), Ct(this, o);
+ }
+ function Rm(o) {
+ var l = this;
+ if (!(o.target && o.target != l.display.input.getField()) && !(Xi(l.display, o) || Ct(l, o) || o.ctrlKey && !o.altKey || k && o.metaKey)) {
+ var c = o.keyCode, f = o.charCode;
+ if (b && c == yd) {
+ yd = null, It(o);
+ return;
+ }
+ if (!(b && (!o.which || o.which < 10) && km(l, o))) {
+ var v = String.fromCharCode(f == null ? c : f);
+ v != "\b" && (L_(l, o, v) || l.display.input.onKeyPress(o));
+ }
+ }
+ }
+ var B_ = 400, bd = function(o, l, c) {
+ this.time = o, this.pos = l, this.button = c;
+ };
+ bd.prototype.compare = function(o, l, c) {
+ return this.time + B_ > o && De(l, this.pos) == 0 && c == this.button;
+ };
+ var Ra, Da;
+ function V_(o, l) {
+ var c = +new Date();
+ return Da && Da.compare(c, o, l) ? (Ra = Da = null, "triple") : Ra && Ra.compare(c, o, l) ? (Da = new bd(c, o, l), Ra = null, "double") : (Ra = new bd(c, o, l), Da = null, "single");
+ }
+ function Dm(o) {
+ var l = this, c = l.display;
+ if (!(Ct(l, o) || c.activeTouch && c.input.supportsTouch())) {
+ if (c.input.ensurePolled(), c.shift = o.shiftKey, Xi(c, o)) {
+ h || (c.scroller.draggable = !1, setTimeout(function() {
+ return c.scroller.draggable = !0;
+ }, 100));
+ return;
+ }
+ if (!_d(l, o)) {
+ var f = Fr(l, o), v = ra(o), O = f ? V_(f, v) : "single";
+ pe(l).focus(), v == 1 && l.state.selectingText && l.state.selectingText(o), !(f && j_(l, v, f, O, o)) && (v == 1 ? f ? H_(l, f, O, o) : Mn(o) == c.scroller && It(o) : v == 2 ? (f && jl(l.doc, f), setTimeout(function() {
+ return c.input.focus();
+ }, 20)) : v == 3 && (T ? l.display.input.onContextMenu(o) : ed(l)));
+ }
+ }
+ }
+ function j_(o, l, c, f, v) {
+ var O = "Click";
+ return f == "double" ? O = "Double" + O : f == "triple" && (O = "Triple" + O), O = (l == 1 ? "Left" : l == 2 ? "Middle" : "Right") + O, $a(o, Cm(O, v), v, function(L) {
+ if (typeof L == "string" && (L = Oa[L]), !L)
+ return !1;
+ var j = !1;
+ try {
+ o.isReadOnly() && (o.state.suppressEdits = !0), j = L(o, c) != xe;
+ } finally {
+ o.state.suppressEdits = !1;
+ }
+ return j;
+ });
+ }
+ function U_(o, l, c) {
+ var f = o.getOption("configureMouse"), v = f ? f(o, l, c) : {};
+ if (v.unit == null) {
+ var O = R ? c.shiftKey && c.metaKey : c.altKey;
+ v.unit = O ? "rectangle" : l == "single" ? "char" : l == "double" ? "word" : "line";
+ }
+ return (v.extend == null || o.doc.extend) && (v.extend = o.doc.extend || c.shiftKey), v.addNew == null && (v.addNew = k ? c.metaKey : c.ctrlKey), v.moveOnDrag == null && (v.moveOnDrag = !(k ? c.altKey : c.ctrlKey)), v;
+ }
+ function H_(o, l, c, f) {
+ d ? setTimeout(ke(Ih, o), 0) : o.curOp.focus = q(te(o));
+ var v = U_(o, c, f), O = o.doc.sel, L;
+ o.options.dragDrop && Du && !o.isReadOnly() && c == "single" && (L = O.contains(l)) > -1 && (De((L = O.ranges[L]).from(), l) < 0 || l.xRel > 0) && (De(L.to(), l) > 0 || l.xRel < 0) ? z_(o, f, l, v) : W_(o, f, l, v);
+ }
+ function z_(o, l, c, f) {
+ var v = o.display, O = !1, L = hn(o, function(ne) {
+ h && (v.scroller.draggable = !1), o.state.draggingText = !1, o.state.delayingBlurEvent && (o.hasFocus() ? o.state.delayingBlurEvent = !1 : ed(o)), lt(v.wrapper.ownerDocument, "mouseup", L), lt(v.wrapper.ownerDocument, "mousemove", j), lt(v.scroller, "dragstart", Q), lt(v.scroller, "drop", L), O || (It(ne), f.addNew || jl(o.doc, c, null, null, f.extend), h && !A || d && p == 9 ? setTimeout(function() {
+ v.wrapper.ownerDocument.body.focus({ preventScroll: !0 }), v.input.focus();
+ }, 20) : v.input.focus());
+ }), j = function(ne) {
+ O = O || Math.abs(l.clientX - ne.clientX) + Math.abs(l.clientY - ne.clientY) >= 10;
+ }, Q = function() {
+ return O = !0;
+ };
+ h && (v.scroller.draggable = !0), o.state.draggingText = L, L.copy = !f.moveOnDrag, $e(v.wrapper.ownerDocument, "mouseup", L), $e(v.wrapper.ownerDocument, "mousemove", j), $e(v.scroller, "dragstart", Q), $e(v.scroller, "drop", L), o.state.delayingBlurEvent = !0, setTimeout(function() {
+ return v.input.focus();
+ }, 20), v.scroller.dragDrop && v.scroller.dragDrop();
+ }
+ function Im(o, l, c) {
+ if (c == "char")
+ return new Pt(l, l);
+ if (c == "word")
+ return o.findWordAt(l);
+ if (c == "line")
+ return new Pt(ye(l.line, 0), _t(o.doc, ye(l.line + 1, 0)));
+ var f = c(o, l);
+ return new Pt(f.from, f.to);
+ }
+ function W_(o, l, c, f) {
+ d && ed(o);
+ var v = o.display, O = o.doc;
+ It(l);
+ var L, j, Q = O.sel, ne = Q.ranges;
+ if (f.addNew && !f.extend ? (j = O.sel.contains(c), j > -1 ? L = ne[j] : L = new Pt(c, c)) : (L = O.sel.primary(), j = O.sel.primIndex), f.unit == "rectangle")
+ f.addNew || (L = new Pt(c, c)), c = Fr(o, l, !0, !0), j = -1;
+ else {
+ var se = Im(o, c, f.unit);
+ f.extend ? L = pd(L, se.anchor, se.head, f.extend) : L = se;
+ }
+ f.addNew ? j == -1 ? (j = ne.length, En(
+ O,
+ Ai(o, ne.concat([L]), j),
+ { scroll: !1, origin: "*mouse" }
+ )) : ne.length > 1 && ne[j].empty() && f.unit == "char" && !f.extend ? (En(
+ O,
+ Ai(o, ne.slice(0, j).concat(ne.slice(j + 1)), 0),
+ { scroll: !1, origin: "*mouse" }
+ ), Q = O.sel) : hd(O, j, L, K) : (j = 0, En(O, new ei([L], 0), K), Q = O.sel);
+ var de = c;
+ function Ee(Qe) {
+ if (De(de, Qe) != 0)
+ if (de = Qe, f.unit == "rectangle") {
+ for (var ot = [], mt = o.options.tabSize, ct = ve(ut(O, c.line).text, c.ch, mt), Et = ve(ut(O, Qe.line).text, Qe.ch, mt), Vt = Math.min(ct, Et), vn = Math.max(ct, Et), Jt = Math.min(c.line, Qe.line), Gn = Math.min(o.lastLine(), Math.max(c.line, Qe.line)); Jt <= Gn; Jt++) {
+ var Bn = ut(O, Jt).text, ln = ie(Bn, Vt, mt);
+ Vt == vn ? ot.push(new Pt(ye(Jt, ln), ye(Jt, ln))) : Bn.length > ln && ot.push(new Pt(ye(Jt, ln), ye(Jt, ie(Bn, vn, mt))));
+ }
+ ot.length || ot.push(new Pt(c, c)), En(
+ O,
+ Ai(o, Q.ranges.slice(0, j).concat(ot), j),
+ { origin: "*mouse", scroll: !1 }
+ ), o.scrollIntoView(Qe);
+ } else {
+ var Vn = L, An = Im(o, Qe, f.unit), dn = Vn.anchor, sn;
+ De(An.anchor, dn) > 0 ? (sn = An.head, dn = un(Vn.from(), An.anchor)) : (sn = An.anchor, dn = Rt(Vn.to(), An.head));
+ var qt = Q.ranges.slice(0);
+ qt[j] = G_(o, new Pt(_t(O, dn), sn)), En(O, Ai(o, qt, j), K);
+ }
+ }
+ var Ce = v.wrapper.getBoundingClientRect(), Ie = 0;
+ function Ne(Qe) {
+ var ot = ++Ie, mt = Fr(o, Qe, !0, f.unit == "rectangle");
+ if (!!mt)
+ if (De(mt, de) != 0) {
+ o.curOp.focus = q(te(o)), Ee(mt);
+ var ct = Pl(v, O);
+ (mt.line >= ct.to || mt.line < ct.from) && setTimeout(hn(o, function() {
+ Ie == ot && Ne(Qe);
+ }), 150);
+ } else {
+ var Et = Qe.clientY < Ce.top ? -20 : Qe.clientY > Ce.bottom ? 20 : 0;
+ Et && setTimeout(hn(o, function() {
+ Ie == ot && (v.scroller.scrollTop += Et, Ne(Qe));
+ }), 50);
+ }
+ }
+ function Ue(Qe) {
+ o.state.selectingText = !1, Ie = 1 / 0, Qe && (It(Qe), v.input.focus()), lt(v.wrapper.ownerDocument, "mousemove", Ye), lt(v.wrapper.ownerDocument, "mouseup", nt), O.history.lastSelOrigin = null;
+ }
+ var Ye = hn(o, function(Qe) {
+ Qe.buttons === 0 || !ra(Qe) ? Ue(Qe) : Ne(Qe);
+ }), nt = hn(o, Ue);
+ o.state.selectingText = nt, $e(v.wrapper.ownerDocument, "mousemove", Ye), $e(v.wrapper.ownerDocument, "mouseup", nt);
+ }
+ function G_(o, l) {
+ var c = l.anchor, f = l.head, v = ut(o.doc, c.line);
+ if (De(c, f) == 0 && c.sticky == f.sticky)
+ return l;
+ var O = ht(v);
+ if (!O)
+ return l;
+ var L = je(O, c.ch, c.sticky), j = O[L];
+ if (j.from != c.ch && j.to != c.ch)
+ return l;
+ var Q = L + (j.from == c.ch == (j.level != 1) ? 0 : 1);
+ if (Q == 0 || Q == O.length)
+ return l;
+ var ne;
+ if (f.line != c.line)
+ ne = (f.line - c.line) * (o.doc.direction == "ltr" ? 1 : -1) > 0;
+ else {
+ var se = je(O, f.ch, f.sticky), de = se - L || (f.ch - c.ch) * (j.level == 1 ? -1 : 1);
+ se == Q - 1 || se == Q ? ne = de < 0 : ne = de > 0;
+ }
+ var Ee = O[Q + (ne ? -1 : 0)], Ce = ne == (Ee.level == 1), Ie = Ce ? Ee.from : Ee.to, Ne = Ce ? "after" : "before";
+ return c.ch == Ie && c.sticky == Ne ? l : new Pt(new ye(c.line, Ie, Ne), f);
+ }
+ function Fm(o, l, c, f) {
+ var v, O;
+ if (l.touches)
+ v = l.touches[0].clientX, O = l.touches[0].clientY;
+ else
+ try {
+ v = l.clientX, O = l.clientY;
+ } catch {
+ return !1;
+ }
+ if (v >= Math.floor(o.display.gutters.getBoundingClientRect().right))
+ return !1;
+ f && It(l);
+ var L = o.display, j = L.lineDiv.getBoundingClientRect();
+ if (O > j.bottom || !Qt(o, c))
+ return ur(l);
+ O -= j.top - L.viewOffset;
+ for (var Q = 0; Q < o.display.gutterSpecs.length; ++Q) {
+ var ne = L.gutters.childNodes[Q];
+ if (ne && ne.getBoundingClientRect().right >= v) {
+ var se = Di(o.doc, O), de = o.display.gutterSpecs[Q];
+ return st(o, c, o, se, de.className, l), ur(l);
+ }
+ }
+ }
+ function _d(o, l) {
+ return Fm(o, l, "gutterClick", !0);
+ }
+ function Pm(o, l) {
+ Xi(o.display, l) || K_(o, l) || Ct(o, l, "contextmenu") || T || o.display.input.onContextMenu(l);
+ }
+ function K_(o, l) {
+ return Qt(o, "gutterContextMenu") ? Fm(o, l, "gutterContextMenu", !1) : !1;
+ }
+ function Mm(o) {
+ o.display.wrapper.className = o.display.wrapper.className.replace(/\s*cm-s-\S+/g, "") + o.options.theme.replace(/(^|\s)\s*/g, " cm-s-"), ca(o);
+ }
+ var wo = { toString: function() {
+ return "CodeMirror.Init";
+ } }, Lm = {}, Yl = {};
+ function Y_(o) {
+ var l = o.optionHandlers;
+ function c(f, v, O, L) {
+ o.defaults[f] = v, O && (l[f] = L ? function(j, Q, ne) {
+ ne != wo && O(j, Q, ne);
+ } : O);
+ }
+ o.defineOption = c, o.Init = wo, c("value", "", function(f, v) {
+ return f.setValue(v);
+ }, !0), c("mode", null, function(f, v) {
+ f.doc.modeOption = v, dd(f);
+ }, !0), c("indentUnit", 2, dd, !0), c("indentWithTabs", !1), c("smartIndent", !0), c("tabSize", 4, function(f) {
+ _a(f), ca(f), Ln(f);
+ }, !0), c("lineSeparator", null, function(f, v) {
+ if (f.doc.lineSep = v, !!v) {
+ var O = [], L = f.doc.first;
+ f.doc.iter(function(Q) {
+ for (var ne = 0; ; ) {
+ var se = Q.text.indexOf(v, ne);
+ if (se == -1)
+ break;
+ ne = se + v.length, O.push(ye(L, se));
+ }
+ L++;
+ });
+ for (var j = O.length - 1; j >= 0; j--)
+ go(f.doc, v, O[j], ye(O[j].line, O[j].ch + v.length));
+ }
+ }), c("specialChars", /[\u0000-\u001f\u007f-\u009f\u00ad\u061c\u200b\u200e\u200f\u2028\u2029\ufeff\ufff9-\ufffc]/g, function(f, v, O) {
+ f.state.specialChars = new RegExp(v.source + (v.test(" ") ? "" : "| "), "g"), O != wo && f.refresh();
+ }), c("specialCharPlaceholder", C1, function(f) {
+ return f.refresh();
+ }, !0), c("electricChars", !0), c("inputStyle", x ? "contenteditable" : "textarea", function() {
+ throw new Error("inputStyle can not (yet) be changed in a running editor");
+ }, !0), c("spellcheck", !1, function(f, v) {
+ return f.getInputField().spellcheck = v;
+ }, !0), c("autocorrect", !1, function(f, v) {
+ return f.getInputField().autocorrect = v;
+ }, !0), c("autocapitalize", !1, function(f, v) {
+ return f.getInputField().autocapitalize = v;
+ }, !0), c("rtlMoveVisually", !M), c("wholeLineUpdateBefore", !0), c("theme", "default", function(f) {
+ Mm(f), ba(f);
+ }, !0), c("keyMap", "default", function(f, v, O) {
+ var L = Gl(v), j = O != wo && Gl(O);
+ j && j.detach && j.detach(f, L), L.attach && L.attach(f, j || null);
+ }), c("extraKeys", null), c("configureMouse", null), c("lineWrapping", !1, J_, !0), c("gutters", [], function(f, v) {
+ f.display.gutterSpecs = sd(v, f.options.lineNumbers), ba(f);
+ }, !0), c("fixedGutter", !0, function(f, v) {
+ f.display.gutters.style.left = v ? Ju(f.display) + "px" : "0", f.refresh();
+ }, !0), c("coverGutterNextToScrollbar", !1, function(f) {
+ return po(f);
+ }, !0), c("scrollbarStyle", "native", function(f) {
+ Bh(f), po(f), f.display.scrollbars.setScrollTop(f.doc.scrollTop), f.display.scrollbars.setScrollLeft(f.doc.scrollLeft);
+ }, !0), c("lineNumbers", !1, function(f, v) {
+ f.display.gutterSpecs = sd(f.options.gutters, v), ba(f);
+ }, !0), c("firstLineNumber", 1, ba, !0), c("lineNumberFormatter", function(f) {
+ return f;
+ }, ba, !0), c("showCursorWhenSelecting", !1, pa, !0), c("resetSelectionOnContextMenu", !0), c("lineWiseCopyCut", !0), c("pasteLinesPerSelection", !0), c("selectionsMayTouch", !1), c("readOnly", !1, function(f, v) {
+ v == "nocursor" && (fo(f), f.display.input.blur()), f.display.input.readOnlyChanged(v);
+ }), c("screenReaderLabel", null, function(f, v) {
+ v = v === "" ? null : v, f.display.input.screenReaderLabelChanged(v);
+ }), c("disableInput", !1, function(f, v) {
+ v || f.display.input.reset();
+ }, !0), c("dragDrop", !0, Q_), c("allowDropFileTypes", null), c("cursorBlinkRate", 530), c("cursorScrollMargin", 0), c("cursorHeight", 1, pa, !0), c("singleCursorHeightPerLine", !0, pa, !0), c("workTime", 100), c("workDelay", 100), c("flattenSpans", !0, _a, !0), c("addModeClass", !1, _a, !0), c("pollInterval", 100), c("undoDepth", 200, function(f, v) {
+ return f.doc.history.undoDepth = v;
+ }), c("historyEventDelay", 1250), c("viewportMargin", 10, function(f) {
+ return f.refresh();
+ }, !0), c("maxHighlightLength", 1e4, _a, !0), c("moveInputWithCursor", !0, function(f, v) {
+ v || f.display.input.resetPosition();
+ }), c("tabindex", null, function(f, v) {
+ return f.display.input.getField().tabIndex = v || "";
+ }), c("autofocus", null), c("direction", "ltr", function(f, v) {
+ return f.doc.setDirection(v);
+ }, !0), c("phrases", null);
+ }
+ function Q_(o, l, c) {
+ var f = c && c != wo;
+ if (!l != !f) {
+ var v = o.display.dragFunctions, O = l ? $e : lt;
+ O(o.display.scroller, "dragstart", v.start), O(o.display.scroller, "dragenter", v.enter), O(o.display.scroller, "dragover", v.over), O(o.display.scroller, "dragleave", v.leave), O(o.display.scroller, "drop", v.drop);
+ }
+ }
+ function J_(o) {
+ o.options.lineWrapping ? (Z(o.display.wrapper, "CodeMirror-wrap"), o.display.sizer.style.minWidth = "", o.display.sizerWidth = null) : (V(o.display.wrapper, "CodeMirror-wrap"), Vu(o)), Xu(o), Ln(o), ca(o), setTimeout(function() {
+ return po(o);
+ }, 100);
+ }
+ function Kt(o, l) {
+ var c = this;
+ if (!(this instanceof Kt))
+ return new Kt(o, l);
+ this.options = l = l ? ge(l) : {}, ge(Lm, l, !1);
+ var f = l.value;
+ typeof f == "string" ? f = new Nn(f, l.mode, null, l.lineSeparator, l.direction) : l.mode && (f.modeOption = l.mode), this.doc = f;
+ var v = new Kt.inputStyles[l.inputStyle](this), O = this.display = new u_(o, f, v, l);
+ O.wrapper.CodeMirror = this, Mm(this), l.lineWrapping && (this.display.wrapper.className += " CodeMirror-wrap"), Bh(this), this.state = {
+ keyMaps: [],
+ overlays: [],
+ modeGen: 0,
+ overwrite: !1,
+ delayingBlurEvent: !1,
+ focused: !1,
+ suppressEdits: !1,
+ pasteIncoming: -1,
+ cutIncoming: -1,
+ selectingText: !1,
+ draggingText: !1,
+ highlight: new we(),
+ keySeq: null,
+ specialChars: null
+ }, l.autofocus && !x && O.input.focus(), d && p < 11 && setTimeout(function() {
+ return c.display.input.reset(!0);
+ }, 20), X_(this), k_(), Nr(this), this.curOp.forceUpdate = !0, Qh(this, f), l.autofocus && !x || this.hasFocus() ? setTimeout(function() {
+ c.hasFocus() && !c.state.focused && td(c);
+ }, 20) : fo(this);
+ for (var L in Yl)
+ Yl.hasOwnProperty(L) && Yl[L](this, l[L], wo);
+ Uh(this), l.finishInit && l.finishInit(this);
+ for (var j = 0; j < wd.length; ++j)
+ wd[j](this);
+ Br(this), h && l.lineWrapping && getComputedStyle(O.lineDiv).textRendering == "optimizelegibility" && (O.lineDiv.style.textRendering = "auto");
+ }
+ Kt.defaults = Lm, Kt.optionHandlers = Yl;
+ function X_(o) {
+ var l = o.display;
+ $e(l.scroller, "mousedown", hn(o, Dm)), d && p < 11 ? $e(l.scroller, "dblclick", hn(o, function(Q) {
+ if (!Ct(o, Q)) {
+ var ne = Fr(o, Q);
+ if (!(!ne || _d(o, Q) || Xi(o.display, Q))) {
+ It(Q);
+ var se = o.findWordAt(ne);
+ jl(o.doc, se.anchor, se.head);
+ }
+ }
+ })) : $e(l.scroller, "dblclick", function(Q) {
+ return Ct(o, Q) || It(Q);
+ }), $e(l.scroller, "contextmenu", function(Q) {
+ return Pm(o, Q);
+ }), $e(l.input.getField(), "contextmenu", function(Q) {
+ l.scroller.contains(Q.target) || Pm(o, Q);
+ });
+ var c, f = { end: 0 };
+ function v() {
+ l.activeTouch && (c = setTimeout(function() {
+ return l.activeTouch = null;
+ }, 1e3), f = l.activeTouch, f.end = +new Date());
+ }
+ function O(Q) {
+ if (Q.touches.length != 1)
+ return !1;
+ var ne = Q.touches[0];
+ return ne.radiusX <= 1 && ne.radiusY <= 1;
+ }
+ function L(Q, ne) {
+ if (ne.left == null)
+ return !0;
+ var se = ne.left - Q.left, de = ne.top - Q.top;
+ return se * se + de * de > 20 * 20;
+ }
+ $e(l.scroller, "touchstart", function(Q) {
+ if (!Ct(o, Q) && !O(Q) && !_d(o, Q)) {
+ l.input.ensurePolled(), clearTimeout(c);
+ var ne = +new Date();
+ l.activeTouch = {
+ start: ne,
+ moved: !1,
+ prev: ne - f.end <= 300 ? f : null
+ }, Q.touches.length == 1 && (l.activeTouch.left = Q.touches[0].pageX, l.activeTouch.top = Q.touches[0].pageY);
+ }
+ }), $e(l.scroller, "touchmove", function() {
+ l.activeTouch && (l.activeTouch.moved = !0);
+ }), $e(l.scroller, "touchend", function(Q) {
+ var ne = l.activeTouch;
+ if (ne && !Xi(l, Q) && ne.left != null && !ne.moved && new Date() - ne.start < 300) {
+ var se = o.coordsChar(l.activeTouch, "page"), de;
+ !ne.prev || L(ne, ne.prev) ? de = new Pt(se, se) : !ne.prev.prev || L(ne, ne.prev.prev) ? de = o.findWordAt(se) : de = new Pt(ye(se.line, 0), _t(o.doc, ye(se.line + 1, 0))), o.setSelection(de.anchor, de.head), o.focus(), It(Q);
+ }
+ v();
+ }), $e(l.scroller, "touchcancel", v), $e(l.scroller, "scroll", function() {
+ l.scroller.clientHeight && (ma(o, l.scroller.scrollTop), Mr(o, l.scroller.scrollLeft, !0), st(o, "scroll", o));
+ }), $e(l.scroller, "mousewheel", function(Q) {
+ return Wh(o, Q);
+ }), $e(l.scroller, "DOMMouseScroll", function(Q) {
+ return Wh(o, Q);
+ }), $e(l.wrapper, "scroll", function() {
+ return l.wrapper.scrollTop = l.wrapper.scrollLeft = 0;
+ }), l.dragFunctions = {
+ enter: function(Q) {
+ Ct(o, Q) || yi(Q);
+ },
+ over: function(Q) {
+ Ct(o, Q) || (T_(o, Q), yi(Q));
+ },
+ start: function(Q) {
+ return x_(o, Q);
+ },
+ drop: hn(o, E_),
+ leave: function(Q) {
+ Ct(o, Q) || bm(o);
+ }
+ };
+ var j = l.input.getField();
+ $e(j, "keyup", function(Q) {
+ return $m.call(o, Q);
+ }), $e(j, "keydown", hn(o, Om)), $e(j, "keypress", hn(o, Rm)), $e(j, "focus", function(Q) {
+ return td(o, Q);
+ }), $e(j, "blur", function(Q) {
+ return fo(o, Q);
+ });
+ }
+ var wd = [];
+ Kt.defineInitHook = function(o) {
+ return wd.push(o);
+ };
+ function Ia(o, l, c, f) {
+ var v = o.doc, O;
+ c == null && (c = "add"), c == "smart" && (v.mode.indent ? O = la(o, l).state : c = "prev");
+ var L = o.options.tabSize, j = ut(v, l), Q = ve(j.text, null, L);
+ j.stateAfter && (j.stateAfter = null);
+ var ne = j.text.match(/^\s*/)[0], se;
+ if (!f && !/\S/.test(j.text))
+ se = 0, c = "not";
+ else if (c == "smart" && (se = v.mode.indent(O, j.text.slice(ne.length), j.text), se == xe || se > 150)) {
+ if (!f)
+ return;
+ c = "prev";
+ }
+ c == "prev" ? l > v.first ? se = ve(ut(v, l - 1).text, null, L) : se = 0 : c == "add" ? se = Q + o.options.indentUnit : c == "subtract" ? se = Q - o.options.indentUnit : typeof c == "number" && (se = Q + c), se = Math.max(0, se);
+ var de = "", Ee = 0;
+ if (o.options.indentWithTabs)
+ for (var Ce = Math.floor(se / L); Ce; --Ce)
+ Ee += L, de += " ";
+ if (Ee < se && (de += fe(se - Ee)), de != ne)
+ return go(v, de, ye(l, 0), ye(l, ne.length), "+input"), j.stateAfter = null, !0;
+ for (var Ie = 0; Ie < v.sel.ranges.length; Ie++) {
+ var Ne = v.sel.ranges[Ie];
+ if (Ne.head.line == l && Ne.head.ch < ne.length) {
+ var Ue = ye(l, ne.length);
+ hd(v, Ie, new Pt(Ue, Ue));
break;
}
}
- f.push(O);
}
- Wn(o, function() {
- for (var j = f.length - 1; j >= 0; j--)
- yo(o.doc, "", f[j].from, f[j].to, "+delete");
- po(o);
- });
- }
- function md(o, l, c) {
- var f = at(o.text, l + c, c);
- return f < 0 || f > o.text.length ? null : f;
- }
- function vd(o, l, c) {
- var f = md(o, l.ch, c);
- return f == null ? null : new ye(l.line, f, c < 0 ? "after" : "before");
- }
- function gd(o, l, c, f, v) {
- if (o) {
- l.doc.direction == "rtl" && (v = -v);
- var O = ht(c, l.doc.direction);
- if (O) {
- var L = v < 0 ? Ae(O) : O[0], j = v < 0 == (L.level == 1), Q = j ? "after" : "before", ne;
- if (L.level > 0 || l.doc.direction == "rtl") {
- var se = so(l, c);
- ne = v < 0 ? c.text.length - 1 : 0;
- var de = Pi(l, se, ne).top;
- ne = We(function(Ee) {
- return Pi(l, se, Ee).top == de;
- }, v < 0 == (L.level == 1) ? L.from : L.to - 1, ne), Q == "before" && (ne = md(c, ne, 1));
- } else
- ne = v < 0 ? L.to : L.from;
- return new ye(f, ne, Q);
- }
+ var Ci = null;
+ function Ql(o) {
+ Ci = o;
}
- return new ye(f, v < 0 ? c.text.length : 0, v < 0 ? "before" : "after");
- }
- function R_(o, l, c, f) {
- var v = ht(l, o.doc.direction);
- if (!v)
- return vd(l, c, f);
- c.ch >= l.text.length ? (c.ch = l.text.length, c.sticky = "before") : c.ch <= 0 && (c.ch = 0, c.sticky = "after");
- var O = je(v, c.ch, c.sticky), L = v[O];
- if (o.doc.direction == "ltr" && L.level % 2 == 0 && (f > 0 ? L.to > c.ch : L.from < c.ch))
- return vd(l, c, f);
- var j = function(Ye, nt) {
- return md(l, Ye instanceof ye ? Ye.ch : Ye, nt);
- }, Q, ne = function(Ye) {
- return o.options.lineWrapping ? (Q = Q || so(o, l), kh(o, l, Q, Ye)) : { begin: 0, end: l.text.length };
- }, se = ne(c.sticky == "before" ? j(c, -1) : c.ch);
- if (o.doc.direction == "rtl" || L.level == 1) {
- var de = L.level == 1 == f < 0, Ee = j(c, de ? 1 : -1);
- if (Ee != null && (de ? Ee <= L.to && Ee <= se.end : Ee >= L.from && Ee >= se.begin)) {
- var Ce = de ? "before" : "after";
- return new ye(c.line, Ee, Ce);
- }
- }
- var Ie = function(Ye, nt, Qe) {
- for (var ot = function(Vt, vn) {
- return vn ? new ye(c.line, j(Vt, 1), "before") : new ye(c.line, Vt, "after");
- }; Ye >= 0 && Ye < v.length; Ye += nt) {
- var mt = v[Ye], ct = nt > 0 == (mt.level != 1), Et = ct ? Qe.begin : j(Qe.end, -1);
- if (mt.from <= Et && Et < mt.to || (Et = ct ? mt.from : j(mt.to, -1), Qe.begin <= Et && Et < Qe.end))
- return ot(Et, ct);
- }
- }, Ne = Ie(O + f, f, se);
- if (Ne)
- return Ne;
- var Ue = f > 0 ? se.end : j(se.begin, -1);
- return Ue != null && !(f > 0 && Ue == l.text.length) && (Ne = Ie(f > 0 ? 0 : v.length - 1, f, ne(Ue)), Ne) ? Ne : null;
- }
- var Oa = {
- selectAll: lm,
- singleSelection: function(o) {
- return o.setSelection(o.getCursor("anchor"), o.getCursor("head"), $);
- },
- killLine: function(o) {
- return wo(o, function(l) {
- if (l.empty()) {
- var c = ut(o.doc, l.head.line).text.length;
- return l.head.ch == c && l.head.line < o.lastLine() ? { from: l.head, to: ye(l.head.line + 1, 0) } : { from: l.head, to: ye(l.head.line, c) };
- } else
- return { from: l.from(), to: l.to() };
- });
- },
- deleteLine: function(o) {
- return wo(o, function(l) {
- return {
- from: ye(l.from().line, 0),
- to: _t(o.doc, ye(l.to().line + 1, 0))
- };
- });
- },
- delLineLeft: function(o) {
- return wo(o, function(l) {
- return {
- from: ye(l.from().line, 0),
- to: l.from()
- };
- });
- },
- delWrappedLineLeft: function(o) {
- return wo(o, function(l) {
- var c = o.charCoords(l.head, "div").top + 5, f = o.coordsChar({ left: 0, top: c }, "div");
- return { from: f, to: l.from() };
- });
- },
- delWrappedLineRight: function(o) {
- return wo(o, function(l) {
- var c = o.charCoords(l.head, "div").top + 5, f = o.coordsChar({ left: o.display.lineDiv.offsetWidth + 100, top: c }, "div");
- return { from: l.from(), to: f };
- });
- },
- undo: function(o) {
- return o.undo();
- },
- redo: function(o) {
- return o.redo();
- },
- undoSelection: function(o) {
- return o.undoSelection();
- },
- redoSelection: function(o) {
- return o.redoSelection();
- },
- goDocStart: function(o) {
- return o.extendSelection(ye(o.firstLine(), 0));
- },
- goDocEnd: function(o) {
- return o.extendSelection(ye(o.lastLine()));
- },
- goLineStart: function(o) {
- return o.extendSelectionsBy(
- function(l) {
- return Sm(o, l.head.line);
- },
- { origin: "+move", bias: 1 }
- );
- },
- goLineStartSmart: function(o) {
- return o.extendSelectionsBy(
- function(l) {
- return Em(o, l.head);
- },
- { origin: "+move", bias: 1 }
- );
- },
- goLineEnd: function(o) {
- return o.extendSelectionsBy(
- function(l) {
- return D_(o, l.head.line);
- },
- { origin: "+move", bias: -1 }
- );
- },
- goLineRight: function(o) {
- return o.extendSelectionsBy(function(l) {
- var c = o.cursorCoords(l.head, "div").top + 5;
- return o.coordsChar({ left: o.display.lineDiv.offsetWidth + 100, top: c }, "div");
- }, X);
- },
- goLineLeft: function(o) {
- return o.extendSelectionsBy(function(l) {
- var c = o.cursorCoords(l.head, "div").top + 5;
- return o.coordsChar({ left: 0, top: c }, "div");
- }, X);
- },
- goLineLeftSmart: function(o) {
- return o.extendSelectionsBy(function(l) {
- var c = o.cursorCoords(l.head, "div").top + 5, f = o.coordsChar({ left: 0, top: c }, "div");
- return f.ch < o.getLine(f.line).search(/\S/) ? Em(o, l.head) : f;
- }, X);
- },
- goLineUp: function(o) {
- return o.moveV(-1, "line");
- },
- goLineDown: function(o) {
- return o.moveV(1, "line");
- },
- goPageUp: function(o) {
- return o.moveV(-1, "page");
- },
- goPageDown: function(o) {
- return o.moveV(1, "page");
- },
- goCharLeft: function(o) {
- return o.moveH(-1, "char");
- },
- goCharRight: function(o) {
- return o.moveH(1, "char");
- },
- goColumnLeft: function(o) {
- return o.moveH(-1, "column");
- },
- goColumnRight: function(o) {
- return o.moveH(1, "column");
- },
- goWordLeft: function(o) {
- return o.moveH(-1, "word");
- },
- goGroupRight: function(o) {
- return o.moveH(1, "group");
- },
- goGroupLeft: function(o) {
- return o.moveH(-1, "group");
- },
- goWordRight: function(o) {
- return o.moveH(1, "word");
- },
- delCharBefore: function(o) {
- return o.deleteH(-1, "codepoint");
- },
- delCharAfter: function(o) {
- return o.deleteH(1, "char");
- },
- delWordBefore: function(o) {
- return o.deleteH(-1, "word");
- },
- delWordAfter: function(o) {
- return o.deleteH(1, "word");
- },
- delGroupBefore: function(o) {
- return o.deleteH(-1, "group");
- },
- delGroupAfter: function(o) {
- return o.deleteH(1, "group");
- },
- indentAuto: function(o) {
- return o.indentSelection("smart");
- },
- indentMore: function(o) {
- return o.indentSelection("add");
- },
- indentLess: function(o) {
- return o.indentSelection("subtract");
- },
- insertTab: function(o) {
- return o.replaceSelection(" ");
- },
- insertSoftTab: function(o) {
- for (var l = [], c = o.listSelections(), f = o.options.tabSize, v = 0; v < c.length; v++) {
- var O = c[v].from(), L = ve(o.getLine(O.line), O.ch, f);
- l.push(fe(f - L % f));
- }
- o.replaceSelections(l);
- },
- defaultTab: function(o) {
- o.somethingSelected() ? o.indentSelection("add") : o.execCommand("insertTab");
- },
- transposeChars: function(o) {
- return Wn(o, function() {
- for (var l = o.listSelections(), c = [], f = 0; f < l.length; f++)
- if (!!l[f].empty()) {
- var v = l[f].head, O = ut(o.doc, v.line).text;
- if (O) {
- if (v.ch == O.length && (v = new ye(v.line, v.ch - 1)), v.ch > 0)
- v = new ye(v.line, v.ch + 1), o.replaceRange(
- O.charAt(v.ch - 1) + O.charAt(v.ch - 2),
- ye(v.line, v.ch - 2),
- v,
- "+transpose"
- );
- else if (v.line > o.doc.first) {
- var L = ut(o.doc, v.line - 1).text;
- L && (v = new ye(v.line, 1), o.replaceRange(
- O.charAt(0) + o.doc.lineSeparator() + L.charAt(L.length - 1),
- ye(v.line - 1, L.length - 1),
- v,
- "+transpose"
- ));
- }
- }
- c.push(new Pt(v, v));
- }
- o.setSelections(c);
- });
- },
- newlineAndIndent: function(o) {
- return Wn(o, function() {
- for (var l = o.listSelections(), c = l.length - 1; c >= 0; c--)
- o.replaceRange(o.doc.lineSeparator(), l[c].anchor, l[c].head, "+input");
- l = o.listSelections();
- for (var f = 0; f < l.length; f++)
- o.indentLine(l[f].from().line, null, !0);
- po(o);
- });
- },
- openLine: function(o) {
- return o.replaceSelection(`
-`, "start");
- },
- toggleOverwrite: function(o) {
- return o.toggleOverwrite();
- }
- };
- function Sm(o, l) {
- var c = ut(o.doc, l), f = _i(c);
- return f != c && (l = Ft(f)), gd(!0, o, f, l, 1);
- }
- function D_(o, l) {
- var c = ut(o.doc, l), f = m1(c);
- return f != c && (l = Ft(f)), gd(!0, o, c, l, -1);
- }
- function Em(o, l) {
- var c = Sm(o, l.line), f = ut(o.doc, c.line), v = ht(f, o.doc.direction);
- if (!v || v[0].level == 0) {
- var O = Math.max(c.ch, f.text.search(/\S/)), L = l.line == c.line && l.ch <= O && l.ch;
- return ye(c.line, L ? 0 : O, c.sticky);
- }
- return c;
- }
- function Kl(o, l, c) {
- if (typeof l == "string" && (l = Oa[l], !l))
- return !1;
- o.display.input.ensurePolled();
- var f = o.display.shift, v = !1;
- try {
- o.isReadOnly() && (o.state.suppressEdits = !0), c && (o.display.shift = !1), v = l(o) != xe;
- } finally {
- o.display.shift = f, o.state.suppressEdits = !1;
- }
- return v;
- }
- function I_(o, l, c) {
- for (var f = 0; f < o.state.keyMaps.length; f++) {
- var v = _o(l, o.state.keyMaps[f], c, o);
- if (v)
- return v;
- }
- return o.options.extraKeys && _o(l, o.options.extraKeys, c, o) || _o(l, o.options.keyMap, c, o);
- }
- var F_ = new we();
- function $a(o, l, c, f) {
- var v = o.state.keySeq;
- if (v) {
- if (wm(l))
- return "handled";
- if (/\'$/.test(l) ? o.state.keySeq = null : F_.set(50, function() {
- o.state.keySeq == v && (o.state.keySeq = null, o.display.input.reset());
- }), xm(o, v + " " + l, c, f))
- return !0;
- }
- return xm(o, l, c, f);
- }
- function xm(o, l, c, f) {
- var v = I_(o, l, f);
- return v == "multi" && (o.state.keySeq = l), v == "handled" && pn(o, "keyHandled", o, l, c), (v == "handled" || v == "multi") && (It(c), qu(o)), !!v;
- }
- function Tm(o, l) {
- var c = Cm(l, !0);
- return c ? l.shiftKey && !o.state.keySeq ? $a(o, "Shift-" + c, l, function(f) {
- return Kl(o, f, !0);
- }) || $a(o, c, l, function(f) {
- if (typeof f == "string" ? /^go[A-Z]/.test(f) : f.motion)
- return Kl(o, f);
- }) : $a(o, c, l, function(f) {
- return Kl(o, f);
- }) : !1;
- }
- function P_(o, l, c) {
- return $a(o, "'" + c + "'", l, function(f) {
- return Kl(o, f, !0);
- });
- }
- var yd = null;
- function km(o) {
- var l = this;
- if (!(o.target && o.target != l.display.input.getField()) && (l.curOp.focus = q(te(l)), !Ct(l, o))) {
- d && p < 11 && o.keyCode == 27 && (o.returnValue = !1);
- var c = o.keyCode;
- l.display.shift = c == 16 || o.shiftKey;
- var f = Tm(l, o);
- b && (yd = f ? c : null, !f && c == 88 && !$i && (k ? o.metaKey : o.ctrlKey) && l.replaceSelection("", null, "cut")), n && !k && !f && c == 46 && o.shiftKey && !o.ctrlKey && document.execCommand && document.execCommand("cut"), c == 18 && !/\bCodeMirror-crosshair\b/.test(l.display.lineDiv.className) && M_(l);
- }
- }
- function M_(o) {
- var l = o.display.lineDiv;
- Z(l, "CodeMirror-crosshair");
- function c(f) {
- (f.keyCode == 18 || !f.altKey) && (V(l, "CodeMirror-crosshair"), lt(document, "keyup", c), lt(document, "mouseover", c));
- }
- $e(document, "keyup", c), $e(document, "mouseover", c);
- }
- function Om(o) {
- o.keyCode == 16 && (this.doc.sel.shift = !1), Ct(this, o);
- }
- function $m(o) {
- var l = this;
- if (!(o.target && o.target != l.display.input.getField()) && !(Xi(l.display, o) || Ct(l, o) || o.ctrlKey && !o.altKey || k && o.metaKey)) {
- var c = o.keyCode, f = o.charCode;
- if (b && c == yd) {
- yd = null, It(o);
- return;
- }
- if (!(b && (!o.which || o.which < 10) && Tm(l, o))) {
- var v = String.fromCharCode(f == null ? c : f);
- v != "\b" && (P_(l, o, v) || l.display.input.onKeyPress(o));
- }
- }
- }
- var L_ = 400, bd = function(o, l, c) {
- this.time = o, this.pos = l, this.button = c;
- };
- bd.prototype.compare = function(o, l, c) {
- return this.time + L_ > o && De(l, this.pos) == 0 && c == this.button;
- };
- var Ra, Da;
- function N_(o, l) {
- var c = +new Date();
- return Da && Da.compare(c, o, l) ? (Ra = Da = null, "triple") : Ra && Ra.compare(c, o, l) ? (Da = new bd(c, o, l), Ra = null, "double") : (Ra = new bd(c, o, l), Da = null, "single");
- }
- function Rm(o) {
- var l = this, c = l.display;
- if (!(Ct(l, o) || c.activeTouch && c.input.supportsTouch())) {
- if (c.input.ensurePolled(), c.shift = o.shiftKey, Xi(c, o)) {
- h || (c.scroller.draggable = !1, setTimeout(function() {
- return c.scroller.draggable = !0;
- }, 100));
- return;
- }
- if (!_d(l, o)) {
- var f = Fr(l, o), v = ra(o), O = f ? N_(f, v) : "single";
- pe(l).focus(), v == 1 && l.state.selectingText && l.state.selectingText(o), !(f && B_(l, v, f, O, o)) && (v == 1 ? f ? j_(l, f, O, o) : Mn(o) == c.scroller && It(o) : v == 2 ? (f && jl(l.doc, f), setTimeout(function() {
- return c.input.focus();
- }, 20)) : v == 3 && (T ? l.display.input.onContextMenu(o) : ed(l)));
- }
- }
- }
- function B_(o, l, c, f, v) {
- var O = "Click";
- return f == "double" ? O = "Double" + O : f == "triple" && (O = "Triple" + O), O = (l == 1 ? "Left" : l == 2 ? "Middle" : "Right") + O, $a(o, Am(O, v), v, function(L) {
- if (typeof L == "string" && (L = Oa[L]), !L)
- return !1;
- var j = !1;
- try {
- o.isReadOnly() && (o.state.suppressEdits = !0), j = L(o, c) != xe;
- } finally {
- o.state.suppressEdits = !1;
- }
- return j;
- });
- }
- function V_(o, l, c) {
- var f = o.getOption("configureMouse"), v = f ? f(o, l, c) : {};
- if (v.unit == null) {
- var O = R ? c.shiftKey && c.metaKey : c.altKey;
- v.unit = O ? "rectangle" : l == "single" ? "char" : l == "double" ? "word" : "line";
- }
- return (v.extend == null || o.doc.extend) && (v.extend = o.doc.extend || c.shiftKey), v.addNew == null && (v.addNew = k ? c.metaKey : c.ctrlKey), v.moveOnDrag == null && (v.moveOnDrag = !(k ? c.altKey : c.ctrlKey)), v;
- }
- function j_(o, l, c, f) {
- d ? setTimeout(ke(Dh, o), 0) : o.curOp.focus = q(te(o));
- var v = V_(o, c, f), O = o.doc.sel, L;
- o.options.dragDrop && Du && !o.isReadOnly() && c == "single" && (L = O.contains(l)) > -1 && (De((L = O.ranges[L]).from(), l) < 0 || l.xRel > 0) && (De(L.to(), l) > 0 || l.xRel < 0) ? U_(o, f, l, v) : H_(o, f, l, v);
- }
- function U_(o, l, c, f) {
- var v = o.display, O = !1, L = hn(o, function(ne) {
- h && (v.scroller.draggable = !1), o.state.draggingText = !1, o.state.delayingBlurEvent && (o.hasFocus() ? o.state.delayingBlurEvent = !1 : ed(o)), lt(v.wrapper.ownerDocument, "mouseup", L), lt(v.wrapper.ownerDocument, "mousemove", j), lt(v.scroller, "dragstart", Q), lt(v.scroller, "drop", L), O || (It(ne), f.addNew || jl(o.doc, c, null, null, f.extend), h && !A || d && p == 9 ? setTimeout(function() {
- v.wrapper.ownerDocument.body.focus({ preventScroll: !0 }), v.input.focus();
- }, 20) : v.input.focus());
- }), j = function(ne) {
- O = O || Math.abs(l.clientX - ne.clientX) + Math.abs(l.clientY - ne.clientY) >= 10;
- }, Q = function() {
- return O = !0;
- };
- h && (v.scroller.draggable = !0), o.state.draggingText = L, L.copy = !f.moveOnDrag, $e(v.wrapper.ownerDocument, "mouseup", L), $e(v.wrapper.ownerDocument, "mousemove", j), $e(v.scroller, "dragstart", Q), $e(v.scroller, "drop", L), o.state.delayingBlurEvent = !0, setTimeout(function() {
- return v.input.focus();
- }, 20), v.scroller.dragDrop && v.scroller.dragDrop();
- }
- function Dm(o, l, c) {
- if (c == "char")
- return new Pt(l, l);
- if (c == "word")
- return o.findWordAt(l);
- if (c == "line")
- return new Pt(ye(l.line, 0), _t(o.doc, ye(l.line + 1, 0)));
- var f = c(o, l);
- return new Pt(f.from, f.to);
- }
- function H_(o, l, c, f) {
- d && ed(o);
- var v = o.display, O = o.doc;
- It(l);
- var L, j, Q = O.sel, ne = Q.ranges;
- if (f.addNew && !f.extend ? (j = O.sel.contains(c), j > -1 ? L = ne[j] : L = new Pt(c, c)) : (L = O.sel.primary(), j = O.sel.primIndex), f.unit == "rectangle")
- f.addNew || (L = new Pt(c, c)), c = Fr(o, l, !0, !0), j = -1;
- else {
- var se = Dm(o, c, f.unit);
- f.extend ? L = pd(L, se.anchor, se.head, f.extend) : L = se;
- }
- f.addNew ? j == -1 ? (j = ne.length, En(
- O,
- Ai(o, ne.concat([L]), j),
- { scroll: !1, origin: "*mouse" }
- )) : ne.length > 1 && ne[j].empty() && f.unit == "char" && !f.extend ? (En(
- O,
- Ai(o, ne.slice(0, j).concat(ne.slice(j + 1)), 0),
- { scroll: !1, origin: "*mouse" }
- ), Q = O.sel) : hd(O, j, L, K) : (j = 0, En(O, new ei([L], 0), K), Q = O.sel);
- var de = c;
- function Ee(Qe) {
- if (De(de, Qe) != 0)
- if (de = Qe, f.unit == "rectangle") {
- for (var ot = [], mt = o.options.tabSize, ct = ve(ut(O, c.line).text, c.ch, mt), Et = ve(ut(O, Qe.line).text, Qe.ch, mt), Vt = Math.min(ct, Et), vn = Math.max(ct, Et), Jt = Math.min(c.line, Qe.line), Gn = Math.min(o.lastLine(), Math.max(c.line, Qe.line)); Jt <= Gn; Jt++) {
- var Bn = ut(O, Jt).text, ln = ie(Bn, Vt, mt);
- Vt == vn ? ot.push(new Pt(ye(Jt, ln), ye(Jt, ln))) : Bn.length > ln && ot.push(new Pt(ye(Jt, ln), ye(Jt, ie(Bn, vn, mt))));
- }
- ot.length || ot.push(new Pt(c, c)), En(
- O,
- Ai(o, Q.ranges.slice(0, j).concat(ot), j),
- { origin: "*mouse", scroll: !1 }
- ), o.scrollIntoView(Qe);
- } else {
- var Vn = L, An = Dm(o, Qe, f.unit), dn = Vn.anchor, sn;
- De(An.anchor, dn) > 0 ? (sn = An.head, dn = un(Vn.from(), An.anchor)) : (sn = An.anchor, dn = Rt(Vn.to(), An.head));
- var qt = Q.ranges.slice(0);
- qt[j] = z_(o, new Pt(_t(O, dn), sn)), En(O, Ai(o, qt, j), K);
- }
- }
- var Ce = v.wrapper.getBoundingClientRect(), Ie = 0;
- function Ne(Qe) {
- var ot = ++Ie, mt = Fr(o, Qe, !0, f.unit == "rectangle");
- if (!!mt)
- if (De(mt, de) != 0) {
- o.curOp.focus = q(te(o)), Ee(mt);
- var ct = Pl(v, O);
- (mt.line >= ct.to || mt.line < ct.from) && setTimeout(hn(o, function() {
- Ie == ot && Ne(Qe);
- }), 150);
- } else {
- var Et = Qe.clientY < Ce.top ? -20 : Qe.clientY > Ce.bottom ? 20 : 0;
- Et && setTimeout(hn(o, function() {
- Ie == ot && (v.scroller.scrollTop += Et, Ne(Qe));
- }), 50);
- }
- }
- function Ue(Qe) {
- o.state.selectingText = !1, Ie = 1 / 0, Qe && (It(Qe), v.input.focus()), lt(v.wrapper.ownerDocument, "mousemove", Ye), lt(v.wrapper.ownerDocument, "mouseup", nt), O.history.lastSelOrigin = null;
- }
- var Ye = hn(o, function(Qe) {
- Qe.buttons === 0 || !ra(Qe) ? Ue(Qe) : Ne(Qe);
- }), nt = hn(o, Ue);
- o.state.selectingText = nt, $e(v.wrapper.ownerDocument, "mousemove", Ye), $e(v.wrapper.ownerDocument, "mouseup", nt);
- }
- function z_(o, l) {
- var c = l.anchor, f = l.head, v = ut(o.doc, c.line);
- if (De(c, f) == 0 && c.sticky == f.sticky)
- return l;
- var O = ht(v);
- if (!O)
- return l;
- var L = je(O, c.ch, c.sticky), j = O[L];
- if (j.from != c.ch && j.to != c.ch)
- return l;
- var Q = L + (j.from == c.ch == (j.level != 1) ? 0 : 1);
- if (Q == 0 || Q == O.length)
- return l;
- var ne;
- if (f.line != c.line)
- ne = (f.line - c.line) * (o.doc.direction == "ltr" ? 1 : -1) > 0;
- else {
- var se = je(O, f.ch, f.sticky), de = se - L || (f.ch - c.ch) * (j.level == 1 ? -1 : 1);
- se == Q - 1 || se == Q ? ne = de < 0 : ne = de > 0;
- }
- var Ee = O[Q + (ne ? -1 : 0)], Ce = ne == (Ee.level == 1), Ie = Ce ? Ee.from : Ee.to, Ne = Ce ? "after" : "before";
- return c.ch == Ie && c.sticky == Ne ? l : new Pt(new ye(c.line, Ie, Ne), f);
- }
- function Im(o, l, c, f) {
- var v, O;
- if (l.touches)
- v = l.touches[0].clientX, O = l.touches[0].clientY;
- else
- try {
- v = l.clientX, O = l.clientY;
- } catch {
- return !1;
- }
- if (v >= Math.floor(o.display.gutters.getBoundingClientRect().right))
- return !1;
- f && It(l);
- var L = o.display, j = L.lineDiv.getBoundingClientRect();
- if (O > j.bottom || !Qt(o, c))
- return ur(l);
- O -= j.top - L.viewOffset;
- for (var Q = 0; Q < o.display.gutterSpecs.length; ++Q) {
- var ne = L.gutters.childNodes[Q];
- if (ne && ne.getBoundingClientRect().right >= v) {
- var se = Di(o.doc, O), de = o.display.gutterSpecs[Q];
- return st(o, c, o, se, de.className, l), ur(l);
- }
- }
- }
- function _d(o, l) {
- return Im(o, l, "gutterClick", !0);
- }
- function Fm(o, l) {
- Xi(o.display, l) || W_(o, l) || Ct(o, l, "contextmenu") || T || o.display.input.onContextMenu(l);
- }
- function W_(o, l) {
- return Qt(o, "gutterContextMenu") ? Im(o, l, "gutterContextMenu", !1) : !1;
- }
- function Pm(o) {
- o.display.wrapper.className = o.display.wrapper.className.replace(/\s*cm-s-\S+/g, "") + o.options.theme.replace(/(^|\s)\s*/g, " cm-s-"), ca(o);
- }
- var Ao = { toString: function() {
- return "CodeMirror.Init";
- } }, Mm = {}, Yl = {};
- function G_(o) {
- var l = o.optionHandlers;
- function c(f, v, O, L) {
- o.defaults[f] = v, O && (l[f] = L ? function(j, Q, ne) {
- ne != Ao && O(j, Q, ne);
- } : O);
- }
- o.defineOption = c, o.Init = Ao, c("value", "", function(f, v) {
- return f.setValue(v);
- }, !0), c("mode", null, function(f, v) {
- f.doc.modeOption = v, dd(f);
- }, !0), c("indentUnit", 2, dd, !0), c("indentWithTabs", !1), c("smartIndent", !0), c("tabSize", 4, function(f) {
- _a(f), ca(f), Ln(f);
- }, !0), c("lineSeparator", null, function(f, v) {
- if (f.doc.lineSep = v, !!v) {
- var O = [], L = f.doc.first;
- f.doc.iter(function(Q) {
- for (var ne = 0; ; ) {
- var se = Q.text.indexOf(v, ne);
- if (se == -1)
- break;
- ne = se + v.length, O.push(ye(L, se));
- }
- L++;
- });
- for (var j = O.length - 1; j >= 0; j--)
- yo(f.doc, v, O[j], ye(O[j].line, O[j].ch + v.length));
- }
- }), c("specialChars", /[\u0000-\u001f\u007f-\u009f\u00ad\u061c\u200b\u200e\u200f\u2028\u2029\ufeff\ufff9-\ufffc]/g, function(f, v, O) {
- f.state.specialChars = new RegExp(v.source + (v.test(" ") ? "" : "| "), "g"), O != Ao && f.refresh();
- }), c("specialCharPlaceholder", w1, function(f) {
- return f.refresh();
- }, !0), c("electricChars", !0), c("inputStyle", x ? "contenteditable" : "textarea", function() {
- throw new Error("inputStyle can not (yet) be changed in a running editor");
- }, !0), c("spellcheck", !1, function(f, v) {
- return f.getInputField().spellcheck = v;
- }, !0), c("autocorrect", !1, function(f, v) {
- return f.getInputField().autocorrect = v;
- }, !0), c("autocapitalize", !1, function(f, v) {
- return f.getInputField().autocapitalize = v;
- }, !0), c("rtlMoveVisually", !M), c("wholeLineUpdateBefore", !0), c("theme", "default", function(f) {
- Pm(f), ba(f);
- }, !0), c("keyMap", "default", function(f, v, O) {
- var L = Gl(v), j = O != Ao && Gl(O);
- j && j.detach && j.detach(f, L), L.attach && L.attach(f, j || null);
- }), c("extraKeys", null), c("configureMouse", null), c("lineWrapping", !1, Y_, !0), c("gutters", [], function(f, v) {
- f.display.gutterSpecs = sd(v, f.options.lineNumbers), ba(f);
- }, !0), c("fixedGutter", !0, function(f, v) {
- f.display.gutters.style.left = v ? Ju(f.display) + "px" : "0", f.refresh();
- }, !0), c("coverGutterNextToScrollbar", !1, function(f) {
- return ho(f);
- }, !0), c("scrollbarStyle", "native", function(f) {
- Nh(f), ho(f), f.display.scrollbars.setScrollTop(f.doc.scrollTop), f.display.scrollbars.setScrollLeft(f.doc.scrollLeft);
- }, !0), c("lineNumbers", !1, function(f, v) {
- f.display.gutterSpecs = sd(f.options.gutters, v), ba(f);
- }, !0), c("firstLineNumber", 1, ba, !0), c("lineNumberFormatter", function(f) {
- return f;
- }, ba, !0), c("showCursorWhenSelecting", !1, pa, !0), c("resetSelectionOnContextMenu", !0), c("lineWiseCopyCut", !0), c("pasteLinesPerSelection", !0), c("selectionsMayTouch", !1), c("readOnly", !1, function(f, v) {
- v == "nocursor" && (co(f), f.display.input.blur()), f.display.input.readOnlyChanged(v);
- }), c("screenReaderLabel", null, function(f, v) {
- v = v === "" ? null : v, f.display.input.screenReaderLabelChanged(v);
- }), c("disableInput", !1, function(f, v) {
- v || f.display.input.reset();
- }, !0), c("dragDrop", !0, K_), c("allowDropFileTypes", null), c("cursorBlinkRate", 530), c("cursorScrollMargin", 0), c("cursorHeight", 1, pa, !0), c("singleCursorHeightPerLine", !0, pa, !0), c("workTime", 100), c("workDelay", 100), c("flattenSpans", !0, _a, !0), c("addModeClass", !1, _a, !0), c("pollInterval", 100), c("undoDepth", 200, function(f, v) {
- return f.doc.history.undoDepth = v;
- }), c("historyEventDelay", 1250), c("viewportMargin", 10, function(f) {
- return f.refresh();
- }, !0), c("maxHighlightLength", 1e4, _a, !0), c("moveInputWithCursor", !0, function(f, v) {
- v || f.display.input.resetPosition();
- }), c("tabindex", null, function(f, v) {
- return f.display.input.getField().tabIndex = v || "";
- }), c("autofocus", null), c("direction", "ltr", function(f, v) {
- return f.doc.setDirection(v);
- }, !0), c("phrases", null);
- }
- function K_(o, l, c) {
- var f = c && c != Ao;
- if (!l != !f) {
- var v = o.display.dragFunctions, O = l ? $e : lt;
- O(o.display.scroller, "dragstart", v.start), O(o.display.scroller, "dragenter", v.enter), O(o.display.scroller, "dragover", v.over), O(o.display.scroller, "dragleave", v.leave), O(o.display.scroller, "drop", v.drop);
- }
- }
- function Y_(o) {
- o.options.lineWrapping ? (Z(o.display.wrapper, "CodeMirror-wrap"), o.display.sizer.style.minWidth = "", o.display.sizerWidth = null) : (V(o.display.wrapper, "CodeMirror-wrap"), Vu(o)), Xu(o), Ln(o), ca(o), setTimeout(function() {
- return ho(o);
- }, 100);
- }
- function Kt(o, l) {
- var c = this;
- if (!(this instanceof Kt))
- return new Kt(o, l);
- this.options = l = l ? ge(l) : {}, ge(Mm, l, !1);
- var f = l.value;
- typeof f == "string" ? f = new Nn(f, l.mode, null, l.lineSeparator, l.direction) : l.mode && (f.modeOption = l.mode), this.doc = f;
- var v = new Kt.inputStyles[l.inputStyle](this), O = this.display = new l_(o, f, v, l);
- O.wrapper.CodeMirror = this, Pm(this), l.lineWrapping && (this.display.wrapper.className += " CodeMirror-wrap"), Nh(this), this.state = {
- keyMaps: [],
- overlays: [],
- modeGen: 0,
- overwrite: !1,
- delayingBlurEvent: !1,
- focused: !1,
- suppressEdits: !1,
- pasteIncoming: -1,
- cutIncoming: -1,
- selectingText: !1,
- draggingText: !1,
- highlight: new we(),
- keySeq: null,
- specialChars: null
- }, l.autofocus && !x && O.input.focus(), d && p < 11 && setTimeout(function() {
- return c.display.input.reset(!0);
- }, 20), Q_(this), x_(), Nr(this), this.curOp.forceUpdate = !0, Yh(this, f), l.autofocus && !x || this.hasFocus() ? setTimeout(function() {
- c.hasFocus() && !c.state.focused && td(c);
- }, 20) : co(this);
- for (var L in Yl)
- Yl.hasOwnProperty(L) && Yl[L](this, l[L], Ao);
- jh(this), l.finishInit && l.finishInit(this);
- for (var j = 0; j < wd.length; ++j)
- wd[j](this);
- Br(this), h && l.lineWrapping && getComputedStyle(O.lineDiv).textRendering == "optimizelegibility" && (O.lineDiv.style.textRendering = "auto");
- }
- Kt.defaults = Mm, Kt.optionHandlers = Yl;
- function Q_(o) {
- var l = o.display;
- $e(l.scroller, "mousedown", hn(o, Rm)), d && p < 11 ? $e(l.scroller, "dblclick", hn(o, function(Q) {
- if (!Ct(o, Q)) {
- var ne = Fr(o, Q);
- if (!(!ne || _d(o, Q) || Xi(o.display, Q))) {
- It(Q);
- var se = o.findWordAt(ne);
- jl(o.doc, se.anchor, se.head);
- }
- }
- })) : $e(l.scroller, "dblclick", function(Q) {
- return Ct(o, Q) || It(Q);
- }), $e(l.scroller, "contextmenu", function(Q) {
- return Fm(o, Q);
- }), $e(l.input.getField(), "contextmenu", function(Q) {
- l.scroller.contains(Q.target) || Fm(o, Q);
- });
- var c, f = { end: 0 };
- function v() {
- l.activeTouch && (c = setTimeout(function() {
- return l.activeTouch = null;
- }, 1e3), f = l.activeTouch, f.end = +new Date());
- }
- function O(Q) {
- if (Q.touches.length != 1)
- return !1;
- var ne = Q.touches[0];
- return ne.radiusX <= 1 && ne.radiusY <= 1;
- }
- function L(Q, ne) {
- if (ne.left == null)
- return !0;
- var se = ne.left - Q.left, de = ne.top - Q.top;
- return se * se + de * de > 20 * 20;
- }
- $e(l.scroller, "touchstart", function(Q) {
- if (!Ct(o, Q) && !O(Q) && !_d(o, Q)) {
- l.input.ensurePolled(), clearTimeout(c);
- var ne = +new Date();
- l.activeTouch = {
- start: ne,
- moved: !1,
- prev: ne - f.end <= 300 ? f : null
- }, Q.touches.length == 1 && (l.activeTouch.left = Q.touches[0].pageX, l.activeTouch.top = Q.touches[0].pageY);
- }
- }), $e(l.scroller, "touchmove", function() {
- l.activeTouch && (l.activeTouch.moved = !0);
- }), $e(l.scroller, "touchend", function(Q) {
- var ne = l.activeTouch;
- if (ne && !Xi(l, Q) && ne.left != null && !ne.moved && new Date() - ne.start < 300) {
- var se = o.coordsChar(l.activeTouch, "page"), de;
- !ne.prev || L(ne, ne.prev) ? de = new Pt(se, se) : !ne.prev.prev || L(ne, ne.prev.prev) ? de = o.findWordAt(se) : de = new Pt(ye(se.line, 0), _t(o.doc, ye(se.line + 1, 0))), o.setSelection(de.anchor, de.head), o.focus(), It(Q);
- }
- v();
- }), $e(l.scroller, "touchcancel", v), $e(l.scroller, "scroll", function() {
- l.scroller.clientHeight && (ma(o, l.scroller.scrollTop), Mr(o, l.scroller.scrollLeft, !0), st(o, "scroll", o));
- }), $e(l.scroller, "mousewheel", function(Q) {
- return zh(o, Q);
- }), $e(l.scroller, "DOMMouseScroll", function(Q) {
- return zh(o, Q);
- }), $e(l.wrapper, "scroll", function() {
- return l.wrapper.scrollTop = l.wrapper.scrollLeft = 0;
- }), l.dragFunctions = {
- enter: function(Q) {
- Ct(o, Q) || yi(Q);
- },
- over: function(Q) {
- Ct(o, Q) || (E_(o, Q), yi(Q));
- },
- start: function(Q) {
- return S_(o, Q);
- },
- drop: hn(o, C_),
- leave: function(Q) {
- Ct(o, Q) || ym(o);
- }
- };
- var j = l.input.getField();
- $e(j, "keyup", function(Q) {
- return Om.call(o, Q);
- }), $e(j, "keydown", hn(o, km)), $e(j, "keypress", hn(o, $m)), $e(j, "focus", function(Q) {
- return td(o, Q);
- }), $e(j, "blur", function(Q) {
- return co(o, Q);
- });
- }
- var wd = [];
- Kt.defineInitHook = function(o) {
- return wd.push(o);
- };
- function Ia(o, l, c, f) {
- var v = o.doc, O;
- c == null && (c = "add"), c == "smart" && (v.mode.indent ? O = la(o, l).state : c = "prev");
- var L = o.options.tabSize, j = ut(v, l), Q = ve(j.text, null, L);
- j.stateAfter && (j.stateAfter = null);
- var ne = j.text.match(/^\s*/)[0], se;
- if (!f && !/\S/.test(j.text))
- se = 0, c = "not";
- else if (c == "smart" && (se = v.mode.indent(O, j.text.slice(ne.length), j.text), se == xe || se > 150)) {
- if (!f)
- return;
- c = "prev";
- }
- c == "prev" ? l > v.first ? se = ve(ut(v, l - 1).text, null, L) : se = 0 : c == "add" ? se = Q + o.options.indentUnit : c == "subtract" ? se = Q - o.options.indentUnit : typeof c == "number" && (se = Q + c), se = Math.max(0, se);
- var de = "", Ee = 0;
- if (o.options.indentWithTabs)
- for (var Ce = Math.floor(se / L); Ce; --Ce)
- Ee += L, de += " ";
- if (Ee < se && (de += fe(se - Ee)), de != ne)
- return yo(v, de, ye(l, 0), ye(l, ne.length), "+input"), j.stateAfter = null, !0;
- for (var Ie = 0; Ie < v.sel.ranges.length; Ie++) {
- var Ne = v.sel.ranges[Ie];
- if (Ne.head.line == l && Ne.head.ch < ne.length) {
- var Ue = ye(l, ne.length);
- hd(v, Ie, new Pt(Ue, Ue));
- break;
- }
- }
- }
- var Ci = null;
- function Ql(o) {
- Ci = o;
- }
- function Ad(o, l, c, f, v) {
- var O = o.doc;
- o.display.shift = !1, f || (f = O.sel);
- var L = +new Date() - 200, j = v == "paste" || o.state.pasteIncoming > L, Q = oa(l), ne = null;
- if (j && f.ranges.length > 1)
- if (Ci && Ci.text.join(`
+ function Ad(o, l, c, f, v) {
+ var O = o.doc;
+ o.display.shift = !1, f || (f = O.sel);
+ var L = +new Date() - 200, j = v == "paste" || o.state.pasteIncoming > L, Q = oa(l), ne = null;
+ if (j && f.ranges.length > 1)
+ if (Ci && Ci.text.join(`
`) == l) {
- if (f.ranges.length % Ci.text.length == 0) {
- ne = [];
- for (var se = 0; se < Ci.text.length; se++)
- ne.push(O.splitLines(Ci.text[se]));
- }
- } else
- Q.length == f.ranges.length && o.options.pasteLinesPerSelection && (ne = Fe(Q, function(Ye) {
- return [Ye];
- }));
- for (var de = o.curOp.updateInput, Ee = f.ranges.length - 1; Ee >= 0; Ee--) {
- var Ce = f.ranges[Ee], Ie = Ce.from(), Ne = Ce.to();
- Ce.empty() && (c && c > 0 ? Ie = ye(Ie.line, Ie.ch - c) : o.state.overwrite && !j ? Ne = ye(Ne.line, Math.min(ut(O, Ne.line).text.length, Ne.ch + Ae(Q).length)) : j && Ci && Ci.lineWise && Ci.text.join(`
+ if (f.ranges.length % Ci.text.length == 0) {
+ ne = [];
+ for (var se = 0; se < Ci.text.length; se++)
+ ne.push(O.splitLines(Ci.text[se]));
+ }
+ } else
+ Q.length == f.ranges.length && o.options.pasteLinesPerSelection && (ne = Fe(Q, function(Ye) {
+ return [Ye];
+ }));
+ for (var de = o.curOp.updateInput, Ee = f.ranges.length - 1; Ee >= 0; Ee--) {
+ var Ce = f.ranges[Ee], Ie = Ce.from(), Ne = Ce.to();
+ Ce.empty() && (c && c > 0 ? Ie = ye(Ie.line, Ie.ch - c) : o.state.overwrite && !j ? Ne = ye(Ne.line, Math.min(ut(O, Ne.line).text.length, Ne.ch + Ae(Q).length)) : j && Ci && Ci.lineWise && Ci.text.join(`
`) == Q.join(`
`) && (Ie = Ne = ye(Ie.line, 0)));
- var Ue = {
- from: Ie,
- to: Ne,
- text: ne ? ne[Ee % ne.length] : Q,
- origin: v || (j ? "paste" : o.state.cutIncoming > L ? "cut" : "+input")
- };
- go(o.doc, Ue), pn(o, "inputRead", o, Ue);
- }
- l && !j && Nm(o, l), po(o), o.curOp.updateInput < 2 && (o.curOp.updateInput = de), o.curOp.typing = !0, o.state.pasteIncoming = o.state.cutIncoming = -1;
- }
- function Lm(o, l) {
- var c = o.clipboardData && o.clipboardData.getData("Text");
- if (c)
- return o.preventDefault(), !l.isReadOnly() && !l.options.disableInput && l.hasFocus() && Wn(l, function() {
- return Ad(l, c, 0, null, "paste");
- }), !0;
- }
- function Nm(o, l) {
- if (!(!o.options.electricChars || !o.options.smartIndent))
- for (var c = o.doc.sel, f = c.ranges.length - 1; f >= 0; f--) {
- var v = c.ranges[f];
- if (!(v.head.ch > 100 || f && c.ranges[f - 1].head.line == v.head.line)) {
- var O = o.getModeAt(v.head), L = !1;
- if (O.electricChars) {
- for (var j = 0; j < O.electricChars.length; j++)
- if (l.indexOf(O.electricChars.charAt(j)) > -1) {
- L = Ia(o, v.head.line, "smart");
- break;
- }
- } else
- O.electricInput && O.electricInput.test(ut(o.doc, v.head.line).text.slice(0, v.head.ch)) && (L = Ia(o, v.head.line, "smart"));
- L && pn(o, "electricInput", o, v.head.line);
- }
+ var Ue = {
+ from: Ie,
+ to: Ne,
+ text: ne ? ne[Ee % ne.length] : Q,
+ origin: v || (j ? "paste" : o.state.cutIncoming > L ? "cut" : "+input")
+ };
+ vo(o.doc, Ue), pn(o, "inputRead", o, Ue);
}
- }
- function Bm(o) {
- for (var l = [], c = [], f = 0; f < o.doc.sel.ranges.length; f++) {
- var v = o.doc.sel.ranges[f].head.line, O = { anchor: ye(v, 0), head: ye(v + 1, 0) };
- c.push(O), l.push(o.getRange(O.anchor, O.head));
+ l && !j && Bm(o, l), co(o), o.curOp.updateInput < 2 && (o.curOp.updateInput = de), o.curOp.typing = !0, o.state.pasteIncoming = o.state.cutIncoming = -1;
}
- return { text: l, ranges: c };
- }
- function Vm(o, l, c, f) {
- o.setAttribute("autocorrect", c ? "" : "off"), o.setAttribute("autocapitalize", f ? "" : "off"), o.setAttribute("spellcheck", !!l);
- }
- function jm() {
- var o = I("textarea", null, null, "position: absolute; bottom: -1em; padding: 0; width: 1px; height: 1em; min-height: 1em; outline: none"), l = I("div", [o], null, "overflow: hidden; position: relative; width: 3px; height: 0px;");
- return h ? o.style.width = "1000px" : o.setAttribute("wrap", "off"), w && (o.style.border = "1px solid black"), Vm(o), l;
- }
- function J_(o) {
- var l = o.optionHandlers, c = o.helpers = {};
- o.prototype = {
- constructor: o,
- focus: function() {
- pe(this).focus(), this.display.input.focus();
- },
- setOption: function(f, v) {
- var O = this.options, L = O[f];
- O[f] == v && f != "mode" || (O[f] = v, l.hasOwnProperty(f) && hn(this, l[f])(this, v, L), st(this, "optionChange", this, f));
- },
- getOption: function(f) {
- return this.options[f];
- },
- getDoc: function() {
- return this.doc;
- },
- addKeyMap: function(f, v) {
- this.state.keyMaps[v ? "push" : "unshift"](Gl(f));
- },
- removeKeyMap: function(f) {
- for (var v = this.state.keyMaps, O = 0; O < v.length; ++O)
- if (v[O] == f || v[O].name == f)
- return v.splice(O, 1), !0;
- },
- addOverlay: On(function(f, v) {
- var O = f.token ? f : o.getMode(this.options, f);
- if (O.startState)
- throw new Error("Overlays may not be stateful.");
- Xe(
- this.state.overlays,
- {
- mode: O,
- modeSpec: f,
- opaque: v && v.opaque,
- priority: v && v.priority || 0
- },
- function(L) {
- return L.priority;
- }
- ), this.state.modeGen++, Ln(this);
- }),
- removeOverlay: On(function(f) {
- for (var v = this.state.overlays, O = 0; O < v.length; ++O) {
- var L = v[O].modeSpec;
- if (L == f || typeof f == "string" && L.name == f) {
- v.splice(O, 1), this.state.modeGen++, Ln(this);
- return;
+ function Nm(o, l) {
+ var c = o.clipboardData && o.clipboardData.getData("Text");
+ if (c)
+ return o.preventDefault(), !l.isReadOnly() && !l.options.disableInput && l.hasFocus() && Wn(l, function() {
+ return Ad(l, c, 0, null, "paste");
+ }), !0;
+ }
+ function Bm(o, l) {
+ if (!(!o.options.electricChars || !o.options.smartIndent))
+ for (var c = o.doc.sel, f = c.ranges.length - 1; f >= 0; f--) {
+ var v = c.ranges[f];
+ if (!(v.head.ch > 100 || f && c.ranges[f - 1].head.line == v.head.line)) {
+ var O = o.getModeAt(v.head), L = !1;
+ if (O.electricChars) {
+ for (var j = 0; j < O.electricChars.length; j++)
+ if (l.indexOf(O.electricChars.charAt(j)) > -1) {
+ L = Ia(o, v.head.line, "smart");
+ break;
+ }
+ } else
+ O.electricInput && O.electricInput.test(ut(o.doc, v.head.line).text.slice(0, v.head.ch)) && (L = Ia(o, v.head.line, "smart"));
+ L && pn(o, "electricInput", o, v.head.line);
}
}
- }),
- indentLine: On(function(f, v, O) {
- typeof v != "string" && typeof v != "number" && (v == null ? v = this.options.smartIndent ? "smart" : "prev" : v = v ? "add" : "subtract"), oe(this.doc, f) && Ia(this, f, v, O);
- }),
- indentSelection: On(function(f) {
- for (var v = this.doc.sel.ranges, O = -1, L = 0; L < v.length; L++) {
- var j = v[L];
- if (j.empty())
- j.head.line > O && (Ia(this, j.head.line, f, !0), O = j.head.line, L == this.doc.sel.primIndex && po(this));
- else {
- var Q = j.from(), ne = j.to(), se = Math.max(O, Q.line);
- O = Math.min(this.lastLine(), ne.line - (ne.ch ? 0 : 1)) + 1;
- for (var de = se; de < O; ++de)
- Ia(this, de, f);
- var Ee = this.doc.sel.ranges;
- Q.ch == 0 && v.length == Ee.length && Ee[L].from().ch > 0 && hd(this.doc, L, new Pt(Q, Ee[L].to()), $);
- }
- }
- }),
- getTokenAt: function(f, v) {
- return Jp(this, f, v);
- },
- getLineTokens: function(f, v) {
- return Jp(this, ye(f), v, !0);
- },
- getTokenTypeAt: function(f) {
- f = _t(this.doc, f);
- var v = Kp(this, ut(this.doc, f.line)), O = 0, L = (v.length - 1) / 2, j = f.ch, Q;
- if (j == 0)
- Q = v[2];
- else
- for (; ; ) {
- var ne = O + L >> 1;
- if ((ne ? v[ne * 2 - 1] : 0) >= j)
- L = ne;
- else if (v[ne * 2 + 1] < j)
- O = ne + 1;
- else {
- Q = v[ne * 2 + 2];
- break;
+ }
+ function Vm(o) {
+ for (var l = [], c = [], f = 0; f < o.doc.sel.ranges.length; f++) {
+ var v = o.doc.sel.ranges[f].head.line, O = { anchor: ye(v, 0), head: ye(v + 1, 0) };
+ c.push(O), l.push(o.getRange(O.anchor, O.head));
+ }
+ return { text: l, ranges: c };
+ }
+ function jm(o, l, c, f) {
+ o.setAttribute("autocorrect", c ? "" : "off"), o.setAttribute("autocapitalize", f ? "" : "off"), o.setAttribute("spellcheck", !!l);
+ }
+ function Um() {
+ var o = I("textarea", null, null, "position: absolute; bottom: -1em; padding: 0; width: 1px; height: 1em; min-height: 1em; outline: none"), l = I("div", [o], null, "overflow: hidden; position: relative; width: 3px; height: 0px;");
+ return h ? o.style.width = "1000px" : o.setAttribute("wrap", "off"), w && (o.style.border = "1px solid black"), jm(o), l;
+ }
+ function Z_(o) {
+ var l = o.optionHandlers, c = o.helpers = {};
+ o.prototype = {
+ constructor: o,
+ focus: function() {
+ pe(this).focus(), this.display.input.focus();
+ },
+ setOption: function(f, v) {
+ var O = this.options, L = O[f];
+ O[f] == v && f != "mode" || (O[f] = v, l.hasOwnProperty(f) && hn(this, l[f])(this, v, L), st(this, "optionChange", this, f));
+ },
+ getOption: function(f) {
+ return this.options[f];
+ },
+ getDoc: function() {
+ return this.doc;
+ },
+ addKeyMap: function(f, v) {
+ this.state.keyMaps[v ? "push" : "unshift"](Gl(f));
+ },
+ removeKeyMap: function(f) {
+ for (var v = this.state.keyMaps, O = 0; O < v.length; ++O)
+ if (v[O] == f || v[O].name == f)
+ return v.splice(O, 1), !0;
+ },
+ addOverlay: On(function(f, v) {
+ var O = f.token ? f : o.getMode(this.options, f);
+ if (O.startState)
+ throw new Error("Overlays may not be stateful.");
+ Xe(
+ this.state.overlays,
+ {
+ mode: O,
+ modeSpec: f,
+ opaque: v && v.opaque,
+ priority: v && v.priority || 0
+ },
+ function(L) {
+ return L.priority;
+ }
+ ), this.state.modeGen++, Ln(this);
+ }),
+ removeOverlay: On(function(f) {
+ for (var v = this.state.overlays, O = 0; O < v.length; ++O) {
+ var L = v[O].modeSpec;
+ if (L == f || typeof f == "string" && L.name == f) {
+ v.splice(O, 1), this.state.modeGen++, Ln(this);
+ return;
}
}
- var se = Q ? Q.indexOf("overlay ") : -1;
- return se < 0 ? Q : se == 0 ? null : Q.slice(0, se - 1);
- },
- getModeAt: function(f) {
- var v = this.doc.mode;
- return v.innerMode ? o.innerMode(v, this.getTokenAt(f).state).mode : v;
- },
- getHelper: function(f, v) {
- return this.getHelpers(f, v)[0];
- },
- getHelpers: function(f, v) {
- var O = [];
- if (!c.hasOwnProperty(v))
- return O;
- var L = c[v], j = this.getModeAt(f);
- if (typeof j[v] == "string")
- L[j[v]] && O.push(L[j[v]]);
- else if (j[v])
- for (var Q = 0; Q < j[v].length; Q++) {
- var ne = L[j[v][Q]];
- ne && O.push(ne);
+ }),
+ indentLine: On(function(f, v, O) {
+ typeof v != "string" && typeof v != "number" && (v == null ? v = this.options.smartIndent ? "smart" : "prev" : v = v ? "add" : "subtract"), oe(this.doc, f) && Ia(this, f, v, O);
+ }),
+ indentSelection: On(function(f) {
+ for (var v = this.doc.sel.ranges, O = -1, L = 0; L < v.length; L++) {
+ var j = v[L];
+ if (j.empty())
+ j.head.line > O && (Ia(this, j.head.line, f, !0), O = j.head.line, L == this.doc.sel.primIndex && co(this));
+ else {
+ var Q = j.from(), ne = j.to(), se = Math.max(O, Q.line);
+ O = Math.min(this.lastLine(), ne.line - (ne.ch ? 0 : 1)) + 1;
+ for (var de = se; de < O; ++de)
+ Ia(this, de, f);
+ var Ee = this.doc.sel.ranges;
+ Q.ch == 0 && v.length == Ee.length && Ee[L].from().ch > 0 && hd(this.doc, L, new Pt(Q, Ee[L].to()), $);
+ }
}
- else
- j.helperType && L[j.helperType] ? O.push(L[j.helperType]) : L[j.name] && O.push(L[j.name]);
- for (var se = 0; se < L._global.length; se++) {
- var de = L._global[se];
- de.pred(j, this) && he(O, de.val) == -1 && O.push(de.val);
- }
- return O;
- },
- getStateAfter: function(f, v) {
- var O = this.doc;
- return f = qn(O, f == null ? O.first + O.size - 1 : f), la(this, f + 1, v).state;
- },
- cursorCoords: function(f, v) {
- var O, L = this.doc.sel.primary();
- return f == null ? O = L.head : typeof f == "object" ? O = _t(this.doc, f) : O = f ? L.from() : L.to(), wi(this, O, v || "page");
- },
- charCoords: function(f, v) {
- return Rl(this, _t(this.doc, f), v || "page");
- },
- coordsChar: function(f, v) {
- return f = Eh(this, f, v || "page"), Ku(this, f.left, f.top);
- },
- lineAtHeight: function(f, v) {
- return f = Eh(this, { top: f, left: 0 }, v || "page").top, Di(this.doc, f + this.display.viewOffset);
- },
- heightAtLine: function(f, v, O) {
- var L = !1, j;
- if (typeof f == "number") {
- var Q = this.doc.first + this.doc.size - 1;
- f < this.doc.first ? f = this.doc.first : f > Q && (f = Q, L = !0), j = ut(this.doc, f);
- } else
- j = f;
- return $l(this, j, { top: 0, left: 0 }, v || "page", O || L).top + (L ? this.doc.height - Ji(j) : 0);
- },
- defaultTextHeight: function() {
- return uo(this.display);
- },
- defaultCharWidth: function() {
- return fo(this.display);
- },
- getViewport: function() {
- return { from: this.display.viewFrom, to: this.display.viewTo };
- },
- addWidget: function(f, v, O, L, j) {
- var Q = this.display;
- f = wi(this, _t(this.doc, f));
- var ne = f.bottom, se = f.left;
- if (v.style.position = "absolute", v.setAttribute("cm-ignore-events", "true"), this.display.input.setUneditable(v), Q.sizer.appendChild(v), L == "over")
- ne = f.top;
- else if (L == "above" || L == "near") {
- var de = Math.max(Q.wrapper.clientHeight, this.doc.height), Ee = Math.max(Q.sizer.clientWidth, Q.lineSpace.clientWidth);
- (L == "above" || f.bottom + v.offsetHeight > de) && f.top > v.offsetHeight ? ne = f.top - v.offsetHeight : f.bottom + v.offsetHeight <= de && (ne = f.bottom), se + v.offsetWidth > Ee && (se = Ee - v.offsetWidth);
- }
- v.style.top = ne + "px", v.style.left = v.style.right = "", j == "right" ? (se = Q.sizer.clientWidth - v.offsetWidth, v.style.right = "0px") : (j == "left" ? se = 0 : j == "middle" && (se = (Q.sizer.clientWidth - v.offsetWidth) / 2), v.style.left = se + "px"), O && K1(this, { left: se, top: ne, right: se + v.offsetWidth, bottom: ne + v.offsetHeight });
- },
- triggerOnKeyDown: On(km),
- triggerOnKeyPress: On($m),
- triggerOnKeyUp: Om,
- triggerOnMouseDown: On(Rm),
- execCommand: function(f) {
- if (Oa.hasOwnProperty(f))
- return Oa[f].call(null, this);
- },
- triggerElectric: On(function(f) {
- Nm(this, f);
- }),
- findPosH: function(f, v, O, L) {
- var j = 1;
- v < 0 && (j = -1, v = -v);
- for (var Q = _t(this.doc, f), ne = 0; ne < v && (Q = Cd(this.doc, Q, j, O, L), !Q.hitSide); ++ne)
- ;
- return Q;
- },
- moveH: On(function(f, v) {
- var O = this;
- this.extendSelectionsBy(function(L) {
- return O.display.shift || O.doc.extend || L.empty() ? Cd(O.doc, L.head, f, v, O.options.rtlMoveVisually) : f < 0 ? L.from() : L.to();
- }, X);
- }),
- deleteH: On(function(f, v) {
- var O = this.doc.sel, L = this.doc;
- O.somethingSelected() ? L.replaceSelection("", null, "+delete") : wo(this, function(j) {
- var Q = Cd(L, j.head, f, v, !1);
- return f < 0 ? { from: Q, to: j.head } : { from: j.head, to: Q };
- });
- }),
- findPosV: function(f, v, O, L) {
- var j = 1, Q = L;
- v < 0 && (j = -1, v = -v);
- for (var ne = _t(this.doc, f), se = 0; se < v; ++se) {
- var de = wi(this, ne, "div");
- if (Q == null ? Q = de.left : de.left = Q, ne = Um(this, de, j, O), ne.hitSide)
- break;
- }
- return ne;
- },
- moveV: On(function(f, v) {
- var O = this, L = this.doc, j = [], Q = !this.display.shift && !L.extend && L.sel.somethingSelected();
- if (L.extendSelectionsBy(function(se) {
- if (Q)
- return f < 0 ? se.from() : se.to();
- var de = wi(O, se.head, "div");
- se.goalColumn != null && (de.left = se.goalColumn), j.push(de.left);
- var Ee = Um(O, de, f, v);
- return v == "page" && se == L.sel.primary() && id(O, Rl(O, Ee, "div").top - de.top), Ee;
- }, X), j.length)
- for (var ne = 0; ne < L.sel.ranges.length; ne++)
- L.sel.ranges[ne].goalColumn = j[ne];
- }),
- findWordAt: function(f) {
- var v = this.doc, O = ut(v, f.line).text, L = f.ch, j = f.ch;
- if (O) {
- var Q = this.getHelper(f, "wordChars");
- (f.sticky == "before" || j == O.length) && L ? --L : ++j;
- for (var ne = O.charAt(L), se = it(ne, Q) ? function(de) {
- return it(de, Q);
- } : /\s/.test(ne) ? function(de) {
- return /\s/.test(de);
- } : function(de) {
- return !/\s/.test(de) && !it(de);
- }; L > 0 && se(O.charAt(L - 1)); )
- --L;
- for (; j < O.length && se(O.charAt(j)); )
- ++j;
- }
- return new Pt(ye(f.line, L), ye(f.line, j));
- },
- toggleOverwrite: function(f) {
- f != null && f == this.state.overwrite || ((this.state.overwrite = !this.state.overwrite) ? Z(this.display.cursorDiv, "CodeMirror-overwrite") : V(this.display.cursorDiv, "CodeMirror-overwrite"), st(this, "overwriteToggle", this, this.state.overwrite));
- },
- hasFocus: function() {
- return this.display.input.getField() == q(te(this));
- },
- isReadOnly: function() {
- return !!(this.options.readOnly || this.doc.cantEdit);
- },
- scrollTo: On(function(f, v) {
- ha(this, f, v);
- }),
- getScrollInfo: function() {
- var f = this.display.scroller;
- return {
- left: f.scrollLeft,
- top: f.scrollTop,
- height: f.scrollHeight - Fi(this) - this.display.barHeight,
- width: f.scrollWidth - Fi(this) - this.display.barWidth,
- clientHeight: Hu(this),
- clientWidth: Dr(this)
- };
- },
- scrollIntoView: On(function(f, v) {
- f == null ? (f = { from: this.doc.sel.primary().head, to: null }, v == null && (v = this.options.cursorScrollMargin)) : typeof f == "number" ? f = { from: ye(f, 0), to: null } : f.from == null && (f = { from: f, to: null }), f.to || (f.to = f.from), f.margin = v || 0, f.from.line != null ? Y1(this, f) : Fh(this, f.from, f.to, f.margin);
- }),
- setSize: On(function(f, v) {
- var O = this, L = function(Q) {
- return typeof Q == "number" || /^\d+$/.test(String(Q)) ? Q + "px" : Q;
- };
- f != null && (this.display.wrapper.style.width = L(f)), v != null && (this.display.wrapper.style.height = L(v)), this.options.lineWrapping && Ah(this);
- var j = this.display.viewFrom;
- this.doc.iter(j, this.display.viewTo, function(Q) {
- if (Q.widgets) {
- for (var ne = 0; ne < Q.widgets.length; ne++)
- if (Q.widgets[ne].noHScroll) {
- mr(O, j, "widget");
+ }),
+ getTokenAt: function(f, v) {
+ return Xp(this, f, v);
+ },
+ getLineTokens: function(f, v) {
+ return Xp(this, ye(f), v, !0);
+ },
+ getTokenTypeAt: function(f) {
+ f = _t(this.doc, f);
+ var v = Yp(this, ut(this.doc, f.line)), O = 0, L = (v.length - 1) / 2, j = f.ch, Q;
+ if (j == 0)
+ Q = v[2];
+ else
+ for (; ; ) {
+ var ne = O + L >> 1;
+ if ((ne ? v[ne * 2 - 1] : 0) >= j)
+ L = ne;
+ else if (v[ne * 2 + 1] < j)
+ O = ne + 1;
+ else {
+ Q = v[ne * 2 + 2];
break;
}
+ }
+ var se = Q ? Q.indexOf("overlay ") : -1;
+ return se < 0 ? Q : se == 0 ? null : Q.slice(0, se - 1);
+ },
+ getModeAt: function(f) {
+ var v = this.doc.mode;
+ return v.innerMode ? o.innerMode(v, this.getTokenAt(f).state).mode : v;
+ },
+ getHelper: function(f, v) {
+ return this.getHelpers(f, v)[0];
+ },
+ getHelpers: function(f, v) {
+ var O = [];
+ if (!c.hasOwnProperty(v))
+ return O;
+ var L = c[v], j = this.getModeAt(f);
+ if (typeof j[v] == "string")
+ L[j[v]] && O.push(L[j[v]]);
+ else if (j[v])
+ for (var Q = 0; Q < j[v].length; Q++) {
+ var ne = L[j[v][Q]];
+ ne && O.push(ne);
+ }
+ else
+ j.helperType && L[j.helperType] ? O.push(L[j.helperType]) : L[j.name] && O.push(L[j.name]);
+ for (var se = 0; se < L._global.length; se++) {
+ var de = L._global[se];
+ de.pred(j, this) && he(O, de.val) == -1 && O.push(de.val);
}
- ++j;
- }), this.curOp.forceUpdate = !0, st(this, "refresh", this);
- }),
- operation: function(f) {
- return Wn(this, f);
- },
- startOperation: function() {
- return Nr(this);
- },
- endOperation: function() {
- return Br(this);
- },
- refresh: On(function() {
- var f = this.display.cachedTextHeight;
- Ln(this), this.curOp.forceUpdate = !0, ca(this), ha(this, this.doc.scrollLeft, this.doc.scrollTop), ad(this.display), (f == null || Math.abs(f - uo(this.display)) > 0.5 || this.options.lineWrapping) && Xu(this), st(this, "refresh", this);
- }),
- swapDoc: On(function(f) {
- var v = this.doc;
- return v.cm = null, this.state.selectingText && this.state.selectingText(), Yh(this, f), ca(this), this.display.input.reset(), ha(this, f.scrollLeft, f.scrollTop), this.curOp.forceScroll = !0, pn(this, "swapDoc", this, v), v;
- }),
- phrase: function(f) {
- var v = this.options.phrases;
- return v && Object.prototype.hasOwnProperty.call(v, f) ? v[f] : f;
- },
- getInputField: function() {
- return this.display.input.getField();
- },
- getWrapperElement: function() {
- return this.display.wrapper;
- },
- getScrollerElement: function() {
- return this.display.scroller;
- },
- getGutterElement: function() {
- return this.display.gutters;
- }
- }, zt(o), o.registerHelper = function(f, v, O) {
- c.hasOwnProperty(f) || (c[f] = o[f] = { _global: [] }), c[f][v] = O;
- }, o.registerGlobalHelper = function(f, v, O, L) {
- o.registerHelper(f, v, L), c[f]._global.push({ pred: O, val: L });
- };
- }
- function Cd(o, l, c, f, v) {
- var O = l, L = c, j = ut(o, l.line), Q = v && o.direction == "rtl" ? -c : c;
- function ne() {
- var nt = l.line + Q;
- return nt < o.first || nt >= o.first + o.size ? !1 : (l = new ye(nt, l.ch, l.sticky), j = ut(o, nt));
- }
- function se(nt) {
- var Qe;
- if (f == "codepoint") {
- var ot = j.text.charCodeAt(l.ch + (c > 0 ? 0 : -1));
- if (isNaN(ot))
- Qe = null;
- else {
- var mt = c > 0 ? ot >= 55296 && ot < 56320 : ot >= 56320 && ot < 57343;
- Qe = new ye(l.line, Math.max(0, Math.min(j.text.length, l.ch + c * (mt ? 2 : 1))), -c);
+ return O;
+ },
+ getStateAfter: function(f, v) {
+ var O = this.doc;
+ return f = qn(O, f == null ? O.first + O.size - 1 : f), la(this, f + 1, v).state;
+ },
+ cursorCoords: function(f, v) {
+ var O, L = this.doc.sel.primary();
+ return f == null ? O = L.head : typeof f == "object" ? O = _t(this.doc, f) : O = f ? L.from() : L.to(), wi(this, O, v || "page");
+ },
+ charCoords: function(f, v) {
+ return Rl(this, _t(this.doc, f), v || "page");
+ },
+ coordsChar: function(f, v) {
+ return f = xh(this, f, v || "page"), Ku(this, f.left, f.top);
+ },
+ lineAtHeight: function(f, v) {
+ return f = xh(this, { top: f, left: 0 }, v || "page").top, Di(this.doc, f + this.display.viewOffset);
+ },
+ heightAtLine: function(f, v, O) {
+ var L = !1, j;
+ if (typeof f == "number") {
+ var Q = this.doc.first + this.doc.size - 1;
+ f < this.doc.first ? f = this.doc.first : f > Q && (f = Q, L = !0), j = ut(this.doc, f);
+ } else
+ j = f;
+ return $l(this, j, { top: 0, left: 0 }, v || "page", O || L).top + (L ? this.doc.height - Ji(j) : 0);
+ },
+ defaultTextHeight: function() {
+ return so(this.display);
+ },
+ defaultCharWidth: function() {
+ return uo(this.display);
+ },
+ getViewport: function() {
+ return { from: this.display.viewFrom, to: this.display.viewTo };
+ },
+ addWidget: function(f, v, O, L, j) {
+ var Q = this.display;
+ f = wi(this, _t(this.doc, f));
+ var ne = f.bottom, se = f.left;
+ if (v.style.position = "absolute", v.setAttribute("cm-ignore-events", "true"), this.display.input.setUneditable(v), Q.sizer.appendChild(v), L == "over")
+ ne = f.top;
+ else if (L == "above" || L == "near") {
+ var de = Math.max(Q.wrapper.clientHeight, this.doc.height), Ee = Math.max(Q.sizer.clientWidth, Q.lineSpace.clientWidth);
+ (L == "above" || f.bottom + v.offsetHeight > de) && f.top > v.offsetHeight ? ne = f.top - v.offsetHeight : f.bottom + v.offsetHeight <= de && (ne = f.bottom), se + v.offsetWidth > Ee && (se = Ee - v.offsetWidth);
+ }
+ v.style.top = ne + "px", v.style.left = v.style.right = "", j == "right" ? (se = Q.sizer.clientWidth - v.offsetWidth, v.style.right = "0px") : (j == "left" ? se = 0 : j == "middle" && (se = (Q.sizer.clientWidth - v.offsetWidth) / 2), v.style.left = se + "px"), O && Q1(this, { left: se, top: ne, right: se + v.offsetWidth, bottom: ne + v.offsetHeight });
+ },
+ triggerOnKeyDown: On(Om),
+ triggerOnKeyPress: On(Rm),
+ triggerOnKeyUp: $m,
+ triggerOnMouseDown: On(Dm),
+ execCommand: function(f) {
+ if (Oa.hasOwnProperty(f))
+ return Oa[f].call(null, this);
+ },
+ triggerElectric: On(function(f) {
+ Bm(this, f);
+ }),
+ findPosH: function(f, v, O, L) {
+ var j = 1;
+ v < 0 && (j = -1, v = -v);
+ for (var Q = _t(this.doc, f), ne = 0; ne < v && (Q = Cd(this.doc, Q, j, O, L), !Q.hitSide); ++ne)
+ ;
+ return Q;
+ },
+ moveH: On(function(f, v) {
+ var O = this;
+ this.extendSelectionsBy(function(L) {
+ return O.display.shift || O.doc.extend || L.empty() ? Cd(O.doc, L.head, f, v, O.options.rtlMoveVisually) : f < 0 ? L.from() : L.to();
+ }, X);
+ }),
+ deleteH: On(function(f, v) {
+ var O = this.doc.sel, L = this.doc;
+ O.somethingSelected() ? L.replaceSelection("", null, "+delete") : _o(this, function(j) {
+ var Q = Cd(L, j.head, f, v, !1);
+ return f < 0 ? { from: Q, to: j.head } : { from: j.head, to: Q };
+ });
+ }),
+ findPosV: function(f, v, O, L) {
+ var j = 1, Q = L;
+ v < 0 && (j = -1, v = -v);
+ for (var ne = _t(this.doc, f), se = 0; se < v; ++se) {
+ var de = wi(this, ne, "div");
+ if (Q == null ? Q = de.left : de.left = Q, ne = Hm(this, de, j, O), ne.hitSide)
+ break;
+ }
+ return ne;
+ },
+ moveV: On(function(f, v) {
+ var O = this, L = this.doc, j = [], Q = !this.display.shift && !L.extend && L.sel.somethingSelected();
+ if (L.extendSelectionsBy(function(se) {
+ if (Q)
+ return f < 0 ? se.from() : se.to();
+ var de = wi(O, se.head, "div");
+ se.goalColumn != null && (de.left = se.goalColumn), j.push(de.left);
+ var Ee = Hm(O, de, f, v);
+ return v == "page" && se == L.sel.primary() && id(O, Rl(O, Ee, "div").top - de.top), Ee;
+ }, X), j.length)
+ for (var ne = 0; ne < L.sel.ranges.length; ne++)
+ L.sel.ranges[ne].goalColumn = j[ne];
+ }),
+ findWordAt: function(f) {
+ var v = this.doc, O = ut(v, f.line).text, L = f.ch, j = f.ch;
+ if (O) {
+ var Q = this.getHelper(f, "wordChars");
+ (f.sticky == "before" || j == O.length) && L ? --L : ++j;
+ for (var ne = O.charAt(L), se = it(ne, Q) ? function(de) {
+ return it(de, Q);
+ } : /\s/.test(ne) ? function(de) {
+ return /\s/.test(de);
+ } : function(de) {
+ return !/\s/.test(de) && !it(de);
+ }; L > 0 && se(O.charAt(L - 1)); )
+ --L;
+ for (; j < O.length && se(O.charAt(j)); )
+ ++j;
+ }
+ return new Pt(ye(f.line, L), ye(f.line, j));
+ },
+ toggleOverwrite: function(f) {
+ f != null && f == this.state.overwrite || ((this.state.overwrite = !this.state.overwrite) ? Z(this.display.cursorDiv, "CodeMirror-overwrite") : V(this.display.cursorDiv, "CodeMirror-overwrite"), st(this, "overwriteToggle", this, this.state.overwrite));
+ },
+ hasFocus: function() {
+ return this.display.input.getField() == q(te(this));
+ },
+ isReadOnly: function() {
+ return !!(this.options.readOnly || this.doc.cantEdit);
+ },
+ scrollTo: On(function(f, v) {
+ ha(this, f, v);
+ }),
+ getScrollInfo: function() {
+ var f = this.display.scroller;
+ return {
+ left: f.scrollLeft,
+ top: f.scrollTop,
+ height: f.scrollHeight - Fi(this) - this.display.barHeight,
+ width: f.scrollWidth - Fi(this) - this.display.barWidth,
+ clientHeight: Hu(this),
+ clientWidth: Dr(this)
+ };
+ },
+ scrollIntoView: On(function(f, v) {
+ f == null ? (f = { from: this.doc.sel.primary().head, to: null }, v == null && (v = this.options.cursorScrollMargin)) : typeof f == "number" ? f = { from: ye(f, 0), to: null } : f.from == null && (f = { from: f, to: null }), f.to || (f.to = f.from), f.margin = v || 0, f.from.line != null ? J1(this, f) : Ph(this, f.from, f.to, f.margin);
+ }),
+ setSize: On(function(f, v) {
+ var O = this, L = function(Q) {
+ return typeof Q == "number" || /^\d+$/.test(String(Q)) ? Q + "px" : Q;
+ };
+ f != null && (this.display.wrapper.style.width = L(f)), v != null && (this.display.wrapper.style.height = L(v)), this.options.lineWrapping && Ch(this);
+ var j = this.display.viewFrom;
+ this.doc.iter(j, this.display.viewTo, function(Q) {
+ if (Q.widgets) {
+ for (var ne = 0; ne < Q.widgets.length; ne++)
+ if (Q.widgets[ne].noHScroll) {
+ mr(O, j, "widget");
+ break;
+ }
+ }
+ ++j;
+ }), this.curOp.forceUpdate = !0, st(this, "refresh", this);
+ }),
+ operation: function(f) {
+ return Wn(this, f);
+ },
+ startOperation: function() {
+ return Nr(this);
+ },
+ endOperation: function() {
+ return Br(this);
+ },
+ refresh: On(function() {
+ var f = this.display.cachedTextHeight;
+ Ln(this), this.curOp.forceUpdate = !0, ca(this), ha(this, this.doc.scrollLeft, this.doc.scrollTop), ad(this.display), (f == null || Math.abs(f - so(this.display)) > 0.5 || this.options.lineWrapping) && Xu(this), st(this, "refresh", this);
+ }),
+ swapDoc: On(function(f) {
+ var v = this.doc;
+ return v.cm = null, this.state.selectingText && this.state.selectingText(), Qh(this, f), ca(this), this.display.input.reset(), ha(this, f.scrollLeft, f.scrollTop), this.curOp.forceScroll = !0, pn(this, "swapDoc", this, v), v;
+ }),
+ phrase: function(f) {
+ var v = this.options.phrases;
+ return v && Object.prototype.hasOwnProperty.call(v, f) ? v[f] : f;
+ },
+ getInputField: function() {
+ return this.display.input.getField();
+ },
+ getWrapperElement: function() {
+ return this.display.wrapper;
+ },
+ getScrollerElement: function() {
+ return this.display.scroller;
+ },
+ getGutterElement: function() {
+ return this.display.gutters;
}
- } else
- v ? Qe = R_(o.cm, j, l, c) : Qe = vd(j, l, c);
- if (Qe == null)
- if (!nt && ne())
- l = gd(v, o.cm, j, l.line, Q);
- else
- return !1;
- else
- l = Qe;
- return !0;
+ }, zt(o), o.registerHelper = function(f, v, O) {
+ c.hasOwnProperty(f) || (c[f] = o[f] = { _global: [] }), c[f][v] = O;
+ }, o.registerGlobalHelper = function(f, v, O, L) {
+ o.registerHelper(f, v, L), c[f]._global.push({ pred: O, val: L });
+ };
}
- if (f == "char" || f == "codepoint")
- se();
- else if (f == "column")
- se(!0);
- else if (f == "word" || f == "group")
- for (var de = null, Ee = f == "group", Ce = o.cm && o.cm.getHelper(l, "wordChars"), Ie = !0; !(c < 0 && !se(!Ie)); Ie = !1) {
- var Ne = j.text.charAt(l.ch) || `
+ function Cd(o, l, c, f, v) {
+ var O = l, L = c, j = ut(o, l.line), Q = v && o.direction == "rtl" ? -c : c;
+ function ne() {
+ var nt = l.line + Q;
+ return nt < o.first || nt >= o.first + o.size ? !1 : (l = new ye(nt, l.ch, l.sticky), j = ut(o, nt));
+ }
+ function se(nt) {
+ var Qe;
+ if (f == "codepoint") {
+ var ot = j.text.charCodeAt(l.ch + (c > 0 ? 0 : -1));
+ if (isNaN(ot))
+ Qe = null;
+ else {
+ var mt = c > 0 ? ot >= 55296 && ot < 56320 : ot >= 56320 && ot < 57343;
+ Qe = new ye(l.line, Math.max(0, Math.min(j.text.length, l.ch + c * (mt ? 2 : 1))), -c);
+ }
+ } else
+ v ? Qe = I_(o.cm, j, l, c) : Qe = vd(j, l, c);
+ if (Qe == null)
+ if (!nt && ne())
+ l = gd(v, o.cm, j, l.line, Q);
+ else
+ return !1;
+ else
+ l = Qe;
+ return !0;
+ }
+ if (f == "char" || f == "codepoint")
+ se();
+ else if (f == "column")
+ se(!0);
+ else if (f == "word" || f == "group")
+ for (var de = null, Ee = f == "group", Ce = o.cm && o.cm.getHelper(l, "wordChars"), Ie = !0; !(c < 0 && !se(!Ie)); Ie = !1) {
+ var Ne = j.text.charAt(l.ch) || `
`, Ue = it(Ne, Ce) ? "w" : Ee && Ne == `
` ? "n" : !Ee || /\s/.test(Ne) ? null : "p";
- if (Ee && !Ie && !Ue && (Ue = "s"), de && de != Ue) {
- c < 0 && (c = 1, se(), l.sticky = "after");
- break;
- }
- if (Ue && (de = Ue), c > 0 && !se(!Ie))
- break;
- }
- var Ye = Hl(o, l, O, L, !0);
- return bt(O, Ye) && (Ye.hitSide = !0), Ye;
- }
- function Um(o, l, c, f) {
- var v = o.doc, O = l.left, L;
- if (f == "page") {
- var j = Math.min(o.display.wrapper.clientHeight, pe(o).innerHeight || v(o).documentElement.clientHeight), Q = Math.max(j - 0.5 * uo(o.display), 3);
- L = (c > 0 ? l.bottom : l.top) + c * Q;
- } else
- f == "line" && (L = c > 0 ? l.bottom + 3 : l.top - 3);
- for (var ne; ne = Ku(o, O, L), !!ne.outside; ) {
- if (c < 0 ? L <= 0 : L >= v.height) {
- ne.hitSide = !0;
- break;
- }
- L += c * 5;
- }
- return ne;
- }
- var Lt = function(o) {
- this.cm = o, this.lastAnchorNode = this.lastAnchorOffset = this.lastFocusNode = this.lastFocusOffset = null, this.polling = new we(), this.composing = null, this.gracePeriod = !1, this.readDOMTimeout = null;
- };
- Lt.prototype.init = function(o) {
- var l = this, c = this, f = c.cm, v = c.div = o.lineDiv;
- v.contentEditable = !0, Vm(v, f.options.spellcheck, f.options.autocorrect, f.options.autocapitalize);
- function O(j) {
- for (var Q = j.target; Q; Q = Q.parentNode) {
- if (Q == v)
- return !0;
- if (/\bCodeMirror-(?:line)?widget\b/.test(Q.className))
- break;
- }
- return !1;
- }
- $e(v, "paste", function(j) {
- !O(j) || Ct(f, j) || Lm(j, f) || p <= 11 && setTimeout(hn(f, function() {
- return l.updateFromDOM();
- }), 20);
- }), $e(v, "compositionstart", function(j) {
- l.composing = { data: j.data, done: !1 };
- }), $e(v, "compositionupdate", function(j) {
- l.composing || (l.composing = { data: j.data, done: !1 });
- }), $e(v, "compositionend", function(j) {
- l.composing && (j.data != l.composing.data && l.readFromDOMSoon(), l.composing.done = !0);
- }), $e(v, "touchstart", function() {
- return c.forceCompositionEnd();
- }), $e(v, "input", function() {
- l.composing || l.readFromDOMSoon();
- });
- function L(j) {
- if (!(!O(j) || Ct(f, j))) {
- if (f.somethingSelected())
- Ql({ lineWise: !1, text: f.getSelections() }), j.type == "cut" && f.replaceSelection("", null, "cut");
- else if (f.options.lineWiseCopyCut) {
- var Q = Bm(f);
- Ql({ lineWise: !0, text: Q.text }), j.type == "cut" && f.operation(function() {
- f.setSelections(Q.ranges, 0, $), f.replaceSelection("", null, "cut");
- });
- } else
- return;
- if (j.clipboardData) {
- j.clipboardData.clearData();
- var ne = Ci.text.join(`
-`);
- if (j.clipboardData.setData("Text", ne), j.clipboardData.getData("Text") == ne) {
- j.preventDefault();
- return;
+ if (Ee && !Ie && !Ue && (Ue = "s"), de && de != Ue) {
+ c < 0 && (c = 1, se(), l.sticky = "after");
+ break;
}
+ if (Ue && (de = Ue), c > 0 && !se(!Ie))
+ break;
}
- var se = jm(), de = se.firstChild;
- f.display.lineSpace.insertBefore(se, f.display.lineSpace.firstChild), de.value = Ci.text.join(`
+ var Ye = Hl(o, l, O, L, !0);
+ return bt(O, Ye) && (Ye.hitSide = !0), Ye;
+ }
+ function Hm(o, l, c, f) {
+ var v = o.doc, O = l.left, L;
+ if (f == "page") {
+ var j = Math.min(o.display.wrapper.clientHeight, pe(o).innerHeight || v(o).documentElement.clientHeight), Q = Math.max(j - 0.5 * so(o.display), 3);
+ L = (c > 0 ? l.bottom : l.top) + c * Q;
+ } else
+ f == "line" && (L = c > 0 ? l.bottom + 3 : l.top - 3);
+ for (var ne; ne = Ku(o, O, L), !!ne.outside; ) {
+ if (c < 0 ? L <= 0 : L >= v.height) {
+ ne.hitSide = !0;
+ break;
+ }
+ L += c * 5;
+ }
+ return ne;
+ }
+ var Lt = function(o) {
+ this.cm = o, this.lastAnchorNode = this.lastAnchorOffset = this.lastFocusNode = this.lastFocusOffset = null, this.polling = new we(), this.composing = null, this.gracePeriod = !1, this.readDOMTimeout = null;
+ };
+ Lt.prototype.init = function(o) {
+ var l = this, c = this, f = c.cm, v = c.div = o.lineDiv;
+ v.contentEditable = !0, jm(v, f.options.spellcheck, f.options.autocorrect, f.options.autocapitalize);
+ function O(j) {
+ for (var Q = j.target; Q; Q = Q.parentNode) {
+ if (Q == v)
+ return !0;
+ if (/\bCodeMirror-(?:line)?widget\b/.test(Q.className))
+ break;
+ }
+ return !1;
+ }
+ $e(v, "paste", function(j) {
+ !O(j) || Ct(f, j) || Nm(j, f) || p <= 11 && setTimeout(hn(f, function() {
+ return l.updateFromDOM();
+ }), 20);
+ }), $e(v, "compositionstart", function(j) {
+ l.composing = { data: j.data, done: !1 };
+ }), $e(v, "compositionupdate", function(j) {
+ l.composing || (l.composing = { data: j.data, done: !1 });
+ }), $e(v, "compositionend", function(j) {
+ l.composing && (j.data != l.composing.data && l.readFromDOMSoon(), l.composing.done = !0);
+ }), $e(v, "touchstart", function() {
+ return c.forceCompositionEnd();
+ }), $e(v, "input", function() {
+ l.composing || l.readFromDOMSoon();
+ });
+ function L(j) {
+ if (!(!O(j) || Ct(f, j))) {
+ if (f.somethingSelected())
+ Ql({ lineWise: !1, text: f.getSelections() }), j.type == "cut" && f.replaceSelection("", null, "cut");
+ else if (f.options.lineWiseCopyCut) {
+ var Q = Vm(f);
+ Ql({ lineWise: !0, text: Q.text }), j.type == "cut" && f.operation(function() {
+ f.setSelections(Q.ranges, 0, $), f.replaceSelection("", null, "cut");
+ });
+ } else
+ return;
+ if (j.clipboardData) {
+ j.clipboardData.clearData();
+ var ne = Ci.text.join(`
`);
- var Ee = q(v.ownerDocument);
- ue(de), setTimeout(function() {
- f.display.lineSpace.removeChild(se), Ee.focus(), Ee == v && c.showPrimarySelection();
- }, 50);
+ if (j.clipboardData.setData("Text", ne), j.clipboardData.getData("Text") == ne) {
+ j.preventDefault();
+ return;
+ }
+ }
+ var se = Um(), de = se.firstChild;
+ f.display.lineSpace.insertBefore(se, f.display.lineSpace.firstChild), de.value = Ci.text.join(`
+`);
+ var Ee = q(v.ownerDocument);
+ ue(de), setTimeout(function() {
+ f.display.lineSpace.removeChild(se), Ee.focus(), Ee == v && c.showPrimarySelection();
+ }, 50);
+ }
}
- }
- $e(v, "copy", L), $e(v, "cut", L);
- }, Lt.prototype.screenReaderLabelChanged = function(o) {
- o ? this.div.setAttribute("aria-label", o) : this.div.removeAttribute("aria-label");
- }, Lt.prototype.prepareSelection = function() {
- var o = Rh(this.cm, !1);
- return o.focus = q(this.div.ownerDocument) == this.div, o;
- }, Lt.prototype.showSelection = function(o, l) {
- !o || !this.cm.display.view.length || ((o.focus || l) && this.showPrimarySelection(), this.showMultipleSelections(o));
- }, Lt.prototype.getSelection = function() {
- return this.cm.display.wrapper.ownerDocument.getSelection();
- }, Lt.prototype.showPrimarySelection = function() {
- var o = this.getSelection(), l = this.cm, c = l.doc.sel.primary(), f = c.from(), v = c.to();
- if (l.display.viewTo == l.display.viewFrom || f.line >= l.display.viewTo || v.line < l.display.viewFrom) {
- o.removeAllRanges();
- return;
- }
- var O = Jl(l, o.anchorNode, o.anchorOffset), L = Jl(l, o.focusNode, o.focusOffset);
- if (!(O && !O.bad && L && !L.bad && De(un(O, L), f) == 0 && De(Rt(O, L), v) == 0)) {
- var j = l.display.view, Q = f.line >= l.display.viewFrom && Hm(l, f) || { node: j[0].measure.map[2], offset: 0 }, ne = v.line < l.display.viewTo && Hm(l, v);
- if (!ne) {
- var se = j[j.length - 1].measure, de = se.maps ? se.maps[se.maps.length - 1] : se.map;
- ne = { node: de[de.length - 1], offset: de[de.length - 2] - de[de.length - 3] };
- }
- if (!Q || !ne) {
+ $e(v, "copy", L), $e(v, "cut", L);
+ }, Lt.prototype.screenReaderLabelChanged = function(o) {
+ o ? this.div.setAttribute("aria-label", o) : this.div.removeAttribute("aria-label");
+ }, Lt.prototype.prepareSelection = function() {
+ var o = Dh(this.cm, !1);
+ return o.focus = q(this.div.ownerDocument) == this.div, o;
+ }, Lt.prototype.showSelection = function(o, l) {
+ !o || !this.cm.display.view.length || ((o.focus || l) && this.showPrimarySelection(), this.showMultipleSelections(o));
+ }, Lt.prototype.getSelection = function() {
+ return this.cm.display.wrapper.ownerDocument.getSelection();
+ }, Lt.prototype.showPrimarySelection = function() {
+ var o = this.getSelection(), l = this.cm, c = l.doc.sel.primary(), f = c.from(), v = c.to();
+ if (l.display.viewTo == l.display.viewFrom || f.line >= l.display.viewTo || v.line < l.display.viewFrom) {
o.removeAllRanges();
return;
}
- var Ee = o.rangeCount && o.getRangeAt(0), Ce;
- try {
- Ce = F(Q.node, Q.offset, ne.offset, ne.node);
- } catch {
+ var O = Jl(l, o.anchorNode, o.anchorOffset), L = Jl(l, o.focusNode, o.focusOffset);
+ if (!(O && !O.bad && L && !L.bad && De(un(O, L), f) == 0 && De(Rt(O, L), v) == 0)) {
+ var j = l.display.view, Q = f.line >= l.display.viewFrom && zm(l, f) || { node: j[0].measure.map[2], offset: 0 }, ne = v.line < l.display.viewTo && zm(l, v);
+ if (!ne) {
+ var se = j[j.length - 1].measure, de = se.maps ? se.maps[se.maps.length - 1] : se.map;
+ ne = { node: de[de.length - 1], offset: de[de.length - 2] - de[de.length - 3] };
+ }
+ if (!Q || !ne) {
+ o.removeAllRanges();
+ return;
+ }
+ var Ee = o.rangeCount && o.getRangeAt(0), Ce;
+ try {
+ Ce = F(Q.node, Q.offset, ne.offset, ne.node);
+ } catch {
+ }
+ Ce && (!n && l.state.focused ? (o.collapse(Q.node, Q.offset), Ce.collapsed || (o.removeAllRanges(), o.addRange(Ce))) : (o.removeAllRanges(), o.addRange(Ce)), Ee && o.anchorNode == null ? o.addRange(Ee) : n && this.startGracePeriod()), this.rememberSelection();
}
- Ce && (!n && l.state.focused ? (o.collapse(Q.node, Q.offset), Ce.collapsed || (o.removeAllRanges(), o.addRange(Ce))) : (o.removeAllRanges(), o.addRange(Ce)), Ee && o.anchorNode == null ? o.addRange(Ee) : n && this.startGracePeriod()), this.rememberSelection();
- }
- }, Lt.prototype.startGracePeriod = function() {
- var o = this;
- clearTimeout(this.gracePeriod), this.gracePeriod = setTimeout(function() {
- o.gracePeriod = !1, o.selectionChanged() && o.cm.operation(function() {
- return o.cm.curOp.selectionChanged = !0;
- });
- }, 20);
- }, Lt.prototype.showMultipleSelections = function(o) {
- G(this.cm.display.cursorDiv, o.cursors), G(this.cm.display.selectionDiv, o.selection);
- }, Lt.prototype.rememberSelection = function() {
- var o = this.getSelection();
- this.lastAnchorNode = o.anchorNode, this.lastAnchorOffset = o.anchorOffset, this.lastFocusNode = o.focusNode, this.lastFocusOffset = o.focusOffset;
- }, Lt.prototype.selectionInEditor = function() {
- var o = this.getSelection();
- if (!o.rangeCount)
- return !1;
- var l = o.getRangeAt(0).commonAncestorContainer;
- return C(this.div, l);
- }, Lt.prototype.focus = function() {
- this.cm.options.readOnly != "nocursor" && ((!this.selectionInEditor() || q(this.div.ownerDocument) != this.div) && this.showSelection(this.prepareSelection(), !0), this.div.focus());
- }, Lt.prototype.blur = function() {
- this.div.blur();
- }, Lt.prototype.getField = function() {
- return this.div;
- }, Lt.prototype.supportsTouch = function() {
- return !0;
- }, Lt.prototype.receivedFocus = function() {
- var o = this, l = this;
- this.selectionInEditor() ? setTimeout(function() {
- return o.pollSelection();
- }, 20) : Wn(this.cm, function() {
- return l.cm.curOp.selectionChanged = !0;
- });
- function c() {
- l.cm.state.focused && (l.pollSelection(), l.polling.set(l.cm.options.pollInterval, c));
- }
- this.polling.set(this.cm.options.pollInterval, c);
- }, Lt.prototype.selectionChanged = function() {
- var o = this.getSelection();
- return o.anchorNode != this.lastAnchorNode || o.anchorOffset != this.lastAnchorOffset || o.focusNode != this.lastFocusNode || o.focusOffset != this.lastFocusOffset;
- }, Lt.prototype.pollSelection = function() {
- if (!(this.readDOMTimeout != null || this.gracePeriod || !this.selectionChanged())) {
- var o = this.getSelection(), l = this.cm;
- if (E && _ && this.cm.display.gutterSpecs.length && X_(o.anchorNode)) {
- this.cm.triggerOnKeyDown({ type: "keydown", keyCode: 8, preventDefault: Math.abs }), this.blur(), this.focus();
- return;
- }
- if (!this.composing) {
- this.rememberSelection();
- var c = Jl(l, o.anchorNode, o.anchorOffset), f = Jl(l, o.focusNode, o.focusOffset);
- c && f && Wn(l, function() {
- En(l.doc, gr(c, f), $), (c.bad || f.bad) && (l.curOp.selectionChanged = !0);
+ }, Lt.prototype.startGracePeriod = function() {
+ var o = this;
+ clearTimeout(this.gracePeriod), this.gracePeriod = setTimeout(function() {
+ o.gracePeriod = !1, o.selectionChanged() && o.cm.operation(function() {
+ return o.cm.curOp.selectionChanged = !0;
});
+ }, 20);
+ }, Lt.prototype.showMultipleSelections = function(o) {
+ G(this.cm.display.cursorDiv, o.cursors), G(this.cm.display.selectionDiv, o.selection);
+ }, Lt.prototype.rememberSelection = function() {
+ var o = this.getSelection();
+ this.lastAnchorNode = o.anchorNode, this.lastAnchorOffset = o.anchorOffset, this.lastFocusNode = o.focusNode, this.lastFocusOffset = o.focusOffset;
+ }, Lt.prototype.selectionInEditor = function() {
+ var o = this.getSelection();
+ if (!o.rangeCount)
+ return !1;
+ var l = o.getRangeAt(0).commonAncestorContainer;
+ return C(this.div, l);
+ }, Lt.prototype.focus = function() {
+ this.cm.options.readOnly != "nocursor" && ((!this.selectionInEditor() || q(this.div.ownerDocument) != this.div) && this.showSelection(this.prepareSelection(), !0), this.div.focus());
+ }, Lt.prototype.blur = function() {
+ this.div.blur();
+ }, Lt.prototype.getField = function() {
+ return this.div;
+ }, Lt.prototype.supportsTouch = function() {
+ return !0;
+ }, Lt.prototype.receivedFocus = function() {
+ var o = this, l = this;
+ this.selectionInEditor() ? setTimeout(function() {
+ return o.pollSelection();
+ }, 20) : Wn(this.cm, function() {
+ return l.cm.curOp.selectionChanged = !0;
+ });
+ function c() {
+ l.cm.state.focused && (l.pollSelection(), l.polling.set(l.cm.options.pollInterval, c));
}
- }
- }, Lt.prototype.pollContent = function() {
- this.readDOMTimeout != null && (clearTimeout(this.readDOMTimeout), this.readDOMTimeout = null);
- var o = this.cm, l = o.display, c = o.doc.sel.primary(), f = c.from(), v = c.to();
- if (f.ch == 0 && f.line > o.firstLine() && (f = ye(f.line - 1, ut(o.doc, f.line - 1).length)), v.ch == ut(o.doc, v.line).text.length && v.line < o.lastLine() && (v = ye(v.line + 1, 0)), f.line < l.viewFrom || v.line > l.viewTo - 1)
- return !1;
- var O, L, j;
- f.line == l.viewFrom || (O = Pr(o, f.line)) == 0 ? (L = Ft(l.view[0].line), j = l.view[0].node) : (L = Ft(l.view[O].line), j = l.view[O - 1].node.nextSibling);
- var Q = Pr(o, v.line), ne, se;
- if (Q == l.view.length - 1 ? (ne = l.viewTo - 1, se = l.lineDiv.lastChild) : (ne = Ft(l.view[Q + 1].line) - 1, se = l.view[Q + 1].node.previousSibling), !j)
- return !1;
- for (var de = o.doc.splitLines(Z_(o, j, se, L, ne)), Ee = Yi(o.doc, ye(L, 0), ye(ne, ut(o.doc, ne).text.length)); de.length > 1 && Ee.length > 1; )
- if (Ae(de) == Ae(Ee))
- de.pop(), Ee.pop(), ne--;
- else if (de[0] == Ee[0])
- de.shift(), Ee.shift(), L++;
- else
- break;
- for (var Ce = 0, Ie = 0, Ne = de[0], Ue = Ee[0], Ye = Math.min(Ne.length, Ue.length); Ce < Ye && Ne.charCodeAt(Ce) == Ue.charCodeAt(Ce); )
- ++Ce;
- for (var nt = Ae(de), Qe = Ae(Ee), ot = Math.min(
- nt.length - (de.length == 1 ? Ce : 0),
- Qe.length - (Ee.length == 1 ? Ce : 0)
- ); Ie < ot && nt.charCodeAt(nt.length - Ie - 1) == Qe.charCodeAt(Qe.length - Ie - 1); )
- ++Ie;
- if (de.length == 1 && Ee.length == 1 && L == f.line)
- for (; Ce && Ce > f.ch && nt.charCodeAt(nt.length - Ie - 1) == Qe.charCodeAt(Qe.length - Ie - 1); )
- Ce--, Ie++;
- de[de.length - 1] = nt.slice(0, nt.length - Ie).replace(/^\u200b+/, ""), de[0] = de[0].slice(Ce).replace(/\u200b+$/, "");
- var mt = ye(L, Ce), ct = ye(ne, Ee.length ? Ae(Ee).length - Ie : 0);
- if (de.length > 1 || de[0] || De(mt, ct))
- return yo(o.doc, de, mt, ct, "+input"), !0;
- }, Lt.prototype.ensurePolled = function() {
- this.forceCompositionEnd();
- }, Lt.prototype.reset = function() {
- this.forceCompositionEnd();
- }, Lt.prototype.forceCompositionEnd = function() {
- !this.composing || (clearTimeout(this.readDOMTimeout), this.composing = null, this.updateFromDOM(), this.div.blur(), this.div.focus());
- }, Lt.prototype.readFromDOMSoon = function() {
- var o = this;
- this.readDOMTimeout == null && (this.readDOMTimeout = setTimeout(function() {
- if (o.readDOMTimeout = null, o.composing)
- if (o.composing.done)
- o.composing = null;
+ this.polling.set(this.cm.options.pollInterval, c);
+ }, Lt.prototype.selectionChanged = function() {
+ var o = this.getSelection();
+ return o.anchorNode != this.lastAnchorNode || o.anchorOffset != this.lastAnchorOffset || o.focusNode != this.lastFocusNode || o.focusOffset != this.lastFocusOffset;
+ }, Lt.prototype.pollSelection = function() {
+ if (!(this.readDOMTimeout != null || this.gracePeriod || !this.selectionChanged())) {
+ var o = this.getSelection(), l = this.cm;
+ if (E && _ && this.cm.display.gutterSpecs.length && q_(o.anchorNode)) {
+ this.cm.triggerOnKeyDown({ type: "keydown", keyCode: 8, preventDefault: Math.abs }), this.blur(), this.focus();
+ return;
+ }
+ if (!this.composing) {
+ this.rememberSelection();
+ var c = Jl(l, o.anchorNode, o.anchorOffset), f = Jl(l, o.focusNode, o.focusOffset);
+ c && f && Wn(l, function() {
+ En(l.doc, gr(c, f), $), (c.bad || f.bad) && (l.curOp.selectionChanged = !0);
+ });
+ }
+ }
+ }, Lt.prototype.pollContent = function() {
+ this.readDOMTimeout != null && (clearTimeout(this.readDOMTimeout), this.readDOMTimeout = null);
+ var o = this.cm, l = o.display, c = o.doc.sel.primary(), f = c.from(), v = c.to();
+ if (f.ch == 0 && f.line > o.firstLine() && (f = ye(f.line - 1, ut(o.doc, f.line - 1).length)), v.ch == ut(o.doc, v.line).text.length && v.line < o.lastLine() && (v = ye(v.line + 1, 0)), f.line < l.viewFrom || v.line > l.viewTo - 1)
+ return !1;
+ var O, L, j;
+ f.line == l.viewFrom || (O = Pr(o, f.line)) == 0 ? (L = Ft(l.view[0].line), j = l.view[0].node) : (L = Ft(l.view[O].line), j = l.view[O - 1].node.nextSibling);
+ var Q = Pr(o, v.line), ne, se;
+ if (Q == l.view.length - 1 ? (ne = l.viewTo - 1, se = l.lineDiv.lastChild) : (ne = Ft(l.view[Q + 1].line) - 1, se = l.view[Q + 1].node.previousSibling), !j)
+ return !1;
+ for (var de = o.doc.splitLines(ew(o, j, se, L, ne)), Ee = Yi(o.doc, ye(L, 0), ye(ne, ut(o.doc, ne).text.length)); de.length > 1 && Ee.length > 1; )
+ if (Ae(de) == Ae(Ee))
+ de.pop(), Ee.pop(), ne--;
+ else if (de[0] == Ee[0])
+ de.shift(), Ee.shift(), L++;
else
- return;
- o.updateFromDOM();
- }, 80));
- }, Lt.prototype.updateFromDOM = function() {
- var o = this;
- (this.cm.isReadOnly() || !this.pollContent()) && Wn(this.cm, function() {
- return Ln(o.cm);
- });
- }, Lt.prototype.setUneditable = function(o) {
- o.contentEditable = "false";
- }, Lt.prototype.onKeyPress = function(o) {
- o.charCode == 0 || this.composing || (o.preventDefault(), this.cm.isReadOnly() || hn(this.cm, Ad)(this.cm, String.fromCharCode(o.charCode == null ? o.keyCode : o.charCode), 0));
- }, Lt.prototype.readOnlyChanged = function(o) {
- this.div.contentEditable = String(o != "nocursor");
- }, Lt.prototype.onContextMenu = function() {
- }, Lt.prototype.resetPosition = function() {
- }, Lt.prototype.needsContentAttribute = !0;
- function Hm(o, l) {
- var c = zu(o, l.line);
- if (!c || c.hidden)
- return null;
- var f = ut(o.doc, l.line), v = gh(c, f, l.line), O = ht(f, o.doc.direction), L = "left";
- if (O) {
- var j = je(O, l.ch);
- L = j % 2 ? "right" : "left";
- }
- var Q = _h(v.map, l.ch, L);
- return Q.offset = Q.collapse == "right" ? Q.end : Q.start, Q;
- }
- function X_(o) {
- for (var l = o; l; l = l.parentNode)
- if (/CodeMirror-gutter-wrapper/.test(l.className))
- return !0;
- return !1;
- }
- function Co(o, l) {
- return l && (o.bad = !0), o;
- }
- function Z_(o, l, c, f, v) {
- var O = "", L = !1, j = o.doc.lineSeparator(), Q = !1;
- function ne(Ce) {
- return function(Ie) {
- return Ie.id == Ce;
- };
- }
- function se() {
- L && (O += j, Q && (O += j), L = Q = !1);
- }
- function de(Ce) {
- Ce && (se(), O += Ce);
- }
- function Ee(Ce) {
- if (Ce.nodeType == 1) {
- var Ie = Ce.getAttribute("cm-text");
- if (Ie) {
- de(Ie);
- return;
- }
- var Ne = Ce.getAttribute("cm-marker"), Ue;
- if (Ne) {
- var Ye = o.findMarks(ye(f, 0), ye(v + 1, 0), ne(+Ne));
- Ye.length && (Ue = Ye[0].find(0)) && de(Yi(o.doc, Ue.from, Ue.to).join(j));
- return;
- }
- if (Ce.getAttribute("contenteditable") == "false")
- return;
- var nt = /^(pre|div|p|li|table|br)$/i.test(Ce.nodeName);
- if (!/^br$/i.test(Ce.nodeName) && Ce.textContent.length == 0)
- return;
- nt && se();
- for (var Qe = 0; Qe < Ce.childNodes.length; Qe++)
- Ee(Ce.childNodes[Qe]);
- /^(pre|p)$/i.test(Ce.nodeName) && (Q = !0), nt && (L = !0);
- } else
- Ce.nodeType == 3 && de(Ce.nodeValue.replace(/\u200b/g, "").replace(/\u00a0/g, " "));
- }
- for (; Ee(l), l != c; )
- l = l.nextSibling, Q = !1;
- return O;
- }
- function Jl(o, l, c) {
- var f;
- if (l == o.display.lineDiv) {
- if (f = o.display.lineDiv.childNodes[c], !f)
- return Co(o.clipPos(ye(o.display.viewTo - 1)), !0);
- l = null, c = 0;
- } else
- for (f = l; ; f = f.parentNode) {
- if (!f || f == o.display.lineDiv)
- return null;
- if (f.parentNode && f.parentNode == o.display.lineDiv)
break;
+ for (var Ce = 0, Ie = 0, Ne = de[0], Ue = Ee[0], Ye = Math.min(Ne.length, Ue.length); Ce < Ye && Ne.charCodeAt(Ce) == Ue.charCodeAt(Ce); )
+ ++Ce;
+ for (var nt = Ae(de), Qe = Ae(Ee), ot = Math.min(
+ nt.length - (de.length == 1 ? Ce : 0),
+ Qe.length - (Ee.length == 1 ? Ce : 0)
+ ); Ie < ot && nt.charCodeAt(nt.length - Ie - 1) == Qe.charCodeAt(Qe.length - Ie - 1); )
+ ++Ie;
+ if (de.length == 1 && Ee.length == 1 && L == f.line)
+ for (; Ce && Ce > f.ch && nt.charCodeAt(nt.length - Ie - 1) == Qe.charCodeAt(Qe.length - Ie - 1); )
+ Ce--, Ie++;
+ de[de.length - 1] = nt.slice(0, nt.length - Ie).replace(/^\u200b+/, ""), de[0] = de[0].slice(Ce).replace(/\u200b+$/, "");
+ var mt = ye(L, Ce), ct = ye(ne, Ee.length ? Ae(Ee).length - Ie : 0);
+ if (de.length > 1 || de[0] || De(mt, ct))
+ return go(o.doc, de, mt, ct, "+input"), !0;
+ }, Lt.prototype.ensurePolled = function() {
+ this.forceCompositionEnd();
+ }, Lt.prototype.reset = function() {
+ this.forceCompositionEnd();
+ }, Lt.prototype.forceCompositionEnd = function() {
+ !this.composing || (clearTimeout(this.readDOMTimeout), this.composing = null, this.updateFromDOM(), this.div.blur(), this.div.focus());
+ }, Lt.prototype.readFromDOMSoon = function() {
+ var o = this;
+ this.readDOMTimeout == null && (this.readDOMTimeout = setTimeout(function() {
+ if (o.readDOMTimeout = null, o.composing)
+ if (o.composing.done)
+ o.composing = null;
+ else
+ return;
+ o.updateFromDOM();
+ }, 80));
+ }, Lt.prototype.updateFromDOM = function() {
+ var o = this;
+ (this.cm.isReadOnly() || !this.pollContent()) && Wn(this.cm, function() {
+ return Ln(o.cm);
+ });
+ }, Lt.prototype.setUneditable = function(o) {
+ o.contentEditable = "false";
+ }, Lt.prototype.onKeyPress = function(o) {
+ o.charCode == 0 || this.composing || (o.preventDefault(), this.cm.isReadOnly() || hn(this.cm, Ad)(this.cm, String.fromCharCode(o.charCode == null ? o.keyCode : o.charCode), 0));
+ }, Lt.prototype.readOnlyChanged = function(o) {
+ this.div.contentEditable = String(o != "nocursor");
+ }, Lt.prototype.onContextMenu = function() {
+ }, Lt.prototype.resetPosition = function() {
+ }, Lt.prototype.needsContentAttribute = !0;
+ function zm(o, l) {
+ var c = zu(o, l.line);
+ if (!c || c.hidden)
+ return null;
+ var f = ut(o.doc, l.line), v = yh(c, f, l.line), O = ht(f, o.doc.direction), L = "left";
+ if (O) {
+ var j = je(O, l.ch);
+ L = j % 2 ? "right" : "left";
}
- for (var v = 0; v < o.display.view.length; v++) {
- var O = o.display.view[v];
- if (O.node == f)
- return q_(O, l, c);
+ var Q = wh(v.map, l.ch, L);
+ return Q.offset = Q.collapse == "right" ? Q.end : Q.start, Q;
}
- }
- function q_(o, l, c) {
- var f = o.text.firstChild, v = !1;
- if (!l || !C(f, l))
- return Co(ye(Ft(o.line), 0), !0);
- if (l == f && (v = !0, l = f.childNodes[c], c = 0, !l)) {
- var O = o.rest ? Ae(o.rest) : o.line;
- return Co(ye(Ft(O), O.text.length), v);
+ function q_(o) {
+ for (var l = o; l; l = l.parentNode)
+ if (/CodeMirror-gutter-wrapper/.test(l.className))
+ return !0;
+ return !1;
}
- var L = l.nodeType == 3 ? l : null, j = l;
- for (!L && l.childNodes.length == 1 && l.firstChild.nodeType == 3 && (L = l.firstChild, c && (c = L.nodeValue.length)); j.parentNode != f; )
- j = j.parentNode;
- var Q = o.measure, ne = Q.maps;
- function se(Ue, Ye, nt) {
- for (var Qe = -1; Qe < (ne ? ne.length : 0); Qe++)
- for (var ot = Qe < 0 ? Q.map : ne[Qe], mt = 0; mt < ot.length; mt += 3) {
- var ct = ot[mt + 2];
- if (ct == Ue || ct == Ye) {
- var Et = Ft(Qe < 0 ? o.line : o.rest[Qe]), Vt = ot[mt] + nt;
- return (nt < 0 || ct != Ue) && (Vt = ot[mt + (nt ? 1 : 0)]), ye(Et, Vt);
+ function Ao(o, l) {
+ return l && (o.bad = !0), o;
+ }
+ function ew(o, l, c, f, v) {
+ var O = "", L = !1, j = o.doc.lineSeparator(), Q = !1;
+ function ne(Ce) {
+ return function(Ie) {
+ return Ie.id == Ce;
+ };
+ }
+ function se() {
+ L && (O += j, Q && (O += j), L = Q = !1);
+ }
+ function de(Ce) {
+ Ce && (se(), O += Ce);
+ }
+ function Ee(Ce) {
+ if (Ce.nodeType == 1) {
+ var Ie = Ce.getAttribute("cm-text");
+ if (Ie) {
+ de(Ie);
+ return;
}
- }
- }
- var de = se(L, j, c);
- if (de)
- return Co(de, v);
- for (var Ee = j.nextSibling, Ce = L ? L.nodeValue.length - c : 0; Ee; Ee = Ee.nextSibling) {
- if (de = se(Ee, Ee.firstChild, 0), de)
- return Co(ye(de.line, de.ch - Ce), v);
- Ce += Ee.textContent.length;
- }
- for (var Ie = j.previousSibling, Ne = c; Ie; Ie = Ie.previousSibling) {
- if (de = se(Ie, Ie.firstChild, -1), de)
- return Co(ye(de.line, de.ch + Ne), v);
- Ne += Ie.textContent.length;
- }
- }
- var en = function(o) {
- this.cm = o, this.prevInput = "", this.pollingFast = !1, this.polling = new we(), this.hasSelection = !1, this.composing = null;
- };
- en.prototype.init = function(o) {
- var l = this, c = this, f = this.cm;
- this.createField(o);
- var v = this.textarea;
- o.wrapper.insertBefore(this.wrapper, o.wrapper.firstChild), w && (v.style.width = "0px"), $e(v, "input", function() {
- d && p >= 9 && l.hasSelection && (l.hasSelection = null), c.poll();
- }), $e(v, "paste", function(L) {
- Ct(f, L) || Lm(L, f) || (f.state.pasteIncoming = +new Date(), c.fastPoll());
- });
- function O(L) {
- if (!Ct(f, L)) {
- if (f.somethingSelected())
- Ql({ lineWise: !1, text: f.getSelections() });
- else if (f.options.lineWiseCopyCut) {
- var j = Bm(f);
- Ql({ lineWise: !0, text: j.text }), L.type == "cut" ? f.setSelections(j.ranges, null, $) : (c.prevInput = "", v.value = j.text.join(`
-`), ue(v));
+ var Ne = Ce.getAttribute("cm-marker"), Ue;
+ if (Ne) {
+ var Ye = o.findMarks(ye(f, 0), ye(v + 1, 0), ne(+Ne));
+ Ye.length && (Ue = Ye[0].find(0)) && de(Yi(o.doc, Ue.from, Ue.to).join(j));
+ return;
+ }
+ if (Ce.getAttribute("contenteditable") == "false")
+ return;
+ var nt = /^(pre|div|p|li|table|br)$/i.test(Ce.nodeName);
+ if (!/^br$/i.test(Ce.nodeName) && Ce.textContent.length == 0)
+ return;
+ nt && se();
+ for (var Qe = 0; Qe < Ce.childNodes.length; Qe++)
+ Ee(Ce.childNodes[Qe]);
+ /^(pre|p)$/i.test(Ce.nodeName) && (Q = !0), nt && (L = !0);
} else
- return;
- L.type == "cut" && (f.state.cutIncoming = +new Date());
+ Ce.nodeType == 3 && de(Ce.nodeValue.replace(/\u200b/g, "").replace(/\u00a0/g, " "));
}
+ for (; Ee(l), l != c; )
+ l = l.nextSibling, Q = !1;
+ return O;
}
- $e(v, "cut", O), $e(v, "copy", O), $e(o.scroller, "paste", function(L) {
- if (!(Xi(o, L) || Ct(f, L))) {
- if (!v.dispatchEvent) {
- f.state.pasteIncoming = +new Date(), c.focus();
- return;
- }
- var j = new Event("paste");
- j.clipboardData = L.clipboardData, v.dispatchEvent(j);
- }
- }), $e(o.lineSpace, "selectstart", function(L) {
- Xi(o, L) || It(L);
- }), $e(v, "compositionstart", function() {
- var L = f.getCursor("from");
- c.composing && c.composing.range.clear(), c.composing = {
- start: L,
- range: f.markText(L, f.getCursor("to"), { className: "CodeMirror-composing" })
- };
- }), $e(v, "compositionend", function() {
- c.composing && (c.poll(), c.composing.range.clear(), c.composing = null);
- });
- }, en.prototype.createField = function(o) {
- this.wrapper = jm(), this.textarea = this.wrapper.firstChild;
- }, en.prototype.screenReaderLabelChanged = function(o) {
- o ? this.textarea.setAttribute("aria-label", o) : this.textarea.removeAttribute("aria-label");
- }, en.prototype.prepareSelection = function() {
- var o = this.cm, l = o.display, c = o.doc, f = Rh(o);
- if (o.options.moveInputWithCursor) {
- var v = wi(o, c.sel.primary().head, "div"), O = l.wrapper.getBoundingClientRect(), L = l.lineDiv.getBoundingClientRect();
- f.teTop = Math.max(0, Math.min(
- l.wrapper.clientHeight - 10,
- v.top + L.top - O.top
- )), f.teLeft = Math.max(0, Math.min(
- l.wrapper.clientWidth - 10,
- v.left + L.left - O.left
- ));
- }
- return f;
- }, en.prototype.showSelection = function(o) {
- var l = this.cm, c = l.display;
- G(c.cursorDiv, o.cursors), G(c.selectionDiv, o.selection), o.teTop != null && (this.wrapper.style.top = o.teTop + "px", this.wrapper.style.left = o.teLeft + "px");
- }, en.prototype.reset = function(o) {
- if (!(this.contextMenuPending || this.composing)) {
- var l = this.cm;
- if (l.somethingSelected()) {
- this.prevInput = "";
- var c = l.getSelection();
- this.textarea.value = c, l.state.focused && ue(this.textarea), d && p >= 9 && (this.hasSelection = c);
+ function Jl(o, l, c) {
+ var f;
+ if (l == o.display.lineDiv) {
+ if (f = o.display.lineDiv.childNodes[c], !f)
+ return Ao(o.clipPos(ye(o.display.viewTo - 1)), !0);
+ l = null, c = 0;
} else
- o || (this.prevInput = this.textarea.value = "", d && p >= 9 && (this.hasSelection = null));
- }
- }, en.prototype.getField = function() {
- return this.textarea;
- }, en.prototype.supportsTouch = function() {
- return !1;
- }, en.prototype.focus = function() {
- if (this.cm.options.readOnly != "nocursor" && (!x || q(this.textarea.ownerDocument) != this.textarea))
- try {
- this.textarea.focus();
- } catch {
+ for (f = l; ; f = f.parentNode) {
+ if (!f || f == o.display.lineDiv)
+ return null;
+ if (f.parentNode && f.parentNode == o.display.lineDiv)
+ break;
+ }
+ for (var v = 0; v < o.display.view.length; v++) {
+ var O = o.display.view[v];
+ if (O.node == f)
+ return tw(O, l, c);
}
- }, en.prototype.blur = function() {
- this.textarea.blur();
- }, en.prototype.resetPosition = function() {
- this.wrapper.style.top = this.wrapper.style.left = 0;
- }, en.prototype.receivedFocus = function() {
- this.slowPoll();
- }, en.prototype.slowPoll = function() {
- var o = this;
- this.pollingFast || this.polling.set(this.cm.options.pollInterval, function() {
- o.poll(), o.cm.state.focused && o.slowPoll();
- });
- }, en.prototype.fastPoll = function() {
- var o = !1, l = this;
- l.pollingFast = !0;
- function c() {
- var f = l.poll();
- !f && !o ? (o = !0, l.polling.set(60, c)) : (l.pollingFast = !1, l.slowPoll());
}
- l.polling.set(20, c);
- }, en.prototype.poll = function() {
- var o = this, l = this.cm, c = this.textarea, f = this.prevInput;
- if (this.contextMenuPending || !l.state.focused || dr(c) && !f && !this.composing || l.isReadOnly() || l.options.disableInput || l.state.keySeq)
- return !1;
- var v = c.value;
- if (v == f && !l.somethingSelected())
- return !1;
- if (d && p >= 9 && this.hasSelection === v || k && /[\uf700-\uf7ff]/.test(v))
- return l.display.input.reset(), !1;
- if (l.doc.sel == l.display.selForContextMenu) {
- var O = v.charCodeAt(0);
- if (O == 8203 && !f && (f = "\u200B"), O == 8666)
- return this.reset(), this.cm.execCommand("undo");
+ function tw(o, l, c) {
+ var f = o.text.firstChild, v = !1;
+ if (!l || !C(f, l))
+ return Ao(ye(Ft(o.line), 0), !0);
+ if (l == f && (v = !0, l = f.childNodes[c], c = 0, !l)) {
+ var O = o.rest ? Ae(o.rest) : o.line;
+ return Ao(ye(Ft(O), O.text.length), v);
+ }
+ var L = l.nodeType == 3 ? l : null, j = l;
+ for (!L && l.childNodes.length == 1 && l.firstChild.nodeType == 3 && (L = l.firstChild, c && (c = L.nodeValue.length)); j.parentNode != f; )
+ j = j.parentNode;
+ var Q = o.measure, ne = Q.maps;
+ function se(Ue, Ye, nt) {
+ for (var Qe = -1; Qe < (ne ? ne.length : 0); Qe++)
+ for (var ot = Qe < 0 ? Q.map : ne[Qe], mt = 0; mt < ot.length; mt += 3) {
+ var ct = ot[mt + 2];
+ if (ct == Ue || ct == Ye) {
+ var Et = Ft(Qe < 0 ? o.line : o.rest[Qe]), Vt = ot[mt] + nt;
+ return (nt < 0 || ct != Ue) && (Vt = ot[mt + (nt ? 1 : 0)]), ye(Et, Vt);
+ }
+ }
+ }
+ var de = se(L, j, c);
+ if (de)
+ return Ao(de, v);
+ for (var Ee = j.nextSibling, Ce = L ? L.nodeValue.length - c : 0; Ee; Ee = Ee.nextSibling) {
+ if (de = se(Ee, Ee.firstChild, 0), de)
+ return Ao(ye(de.line, de.ch - Ce), v);
+ Ce += Ee.textContent.length;
+ }
+ for (var Ie = j.previousSibling, Ne = c; Ie; Ie = Ie.previousSibling) {
+ if (de = se(Ie, Ie.firstChild, -1), de)
+ return Ao(ye(de.line, de.ch + Ne), v);
+ Ne += Ie.textContent.length;
+ }
}
- for (var L = 0, j = Math.min(f.length, v.length); L < j && f.charCodeAt(L) == v.charCodeAt(L); )
- ++L;
- return Wn(l, function() {
- Ad(
- l,
- v.slice(L),
- f.length - L,
- null,
- o.composing ? "*compose" : null
- ), v.length > 1e3 || v.indexOf(`
+ var en = function(o) {
+ this.cm = o, this.prevInput = "", this.pollingFast = !1, this.polling = new we(), this.hasSelection = !1, this.composing = null;
+ };
+ en.prototype.init = function(o) {
+ var l = this, c = this, f = this.cm;
+ this.createField(o);
+ var v = this.textarea;
+ o.wrapper.insertBefore(this.wrapper, o.wrapper.firstChild), w && (v.style.width = "0px"), $e(v, "input", function() {
+ d && p >= 9 && l.hasSelection && (l.hasSelection = null), c.poll();
+ }), $e(v, "paste", function(L) {
+ Ct(f, L) || Nm(L, f) || (f.state.pasteIncoming = +new Date(), c.fastPoll());
+ });
+ function O(L) {
+ if (!Ct(f, L)) {
+ if (f.somethingSelected())
+ Ql({ lineWise: !1, text: f.getSelections() });
+ else if (f.options.lineWiseCopyCut) {
+ var j = Vm(f);
+ Ql({ lineWise: !0, text: j.text }), L.type == "cut" ? f.setSelections(j.ranges, null, $) : (c.prevInput = "", v.value = j.text.join(`
+`), ue(v));
+ } else
+ return;
+ L.type == "cut" && (f.state.cutIncoming = +new Date());
+ }
+ }
+ $e(v, "cut", O), $e(v, "copy", O), $e(o.scroller, "paste", function(L) {
+ if (!(Xi(o, L) || Ct(f, L))) {
+ if (!v.dispatchEvent) {
+ f.state.pasteIncoming = +new Date(), c.focus();
+ return;
+ }
+ var j = new Event("paste");
+ j.clipboardData = L.clipboardData, v.dispatchEvent(j);
+ }
+ }), $e(o.lineSpace, "selectstart", function(L) {
+ Xi(o, L) || It(L);
+ }), $e(v, "compositionstart", function() {
+ var L = f.getCursor("from");
+ c.composing && c.composing.range.clear(), c.composing = {
+ start: L,
+ range: f.markText(L, f.getCursor("to"), { className: "CodeMirror-composing" })
+ };
+ }), $e(v, "compositionend", function() {
+ c.composing && (c.poll(), c.composing.range.clear(), c.composing = null);
+ });
+ }, en.prototype.createField = function(o) {
+ this.wrapper = Um(), this.textarea = this.wrapper.firstChild;
+ }, en.prototype.screenReaderLabelChanged = function(o) {
+ o ? this.textarea.setAttribute("aria-label", o) : this.textarea.removeAttribute("aria-label");
+ }, en.prototype.prepareSelection = function() {
+ var o = this.cm, l = o.display, c = o.doc, f = Dh(o);
+ if (o.options.moveInputWithCursor) {
+ var v = wi(o, c.sel.primary().head, "div"), O = l.wrapper.getBoundingClientRect(), L = l.lineDiv.getBoundingClientRect();
+ f.teTop = Math.max(0, Math.min(
+ l.wrapper.clientHeight - 10,
+ v.top + L.top - O.top
+ )), f.teLeft = Math.max(0, Math.min(
+ l.wrapper.clientWidth - 10,
+ v.left + L.left - O.left
+ ));
+ }
+ return f;
+ }, en.prototype.showSelection = function(o) {
+ var l = this.cm, c = l.display;
+ G(c.cursorDiv, o.cursors), G(c.selectionDiv, o.selection), o.teTop != null && (this.wrapper.style.top = o.teTop + "px", this.wrapper.style.left = o.teLeft + "px");
+ }, en.prototype.reset = function(o) {
+ if (!(this.contextMenuPending || this.composing)) {
+ var l = this.cm;
+ if (l.somethingSelected()) {
+ this.prevInput = "";
+ var c = l.getSelection();
+ this.textarea.value = c, l.state.focused && ue(this.textarea), d && p >= 9 && (this.hasSelection = c);
+ } else
+ o || (this.prevInput = this.textarea.value = "", d && p >= 9 && (this.hasSelection = null));
+ }
+ }, en.prototype.getField = function() {
+ return this.textarea;
+ }, en.prototype.supportsTouch = function() {
+ return !1;
+ }, en.prototype.focus = function() {
+ if (this.cm.options.readOnly != "nocursor" && (!x || q(this.textarea.ownerDocument) != this.textarea))
+ try {
+ this.textarea.focus();
+ } catch {
+ }
+ }, en.prototype.blur = function() {
+ this.textarea.blur();
+ }, en.prototype.resetPosition = function() {
+ this.wrapper.style.top = this.wrapper.style.left = 0;
+ }, en.prototype.receivedFocus = function() {
+ this.slowPoll();
+ }, en.prototype.slowPoll = function() {
+ var o = this;
+ this.pollingFast || this.polling.set(this.cm.options.pollInterval, function() {
+ o.poll(), o.cm.state.focused && o.slowPoll();
+ });
+ }, en.prototype.fastPoll = function() {
+ var o = !1, l = this;
+ l.pollingFast = !0;
+ function c() {
+ var f = l.poll();
+ !f && !o ? (o = !0, l.polling.set(60, c)) : (l.pollingFast = !1, l.slowPoll());
+ }
+ l.polling.set(20, c);
+ }, en.prototype.poll = function() {
+ var o = this, l = this.cm, c = this.textarea, f = this.prevInput;
+ if (this.contextMenuPending || !l.state.focused || dr(c) && !f && !this.composing || l.isReadOnly() || l.options.disableInput || l.state.keySeq)
+ return !1;
+ var v = c.value;
+ if (v == f && !l.somethingSelected())
+ return !1;
+ if (d && p >= 9 && this.hasSelection === v || k && /[\uf700-\uf7ff]/.test(v))
+ return l.display.input.reset(), !1;
+ if (l.doc.sel == l.display.selForContextMenu) {
+ var O = v.charCodeAt(0);
+ if (O == 8203 && !f && (f = "\u200B"), O == 8666)
+ return this.reset(), this.cm.execCommand("undo");
+ }
+ for (var L = 0, j = Math.min(f.length, v.length); L < j && f.charCodeAt(L) == v.charCodeAt(L); )
+ ++L;
+ return Wn(l, function() {
+ Ad(
+ l,
+ v.slice(L),
+ f.length - L,
+ null,
+ o.composing ? "*compose" : null
+ ), v.length > 1e3 || v.indexOf(`
`) > -1 ? c.value = o.prevInput = "" : o.prevInput = v, o.composing && (o.composing.range.clear(), o.composing.range = l.markText(
- o.composing.start,
- l.getCursor("to"),
- { className: "CodeMirror-composing" }
- ));
- }), !0;
- }, en.prototype.ensurePolled = function() {
- this.pollingFast && this.poll() && (this.pollingFast = !1);
- }, en.prototype.onKeyPress = function() {
- d && p >= 9 && (this.hasSelection = null), this.fastPoll();
- }, en.prototype.onContextMenu = function(o) {
- var l = this, c = l.cm, f = c.display, v = l.textarea;
- l.contextMenuPending && l.contextMenuPending();
- var O = Fr(c, o), L = f.scroller.scrollTop;
- if (!O || b)
- return;
- var j = c.options.resetSelectionOnContextMenu;
- j && c.doc.sel.contains(O) == -1 && hn(c, En)(c.doc, gr(O), $);
- var Q = v.style.cssText, ne = l.wrapper.style.cssText, se = l.wrapper.offsetParent.getBoundingClientRect();
- l.wrapper.style.cssText = "position: static", v.style.cssText = `position: absolute; width: 30px; height: 30px;
+ o.composing.start,
+ l.getCursor("to"),
+ { className: "CodeMirror-composing" }
+ ));
+ }), !0;
+ }, en.prototype.ensurePolled = function() {
+ this.pollingFast && this.poll() && (this.pollingFast = !1);
+ }, en.prototype.onKeyPress = function() {
+ d && p >= 9 && (this.hasSelection = null), this.fastPoll();
+ }, en.prototype.onContextMenu = function(o) {
+ var l = this, c = l.cm, f = c.display, v = l.textarea;
+ l.contextMenuPending && l.contextMenuPending();
+ var O = Fr(c, o), L = f.scroller.scrollTop;
+ if (!O || b)
+ return;
+ var j = c.options.resetSelectionOnContextMenu;
+ j && c.doc.sel.contains(O) == -1 && hn(c, En)(c.doc, gr(O), $);
+ var Q = v.style.cssText, ne = l.wrapper.style.cssText, se = l.wrapper.offsetParent.getBoundingClientRect();
+ l.wrapper.style.cssText = "position: static", v.style.cssText = `position: absolute; width: 30px; height: 30px;
top: ` + (o.clientY - se.top - 5) + "px; left: " + (o.clientX - se.left - 5) + `px;
z-index: 1000; background: ` + (d ? "rgba(255, 255, 255, .05)" : "transparent") + `;
outline: none; border-width: 0; outline: none; overflow: hidden; opacity: .05; filter: alpha(opacity=5);`;
- var de;
- h && (de = v.ownerDocument.defaultView.scrollY), f.input.focus(), h && v.ownerDocument.defaultView.scrollTo(null, de), f.input.reset(), c.somethingSelected() || (v.value = l.prevInput = " "), l.contextMenuPending = Ce, f.selForContextMenu = c.doc.sel, clearTimeout(f.detectingSelectAll);
- function Ee() {
- if (v.selectionStart != null) {
- var Ne = c.somethingSelected(), Ue = "\u200B" + (Ne ? v.value : "");
- v.value = "\u21DA", v.value = Ue, l.prevInput = Ne ? "" : "\u200B", v.selectionStart = 1, v.selectionEnd = Ue.length, f.selForContextMenu = c.doc.sel;
+ var de;
+ h && (de = v.ownerDocument.defaultView.scrollY), f.input.focus(), h && v.ownerDocument.defaultView.scrollTo(null, de), f.input.reset(), c.somethingSelected() || (v.value = l.prevInput = " "), l.contextMenuPending = Ce, f.selForContextMenu = c.doc.sel, clearTimeout(f.detectingSelectAll);
+ function Ee() {
+ if (v.selectionStart != null) {
+ var Ne = c.somethingSelected(), Ue = "\u200B" + (Ne ? v.value : "");
+ v.value = "\u21DA", v.value = Ue, l.prevInput = Ne ? "" : "\u200B", v.selectionStart = 1, v.selectionEnd = Ue.length, f.selForContextMenu = c.doc.sel;
+ }
}
- }
- function Ce() {
- if (l.contextMenuPending == Ce && (l.contextMenuPending = !1, l.wrapper.style.cssText = ne, v.style.cssText = Q, d && p < 9 && f.scrollbars.setScrollTop(f.scroller.scrollTop = L), v.selectionStart != null)) {
- (!d || d && p < 9) && Ee();
- var Ne = 0, Ue = function() {
- f.selForContextMenu == c.doc.sel && v.selectionStart == 0 && v.selectionEnd > 0 && l.prevInput == "\u200B" ? hn(c, lm)(c) : Ne++ < 10 ? f.detectingSelectAll = setTimeout(Ue, 500) : (f.selForContextMenu = null, f.input.reset());
+ function Ce() {
+ if (l.contextMenuPending == Ce && (l.contextMenuPending = !1, l.wrapper.style.cssText = ne, v.style.cssText = Q, d && p < 9 && f.scrollbars.setScrollTop(f.scroller.scrollTop = L), v.selectionStart != null)) {
+ (!d || d && p < 9) && Ee();
+ var Ne = 0, Ue = function() {
+ f.selForContextMenu == c.doc.sel && v.selectionStart == 0 && v.selectionEnd > 0 && l.prevInput == "\u200B" ? hn(c, sm)(c) : Ne++ < 10 ? f.detectingSelectAll = setTimeout(Ue, 500) : (f.selForContextMenu = null, f.input.reset());
+ };
+ f.detectingSelectAll = setTimeout(Ue, 200);
+ }
+ }
+ if (d && p >= 9 && Ee(), T) {
+ yi(o);
+ var Ie = function() {
+ lt(window, "mouseup", Ie), setTimeout(Ce, 20);
};
- f.detectingSelectAll = setTimeout(Ue, 200);
+ $e(window, "mouseup", Ie);
+ } else
+ setTimeout(Ce, 50);
+ }, en.prototype.readOnlyChanged = function(o) {
+ o || this.reset(), this.textarea.disabled = o == "nocursor", this.textarea.readOnly = !!o;
+ }, en.prototype.setUneditable = function() {
+ }, en.prototype.needsContentAttribute = !1;
+ function nw(o, l) {
+ if (l = l ? ge(l) : {}, l.value = o.value, !l.tabindex && o.tabIndex && (l.tabindex = o.tabIndex), !l.placeholder && o.placeholder && (l.placeholder = o.placeholder), l.autofocus == null) {
+ var c = q(o.ownerDocument);
+ l.autofocus = c == o || o.getAttribute("autofocus") != null && c == document.body;
}
- }
- if (d && p >= 9 && Ee(), T) {
- yi(o);
- var Ie = function() {
- lt(window, "mouseup", Ie), setTimeout(Ce, 20);
- };
- $e(window, "mouseup", Ie);
- } else
- setTimeout(Ce, 50);
- }, en.prototype.readOnlyChanged = function(o) {
- o || this.reset(), this.textarea.disabled = o == "nocursor", this.textarea.readOnly = !!o;
- }, en.prototype.setUneditable = function() {
- }, en.prototype.needsContentAttribute = !1;
- function ew(o, l) {
- if (l = l ? ge(l) : {}, l.value = o.value, !l.tabindex && o.tabIndex && (l.tabindex = o.tabIndex), !l.placeholder && o.placeholder && (l.placeholder = o.placeholder), l.autofocus == null) {
- var c = q(o.ownerDocument);
- l.autofocus = c == o || o.getAttribute("autofocus") != null && c == document.body;
- }
- function f() {
- o.value = j.getValue();
- }
- var v;
- if (o.form && ($e(o.form, "submit", f), !l.leaveSubmitMethodAlone)) {
- var O = o.form;
- v = O.submit;
- try {
- var L = O.submit = function() {
- f(), O.submit = v, O.submit(), O.submit = L;
+ function f() {
+ o.value = j.getValue();
+ }
+ var v;
+ if (o.form && ($e(o.form, "submit", f), !l.leaveSubmitMethodAlone)) {
+ var O = o.form;
+ v = O.submit;
+ try {
+ var L = O.submit = function() {
+ f(), O.submit = v, O.submit(), O.submit = L;
+ };
+ } catch {
+ }
+ }
+ l.finishInit = function(Q) {
+ Q.save = f, Q.getTextArea = function() {
+ return o;
+ }, Q.toTextArea = function() {
+ Q.toTextArea = isNaN, f(), o.parentNode.removeChild(Q.getWrapperElement()), o.style.display = "", o.form && (lt(o.form, "submit", f), !l.leaveSubmitMethodAlone && typeof o.form.submit == "function" && (o.form.submit = v));
};
- } catch {
- }
+ }, o.style.display = "none";
+ var j = Kt(
+ function(Q) {
+ return o.parentNode.insertBefore(Q, o.nextSibling);
+ },
+ l
+ );
+ return j;
}
- l.finishInit = function(Q) {
- Q.save = f, Q.getTextArea = function() {
- return o;
- }, Q.toTextArea = function() {
- Q.toTextArea = isNaN, f(), o.parentNode.removeChild(Q.getWrapperElement()), o.style.display = "", o.form && (lt(o.form, "submit", f), !l.leaveSubmitMethodAlone && typeof o.form.submit == "function" && (o.form.submit = v));
- };
- }, o.style.display = "none";
- var j = Kt(
- function(Q) {
- return o.parentNode.insertBefore(Q, o.nextSibling);
- },
- l
- );
- return j;
- }
- function tw(o) {
- o.off = lt, o.on = $e, o.wheelEventPixels = s_, o.Doc = Nn, o.splitLines = oa, o.countColumn = ve, o.findColumn = ie, o.isWordChar = Oe, o.Pass = xe, o.signal = st, o.Line = ao, o.changeEnd = yr, o.scrollbarModel = Lh, o.Pos = ye, o.cmpPos = De, o.modes = bi, o.mimeModes = fr, o.resolveMode = zn, o.getMode = Gi, o.modeExtensions = cr, o.extendMode = wl, o.copyState = Ki, o.startState = aa, o.innerMode = pr, o.commands = Oa, o.keyMap = qi, o.keyName = Cm, o.isModifierKey = wm, o.lookupKey = _o, o.normalizeKeyMap = $_, o.StringStream = Zt, o.SharedTextMarker = xa, o.TextMarker = _r, o.LineWidget = Ea, o.e_preventDefault = It, o.e_stopPropagation = ui, o.e_stop = yi, o.addClass = Z, o.contains = C, o.rmClass = V, o.keyNames = wr;
- }
- G_(Kt), J_(Kt);
- var nw = "iter insert remove copy getEditor constructor".split(" ");
- for (var Xl in Nn.prototype)
- Nn.prototype.hasOwnProperty(Xl) && he(nw, Xl) < 0 && (Kt.prototype[Xl] = function(o) {
- return function() {
- return o.apply(this.doc, arguments);
- };
- }(Nn.prototype[Xl]));
- return zt(Nn), Kt.inputStyles = { textarea: en, contenteditable: Lt }, Kt.defineMode = function(o) {
- !Kt.defaults.mode && o != "null" && (Kt.defaults.mode = o), _l.apply(this, arguments);
- }, Kt.defineMIME = ro, Kt.defineMode("null", function() {
- return { token: function(o) {
- return o.skipToEnd();
- } };
- }), Kt.defineMIME("text/plain", "null"), Kt.defineExtension = function(o, l) {
- Kt.prototype[o] = l;
- }, Kt.defineDocExtension = function(o, l) {
- Nn.prototype[o] = l;
- }, Kt.fromTextArea = ew, tw(Kt), Kt.version = "6.65.7", Kt;
- });
-})(to);
-const rr = to.exports;
+ function iw(o) {
+ o.off = lt, o.on = $e, o.wheelEventPixels = d_, o.Doc = Nn, o.splitLines = oa, o.countColumn = ve, o.findColumn = ie, o.isWordChar = Oe, o.Pass = xe, o.signal = st, o.Line = oo, o.changeEnd = yr, o.scrollbarModel = Nh, o.Pos = ye, o.cmpPos = De, o.modes = bi, o.mimeModes = fr, o.resolveMode = zn, o.getMode = Gi, o.modeExtensions = cr, o.extendMode = wl, o.copyState = Ki, o.startState = aa, o.innerMode = pr, o.commands = Oa, o.keyMap = qi, o.keyName = Sm, o.isModifierKey = Am, o.lookupKey = bo, o.normalizeKeyMap = D_, o.StringStream = Zt, o.SharedTextMarker = xa, o.TextMarker = _r, o.LineWidget = Ea, o.e_preventDefault = It, o.e_stopPropagation = ui, o.e_stop = yi, o.addClass = Z, o.contains = C, o.rmClass = V, o.keyNames = wr;
+ }
+ Y_(Kt), Z_(Kt);
+ var rw = "iter insert remove copy getEditor constructor".split(" ");
+ for (var Xl in Nn.prototype)
+ Nn.prototype.hasOwnProperty(Xl) && he(rw, Xl) < 0 && (Kt.prototype[Xl] = function(o) {
+ return function() {
+ return o.apply(this.doc, arguments);
+ };
+ }(Nn.prototype[Xl]));
+ return zt(Nn), Kt.inputStyles = { textarea: en, contenteditable: Lt }, Kt.defineMode = function(o) {
+ !Kt.defaults.mode && o != "null" && (Kt.defaults.mode = o), _l.apply(this, arguments);
+ }, Kt.defineMIME = io, Kt.defineMode("null", function() {
+ return { token: function(o) {
+ return o.skipToEnd();
+ } };
+ }), Kt.defineMIME("text/plain", "null"), Kt.defineExtension = function(o, l) {
+ Kt.prototype[o] = l;
+ }, Kt.defineDocExtension = function(o, l) {
+ Nn.prototype[o] = l;
+ }, Kt.fromTextArea = nw, iw(Kt), Kt.version = "6.65.7", Kt;
+ });
+ }(Bf)), Bf.exports;
+}
+var rr = qo();
(function(e, t) {
(function(i) {
- i(to.exports);
+ i(qo());
})(function(i) {
i.defineMode("javascript", function(r, n) {
var a = r.indentUnit, s = n.statementIndent, u = n.jsonld, d = n.json || u, p = n.trackScope !== !1, h = n.typescript, g = n.wordCharacters || /[\w$\xa1-\uffff]/, _ = function() {
@@ -28552,7 +28554,7 @@ const rr = to.exports;
return ce;
}
function he(oe, ce) {
- return oe == "var" ? I(ge("vardef", ce), yi, we(";"), ve) : oe == "keyword a" ? I(ge("form"), K, he, ve) : oe == "keyword b" ? I(ge("form"), he, ve) : oe == "keyword d" ? W.stream.match(/^\s*$/, !1) ? I() : I(ge("stat"), ie, we(";"), ve) : oe == "debugger" ? I(we(";")) : oe == "{" ? I(ge("}"), pe, ft, ve, ke) : oe == ";" ? I() : oe == "if" ? (W.state.lexical.info == "else" && W.state.cc[W.state.cc.length - 1] == ve && W.state.cc.pop()(), I(ge("form"), K, he, ve, io)) : oe == "function" ? I($i) : oe == "for" ? I(ge("form"), pe, yl, he, ke, ve) : oe == "class" || h && ce == "interface" ? (W.marked = "keyword", I(ge("form", oe == "class" ? oe : ce), _l, ve)) : oe == "variable" ? h && ce == "declare" ? (W.marked = "keyword", I(he)) : h && (ce == "module" || ce == "enum" || ce == "type") && W.stream.match(/^\s*\w/, !1) ? (W.marked = "keyword", ce == "enum" ? I(oo) : ce == "type" ? I(bl, we("operator"), $e, we(";")) : I(ge("form"), Mn, we("{"), ge("}"), ft, ve, ve)) : h && ce == "namespace" ? (W.marked = "keyword", I(ge("form"), xe, he, ve)) : h && ce == "abstract" ? (W.marked = "keyword", I(he)) : I(ge("stat"), it) : oe == "switch" ? I(
+ return oe == "var" ? I(ge("vardef", ce), yi, we(";"), ve) : oe == "keyword a" ? I(ge("form"), K, he, ve) : oe == "keyword b" ? I(ge("form"), he, ve) : oe == "keyword d" ? W.stream.match(/^\s*$/, !1) ? I() : I(ge("stat"), ie, we(";"), ve) : oe == "debugger" ? I(we(";")) : oe == "{" ? I(ge("}"), pe, ft, ve, ke) : oe == ";" ? I() : oe == "if" ? (W.state.lexical.info == "else" && W.state.cc[W.state.cc.length - 1] == ve && W.state.cc.pop()(), I(ge("form"), K, he, ve, no)) : oe == "function" ? I($i) : oe == "for" ? I(ge("form"), pe, yl, he, ke, ve) : oe == "class" || h && ce == "interface" ? (W.marked = "keyword", I(ge("form", oe == "class" ? oe : ce), _l, ve)) : oe == "variable" ? h && ce == "declare" ? (W.marked = "keyword", I(he)) : h && (ce == "module" || ce == "enum" || ce == "type") && W.stream.match(/^\s*\w/, !1) ? (W.marked = "keyword", ce == "enum" ? I(ro) : ce == "type" ? I(bl, we("operator"), $e, we(";")) : I(ge("form"), Mn, we("{"), ge("}"), ft, ve, ve)) : h && ce == "namespace" ? (W.marked = "keyword", I(ge("form"), xe, he, ve)) : h && ce == "abstract" ? (W.marked = "keyword", I(he)) : I(ge("stat"), it) : oe == "switch" ? I(
ge("form"),
K,
we("{"),
@@ -28799,7 +28801,7 @@ const rr = to.exports;
return I($e);
}
function yi(oe, ce) {
- return ce == "enum" ? (W.marked = "keyword", I(oo)) : G(Mn, je, di, Iu);
+ return ce == "enum" ? (W.marked = "keyword", I(ro)) : G(Mn, je, di, Iu);
}
function Mn(oe, ce) {
if (h && q(ce))
@@ -28827,7 +28829,7 @@ const rr = to.exports;
if (oe == ",")
return I(yi);
}
- function io(oe, ce) {
+ function no(oe, ce) {
if (oe == "keyword b" && ce == "else")
return I(ge("form", "else"), he, ve);
}
@@ -28873,17 +28875,17 @@ const rr = to.exports;
return ce == "@" && I(xe, bi), oe == "spread" ? I(bi) : h && q(ce) ? (W.marked = "keyword", I(bi)) : h && oe == "this" ? I(je, di) : G(Mn, je, di);
}
function fr(oe, ce) {
- return oe == "variable" ? _l(oe, ce) : ro(oe, ce);
+ return oe == "variable" ? _l(oe, ce) : io(oe, ce);
}
function _l(oe, ce) {
if (oe == "variable")
- return F(ce), I(ro);
+ return F(ce), I(io);
}
- function ro(oe, ce) {
+ function io(oe, ce) {
if (ce == "<")
- return I(ge(">"), We(ui, ">"), ve, ro);
+ return I(ge(">"), We(ui, ">"), ve, io);
if (ce == "extends" || ce == "implements" || h && oe == ",")
- return ce == "implements" && (W.marked = "keyword"), I(h ? $e : xe, ro);
+ return ce == "implements" && (W.marked = "keyword"), I(h ? $e : xe, io);
if (oe == "{")
return I(ge("}"), zn, ve);
}
@@ -28947,7 +28949,7 @@ const rr = to.exports;
function Yi(oe) {
return oe == "]" ? I() : G(We($, "]"));
}
- function oo() {
+ function ro() {
return G(ge("form"), Mn, we("{"), ge("}"), We(fi, "}"), ve, ve);
}
function fi() {
@@ -28989,7 +28991,7 @@ const rr = to.exports;
var Rt = oe.cc[Ot];
if (Rt == ve)
De = De.prev;
- else if (Rt != io && Rt != ke)
+ else if (Rt != no && Rt != ke)
break;
}
for (; (De.type == "stat" || De.type == "form") && (ye == "}" || (bt = oe.cc[oe.cc.length - 1]) && (bt == re || bt == fe) && !/^[,\.=+\-*:?[\(]/.test(ce)); )
@@ -29018,7 +29020,7 @@ const rr = to.exports;
})();
(function(e, t) {
(function(i) {
- i(to.exports);
+ i(qo());
})(function(i) {
var r = "CodeMirror-hint", n = "CodeMirror-hint-active";
i.showHint = function(m, w, E) {
@@ -29369,7 +29371,7 @@ const rr = to.exports;
})();
(function(e, t) {
(function(i) {
- i(to.exports);
+ i(qo());
})(function(i) {
var r = i.Pos;
function n(m, w) {
@@ -29470,7 +29472,7 @@ const rr = to.exports;
}
});
})();
-const NI = "[[FORM-CREATE-PREFIX-", BI = "-FORM-CREATE-SUFFIX]]", VI = Be({
+const VI = "[[FORM-CREATE-PREFIX-", jI = "-FORM-CREATE-SUFFIX]]", UI = Be({
name: "FnEditor",
emits: ["update:modelValue", "change"],
props: {
@@ -29528,7 +29530,7 @@ const NI = "[[FORM-CREATE-PREFIX-", BI = "-FORM-CREATE-SUFFIX]]", VI = Be({
} catch (i) {
return console.error(i), In(this.t("struct.errorMsg")), !1;
}
- this.body ? this.fn = (this.fnx ? "$FNX:" : "") + e : this.fn = NI + t + BI;
+ this.body ? this.fn = (this.fnx ? "$FNX:" : "") + e : this.fn = VI + t + jI;
}
return this.submit(), !0;
},
@@ -29562,21 +29564,21 @@ const NI = "[[FORM-CREATE-PREFIX-", BI = "-FORM-CREATE-SUFFIX]]", VI = Be({
});
}
}
-}), jI = { class: "_fd-fn" }, UI = { class: "_fd-fn-tip" }, HI = { class: "cm-keyword" }, zI = { key: 0 }, WI = { class: "_fd-fn-arg" }, GI = {
+}), HI = { class: "_fd-fn" }, zI = { class: "_fd-fn-tip" }, WI = { class: "cm-keyword" }, GI = { key: 0 }, KI = { class: "_fd-fn-arg" }, YI = {
ref: "editor",
class: "_fd-fn-editor"
};
-function KI(e, t, i, r, n, a) {
+function QI(e, t, i, r, n, a) {
const s = ee("el-table-column"), u = ee("el-table"), d = ee("el-popover"), p = ee("el-button");
- return H(), ae("div", jI, [
- J("div", UI, [
+ return H(), ae("div", HI, [
+ J("div", zI, [
t[2] || (t[2] = J("div", { class: "_fd-fn-ind" }, null, -1)),
- J("div", HI, [
+ J("div", WI, [
J("span", null, [
be("function " + le(e.name) + "(", 1),
(H(!0), ae(Me, null, ze(e.argList, (h, g) => (H(), ae(Me, null, [
be(le(g > 0 ? ", " : ""), 1),
- h.type === "string" ? (H(), ae("span", zI, le(h.name), 1)) : (H(), me(d, {
+ h.type === "string" ? (H(), ae("span", GI, le(h.name), 1)) : (H(), me(d, {
key: 1,
placement: "top-start",
width: 400,
@@ -29586,7 +29588,7 @@ function KI(e, t, i, r, n, a) {
content: h.info || ""
}, {
reference: N(() => [
- J("span", WI, [
+ J("span", KI, [
be(le(h.name), 1),
t[0] || (t[0] = J("i", { class: "fc-icon icon-question" }, null, -1))
])
@@ -29623,7 +29625,7 @@ function KI(e, t, i, r, n, a) {
])
])
]),
- J("div", GI, null, 512),
+ J("div", YI, null, 512),
t[3] || (t[3] = J("div", { class: "_fd-fn-tip" }, [
J("div", { class: "_fd-fn-ind" }),
J("div", { class: "cm-keyword" }, "}")
@@ -29641,8 +29643,8 @@ function KI(e, t, i, r, n, a) {
}, 8, ["onClick"])) : Te("", !0)
]);
}
-const sr = /* @__PURE__ */ Ve(VI, [["render", KI]]);
-const YI = Be({
+const sr = /* @__PURE__ */ Ve(UI, [["render", QI]]);
+const JI = Be({
name: "ConditionInput",
inject: ["designer"],
emits: ["update:modelValue", "change"],
@@ -29669,10 +29671,10 @@ const YI = Be({
},
created() {
}
-}), QI = { class: "_fd-cdi-input" };
-function JI(e, t, i, r, n, a) {
+}), XI = { class: "_fd-cdi-input" };
+function ZI(e, t, i, r, n, a) {
const s = ee("el-cascader"), u = ee("el-input-number"), d = ee("el-option"), p = ee("el-select"), h = ee("el-switch"), g = ee("el-input");
- return H(), ae("div", QI, [
+ return H(), ae("div", XI, [
e.type === "cascader" ? (H(), me(s, jt({
key: 0,
size: "default",
@@ -29725,8 +29727,8 @@ function JI(e, t, i, r, n, a) {
}), null, 16, ["modelValue", "onBlur"]))
]);
}
-const XI = /* @__PURE__ */ Ve(YI, [["render", JI]]);
-const ZI = Be({
+const qI = /* @__PURE__ */ Ve(JI, [["render", ZI]]);
+const eF = Be({
name: "PatternInput",
emits: ["update:modelValue", "change"],
props: {
@@ -29816,10 +29818,10 @@ const ZI = Be({
this.$emit("update:modelValue", this.value), this.$emit("change", this.value);
}
}
-}), qI = { class: "_fd-pattern-input" };
-function eF(e, t, i, r, n, a) {
+}), tF = { class: "_fd-pattern-input" };
+function nF(e, t, i, r, n, a) {
const s = ee("el-dropdown-item"), u = ee("el-dropdown-menu"), d = ee("el-dropdown"), p = ee("el-input");
- return H(), ae("div", qI, [
+ return H(), ae("div", tF, [
z(p, {
size: e.size,
modelValue: e.value,
@@ -29859,8 +29861,8 @@ function eF(e, t, i, r, n, a) {
}, 8, ["size", "modelValue", "onBlur"])
]);
}
-const Op = /* @__PURE__ */ Ve(ZI, [["render", eF]]);
-const tF = Be({
+const $p = /* @__PURE__ */ Ve(eF, [["render", nF]]);
+const iF = Be({
name: "RuleSelect",
inject: ["designer"],
emits: ["update:modelValue", "change"],
@@ -29924,11 +29926,11 @@ const tF = Be({
this.$emit("update:modelValue", e), this.$emit("change", e);
}
}
-}), nF = {
+}), rF = {
key: 0,
class: "_fd-rule-select-node"
};
-function iF(e, t, i, r, n, a) {
+function oF(e, t, i, r, n, a) {
const s = ee("el-tree-select");
return H(), me(s, {
class: "_fd-rule-select",
@@ -29941,7 +29943,7 @@ function iF(e, t, i, r, n, a) {
data: e.tree
}, {
default: N(({ data: u }) => [
- u.value === "___subform" ? (H(), ae("div", nF, [
+ u.value === "___subform" ? (H(), ae("div", rF, [
J("div", null, le(u.label), 1),
J("span", null, le(e.t("props.subform")), 1)
])) : (H(), ae(Me, { key: 1 }, [
@@ -29951,8 +29953,8 @@ function iF(e, t, i, r, n, a) {
_: 1
}, 8, ["modelValue", "onUpdate:modelValue", "size", "multiple", "showCheckbox", "data"]);
}
-const $p = /* @__PURE__ */ Ve(tF, [["render", iF]]);
-const rF = Be({
+const Rp = /* @__PURE__ */ Ve(iF, [["render", oF]]);
+const aF = Be({
name: "ValueInput",
emits: ["update:modelValue", "change", "change-type", "blur"],
inject: ["designer"],
@@ -29994,7 +29996,7 @@ const rF = Be({
}
}
});
-function oF(e, t, i, r, n, a) {
+function lF(e, t, i, r, n, a) {
const s = ee("el-option"), u = ee("el-select"), d = ee("el-input");
return H(), me(d, jt({
class: "_fd-value-input",
@@ -30036,8 +30038,8 @@ function oF(e, t, i, r, n, a) {
} : void 0
]), 1040, ["modelValue", "onBlur"]);
}
-const wu = /* @__PURE__ */ Ve(rF, [["render", oF]]);
-const aF = Be({
+const wu = /* @__PURE__ */ Ve(aF, [["render", lF]]);
+const sF = Be({
name: "Warning",
props: {
tooltip: String
@@ -30045,14 +30047,14 @@ const aF = Be({
data() {
return {};
}
-}), lF = ["innerHTML"], sF = {
+}), uF = ["innerHTML"], dF = {
key: 0,
class: "_fd-warning-text"
-}, uF = {
+}, fF = {
key: 1,
class: "fc-icon icon-question"
};
-function dF(e, t, i, r, n, a) {
+function cF(e, t, i, r, n, a) {
const s = ee("el-tooltip");
return H(), me(s, {
effect: "dark",
@@ -30060,18 +30062,18 @@ function dF(e, t, i, r, n, a) {
"popper-class": "_fd-warning-pop"
}, {
content: N(() => [
- J("span", { innerHTML: e.tooltip }, null, 8, lF)
+ J("span", { innerHTML: e.tooltip }, null, 8, uF)
]),
default: N(() => [
- e.$slots.default ? (H(), ae("span", sF, [
+ e.$slots.default ? (H(), ae("span", dF, [
kt(e.$slots, "default")
- ])) : (H(), ae("i", uF))
+ ])) : (H(), ae("i", fF))
]),
_: 3
});
}
-const ki = /* @__PURE__ */ Ve(aF, [["render", dF]]);
-const fF = Be({
+const ki = /* @__PURE__ */ Ve(sF, [["render", cF]]);
+const pF = Be({
name: "VariableConfig",
components: { Warning: ki },
emits: ["submit", "confirm"],
@@ -30272,10 +30274,10 @@ const fF = Be({
e && (this.$emit("confirm", `{{${e}}}`), this.$refs.pop.hide(), this.variable = "");
}
}
-}), cF = { class: "_fd-variable" }, pF = { style: { width: "230px" } }, hF = { class: "_fd-variable-item-label" }, mF = { class: "_fd-variable-info" };
-function vF(e, t, i, r, n, a) {
+}), hF = { class: "_fd-variable" }, mF = { style: { width: "230px" } }, vF = { class: "_fd-variable-item-label" }, gF = { class: "_fd-variable-info" };
+function yF(e, t, i, r, n, a) {
const s = ee("el-input"), u = ee("el-header"), d = ee("el-tree"), p = ee("el-main"), h = ee("el-container"), g = ee("el-popover"), _ = ee("el-badge"), S = ee("Warning"), b = ee("el-aside"), A = ee("el-button"), y = ee("el-dialog");
- return H(), ae("div", cF, [
+ return H(), ae("div", hF, [
e.popover ? (H(), me(g, {
key: 0,
ref: "pop",
@@ -30423,7 +30425,7 @@ function vF(e, t, i, r, n, a) {
default: N(() => [
z(u, null, {
default: N(() => [
- J("div", pF, le(e.t("computed.variable.attr")), 1),
+ J("div", mF, le(e.t("computed.variable.attr")), 1),
J("div", null, le(e.t("computed.variable.bind")), 1)
]),
_: 1
@@ -30434,7 +30436,7 @@ function vF(e, t, i, r, n, a) {
key: m.label,
class: qe(["_fd-variable-item", { active: w === e.activeIdx, "_fd-variable-top": m.attach === !0 }])
}, [
- J("div", hF, le(m.label), 1),
+ J("div", vF, le(m.label), 1),
t[13] || (t[13] = J("div", null, "=", -1)),
z(s, {
modelValue: m.value,
@@ -30477,7 +30479,7 @@ function vF(e, t, i, r, n, a) {
}),
z(p, null, {
default: N(() => [
- J("div", mF, le(e.t("warning.variableInfo")), 1),
+ J("div", gF, le(e.t("warning.variableInfo")), 1),
z(d, {
ref: "treeRef",
data: e.treeInfo,
@@ -30517,17 +30519,17 @@ function vF(e, t, i, r, n, a) {
], 64))
]);
}
-const ml = /* @__PURE__ */ Ve(fF, [["render", vF]]);
-const Bo = {
+const ml = /* @__PURE__ */ Ve(pF, [["render", yF]]);
+const No = {
input: ["==", "!=", "on", "notOn", "empty", "notEmpty", "pattern"],
select: ["==", "!=", "on", "notOn", "empty", "notEmpty"],
switch: ["==", "!="],
number: ["==", "!=", ">", ">=", "<", "<=", "empty", "notEmpty"]
};
-Bo.cascader = Bo.select;
-const X0 = Be({
+No.cascader = No.select;
+const q0 = Be({
name: "ConditionGroup",
- components: { VariableConfig: ml, ValueInput: wu, RuleSelect: $p, PatternInput: Op, ConditionInput: XI },
+ components: { VariableConfig: ml, ValueInput: wu, RuleSelect: Rp, PatternInput: $p, ConditionInput: qI },
inject: ["designer"],
emits: ["update:modelValue", "change"],
props: {
@@ -30559,7 +30561,7 @@ const X0 = Be({
return {
mode: "AND",
list: [],
- ConditionGroup: Gt(X0)
+ ConditionGroup: Gt(q0)
};
},
methods: {
@@ -30581,7 +30583,7 @@ const X0 = Be({
e.field = "", e.input = null, e.formula = null;
},
changeField(e) {
- e.field ? (e.condition = "==", e.type === "field" ? this.tidyItem(e) : (e.input = !0, e.formula = Bo.select.map((t) => ({
+ e.field ? (e.condition = "==", e.type === "field" ? this.tidyItem(e) : (e.input = !0, e.formula = No.select.map((t) => ({
label: this.formulaLabel[t],
value: t
})))) : (e.input = null, e.formula = null), this.onInput();
@@ -30612,7 +30614,7 @@ const X0 = Be({
}), this.mode = e.mode === "OR" ? "OR" : "AND", this.list = (e.group || []).map((t) => t.mode != null ? t : this.tidyItem({ ...t }))), this.list.length || this.list.push({ type: "field" }, { type: "field" });
},
tidyItem(e) {
- return e.variable ? (e.input = !0, e.field = e.variable, e.formula = Bo.select.map((t) => ({
+ return e.variable ? (e.input = !0, e.field = e.variable, e.formula = No.select.map((t) => ({
label: this.formulaLabel[t],
value: t
})), e.type = "variable", e) : (e.type = "field", this.rules.forEach((t) => {
@@ -30622,7 +30624,7 @@ const X0 = Be({
} : { ...i } : {
type: "input"
};
- r.options && (r.options = St.String(r.options) ? Wo(t.rule.__fc__.prop, r.options) : r.options), e.formula = (Bo[r.type] || Bo.input).map((n) => ({
+ r.options && (r.options = St.String(r.options) ? zo(t.rule.__fc__.prop, r.options) : r.options), e.formula = (No[r.type] || No.input).map((n) => ({
label: this.formulaLabel[n],
value: n
})), e.var = !!e.compare, e.input = r;
@@ -30649,15 +30651,15 @@ const X0 = Be({
created() {
this.tidyValue();
}
-}), gF = X0, yF = { class: "_fd-cdg-input" }, bF = { class: "_fd-cdg-item" }, _F = { class: "_fd-cdg-and" }, wF = { class: "_fd-cdg-options" }, AF = ["onClick"], CF = {
+}), bF = q0, _F = { class: "_fd-cdg-input" }, wF = { class: "_fd-cdg-item" }, AF = { class: "_fd-cdg-and" }, CF = { class: "_fd-cdg-options" }, SF = ["onClick"], EF = {
key: 3,
class: "_fd-cfg-value"
-}, SF = ["onClick"], EF = { class: "_fd-cdg-btns" };
-function xF(e, t, i, r, n, a) {
+}, xF = ["onClick"], TF = { class: "_fd-cdg-btns" };
+function kF(e, t, i, r, n, a) {
const s = ee("el-option"), u = ee("el-select"), d = ee("ConditionGroup", !0), p = ee("VariableConfig"), h = ee("el-input"), g = ee("RuleSelect"), _ = ee("ValueInput"), S = ee("PatternInput"), b = ee("ConditionInput"), A = ee("el-checkbox"), y = ee("el-button");
- return H(), ae("div", yF, [
- J("div", bF, [
- J("div", _F, [
+ return H(), ae("div", _F, [
+ J("div", wF, [
+ J("div", AF, [
e.list.length > 0 ? (H(), me(u, {
key: 0,
size: "default",
@@ -30678,7 +30680,7 @@ function xF(e, t, i, r, n, a) {
_: 1
}, 8, ["modelValue", "onChange"])) : Te("", !0)
]),
- J("div", wF, [
+ J("div", CF, [
(H(!0), ae(Me, null, ze(e.list, (m, w) => (H(), ae(Me, null, [
m.mode != null ? (H(), ae("div", {
class: "_fd-cdg-option is-group",
@@ -30692,7 +30694,7 @@ function xF(e, t, i, r, n, a) {
J("i", {
class: qe(["fc-icon icon-add-circle", { disabled: e.list.length === 1 }]),
onClick: (E) => e.removeItem(w)
- }, null, 10, AF)
+ }, null, 10, SF)
])) : (H(), ae("div", {
class: "_fd-cdg-option",
key: w
@@ -30761,7 +30763,7 @@ function xF(e, t, i, r, n, a) {
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue", "onChange"])) : Te("", !0),
- m.input && ["empty", "notEmpty"].indexOf(m.condition) === -1 ? (H(), ae("div", CF, [
+ m.input && ["empty", "notEmpty"].indexOf(m.condition) === -1 ? (H(), ae("div", EF, [
m.var ? (H(), me(g, {
key: 0,
class: "_fd-cdg-field",
@@ -30804,12 +30806,12 @@ function xF(e, t, i, r, n, a) {
J("i", {
class: "fc-icon icon-delete",
onClick: (E) => e.removeItem(w)
- }, null, 8, SF)
+ }, null, 8, xF)
]))
], 64))), 256))
])
]),
- J("div", EF, [
+ J("div", TF, [
z(y, {
link: "",
type: "primary",
@@ -30835,10 +30837,10 @@ function xF(e, t, i, r, n, a) {
])
]);
}
-const TF = /* @__PURE__ */ Ve(gF, [["render", xF]]);
-const kF = Be({
+const OF = /* @__PURE__ */ Ve(bF, [["render", kF]]);
+const $F = Be({
name: "ComputedConfig",
- components: { Warning: ki, RuleSelect: $p, ConditionGroup: TF },
+ components: { Warning: ki, RuleSelect: Rp, ConditionGroup: OF },
props: {
modelValue: [String, Object, Array],
type: String,
@@ -30916,12 +30918,12 @@ const kF = Be({
{
id: "_formula",
label: this.t("computed.formula"),
- children: Fy.map((u) => ({
+ children: My.map((u) => ({
label: this.t("formula." + u.key),
children: u.children.map((d) => ({
label: d,
info: this.t("formula." + d),
- example: cc[d] || "",
+ example: pc[d] || "",
formula: !0
}))
}))
@@ -30967,7 +30969,7 @@ const kF = Be({
spanOver(e) {
if (e.target.classList.contains("cm-keyword")) {
const t = e.target.innerText.trim();
- this.formulaInfo = this.t("formula." + t) || "", this.formulaExample = cc[t] || "";
+ this.formulaInfo = this.t("formula." + t) || "", this.formulaExample = pc[t] || "";
}
},
nodeOver(e) {
@@ -31023,7 +31025,7 @@ const kF = Be({
this.visible = !1;
},
setValue(e) {
- const t = this.designer.setupState.fields().map(sy);
+ const t = this.designer.setupState.fields().map(dy);
e = e.replace(new RegExp(`["'](${t.join("|")})(\\.(${t.join("|")}))*(?![a-zA-Z0-9_$])["']`, "g"), (i) => "__var___" + i + "__var__"), e = e.replace(new RegExp(`(? "__var___" + i + "__var__"), e.split("__var__").forEach((i) => {
let r;
if (i.indexOf("_") === 0) {
@@ -31074,32 +31076,32 @@ const kF = Be({
});
}
}
-}), OF = { class: "_fd-computed" }, $F = { class: "_fd-comp-title" }, RF = {
+}), RF = { class: "_fd-computed" }, DF = { class: "_fd-comp-title" }, IF = {
class: "_fd-comp-title",
style: { "margin-top": "30px" }
-}, DF = { class: "_fd-comp-linkage" }, IF = {
+}, FF = { class: "_fd-comp-linkage" }, PF = {
class: "_fd-comp-title",
style: { "margin-top": "30px" }
-}, FF = ["onMouseover"], PF = {
+}, MF = ["onMouseover"], LF = {
key: 0,
class: "_group"
-}, MF = {
+}, NF = {
key: 1,
class: "_subform"
-}, LF = ["onClick"], NF = {
+}, BF = ["onClick"], VF = {
key: 0,
ref: "editor",
class: "_fd-comp-script"
-}, BF = {
+}, jF = {
key: 0,
class: "_fd-comp-info"
-}, VF = { key: 0 }, jF = { key: 1 }, UF = {
+}, UF = { key: 0 }, HF = { key: 1 }, zF = {
key: 2,
style: { color: "#f56c6c" }
};
-function HF(e, t, i, r, n, a) {
+function WF(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-badge"), d = ee("Warning"), p = ee("el-tab-pane"), h = ee("el-tabs"), g = ee("ConditionGroup"), _ = ee("RuleSelect"), S = ee("el-radio"), b = ee("el-radio-group"), A = ee("el-main"), y = ee("el-container"), m = ee("el-tree"), w = ee("el-aside"), E = ee("el-header"), x = ee("el-dialog");
- return H(), ae("div", OF, [
+ return H(), ae("div", RF, [
z(u, {
type: "warning",
"is-dot": "",
@@ -31189,7 +31191,7 @@ function HF(e, t, i, r, n, a) {
default: N(() => [
z(A, null, {
default: N(() => [
- J("div", $F, le(e.t("computed.setting")), 1),
+ J("div", DF, le(e.t("computed.setting")), 1),
e.visible ? (H(), me(g, {
key: 0,
modelValue: e.condition,
@@ -31197,8 +31199,8 @@ function HF(e, t, i, r, n, a) {
ref: "condition"
}, null, 8, ["modelValue"])) : Te("", !0),
e.type === "linkage" ? (H(), ae(Me, { key: 1 }, [
- J("div", RF, le(e.t("computed.linkage.trigger")), 1),
- J("div", DF, [
+ J("div", IF, le(e.t("computed.linkage.trigger")), 1),
+ J("div", FF, [
be(le(e.t("computed.linkage.info.0")) + " ", 1),
z(_, {
modelValue: e.linkage,
@@ -31211,7 +31213,7 @@ function HF(e, t, i, r, n, a) {
be(" " + le(e.t("computed.linkage.info.1")), 1)
])
], 64)) : (H(), ae(Me, { key: 2 }, [
- J("div", IF, le(e.t("computed.invert")), 1),
+ J("div", PF, le(e.t("computed.invert")), 1),
z(b, {
modelValue: e.invert,
"onUpdate:modelValue": t[4] || (t[4] = (k) => e.invert = k)
@@ -31261,8 +31263,8 @@ function HF(e, t, i, r, n, a) {
}, [
J("div", null, [
R.rule ? (H(), ae(Me, { key: 0 }, [
- R.rule._menu.subForm === "object" ? (H(), ae("span", PF, "{ " + le(e.t("props.group")) + " }", 1)) : Te("", !0),
- R.rule._menu.subForm === "array" ? (H(), ae("span", MF, "[ " + le(e.t("props.collection")) + " ]", 1)) : Te("", !0)
+ R.rule._menu.subForm === "object" ? (H(), ae("span", LF, "{ " + le(e.t("props.group")) + " }", 1)) : Te("", !0),
+ R.rule._menu.subForm === "array" ? (H(), ae("span", NF, "[ " + le(e.t("props.collection")) + " ]", 1)) : Te("", !0)
], 64)) : Te("", !0),
J("span", null, le(R.rule ? e.getTitle(R.rule) : (R.label || "").trim()), 1)
]),
@@ -31270,8 +31272,8 @@ function HF(e, t, i, r, n, a) {
key: 0,
class: "_fd-comp-id",
onClick: vt((M) => e.setField(R), ["stop"])
- }, " ID ", 8, LF)) : Te("", !0)
- ], 42, FF)
+ }, " ID ", 8, BF)) : Te("", !0)
+ ], 42, MF)
]),
_: 1
}, 8, ["data", "default-expanded-keys", "onNodeClick"])
@@ -31293,14 +31295,14 @@ function HF(e, t, i, r, n, a) {
}),
z(A, null, {
default: N(() => [
- e.visible ? (H(), ae("div", NF, null, 512)) : Te("", !0)
+ e.visible ? (H(), ae("div", VF, null, 512)) : Te("", !0)
]),
_: 1
}),
- e.formulaInfo || e.err ? (H(), ae("div", BF, [
- e.formulaInfo ? (H(), ae("div", VF, le(e.t("computed.formulaInfo")) + ": " + le(e.formulaInfo), 1)) : Te("", !0),
- e.formulaExample ? (H(), ae("div", jF, le(e.t("computed.formulaExample")) + ": " + le(e.formulaExample), 1)) : Te("", !0),
- e.err ? (H(), ae("div", UF, le(e.t("validate.message")) + ": " + le(e.err), 1)) : Te("", !0)
+ e.formulaInfo || e.err ? (H(), ae("div", jF, [
+ e.formulaInfo ? (H(), ae("div", UF, le(e.t("computed.formulaInfo")) + ": " + le(e.formulaInfo), 1)) : Te("", !0),
+ e.formulaExample ? (H(), ae("div", HF, le(e.t("computed.formulaExample")) + ": " + le(e.formulaExample), 1)) : Te("", !0),
+ e.err ? (H(), ae("div", zF, le(e.t("validate.message")) + ": " + le(e.err), 1)) : Te("", !0)
])) : Te("", !0)
]),
_: 1
@@ -31316,8 +31318,8 @@ function HF(e, t, i, r, n, a) {
}, 8, ["title", "modelValue"])
]);
}
-const Z0 = /* @__PURE__ */ Ve(kF, [["render", HF]]);
-const Fs = "$FNX:", eg = (e) => St.String(e) && e.indexOf(Fs) === 0, zF = Be({
+const eb = /* @__PURE__ */ Ve($F, [["render", WF]]);
+const Fs = "$FNX:", ng = (e) => St.String(e) && e.indexOf(Fs) === 0, GF = Be({
name: "EventConfig",
emits: ["update:modelValue"],
props: {
@@ -31335,9 +31337,9 @@ const Fs = "$FNX:", eg = (e) => St.String(e) && e.indexOf(Fs) === 0, zF = Be({
inject: ["designer"],
components: {
Warning: ki,
- ComputedConfig: Z0,
+ ComputedConfig: eb,
FnEditor: sr,
- fcDraggable: Yo,
+ fcDraggable: Ko,
DragForm: tt.$form()
},
data() {
@@ -31381,7 +31383,7 @@ const Fs = "$FNX:", eg = (e) => St.String(e) && e.indexOf(Fs) === 0, zF = Be({
},
behaviorMenu() {
const e = [];
- return Py.forEach((t) => {
+ return Ly.forEach((t) => {
e.push({
label: t.key,
children: t.children.map((i) => ({
@@ -31438,11 +31440,11 @@ const Fs = "$FNX:", eg = (e) => St.String(e) && e.indexOf(Fs) === 0, zF = Be({
this.cus = !0;
},
loadFnStr(e) {
- if (eg(e))
+ if (ng(e))
return e.replace(Fs, "");
if (St.Function(e)) {
const t = e.__json || "";
- return t ? eg(t) ? t.replace(Fs, "") : t : "" + e;
+ return t ? ng(t) ? t.replace(Fs, "") : t : "" + e;
} else if (e && e.indexOf("$GLOBAL:") === 0)
return e;
},
@@ -31544,7 +31546,7 @@ const Fs = "$FNX:", eg = (e) => St.String(e) && e.indexOf(Fs) === 0, zF = Be({
this.destroy(), this.activeBehavior = gt(this.event[e].behaviors[t]), this.activeBehavior.pid = e, this.defActive = this.activeBehavior.id, this.updateBehaviorForm();
},
updateBehaviorForm() {
- let e = My[this.activeBehavior.method];
+ let e = Ny[this.activeBehavior.method];
St.Function(e) && (e = e(this.designer.setupState));
const t = (i) => {
i.field && !i.title && (i.title = this.t("behavior." + this.activeBehavior.method + ".props." + i.field) || this.t("behavior.props." + i.field) || this.t("props." + i.field), i.warning = this.t("behavior." + this.activeBehavior.method + ".warning." + i.field));
@@ -31592,23 +31594,23 @@ const Fs = "$FNX:", eg = (e) => St.String(e) && e.indexOf(Fs) === 0, zF = Be({
created() {
this.init();
}
-}), WF = { class: "_fd-event" }, GF = { class: "_fd-event-item" }, KF = {
+}), KF = { class: "_fd-event" }, YF = { class: "_fd-event-item" }, QF = {
key: 0,
class: "_fd-label"
-}, YF = { class: "_fd-event-item" }, QF = { class: "_fd-label" }, JF = { class: "_fd-menu" }, XF = ["onClick"], ZF = { class: "_fd-event-method" }, qF = {
+}, JF = { class: "_fd-event-item" }, XF = { class: "_fd-label" }, ZF = { class: "_fd-menu" }, qF = ["onClick"], eP = { class: "_fd-event-method" }, tP = {
key: 0,
class: "_fd-label"
-}, eP = ["onClick"], tP = ["onClick"], nP = { class: "_fd-event-behaviors" }, iP = ["onClick"], rP = { class: "_fd-event-behavior-label" }, oP = ["onClick"], aP = { class: "_fd-event-behavior-info" }, lP = {
+}, nP = ["onClick"], iP = ["onClick"], rP = { class: "_fd-event-behaviors" }, oP = ["onClick"], aP = { class: "_fd-event-behavior-label" }, lP = ["onClick"], sP = { class: "_fd-event-behavior-info" }, uP = {
key: 0,
class: "_fd-menu-item",
style: { "padding-left": "10px" }
-}, sP = { class: "_fd-event-title" }, uP = { class: "_fd-event-select" }, dP = { class: "_fd-event-behavior-title" }, fP = { class: "_fd-event-behavior-title" }, cP = {
+}, dP = { class: "_fd-event-title" }, fP = { class: "_fd-event-select" }, cP = { class: "_fd-event-behavior-title" }, pP = { class: "_fd-event-behavior-title" }, hP = {
key: 0,
class: "_fd-event-behavior-title"
-}, pP = { class: "_fd-event-behavior-title" }, hP = { class: "_fd-form-item-warning" }, mP = { class: "_fd-form-item-warning" }, vP = { class: "_fd-form-item-warning" };
-function gP(e, t, i, r, n, a) {
+}, mP = { class: "_fd-event-behavior-title" }, vP = { class: "_fd-form-item-warning" }, gP = { class: "_fd-form-item-warning" }, yP = { class: "_fd-form-item-warning" };
+function bP(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-badge"), d = ee("el-dropdown-item"), p = ee("el-dropdown-menu"), h = ee("el-dropdown"), g = ee("el-header"), _ = ee("el-tooltip"), S = ee("fcDraggable"), b = ee("el-input"), A = ee("el-main"), y = ee("el-container"), m = ee("el-aside"), w = ee("FnEditor"), E = ee("el-tab-pane"), x = ee("el-option"), k = ee("el-select"), R = ee("el-tabs"), M = ee("el-menu-item"), P = ee("el-sub-menu"), B = ee("el-menu"), T = ee("Warning"), D = ee("DragForm"), V = ee("el-radio-button"), W = ee("el-radio-group"), G = ee("el-form-item"), I = ee("ComputedConfig"), U = ee("el-form"), F = ee("el-dialog");
- return H(), ae("div", WF, [
+ return H(), ae("div", KF, [
z(u, {
value: e.eventNum,
type: "warning",
@@ -31692,9 +31694,9 @@ function gP(e, t, i, r, n, a) {
disabled: e.useEventKeys.indexOf(C) > -1
}, {
default: N(() => [
- J("div", GF, [
+ J("div", YF, [
J("span", null, le(C), 1),
- e.eventInfo[C] ? (H(), ae("span", KF, le(e.eventInfo[C]), 1)) : Te("", !0)
+ e.eventInfo[C] ? (H(), ae("span", QF, le(e.eventInfo[C]), 1)) : Te("", !0)
])
]),
_: 2
@@ -31705,9 +31707,9 @@ function gP(e, t, i, r, n, a) {
disabled: e.useEventKeys.indexOf(C) > -1
}, {
default: N(() => [
- J("div", YF, [
+ J("div", JF, [
J("div", null, le(C), 1),
- J("span", QF, le(e.eventInfo[C]), 1)
+ J("span", XF, le(e.eventInfo[C]), 1)
])
]),
_: 2
@@ -31748,7 +31750,7 @@ function gP(e, t, i, r, n, a) {
}),
z(A, null, {
default: N(() => [
- J("div", JF, [
+ J("div", ZF, [
(H(!0), ae(Me, null, ze(e.event, (C, q) => (H(), ae("div", {
key: C.id,
class: qe(["_fd-menu-item", { "is-active": C.id === e.defActive }])
@@ -31757,12 +31759,12 @@ function gP(e, t, i, r, n, a) {
class: "_fd-event-title",
onClick: vt((Z) => e.edit(q), ["stop"])
}, [
- J("div", ZF, [
+ J("div", eP, [
J("span", null, [
t[16] || (t[16] = be("function")),
J("span", null, le(C.name), 1)
]),
- e.eventInfo[C.name] ? (H(), ae("span", qF, le(e.eventInfo[C.name]), 1)) : Te("", !0)
+ e.eventInfo[C.name] ? (H(), ae("span", tP, le(e.eventInfo[C.name]), 1)) : Te("", !0)
]),
C.name !== "hook_load" ? (H(), me(_, {
key: 0,
@@ -31775,16 +31777,16 @@ function gP(e, t, i, r, n, a) {
J("i", {
class: "fc-icon icon-task-add",
onClick: vt((Z) => e.addBehavior(q), ["stop"])
- }, null, 8, eP)
+ }, null, 8, nP)
]),
_: 2
}, 1032, ["content"])) : Te("", !0),
J("i", {
class: "fc-icon icon-delete-circle",
onClick: vt((Z) => e.rm(q), ["stop"])
- }, null, 8, tP)
- ], 8, XF),
- J("div", nP, [
+ }, null, 8, iP)
+ ], 8, qF),
+ J("div", rP, [
z(S, {
group: { name: "behavior", put: !1 },
sort: !0,
@@ -31799,7 +31801,7 @@ function gP(e, t, i, r, n, a) {
class: qe(["_fd-event-behavior", { "is-active": Z.id === e.defActive }]),
onClick: vt((ue) => e.editBehavior(q, Y), ["stop"])
}, [
- J("div", rP, [
+ J("div", aP, [
J("div", null, [
t[17] || (t[17] = J("i", { class: "fc-icon icon-drag" }, null, -1)),
J("span", null, le(e.t("behavior." + Z.method + ".name")), 1)
@@ -31807,17 +31809,17 @@ function gP(e, t, i, r, n, a) {
J("i", {
class: "fc-icon icon-delete-circle",
onClick: vt((ue) => e.rmBehavior(q, Y), ["stop"])
- }, null, 8, oP)
+ }, null, 8, lP)
]),
- J("div", aP, le(e.t("behavior." + Z.method + ".info") || e.t("behavior." + Z.method + ".name")), 1)
- ], 10, iP)
+ J("div", sP, le(e.t("behavior." + Z.method + ".info") || e.t("behavior." + Z.method + ".name")), 1)
+ ], 10, oP)
]),
_: 2
}, 1032, ["list"])
])
], 2))), 128)),
- e.cus ? (H(), ae("div", lP, [
- J("div", sP, [
+ e.cus ? (H(), ae("div", uP, [
+ J("div", dP, [
z(b, {
type: "text",
modelValue: e.cusValue,
@@ -31912,7 +31914,7 @@ function gP(e, t, i, r, n, a) {
name: "event"
}, {
default: N(() => [
- J("div", uP, [
+ J("div", fP, [
z(k, {
modelValue: e.eventKey,
"onUpdate:modelValue": t[5] || (t[5] = (C) => e.eventKey = C),
@@ -31955,7 +31957,7 @@ function gP(e, t, i, r, n, a) {
class: "_fd-event-behavior-list"
}, {
default: N(() => [
- J("div", dP, le(e.t("behavior.props.execute")), 1),
+ J("div", cP, le(e.t("behavior.props.execute")), 1),
z(B, {
defaultActive: e.activeBehavior.method,
onSelect: e.handleSelect
@@ -31988,11 +31990,11 @@ function gP(e, t, i, r, n, a) {
}),
z(A, { class: "_fd-event-behavior-con" }, {
default: N(() => [
- J("div", fP, [
+ J("div", pP, [
be(le(e.t("behavior.props.info")) + " ", 1),
J("div", null, le(e.t("behavior." + e.activeBehavior.method + ".info") || e.t("behavior." + e.activeBehavior.method + ".name")), 1)
]),
- e.form.rule && e.form.rule.length ? (H(), ae("div", cP, le(e.t("designer.rule")), 1)) : Te("", !0),
+ e.form.rule && e.form.rule.length ? (H(), ae("div", hP, le(e.t("designer.rule")), 1)) : Te("", !0),
e.form.rule && e.form.rule.length ? (H(), me(D, {
key: 1,
rule: e.form.rule,
@@ -32017,7 +32019,7 @@ function gP(e, t, i, r, n, a) {
]),
_: 1
}, 8, ["rule", "option", "modelValue", "api"])) : Te("", !0),
- J("div", pP, le(e.t("designer.advanced")), 1),
+ J("div", mP, le(e.t("designer.advanced")), 1),
z(U, {
size: "small",
labelWidth: "auto"
@@ -32047,7 +32049,7 @@ function gP(e, t, i, r, n, a) {
]),
_: 1
}, 8, ["modelValue"]),
- J("div", hP, le(e.t("warning.behaviorIgnoreError")), 1)
+ J("div", vP, le(e.t("warning.behaviorIgnoreError")), 1)
]),
_: 1
}, 8, ["label"]),
@@ -32062,7 +32064,7 @@ function gP(e, t, i, r, n, a) {
invertLabel: e.t("behavior.props.break"),
validLabel: e.t("behavior.props.continue")
}, null, 8, ["modelValue", "title", "invertLabel", "validLabel"]),
- J("div", mP, le(e.t("warning.behaviorExpression")), 1)
+ J("div", gP, le(e.t("warning.behaviorExpression")), 1)
]),
_: 1
}, 8, ["label"]),
@@ -32077,7 +32079,7 @@ function gP(e, t, i, r, n, a) {
invertLabel: e.t("behavior.props.continue"),
validLabel: e.t("behavior.props.stop")
}, null, 8, ["modelValue", "title", "invertLabel", "validLabel"]),
- J("div", vP, le(e.t("warning.behaviorStopPropagation")), 1)
+ J("div", yP, le(e.t("warning.behaviorStopPropagation")), 1)
]),
_: 1
}, 8, ["label"])
@@ -32104,7 +32106,7 @@ function gP(e, t, i, r, n, a) {
}, 8, ["title", "modelValue"])
]);
}
-const q0 = /* @__PURE__ */ Ve(zF, [["render", gP]]), eb = Be({
+const tb = /* @__PURE__ */ Ve(GF, [["render", bP]]), nb = Be({
name: "VNode",
props: {
fn: Function
@@ -32119,17 +32121,17 @@ Highlight.js v11.9.0 (git: b7ec4bfafc)
(c) 2006-2024 undefined and other contributors
License: BSD-3-Clause
*/
-function tb(e) {
+function ib(e) {
return e instanceof Map ? e.clear = e.delete = e.set = () => {
throw Error("map is read-only");
} : e instanceof Set && (e.add = e.clear = e.delete = () => {
throw Error("set is read-only");
}), Object.freeze(e), Object.getOwnPropertyNames(e).forEach((t) => {
const i = e[t], r = typeof i;
- r !== "object" && r !== "function" || Object.isFrozen(i) || tb(i);
+ r !== "object" && r !== "function" || Object.isFrozen(i) || ib(i);
}), e;
}
-class tg {
+class ig {
constructor(t) {
t.data === void 0 && (t.data = {}), this.data = t.data, this.isMatchIgnored = !1;
}
@@ -32137,7 +32139,7 @@ class tg {
this.isMatchIgnored = !0;
}
}
-function nb(e) {
+function rb(e) {
return e.replace(/&/g, "&").replace(//g, ">").replace(/"/g, """).replace(/'/g, "'");
}
function kr(e, ...t) {
@@ -32149,16 +32151,16 @@ function kr(e, ...t) {
i[n] = r[n];
}), i;
}
-const ng = (e) => !!e.scope;
-class yP {
+const rg = (e) => !!e.scope;
+class _P {
constructor(t, i) {
this.buffer = "", this.classPrefix = i.classPrefix, t.walk(this);
}
addText(t) {
- this.buffer += nb(t);
+ this.buffer += rb(t);
}
openNode(t) {
- if (!ng(t))
+ if (!rg(t))
return;
const i = ((r, { prefix: n }) => {
if (r.startsWith("language:"))
@@ -32172,7 +32174,7 @@ class yP {
this.span(i);
}
closeNode(t) {
- ng(t) && (this.buffer += "");
+ rg(t) && (this.buffer += "");
}
value() {
return this.buffer;
@@ -32181,13 +32183,13 @@ class yP {
this.buffer += ``;
}
}
-const ig = (e = {}) => {
+const og = (e = {}) => {
const t = { children: [] };
return Object.assign(t, e), t;
};
-class Rp {
+class Dp {
constructor() {
- this.rootNode = ig(), this.stack = [this.rootNode];
+ this.rootNode = og(), this.stack = [this.rootNode];
}
get top() {
return this.stack[this.stack.length - 1];
@@ -32199,7 +32201,7 @@ class Rp {
this.top.children.push(t);
}
openNode(t) {
- const i = ig({ scope: t });
+ const i = og({ scope: t });
this.add(i), this.stack.push(i);
}
closeNode() {
@@ -32221,11 +32223,11 @@ class Rp {
}
static _collapse(t) {
typeof t != "string" && t.children && (t.children.every((i) => typeof i == "string") ? t.children = [t.children.join("")] : t.children.forEach((i) => {
- Rp._collapse(i);
+ Dp._collapse(i);
}));
}
}
-class bP extends Rp {
+class wP extends Dp {
constructor(t) {
super(), this.options = t;
}
@@ -32243,7 +32245,7 @@ class bP extends Rp {
i && (r.scope = "language:" + i), this.add(r);
}
toHTML() {
- return new yP(this, this.options).value();
+ return new _P(this, this.options).value();
}
finalize() {
return this.closeAllNodes(), !0;
@@ -32252,36 +32254,36 @@ class bP extends Rp {
function rl(e) {
return e ? typeof e == "string" ? e : e.source : null;
}
-function ib(e) {
- return no("(?=", e, ")");
+function ob(e) {
+ return to("(?=", e, ")");
}
-function _P(e) {
- return no("(?:", e, ")*");
+function AP(e) {
+ return to("(?:", e, ")*");
}
-function wP(e) {
- return no("(?:", e, ")?");
+function CP(e) {
+ return to("(?:", e, ")?");
}
-function no(...e) {
+function to(...e) {
return e.map((t) => rl(t)).join("");
}
-function Dp(...e) {
+function Ip(...e) {
return "(" + (((i) => {
const r = i[i.length - 1];
return typeof r == "object" && r.constructor === Object ? (i.splice(i.length - 1, 1), r) : {};
})(e).capture ? "" : "?:") + e.map((i) => rl(i)).join("|") + ")";
}
-function rb(e) {
+function ab(e) {
return RegExp(e.toString() + "|").exec("").length - 1;
}
-const AP = /\[(?:[^\\\]]|\\.)*\]|\(\??|\\([1-9][0-9]*)|\\./;
-function Ac(e, { joinWith: t }) {
+const SP = /\[(?:[^\\\]]|\\.)*\]|\(\??|\\([1-9][0-9]*)|\\./;
+function Cc(e, { joinWith: t }) {
let i = 0;
return e.map((r) => {
i += 1;
const n = i;
let a = rl(r), s = "";
for (; a.length > 0; ) {
- const u = AP.exec(a);
+ const u = SP.exec(a);
if (!u) {
s += a;
break;
@@ -32291,16 +32293,16 @@ function Ac(e, { joinWith: t }) {
return s;
}).map((r) => `(${r})`).join(t);
}
-const rg = "[a-zA-Z]\\w*", Bf = "[a-zA-Z_]\\w*", og = "\\b\\d+(\\.\\d+)?", ag = "(-?)(\\b0[xX][a-fA-F0-9]+|(\\b\\d+(\\.\\d*)?|\\.\\d+)([eE][-+]?\\d+)?)", lg = "\\b(0b[01]+)", tl = {
+const ag = "[a-zA-Z]\\w*", Vf = "[a-zA-Z_]\\w*", lg = "\\b\\d+(\\.\\d+)?", sg = "(-?)(\\b0[xX][a-fA-F0-9]+|(\\b\\d+(\\.\\d*)?|\\.\\d+)([eE][-+]?\\d+)?)", ug = "\\b(0b[01]+)", tl = {
begin: "\\\\[\\s\\S]",
relevance: 0
-}, CP = {
+}, EP = {
scope: "string",
begin: "'",
end: "'",
illegal: "\\n",
contains: [tl]
-}, SP = {
+}, xP = {
scope: "string",
begin: '"',
end: '"',
@@ -32320,28 +32322,28 @@ const rg = "[a-zA-Z]\\w*", Bf = "[a-zA-Z_]\\w*", og = "\\b\\d+(\\.\\d+)?", ag =
excludeBegin: !0,
relevance: 0
});
- const n = Dp("I", "a", "is", "so", "us", "to", "at", "if", "in", "it", "on", /[A-Za-z]+['](d|ve|re|ll|t|s|n)/, /[A-Za-z]+[-][a-z]+/, /[A-Za-z][a-z]{2,}/);
- return r.contains.push({ begin: no(/[ ]+/, "(", n, /[.]?[:]?([.][ ]|[ ])/, "){3}") }), r;
-}, EP = Au("//", "$"), xP = Au("/\\*", "\\*/"), TP = Au("#", "$");
+ const n = Ip("I", "a", "is", "so", "us", "to", "at", "if", "in", "it", "on", /[A-Za-z]+['](d|ve|re|ll|t|s|n)/, /[A-Za-z]+[-][a-z]+/, /[A-Za-z][a-z]{2,}/);
+ return r.contains.push({ begin: to(/[ ]+/, "(", n, /[.]?[:]?([.][ ]|[ ])/, "){3}") }), r;
+}, TP = Au("//", "$"), kP = Au("/\\*", "\\*/"), OP = Au("#", "$");
var ys = Object.freeze({
__proto__: null,
- APOS_STRING_MODE: CP,
+ APOS_STRING_MODE: EP,
BACKSLASH_ESCAPE: tl,
BINARY_NUMBER_MODE: {
scope: "number",
- begin: lg,
+ begin: ug,
relevance: 0
},
- BINARY_NUMBER_RE: lg,
+ BINARY_NUMBER_RE: ug,
COMMENT: Au,
- C_BLOCK_COMMENT_MODE: xP,
- C_LINE_COMMENT_MODE: EP,
+ C_BLOCK_COMMENT_MODE: kP,
+ C_LINE_COMMENT_MODE: TP,
C_NUMBER_MODE: {
scope: "number",
- begin: ag,
+ begin: sg,
relevance: 0
},
- C_NUMBER_RE: ag,
+ C_NUMBER_RE: sg,
END_SAME_AS_BEGIN: (e) => Object.assign(e, {
"on:begin": (t, i) => {
i.data._beginMatch = t[1];
@@ -32350,16 +32352,16 @@ var ys = Object.freeze({
i.data._beginMatch !== t[1] && i.ignoreMatch();
}
}),
- HASH_COMMENT_MODE: TP,
- IDENT_RE: rg,
+ HASH_COMMENT_MODE: OP,
+ IDENT_RE: ag,
MATCH_NOTHING_RE: /\b\B/,
- METHOD_GUARD: { begin: "\\.\\s*" + Bf, relevance: 0 },
- NUMBER_MODE: { scope: "number", begin: og, relevance: 0 },
- NUMBER_RE: og,
+ METHOD_GUARD: { begin: "\\.\\s*" + Vf, relevance: 0 },
+ NUMBER_MODE: { scope: "number", begin: lg, relevance: 0 },
+ NUMBER_RE: lg,
PHRASAL_WORDS_MODE: {
begin: /\b(a|an|the|are|I'm|isn't|don't|doesn't|won't|but|just|should|pretty|simply|enough|gonna|going|wtf|so|such|will|you|your|they|like|more)\b/
},
- QUOTE_STRING_MODE: SP,
+ QUOTE_STRING_MODE: xP,
REGEXP_MODE: {
scope: "regexp",
begin: /\/(?=[^/\n]*\/)/,
@@ -32369,7 +32371,7 @@ var ys = Object.freeze({
RE_STARTERS_RE: "!|!=|!==|%|%=|&|&&|&=|\\*|\\*=|\\+|\\+=|,|-|-=|/=|/|:|;|<<|<<=|<=|<|===|==|=|>>>=|>>=|>=|>>>|>>|>|\\?|\\[|\\{|\\(|\\^|\\^=|\\||\\|=|\\|\\||~",
SHEBANG: (e = {}) => {
const t = /^#![ ]*\//;
- return e.binary && (e.begin = no(t, /.*\b/, e.binary, /\b.*/)), kr({
+ return e.binary && (e.begin = to(t, /.*\b/, e.binary, /\b.*/)), kr({
scope: "meta",
begin: t,
end: /$/,
@@ -32379,33 +32381,33 @@ var ys = Object.freeze({
}
}, e);
},
- TITLE_MODE: { scope: "title", begin: rg, relevance: 0 },
- UNDERSCORE_IDENT_RE: Bf,
- UNDERSCORE_TITLE_MODE: { scope: "title", begin: Bf, relevance: 0 }
+ TITLE_MODE: { scope: "title", begin: ag, relevance: 0 },
+ UNDERSCORE_IDENT_RE: Vf,
+ UNDERSCORE_TITLE_MODE: { scope: "title", begin: Vf, relevance: 0 }
});
-function kP(e, t) {
+function $P(e, t) {
e.input[e.index - 1] === "." && t.ignoreMatch();
}
-function OP(e, t) {
+function RP(e, t) {
e.className !== void 0 && (e.scope = e.className, delete e.className);
}
-function $P(e, t) {
- t && e.beginKeywords && (e.begin = "\\b(" + e.beginKeywords.split(" ").join("|") + ")(?!\\.)(?=\\b|\\s)", e.__beforeBegin = kP, e.keywords = e.keywords || e.beginKeywords, delete e.beginKeywords, e.relevance === void 0 && (e.relevance = 0));
-}
-function RP(e, t) {
- Array.isArray(e.illegal) && (e.illegal = Dp(...e.illegal));
-}
function DP(e, t) {
+ t && e.beginKeywords && (e.begin = "\\b(" + e.beginKeywords.split(" ").join("|") + ")(?!\\.)(?=\\b|\\s)", e.__beforeBegin = $P, e.keywords = e.keywords || e.beginKeywords, delete e.beginKeywords, e.relevance === void 0 && (e.relevance = 0));
+}
+function IP(e, t) {
+ Array.isArray(e.illegal) && (e.illegal = Ip(...e.illegal));
+}
+function FP(e, t) {
if (e.match) {
if (e.begin || e.end)
throw Error("begin & end are not supported with match");
e.begin = e.match, delete e.match;
}
}
-function IP(e, t) {
+function PP(e, t) {
e.relevance === void 0 && (e.relevance = 1);
}
-const FP = (e, t) => {
+const MP = (e, t) => {
if (!e.beforeMatch)
return;
if (e.starts)
@@ -32413,41 +32415,41 @@ const FP = (e, t) => {
const i = Object.assign({}, e);
Object.keys(e).forEach((r) => {
delete e[r];
- }), e.keywords = i.keywords, e.begin = no(i.beforeMatch, ib(i.begin)), e.starts = {
+ }), e.keywords = i.keywords, e.begin = to(i.beforeMatch, ob(i.begin)), e.starts = {
relevance: 0,
contains: [Object.assign(i, { endsParent: !0 })]
}, e.relevance = 0, delete i.beforeMatch;
-}, PP = ["of", "and", "for", "in", "not", "or", "if", "then", "parent", "list", "value"], MP = "keyword";
-function ob(e, t, i = MP) {
+}, LP = ["of", "and", "for", "in", "not", "or", "if", "then", "parent", "list", "value"], NP = "keyword";
+function lb(e, t, i = NP) {
const r = /* @__PURE__ */ Object.create(null);
return typeof e == "string" ? n(i, e.split(" ")) : Array.isArray(e) ? n(i, e) : Object.keys(e).forEach((a) => {
- Object.assign(r, ob(e[a], t, a));
+ Object.assign(r, lb(e[a], t, a));
}), r;
function n(a, s) {
t && (s = s.map((u) => u.toLowerCase())), s.forEach((u) => {
const d = u.split("|");
- r[d[0]] = [a, LP(d[0], d[1])];
+ r[d[0]] = [a, BP(d[0], d[1])];
});
}
}
-function LP(e, t) {
- return t ? Number(t) : ((i) => PP.includes(i.toLowerCase()))(e) ? 0 : 1;
+function BP(e, t) {
+ return t ? Number(t) : ((i) => LP.includes(i.toLowerCase()))(e) ? 0 : 1;
}
-const sg = {}, Wr = (e) => {
+const dg = {}, Wr = (e) => {
console.error(e);
-}, ug = (e, ...t) => {
+}, fg = (e, ...t) => {
console.log("WARN: " + e, ...t);
-}, Fo = (e, t) => {
- sg[`${e}/${t}`] || (console.log(`Deprecated as of ${e}. ${t}`), sg[`${e}/${t}`] = !0);
+}, Io = (e, t) => {
+ dg[`${e}/${t}`] || (console.log(`Deprecated as of ${e}. ${t}`), dg[`${e}/${t}`] = !0);
}, bs = Error();
-function dg(e, t, { key: i }) {
+function cg(e, t, { key: i }) {
let r = 0;
const n = e[i], a = {}, s = {};
for (let u = 1; u <= t.length; u++)
- s[u + r] = n[u], a[u + r] = !0, r += rb(t[u - 1]);
+ s[u + r] = n[u], a[u + r] = !0, r += ab(t[u - 1]);
e[i] = s, e[i]._emit = a, e[i]._multi = !0;
}
-function NP(e) {
+function VP(e) {
((t) => {
t.scope && typeof t.scope == "object" && t.scope !== null && (t.beginScope = t.scope, delete t.scope);
})(e), typeof e.beginScope == "string" && (e.beginScope = {
@@ -32460,7 +32462,7 @@ function NP(e) {
throw Wr("skip, excludeBegin, returnBegin not compatible with beginScope: {}"), bs;
if (typeof t.beginScope != "object" || t.beginScope === null)
throw Wr("beginScope must be object"), bs;
- dg(t, t.begin, { key: "beginScope" }), t.begin = Ac(t.begin, { joinWith: "" });
+ cg(t, t.begin, { key: "beginScope" }), t.begin = Cc(t.begin, { joinWith: "" });
}
})(e), ((t) => {
if (Array.isArray(t.end)) {
@@ -32468,11 +32470,11 @@ function NP(e) {
throw Wr("skip, excludeEnd, returnEnd not compatible with endScope: {}"), bs;
if (typeof t.endScope != "object" || t.endScope === null)
throw Wr("endScope must be object"), bs;
- dg(t, t.end, { key: "endScope" }), t.end = Ac(t.end, { joinWith: "" });
+ cg(t, t.end, { key: "endScope" }), t.end = Cc(t.end, { joinWith: "" });
}
})(e);
}
-function BP(e) {
+function jP(e) {
function t(n, a) {
return RegExp(rl(n), "m" + (e.case_insensitive ? "i" : "") + (e.unicodeRegex ? "u" : "") + (a ? "g" : ""));
}
@@ -32481,12 +32483,12 @@ function BP(e) {
this.matchIndexes = {}, this.regexes = [], this.matchAt = 1, this.position = 0;
}
addRule(a, s) {
- s.position = this.position++, this.matchIndexes[this.matchAt] = s, this.regexes.push([s, a]), this.matchAt += rb(a) + 1;
+ s.position = this.position++, this.matchIndexes[this.matchAt] = s, this.regexes.push([s, a]), this.matchAt += ab(a) + 1;
}
compile() {
this.regexes.length === 0 && (this.exec = () => null);
const a = this.regexes.map((s) => s[1]);
- this.matcherRe = t(Ac(a, {
+ this.matcherRe = t(Cc(a, {
joinWith: "|"
}), !0), this.lastIndex = 0;
}
@@ -32535,11 +32537,11 @@ function BP(e) {
const u = a;
if (a.isCompiled)
return u;
- [OP, DP, NP, FP].forEach((p) => p(a, s)), e.compilerExtensions.forEach((p) => p(a, s)), a.__beforeBegin = null, [$P, RP, IP].forEach((p) => p(a, s)), a.isCompiled = !0;
+ [RP, FP, VP, MP].forEach((p) => p(a, s)), e.compilerExtensions.forEach((p) => p(a, s)), a.__beforeBegin = null, [DP, IP, PP].forEach((p) => p(a, s)), a.isCompiled = !0;
let d = null;
- return typeof a.keywords == "object" && a.keywords.$pattern && (a.keywords = Object.assign({}, a.keywords), d = a.keywords.$pattern, delete a.keywords.$pattern), d = d || /\w+/, a.keywords && (a.keywords = ob(a.keywords, e.case_insensitive)), u.keywordPatternRe = t(d, !0), s && (a.begin || (a.begin = /\B|\b/), u.beginRe = t(u.begin), a.end || a.endsWithParent || (a.end = /\B|\b/), a.end && (u.endRe = t(u.end)), u.terminatorEnd = rl(u.end) || "", a.endsWithParent && s.terminatorEnd && (u.terminatorEnd += (a.end ? "|" : "") + s.terminatorEnd)), a.illegal && (u.illegalRe = t(a.illegal)), a.contains || (a.contains = []), a.contains = [].concat(...a.contains.map((p) => ((h) => (h.variants && !h.cachedVariants && (h.cachedVariants = h.variants.map((g) => kr(h, {
+ return typeof a.keywords == "object" && a.keywords.$pattern && (a.keywords = Object.assign({}, a.keywords), d = a.keywords.$pattern, delete a.keywords.$pattern), d = d || /\w+/, a.keywords && (a.keywords = lb(a.keywords, e.case_insensitive)), u.keywordPatternRe = t(d, !0), s && (a.begin || (a.begin = /\B|\b/), u.beginRe = t(u.begin), a.end || a.endsWithParent || (a.end = /\B|\b/), a.end && (u.endRe = t(u.end)), u.terminatorEnd = rl(u.end) || "", a.endsWithParent && s.terminatorEnd && (u.terminatorEnd += (a.end ? "|" : "") + s.terminatorEnd)), a.illegal && (u.illegalRe = t(a.illegal)), a.contains || (a.contains = []), a.contains = [].concat(...a.contains.map((p) => ((h) => (h.variants && !h.cachedVariants && (h.cachedVariants = h.variants.map((g) => kr(h, {
variants: null
- }, g))), h.cachedVariants ? h.cachedVariants : ab(h) ? kr(h, {
+ }, g))), h.cachedVariants ? h.cachedVariants : sb(h) ? kr(h, {
starts: h.starts ? kr(h.starts) : null
}) : Object.isFrozen(h) ? kr(h) : h))(p === "self" ? a : p))), a.contains.forEach((p) => {
n(p, u);
@@ -32554,15 +32556,15 @@ function BP(e) {
})(u), u;
}(e);
}
-function ab(e) {
- return !!e && (e.endsWithParent || ab(e.starts));
+function sb(e) {
+ return !!e && (e.endsWithParent || sb(e.starts));
}
-class VP extends Error {
+class UP extends Error {
constructor(t, i) {
super(t), this.name = "HTMLInjectionError", this.html = i;
}
}
-const Vf = nb, fg = kr, cg = Symbol("nomatch"), lb = (e) => {
+const jf = rb, pg = kr, hg = Symbol("nomatch"), ub = (e) => {
const t = /* @__PURE__ */ Object.create(null), i = /* @__PURE__ */ Object.create(null), r = [];
let n = !0;
const a = "Could not find the language '{}', did you forget to load/include a language module?", s = {
@@ -32578,14 +32580,14 @@ const Vf = nb, fg = kr, cg = Symbol("nomatch"), lb = (e) => {
classPrefix: "hljs-",
cssSelector: "pre code",
languages: null,
- __emitter: bP
+ __emitter: wP
};
function d(E) {
return u.noHighlightRe.test(E);
}
function p(E, x, k) {
let R = "", M = "";
- typeof x == "object" ? (R = E, k = x.ignoreIllegals, M = x.language) : (Fo("10.7.0", "highlight(lang, code, ...args) has been deprecated."), Fo("10.7.0", `Please use highlight(code, options) instead.
+ typeof x == "object" ? (R = E, k = x.ignoreIllegals, M = x.language) : (Io("10.7.0", "highlight(lang, code, ...args) has been deprecated."), Io("10.7.0", `Please use highlight(code, options) instead.
https://github.com/highlightjs/highlight.js/issues/2277`), M = E, R = x), k === void 0 && (k = !0);
const P = { code: R, language: M };
w("before:highlight", P);
@@ -32659,7 +32661,7 @@ https://github.com/highlightjs/highlight.js/issues/2277`), M = E, R = x), k ===
})(he.endRe, xe);
if ($) {
if (he["on:end"]) {
- const K = new tg(he);
+ const K = new ig(he);
he["on:end"](Se, K), K.isMatchIgnored && ($ = !1);
}
if ($) {
@@ -32677,7 +32679,7 @@ https://github.com/highlightjs/highlight.js/issues/2277`), M = E, R = x), k ===
function I(he) {
const Se = he[0], xe = x.substring(he.index), $ = W(Y, he, xe);
if (!$)
- return cg;
+ return hg;
const K = Y;
Y.endScope && Y.endScope._wrap ? (B(), T(Se, Y.endScope._wrap)) : Y.endScope && Y.endScope._multi ? (B(), D(Y.endScope, he)) : K.skip ? pe += Se : (K.returnEnd || K.excludeEnd || (pe += Se), B(), K.excludeEnd && (pe = Se));
do
@@ -32699,7 +32701,7 @@ https://github.com/highlightjs/highlight.js/issues/2277`), M = E, R = x), k ===
}
if (U = Se, Se.type === "begin")
return (($) => {
- const K = $[0], X = $.rule, ie = new tg(X), re = [X.__beforeBegin, X["on:begin"]];
+ const K = $[0], X = $.rule, ie = new ig(X), re = [X.__beforeBegin, X["on:begin"]];
for (const fe of re)
if (fe && (fe($, ie), ie.isMatchIgnored))
return G(K);
@@ -32711,7 +32713,7 @@ https://github.com/highlightjs/highlight.js/issues/2277`), M = E, R = x), k ===
}
if (Se.type === "end") {
const $ = I(Se);
- if ($ !== cg)
+ if ($ !== hg)
return $;
}
if (Se.type === "illegal" && xe === "")
@@ -32723,7 +32725,7 @@ https://github.com/highlightjs/highlight.js/issues/2277`), M = E, R = x), k ===
const C = A(E);
if (!C)
throw Wr(a.replace("{}", E)), Error('Unknown language: "' + E + '"');
- const q = BP(C);
+ const q = jP(C);
let Z = "", Y = R || q;
const ue = {}, te = new u.__emitter(u);
(() => {
@@ -32759,7 +32761,7 @@ https://github.com/highlightjs/highlight.js/issues/2277`), M = E, R = x), k ===
if (he.message && he.message.includes("Illegal"))
return {
language: E,
- value: Vf(x),
+ value: jf(x),
illegal: !0,
relevance: 0,
_illegalBy: {
@@ -32774,7 +32776,7 @@ https://github.com/highlightjs/highlight.js/issues/2277`), M = E, R = x), k ===
if (n)
return {
language: E,
- value: Vf(x),
+ value: jf(x),
illegal: !1,
relevance: 0,
errorRaised: he,
@@ -32787,7 +32789,7 @@ https://github.com/highlightjs/highlight.js/issues/2277`), M = E, R = x), k ===
function g(E, x) {
x = x || u.languages || Object.keys(t);
const k = ((D) => {
- const V = { value: Vf(D), illegal: !1, relevance: 0, _top: s, _emitter: new u.__emitter(u) };
+ const V = { value: jf(D), illegal: !1, relevance: 0, _top: s, _emitter: new u.__emitter(u) };
return V._emitter.addText(D), V;
})(E), R = x.filter(A).filter(m).map((D) => h(D, E, !1));
R.unshift(k);
@@ -32812,7 +32814,7 @@ https://github.com/highlightjs/highlight.js/issues/2277`), M = E, R = x), k ===
const T = u.languageDetectRe.exec(B);
if (T) {
const D = A(T[1]);
- return D || (ug(a.replace("{}", T[1])), ug("Falling back to no-highlight mode for this block.", P)), D ? T[1] : "no-highlight";
+ return D || (fg(a.replace("{}", T[1])), fg("Falling back to no-highlight mode for this block.", P)), D ? T[1] : "no-highlight";
}
return B.split(/\s+/).find((D) => d(D) || A(D));
})(E);
@@ -32824,7 +32826,7 @@ https://github.com/highlightjs/highlight.js/issues/2277`), M = E, R = x), k ===
}), E.dataset.highlighted)
return console.log("Element previously highlighted. To highlight again, first unset `dataset.highlighted`.", E);
if (E.children.length > 0 && (u.ignoreUnescapedHTML || (console.warn("One of your code blocks includes unescaped HTML. This is a potentially serious security risk."), console.warn("https://github.com/highlightjs/highlight.js/wiki/security"), console.warn("The element with unescaped HTML:"), console.warn(E)), u.throwUnescapedHTML))
- throw new VP("One of your code blocks includes unescaped HTML.", E.innerHTML);
+ throw new UP("One of your code blocks includes unescaped HTML.", E.innerHTML);
x = E;
const R = x.textContent, M = k ? p(R, { language: k, ignoreIllegals: !0 }) : g(R);
E.innerHTML = M.value, E.dataset.highlighted = "yes", ((P, B, T) => {
@@ -32868,15 +32870,15 @@ https://github.com/highlightjs/highlight.js/issues/2277`), M = E, R = x), k ===
highlightAuto: g,
highlightAll: b,
highlightElement: _,
- highlightBlock: (E) => (Fo("10.7.0", "highlightBlock will be removed entirely in v12.0"), Fo("10.7.0", "Please use highlightElement now."), _(E)),
+ highlightBlock: (E) => (Io("10.7.0", "highlightBlock will be removed entirely in v12.0"), Io("10.7.0", "Please use highlightElement now."), _(E)),
configure: (E) => {
- u = fg(u, E);
+ u = pg(u, E);
},
initHighlighting: () => {
- b(), Fo("10.6.0", "initHighlighting() deprecated. Use highlightAll() now.");
+ b(), Io("10.6.0", "initHighlighting() deprecated. Use highlightAll() now.");
},
initHighlightingOnLoad: () => {
- b(), Fo("10.6.0", "initHighlightingOnLoad() deprecated. Use highlightAll() now.");
+ b(), Io("10.6.0", "initHighlightingOnLoad() deprecated. Use highlightAll() now.");
},
registerLanguage: (E, x) => {
let k = null;
@@ -32900,7 +32902,7 @@ https://github.com/highlightjs/highlight.js/issues/2277`), M = E, R = x), k ===
getLanguage: A,
registerAliases: y,
autoDetection: m,
- inherit: fg,
+ inherit: pg,
addPlugin: (E) => {
((x) => {
x["before:highlightBlock"] && !x["before:highlightElement"] && (x["before:highlightElement"] = (k) => {
@@ -32919,19 +32921,19 @@ https://github.com/highlightjs/highlight.js/issues/2277`), M = E, R = x), k ===
}, e.safeMode = () => {
n = !0;
}, e.versionString = "11.9.0", e.regex = {
- concat: no,
- lookahead: ib,
- either: Dp,
- optional: wP,
- anyNumberOfTimes: _P
+ concat: to,
+ lookahead: ob,
+ either: Ip,
+ optional: CP,
+ anyNumberOfTimes: AP
};
for (const E in ys)
- typeof ys[E] == "object" && tb(ys[E]);
+ typeof ys[E] == "object" && ib(ys[E]);
return Object.assign(e, ys), e;
-}, jo = lb({});
-jo.newInstance = () => lb({});
+}, Vo = ub({});
+Vo.newInstance = () => ub({});
/*! `xml` grammar compiled for Highlight.js 11.9.0 */
-var jP = (() => (e) => {
+var HP = (() => (e) => {
const t = e.regex, i = t.concat(/[\p{L}_]/u, t.optional(/[\p{L}0-9_.-]*:/u), /[\p{L}0-9_.-]*/u), r = {
className: "symbol",
begin: /&[a-z]+;|&#[0-9]+;|&#x[a-f0-9]+;/
@@ -33024,7 +33026,7 @@ var jP = (() => (e) => {
};
})();
/*! `javascript` grammar compiled for Highlight.js 11.9.0 */
-var UP = (() => {
+var zP = (() => {
const e = "[A-Za-z$_][0-9A-Za-z$_]*", t = ["as", "in", "of", "if", "for", "while", "finally", "var", "new", "function", "do", "return", "void", "else", "break", "catch", "instanceof", "with", "throw", "case", "default", "try", "switch", "continue", "typeof", "delete", "let", "yield", "const", "class", "debugger", "async", "await", "static", "import", "from", "export", "extends"], i = ["true", "false", "null", "undefined", "NaN", "Infinity"], r = ["Object", "Function", "Boolean", "Symbol", "Math", "Date", "Number", "BigInt", "String", "RegExp", "Array", "Float32Array", "Float64Array", "Int8Array", "Uint8Array", "Uint8ClampedArray", "Int16Array", "Int32Array", "Uint16Array", "Uint32Array", "BigInt64Array", "BigUint64Array", "Set", "Map", "WeakSet", "WeakMap", "ArrayBuffer", "SharedArrayBuffer", "Atomics", "DataView", "JSON", "Promise", "Generator", "GeneratorFunction", "AsyncFunction", "Reflect", "Proxy", "Intl", "WebAssembly"], n = ["Error", "EvalError", "InternalError", "RangeError", "ReferenceError", "SyntaxError", "TypeError", "URIError"], a = ["setInterval", "setTimeout", "clearInterval", "clearTimeout", "require", "exports", "eval", "isFinite", "isNaN", "parseFloat", "parseInt", "decodeURI", "decodeURIComponent", "encodeURI", "encodeURIComponent", "escape", "unescape"], s = ["arguments", "this", "super", "console", "window", "document", "localStorage", "sessionStorage", "module", "global"], u = [].concat(a, r, n);
return (d) => {
const p = d.regex, h = e, g = {
@@ -33267,7 +33269,7 @@ var UP = (() => {
};
};
})();
-const HP = Be({
+const WP = Be({
name: "ConfigItem",
components: { Warning: ki },
props: {
@@ -33286,17 +33288,17 @@ const HP = Be({
visit: !1
};
}
-}), zP = { class: "_fd-config-item" }, WP = { class: "_fd-ci-head" }, GP = {
+}), GP = { class: "_fd-config-item" }, KP = { class: "_fd-ci-head" }, YP = {
key: 0,
class: "_fd-ci-con"
-}, KP = {
+}, QP = {
key: 1,
class: "_fd-ci-info"
};
-function YP(e, t, i, r, n, a) {
+function JP(e, t, i, r, n, a) {
const s = ee("Warning");
- return H(), ae("div", zP, [
- J("div", WP, [
+ return H(), ae("div", GP, [
+ J("div", KP, [
J("div", {
class: qe(["_fd-ci-label", e.$slots.append && e.arrow !== !1 ? "is-arrow" : ""]),
onClick: t[0] || (t[0] = (u) => e.visit = e.$slots.append && e.arrow !== !1 && !e.visit)
@@ -33319,8 +33321,8 @@ function YP(e, t, i, r, n, a) {
class: qe(["fc-icon icon-down", e.showAppend || e.visit ? "down" : ""])
}, null, 2)) : Te("", !0)
], 2),
- e.$slots.default || e.info ? (H(), ae("div", GP, [
- e.$slots.default ? kt(e.$slots, "default", { key: 0 }) : (H(), ae("span", KP, le(e.info), 1))
+ e.$slots.default || e.info ? (H(), ae("div", YP, [
+ e.$slots.default ? kt(e.$slots, "default", { key: 0 }) : (H(), ae("span", QP, le(e.info), 1))
])) : Te("", !0)
]),
e.showAppend || e.visit ? (H(), ae("div", {
@@ -33332,8 +33334,8 @@ function YP(e, t, i, r, n, a) {
], 4)) : Te("", !0)
]);
}
-const si = /* @__PURE__ */ Ve(HP, [["render", YP]]);
-const QP = Be({
+const si = /* @__PURE__ */ Ve(WP, [["render", JP]]);
+const XP = Be({
name: "PageInput",
inject: ["designer"],
emits: ["add", "delete", "change"],
@@ -33363,55 +33365,55 @@ const QP = Be({
return this.t("com." + e.name + ".name") || e.label;
},
getPageLabel(e) {
- return e.default ? this.t("designer.main") : Wo(e.main, e.config.labelField, "") || this.getPageName(e.main._menu);
+ return e.default ? this.t("designer.main") : zo(e.main, e.config.labelField, "") || this.getPageName(e.main._menu);
}
}
-}), JP = { class: "_fd-page-input" }, XP = ["onClick"], ZP = { class: "_fd-page-label" }, qP = {
+}), ZP = { class: "_fd-page-input" }, qP = ["onClick"], e3 = { class: "_fd-page-label" }, t3 = {
key: 0,
class: "fc-icon icon-yes"
-}, e3 = {
+}, n3 = {
key: 0,
class: "_fd-page-id"
-}, t3 = ["onClick"], n3 = {
+}, i3 = ["onClick"], r3 = {
key: 0,
class: "_fd-page-btns"
-}, i3 = ["onClick"], r3 = ["onClick"];
-function o3(e, t, i, r, n, a) {
+}, o3 = ["onClick"], a3 = ["onClick"];
+function l3(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-dropdown-item"), d = ee("el-dropdown-menu"), p = ee("el-dropdown");
- return H(), ae("div", JP, [
+ return H(), ae("div", ZP, [
(H(!0), ae(Me, null, ze(e.pageData, (h, g) => (H(), ae("div", {
key: h.main ? h.main.name : "",
class: qe(["_fd-page-item", { active: h === e.activePage }]),
onClick: (_) => e.$emit("change", g)
}, [
J("div", null, [
- J("div", ZP, [
+ J("div", e3, [
J("span", null, le(e.getPageLabel(h)), 1),
- h === e.activePage ? (H(), ae("i", qP)) : Te("", !0)
+ h === e.activePage ? (H(), ae("i", t3)) : Te("", !0)
]),
- h.main ? (H(), ae("div", e3, [
+ h.main ? (H(), ae("div", n3, [
be(" ID\uFF1A" + le(h.main.name) + " ", 1),
J("i", {
onClick: vt((_) => e.copy(h.main.name), ["stop"]),
class: "fc-icon icon-group"
- }, null, 8, t3)
+ }, null, 8, i3)
])) : Te("", !0)
]),
- h.default ? Te("", !0) : (H(), ae("div", n3, [
+ h.default ? Te("", !0) : (H(), ae("div", r3, [
J("div", {
class: "_fd-page-copy",
onClick: vt((_) => e.$emit("copy", g), ["stop"])
}, t[0] || (t[0] = [
J("i", { class: "fc-icon icon-copy" }, null, -1)
- ]), 8, i3),
+ ]), 8, o3),
J("div", {
class: "_fd-page-del",
onClick: vt((_) => e.$emit("delete", g), ["stop"])
}, t[1] || (t[1] = [
J("i", { class: "fc-icon icon-delete" }, null, -1)
- ]), 8, r3)
+ ]), 8, a3)
]))
- ], 10, XP))), 128)),
+ ], 10, qP))), 128)),
z(p, {
size: "default",
trigger: "click"
@@ -33448,25 +33450,25 @@ function o3(e, t, i, r, n, a) {
})
]);
}
-const a3 = /* @__PURE__ */ Ve(QP, [["render", o3]]);
-function pg(e) {
+const s3 = /* @__PURE__ */ Ve(XP, [["render", l3]]);
+function mg(e) {
return Array.isArray(e) ? e : [null, void 0, ""].indexOf(e) > -1 ? [] : [e];
}
function vl(e) {
let t = e.replace(/([A-Z])/g, "-$1").toLocaleLowerCase();
return t.indexOf("-") === 0 && (t = t.substr(1)), t;
}
-function hg(e, t, i) {
+function vg(e, t, i) {
let r = e, n;
return (t || "").split(".").forEach((a) => {
n && ((!r[n] || typeof r[n] != "object") && (r[n] = {}), r = r[n]), n = a;
}), r[n] = i, r;
}
-var sb = { exports: {} }, ja = {}, _s = { exports: {} }, jf = {}, Uf = {}, mg;
-function Ip() {
- if (mg)
- return Uf;
- mg = 1;
+var db = { exports: {} }, ja = {}, _s = { exports: {} }, Uf = {}, Hf = {}, gg;
+function Fp() {
+ if (gg)
+ return Hf;
+ gg = 1;
function e(r) {
this.__parent = r, this.__character_count = 0, this.__indent_count = -1, this.__alignment_count = 0, this.__wrap_point_index = 0, this.__wrap_point_character_count = 0, this.__wrap_point_indent_count = -1, this.__wrap_point_alignment_count = 0, this.__items = [];
}
@@ -33591,31 +33593,31 @@ function Ip() {
}
a--;
}
- }, Uf.Output = i, Uf;
+ }, Hf.Output = i, Hf;
}
-var Hf = {}, vg;
-function ub() {
- if (vg)
- return Hf;
- vg = 1;
+var zf = {}, yg;
+function fb() {
+ if (yg)
+ return zf;
+ yg = 1;
function e(t, i, r, n) {
this.type = t, this.text = i, this.comments_before = null, this.newlines = r || 0, this.whitespace_before = n || "", this.parent = null, this.next = null, this.previous = null, this.opened = null, this.closed = null, this.directives = null;
}
- return Hf.Token = e, Hf;
+ return zf.Token = e, zf;
}
-var zf = {}, gg;
-function db() {
- return gg || (gg = 1, function(e) {
+var Wf = {}, bg;
+function cb() {
+ return bg || (bg = 1, function(e) {
var t = "\\x23\\x24\\x40\\x41-\\x5a\\x5f\\x61-\\x7a", i = "\\x24\\x30-\\x39\\x41-\\x5a\\x5f\\x61-\\x7a", r = "\\xaa\\xb5\\xba\\xc0-\\xd6\\xd8-\\xf6\\xf8-\\u02c1\\u02c6-\\u02d1\\u02e0-\\u02e4\\u02ec\\u02ee\\u0370-\\u0374\\u0376\\u0377\\u037a-\\u037d\\u0386\\u0388-\\u038a\\u038c\\u038e-\\u03a1\\u03a3-\\u03f5\\u03f7-\\u0481\\u048a-\\u0527\\u0531-\\u0556\\u0559\\u0561-\\u0587\\u05d0-\\u05ea\\u05f0-\\u05f2\\u0620-\\u064a\\u066e\\u066f\\u0671-\\u06d3\\u06d5\\u06e5\\u06e6\\u06ee\\u06ef\\u06fa-\\u06fc\\u06ff\\u0710\\u0712-\\u072f\\u074d-\\u07a5\\u07b1\\u07ca-\\u07ea\\u07f4\\u07f5\\u07fa\\u0800-\\u0815\\u081a\\u0824\\u0828\\u0840-\\u0858\\u08a0\\u08a2-\\u08ac\\u0904-\\u0939\\u093d\\u0950\\u0958-\\u0961\\u0971-\\u0977\\u0979-\\u097f\\u0985-\\u098c\\u098f\\u0990\\u0993-\\u09a8\\u09aa-\\u09b0\\u09b2\\u09b6-\\u09b9\\u09bd\\u09ce\\u09dc\\u09dd\\u09df-\\u09e1\\u09f0\\u09f1\\u0a05-\\u0a0a\\u0a0f\\u0a10\\u0a13-\\u0a28\\u0a2a-\\u0a30\\u0a32\\u0a33\\u0a35\\u0a36\\u0a38\\u0a39\\u0a59-\\u0a5c\\u0a5e\\u0a72-\\u0a74\\u0a85-\\u0a8d\\u0a8f-\\u0a91\\u0a93-\\u0aa8\\u0aaa-\\u0ab0\\u0ab2\\u0ab3\\u0ab5-\\u0ab9\\u0abd\\u0ad0\\u0ae0\\u0ae1\\u0b05-\\u0b0c\\u0b0f\\u0b10\\u0b13-\\u0b28\\u0b2a-\\u0b30\\u0b32\\u0b33\\u0b35-\\u0b39\\u0b3d\\u0b5c\\u0b5d\\u0b5f-\\u0b61\\u0b71\\u0b83\\u0b85-\\u0b8a\\u0b8e-\\u0b90\\u0b92-\\u0b95\\u0b99\\u0b9a\\u0b9c\\u0b9e\\u0b9f\\u0ba3\\u0ba4\\u0ba8-\\u0baa\\u0bae-\\u0bb9\\u0bd0\\u0c05-\\u0c0c\\u0c0e-\\u0c10\\u0c12-\\u0c28\\u0c2a-\\u0c33\\u0c35-\\u0c39\\u0c3d\\u0c58\\u0c59\\u0c60\\u0c61\\u0c85-\\u0c8c\\u0c8e-\\u0c90\\u0c92-\\u0ca8\\u0caa-\\u0cb3\\u0cb5-\\u0cb9\\u0cbd\\u0cde\\u0ce0\\u0ce1\\u0cf1\\u0cf2\\u0d05-\\u0d0c\\u0d0e-\\u0d10\\u0d12-\\u0d3a\\u0d3d\\u0d4e\\u0d60\\u0d61\\u0d7a-\\u0d7f\\u0d85-\\u0d96\\u0d9a-\\u0db1\\u0db3-\\u0dbb\\u0dbd\\u0dc0-\\u0dc6\\u0e01-\\u0e30\\u0e32\\u0e33\\u0e40-\\u0e46\\u0e81\\u0e82\\u0e84\\u0e87\\u0e88\\u0e8a\\u0e8d\\u0e94-\\u0e97\\u0e99-\\u0e9f\\u0ea1-\\u0ea3\\u0ea5\\u0ea7\\u0eaa\\u0eab\\u0ead-\\u0eb0\\u0eb2\\u0eb3\\u0ebd\\u0ec0-\\u0ec4\\u0ec6\\u0edc-\\u0edf\\u0f00\\u0f40-\\u0f47\\u0f49-\\u0f6c\\u0f88-\\u0f8c\\u1000-\\u102a\\u103f\\u1050-\\u1055\\u105a-\\u105d\\u1061\\u1065\\u1066\\u106e-\\u1070\\u1075-\\u1081\\u108e\\u10a0-\\u10c5\\u10c7\\u10cd\\u10d0-\\u10fa\\u10fc-\\u1248\\u124a-\\u124d\\u1250-\\u1256\\u1258\\u125a-\\u125d\\u1260-\\u1288\\u128a-\\u128d\\u1290-\\u12b0\\u12b2-\\u12b5\\u12b8-\\u12be\\u12c0\\u12c2-\\u12c5\\u12c8-\\u12d6\\u12d8-\\u1310\\u1312-\\u1315\\u1318-\\u135a\\u1380-\\u138f\\u13a0-\\u13f4\\u1401-\\u166c\\u166f-\\u167f\\u1681-\\u169a\\u16a0-\\u16ea\\u16ee-\\u16f0\\u1700-\\u170c\\u170e-\\u1711\\u1720-\\u1731\\u1740-\\u1751\\u1760-\\u176c\\u176e-\\u1770\\u1780-\\u17b3\\u17d7\\u17dc\\u1820-\\u1877\\u1880-\\u18a8\\u18aa\\u18b0-\\u18f5\\u1900-\\u191c\\u1950-\\u196d\\u1970-\\u1974\\u1980-\\u19ab\\u19c1-\\u19c7\\u1a00-\\u1a16\\u1a20-\\u1a54\\u1aa7\\u1b05-\\u1b33\\u1b45-\\u1b4b\\u1b83-\\u1ba0\\u1bae\\u1baf\\u1bba-\\u1be5\\u1c00-\\u1c23\\u1c4d-\\u1c4f\\u1c5a-\\u1c7d\\u1ce9-\\u1cec\\u1cee-\\u1cf1\\u1cf5\\u1cf6\\u1d00-\\u1dbf\\u1e00-\\u1f15\\u1f18-\\u1f1d\\u1f20-\\u1f45\\u1f48-\\u1f4d\\u1f50-\\u1f57\\u1f59\\u1f5b\\u1f5d\\u1f5f-\\u1f7d\\u1f80-\\u1fb4\\u1fb6-\\u1fbc\\u1fbe\\u1fc2-\\u1fc4\\u1fc6-\\u1fcc\\u1fd0-\\u1fd3\\u1fd6-\\u1fdb\\u1fe0-\\u1fec\\u1ff2-\\u1ff4\\u1ff6-\\u1ffc\\u2071\\u207f\\u2090-\\u209c\\u2102\\u2107\\u210a-\\u2113\\u2115\\u2119-\\u211d\\u2124\\u2126\\u2128\\u212a-\\u212d\\u212f-\\u2139\\u213c-\\u213f\\u2145-\\u2149\\u214e\\u2160-\\u2188\\u2c00-\\u2c2e\\u2c30-\\u2c5e\\u2c60-\\u2ce4\\u2ceb-\\u2cee\\u2cf2\\u2cf3\\u2d00-\\u2d25\\u2d27\\u2d2d\\u2d30-\\u2d67\\u2d6f\\u2d80-\\u2d96\\u2da0-\\u2da6\\u2da8-\\u2dae\\u2db0-\\u2db6\\u2db8-\\u2dbe\\u2dc0-\\u2dc6\\u2dc8-\\u2dce\\u2dd0-\\u2dd6\\u2dd8-\\u2dde\\u2e2f\\u3005-\\u3007\\u3021-\\u3029\\u3031-\\u3035\\u3038-\\u303c\\u3041-\\u3096\\u309d-\\u309f\\u30a1-\\u30fa\\u30fc-\\u30ff\\u3105-\\u312d\\u3131-\\u318e\\u31a0-\\u31ba\\u31f0-\\u31ff\\u3400-\\u4db5\\u4e00-\\u9fcc\\ua000-\\ua48c\\ua4d0-\\ua4fd\\ua500-\\ua60c\\ua610-\\ua61f\\ua62a\\ua62b\\ua640-\\ua66e\\ua67f-\\ua697\\ua6a0-\\ua6ef\\ua717-\\ua71f\\ua722-\\ua788\\ua78b-\\ua78e\\ua790-\\ua793\\ua7a0-\\ua7aa\\ua7f8-\\ua801\\ua803-\\ua805\\ua807-\\ua80a\\ua80c-\\ua822\\ua840-\\ua873\\ua882-\\ua8b3\\ua8f2-\\ua8f7\\ua8fb\\ua90a-\\ua925\\ua930-\\ua946\\ua960-\\ua97c\\ua984-\\ua9b2\\ua9cf\\uaa00-\\uaa28\\uaa40-\\uaa42\\uaa44-\\uaa4b\\uaa60-\\uaa76\\uaa7a\\uaa80-\\uaaaf\\uaab1\\uaab5\\uaab6\\uaab9-\\uaabd\\uaac0\\uaac2\\uaadb-\\uaadd\\uaae0-\\uaaea\\uaaf2-\\uaaf4\\uab01-\\uab06\\uab09-\\uab0e\\uab11-\\uab16\\uab20-\\uab26\\uab28-\\uab2e\\uabc0-\\uabe2\\uac00-\\ud7a3\\ud7b0-\\ud7c6\\ud7cb-\\ud7fb\\uf900-\\ufa6d\\ufa70-\\ufad9\\ufb00-\\ufb06\\ufb13-\\ufb17\\ufb1d\\ufb1f-\\ufb28\\ufb2a-\\ufb36\\ufb38-\\ufb3c\\ufb3e\\ufb40\\ufb41\\ufb43\\ufb44\\ufb46-\\ufbb1\\ufbd3-\\ufd3d\\ufd50-\\ufd8f\\ufd92-\\ufdc7\\ufdf0-\\ufdfb\\ufe70-\\ufe74\\ufe76-\\ufefc\\uff21-\\uff3a\\uff41-\\uff5a\\uff66-\\uffbe\\uffc2-\\uffc7\\uffca-\\uffcf\\uffd2-\\uffd7\\uffda-\\uffdc", n = "\\u0300-\\u036f\\u0483-\\u0487\\u0591-\\u05bd\\u05bf\\u05c1\\u05c2\\u05c4\\u05c5\\u05c7\\u0610-\\u061a\\u0620-\\u0649\\u0672-\\u06d3\\u06e7-\\u06e8\\u06fb-\\u06fc\\u0730-\\u074a\\u0800-\\u0814\\u081b-\\u0823\\u0825-\\u0827\\u0829-\\u082d\\u0840-\\u0857\\u08e4-\\u08fe\\u0900-\\u0903\\u093a-\\u093c\\u093e-\\u094f\\u0951-\\u0957\\u0962-\\u0963\\u0966-\\u096f\\u0981-\\u0983\\u09bc\\u09be-\\u09c4\\u09c7\\u09c8\\u09d7\\u09df-\\u09e0\\u0a01-\\u0a03\\u0a3c\\u0a3e-\\u0a42\\u0a47\\u0a48\\u0a4b-\\u0a4d\\u0a51\\u0a66-\\u0a71\\u0a75\\u0a81-\\u0a83\\u0abc\\u0abe-\\u0ac5\\u0ac7-\\u0ac9\\u0acb-\\u0acd\\u0ae2-\\u0ae3\\u0ae6-\\u0aef\\u0b01-\\u0b03\\u0b3c\\u0b3e-\\u0b44\\u0b47\\u0b48\\u0b4b-\\u0b4d\\u0b56\\u0b57\\u0b5f-\\u0b60\\u0b66-\\u0b6f\\u0b82\\u0bbe-\\u0bc2\\u0bc6-\\u0bc8\\u0bca-\\u0bcd\\u0bd7\\u0be6-\\u0bef\\u0c01-\\u0c03\\u0c46-\\u0c48\\u0c4a-\\u0c4d\\u0c55\\u0c56\\u0c62-\\u0c63\\u0c66-\\u0c6f\\u0c82\\u0c83\\u0cbc\\u0cbe-\\u0cc4\\u0cc6-\\u0cc8\\u0cca-\\u0ccd\\u0cd5\\u0cd6\\u0ce2-\\u0ce3\\u0ce6-\\u0cef\\u0d02\\u0d03\\u0d46-\\u0d48\\u0d57\\u0d62-\\u0d63\\u0d66-\\u0d6f\\u0d82\\u0d83\\u0dca\\u0dcf-\\u0dd4\\u0dd6\\u0dd8-\\u0ddf\\u0df2\\u0df3\\u0e34-\\u0e3a\\u0e40-\\u0e45\\u0e50-\\u0e59\\u0eb4-\\u0eb9\\u0ec8-\\u0ecd\\u0ed0-\\u0ed9\\u0f18\\u0f19\\u0f20-\\u0f29\\u0f35\\u0f37\\u0f39\\u0f41-\\u0f47\\u0f71-\\u0f84\\u0f86-\\u0f87\\u0f8d-\\u0f97\\u0f99-\\u0fbc\\u0fc6\\u1000-\\u1029\\u1040-\\u1049\\u1067-\\u106d\\u1071-\\u1074\\u1082-\\u108d\\u108f-\\u109d\\u135d-\\u135f\\u170e-\\u1710\\u1720-\\u1730\\u1740-\\u1750\\u1772\\u1773\\u1780-\\u17b2\\u17dd\\u17e0-\\u17e9\\u180b-\\u180d\\u1810-\\u1819\\u1920-\\u192b\\u1930-\\u193b\\u1951-\\u196d\\u19b0-\\u19c0\\u19c8-\\u19c9\\u19d0-\\u19d9\\u1a00-\\u1a15\\u1a20-\\u1a53\\u1a60-\\u1a7c\\u1a7f-\\u1a89\\u1a90-\\u1a99\\u1b46-\\u1b4b\\u1b50-\\u1b59\\u1b6b-\\u1b73\\u1bb0-\\u1bb9\\u1be6-\\u1bf3\\u1c00-\\u1c22\\u1c40-\\u1c49\\u1c5b-\\u1c7d\\u1cd0-\\u1cd2\\u1d00-\\u1dbe\\u1e01-\\u1f15\\u200c\\u200d\\u203f\\u2040\\u2054\\u20d0-\\u20dc\\u20e1\\u20e5-\\u20f0\\u2d81-\\u2d96\\u2de0-\\u2dff\\u3021-\\u3028\\u3099\\u309a\\ua640-\\ua66d\\ua674-\\ua67d\\ua69f\\ua6f0-\\ua6f1\\ua7f8-\\ua800\\ua806\\ua80b\\ua823-\\ua827\\ua880-\\ua881\\ua8b4-\\ua8c4\\ua8d0-\\ua8d9\\ua8f3-\\ua8f7\\ua900-\\ua909\\ua926-\\ua92d\\ua930-\\ua945\\ua980-\\ua983\\ua9b3-\\ua9c0\\uaa00-\\uaa27\\uaa40-\\uaa41\\uaa4c-\\uaa4d\\uaa50-\\uaa59\\uaa7b\\uaae0-\\uaae9\\uaaf2-\\uaaf3\\uabc0-\\uabe1\\uabec\\uabed\\uabf0-\\uabf9\\ufb20-\\ufb28\\ufe00-\\ufe0f\\ufe20-\\ufe26\\ufe33\\ufe34\\ufe4d-\\ufe4f\\uff10-\\uff19\\uff3f", a = "\\\\u[0-9a-fA-F]{4}|\\\\u\\{[0-9a-fA-F]+\\}", s = "(?:" + a + "|[" + t + r + "])", u = "(?:" + a + "|[" + i + r + n + "])*";
e.identifier = new RegExp(s + u, "g"), e.identifierStart = new RegExp(s), e.identifierMatch = new RegExp("(?:" + a + "|[" + i + r + n + "])+"), e.newline = /[\n\r\u2028\u2029]/, e.lineBreak = new RegExp(`\r
|` + e.newline.source), e.allLineBreaks = new RegExp(e.lineBreak.source, "g");
- }(zf)), zf;
+ }(Wf)), Wf;
}
-var Wf = {}, Ua = {}, yg;
-function Fp() {
- if (yg)
+var Gf = {}, Ua = {}, _g;
+function Pp() {
+ if (_g)
return Ua;
- yg = 1;
+ _g = 1;
function e(r, n) {
this.raw_options = t(r, n), this.disabled = this._get_boolean("disabled"), this.eol = this._get_characters("eol", "auto"), this.end_with_newline = this._get_boolean("end_with_newline"), this.indent_size = this._get_number("indent_size", 4), this.indent_char = this._get_characters("indent_char", " "), this.indent_level = this._get_number("indent_level"), this.preserve_newlines = this._get_boolean("preserve_newlines", !0), this.max_preserve_newlines = this._get_number("max_preserve_newlines", 32786), this.preserve_newlines || (this.max_preserve_newlines = 0), this.indent_with_tabs = this._get_boolean("indent_with_tabs", this.indent_char === " "), this.indent_with_tabs && (this.indent_char = " ", this.indent_size === 1 && (this.indent_size = 4)), this.wrap_line_length = this._get_number("wrap_line_length", this._get_number("max_char")), this.indent_empty_lines = this._get_boolean("indent_empty_lines"), this.templating = this._get_selection_list("templating", ["auto", "none", "angular", "django", "erb", "handlebars", "php", "smarty"], ["auto"]);
}
@@ -33682,12 +33684,12 @@ You passed in: '` + this.raw_options[r] + "'"
}
return Ua.Options = e, Ua.normalizeOpts = i, Ua.mergeOpts = t, Ua;
}
-var bg;
-function fb() {
- if (bg)
- return Wf;
- bg = 1;
- var e = Fp().Options, t = ["before-newline", "after-newline", "preserve-newline"];
+var wg;
+function pb() {
+ if (wg)
+ return Gf;
+ wg = 1;
+ var e = Pp().Options, t = ["before-newline", "after-newline", "preserve-newline"];
function i(r) {
e.call(this, r, "js");
var n = this.raw_options.brace_style || null;
@@ -33698,13 +33700,13 @@ function fb() {
a[s] === "preserve-inline" ? this.brace_preserve_inline = !0 : this.brace_style = a[s];
this.unindent_chained_methods = this._get_boolean("unindent_chained_methods"), this.break_chained_methods = this._get_boolean("break_chained_methods"), this.space_in_paren = this._get_boolean("space_in_paren"), this.space_in_empty_paren = this._get_boolean("space_in_empty_paren"), this.jslint_happy = this._get_boolean("jslint_happy"), this.space_after_anon_function = this._get_boolean("space_after_anon_function"), this.space_after_named_function = this._get_boolean("space_after_named_function"), this.keep_array_indentation = this._get_boolean("keep_array_indentation"), this.space_before_conditional = this._get_boolean("space_before_conditional", !0), this.unescape_strings = this._get_boolean("unescape_strings"), this.e4x = this._get_boolean("e4x"), this.comma_first = this._get_boolean("comma_first"), this.operator_position = this._get_selection("operator_position", t), this.test_output_raw = this._get_boolean("test_output_raw"), this.jslint_happy && (this.space_after_anon_function = !0);
}
- return i.prototype = new e(), Wf.Options = i, Wf;
+ return i.prototype = new e(), Gf.Options = i, Gf;
}
-var Po = {}, Gf = {}, _g;
-function Pp() {
- if (_g)
- return Gf;
- _g = 1;
+var Fo = {}, Kf = {}, Ag;
+function Mp() {
+ if (Ag)
+ return Kf;
+ Ag = 1;
var e = RegExp.prototype.hasOwnProperty("sticky");
function t(i) {
this.__input = i || "", this.__input_length = this.__input.length, this.__position = 0;
@@ -33754,13 +33756,13 @@ function Pp() {
}, t.prototype.lookBack = function(i) {
var r = this.__position - 1;
return r >= i.length && this.__input.substring(r - i.length, r).toLowerCase() === i;
- }, Gf.InputScanner = t, Gf;
+ }, Kf.InputScanner = t, Kf;
}
-var ws = {}, Kf = {}, wg;
-function l3() {
- if (wg)
- return Kf;
- wg = 1;
+var ws = {}, Yf = {}, Cg;
+function u3() {
+ if (Cg)
+ return Yf;
+ Cg = 1;
function e(t) {
this.__tokens = [], this.__tokens_length = this.__tokens.length, this.__position = 0, this.__parent_token = t;
}
@@ -33778,13 +33780,13 @@ function l3() {
return t = t || 0, t += this.__position, t >= 0 && t < this.__tokens_length && (i = this.__tokens[t]), i;
}, e.prototype.add = function(t) {
this.__parent_token && (t.parent = this.__parent_token), this.__tokens.push(t), this.__tokens_length += 1;
- }, Kf.TokenStream = e, Kf;
+ }, Yf.TokenStream = e, Yf;
}
-var Yf = {}, Qf = {}, Ag;
+var Qf = {}, Jf = {}, Sg;
function Cu() {
- if (Ag)
- return Qf;
- Ag = 1;
+ if (Sg)
+ return Jf;
+ Sg = 1;
function e(t, i) {
this._input = t, this._starting_pattern = null, this._match_pattern = null, this._until_pattern = null, this._until_after = !1, i && (this._starting_pattern = this._input.get_regexp(i._starting_pattern, !0), this._match_pattern = this._input.get_regexp(i._match_pattern, !0), this._until_pattern = this._input.get_regexp(i._until_pattern), this._until_after = i._until_after);
}
@@ -33808,13 +33810,13 @@ function Cu() {
}, e.prototype._create = function() {
return new e(this._input, this);
}, e.prototype._update = function() {
- }, Qf.Pattern = e, Qf;
+ }, Jf.Pattern = e, Jf;
}
-var Cg;
-function s3() {
- if (Cg)
- return Yf;
- Cg = 1;
+var Eg;
+function d3() {
+ if (Eg)
+ return Qf;
+ Eg = 1;
var e = Cu().Pattern;
function t(i, r) {
e.call(this, i, r), r ? this._line_regexp = this._input.get_regexp(r._line_regexp) : this.__set_whitespace_patterns("", ""), this.newline_count = 0, this.whitespace_before_token = "";
@@ -33846,14 +33848,14 @@ function s3() {
for (var n = 0, a = [], s = i.exec(r); s; )
a.push(r.substring(n, s.index)), n = s.index + s[0].length, s = i.exec(r);
return n < r.length ? a.push(r.substring(n, r.length)) : a.push(""), a;
- }, Yf.WhitespacePattern = t, Yf;
+ }, Qf.WhitespacePattern = t, Qf;
}
-var Sg;
+var xg;
function tu() {
- if (Sg)
+ if (xg)
return ws;
- Sg = 1;
- var e = Pp().InputScanner, t = ub().Token, i = l3().TokenStream, r = s3().WhitespacePattern, n = {
+ xg = 1;
+ var e = Mp().InputScanner, t = fb().Token, i = u3().TokenStream, r = d3().WhitespacePattern, n = {
START: "TK_START",
RAW: "TK_RAW",
EOF: "TK_EOF"
@@ -33893,11 +33895,11 @@ function tu() {
return this._patterns.whitespace.read();
}, ws.Tokenizer = a, ws.TOKEN = n, ws;
}
-var Jf = {}, Eg;
-function Mp() {
- if (Eg)
- return Jf;
- Eg = 1;
+var Xf = {}, Tg;
+function Lp() {
+ if (Tg)
+ return Xf;
+ Tg = 1;
function e(t, i) {
t = typeof t == "string" ? t : t.source, i = typeof i == "string" ? i : i.source, this.__directives_block_pattern = new RegExp(t + / beautify( \w+[:]\w+)+ /.source + i, "g"), this.__directive_pattern = / (\w+)[:](\w+)/g, this.__directives_end_ignore_pattern = new RegExp(t + /\sbeautify\signore:end\s/.source + i, "g");
}
@@ -33911,13 +33913,13 @@ function Mp() {
return i;
}, e.prototype.readIgnored = function(t) {
return t.readUntilAfter(this.__directives_end_ignore_pattern);
- }, Jf.Directives = e, Jf;
+ }, Xf.Directives = e, Xf;
}
-var Xf = {}, xg;
-function cb() {
- if (xg)
- return Xf;
- xg = 1;
+var Zf = {}, kg;
+function hb() {
+ if (kg)
+ return Zf;
+ kg = 1;
var e = Cu().Pattern, t = {
django: !1,
erb: !1,
@@ -33975,14 +33977,14 @@ function cb() {
} else
n === "{" && (!this._disabled.handlebars && !this._excluded.handlebars && (r = r || this.__patterns.handlebars_comment.read(), r = r || this.__patterns.handlebars_unescaped.read(), r = r || this.__patterns.handlebars.read()), this._disabled.django || (!this._excluded.django && !this._excluded.handlebars && (r = r || this.__patterns.django_value.read()), this._excluded.django || (r = r || this.__patterns.django_comment.read(), r = r || this.__patterns.django.read())), this._disabled.smarty || this._disabled.django && this._disabled.handlebars && (r = r || this.__patterns.smarty_comment.read(), r = r || this.__patterns.smarty_literal.read(), r = r || this.__patterns.smarty.read()));
return r;
- }, Xf.TemplatablePattern = i, Xf;
+ }, Zf.TemplatablePattern = i, Zf;
}
-var Tg;
+var Og;
function As() {
- if (Tg)
- return Po;
- Tg = 1;
- var e = Pp().InputScanner, t = tu().Tokenizer, i = tu().TOKEN, r = Mp().Directives, n = db(), a = Cu().Pattern, s = cb().TemplatablePattern;
+ if (Og)
+ return Fo;
+ Og = 1;
+ var e = Mp().InputScanner, t = tu().Tokenizer, i = tu().TOKEN, r = Lp().Directives, n = cb(), a = Cu().Pattern, s = hb().TemplatablePattern;
function u(R, M) {
return M.indexOf(R) !== -1;
}
@@ -34174,14 +34176,14 @@ function As() {
V += T.read(), D += V;
}
return D;
- }, Po.Tokenizer = x, Po.TOKEN = d, Po.positionable_operators = S.slice(), Po.line_starters = y.slice(), Po;
+ }, Fo.Tokenizer = x, Fo.TOKEN = d, Fo.positionable_operators = S.slice(), Fo.line_starters = y.slice(), Fo;
}
-var kg;
-function u3() {
- if (kg)
- return jf;
- kg = 1;
- var e = Ip().Output, t = ub().Token, i = db(), r = fb().Options, n = As().Tokenizer, a = As().line_starters, s = As().positionable_operators, u = As().TOKEN;
+var $g;
+function f3() {
+ if ($g)
+ return Uf;
+ $g = 1;
+ var e = Fp().Output, t = fb().Token, i = cb(), r = pb().Options, n = As().Tokenizer, a = As().line_starters, s = As().positionable_operators, u = As().TOKEN;
function d(T, D) {
return D.indexOf(T) !== -1;
}
@@ -34549,14 +34551,14 @@ function u3() {
for (; this._flags.mode === m.Statement; )
this.restore_mode();
this.handle_whitespace_and_comments(T);
- }, jf.Beautifier = P, jf;
+ }, Uf.Beautifier = P, Uf;
}
-var Og;
-function d3() {
- if (Og)
+var Rg;
+function c3() {
+ if (Rg)
return _s.exports;
- Og = 1;
- var e = u3().Beautifier, t = fb().Options;
+ Rg = 1;
+ var e = f3().Beautifier, t = pb().Options;
function i(r, n) {
var a = new e(r, n);
return a.beautify();
@@ -34565,12 +34567,12 @@ function d3() {
return new t();
}, _s.exports;
}
-var Cs = { exports: {} }, Zf = {}, qf = {}, $g;
-function pb() {
- if ($g)
- return qf;
- $g = 1;
- var e = Fp().Options;
+var Cs = { exports: {} }, qf = {}, ec = {}, Dg;
+function mb() {
+ if (Dg)
+ return ec;
+ Dg = 1;
+ var e = Pp().Options;
function t(i) {
e.call(this, i, "css"), this.selector_separator_newline = this._get_boolean("selector_separator_newline", !0), this.newline_between_rules = this._get_boolean("newline_between_rules", !0);
var r = this._get_boolean("space_around_selector_separator");
@@ -34580,14 +34582,14 @@ function pb() {
for (var a = 0; a < n.length; a++)
n[a] !== "expand" ? this.brace_style = "collapse" : this.brace_style = n[a];
}
- return t.prototype = new e(), qf.Options = t, qf;
+ return t.prototype = new e(), ec.Options = t, ec;
}
-var Rg;
-function f3() {
- if (Rg)
- return Zf;
- Rg = 1;
- var e = pb().Options, t = Ip().Output, i = Pp().InputScanner, r = Mp().Directives, n = new r(/\/\*/, /\*\//), a = /\r\n|[\r\n]/, s = /\r\n|[\r\n]/g, u = /\s/, d = /(?:\s|\n)+/g, p = /\/\*(?:[\s\S]*?)((?:\*\/)|$)/g, h = /\/\/(?:[^\n\r\u2028\u2029]*)/g;
+var Ig;
+function p3() {
+ if (Ig)
+ return qf;
+ Ig = 1;
+ var e = mb().Options, t = Fp().Output, i = Mp().InputScanner, r = Lp().Directives, n = new r(/\/\*/, /\*\//), a = /\r\n|[\r\n]/, s = /\r\n|[\r\n]/g, u = /\s/, d = /(?:\s|\n)+/g, p = /\/\*(?:[\s\S]*?)((?:\*\/)|$)/g, h = /\/\/(?:[^\n\r\u2028\u2029]*)/g;
function g(_, S) {
this._source_text = _ || "", this._options = new e(S), this._ch = null, this._input = null, this.NESTED_AT_RULE = {
page: !0,
@@ -34718,14 +34720,14 @@ function f3() {
}
var C = this._output.get_code(S);
return C;
- }, Zf.Beautifier = g, Zf;
+ }, qf.Beautifier = g, qf;
}
-var Dg;
-function c3() {
- if (Dg)
+var Fg;
+function h3() {
+ if (Fg)
return Cs.exports;
- Dg = 1;
- var e = f3().Beautifier, t = pb().Options;
+ Fg = 1;
+ var e = p3().Beautifier, t = mb().Options;
function i(r, n) {
var a = new e(r, n);
return a.beautify();
@@ -34734,12 +34736,12 @@ function c3() {
return new t();
}, Cs.exports;
}
-var Ss = { exports: {} }, ec = {}, tc = {}, Ig;
-function hb() {
- if (Ig)
- return tc;
- Ig = 1;
- var e = Fp().Options;
+var Ss = { exports: {} }, tc = {}, nc = {}, Pg;
+function vb() {
+ if (Pg)
+ return nc;
+ Pg = 1;
+ var e = Pp().Options;
function t(i) {
e.call(this, i, "html"), this.templating.length === 1 && this.templating[0] === "auto" && (this.templating = ["django", "erb", "handlebars", "php"]), this.indent_inner_html = this._get_boolean("indent_inner_html"), this.indent_body_inner_html = this._get_boolean("indent_body_inner_html", !0), this.indent_head_inner_html = this._get_boolean("indent_head_inner_html", !0), this.indent_handlebars = this._get_boolean("indent_handlebars", !0), this.wrap_attributes = this._get_selection(
"wrap_attributes",
@@ -34828,14 +34830,14 @@ function hb() {
"textarea"
]), this.unformatted_content_delimiter = this._get_characters("unformatted_content_delimiter"), this.indent_scripts = this._get_selection("indent_scripts", ["normal", "keep", "separate"]);
}
- return t.prototype = new e(), tc.Options = t, tc;
+ return t.prototype = new e(), nc.Options = t, nc;
}
-var Es = {}, Fg;
-function Pg() {
- if (Fg)
+var Es = {}, Mg;
+function Lg() {
+ if (Mg)
return Es;
- Fg = 1;
- var e = tu().Tokenizer, t = tu().TOKEN, i = Mp().Directives, r = cb().TemplatablePattern, n = Cu().Pattern, a = {
+ Mg = 1;
+ var e = tu().Tokenizer, t = tu().TOKEN, i = Lp().Directives, r = hb().TemplatablePattern, n = Cu().Pattern, a = {
TAG_OPEN: "TK_TAG_OPEN",
TAG_CLOSE: "TK_TAG_CLOSE",
CONTROL_FLOW_OPEN: "TK_CONTROL_FLOW_OPEN",
@@ -34966,12 +34968,12 @@ function Pg() {
return this._options.unformatted_content_delimiter && d === this._options.unformatted_content_delimiter[0] && (h = this.__patterns.unformatted_content_delimiter.read()), h || (h = p && p.type === a.CONTROL_FLOW_OPEN ? this.__patterns.word_control_flow_close_excluded.read() : this.__patterns.word.read()), h ? this._create_token(a.TEXT, h) : null;
}, Es.Tokenizer = u, Es.TOKEN = a, Es;
}
-var Mg;
-function p3() {
- if (Mg)
- return ec;
- Mg = 1;
- var e = hb().Options, t = Ip().Output, i = Pg().Tokenizer, r = Pg().TOKEN, n = /\r\n|[\r\n]/, a = /\r\n|[\r\n]/g, s = function(y, m) {
+var Ng;
+function m3() {
+ if (Ng)
+ return tc;
+ Ng = 1;
+ var e = vb().Options, t = Fp().Output, i = Lg().Tokenizer, r = Lg().TOKEN, n = /\r\n|[\r\n]/, a = /\r\n|[\r\n]/g, s = function(y, m) {
this.indent_level = 0, this.alignment_size = 0, this.max_preserve_newlines = y.max_preserve_newlines, this.preserve_newlines = y.preserve_newlines, this._output = new t(y, m);
};
s.prototype.current_line_has_match = function(y) {
@@ -35195,14 +35197,14 @@ function p3() {
y.tag_name === "rp" || y.tag_name === "rt" ? (m = m || this._tag_stack.try_pop("rt", ["ruby", "rtc"]), m = m || this._tag_stack.try_pop("rp", ["ruby", "rtc"])) : y.tag_name === "optgroup" ? m = m || this._tag_stack.try_pop("optgroup", ["select"]) : y.tag_name === "option" ? m = m || this._tag_stack.try_pop("option", ["select", "datalist", "optgroup"]) : y.tag_name === "colgroup" ? m = m || this._tag_stack.try_pop("caption", ["table"]) : y.tag_name === "thead" ? (m = m || this._tag_stack.try_pop("caption", ["table"]), m = m || this._tag_stack.try_pop("colgroup", ["table"])) : y.tag_name === "tbody" || y.tag_name === "tfoot" ? (m = m || this._tag_stack.try_pop("caption", ["table"]), m = m || this._tag_stack.try_pop("colgroup", ["table"]), m = m || this._tag_stack.try_pop("thead", ["table"]), m = m || this._tag_stack.try_pop("tbody", ["table"])) : y.tag_name === "tr" ? (m = m || this._tag_stack.try_pop("caption", ["table"]), m = m || this._tag_stack.try_pop("colgroup", ["table"]), m = m || this._tag_stack.try_pop("tr", ["table", "thead", "tbody", "tfoot"])) : (y.tag_name === "th" || y.tag_name === "td") && (m = m || this._tag_stack.try_pop("td", ["table", "thead", "tbody", "tfoot", "tr"]), m = m || this._tag_stack.try_pop("th", ["table", "thead", "tbody", "tfoot", "tr"]));
return y.parent = this._tag_stack.get_parser_token(), m;
}
- }, ec.Beautifier = _, ec;
+ }, tc.Beautifier = _, tc;
}
-var Lg;
-function h3() {
- if (Lg)
+var Bg;
+function v3() {
+ if (Bg)
return Ss.exports;
- Lg = 1;
- var e = p3().Beautifier, t = hb().Options;
+ Bg = 1;
+ var e = m3().Beautifier, t = vb().Options;
function i(r, n, a, s) {
var u = new e(r, n, a, s);
return u.beautify();
@@ -35211,12 +35213,12 @@ function h3() {
return new t();
}, Ss.exports;
}
-var Ng;
-function m3() {
- if (Ng)
+var Vg;
+function g3() {
+ if (Vg)
return ja;
- Ng = 1;
- var e = d3(), t = c3(), i = h3();
+ Vg = 1;
+ var e = c3(), t = h3(), i = v3();
function r(n, a, s, u) {
return s = s || e, u = u || t, i(n, a, s, u);
}
@@ -35230,12 +35232,12 @@ function m3() {
return a.js = i.js_beautify, a.css = r.css_beautify, a.html = n.html_beautify, a.js_beautify = i.js_beautify, a.css_beautify = r.css_beautify, a.html_beautify = n.html_beautify, a;
}
(function(i) {
- var r = m3();
+ var r = g3();
r.js_beautify = r.js, r.css_beautify = r.css, r.html_beautify = r.html, i.exports = t(r, r, r);
})(e);
-})(sb);
-const Uo = sb.exports;
-function v3(e) {
+})(db);
+const jo = db.exports;
+function y3(e) {
const t = {};
return Object.values(e.import).forEach((i) => {
t[i.name] = i.path;
@@ -35255,7 +35257,7 @@ methods: ${ai(e.methods)}
});
`;
}
-function g3(e) {
+function b3(e) {
const t = {};
return Object.values(e.import).forEach((i) => {
t[i.name] = i.path;
@@ -35268,7 +35270,7 @@ ${Object.keys(e.methods).map((i) => ai(e.methods[i])).join(`
`)}
`;
}
-function Cc(e, t) {
+function Sc(e, t) {
const i = [];
return e && e.forEach((r) => {
if (!(r && r._menu && r._menu.sfc === !1))
@@ -35277,15 +35279,15 @@ function Cc(e, t) {
else if (r._fc_drag_tag) {
const n = {
...r,
- children: Cc(r.children),
+ children: Sc(r.children),
_sfc: {}
};
t && (n.slot = t), n.children.length ? typeof n.children[0] == "string" && (n._sfc.content = n.children[0], delete n.children) : delete n.children, i.push(n);
} else
- i.push(...Cc(r.children, ["DragBox", "DragTool"].indexOf(r.type) > -1 ? r.slot || t : ""));
+ i.push(...Sc(r.children, ["DragBox", "DragTool"].indexOf(r.type) > -1 ? r.slot || t : ""));
}), i;
}
-function y3(e, t, i, r) {
+function _3(e, t, i, r) {
const n = e[0] ? e[0].__fc__.vNode.aliasMap : void 0, a = {
style: {},
import: {},
@@ -35335,7 +35337,7 @@ function y3(e, t, i, r) {
a.data.formData[y.field] = k, w.vModel !== !1 && E.push(`v-model${w.modelField ? ":" + w.modelField : ""}="formData.${u()}${y.field}"`);
}
if (y.style) {
- const k = b3(y.style || "");
+ const k = w3(y.style || "");
k && E.push(`style="${k}"`);
}
w.attr && Object.keys(w.attr).forEach((k) => {
@@ -35365,7 +35367,7 @@ function y3(e, t, i, r) {
const R = x.native !== !1 && (x.field || x.title);
return k || (x._sfc && x._sfc.parentField && s.push(x.parentField), x._sfc && x._sfc.content ? w = `${x._sfc.content}` : x.children && (w = `
` + h(x.children) + `
-`), n && n[x.type] && (x.type = Dc(n[x.type])), k = d(x, w), x._sfc && x._sfc.parentField && s.pop()), R && ((M = x == null ? void 0 : x.wrap) == null ? void 0 : M.show) !== !1 && (k = d({
+`), n && n[x.type] && (x.type = Ic(n[x.type])), k = d(x, w), x._sfc && x._sfc.parentField && s.pop()), R && ((M = x == null ? void 0 : x.wrap) == null ? void 0 : M.show) !== !1 && (k = d({
type: "elFormItem",
props: {
labelWidth: x.title ? void 0 : "0px",
@@ -35382,7 +35384,7 @@ function y3(e, t, i, r) {
}).join(`
`) : "";
}
- e = Cc(e);
+ e = Sc(e);
const g = [];
t.submitBtn.show && g.push({
type: "elButton",
@@ -35430,16 +35432,16 @@ function y3(e, t, i, r) {
}
]);
t.formData && su(a.data.formData, t.formData);
- const S = Uo.html(_, {
+ const S = jo.html(_, {
indent_size: 2,
indent_char: " ",
indent_scripts: "separate",
jslint_happy: !1
- }), b = Uo.js(r ? v3(a) : g3(a), {
+ }), b = jo.js(r ? y3(a) : b3(a), {
indent_size: 2,
indent_char: " ",
indent_scripts: "separate"
- }), A = Uo.css(Object.values(a.style).join(`
+ }), A = jo.css(Object.values(a.style).join(`
`), {
indent_size: 2,
indent_char: " ",
@@ -35454,12 +35456,12 @@ ${A}
`;
}
-function b3(e) {
+function w3(e) {
return !e || typeof e == "string" ? e || "" : Object.keys(e).reduce((t, i) => (e[i] != null && e[i] !== "" && t.push(vl(i) + ":" + e[i] + ";"), t), []).join("");
}
-const _3 = Be({
+const A3 = Be({
name: "SubList",
- components: { fcDraggable: Yo, VNode: eb, ConfigItem: si },
+ components: { fcDraggable: Ko, VNode: nb, ConfigItem: si },
inject: ["designer"],
computed: {
t() {
@@ -35486,11 +35488,11 @@ const _3 = Be({
this.activeRule.children.splice(t, 0, i[0]), this.activeRule.key = rt();
}
}
-}), w3 = { class: "_fc-sublist" }, A3 = { class: "_fc-r-title" }, C3 = ["onClick"], S3 = ["onClick"];
-function E3(e, t, i, r, n, a) {
+}), C3 = { class: "_fc-sublist" }, S3 = { class: "_fc-r-title" }, E3 = ["onClick"], x3 = ["onClick"];
+function T3(e, t, i, r, n, a) {
const s = ee("VNode"), u = ee("ConfigItem"), d = ee("fcDraggable");
- return H(), ae("div", w3, [
- J("p", A3, [
+ return H(), ae("div", C3, [
+ J("p", S3, [
J("span", null, le(e.t("designer.sublist")), 1),
J("i", {
class: "fc-icon icon-add-circle",
@@ -35517,11 +35519,11 @@ function E3(e, t, i, r, n, a) {
J("i", {
class: "fc-icon icon-copy",
onClick: (g) => e.toolHandle(p, "copy")
- }, null, 8, C3),
+ }, null, 8, E3),
J("i", {
class: "fc-icon icon-delete",
onClick: (g) => e.toolHandle(p, "delete")
- }, null, 8, S3)
+ }, null, 8, x3)
]),
_: 2
}, [
@@ -35540,8 +35542,8 @@ function E3(e, t, i, r, n, a) {
}, 8, ["onEnd", "list"])
]);
}
-const x3 = /* @__PURE__ */ Ve(_3, [["render", E3]]);
-const T3 = Be({
+const k3 = /* @__PURE__ */ Ve(A3, [["render", T3]]);
+const O3 = Be({
name: "ToolsBar",
inject: ["designer"],
computed: {
@@ -35583,14 +35585,14 @@ const T3 = Be({
this.designer.setupState.clearActiveRule();
}
}
-}), k3 = {
+}), $3 = {
key: 0,
class: "_fc-r-tools-bar"
-}, O3 = { class: "_fc-r-tools" }, $3 = ["onClick"];
-function R3(e, t, i, r, n, a) {
+}, R3 = { class: "_fc-r-tools" }, D3 = ["onClick"];
+function I3(e, t, i, r, n, a) {
const s = ee("el-tooltip");
- return e.tools.length > 2 ? (H(), ae("div", k3, [
- J("div", O3, [
+ return e.tools.length > 2 ? (H(), ae("div", $3, [
+ J("div", R3, [
(H(!0), ae(Me, null, ze(e.tools, (u) => (H(), me(s, {
key: u.icon,
effect: "dark",
@@ -35607,7 +35609,7 @@ function R3(e, t, i, r, n, a) {
J("i", {
class: qe(["fc-icon", `icon-config-${u.icon}`])
}, null, 2)
- ], 8, $3)
+ ], 8, D3)
]),
_: 2
}, 1032, ["content"]))), 128)),
@@ -35620,20 +35622,20 @@ function R3(e, t, i, r, n, a) {
])
])) : Te("", !0);
}
-const D3 = /* @__PURE__ */ Ve(T3, [["render", R3]]);
-const I3 = Be({
+const F3 = /* @__PURE__ */ Ve(O3, [["render", I3]]);
+const P3 = Be({
name: "ConfigTitle"
-}), F3 = {
+}), M3 = {
ref: "cell",
class: "_fd-config-title"
};
-function P3(e, t, i, r, n, a) {
- return H(), ae("div", F3, [
+function L3(e, t, i, r, n, a) {
+ return H(), ae("div", M3, [
kt(e.$slots, "default")
], 512);
}
-const mb = /* @__PURE__ */ Ve(I3, [["render", P3]]);
-var M3 = {
+const gb = /* @__PURE__ */ Ve(P3, [["render", L3]]);
+var N3 = {
name: "zh-cn",
el: {
breadcrumb: {
@@ -35811,7 +35813,7 @@ var M3 = {
}
}
};
-const L3 = Be({
+const B3 = Be({
name: "TypeSelect",
inject: ["designer"],
computed: {
@@ -35863,11 +35865,11 @@ const L3 = Be({
});
}
}
-}), N3 = {
+}), V3 = {
key: 0,
class: "fc-icon icon-down"
};
-function B3(e, t, i, r, n, a) {
+function j3(e, t, i, r, n, a) {
const s = ee("el-tag"), u = ee("el-dropdown-item"), d = ee("el-dropdown-menu"), p = ee("el-dropdown");
return H(), me(p, {
class: "_fd-type-select",
@@ -35907,7 +35909,7 @@ function B3(e, t, i, r, n, a) {
default: N(() => [
e.activeRule ? (H(), ae(Me, { key: 0 }, [
be(le(e.t("com." + e.activeRule._menu.name + ".name") || e.activeRule._menu.label) + " ", 1),
- e.menus.length ? (H(), ae("i", N3)) : Te("", !0)
+ e.menus.length ? (H(), ae("i", V3)) : Te("", !0)
], 64)) : (H(), ae(Me, { key: 1 }, [
be(le(e.t("com." + e.customForm.config.name + ".name") || e.customForm.config.label || e.customForm.config.name), 1)
], 64))
@@ -35918,15 +35920,15 @@ function B3(e, t, i, r, n, a) {
_: 1
}, 8, ["disabled", "onCommand"]);
}
-const V3 = /* @__PURE__ */ Ve(L3, [["render", B3]]);
-const j3 = Be({
+const U3 = /* @__PURE__ */ Ve(B3, [["render", j3]]);
+const H3 = Be({
name: "FieldList",
inject: ["designer"],
props: {
field: Array
},
components: {
- fcDraggable: Yo
+ fcDraggable: Ko
},
methods: {
nodeClick(e) {
@@ -35936,17 +35938,17 @@ const j3 = Be({
}
}
}
-}), U3 = { class: "_fc-field-node" }, H3 = { class: "_fc-field-node-label" }, z3 = {
+}), z3 = { class: "_fc-field-node" }, W3 = { class: "_fc-field-node-label" }, G3 = {
key: 1,
class: "fc-icon icon-folder"
-}, W3 = {
+}, K3 = {
key: 1,
class: "_fc-field-node"
-}, G3 = { class: "_fc-field-node-label" }, K3 = {
+}, Y3 = { class: "_fc-field-node-label" }, Q3 = {
key: 1,
class: "fc-icon icon-folder"
};
-function Y3(e, t, i, r, n, a) {
+function J3(e, t, i, r, n, a) {
const s = ee("fcDraggable"), u = ee("el-tree");
return H(), me(u, {
ref: "treeRef",
@@ -35967,23 +35969,23 @@ function Y3(e, t, i, r, n, a) {
class: "_fc-field-drag"
}, {
item: N(() => [
- J("div", U3, [
- J("div", H3, [
+ J("div", z3, [
+ J("div", W3, [
d.isLeaf ? (H(), ae("i", {
key: 0,
class: qe(["fc-icon", p.icon || "icon-input"])
- }, null, 2)) : (H(), ae("i", z3)),
+ }, null, 2)) : (H(), ae("i", G3)),
J("span", null, le(p.label), 1)
])
])
]),
_: 2
- }, 1032, ["list"])) : (H(), ae("div", W3, [
- J("div", G3, [
+ }, 1032, ["list"])) : (H(), ae("div", K3, [
+ J("div", Y3, [
d.isLeaf ? (H(), ae("i", {
key: 0,
class: qe(["fc-icon", p.icon || "icon-input"])
- }, null, 2)) : (H(), ae("i", K3)),
+ }, null, 2)) : (H(), ae("i", Q3)),
J("span", null, le(p.label), 1)
])
]))
@@ -35991,13 +35993,13 @@ function Y3(e, t, i, r, n, a) {
_: 1
}, 8, ["data", "onNodeClick"]);
}
-const Q3 = /* @__PURE__ */ Ve(j3, [["render", Y3]]), J3 = ["props"], X3 = ["class", "style", "directives"], Z3 = ["on", "hook"], vb = (e, t = {}, i = {}) => {
- const r = [...J3, ...i.normal || []], n = [...X3, ...i.array || []], a = [...Z3, ...i.functional || []], s = i.props || [];
+const X3 = /* @__PURE__ */ Ve(H3, [["render", J3]]), Z3 = ["props"], q3 = ["class", "style", "directives"], eM = ["on", "hook"], yb = (e, t = {}, i = {}) => {
+ const r = [...Z3, ...i.normal || []], n = [...q3, ...i.array || []], a = [...eM, ...i.functional || []], s = i.props || [];
return e.reduce((u, d) => {
for (const p in d)
if (u[p])
if (s.indexOf(p) > -1)
- u[p] = vb([d[p]], u[p]);
+ u[p] = yb([d[p]], u[p]);
else if (r.indexOf(p) > -1)
u[p] = { ...u[p], ...d[p] };
else if (n.indexOf(p) > -1) {
@@ -36012,17 +36014,17 @@ const Q3 = /* @__PURE__ */ Ve(j3, [["render", Y3]]), J3 = ["props"], X3 = ["clas
u[p][h] = d[p][h];
else if (p === "hook")
for (let h in d[p])
- u[p][h] ? u[p][h] = q3(u[p][h], d[p][h]) : u[p][h] = d[p][h];
+ u[p][h] ? u[p][h] = tM(u[p][h], d[p][h]) : u[p][h] = d[p][h];
else
u[p] = d[p];
else
r.indexOf(p) > -1 || a.indexOf(p) > -1 || s.indexOf(p) > -1 ? u[p] = { ...d[p] } : n.indexOf(p) > -1 ? u[p] = d[p] instanceof Array ? [...d[p]] : typeof d[p] == "object" ? { ...d[p] } : d[p] : u[p] = d[p];
return u;
}, t);
-}, q3 = (e, t) => function() {
+}, tM = (e, t) => function() {
e && e.apply(this, arguments), t && t.apply(this, arguments);
};
-const eM = Be({
+const nM = Be({
name: "FormList",
inject: ["designer"],
props: {
@@ -36040,7 +36042,7 @@ const eM = Be({
this.designer.setupState.openInputData(!1), this.designer.setupState.pageData = [], this.designer.setupState.setOptions(e.options), this.designer.setupState.setRule(e.rule), this.designer.emit("switchForm", t);
},
starLoad() {
- this.loading || (this.load = sw.service({
+ this.loading || (this.load = dw.service({
target: document.getElementsByClassName("_fc-m-drag")[0],
lock: !0
}), this.loading = !0, this.timerId = setTimeout(() => {
@@ -36072,17 +36074,17 @@ const eM = Be({
this.loadConfig(t, e);
}
}
-}), tM = { class: "_fc-form-node" }, nM = { class: "_fc-form-node-label" }, iM = {
+}), iM = { class: "_fc-form-node" }, rM = { class: "_fc-form-node-label" }, oM = {
key: 0,
class: "fc-icon icon-form"
-}, rM = {
+}, aM = {
key: 1,
class: "fc-icon icon-folder"
-}, oM = {
+}, lM = {
key: 0,
class: "_fc-form-node-info"
-}, aM = ["onClick"];
-function lM(e, t, i, r, n, a) {
+}, sM = ["onClick"];
+function uM(e, t, i, r, n, a) {
const s = ee("el-tree");
return H(), me(s, {
ref: "treeRef",
@@ -36091,26 +36093,26 @@ function lM(e, t, i, r, n, a) {
indent: 5
}, {
default: N(({ node: u, data: d }) => [
- J("div", tM, [
- J("div", nM, [
- u.isLeaf ? (H(), ae("i", iM)) : (H(), ae("i", rM)),
+ J("div", iM, [
+ J("div", rM, [
+ u.isLeaf ? (H(), ae("i", oM)) : (H(), ae("i", aM)),
J("div", null, [
J("div", null, le(d.label), 1),
- d.info ? (H(), ae("span", oM, le(d.info), 1)) : Te("", !0)
+ d.info ? (H(), ae("span", lM, le(d.info), 1)) : Te("", !0)
])
]),
u.isLeaf && !d.disabled ? (H(), ae("i", {
key: 0,
class: "fc-icon icon-edit",
onClick: vt((p) => e.nodeClick(d), ["stop"])
- }, null, 8, aM)) : Te("", !0)
+ }, null, 8, sM)) : Te("", !0)
])
]),
_: 1
}, 8, ["data"]);
}
-const sM = /* @__PURE__ */ Ve(eM, [["render", lM]]);
-const uM = Be({
+const dM = /* @__PURE__ */ Ve(nM, [["render", uM]]);
+const fM = Be({
name: "GlobalEventConfig",
emits: ["update:modelValue"],
props: {
@@ -36194,13 +36196,13 @@ const uM = Be({
args: []
};
}
-}), dM = { class: "_fd-gec" }, fM = ["onClick"], cM = { class: "_fd-gec-method" }, pM = {
+}), cM = { class: "_fd-gec" }, pM = ["onClick"], hM = { class: "_fd-gec-method" }, mM = {
key: 0,
class: "_fd-label"
-}, hM = ["onClick"];
-function mM(e, t, i, r, n, a) {
+}, vM = ["onClick"];
+function gM(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-badge"), d = ee("Warning"), p = ee("el-header"), h = ee("el-menu-item"), g = ee("el-input"), _ = ee("el-menu"), S = ee("el-main"), b = ee("el-container"), A = ee("el-aside"), y = ee("FnEditor"), m = ee("el-dialog");
- return H(), ae("div", dM, [
+ return H(), ae("div", cM, [
z(u, {
value: e.eventNum,
type: "warning",
@@ -36300,16 +36302,16 @@ function mM(e, t, i, r, n, a) {
class: "_fd-gec-title",
onClick: vt((x) => e.active(E), ["stop"])
}, [
- J("div", cM, [
+ J("div", hM, [
J("span", null, le(E), 1),
- w.label ? (H(), ae("span", pM, le(w.label), 1)) : Te("", !0)
+ w.label ? (H(), ae("span", mM, le(w.label), 1)) : Te("", !0)
]),
w.deletable !== !1 ? (H(), ae("i", {
key: 0,
class: "fc-icon icon-delete",
onClick: vt((x) => e.rm(E), ["stop"])
- }, null, 8, hM)) : Te("", !0)
- ], 8, fM)
+ }, null, 8, vM)) : Te("", !0)
+ ], 8, pM)
]),
_: 2
}, 1032, ["class"]))), 256)),
@@ -36415,8 +36417,8 @@ function mM(e, t, i, r, n, a) {
}, 8, ["modelValue"])
]);
}
-const gb = /* @__PURE__ */ Ve(uM, [["render", mM]]);
-const vM = Be({
+const bb = /* @__PURE__ */ Ve(fM, [["render", gM]]);
+const yM = Be({
name: "StructEditor",
props: {
modelValue: [Object, Array, Function],
@@ -36469,7 +36471,7 @@ const vM = Be({
line: !0,
tabSize: 2,
lineWrapping: !0,
- value: e ? Uo.js(e, {
+ value: e ? jo.js(e, {
indent_size: "2",
indent_char: " ",
max_preserve_newlines: "5",
@@ -36493,14 +36495,14 @@ const vM = Be({
return this.validate && this.validate(t) === !1 ? (this.err = !0, !1) : (this.visible = !1, this.toJson(t) !== this.oldVal && this.$emit("update:modelValue", t), !0);
}
}
-}), gM = { class: "_fd-struct-editor" }, yM = { ref: "editor" };
-function bM(e, t, i, r, n, a) {
- return H(), ae("div", gM, [
- J("div", yM, null, 512)
+}), bM = { class: "_fd-struct-editor" }, _M = { ref: "editor" };
+function wM(e, t, i, r, n, a) {
+ return H(), ae("div", bM, [
+ J("div", _M, null, 512)
]);
}
-const Lp = /* @__PURE__ */ Ve(vM, [["render", bM]]);
-const _M = (e) => [
+const Np = /* @__PURE__ */ Ve(yM, [["render", wM]]);
+const AM = (e) => [
{
type: "input",
field: "action",
@@ -36573,7 +36575,7 @@ const _M = (e) => [
warning: e("warning.fetchData"),
value: {}
}
-], wM = Be({
+], CM = Be({
name: "GlobalFetchConfig",
emits: ["update:modelValue"],
props: {
@@ -36584,7 +36586,7 @@ const _M = (e) => [
VariableConfig: ml,
DragForm: tt.$form(),
FnEditor: sr,
- StructEditor: Lp
+ StructEditor: Np
},
inject: ["designer"],
data() {
@@ -36632,7 +36634,7 @@ const _M = (e) => [
active(e) {
if (this.activeIdx !== e) {
const t = this.list[e];
- this.form.rule = t.type === "static" ? [] : _M(this.t), this.form.formData = { ...t }, this.form.label = t.label, this.form.type = t.type, this.form.data = t.data, this.form.dataType = t.dataType, this.form.parse = t.parse || "", this.form.beforeFetch = t.beforeFetch || "", this.form.onError = t.onError || "", this.activeIdx = e;
+ this.form.rule = t.type === "static" ? [] : AM(this.t), this.form.formData = { ...t }, this.form.label = t.label, this.form.type = t.type, this.form.data = t.data, this.form.dataType = t.dataType, this.form.parse = t.parse || "", this.form.beforeFetch = t.beforeFetch || "", this.form.onError = t.onError || "", this.activeIdx = e;
}
},
addCus() {
@@ -36677,13 +36679,13 @@ const _M = (e) => [
this.$emit("update:modelValue", { ...this.list }), this.visible = !1;
}
}
-}), AM = { class: "_fd-gfc" }, CM = ["onClick"], SM = { class: "_fd-gfc-method" }, EM = {
+}), SM = { class: "_fd-gfc" }, EM = ["onClick"], xM = { class: "_fd-gfc-method" }, TM = {
key: 0,
class: "_fd-label"
-}, xM = ["onClick"], TM = { class: "_fd-gfc-info" };
-function kM(e, t, i, r, n, a) {
+}, kM = ["onClick"], OM = { class: "_fd-gfc-info" };
+function $M(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-badge"), d = ee("Warning"), p = ee("el-dropdown-item"), h = ee("el-dropdown-menu"), g = ee("el-dropdown"), _ = ee("el-header"), S = ee("el-menu-item"), b = ee("el-input"), A = ee("el-menu"), y = ee("el-main"), m = ee("el-container"), w = ee("el-aside"), E = ee("DragForm"), x = ee("el-tab-pane"), k = ee("FnEditor"), R = ee("el-tabs"), M = ee("StructEditor"), P = ee("el-dialog");
- return H(), ae("div", AM, [
+ return H(), ae("div", SM, [
z(u, {
value: e.dataNum,
type: "warning",
@@ -36810,16 +36812,16 @@ function kM(e, t, i, r, n, a) {
class: "_fd-gfc-title",
onClick: vt((D) => e.active(T), ["stop"])
}, [
- J("div", SM, [
+ J("div", xM, [
J("span", null, le(T), 1),
- B.label ? (H(), ae("span", EM, le(B.label), 1)) : Te("", !0)
+ B.label ? (H(), ae("span", TM, le(B.label), 1)) : Te("", !0)
]),
B.deletable !== !1 ? (H(), ae("i", {
key: 0,
class: "fc-icon icon-delete",
onClick: vt((D) => e.rm(T), ["stop"])
- }, null, 8, xM)) : Te("", !0)
- ], 8, CM)
+ }, null, 8, kM)) : Te("", !0)
+ ], 8, EM)
]),
_: 2
}, 1032, ["class"]))), 256)),
@@ -36914,7 +36916,7 @@ function kM(e, t, i, r, n, a) {
style: { "padding-right": "15px" }
}, {
default: N(() => [
- J("div", TM, le(e.t("fetch.info")), 1),
+ J("div", OM, le(e.t("fetch.info")), 1),
z(E, {
api: e.form.api,
"onUpdate:api": t[4] || (t[4] = (B) => e.form.api = B),
@@ -37028,8 +37030,8 @@ function kM(e, t, i, r, n, a) {
}, 8, ["modelValue"])
]);
}
-const yb = /* @__PURE__ */ Ve(wM, [["render", kM]]);
-const OM = Be({
+const _b = /* @__PURE__ */ Ve(CM, [["render", $M]]);
+const RM = Be({
name: "SizeInput",
inject: ["designer"],
emits: ["update:modelValue", "change"],
@@ -37079,10 +37081,10 @@ const OM = Be({
created() {
this.parseValue();
}
-}), $M = { class: "_fd-size-input" };
-function RM(e, t, i, r, n, a) {
+}), DM = { class: "_fd-size-input" };
+function IM(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-inputNumber"), d = ee("el-dropdown-item"), p = ee("el-dropdown-menu"), h = ee("el-dropdown");
- return H(), ae("div", $M, [
+ return H(), ae("div", DM, [
e.unit[e.idx] === "auto" ? (H(), me(s, {
key: 0,
size: e.size,
@@ -37134,8 +37136,8 @@ function RM(e, t, i, r, n, a) {
], 64))
]);
}
-const ea = /* @__PURE__ */ Ve(OM, [["render", RM]]);
-const DM = Be({
+const ea = /* @__PURE__ */ Ve(RM, [["render", IM]]);
+const FM = Be({
name: "BoxSizeInput",
components: { SizeInput: ea, ConfigItem: si },
props: {
@@ -37216,13 +37218,13 @@ const DM = Be({
created() {
this.tidyValue();
}
-}), IM = { class: "_fd-box-size-input" }, FM = {
+}), PM = { class: "_fd-box-size-input" }, MM = {
key: 0,
style: { "font-size": "12px", "line-height": "16px" }
};
-function PM(e, t, i, r, n, a) {
+function LM(e, t, i, r, n, a) {
const s = ee("SizeInput"), u = ee("el-form-item"), d = ee("el-radio-button"), p = ee("el-tooltip"), h = ee("el-radio-group"), g = ee("el-form"), _ = ee("ConfigItem");
- return H(), ae("div", IM, [
+ return H(), ae("div", PM, [
z(_, {
label: e.t("props.size"),
info: Object.keys(e.modelValue).length > 0 ? e.t("struct.configured") : ""
@@ -37270,7 +37272,7 @@ function PM(e, t, i, r, n, a) {
onClick: (b) => e.changeOverflow(S.value)
}, {
default: N(() => [
- S.text ? (H(), ae("span", FM, "Auto ")) : (H(), ae("i", {
+ S.text ? (H(), ae("span", MM, "Auto ")) : (H(), ae("i", {
key: 1,
class: qe(["fc-icon", S.icon])
}, null, 2))
@@ -37294,8 +37296,8 @@ function PM(e, t, i, r, n, a) {
}, 8, ["label", "info"])
]);
}
-const MM = /* @__PURE__ */ Ve(DM, [["render", PM]]);
-const LM = Be({
+const NM = /* @__PURE__ */ Ve(FM, [["render", LM]]);
+const BM = Be({
name: "ColorInput",
inject: ["designer"],
emits: ["update:modelValue", "change"],
@@ -37348,10 +37350,10 @@ const LM = Be({
methods: {},
created() {
}
-}), NM = { class: "_fd-color-input" };
-function BM(e, t, i, r, n, a) {
+}), VM = { class: "_fd-color-input" };
+function jM(e, t, i, r, n, a) {
const s = ee("el-color-picker"), u = ee("el-input");
- return H(), ae("div", NM, [
+ return H(), ae("div", VM, [
z(u, {
clearable: "",
modelValue: e.value,
@@ -37370,8 +37372,8 @@ function BM(e, t, i, r, n, a) {
}, 8, ["modelValue"])
]);
}
-const ta = /* @__PURE__ */ Ve(LM, [["render", BM]]);
-const VM = Be({
+const ta = /* @__PURE__ */ Ve(BM, [["render", jM]]);
+const UM = Be({
name: "BorderInput",
components: { ColorInput: ta, SizeInput: ea, ConfigItem: si },
inject: ["designer"],
@@ -37440,22 +37442,22 @@ const VM = Be({
created() {
this.tidyValue(), this.initCur();
}
-}), jM = { class: "_fd-border-input" }, UM = { class: "_fd-bi-left" }, HM = { class: "_fd-bil-row" }, zM = { class: "_fd-bil-row" }, WM = { class: "_fd-bil-row" }, GM = { class: "_fd-bi-right" }, KM = { class: "_fd-bi-opt" };
-function YM(e, t, i, r, n, a) {
+}), HM = { class: "_fd-border-input" }, zM = { class: "_fd-bi-left" }, WM = { class: "_fd-bil-row" }, GM = { class: "_fd-bil-row" }, KM = { class: "_fd-bil-row" }, YM = { class: "_fd-bi-right" }, QM = { class: "_fd-bi-opt" };
+function JM(e, t, i, r, n, a) {
const s = ee("el-option"), u = ee("el-select"), d = ee("SizeInput"), p = ee("ColorInput"), h = ee("ConfigItem");
return H(), me(h, {
label: e.t("style.border")
}, {
append: N(() => [
- J("div", jM, [
- J("div", UM, [
- J("div", HM, [
+ J("div", HM, [
+ J("div", zM, [
+ J("div", WM, [
J("div", {
class: qe(["_fd-bil-col", e.active === "Top" ? "active" : ""]),
onClick: t[0] || (t[0] = (g) => e.active = "Top")
}, "\u2533 ", 2)
]),
- J("div", zM, [
+ J("div", GM, [
J("div", {
class: qe(["_fd-bil-col", e.active === "Left" ? "active" : ""]),
onClick: t[1] || (t[1] = (g) => e.active = "Left")
@@ -37469,14 +37471,14 @@ function YM(e, t, i, r, n, a) {
onClick: t[3] || (t[3] = (g) => e.active = "Right")
}, " \u252B ", 2)
]),
- J("div", WM, [
+ J("div", KM, [
J("div", {
class: qe(["_fd-bil-col", e.active === "Bottom" ? "active" : ""]),
onClick: t[4] || (t[4] = (g) => e.active = "Bottom")
}, "\u253B ", 2)
])
]),
- J("div", GM, [
+ J("div", YM, [
z(u, {
modelValue: e.curStyle,
"onUpdate:modelValue": t[5] || (t[5] = (g) => e.curStyle = g),
@@ -37489,7 +37491,7 @@ function YM(e, t, i, r, n, a) {
value: g.value
}, {
default: N(() => [
- J("div", KM, [
+ J("div", QM, [
J("div", {
class: qe(["_line", g.value])
}, null, 2)
@@ -37522,8 +37524,8 @@ function YM(e, t, i, r, n, a) {
_: 1
}, 8, ["label"]);
}
-const QM = /* @__PURE__ */ Ve(VM, [["render", YM]]);
-const JM = Be({
+const XM = /* @__PURE__ */ Ve(UM, [["render", JM]]);
+const ZM = Be({
name: "RadiusInput",
components: { ConfigItem: si, ColorInput: ta, SizeInput: ea },
inject: ["designer"],
@@ -37584,16 +37586,16 @@ const JM = Be({
created() {
this.tidyValue();
}
-}), XM = { class: "_fd-radius-input" }, ZM = { class: "_fd-radius-con" }, qM = { class: "_fd-radius-item" }, eL = { class: "_fd-radius-item" }, tL = { class: "_fd-radius-item" }, nL = { class: "_fd-radius-item" };
-function iL(e, t, i, r, n, a) {
+}), qM = { class: "_fd-radius-input" }, eL = { class: "_fd-radius-con" }, tL = { class: "_fd-radius-item" }, nL = { class: "_fd-radius-item" }, iL = { class: "_fd-radius-item" }, rL = { class: "_fd-radius-item" };
+function oL(e, t, i, r, n, a) {
const s = ee("SizeInput"), u = ee("ConfigItem");
- return H(), ae("div", XM, [
+ return H(), ae("div", qM, [
z(u, {
label: e.t("style.borderRadius")
}, {
append: N(() => [
- J("div", ZM, [
- J("div", qM, [
+ J("div", eL, [
+ J("div", tL, [
t[5] || (t[5] = J("div", {
class: "_fd-radius-icon",
style: { transform: "rotate(180deg)" }
@@ -37607,7 +37609,7 @@ function iL(e, t, i, r, n, a) {
onChange: e.onInput
}, null, 8, ["unit", "modelValue", "onChange"])
]),
- J("div", eL, [
+ J("div", nL, [
t[6] || (t[6] = J("div", {
class: "_fd-radius-icon",
style: { transform: "rotate(-90deg)" }
@@ -37621,7 +37623,7 @@ function iL(e, t, i, r, n, a) {
onChange: e.onInput
}, null, 8, ["unit", "modelValue", "onChange"])
]),
- J("div", tL, [
+ J("div", iL, [
t[7] || (t[7] = J("div", {
class: "_fd-radius-icon",
style: { transform: "rotate(90deg)" }
@@ -37635,7 +37637,7 @@ function iL(e, t, i, r, n, a) {
onChange: e.onInput
}, null, 8, ["unit", "modelValue", "onChange"])
]),
- J("div", nL, [
+ J("div", rL, [
t[8] || (t[8] = J("div", { class: "_fd-radius-icon" }, [
J("i", { class: "fc-icon icon-radius" })
], -1)),
@@ -37660,8 +37662,8 @@ function iL(e, t, i, r, n, a) {
}, 8, ["label"])
]);
}
-const rL = /* @__PURE__ */ Ve(JM, [["render", iL]]);
-const oL = Be({
+const aL = /* @__PURE__ */ Ve(ZM, [["render", oL]]);
+const lL = Be({
name: "BorderInput",
components: { ColorInput: ta, SizeInput: ea, ConfigItem: si },
inject: ["designer"],
@@ -37722,14 +37724,14 @@ const oL = Be({
created() {
this.tidyValue();
}
-}), aL = { class: "_fd-font-input" };
-function lL(e, t, i, r, n, a) {
+}), sL = { class: "_fd-font-input" };
+function uL(e, t, i, r, n, a) {
const s = ee("SizeInput"), u = ee("el-form-item"), d = ee("el-option"), p = ee("el-select"), h = ee("el-form"), g = ee("ConfigItem");
return H(), me(g, {
label: e.t("style.font.name")
}, {
append: N(() => [
- J("div", aL, [
+ J("div", sL, [
z(h, {
"label-width": "50px",
"label-position": "top",
@@ -37867,8 +37869,8 @@ function lL(e, t, i, r, n, a) {
_: 1
}, 8, ["label"]);
}
-const sL = /* @__PURE__ */ Ve(oL, [["render", lL]]);
-const uL = Be({
+const dL = /* @__PURE__ */ Ve(lL, [["render", uL]]);
+const fL = Be({
name: "DisplayInput",
components: { ConfigItem: si },
inject: ["designer"],
@@ -37979,10 +37981,10 @@ const uL = Be({
created() {
this.tidyValue();
}
-}), dL = { class: "_fd-display-input" }, fL = { class: "_fd-display-raw" }, cL = { class: "_label" };
-function pL(e, t, i, r, n, a) {
+}), cL = { class: "_fd-display-input" }, pL = { class: "_fd-display-raw" }, hL = { class: "_label" };
+function mL(e, t, i, r, n, a) {
const s = ee("el-radio-button"), u = ee("el-tooltip"), d = ee("el-radio-group"), p = ee("ConfigItem");
- return H(), ae("div", dL, [
+ return H(), ae("div", cL, [
z(p, {
label: e.t("style.display.name"),
arrow: !1,
@@ -37992,8 +37994,8 @@ function pL(e, t, i, r, n, a) {
J("div", {
class: qe(["_fd-display-con", [e.style.flexDirection, ["column", "column-reverse"].indexOf(e.style.flexDirection) > -1 ? "rotate-flag" : ""]])
}, [
- (H(!0), ae(Me, null, ze(e.options, (h) => (H(), ae("div", fL, [
- J("div", cL, le(e.t("style." + h.key + ".name")) + ": ", 1),
+ (H(!0), ae(Me, null, ze(e.options, (h) => (H(), ae("div", pL, [
+ J("div", hL, le(e.t("style." + h.key + ".name")) + ": ", 1),
z(d, {
"model-value": e.style[h.key],
size: "small"
@@ -38072,8 +38074,8 @@ function pL(e, t, i, r, n, a) {
}, 8, ["label", "showAppend"])
]);
}
-const hL = /* @__PURE__ */ Ve(uL, [["render", pL]]);
-const mL = Be({
+const vL = /* @__PURE__ */ Ve(fL, [["render", mL]]);
+const gL = Be({
name: "ShadowContent",
components: { ColorInput: ta },
inject: ["designer"],
@@ -38166,10 +38168,10 @@ const mL = Be({
mounted() {
this.initStyle(this.modelValue);
}
-}), vL = { class: "_fd-shadow-content" }, gL = { class: "_fd-sc-right" };
-function yL(e, t, i, r, n, a) {
+}), yL = { class: "_fd-shadow-content" }, bL = { class: "_fd-sc-right" };
+function _L(e, t, i, r, n, a) {
const s = ee("el-radio-button"), u = ee("el-tooltip"), d = ee("el-radio-group"), p = ee("el-form-item"), h = ee("ColorInput"), g = ee("el-option"), _ = ee("el-select"), S = ee("el-input"), b = ee("el-form");
- return H(), ae("div", vL, [
+ return H(), ae("div", yL, [
z(b, {
"label-width": "50px",
"label-position": "top",
@@ -38358,7 +38360,7 @@ function yL(e, t, i, r, n, a) {
]),
_: 1
}),
- J("div", gL, [
+ J("div", bL, [
J("div", {
ref: "box",
class: qe(["_fd-sc-box", e.down ? "down" : ""]),
@@ -38380,11 +38382,11 @@ function yL(e, t, i, r, n, a) {
])
]);
}
-const bL = /* @__PURE__ */ Ve(mL, [["render", yL]]);
-const _L = Be({
+const wL = /* @__PURE__ */ Ve(gL, [["render", _L]]);
+const AL = Be({
name: "ShadowInput",
emits: ["update:modelValue", "change"],
- components: { ConfigItem: si, ShadowContent: bL },
+ components: { ConfigItem: si, ShadowContent: wL },
inject: ["designer"],
props: {
modelValue: String
@@ -38416,10 +38418,10 @@ const _L = Be({
},
created() {
}
-}), wL = { class: "_fd-shadow-input" };
-function AL(e, t, i, r, n, a) {
+}), CL = { class: "_fd-shadow-input" };
+function SL(e, t, i, r, n, a) {
const s = ee("el-dropdown-item"), u = ee("el-dropdown-menu"), d = ee("el-dropdown"), p = ee("el-input"), h = ee("ShadowContent"), g = ee("ConfigItem");
- return H(), ae("div", wL, [
+ return H(), ae("div", CL, [
z(g, {
label: e.t("style.shadow.name")
}, {
@@ -38466,8 +38468,8 @@ function AL(e, t, i, r, n, a) {
}, 8, ["label"])
]);
}
-const CL = /* @__PURE__ */ Ve(_L, [["render", AL]]);
-const SL = Be({
+const EL = /* @__PURE__ */ Ve(AL, [["render", SL]]);
+const xL = Be({
name: "TableOptions",
components: { ValueInput: wu },
emits: ["update:modelValue", "change"],
@@ -38525,7 +38527,7 @@ const SL = Be({
},
tidyModelValue() {
const e = this.modelValue;
- return this.valueType === "string" ? (e || []).map((t) => ({ value: "" + t })) : this.valueType === "object" ? Object.keys(e || {}).map((t) => ({ label: t, value: e[t] })) : [...e || []].map((t) => p2(t));
+ return this.valueType === "string" ? (e || []).map((t) => ({ value: "" + t })) : this.valueType === "object" ? Object.keys(e || {}).map((t) => ({ label: t, value: e[t] })) : [...e || []].map((t) => m2(t));
},
tidyValue() {
if (this.valueType === "object") {
@@ -38560,10 +38562,10 @@ const SL = Be({
this.value.splice(e, 1), this.input();
}
}
-}), EL = { class: "_td-table-opt" }, xL = ["onClick"], TL = { class: "_td-table-opt-handle" };
-function kL(e, t, i, r, n, a) {
+}), TL = { class: "_td-table-opt" }, kL = ["onClick"], OL = { class: "_td-table-opt-handle" };
+function $L(e, t, i, r, n, a) {
const s = ee("ValueInput"), u = ee("el-input"), d = ee("el-table-column"), p = ee("el-table"), h = ee("el-button"), g = ee("el-checkbox");
- return H(), ae("div", EL, [
+ return H(), ae("div", TL, [
(H(), me(p, {
data: e.value,
key: e.checked ? "2" : "1",
@@ -38603,14 +38605,14 @@ function kL(e, t, i, r, n, a) {
J("i", {
class: "fc-icon icon-delete",
onClick: (S) => e.del(_.$index)
- }, null, 8, xL)
+ }, null, 8, kL)
]),
_: 1
})
]),
_: 1
}, 8, ["data", "size"])),
- J("div", TL, [
+ J("div", OL, [
!e.max || e.max > e.value.length ? (H(), me(h, {
key: 0,
link: "",
@@ -38632,8 +38634,8 @@ function kL(e, t, i, r, n, a) {
])
]);
}
-const bb = /* @__PURE__ */ Ve(SL, [["render", kL]]);
-const OL = Be({
+const wb = /* @__PURE__ */ Ve(xL, [["render", $L]]);
+const RL = Be({
name: "BoxSpaceInput",
components: { ConfigItem: si },
props: {
@@ -38716,11 +38718,11 @@ const OL = Be({
created() {
this.tidyValue();
}
-}), $L = { class: "_fd-box-space-input" }, RL = { class: "_padding" }, DL = { class: "_padding-title" }, IL = ["value"], FL = ["value"], PL = ["value"], ML = ["value"], LL = { class: "_fd-help" }, NL = { class: "_margin" }, BL = { class: "_margin-title" }, VL = { class: "_fd-help" }, jL = ["value"], UL = ["value"], HL = ["value"], zL = ["value"];
-function WL(e, t, i, r, n, a) {
- return H(), ae("div", $L, [
- J("div", RL, [
- J("span", DL, le(e.t("style.margin")), 1),
+}), DL = { class: "_fd-box-space-input" }, IL = { class: "_padding" }, FL = { class: "_padding-title" }, PL = ["value"], ML = ["value"], LL = ["value"], NL = ["value"], BL = { class: "_fd-help" }, VL = { class: "_margin" }, jL = { class: "_margin-title" }, UL = { class: "_fd-help" }, HL = ["value"], zL = ["value"], WL = ["value"], GL = ["value"];
+function KL(e, t, i, r, n, a) {
+ return H(), ae("div", DL, [
+ J("div", IL, [
+ J("span", FL, le(e.t("style.margin")), 1),
J("input", {
class: "_fd-input _fd-top",
placeholder: " ",
@@ -38728,7 +38730,7 @@ function WL(e, t, i, r, n, a) {
type: "text",
onBlur: t[0] || (t[0] = (s) => e.setValue("margin", "Top", s)),
onInput: t[1] || (t[1] = (s) => e.change("marginTop", s))
- }, null, 40, IL),
+ }, null, 40, PL),
J("input", {
class: "_fd-input _fd-right",
placeholder: " ",
@@ -38736,7 +38738,7 @@ function WL(e, t, i, r, n, a) {
type: "text",
onBlur: t[2] || (t[2] = (s) => e.setValue("margin", "Right", s)),
onInput: t[3] || (t[3] = (s) => e.change("marginRight", s))
- }, null, 40, FL),
+ }, null, 40, ML),
J("input", {
class: "_fd-input _fd-bottom",
placeholder: " ",
@@ -38744,7 +38746,7 @@ function WL(e, t, i, r, n, a) {
type: "text",
onBlur: t[4] || (t[4] = (s) => e.setValue("margin", "Bottom", s)),
onInput: t[5] || (t[5] = (s) => e.change("marginBottom", s))
- }, null, 40, PL),
+ }, null, 40, LL),
J("input", {
class: "_fd-input _fd-left",
placeholder: " ",
@@ -38752,8 +38754,8 @@ function WL(e, t, i, r, n, a) {
type: "text",
onBlur: t[6] || (t[6] = (s) => e.setValue("margin", "Left", s)),
onInput: t[7] || (t[7] = (s) => e.change("marginLeft", s))
- }, null, 40, ML),
- J("div", LL, [
+ }, null, 40, NL),
+ J("div", BL, [
J("i", {
class: qe(["fc-icon icon-link2", e.marginLock ? "active" : ""]),
title: "lock",
@@ -38765,9 +38767,9 @@ function WL(e, t, i, r, n, a) {
onClick: t[9] || (t[9] = (s) => e.clear("margin"))
})
]),
- J("div", NL, [
- J("span", BL, le(e.t("style.padding")), 1),
- J("div", VL, [
+ J("div", VL, [
+ J("span", jL, le(e.t("style.padding")), 1),
+ J("div", UL, [
J("i", {
class: qe(["fc-icon icon-link2", e.paddingLock ? "active" : ""]),
title: "lock",
@@ -38786,7 +38788,7 @@ function WL(e, t, i, r, n, a) {
type: "text",
onBlur: t[12] || (t[12] = (s) => e.setValue("padding", "Top", s)),
onInput: t[13] || (t[13] = (s) => e.change("paddingTop", s))
- }, null, 40, jL),
+ }, null, 40, HL),
J("input", {
class: "_fd-input _fd-right",
placeholder: " ",
@@ -38794,7 +38796,7 @@ function WL(e, t, i, r, n, a) {
type: "text",
onBlur: t[14] || (t[14] = (s) => e.setValue("padding", "Right", s)),
onInput: t[15] || (t[15] = (s) => e.change("paddingRight", s))
- }, null, 40, UL),
+ }, null, 40, zL),
J("input", {
class: "_fd-input _fd-bottom",
placeholder: " ",
@@ -38802,7 +38804,7 @@ function WL(e, t, i, r, n, a) {
type: "text",
onBlur: t[16] || (t[16] = (s) => e.setValue("padding", "Bottom", s)),
onInput: t[17] || (t[17] = (s) => e.change("paddingBottom", s))
- }, null, 40, HL),
+ }, null, 40, WL),
J("input", {
class: "_fd-input _fd-left",
placeholder: " ",
@@ -38810,21 +38812,21 @@ function WL(e, t, i, r, n, a) {
type: "text",
onBlur: t[18] || (t[18] = (s) => e.setValue("padding", "Left", s)),
onInput: t[19] || (t[19] = (s) => e.change("paddingLeft", s))
- }, null, 40, zL),
+ }, null, 40, GL),
t[20] || (t[20] = J("div", { class: "_box" }, null, -1))
])
])
]);
}
-const GL = /* @__PURE__ */ Ve(OL, [["render", WL]]);
-const _b = [
+const YL = /* @__PURE__ */ Ve(RL, [["render", KL]]);
+const Ab = [
"display",
"flexDirection",
"flexWrap",
"alignContent",
"justifyContent",
"alignItems"
-], wb = [
+], Cb = [
"fontSize",
"fontWeight",
"fontStyle",
@@ -38832,7 +38834,7 @@ const _b = [
"textAlign",
"lineHeight",
"letterSpacing"
-], Ab = [
+], Sb = [
"height",
"width",
"minWidth",
@@ -38840,7 +38842,7 @@ const _b = [
"maxWidth",
"maxHeight",
"overflow"
-], Bg = [
+], jg = [
"color",
"backgroundColor",
"scale",
@@ -38872,24 +38874,24 @@ const _b = [
"borderRightStyle",
"borderRightColor",
"borderRightWidth",
- ..._b,
- ...wb,
- ...Ab
-], KL = Be({
+ ...Ab,
+ ...Cb,
+ ...Sb
+], QL = Be({
name: "StyleConfig",
inject: ["designer"],
emits: ["update:modelValue"],
components: {
- BoxSpaceInput: GL,
- TableOptions: bb,
+ BoxSpaceInput: YL,
+ TableOptions: wb,
ColorInput: ta,
ConfigItem: si,
- DisplayInput: hL,
- RadiusInput: rL,
- BoxSizeInput: MM,
- BorderInput: QM,
- ShadowInput: CL,
- FontInput: sL
+ DisplayInput: vL,
+ RadiusInput: aL,
+ BoxSizeInput: NM,
+ BorderInput: XM,
+ ShadowInput: EL,
+ FontInput: dL
},
props: {
modelValue: {
@@ -38926,11 +38928,11 @@ const _b = [
tidyStyle() {
const e = { ...this.modelValue || {} }, t = {};
Object.keys(e).forEach((d) => {
- const p = Dc(d);
+ const p = Ic(d);
(["margin", "padding"].indexOf(d) > -1 || d.indexOf("margin") > -1 || d.indexOf("padding") > -1) && (t[p] = e[d]);
});
const i = {};
- Ab.forEach((d) => {
+ Sb.forEach((d) => {
e[d] && (i[d] = e[d]);
}), this.radius = e.borderRadius || "", delete e.borderRadius;
const r = {};
@@ -38942,19 +38944,19 @@ const _b = [
let a = e.scale;
ji(e.scale) ? a = 100 : isNaN(Number(a)) ? a = parseFloat(a) || 100 : a = a > 0 ? a * 100 : 0;
const s = {};
- _b.forEach((d) => {
+ Ab.forEach((d) => {
e[d] && (s[d] = e[d]);
});
const u = {};
- wb.forEach((d) => {
+ Cb.forEach((d) => {
e[d] && (u[d] = e[d]);
- }), this.opacity = n, this.scale = a, this.size = i, this.space = t, this.border = r, this.display = s, this.font = u, this.boxShadow = e.boxShadow || "", this.color = e.color || "", this.backgroundColor = e.backgroundColor || "", Bg.forEach((d) => {
+ }), this.opacity = n, this.scale = a, this.size = i, this.space = t, this.border = r, this.display = s, this.font = u, this.boxShadow = e.boxShadow || "", this.color = e.color || "", this.backgroundColor = e.backgroundColor || "", jg.forEach((d) => {
delete e[d];
}), this.formData = e;
},
onInput() {
let e = { ...this.formData }, t = {};
- Bg.forEach((r) => {
+ jg.forEach((r) => {
if (e[r])
t[r] = e[r], delete e[r];
else {
@@ -38985,10 +38987,10 @@ const _b = [
created() {
this.tidyStyle();
}
-}), YL = { class: "_fd-style-config" };
-function QL(e, t, i, r, n, a) {
+}), JL = { class: "_fd-style-config" };
+function XL(e, t, i, r, n, a) {
const s = ee("BoxSpaceInput"), u = ee("BoxSizeInput"), d = ee("DisplayInput"), p = ee("ColorInput"), h = ee("ConfigItem"), g = ee("BorderInput"), _ = ee("RadiusInput"), S = ee("FontInput"), b = ee("ShadowInput"), A = ee("el-slider"), y = ee("TableOptions");
- return H(), ae("div", YL, [
+ return H(), ae("div", JL, [
z(s, {
modelValue: e.space,
"onUpdate:modelValue": t[0] || (t[0] = (m) => e.space = m),
@@ -39099,10 +39101,10 @@ function QL(e, t, i, r, n, a) {
}, 8, ["label", "info"])
]);
}
-const Cb = /* @__PURE__ */ Ve(KL, [["render", QL]]);
+const Eb = /* @__PURE__ */ Ve(QL, [["render", XL]]);
(function(e, t) {
(function(i) {
- i(to.exports);
+ i(qo());
})(function(i) {
i.defineMode("css", function(T, D) {
var V = D.inline;
@@ -40668,7 +40670,7 @@ const Cb = /* @__PURE__ */ Ve(KL, [["render", QL]]);
});
});
})();
-const JL = Be({
+const ZL = Be({
name: "StyleEditor",
props: {
modelValue: String
@@ -40695,7 +40697,7 @@ const JL = Be({
line: !0,
tabSize: 2,
lineWrapping: !0,
- value: e ? Uo.css(e, {
+ value: e ? jo.css(e, {
indent_size: 2,
indent_char: " ",
indent_scripts: "separate"
@@ -40708,14 +40710,14 @@ const JL = Be({
return e !== this.oldVal && this.$emit("update:modelValue", e), !0;
}
}
-}), XL = { class: "_fd-style-editor" }, ZL = { ref: "editor" };
-function qL(e, t, i, r, n, a) {
- return H(), ae("div", XL, [
- J("div", ZL, null, 512)
+}), qL = { class: "_fd-style-editor" }, eN = { ref: "editor" };
+function tN(e, t, i, r, n, a) {
+ return H(), ae("div", qL, [
+ J("div", eN, null, 512)
]);
}
-const eN = /* @__PURE__ */ Ve(JL, [["render", qL]]);
-const tN = Be({
+const nN = /* @__PURE__ */ Ve(ZL, [["render", tN]]);
+const iN = Be({
name: "GlobalClassConfig",
emits: ["update:modelValue"],
props: {
@@ -40723,8 +40725,8 @@ const tN = Be({
},
components: {
Warning: ki,
- StyleEditor: eN,
- StyleConfig: Cb
+ StyleEditor: nN,
+ StyleConfig: Eb
},
inject: ["designer"],
data() {
@@ -40820,13 +40822,13 @@ const tN = Be({
unmounted() {
document.head.removeChild(this.styleEl);
}
-}), nN = { class: "_fd-gcc" }, iN = { class: "_fd-gcc-method" }, rN = { class: "_fd-label" }, oN = ["onClick"], aN = { class: "_fd-gcc-method" }, lN = {
+}), rN = { class: "_fd-gcc" }, oN = { class: "_fd-gcc-method" }, aN = { class: "_fd-label" }, lN = ["onClick"], sN = { class: "_fd-gcc-method" }, uN = {
key: 0,
class: "_fd-label"
-}, sN = ["onClick"];
-function uN(e, t, i, r, n, a) {
+}, dN = ["onClick"];
+function fN(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-badge"), d = ee("Warning"), p = ee("el-header"), h = ee("el-menu-item"), g = ee("el-input"), _ = ee("el-menu"), S = ee("el-main"), b = ee("el-container"), A = ee("el-aside"), y = ee("StyleEditor"), m = ee("StyleConfig"), w = ee("el-form"), E = ee("el-dialog");
- return H(), ae("div", nN, [
+ return H(), ae("div", rN, [
z(u, {
value: e.eventNum,
type: "warning",
@@ -40926,8 +40928,8 @@ function uN(e, t, i, r, n, a) {
class: "_fd-gcc-title",
onClick: t[0] || (t[0] = vt((...x) => e.changeStyle && e.changeStyle(...x), ["stop"]))
}, [
- J("div", iN, [
- J("span", rN, le(e.t("form.globalClass")), 1)
+ J("div", oN, [
+ J("span", aN, le(e.t("form.globalClass")), 1)
])
])
]),
@@ -40941,16 +40943,16 @@ function uN(e, t, i, r, n, a) {
class: "_fd-gcc-title",
onClick: vt((R) => e.active(k), ["stop"])
}, [
- J("div", aN, [
+ J("div", sN, [
J("span", null, "." + le(k), 1),
- x.label ? (H(), ae("span", lN, le(x.label), 1)) : Te("", !0)
+ x.label ? (H(), ae("span", uN, le(x.label), 1)) : Te("", !0)
]),
x.deletable !== !1 ? (H(), ae("i", {
key: 0,
class: "fc-icon icon-delete",
onClick: vt((R) => e.rm(k), ["stop"])
- }, null, 8, sN)) : Te("", !0)
- ], 8, oN)
+ }, null, 8, dN)) : Te("", !0)
+ ], 8, lN)
]),
_: 2
}, 1032, ["class"]))), 256)),
@@ -41069,8 +41071,8 @@ function uN(e, t, i, r, n, a) {
}, 8, ["modelValue"])
]);
}
-const Sb = /* @__PURE__ */ Ve(tN, [["render", uN]]);
-const dN = Be({
+const xb = /* @__PURE__ */ Ve(iN, [["render", fN]]);
+const cN = Be({
name: "GlobalVariableConfig",
emits: ["update:modelValue"],
props: {
@@ -41142,13 +41144,13 @@ const dN = Be({
this.activeIdx && !this.save() || (this.$emit("update:modelValue", { ...this.value }), this.visible = !1);
}
}
-}), fN = { class: "_fd-gvc" }, cN = ["onClick"], pN = { class: "_fd-gvc-method" }, hN = {
+}), pN = { class: "_fd-gvc" }, hN = ["onClick"], mN = { class: "_fd-gvc-method" }, vN = {
key: 0,
class: "_fd-label"
-}, mN = ["onClick"];
-function vN(e, t, i, r, n, a) {
+}, gN = ["onClick"];
+function yN(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-badge"), d = ee("Warning"), p = ee("el-header"), h = ee("el-menu-item"), g = ee("el-input"), _ = ee("el-menu"), S = ee("el-main"), b = ee("el-container"), A = ee("el-aside"), y = ee("FnEditor"), m = ee("el-dialog");
- return H(), ae("div", fN, [
+ return H(), ae("div", pN, [
z(u, {
value: e.eventNum,
type: "warning",
@@ -41248,16 +41250,16 @@ function vN(e, t, i, r, n, a) {
class: "_fd-gvc-title",
onClick: vt((x) => e.active(E), ["stop"])
}, [
- J("div", pN, [
+ J("div", mN, [
J("span", null, le(E), 1),
- w.label ? (H(), ae("span", hN, le(w.label), 1)) : Te("", !0)
+ w.label ? (H(), ae("span", vN, le(w.label), 1)) : Te("", !0)
]),
w.deletable !== !1 ? (H(), ae("i", {
key: 0,
class: "fc-icon icon-delete",
onClick: vt((x) => e.rm(E), ["stop"])
- }, null, 8, mN)) : Te("", !0)
- ], 8, cN)
+ }, null, 8, gN)) : Te("", !0)
+ ], 8, hN)
]),
_: 2
}, 1032, ["class"]))), 256)),
@@ -41363,10 +41365,10 @@ function vN(e, t, i, r, n, a) {
}, 8, ["modelValue"])
]);
}
-const Eb = /* @__PURE__ */ Ve(dN, [["render", vN]]);
-const gN = Be({
+const Tb = /* @__PURE__ */ Ve(cN, [["render", yN]]);
+const bN = Be({
name: "JsonPreview",
- components: { StructEditor: Lp },
+ components: { StructEditor: Np },
inject: ["designer"],
data() {
return {
@@ -41406,7 +41408,7 @@ const gN = Be({
}, { deep: !0 });
}
});
-function yN(e, t, i, r, n, a) {
+function _N(e, t, i, r, n, a) {
const s = ee("el-header"), u = ee("StructEditor"), d = ee("el-main"), p = ee("el-container");
return H(), me(p, { class: "_fc-json-preview" }, {
default: N(() => [
@@ -41444,8 +41446,8 @@ function yN(e, t, i, r, n, a) {
_: 1
});
}
-const bN = /* @__PURE__ */ Ve(gN, [["render", yN]]);
-const _N = Be({
+const wN = /* @__PURE__ */ Ve(bN, [["render", _N]]);
+const AN = Be({
name: "Struct",
emits: ["update:modelValue"],
props: {
@@ -41482,7 +41484,7 @@ const _N = Be({
},
methods: {
load() {
- const e = ai(ly(this.modelValue ? gt(this.modelValue) : this.defaultValue));
+ const e = ai(uy(this.modelValue ? gt(this.modelValue) : this.defaultValue));
this.oldVal = e, this.$nextTick(() => {
this.editor = Gt(rr(this.$refs.editor, {
lineNumbers: !0,
@@ -41491,7 +41493,7 @@ const _N = Be({
line: !0,
tabSize: 2,
lineWrapping: !0,
- value: e ? Uo.js(e, {
+ value: e ? jo.js(e, {
indent_size: "2",
indent_char: " ",
max_preserve_newlines: "5",
@@ -41511,13 +41513,13 @@ const _N = Be({
return this.validate && this.validate(t) === !1 ? (In(this.t("struct.errorMsg")), !1) : (this.visible = !1, ai(t) !== this.oldVal && this.$emit("update:modelValue", t), !0);
}
}
-}), wN = { class: "_fd-struct" }, AN = {
+}), CN = { class: "_fd-struct" }, SN = {
key: 0,
ref: "editor"
};
-function CN(e, t, i, r, n, a) {
+function EN(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-badge"), d = ee("el-dialog");
- return H(), ae("div", wN, [
+ return H(), ae("div", CN, [
z(u, {
type: "warning",
"is-dot": "",
@@ -41577,16 +41579,16 @@ function CN(e, t, i, r, n, a) {
])
]),
default: N(() => [
- e.visible ? (H(), ae("div", AN, null, 512)) : Te("", !0)
+ e.visible ? (H(), ae("div", SN, null, 512)) : Te("", !0)
]),
_: 1
}, 8, ["title", "modelValue"])
]);
}
-const xb = /* @__PURE__ */ Ve(_N, [["render", CN]]);
-const SN = Be({
+const kb = /* @__PURE__ */ Ve(AN, [["render", EN]]);
+const xN = Be({
name: "PropsInput",
- components: { Struct: xb },
+ components: { Struct: kb },
inject: ["designer"],
data() {
return {};
@@ -41616,7 +41618,7 @@ const SN = Be({
}
}
});
-function EN(e, t, i, r, n, a) {
+function TN(e, t, i, r, n, a) {
const s = ee("el-tooltip"), u = ee("Struct");
return H(), me(u, {
class: "_fd-props-input",
@@ -41640,8 +41642,8 @@ function EN(e, t, i, r, n, a) {
_: 1
}, 8, ["modelValue", "onUpdate:modelValue", "title"]);
}
-const xN = /* @__PURE__ */ Ve(SN, [["render", EN]]);
-const TN = Be({
+const kN = /* @__PURE__ */ Ve(xN, [["render", TN]]);
+const ON = Be({
name: "LanguageConfig",
inject: ["designer"],
computed: {
@@ -41714,13 +41716,13 @@ const TN = Be({
});
}), this.column = Object.values(t);
}
-}), kN = { class: "_fd-language-config" }, ON = { class: "_fc-l-label" }, $N = { class: "_fc-l-info" }, RN = { class: "_fd-lc-header" }, DN = { class: "_fd-lc-body" }, IN = { class: "_fd-lc-handle" }, FN = ["onClick"], PN = ["onClick"], MN = ["onClick"], LN = ["onClick"];
-function NN(e, t, i, r, n, a) {
+}), $N = { class: "_fd-language-config" }, RN = { class: "_fc-l-label" }, DN = { class: "_fc-l-info" }, IN = { class: "_fd-lc-header" }, FN = { class: "_fd-lc-body" }, PN = { class: "_fd-lc-handle" }, MN = ["onClick"], LN = ["onClick"], NN = ["onClick"], BN = ["onClick"];
+function VN(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-table-column"), d = ee("el-input"), p = ee("el-table");
- return H(), ae("div", kN, [
- J("div", ON, le(e.t("language.name")), 1),
- J("div", $N, le(e.t("warning.language")), 1),
- J("div", RN, [
+ return H(), ae("div", $N, [
+ J("div", RN, le(e.t("language.name")), 1),
+ J("div", DN, le(e.t("warning.language")), 1),
+ J("div", IN, [
z(s, {
size: "small",
onClick: e.addColumn
@@ -41743,7 +41745,7 @@ function NN(e, t, i, r, n, a) {
_: 1
}, 8, ["disabled", "onClick"])
]),
- J("div", DN, [
+ J("div", FN, [
z(p, {
data: e.column,
size: "small",
@@ -41786,24 +41788,24 @@ function NN(e, t, i, r, n, a) {
fixed: "right"
}, {
default: N((h) => [
- J("div", IN, [
+ J("div", PN, [
h.row.input ? (H(), ae("i", {
key: 1,
class: "fc-icon icon-check",
onClick: (g) => e.saveColumn(h.row)
- }, null, 8, PN)) : (H(), ae("i", {
+ }, null, 8, LN)) : (H(), ae("i", {
key: 0,
class: "fc-icon icon-edit",
onClick: (g) => h.row.input = !0
- }, null, 8, FN)),
+ }, null, 8, MN)),
J("i", {
class: "fc-icon icon-group",
onClick: (g) => e.copy(h.row.key)
- }, null, 8, MN),
+ }, null, 8, NN),
J("i", {
class: "fc-icon icon-delete-circle",
onClick: (g) => e.rmColumn(h.$index)
- }, null, 8, LN)
+ }, null, 8, BN)
])
]),
_: 1
@@ -41814,8 +41816,8 @@ function NN(e, t, i, r, n, a) {
])
]);
}
-const BN = /* @__PURE__ */ Ve(TN, [["render", NN]]);
-const VN = Be({
+const jN = /* @__PURE__ */ Ve(ON, [["render", VN]]);
+const UN = Be({
name: "SlotsConfig",
inject: ["designer"],
components: { ConfigItem: si },
@@ -42019,10 +42021,10 @@ const VN = Be({
},
mounted() {
}
-}), jN = { class: "_fd-slots-config" }, UN = { class: "_fd-slots-icons" }, HN = ["onClick"];
-function zN(e, t, i, r, n, a) {
+}), HN = { class: "_fd-slots-config" }, zN = { class: "_fd-slots-icons" }, WN = ["onClick"];
+function GN(e, t, i, r, n, a) {
const s = ee("el-option"), u = ee("el-select"), d = ee("el-popover"), p = ee("el-input"), h = ee("ConfigItem");
- return H(), ae("div", jN, [
+ return H(), ae("div", HN, [
(H(!0), ae(Me, null, ze(e.easySlots, (g, _) => (H(), me(h, {
label: g.label
}, {
@@ -42069,7 +42071,7 @@ function zN(e, t, i, r, n, a) {
J("i", { class: "fc-icon icon-menu" }, null, -1)
])),
default: N(() => [
- J("div", UN, [
+ J("div", zN, [
(H(!0), ae(Me, null, ze(e.icons, (S) => (H(), ae("div", {
class: "_fd-slots-icon",
onClick: (b) => e.changeIcon(g, S, _)
@@ -42077,7 +42079,7 @@ function zN(e, t, i, r, n, a) {
J("i", {
class: qe(["fc-icon iconfont", S])
}, null, 2)
- ], 8, HN))), 256))
+ ], 8, WN))), 256))
])
]),
_: 2
@@ -42091,8 +42093,8 @@ function zN(e, t, i, r, n, a) {
}, 1032, ["label"]))), 256))
]);
}
-const WN = /* @__PURE__ */ Ve(VN, [["render", zN]]);
-const GN = Be({
+const KN = /* @__PURE__ */ Ve(UN, [["render", GN]]);
+const YN = Be({
name: "QuickLayout",
inject: ["designer"],
data() {
@@ -42141,10 +42143,10 @@ const GN = Be({
}), this.$refs.pop.hide(), r && this.designer.setupState.addOperationRecord();
}
}
-}), KN = { class: "_fd-quick-layout" }, YN = { class: "_fd-quick-layout-content" }, QN = ["onClick"];
-function JN(e, t, i, r, n, a) {
+}), QN = { class: "_fd-quick-layout" }, JN = { class: "_fd-quick-layout-content" }, XN = ["onClick"];
+function ZN(e, t, i, r, n, a) {
const s = ee("el-tooltip"), u = ee("el-popover");
- return H(), ae("div", KN, [
+ return H(), ae("div", QN, [
z(u, {
ref: "pop",
placement: "bottom",
@@ -42168,7 +42170,7 @@ function JN(e, t, i, r, n, a) {
])
]),
default: N(() => [
- J("div", YN, [
+ J("div", JN, [
(H(!0), ae(Me, null, ze(e.layout, (d, p) => (H(), ae("div", {
onClick: (h) => e.change(p)
}, [
@@ -42176,15 +42178,15 @@ function JN(e, t, i, r, n, a) {
class: qe(["fc-icon", "icon-column" + (p + 1)])
}, null, 2),
J("span", null, le(d.label), 1)
- ], 8, QN))), 256))
+ ], 8, XN))), 256))
])
]),
_: 1
}, 512)
]);
}
-const XN = /* @__PURE__ */ Ve(GN, [["render", JN]]);
-const ZN = Be({
+const qN = /* @__PURE__ */ Ve(YN, [["render", ZN]]);
+const eB = Be({
name: "PrintForm",
components: {
SizeInput: ea,
@@ -42308,10 +42310,10 @@ const ZN = Be({
created() {
window.html2canvas ? kn.done("html2canvas") : kn.isDefined("html2canvas") || kn.loadNpm("html2canvas@1.4.1/dist/html2canvas.min.js", "html2canvas"), window.jspdf ? kn.done("jspdf") : kn.isDefined("jspdf") || kn.loadNpm("jspdf@3.0.1/dist/jspdf.umd.js", "jspdf");
}
-}), qN = { class: "_fd-print" };
-function eB(e, t, i, r, n, a) {
+}), tB = { class: "_fd-print" };
+function nB(e, t, i, r, n, a) {
const s = ee("el-tooltip"), u = ee("el-header"), d = ee("el-radio-button"), p = ee("el-radio-group"), h = ee("el-form-item"), g = ee("el-input-number"), _ = ee("el-form"), S = ee("el-main"), b = ee("el-container"), A = ee("el-aside"), y = ee("ViewForm"), m = ee("el-button"), w = ee("el-dialog");
- return H(), ae("div", qN, [
+ return H(), ae("div", tB, [
z(s, {
effect: "dark",
content: e.t("designer.print.title"),
@@ -42526,8 +42528,8 @@ function eB(e, t, i, r, n, a) {
}, 8, ["modelValue", "title"])
]);
}
-const tB = /* @__PURE__ */ Ve(ZN, [["render", eB]]);
-const nB = Be({
+const iB = /* @__PURE__ */ Ve(eB, [["render", nB]]);
+const rB = Be({
name: "AiChat",
inject: ["designer"],
data() {
@@ -42596,7 +42598,7 @@ const nB = Be({
})
}).then((e) => {
e.json().then((t) => {
- this.chat && (t.status === 200 ? (this.chat.status = "success", this.designer.setupState.setRule(t.data.rule)) : (this.chat.status = "fail", t.message && Ic(t.message)), this.chat = null);
+ this.chat && (t.status === 200 ? (this.chat.status = "success", this.designer.setupState.setRule(t.data.rule)) : (this.chat.status = "fail", t.message && Fc(t.message)), this.chat = null);
});
}).catch(() => {
this.chat = null;
@@ -42621,17 +42623,17 @@ const nB = Be({
unmounted() {
localStorage.setItem("fc_ai_history", JSON.stringify(this.history));
}
-}), iB = { class: "_fd-ai-chat" }, rB = { class: "_fd-ai-chat-header" }, oB = { class: "_fc-l-label" }, aB = { class: "_fc-l-info" }, lB = { class: "_fd-ai-chat-prompt" }, sB = ["onClick"], uB = { class: "_fd-ai-chat-history" }, dB = { class: "_fd-ai-chat-history-chat" }, fB = { key: 0 }, cB = { key: 1 }, pB = { key: 2 }, hB = { class: "_fd-ai-chat-input" }, mB = { class: "_fd-ai-chat-clear" };
-function vB(e, t, i, r, n, a) {
+}), oB = { class: "_fd-ai-chat" }, aB = { class: "_fd-ai-chat-header" }, lB = { class: "_fc-l-label" }, sB = { class: "_fc-l-info" }, uB = { class: "_fd-ai-chat-prompt" }, dB = ["onClick"], fB = { class: "_fd-ai-chat-history" }, cB = { class: "_fd-ai-chat-history-chat" }, pB = { key: 0 }, hB = { key: 1 }, mB = { key: 2 }, vB = { class: "_fd-ai-chat-input" }, gB = { class: "_fd-ai-chat-clear" };
+function yB(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-input");
- return H(), ae("div", iB, [
- J("div", rB, [
- J("div", oB, [
+ return H(), ae("div", oB, [
+ J("div", aB, [
+ J("div", lB, [
t[4] || (t[4] = J("i", { class: "fc-icon icon-ai bright" }, null, -1)),
be(" FormCreate " + le(e.t("ai.name")), 1)
]),
- J("div", aB, le(e.t("ai.info")), 1),
- J("div", lB, [
+ J("div", sB, le(e.t("ai.info")), 1),
+ J("div", uB, [
J("span", null, le(e.t("ai.try")), 1),
J("span", {
class: "_fd-ai-chat-refresh",
@@ -42647,26 +42649,26 @@ function vB(e, t, i, r, n, a) {
}, [
J("span", null, le(d), 1),
t[6] || (t[6] = J("i", { class: "fc-icon icon-down" }, null, -1))
- ], 8, sB))), 256))
+ ], 8, dB))), 256))
]),
- J("div", uB, [
+ J("div", fB, [
(H(!0), ae(Me, null, ze(e.history, (d, p) => (H(), ae("div", {
key: p,
class: "_fd-ai-chat-history-item",
ref_for: !0,
ref: "chat"
}, [
- J("div", dB, [
+ J("div", cB, [
J("div", null, le(d.message), 1)
]),
J("div", {
class: qe(["_fd-ai-chat-history-status", d.status || "success"])
}, [
J("div", null, [
- d.status === "loading" ? (H(), ae("div", fB, le(e.t("ai.loading")), 1)) : d.status === "fail" ? (H(), ae("div", cB, [
+ d.status === "loading" ? (H(), ae("div", pB, le(e.t("ai.loading")), 1)) : d.status === "fail" ? (H(), ae("div", hB, [
t[7] || (t[7] = J("i", { class: "fc-icon icon-warning" }, null, -1)),
be(le(e.t("ai.fail")), 1)
- ])) : (H(), ae("div", pB, [
+ ])) : (H(), ae("div", mB, [
t[8] || (t[8] = J("i", { class: "fc-icon icon-yes" }, null, -1)),
be(le(e.t("ai.success")), 1)
]))
@@ -42674,8 +42676,8 @@ function vB(e, t, i, r, n, a) {
], 2)
], 512))), 128))
]),
- J("div", hB, [
- J("div", mB, [
+ J("div", vB, [
+ J("div", gB, [
z(s, {
size: "small",
text: "",
@@ -42708,33 +42710,33 @@ function vB(e, t, i, r, n, a) {
])
]);
}
-const gB = /* @__PURE__ */ Ve(nB, [["render", vB]]);
-function Tb(e, t) {
+const bB = /* @__PURE__ */ Ve(rB, [["render", yB]]);
+function Ob(e, t) {
return function() {
return e.apply(t, arguments);
};
}
-const { toString: yB } = Object.prototype, { getPrototypeOf: Np } = Object, { iterator: Su, toStringTag: kb } = Symbol, Eu = ((e) => (t) => {
- const i = yB.call(t);
+const { toString: _B } = Object.prototype, { getPrototypeOf: Bp } = Object, { iterator: Su, toStringTag: $b } = Symbol, Eu = ((e) => (t) => {
+ const i = _B.call(t);
return e[i] || (e[i] = i.slice(8, -1).toLowerCase());
})(/* @__PURE__ */ Object.create(null)), Oi = (e) => (e = e.toLowerCase(), (t) => Eu(t) === e), xu = (e) => (t) => typeof t === e, { isArray: na } = Array, ol = xu("undefined");
-function bB(e) {
+function wB(e) {
return e !== null && !ol(e) && e.constructor !== null && !ol(e.constructor) && Xn(e.constructor.isBuffer) && e.constructor.isBuffer(e);
}
-const Ob = Oi("ArrayBuffer");
-function _B(e) {
+const Rb = Oi("ArrayBuffer");
+function AB(e) {
let t;
- return typeof ArrayBuffer < "u" && ArrayBuffer.isView ? t = ArrayBuffer.isView(e) : t = e && e.buffer && Ob(e.buffer), t;
+ return typeof ArrayBuffer < "u" && ArrayBuffer.isView ? t = ArrayBuffer.isView(e) : t = e && e.buffer && Rb(e.buffer), t;
}
-const wB = xu("string"), Xn = xu("function"), $b = xu("number"), Tu = (e) => e !== null && typeof e == "object", AB = (e) => e === !0 || e === !1, Ps = (e) => {
+const CB = xu("string"), Xn = xu("function"), Db = xu("number"), Tu = (e) => e !== null && typeof e == "object", SB = (e) => e === !0 || e === !1, Ps = (e) => {
if (Eu(e) !== "object")
return !1;
- const t = Np(e);
- return (t === null || t === Object.prototype || Object.getPrototypeOf(t) === null) && !(kb in e) && !(Su in e);
-}, CB = Oi("Date"), SB = Oi("File"), EB = Oi("Blob"), xB = Oi("FileList"), TB = (e) => Tu(e) && Xn(e.pipe), kB = (e) => {
+ const t = Bp(e);
+ return (t === null || t === Object.prototype || Object.getPrototypeOf(t) === null) && !($b in e) && !(Su in e);
+}, EB = Oi("Date"), xB = Oi("File"), TB = Oi("Blob"), kB = Oi("FileList"), OB = (e) => Tu(e) && Xn(e.pipe), $B = (e) => {
let t;
return e && (typeof FormData == "function" && e instanceof FormData || Xn(e.append) && ((t = Eu(e)) === "formdata" || t === "object" && Xn(e.toString) && e.toString() === "[object FormData]"));
-}, OB = Oi("URLSearchParams"), [$B, RB, DB, IB] = ["ReadableStream", "Request", "Response", "Headers"].map(Oi), FB = (e) => e.trim ? e.trim() : e.replace(/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g, "");
+}, RB = Oi("URLSearchParams"), [DB, IB, FB, PB] = ["ReadableStream", "Request", "Response", "Headers"].map(Oi), MB = (e) => e.trim ? e.trim() : e.replace(/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g, "");
function gl(e, t, { allOwnKeys: i = !1 } = {}) {
if (e === null || typeof e > "u")
return;
@@ -42749,7 +42751,7 @@ function gl(e, t, { allOwnKeys: i = !1 } = {}) {
u = a[r], t.call(null, e[u], u, e);
}
}
-function Rb(e, t) {
+function Ib(e, t) {
t = t.toLowerCase();
const i = Object.keys(e);
let r = i.length, n;
@@ -42758,23 +42760,23 @@ function Rb(e, t) {
return n;
return null;
}
-const Gr = (() => typeof globalThis < "u" ? globalThis : typeof self < "u" ? self : typeof window < "u" ? window : global)(), Db = (e) => !ol(e) && e !== Gr;
-function Sc() {
- const { caseless: e } = Db(this) && this || {}, t = {}, i = (r, n) => {
- const a = e && Rb(t, n) || n;
- Ps(t[a]) && Ps(r) ? t[a] = Sc(t[a], r) : Ps(r) ? t[a] = Sc({}, r) : na(r) ? t[a] = r.slice() : t[a] = r;
+const Gr = (() => typeof globalThis < "u" ? globalThis : typeof self < "u" ? self : typeof window < "u" ? window : global)(), Fb = (e) => !ol(e) && e !== Gr;
+function Ec() {
+ const { caseless: e } = Fb(this) && this || {}, t = {}, i = (r, n) => {
+ const a = e && Ib(t, n) || n;
+ Ps(t[a]) && Ps(r) ? t[a] = Ec(t[a], r) : Ps(r) ? t[a] = Ec({}, r) : na(r) ? t[a] = r.slice() : t[a] = r;
};
for (let r = 0, n = arguments.length; r < n; r++)
arguments[r] && gl(arguments[r], i);
return t;
}
-const PB = (e, t, i, { allOwnKeys: r } = {}) => (gl(t, (n, a) => {
- i && Xn(n) ? e[a] = Tb(n, i) : e[a] = n;
-}, { allOwnKeys: r }), e), MB = (e) => (e.charCodeAt(0) === 65279 && (e = e.slice(1)), e), LB = (e, t, i, r) => {
+const LB = (e, t, i, { allOwnKeys: r } = {}) => (gl(t, (n, a) => {
+ i && Xn(n) ? e[a] = Ob(n, i) : e[a] = n;
+}, { allOwnKeys: r }), e), NB = (e) => (e.charCodeAt(0) === 65279 && (e = e.slice(1)), e), BB = (e, t, i, r) => {
e.prototype = Object.create(t.prototype, r), e.prototype.constructor = e, Object.defineProperty(e, "super", {
value: t.prototype
}), i && Object.assign(e.prototype, i);
-}, NB = (e, t, i, r) => {
+}, VB = (e, t, i, r) => {
let n, a, s;
const u = {};
if (t = t || {}, e == null)
@@ -42782,51 +42784,51 @@ const PB = (e, t, i, { allOwnKeys: r } = {}) => (gl(t, (n, a) => {
do {
for (n = Object.getOwnPropertyNames(e), a = n.length; a-- > 0; )
s = n[a], (!r || r(s, e, t)) && !u[s] && (t[s] = e[s], u[s] = !0);
- e = i !== !1 && Np(e);
+ e = i !== !1 && Bp(e);
} while (e && (!i || i(e, t)) && e !== Object.prototype);
return t;
-}, BB = (e, t, i) => {
+}, jB = (e, t, i) => {
e = String(e), (i === void 0 || i > e.length) && (i = e.length), i -= t.length;
const r = e.indexOf(t, i);
return r !== -1 && r === i;
-}, VB = (e) => {
+}, UB = (e) => {
if (!e)
return null;
if (na(e))
return e;
let t = e.length;
- if (!$b(t))
+ if (!Db(t))
return null;
const i = new Array(t);
for (; t-- > 0; )
i[t] = e[t];
return i;
-}, jB = ((e) => (t) => e && t instanceof e)(typeof Uint8Array < "u" && Np(Uint8Array)), UB = (e, t) => {
+}, HB = ((e) => (t) => e && t instanceof e)(typeof Uint8Array < "u" && Bp(Uint8Array)), zB = (e, t) => {
const r = (e && e[Su]).call(e);
let n;
for (; (n = r.next()) && !n.done; ) {
const a = n.value;
t.call(e, a[0], a[1]);
}
-}, HB = (e, t) => {
+}, WB = (e, t) => {
let i;
const r = [];
for (; (i = e.exec(t)) !== null; )
r.push(i);
return r;
-}, zB = Oi("HTMLFormElement"), WB = (e) => e.toLowerCase().replace(
+}, GB = Oi("HTMLFormElement"), KB = (e) => e.toLowerCase().replace(
/[-_\s]([a-z\d])(\w*)/g,
function(i, r, n) {
return r.toUpperCase() + n;
}
-), Vg = (({ hasOwnProperty: e }) => (t, i) => e.call(t, i))(Object.prototype), GB = Oi("RegExp"), Ib = (e, t) => {
+), Ug = (({ hasOwnProperty: e }) => (t, i) => e.call(t, i))(Object.prototype), YB = Oi("RegExp"), Pb = (e, t) => {
const i = Object.getOwnPropertyDescriptors(e), r = {};
gl(i, (n, a) => {
let s;
(s = t(n, a, e)) !== !1 && (r[a] = s || n);
}), Object.defineProperties(e, r);
-}, KB = (e) => {
- Ib(e, (t, i) => {
+}, QB = (e) => {
+ Pb(e, (t, i) => {
if (Xn(e) && ["arguments", "caller", "callee"].indexOf(i) !== -1)
return !1;
const r = e[i];
@@ -42840,19 +42842,19 @@ const PB = (e, t, i, { allOwnKeys: r } = {}) => (gl(t, (n, a) => {
});
}
});
-}, YB = (e, t) => {
+}, JB = (e, t) => {
const i = {}, r = (n) => {
n.forEach((a) => {
i[a] = !0;
});
};
return na(e) ? r(e) : r(String(e).split(t)), i;
-}, QB = () => {
-}, JB = (e, t) => e != null && Number.isFinite(e = +e) ? e : t;
-function XB(e) {
- return !!(e && Xn(e.append) && e[kb] === "FormData" && e[Su]);
+}, XB = () => {
+}, ZB = (e, t) => e != null && Number.isFinite(e = +e) ? e : t;
+function qB(e) {
+ return !!(e && Xn(e.append) && e[$b] === "FormData" && e[Su]);
}
-const ZB = (e) => {
+const e8 = (e) => {
const t = new Array(10), i = (r, n) => {
if (Tu(r)) {
if (t.indexOf(r) >= 0)
@@ -42869,70 +42871,70 @@ const ZB = (e) => {
return r;
};
return i(e, 0);
-}, qB = Oi("AsyncFunction"), e8 = (e) => e && (Tu(e) || Xn(e)) && Xn(e.then) && Xn(e.catch), Fb = ((e, t) => e ? setImmediate : t ? ((i, r) => (Gr.addEventListener("message", ({ source: n, data: a }) => {
+}, t8 = Oi("AsyncFunction"), n8 = (e) => e && (Tu(e) || Xn(e)) && Xn(e.then) && Xn(e.catch), Mb = ((e, t) => e ? setImmediate : t ? ((i, r) => (Gr.addEventListener("message", ({ source: n, data: a }) => {
n === Gr && a === i && r.length && r.shift()();
}, !1), (n) => {
r.push(n), Gr.postMessage(i, "*");
}))(`axios@${Math.random()}`, []) : (i) => setTimeout(i))(
typeof setImmediate == "function",
Xn(Gr.postMessage)
-), t8 = typeof queueMicrotask < "u" ? queueMicrotask.bind(Gr) : typeof process < "u" && process.nextTick || Fb, n8 = (e) => e != null && Xn(e[Su]), Pe = {
+), i8 = typeof queueMicrotask < "u" ? queueMicrotask.bind(Gr) : typeof process < "u" && process.nextTick || Mb, r8 = (e) => e != null && Xn(e[Su]), Pe = {
isArray: na,
- isArrayBuffer: Ob,
- isBuffer: bB,
- isFormData: kB,
- isArrayBufferView: _B,
- isString: wB,
- isNumber: $b,
- isBoolean: AB,
+ isArrayBuffer: Rb,
+ isBuffer: wB,
+ isFormData: $B,
+ isArrayBufferView: AB,
+ isString: CB,
+ isNumber: Db,
+ isBoolean: SB,
isObject: Tu,
isPlainObject: Ps,
- isReadableStream: $B,
- isRequest: RB,
- isResponse: DB,
- isHeaders: IB,
+ isReadableStream: DB,
+ isRequest: IB,
+ isResponse: FB,
+ isHeaders: PB,
isUndefined: ol,
- isDate: CB,
- isFile: SB,
- isBlob: EB,
- isRegExp: GB,
+ isDate: EB,
+ isFile: xB,
+ isBlob: TB,
+ isRegExp: YB,
isFunction: Xn,
- isStream: TB,
- isURLSearchParams: OB,
- isTypedArray: jB,
- isFileList: xB,
+ isStream: OB,
+ isURLSearchParams: RB,
+ isTypedArray: HB,
+ isFileList: kB,
forEach: gl,
- merge: Sc,
- extend: PB,
- trim: FB,
- stripBOM: MB,
- inherits: LB,
- toFlatObject: NB,
+ merge: Ec,
+ extend: LB,
+ trim: MB,
+ stripBOM: NB,
+ inherits: BB,
+ toFlatObject: VB,
kindOf: Eu,
kindOfTest: Oi,
- endsWith: BB,
- toArray: VB,
- forEachEntry: UB,
- matchAll: HB,
- isHTMLForm: zB,
- hasOwnProperty: Vg,
- hasOwnProp: Vg,
- reduceDescriptors: Ib,
- freezeMethods: KB,
- toObjectSet: YB,
- toCamelCase: WB,
- noop: QB,
- toFiniteNumber: JB,
- findKey: Rb,
+ endsWith: jB,
+ toArray: UB,
+ forEachEntry: zB,
+ matchAll: WB,
+ isHTMLForm: GB,
+ hasOwnProperty: Ug,
+ hasOwnProp: Ug,
+ reduceDescriptors: Pb,
+ freezeMethods: QB,
+ toObjectSet: JB,
+ toCamelCase: KB,
+ noop: XB,
+ toFiniteNumber: ZB,
+ findKey: Ib,
global: Gr,
- isContextDefined: Db,
- isSpecCompliantForm: XB,
- toJSONObject: ZB,
- isAsyncFn: qB,
- isThenable: e8,
- setImmediate: Fb,
- asap: t8,
- isIterable: n8
+ isContextDefined: Fb,
+ isSpecCompliantForm: qB,
+ toJSONObject: e8,
+ isAsyncFn: t8,
+ isThenable: n8,
+ setImmediate: Mb,
+ asap: i8,
+ isIterable: r8
};
function Tt(e, t, i, r, n) {
Error.call(this), Error.captureStackTrace ? Error.captureStackTrace(this, this.constructor) : this.stack = new Error().stack, this.message = e, this.name = "AxiosError", t && (this.code = t), i && (this.config = i), r && (this.request = r), n && (this.response = n, this.status = n.status ? n.status : null);
@@ -42954,7 +42956,7 @@ Pe.inherits(Tt, Error, {
};
}
});
-const Pb = Tt.prototype, Mb = {};
+const Lb = Tt.prototype, Nb = {};
[
"ERR_BAD_OPTION_VALUE",
"ERR_BAD_OPTION",
@@ -42969,32 +42971,32 @@ const Pb = Tt.prototype, Mb = {};
"ERR_NOT_SUPPORT",
"ERR_INVALID_URL"
].forEach((e) => {
- Mb[e] = { value: e };
+ Nb[e] = { value: e };
});
-Object.defineProperties(Tt, Mb);
-Object.defineProperty(Pb, "isAxiosError", { value: !0 });
+Object.defineProperties(Tt, Nb);
+Object.defineProperty(Lb, "isAxiosError", { value: !0 });
Tt.from = (e, t, i, r, n, a) => {
- const s = Object.create(Pb);
+ const s = Object.create(Lb);
return Pe.toFlatObject(e, s, function(d) {
return d !== Error.prototype;
}, (u) => u !== "isAxiosError"), Tt.call(s, e.message, t, i, r, n), s.cause = e, s.name = e.name, a && Object.assign(s, a), s;
};
-const i8 = null;
-function Ec(e) {
+const o8 = null;
+function xc(e) {
return Pe.isPlainObject(e) || Pe.isArray(e);
}
-function Lb(e) {
+function Bb(e) {
return Pe.endsWith(e, "[]") ? e.slice(0, -2) : e;
}
-function jg(e, t, i) {
+function Hg(e, t, i) {
return e ? e.concat(t).map(function(n, a) {
- return n = Lb(n), !i && a ? "[" + n + "]" : n;
+ return n = Bb(n), !i && a ? "[" + n + "]" : n;
}).join(i ? "." : "") : t;
}
-function r8(e) {
- return Pe.isArray(e) && !e.some(Ec);
+function a8(e) {
+ return Pe.isArray(e) && !e.some(xc);
}
-const o8 = Pe.toFlatObject(Pe, {}, null, function(t) {
+const l8 = Pe.toFlatObject(Pe, {}, null, function(t) {
return /^is[A-Z]/.test(t);
});
function ku(e, t, i) {
@@ -43024,20 +43026,20 @@ function ku(e, t, i) {
if (b && !y && typeof b == "object") {
if (Pe.endsWith(A, "{}"))
A = r ? A : A.slice(0, -2), b = JSON.stringify(b);
- else if (Pe.isArray(b) && r8(b) || (Pe.isFileList(b) || Pe.endsWith(A, "[]")) && (m = Pe.toArray(b)))
- return A = Lb(A), m.forEach(function(E, x) {
+ else if (Pe.isArray(b) && a8(b) || (Pe.isFileList(b) || Pe.endsWith(A, "[]")) && (m = Pe.toArray(b)))
+ return A = Bb(A), m.forEach(function(E, x) {
!(Pe.isUndefined(E) || E === null) && t.append(
- s === !0 ? jg([A], x, a) : s === null ? A : A + "[]",
+ s === !0 ? Hg([A], x, a) : s === null ? A : A + "[]",
p(E)
);
}), !1;
}
- return Ec(b) ? !0 : (t.append(jg(y, A, a), p(b)), !1);
+ return xc(b) ? !0 : (t.append(Hg(y, A, a), p(b)), !1);
}
- const g = [], _ = Object.assign(o8, {
+ const g = [], _ = Object.assign(l8, {
defaultVisitor: h,
convertValue: p,
- isVisitable: Ec
+ isVisitable: xc
});
function S(b, A) {
if (!Pe.isUndefined(b)) {
@@ -43058,7 +43060,7 @@ function ku(e, t, i) {
throw new TypeError("data must be an object");
return S(e), t;
}
-function Ug(e) {
+function zg(e) {
const t = {
"!": "%21",
"'": "%27",
@@ -43072,40 +43074,40 @@ function Ug(e) {
return t[r];
});
}
-function Bp(e, t) {
+function Vp(e, t) {
this._pairs = [], e && ku(e, this, t);
}
-const Nb = Bp.prototype;
-Nb.append = function(t, i) {
+const Vb = Vp.prototype;
+Vb.append = function(t, i) {
this._pairs.push([t, i]);
};
-Nb.toString = function(t) {
+Vb.toString = function(t) {
const i = t ? function(r) {
- return t.call(this, r, Ug);
- } : Ug;
+ return t.call(this, r, zg);
+ } : zg;
return this._pairs.map(function(n) {
return i(n[0]) + "=" + i(n[1]);
}, "").join("&");
};
-function a8(e) {
+function s8(e) {
return encodeURIComponent(e).replace(/%3A/gi, ":").replace(/%24/g, "$").replace(/%2C/gi, ",").replace(/%20/g, "+").replace(/%5B/gi, "[").replace(/%5D/gi, "]");
}
-function Bb(e, t, i) {
+function jb(e, t, i) {
if (!t)
return e;
- const r = i && i.encode || a8;
+ const r = i && i.encode || s8;
Pe.isFunction(i) && (i = {
serialize: i
});
const n = i && i.serialize;
let a;
- if (n ? a = n(t, i) : a = Pe.isURLSearchParams(t) ? t.toString() : new Bp(t, i).toString(r), a) {
+ if (n ? a = n(t, i) : a = Pe.isURLSearchParams(t) ? t.toString() : new Vp(t, i).toString(r), a) {
const s = e.indexOf("#");
s !== -1 && (e = e.slice(0, s)), e += (e.indexOf("?") === -1 ? "?" : "&") + a;
}
return e;
}
-class l8 {
+class u8 {
constructor() {
this.handlers = [];
}
@@ -43129,40 +43131,40 @@ class l8 {
});
}
}
-const Hg = l8, Vb = {
+const Wg = u8, Ub = {
silentJSONParsing: !0,
forcedJSONParsing: !0,
clarifyTimeoutError: !1
-}, s8 = typeof URLSearchParams < "u" ? URLSearchParams : Bp, u8 = typeof FormData < "u" ? FormData : null, d8 = typeof Blob < "u" ? Blob : null, f8 = {
+}, d8 = typeof URLSearchParams < "u" ? URLSearchParams : Vp, f8 = typeof FormData < "u" ? FormData : null, c8 = typeof Blob < "u" ? Blob : null, p8 = {
isBrowser: !0,
classes: {
- URLSearchParams: s8,
- FormData: u8,
- Blob: d8
+ URLSearchParams: d8,
+ FormData: f8,
+ Blob: c8
},
protocols: ["http", "https", "file", "blob", "url", "data"]
-}, Vp = typeof window < "u" && typeof document < "u", xc = typeof navigator == "object" && navigator || void 0, c8 = Vp && (!xc || ["ReactNative", "NativeScript", "NS"].indexOf(xc.product) < 0), p8 = (() => typeof WorkerGlobalScope < "u" && self instanceof WorkerGlobalScope && typeof self.importScripts == "function")(), h8 = Vp && window.location.href || "http://localhost", m8 = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
+}, jp = typeof window < "u" && typeof document < "u", Tc = typeof navigator == "object" && navigator || void 0, h8 = jp && (!Tc || ["ReactNative", "NativeScript", "NS"].indexOf(Tc.product) < 0), m8 = (() => typeof WorkerGlobalScope < "u" && self instanceof WorkerGlobalScope && typeof self.importScripts == "function")(), v8 = jp && window.location.href || "http://localhost", g8 = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
__proto__: null,
- hasBrowserEnv: Vp,
- hasStandardBrowserWebWorkerEnv: p8,
- hasStandardBrowserEnv: c8,
- navigator: xc,
- origin: h8
+ hasBrowserEnv: jp,
+ hasStandardBrowserWebWorkerEnv: m8,
+ hasStandardBrowserEnv: h8,
+ navigator: Tc,
+ origin: v8
}, Symbol.toStringTag, { value: "Module" })), Dn = {
- ...m8,
- ...f8
+ ...g8,
+ ...p8
};
-function v8(e, t) {
+function y8(e, t) {
return ku(e, new Dn.classes.URLSearchParams(), Object.assign({
visitor: function(i, r, n, a) {
return Dn.isNode && Pe.isBuffer(i) ? (this.append(r, i.toString("base64")), !1) : a.defaultVisitor.apply(this, arguments);
}
}, t));
}
-function g8(e) {
+function b8(e) {
return Pe.matchAll(/\w+|\[(\w*)]/g, e).map((t) => t[0] === "[]" ? "" : t[1] || t[0]);
}
-function y8(e) {
+function _8(e) {
const t = {}, i = Object.keys(e);
let r;
const n = i.length;
@@ -43171,23 +43173,23 @@ function y8(e) {
a = i[r], t[a] = e[a];
return t;
}
-function jb(e) {
+function Hb(e) {
function t(i, r, n, a) {
let s = i[a++];
if (s === "__proto__")
return !0;
const u = Number.isFinite(+s), d = a >= i.length;
- return s = !s && Pe.isArray(n) ? n.length : s, d ? (Pe.hasOwnProp(n, s) ? n[s] = [n[s], r] : n[s] = r, !u) : ((!n[s] || !Pe.isObject(n[s])) && (n[s] = []), t(i, r, n[s], a) && Pe.isArray(n[s]) && (n[s] = y8(n[s])), !u);
+ return s = !s && Pe.isArray(n) ? n.length : s, d ? (Pe.hasOwnProp(n, s) ? n[s] = [n[s], r] : n[s] = r, !u) : ((!n[s] || !Pe.isObject(n[s])) && (n[s] = []), t(i, r, n[s], a) && Pe.isArray(n[s]) && (n[s] = _8(n[s])), !u);
}
if (Pe.isFormData(e) && Pe.isFunction(e.entries)) {
const i = {};
return Pe.forEachEntry(e, (r, n) => {
- t(g8(r), n, i, 0);
+ t(b8(r), n, i, 0);
}), i;
}
return null;
}
-function b8(e, t, i) {
+function w8(e, t, i) {
if (Pe.isString(e))
try {
return (t || JSON.parse)(e), Pe.trim(e);
@@ -43197,13 +43199,13 @@ function b8(e, t, i) {
}
return (i || JSON.stringify)(e);
}
-const jp = {
- transitional: Vb,
+const Up = {
+ transitional: Ub,
adapter: ["xhr", "http", "fetch"],
transformRequest: [function(t, i) {
const r = i.getContentType() || "", n = r.indexOf("application/json") > -1, a = Pe.isObject(t);
if (a && Pe.isHTMLForm(t) && (t = new FormData(t)), Pe.isFormData(t))
- return n ? JSON.stringify(jb(t)) : t;
+ return n ? JSON.stringify(Hb(t)) : t;
if (Pe.isArrayBuffer(t) || Pe.isBuffer(t) || Pe.isStream(t) || Pe.isFile(t) || Pe.isBlob(t) || Pe.isReadableStream(t))
return t;
if (Pe.isArrayBufferView(t))
@@ -43213,7 +43215,7 @@ const jp = {
let u;
if (a) {
if (r.indexOf("application/x-www-form-urlencoded") > -1)
- return v8(t, this.formSerializer).toString();
+ return y8(t, this.formSerializer).toString();
if ((u = Pe.isFileList(t)) || r.indexOf("multipart/form-data") > -1) {
const d = this.env && this.env.FormData;
return ku(
@@ -43223,10 +43225,10 @@ const jp = {
);
}
}
- return a || n ? (i.setContentType("application/json", !1), b8(t)) : t;
+ return a || n ? (i.setContentType("application/json", !1), w8(t)) : t;
}],
transformResponse: [function(t) {
- const i = this.transitional || jp.transitional, r = i && i.forcedJSONParsing, n = this.responseType === "json";
+ const i = this.transitional || Up.transitional, r = i && i.forcedJSONParsing, n = this.responseType === "json";
if (Pe.isResponse(t) || Pe.isReadableStream(t))
return t;
if (t && Pe.isString(t) && (r && !this.responseType || n)) {
@@ -43260,9 +43262,9 @@ const jp = {
}
};
Pe.forEach(["delete", "get", "head", "post", "put", "patch"], (e) => {
- jp.headers[e] = {};
+ Up.headers[e] = {};
});
-const Up = jp, _8 = Pe.toObjectSet([
+const Hp = Up, A8 = Pe.toObjectSet([
"age",
"authorization",
"content-length",
@@ -43280,29 +43282,29 @@ const Up = jp, _8 = Pe.toObjectSet([
"referer",
"retry-after",
"user-agent"
-]), w8 = (e) => {
+]), C8 = (e) => {
const t = {};
let i, r, n;
return e && e.split(`
`).forEach(function(s) {
- n = s.indexOf(":"), i = s.substring(0, n).trim().toLowerCase(), r = s.substring(n + 1).trim(), !(!i || t[i] && _8[i]) && (i === "set-cookie" ? t[i] ? t[i].push(r) : t[i] = [r] : t[i] = t[i] ? t[i] + ", " + r : r);
+ n = s.indexOf(":"), i = s.substring(0, n).trim().toLowerCase(), r = s.substring(n + 1).trim(), !(!i || t[i] && A8[i]) && (i === "set-cookie" ? t[i] ? t[i].push(r) : t[i] = [r] : t[i] = t[i] ? t[i] + ", " + r : r);
}), t;
-}, zg = Symbol("internals");
+}, Gg = Symbol("internals");
function Ha(e) {
return e && String(e).trim().toLowerCase();
}
function Ms(e) {
return e === !1 || e == null ? e : Pe.isArray(e) ? e.map(Ms) : String(e);
}
-function A8(e) {
+function S8(e) {
const t = /* @__PURE__ */ Object.create(null), i = /([^\s,;=]+)\s*(?:=\s*([^,;]+))?/g;
let r;
for (; r = i.exec(e); )
t[r[1]] = r[2];
return t;
}
-const C8 = (e) => /^[-_a-zA-Z0-9^`|~,!#$%&'*+.]+$/.test(e.trim());
-function nc(e, t, i, r, n) {
+const E8 = (e) => /^[-_a-zA-Z0-9^`|~,!#$%&'*+.]+$/.test(e.trim());
+function ic(e, t, i, r, n) {
if (Pe.isFunction(r))
return r.call(this, t, i);
if (n && (t = i), !!Pe.isString(t)) {
@@ -43312,10 +43314,10 @@ function nc(e, t, i, r, n) {
return r.test(t);
}
}
-function S8(e) {
+function x8(e) {
return e.trim().toLowerCase().replace(/([a-z\d])(\w*)/g, (t, i, r) => i.toUpperCase() + r);
}
-function E8(e, t) {
+function T8(e, t) {
const i = Pe.toCamelCase(" " + t);
["get", "set", "has"].forEach((r) => {
Object.defineProperty(e, r + i, {
@@ -43342,8 +43344,8 @@ class Ou {
const s = (u, d) => Pe.forEach(u, (p, h) => a(p, h, d));
if (Pe.isPlainObject(t) || t instanceof this.constructor)
s(t, i);
- else if (Pe.isString(t) && (t = t.trim()) && !C8(t))
- s(w8(t), i);
+ else if (Pe.isString(t) && (t = t.trim()) && !E8(t))
+ s(C8(t), i);
else if (Pe.isObject(t) && Pe.isIterable(t)) {
let u = {}, d, p;
for (const h of t) {
@@ -43364,7 +43366,7 @@ class Ou {
if (!i)
return n;
if (i === !0)
- return A8(n);
+ return S8(n);
if (Pe.isFunction(i))
return i.call(this, n, r);
if (Pe.isRegExp(i))
@@ -43376,7 +43378,7 @@ class Ou {
has(t, i) {
if (t = Ha(t), t) {
const r = Pe.findKey(this, t);
- return !!(r && this[r] !== void 0 && (!i || nc(this, this[r], r, i)));
+ return !!(r && this[r] !== void 0 && (!i || ic(this, this[r], r, i)));
}
return !1;
}
@@ -43386,7 +43388,7 @@ class Ou {
function a(s) {
if (s = Ha(s), s) {
const u = Pe.findKey(r, s);
- u && (!i || nc(r, r[u], u, i)) && (delete r[u], n = !0);
+ u && (!i || ic(r, r[u], u, i)) && (delete r[u], n = !0);
}
}
return Pe.isArray(t) ? t.forEach(a) : a(t), n;
@@ -43396,7 +43398,7 @@ class Ou {
let r = i.length, n = !1;
for (; r--; ) {
const a = i[r];
- (!t || nc(this, this[a], a, t, !0)) && (delete this[a], n = !0);
+ (!t || ic(this, this[a], a, t, !0)) && (delete this[a], n = !0);
}
return n;
}
@@ -43408,7 +43410,7 @@ class Ou {
i[s] = Ms(n), delete i[a];
return;
}
- const u = t ? S8(a) : String(a).trim();
+ const u = t ? x8(a) : String(a).trim();
u !== a && delete i[a], i[u] = Ms(n), r[u] = !0;
}), this;
}
@@ -43442,12 +43444,12 @@ class Ou {
return i.forEach((n) => r.set(n)), r;
}
static accessor(t) {
- const r = (this[zg] = this[zg] = {
+ const r = (this[Gg] = this[Gg] = {
accessors: {}
}).accessors, n = this.prototype;
function a(s) {
const u = Ha(s);
- r[u] || (E8(n, s), r[u] = !0);
+ r[u] || (T8(n, s), r[u] = !0);
}
return Pe.isArray(t) ? t.forEach(a) : a(t), this;
}
@@ -43464,14 +43466,14 @@ Pe.reduceDescriptors(Ou.prototype, ({ value: e }, t) => {
});
Pe.freezeMethods(Ou);
const xi = Ou;
-function ic(e, t) {
- const i = this || Up, r = t || i, n = xi.from(r.headers);
+function rc(e, t) {
+ const i = this || Hp, r = t || i, n = xi.from(r.headers);
let a = r.data;
return Pe.forEach(e, function(u) {
a = u.call(i, a, n.normalize(), t ? t.status : void 0);
}), n.normalize(), a;
}
-function Ub(e) {
+function zb(e) {
return !!(e && e.__CANCEL__);
}
function ia(e, t, i) {
@@ -43480,7 +43482,7 @@ function ia(e, t, i) {
Pe.inherits(ia, Tt, {
__CANCEL__: !0
});
-function Hb(e, t, i) {
+function Wb(e, t, i) {
const r = i.config.validateStatus;
!i.status || !r || r(i.status) ? e(i) : t(new Tt(
"Request failed with status code " + i.status,
@@ -43490,11 +43492,11 @@ function Hb(e, t, i) {
i
));
}
-function x8(e) {
+function k8(e) {
const t = /^([-+\w]{1,25})(:?\/\/|:)/.exec(e);
return t && t[1] || "";
}
-function T8(e, t) {
+function O8(e, t) {
e = e || 10;
const i = new Array(e), r = new Array(e);
let n = 0, a = 0, s;
@@ -43510,7 +43512,7 @@ function T8(e, t) {
return S ? Math.round(_ * 1e3 / S) : void 0;
};
}
-function k8(e, t) {
+function $8(e, t) {
let i = 0, r = 1e3 / t, n, a;
const s = (p, h = Date.now()) => {
i = h, n = null, a && (clearTimeout(a), a = null), e.apply(null, p);
@@ -43524,8 +43526,8 @@ function k8(e, t) {
}
const nu = (e, t, i = 3) => {
let r = 0;
- const n = T8(50, 250);
- return k8((a) => {
+ const n = O8(50, 250);
+ return $8((a) => {
const s = a.loaded, u = a.lengthComputable ? a.total : void 0, d = s - r, p = n(d), h = s <= u;
r = s;
const g = {
@@ -43541,17 +43543,17 @@ const nu = (e, t, i = 3) => {
};
e(g);
}, i);
-}, Wg = (e, t) => {
+}, Kg = (e, t) => {
const i = e != null;
return [(r) => t[0]({
lengthComputable: i,
total: e,
loaded: r
}), t[1]];
-}, Gg = (e) => (...t) => Pe.asap(() => e(...t)), O8 = Dn.hasStandardBrowserEnv ? ((e, t) => (i) => (i = new URL(i, Dn.origin), e.protocol === i.protocol && e.host === i.host && (t || e.port === i.port)))(
+}, Yg = (e) => (...t) => Pe.asap(() => e(...t)), R8 = Dn.hasStandardBrowserEnv ? ((e, t) => (i) => (i = new URL(i, Dn.origin), e.protocol === i.protocol && e.host === i.host && (t || e.port === i.port)))(
new URL(Dn.origin),
Dn.navigator && /(msie|trident)/i.test(Dn.navigator.userAgent)
-) : () => !0, $8 = Dn.hasStandardBrowserEnv ? {
+) : () => !0, D8 = Dn.hasStandardBrowserEnv ? {
write(e, t, i, r, n, a) {
const s = [e + "=" + encodeURIComponent(t)];
Pe.isNumber(i) && s.push("expires=" + new Date(i).toGMTString()), Pe.isString(r) && s.push("path=" + r), Pe.isString(n) && s.push("domain=" + n), a === !0 && s.push("secure"), document.cookie = s.join("; ");
@@ -43572,17 +43574,17 @@ const nu = (e, t, i = 3) => {
remove() {
}
};
-function R8(e) {
+function I8(e) {
return /^([a-z][a-z\d+\-.]*:)?\/\//i.test(e);
}
-function D8(e, t) {
+function F8(e, t) {
return t ? e.replace(/\/?\/$/, "") + "/" + t.replace(/^\/+/, "") : e;
}
-function zb(e, t, i) {
- let r = !R8(t);
- return e && (r || i == !1) ? D8(e, t) : t;
+function Gb(e, t, i) {
+ let r = !I8(t);
+ return e && (r || i == !1) ? F8(e, t) : t;
}
-const Kg = (e) => e instanceof xi ? { ...e } : e;
+const Qg = (e) => e instanceof xi ? { ...e } : e;
function Qr(e, t) {
t = t || {};
const i = {};
@@ -43642,17 +43644,17 @@ function Qr(e, t) {
socketPath: s,
responseEncoding: s,
validateStatus: u,
- headers: (p, h, g) => n(Kg(p), Kg(h), g, !0)
+ headers: (p, h, g) => n(Qg(p), Qg(h), g, !0)
};
return Pe.forEach(Object.keys(Object.assign({}, e, t)), function(h) {
const g = d[h] || n, _ = g(e[h], t[h], h);
Pe.isUndefined(_) && g !== u || (i[h] = _);
}), i;
}
-const Wb = (e) => {
+const Kb = (e) => {
const t = Qr({}, e);
let { data: i, withXSRFToken: r, xsrfHeaderName: n, xsrfCookieName: a, headers: s, auth: u } = t;
- t.headers = s = xi.from(s), t.url = Bb(zb(t.baseURL, t.url, t.allowAbsoluteUrls), e.params, e.paramsSerializer), u && s.set(
+ t.headers = s = xi.from(s), t.url = jb(Gb(t.baseURL, t.url, t.allowAbsoluteUrls), e.params, e.paramsSerializer), u && s.set(
"Authorization",
"Basic " + btoa((u.username || "") + ":" + (u.password ? unescape(encodeURIComponent(u.password)) : ""))
);
@@ -43665,14 +43667,14 @@ const Wb = (e) => {
s.setContentType([p || "multipart/form-data", ...h].join("; "));
}
}
- if (Dn.hasStandardBrowserEnv && (r && Pe.isFunction(r) && (r = r(t)), r || r !== !1 && O8(t.url))) {
- const p = n && a && $8.read(a);
+ if (Dn.hasStandardBrowserEnv && (r && Pe.isFunction(r) && (r = r(t)), r || r !== !1 && R8(t.url))) {
+ const p = n && a && D8.read(a);
p && s.set(n, p);
}
return t;
-}, I8 = typeof XMLHttpRequest < "u", F8 = I8 && function(e) {
+}, P8 = typeof XMLHttpRequest < "u", M8 = P8 && function(e) {
return new Promise(function(i, r) {
- const n = Wb(e);
+ const n = Kb(e);
let a = n.data;
const s = xi.from(n.headers).normalize();
let { responseType: u, onUploadProgress: d, onDownloadProgress: p } = n, h, g, _, S, b;
@@ -43694,7 +43696,7 @@ const Wb = (e) => {
config: e,
request: y
};
- Hb(function(M) {
+ Wb(function(M) {
i(M), A();
}, function(M) {
r(M), A();
@@ -43708,7 +43710,7 @@ const Wb = (e) => {
r(new Tt("Network Error", Tt.ERR_NETWORK, e, y)), y = null;
}, y.ontimeout = function() {
let x = n.timeout ? "timeout of " + n.timeout + "ms exceeded" : "timeout exceeded";
- const k = n.transitional || Vb;
+ const k = n.transitional || Ub;
n.timeoutErrorMessage && (x = n.timeoutErrorMessage), r(new Tt(
x,
k.clarifyTimeoutError ? Tt.ETIMEDOUT : Tt.ECONNABORTED,
@@ -43720,14 +43722,14 @@ const Wb = (e) => {
}), Pe.isUndefined(n.withCredentials) || (y.withCredentials = !!n.withCredentials), u && u !== "json" && (y.responseType = n.responseType), p && ([_, b] = nu(p, !0), y.addEventListener("progress", _)), d && y.upload && ([g, S] = nu(d), y.upload.addEventListener("progress", g), y.upload.addEventListener("loadend", S)), (n.cancelToken || n.signal) && (h = (E) => {
!y || (r(!E || E.type ? new ia(null, e, y) : E), y.abort(), y = null);
}, n.cancelToken && n.cancelToken.subscribe(h), n.signal && (n.signal.aborted ? h() : n.signal.addEventListener("abort", h)));
- const w = x8(n.url);
+ const w = k8(n.url);
if (w && Dn.protocols.indexOf(w) === -1) {
r(new Tt("Unsupported protocol " + w + ":", Tt.ERR_BAD_REQUEST, e));
return;
}
y.send(a || null);
});
-}, P8 = (e, t) => {
+}, L8 = (e, t) => {
const { length: i } = e = e ? e.filter(Boolean) : [];
if (t || i) {
let r = new AbortController(), n;
@@ -43750,7 +43752,7 @@ const Wb = (e) => {
const { signal: d } = r;
return d.unsubscribe = () => Pe.asap(u), d;
}
-}, M8 = P8, L8 = function* (e, t) {
+}, N8 = L8, B8 = function* (e, t) {
let i = e.byteLength;
if (!t || i < t) {
yield e;
@@ -43759,10 +43761,10 @@ const Wb = (e) => {
let r = 0, n;
for (; r < i; )
n = r + t, yield e.slice(r, n), r = n;
-}, N8 = async function* (e, t) {
- for await (const i of B8(e))
- yield* L8(i, t);
-}, B8 = async function* (e) {
+}, V8 = async function* (e, t) {
+ for await (const i of j8(e))
+ yield* B8(i, t);
+}, j8 = async function* (e) {
if (e[Symbol.asyncIterator]) {
yield* e;
return;
@@ -43778,8 +43780,8 @@ const Wb = (e) => {
} finally {
await t.cancel();
}
-}, Yg = (e, t, i, r) => {
- const n = N8(e, t);
+}, Jg = (e, t, i, r) => {
+ const n = V8(e, t);
let a = 0, s, u = (d) => {
s || (s = !0, r && r(d));
};
@@ -43807,13 +43809,13 @@ const Wb = (e) => {
}, {
highWaterMark: 2
});
-}, $u = typeof fetch == "function" && typeof Request == "function" && typeof Response == "function", Gb = $u && typeof ReadableStream == "function", V8 = $u && (typeof TextEncoder == "function" ? ((e) => (t) => e.encode(t))(new TextEncoder()) : async (e) => new Uint8Array(await new Response(e).arrayBuffer())), Kb = (e, ...t) => {
+}, $u = typeof fetch == "function" && typeof Request == "function" && typeof Response == "function", Yb = $u && typeof ReadableStream == "function", U8 = $u && (typeof TextEncoder == "function" ? ((e) => (t) => e.encode(t))(new TextEncoder()) : async (e) => new Uint8Array(await new Response(e).arrayBuffer())), Qb = (e, ...t) => {
try {
return !!e(...t);
} catch {
return !1;
}
-}, j8 = Gb && Kb(() => {
+}, H8 = Yb && Qb(() => {
let e = !1;
const t = new Request(Dn.origin, {
body: new ReadableStream(),
@@ -43823,8 +43825,8 @@ const Wb = (e) => {
}
}).headers.has("Content-Type");
return e && !t;
-}), Qg = 64 * 1024, Tc = Gb && Kb(() => Pe.isReadableStream(new Response("").body)), iu = {
- stream: Tc && ((e) => e.body)
+}), Xg = 64 * 1024, kc = Yb && Qb(() => Pe.isReadableStream(new Response("").body)), iu = {
+ stream: kc && ((e) => e.body)
};
$u && ((e) => {
["text", "arrayBuffer", "blob", "formData", "stream"].forEach((t) => {
@@ -43833,7 +43835,7 @@ $u && ((e) => {
});
});
})(new Response());
-const U8 = async (e) => {
+const z8 = async (e) => {
if (e == null)
return 0;
if (Pe.isBlob(e))
@@ -43846,11 +43848,11 @@ const U8 = async (e) => {
if (Pe.isArrayBufferView(e) || Pe.isArrayBuffer(e))
return e.byteLength;
if (Pe.isURLSearchParams(e) && (e = e + ""), Pe.isString(e))
- return (await V8(e)).byteLength;
-}, H8 = async (e, t) => {
+ return (await U8(e)).byteLength;
+}, W8 = async (e, t) => {
const i = Pe.toFiniteNumber(e.getContentLength());
- return i == null ? U8(t) : i;
-}, z8 = $u && (async (e) => {
+ return i == null ? z8(t) : i;
+}, G8 = $u && (async (e) => {
let {
url: t,
method: i,
@@ -43864,26 +43866,26 @@ const U8 = async (e) => {
headers: h,
withCredentials: g = "same-origin",
fetchOptions: _
- } = Wb(e);
+ } = Kb(e);
p = p ? (p + "").toLowerCase() : "text";
- let S = M8([n, a && a.toAbortSignal()], s), b;
+ let S = N8([n, a && a.toAbortSignal()], s), b;
const A = S && S.unsubscribe && (() => {
S.unsubscribe();
});
let y;
try {
- if (d && j8 && i !== "get" && i !== "head" && (y = await H8(h, r)) !== 0) {
+ if (d && H8 && i !== "get" && i !== "head" && (y = await W8(h, r)) !== 0) {
let k = new Request(t, {
method: "POST",
body: r,
duplex: "half"
}), R;
if (Pe.isFormData(r) && (R = k.headers.get("content-type")) && h.setContentType(R), k.body) {
- const [M, P] = Wg(
+ const [M, P] = Kg(
y,
- nu(Gg(d))
+ nu(Yg(d))
);
- r = Yg(k.body, Qg, M, P);
+ r = Jg(k.body, Xg, M, P);
}
}
Pe.isString(g) || (g = g ? "include" : "omit");
@@ -43898,18 +43900,18 @@ const U8 = async (e) => {
credentials: m ? g : void 0
});
let w = await fetch(b);
- const E = Tc && (p === "stream" || p === "response");
- if (Tc && (u || E && A)) {
+ const E = kc && (p === "stream" || p === "response");
+ if (kc && (u || E && A)) {
const k = {};
["status", "statusText", "headers"].forEach((B) => {
k[B] = w[B];
});
- const R = Pe.toFiniteNumber(w.headers.get("content-length")), [M, P] = u && Wg(
+ const R = Pe.toFiniteNumber(w.headers.get("content-length")), [M, P] = u && Kg(
R,
- nu(Gg(u), !0)
+ nu(Yg(u), !0)
) || [];
w = new Response(
- Yg(w.body, Qg, M, () => {
+ Jg(w.body, Xg, M, () => {
P && P(), A && A();
}),
k
@@ -43918,7 +43920,7 @@ const U8 = async (e) => {
p = p || "text";
let x = await iu[Pe.findKey(iu, p) || "text"](w, e);
return !E && A && A(), await new Promise((k, R) => {
- Hb(k, R, {
+ Wb(k, R, {
data: x,
headers: xi.from(w.headers),
status: w.status,
@@ -43935,12 +43937,12 @@ const U8 = async (e) => {
}
) : Tt.from(m, m && m.code, e, b);
}
-}), kc = {
- http: i8,
- xhr: F8,
- fetch: z8
+}), Oc = {
+ http: o8,
+ xhr: M8,
+ fetch: G8
};
-Pe.forEach(kc, (e, t) => {
+Pe.forEach(Oc, (e, t) => {
if (e) {
try {
Object.defineProperty(e, "name", { value: t });
@@ -43949,7 +43951,7 @@ Pe.forEach(kc, (e, t) => {
Object.defineProperty(e, "adapterName", { value: t });
}
});
-const Jg = (e) => `- ${e}`, W8 = (e) => Pe.isFunction(e) || e === null || e === !1, Yb = {
+const Zg = (e) => `- ${e}`, K8 = (e) => Pe.isFunction(e) || e === null || e === !1, Jb = {
getAdapter: (e) => {
e = Pe.isArray(e) ? e : [e];
const { length: t } = e;
@@ -43958,7 +43960,7 @@ const Jg = (e) => `- ${e}`, W8 = (e) => Pe.isFunction(e) || e === null || e ===
for (let a = 0; a < t; a++) {
i = e[a];
let s;
- if (r = i, !W8(i) && (r = kc[(s = String(i)).toLowerCase()], r === void 0))
+ if (r = i, !K8(i) && (r = Oc[(s = String(i)).toLowerCase()], r === void 0))
throw new Tt(`Unknown adapter '${s}'`);
if (r)
break;
@@ -43969,8 +43971,8 @@ const Jg = (e) => `- ${e}`, W8 = (e) => Pe.isFunction(e) || e === null || e ===
([u, d]) => `adapter ${u} ` + (d === !1 ? "is not supported by the environment" : "is not available in the build")
);
let s = t ? a.length > 1 ? `since :
-` + a.map(Jg).join(`
-`) : " " + Jg(a[0]) : "as no adapter specified";
+` + a.map(Zg).join(`
+`) : " " + Zg(a[0]) : "as no adapter specified";
throw new Tt(
"There is no suitable adapter to dispatch the request " + s,
"ERR_NOT_SUPPORT"
@@ -43978,40 +43980,40 @@ const Jg = (e) => `- ${e}`, W8 = (e) => Pe.isFunction(e) || e === null || e ===
}
return r;
},
- adapters: kc
+ adapters: Oc
};
-function rc(e) {
+function oc(e) {
if (e.cancelToken && e.cancelToken.throwIfRequested(), e.signal && e.signal.aborted)
throw new ia(null, e);
}
-function Xg(e) {
- return rc(e), e.headers = xi.from(e.headers), e.data = ic.call(
+function qg(e) {
+ return oc(e), e.headers = xi.from(e.headers), e.data = rc.call(
e,
e.transformRequest
- ), ["post", "put", "patch"].indexOf(e.method) !== -1 && e.headers.setContentType("application/x-www-form-urlencoded", !1), Yb.getAdapter(e.adapter || Up.adapter)(e).then(function(r) {
- return rc(e), r.data = ic.call(
+ ), ["post", "put", "patch"].indexOf(e.method) !== -1 && e.headers.setContentType("application/x-www-form-urlencoded", !1), Jb.getAdapter(e.adapter || Hp.adapter)(e).then(function(r) {
+ return oc(e), r.data = rc.call(
e,
e.transformResponse,
r
), r.headers = xi.from(r.headers), r;
}, function(r) {
- return Ub(r) || (rc(e), r && r.response && (r.response.data = ic.call(
+ return zb(r) || (oc(e), r && r.response && (r.response.data = rc.call(
e,
e.transformResponse,
r.response
), r.response.headers = xi.from(r.response.headers))), Promise.reject(r);
});
}
-const Qb = "1.9.0", Ru = {};
+const Xb = "1.9.0", Ru = {};
["object", "boolean", "number", "function", "string", "symbol"].forEach((e, t) => {
Ru[e] = function(r) {
return typeof r === e || "a" + (t < 1 ? "n " : " ") + e;
};
});
-const Zg = {};
+const ey = {};
Ru.transitional = function(t, i, r) {
function n(a, s) {
- return "[Axios v" + Qb + "] Transitional option '" + a + "'" + s + (r ? ". " + r : "");
+ return "[Axios v" + Xb + "] Transitional option '" + a + "'" + s + (r ? ". " + r : "");
}
return (a, s, u) => {
if (t === !1)
@@ -44019,7 +44021,7 @@ Ru.transitional = function(t, i, r) {
n(s, " has been removed" + (i ? " in " + i : "")),
Tt.ERR_DEPRECATED
);
- return i && !Zg[s] && (Zg[s] = !0, console.warn(
+ return i && !ey[s] && (ey[s] = !0, console.warn(
n(
s,
" has been deprecated since v" + i + " and will be removed in the near future"
@@ -44030,7 +44032,7 @@ Ru.transitional = function(t, i, r) {
Ru.spelling = function(t) {
return (i, r) => (console.warn(`${r} is likely a misspelling of ${t}`), !0);
};
-function G8(e, t, i) {
+function Y8(e, t, i) {
if (typeof e != "object")
throw new Tt("options must be an object", Tt.ERR_BAD_OPTION_VALUE);
const r = Object.keys(e);
@@ -44048,14 +44050,14 @@ function G8(e, t, i) {
}
}
const Ls = {
- assertOptions: G8,
+ assertOptions: Y8,
validators: Ru
}, Li = Ls.validators;
class ru {
constructor(t) {
this.defaults = t || {}, this.interceptors = {
- request: new Hg(),
- response: new Hg()
+ request: new Wg(),
+ response: new Wg()
};
}
async request(t, i) {
@@ -44112,7 +44114,7 @@ class ru {
});
let h, g = 0, _;
if (!d) {
- const b = [Xg.bind(this), void 0];
+ const b = [qg.bind(this), void 0];
for (b.unshift.apply(b, u), b.push.apply(b, p), _ = b.length, h = Promise.resolve(i); g < _; )
h = h.then(b[g++], b[g++]);
return h;
@@ -44129,7 +44131,7 @@ class ru {
}
}
try {
- h = Xg.call(this, S);
+ h = qg.call(this, S);
} catch (b) {
return Promise.reject(b);
}
@@ -44139,8 +44141,8 @@ class ru {
}
getUri(t) {
t = Qr(this.defaults, t);
- const i = zb(t.baseURL, t.url, t.allowAbsoluteUrls);
- return Bb(i, t.params, t.paramsSerializer);
+ const i = Gb(t.baseURL, t.url, t.allowAbsoluteUrls);
+ return jb(i, t.params, t.paramsSerializer);
}
}
Pe.forEach(["delete", "get", "head", "options"], function(t) {
@@ -44168,7 +44170,7 @@ Pe.forEach(["post", "put", "patch"], function(t) {
ru.prototype[t] = i(), ru.prototype[t + "Form"] = i(!0);
});
const Ns = ru;
-class Hp {
+class zp {
constructor(t) {
if (typeof t != "function")
throw new TypeError("executor must be a function.");
@@ -44222,23 +44224,23 @@ class Hp {
static source() {
let t;
return {
- token: new Hp(function(n) {
+ token: new zp(function(n) {
t = n;
}),
cancel: t
};
}
}
-const K8 = Hp;
-function Y8(e) {
+const Q8 = zp;
+function J8(e) {
return function(i) {
return e.apply(null, i);
};
}
-function Q8(e) {
+function X8(e) {
return Pe.isObject(e) && e.isAxiosError === !0;
}
-const Oc = {
+const $c = {
Continue: 100,
SwitchingProtocols: 101,
Processing: 102,
@@ -44303,70 +44305,70 @@ const Oc = {
NotExtended: 510,
NetworkAuthenticationRequired: 511
};
-Object.entries(Oc).forEach(([e, t]) => {
- Oc[t] = e;
+Object.entries($c).forEach(([e, t]) => {
+ $c[t] = e;
});
-const J8 = Oc;
-function Jb(e) {
- const t = new Ns(e), i = Tb(Ns.prototype.request, t);
+const Z8 = $c;
+function Zb(e) {
+ const t = new Ns(e), i = Ob(Ns.prototype.request, t);
return Pe.extend(i, Ns.prototype, t, { allOwnKeys: !0 }), Pe.extend(i, t, null, { allOwnKeys: !0 }), i.create = function(n) {
- return Jb(Qr(e, n));
+ return Zb(Qr(e, n));
}, i;
}
-const cn = Jb(Up);
+const cn = Zb(Hp);
cn.Axios = Ns;
cn.CanceledError = ia;
-cn.CancelToken = K8;
-cn.isCancel = Ub;
-cn.VERSION = Qb;
+cn.CancelToken = Q8;
+cn.isCancel = zb;
+cn.VERSION = Xb;
cn.toFormData = ku;
cn.AxiosError = Tt;
cn.Cancel = cn.CanceledError;
cn.all = function(t) {
return Promise.all(t);
};
-cn.spread = Y8;
-cn.isAxiosError = Q8;
+cn.spread = J8;
+cn.isAxiosError = X8;
cn.mergeConfig = Qr;
cn.AxiosHeaders = xi;
-cn.formToJSON = (e) => jb(Pe.isHTMLForm(e) ? new FormData(e) : e);
-cn.getAdapter = Yb.getAdapter;
-cn.HttpStatusCode = J8;
+cn.formToJSON = (e) => Hb(Pe.isHTMLForm(e) ? new FormData(e) : e);
+cn.getAdapter = Jb.getAdapter;
+cn.HttpStatusCode = Z8;
cn.default = cn;
-const qg = cn;
-jo.registerLanguage("javascript", UP);
-jo.registerLanguage("xml", jP);
-const X8 = Be({
+const ty = cn;
+Vo.registerLanguage("javascript", zP);
+Vo.registerLanguage("xml", HP);
+const q8 = Be({
name: "FcDesigner",
components: {
- AiChat: gB,
- SlotsConfig: WN,
+ AiChat: bB,
+ SlotsConfig: KN,
Warning: ki,
- QuickLayout: XN,
- PrintForm: tB,
- LanguageConfig: BN,
- PropsInput: xN,
- JsonPreview: bN,
- GlobalVariableConfig: Eb,
- GlobalClassConfig: Sb,
- GlobalEventConfig: gb,
- GlobalFetchConfig: yb,
- FormList: sM,
- FieldList: Q3,
- TypeSelect: V3,
- ConfigTitle: mb,
+ QuickLayout: qN,
+ PrintForm: iB,
+ LanguageConfig: jN,
+ PropsInput: kN,
+ JsonPreview: wN,
+ GlobalVariableConfig: Tb,
+ GlobalClassConfig: xb,
+ GlobalEventConfig: bb,
+ GlobalFetchConfig: _b,
+ FormList: dM,
+ FieldList: X3,
+ TypeSelect: U3,
+ ConfigTitle: gb,
VariableConfig: ml,
- ToolsBar: D3,
- SubList: x3,
- PageInput: a3,
- fcDraggable: Yo,
+ ToolsBar: F3,
+ SubList: k3,
+ PageInput: s3,
+ fcDraggable: Ko,
DragForm: tt.$form(),
ViewForm: li.$form(),
- DragFormMobile: qo.$form(),
- ViewFormMobile: LI.$form(),
- EventConfig: q0,
+ DragFormMobile: Zo.$form(),
+ ViewFormMobile: BI.$form(),
+ EventConfig: tb,
ConfigItem: si,
- VNode: eb
+ VNode: nb
},
props: {
menu: Array,
@@ -44395,14 +44397,14 @@ const X8 = Be({
var ge, ve, we, he, Se, xe;
let t;
t = !1;
- const { menu: i, height: r, mask: n, locale: a, handle: s } = zm(e), u = lw(), d = vi({ active: null });
- Wm("fcx", d), Wm("designer", u);
+ const { menu: i, height: r, mask: n, locale: a, handle: s } = Wm(e), u = uw(), d = vi({ active: null });
+ Gm("fcx", d), Gm("designer", u);
const p = e.appUrl, h = Ei(e, "config", {}), g = Ei(e, "theme"), _ = Ei(e, "field", []), S = Ei(e, "list", []), b = Ei(h.value, "baseRule", null), A = Ei(h.value, "componentRule", {}), y = Ei(h.value, "updateDefaultRule", {}), m = Ei(h.value, "validateRule", null), w = Ei(h.value, "formRule", null), E = Cn(() => {
const $ = r.value;
return $ ? St.Number($) ? `${$}px` : $ : "100%";
}), x = Cn(() => h.value.fieldReadonly !== !1), k = Cn(() => h.value.fieldList || []), R = Cn(() => h.value.varList || []), M = Cn(() => h.value.hiddenMenu || []), P = Cn(() => h.value.hiddenItem || []), B = Cn(() => h.value.hiddenDragMenu === !0), T = Cn(() => h.value.hiddenDragBtn === !0), D = Cn(() => u.refs.dragCon.clientHeight), V = Cn(() => {
var $;
- return ((($ = a.value) == null ? void 0 : $.name) || "zh-cn") === "zh-cn" ? M3 : null;
+ return ((($ = a.value) == null ? void 0 : $.name) || "zh-cn") === "zh-cn" ? N3 : null;
}), W = Cn(() => te.getConfig("showGridLine") !== !1 || te.getConfig("showQuickLayout") !== !1 || te.getConfig("showPrintBtn") !== !1), G = Cn(() => {
const $ = ["base", "advanced", "props", "slots", "style", "event", "validate"];
let K = h.value.configFormOrder ? [...h.value.configFormOrder] : [], X = [];
@@ -44410,11 +44412,11 @@ const X8 = Be({
X.indexOf(ie) === -1 && $.indexOf(ie) > -1 && X.push(ie);
}) : X = $, X.map((ie) => `"${ie}"`).join(" ");
});
- xo(g, ($, K) => {
+ Eo(g, ($, K) => {
K && document.body.classList.remove("fd-theme-" + K), $ && document.body.classList.add("fd-theme-" + $);
});
- let I = wc;
- a.value && (I = oc(a).t);
+ let I = Ac;
+ a.value && (I = ac(a).t);
const U = (...$) => I(...$), F = ($, K, ...X) => {
if (K) {
if (St.Function(K))
@@ -44445,7 +44447,7 @@ const X8 = Be({
}
},
fieldData: [],
- datasetId: "",
+ tableId: "",
pageData: [],
gridLine: !1,
hiddenLeft: !1,
@@ -44453,7 +44455,7 @@ const X8 = Be({
moveRule: null,
addRule: null,
added: null,
- bus: Sw(),
+ bus: xw(),
device: ((ge = h.value) == null ? void 0 : ge.device) || "pc",
activeModule: "base",
activeTab: "form",
@@ -44462,7 +44464,7 @@ const X8 = Be({
activeRule: null,
children: Bs([]),
treeInfo: [],
- menuList: i.value || a2(),
+ menuList: i.value || s2(),
dragRuleList: {},
eventShow: !1,
unloadStatus: !1,
@@ -44493,7 +44495,7 @@ const X8 = Be({
},
oldOptionsKeys: [],
form: {
- rule: F(Xm, w.value, { t: U }),
+ rule: F(Zm, w.value, { t: U }),
api: {},
option: {
global: {
@@ -44545,7 +44547,7 @@ const X8 = Be({
},
advancedForm: {
isShow: !1,
- rule: qm({ t: U }),
+ rule: ev({ t: U }),
api: {},
value: {},
options: {
@@ -44571,7 +44573,7 @@ const X8 = Be({
},
styleForm: {
isShow: !1,
- rule: Zm({ t: U }),
+ rule: qm({ t: U }),
api: {},
value: {},
options: {
@@ -44587,7 +44589,7 @@ const X8 = Be({
},
validateForm: {
isShow: !1,
- rule: F(ev, m.value, { t: U }),
+ rule: F(tv, m.value, { t: U }),
api: {},
value: [],
options: {
@@ -44665,11 +44667,11 @@ const X8 = Be({
let ie = $.children;
return K.inside && (ie = ie[0].children), X.inside || (ie = ie.map((re) => re.children[0])), ie.filter((re) => re._fc_drag_tag === X.name);
});
- xo(() => C.preview.state, function($) {
+ Eo(() => C.preview.state, function($) {
$ || Yn(() => {
C.previewStatus = "form", C.preview.rule = C.preview.option = null;
});
- }), xo(() => C.previewStatus, ($) => {
+ }), Eo(() => C.previewStatus, ($) => {
C.preview.rule && (C.preview.option.preview = $ === "preview");
});
let Z = null;
@@ -44686,16 +44688,16 @@ const X8 = Be({
Ae || (fe = js(fe)), re[fe] || (re[fe] = {}), re = re[fe];
}), K({ source: re, field: ie });
}, ue = Cn(() => C.pageData.filter(($) => !$.default).length);
- xo(() => a.value, ($) => {
- I = $ ? oc(a).t : wc, te.clearActiveRule();
+ Eo(() => a.value, ($) => {
+ I = $ ? ac(a).t : Ac, te.clearActiveRule();
const K = C.form.api.formData && C.form.api.formData(), X = C.baseForm.api.formData && C.baseForm.api.formData(), ie = C.validateForm.api.formData && C.validateForm.api.formData();
- C.validateForm.rule = F(ev, m.value, { t: U }), C.baseForm.rule = F(Fa, b.value, { t: U }), C.form.rule = F(Xm, w.value, { t: U }), C.styleForm.rule = Zm({ t: U }), C.advancedForm.rule = qm({ t: U }), C.cacheProps = {};
+ C.validateForm.rule = F(tv, m.value, { t: U }), C.baseForm.rule = F(Fa, b.value, { t: U }), C.form.rule = F(Zm, w.value, { t: U }), C.styleForm.rule = qm({ t: U }), C.advancedForm.rule = ev({ t: U }), C.cacheProps = {};
const re = C.activeRule;
let fe = null;
re && (fe = C.propsForm.api.formData && C.propsForm.api.formData(), C.propsForm.rule = C.cacheProps[re._fc_id] = te.getPropsRule(re)), Yn(() => {
K && C.form.api.setValue(K), X && C.baseForm.api.setValue(X), ie && C.validateForm.api.setValue(ie), fe && C.propsForm.api.setValue(fe);
});
- }), xo(() => h.value.license, ($) => {
+ }), Eo(() => h.value.license, ($) => {
li.license = $, tt.license = $, window && window.formCreate && (window.formCreate.license = $);
}, { immediate: !0 });
const te = {
@@ -44705,32 +44707,49 @@ const X8 = Be({
});
},
onDatasetChange($) {
- let K = p;
- K == null && (K = ""), C.fieldData = [], qg.get(K + "/datasetData/getFieldsByTableId", {
+ let K = "eyJ0eXAiOiJKV1QiLCJhbGciOiJIUzI1NiJ9.eyJ1aWQiOjEsIm9pZCI6MX0.i8pMPviPZoQyjXML3dLfLek4XML2acUf-x0K90u9KoY";
+ if (localStorage.getItem("user.token") != null && localStorage.getItem("user.token") != "") {
+ const ie = JSON.parse(localStorage.getItem("user.token"));
+ K = JSON.parse(ie.v);
+ }
+ let X = p;
+ X == null && (X = ""), C.fieldData = [], ty.get(X + "/datasetData/getFieldsByTableId", {
+ headers: {
+ "X-De-Token": K
+ },
params: {
id: $
}
- }).then((X) => {
- console.log(X), X.data.data.forEach((ie) => {
- ie.label = ie.name, ie.item = "input", ie.fieldtype = ie.type, ie.maxlength = ie.size, ie.field = ie.origin_name, ie.update = {
+ }).then((ie) => {
+ console.log(ie), ie.data.data.forEach((re) => {
+ re.label = re.name, re.item = "input", re.fieldtype = re.type, re.maxlength = re.size, re.field = re.origin_name, re.update = {
disabled: !1
- }, C.fieldData.push(ie);
+ }, C.fieldData.push(re);
});
- }).catch((X) => {
- console.error(" \u8BF7\u6C42\u51FA\u9519:", X);
+ }).catch((ie) => {
+ console.error(" \u8BF7\u6C42\u51FA\u9519:", ie);
});
},
getInit() {
C.formOptions.appUrl = p;
let $ = p;
- $ == null && ($ = ""), qg.get($ + "/datasetData/getTablesByAppId", {
+ $ == null && ($ = "");
+ let K = "eyJ0eXAiOiJKV1QiLCJhbGciOiJIUzI1NiJ9.eyJ1aWQiOjEsIm9pZCI6MX0.i8pMPviPZoQyjXML3dLfLek4XML2acUf-x0K90u9KoY";
+ if (localStorage.getItem("user.token") != null && localStorage.getItem("user.token") != "") {
+ const X = JSON.parse(localStorage.getItem("user.token"));
+ K = JSON.parse(X.v);
+ }
+ ty.get($ + "/datasetData/getTablesByAppId", {
+ headers: {
+ "X-De-Token": K
+ },
params: {
appid: e.appId
}
- }).then((K) => {
- C.datasetData = K.data.data;
- }).catch((K) => {
- console.error(" \u8BF7\u6C42\u51FA\u9519:", K);
+ }).then((X) => {
+ C.datasetData = X.data.data;
+ }).catch((X) => {
+ console.error(" \u8BF7\u6C42\u51FA\u9519:", X);
});
},
setDevice($) {
@@ -44765,7 +44784,7 @@ const X8 = Be({
copyPage($) {
if ($) {
const K = C.pageData[$], X = gt(C.pageData[$].rule)[0], ie = X.type === "DragTool" ? X.children[0] : X;
- ie.name = "ref_" + rt(), ie._fc_id = "id_" + rt(), hg(ie, K.config.labelField, Wo(ie, K.config.labelField, "") + " Copy"), C.pageData.splice($ + 1, 0, {
+ ie.name = "ref_" + rt(), ie._fc_id = "id_" + rt(), vg(ie, K.config.labelField, zo(ie, K.config.labelField, "") + " Copy"), C.pageData.splice($ + 1, 0, {
config: K.config,
type: K.type,
main: ie,
@@ -44806,7 +44825,7 @@ const X8 = Be({
Z && Z(), Z = null;
},
watchActiveRule() {
- te.unWatchActiveRule(), Z = xo(() => C.activeRule, function($) {
+ te.unWatchActiveRule(), Z = Eo(() => C.activeRule, function($) {
$ && te.updateRuleFormData();
}, { deep: !0, flush: "post" });
},
@@ -44858,7 +44877,7 @@ const X8 = Be({
ji($[X]) && delete $[X];
});
const K = JSON.stringify(te.getPreviewFormData()) !== JSON.stringify($);
- C.activePage.default ? (C.inputForm.data = $, u.emit("inputData", $)) : (hg(C.activePage.main, C.activePage.config.formDataField, $), u.emit("inputPageData", $)), C.inputForm.state = !1, K && te.addOperationRecord();
+ C.activePage.default ? (C.inputForm.data = $, u.emit("inputData", $)) : (vg(C.activePage.main, C.activePage.config.formDataField, $), u.emit("inputPageData", $)), C.inputForm.state = !1, K && te.addOperationRecord();
},
inputClear() {
te.inputReset({});
@@ -44937,7 +44956,7 @@ const X8 = Be({
});
},
getPreviewFormData() {
- return C.activePage.default ? C.inputForm.data : Wo(C.activePage.main, C.activePage.config.formDataField, {}) || {};
+ return C.activePage.default ? C.inputForm.data : zo(C.activePage.main, C.activePage.config.formDataField, {}) || {};
},
getPreviewRule() {
return C.activePage.default ? te.getJson() : tt.toJson(te.parseRule(gt(C.children)));
@@ -44951,14 +44970,14 @@ const X8 = Be({
openPreview() {
C.preview.state = !0, C.previewDevice = C.device === "mobile" ? "mobile" : "pc";
const $ = te.getPreviewRule(), K = te.getOptionsJson(), X = te.getConfig("useTemplate", !1);
- C.preview.option = tt.parseJson(K), C.activePage.default || (C.preview.option.formData = gt(te.getPreviewFormData())), C.preview.rule = tt.parseJson($), C.preview.html = jo.highlight(
- X ? hw($, K) : mw($, K),
- { language: "xml" }
- ).value, C.preview.mobileHtml = jo.highlight(
+ C.preview.option = tt.parseJson(K), C.activePage.default || (C.preview.option.formData = gt(te.getPreviewFormData())), C.preview.rule = tt.parseJson($), C.preview.html = Vo.highlight(
X ? vw($, K) : gw($, K),
{ language: "xml" }
- ).value, C.preview.sfc = jo.highlight(
- y3(C.children, C.preview.option, C.dragRuleList, X),
+ ).value, C.preview.mobileHtml = Vo.highlight(
+ X ? yw($, K) : bw($, K),
+ { language: "xml" }
+ ).value, C.preview.sfc = Vo.highlight(
+ _3(C.children, C.preview.option, C.dragRuleList, X),
{ language: "xml" }
).value;
},
@@ -45013,6 +45032,7 @@ const X8 = Be({
return tt.toJson([te.getOption()]).slice(1).slice(0, -1);
},
setRule($, K) {
+ debugger;
$ || ($ = []), !K && te.initPage();
const X = te.loadRule(St.String($) ? tt.parseJson($) : gt($)), ie = [];
X.forEach((re) => {
@@ -45045,6 +45065,7 @@ const X8 = Be({
C.activeRule = null, C.customForm.config = null, C.activeTab = "form", d.active = "";
},
setOption($) {
+ $.datasetInfo && $.datasetInfo.table_id && (C.tableId = $.datasetInfo.table_id, te.dsClick(C.tableId));
const K = gt(te.getConfig("formOptions", {})), X = K.form || {};
delete K.form;
let ie = { ...K, ...St.String($) ? JSON.parse($) : gt($ || {}) };
@@ -45127,7 +45148,7 @@ const X8 = Be({
if (re._fc_drag_skip)
return;
let fe = C.dragRuleList[re._fc_drag_tag] || C.dragRuleList[re.type];
- if (fe || (fe = fE(re), re._fc_drag_tag = "_"), X && (re._fc_template = X), fe && fe.loadRule && fe.loadRule(re), re.children = te.loadRule(re.children || [], fe, X), fe) {
+ if (fe || (fe = pE(re), re._fc_drag_tag = "_"), X && (re._fc_template = X), fe && fe.loadRule && fe.loadRule(re), re.children = te.loadRule(re.children || [], fe, X), fe) {
const Ae = re.slot;
let Fe;
K && K.slot && Ae && Ae !== "default" && (Fe = te.getSlotConfig(K, Ae, fe)), delete re.slot, re = te.makeRule(Fe || fe, re), Ae && (re.slot = Ae);
@@ -45313,9 +45334,9 @@ const X8 = Be({
St.Function(X) ? K = { ...K, ...X($) } : Array.isArray(X) && X.forEach((fe) => {
K[fe] = void 0;
}), Object.keys($).forEach((fe) => {
- ["effect", "config", "payload", "id", "type", "_menu"].indexOf(fe) < 0 && (K["formCreate" + zo(fe)] = gt($[fe]));
+ ["effect", "config", "payload", "id", "type", "_menu"].indexOf(fe) < 0 && (K["formCreate" + Ho(fe)] = gt($[fe]));
}), te.processObj($.props || {}, K), ["props", "effect", "attrs", "style", "wrap", "col"].forEach((fe) => {
- $[fe] && typeof $[fe] == "object" && te.processObj($[fe] || {}, K, "formCreate" + zo(fe));
+ $[fe] && typeof $[fe] == "object" && te.processObj($[fe] || {}, K, "formCreate" + Ho(fe));
});
const ie = {};
["value", "hidden", "$required", "props.disabled"].forEach((fe) => {
@@ -45502,7 +45523,7 @@ const X8 = Be({
},
checkAllowDrag($, K) {
function X(fe) {
- return Array.isArray(fe) && (fe = { item: fe }), pg(fe.item).indexOf($.name) > -1 ? !0 : pg(fe.menu).indexOf($.menu) > -1;
+ return Array.isArray(fe) && (fe = { item: fe }), mg(fe.item).indexOf($.name) > -1 ? !0 : mg(fe.menu).indexOf($.menu) > -1;
}
const ie = te.getConfig("allowDrag", {})[K.name], re = te.getConfig("denyDrag", {})[K.name];
return K.allowDrag && X(K.allowDrag) || ie && X(ie) ? !0 : K.allowDrag || ie || K.denyDrag && X(K.denyDrag) ? !1 : !(re && X(re));
@@ -45546,7 +45567,7 @@ const X8 = Be({
}
else {
let Re = gt(ie);
- delete Re.children, delete Re.component, X = vb([X, Re]);
+ delete Re.children, delete Re.component, X = yb([X, Re]);
}
X._menu = Gt({ ...$ }), X._menu._get = () => X, X._fc_id || (X._fc_id = "id_" + rt()), !X.name && !$.aide && (X.name = "ref_" + rt()), $.component && (X.component = Gt($.component)), X._computed || (X._computed = {}), X.effect || (X.effect = {}), $.input && !X.field && (X.field = rt()), X.$easySlots || (X.$easySlots = {}), $.languageKey && te.mergeOptions({
languageKey: $.languageKey
@@ -45765,16 +45786,16 @@ const X8 = Be({
te.triggerActive($.rule);
},
getFormDescription() {
- return Qm(te.getDescription());
+ return Jm(te.getDescription());
},
getDescription() {
- return Jm(C.dragForm.rule[0].children);
+ return Xm(C.dragForm.rule[0].children);
},
getSubFormDescription($) {
let K = $.__fc__ && $.__fc__.parent;
for (; K; ) {
if (K.rule._menu && ["array", "object"].indexOf(K.rule._menu.subForm) > -1)
- return Qm(Jm(K.rule.children));
+ return Jm(Xm(K.rule.children));
K = K.parent;
}
return null;
@@ -45790,7 +45811,7 @@ const X8 = Be({
},
updateTree: Qs(function() {
Yn(() => {
- C.treeInfo = ac(C.dragForm.rule[0].children);
+ C.treeInfo = lc(C.dragForm.rule[0].children);
});
}, 300),
findTree($) {
@@ -45885,12 +45906,12 @@ const X8 = Be({
pe.ArrowUp($);
}
};
- te.initPage(), te.setOption({}), i.value ? vv.forEach(($) => {
+ te.initPage(), te.setOption({}), i.value ? gv.forEach(($) => {
C.dragRuleList[$.name] = $;
- }) : te.addComponent(vv);
+ }) : te.addComponent(gv);
const ke = Cn(() => Object.keys(te.getPreviewFormData()).length > 0);
return {
- ...zm(C),
+ ...Wm(C),
...te,
fieldRef: _,
formListRef: S,
@@ -46027,40 +46048,40 @@ const X8 = Be({
onPopoverHide() {
}
}
-}), Z8 = { class: "_fc-l-label" }, q8 = { class: "_fc-l-info" }, e4 = { class: "_fc-l-global" }, t4 = { class: "_fc-l-label" }, n4 = { class: "_fc-l-label" }, i4 = { class: "_fc-l-label" }, r4 = { class: "_fc-l-label" }, o4 = { class: "_fc-l-label" }, a4 = { class: "_fc-l-info" }, l4 = { class: "_fc-l-label" }, s4 = { class: "_fc-l-info" }, u4 = ["onClick"], d4 = ["onClick"], f4 = { class: "_fc-l-icon" }, c4 = { class: "_fc-l-name" }, p4 = {
+}), e4 = { class: "_fc-l-label" }, t4 = { class: "_fc-l-info" }, n4 = { class: "_fc-l-global" }, i4 = { class: "_fc-l-label" }, r4 = { class: "_fc-l-label" }, o4 = { class: "_fc-l-label" }, a4 = { class: "_fc-l-label" }, l4 = { class: "_fc-l-label" }, s4 = { class: "_fc-l-info" }, u4 = { class: "_fc-l-label" }, d4 = { class: "_fc-l-info" }, f4 = ["onClick"], c4 = ["onClick"], p4 = { class: "_fc-l-icon" }, h4 = { class: "_fc-l-name" }, m4 = {
key: 1,
class: "_fc-l-name"
-}, h4 = { class: "_fc-tree-label" }, m4 = ["onClick"], v4 = { class: "_fc-m-tools-l" }, g4 = { class: "_fc-m-menus" }, y4 = {
+}, v4 = { class: "_fc-tree-label" }, g4 = ["onClick"], y4 = { class: "_fc-m-tools-l" }, b4 = { class: "_fc-m-menus" }, _4 = {
key: 1,
class: "_fc-m-menus"
-}, b4 = {
+}, w4 = {
key: 2,
class: "line"
-}, _4 = { class: "_fc-m-tools-r" }, w4 = { class: "_fd-input-btn" }, A4 = {
+}, A4 = { class: "_fc-m-tools-r" }, C4 = { class: "_fd-input-btn" }, S4 = {
key: 0,
class: "fc-icon icon-check"
-}, C4 = {
+}, E4 = {
key: 0,
class: "_fc-m-input"
-}, S4 = {
+}, x4 = {
key: 0,
class: "_fc-m-input-handle"
-}, E4 = { class: "_fc-r-title" }, x4 = { class: "_fc-r-title" }, T4 = { style: { "grid-area": "base" } }, k4 = { style: { "grid-area": "advanced" } }, O4 = { style: { "grid-area": "props" } }, $4 = { style: { "grid-area": "slots" } }, R4 = { style: { "grid-area": "style" } }, D4 = { style: { "grid-area": "event" } }, I4 = { style: { "grid-area": "validate" } }, F4 = {
+}, T4 = { class: "_fc-r-title" }, k4 = { class: "_fc-r-title" }, O4 = { style: { "grid-area": "base" } }, $4 = { style: { "grid-area": "advanced" } }, R4 = { style: { "grid-area": "props" } }, D4 = { style: { "grid-area": "slots" } }, I4 = { style: { "grid-area": "style" } }, F4 = { style: { "grid-area": "event" } }, P4 = { style: { "grid-area": "validate" } }, M4 = {
key: 0,
class: "_fd-preview-device"
-}, P4 = {
+}, L4 = {
key: 0,
class: "_fd-preview-mobile"
-}, M4 = {
+}, N4 = {
key: 3,
class: "_fd-preview-code",
ref: "previewCode"
-}, L4 = ["innerHTML"], N4 = {
+}, B4 = ["innerHTML"], V4 = {
key: 4,
class: "_fd-preview-code",
ref: "previewCode"
-}, B4 = ["innerHTML"];
-function V4(e, t, i, r, n, a) {
+}, j4 = ["innerHTML"];
+function U4(e, t, i, r, n, a) {
const s = ee("el-tooltip"), u = ee("el-badge"), d = ee("el-aside"), p = ee("AiChat"), h = ee("LanguageConfig"), g = ee("JsonPreview"), _ = ee("GlobalEventConfig"), S = ee("GlobalFetchConfig"), b = ee("GlobalClassConfig"), A = ee("GlobalVariableConfig"), y = ee("el-main"), m = ee("el-container"), w = ee("FormList"), E = ee("PageInput"), x = ee("el-header"), k = ee("fcDraggable"), R = ee("el-option"), M = ee("el-select"), P = ee("FieldList"), B = ee("el-dropdown-item"), T = ee("el-dropdown-menu"), D = ee("el-dropdown"), V = ee("el-tree"), W = ee("QuickLayout"), G = ee("PrintForm"), I = ee("el-button"), U = ee("el-popconfirm"), F = ee("el-switch"), C = ee("ViewForm"), q = ee("DragFormMobile"), Z = ee("DragForm"), Y = ee("ToolsBar"), ue = ee("Warning"), te = ee("TypeSelect"), pe = ee("el-input"), ke = ee("SubList"), ge = ee("ConfigTitle"), ve = ee("VariableConfig"), we = ee("PropsInput"), he = ee("SlotsConfig"), Se = ee("EventConfig"), xe = ee("el-tab-pane"), $ = ee("el-tabs"), K = ee("ViewFormMobile"), X = ee("el-dialog"), ie = ee("el-config-provider");
return H(), me(m, {
class: "_fc-designer",
@@ -46233,28 +46254,28 @@ function V4(e, t, i, r, n, a) {
default: N(() => [
z(y, null, {
default: N(() => [
- J("div", Z8, le(e.t("form.globalConfig")), 1),
- J("div", q8, le(e.t("warning.globalConfig")), 1),
- J("div", e4, [
- J("div", t4, le(e.t("form.globalEvent")), 1),
+ J("div", e4, le(e.t("form.globalConfig")), 1),
+ J("div", t4, le(e.t("warning.globalConfig")), 1),
+ J("div", n4, [
+ J("div", i4, le(e.t("form.globalEvent")), 1),
z(_, {
ref: "globalEvent",
modelValue: e.formOptions.globalEvent,
"onUpdate:modelValue": t[8] || (t[8] = (re) => e.formOptions.globalEvent = re)
}, null, 8, ["modelValue"]),
- J("div", n4, le(e.t("form.globalFetch")), 1),
+ J("div", r4, le(e.t("form.globalFetch")), 1),
z(S, {
ref: "globalFetch",
modelValue: e.formOptions.globalData,
"onUpdate:modelValue": t[9] || (t[9] = (re) => e.formOptions.globalData = re)
}, null, 8, ["modelValue"]),
- J("div", i4, le(e.t("form.globalClass")), 1),
+ J("div", o4, le(e.t("form.globalClass")), 1),
z(b, {
ref: "globalClass",
modelValue: e.formOptions.globalClass,
"onUpdate:modelValue": t[10] || (t[10] = (re) => e.formOptions.globalClass = re)
}, null, 8, ["modelValue"]),
- J("div", r4, le(e.t("computed.variable.title")), 1),
+ J("div", a4, le(e.t("computed.variable.title")), 1),
z(A, {
ref: "globalVariable",
modelValue: e.formOptions.globalVariable,
@@ -46273,8 +46294,8 @@ function V4(e, t, i, r, n, a) {
default: N(() => [
z(y, null, {
default: N(() => [
- J("div", o4, le(e.t("designer.formList")), 1),
- J("div", a4, le(e.t("warning.formList")), 1),
+ J("div", l4, le(e.t("designer.formList")), 1),
+ J("div", s4, le(e.t("warning.formList")), 1),
kt(e.$slots, "form-list", {}, () => [
z(w, { list: e.formListRef }, null, 8, ["list"])
])
@@ -46290,8 +46311,8 @@ function V4(e, t, i, r, n, a) {
default: N(() => [
e.getConfig("showPageManage", !0) ? (H(), me(y, { key: 0 }, {
default: N(() => [
- J("div", l4, le(e.t("designer.pageManage")), 1),
- J("div", s4, le(e.t("warning.pageManage")), 1),
+ J("div", u4, le(e.t("designer.pageManage")), 1),
+ J("div", d4, le(e.t("warning.pageManage")), 1),
z(E, {
onDelete: e.deletePage,
onCopy: e.copyPage,
@@ -46342,7 +46363,7 @@ function V4(e, t, i, r, n, a) {
J("i", {
class: qe(["fc-icon icon-arrow", { down: !re.hidden }])
}, null, 2)
- ], 8, u4),
+ ], 8, f4),
bn(z(k, {
group: { name: "default", pull: "clone", put: !1 },
sort: !1,
@@ -46357,14 +46378,14 @@ function V4(e, t, i, r, n, a) {
onClick: (Fe) => e.clickMenu(Ae)
}, [
re.name !== "template" ? (H(), ae(Me, { key: 0 }, [
- J("div", f4, [
+ J("div", p4, [
J("i", {
class: qe(["fc-icon", Ae.icon || "icon-input"])
}, null, 2)
]),
- J("span", c4, le(e.t("com." + Ae.name + ".name") || Ae.label), 1)
- ], 64)) : (H(), ae("span", p4, le(e.t("tmp." + Ae.name) || Ae.label), 1))
- ], 10, d4)) : Te("", !0)
+ J("span", h4, le(e.t("com." + Ae.name + ".name") || Ae.label), 1)
+ ], 64)) : (H(), ae("span", m4, le(e.t("tmp." + Ae.name) || Ae.label), 1))
+ ], 10, c4)) : Te("", !0)
]),
_: 2
}, 1032, ["list"]), [
@@ -46380,8 +46401,8 @@ function V4(e, t, i, r, n, a) {
e.activeMenuTab === "field" ? (H(), me(y, { key: 0 }, {
default: N(() => [
z(M, {
- modelValue: e.datasetId,
- "onUpdate:modelValue": t[15] || (t[15] = (re) => e.datasetId = re),
+ modelValue: e.tableId,
+ "onUpdate:modelValue": t[15] || (t[15] = (re) => e.tableId = re),
clearable: "",
filterable: "",
style: { width: "240px", margin: "12px" },
@@ -46415,7 +46436,7 @@ function V4(e, t, i, r, n, a) {
J("div", {
class: qe(["_fc-tree-node", { active: e.activeRule === fe.rule }])
}, [
- J("div", h4, [
+ J("div", v4, [
J("i", {
class: qe(["fc-icon", fe.rule._menu && fe.rule._menu.icon || "icon-cell"])
}, null, 2),
@@ -46431,7 +46452,7 @@ function V4(e, t, i, r, n, a) {
class: qe(["fc-icon", fe.rule._hidden === !0 ? "icon-eye-close" : "icon-eye"]),
onClick: (Ae) => e.toolHidden(fe.rule),
style: { "margin-right": "8px" }
- }, null, 10, m4),
+ }, null, 10, g4),
z(D, {
trigger: "click",
size: "default"
@@ -46498,10 +46519,10 @@ function V4(e, t, i, r, n, a) {
height: "40"
}, {
default: N(() => [
- J("div", v4, [
+ J("div", y4, [
e.inputForm.state ? Te("", !0) : (H(), ae(Me, { key: 0 }, [
e.getConfig("showDevice") !== !1 ? (H(), ae(Me, { key: 0 }, [
- J("div", g4, [
+ J("div", b4, [
J("i", {
class: qe(["fc-icon icon-pc", { active: e.device === "pc" }]),
onClick: t[17] || (t[17] = (re) => e.setDevice("pc"))
@@ -46517,7 +46538,7 @@ function V4(e, t, i, r, n, a) {
]),
t[59] || (t[59] = J("div", { class: "line" }, null, -1))
], 64)) : Te("", !0),
- e.toolsMenuStatus ? (H(), ae("div", y4, [
+ e.toolsMenuStatus ? (H(), ae("div", _4, [
e.getConfig("showGridLine") !== !1 ? (H(), me(s, {
key: 0,
effect: "dark",
@@ -46546,7 +46567,7 @@ function V4(e, t, i, r, n, a) {
}))
]), 1536)) : Te("", !0)
])) : Te("", !0),
- e.toolsMenuStatus ? (H(), ae("div", b4)) : Te("", !0),
+ e.toolsMenuStatus ? (H(), ae("div", w4)) : Te("", !0),
J("div", null, [
J("i", {
class: qe(["fc-icon icon-pre-step", { disabled: !e.operation.list[e.operation.idx - 1] }]),
@@ -46559,7 +46580,7 @@ function V4(e, t, i, r, n, a) {
])
], 64))
]),
- J("div", _4, [
+ J("div", A4, [
e.inputForm.state ? Te("", !0) : (H(), ae(Me, { key: 0 }, [
kt(e.$slots, "handle"),
e.getConfig("showSaveBtn", !1) ? (H(), me(I, {
@@ -46647,8 +46668,8 @@ function V4(e, t, i, r, n, a) {
], 64)),
e.getConfig("showInputData", !0) ? (H(), ae(Me, { key: 1 }, [
t[64] || (t[64] = J("div", { class: "line" }, null, -1)),
- J("div", w4, [
- e.inputCheckStatus ? (H(), ae("i", A4)) : Te("", !0),
+ J("div", C4, [
+ e.inputCheckStatus ? (H(), ae("i", S4)) : Te("", !0),
J("span", null, le(e.t("props.inputData")) + "\uFF1A", 1),
z(F, {
size: "small",
@@ -46669,7 +46690,7 @@ function V4(e, t, i, r, n, a) {
ref: "dragCon",
style: wn({ "--fc-drag-empty": `'${e.t("designer.dragEmpty")}'`, "--fc-child-empty": `'${e.t("designer.childEmpty")}'` })
}, [
- e.inputForm.state ? (H(), ae("div", C4, [
+ e.inputForm.state ? (H(), ae("div", E4, [
(H(), me(C, {
key: e.inputForm.key,
rule: e.inputForm.rule,
@@ -46714,7 +46735,7 @@ function V4(e, t, i, r, n, a) {
}))
]), 1032, ["rule", "option", "api"]))
], 6),
- e.inputForm.state ? (H(), ae("div", S4, [
+ e.inputForm.state ? (H(), ae("div", x4, [
z(I, {
plain: "",
onClick: t[26] || (t[26] = (re) => e.inputClear())
@@ -46824,10 +46845,10 @@ function V4(e, t, i, r, n, a) {
var re;
return [
e.activeRule || e.customForm.config && (e.customForm.config.name || e.customForm.config.label) ? (H(), ae(Me, { key: 0 }, [
- J("p", E4, le(e.t("designer.type")), 1),
+ J("p", T4, le(e.t("designer.type")), 1),
z(te),
e.activeRule && e.activeRule.name && e.config.showComponentName !== !1 ? (H(), ae(Me, { key: 0 }, [
- J("p", x4, [
+ J("p", k4, [
z(ue, {
tooltip: e.t("warning.name")
}, {
@@ -46864,7 +46885,7 @@ function V4(e, t, i, r, n, a) {
class: "_fc-r-config",
style: wn({ "grid-template-areas": e.configFormOrderStyle })
}, [
- J("div", T4, [
+ J("div", O4, [
e.baseForm.isShow ? (H(), me(ge, {
key: 0,
id: "_fd-config-base"
@@ -46900,7 +46921,7 @@ function V4(e, t, i, r, n, a) {
[Sn, e.baseForm.isShow]
])
]),
- J("div", k4, [
+ J("div", $4, [
e.advancedForm.isShow ? (H(), me(ge, {
key: 0,
id: "_fd-config-advanced"
@@ -46921,7 +46942,7 @@ function V4(e, t, i, r, n, a) {
[Sn, e.advancedForm.isShow]
])
]),
- J("div", O4, [
+ J("div", R4, [
e.propsForm.isShow ? (H(), me(ge, {
key: 0,
id: "_fd-config-props"
@@ -46977,7 +46998,7 @@ function V4(e, t, i, r, n, a) {
onChange: e.customFormChange
}, null, 8, ["api", "rule", "option", "onChange"])) : Te("", !0)
]),
- J("div", $4, [
+ J("div", D4, [
e.activeRule && ((re = e.config) == null ? void 0 : re.showSlotsConfig) !== !1 && e.activeRule._menu.easySlots && e.activeRule._menu.easySlots.length ? (H(), ae(Me, { key: 0 }, [
z(ge, { id: "_fd-config-slots" }, {
default: N(() => [
@@ -46988,7 +47009,7 @@ function V4(e, t, i, r, n, a) {
z(he)
], 64)) : Te("", !0)
]),
- J("div", R4, [
+ J("div", I4, [
e.styleForm.isShow ? (H(), me(ge, {
key: 0,
id: "_fd-config-style"
@@ -47009,7 +47030,7 @@ function V4(e, t, i, r, n, a) {
[Sn, e.styleForm.isShow]
])
]),
- J("div", D4, [
+ J("div", F4, [
e.eventShow ? (H(), me(ge, {
key: 0,
id: "_fd-config-event"
@@ -47027,7 +47048,7 @@ function V4(e, t, i, r, n, a) {
"onUpdate:modelValue": e.changeEvent
}, null, 8, ["event-name", "component-name", "model-value", "onUpdate:modelValue"])) : Te("", !0)
]),
- J("div", I4, [
+ J("div", P4, [
e.activeRule ? (H(), ae(Me, { key: 0 }, [
e.validateForm.isShow ? (H(), me(ge, {
key: 0,
@@ -47112,7 +47133,7 @@ function V4(e, t, i, r, n, a) {
]),
_: 1
}, 8, ["modelValue"]),
- e.previewStatus !== "sfc" && !e.onlyPC ? (H(), ae("div", F4, [
+ e.previewStatus !== "sfc" && !e.onlyPC ? (H(), ae("div", M4, [
J("div", {
class: qe({ active: e.previewDevice === "pc" }),
onClick: t[44] || (t[44] = (re) => e.previewDevice = "pc")
@@ -47136,7 +47157,7 @@ function V4(e, t, i, r, n, a) {
J("i", { class: "fc-icon icon-copy" }, null, -1)
]))) : Te("", !0),
e.previewStatus === "form" || e.previewStatus === "preview" ? (H(), ae(Me, { key: 2 }, [
- e.previewDevice === "mobile" ? (H(), ae("div", P4, [
+ e.previewDevice === "mobile" ? (H(), ae("div", L4, [
J("div", null, [
e.preview.state ? (H(), me(K, {
key: 0,
@@ -47174,14 +47195,14 @@ function V4(e, t, i, r, n, a) {
}))
]), 1032, ["rule", "option", "onSubmit", "onReset", "api"])) : Te("", !0)
], 64))
- ], 64)) : e.previewStatus === "component" ? (H(), ae("pre", M4, [
+ ], 64)) : e.previewStatus === "component" ? (H(), ae("pre", N4, [
J("code", {
innerHTML: e.previewDevice === "mobile" ? e.preview.mobileHtml : e.preview.html
- }, null, 8, L4)
- ], 512)) : (H(), ae("pre", N4, [
+ }, null, 8, B4)
+ ], 512)) : (H(), ae("pre", V4, [
J("code", {
innerHTML: e.preview.sfc
- }, null, 8, B4)
+ }, null, 8, j4)
], 512))
]),
_: 3
@@ -47199,8 +47220,8 @@ function V4(e, t, i, r, n, a) {
_: 3
}, 8, ["style", "onDragenter", "onDragleave", "onDrop"]);
}
-const an = /* @__PURE__ */ Ve(X8, [["render", V4]]);
-const j4 = Be({
+const an = /* @__PURE__ */ Ve(q8, [["render", U4]]);
+const H4 = Be({
name: "DragTool",
emits: ["create", "copy", "addChild", "delete", "active", "action", "fc.el"],
props: {
@@ -47263,28 +47284,28 @@ const j4 = Be({
mounted() {
this.$emit("fc.el", this);
}
-}), U4 = {
+}), z4 = {
key: 0,
class: "_fd-drag-mask"
-}, H4 = {
+}, W4 = {
key: 1,
class: "_fd-drag-hidden"
-}, z4 = {
+}, G4 = {
key: 0,
class: "_fd-drag-btn",
style: { cursor: "move" }
-}, W4 = {
+}, K4 = {
key: 3,
class: "_fd-drag-r"
};
-function G4(e, t, i, r, n, a) {
+function Y4(e, t, i, r, n, a) {
const s = ee("el-dropdown-item"), u = ee("el-dropdown-menu"), d = ee("el-dropdown");
return H(), ae("div", {
class: qe(["_fd-drag-tool", { active: e.fcx.active === e.id, "is-inside": e.inside, "is-inline": e.inline }]),
onClick: t[10] || (t[10] = vt((...p) => e.active && e.active(...p), ["stop"]))
}, [
- e.mask ? (H(), ae("div", U4)) : Te("", !0),
- e.hidden ? (H(), ae("div", H4, [
+ e.mask ? (H(), ae("div", z4)) : Te("", !0),
+ e.hidden ? (H(), ae("div", W4, [
t[11] || (t[11] = J("i", { class: "fc-icon icon-eye-close" }, null, -1)),
be(" " + le(e.t("props.hide")), 1)
])) : Te("", !0),
@@ -47294,13 +47315,13 @@ function G4(e, t, i, r, n, a) {
onClick: t[0] || (t[0] = vt(() => {
}, ["stop"]))
}, [
- e.dragBtn !== !1 ? bn((H(), ae("div", z4, t[12] || (t[12] = [
+ e.dragBtn !== !1 ? bn((H(), ae("div", G4, t[12] || (t[12] = [
J("i", { class: "fc-icon icon-move" }, null, -1)
]), 512)), [
[Sn, e.fcx.active === e.id]
]) : Te("", !0)
])),
- e.btns !== !1 && !e.hiddenMenu ? (H(), ae("div", W4, [
+ e.btns !== !1 && !e.hiddenMenu ? (H(), ae("div", K4, [
kt(e.$slots, "handle", {}, () => [
e.actions && e.actions.length > 0 ? (H(), ae("div", {
key: 0,
@@ -47380,8 +47401,8 @@ function G4(e, t, i, r, n, a) {
kt(e.$slots, "default")
], 2);
}
-const Xb = /* @__PURE__ */ Ve(j4, [["render", G4]]);
-const K4 = Be({
+const qb = /* @__PURE__ */ Ve(H4, [["render", Y4]]);
+const Q4 = Be({
name: "HtmlEditor",
emits: ["update:modelValue"],
props: {
@@ -47438,13 +47459,13 @@ const K4 = Be({
return !this.text && this.validateXML(e) ? (In(this.t("struct.errorMsg")), !1) : (this.visible = !1, e !== this.oldVal && this.$emit("update:modelValue", e), !0);
}
}
-}), Y4 = { class: "_fd-html-editor" }, Q4 = {
+}), J4 = { class: "_fd-html-editor" }, X4 = {
key: 0,
ref: "editor"
};
-function J4(e, t, i, r, n, a) {
+function Z4(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-dialog");
- return H(), ae("div", Y4, [
+ return H(), ae("div", J4, [
z(s, {
class: "_fd-plain-button",
plain: "",
@@ -47488,14 +47509,14 @@ function J4(e, t, i, r, n, a) {
])
]),
default: N(() => [
- e.visible ? (H(), ae("div", Q4, null, 512)) : Te("", !0)
+ e.visible ? (H(), ae("div", X4, null, 512)) : Te("", !0)
]),
_: 1
}, 8, ["title", "modelValue"])
]);
}
-const X4 = /* @__PURE__ */ Ve(K4, [["render", J4]]);
-const Z4 = Be({
+const q4 = /* @__PURE__ */ Ve(Q4, [["render", Z4]]);
+const e5 = Be({
name: "FieldInput",
inject: ["designer"],
emits: ["update:modelValue"],
@@ -47601,7 +47622,7 @@ const Z4 = Be({
},
checkValue() {
const e = this.oldValue;
- sy(e);
+ dy(e);
let t = (this.value || "").replace(/[\s\ ]/g, "");
if (t)
if (/^[a-zA-Z]/.test(t)) {
@@ -47648,10 +47669,10 @@ const Z4 = Be({
this.designer.setupState.bus.$off("dragEnd", e);
});
}
-}), q4 = { class: "_fd-field-input" };
-function e5(e, t, i, r, n, a) {
+}), t5 = { class: "_fd-field-input" };
+function n5(e, t, i, r, n, a) {
const s = ee("el-input"), u = ee("el-tree-select");
- return H(), ae("div", q4, [
+ return H(), ae("div", t5, [
J("i", {
class: "fc-icon icon-group",
onClick: t[0] || (t[0] = vt((...d) => e.copy && e.copy(...d), ["stop"]))
@@ -47694,8 +47715,8 @@ function e5(e, t, i, r, n, a) {
]), 1032, ["modelValue", "readonly", "disabled", "onFocus", "onBlur"]))
]);
}
-const t5 = /* @__PURE__ */ Ve(Z4, [["render", e5]]);
-const n5 = Be({
+const i5 = /* @__PURE__ */ Ve(e5, [["render", n5]]);
+const r5 = Be({
name: "PromptInput",
emits: ["update:modelValue", "change"],
props: {
@@ -47718,7 +47739,7 @@ const n5 = Be({
}
}
});
-function i5(e, t, i, r, n, a) {
+function o5(e, t, i, r, n, a) {
const s = ee("el-dropdown-item"), u = ee("el-dropdown-menu"), d = ee("el-dropdown"), p = ee("el-input");
return H(), me(p, {
size: e.size,
@@ -47759,8 +47780,8 @@ function i5(e, t, i, r, n, a) {
_: 1
}, 8, ["size", "modelValue", "onBlur"]);
}
-const r5 = /* @__PURE__ */ Ve(n5, [["render", i5]]);
-const o5 = (e) => [
+const a5 = /* @__PURE__ */ Ve(r5, [["render", o5]]);
+const l5 = (e) => [
{
type: "input",
field: "action",
@@ -47833,7 +47854,7 @@ const o5 = (e) => [
warning: e("warning.fetchData"),
value: {}
}
-], a5 = Be({
+], s5 = Be({
name: "FetchConfig",
emits: ["update:modelValue"],
props: {
@@ -47844,7 +47865,7 @@ const o5 = (e) => [
Warning: ki,
DragForm: tt.$form(),
FnEditor: sr,
- StructEditor: Lp
+ StructEditor: Np
},
inject: ["designer"],
data() {
@@ -47885,7 +47906,7 @@ const o5 = (e) => [
},
active() {
const e = this.value;
- this.form.rule = e.type === "static" ? [] : o5(this.t), this.form.formData = { ...e }, this.form.label = e.label, this.form.type = e.type, this.form.data = e.data, this.form.dataType = e.dataType, this.form.parse = e.parse || "", this.form.beforeFetch = e.beforeFetch || "", this.form.onError = e.onError || "";
+ this.form.rule = e.type === "static" ? [] : l5(this.t), this.form.formData = { ...e }, this.form.label = e.label, this.form.type = e.type, this.form.data = e.data, this.form.dataType = e.dataType, this.form.parse = e.parse || "", this.form.beforeFetch = e.beforeFetch || "", this.form.onError = e.onError || "";
},
save() {
this.form.api.validate().then(() => {
@@ -47899,10 +47920,10 @@ const o5 = (e) => [
created() {
this.active();
}
-}), l5 = { class: "_fd-fetch-config" }, s5 = { class: "_fd-fetch-info" };
-function u5(e, t, i, r, n, a) {
+}), u5 = { class: "_fd-fetch-config" }, d5 = { class: "_fd-fetch-info" };
+function f5(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-badge"), d = ee("Warning"), p = ee("DragForm"), h = ee("el-tab-pane"), g = ee("FnEditor"), _ = ee("el-tabs"), S = ee("el-container"), b = ee("el-dialog");
- return H(), ae("div", l5, [
+ return H(), ae("div", u5, [
z(u, {
type: "warning",
"is-dot": "",
@@ -47979,7 +48000,7 @@ function u5(e, t, i, r, n, a) {
style: { "padding-right": "15px" }
}, {
default: N(() => [
- J("div", s5, le(e.t("fetch.info")), 1),
+ J("div", d5, le(e.t("fetch.info")), 1),
z(p, {
api: e.form.api,
"onUpdate:api": t[1] || (t[1] = (A) => e.form.api = A),
@@ -48079,8 +48100,8 @@ function u5(e, t, i, r, n, a) {
}, 8, ["modelValue"])
]);
}
-const d5 = /* @__PURE__ */ Ve(a5, [["render", u5]]);
-const f5 = Be({
+const c5 = /* @__PURE__ */ Ve(s5, [["render", f5]]);
+const p5 = Be({
name: "TableColumnConfig",
components: { FnEditor: sr },
props: {
@@ -48193,16 +48214,16 @@ const f5 = Be({
return;
}
}
- n.render && (n.render = Ho(n.render)), e.push(n);
+ n.render && (n.render = Uo(n.render)), e.push(n);
}
}
this.$emit("update:modelValue", e), this.$emit("change", e), this.visible = !1;
}
}
-}), c5 = { class: "_fd-table-column-config" }, p5 = { class: "flex" }, h5 = ["onClick"], m5 = ["onClick"], v5 = ["onClick"], g5 = ["onClick"];
-function y5(e, t, i, r, n, a) {
+}), h5 = { class: "_fd-table-column-config" }, m5 = { class: "flex" }, v5 = ["onClick"], g5 = ["onClick"], y5 = ["onClick"], b5 = ["onClick"];
+function _5(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-badge"), d = ee("FnEditor"), p = ee("el-table-column"), h = ee("el-input"), g = ee("el-option"), _ = ee("el-select"), S = ee("el-switch"), b = ee("el-table"), A = ee("el-dialog");
- return H(), ae("div", c5, [
+ return H(), ae("div", h5, [
z(u, {
type: "warning",
"is-dot": "",
@@ -48446,7 +48467,7 @@ function y5(e, t, i, r, n, a) {
}, 8, ["label"]),
z(p, { width: "110" }, {
default: N(({ row: y }) => [
- J("div", p5, [
+ J("div", m5, [
z(_, {
modelValue: y.format,
"onUpdate:modelValue": (m) => y.format = m,
@@ -48465,7 +48486,7 @@ function y5(e, t, i, r, n, a) {
key: 0,
class: "fc-icon icon-edit",
onClick: (m) => e.editFn(y)
- }, null, 8, h5)) : Te("", !0)
+ }, null, 8, v5)) : Te("", !0)
])
]),
header: N(() => [
@@ -48497,15 +48518,15 @@ function y5(e, t, i, r, n, a) {
J("i", {
class: "fc-icon icon-add-circle",
onClick: (w) => e.add(m)
- }, null, 8, m5),
+ }, null, 8, g5),
J("i", {
class: "fc-icon icon-add-child",
onClick: (w) => e.addChild(y)
- }, null, 8, v5),
+ }, null, 8, y5),
J("i", {
class: "fc-icon icon-delete-circle",
onClick: (w) => e.remove(y)
- }, null, 8, g5)
+ }, null, 8, b5)
]),
_: 1
}, 8, ["label"])
@@ -48532,8 +48553,8 @@ function y5(e, t, i, r, n, a) {
}, 8, ["title", "modelValue"])
]);
}
-const b5 = /* @__PURE__ */ Ve(f5, [["render", y5]]);
-const _5 = Be({
+const w5 = /* @__PURE__ */ Ve(p5, [["render", _5]]);
+const A5 = Be({
name: "TableColumnConfig",
props: {
modelValue: Array
@@ -48624,10 +48645,10 @@ const _5 = Be({
this.$emit("update:modelValue", e), this.$emit("change", e), this.visible = !1;
}
}
-}), w5 = { class: "_fd-table-button-config" }, A5 = ["onClick"], C5 = ["onClick"], S5 = ["onClick"], E5 = ["onClick"];
-function x5(e, t, i, r, n, a) {
+}), C5 = { class: "_fd-table-button-config" }, S5 = ["onClick"], E5 = ["onClick"], x5 = ["onClick"], T5 = ["onClick"];
+function k5(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-badge"), d = ee("FnEditor"), p = ee("el-table-column"), h = ee("el-input"), g = ee("el-option"), _ = ee("el-select"), S = ee("el-switch"), b = ee("el-table"), A = ee("el-dialog");
- return H(), ae("div", w5, [
+ return H(), ae("div", C5, [
z(u, {
type: "warning",
"is-dot": "",
@@ -48826,14 +48847,14 @@ function x5(e, t, i, r, n, a) {
}, [
be(le(e.t("com.dataTable.handle")), 1),
t[6] || (t[6] = J("i", { class: "fc-icon icon-edit" }, null, -1))
- ], 8, A5),
+ ], 8, S5),
J("div", {
class: "_fd-tcb-btn",
onClick: (m) => e.handle(y, "click", ["scope", "api"])
}, [
be(le(e.t("com.dataTable.click")), 1),
t[7] || (t[7] = J("i", { class: "fc-icon icon-edit" }, null, -1))
- ], 8, C5)
+ ], 8, E5)
]),
_: 1
}, 8, ["label"]),
@@ -48845,11 +48866,11 @@ function x5(e, t, i, r, n, a) {
J("i", {
class: "fc-icon icon-add-circle",
onClick: (m) => e.add(y)
- }, null, 8, S5),
+ }, null, 8, x5),
J("i", {
class: "fc-icon icon-delete-circle",
onClick: (m) => e.remove(y)
- }, null, 8, E5)
+ }, null, 8, T5)
]),
_: 1
}, 8, ["label"])
@@ -48873,8 +48894,8 @@ function x5(e, t, i, r, n, a) {
}, 8, ["title", "modelValue"])
]);
}
-const T5 = /* @__PURE__ */ Ve(_5, [["render", x5]]);
-const k5 = "[[FORM-CREATE-PREFIX-", O5 = "-FORM-CREATE-SUFFIX]]", $5 = Be({
+const O5 = /* @__PURE__ */ Ve(A5, [["render", k5]]);
+const $5 = "[[FORM-CREATE-PREFIX-", R5 = "-FORM-CREATE-SUFFIX]]", D5 = Be({
name: "FnConfig",
emits: ["update:modelValue"],
props: {
@@ -48917,7 +48938,7 @@ const k5 = "[[FORM-CREATE-PREFIX-", O5 = "-FORM-CREATE-SUFFIX]]", $5 = Be({
},
watch: {
visible(e) {
- this.event = e ? this.loadFN(Rc({}, this.modelValue || {})) : {}, e || this.destroy();
+ this.event = e ? this.loadFN(Dc({}, this.modelValue || {})) : {}, e || this.destroy();
}
},
methods: {
@@ -48941,7 +48962,7 @@ const k5 = "[[FORM-CREATE-PREFIX-", O5 = "-FORM-CREATE-SUFFIX]]", $5 = Be({
}), t;
},
edit(e) {
- e.key = rt(), this.activeData = e, this.eventStr = e.fn || k5 + `function ${e.item.name}(${this.getArgs(e.item)}){}` + O5, this.defActive = e.item.name;
+ e.key = rt(), this.activeData = e, this.eventStr = e.fn || $5 + `function ${e.item.name}(${this.getArgs(e.item)}){}` + R5, this.defActive = e.item.name;
},
save() {
return this.$refs.fn.save() ? (this.activeData.fn = this.eventStr, this.destroy(), !0) : !1;
@@ -48956,16 +48977,16 @@ const k5 = "[[FORM-CREATE-PREFIX-", O5 = "-FORM-CREATE-SUFFIX]]", $5 = Be({
this.activeData && !this.save() || (this.$emit("update:modelValue", this.parseFN(this.event)), this.visible = !1, this.destroy());
}
}
-}), R5 = { class: "_fd-fn-list" }, D5 = ["onClick"], I5 = {
+}), I5 = { class: "_fd-fn-list" }, F5 = ["onClick"], P5 = {
key: 0,
class: "_fd-label"
-}, F5 = {
+}, M5 = {
key: 1,
class: "_fd-dot"
};
-function P5(e, t, i, r, n, a) {
+function L5(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-badge"), d = ee("el-text"), p = ee("el-header"), h = ee("el-menu-item"), g = ee("el-menu"), _ = ee("el-main"), S = ee("el-container"), b = ee("el-aside"), A = ee("FnEditor"), y = ee("el-dialog");
- return H(), ae("div", R5, [
+ return H(), ae("div", I5, [
z(u, {
value: e.eventNum,
type: "warning",
@@ -49067,9 +49088,9 @@ function P5(e, t, i, r, n, a) {
t[5] || (t[5] = be("function")),
J("span", null, le(w), 1)
]),
- e.eventInfo[w] ? (H(), ae("span", I5, le(e.eventInfo[w]), 1)) : Te("", !0),
- m.fn ? (H(), ae("span", F5)) : Te("", !0)
- ], 8, D5)
+ e.eventInfo[w] ? (H(), ae("span", P5, le(e.eventInfo[w]), 1)) : Te("", !0),
+ m.fn ? (H(), ae("span", M5)) : Te("", !0)
+ ], 8, F5)
]),
_: 2
}, 1032, ["index"]))), 128))
@@ -49143,8 +49164,8 @@ function P5(e, t, i, r, n, a) {
}, 8, ["title", "modelValue"])
]);
}
-const M5 = /* @__PURE__ */ Ve($5, [["render", P5]]);
-const L5 = Be({
+const N5 = /* @__PURE__ */ Ve(D5, [["render", L5]]);
+const B5 = Be({
name: "FnInput",
components: { FnEditor: sr },
emits: ["update:modelValue", "change"],
@@ -49185,10 +49206,10 @@ const L5 = Be({
this.$refs.editor.save() && (this.$emit("update:modelValue", this.value), this.$emit("change", this.value), this.visible = !1);
}
}
-}), N5 = { class: "_fd-fn-input" };
-function B5(e, t, i, r, n, a) {
+}), V5 = { class: "_fd-fn-input" };
+function j5(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-badge"), d = ee("FnEditor"), p = ee("el-dialog");
- return H(), ae("div", N5, [
+ return H(), ae("div", V5, [
z(u, {
type: "warning",
"is-dot": "",
@@ -49259,8 +49280,8 @@ function B5(e, t, i, r, n, a) {
}, 8, ["title", "modelValue"])
]);
}
-const Zb = /* @__PURE__ */ Ve(L5, [["render", B5]]);
-const V5 = Be({
+const e1 = /* @__PURE__ */ Ve(B5, [["render", j5]]);
+const U5 = Be({
name: "GlobalFetchSelect",
emits: ["update:modelValue"],
props: {
@@ -49302,10 +49323,10 @@ const V5 = Be({
e.to = this.to || "options", e.key = this.value, e._uni = this.uni, this.$emit("update:modelValue", e);
}
}
-}), j5 = { class: "_fd-gfs" }, U5 = { class: "_fd-gfs-handle" };
-function H5(e, t, i, r, n, a) {
+}), H5 = { class: "_fd-gfs" }, z5 = { class: "_fd-gfs-handle" };
+function W5(e, t, i, r, n, a) {
const s = ee("el-option"), u = ee("el-select");
- return H(), ae("div", j5, [
+ return H(), ae("div", H5, [
z(u, {
modelValue: e.value,
"onUpdate:modelValue": t[0] || (t[0] = (d) => e.value = d),
@@ -49322,7 +49343,7 @@ function H5(e, t, i, r, n, a) {
]),
_: 1
}, 8, ["modelValue", "onChange"]),
- J("div", U5, [
+ J("div", z5, [
J("i", {
onClick: t[1] || (t[1] = (...d) => e.refresh && e.refresh(...d)),
class: qe(["fc-icon icon-refresh", { disabled: !e.value, "_fc-loading": this.loading }]),
@@ -49337,8 +49358,8 @@ function H5(e, t, i, r, n, a) {
])
]);
}
-const z5 = /* @__PURE__ */ Ve(V5, [["render", H5]]);
-const W5 = Be({
+const G5 = /* @__PURE__ */ Ve(U5, [["render", W5]]);
+const K5 = Be({
name: "GlobalClassSelect",
emits: ["update:modelValue"],
props: {
@@ -49378,10 +49399,10 @@ const W5 = Be({
created() {
this.tidyValue();
}
-}), G5 = { class: "_fd-gcs" }, K5 = { class: "_fd-gcs-handle" };
-function Y5(e, t, i, r, n, a) {
+}), Y5 = { class: "_fd-gcs" }, Q5 = { class: "_fd-gcs-handle" };
+function J5(e, t, i, r, n, a) {
const s = ee("el-option"), u = ee("el-select");
- return H(), ae("div", G5, [
+ return H(), ae("div", Y5, [
z(u, {
modelValue: e.value,
"onUpdate:modelValue": t[0] || (t[0] = (d) => e.value = d),
@@ -49402,7 +49423,7 @@ function Y5(e, t, i, r, n, a) {
]),
_: 1
}, 8, ["modelValue", "onChange"]),
- J("div", K5, [
+ J("div", Q5, [
J("div", {
class: "_fc-manage-text",
onClick: t[1] || (t[1] = (...d) => e.openConfig && e.openConfig(...d))
@@ -49412,8 +49433,8 @@ function Y5(e, t, i, r, n, a) {
])
]);
}
-const Q5 = /* @__PURE__ */ Ve(W5, [["render", Y5]]);
-const J5 = Be({
+const X5 = /* @__PURE__ */ Ve(K5, [["render", J5]]);
+const Z5 = Be({
name: "FetchTable",
components: { VariableConfig: ml },
inject: ["designer"],
@@ -49462,10 +49483,10 @@ const J5 = Be({
});
}), this.value = e;
}
-}), X5 = { class: "_fd-fetch-table" }, Z5 = { style: { width: "40%" } }, q5 = { class: "_fd-fetch-table-key" }, eV = ["onClick"];
-function tV(e, t, i, r, n, a) {
+}), q5 = { class: "_fd-fetch-table" }, eV = { style: { width: "40%" } }, tV = { class: "_fd-fetch-table-key" }, nV = ["onClick"];
+function iV(e, t, i, r, n, a) {
const s = ee("el-header"), u = ee("VariableConfig"), d = ee("el-input"), p = ee("el-main"), h = ee("el-container"), g = ee("el-button");
- return H(), ae("div", X5, [
+ return H(), ae("div", q5, [
e.value.length > 0 ? (H(), me(h, {
key: 0,
class: "_fd-fetch-table-con"
@@ -49473,7 +49494,7 @@ function tV(e, t, i, r, n, a) {
default: N(() => [
z(s, null, {
default: N(() => [
- J("div", Z5, le(e.t("props.key")), 1),
+ J("div", eV, le(e.t("props.key")), 1),
J("div", null, le(e.t("props.value")), 1)
]),
_: 1
@@ -49484,7 +49505,7 @@ function tV(e, t, i, r, n, a) {
key: S,
class: "_fd-fetch-table-row"
}, [
- J("div", q5, [
+ J("div", tV, [
z(d, {
modelValue: _.key,
"onUpdate:modelValue": (b) => _.key = b,
@@ -49515,7 +49536,7 @@ function tV(e, t, i, r, n, a) {
J("i", {
class: "fc-icon icon-delete-circle",
onClick: (b) => e.rm(S)
- }, null, 8, eV)
+ }, null, 8, nV)
]))), 128))
]),
_: 1
@@ -49536,7 +49557,7 @@ function tV(e, t, i, r, n, a) {
}, 8, ["onClick"])
]);
}
-const nV = /* @__PURE__ */ Ve(J5, [["render", tV]]), qb = Be({
+const rV = /* @__PURE__ */ Ve(Z5, [["render", iV]]), t1 = Be({
name: "DragBox",
props: ["rule", "tag", "formCreateInject", "list"],
render(e) {
@@ -49546,7 +49567,7 @@ const nV = /* @__PURE__ */ Ve(J5, [["render", tV]]), qb = Be({
const r = {};
return e.$slots.default && e.$slots.default().forEach((a) => {
a.key && (r[a.key] = a);
- }), on(Yo, t, {
+ }), on(Ko, t, {
item: ({ element: n, index: a }) => {
var d, p, h;
let s = "";
@@ -49564,7 +49585,7 @@ const nV = /* @__PURE__ */ Ve(J5, [["render", tV]]), qb = Be({
});
}
});
-const iV = Be({
+const oV = Be({
name: "FcTableView",
props: {
mini: Boolean,
@@ -49584,8 +49605,8 @@ const iV = Be({
},
inject: ["designer"],
components: {
- DragTool: Xb,
- DragBox: qb
+ DragTool: qb,
+ DragBox: t1
},
watch: {
rule: {
@@ -49884,8 +49905,8 @@ const iV = Be({
beforeMount() {
this.loadRule();
}
-}), rV = { class: "_fd-table-view-cell" }, oV = ["onClick"], aV = ["onClick"];
-function lV(e, t, i, r, n, a) {
+}), aV = { class: "_fd-table-view-cell" }, lV = ["onClick"], sV = ["onClick"];
+function uV(e, t, i, r, n, a) {
const s = ee("DragBox"), u = ee("el-dropdown-item"), d = ee("el-dropdown-menu"), p = ee("el-dropdown"), h = ee("DragTool");
return H(), ae("div", {
class: qe(["_fd-table-view", { "is-mini": e.mini }])
@@ -49905,7 +49926,7 @@ function lV(e, t, i, r, n, a) {
style: [e.tableColor, e.style && e.style[`${_}:${b}`] || {}],
class: e.rule.class && e.rule.class[`${_}:${b}`] || ""
}), [
- J("div", rV, [
+ J("div", aV, [
z(h, {
"drag-btn": !1,
"handle-btn": !0,
@@ -49918,7 +49939,7 @@ function lV(e, t, i, r, n, a) {
onClick: vt((A) => e.addRow({ pid: _, idx: b, data: e.lattice[_][b] }, 0), ["stop"])
}, t[3] || (t[3] = [
J("i", { class: "fc-icon icon-add-col" }, null, -1)
- ]), 8, oV),
+ ]), 8, lV),
J("div", {
class: "_fd-drag-btn _fd-table-view-btn",
onClick: vt((A) => e.addCol({ pid: _, idx: b, data: e.lattice[_][b] }, 0), ["stop"])
@@ -49927,7 +49948,7 @@ function lV(e, t, i, r, n, a) {
class: "fc-icon icon-add-col",
style: { transform: "rotate(90deg)" }
}, null, -1)
- ]), 8, aV),
+ ]), 8, sV),
J("div", {
class: "_fd-drag-btn _fd-table-view-btn",
onClick: t[2] || (t[2] = vt(() => {
@@ -50065,8 +50086,8 @@ function lV(e, t, i, r, n, a) {
], 4)
], 2);
}
-const sV = /* @__PURE__ */ Ve(iV, [["render", lV]]);
-const uV = Be({
+const dV = /* @__PURE__ */ Ve(oV, [["render", uV]]);
+const fV = Be({
name: "FcValue",
props: ["modelValue"],
inject: ["designer"],
@@ -50080,11 +50101,11 @@ const uV = Be({
return this.designer.setupState.t;
}
}
-}), dV = { class: "_fd-value" };
-function fV(e, t, i, r, n, a) {
- return H(), ae("div", dV, le(e.t("com.fcValue.empty")), 1);
+}), cV = { class: "_fd-value" };
+function pV(e, t, i, r, n, a) {
+ return H(), ae("div", cV, le(e.t("com.fcValue.empty")), 1);
}
-const cV = /* @__PURE__ */ Ve(uV, [["render", fV]]), pV = Be({
+const hV = /* @__PURE__ */ Ve(fV, [["render", pV]]), mV = Be({
name: "FcSlotView",
inheritAttrs: !1,
inject: ["parentFC", "designer"],
@@ -50126,7 +50147,7 @@ const cV = /* @__PURE__ */ Ve(uV, [["render", fV]]), pV = Be({
}
}
});
-const hV = Be({
+const vV = Be({
name: "FcJsonView",
inheritAttrs: !1,
inject: ["designer"],
@@ -50236,7 +50257,7 @@ const hV = Be({
this.rule && this.loadRule();
}
});
-const mV = Be({
+const gV = Be({
name: "LanguageInput",
inject: ["designer"],
emits: ["update:modelValue", "blur", "change"],
@@ -50290,8 +50311,8 @@ const mV = Be({
},
mounted() {
}
-}), vV = { class: "_fd-language-list" }, gV = { class: "_fd-language-header" }, yV = { class: "_fd-language-title" }, bV = { class: "_fd-language-name" }, _V = ["onClick"];
-function wV(e, t, i, r, n, a) {
+}), yV = { class: "_fd-language-list" }, bV = { class: "_fd-language-header" }, _V = { class: "_fd-language-title" }, wV = { class: "_fd-language-name" }, AV = ["onClick"];
+function CV(e, t, i, r, n, a) {
const s = ee("el-popover"), u = ee("el-input");
return H(), me(u, {
class: qe(["_fd-language-input", { "is-variable": e.isVar }]),
@@ -50317,16 +50338,16 @@ function wV(e, t, i, r, n, a) {
J("i", { class: "fc-icon icon-language" }, null, -1)
])),
default: N(() => [
- J("div", vV, [
- J("div", gV, [
- J("div", yV, [
+ J("div", yV, [
+ J("div", bV, [
+ J("div", _V, [
be(le(e.t("language.select")), 1),
J("i", {
class: "fc-icon icon-setting",
onClick: t[0] || (t[0] = (...d) => e.openConfig && e.openConfig(...d))
})
]),
- J("div", bV, [
+ J("div", wV, [
(H(!0), ae(Me, null, ze(e.localeList, (d) => (H(), ae("div", {
key: d.value
}, le(d.label), 1))), 128))
@@ -50340,7 +50361,7 @@ function wV(e, t, i, r, n, a) {
(H(!0), ae(Me, null, ze(e.localeList, (p) => (H(), ae("div", {
key: p.value
}, le(d[p.value] || "-"), 1))), 128))
- ], 8, _V))), 128))
+ ], 8, AV))), 128))
])
]),
_: 1
@@ -50350,8 +50371,8 @@ function wV(e, t, i, r, n, a) {
} : void 0
]), 1032, ["class", "placeholder", "disabled", "modelValue", "onUpdate:modelValue", "size"]);
}
-const zp = /* @__PURE__ */ Ve(mV, [["render", wV]]);
-const AV = Be({
+const Wp = /* @__PURE__ */ Ve(gV, [["render", CV]]);
+const SV = Be({
name: "Validate",
inject: ["designer"],
emits: ["update:modelValue"],
@@ -50359,9 +50380,9 @@ const AV = Be({
modelValue: Array
},
components: {
- LanguageInput: zp,
- FnInput: Zb,
- PatternInput: Op
+ LanguageInput: Wp,
+ FnInput: e1,
+ PatternInput: $p
},
watch: {
modelValue(e) {
@@ -50424,12 +50445,12 @@ const AV = Be({
}), t)));
}
}
-}), CV = { class: "_fd-validate" }, SV = { class: "_fd-validate-item" }, EV = { class: "_fd-validate-title" }, xV = ["onClick"];
-function TV(e, t, i, r, n, a) {
+}), EV = { class: "_fd-validate" }, xV = { class: "_fd-validate-item" }, TV = { class: "_fd-validate-title" }, kV = ["onClick"];
+function OV(e, t, i, r, n, a) {
const s = ee("el-option"), u = ee("el-select"), d = ee("el-form-item"), p = ee("el-col"), h = ee("PatternInput"), g = ee("FnInput"), _ = ee("el-input-number"), S = ee("LanguageInput"), b = ee("el-row"), A = ee("el-button"), y = ee("el-dropdown-item"), m = ee("el-dropdown-menu"), w = ee("el-dropdown");
- return H(), ae("div", CV, [
- (H(!0), ae(Me, null, ze(e.validate, (E, x) => (H(), ae("div", SV, [
- J("div", EV, [
+ return H(), ae("div", EV, [
+ (H(!0), ae(Me, null, ze(e.validate, (E, x) => (H(), ae("div", xV, [
+ J("div", TV, [
J("div", null, [
J("span", null, le(x + 1), 1),
be(" " + le(e.modes[E.mode]), 1)
@@ -50437,7 +50458,7 @@ function TV(e, t, i, r, n, a) {
J("i", {
class: "fc-icon icon-delete-circle",
onClick: (k) => e.remove(x)
- }, null, 8, xV)
+ }, null, 8, kV)
]),
z(b, null, {
default: N(() => [
@@ -50566,10 +50587,10 @@ function TV(e, t, i, r, n, a) {
}, 8, ["onCommand"])
]);
}
-const kV = /* @__PURE__ */ Ve(AV, [["render", TV]]);
-const OV = Be({
+const $V = /* @__PURE__ */ Ve(SV, [["render", OV]]);
+const RV = Be({
name: "Required",
- components: { LanguageInput: zp },
+ components: { LanguageInput: Wp },
emits: ["update:modelValue"],
props: {
modelValue: {}
@@ -50605,10 +50626,10 @@ const OV = Be({
this.required === !1 ? e = !1 : e = this.requiredMsg || !0, this.$emit("update:modelValue", e);
}
}
-}), $V = { class: "_fd-required" };
-function RV(e, t, i, r, n, a) {
+}), DV = { class: "_fd-required" };
+function IV(e, t, i, r, n, a) {
const s = ee("el-switch"), u = ee("LanguageInput");
- return H(), ae("div", $V, [
+ return H(), ae("div", DV, [
z(s, {
modelValue: e.required,
"onUpdate:modelValue": t[0] || (t[0] = (d) => e.required = d)
@@ -50621,8 +50642,8 @@ function RV(e, t, i, r, n, a) {
}, null, 8, ["modelValue", "placeholder"])) : Te("", !0)
]);
}
-const DV = /* @__PURE__ */ Ve(OV, [["render", RV]]);
-const IV = Be({
+const FV = /* @__PURE__ */ Ve(RV, [["render", IV]]);
+const PV = Be({
name: "TreeOptions",
components: { ValueInput: wu },
emits: ["update:modelValue"],
@@ -50697,10 +50718,10 @@ const IV = Be({
i.data.children ? (i.data.children.splice(i.data.children.indexOf(t), 1), i.data.children.length || delete i.data.children) : i.data.splice(i.data.indexOf(t), 1), this.change();
}
}
-}), FV = { class: "_fd-tree-opt" }, PV = { class: "_fd-tree-opt-node" }, MV = ["onClick"], LV = ["onClick"], NV = ["onClick"], BV = ["onClick"], VV = ["onClick"], jV = ["onClick"];
-function UV(e, t, i, r, n, a) {
+}), MV = { class: "_fd-tree-opt" }, LV = { class: "_fd-tree-opt-node" }, NV = ["onClick"], BV = ["onClick"], VV = ["onClick"], jV = ["onClick"], UV = ["onClick"], HV = ["onClick"];
+function zV(e, t, i, r, n, a) {
const s = ee("el-input"), u = ee("ValueInput"), d = ee("el-tree"), p = ee("el-checkbox");
- return H(), ae("div", FV, [
+ return H(), ae("div", MV, [
(H(), me(d, {
data: e.value,
"node-key": "index",
@@ -50709,7 +50730,7 @@ function UV(e, t, i, r, n, a) {
"expand-on-click-node": !1
}, {
default: N(({ node: h, data: g }) => [
- J("div", PV, [
+ J("div", LV, [
e.checked ? (H(), me(s, {
key: 1,
class: "_fd-tree-opt-last _label",
@@ -50723,19 +50744,19 @@ function UV(e, t, i, r, n, a) {
onClick: (_) => e.add(h, g)
}, t[4] || (t[4] = [
J("i", { class: "fc-icon icon-add" }, null, -1)
- ]), 8, BV),
+ ]), 8, jV),
J("div", {
class: "_fd-tree-opt-btn",
onClick: (_) => e.append(g)
}, t[5] || (t[5] = [
J("i", { class: "fc-icon icon-add-child" }, null, -1)
- ]), 8, VV),
+ ]), 8, UV),
J("div", {
class: "_fd-tree-opt-btn _fd-tree-opt-danger",
onClick: (_) => e.remove(h, g)
}, t[6] || (t[6] = [
J("i", { class: "fc-icon icon-delete" }, null, -1)
- ]), 8, jV)
+ ]), 8, HV)
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue", "onBlur"])) : (H(), ae(Me, { key: 0 }, [
@@ -50758,19 +50779,19 @@ function UV(e, t, i, r, n, a) {
onClick: (_) => e.add(h, g)
}, t[1] || (t[1] = [
J("i", { class: "fc-icon icon-add" }, null, -1)
- ]), 8, MV),
+ ]), 8, NV),
J("div", {
class: "_fd-tree-opt-btn",
onClick: (_) => e.append(g)
}, t[2] || (t[2] = [
J("i", { class: "fc-icon icon-add-child" }, null, -1)
- ]), 8, LV),
+ ]), 8, BV),
J("div", {
class: "_fd-tree-opt-btn _fd-tree-opt-danger",
onClick: (_) => e.remove(h, g)
}, t[3] || (t[3] = [
J("i", { class: "fc-icon icon-delete" }, null, -1)
- ]), 8, NV)
+ ]), 8, VV)
]),
_: 2
}, 1032, ["modelValue", "onUpdate:modelValue", "onBlur", "onChangeType"])
@@ -50787,13 +50808,13 @@ function UV(e, t, i, r, n, a) {
}, null, 8, ["modelValue", "label"])) : Te("", !0)
]);
}
-const HV = /* @__PURE__ */ Ve(IV, [["render", UV]]);
-const e1 = (e) => {
+const WV = /* @__PURE__ */ Ve(PV, [["render", zV]]);
+const n1 = (e) => {
const t = [];
return e.forEach((i) => {
- i.field && t.push(i.field), i.children && t.push(...e1(i.children));
+ i.field && t.push(i.field), i.children && t.push(...n1(i.children));
}), t;
-}, zV = Be({
+}, GV = Be({
name: "StepForm",
props: {
stepsProps: Object,
@@ -50848,7 +50869,7 @@ const e1 = (e) => {
},
validate() {
return new Promise((e, t) => {
- const i = e1(this.cacheRule[this.active].children);
+ const i = n1(this.cacheRule[this.active].children);
i.length > 0 ? Promise.all(i.map((r) => this.subApi.validateField(r))).then(() => {
e();
}).catch((r) => {
@@ -50886,10 +50907,10 @@ const e1 = (e) => {
created() {
this.init();
}
-}), WV = { class: "_fc-step-form" };
-function GV(e, t, i, r, n, a) {
+}), KV = { class: "_fc-step-form" };
+function YV(e, t, i, r, n, a) {
const s = ee("el-step"), u = ee("el-steps"), d = ee("el-button"), p = ee("el-col"), h = ee("el-row");
- return H(), ae("div", WV, [
+ return H(), ae("div", KV, [
z(u, jt({ active: e.active }, e.stepsProps), {
default: N(() => [
(H(!0), ae(Me, null, ze(e.steps, (g) => (H(), me(s, jt({ ref_for: !0 }, g.props), null, 16))), 256))
@@ -50950,8 +50971,8 @@ function GV(e, t, i, r, n, a) {
})
]);
}
-const KV = /* @__PURE__ */ Ve(zV, [["render", GV]]);
-const YV = Be({
+const QV = /* @__PURE__ */ Ve(GV, [["render", YV]]);
+const JV = Be({
name: "StepFormView",
props: {
stepsProps: Object,
@@ -51000,10 +51021,10 @@ const YV = Be({
this.activeRef && (this.active = this.formCreateInject.children.indexOf(this.activeRef));
});
}
-}), QV = { class: "_fd-step-form" };
-function JV(e, t, i, r, n, a) {
+}), XV = { class: "_fd-step-form" };
+function ZV(e, t, i, r, n, a) {
const s = ee("el-step"), u = ee("el-steps"), d = ee("el-button"), p = ee("el-col"), h = ee("el-row");
- return H(), ae("div", QV, [
+ return H(), ae("div", XV, [
z(u, jt({ active: e.active }, e.stepsProps), {
default: N(() => [
(H(!0), ae(Me, null, ze(e.formCreateInject.children, (g, _) => (H(), me(s, {
@@ -51050,28 +51071,28 @@ function JV(e, t, i, r, n, a) {
})
]);
}
-const XV = /* @__PURE__ */ Ve(YV, [["render", JV]]);
-const ZV = Be({
+const qV = /* @__PURE__ */ Ve(JV, [["render", ZV]]);
+const e6 = Be({
name: "TableFormView",
data() {
return {};
}
-}), qV = { class: "_fd-table-form" }, e6 = {
+}), t6 = { class: "_fd-table-form" }, n6 = {
key: 0,
class: "_fd-tf-wrap"
-}, t6 = {
+}, i6 = {
key: 1,
class: "_fc-child-empty"
};
-function n6(e, t, i, r, n, a) {
- return H(), ae("div", qV, [
- e.$slots.default ? (H(), ae("div", e6, [
+function r6(e, t, i, r, n, a) {
+ return H(), ae("div", t6, [
+ e.$slots.default ? (H(), ae("div", n6, [
kt(e.$slots, "default")
- ])) : (H(), ae("div", t6))
+ ])) : (H(), ae("div", i6))
]);
}
-const t1 = /* @__PURE__ */ Ve(ZV, [["render", n6]]);
-const i6 = Be({
+const i1 = /* @__PURE__ */ Ve(e6, [["render", r6]]);
+const o6 = Be({
name: "NestedTableFormView",
inject: ["designer"],
data() {
@@ -51082,29 +51103,29 @@ const i6 = Be({
return this.designer.setupState.t;
}
}
-}), r6 = { class: "_fd-ntable-form" }, o6 = {
+}), a6 = { class: "_fd-ntable-form" }, l6 = {
key: 0,
class: "_fd-ntf-wrap"
-}, a6 = {
+}, s6 = {
key: 1,
class: "_fc-child-empty"
-}, l6 = {
+}, u6 = {
key: 2,
class: "_fd-ntable-sub"
-}, s6 = { class: "_title" };
-function u6(e, t, i, r, n, a) {
- return H(), ae("div", r6, [
- e.$slots.default ? (H(), ae("div", o6, [
- kt(e.$slots, "default")
- ])) : (H(), ae("div", a6)),
+}, d6 = { class: "_title" };
+function f6(e, t, i, r, n, a) {
+ return H(), ae("div", a6, [
e.$slots.default ? (H(), ae("div", l6, [
- J("div", s6, le(e.t("com.nestedSubTableForm.name")), 1),
+ kt(e.$slots, "default")
+ ])) : (H(), ae("div", s6)),
+ e.$slots.default ? (H(), ae("div", u6, [
+ J("div", d6, le(e.t("com.nestedSubTableForm.name")), 1),
kt(e.$slots, "nested")
])) : Te("", !0)
]);
}
-const d6 = /* @__PURE__ */ Ve(i6, [["render", u6]]);
-const f6 = Be({
+const c6 = /* @__PURE__ */ Ve(o6, [["render", f6]]);
+const p6 = Be({
name: "InfiniteTableFormView",
inject: ["designer"],
data() {
@@ -51115,22 +51136,22 @@ const f6 = Be({
return this.designer.setupState.t;
}
}
-}), c6 = { class: "_fd-itable-form" }, p6 = {
+}), h6 = { class: "_fd-itable-form" }, m6 = {
key: 0,
class: "_fd-itf-wrap"
-}, h6 = {
+}, v6 = {
key: 1,
class: "_fc-child-empty"
};
-function m6(e, t, i, r, n, a) {
- return H(), ae("div", c6, [
- e.$slots.default ? (H(), ae("div", p6, [
+function g6(e, t, i, r, n, a) {
+ return H(), ae("div", h6, [
+ e.$slots.default ? (H(), ae("div", m6, [
kt(e.$slots, "default")
- ])) : (H(), ae("div", h6))
+ ])) : (H(), ae("div", v6))
]);
}
-const v6 = /* @__PURE__ */ Ve(f6, [["render", m6]]);
-const g6 = Be({
+const y6 = /* @__PURE__ */ Ve(p6, [["render", g6]]);
+const b6 = Be({
name: "TableFormColumnView",
props: {
label: String,
@@ -51147,26 +51168,26 @@ const g6 = Be({
data() {
return {};
}
-}), y6 = { class: "_fd-tf-title" }, b6 = {
+}), _6 = { class: "_fd-tf-title" }, w6 = {
key: 0,
class: "_fd-tf-required"
-}, _6 = { class: "_fd-tf-con" };
-function w6(e, t, i, r, n, a) {
+}, A6 = { class: "_fd-tf-con" };
+function C6(e, t, i, r, n, a) {
return H(), ae("div", {
class: "_fd-tf-col",
style: wn(e.colStyle)
}, [
- J("div", y6, [
- e.required ? (H(), ae("span", b6, "*")) : Te("", !0),
+ J("div", _6, [
+ e.required ? (H(), ae("span", w6, "*")) : Te("", !0),
be(le(e.label || ""), 1)
]),
- J("div", _6, [
+ J("div", A6, [
kt(e.$slots, "default")
])
], 4);
}
-const n1 = /* @__PURE__ */ Ve(g6, [["render", w6]]);
-const A6 = Be({
+const r1 = /* @__PURE__ */ Ve(b6, [["render", C6]]);
+const S6 = Be({
name: "StepFormItemView",
props: {
title: String,
@@ -51185,9 +51206,9 @@ const A6 = Be({
this.stepForm.stepItemRef.splice(this.stepForm.stepItemRef.indexOf(this), 1);
},
methods: {}
-}), C6 = { class: "_fd-step-form-item" };
-function S6(e, t, i, r, n, a) {
- return H(), ae("div", C6, [
+}), E6 = { class: "_fd-step-form-item" };
+function x6(e, t, i, r, n, a) {
+ return H(), ae("div", E6, [
bn(J("div", null, [
kt(e.$slots, "default")
], 512), [
@@ -51195,8 +51216,8 @@ function S6(e, t, i, r, n, a) {
])
]);
}
-const E6 = /* @__PURE__ */ Ve(A6, [["render", S6]]);
-const x6 = Be({
+const T6 = /* @__PURE__ */ Ve(S6, [["render", x6]]);
+const k6 = Be({
name: "FcDialog",
inject: ["designer"],
inheritAttrs: !1,
@@ -51216,21 +51237,21 @@ const x6 = Be({
return this.designer.setupState.t;
}
}
-}), T6 = { class: "el-dialog__header show-close" }, k6 = { class: "el-dialog__title" }, O6 = {
+}), O6 = { class: "el-dialog__header show-close" }, $6 = { class: "el-dialog__title" }, R6 = {
key: 0,
class: "el-dialog__headerbtn",
type: "button",
style: { right: "48px" }
-}, $6 = { class: "el-dialog__body" }, R6 = { class: "el-dialog__footer" };
-function D6(e, t, i, r, n, a) {
+}, D6 = { class: "el-dialog__body" }, I6 = { class: "el-dialog__footer" };
+function F6(e, t, i, r, n, a) {
const s = ee("el-button");
return H(), ae("div", {
class: "_fd-dialog el-dialog",
style: wn(`--fc-dialog-height:${e.dragConHeight - 23}px;`)
}, [
- J("header", T6, [
- J("span", k6, le(e.title), 1),
- e.fullscreen ? Te("", !0) : (H(), ae("button", O6, t[0] || (t[0] = [
+ J("header", O6, [
+ J("span", $6, le(e.title), 1),
+ e.fullscreen ? Te("", !0) : (H(), ae("button", R6, t[0] || (t[0] = [
J("i", { class: "fc-icon icon-page-max" }, null, -1)
]))),
t[1] || (t[1] = J("button", {
@@ -51250,10 +51271,10 @@ function D6(e, t, i, r, n, a) {
])
], -1))
]),
- J("div", $6, [
+ J("div", D6, [
kt(e.$slots, "default")
]),
- J("footer", R6, [
+ J("footer", I6, [
e.footer !== !1 ? (H(), ae(Me, { key: 0 }, [
z(s, null, {
default: N(() => [
@@ -51271,8 +51292,8 @@ function D6(e, t, i, r, n, a) {
])
], 4);
}
-const I6 = /* @__PURE__ */ Ve(x6, [["render", D6]]);
-const F6 = Be({
+const P6 = /* @__PURE__ */ Ve(k6, [["render", F6]]);
+const M6 = Be({
name: "FcDialog",
inject: ["designer"],
inheritAttrs: !1,
@@ -51292,12 +51313,12 @@ const F6 = Be({
return this.designer.setupState.t;
}
}
-}), P6 = { class: "el-drawer__header" }, M6 = {
+}), L6 = { class: "el-drawer__header" }, N6 = {
key: 0,
class: "el-drawer__close-btn",
type: "button"
-}, L6 = { class: "el-drawer__body" }, N6 = { class: "el-drawer__footer" };
-function B6(e, t, i, r, n, a) {
+}, B6 = { class: "el-drawer__body" }, V6 = { class: "el-drawer__footer" };
+function j6(e, t, i, r, n, a) {
const s = ee("el-button");
return H(), ae("div", {
class: "el-drawer _fd-drawer",
@@ -51307,9 +51328,9 @@ function B6(e, t, i, r, n, a) {
class: "el-drawer__sr-focus",
tabindex: "-1"
}, null, -1)),
- J("header", P6, [
+ J("header", L6, [
J("span", null, le(e.title), 1),
- e.size !== "100%" ? (H(), ae("button", M6, t[0] || (t[0] = [
+ e.size !== "100%" ? (H(), ae("button", N6, t[0] || (t[0] = [
J("i", { class: "fc-icon icon-page-max" }, null, -1)
]))) : Te("", !0),
t[1] || (t[1] = J("button", {
@@ -51329,10 +51350,10 @@ function B6(e, t, i, r, n, a) {
])
], -1))
]),
- J("div", L6, [
+ J("div", B6, [
kt(e.$slots, "default")
]),
- J("div", N6, [
+ J("div", V6, [
e.footer !== !1 ? (H(), ae(Me, { key: 0 }, [
z(s, null, {
default: N(() => [
@@ -51350,8 +51371,8 @@ function B6(e, t, i, r, n, a) {
])
], 4);
}
-const V6 = /* @__PURE__ */ Ve(F6, [["render", B6]]);
-const j6 = Be({
+const U6 = /* @__PURE__ */ Ve(M6, [["render", j6]]);
+const H6 = Be({
name: "FcDialog",
emits: ["confirm", "submit", "validateFail", "update:modelValue"],
props: {
@@ -51419,12 +51440,12 @@ const j6 = Be({
this.formCreateInject.api.top.bus.$off("fc.closeDialog", this.close);
});
}
-}), U6 = { class: "el-drawer__title" }, H6 = {
+}), z6 = { class: "el-drawer__title" }, W6 = {
key: 0,
class: "el-drawer__close-btn",
type: "button"
};
-function z6(e, t, i, r, n, a) {
+function G6(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-drawer");
return H(), me(u, jt({ class: "_fc-drawer" }, e.$attrs, {
size: e.max ? "100%" : e.size,
@@ -51433,8 +51454,8 @@ function z6(e, t, i, r, n, a) {
destroyOnClose: ""
}), {
header: N(() => [
- J("span", U6, le(e.title), 1),
- e.size !== "100%" ? (H(), ae("button", H6, [
+ J("span", z6, le(e.title), 1),
+ e.size !== "100%" ? (H(), ae("button", W6, [
e.max ? (H(), ae("i", {
key: 0,
class: "fc-icon icon-page-min",
@@ -51481,8 +51502,8 @@ function z6(e, t, i, r, n, a) {
_: 1
}, 16, ["size", "modelValue"]);
}
-const W6 = /* @__PURE__ */ Ve(j6, [["render", z6]]);
-const G6 = Be({
+const K6 = /* @__PURE__ */ Ve(H6, [["render", G6]]);
+const Y6 = Be({
name: "FcCell",
inheritAttrs: !1,
data() {
@@ -51513,7 +51534,7 @@ const G6 = Be({
});
}
});
-function K6(e, t, i, r, n, a) {
+function Q6(e, t, i, r, n, a) {
return H(), ae("div", {
ref: "cell",
class: qe(["_fd-cell", { "is-new": e.isNew }]),
@@ -51524,13 +51545,13 @@ function K6(e, t, i, r, n, a) {
], 16)
], 6);
}
-const Y6 = /* @__PURE__ */ Ve(G6, [["render", K6]]);
-const Q6 = Be({
+const J6 = /* @__PURE__ */ Ve(Y6, [["render", Q6]]);
+const X6 = Be({
name: "fcRow",
mounted() {
}
});
-function J6(e, t, i, r, n, a) {
+function Z6(e, t, i, r, n, a) {
const s = ee("el-col");
return H(), me(s, { span: 24 }, {
default: N(() => [
@@ -51543,8 +51564,8 @@ function J6(e, t, i, r, n, a) {
_: 3
});
}
-const X6 = /* @__PURE__ */ Ve(Q6, [["render", J6]]);
-const Z6 = Be({
+const q6 = /* @__PURE__ */ Ve(X6, [["render", Z6]]);
+const ej = Be({
name: "HideSwitch",
props: {
modelValue: [String, Boolean, Number],
@@ -51571,7 +51592,7 @@ const Z6 = Be({
}
}
});
-function q6(e, t, i, r, n, a) {
+function tj(e, t, i, r, n, a) {
return H(), ae("div", {
class: qe(["_fd-hide-config", { disabled: !!e.disabled, active: e.modelValue === e.activeValue }]),
onClick: t[0] || (t[0] = (...s) => e.onInput && e.onInput(...s))
@@ -51585,8 +51606,8 @@ function q6(e, t, i, r, n, a) {
], 64))
], 2);
}
-const ej = /* @__PURE__ */ Ve(Z6, [["render", q6]]);
-const tj = Be({
+const nj = /* @__PURE__ */ Ve(ej, [["render", tj]]);
+const ij = Be({
name: "SpanInput",
props: {
modelValue: [Number, String]
@@ -51615,7 +51636,7 @@ const tj = Be({
}
}
});
-function nj(e, t, i, r, n, a) {
+function rj(e, t, i, r, n, a) {
const s = ee("el-radio-button"), u = ee("el-radio-group");
return H(), me(u, {
modelValue: e.modelValue,
@@ -51637,8 +51658,8 @@ function nj(e, t, i, r, n, a) {
_: 1
}, 8, ["modelValue"]);
}
-const ij = /* @__PURE__ */ Ve(tj, [["render", nj]]);
-const rj = Be({
+const oj = /* @__PURE__ */ Ve(ij, [["render", rj]]);
+const aj = Be({
name: "FcCity",
props: {
modelValue: Array,
@@ -51726,10 +51747,10 @@ const rj = Be({
mounted() {
this.updateValue();
}
-}), oj = { class: "_fc-city" };
-function aj(e, t, i, r, n, a) {
+}), lj = { class: "_fc-city" };
+function sj(e, t, i, r, n, a) {
const s = ee("el-option"), u = ee("el-select");
- return H(), ae("div", oj, [
+ return H(), ae("div", lj, [
z(u, {
disabled: e.disabled,
clearable: e.clearable,
@@ -51779,8 +51800,8 @@ function aj(e, t, i, r, n, a) {
}, 8, ["disabled", "clearable", "modelValue", "onChange"])) : Te("", !0)
]);
}
-const lj = /* @__PURE__ */ Ve(rj, [["render", aj]]);
-const sj = Be({
+const uj = /* @__PURE__ */ Ve(aj, [["render", sj]]);
+const dj = Be({
name: "SignaturePad",
emits: ["update:modelValue", "change", "remove"],
data() {
@@ -51821,19 +51842,19 @@ const sj = Be({
this.updateValue(""), this.$emit("remove");
}
}
-}), uj = { class: "_fc-signature" }, dj = {
+}), fj = { class: "_fc-signature" }, cj = {
key: 0,
class: "_fc-signature-preview"
-}, fj = ["src"], cj = {
+}, pj = ["src"], hj = {
class: "_fc-signature-pad",
ref: "pad",
width: "600px",
height: "270px"
};
-function pj(e, t, i, r, n, a) {
+function mj(e, t, i, r, n, a) {
const s = ee("el-button"), u = ee("el-dialog");
- return H(), ae("div", uj, [
- e.modelValue ? (H(), ae("div", dj, [
+ return H(), ae("div", fj, [
+ e.modelValue ? (H(), ae("div", cj, [
J("i", {
class: "fc-icon icon-delete2",
onClick: t[0] || (t[0] = (...d) => e.remove && e.remove(...d))
@@ -51841,7 +51862,7 @@ function pj(e, t, i, r, n, a) {
J("img", {
src: e.modelValue,
alt: "signature"
- }, null, 8, fj)
+ }, null, 8, pj)
])) : (H(), ae("div", {
key: 1,
class: "_fc-signature-btn",
@@ -51885,16 +51906,16 @@ function pj(e, t, i, r, n, a) {
])
]),
default: N(() => [
- J("canvas", cj, null, 512)
+ J("canvas", hj, null, 512)
]),
_: 1
}, 8, ["title", "modelValue"])
]);
}
-const hj = /* @__PURE__ */ Ve(sj, [["render", pj]]);
-const mj = Be({
+const vj = /* @__PURE__ */ Ve(dj, [["render", mj]]);
+const gj = Be({
name: "FcDataSelectView",
- components: { FcInlineForm: jc, DataTable: Vc },
+ components: { FcInlineForm: Uc, DataTable: jc },
inject: ["designer"],
props: {
title: String,
@@ -51921,11 +51942,11 @@ const mj = Be({
e.stopPropagation(), this.visible = !this.visible;
}
}
-}), vj = {
+}), yj = {
key: 0,
class: "el-dialog"
-}, gj = { class: "el-dialog__header show-close" }, yj = { class: "el-dialog__title" };
-function bj(e, t, i, r, n, a) {
+}, bj = { class: "el-dialog__header show-close" }, _j = { class: "el-dialog__title" };
+function wj(e, t, i, r, n, a) {
const s = ee("el-select");
return H(), ae("div", {
class: "_fd-data-select",
@@ -51936,23 +51957,23 @@ function bj(e, t, i, r, n, a) {
disabled: e.disabled,
placeholder: e.placeholder
}, null, 8, ["onClickCapture", "disabled", "placeholder"]),
- e.visible ? (H(), ae("div", vj, [
- J("header", gj, [
- J("span", yj, le(e.title), 1)
+ e.visible ? (H(), ae("div", yj, [
+ J("header", bj, [
+ J("span", _j, le(e.title), 1)
]),
kt(e.$slots, "search"),
kt(e.$slots, "table")
])) : Te("", !0)
], 4);
}
-const _j = /* @__PURE__ */ Ve(mj, [["render", bj]]);
+const Aj = /* @__PURE__ */ Ve(gj, [["render", wj]]);
/*!
* @form-create/component-wangeditor v3.2.14
* (c) 2018-2024 xaboy
* Github https://github.com/xaboy/form-create with wangeditor
* Released under the MIT License.
*/
-function ey(e, t) {
+function ny(e, t) {
var i = Object.keys(e);
if (Object.getOwnPropertySymbols) {
var r = Object.getOwnPropertySymbols(e);
@@ -51962,12 +51983,12 @@ function ey(e, t) {
}
return i;
}
-function wj(e) {
+function Cj(e) {
for (var t = 1; t < arguments.length; t++) {
var i = arguments[t] != null ? arguments[t] : {};
- t % 2 ? ey(Object(i), !0).forEach(function(r) {
- Aj(e, r, i[r]);
- }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(e, Object.getOwnPropertyDescriptors(i)) : ey(Object(i)).forEach(function(r) {
+ t % 2 ? ny(Object(i), !0).forEach(function(r) {
+ Sj(e, r, i[r]);
+ }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(e, Object.getOwnPropertyDescriptors(i)) : ny(Object(i)).forEach(function(r) {
Object.defineProperty(e, r, Object.getOwnPropertyDescriptor(i, r));
});
}
@@ -51980,7 +52001,7 @@ function yn(e) {
return t && typeof Symbol == "function" && t.constructor === Symbol && t !== Symbol.prototype ? "symbol" : typeof t;
}, yn(e);
}
-function Aj(e, t, i) {
+function Sj(e, t, i) {
return t in e ? Object.defineProperty(e, t, {
value: i,
enumerable: !0,
@@ -51988,10 +52009,10 @@ function Aj(e, t, i) {
writable: !0
}) : e[t] = i, e;
}
-function Cj(e) {
+function Ej(e) {
return e && e.__esModule && Object.prototype.hasOwnProperty.call(e, "default") ? e.default : e;
}
-var i1 = { exports: {} };
+var o1 = { exports: {} };
(function(e, t) {
(function(r, n) {
e.exports = n();
@@ -60626,14 +60647,14 @@ var i1 = { exports: {} };
(0, s.default)(r, "__esModule", { value: !0 });
}]).default;
});
-})(i1);
-var Sj = /* @__PURE__ */ Cj(i1.exports), Ej = "fcEditor", xj = 1, Tj = Object.assign || function(e) {
+})(o1);
+var xj = /* @__PURE__ */ Ej(o1.exports), Tj = "fcEditor", kj = 1, Oj = Object.assign || function(e) {
for (var t, i = 1; i < arguments.length; i++)
for (var r in t = arguments[i], t)
Object.prototype.hasOwnProperty.call(t, r) && (e[r] = t[r]);
return e;
-}, kj = Be({
- name: Ej,
+}, $j = Be({
+ name: Tj,
props: {
modelValue: String,
init: Function,
@@ -60645,7 +60666,7 @@ var Sj = /* @__PURE__ */ Cj(i1.exports), Ej = "fcEditor", xj = 1, Tj = Object.as
data: function() {
return {
editor: {},
- uni: xj++
+ uni: kj++
};
},
watch: {
@@ -60667,11 +60688,11 @@ var Sj = /* @__PURE__ */ Cj(i1.exports), Ej = "fcEditor", xj = 1, Tj = Object.as
mounted: function() {
var t = this;
this.$nextTick(function() {
- t.editor = new Sj("#editor".concat(t.uni)), t.editor.config.zIndex = 2, t.editor.config.focus = !1, t.editor.config.autoFocus = !1, t.config && Tj(t.editor.config, t.config), t.init && t.init(t.editor), t.editor.create(), t.enable(), t.editor.txt.html(t.modelValue);
+ t.editor = new xj("#editor".concat(t.uni)), t.editor.config.zIndex = 2, t.editor.config.focus = !1, t.editor.config.autoFocus = !1, t.config && Oj(t.editor.config, t.config), t.init && t.init(t.editor), t.editor.create(), t.enable(), t.editor.txt.html(t.modelValue);
});
},
render: function() {
- var t = wj({}, this.$attrs);
+ var t = Cj({}, this.$attrs);
return delete t.id, z("div", jt(t, {
onInput: this.result,
id: "editor".concat(this.uni),
@@ -60684,7 +60705,7 @@ var Sj = /* @__PURE__ */ Cj(i1.exports), Ej = "fcEditor", xj = 1, Tj = Object.as
});
(function(e, t) {
(function(i) {
- i(to.exports);
+ i(qo());
})(function(i) {
i.defineSimpleMode = function(_, S) {
i.defineMode(_, function(b) {
@@ -60875,144 +60896,144 @@ rr.defineSimpleMode("fcComputedMode", {
const Ht = (e, t, i) => {
tt.component(e, i || t), li.component(e, t);
};
-tt.component("draggable", Yo);
-tt.component("DragTool", Xb);
-tt.component("DragBox", qb);
-tt.component("Validate", kV);
-tt.component("Struct", xb);
-tt.component("HtmlEditor", X4);
+tt.component("draggable", Ko);
+tt.component("DragTool", qb);
+tt.component("DragBox", t1);
+tt.component("Validate", $V);
+tt.component("Struct", kb);
+tt.component("HtmlEditor", q4);
tt.component("FnEditor", sr);
-tt.component("ComputedConfig", Z0);
-tt.component("Required", DV);
-tt.component("TableOptions", bb);
-tt.component("TreeOptions", HV);
-tt.component("TableFormColumn", n1);
-tt.component("TableFormColumn2", n1);
-tt.component("EventConfig", q0);
-tt.component("FetchConfig", d5);
-tt.component("TableColumnConfig", b5);
-tt.component("TableButtonConfig", T5);
+tt.component("ComputedConfig", eb);
+tt.component("Required", FV);
+tt.component("TableOptions", wb);
+tt.component("TreeOptions", WV);
+tt.component("TableFormColumn", r1);
+tt.component("TableFormColumn2", r1);
+tt.component("EventConfig", tb);
+tt.component("FetchConfig", c5);
+tt.component("TableColumnConfig", w5);
+tt.component("TableButtonConfig", O5);
tt.component("SizeInput", ea);
-tt.component("PatternInput", Op);
-tt.component("StyleConfig", Cb);
-tt.component("GlobalFetchConfig", yb);
-tt.component("GlobalFetchSelect", z5);
-tt.component("GlobalEventConfig", gb);
-tt.component("GlobalClassConfig", Sb);
-tt.component("GlobalClassSelect", Q5);
-tt.component("GlobalVariableConfig", Eb);
-tt.component("FetchTable", nV);
+tt.component("PatternInput", $p);
+tt.component("StyleConfig", Eb);
+tt.component("GlobalFetchConfig", _b);
+tt.component("GlobalFetchSelect", G5);
+tt.component("GlobalEventConfig", bb);
+tt.component("GlobalClassConfig", xb);
+tt.component("GlobalClassSelect", X5);
+tt.component("GlobalVariableConfig", Tb);
+tt.component("FetchTable", rV);
tt.component("VariableConfig", ml);
tt.component("ColorInput", ta);
tt.component("ConfigItem", si);
-tt.component("ConfigTitle", mb);
-tt.component("FieldInput", t5);
-tt.component("PromptInput", r5);
+tt.component("ConfigTitle", gb);
+tt.component("FieldInput", i5);
+tt.component("PromptInput", a5);
tt.component("ValueInput", wu);
-tt.component("StepFormItem", E6);
-tt.component("FcRow", X6);
-tt.component("FnConfig", M5);
-tt.component("FnInput", Zb);
-tt.component("RuleSelect", $p);
-tt.component("HideConfig", ej);
-tt.component("SpanInput", ij);
-tt.component("LanguageInput", zp);
-Ht("FcSlot", Yy, pV);
-Ht("FcJson", Qy, hV);
-Ht("DataTable", Vc);
-Ht("FcEditor", kj);
-Ht("fcInlineForm", jc);
-Ht("FcCell", Gy, Y6);
-Ht("TableForm", Uy, t1);
-Ht("TableFormPro", Hy, t1);
-Ht("StepForm", KV, XV);
-Ht("FcValue", Ky, cV);
-Ht("FcTable", jy, sV);
-Ht("NestedTableForm", Wy, d6);
-Ht("InfiniteTableForm", zy, v6);
-Ht("FcDialog", c0, I6);
-Ht("FcDrawer", W6, V6);
-Ht("AudioBox", h0);
-Ht("VideoBox", U0);
-Ht("BarCodeBox", j0);
-Ht("IframeBox", m0);
-Ht("QrCodeBox", z0);
-Ht("SignaturePad", hj);
-Ht("FcEcharts", Jy);
-Ht("FcTitle", Zy);
-Ht("FcCity", lj);
-Ht("FcId", Xy);
-Ht("FcMarkdown", f0);
-Ht("fcDataSelect", p0, _j);
-const Oj = function(e) {
+tt.component("StepFormItem", T6);
+tt.component("FcRow", q6);
+tt.component("FnConfig", N5);
+tt.component("FnInput", e1);
+tt.component("RuleSelect", Rp);
+tt.component("HideConfig", nj);
+tt.component("SpanInput", oj);
+tt.component("LanguageInput", Wp);
+Ht("FcSlot", Jy, mV);
+Ht("FcJson", Xy, vV);
+Ht("DataTable", jc);
+Ht("FcEditor", $j);
+Ht("fcInlineForm", Uc);
+Ht("FcCell", Yy, J6);
+Ht("TableForm", zy, i1);
+Ht("TableFormPro", Wy, i1);
+Ht("StepForm", QV, qV);
+Ht("FcValue", Qy, hV);
+Ht("FcTable", Hy, dV);
+Ht("NestedTableForm", Ky, c6);
+Ht("InfiniteTableForm", Gy, y6);
+Ht("FcDialog", h0, P6);
+Ht("FcDrawer", K6, U6);
+Ht("AudioBox", v0);
+Ht("VideoBox", z0);
+Ht("BarCodeBox", H0);
+Ht("IframeBox", g0);
+Ht("QrCodeBox", G0);
+Ht("SignaturePad", vj);
+Ht("FcEcharts", Zy);
+Ht("FcTitle", e0);
+Ht("FcCity", uj);
+Ht("FcId", qy);
+Ht("FcMarkdown", p0);
+Ht("fcDataSelect", m0, Aj);
+const Rj = function(e) {
(Array.isArray(e) ? e : [e]).forEach((i) => {
- rn[i.name] = i.handle, cc[i.name] = i.example, eu.value.formula[i.name] = i.info, Fy.forEach((r) => {
+ rn[i.name] = i.handle, pc[i.name] = i.example, eu.value.formula[i.name] = i.info, My.forEach((r) => {
r.key === i.menu && r.children.push(i.name), li.setFormula(i.name, i.handle), tt.setFormula(i.name, i.handle);
});
});
-}, $j = function(e) {
+}, Dj = function(e) {
(Array.isArray(e) ? e : [e]).forEach((i) => {
- Nc[i.name] = i.handle, My[i.name] = i.rule, eu.value.behavior[i.name] = {
+ Bc[i.name] = i.handle, Ny[i.name] = i.rule, eu.value.behavior[i.name] = {
info: i.info,
name: i.label
- }, Py.forEach((r) => {
+ }, Ly.forEach((r) => {
r.key === i.menu && r.children.push(i.name);
});
});
-}, Rj = function(e) {
+}, Ij = function(e) {
e.component("FcDesigner", an);
};
-an.install = Rj;
+an.install = Ij;
an.makeOptionsRule = Jr;
an.formCreate = li;
an.designerForm = tt;
an.component = Ht;
-an.setFormula = Oj;
-an.setBehavior = $j;
-an.useLocale = J0;
+an.setFormula = Rj;
+an.setBehavior = Dj;
+an.useLocale = Z0;
an.copyTextToClipboard = tr;
an.getInjectArg = Fn;
an.localeOptions = yt;
an.localeProps = Ke;
-an.makeRequiredRule = oy;
+an.makeRequiredRule = ly;
an.makeTreeOptions = Wi;
an.makeTreeOptionsRule = ll;
-an.makeTitleRule = ay;
+an.makeTitleRule = sy;
an.makeDataRule = Ti;
an.toJSON = ai;
an.loadjs = kn;
-an.t = wc;
+an.t = Ac;
an.utils = {
copyTextToClipboard: tr,
getInjectArg: Fn,
localeOptions: yt,
localeProps: Ke,
- makeTitleRule: ay,
+ makeTitleRule: sy,
makeOptionsRule: Jr,
- makeRequiredRule: oy,
+ makeRequiredRule: ly,
makeTreeOptions: Wi,
makeTreeOptionsRule: ll,
makeDataRule: Ti,
toJSON: ai
};
-const ty = "3.2.22";
-ww(ty, li.version) === 1 && console.error("Please use FormCreate version " + ty + " or greater, see https://github.com/xaboy/form-create.");
+const iy = "3.2.22";
+Cw(iy, li.version) === 1 && console.error("Please use FormCreate version " + iy + " or greater, see https://github.com/xaboy/form-create.");
export {
tr as copyTextToClipboard,
an as default,
tt as designerForm,
li as formCreate,
Fn as getInjectArg,
- Rj as install,
+ Ij as install,
kn as loadjs,
yt as localeOptions,
Ke as localeProps,
Ti as makeDataRule,
Jr as makeOptionsRule,
- oy as makeRequiredRule,
- ay as makeTitleRule,
+ ly as makeRequiredRule,
+ sy as makeTitleRule,
Wi as makeTreeOptions,
ll as makeTreeOptionsRule,
- wc as t,
+ Ac as t,
ai as toJSON
};
diff --git a/core/core-frontend/src/fcDesignerPro/index.umd.js b/core/core-frontend/src/fcDesignerPro/index.umd.js
index 073b203..5f534b3 100644
--- a/core/core-frontend/src/fcDesignerPro/index.umd.js
+++ b/core/core-frontend/src/fcDesignerPro/index.umd.js
@@ -5,11 +5,11 @@
* license 仅限于被授权主体（个人、企业或组织）使用
*/
(function(){"use strict";try{if(typeof document!="undefined"){var e=document.createElement("style");e.appendChild(document.createTextNode('._fc-step-form .van-step{line-height:1.4;text-align:left}._fc-popup.van-popup{display:flex;height:100%;padding-bottom:110px;padding-top:50px}._fc-popup-title{color:#333;font-size:16px;left:0;position:absolute;text-align:center;top:16px;width:100%}._fc-popup-content{display:flex;flex:1;overflow:auto}._fc-popup-footer{bottom:0;left:0;padding:10px;position:absolute;right:0}._fc-data-table{width:100%}._fc-data-table .el-table{--el-table-header-bg-color:#e8eefc}._fc-data-table .el-pagination{display:flex;margin-top:10px}._fc-data-table .el-pagination.left{justify-content:flex-start}._fc-data-table .el-pagination.center{justify-content:center}._fc-data-table .el-pagination.right{justify-content:flex-end}._fc-data-table ._fc-data-table-img-list .el-image{height:60px;max-width:150px}._fc-table{overflow:auto}._fc-table>table{border-bottom:1px solid #ebeef5;border-right:1px solid #ebeef5;border-color:#ebeef5 currentcolor currentcolor #ebeef5;border-style:solid none none solid;border-width:1px 0 0 1px;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fc-table td,._fc-table tr{min-height:50px}._fc-table td{border-bottom:0;border-right:0;border-color:currentcolor #ebeef5 #ebeef5 currentcolor;border-style:none solid solid none;border-width:0 1px 1px 0;box-sizing:border-box;min-width:80px;overflow:hidden;overflow-wrap:break-word;padding:5px;position:relative}._fc-table.is-mini td{min-height:12px;padding:0}._fc-table.is-mini .el-form-item{margin:0;padding:0}._fc-table-form{color:var(--fc-text-color-2);overflow:auto}._fc-table-form .form-create td .el-form-item{margin-bottom:1px}._fc-table-form .form-create td .el-form-item.is-error{margin-bottom:22px}._fc-table-form .el-form-item__label,._fc-table-form .van-field__label{display:none!important}._fc-table-form .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fc-tf-head-idx,._fc-tf-idx{font-weight:500;min-width:40px;text-align:center;width:40px}._fc-tf-btn,._fc-tf-edit{min-width:70px;text-align:center;width:70px}._fc-tf-btn .fc-icon{cursor:pointer}._fc-table-form._fc-disabled ._fc-tf-btn .fc-icon,._fc-table-form._fc-disabled>.el-button{cursor:not-allowed}._fc-tf-table{border:1px solid #ebeef5;border-bottom:0;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fc-table-form ._fc-tf-table>thead>tr>th{border:0;border-bottom:1px solid #ebeef5;font-weight:500;height:40px}._fc-table-form ._fc-tf-table>thead>tr>th+th{border-left:1px solid #ebeef5}._fc-table-form tr{min-height:50px}._fc-table-form ._fc-read-view{text-align:center;width:100%}._fc-table-form td{border:0;border-bottom:1px solid #ebeef5;box-sizing:border-box;min-height:50px;min-width:80px;overflow:hidden;overflow-wrap:break-word;padding:5px;position:relative}._fc-table-form td+td{border-left:1px solid #ebeef5}._fc-tf-table .el-cascader,._fc-tf-table .el-date-editor,._fc-tf-table .el-input-number,._fc-tf-table .el-select,._fc-tf-table .el-slider{width:100%}._fc-tf-head-required:before{color:#f56c6c;content:"*";margin-right:4px}._fc-table-form-v2{color:var(--fc-text-color-2);overflow:auto;width:100%}._fc-table-form-v2 .is-required:before{color:#f56c6c;content:"*";margin-right:4px}._fc-table-form-v2 .form-create td .el-form-item{margin-bottom:1px}._fc-table-form-v2 .form-create td .el-form-item.is-error{margin-bottom:22px}._fc-table-form-v2 .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fc-table-form-v2 .el-form-item__label{display:none!important}._fc-tf-pro-handle{align-items:center;display:flex;flex-direction:row;justify-content:space-between;margin-top:12px}._fc-table-form-v2 .el-cascader,._fc-table-form-v2 .el-date-editor,._fc-table-form-v2 .el-input-number,._fc-table-form-v2 .el-select,._fc-table-form-v2 .el-slider{width:100%}._fc-infinite-table-form{color:var(--fc-text-color-2);overflow:auto}._fc-infinite-table-form .form-create .el-form-item{margin-bottom:1px}._fc-infinite-table-form .form-create .el-form-item.is-error{margin-bottom:22px}._fc-infinite-table-form .el-form-item__label,._fc-infinite-table-form .van-field__label{display:none!important}._fc-infinite-table-form .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fc-itf-table ._fc-itf-head-idx,._fc-itf-table ._fc-itf-idx{font-weight:500;min-width:40px;padding:0;text-align:center;width:40px}._fc-itf-idx div{border:1px solid #bfbfbf;border-radius:6px;cursor:pointer;display:inline-flex;height:18px;justify-content:center;line-height:16px;width:18px}._fc-itf-sub-idx{width:30px}._fc-itf-btn,._fc-itf-edit{min-width:70px;text-align:center;width:70px}._fc-itf-btn .fc-icon{cursor:pointer}._fc-infinite-table-form._fc-disabled ._fc-itf-btn .fc-icon,._fc-infinite-table-form._fc-disabled>.el-button{cursor:not-allowed}._fc-itf-table{border:1px solid #ebeef5;border-bottom:0;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fc-itf-table>thead>tr>th{border:0;border-bottom:1px solid #ebeef5;font-weight:500;height:40px}._fc-itf-table ._fc-itf-table>thead{display:none}._fc-itf-table ._fc-itf-table{border-right:0}._fc-itf-table>thead>tr>th+th{border-left:1px solid #ebeef5}._fc-itf-table tr{min-height:50px}._fc-itf-table ._fc-read-view{text-align:center;width:100%}._fc-itf-table td{border:0;border-bottom:1px solid #ebeef5;box-sizing:border-box;min-height:50px;min-width:80px;overflow:hidden;overflow-wrap:break-word;padding:10px;position:relative}._fc-itf-table td+td{border-left:1px solid #ebeef5}._fc-itf-table .el-cascader,._fc-itf-table .el-date-editor,._fc-itf-table .el-input-number,._fc-itf-table .el-select,._fc-itf-table .el-slider{width:100%}._fc-infinite-table-form ._fc-itf-sub{padding:5px 0 5px 10px}._fc-itf-sub ._fc-table-form{background-color:var(--fc-bg-color-1)}._fc-itf-sub ._fc-tf-table{border:0}._fc-itf-idx+._fc-itf-idx,._fc-itf-sub-idx+._fc-itf-head-idx{border-left:0}._fc-itf-head-required:before{color:#f56c6c;content:"*";margin-right:4px}._fc-nested-table-form{color:var(--fc-text-color-2);overflow:auto}._fc-nested-table-form .form-create .el-form-item{margin-bottom:1px}._fc-nested-table-form .form-create .el-form-item.is-error{margin-bottom:22px}._fc-nested-table-form .el-form-item__label,._fc-nested-table-form .van-field__label{display:none!important}._fc-nested-table-form .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fc-ntf-table ._fc-ntf-head-idx,._fc-ntf-table ._fc-ntf-idx{font-weight:500;min-width:40px;padding:0;text-align:center;width:40px}._fc-ntf-idx div{border:1px solid #bfbfbf;border-radius:6px;cursor:pointer;display:inline-flex;height:18px;justify-content:center;line-height:16px;width:18px}._fc-ntf-sub-idx{width:30px}._fc-ntf-btn,._fc-ntf-edit{min-width:70px;text-align:center;width:70px}._fc-ntf-btn .fc-icon{cursor:pointer}._fc-nested-table-form._fc-disabled ._fc-ntf-btn .fc-icon,._fc-nested-table-form._fc-disabled>.el-button{cursor:not-allowed}._fc-ntf-table{border:1px solid #ebeef5;border-bottom:0;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fc-ntf-table>thead>tr>th{border:0;border-bottom:1px solid #ebeef5;font-weight:500;height:40px}._fc-ntf-table>thead>tr>th+th{border-left:1px solid #ebeef5}._fc-ntf-table tr{min-height:50px}._fc-ntf-table ._fc-read-view{text-align:center;width:100%}._fc-ntf-table td{border:0;border-bottom:1px solid #ebeef5;box-sizing:border-box;min-height:50px;min-width:80px;overflow:hidden;overflow-wrap:break-word;padding:10px;position:relative}._fc-ntf-table td+td{border-left:1px solid #ebeef5}._fc-ntf-table .el-cascader,._fc-ntf-table .el-date-editor,._fc-ntf-table .el-input-number,._fc-ntf-table .el-select,._fc-ntf-table .el-slider{width:100%}._fc-nested-table-form ._fc-ntf-sub{background-color:#fafafa}._fc-ntf-sub ._fc-table-form{background-color:var(--fc-bg-color-1)}._fc-ntf-sub ._fc-tf-table{border:0}._fc-ntf-idx+._fc-ntf-idx,._fc-ntf-sub-idx+._fc-ntf-head-idx{border-left:0}._fc-ntf-head-required:before{color:#f56c6c;content:"*";margin-right:4px}._fc-cell{display:inline-block}._fc-cell .el-cascader,._fc-cell .el-date-editor,._fc-cell .el-input-number,._fc-cell .el-select,._fc-cell .el-slider,._fc-city-m{width:100%}._fc-city-m .van-cell{padding:0}._fc-line-form{align-items:flex-start;display:flex;flex-flow:wrap;width:100%}.form-create-m ._fc-line-form{display:flex;flex-wrap:wrap}.form-create ._fc-line-form ._fc-line-form,.form-create ._fc-line-form ._fd-drag-item,.form-create ._fc-line-form ._fd-drag-tool,.form-create ._fc-line-form .el-col-24{display:inline-flex;flex:initial;flex:unset!important;flex-wrap:wrap;max-width:100%;width:auto!important}._fc-m-con .form-create ._fc-line-form>.el-col-24{width:100%!important}._fc-line-form .el-form-item{display:inline-flex;vertical-align:middle}._fc-line-form .el-select,._fc-line-form .el-slider{width:220px}._fc-echarts{height:300px;width:100%}._fc-m-signature{width:100%}._fc-m-signature-btn,._fc-m-signature-preview{background:#fff;border:1px dashed #d4d7e0;border-radius:4px;box-sizing:border-box;color:#c9ccd8;font-size:14px;height:88px;line-height:88px;min-width:160px;position:relative;text-align:center;width:100%}._fc-m-signature-btn{cursor:pointer}._fc-m-signature-preview>img{display:inline-block;height:88px}._fc-m-signature-preview .icon-delete2{cursor:pointer;display:inline-block;font-size:14px;line-height:14px;position:absolute;right:9px;top:9px}._fc-m-signature-btn i{font-size:14px}._fc-m-signature-dialog .van-dialog__header{padding:15px 0;position:relative}._fc-m-signature-dialog .icon-add2{color:var(--fc-text-color-3);display:inline-block;position:absolute;right:18px;transform:rotate(45deg)}._fc-m-signature-pad{background-image:linear-gradient(#fff 14px,transparent 0),linear-gradient(90deg,#fff 14px,#d4d7e0 0);background-size:15px 15px;border:1px dashed #d4d7e0;border-radius:4px;box-sizing:border-box;width:100%}._fc-title{font-size:16px;font-weight:600;margin-bottom:16px;margin-top:1em;width:100%}._fc-title.h1,._fc-title.h2{border-bottom:1px solid #eee;padding-bottom:.3em}._fc-title.h1{font-size:32px;line-height:1.2}._fc-title.h2{font-size:24px;line-height:1.225}._fc-title.h3{font-size:20px;line-height:1.43}._fc-title.h4{font-size:16px}._fc-title.h5{font-size:14px}._fc-title.h6{font-size:12px}._fc-markdown{-ms-text-size-adjust:100%;-webkit-text-size-adjust:100%;word-wrap:break-word;color-scheme:light;font-size:16px;line-height:1.5;margin:0;width:100%}._fc-markdown details,._fc-markdown figcaption,._fc-markdown figure{display:block}._fc-markdown summary{display:list-item}._fc-markdown [hidden]{display:none!important}._fc-markdown a{background-color:transparent;color:#0969da;text-decoration:none}._fc-markdown abbr[title]{border-bottom:none;-webkit-text-decoration:underline dotted;text-decoration:underline dotted}._fc-markdown b,._fc-markdown strong{font-weight:600}._fc-markdown dfn{font-style:italic}._fc-markdown h1{border-bottom:1px solid #d1d9e0b3;font-size:2em;font-weight:600;margin:.67em 0;padding-bottom:.3em}._fc-markdown mark{background-color:#fff8c5;color:#1f2328}._fc-markdown small{font-size:90%}._fc-markdown sub,._fc-markdown sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}._fc-markdown sub{bottom:-.25em}._fc-markdown sup{top:-.5em}._fc-markdown img{border-style:none;box-sizing:content-box;max-width:100%}._fc-markdown code,._fc-markdown kbd,._fc-markdown pre,._fc-markdown samp{font-family:monospace;font-size:1em}._fc-markdown figure{margin:1em 2.5rem}._fc-markdown hr{background:transparent;background-color:#d1d9e0;border:0;box-sizing:content-box;height:.25em;margin:1.5rem 0;overflow:hidden;padding:0}._fc-markdown input{font:inherit;font-family:inherit;font-size:inherit;line-height:inherit;margin:0;overflow:visible}._fc-markdown [type=button],._fc-markdown [type=reset],._fc-markdown [type=submit]{-webkit-appearance:button;appearance:button}._fc-markdown [type=checkbox],._fc-markdown [type=radio]{box-sizing:border-box;padding:0}._fc-markdown [type=number]::-webkit-inner-spin-button,._fc-markdown [type=number]::-webkit-outer-spin-button{height:auto}._fc-markdown [type=search]::-webkit-search-cancel-button,._fc-markdown [type=search]::-webkit-search-decoration{-webkit-appearance:none;appearance:none}._fc-markdown ::-webkit-input-placeholder{color:inherit;opacity:.54}._fc-markdown ::-webkit-file-upload-button{-webkit-appearance:button;appearance:button;font:inherit}._fc-markdown a:hover{text-decoration:underline}._fc-markdown ::placeholder{color:#59636e;opacity:1}._fc-markdown hr:after,._fc-markdown hr:before{content:"";display:table}._fc-markdown hr:after{clear:both}._fc-markdown table{border-collapse:collapse;border-spacing:0;display:block;font-variant:tabular-nums;max-width:100%;overflow:auto;width:max-content}._fc-markdown td,._fc-markdown th{padding:0}._fc-markdown details summary{cursor:pointer}._fc-markdown [role=button]:focus,._fc-markdown a:focus,._fc-markdown input[type=checkbox]:focus,._fc-markdown input[type=radio]:focus{box-shadow:none;outline:2px solid #0969da;outline-offset:-2px}._fc-markdown [role=button]:focus:not(:focus-visible),._fc-markdown a:focus:not(:focus-visible),._fc-markdown input[type=checkbox]:focus:not(:focus-visible),._fc-markdown input[type=radio]:focus:not(:focus-visible){outline:1px solid transparent}._fc-markdown [role=button]:focus-visible,._fc-markdown a:focus-visible,._fc-markdown input[type=checkbox]:focus-visible,._fc-markdown input[type=radio]:focus-visible{box-shadow:none;outline:2px solid #0969da;outline-offset:-2px}._fc-markdown a:not([class]):focus,._fc-markdown a:not([class]):focus-visible,._fc-markdown input[type=checkbox]:focus,._fc-markdown input[type=checkbox]:focus-visible,._fc-markdown input[type=radio]:focus,._fc-markdown input[type=radio]:focus-visible{outline-offset:0}._fc-markdown kbd{background-color:#f6f8fa;border:1px solid #d1d9e0b3;border-radius:6px;box-shadow:inset 0 -1px #d1d9e0b3;color:#1f2328;display:inline-block;font:11px ui-monospace,SFMono-Regular,SF Mono,Menlo,Consolas,Liberation Mono,monospace;line-height:10px;padding:.25rem;vertical-align:middle}._fc-markdown h1,._fc-markdown h2,._fc-markdown h3,._fc-markdown h4,._fc-markdown h5,._fc-markdown h6{font-weight:600;line-height:1.25;margin-bottom:1rem;margin-top:1.5rem}._fc-markdown h2{border-bottom:1px solid #d1d9e0b3;font-size:1.5em;font-weight:600;padding-bottom:.3em}._fc-markdown h3{font-size:1.25em;font-weight:600}._fc-markdown h4{font-size:1em;font-weight:600}._fc-markdown h5{font-size:.875em;font-weight:600}._fc-markdown h6{color:#59636e;font-size:.85em;font-weight:600}._fc-markdown p{margin-bottom:10px;margin-top:0}._fc-markdown blockquote{border-left:.25em solid #d1d9e0;color:#59636e;margin:0;padding:0 1em}._fc-markdown ol,._fc-markdown ul{margin-bottom:0;margin-top:0;padding-left:2em}._fc-markdown ol ol,._fc-markdown ul ol{list-style-type:lower-roman}._fc-markdown ol ol ol,._fc-markdown ol ul ol,._fc-markdown ul ol ol,._fc-markdown ul ul ol{list-style-type:lower-alpha}._fc-markdown dd{margin-left:0}._fc-markdown code,._fc-markdown pre,._fc-markdown samp,._fc-markdown tt{font-family:ui-monospace,SFMono-Regular,SF Mono,Menlo,Consolas,Liberation Mono,monospace;font-size:12px}._fc-markdown pre{word-wrap:normal;margin-bottom:0;margin-top:0}._fc-markdown input::-webkit-inner-spin-button,._fc-markdown input::-webkit-outer-spin-button{appearance:none;margin:0}._fc-markdown:after,._fc-markdown:before{content:"";display:table}._fc-markdown:after{clear:both}._fc-markdown>:first-child{margin-top:0!important}._fc-markdown>:last-child{margin-bottom:0!important}._fc-markdown a:not([href]){color:inherit;text-decoration:none}._fc-markdown blockquote,._fc-markdown details,._fc-markdown dl,._fc-markdown ol,._fc-markdown p,._fc-markdown pre,._fc-markdown table,._fc-markdown ul{margin-bottom:1rem;margin-top:0}._fc-markdown blockquote>:first-child{margin-top:0}._fc-markdown blockquote>:last-child{margin-bottom:0}._fc-markdown h1:hover .anchor,._fc-markdown h2:hover .anchor,._fc-markdown h3:hover .anchor,._fc-markdown h4:hover .anchor,._fc-markdown h5:hover .anchor,._fc-markdown h6:hover .anchor{text-decoration:none}._fc-markdown h1 code,._fc-markdown h1 tt,._fc-markdown h2 code,._fc-markdown h2 tt,._fc-markdown h3 code,._fc-markdown h3 tt,._fc-markdown h4 code,._fc-markdown h4 tt,._fc-markdown h5 code,._fc-markdown h5 tt,._fc-markdown h6 code,._fc-markdown h6 tt{font-size:inherit;padding:0 .2em}._fc-markdown summary h1,._fc-markdown summary h2,._fc-markdown summary h3,._fc-markdown summary h4,._fc-markdown summary h5,._fc-markdown summary h6{display:inline-block}._fc-markdown summary h1,._fc-markdown summary h2{border-bottom:0;padding-bottom:0}._fc-markdown ol.no-list,._fc-markdown ul.no-list{list-style-type:none;padding:0}._fc-markdown ol[type="a s"]{list-style-type:lower-alpha}._fc-markdown ol[type="A s"]{list-style-type:upper-alpha}._fc-markdown ol[type="i s"]{list-style-type:lower-roman}._fc-markdown ol[type="I s"]{list-style-type:upper-roman}._fc-markdown div>ol:not([type]),._fc-markdown ol[type="1"]{list-style-type:decimal}._fc-markdown ol ol,._fc-markdown ol ul,._fc-markdown ul ol,._fc-markdown ul ul{margin-bottom:0;margin-top:0}._fc-markdown li>p{margin-top:1rem}._fc-markdown li+li{margin-top:.25em}._fc-markdown dl{padding:0}._fc-markdown dl dt{font-size:1em;font-style:italic;font-weight:600;margin-top:1rem;padding:0}._fc-markdown dl dd{margin-bottom:1rem;padding:0 1rem}._fc-markdown table th{font-weight:600}._fc-markdown table td,._fc-markdown table th{border:1px solid #d1d9e0;padding:6px 13px}._fc-markdown table td>:last-child{margin-bottom:0}._fc-markdown table tr{background-color:#fff;border-top:1px solid #d1d9e0b3}._fc-markdown table tr:nth-child(2n){background-color:#f6f8fa}._fc-markdown table img{background-color:transparent}._fc-markdown img[align=right]{padding-left:20px}._fc-markdown img[align=left]{padding-right:20px}._fc-markdown .emoji{background-color:transparent;max-width:none;vertical-align:text-top}._fc-markdown span.frame{display:block;overflow:hidden}._fc-markdown span.frame>span{border:1px solid #d1d9e0;display:block;float:left;margin:13px 0 0;overflow:hidden;padding:7px;width:auto}._fc-markdown span.frame span img{display:block;float:left}._fc-markdown span.frame span span{clear:both;color:#1f2328;display:block;padding:5px 0 0}._fc-markdown span.align-center{clear:both;display:block;overflow:hidden}._fc-markdown span.align-center>span{display:block;margin:13px auto 0;overflow:hidden;text-align:center}._fc-markdown span.align-center span img{margin:0 auto;text-align:center}._fc-markdown span.align-right{clear:both;display:block;overflow:hidden}._fc-markdown span.align-right>span{display:block;margin:13px 0 0;overflow:hidden;text-align:right}._fc-markdown span.align-right span img{margin:0;text-align:right}._fc-markdown span.float-left{display:block;float:left;margin-right:13px;overflow:hidden}._fc-markdown span.float-left span{margin:13px 0 0}._fc-markdown span.float-right{display:block;float:right;margin-left:13px;overflow:hidden}._fc-markdown span.float-right>span{display:block;margin:13px auto 0;overflow:hidden;text-align:right}._fc-markdown code,._fc-markdown tt{background-color:#818b981f;border-radius:6px;font-size:85%;margin:0;padding:.2em .4em;white-space:break-spaces}._fc-markdown code br,._fc-markdown tt br{display:none}._fc-markdown del code{text-decoration:inherit}._fc-markdown samp{font-size:85%}._fc-markdown pre code{font-size:100%}._fc-markdown pre>code{background:transparent;border:0;margin:0;padding:0;white-space:pre;word-break:normal}._fc-markdown .highlight{margin-bottom:1rem}._fc-markdown .highlight pre{margin-bottom:0;word-break:normal}._fc-markdown .highlight pre,._fc-markdown pre{background-color:#f6f8fa;border-radius:6px;color:#1f2328;font-size:85%;line-height:1.45;overflow:auto;padding:1rem}._fc-markdown pre code,._fc-markdown pre tt{word-wrap:normal;background-color:transparent;border:0;display:inline;line-height:inherit;margin:0;max-width:auto;overflow:visible;padding:0}._fc-markdown [data-footnote-ref]:before{content:"["}._fc-markdown [data-footnote-ref]:after{content:"]"}._fc-markdown [role=button]:focus:not(:focus-visible),._fc-markdown [role=tabpanel][tabindex="0"]:focus:not(:focus-visible),._fc-markdown a:focus:not(:focus-visible),._fc-markdown button:focus:not(:focus-visible),._fc-markdown summary:focus:not(:focus-visible){box-shadow:none;outline:none}._fc-markdown [tabindex="0"]:focus:not(:focus-visible),._fc-markdown details-dialog:focus:not(:focus-visible){outline:none}._fc-markdown g-emoji{display:inline-block;font-family:Apple Color Emoji,Segoe UI Emoji,Segoe UI Symbol;font-size:1em;font-style:normal!important;font-weight:400;line-height:1;min-width:1ch;vertical-align:-.075em}._fc-markdown g-emoji img{height:1em;width:1em}._fc-markdown .task-list-item{list-style-type:none}._fc-markdown .task-list-item label{font-weight:400}._fc-markdown .task-list-item.enabled label{cursor:pointer}._fc-markdown .task-list-item+.task-list-item{margin-top:.25rem}._fc-markdown .task-list-item .handle{display:none}._fc-markdown .task-list-item-checkbox{margin:0 .2em .25em -1.4em;vertical-align:middle}._fc-markdown ul:dir(rtl) .task-list-item-checkbox{margin:0 -1.6em .25em .2em}._fc-markdown ol:dir(rtl) .task-list-item-checkbox{margin:0 -1.6em .25em .2em}._fc-dialog .el-dialog__headerbtn{align-items:center;color:var(--el-color-info);display:flex;justify-content:center}._fc-dialog .el-dialog__headerbtn:hover .fc-icon{color:var(--el-color-primary)}._fc-data-select-pop{display:none!important}._fc-data-select,._fc-iframe-box,._fc-video-box{width:100%}.form-create-m .van-checkbox--horizontal,.form-create-m .van-radio--horizontal{margin-bottom:5px}.form-create-m .el-input__wrapper,.form-create-m .el-select__wrapper{border-radius:0;box-shadow:none;padding-right:0}.form-create-m .el-input__wrapper:before,.form-create-m .el-select__wrapper:before{border-bottom:1px solid var(--van-cell-border-color);bottom:0;box-sizing:border-box;content:" ";left:var(--van-padding-md);pointer-events:none;position:absolute;right:var(--van-padding-md);transform:scaleY(.5)}.form-create-m .el-select__suffix{display:none}.form-create-m .el-input__wrapper:after,.form-create-m .el-select__wrapper:after{color:var(--van-cell-right-icon-color);content:"\\e660";font:normal normal normal 14px/1 var(--van-icon-font-family,"vant-icon")}.form-create-m .el-date-editor.el-input,.form-create-m .el-date-editor.el-input__wrapper,.form-create-m .el-tree{width:100%}.form-create-m .el-upload--picture-card,.form-create-m .el-upload-list{--el-upload-list-picture-card-size:64px;--el-upload-picture-card-size:64px}.form-create-m.is-preview ._fc-upload .el-icon--close,.form-create-m.is-preview ._fc-upload .el-icon--close-tip,.form-create-m.is-preview ._fc-upload .el-upload{display:none!important}@font-face{font-family:fc-icon;src:url(data:font/woff;base64,d09GRgABAAAAAFEEAAsAAAAAoPAAAQAAAAAAAAAAAAAAAAAAAAAAAAAAAABHU1VCAAABCAAAADsAAABUIIslek9TLzIAAAFEAAAARAAAAGA8FUuIY21hcAAAAYgAAAP7AAAKGJ2RrB1nbHlmAAAFhAAAQ/kAAIgow5ZWYGhlYWQAAEmAAAAALwAAADYrnfY1aGhlYQAASbAAAAAeAAAAJAfeBJ5obXR4AABJ0AAAAF0AAAJ4jxAAAGxvY2EAAEowAAABPgAAAT5fhjx4bWF4cAAAS3AAAAAfAAAAIAHCAPxuYW1lAABLkAAAAUUAAAJb1Yvg7HBvc3QAAEzYAAAELAAABq340wMHeJxjYGRgYOBiMGCwY2BycfMJYeDLSSzJY5BiYGGAAJA8MpsxJzM9kYEDxgPKsYBpDiBmg4gCACY7BUgAeJxjYGFRZZzAwMrAwNTJdIaBgaEfQjO+ZjBi5ACKMrAyM2AFAWmuKQwHnjG8mMzc8L+BgYH5DgOQZGBEUcQEAICVDRp4nO3WZXOVVxiF4fsAhUpq1N3d3agBJQ3u7u7u7u7BIfVSo+7u7u58XMO/oGtndforemauTN53MnNmdp61ng0cAjS0y60RNNhHxb9R2eu3lfr3DTm8/n2jymw/V3EoDWgk1FLV2n+g9uBB8FNztVJNnv77VPzXVRxD00qz+m8Zx3gmMJFJTGaKv3kq05jODGYyi9nMYS7zmM8CFrKIxSxhKctYzgpWsorVnMsazmMt61jPBjayic3Ucg7ncwFb2MqFnM02LmI7O9jJLnazhzqu5Cqu5hrO4Fqu42Ku5wZu5CZu5hZu5RJuoxm3cwd3chd3cynNaUFL7qEV1dxLDa1pQ1va0Z4OdKQTl9GZLj6VrnSjOz3oSS9604e+9KM/AxjIIAYzhKEMYzgjGMkVjGI0YxjLWZzJyZzCqZzG6ZzECZxIE47jeJ/pYT7lxhzh8zqSozjap3YsTctJl/9CpTH/f6rKjyZj/32qK1MXZX7VPDxjqEV42jyl4blDrcITiKrDs4hqwlOJWofnE7WJkhG1Dc8saheeXtQ+PMeoQ3iiUcfwbKNO4SlHncPzjrqEJx91DWcAdQunAXUP5wL1CCcE9QxnBfUKpwb1DucH9QknCfUNZwr1C6cL9Q/nDA0IJw4NDGcPDQqnEA0O5xENCScTDQ1nFA0LpxUND+cWjQgnGI0MZxmNCqcajQ7nG40JJx2NDWcejQunH40P9wCaEG4ENDHcDWhSuCXQ5HBfoCnh5kBTwx2CpoXbBE0P9wqaEW4YNDPcNWhWuHXQ7HD/oDnhJkJzw52E5kX9DM8P9xRaEG4stDDcXWhRuMXQ4nCfoSXhZkNLwx2HloXbDi0P9x5aEW5AtDLchWhVuBXR6nA/ojXhpkRrw52J1oXbE60P9yjaEG5UtDHcrWhTuGXR5nDfotpw86It4Q5GW8NtjLYFJd/bg5LvHUHJ985wa6NdQcn67qBkfU+401FdUHJ/X1Byf39Qcv9AUHL/YFBy/1BQcv9wUHL/SFBy/2hQcr83vDfQY0HpgMeD0gFPRNnBejIoffBUUPpgX1D64Omg9MEzQemDZ4PSB88FpQ+eD0ofvBCUPngxKH3wUlD64OWg9MErQemDV4PSB68FpQ9eD0ofvBGUPngzKH3wVlD64O2g9ME7QemDd8MbE70XlG54Pyjd8EFQuuHDoHTDR+Ediz4Ob1v0SXjvok/DGxh9Ft7F6PPwVkZfhPcz+jK8qdFX4Z2Nvg5vb/RNeI+jb8MbHX0X3u3o+/CWRz+E9z36Mcr9Sj+F7wDo5/BtAP0SZfvp1/ANAf0Wviug38O3BvRH+P6A/gzfJNBf4TsF+jt8u0D7o9z9DtQGlX8AZj1A2gB4nL29CWAbxdkwvDOr1UoraXWuVrJ1ryXZli1bt287sU3iXE6AhBzk5ko4c5T7PgqlXC2EQikBCg3QchYCoQVajtK3tNCWu/SjLUc52r6F9oWWt402/zOzK1ly4tjt1/+zR3PP7M75nDPLGBj4Y6/ATzNuRmF6mHGGQdkQkpweESnRWBoVnPkBlOOiMSPEeXPRbBFiElwYDaKc7OSVZMGOlA4kgc9Zime9QYj22pEx1oESxV5UyBfx35tHm8GoLs1Ff1ZdSiajoD+DrY7whx/Kt5tMnXyBb4Zfp8mEzhVdPmRgi4jDRcyyXjd+qnmkWd0FFhi0EqyhjKLuorWsVDJLuSef5EzqsybTHWcaDGfeAVX0mZBb/AixhmGMh7HxI9HNMDaG2fcpewVrZTxME3MIM4c5jDmcWcesZ05kTmLOZM5iLp3Uenzg1iezIRxESiGfUPSUXiQpenacc/eirJTxpFCskMkXagOlXIYElAwJ9KKpAmxLQ7qxMd2gDnuaAnbwoyfUYbvHY0dPiB7P7SRyyGNXhyEgZrPueKPD0Rh3Px75KELMLcRcF41EokdG4G8V8eHToBZ1GCySEz0BlVdrQE/YPa+S6GyWBMmThuyBJg96gtRc/jmp5DJi3Rmp+YNpY6j2J8vwjIWxM4w7KtF/5FTo/3bWt/dD8sPrL7jrAryUWOu1GNZHpp4AdbzJXs4mmCRTYIrMIMzAiVGhoxFE8I4pVMhli/1I63KI0rscQRSMkAyDUYTh8ZJhiSLF480W84mYUc56YXiMUCYBY1OEkXRG4zAiUAGMCJSVagNsJJgJBDJBRXFIkqP8Q2IrihZ37EjYi67xhkfUq9CufKgtHG4L2b3hsFc9hdjoAojfqj7je8NXNXh1IBP4EH4jXvuHdi+1RvSowZdJqZefUf8MLlR2NFT0LK2ozxseVd97w8f5wBylOQxjrva1zMSZDqaT6WP6mTFmHrMMekmCPuHpBJWi1WkIfYfJTMZK1Enarc1dvnY+SlMGMKO+bnNj6PkW9fXKDMOHVnzqLrRSfR81wIT5TeS4yCSD3h1y2tSXRM8sOttayIRFLcRfvo/UwPpmlTfDix0qeq4mc+kbVYvOqTfYU9lmxspITB7WKINiIvKEUHYA5dOIjyXyxazXY2RjIpY8shf+S8Xa/0I+jdlEEv4LMDPIavbwRt6Ig6mxVGpsGbFSsHEcAnvH6Lnr8yuGjskl7C4p0BgNKYGI3GCz59efN5LPzGktzDnrq2fOLbbM7cQnpeYeMdbaOnbE3NT/ZEezYNC9hXXnjV520erFLV6z1e6RAyElnkplssUSVFso80p6ZGztuvnnzpt37vx1a8dG0kxDdQztsNt6mAiMYh5m/SxmCbMUxnEDs5E5mTmFOZs5h/kSczlzPfM15nbmDuYB5kHmCbIW6ueyrEi5ZO30jU+XYfoayBRw0ingzPfiiYRaP19boq64uzZQWwR92xMMetS9UjAoffb++9cLeQEMXkrC6l6SBrE7hJwARv30QHlRRGgTwFxbcdoFMNcKPxTAXCv8QABTn8ZaK3UjgxScVanoKweMVX9XeSQyeIJDlXf5iqDeKwjoMEF7gGa+qtX/Ve1p6ntCSagaxlgdYwJPm2CEe5iRGcJUAhycFAQ481EoQLc9p6w4c9rcPyggLZdD8IesxZVFMNdcs3RpfCgeH2KtdQXAmgWQs1rskpD6AJRaHCqsOmFVAV3Rp/4pPrhgMF6z35B2JJlmfabOZhbNsDWwFc0Q3B28XWfiN8rNK+PwdxaxzibWNK26b2hPvOaPqYNVpD1dMx0TXjZ6w4hPJHkRJ9N4AHll3hgCt1RMI+NBX/znJSEZx/Z8pNeS7gslslzz3AUNN3Bmfyzm44yN+fQ0jdguJkYsqCS2vRVsEU1C36LhsCM42xnzm81+Z0NabKCwU2uTBDAhwWSZHMDPIWYB7CRbD4TJ4P3ah6ZEVeoCiCI8dD5CVRWQW4HDGlzG1wFSQbGMCpAgWEsFwfCoX4h8GCFmJzVriMFOkhWKPUcgRGN743PPiZIkPgeFJiMsdTgPqVB9iOA1Z0Wi0chZBHKgNpLxOaiE4C7PQcFZHrFSHVPTV5V1mQH4OQDw8whm1b+xPukErgRkSIGugAB0hOz1EPQ3kR9ExSyXk5Rplm0wFAp+GAoGQ7cTX9ZkGjT5nMRSL7333pku34q7I/h4KPR40GTym4ZMTp950OzpY3QcnyULwQpQB9wSNIqsvygd3WI2jLweHhnhxdMY3rtkRnwJbYngX0ci5XgE/dOq2C6xWtWzzdZbBY/diPxYQLer17jPQCePkd7HP7dav2hTrOo5JjaKjaLbcpdoRiPqdRf40Unk8Rz0/1/ZL7M2Jga9vhB2kSMAWyTwqFQM4xJAo1JOg07wDh2INyaSBEShCSgP63AyiK8B8Mkqyvd1m/tOUTT880WHlbO5BdPHDsc/fiyGWDf6QmpJf9TrUQJNjQGvHGiIBxS3HB1Y3FZqGUqNLZ+XGmrpmpcaaGsbSKF33Tb1kZWANly/CVmsLuwS1bfNdu4Mk/n6E0x2J4fOt7lRa6x/SapUSKdiEdltt7vlSKytvVCCx8TU1kR2/LD2BW1tC9oPG89+P5wiFWv9oM1DMhYKrNgFk0dDR9sOtmy5ASR7s6UBFMKA2sSSsBfxIkqjTyLod5GICuPRra8sDeHSkLfyfWTxEKzLU/6v3qtGs6uKBrvDZsTcnBtGYl35AC9LxgJZUfh1iuQNQwUTlMAsjTbQqJC/bkQb5o4ZeWy2O4zr12fCoU6L0eYDOkCjJ9/T4UYKcNUcU5rpCnMq7km/g6+e/z311JsXLz4tkxnPZtPz5uH3CJ24WacTryd0Yjambqb5r49l16jb0RX1v/1hQxLed8YQjpM8XlgveSB2Dw4NyisJzYMGfJZbBOEWi2+6hT3r/NdsNtPxRp/xeJNNXz9vsruATvLA+s0yvcxc8pZkXVD0NkYQ3jxZHLKOLhN/nsTyGioB7YBWyDGjtlDYoldW0gjoBmUAYWbbhrVdPT1daze8X/FsW3vHmjV3/ODQxR2dnR2LD12XIvjvMmKlkl1di7q6ksc+2rskd/n1l+eW9D7KJuoKU8/omjuevGMNKfxDUktXamwpwb7BGiqNl8Cov0brDu/q6+s6fB0ZB0znTj9+gq4Nxk1WhZOuCmf+2Z2ob+dO9dmd+HFikxAdt3fwMWyIIfSRwHihRyYov9rdGgfGUn0pMA2kMfjVEPGnnu9U/Z2d6INOKI9o/66F/m2g/Yq8Iu5AsB0RVJmsLVwsoSJmZAdqsaNQyvELoNp+IQQCHt4kAG3DJpzq645UCNl/Wb6Z0HF44y8FE+8JBCDVqdX/Eh0/OruATvUYAZgCMdML61ZkAafAJaBhByGNF1lANVivDGF2HVmzvyHW5bmrbvzi4VLnCVd//YLFvNPGiRIyrfn69+67qN931G177hmU2ISWNeDp6bYsPP9r156Ydx164ULW6kHIa1+98xhf34UPPnrTOnH4kCsAKLK0v2/H/8WYoL8d8F5srhSVc6zCunNu5Mw50UX/3NaL3L3b/nFm27GGY5F4Av5xeesd38LXqCeisPo2+mp5K76K0cYL6tqGf0T9NsYP/ZigaykPGMks2PEZdy1x4axDL/6NlCs7juwAo2xXwCDv1CH8ow51bTqNbusoP67AHx45eJghPTFNWxYxKwFrOPZgbfrPplzZkYa/DmVUAfOTNIQ60gcMpDsgqAX+1Ybv1xGmKfuhvt3R2kAdRhmtb8MHHWCgfuqqa5V9Chh0m+ZOvG79a2hjYtjvXer3B2ctCL2yA1/W0VE+vUPBtypKed1+XVGZr1vxrw8+X6sUrLOOjv43Uq7ObMxmN2Y0G4nZDdmqgVAlAWz8Zua3GTDqlZqLth08TGEDtOUd/AiFX+2A1x4xQwgmIl4qlqScU2cdkB1J4wwAXMgBcqUBFx5204JCiB6AG0sTsxJgyjsSs+LxWQl8fHkHbKchfDzY5Q8dCW+yIY3u80WjvrflaFT+QrIDNSNvSnJYvK02P7rrNNM8m68d74ay6n1aHehQcIdTIfU+UhM6NJQ62iEb2y3yO6ihKyqr75OKUIMcnZdrCQbdzS6LIwAIiuLKiA2DLfrc+EBv/2LmyJliG4BqSp4chPIKAYu5bEk2KjECSCmLSYkVSBB24azMA0Tx6BxIduVBukAdSrgRNjlCJ+XnLip1SLFcd6Rfzm68eMlQRGoINjSlB6wtdj9q8Phc03TCt441WVhLOnTMrJOGHI2Nspy++MiFx4yG/K2BppLPEXSnkk6D6KS0+pPsn9hhoANbmFFmKbOa2cKczZzHfFnnDUpV3qDeF9Fq/2QKWm8omSRpcwq2fc3VYJNTIW6O1SAW4RxBDxDOEZ8r5eRcSZFyxdIALuQTScqj0NENmDIpVEjKSimb04JJpYC/oS6nbbtLXa71ID5eazuJ9RIOaVMTsW+wS5K9tZXY42QiqY+TCbA2eUjCPuZoXjV3ICbYJKvbYRUtTsEh++0mwWR0x3b4Mz9xc2bBarbZfHi33pfDlb6t9PWw1ru/kMJSWQQLDP4rWOoHUflteJz8jhxd9Ehr6yOPIITsXpvdb+Akn9uK8bGc1WlFqLNveBxZHOBDLRUe9n+zV7NuphHoygHA6I9iToIROAv6/2oK7WVAE+UoXWMiTkaNFK8vUhKasG2BCEElIleIQgcCEs4rRJxSAFOKhhGvdCDFjpTkIIpmKbpnR4Qa0tZmCkEuwsjzErookeTpmGQp7ueeNGoEY0V3ukMstCLX2k1Q+/IdhLLuaXnxRasLovFRFjd2WNUfxjJshOP6uHb4cajHsJDLGGxjNq6DW8ghQ8olWFgDNhgNBrNgD9idGzhufabTYrZK/y21/CTVaRGMJusVTll2qq8RGzWqnyIr6w5Il8IDulvV0ylPGJFXwOtaemY7reVvWNwsgl69EnKwWeUZLsHdy4FJcOwbvKGlxcC/wfrtraKBRayB48QWp8/Icm9wF3Ugg9FpM/cNHZHgDF5IflB2rnX4fI61Trk0i+71gNs9BbjX/ryscYDjJ/7HOVp1EqD4AIJBpCjkIAJSrcTGKCs6Vf4LxalT2F7+S7xQiGM72OVx1rz37+uak8nmi5PNzcmLiG88cl44fF5E/YO5QbjhBt5pt7C8cdUqs4FjE6m5qfInYIHBDrBG8/HyJ/F8Po4d8fxjo8+SSio/9eRwJBJeJrCmM8/iWN7mtBvHxnivhSF0Ww0NNMyMwD66BPaRmcIRSlx4ZQoziE1JjkRSAbqDzMka4CzVBg4uG9xqDkckKRI2z+XlBpmfWx+8I4LWAbF7a6TiTkNTvWi3mhpjDWab3WqzWe02c0Os0WS1W0TRchLhYVyui7V0vPhb+CMmwHRT+QppU4UhS1sU1aipHCxc2BplnVurRKdPVLTEXgRUl+oMmcdNdrPZbho3h2IhU/kDLYT9ptArrqAZ5bWw+jNzUAkRRzSDgejQr6EsjmjJ5d+R0uY5WmiOOYQ/ctrNdviJLpdIPXYgT5x2k90FP2fVo75RTa4W0ObCm+wL+62X/8AqYZX0ovb2RWnVmF6YBoPU8r7m7u5mjMAuH8aye8vrqrN+5nOb0fnud+uySBNQyRITJTiiU0HkNyW++tVMBv8+my3fq2FfqE3DyVirLre8KKNuz2TQFZmKS+nUff9gf4g/h/lBOBtkMw4hEScmCEad/ycjuvMOaGLMaKHiI1wu7OYspsuNHGdzuvhxT0AaF4Ie4XLBrl4keswOl8OMnzE73HYBKD38OcL85bwLvJxxsXopZYKesVjwBIUvWVCZ9dghqxnMbbdp7jM2IPn0uQz9skvnNwUmYc0cFQ/Gk1wWQLjz6uvQyuuuU3ddx8rh0lhSPQWhr0jNYSdr3QGRkLjjOXV7cqwURiuQM9wsoSu0vniT/SHMlQ5thtRzJAoEh9DwCcrDo+w7KpyD+QCIBU8glAydhzoQleUWccPWjRoTYePvN6zr6vaIJ5PWzjcX84ce/v1FC1rbjJmO8SVrREkyip4dNqvQYLvLInomMSC2UTJ4zYJ5zS3WfHbxoY+PL2pPe4Keb3vE3xU5f6OV62fdls8Ja5j20ZvsL6ENPiYGex/j1tCl3CR8yY+SVPYM45igCFF1T5DIsPej6tqGZj/f1Ywsn6kGbb6jf8Bk3wVzvQs/3d0rerYLZJiE7fCO27UR2+5BH6lXx/OjlblO5v7HaOvn+fjKlfG8utkjbiezQthOugPKwwTZTl9fn/tP6GNMaJkgmftTz/l4ZVU4dHLkbG3yq/5sFr8PC+K0yZN+h7YatPH+jH2WRfCULMPEc0XC/krE7MhJuC6SMwm2B5ATbtLML2q4CK9gr9HCXy54AsK4FPAsFgJk0qtftXsEu5vMeegSh437CzZdTpLG0emEh69eNk5KXC7s9YjPaH13662EF/mM1UPZRu4q/LIxMpMGLGyQmQ+Y2HJmBXM0czHzFeZmZifzbeY7zKPMHuZZghdTyTgVZ7QgDT8rFtiKoENPqTBfiaCD7HAE/edqAVgdhVuqCgFgA2Q1EiKZINxsoDQ0RDpLNosk2RpiJJZsHNB9OvkxCKsgEZ+ZgJ69YkKejl8vb3ba8DLRE5uG7XurH630+9VdfvSEf6MfzEa/z+dvCieSIZffaUeszcL7XOFEIuzy2Z1Gg9Pml0yikectAB1s1tstViv18Tb1Xv+9Pt+9/lobDX1UeexHH1HtAby7Tiqjs5ErYpkTfX7yeL8v69/o8230q+c297XYLTaErbzB3tzfDMCJM4hmR1pgjZyJNyO7R7R5bYLNYhDm++FvPik9j1gwBywaP4uNMyEmzKSYNqYL4PcocxvzFvM+83FFm2R/vR19kdejKVP2fLxIkG/Cf4e5P0CHkBKSgCOEkCzB7ieJECPCpIJ8ZOhhCsCORwdc2+hg/BPETRYS+VJhAJF6iL5USeYlL2wmfIYniyhDZRsSVXAgG2umVCA7ailTIhznDLw3lE5m9M1WJhOOTLIqjxd/u4VwwBV1G8GBdu/WMCNnBC0EfOmhSOSX1KwlBm2xBgVA6C02i9GAhaC1WbRyCLts2C5hlsWSHdtcGHFWsdkWtCCOs9qsQBhYgrYEyWh0OScyOl1GknG4yZAIIIxRIGGIIiMvJ2WeVwzxIIkLxg2K0SQlvTxfDLe19be1hQRRlESRbWoeafnxj5UsvLZDycwiqNwn0Iz7ibjvAYKiUetynoXXNZhMBgM2s0aZD9kxZ7R5MJZE1hmFt/FghCQbZ8T2EC/zBnhnkptDgoH3ktyOINBv8LYOxQGvDv6gnbWHTCEPslgDKQOy+mzI0Bq0WpAbGTmnk+PdlRS/FUigAEkxcnY7ZxxtGyDinawo2e2SSPZjij9+UI+LIH3XjdZOszq+FYq//DKSXn5ZPUzBL8Vi5bRScfE3y4/jkfLjMUWJ4S8psZjCVHhiL+EfMWZdnwSeQYhMBYjLeNWH6h6xabMUfjmM2jZ5wVGDMdYUi+39PIYTYa96NdriDe8EsvgT7JDC8DT4q8LHH+qyh9JM5Q5UrFginBRdHTBfD9tLPT2ldUTMsHbthJhBfU4ICFvfJqjQPwSy4c9AsKA+LAhb3yHI0P8KUCJQkelo70xwWCKFmhn2ylK2hgWBDWSaBoWrGOgE7plX7753vOXJlvF7t85h50yDqJ6v9m3dip5V//Dcc5RX8An7IDtEZfYtTCtThB4dZtYypzHnz0xmTzBsd63EOVobYOs5d7AL5QoKRbvyiZwGZoqlnERBk+KlzK8EX9k5WJdOmX4c6Wn3+dp7IthZ/jiRh63EqdGmlr2fPU+mH0qTqfhxpht2sVAp4LFG8g67/Zc3CJl2Z6j0fHtfvl1OWnE8nDa3W5fnBnoKjbFodzTKWqB6VQHC19fWG0ZvhXvb/KOFuKoQAhi9FS+cN4oGlM2x2GZFs9WLB3PxREPOZ/XGXc4Wb4s/EnZFF+V6V3Z73FxbX9thq8dGFyeaepVYb5zyYmDCnssK+/F15xJJax13Wp5ZAFGaFnkJPWvRN/ASUXTEC0OfhsOfhgZDu8Ph3aE5oZPC4ZNCszXdQHWnAWgsFrk5syxzf/+nwWMxWM3cyehM9Yv4mVA4HNpNFHYervrwoSZBMJWXWmWzYMHHlm8UBIw5GTaZ/up8/r4+n49mrpyh/gpdqSImoAKwDIqI8FKOcqQAJ2cJoCJMO0Kwy2Q2DCKegCUijid6AEV3lsrdwU+WMVQmeaFcBachRA5BcGDmBDRexgF5Gm83yRKLjKID6EvBZrVYsZErWBzYaR0Z4tsDBqVgYq2yxPM2p0k09A1bYFe2LrGzbq+v0+yENpnsRpvbnO4wY+S2GR3meJOZxmTaTBi5pll+A43+pMkuIJNosvq8nhZekpBo4awudW8wgTCbjlklo0WyeByWzxASBc7qRN3CrEBEfcVsamuzsQi5Gs3FksliFF2s2Nmpx/TkaAzDuHT9iui08qLjmO06BXZA/JGdEjLUrfe6SVyqW/x1eEptypYoOheA/oVRvCpyXjR6XmRfBJ0bjaoXRirubwlYLf8IkiDDrSRwa/SuSOSuKKJqxPjZiuav+pluE0WBrZE9ETDqjSTuyGoAko6MPhqJPBrV5+4n7E2shXHoekp07hKZdA30INsV1fSogSB1rCJx857jj9/z2uqV+WIxv3L1CasWLmhrb29bsHB3xaO+F0Wz4dWehG3m+D2v7tlcLKxY/caRKwvFWe1t8xftXji/LZ1um79w96L5be3qK+QtJ3SQydqqjF+8Rj+IqXuLOhwxXrP6uChh5NJ1h6pyZxiBXG0AHRVDwVhMfTf2WYzlAfD+bwy/A/NVfYbM3Lzq7IiZUD9Qe+8R0HslsdgE2WivIl5U/q0+x6OjapOSY/NxtJVUVqmUuEyFf/O9uvZkKXU+o5bI2haibSA5GqDat1RfbIOCAoqivqd8pmgNUPC7ZEd/Fpb934AgC3o85+mknOfAr36/R1TfpQyMIFU3f1ejf0lI13N4g71Lf/cA4E3dk6WNk0VVChFUA3EZrXC7YWsj2AbZs3YUfloAg+8hIvnnifX973y7/BbGl/FmM18+3cp9zWD4msHEJgrqsfk8urEAaNCxUjgsoRuJHval6Izyuyw7TzDGefM8nmNPZC3sCSzWZaNP4if20yebGZ4xSdH2gH42PBWfGCBy+cF8Af7yL9c5+PFWfTDARX3gjgBwfZYC1754YbCgfl4oIFNhskt55J/iP1IeAtGlIPhkEOgowv3LUH2TGt0KrupjZxiH1s5r60+l+tvQFfPABv/n00bgp0KUMAhrjnor0aFKpcKaA0GNbNAcpooP147JDOWANRyx6foc/Rr6LD7jftbh9kswnx2A7Y0xmyj2rInEiN5Wnu59xsrmBwutWNn+0ojoa1cyFkqUqV6bpyhPk45T2zas27Jl3Ybfb1y7devajVsXXlFolj0eublwxU3g9UqSF7yoKHr0TAhLja6adI84dRKbaPAfcdwR/gbdGW2QXZIrBD+5ocarPuUR81quPGdzYk9gIkfQ8+HBEjWdoH2fwt5shZ40E14rkO9I5pMlfMYDatsD+Nj7l9+/nPhT38XHPHDE/UdU6ZW7YJW2AuZP6BXCYFRyysS496MBTKZGQaqfG3E54+WRMZlJlFARvWlzIZcNPUeIUfSJkkGERW4iQgZHC1Exa8HHyLKsEktGN3nxp8jd4NLo1ozyY5PdZHaY8I91eQQhYkU9O6CTN8k6rrob/+GAeEM9nuCcMlBHTpZqoc3NEfw6gPSWSNVFCwA6PhxBv4ggHnz/G3mWAvE/UNB/IqGw0VgFzF8cUT+HEqbIpL0uxaSpjvFSgsvMZH0hhVeAnFIAZ+SUQk4TYfIwV3kqFqbCygJMeIWQKCmgV7KcJnYvUXaZrBBuMVkiHooa5IwHXaOq/zBHdklxST4QCCH7cSe3Oi0Wo8XpEuyNdld3l91kt1usPrNfzHbZkaMhme2KBFLdjXbUyZptfquXt0cyNp7rME6zxNUX0u++u2zFimXv+uwtVmhKY7PDx7FH9RtMkpM3pIwhc+5032BXbySYkLyixW4RpIUJp8kVp/PzdXY77AkpoPyWUwkC+R+k5zM0hQtArpOUT96BnITH5CUrmmgUEwQeUlnKgyLrnHfSjCzsAYS9RNhRGnspYeRxyKW0DcxpirvMFsSJzoY1D7OiuHud3ykaEbKanNHmQwY641ajw2TpnjM014IsYfOhN3710LQdWeYOzelpXmawcrIBGU4zWA0vgevlrAY24mzyK1YeIYtJPdXg9gVDJ8/DBsP8k0NBn8eArjAJCCHeqjQ0W43LhEzAZ0Tqd0MJ4cjhgWWdLQiNI84fyKhfOBYqdEPFV3HI8AdwoaxB08WD+bYHzwEYxLjTsFS9shlpyq4INrsLzEbO6ZVNaDlabvJ6HUajSb3cpljRP01e2WHkTepdkGA0OrxekmDTeeRQ5/dxGLAjASAbgWoLCUzjFXfOrc1NZ+3cFFHd5DzI3IxVJyaynSLNPmHu8aPxRBId+6VrSz4R6B1ZtplDTkleMN9t9XgsVmvMNTzfjTbHCrPmp5p6FigeNGgUnCPNrbNcZn7AhJoHUFp9aetpp21F6Yi76LTwpnjea/cYDJcs5oSAbOZ6+BbL8K3hw8fGU/FsICBZ3aVjcl6rnNFh4Jv4d4yPaWd66PmpLAUKHmOFX6NBHYpzi9gT0lSJ8YTyxoSuaM3BK5w/bMlYf/fwSPfA2OI7Fo8NdI8Md/ePLTlscHb/sX39x/XNPntW/3H9fcf2zx6ksr0jF6bbF6UbyUHGIrHw75oiXYWzjj2z2BVVlGhX8cxjzyp0RZpGGxuWHbXsqCMaAoGGI8CzrKFxKy1NrVG9NFh6234E+3oAMJIxbeUQNqtGu0KTZGihojURSNgw0hIJxwPyUUYvtFzrDsnDJ4kiOSKbC3jjxaysSfGSgDuieHZkGTRn1kBXbymb6Zk9d+zQxWP9PSNrf5VxSdAoX6vY6RuOty9qD3/p8MXz+npmpzON0BGzh1ye3k51rxAQ8Bm6cK98mYCvyLadUUhthFbKUiKbbgg2RaEzcoM7Du8UW31QoeTKBMLQcYnhv9N+yvfP7Uwn20h34B6bTxDKlxpdLhvH8fh0IajLqL9PxzkJ8OJgo0xU6Kvn52oHGEv6mPb0w5gumQtjOrunb97iw2MDHQ3aGCxqr4xgw5Qj+GhDx0AsfYABq667K3Bax+e1M29MnZ6cMqEOqysXSTl0oLibMsdlwFxJjm8dRw5rrZg3D68inuNIFAm1Zz7PgAl6PicxYA29iRpqQ1U94wfws4yd6hFqQkrYT7UDpFwVdt3gd33ssi5nWbTM5d/7kd+Fn3L50d9ud/lty7Hf1aeoVzkbGpxoK0NgJOAppx7gfMnMcdADix7qaOC3NbxDHdBV3J9WB6h6w9OAoqilCJoPUH13JPJ8NPo8wG4/EPYfTKcWcTJBAR7UGOsaQVzR5f1tdcyisJekYTeZxyxi1jAbJulGRg8wVu4ptSJnOtpXdqxPp9d3oDvcjY3uDcQ6/JBDvgoxEK/+Kb0hDeZiEr3e09joOeyQQ3CBeNbrOdExmpppwP0hifnQHej/GTLrKqhnaC6Nphn6foZMtSEdb/8O5beFofW9Bx5HFKUs1SihcpJUiterL7RSJYWGWJtG/qphzUUnqK9QGrgNaOaNbxDvG5QOPl+9hcavp6H9OVvlnxESO+h53BOQqAwYPJq2QIWP8QwboXMwV6PFcyJzzkz5hZMHov6QF1c7Nes0lOPTlGSbDoK0nRDt6IjujKbT0Z07TTabaafZZlMjynKlatBbkY6OyE6aj6SaST42Qnrkb3r3CDrj72+U8SfE81vS0QIpVYime6zmAqm4YLZaiQKw+jmx59A0mqtHSyO5dPrhJZ3XOjyznmMlgtvS00lOGHByXl1SKFOL8k9ybG6CQUr6oY5B+sh/2z1WE2cwS2478Zo5lpfd0/A1y09brTxnMSmoVXFbbIC0WnhFfU1xVc6LfMo+q991QE6KH0rbgWfEMZbSiHCGAYZAEwpFrzyA47oWU52AkU2Ee9p9U8lItg4P9Ha0XHnzOYHIvKal6ebk/Bv6/evPV99vaPP72xqSXV1Jm9vd4HazVn9bT0RNaD2D3gSLyAQSFNd+M1541+9rO2F4jrhu3hFdgaB1jivaMXx013UNbbk2f9eirkFSR4NbPyPztRq+V3BaLYihws4CGDSuuWp8dBQ/ni9/ks9jR77ibt77MMNUzuDsqK9/ak34JNT/UJ5Um0dvatVfMWXt2n5zDdRNZHky00jovwqni0gNNW5XRXPjrzsJL2snenwn8agS1LsTfpeFvepKb5iMQtiLdnnDO/c+zC4g9RM6+j32QdgbgnQvowx/Po2pSDpENBPlyikXimiTaMCNSjQJ8FESk0QdypEblgYyzr45Iw3bQl6pd/Hi4KqOVaktpywNBlvQttZt2w4PRVq312TbHpSk3vHx0KoO9JoSNWebO8PNZtm/Pbh4cY8khY7sOLI1GDp8y5ZWtC0VCR++bVvL9rps44t7PR7IVoXb30ffrDkfVIGMJzfjvc3NZUMzuo0qhLlof/6cjpWNEaE/A1TaVmK6mFHmEHrHxHqAZOS8PeyNbqWKIQHSyx0khP5/yPnSuBRvjUvUQrvqAou9TakmL7XK3/xPZsOvS3q0pJvJXvW6//scOv73C/SLunH4F/r75albUxs4f9o3qeBot9I7NJphT1zIHMOcxnyZuUnbGYneD5444NyL+EkgTInXHoOu3jxSn2n/mvCBa0LT1nQj0ZEmejP36cej70f3Ec2Z+ymG8E39bpj7tGPX991H1KGIpS6qK0c89QX1ApPLsVaiq3N/tYx2hJqWuV+/yuN+eAnyHvVJ6k6av6L6Q2uoLamXgOeR8jUpjHYnz5tA0xHdAoXpoOcal9J1eTbzJRiZO5mHptA3cPPaoWCqhpNM2JGuFg8Z4oRDokUnS4qkJ0ChuCLp4kySS9FiaYpb06qXpRykcCSQK1ApJ/nxUk4vE9VYMjE9NwD8JF+tfrDqQi4crh6p/H1F6aFkQaLHLWKbR7IjS++llnjUxHX2OFjJimys1WNw9HRyfKzpxR+wPCvmOqzcoKWsPmkd4GzpnAhxCD2JMMfa5syxsRx+yNqREw1G9gfIMqheDxHoScxjSHyeG7BCRqPBWuxEC8kzbaz2TI/bk0ze7+jOGOAxAmuVfmSANEtTjIf3OJCqRfk8xBYTigHFE10GZPKzNpeBi3s4U2vabE63mjhPwmBw2V5w5bJOg7PRxI8fZTQeNc6bGiGYzbncrc1uJJgxuEgmkb72di+/cXwWSXCk223YbJ7HL9po8qbbZdYVrHkYi/jTOE+cg+pZ8ihTImvWH6/pPL7JngzzpnKXCqFR9rsjhdx7g6ZknbIlcq6k/BGxMbjwezCHo7lc+be5issmIEcTzfF/5GhXuYn15LLZXNmfzeWy2nvcyi5g1/1fvYfdryh+NUJs9Ds1gn5Xfq+I/lQsqp5ixWXXKf69e0gOdq5f6du7h724CH977yF2BX94muKsccBZ11dlrLp2KnmNQaSf6qHqmOQFeYWSXiUd5lcUAzDFDotxgstXTi4ABkIE/b2Y4sJG9DVNbvcWECJEQ9lEtpG3NOXNvf8rep7mnYRbYXzmXqoIuI+zOSVWIvGaFvPT90A88tghweFhE1TT+S26PzHkuOreh4HIoeF9EMZoxCPe+zTPcTaXy/g0OfvqwR4rYkTPs3UJViNN2MeQzYWcuX2W/RXbT3F4b04mqgtSjnKGqFISUdmVclk9VLmxjJc8mp6eJkIMwk4AbSdYEG5C6GzOyC//o4273mC4nrP9cTlmsYE92yAYIMG0/I8YsWbDDo7bYbT94QiTkTubFdhudL3R+sflPIS0fFABIvm0Ov6ESCUsYidSoXoW6brVT1M+8RiVYsCA1Usx8mTgpKRci9PjHEcuc6gZywlFXFTMot+LLo8NvVwhvgToeTNCFdKMqOXgbwmCevrEwFFxLrpMCLAJJDW6UYUKeVmAkmanGb9cwf4JOSAIQSjtoGPktu3TtHXvgeKMxtvdp7IP4X8ABGYqqGaU7u+EfKTEI1AdUZkqVZIhKSVKKA9j4oD+PRmduWzenNY2X8Q3eOIs9fITBGxmrVHLfTaMbfhPJo6zSxJ/clvrnHnL3iHnjt6ZdeLg8ULIwlks0By3TeObGRi8G/BsG+PUV2q0skaJbhW7ya/s/VTx4+vKJ+Dr9r7G/nDvEN6t+Mt7sQFWntrV2qfJmFT22yxmQgC1hrQzIgRpqODsIgB9QKCVqpRaGzaiWSQ7ISFKsziLJXIShIpJbmk+RPbNSX6bSJsejOSsg9Zc5Lsk8J3vCHar2fCd7naIQfd9m4/kLS35hziz1c7ipnC4Kd9U/mtTHidCoQTON2GxKT9gt5T/arZjBYchDlLKb0dYbDdj0WLX94onYV65AB9LT2j0SUoxjcmLD2BOIuQrjIamo1HIeeitNzkRxwuE0IXRwvI2osQ3ig45++ZvnNc0P3LaTeqntz7gDaFvbSWa+yOHnLXzG+c2LYB4ZIH4sAZfti255qiEsn5s/PRZy+4aCXn3lAUCG7dCdDy2Ye74abOX3TUa9u6h+ry6Xj5PNdqJvlw7k2EKTDdgb7MYpkReEl6HiJW0q0FyhOrWJCg8grSS/ovrv+ik3/ODmxtQ36bTtqxf1z9gY0dZ5Jw798StF6r7Rskfu2C0vGETioHZrNmnrxgtbNo5ypYKq448ZdMm8bzNx/YNsOiIzZv3bNr02KZNhc2bx0erfxWa5S38EuMleC9ZhXIIi5gn+n3QoQPYTZTnK1rzWaJNn8SGgZMXO3tW5w3d63vUYHZ5ty02N8MvOutVS8hyRqsQlizDlrBwrcWCf5k7ss846+jtG3rZ9OKjVg/b5mybrf7YArks3hDkslwrhC1Vmej3KZ4VZAanwqkSFcIeMBwpR6UcXqlyBphsnZULWBLYs40McncXlQ4Tz9qNJzl9vpjfZ5rX0lz0+vNtacngLok2VLRZvG2WhkUHRDC+i+QmUgzdlm4dywZjnc1Bv9GdCQfCDkfA63YnbUq6f+7EOYendJ5GETDFMcAVZ8TV2F8XNU6cyjkdCgLqeFtsjGhATilkHIY9bu1ackDhNCFgOU1ALUKARARJRBB+alm5Kha7SpmOtaEeJZBynoBwmkU4XQg8XB/s11Vw9TPeV7FRqjda0qUfOl8KH+SuSk7T2/NorSZtlclMo9JU/eaSWBJ2W0A4qV7jAJLx5y0jzXJLKaQ6QqUWuXmkBX2iOnQheDarniwIc+YI7kbzWjOYxs/qg0cBQMdF7G2gto2NEH61I1RsleXWYoiKwYcqMnJS3+tCgzB3rrnRLawRaB2TwsciLNnUC2wO1mtD50HdOp/zeZ0/V+G1LwGc5wvMJXV3Rk5JW8lTCs1nUnpG1Ntt2r2R3wsQJ/C975GDzd9zSNIVMTRXUdQ9sQ/J2KpnT5EN3R/sDIL5nu5oCWCxCRLUs4N3VHJUCq0lmrl3xNRHYzE0FlNn6Tn0/CNaxST3yJQpE+cftT0rrcG2/XYtIhu0A6wIkWOObBp1AJrB7q/wPdVGNie/qsfIdXYUbWMZ9Nvk7ASrDCYyovvkp4Ww0HqGJeSlG9fwgTe4sczSfNZmO3T9EG6evWikjeM6hg9Tn7JYoKRE98VhS0ij999kX6U8NQLrvUwDQOsYk4AWOaMAKaJOpcDKfFKBXxx+uQJYTvi5ndqVmewr5dWjuOG4L5/R8s1NJ7V8Dd1wc8uO6N0t5+9s+QJbXo3Xlt/HDfic8up7jsUNI6r59JbbTmy5PgOZ/gSZkA2yofmQ7/bR8vuV/etGdjalFWQmzCSJXrqbSB61PkvSJcqjEirJdpbcsZt0k0NC4Mq6+4Ej5cBH2O3HONrs5bsdji+P46HF5R9t6Tyl2LVpU1fu5E1/jA0OxkLDg3/2tbX5pI421monOdugCCnZZk8tLv9gMTrrlMwpV27q7j5uw2A3XjsYiw32JmIb2mRfW0ujT5fBfxWfS05WucnA1gjg4S23WJus/4PurIjfe62KTf3Yih63Wj9Fd5o5jsree2025LSSowoUlv8PeyvLVO+K1bicYf2WKDIitMuTRLmn5gfj04G0X7KSh71l76f4BXL1zOn3xO7J7YrdGd0ZuyVxi7Lzyjtjd155S+yWL96p7MKZ8jU4o4roryyz91PWOljeegdk/8Eu5c5f7lRueQGyqY0QaAJPBFy8CvKfMqiK5H2ddecH9j8zfiRzHLMJ9ptTmQtnfi52aq39OpVeogNY8fNTJZTqoFX0YFpri8mJ8ueJLiZqp3vO5bF5MTDfP5DzPWVMAYP/QrRf4rq06te69kucYP3o11RLvz9G9PN1o46R6snv3DqPvga/s18/LvtP9BpLT45Wzlv3InpxB2s9iCZ6eYnWF0QltY28p/cok8HstqgPadRsuVXwBP/Vti8+mve6LYhK4VKAEzBVHdzvQrtl/Ra0UZg1WyawlQmYvf8JD3e0ALO8EEWZEj0XVoMgyrmsvH8sISoOlLfIesLaQY6wGq/40K+rbcnnz9j7ESuTX/n1Pg6xLGc3dnRyDoHr43iDkZthHJsgFZc/qTxCIwTrpFWqOqJ+bwSV+g02zsBxnZ2cxc71G1C5PoIr93FWI2s0dnQYLXYjPAvpeh+34tNh1wgzbUQjGFXO1OtH7aEHqa5KRd4an1qP5a7hrbNnbx1WXx/eMgyG3G+cOTwDBrVkiat+a4QkXEpTacpGYuHTZm/9IikJ1lDm8KNIHFhDB4ytvWs8pZ9CPIQ5lDmMWcusY05gtjPnMpcR7aP6caeXXO83PXpZp9YUQkjWnUyZ+oxiXQCRm1+I2E67AYb0SNWHbn6uejpU/Kh6fHPi/OhzF0VM5GIA98rIiZEDGvV2FFV/S6hr4mp3EFR9+KceceIA6qz6urX7pMs3QwHIjGeL7gs1zcOKdRFVSZwz5G50XTSL3k9wwZDJ7hLNNfcoegGekztXlk1w8Q92epevWSdpJGKvtlC4Ax8Hbjn4edo7NvDYyJr9poULjXaHxWAwbuAtnAWhA53N1fjrU52F/ekG3ms2mKAmjjNY7Q5ugwmhPZPP0066x3SE2cgcxZwC+8o5MKMun+GeOunouqghsUqVNeimJIN+o4FOItGtlWJ3pZlNuoPf7LFGdGW1mZKlswtQP7eYca8xmxXFaDDYHE6johAaQFEIZQF2w4bI7ZFJZhrNlsUuMUM1diuPcjW6M6JLfUEgNRqdDivHGSce4Abb/Csy7d4g1qn0OpCJ+5wdTBRwR+1U8YHOr0y+dbHuJsIqyMLM5j2bN+95dfUKcoplxerjV9y4YsWNDy2cT06wzF+4MhNsDoJxkoez1s17Xnl0M8n22uoVheKs5V//7o0rSLaHSf5bpWCwJRjcql37X5X5P1l3Z/PMoWwdPhE5yNHH8jhr2vv5hbGHY2AItE0R8pZqyVLyNp+okLeJ/FWj6rv0tKrGf/ipjgcUZ6iNQqTUPD0/TbVAw4htP8iLnWIOStisviFEhS8asdHuchpPmEaHYqeAXQGLeqcVWe/l3U4LNpq+rNOXB8b91szszYmc3j3D3ZleGCwinZD0HhSXUzeNjp4feyY2yaj/6Dca+zmbhecttmmanNr7IV5AEKCdVQsd0290GfsNLGcxnskLHK7wi3ZDHwSBAtxUoap1prISj5EhKZaIajLRqSRnhlhRkxGkEcE+9O02hYxJJUZVhw7y+YaoTlBjgIDoiUBH4O14iS01q2fYxBtcNpsruAi2nmarpREZ7bzg4rpMfpHfgbbxbje/D7M44EPnExq4fDWxYzGNtMVbgp0BRzAp/QYvgl336a7kl1J9Jtsd7lzeHWQb0Y+T3ewokCn/xbMmvmBixSh/i998gdmPUPOvzdI6r/3PhCr+M6GXO4N/1gj1P0vJoGNk0j3vlXtuZ7zayH9c/0bGDO6NpTfRtMzaM2uaHe8fQ+cO/UYdJhdvoyf0u18q94NPfrspcM8SRUAUciNctDDNnd5frF4LPO113a9qFwqTq4Nn6WfuqF7oT2Zy9mHKKyXrAnXyte1R/Fo0Wm6NRi+JRC6JopbIFyNgwL2ERJXvq6Tjn9DTjK/XfttEfYPgHTrt8qIuYySjXGJ6mfnaN3Imy/dgBz1AHNrvsJqU2/+bJJDvXXLmTKUfBUFB9X+Q7W4a0UMjHlFXol2ojfgvIdapxxyjfXrkbXpSzbEPyHW0IQRhmj3sDY3sY3mS7g2FSDg8ug+N1IfPr89OhkOk7f2BTrPUU7xHMquZzczxzOkzo2Dq9VmnDLB1qh7yQUJsJNLT5vO19UTKf6n46ig7dWsMuRRF/XNssrupIPqCPpFahSn8MyBg7iBw7JaJPbNBJGUDflH03yMSe7JXl1GTO38leg5pEHrycIaJV88c9aOcVMFM2bq7SagP9g6iVQhTppCDn0ysXEHhciXiU/gkTSkRf4HdVdn0R7XXXTGx75MrhcRl+fyyvK+70H0nauhPsNlV4dCqLPveVSt3BDVIEQySlgbxVyb8JEV9cenSt1avfiv13e+m3nrkkbe++c23Hkm+1foQzBe5Zg+MA40zcd/OMcxWZhtzHnM+cwVzzQHu3tFuhKqinkQyHdWUZyWCNRE40YFQlp65KGgTgMAMgCo18mvtGq147Xwq1J1pndm3DYiaXrIO+akNZGqRN3KV2QTLpoGQPEdTqgQwSbyEBt2NbgiU7z9I2tWVS9orLurfH7V9c9asjsiaaHRNJBf5UYSYiG6zVqjnaI1kusTqwogESf00sPfDg6U+Sio4vnrZ3XFVy6u+rtCvKBiJDnikecIwzKRvgdTqth/+b2i3c1NiQhN07sFB4scR1AAd934ENWu7u2avorj+dBerk/Y9R3uA0pay+pzWWain8p0EfA20swZ7rnx9im5F4OMVDdfXMRhNVaxOS//ssXPmzTtnbP78rrVdYOZvmF9aXwIzf76esKNyEg9fM3bOdeeMDXWtO2Vd15Du0KhPtNsIzTUwXNPB72XmwEpbWcHJaN9rX8fSWQh83YWv+gYdrQOidQGZ6JTKJbmULCX5kiIn+TCuDcmVz5Ft3Eig+cbn1NcpVK/5MFQFvGpmdGhI/WnQ7Q4Gmq1NxiZOsTafWB/EdwM+pu7SvkKGVgJOQLCIXZUPj610xwP28hXalwjIMGXLC1CHpChSkI85k0lnjA/WhSr6L49V78efSsI53e34tZwi14SEs+LZuobcVvPkYdptNYetm3vGnDlnXE2sOfmVhcLKTcSawZU1K+accQ0pBdZoftVxq/L5lZtX5pnabxEQGWczUJsz+iIdwSXjOi6ZTJIFQARu+5HdVw6h7MQngZJeIpDbb4kM7f0D60WEJ1g9C7IL/1U/U1Cis28V5WNtAoxg27/Ac5h0wEM6QNz+pwik3MR5cnnijLnpYHfzXEPQnMcIcvPQffdRh1j33X03WlAbuk7/jNtDBfIFtrawxvddqdOyu3S+70pKy+6KF0ph72aCb232hnvWnhz2biLVbCKBG2sDqKR90c2rOfoZ5l+xf2dT+plDel1kuKJlHdY+NUAYUtrHVzRql94JRn52qopP9GEwIbdwMlEcxMk0SuLDHKZ1nGR7zS6bectNZhOOY4svJP7A0mB9Ugz5LBA2CV+38GbZ/ppVMq4ztxqWiJ2h3Rd53CwKf9Nf9JtvD3N2F3/RI41pkY3wzqesdhzG7mDQcr3Zb3vFHnBh/igeDFDJ9ldsfvP1lmDQDVns1qc84uo7GhWu4Xx3vtG8e6kNWwxLdzcWPPz5DYawr8IDf4f9gG0B7OcIOl+2MmcxFzMMF0sqiWT1v0RuFq9840Xy0mPBCV4kbQZfzlsiBzDJ2s3J3hJducmCXpQe05S1+9hkLwtrt5jGxpLHCysYpgl4YC2TmVProTMIm+ISm8k0xwM+JzvbbEo2XX7EmtXHrTyk0+/C/tH28VQy6BU4TkCmptsM24JGk+AMDwCIcge8ja5Ot83b2j9/2aJFc7eEFKOx2+7xhqLNtwdTgMW1hnpCLSEwN8APhVLBuzU3tDTcEgy2BkMGY6M35g94jEedsH7V0nMDYbtzrGtpe87IXjOagrnNea0Bi6/dvmjMPSxAzXl3M4dZxJudnSehZHJ+Z69obfAdMzx/yeoVbtkTcMmoF5oeaoXfF4H2hmcEBz2hEDiziRMK3QwOPLtC1z+p8zZm+l0WyvrTlbU0ye7BOUTvC0Hh8cd1Tb9XIPCqMA1X4l1BeOIJcl7S5eRfEQQoU9ENJvgzkdoqNV89XAN45Y3MN5mHK++v0asHutNv5pc2szLRdCEbTyknSyEqxydHsmVeSepXNNJ5RrUpIYtXO3RKJie9308/W+qh4CZfmjglUwojkl/i9e+kFkp0+6q2P66Lms4kfLUj629+vs4o2BcHjHEOGb2c8SuRNOISRski2q2uqNfqTi1McwkOG0ySzSQarVYpZPU2f5CSQyF5GbFSnoaGFr//Sm42F+e4ZsMIcehQEBqTPLxCIGiny0afrrsu+gLu4gZHQ6vCcZxBEi22SzguFuU4URDsvMHECfaueFPEyFmMZsxZedbIGniTPRxoQr7A8UGfL3h8wNcW6YuASbDbtnDckxw+dRtxavj3Fcp6huesOGfOKUuKE4gecuLKSWgggHxAGPGEOCocHHX8eddr1/687wj4odMe2A5/06CLx6g59ELmevVva2LXI2FNrEtt6rsX9Z/Vx1T5rbfVwOrJN45MAa3NSEYsks0YHKt+otMVLLV6yZHOSR+/e6S9PH8heiCtjiMrcRZPB77L2/DudHk+mo8ehNzqp+iBdnUxpe0n5CW1d1MdxWxnvsBcwFzIXDUzCcoM7z91V3h6/1ZV00leprjJNKtzoGZcShPK7KBCGXB1htYOUgKsw7XrSaFeLTegrO2NOypV7yBoam3uynWmMDc8M+rvq5mbmG8wdzF3M7v/3/f9lJoFtTWh2s8oOf+DI6Tuqhw0QSsJ5q/RAR51p/86P5jf+Ef9YMZJd5bvJffjhfYQ858crxWV8WrWHoaYkPr7YBA1gkM+yFfROdT0Fzw131icKW1R913Aic5GWWyYlra4nvCbPozdrii3x2ZAURwd+zwG5nNdYZDbj2bv+TdodXlmFLnaXaHIX6AXy8MWRXY0jRRBf4Ydrm6HuoCQdN01hDcz+fsDFR7DwhneMFPHA6rjCdNrDqEgPcUYmuYTqh9H0DnQjIsiEXJ1XQTzVtMSo2DAhiUGq4WfBlSo+wjFfjYhWtWrl5isvMUK5bBBoDTdX9kXWcLlJndpDdS2KsmTowYEYUnWtY3eSFAi6uEHaCO7NFqKgvnJoD3lmP1cpBjFka4oXlne5Q2GpJ+7xJ4Bi934shQKqSaq9KO+HGNt0a6o2gwWGrCz4qxwPoJ+C6FDwpLaLIVt/f0WHJbQG96QqmoXzE7gX+FJfJ9TmXOZS5lrmPv1lvjRfwQB03At7bofj3ZJh363lYZteQEH1e/2KMkaJrX/pceQQnEtySPn4FVkiV6l049I7ty/gnp9pSnNGjoNiOWdomABJDq13GuxGDIGZDB5LWYjsqQija2vGiCP4ZFMZ+eGTCbjpicO7zb4Oc6PELKZOYPcZBMkg0HSP9XxMTIj036I1+ejzzTX/KlnBJsMBqPRZBKMZj4oB5vc5gaRM1g4E+JYCy+Y/HJjstfwdwOYnv7DensP68805hvBHGnoMMQMR/Iw85oM5DpL9wkQ7jBU7+J4FWj5ijxjUPtS1P4X6h04rubYjEafU04sSyhXom8EYCVXkfoVYMaeRqhlSobffeONuJt4HiNREFJ/yaIBjAcwf4OB5w03sBsggNBEGP8lLJUvpR/SO0MKj5TvxDdPjpAhuwH3syzbZDREDLyCWfUBGjeA9ThjE2Y1nspv2ZfZKOzhaco/Y8yoOltlRK/ERcV8nDLKyF2v9KSN9qUPRKbfAXhEOaomf4/6fHtGLZcWetxAuJcaO92ITZZ53u2xIVb0mFFR4HlBLZs9jR6z+rzA/0rpicV6RokVsxOwZPfFYuhZVEwuLKllKK8+n4S62MTJ+2weNyn7vFa2TCpCRbNHfFcvD9aIozHcaI91xvSx/QL+DFZtA9DbROPoMIZxT1BtifyEbi7Aq+qFStqp75r7lRL5OCIZNX9dwldONzqdNpiZpwuNHtxLbAEst7n8IrpOS+LVE3UP8tbEQSb1MxQiBdS3zQE3ug6FeKeTaGCo75DKtpwO1J/V6TKebnY3lt84XXA3QtWeRgGquZY3GGxOp1E9wah7PqqJg/xWFCZZoSZ3AF2LwrQqJ0/DjI773q5/d71WjreYyrUIH+vUuq8yTuZH1X1BSZ5hXD3qNPWl3xFyN81Gep3N+DheRb9+vp1+ofxC9TIEfUAiXqcRYfWPSNovoryJ4keoH7b7Z6ou+f75Rr3qvvEv1wZ2BqUN5Hlg9S7eqT8cknvH8VBI5QAF+ic4BAVCLaTmKh70fI0+Y+WrrtPKAglfMgo/pGs1sqnK5dLlv1TlbUSUR1gBVMlh+yiaM4LmaHcXsAtmIJwbreRVHyNqhpru99vsW6ynTr7cQ/Q36mTLdUoaztoROxDiIVPJXMzIS7qsSqYbHtk/Cvqul1zRhbPd3eUXuy7M7clm9+TIaVH8lXAuDEa9P5wPhfLhuxzycXYvlh3Hue2cs+L3iKyHoIKql5wtRX/IqXIuhz7K7WNqiqIlEDhmv5JGrUadD/7Tmjsq6ttbdzftedVLE14gUA/dRWAPOpfEkBRG511+wt5A7+5tP6Dek9YjNbK7XEVul8CWzY9t3vwYVV4iV/GeILouIF8kOt/d6L6ACKUucE++qPdnJLLRfX5NNl0u8xTeR9vkYXyTv5hcc2n7F5pg62/aW25CW17fmPtjfsPrV68wLJ8fb2qK44fLL1x5Jc6pu/72N32/vAFggqMer/+X7yWuOz1SaTFpSrGw8sgTVi7S7hxe9PAiTcVrkfr7iHZJceRtKs6LbH7slcc2k8y0A4bqMhNPWn2ZZLyNFCFF9Xf/BD9SN7frbzqJ132Ts663El1busCgZs1VQ01sbzy+90dNeH2Xel9XFzq06/Au1Qief3SpnwCKFGeY/w8acz5TAAAAeJxjYGRgYADifx656fH8Nl8ZuFkYQOCJfaQMgv6/gIWBOQHI5WBgAokCABA7CQsAeJxjYGRgYG7438AQw1LPAAQsDAyMDKhgHgBUCwOGAAB4nGNhYGBgwYYdcIgTwjB99gTUOCCpdcAijgtjMwNdHF2NPQ47bNDU2BBwHyE3GhPpB3si1GBzBwgb4PAXrvBFjwd7PHGDbFY9FrvtcahFdy8DA6Y/0dQBAAt/GYkAAAAAAAAAAHYBHgFAAdQCSAK2A6gEDAR0BN4FdAXyBjQGuAcoB4IH1AhGCF4IhAi0CP4JJAmKCg4KVAp8CuILYgviDKINcg4EDooPCg9kD5oP8BAgEIIQ4hEYEWQSZhOqE94UEhRsFLgVaBXUFqIXMheCF+oYSBicGQQZZhmwGlAaahq+GxIbuhxKHHQc6B1WHdweMB56HqQfCh+MH+YgiiDsIWYhliHEIfQiViJsIzAjdiRAJVwloCXkJm4mzic4J3gnnCf6KE4osCj0KVYp1CpaKworbiu2LAwsNCyMLTAtrC5SLqwvXC/YMJAw5jE0MYoyDDKcMu4zPDOONAY0rjUeNhI2hjbQN2Q3yDgQOLI5Ljn4Ok47PDueO/Q8rD2QPew+RD6yPw4/9kByQORBckIUQmxC6EMQQ1JDfEPaRBQAAHicY2BkYGCYx/CBQYoBBJiAmAsIGRj+g/kMADK6Ar8AeJxdkc1OwkAUhc/IjxESF5q4cDVuiImhBZbsDAnsWeC6lCk/aTvNdCBh5dP4BD6BT+AT6Ev4Ah7K1QTazJ3vnLn3zk0L4AbfUDg+t1xHVrikOvIF+V64Rn4QrpMfhRtoIxRu0h8Kt/CEZ+E2O6bsoOpXVB28Citc4034gvwuXCN/CNfJn8IN3OFLuEn/R7iFmVLCbXTUy8iZyJuFnu/1OrZ5YnOfxN0DTs1ym0ZOlGwz48q1zXU/6IkzMblxfy3K3XLgfaITZzM9Zi+TplYXzm5M7IOV98UwDBPxg9hmGMHBIIJnXEBjjj3jGjEsciRV9NxjdP/dKXOX2PJDRaw+PTtVM2Y6lNQHpdFHgN5ZzoQ5eZV3PkWJHe8Z0D1MoLkcKzLSWOYynCElaxTV2YZOTD/Aqqoq+JNDvslZflDdnf0CPF1o6QAAAHicbVSHlts2ELw5kRQlnc9xzum9Vyax7PTee+89ELGi4AMJGgClU3rvvVfnV7OgpOT8XvSeCAK7AGZnZ7i2vrb49df+/3cU6+ggQowEXaTooY8BNrAHm9iL47APx2ML+3ECTsRJOBmn4FSchtNxBs7EWTgb5+BcnIfzcQEuxEW4GJfgUlyGy5HhClyJq3AAQxzEIVyNa3AtrsP1uAE34ibcjFtwK27D7bgDd+Iu3I17cC/uw/14AA/iITyMR/AoHsPjeAJP4ik8jWfwLJ7D83gBL+IlvIxX8Cpeg8AIOSQIYxSYQOEwtqFRooJBjSOwcPBoMMUMO5jjdbyBN/EW3sY7eBfv4X18gA/xET7GJ/gUn+FzfIEv8RW+xjf4Ft/he/yAH/ETfsYv+BW/4Xf8gT/xF47i77W0FHZbmlk1kMKLzJGm3PcKq2SmVUVxbVXlo1z5eapNLrwyVXLE5kZSqqq68ZmSiRpbUVIsGqlMf2xsmZUc17FXXlPkVFF1hZSWnOs5z0c4r/LuSLSnxFMlySRiyrfbrmtcTZXszoStVFVEjieppTHvnQzXhermRjdldXA5HlqOw+V4INFibhrfc1SUVHmS3TAw5t4CrBdFx4vRRm6qsSoymnKUMVGdBdiJ0wzGJlIJbYqtww0DHc8zV4uchDVNJZOm1kbIKDf1vO9VSZkVVUGpF2474xr3H7NnRH5GVCWqrI31A75YU3vRwcESwEg4Ol5oZkh5Kl3mvCWfT3YvjTXtMAtxPqF8OxKNN2kuNK8IuyrD+bmmvcuJkFNR5SRXwdqa2m1yO8hTliubaxruOWaaLGb7pbLceyYrs2ZmmRvraEMqVzOpLYxIWlHsWa2MWA/bUVBNTFL5YRSeodEZN2NrlaWqIKM2d4VwytXxNoqC7DaPTezQnHr8z3JtHHVrhqFoNgi3ZxWjEnUyNpqbNGh1tiig14ZDMAqrvTYU2IsUXxmrUhS0b9WZkMsqtH5ztZIHpdi9/7Zu0YOY4WwP41JVjYtZRc0wKo2lKLymmrve8KmdWsikNCOlKa15npVih9Omq5mqUi4hCwpbr/MoLHaXck6skKpxAyemLAqlNcn0SEOudZjLrdE6DKr2XUfet27g1MRNBPOWToVVQU+dObmNxRpTyJmhI9QPj6U2uRta1I53zhTXxR4bBYIGXCYt/R5zSxo2sCbLXhdWpq3aRmaHteZyEUwxarw3Vb/9SrRKjgu2RN2VKjjYRoHXDUkLyFyDiya+1EkQhbFxa78oUMrMODczVsaBANNhrSWL3keWQccM19hkgSs67JiMqilHZOPWUv3/TLTLT8MoeDHijCr1tMPdJdH1xmiv6shp41PPXLgxWXZ/0ZvxPTZ896LAQdye02uFO1FaRvw27PBja5cLg1EDxn6b1qpu367wQkJra/8AhSEfTQ==) format("woff")}.fc-icon{-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;font-family:fc-icon!important;font-size:16px;font-style:normal}.icon-data-select:before{content:"\\e6dd"}.icon-markdown:before{content:"\\e893"}.icon-grid-line:before{content:"\\e600"}.icon-print:before{content:"\\e6de"}.icon-city:before{content:"\\e64b"}.icon-location:before{content:"\\e6d4"}.icon-qrcode:before{content:"\\e6ce"}.icon-input-id:before{content:"\\e6d1"}.icon-iframe:before{content:"\\e6d2"}.icon-audio:before{content:"\\e6d3"}.icon-form-model:before{content:"\\e6d5"}.icon-title:before{content:"\\e6d6"}.icon-sign:before{content:"\\e6d7"}.icon-address:before{content:"\\e6d8"}.icon-statistic:before{content:"\\e6d9"}.icon-barcode:before{content:"\\e6da"}.icon-video:before{content:"\\e6db"}.icon-avatar:before{content:"\\e6dc"}.icon-suspend:before{content:"\\e6cf"}.icon-warning:before{content:"\\e6d0"}.icon-send:before{content:"\\e6cc"}.icon-refresh2:before{content:"\\e6cd"}.icon-ai:before{content:"\\e6cb"}.icon-ai.bright{-webkit-text-fill-color:transparent;background:linear-gradient(90deg,#328ff7,#62e3a3);-webkit-background-clip:text}.icon-column4:before{content:"\\e6c7"}.icon-column3:before{content:"\\e6c6"}.icon-column2:before{content:"\\e6c8"}.icon-column1:before{content:"\\e6c9"}.icon-layout:before{content:"\\e6ca"}.icon-segmented:before{content:"\\e682"}.icon-mention:before{content:"\\e6c5"}.icon-input-tag:before{content:"\\e6c4"}.icon-up:before{content:"\\e697";display:inline-block;transform:rotate(180deg)}.icon-alignitems-flexstart:before{content:"\\e67f";display:inline-block;transform:rotate(180deg)}.icon-align-center:before{content:"\\e6a5";display:inline-block;transform:rotate(90deg)}.icon-align-flexstart:before{content:"\\e6a4";display:inline-block;transform:rotate(90deg)}.icon-align-spacearound:before{content:"\\e670";display:inline-block;transform:rotate(-90deg)}.icon-align-spacebetween:before{content:"\\e695";display:inline-block;transform:rotate(-90deg)}.icon-align-stretch:before{content:"\\e6a7";display:inline-block;transform:rotate(-90deg)}.icon-align-flexend:before{content:"\\e6a4";display:inline-block;transform:rotate(-90deg)}.icon-justify-flexend:before{content:"\\e6a4";display:inline-block;transform:rotate(180deg)}.icon-direction-row:before{content:"\\e68b";display:inline-block;transform:rotate(180deg)}.icon-direction-column:before{content:"\\e68b";display:inline-block;transform:rotate(-90deg)}.icon-direction-columnreverse:before{content:"\\e68b";display:inline-block;transform:rotate(90deg)}.icon-arrow:before{content:"\\e697";display:inline-block;transform:rotate(180deg)}.icon-cell:before{content:"\\e654"}.icon-table:before{content:"\\eb0a"}.icon-next-step:before{content:"\\e6b4";display:inline-block;transform:rotateY(180deg)}.icon-grid:before{content:"\\e65c";display:inline-block;transform:rotate(90deg)}.icon-alignitems-stretch:before{content:"\\e67e"}.icon-alignitems-flexend:before{content:"\\e67f"}.icon-check:before{content:"\\e680"}.icon-auto:before{content:"\\e681"}.icon-config-event:before{content:"\\e66e"}.icon-calendar:before{content:"\\e683"}.icon-config-style:before{content:"\\e684"}.icon-copy:before{content:"\\e676"}.icon-config-advanced:before{content:"\\e686"}.icon-config-props:before{content:"\\e687"}.icon-delete-circle2:before{content:"\\e688"}.icon-delete-circle:before,.icon-delete2:before{content:"\\e689"}.icon-delete:before{content:"\\e68a"}.icon-direction-rowreverse:before{content:"\\e68b"}.icon-display-flex:before{content:"\\e68c"}.icon-dialog:before{content:"\\e66f"}.icon-drag:before{content:"\\e68e"}.icon-display-block:before{content:"\\e68f"}.icon-data:before{content:"\\e690"}.icon-edit2:before{content:"\\e691"}.icon-edit:before{content:"\\e692"}.icon-add-col:before{content:"\\e693"}.icon-display-inlineblock:before{content:"\\e694"}.icon-config-base:before{content:"\\e6bf"}.icon-config-validate:before{content:"\\e696"}.icon-down:before{content:"\\e697"}.icon-display-inline:before{content:"\\e698"}.icon-eye:before{content:"\\e699"}.icon-eye-close:before{content:"\\e69a"}.icon-import:before{content:"\\e6a6"}.icon-preview:before{content:"\\e69b"}.icon-flex-nowrap:before{content:"\\e69c"}.icon-folder:before{content:"\\e69d"}.icon-form-circle:before{content:"\\e69e"}.icon-flex-wrap:before{content:"\\e69f"}.icon-form:before{content:"\\e6a0"}.icon-form-item:before{content:"\\e6a1"}.icon-icon:before{content:"\\e6a2"}.icon-image:before{content:"\\e6a3"}.icon-justify-flexstart:before{content:"\\e6a4"}.icon-justify-center:before{content:"\\e6a5"}.icon-justify-spacearound:before{content:"\\e670"}.icon-justify-stretch:before{content:"\\e6a7"}.icon-link2:before{content:"\\e6a8"}.icon-justify-spacebetween:before{content:"\\e695"}.icon-minus:before{content:"\\e6aa"}.icon-menu2:before{content:"\\e6ab"}.icon-more:before{content:"\\e6ac"}.icon-menu:before{content:"\\e6ad"}.icon-language:before{content:"\\e6ae"}.icon-pad:before{content:"\\e6af"}.icon-mobile:before{content:"\\e6b0"}.icon-page-max:before{content:"\\e6b1"}.icon-move:before{content:"\\e6b2"}.icon-page-min:before{content:"\\e6b3"}.icon-pre-step:before{content:"\\e6b4"}.icon-pc:before{content:"\\e6b5"}.icon-page:before{content:"\\e6b6"}.icon-refresh:before{content:"\\e6b7"}.icon-radius:before{content:"\\e6b8"}.icon-save-filled:before{content:"\\e6b9"}.icon-question:before{content:"\\e6ba"}.icon-scroll:before{content:"\\e6bb"}.icon-script:before{content:"\\e6bc"}.icon-setting:before{content:"\\e6bd"}.icon-save-online:before,.icon-save:before{content:"\\e6be"}.icon-task-add:before{content:"\\e68d"}.icon-shadow:before{content:"\\e6c0"}.icon-variable:before{content:"\\e6c1"}.icon-yes:before{content:"\\e6c2"}.icon-shadow-inset:before{content:"\\e6c3"}.icon-date:before{content:"\\e642"}.icon-date-range:before{content:"\\e643"}.icon-collapse:before{content:"\\e644"}.icon-slider:before{content:"\\e665"}.icon-switch:before{content:"\\e646"}.icon-subform:before{content:"\\e647"}.icon-time-range:before{content:"\\e685"}.icon-tree-select:before{content:"\\e649"}.icon-value:before{content:"\\e64a"}.icon-table-form3:before{content:"\\e6a9"}.icon-alert:before{content:"\\e64c"}.icon-card:before{content:"\\e64d"}.icon-checkbox:before{content:"\\e64e"}.icon-cascader:before{content:"\\e64f"}.icon-button:before{content:"\\e650"}.icon-data-table:before{content:"\\e651"}.icon-group:before{content:"\\e652"}.icon-divider:before{content:"\\e653"}.icon-flex:before{content:"\\e654"}.icon-descriptions:before{content:"\\e655"}.icon-html:before{content:"\\e656"}.icon-editor:before{content:"\\e657"}.icon-input:before{content:"\\e658"}.icon-link:before{content:"\\e659"}.icon-password:before{content:"\\e65a"}.icon-radio:before{content:"\\e65b"}.icon-row:before{content:"\\e65c"}.icon-inline:before{content:"\\e65d"}.icon-rate:before{content:"\\e65e"}.icon-color:before{content:"\\e65f"}.icon-select:before{content:"\\e660"}.icon-json:before{content:"\\e661"}.icon-number:before{content:"\\e662"}.icon-space:before{content:"\\e664"}.icon-step-form:before{content:"\\e663"}.icon-table-form:before{content:"\\e666"}.icon-table-form2:before{content:"\\e667"}.icon-time:before{content:"\\e668"}.icon-span:before{content:"\\e669"}.icon-textarea:before{content:"\\e66a"}.icon-tooltip:before{content:"\\e66b"}.icon-slot:before{content:"\\e66c"}.icon-transfer:before{content:"\\e66d"}.icon-upload:before{content:"\\e673"}.icon-tag:before{content:"\\e671"}.icon-watermark:before{content:"\\e672"}.icon-tab:before{content:"\\e674"}.icon-tree:before{content:"\\e675"}.icon-table:before{content:"\\e677"}.icon-add-child:before{content:"\\e678"}.icon-add2:before{content:"\\e679"}.icon-add:before{content:"\\e67a"}.icon-alignitems-baseline:before{content:"\\e67b"}.icon-add-circle:before{content:"\\e67c"}.icon-alignitems-center:before{content:"\\e67d"}._fd-step-form .van-step{cursor:pointer;line-height:1.4;text-align:left}._fd-popup.van-popup{background:var(--fc-bg-color-1);margin:10px;overflow:auto;padding-top:50px;position:relative;width:calc(100% - 20px)}._fd-popup-content{display:flex;flex:1;height:calc(var(--fc-dialog-height) - 152px);margin-bottom:5px;overflow:auto;padding:1px}._fd-popup-content>._fd-drag-box{align-content:flex-start;align-items:flex-start;box-sizing:border-box;display:flex;flex-wrap:wrap;height:calc(var(--fc-dialog-height) - 105px);justify-content:flex-start;outline:1px dashed var(--fc-tool-border-color);overflow:auto;position:relative}._fd-popup-content ._fd-drag-box{outline:1px dashed var(--fc-line-color-3)}._fd-popup-title{color:#333;font-size:16px;left:0;position:absolute;text-align:center;top:16px;width:100%}.CodeMirror{color:#000;direction:ltr;font-family:monospace;height:300px}.CodeMirror-lines{padding:4px 0}.CodeMirror pre.CodeMirror-line,.CodeMirror pre.CodeMirror-line-like{padding:0 4px}.CodeMirror-gutter-filler,.CodeMirror-scrollbar-filler{background-color:#fff}.CodeMirror-gutters{background-color:#f7f7f7;border-right:1px solid #ddd;white-space:nowrap}.CodeMirror-linenumber{color:#999;min-width:20px;padding:0 3px 0 5px;text-align:right;white-space:nowrap}.CodeMirror-guttermarker{color:#000}.CodeMirror-guttermarker-subtle{color:#999}.CodeMirror-cursor{border-left:1px solid #000;border-right:none;width:0}.CodeMirror div.CodeMirror-secondarycursor{border-left:1px solid silver}.cm-fat-cursor .CodeMirror-cursor{background:#7e7;border:0!important;width:auto}.cm-fat-cursor div.CodeMirror-cursors{z-index:1}.cm-fat-cursor .CodeMirror-line::selection,.cm-fat-cursor .CodeMirror-line>span::selection,.cm-fat-cursor .CodeMirror-line>span>span::selection{background:transparent}.cm-fat-cursor .CodeMirror-line::-moz-selection,.cm-fat-cursor .CodeMirror-line>span::-moz-selection,.cm-fat-cursor .CodeMirror-line>span>span::-moz-selection{background:transparent}.cm-fat-cursor{caret-color:transparent}.cm-tab{display:inline-block;text-decoration:inherit}.CodeMirror-rulers{bottom:0;left:0;overflow:hidden;position:absolute;right:0;top:-50px}.CodeMirror-ruler{border-left:1px solid #ccc;bottom:0;position:absolute;top:0}.cm-s-default .cm-header{color:#00f}.cm-s-default .cm-quote{color:#090}.cm-negative{color:#d44}.cm-positive{color:#292}.cm-header,.cm-strong{font-weight:700}.cm-em{font-style:italic}.cm-link{text-decoration:underline}.cm-strikethrough{text-decoration:line-through}.cm-s-default .cm-keyword{color:#708}.cm-s-default .cm-atom{color:#219}.cm-s-default .cm-number{color:#164}.cm-s-default .cm-def{color:#00f}.cm-s-default .cm-variable-2{color:#05a}.cm-s-default .cm-type,.cm-s-default .cm-variable-3{color:#085}.cm-s-default .cm-comment{color:#a50}.cm-s-default .cm-string{color:#a11}.cm-s-default .cm-string-2{color:#f50}.cm-s-default .cm-meta,.cm-s-default .cm-qualifier{color:#555}.cm-s-default .cm-builtin{color:#30a}.cm-s-default .cm-bracket{color:#997}.cm-s-default .cm-tag{color:#170}.cm-s-default .cm-attribute{color:#00c}.cm-s-default .cm-hr{color:#999}.cm-s-default .cm-link{color:#00c}.cm-invalidchar,.cm-s-default .cm-error{color:red}.CodeMirror-composing{border-bottom:2px solid}div.CodeMirror span.CodeMirror-matchingbracket{color:#0b0}div.CodeMirror span.CodeMirror-nonmatchingbracket{color:#a22}.CodeMirror-matchingtag{background:rgba(255,150,0,.3)}.CodeMirror-activeline-background{background:#e8f2ff}.CodeMirror{background:#fff;overflow:hidden;position:relative}.CodeMirror-scroll{height:100%;margin-bottom:-50px;margin-right:-50px;outline:none;overflow:scroll!important;padding-bottom:50px;position:relative;z-index:0}.CodeMirror-sizer{border-right:50px solid transparent;position:relative}.CodeMirror-gutter-filler,.CodeMirror-hscrollbar,.CodeMirror-scrollbar-filler,.CodeMirror-vscrollbar{display:none;outline:none;position:absolute;z-index:5}.CodeMirror-vscrollbar{overflow-x:hidden;overflow-y:scroll;right:0;top:0}.CodeMirror-hscrollbar{bottom:0;left:0;overflow-x:scroll;overflow-y:hidden}.CodeMirror-scrollbar-filler{bottom:0;right:0}.CodeMirror-gutter-filler{bottom:0;left:0}.CodeMirror-gutters{left:0;min-height:100%;position:absolute;top:0;z-index:3}.CodeMirror-gutter{display:inline-block;height:100%;margin-bottom:-50px;vertical-align:top;white-space:normal}.CodeMirror-gutter-wrapper{background:none!important;border:none!important;position:absolute;z-index:4}.CodeMirror-gutter-background{bottom:0;position:absolute;top:0;z-index:4}.CodeMirror-gutter-elt{cursor:default;position:absolute;z-index:4}.CodeMirror-gutter-wrapper ::selection{background-color:transparent}.CodeMirror-gutter-wrapper ::-moz-selection{background-color:transparent}.CodeMirror-lines{cursor:text;min-height:1px}.CodeMirror pre.CodeMirror-line,.CodeMirror pre.CodeMirror-line-like{word-wrap:normal;-webkit-tap-highlight-color:transparent;background:transparent;border-radius:0;border-width:0;color:inherit;font-family:inherit;font-size:inherit;font-variant-ligatures:contextual;line-height:inherit;margin:0;overflow:visible;position:relative;white-space:pre;z-index:2}.CodeMirror-wrap pre.CodeMirror-line,.CodeMirror-wrap pre.CodeMirror-line-like{word-wrap:break-word;white-space:pre-wrap;word-break:normal}.CodeMirror-linebackground{bottom:0;left:0;position:absolute;right:0;top:0;z-index:0}.CodeMirror-linewidget{padding:.1px;position:relative;z-index:2}.CodeMirror-rtl pre{direction:rtl}.CodeMirror-code{outline:none}.CodeMirror-gutter,.CodeMirror-gutters,.CodeMirror-linenumber,.CodeMirror-scroll,.CodeMirror-sizer{box-sizing:content-box}.CodeMirror-measure{height:0;overflow:hidden;position:absolute;visibility:hidden;width:100%}.CodeMirror-cursor{pointer-events:none;position:absolute}.CodeMirror-measure pre{position:static}div.CodeMirror-cursors{position:relative;visibility:hidden;z-index:3}.CodeMirror-focused div.CodeMirror-cursors,div.CodeMirror-dragcursors{visibility:visible}.CodeMirror-selected{background:#d9d9d9}.CodeMirror-focused .CodeMirror-selected{background:#d7d4f0}.CodeMirror-crosshair{cursor:crosshair}.CodeMirror-line::selection,.CodeMirror-line>span::selection,.CodeMirror-line>span>span::selection{background:#d7d4f0}.CodeMirror-line::-moz-selection,.CodeMirror-line>span::-moz-selection,.CodeMirror-line>span>span::-moz-selection{background:#d7d4f0}.cm-searching{background-color:#ffa;background-color:#ff06}.cm-force-border{padding-right:.1px}@media print{.CodeMirror div.CodeMirror-cursors{visibility:hidden}}.cm-tab-wrap-hack:after{content:""}span.CodeMirror-selectedtext{background:none}.CodeMirror-hints{background:#fff;border:1px solid silver;border-radius:3px;box-shadow:2px 3px 5px #0003;font-family:monospace;font-size:90%;list-style:none;margin:0;max-height:20em;overflow:hidden;overflow-y:auto;padding:2px;position:absolute;z-index:1}.CodeMirror-hint{border-radius:2px;color:#000;cursor:pointer;margin:0;padding:0 4px;white-space:pre}li.CodeMirror-hint-active{background:#08f;color:#fff}._fd-fn{display:flex;flex-direction:column;height:100%;position:relative;width:100%}._fd-fn .el-button{bottom:3px;box-shadow:0 6px 16px #00000014,0 3px 6px -4px #0000001f,0 9px 28px 8px #0000000d;position:absolute;right:5px}._fd-fn-editor{display:flex;flex:1;overflow:auto;width:100%}._fd-fn-editor .CodeMirror{height:100%;width:100%}._fd-fn-tip{background:var(--fc-bg-color-2);color:var(--fc-text-color-1);direction:ltr;font-family:monospace}._fd-fn-tip .cm-keyword{color:#708;line-height:24px;overflow-x:auto;white-space:nowrap}._fd-fn-tip .cm-keyword::-webkit-scrollbar{background-color:transparent;height:0;width:0}._fd-fn-ind{background-color:var(--fc-bg-color-3);border-right:1px solid var(--fc-line-color-2);display:inline-block;float:left;height:24px;margin-right:4px;width:29px}._fd-fn-arg{cursor:pointer;text-decoration:underline}._fd-fn-arg i{color:var(--fc-style-color-1);font-size:12px}._fd-cdi-input>div{width:100%}._fd-pattern-input{width:100%}._fd-pattern-input .el-input-group__append{padding:0 10px}._fd-pattern-input .fc-icon{cursor:pointer}._fd-pattern-popper .el-dropdown__list{height:350px;overflow:auto}.el-tree._fd-rule-select{min-width:200px}._fd-rule-select .el-tree-node:has(._fd-rule-select-node){border-bottom-style:solid;border-bottom:1px dashed var(--fc-line-color-3);padding-bottom:5px}._fd-rule-select .el-tree-node:has(._fd-rule-select-node)>.el-tree-node__content>.el-checkbox{display:none}._fd-rule-select .el-tree-node:has(._fd-rule-select-node)>.el-tree-node__content>.el-select-dropdown__item{padding-right:20px}._fd-rule-select-node{display:flex;justify-content:space-between}._fd-rule-select-node>div{color:#61affe}._fd-rule-select-node>span{font-size:12px}._fd-value-input .el-input__validateIcon{display:none}._fd-value-input .el-select,._fd-value-input .el-select__wrapper{height:100%}._fd-warning-pop{max-width:400px}._fd-warning-text{cursor:help;text-decoration:underline;text-decoration-style:dashed}._fd-variable-btn{align-items:center;background:var(--fc-style-bg-color-1);border-radius:5px;color:var(--fc-style-color-1);cursor:pointer;display:flex;font-size:12px;margin-left:6px;padding:2px 6px}._fd-variable-con .el-main{padding:0}._fd-variable-l,._fd-variable-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-variable-r{margin-left:10px}._fd-variable-l .el-header,._fd-variable-r .el-header{align-items:center;background:var(--fc-bg-color-3);color:var(--fc-text-color-1);display:flex;font-size:13px;height:40px}._fd-variable-r .el-header .fc-icon{color:var(--fc-style-color-1);cursor:pointer;font-size:13px;margin-left:2px}._fd-variable-r .el-main{padding:10px}._fd-variable-info{background:hsla(0,0%,67%,.1);border-radius:6px;color:var(--fc-text-color-2);display:flex;font-size:12px;line-height:18px;margin-bottom:6px;padding:8px 13px;position:relative}._fd-variable-node{align-items:center;color:var(--fc-text-color-1);display:flex;font-size:13px;height:26px;justify-content:space-between;line-height:26px;padding-right:5px;width:100%}._fd-variable-node>span{color:var(--fc-text-color-3);font-size:12px}._fd-variable-item{align-items:center;border-bottom:1px solid var(--fc-line-color-3);display:flex;min-height:40px;padding:0 20px}._fd-variable-top ._fd-variable-item-label{color:#fca130}._fd-variable-item-label{font-size:13px;margin-right:18px;width:198px}._fd-variable-item .el-input{display:flex;flex:1;font-size:13px;margin-top:4px}._fd-variable-item.active,._fd-variable-item.active ._fd-variable-item-label,._fd-variable-item.active input{color:var(--fc-style-color-1)}._fd-variable-item.active .el-input{--el-input-icon-color:var(--fc-style-color-1)}._fd-variable-item input{text-align:center}._fd-variable-item .el-input .el-input__wrapper{box-shadow:none}._fd-variable-pop.el-popover.el-popper{height:400px;padding:0}._fd-variable-pop-header .fc-icon{color:var(--fc-style-color-1);cursor:pointer;margin-left:4px}._fd-variable-pop .el-header{align-items:center;background-color:var(--fc-bg-color-2);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:0 10px}._fd-variable-pop .el-main{padding:10px}._fd-variable-pop .el-tree-node__content>.el-tree-node__expand-icon{padding:3px}._fd-variable-pop .el-input-group__append{background:var(--fc-style-color-1);color:#fff;cursor:pointer;padding:0;width:60px}._fd-variable-pop .el-input-group__append div{text-align:center;width:100%}._fd-variable-pop-node{align-items:center;display:flex;font-size:13px;height:26px;justify-content:space-between;line-height:26px;padding-right:5px;width:100%}._fd-variable-pop-node>span{color:var(--fc-text-color-3);font-size:12px}._fd-cdg-input{display:flex;flex-direction:column}._fd-cdg-btns{margin-left:30px;margin-top:10px}._fd-cdg-btns .el-button{color:var(--fc-text-color-2)}._fd-cdg-item{display:flex}._fd-cdg-item .el-select{background-color:var(--fc-bg-color-2)}._fd-cdg-and{display:flex;flex-shrink:0;position:relative;width:100px}._fd-cdg-and>.el-select{left:-5px;margin-top:-16px;position:absolute;top:50%;width:80px;z-index:1}._fd-cdg-and:before{background-color:var(--fc-line-color-2);bottom:1px;content:"";left:30px;margin-bottom:16px;margin-top:14px;position:absolute;top:1px;width:1px}._fd-cdg-options{display:flex;flex-direction:column}._fd-cdg-option{align-items:center;display:flex;position:relative}._fd-cdg-field{width:208px}._fd-cdg-variable{height:32px;width:208px}._fd-cdg-term{width:104px}._fd-cdg-option>._fd-cfg-value{align-items:center;display:flex;width:208px}._fd-cdg-option>.fc-icon{color:var(--fc-text-color-2);cursor:pointer;margin-left:10px}._fd-cdg-option>.fc-icon.disabled{cursor:not-allowed}._fd-cdg-option>._fd-cfg-value>div{width:100%}._fd-cdg-option>.el-input+.el-select,._fd-cdg-option>.el-select+.el-input,._fd-cdg-option>.el-select+.el-select,._fd-cfg-value,._fd-cfg-value .el-checkbox{margin-left:10px}._fd-cdg-option:before{background-color:var(--fc-line-color-2);content:"";height:1px;left:-70px;margin-top:-1px;position:absolute;top:50%;width:105px}._fd-cdg-option.is-group{border:1px dashed #ccd3db;padding:14px}._fd-cdg-option.is-group>.fc-icon{font-size:18px;position:absolute;right:-10px;top:-10px;transform:rotate(45deg);z-index:1}._fd-cdg-option.is-group:before{margin-top:-17px}._fd-cdg-option+._fd-cdg-option{margin-top:16px}._fd-computed,._fd-computed .el-badge{width:100%}._fd-computed .el-button{font-weight:400;width:100%}._fd-comp-con,._fd-comp-condition{height:500px}._fd-comp-condition .el-main{padding:20px 5px}._fd-comp-con .el-tree>.el-tree-node{color:var(--fc-text-color-1);font-size:13px;font-weight:500;margin:1px;padding:14px}._fd-comp-con .el-tree>.el-tree-node+.el-tree-node{border-top:1px solid var(--fc-line-color-3)}._fd-comp-con .el-tree-node{font-weight:400}._fd-comp-con .el-tree-node__content{margin-top:5px}._fd-comp-dialog .el-dialog__body{padding:0 10px}._fd-comp-dialog .el-tabs__header{margin-bottom:0}._fd-comp-con .el-main{padding:0}._fd-comp-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-comp-head{align-items:center;border-bottom:1px solid var(--fc-line-color-3);color:var(--fc-text-color-1);display:flex;font-size:13px;font-weight:500;height:38px;padding:5px 15px}._fd-comp-r>.el-main,._fd-comp-script{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-comp-script{width:100%}._fd-comp-r>.el-main{flex-direction:column}._fd-comp-info{background:var(--fc-bg-color-2);border-radius:6px;color:var(--fc-text-color-2);height:90px;line-height:20px;margin:10px;padding:15px}._fd-comp-con .CodeMirror{height:100%;width:100%}._fd-comp-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-comp-node{align-items:center;display:flex;font-size:13px;height:26px;justify-content:space-between;line-height:26px;padding-right:5px;width:100%}._fd-comp-node ._group{color:#61affe;font-weight:700;margin-right:5px}._fd-comp-node ._subform{color:#fca130;font-weight:700;margin-right:5px}._fd-comp-node.disabled{color:var(--fc-text-color-3);cursor:not-allowed}._fd-comp-node.disabled ._fd-comp-id{background-color:#999}._fd-comp-id{background-color:var(--fc-style-color-1);border-radius:5px;color:#fff;font-weight:500;height:20px;line-height:20px;text-align:center;width:20px}._fd-comp-dialog .el-aside{border:1px solid var(--fc-line-color-3);border-right:0;width:300px}._fd-comp-title{color:var(--fc-text-color-1);font-weight:500;margin-bottom:15px;padding-left:5px;position:relative}._fd-comp-title:before{background-color:var(--fc-style-color-1);content:" ";display:inline-block;height:1em;left:-5px;position:absolute;top:3px;width:3px}._fd-comp-script .CodeMirror pre.CodeMirror-line{line-height:26px}._fd-comp-linkage{align-items:center;display:flex;font-size:12px}._fd-comp-linkage>._fd-rule-select{display:inline-block;margin:0 6px;width:120px}._fd-event .el-button{font-weight:400;width:100%}._fd-event .el-badge,._fd-menu{width:100%}._fd-menu{box-sizing:border-box;display:flex;flex-direction:column}._fd-menu-item{border:1px solid transparent;border-bottom:1px dashed var(--fc-line-color-3);padding:0 15px}._fd-menu-item.is-active{border:1px solid var(--fc-style-color-1)}._fd-menu-item.is-active ._fd-event-title i{color:var(--fc-style-color-1)}._fd-event-dialog .el-tabs__header{margin:0}._fd-event-select{align-items:center;display:flex;margin-left:15px;margin-top:15px}._fd-event-select .el-select{width:240px}._fd-event-con .el-main{padding:0}._fd-event-l,._fd-event-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-event-dropdown .el-dropdown-menu{max-height:500px;overflow:auto}._fd-event-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-event-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-event-r{border-left:0}._fd-event-r ._fd-event-head{justify-content:flex-end}._fd-event-l>.el-main,._fd-event-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-event-r>.el-main{flex-direction:column}._fd-event-r>.el-main.is-behavior{flex-direction:unset}._fd-event-item{display:flex;flex-direction:column;font-size:14px;justify-content:center;max-width:250px;overflow:hidden;white-space:pre-wrap}._fd-event-item ._fd-label{color:var(--fc-text-color-3);font-size:12px}._fd-event-l .el-menu-item.is-active ._fd-event-title i{color:var(--fc-style-color-1)}._fd-event-method{color:#9d238c;display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;overflow:hidden;white-space:pre-wrap;width:225px}._fd-event-method ._fd-label{color:var(--fc-text-color-3);font-size:12px;margin-top:4px}._fd-event-method>span:first-child,._fd-fn-list-method>span:first-child{color:#9d238c}._fd-event-method>span:first-child>span,._fd-fn-list-method>span:first-child>span{color:var(--fc-text-color-1);margin-left:10px}._fd-event-title{align-items:center;cursor:pointer;display:flex;justify-content:space-between;padding:12px 0;width:100%}._fd-event-title .fc-icon{color:var(--fc-text-color-2);font-size:18px;margin-right:6px}._fd-event-title .el-input{width:200px}._fd-event-title .el-input__wrapper{box-shadow:none}._fd-event-con .CodeMirror{height:100%;width:100%}._fd-event-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-event-behaviors{width:100%}._fd-event-behavior{background:var(--fc-bg-color-3);border-radius:5px;box-sizing:border-box;cursor:pointer;font-size:12px;margin-bottom:12px;padding:12px;width:100%}._fd-event-behavior.is-active{background:var(--fc-style-color-1)}._fd-event-behavior.is-active ._fd-event-behavior-info,._fd-event-behavior.is-active ._fd-event-behavior-label{color:#fff}._fd-event-behavior-label{color:var(--fc-text-color-2);display:flex;justify-content:space-between}._fd-event-behavior-label>div{display:flex}._fd-event-behavior-info{color:var(--fc-text-color-3);margin-left:16px}._fd-event-behavior-list{border-right:1px solid var(--fc-line-color-3);height:100%;padding:15px}._fd-event-behavior-list .el-menu-item,._fd-event-behavior-list .el-sub-menu__title{height:30px}._fd-event-behavior-list .el-menu{border-right:0}._fd-event-behavior-list .el-menu-item.is-active{background:var(--fc-style-color-1);color:#fff}._fd-event-behavior-list .el-menu-item,._fd-event-behavior-list .el-sub-menu__title{border-radius:6px!important;margin-bottom:4px}._fd-event-con ._fd-event-behavior-con{padding:15px}._fd-event-con .form-create .form-create .el-form-item{margin-bottom:18px}._fd-event-con .el-form ._fd-form-item-warning{color:var(--fc-text-color-3);font-size:12px;font-weight:400;line-height:17px;margin-top:6px}._fd-event-behavior-title{color:var(--fc-text-color-1);font-size:13px;font-weight:500;margin-bottom:12px}._fd-event-behavior-title>div{color:var(--fc-text-color-3);font-size:12px;font-weight:400}._fd-config-item{color:var(--fc-text-color-2);display:flex;flex-direction:column;font-size:12px;margin-bottom:10px;width:100%}._fd-ci-head{justify-content:space-between}._fd-ci-head,._fd-ci-label{align-items:center;display:flex}._fd-ci-label{color:var(--fc-text-color-1);font-size:12px}._fd-ci-con{align-items:center;display:flex;justify-content:flex-end;min-width:150px}._fd-ci-label.is-arrow{cursor:pointer}._fd-ci-append{background:var(--fc-bg-color-2);display:flex;flex-direction:column;margin:5px 3px 3px;padding:4px}._fd-ci-label i{font-size:12px;font-weight:600}._fd-ci-label i.down{transform:rotate(-180deg)}._fd-ci-info{font-size:12px;padding-right:5px}._fd-page-item{align-items:center;border-bottom:1px solid var(--fc-line-color-3);box-sizing:content-box;cursor:pointer;display:flex;flex-direction:row;font-size:12px;height:30px;justify-content:space-between;margin:0 12px;padding:12px 0}._fd-page-item.active ._fd-page-label{color:var(--fc-style-color-1)}._fd-page-btns{display:flex}._fd-page-label{color:var(--fc-text-color-1);font-weight:600}._fd-page-label .fc-icon{font-size:12px;margin-left:5px}._fd-page-id{align-items:center;color:var(--fc-text-color-3);display:flex;font-weight:400}._fd-page-id .fc-icon{margin-left:5px}._fd-page-id .fc-icon:hover,._fd-page-input .el-button{color:var(--fc-style-color-1)}._fd-page-input .el-button{font-size:12px;font-weight:400;margin-left:12px;margin-top:12px}._fd-page-input .el-button .fc-icon{font-size:12px;margin-left:5px}._fd-page-del{align-items:center;background-color:var(--fc-style-bg-color-3);border-radius:25px;display:flex;height:24px;justify-content:center;margin-left:4px;width:24px}._fd-page-del .fc-icon{color:var(--fc-style-color-3);font-size:14px}._fd-page-copy{align-items:center;background-color:var(--fc-style-bg-color-1);border-radius:25px;display:flex;height:24px;justify-content:center;width:24px}._fd-page-copy .fc-icon{color:var(--fc-style-color-1);font-size:14px}._fc-sublist ._fc-r-title{align-items:center;display:flex;justify-content:space-between}._fc-sublist .fc-icon{cursor:pointer}._fc-sublist ._fd-config-item+._fd-config-item{margin-top:8px}._fc-r-tools-bar{height:30px}._fc-r-tools-close{color:var(--fc-text-color-2);position:absolute;right:5px;transform:rotate(45deg)}._fc-r-tools{border-top:1px solid var(--fc-line-color-3);left:0;padding:0 10px;position:absolute;right:0}._fc-r-tool,._fc-r-tools{align-items:center;display:flex}._fc-r-tool{cursor:pointer;height:28px;justify-content:center;width:28px}._fc-r-tool:hover{color:var(--fc-style-color-1)}._fc-r-tool .fc-icon{font-size:22px}._fc-r-tools-close .fc-icon{font-size:18px}._fd-config-title{align-items:center;display:flex;font-size:14px;margin:26px 0 16px;padding-left:10px;position:relative}._fd-config-title:before{background-color:var(--fc-style-color-1);content:" ";display:block;height:20px;left:0;position:absolute;width:2px}._fd-type-select{cursor:pointer}._fd-type-select.is-disabled{cursor:default}._fd-type-select .fc-icon{font-size:14px}._fd-type-select-pop{max-height:500px;overflow:auto}._fd-type-select-pop .fc-icon{font-size:14px}._fc-field-tree .el-tree-node__content{color:var(--fc-text-color-1);display:flex;flex:1}._fc-field-tree .el-tree-node__content:hover{background-color:var(--fc-style-bg-color-1);color:var(--fc-style-color-1)}._fc-field-tree ._fc-field-drag{display:flex;flex:1;flex-direction:column}._fc-field-tree .fc-icon{font-size:18px;margin-right:5px}._fc-field-tree .icon-folder{color:var(--fc-style-color-1)}._fc-field-node-label{align-items:center;display:flex;user-select:none}._fc-l ._fc-form-tree .el-tree-node__content{color:var(--fc-text-color-1);display:flex;flex:1;height:auto;padding:5px 0}._fc-form-tree .el-tree-node__content:hover{background-color:var(--fc-style-bg-color-1);color:var(--fc-style-color-1)}._fc-form-tree .fc-icon{color:var(--fc-style-color-1);font-size:18px;margin-right:5px}._fc-form-tree .icon-folder{color:#ffba00}._fc-form-node{display:flex;flex-direction:row;justify-content:space-between;padding-right:12px;width:100%}._fc-form-node-label{align-items:flex-start;display:flex;user-select:none;white-space:normal}._fc-form-node-info{color:var(--fc-text-color-2);font-size:12px}._fd-gec,._fd-gec .el-badge{width:100%}._fd-gec .el-button{font-weight:400;width:100%}._fd-gec-con .el-main{padding:0}._fd-gec-l,._fd-gec-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-gec-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-gec-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-gec-r{border-left:0}._fd-gec-r ._fd-gec-head{justify-content:flex-end}._fd-gec-l>.el-main,._fd-gec-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-gec-r>.el-main{flex-direction:column}._fd-gec-l .el-menu{border-right:0;border-top:0;overflow:auto;padding:0 10px 5px;width:100%}._fd-gec-l .el-menu-item.is-active{background:var(--fc-bg-color-3);color:var(--fc-text-color-2)}._fd-gec-l .el-menu-item{border:1px solid var(--fc-line-color-3);border-radius:5px;height:auto;line-height:1em;margin-top:5px;padding:0}._fd-gec-method{color:#9d238c;display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;overflow:hidden;white-space:pre-wrap;width:225px}._fd-gec-method ._fd-label{color:var(--fc-text-color-3);font-size:12px;margin-top:4px}._fd-gec-title{align-items:center;display:flex;justify-content:space-between;padding:10px 0;width:100%}._fd-gec-title .el-input{width:200px}._fd-gec-title .fc-icon{color:var(--fc-text-color-2);font-size:18px;margin-right:6px}._fd-gec-title .el-input__wrapper{box-shadow:none}._fd-gec-con .el-menu-item.is-active i{color:var(--fc-text-color-2)}._fd-gec-con .CodeMirror{height:100%;width:100%}._fd-gec-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-struct-editor{flex:1;width:100%}._fd-struct-editor>div{height:100%}._fd-gfc,._fd-gfc .el-badge{width:100%}._fd-gfc .el-button{font-weight:400;width:100%}._fd-gfc-dialog .el-tabs__header{margin-bottom:0}._fd-gfc-dialog .form-create{margin-top:15px}._fd-gfc-dialog ._fc-tabs{display:flex;height:100%}._fd-gfc-dialog ._fc-tabs .el-tabs__content{display:flex;flex:1;overflow:auto}._fd-gfc-info{background:hsla(0,0%,67%,.1);border-radius:6px;color:var(--fc-text-color-2);display:flex;font-size:12px;line-height:18px;margin-left:15px;margin-top:8px;padding:8px 13px;position:relative}._fd-gfc-con .el-main{padding:0}._fd-gfc-l,._fd-gfc-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-gfc-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-gfc-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-gfc-r{border-left:0}._fd-gfc-r ._fd-gfc-head{justify-content:flex-end}._fd-gfc-l>.el-main,._fd-gfc-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-gfc-r>.el-main{flex-direction:column}._fd-gfc-l .el-menu{border-right:0;border-top:0;overflow:auto;padding:0 10px 5px;width:100%}._fd-gfc-l .el-menu-item.is-active{background:var(--fc-bg-color-3);color:var(--fc-text-color-2)}._fd-gfc-l .el-menu-item{border:1px solid var(--fc-line-color-3);border-radius:5px;height:auto;line-height:1em;margin-top:5px;padding:0}._fd-gfc-method{color:#702c71;display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;overflow:hidden;white-space:pre-wrap;width:100%}._fd-gfc-method ._fd-label{color:var(--fc-text-color-3);font-size:12px;margin-top:4px}._fd-gfc-title{align-items:center;display:flex;justify-content:space-between;padding:10px 0;width:100%}._fd-gfc-title .el-input{width:200px}._fd-gfc-title .fc-icon{color:var(--fc-text-color-2);font-size:18px;margin-right:6px}._fd-gfc-title .el-input__wrapper{box-shadow:none}._fd-gfc-title .el-menu-item.is-active i{color:var(--fc-text-color-2)}._fd-gfc-con .CodeMirror{height:100%;width:100%}._fd-gfc-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-size-input{align-items:center;display:flex}._fd-size-input .el-input-number--small{width:122px}._fd-size-input .el-button{font-size:12px;margin-left:3px;padding:5px;width:25px}._fd-box-size-input .el-form{grid-column-gap:10px;display:grid;grid-template-columns:repeat(2,1fr);width:100%}._fd-box-size-input .el-radio-group{width:100%}._fd-box-size-input .el-radio-button__inner{padding:4px;width:100%}._fd-box-size-input .el-radio-button{flex:1}._fd-box-size-input ._fd-size-input .el-input-number--small{width:100%}._fd-color-input{width:150px}._fd-color-input .el-input .el-color-picker{margin:0}._fd-color-input .el-input .el-input-group__append{padding:0;width:24px}._fd-color-input .el-input .el-color-picker__trigger{border-left:0;border-radius:0 3px 3px 0}._fd-border-input{display:flex;height:110px;justify-content:center;width:100%}._fd-border-input ._fd-bi-left{align-items:center;display:flex;flex-direction:column;height:115px;justify-content:center;width:115px}._fd-border-input ._fd-bi-right{display:flex;flex-direction:column;justify-content:space-around;padding:5px;width:140px}._fd-border-input ._fd-bi-right ._fd-color-input{width:140px}._fd-bi-opt{align-items:center;display:flex;height:100%;width:100%}._fd-bi-opt ._line{width:100%}._fd-bi-opt .solid{border:1px solid #000}._fd-bi-opt .dashed{border:1px dashed #000}._fd-bi-opt .dotted{border:1px dotted #000}._fd-bi-opt .double{border:1px double #000}._fd-border-input ._fd-bil-row{display:flex;height:38px;justify-content:center}._fd-border-input ._fd-bil-col{align-items:center;cursor:pointer;display:flex;font-size:16px;height:22px;justify-content:center;margin:8px;width:22px}._fd-border-input ._fd-bil-col.active{color:var(--fc-style-color-1);outline:1px dashed var(--fc-style-color-1)}.line-box{box-sizing:border-box;height:20px;padding:1px;width:150px}.line-box-con{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABAAAAAQCAYAAAAf8/9hAAAAAXNSR0IArs4c6QAAAD5JREFUOE9jZGBg+M+AChjR+HjlQYqHgQFoXibNS+gBBjKMpDAZHAaQ5GQGBgYUV4+mA7QAgaYokgJ14NMBAK1TIAlUJpxYAAAAAElFTkSuQmCC);height:100%;opacity:.3;width:100%}._fd-radius-input{display:flex;flex-direction:column;width:100%}._fd-radius-con{display:flex;flex-wrap:wrap}._fd-radius-item{box-sizing:border-box;padding:5px 0;width:50%}._fd-radius-item,._fd-radius-item ._fd-radius-icon{align-items:center;display:flex;justify-content:center}._fd-radius-item ._fd-radius-icon{height:24px;width:24px}._fd-radius-item ._fd-size-input .el-input-number--small{width:70px}._fd-font-input{display:flex;justify-content:center;padding:0 5px}._fd-fi-box{overflow:hidden;width:150px}._fd-font-input .el-form{grid-column-gap:10px;display:grid;grid-template-columns:repeat(2,1fr);width:100%}._fd-font-input .el-form--inline .el-form-item{margin:0;padding:0}._fd-font-input ._fd-size-input .el-input-number--small{width:100%}._fd-display-input{display:flex;flex-direction:column}._fd-display-input .el-radio-button__inner{padding:4px;width:100%}._fd-display-input .el-radio-button{flex:1}._fd-display-input .is-active i{color:#fff}._fd-display-input .el-radio-button__inner{color:var(--fc-text-color-1)}._fd-display-con{display:flex;flex-wrap:wrap}._fd-display-con.rotate-flag .rotate{display:inline-block;transform:rotate(-90deg)}._fd-display-con.column .icon-justify-flexstart:before{display:inline-block;transform:rotate(180deg)}._fd-display-con.column .icon-justify-flexend:before{display:inline-block;transform:rotate(0)}._fd-display-con.row-reverse .icon-justify-flexstart:before{display:inline-block;transform:rotate(180deg)}._fd-display-con.column-reverse .icon-justify-flexstart:before,._fd-display-con.row-reverse .icon-justify-flexend:before{display:inline-block;transform:rotate(0)}._fd-display-con.column-reverse .icon-justify-flexend:before{display:inline-block;transform:rotate(180deg)}._fd-display-raw{display:flex;flex-direction:column;margin-bottom:5px;width:100%}._fd-shadow-content{align-items:center;display:flex;flex-direction:column;justify-content:space-between;padding:0 5px}._fd-sc-form .fc-icon{font-size:12px}._fd-shadow-content .el-form{grid-column-gap:10px;display:grid;grid-template-columns:repeat(2,1fr);width:100%}._fd-shadow-content .el-form-item{display:grid!important;margin:0!important}._fd-shadow-content .el-input__wrapper{flex:1}._fd-shadow-content ._fd-sc-box{border:1px solid #ccc;border-radius:5px;cursor:pointer;height:250px;overflow:hidden;position:relative;width:250px}._fd-shadow-content ._fd-sc-box .spot{border-radius:100%;height:0;position:absolute;width:0}._fd-shadow-content ._fd-sc-box .spot-id{background:#1989fa;border-radius:100%;height:10px;left:-5px;position:absolute;top:-5px;width:10px;z-index:1}._fd-shadow-content ._fd-sc-box.down .spot-id{box-shadow:1px 1px 10px 2px #1989fa}._fd-shadow-content ._fd-sc-box .center-spot{background:#1989fa;border-radius:100%;height:0;left:125px;position:absolute;top:125px;width:0}._fd-shadow-content ._fd-sc-box .x-hr{background:#ccc;height:1px;position:absolute;top:125px;width:100%}._fd-shadow-content ._fd-sc-box .y-hr{background:#ccc;height:100%;left:125px;position:absolute;width:1px}._fd-shadow-content .el-select__placeholder{text-align:center}._fd-shadow-content .el-input-group__append{padding:0;width:55px}._fd-shadow-content ._fd-color-input,._fd-shadow-content .el-input{width:100%}._fd-shadow-content ._fd-sc-right{margin-top:10px}._fd-shadow-content ._fd-sc-radio{width:100%}._fd-shadow-content ._fd-sc-radio .el-radio-button{display:flex;flex:1}._fd-shadow-content ._fd-sc-radio .el-radio-button__inner{width:100%}._fd-shadow-input ._fd-ci-con{width:150px}._fd-shadow-input :focus-visible{outline:0 none}._fd-si-input .el-input-group__append{display:inline-flex;padding:0;width:24px}._fd-si-input .el-input__wrapper{flex:1}._fd-shadow-input ._fd-ci-con .fc-icon{cursor:pointer}._td-table-opt{width:100%}._td-table-opt .icon-delete{cursor:pointer}._td-table-opt .el-table{z-index:1}._td-table-opt-handle{align-items:center;display:flex;justify-content:space-between;padding-right:5px}._fd-box-space-input{color:#000}._fd-box-space-input ._margin,._fd-box-space-input ._padding{background-color:#f2cea5;box-sizing:border-box;height:180px;padding:40px 55px;position:relative;width:100%}._fd-box-space-input ._margin,html.dark ._fd-box-space-input ._padding{background-color:#a9855c}._fd-box-space-input ._margin{background-color:#c6cf92;height:100px;width:100%}._fd-box-space-input ._fd-input{background-color:unset;border:0;display:inline-block;font-size:12px;height:20px;margin:0;max-width:40px;outline:0 none;padding:0;text-align:center;text-decoration:underline;width:30%}._fd-box-space-input ._fd-input:focus,._fd-box-space-input ._fd-input:hover{background-color:var(--fc-bg-color-3);color:var(--fc-text-color-1);opacity:.9}._fd-box-space-input ._fd-left,._fd-box-space-input ._fd-right{left:7px;margin-top:-10px;position:absolute;top:50%}._fd-box-space-input ._fd-bottom,._fd-box-space-input ._fd-top{left:50%;margin-left:-20px;position:absolute;top:5px}._fd-box-space-input ._fd-bottom{bottom:15px;top:unset}._fd-box-space-input ._fd-right{left:unset;right:2px}._fd-box-space-input ._box{align-items:center;background-color:#94b5c0;display:flex;height:100%;justify-content:center;width:100%}._fd-box-space-input ._margin-title,._fd-box-space-input ._padding-title{left:4px;position:absolute;top:2px}._fd-box-space-input ._fd-help{align-items:center;color:var(--fc-text-color-3);display:flex;position:absolute;right:5px;top:5px}._fd-box-space-input ._padding .fc-icon{color:var(--fc-text-color-1);cursor:pointer;font-size:12px}._fd-box-space-input ._padding .fc-icon+.fc-icon{margin-left:2px}._fd-box-space-input .fc-icon.active{color:var(--fc-style-color-1)}._fd-box-space-input ._fd-x{margin:0 5px}._fd-style-config{display:flex;flex-direction:column;width:100%}._fd-opacity-input ._fd-ci-con{align-items:center;display:flex;justify-content:space-between;width:150px}._fd-opacity-input ._fd-ci-con>span{width:32px}._fd-opacity-input .el-slider{flex:1;margin-right:15px}._fd-style-editor{flex:1;width:100%}._fd-style-editor .CodeMirror,._fd-style-editor>div{height:100%}._fd-gcc,._fd-gcc .el-badge{width:100%}._fd-gcc .el-button{font-weight:400;width:100%}._fd-gcc-con .el-main{padding:0}._fd-gcc-l,._fd-gcc-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-gcc-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-gcc-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-gcc-r{border-left:0}._fd-gcc-r ._fd-gcc-head{justify-content:flex-end}._fd-gcc-l>.el-main,._fd-gcc-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-gcc-r>.el-main{flex-direction:column;padding:20px}._fd-gcc-r>.el-main._fd-gcc-style{padding:0}._fd-gcc-r .el-form-item{margin-bottom:10px!important}._fd-gcc-l .el-menu{border-right:0;border-top:0;overflow:auto;padding:0 10px 5px;width:100%}._fd-gcc-l .el-menu-item.is-active{background:var(--fc-bg-color-3);color:var(--fc-style-color-1)}._fd-gcc-l .el-menu-item{border:1px solid var(--fc-line-color-3);border-radius:5px;height:auto;line-height:1em;margin-top:5px;padding:0}._fd-gcc-default.is-active ._fd-label{color:var(--fc-style-color-1);margin-top:0}._fd-gcc-method{color:#923b76;display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;overflow:hidden;white-space:pre-wrap;width:175px}._fd-gcc-method ._fd-label{color:var(--fc-text-color-3);font-size:12px}._fd-gcc-method span+._fd-label{margin-top:4px}._fd-gcc-title{align-items:center;display:flex;justify-content:space-between;padding:10px 0;width:100%}._fd-gcc-title .el-input{width:160px}._fd-gcc-title .fc-icon{color:var(--fc-text-color-2);font-size:18px;margin-right:6px}._fd-gcc-title .el-input__wrapper{box-shadow:none}._fd-gcc-con .el-menu-item.is-active i{color:var(--fc-text-color-2)}._fd-gvc,._fd-gvc .el-badge{width:100%}._fd-gvc .el-button{font-weight:400;width:100%}._fd-gvc-con .el-main{padding:0}._fd-gvc-l,._fd-gvc-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-gvc-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-gvc-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-gvc-r{border-left:0}._fd-gvc-r ._fd-gvc-head{justify-content:flex-end}._fd-gvc-l>.el-main,._fd-gvc-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-gvc-r>.el-main{flex-direction:column;padding:0}._fd-gvc-l .el-menu{border-right:0;border-top:0;overflow:auto;padding:0 10px 5px;width:100%}._fd-gvc-l .el-menu-item.is-active{background:var(--fc-bg-color-3);color:var(--fc-text-color-2)}._fd-gvc-l .el-menu-item{border:1px solid var(--fc-line-color-3);border-radius:5px;height:auto;line-height:1em;margin-top:5px;padding:0}._fd-gvc-method{color:#923b76;display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;overflow:hidden;white-space:pre-wrap;width:175px}._fd-gvc-method ._fd-label{color:var(--fc-text-color-3);font-size:12px;margin-top:4px}._fd-gvc-title{align-items:center;display:flex;justify-content:space-between;padding:10px 0;width:100%}._fd-gvc-title .el-input{width:160px}._fd-gvc-title .fc-icon{color:var(--fc-text-color-2);font-size:18px;margin-right:6px}._fd-gvc-title .el-input__wrapper{box-shadow:none}._fd-gvc-con .el-menu-item.is-active i{color:var(--fc-text-color-2)}._fc-json-preview{color:var(--fc-text-color-1);display:flex;width:100%}._fc-json-preview .CodeMirror{font-size:12px;height:100%}._fd-struct,._fd-struct .el-badge{width:100%}._fd-struct .el-button{font-weight:400;width:100%}._fd-struct-dialog .CodeMirror{height:500px}._fd-struct-dialog .el-dialog__body{padding:0}._fd-props-input{flex:1;text-align:right}._fd-props-input .fc-icon{cursor:pointer}._fd-lc-body,._fd-lc-header{padding:0 12px}._fd-lc-body{overflow:auto}._fd-lc-header{display:flex;justify-content:flex-end;margin-bottom:12px}._fd-language-config .el-table__cell{height:34px}._fd-lc-handle{align-items:center;cursor:pointer;display:flex;justify-content:space-between}._fd-slots-config .el-input{margin-left:5px;min-width:170px;width:170px}._fd-slots-config .el-select{width:60px}._fd-slots-config .el-select input,._fd-slots-config .fc-icon{cursor:pointer}._fd-slots-config .el-input-group__append{padding:0 5px}._fd-slots-icons{grid-gap:10px;display:grid;grid-template-columns:repeat(13,1fr);width:100%}._fd-slots-icon{color:var(--fc-text-color-1);cursor:pointer;text-align:center}._fd-slots-config-pop{max-height:320px;overflow:auto}._fd-quick-layout-content{grid-column-gap:10px;display:grid;grid-template-columns:repeat(4,1fr);width:100%}._fd-quick-layout-content>div{cursor:pointer;display:flex;flex-direction:column;font-size:12px;text-align:center}._fd-quick-layout-content>div:hover{color:var(--fc-style-color-1)}._fd-quick-layout-content i{font-size:24px}._fd-print .el-button{font-weight:400;width:100%}._fd-print-con .el-main{padding:0}._fd-print-l,._fd-print-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-print-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-print-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-print-r{border-left:0}._fd-print-r ._fd-print-head{justify-content:flex-end}._fd-print-l>.el-main,._fd-print-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:column;min-width:0;padding:10px;width:100%}._fd-print-l .el-form .el-radio-button__inner,._fd-print-l .el-form .el-radio-group{width:100%}._fd-print-l .el-form .el-radio-button{flex:1}._fd-print-r>.el-main{flex-direction:column;padding:20px;position:relative}._fd-print-form{box-sizing:border-box;padding:2px}._fd-print-form .el-input__wrapper,._fd-print-form .el-select__wrapper,._fd-print-form .el-textarea__inner{border:1px solid var(--el-input-border-color,var(--el-border-color));box-shadow:none!important}._fd-print-form .el-select__placeholder{position:unset!important;top:unset!important;transform:unset!important}._fd-print-form .is-disabled .el-input__wrapper{background-color:unset!important}._fd-print-form .is-disabled .el-input__inner{color:unset!important}._fd-print-form-word .el-input__wrapper,._fd-print-form-word .el-select__wrapper,._fd-print-form-word .el-textarea__inner{border:none!important;border-color:inherit!important;border-radius:0!important}._fd-print-form-word .el-input-number__decrease,._fd-print-form-word .el-input-number__increase{display:none!important}._fd-print-form-word ._fc-read-view{border-bottom:1px solid var(--el-input-border-color,var(--el-border-color))!important;border-color:inherit!important;display:block;height:1.5em;line-height:1.5em;padding:0 4px;width:100%}._fd-print-page-line{border-bottom:1px dashed var(--fc-line-color-3);box-sizing:border-box;color:var(--fc-text-color-3);font-size:12px;height:1px;left:0;line-height:2em;padding-left:4px;position:absolute;right:0;z-index:1}._fd-ai-chat{box-sizing:border-box;display:flex;flex-direction:column;font-size:12px;height:100%;padding:12px}._fd-ai-chat-header{border:1px solid var(--fc-line-color-3);border-radius:6px}._fd-ai-chat-prompt{display:flex;justify-content:space-between;padding:8px 12px 10px}._fd-ai-chat-prompt .fc-icon{font-size:12px;margin-right:2px}._fd-ai-chat-refresh{color:var(--fc-style-color-1);cursor:pointer}._fd-ai-chat-question{align-items:center;background:var(--fc-bg-color-2);border-radius:6px;color:var(--fc-text-color-2);cursor:pointer;display:flex;justify-content:space-between;margin:0 12px 12px;padding:7px 10px}._fd-ai-chat-question+._fd-ai-chat-question{margin-top:6px}._fd-ai-chat-question .fc-icon{margin-left:12px}._fd-ai-chat-question .icon-down:before{display:inline-block;transform:rotate(-90deg)}._fd-ai-chat-history{display:flex;flex:1;flex-direction:column;margin-top:12px;overflow:auto}._fd-ai-chat-history-chat{align-items:flex-end;display:flex;flex-direction:column;margin-bottom:10px}._fd-ai-chat-history-chat>div{background:var(--fc-style-bg-color-1);border-radius:6px 0 6px 6px;color:var(--fc-style-color-1);max-width:70%;padding:10px;white-space:pre-wrap}._fd-ai-chat-history-status{align-items:flex-start;display:flex;flex-direction:column;margin-bottom:10px}._fd-ai-chat-history-status>div{background:var(--fc-bg-color-2);border-radius:0 6px 6px;color:var(--fc-text-color-2);max-width:70%;overflow:hidden;padding:10px;position:relative}._fd-ai-chat-history-status>div>div{align-items:center;display:flex;position:relative;z-index:1}._fd-ai-chat-history-status.loading>div:after{animation:b 3s linear infinite;background:linear-gradient(0deg,var(--fc-style-color-1) 0,var(--fc-style-color-4) 100%);bottom:-2px;content:"";filter:blur(5px);left:-2px;padding:1px;position:absolute;right:-2px;top:-2px}._fd-ai-chat-history-status.loading>div{border-radius:0 6px 6px;padding:1px}._fd-ai-chat-history-status.loading>div>div{background-color:var(--fc-bg-color-1);border-radius:0 6px 6px;padding:7px 10px}._fd-ai-chat-history-status.success>div{background:var(--fc-style-bg-color-2);color:var(--fc-style-color-2)}._fd-ai-chat-history-status .fc-icon{background:var(--fc-style-color-2);border-radius:15px;color:#fff;font-size:14px;height:15px;margin-right:5px;text-align:center;width:15px}._fd-ai-chat-history-status.fail>div{background:var(--fc-style-bg-color-3);color:var(--fc-style-color-3)}._fd-ai-chat-history-status.fail .fc-icon{background:var(--fc-style-color-3)}._fd-ai-chat-input{border-radius:6px;margin-top:12px;position:relative;width:100%}._fd-ai-chat-clear{margin-bottom:6px;text-align:right}._fd-ai-chat-clear .el-button{margin-right:2px;padding:0}._fd-ai-chat-clear .fc-icon{font-size:13px}._fd-ai-chat-input .el-textarea{box-sizing:border-box;height:120px;padding:1px;position:relative}._fd-ai-chat-input .el-textarea:before{background:linear-gradient(135deg,var(--fc-style-color-1),var(--fc-style-color-4));border-radius:6px;bottom:0;content:"";left:0;position:absolute;right:0;top:0}._fd-ai-chat-input .el-textarea__inner{background:var(--fc-bg-color-1);border-radius:6px;box-shadow:none;height:100%;resize:none}._fd-ai-chat-input>.fc-icon{align-items:center;background:var(--fc-style-color-1);border-radius:15px;bottom:12px;color:#fff;cursor:pointer;display:flex;font-size:14px;height:20px;justify-content:center;position:absolute;right:12px;text-align:center;width:20px}._fd-ai-chat-input .icon-suspend{background:linear-gradient(90deg,var(--fc-style-color-1) 0,var(--fc-style-color-4) 100%)}._fd-ai-chat-input .disabled{background:var(--fc-text-color-3)}@keyframes b{0%{transform:rotate(0)}to{transform:rotate(1turn)}}.m-title{align-items:center;color:#1f2329;flex-direction:row;font-weight:500;height:28px;justify-content:space-between;padding-top:8px;width:100%}.m-title,.tree-row-item{display:flex;font-size:12px;font-style:normal;line-height:20px}.tree-row-item{font-weight:400;overflow-x:hidden;padding-right:11px;text-overflow:ellipsis;white-space:nowrap;word-break:break-all}._fd-drag-tool{word-wrap:break-word;box-sizing:border-box;display:block;min-height:20px;min-width:0;outline:1px dashed var(--fc-tool-border-color);overflow:hidden;padding:2px;position:relative;word-break:break-all;z-index:0}._fd-drag-tool ._fd-drag-tool{margin:2px;max-height:calc(100% - 7px);max-width:calc(100% - 4px)}._fd-drag-tool.is-inline{display:inline-block}._fd-drag-tool.is-inside{height:inherit;width:inherit}._fd-drag-tool:hover{outline-color:var(--fc-style-color-1);outline-style:solid;z-index:1}._fd-drag-tool:has(._fd-drag-tool:hover){outline-style:dashed}._fd-drag-tool:not(.active):hover>div>._fd-drag-btn{display:flex!important;opacity:.7}._fd-drag-tool:has(._fd-drag-tool:not(.active):hover,._fd-drag-tool.active:hover)>div>._fd-drag-btn{display:none!important}._fd-drag-tool:has(._fd-drag-tool){padding:2px}._fd-drag-tool+._fd-drag-tool{margin-top:5px}._fd-drag-tool.active{min-height:36px;min-width:80px;outline:2px solid var(--fc-style-color-1)!important;z-index:2}._fd-drag-tool.active>div>._fd-drag-btn{display:flex}._fd-drag-tool._fd-drop-hover ._fd-drag-box{padding-bottom:15px!important;padding-top:15px!important}._fd-drag-tool._fd-drop-hover:hover{outline:1px dashed var(--fc-tool-border-color)}._fd-drag-tool ._fd-drag-btn{display:none}._fd-drag-r{padding:0 2px 2px 0;right:0;top:calc(100% - 20px)}._fd-drag-l,._fd-drag-r{position:absolute;z-index:4}._fd-drag-l{left:0;top:0}._fd-drag-btn{align-items:center;background-color:var(--fc-style-color-1);color:#fff;cursor:pointer;float:left;height:18px;justify-content:center;line-height:20px;padding-bottom:1px;width:18px}._fd-drag-btn .el-dropdown{color:#fff}._fd-drag-btn+._fd-drag-btn{margin-left:2px}._fd-drag-danger{background-color:var(--fc-style-color-3)}._fd-drag-btn i{font-size:14px}._fd-drag-hidden,._fd-drag-mask{bottom:0;left:0;position:absolute;right:0;top:0;z-index:3}._fd-drag-hidden{align-items:center;background:rgba(51,51,51,.7);color:#fff;display:flex;font-size:14px;justify-content:center}._fd-drag-tool.active ._fd-drag-hidden,._fd-drag-tool:has(._fd-drag-tool.active) ._fd-drag-hidden,._fd-drag-tool:hover ._fd-drag-hidden{display:none}._fd-drag-hidden .fc-icon{margin-right:5px}._fd-html-editor{width:100%}._fd-html-editor>.el-button{font-weight:400;width:100%}._fd-html-editor-con .CodeMirror{height:450px}._fd-html-editor-con .CodeMirror-line{font-size:13px!important;line-height:16px!important}._fd-html-editor-con .CodeMirror-lint-tooltip{z-index:1!important}._fd-html-editor-con .el-dialog__body{padding:0 20px}._fd-field-input{position:relative;width:100%}._fd-field-input>.fc-icon{color:#a8abb2;cursor:pointer;height:24px;position:absolute;right:28px;text-align:center;top:1px;width:24px;z-index:1}._fd-field-input .el-input-group__append{color:var(--fc-text-color-3);cursor:pointer;margin:0;padding:0;width:25px}._fd-field-popper .el-tree-node__content{color:#333;padding:2px 0}._fd-field-popper .el-select-dropdown__list>.el-select-dropdown__item{border-bottom:1px solid var(--fc-line-color-3);box-sizing:border-box;height:26px;padding-left:15px}._fd-list-input{width:100%}._fd-list-input .el-input-group__append{padding:0 10px}._fd-list-input .fc-icon{cursor:pointer}._fd-fetch-config,._fd-fetch-config .el-badge{width:100%}._fd-fetch-config .el-button{font-weight:400;width:100%}._fd-fetch-dialog .el-tabs__header{margin-bottom:0}._fd-fetch-dialog .form-create{margin-top:15px}._fd-fetch-dialog ._fc-tabs{display:flex}._fd-fetch-dialog ._fc-tabs .el-tabs__content{display:flex;flex:1;overflow:auto}._fd-fetch-info{background:hsla(0,0%,67%,.1);border-radius:6px;color:var(--fc-text-color-2);display:flex;font-size:12px;line-height:18px;margin-left:15px;margin-top:8px;padding:8px 13px;position:relative}._fd-fetch-con .el-main{padding:0}._fd-fetch-con .CodeMirror{height:100%;width:100%}._fd-fetch-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-table-column-config,._fd-table-column-config .el-badge{width:100%}._fd-table-column-config .el-button{font-weight:400;width:100%}._fd-tcc-dialog .flex{display:flex;width:100%}._fd-tcc-dialog .el-dialog__body{height:500px;overflow:auto}._fd-tcc-dialog ._fd-fn{height:100%}._fd-tcc-table .fc-icon{cursor:pointer}._fd-tcc-table .fc-icon+.fc-icon{margin-left:4px}._fd-tcc-table .cell{align-items:center;display:flex;flex-direction:row}._fd-tcc-table .el-table__indent{padding-left:8px!important}._fd-table-button-config,._fd-table-button-config .el-badge{width:100%}._fd-table-button-config .el-button{font-weight:400;width:100%}._fd-tcb-dialog .el-dialog__body{height:500px;overflow:auto}._fd-tcb-btn{cursor:pointer;display:flex}._fd-fn-list,._fd-fn-list .el-badge{width:100%}._fd-fn-list .el-button{font-weight:400;width:100%}._fd-fn-list-con .el-main{padding:0}._fd-fn-list-l,._fd-fn-list-r{border:1px solid var(--fc-line-color-3);display:flex;flex:1;flex-direction:column;height:100%}._fd-fn-list-head{align-items:center;background:var(--fc-bg-color-3);border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:5px 15px}._fd-fn-list-head .el-button.is-link{color:var(--fc-style-color-1)}._fd-fn-list-r{border-left:0}._fd-fn-list-r ._fd-fn-list-head{justify-content:flex-end}._fd-fn-list-l>.el-main,._fd-fn-list-r>.el-main{box-sizing:border-box;display:flex;flex:1;flex-basis:auto;flex-direction:row;min-width:0;width:100%}._fd-fn-list-r>.el-main{flex-direction:column}._fd-fn-list-l .el-menu{border-right:0;border-top:0;overflow:auto;padding:0 10px 5px;width:100%}._fd-fn-list-l .el-menu-item.is-active{background:var(--fc-bg-color-3);color:var(--fc-text-color-2)}._fd-fn-list-l .el-menu-item{border:1px solid var(--fc-line-color-3);border-radius:5px;height:auto;line-height:1em;margin-top:5px;padding:0}._fd-fn-list-method{display:flex;flex-direction:column;font-family:monospace;font-size:14px;justify-content:center;line-height:1em;overflow:hidden;padding:10px 20px 10px 0;position:relative;white-space:pre-wrap;width:100%}._fd-fn-list-method ._fd-label{color:var(--fc-text-color-3);font-size:12px;margin-top:4px}._fd-fn-list-method ._fd-dot{background:#00c050;border-radius:15px;display:block;height:6px;margin-top:-3px;position:absolute;right:16px;top:50%;width:6px}._fd-fn-list-method-info>span:first-child,._fd-fn-list-method>span:first-child{color:#9d238c}._fd-fn-list-method-info>span:first-child>span,._fd-fn-list-method>span:first-child>span{color:var(--fc-text-color-1);margin-left:10px}._fd-fn-list-con .CodeMirror{height:100%;width:100%}._fd-fn-list-con .CodeMirror-wrap pre.CodeMirror-line{padding-left:20px}._fd-fn-input,._fd-fn-input .el-badge{width:100%}._fd-fn-input .el-button{font-weight:400;width:100%}._fd-fn-input-dialog .CodeMirror-lint-tooltip{z-index:1!important}._fd-fn-input-dialog .el-dialog__body{height:500px;padding:0}._fd-gfs{align-items:center;display:flex;width:100%}._fd-gfs .el-select{width:190px}._fd-gfs-handle{display:inline-flex;height:14px;line-height:14px}._fd-gfs-handle .fc-icon{color:var(--fc-style-color-1);cursor:pointer;margin-left:4px}._fd-gfs-handle .icon-refresh.disabled{color:#a9abb2;cursor:not-allowed}._fd-gfs-handle ._fc-manage-text{border-left:1px solid var(--fc-line-color-3);padding-left:4px}._fd-gcs{align-items:center;display:flex;width:100%}._fd-gcs .el-select{width:190px}._fd-gcs-handle{display:inline-flex;height:14px;line-height:14px}._fd-gcs-handle ._fc-manage-text{border-left:1px solid var(--fc-line-color-3);padding-left:4px}._fd-fetch-table{width:100%}._fd-fetch-table .el-button>span{font-size:12px;font-weight:400}._fd-fetch-table-con{border:1px solid var(--fc-line-color-3);border-bottom:0;display:flex;flex:1;flex-direction:column;height:100%}._fd-fetch-table-con .el-header{align-items:center;background:var(--fc-bg-color-3);color:var(--fc-text-color-1);display:flex;height:30px;padding-left:12px}._fd-fetch-table-row{align-items:center;border-bottom:1px solid var(--fc-line-color-3);display:flex;min-height:34px;padding:0 10px 4px}._fd-fetch-table-row>.fc-icon{align-items:center;color:var(--fc-text-color-2);cursor:pointer;display:flex;font-size:18px;height:24px;justify-content:center;margin-left:12px;margin-top:4px;width:24px}._fd-fetch-table-row .el-input{display:flex;flex:1;font-size:13px;margin-top:4px}._fd-fetch-table-key{margin-right:15px;width:calc(40% - 20px)}._fd-table-view{overflow:auto}._fd-table-view-cell{background:var(--fc-bg-color-1);border:1px inset rgba(0,0,0,.1);height:100%;min-height:50px}._fd-table-view-cell>._fd-drag-tool{border:0;height:100%;margin:0;max-height:100%;max-width:100%;min-width:unset;width:100%}._fd-table-view-btn{flex-direction:column;padding:0}._fd-table-view-btn .fc-icon{color:#fff;font-size:16px;width:18px}._fd-table-view-icon{color:#fff;display:flex;height:100%;justify-content:center;margin-top:1px;width:100%}._fd-table-view>table{border-bottom:1px solid #ebeef5;border-right:1px solid #ebeef5;border-color:#ebeef5 currentcolor currentcolor #ebeef5;border-style:solid none none solid;border-width:1px 0 0 1px;height:100%;overflow:hidden;table-layout:fixed;width:100%}._fd-table-view tr{min-height:50px}._fd-table-view td{border-bottom:0;border-right:0;border-color:currentcolor #ebeef5 #ebeef5 currentcolor;border-style:none solid solid none;border-width:0 1px 1px 0;box-sizing:border-box;min-height:50px;min-width:80px;overflow-wrap:break-word;padding:0;position:relative;white-space:nowrap}._fd-tableCell-drag{height:100%}._fd-table-view.is-mini td{min-height:12px;padding:0}._fd-table-view.is-mini .el-form-item{margin:0;padding:0}._fd-value{color:var(--fc-text-color-3);white-space:nowrap}._fd-json-container{--fc-json-mask:" ";display:flex;flex:1;flex-direction:column;flex-wrap:wrap;justify-content:center;min-height:20px;position:relative}._fd-json-container ._fd-dialog,._fd-json-container ._fd-drawer,._fd-json-container ._fd-popup{display:none}._fd-language-list{max-height:320px;overflow:auto;padding-top:70px}._fd-language-input .el-input-group__append{color:var(--fc-text-color-3);cursor:pointer;margin:0;padding:0;width:25px}._fd-language-input.is-variable input{color:var(--fc-style-color-1)}._fd-language-header,._fd-language-item{border-bottom:1px solid var(--fc-line-color-3);display:flex;padding:0 12px}._fd-language-header{background-color:var(--fc-bg-color-1);color:var(--fc-text-color-1);flex-direction:column;font-weight:500;left:0;overflow:auto;padding-top:10px;position:absolute;right:0;top:0}._fd-language-item>div,._fd-language-name>div{flex:1;font-size:12px;min-width:70px;padding:5px}._fd-language-title{margin:6px 0}._fd-language-title .fc-icon{color:var(--fc-style-color-1);cursor:pointer;font-size:14px}._fd-language-name{display:flex}._fd-language-name>div{color:var(--fc-text-color-3);overflow:hidden;text-overflow:ellipsis;white-space:nowrap}._fd-language-item{cursor:pointer}._fd-language-item:hover{background-color:var(--fc-style-bg-color-1);color:var(--fc-style-color-1)}._fd-language-popover{padding:0!important}._fd-validate{display:flex;flex-direction:column;width:100%}._fd-validate-btn{font-weight:400;width:100%}._fd-validate-pop .el-dropdown-menu__item{width:248px}._fd-validate-item{border-bottom:1px dashed var(--fc-line-color-3);margin-bottom:10px}._fd-validate-item .el-col-12:first-child{padding-right:5px}._fd-validate-item .el-col-12+.el-col-12{padding-left:5px}._fd-validate-item .el-input-number{width:100%}._fd-validate-title{display:flex;flex-direction:row;justify-content:space-between;margin-bottom:10px}._fd-validate-title>div{align-items:center;display:flex}._fd-validate-title>div>span{background:var(--fc-bg-color-3);border-radius:15px;font-size:12px;height:16px;line-height:16px;margin-right:5px;text-align:center;width:16px}._fd-validate-title i{cursor:pointer}._fd-validate-title i:hover{color:var(--fc-style-color-3)}._fd-validate .append-msg{cursor:pointer}._fd-validate .el-input-group__append{padding:0 10px}._fd-required{align-items:center;display:flex;width:100%}._fd-required .el-input{margin-left:15px}._fd-required .el-switch{height:28px}._fd-tree-opt ._fd-tree-opt-btn{background-color:var(--fc-style-color-1);color:#fff;cursor:pointer;float:left;height:19px;justify-content:center;line-height:20px;padding-bottom:1px;text-align:center;width:18px}._fd-tree-opt-node{align-items:center;display:flex}._fd-tree-opt-first{margin-right:5px;width:60px}._fd-tree-opt-last{width:165px}._fd-tree-opt-last._label{width:175px}._fd-tree-opt-last._label .el-input-group__append{width:65px}._fd-tree-opt ._fd-tree-opt-danger{background-color:var(--fc-style-color-3);border-radius:0 2px 2px 0}._fd-tree-opt .el-tree-node__content{height:28px;margin-bottom:3px}._fd-tree-opt .el-input__inner{border-right:0}._fd-tree-opt .el-input-group__append{background:var(--fc-bg-color-1);padding-left:1px;padding-right:2px;width:90px}._fc-step-form{width:100%}._fc-step-form>.el-steps{margin-bottom:20px}._fc-step-form .el-step .el-step__head{line-height:1.4}._fd-step-form{width:100%}._fd-step-form .el-step{cursor:pointer}._fd-step-form>.el-steps{margin-bottom:20px}._fd-step-form .el-step .el-step__head{line-height:1.4}._fd-table-form{background:var(--fc-bg-color-1);border:1px solid var(--fc-line-color-3);width:100%}._fc-child-empty,._fd-table-form{min-height:130px}._fd-tf-wrap{display:flex;overflow:auto}._fd-tf-wrap>._fd-drag-tool{display:flex;flex-shrink:0;height:auto;margin:2px;overflow:auto}._fd-ntable-form{background:var(--fc-bg-color-1);border:1px solid var(--fc-line-color-3);min-height:130px;width:100%}._fd-ntable-sub .el-form-item__label,._fd-ntable-sub .van-field__label{display:none}._fd-ntable-form ._fc-child-empty{min-height:130px}._fd-ntf-wrap{display:flex;overflow:auto}._fd-ntf-wrap>._fd-drag-tool{display:flex;flex-shrink:0;height:auto;margin:2px}._fd-ntable-sub ._title{background-color:var(--fc-bg-color-3);border-radius:8px 8px 0 0;color:#65676b;display:inline-block;font-size:12px;height:20px;line-height:1em;margin-left:2px;padding:6px 8px 0;text-align:center}._fd-ntable-sub>._fd-drag-tool{margin-top:0}._fd-itable-form{background:var(--fc-bg-color-1);border:1px solid var(--fc-line-color-3);min-height:130px;width:100%}._fd-itable-form ._fc-child-empty{min-height:130px}._fd-itf-wrap{display:flex;overflow:auto}._fd-itf-wrap>._fd-drag-tool{display:flex;flex-shrink:0;height:auto;margin:2px}._fd-tf-col ._fd-tf-con .el-form-item{margin-bottom:1px!important}._fd-tf-col{display:flex;flex-direction:column;flex-shrink:0;flex-wrap:wrap;width:180px}._fd-tf-con .el-form-item__label,._fd-tf-con .van-field__label{display:none!important}._fd-tf-con{display:flex;flex:1;width:100%}._fd-tf-con .el-form-item__content{display:flex;margin-left:0!important;width:100%!important}._fd-tf-title{align-items:center;border-bottom:1px solid #ebeef5;display:flex;height:40px;margin-bottom:0;padding-left:5px}._fd-tf-required{color:#f56c6c;margin-right:4px}._fd-tf-con ._fc-l-item{display:flex;flex-shrink:0;margin-top:4px;width:100%}._fd-tf-con ._fc-l-item>*{display:none!important}._fd-tf-con .el-cascader,._fd-tf-con .el-date-editor,._fd-tf-con .el-input-number,._fd-tf-con .el-select,._fd-tf-con .el-slider{width:100%}._fd-tf-col:has(._fd-tf-col){width:auto!important}._fd-tf-con>._fd-tableFormColumn2-drag:has(._fd-tf-col){display:flex!important;flex-direction:row!important;flex-wrap:nowrap!important}._fd-tf-con>._fd-tableFormColumn2-drag:has(._fd-tf-col)>._fd-drag-item{flex:unset}._fd-step-form-item>._fd-drag-tool{min-height:200px}._fd-dialog.el-dialog{margin:10px;width:calc(100% - 20px)}._fd-dialog .el-dialog__headerbtn{align-items:center;color:var(--el-color-info);display:flex;justify-content:center}._fd-dialog .el-dialog__headerbtn:hover .fc-icon{color:var(--el-color-primary)}._fd-dialog .el-dialog__body>._fd-drag-box{align-content:flex-start;align-items:flex-start;box-sizing:border-box;display:flex;flex-wrap:wrap;height:calc(var(--fc-dialog-height) - 125px);justify-content:flex-start;outline:1px dashed var(--fc-tool-border-color);overflow:auto;position:relative}._fd-drawer.el-drawer{box-shadow:unset;width:100%}._fd-drawer .el-drawer__header{border-bottom:1px solid var(--fc-line-color-3);color:#333;font-size:15px;font-weight:600;margin-bottom:0;padding:14px 24px 14px 20px}._fd-drawer .el-drawer__body{padding:12px}._fd-drawer .el-drawer__close-btn{color:#909399;font-size:14px}._fd-drawer .el-drawer__footer{box-shadow:0 -2px 4px #0000000d;padding:10px 0;text-align:center}._fd-drawer .el-drawer__body>._fd-drag-box{align-content:flex-start;align-items:flex-start;box-sizing:border-box;display:flex;flex-wrap:wrap;height:calc(var(--fc-drawer-height) - 105px);justify-content:flex-start;outline:1px dashed var(--fc-tool-border-color);overflow:auto;position:relative}._fc-drawer .el-drawer__header{border-bottom:1px solid var(--fc-line-color-3);color:#333;font-size:15px;font-weight:600;margin-bottom:0;padding:14px 24px 14px 20px}._fc-drawer .el-drawer__body{padding:10px 24px 50px}._fc-drawer .el-drawer__close-btn{color:#909399;font-size:14px}._fc-drawer .el-drawer__footer{background:var(--fc-bg-color-1);bottom:0;box-shadow:0 -2px 4px #0000000d;left:0;padding:10px 0;position:absolute;right:0;text-align:center;width:100%;z-index:1}._fd-cell{display:inline-block}._fd-cell.is-new{width:100%!important}._fd-cell>div{box-sizing:border-box}._fd-cell>div>._fd-drag-tool.is-inline,._fd-cell>div>._fd-drag-tool>._fd-drag-box{align-content:var(--fc-cell-alignContent)!important;align-items:var(--fc-cell-alignItems)!important;display:var(--fc-cell-display)!important;flex-direction:var(--fc-cell-flexDirection)!important;flex-wrap:var(--fc-cell-flexWrap)!important;justify-content:var(--fc-cell-justifyContent)!important}._fd-cell>div>._fd-drag-item:has(>._fd-drag-tool>.el-col-24,>.el-col-24),._fd-cell>div>._fd-drag-tool>._fd-drag-box>._fd-drag-item:has(>._fd-drag-tool>.el-col-24,>.el-col-24){flex:none}._fd-cell .el-cascader,._fd-cell .el-date-editor,._fd-cell .el-input-number,._fd-cell .el-select,._fd-cell .el-slider,._fd-row{width:100%}._fd-hide-config{align-items:center;color:var(--fc-text-color-2);cursor:pointer;display:flex}._fd-hide-config .fc-icon{margin-right:3px}._fd-hide-config.active{color:var(--fc-style-color-1)}._fd-hide-config.disabled{color:var(--fc-text-color-3);cursor:not-allowed}._fd-span-input{width:100%}._fd-span-input .el-radio-button__inner{line-height:16px;padding:4px;width:100%}._fd-span-input .el-radio-button{flex:1}._fc-city .el-select{width:150px}.form-create-m ._fc-city,.form-create-m ._fc-city .el-select{width:100%}.form-create ._fc-city .el-select+.el-select{margin-left:12px}._fc-signature{width:100%}._fc-signature-btn,._fc-signature-preview{background:#fff;border:1px dashed #d4d7e0;border-radius:4px;box-sizing:border-box;color:#c9ccd8;font-size:14px;height:88px;line-height:88px;min-width:160px;position:relative;text-align:center;width:100%}._fc-signature-btn{cursor:pointer}._fc-signature-preview>img{display:inline-block;height:88px}._fc-signature-preview .icon-delete2{cursor:pointer;display:inline-block;font-size:14px;line-height:14px;position:absolute;right:9px;top:9px}._fc-signature-btn i{font-size:14px}._fc-signature-dialog .el-dialog__body{text-align:center}._fc-signature-pad{background-image:linear-gradient(#fff 14px,transparent 0),linear-gradient(90deg,#fff 14px,#d4d7e0 0);background-size:15px 15px;border:1px dashed #d4d7e0;border-radius:4px}._fd-data-select{width:100%}._fd-data-select>.el-dialog{margin:10px;width:calc(100% - 20px)}:root{--fc-drag-empty:"\\62d6\\62fd\\5de6\\4fa7\\5217\\8868\\4e2d\\7684\\7ec4\\4ef6\\5230\\6b64\\5904";--fc-child-empty:"\\70b9\\51fb\\53f3\\4e0b\\89d2 \\e789 \\6309\\94ae\\6dfb\\52a0\\4e00\\5217";--fc-text-color-1:#262626;--fc-text-color-2:#666;--fc-text-color-3:#aaa;--fc-bg-color-1:#fff;--fc-bg-color-2:#f5f5f5;--fc-bg-color-3:#ececec;--fc-line-color-1:#ddd;--fc-line-color-2:#d9d9d9;--fc-line-color-3:#ececec;--fc-style-color-1:#2e73ff;--fc-style-bg-color-1:rgba(46,115,255,.05);--fc-style-color-2:#00c050;--fc-style-bg-color-2:rgba(0,192,80,.05);--fc-style-color-3:#ff2e2e;--fc-style-bg-color-3:rgba(255,46,46,.05);--fc-style-color-4:#4efdb7;--fc-style-bg-color-4:rgba(78,253,183,.05);--fc-grid-line-color:rgba(0,0,0,.05)}html.dark{--fc-text-color-1:#e5eaf3;--fc-text-color-2:#cfd3dc;--fc-text-color-3:#6c6e72;--fc-bg-color-1:#0a0a0a;--fc-bg-color-2:#191919;--fc-bg-color-3:#2b2b2c;--fc-line-color-1:#393a3c;--fc-line-color-2:#636466;--fc-line-color-3:#2b2b2c;--fc-grid-line-color:hsla(0,0%,100%,.15)}._fc-designer,._fd-config-dialog{--el-color-primary:#2e73ff;--el-color-primary-light-3:#69f;--el-color-primary-light-5:#9bf;--el-color-primary-light-7:#ccdfff;--el-color-primary-light-8:#e0ebff;--el-color-primary-light-9:#ccdfff;--el-color-primary-dark-2:#265fcc;--el-color-success:#00c050;--el-color-success-light-3:#4ddb82;--el-color-success-light-5:#80e6a3;--el-color-success-light-7:#b3f1c5;--el-color-success-light-8:#ccf6d5;--el-color-success-light-9:#e6fae6;--el-color-success-dark-2:#00a046;--el-color-danger:#ff2e2e;--el-color-danger-light-3:#f66;--el-color-danger-light-5:#f99;--el-color-danger-light-7:#fcc;--el-color-danger-light-8:#ffd9d9;--el-color-danger-light-9:#ffe6e6;--el-color-danger-dark-2:#cc2626;--el-menu-hover-bg-color:var(--el-color-primary-light-9)}._fc-designer .el-button--primary,._fd-config-dialog .el-button--primary{--el-button-bg-color:var(--el-color-primary);--el-button-text-color:var(--el-color-white);--el-button-border-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-color-primary-light-3);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-border-color:var(--el-color-primary-light-3);--el-button-active-bg-color:var(--el-color-primary-dark-2);--el-button-active-border-color:var(--el-color-primary-dark-2)}._fc-designer .el-button--primary.is-plain,._fd-config-dialog .el-button--primary.is-plain{--el-button-bg-color:var(--el-color-primary-light-8);--el-button-text-color:var(--el-color-primary);--el-button-border-color:var(--el-color-primary-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-primary);--el-button-hover-border-color:var(--el-color-primary);--el-button-active-bg-color:var(--el-color-primary-dark-2);--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:var(--el-color-primary-dark-2)}._fc-designer .el-button--primary.is-link,._fd-config-dialog .el-button--primary.is-link{--el-button-text-color:var(--el-color-primary)}._fc-designer .el-button--success,._fd-config-dialog .el-button--success{--el-button-bg-color:var(--el-color-success);--el-button-text-color:var(--el-color-white);--el-button-border-color:var(--el-color-success);--el-button-hover-bg-color:var(--el-color-success-light-3);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-border-color:var(--el-color-success-light-3);--el-button-active-bg-color:var(--el-color-success-dark-2);--el-button-active-border-color:var(--el-color-success-dark-2)}._fc-designer .el-button--success.is-plain,._fd-config-dialog .el-button--success.is-plain{--el-button-bg-color:var(--el-color-success-light-8);--el-button-text-color:var(--el-color-success);--el-button-border-color:var(--el-color-success-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-success);--el-button-hover-border-color:var(--el-color-success);--el-button-active-bg-color:var(--el-color-success-dark-2);--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:var(--el-color-primary-dark-2)}._fc-designer .el-button--success.is-link,._fd-config-dialog .el-button--success.is-link{--el-button-text-color:var(--el-color-success)}._fc-designer .el-button--danger,._fd-config-dialog .el-button--danger{--el-button-bg-color:var(--el-color-danger);--el-button-text-color:var(--el-color-white);--el-button-border-color:var(--el-color-danger);--el-button-hover-bg-color:var(--el-color-danger-light-3);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-border-color:var(--el-color-danger-light-3);--el-button-active-bg-color:var(--el-color-danger-dark-2);--el-button-active-border-color:var(--el-color-danger-dark-2)}._fc-designer .el-button--danger.is-plain,._fd-config-dialog .el-button--danger.is-plain{--el-button-bg-color:var(--el-color-danger-light-8);--el-button-text-color:var(--el-color-danger);--el-button-border-color:var(--el-color-danger-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-danger);--el-button-hover-border-color:var(--el-color-danger);--el-button-active-bg-color:var(--el-color-danger-dark-2);--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:var(--el-color-primary-dark-2)}._fc-designer .el-button--danger.is-link,._fd-config-dialog .el-button--danger.is-link{--el-button-text-color:var(--el-color-danger)}._fd-plain-button{border-color:var(--fc-style-color-1);color:var(--fc-style-color-1)}._fc-designer .CodeMirror-gutters,._fd-config-dialog .CodeMirror-gutters{background-color:var(--fc-bg-color-3);border-right-color:var(--fc-line-color-2)}._fc-designer .CodeMirror-scroll,._fd-config-dialog .CodeMirror-scroll{background-color:var(--fc-bg-color-2);caret-color:var(--fc-text-color-1);color:var(--fc-text-color-1)}._fd-config-dialog .CodeMirror-scroll{background-color:var(--el-bg-color)}._fc-designer{--fc-tool-border-color:var(--fc-line-color-1);background-color:var(--fc-bg-color-1);cursor:default;height:100%;min-height:500px;overflow:hidden;position:relative}._fc-designer>.el-main{bottom:0;left:0;padding:0;position:absolute;right:0;top:0}._fc-l-menu{border-right:1px solid var(--fc-line-color-3);border-top:1px solid var(--fc-line-color-3);flex-direction:column}._fc-l-menu,._fc-l-menu-item{align-items:center;display:flex}._fc-l-menu-item{box-sizing:border-box;cursor:pointer;height:40px;justify-content:center;width:100%}._fc-l-menu-item.active{color:var(--fc-style-color-1)}._fc-l-menu-form{border-bottom:1px solid var(--fc-line-color-3)}._fc-l-menu-item i{font-size:22px}._fc-l-menu-item i:hover{color:var(--fc-style-color-1)}._fc-l-menu-item .el-badge__content{--el-badge-size:15px;--el-badge-padding:4px;background-color:var(--fc-style-color-1)}._fc-l-label{color:var(--fc-text-color-1);font-size:14px;font-weight:500;line-height:17px;margin-top:5px;padding:10px 12px}._fc-l-info{color:var(--fc-text-color-3);font-size:12px;font-style:normal;font-weight:400;line-height:17px;text-align:left}._fc-l-global,._fc-l-info{padding:0 12px}._fc-l-global ._fc-l-label{font-size:12px;font-weight:400;margin-bottom:8px;margin-top:14px;padding:0}._fc-m .form-create>.el-row>._fd-drag-box{align-content:flex-start;align-items:flex-start;box-sizing:border-box;display:flex;flex-wrap:wrap;justify-content:flex-start;position:relative;width:100%}._fc-m .form-create .el-col-24._fd-drag-box{align-content:flex-start;display:flex;flex-direction:row;flex-wrap:wrap}._fc-m .form-create ._fc-field-node,._fc-m .form-create ._fc-l-item,._fc-m .form-create-m ._fc-field-node,._fc-m .form-create-m ._fc-l-item{align-items:center;background:var(--fc-bg-color-2);border:1px dashed #000;border-radius:4px;color:var(--fc-text-color-1);display:flex!important;height:30px;justify-content:center;margin:5px 0;overflow:hidden;padding-bottom:0;transition:all .3s ease;width:calc(100% - 2px)}._fc-m .form-create ._fc-l-item.is-inline,._fc-m .form-create-m ._fc-l-item.is-inline{box-sizing:border-box;display:inline-flex!important;vertical-align:top;width:100px}._fc-m .form-create ._fc-field-node .fc-icon,._fc-m .form-create ._fc-l-item ._fc-l-icon,._fc-m .form-create-m ._fc-field-node .fc-icon,._fc-m .form-create-m ._fc-l-item ._fc-l-icon{display:inline-block!important;font-size:21px;padding:0 4px}._fc-m .form-create ._fc-field-node ._fc-field-node-label>span,._fc-m .form-create ._fc-l-item ._fc-l-name,._fc-m .form-create-m ._fc-field-node ._fc-field-node-label>span,._fc-m .form-create-m ._fc-l-item ._fc-l-name{display:inline-block!important;font-size:12px}._fc-m .form-create ._fc-field-node ._fc-field-node-label,._fc-m .form-create-m ._fc-field-node ._fc-field-node-label{align-items:center;display:flex!important}._fc-l,._fc-m,._fc-r{border-top:1px solid var(--fc-line-color-3);box-sizing:border-box;overflow:unset;position:relative}._fc-l-close,._fc-l-open,._fc-r-close,._fc-r-open{align-items:center;background:var(--fc-bg-color-1);border-radius:0 5px 5px 0;cursor:pointer;display:flex;height:46px;justify-content:center;position:absolute;right:-12px;top:50%;width:12px;z-index:1}._fc-l-open{left:0;right:unset}._fc-r-close{left:-12px;right:unset}._fc-r-close,._fc-r-open{border-radius:5px 0 0 5px}._fc-r-open{right:0}._fc-l-close>i,._fc-r-open>i{display:block;font-size:9px;transform:rotate(-90deg)}._fc-l-open>i,._fc-r-close>i{display:block;font-size:9px;transform:rotate(90deg)}._fc-r-tab-props{padding:0 20px}._fc-r-title{color:var(--fc-text-color-1);font-size:12px;margin:15px 0 5px}._fc-r-config{display:grid;grid-template-areas:"a" "b" "c" "d" "e" "f" "g";grid-template-columns:280px}._fc-r-name-input .el-input-group__append{color:var(--fc-text-color-3);cursor:pointer;margin:0;padding:0;width:25px}._fc-r-name-input .icon-group{cursor:pointer}._fc-r-name-input .icon-group:hover{color:var(--fc-style-color-1)}._fc-r .el-main{padding-bottom:100px}._fc-l>.el-container{height:100%}._fc-l .el-main{padding:0}._fc-l .el-tree-node__label{color:#333;font-weight:400;padding:3px}._fc-l .el-tree-node__content{height:30px;margin:5px 5px 0}._fc-l .el-tree-node__content>.el-tree-node__expand-icon{color:#333}._fc-l .el-tree-node__expand-icon.is-leaf{color:transparent}@keyframes a{0%{transform:rotate(0)}to{transform:rotate(1turn)}}._fc-loading{animation:a 2s linear infinite}._fc-struct-tree{color:var(--fc-text-color-1)}._fc-tree-node{align-items:center;display:flex;height:26px;justify-content:space-between;line-height:26px;padding-right:5px;width:100%}._fc-struct-tree .el-tree-node__content:hover{background-color:var(--fc-style-bg-color-1);color:var(--fc-style-color-1)!important}._fc-tree-node.active,._fc-tree-node.active .icon-more{color:var(--fc-style-color-1)}._fc-tree-label{align-items:center;display:flex}._fc-tree-label>i{font-weight:400;margin-right:2px}._fc-tree-more{align-items:center;display:flex;padding:0 15px}._fc-tree-more .icon-more{font-weight:700}._fc-l-tabs,._fc-r-tabs{border-bottom:1px solid var(--fc-line-color-3);padding:0 10px;position:relative;width:100%}._fc-l-tab,._fc-r-tab{box-sizing:border-box;color:var(--fc-text-color-1);cursor:pointer;display:inline-block;font-size:14px;font-weight:400;height:40px;line-height:40px;list-style:none;margin:0 10px;position:relative;text-align:center}._fc-l ._fc-l-tab.active{border-bottom:2px solid var(--fc-style-color-1);color:var(--fc-style-color-1)}._fc-l-group{border:1px solid var(--fc-line-color-2);margin:12px;padding:0;user-select:none}._fc-l-group ._fc-l-list{align-items:stretch;display:grid;grid-template-columns:repeat(3,1fr)}._fc-l-group.is-template ._fc-l-list{grid-column-gap:5px;align-items:stretch;display:grid;grid-template-columns:repeat(2,1fr);padding:0 7px}._fc-l-group.is-template ._fc-l-item{background:var(--fc-bg-color-2);height:30px;line-height:28px;margin-bottom:5px;overflow:hidden;padding-bottom:0;text-overflow:ellipsis;white-space:nowrap}._fc-l-group.is-template ._fc-l-item:hover{background:var(--fc-style-color-1)}._fc-l-title{align-items:center;cursor:pointer;display:flex;font-weight:600;justify-content:space-between;margin:0;padding:12px}._fc-l-title,._fc-l-title i{font-size:14px}._fc-l-title i.down{transform:rotate(90deg)}._fc-l-item{background:var(--fc-bg-color-1);color:var(--fc-text-color-1);cursor:pointer;display:inline-block;line-height:1;padding-bottom:10px;text-align:center;transition:all .2s ease}._fc-l-item i{display:inline-block;font-size:21px}._fc-l-item ._fc-l-name{font-size:12px}._fc-l-item ._fc-l-icon{padding:10px 5px 12px}._fc-l-item:hover{background:var(--fc-style-color-1);color:#fff}._fc-m-tools{border:1px solid var(--fc-line-color-3);border-top:0;height:40px;justify-content:space-between;padding:0 10px;white-space:nowrap}._fc-m-tools,._fc-m-tools-l,._fc-m-tools-r{align-items:center;display:flex}._fc-m-tools-r{overflow:auto}._fc-m-menus{display:flex;flex-direction:row}._fc-m-menus .fc-icon{cursor:pointer;width:18px}._fc-m-menus .fc-icon.active{color:var(--fc-style-color-1)}._fc-m-menus>*+*{margin-left:5px}._fc-m-tools .line{background:var(--fc-line-color-3);height:24px;margin:0 10px;width:1px}._fc-m-tools .el-button{align-items:center;border-radius:5px;display:flex;padding:5px 10px}._fc-m-tools .el-button>span{align-items:center;display:inline-flex;justify-content:center}._fc-m-tools .el-button+.el-button,._fc-m-tools .el-dropdown{margin-left:10px}._fc-m-tools ._fd-m-extend{background-color:var(--fc-bg-color-3);border-color:var(--fc-line-color-1);border-radius:5px;color:#666;padding:5px}._fc-m-tools ._fd-m-extend .fc-icon{margin-right:0}._fc-m-tools ._fd-input-btn{align-items:center;display:flex;font-size:12px;justify-content:space-between}._fc-m-tools ._fd-input-btn .icon-check{color:#67c23a;font-size:18px}._fc-m-tools-r .fc-icon{font-size:14px;margin-right:2px}._fc-m-tools-l .fc-icon{cursor:pointer;font-size:18px}._fc-m-tools-l .fc-icon+.fc-icon{margin-left:10px}._fc-m-tools-l .fc-icon.disabled{color:var(--fc-text-color-3);cursor:not-allowed}._fc-r .el-tabs__nav-wrap:after{background-color:var(--fc-bg-color-3);height:1px}._fc-r .el-button,._fc-r .el-checkbox,._fc-r .el-radio-button__inner,._fc-r .el-table__cell .cell{font-weight:400}._fc-r ._fc-r-tab.active{border-bottom:2px solid var(--fc-style-color-1);color:var(--fc-style-color-1)}._fc-m-con{background:var(--fc-bg-color-2);padding:20px;position:relative}._fc-m-drag.mobile,._fc-m-drag.pad{border:10px solid #000;border-radius:25px}._fc-m-drag{box-sizing:border-box;margin:0 auto;overflow:auto;padding:2px}._fc-m-drag._fc-grid-line{--van-cell-background:transparent;background-image:linear-gradient(to right,var(--fc-grid-line-color) 1px,transparent 1px),linear-gradient(to bottom,var(--fc-grid-line-color) 1px,transparent 1px);background-repeat:repeat;background-size:16px 16px}._fc-m-input{padding:5px 5px 80px}._fc-m-input-handle{background:var(--fc-bg-color-1);bottom:0;box-shadow:0 2px 10px #0000000d;left:0;margin:20px;padding:12px;position:absolute;right:0;text-align:center;z-index:3}._fc-m-input-handle>.el-button{font-size:13px}._fc-m-drag.mobile{width:400px}._fc-m-drag.pad{width:770px}._fc-m-drag,.draggable-drag{background-color:var(--fc-bg-color-1);height:100%;position:relative}._fc-m-drag>form,._fc-m-drag>form>.el-row,._fc-m-drag>form>.van-row{height:100%}._fc-m-drag>form>.el-row>._fd-drag-tool,._fc-m-drag>form>.van-row>._fd-drag-tool{width:100%}._fd-fcDialog-drag,._fd-fcDrawer-drag{padding:3px}._fc-m-drag>form>.van-row{flex-direction:column}._fc-m-drag .el-tree{width:100%}._fd-drag-box{height:100%;min-height:80px;transition:padding-bottom,padding-top .3s ease;width:100%}._fd-drag-box ._fd-drag-box{outline:1px dashed var(--fc-line-color-1)}._fd-drag-tool>._fd-drag-box{outline:none}._fd-drag-box>div[data-draggable]{margin-bottom:1px}._fc-r ._fc-group-container+._fc-group-container{margin-top:20px}._fc-r ._fc-group-container{margin:0;padding:10px}._fc-r ._fc-group-handle{right:15px}._fc-r .el-form-item{margin-bottom:10px!important}._fc-r .el-form-item__label{color:var(--fc-text-color-1)}.cm-fc-field,.cm-fc-id{background-color:var(--fc-style-color-1);border-radius:5px;color:#fff;display:inline-block;line-height:1.5em;padding:0 8px}.cm-fc-id{background-color:#df2121}.CodeMirror-widget+.CodeMirror-widget{margin-left:5px}._fc-tabs .el-tabs__item{font-weight:400}._fc-tabs .el-tabs__nav-scroll{padding:0 15px}._fc-tabs .el-tab-pane{width:100%}._fc-tabs .el-tabs__nav-wrap:after{height:1px}.form-create .fc-none{display:none}._fc-child-empty,._fd-draggable-drag.drag-holder,._fd-elCard-drag.drag-holder,._fd-elCollapseItem-drag.drag-holder,._fd-elTabPane-drag.drag-holder,._fd-elTooltip-drag.drag-holder,._fd-fcDialog-drag.drag-holder,._fd-fcDrawer-drag.drag-holder,._fd-fcInlineForm-drag.drag-holder,._fd-group-drag.drag-holder,._fd-stepFormItem-drag.drag-holder,._fd-subForm-drag.drag-holder,._fd-tableFormColumn-drag.drag-holder,._fd-tableFormColumn2-drag.drag-holder{background:var(--fc-bg-color-2) url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAOYAAAAMCAMAAABBazFtAAAA1VBMVEX///8uLi5wcHBDQ0P7+/v4+PhaWlpNTU3x8fHR0dH9/f1dXV0jIyPb29ucnJxSUlJLS0s7Ozvm5ubOzs5hYWH19fXIyMh9fX0+Pj5WVlbu7u6vr69ra2s1NTXj4+O8vLx0dHTX19fDw8OOjo6Hh4d5eXlISEg4ODi5ubkyMjLU1NSjo6Ofn5/r6+u0tLSLi4sWFharq6uEhITFxcXAwMCnp6eBgYGxsbFmZmbz8/OXl5eTk5MAAAANDQ23t7ccHBzd3d3Hx8cqKiro6OjKysrf39+QkJAsSMNaAAAFiElEQVRIx+WV17aaUBRFF016BymiiFLECrZrN5ry/58UjrnGkfKSPOQl0+E+e6Asz9SN4Gc+sCCEZOlx+AmX+7WTAFYAuOaJ8JmC38HiRyT2cVQCrNdBTiLl15TZ7HUW+8r7NRXhHr+hI7/TYQVB0DtNkcDbEMZFPJZEXe/Uuq7TIGgaqa9O3fJVfGHHDjBKAZgcCOP82zZ1vfUlCAIPwN4E1yUGu9aDISCrjrVwyvMNoBB/+fLlCMROFc/pbmW9UhrcdrvtBU1JAKzoj48XvI9d9hj51RHDGqzO8xcgXQBYvgGIed5LeF7Hk4+2vTsMI9u27Ip5UInCiSonueddOVfVFmknDH1gEUW+GUVbsBRFVVVTZupUsZDlbQcfD7Td71d0fxVT1PlKNUxs+Va04mRcADikjeGcbF4kjHSgVJ04mH+QwO7v+9rcbCqg25nBr20WrxQAn6PdKYrMIjqAw4C2DLBA8LnrUvW46WZlHJrq4gC4+fRdczr9yNwysu0ndts5LqL2J9g77AMJcMSOA9Q+TVccO1gsUkaWKUBcrfr91coG3CH5NSMO4Zj6FGKoOdiUyjCO75fYAkSF+xZMT7UWwxsFwFGz5rjJIvEIy54O3AfBfIgG7XpSViYsHSjqWmXQ8EohWKpyU/1a5VCwD81jjeBGWfxzTCd9TFIAXPjUVHzmdvXPL03F68qB712hThJPTpJkqg5LPqvp0Yji1G7a/vRGTS4cGenjsSksYNw0bS0Dq+Zb7vjq+9CqajlWJbil0kxld9xo+mFr/UEtgN0SlxnonTRbE1ZEs5Ll41nhKxX1KYHpbr4A3aNzKAyGObxSCAYd5RGTlTbo20PTsBDo8uZ85u+TgSF/yAWo/HZgGAnDXO9MwKqiuKtFZj3DEwp5Mk+bZZAFVZZRfDaQBJ8dp90oZdd0L+wOla0vrmTZP518WR7caJ73/TtPt5GdWnuxuDlApzjw3ax/Zmemo8/nc15sNJ1Ri7nyETayZN05SLKGqR4EMoimovZG29z1wRXnPDkeCwtgMD8w6AzxSiEYg2aamSNtI86IZmgC/EAV+FzgLaALOjcMw22692uzl9EnJzO72eSluZKlgblRACnX0KNcIA7OLY+/Mv4n0XP6ZkzVugi4/Hab74F9r+eUjNPr7Ve6efHC9lCZLMtICq+Wt8Hmra13Oh2DaM6Y1of0zRE5DrsaW5Z10W8DXaLpVrQ5meyyA4ZTqvfRvfYB7qwzE59ovlLkqhIMuk/TO4e3wZVEczgFCrpKnEnWAsnbM9a6hZemtaXqGdfzjBpP7jsB0upCNNcRUz78XQZ0QovpGhh48839YAiw+JGmxXkP4LaZpi09DlvLdNeBt+RDMrS4lAEa2mTclEazlfqtD7PTHE2KIUEbAuhHi4VCNNUWZy7X8ak5laWAN8UXsHIAmETzlUIwBNmetVTaBrRRo7lxAQrmaCmcLkRuE4o+FZJu/vmhOUuZbTE3tsrgdW2OHigA+3lIpSXdiHxUZDmhJ3kbGA4FtThW1lpZQdOaT18PqC+km5YrwHQBjMnQphi39GIjAe0MAN1oRp+44Is+NS3Y58kkjU4keTweJxB1aAvONFdUEOzJlg/FbNMN0w7wmSeaz5Sn5jI3mN7Obm4th2BeNLeWxIAZ1XxQfsD+5IxpqnvgwJ1l96GJQaYy86Vq4jvl4gEFUQmOAthJGSLxenHY71xYrjBtxtlOl9OeRf6mgd5soDadBiSfAIZoJjtcyvUotyFkW+CTB4lnBNg0sBuqGC0Q01stTkYevsHfp5h+5vwsF6GlQGHpjewm3QrAm0Y0XymElvCoSvi5/44mviGP6A3aAdxJbL6x7iIHOwXeNf1+MWf6Cv4M6W/eIuGfIr0vz/Xx+J/4CrqNrFdzXxZoAAAAAElFTkSuQmCC);background-size:0;min-height:90px;position:relative}._fc-child-empty:after,._fd-draggable-drag.drag-holder:after,._fd-elCard-drag.drag-holder:after,._fd-elCollapseItem-drag.drag-holder:after,._fd-elTabPane-drag.drag-holder:after,._fd-elTooltip-drag.drag-holder:after,._fd-fcDialog-drag.drag-holder:after,._fd-fcDrawer-drag.drag-holder:after,._fd-fcInlineForm-drag.drag-holder:after,._fd-group-drag.drag-holder:after,._fd-stepFormItem-drag.drag-holder:after,._fd-subForm-drag.drag-holder:after,._fd-tableFormColumn-drag.drag-holder:after,._fd-tableFormColumn2-drag.drag-holder:after{align-items:center;bottom:0;color:var(--fc-text-color-3);content:var(--fc-drag-empty);display:flex;font-size:12px;justify-content:center;left:0;position:absolute;right:0;top:0}._fc-designer ._fc-m-drag ._fd-draggable-drag{overflow:auto;padding:2px 2px 100px}._fc-m-drag._fd-drop-hover ._fd-draggable-drag{padding-top:20px}._fd-draggable-drag.drag-holder{background-color:var(--fc-bg-color-1)}._fd-draggable-drag.drag-holder:after{font-size:16px}._fd-drag-item{width:100%}._fd-drag-item.is-inline{display:inline;vertical-align:top;width:auto}._fd-drag-item.is-inline>div{vertical-align:top}._fc-child-empty:after{content:var(--fc-child-empty);font-family:fc-icon!important}.fc-configured{color:var(--fc-text-color-3);margin-left:5px}._fc-manage-text{color:var(--fc-style-color-1);cursor:pointer;margin-left:4px}._fc-message-tip{background-color:var(--fc-bg-color-1);border-color:#fff;border-radius:8px;box-shadow:0 6px 16px #00000014,0 3px 6px -4px #0000001f,0 9px 28px 8px #0000000d;padding:9px 13px;top:16px;z-index:4}._fc-message-tip>.el-icon{font-size:18px}._fc-message-tip .el-message__content{color:var(--fc-text-color-1);font-size:14px}._fd-preview-copy{align-items:center;background:var(--fc-style-bg-color-1);border-radius:10px;color:var(--fc-style-color-1);cursor:pointer;display:flex;height:28px;justify-content:center;position:absolute;right:35px;top:65px;width:28px}._fd-preview-dialog{border-radius:6px;min-height:40%;padding-top:0}._fd-preview-dialog>.el-dialog__header{float:right;position:absolute;right:0;top:0;z-index:2}._fd-preview-code{margin-top:0;max-height:510px;overflow:auto}._fd-preview-tabs .el-tabs__nav-wrap:after{background-color:var(--fc-line-color-3);height:1px}._fd-preview-tabs .el-tabs__item{height:46px}._fd-preview-code>code{white-space:pre-wrap}._fd-preview-device{align-items:center;display:flex;position:absolute;right:50px;top:9px}._fd-preview-device>div{align-items:center;border-radius:3px;cursor:pointer;height:28px;margin-right:10px;width:76px}._fd-preview-device>div,._fd-preview-mobile{display:flex;justify-content:center}._fd-preview-mobile>div{border:6px solid #000;border-radius:24px;box-sizing:border-box;height:70vh;overflow:auto;width:350px}._fd-preview-device>div.active{background:var(--fc-style-bg-color-1);color:var(--fc-style-color-1)}._fd-row-line{background:var(--fc-line-color-3);height:1px;margin:10px 0;width:100%}.CodeMirror-hints{z-index:5}.fc-wrap-right .el-form-item__label{justify-content:flex-end}.fc-wrap-left .el-form-item__label{justify-content:flex-start}.fc-wrap-top.el-form-item{display:block}.fc-wrap-top.el-form-item .el-form-item__label{display:block;height:auto;line-height:22px;margin-bottom:8px;text-align:left}.el-form--large .fc-wrap-top.el-form-item .el-form-item__label{line-height:22px;margin-bottom:12px}.el-form--default .fc-wrap-top.el-form-item .el-form-item__label{line-height:22px;margin-bottom:8px}.el-form--small .fc-wrap-top.el-form-item .el-form-item__label{line-height:20px;margin-bottom:4px}._fd-slot-empty{align-items:center;background:var(--fc-bg-color-2);color:var(--fc-text-color-3);display:flex;flex-direction:row;font-size:12px;justify-content:center;min-height:90px;position:relative;width:100%}.form-create-m ._fd-slot-empty{flex-direction:column}._fd-slot-empty>span{color:var(--fc-text-color-2)}._fd-drag-item:has(>._fd-drag-tool>.el-col,>.el-col){transition:all .3s}._fd-drag-item:has(>._fd-drag-tool>.el-col-1,>.el-col-1){flex:0 0 4.1666666667%;max-width:4.1666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-2,>.el-col-2){flex:0 0 8.3333333333%;max-width:8.3333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-3,>.el-col-3){flex:0 0 12.5%;max-width:12.5%}._fd-drag-item:has(>._fd-drag-tool>.el-col-4,>.el-col-4){flex:0 0 16.6666666667%;max-width:16.6666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-5,>.el-col-5){flex:0 0 20.8333333333%;max-width:20.8333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-6,>.el-col-6){flex:0 0 25%;max-width:25%}._fd-drag-item:has(>._fd-drag-tool>.el-col-7,>.el-col-7){flex:0 0 29.1666666667%;max-width:29.1666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-8,>.el-col-8){flex:0 0 33.3333333333%;max-width:33.3333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-9,>.el-col-9){flex:0 0 37.5%;max-width:37.5%}._fd-drag-item:has(>._fd-drag-tool>.el-col-10,>.el-col-10){flex:0 0 41.6666666667%;max-width:41.6666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-11,>.el-col-11){flex:0 0 45.8333333333%;max-width:45.8333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-12,>.el-col-12){flex:0 0 50%;max-width:50%}._fd-drag-item:has(>._fd-drag-tool>.el-col-13,>.el-col-13){flex:0 0 54.1666666667%;max-width:54.1666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-14,>.el-col-14){flex:0 0 58.3333333333%;max-width:58.3333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-15,>.el-col-15){flex:0 0 62.5%;max-width:62.5%}._fd-drag-item:has(>._fd-drag-tool>.el-col-16,>.el-col-16){flex:0 0 66.6666666667%;max-width:66.6666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-17,>.el-col-17){flex:0 0 70.8333333333%;max-width:70.8333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-18,>.el-col-18){flex:0 0 75%;max-width:75%}._fd-drag-item:has(>._fd-drag-tool>.el-col-19,>.el-col-19){flex:0 0 79.1666666667%;max-width:79.1666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-20,>.el-col-20){flex:0 0 83.3333333333%;max-width:83.3333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-21,>.el-col-21){flex:0 0 87.5%;max-width:87.5%}._fd-drag-item:has(>._fd-drag-tool>.el-col-22,>.el-col-22){flex:0 0 91.6666666667%;max-width:91.6666666667%}._fd-drag-item:has(>._fd-drag-tool>.el-col-23,>.el-col-23){flex:0 0 95.8333333333%;max-width:95.8333333333%}._fd-drag-item:has(>._fd-drag-tool>.el-col-24,>.el-col-24){flex:0 0 100%;max-width:100%}._fd-drag-item>._fd-drag-tool>.el-col,._fd-drag-item>.el-col{flex:0 0 100%;max-width:100%}.fc-icon[class*=icon-chart-]{background-color:var(--fc-bg-color-2);background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAXAAAABsCAYAAAEEfdn9AAAAAXNSR0IArs4c6QAAAERlWElmTU0AKgAAAAgAAYdpAAQAAAABAAAAGgAAAAAAA6ABAAMAAAABAAEAAKACAAQAAAABAAABcKADAAQAAAABAAAAbAAAAACUwJ3TAAA5qklEQVR4Ae1dB5wURdavnpkNwLLkICAZFpaogpKUoBgQUBARRMCACUVPBfXUO/XzPM/Tk/PEjApyEhRFEeEIShZUQFhWYBElSFxQCcKmmenv/3qmmu6e7p7pCTu7ULW/2a7w6lXVv1+/elVdVc1YOXUS1bvDg3JLJ/Xf9JK0Pdl5XGYV9jM2ThsvSyyPfto4o98s3ciH8nBe/Grks2ng4M3GOJ5v08BBah08nIgYSTLL4mHtdXO/G/Jq/HLpQ/Vz7tBGK5XALftQZmyoNq9ZhXlG4sX9Lr/7aNsF05VgztU3zEn7o97MDnM/abdpwODcdotmtud0WlCo8h3mzslSK05EPJJn4Nf2X8wayP3aK1U2Z8CQVe0/n52lzStJ7F4msVNMZhX9aBXCW5FvO+W14iW7i7Ozlk+cRZVs/8UnXXL6D9rKngMXjWv/+RyKmEVRpqKioVW8hCD/adN+vvBv3VHpHjs7P9+JUNCmUaUprDSCsZHaNDNePD+BIfnZ7zys8NBKgsz+SnEq4pQBxAp/tOYVxRP8ZwzztKbfPrGa/E2+e2Qdj6OrVmy08dxvxY+nm12NPNWKmxFHE0caxyqfXZrTPBGJihVTbbz2AdLGJ8qvIk5yh0Iy8PtDcrFCyNnb2kJRsddxu+42xKkawngrtXSJ8OsQx4N0Mz1Msp+lmxTWB49yG208VZb/gg3XJifUr6u4WUl5PR+6juJRwedlmb2hpSHx0HYK2rRE+1VRoScdaC+hAlFB0ruKy1r+r4+D3ndR+XeD/sBFYg9XPtzxdwpAvy7WpYnAGYaAZGXllQUL0AprqlvIw2nUDvQA8p+REeJ/MMbZhUF/AedFVyNt7lUjX87rfZ/OPCAav8SG0lWrCJSHk5iQWqNEo+PWXIhx5GKroevbmOZ1sXv8/oAdRA8954ky1sMKVCsMnjxJZ+BpDTYiwIP/DC4fqsTwqFqFIilDu7lzJmkJQirME/2sOy8A1y2wc7J5EvqBK6GhWqJAH1mH2spb8dMaVZUPdbqZ8+JXAoisQ+50FeeR2qtRdHglTtXYUpEK45XX5gFEyogKdXZThwZLUUVdy4/z0uVFoOk3j68xxlFYKxVKxXmEttU8oxXzir9mnyIaszycH+ehvVrx09IY/Wb8wiJuZBIuHE8L0K4sABAfB7GoHh9OkXFREVdkz8UqMT87aXY7XR6W6fey4xq2f0GeFaBdHkz7TZOWcK+COFWaHiLI0i1UIsza1rzknP5DVtITbag0JT9Dlfb4WYbXy0Zz+tK6KhXHv1fw5H/GC4U6U40s2eWrDaNLpyKJjhpD1/XXDlpP19J2qqi4XOw9FP4eKunTVsJMawTTb6drhWPNH3Z72EbZq80l/JYIoHMrn1NwVi0q68ahKuJWDYgkHs/pXCMdFJTp5JeR7mwLRwQ4N4sUpWmCUDTgyi72vTpJRwa1xEai733C7WedYX1ruzldiUh3l7jY2GDketTpax2BIcCVtiFaCZpZQJSQM+C6b2TJX9WYJ3N/l5FN1j3yrTGewsDoO/SEmeQnvmR6kp+cVi/rAOeVs6pIIHvofy3zlKKa72QvfPufoVT6GIxAzuMxKHctyuwC/TZtx0V/684nJHk6XflN9wNhNIwmfcZQr4j4CygdcVvBQ5mioDB3OQMGca/u2mDjfV1q7Omti6MAtUXypeW0mz+zq0umYgPOJ7FGuQMGLUK6DkCezsGmsORhjc77bE5nngYBUp0OcDUWHg6i9u5o07X+9vPmPKUNQ3qH8zCAncH92ivxr7H3ssG/NljySc3dVww40mhhHiTe2+HzObqZMp4HDbqX+/k1GLcdT0dD5N2I+BDAqf78ZvF8dMV9U+aCtHHk17YX7ZgP06cWaDu7ZbZbm2bMpw37fWxRYNAakHZtmg5w3IhRkLa6qDzLzO80qiTtaF0ihqE4B/ea5kJNnRWopsTBSF75BhvuUcbn9TfdZTpO5zxsnzrU184BMHXUaEdnTEO7+mmE05isC9vWT0cpAqWKgHIDrebfrGpSmqaXVR3KazyetlAHFdKP6z26QpdVC6WKPYZ30pwThb0eFmId8PQz4RoCuOxjEqb5JlKHRADgeg/00/V2jeU3R0uTM2Do/3jHq40nPwea9B78WygMiyATN/oVl1f/DteYt7yHdZ0m+p5zZTe71tBR0A1IQ0PHmXU+HNSUU7U8rZe8NRt5fyEA2837UDc1aQSKaAhw/JS5XTKd0LsbijbmKv9hHeAKWNQmL2sF4FUzjICGWrn9tFV6uuHc2jgdE2oKadOMfn7DzPgYac+EsA5wapAixW6AZjClYCLpXovH0niSbJ5fC7TZE8TpxFUgEBUCis4sy2bhmVY3PMXClSYCITrcaeGwLsgySdXl82MySmJ/18WJgIJARIBzO9usUwPY7UKwdKFTlMMDzk1Dnh/hFfDX0XaqPE17pfqY1UVLQ37ib4zThu3KOdRidr1DWbOmSX7P4XbzZwzT5rPy8/L4DKXbW2FV2/nTb9PSRwS4NoPRb1dpI602zCuH6xTwuJmHw/HjNz9S0LVlav14AgfTJJ2Z46YqpckubwMe1lpUxny8/tp4n6eghzZMfh3gPFO4RmuZYJXMbIRVlWK1+ESbh8rBk3ExGpxP/mB4IsK6tYDaPBxoY5ydpFM7UL+Qt1HEA/U0XcqkA1diF2H80UrysakUTz8z0Dlu2rpxf07/ofPbz/uwHw/rAOeRTq5Y4x2qUsIw4De0oOr2ChWOtlRtcspWmLkzPf14k0I7FjTtgNHv67hpPn4jrIBH/XT87fgGhef0nLjMvgHY31AeAprfDDselGZ4+aB7e2UJOGdudke1BYZL19Jq/Tn9r1+Kx7Uezy97iqScfsO2uYsqf9524fvjtbTkD4I82SWxMRTG9W6zdRCUpnWcvzbOys+FB5pmMW5mX6KDUeCiNz+QYqXc3KuHT2v7xYyQRXlanj4X+46HuXDxsCXgnCDcFRUaCjAwNg11WHvxNdZP7Dam0GNOYFc61nI83Vh3caVFvtSTl4cDh4PN+dFNgH8yfmOgjixfMvCngOezehqM5ZOqANjKEwLgJiOdygpxBKqFWvnRSBwz4GhoHUiaqUNDO0JSQgCnx5w3btOAQf+IBGzTAgKRiuTZpEedZJROO0YAvBvo1RfaCOe4/KGzrHrAse4bS0j3kLjSCp/UE+fsoUIA2mKAesxsLs9KWpTKAXEzx8GmNKt3mMZ8ThpvzGtbRyNxlGGA+yuyqv0F6mvqdIBjguozrhtaLn9BXUMGwLfh8RVOIFD+EFDktixPEJU/SO1rDPUmXGkiYAk4RljX4HdlaVYGbz/etTCvSrUaiSzMFHCyW9FwN1YdtTDasPGqDPjPw+91zg+d+lRYQt1jsUY4r7J81QGOBtfhAMNieY5XnMfxcLgrwBtOI0crOpJi0NRBeh8aycHcnIZflzMdbMJDBzhMv0P4rQuO4JThtELkYUvpauawGt8N1dNAmwakZ9AwfVvve00HJS4fOw8juM4EMGi3AvwLya/cWGwn0/I60/w6wIOSPEXbSAIfG056W0n5piuGTznUaqZEQ3ySXMqLp6MWDW5aLZ00GZNM3bX8yI8bpGzKIj/Sh2klm+/do7Qz0ekAVxoo6xfXQ/poBGXqTtbaVMnnLrzwUPNZSyCxWIjCniVCv5ut4uBj/kM5C0HLQFEpwZuDgdb32rQz3R8COADeg0YX8IaDYAT5sRD+HR7Hr5UOdzippHnTldkxdLJVKAwem91upq6P5vRmV5q84jOTZulnWpxuaO+B1YBH3Iuf6rD8rCJAL9KqATURHu28COiUGTtI+xCoIeFMENABTmADtAoAeYmWFtbLW9pwzH5MkuExyCc+NEnmKayq+NGBLkaU8tTEXEYZZaADnOqIzrEA/9QNj4moN02Scb7GSTIeL64CAYGAQEAgEA4BdfTtdIY2HGNjOj+vQZRjRMY+LHCzx8cqleMGG1A4gcCZi0CIER5tU2nK0F+sbASi+ccirITRHQJix5dPutjR8DTtLBePi/aKOtbDfMV+u/yYuRuLtV1zMCF0wI4u0jSaVsUgZG+k9FZ0wGw60pQ971Y0dvHxxNGunHik8TOGtPM/Nff0HVh/41jblbpUdtwEvMSL0x2C/QFJNryWq6Di0ehYeEA4cpA/DfM9tJy5GDdbtzaSAPX5AkvVaEoJQk578mdEWyZtw1Q3qGEYD34lmNawXLQaSTmo841OFIOB5ypDOKJgXq8Hh2DdpzIbbJVBkj2H2ix4r7fbmxGxgjPywjT/OtjOlXk87gUth1LX+1D8kYaL5+LHUgqrv5e96J1/cFrj1VrAJXY1bkJdygAgdwNQ3VyWkVEs4dLSJpAt9TiT4Nu8+hDgj0lQIHTjMLM8HvGNgoAeQPt7OW0X5v668+l/aOtU8LzTuOgSNCngOy7Fx972uZntImG78ksLN6xE/AG46GQlpaDWa9X39v64+r4e+ftafdDhRK0NT8rukhay5K2T22/kFqq33dEyZu3CPbgK9+jf6sDQjMgQV5L+2y15fe49kPXVpKmGJCWoq7SWADf+JXpsNE73BGniY/Zqux4js0iPujHmMwsDwEy06VLFRCDVjNNSSDNAwNdi8vkVaq+/hHWHuXXELH9EcRI7HzfpfIUWHqNDWVUgmMcovsSNbcaM5aO3m+Xzspqu1MBJeqjfSmM+q7AddmZ5Uk7WfjX7yzf/Y5ZmjCuqtDdt26XjqLdTXOaBLiPo/HI8uPNQx5fpCB6siy5u9M2jqSk4Hccr4UUpdvLyB+J4vbXTcMr8ARzY3ivIwvZCwm1HUDdveB/TdD/1xebOUsDNyU8fEcTTta96eFxcr/7Ibflw5SoaLwgFDrRajQOtalL9Ed+F54Vwqy63341TsEGnK0XE1E4JSxMYu4j4KDoD//BA8dMUa+PGjoOwMGh7Ml8cvYSgnQu+tBMDiHckLlLhJl5a4ab200OIvqcthLg/pfNF/5KbNcM4ZTVwfBvw/pOWQmOnxQIs/m8qS75z8nrfPzxr6ctRm3hKWehla29XTiCmoOqgMAqxZLmDGmHwaG6nIaUUgzEJj8N6YnPTQtlV0phnIw2YUljt/exF7yq25a6OL3U41nDlhzy9xu7Lrm2w6Z6IhQ4CSrsxwjqig5wfg7kyjRNDONyIuwLhiM3B4Lac8TR45XysrhDMvVZppvF41aqNV3o2+XTvRqYdpYOv2ruj/g9TXPM1T1/3Y7fHlUUFhZX2PoCo8AIu46xuSf9VAOJl51xu1snssA2ep0wIOGkwXiEnV7zj3gNw1deidnk39x/2od9VpDzpmfu6D2+yfvwGosfeqOkl6b+PgqCP4vmxj3UZ9rHeycOJukKgq2gfCAgHubWBi7P/0P6DwuUAf0cDf7tNKeDVXOkM/eyqQLekL50O3rbLr6cOhMBzMHq2VuAX/p7iqF7QZ2O4buvKhIDb1tAmEV0ino3IXLt5M0P7N2TFxr8biQMEfGu7hbPauIpSI+ZpVrJiBpklJDgOqv/LcEVAeOLmwGqH0lZIWTwd2G3D4F7pEbDYsRlmtB5HL9cBZf0Kwf8C15edlGcp4FY3ysqciGVaMOq8cbxhaJd6VLoTAMsKLYRXmbkoK/WJRz2wufcnqLBbIR8BF8X9VvNyHuIqEBAICAQEAuUEAdWCEougnN0xvpjHWS5BXdoICBMlDOKYCnuHT4eFIRXJZRABRwKOgYyyURa70gZTW2h6D/Ovd5fBdoWtEure044IQj0lKNg9MHpXXwTZ5RFpZQ8By1kUbVWxUGgsFgy5zeY7Mf/qweA2MI/tUk4ZWq7NG0d/fwhlE9ThVbyYjWoqT3kdnhLYJkq2WXBQfiNmjNbzeiKOdp1fSGE8/RfioT7GCTmNuJYfBCwFHNqrK25uJ6UpwXVheClxBcItSLyQ/hyE5Cho/qs218/aI6k9hV0pWC1XEm4aPpATi5M8XnyQGzzn0tdxVH7wkBZFOXSE5DzqbvJ6/2lEYcbuvxJNvc139Ki186rD5Ld1EpsJwT0PdSKppsU8ryv0OEIB8dNRBhawsfXwK1t3aQsvfU0RYeHKOQKmAk7nZ0CYW0CgluImp6GNtPbYzFXlb+Jo3tztY+kQlpZYIdcSL3lvQYaIds9iIp9239KXMFUH7xZoUjrg7A3EK7tkKfHcTXfM+bH74xBwqZgLN8ykG/FG06qOJNTDIMChTsbXPOgjEx62DeV1BhidfDI7QVum8aDq3q4q9QvlIGLKOAKmAk4mAASV9tf3pvpDiOmFKOk/S0cCAds84CAtEKiIXgsbV8O1Xvafdml/nFsTPQPnRq/MJ6I+L+A6sMJv2Qxfn9at4bYVbl6l4LqJYFD92goWCsn4U96cRb2AmTMV1zKHgKmAUy1JaCCnihaDsL3JNbVZC0D3tTYeJsd2CE1Ubl/Lme2arJuwHrZ9PxjB/TweNjV4CEVfDcNUjT8mr/EBs3pTG1MhInPSELAUcKoRhHoThLsDXZVX9x7WFsKmaPVgugeatQ6WKz4KDd4NcYEtVDJbSOl2DvmeQnpLK4GC2XEMD0oBzKUC4oPyO9JVOIGAEwTsBVxmKyDctPgln6YDsf5XRw/h9yJtn2KvBmY3vobibhVJBSCwT9nRwT45At6TIxum2nESaWczAjqBNQUiOMCDyULfVrB2QZMENNusiZKXovRAJsVb9SBiUGkCVjmMwn0UTiAgEBAICAQEAgIBgYBAQCAgEChFBNRxo1gu6wx1vlxW4Fa2cRODTGf3R1CXMwSEgJezGyaq6wwBIeDO8BLU5QyB8C96EtwgvAXtibelD0VSDF7WDIyETtAIBDgCcRNwvOmsyJnitf4p7g93xdEAo/HKX1nNF46WNizEdG6gtgBa2x5mzYyybJixVXiwaJ1NzA4HFbXGIrKIT8myKxBrecIeHWyZX2YbMLsw3DK9jCXQ6bz52R/WO5g14yuqmttbcUXb+R/cHkk14yLgtP7E72KnV/u52GdYgLUnkgokhUZifVDn/0DgPsLC7yfM6gABugBCEFhjLrE/42F4zowu0jjgQ0eMdcUBPY3xQC+INF8i6NC2l/DQRu3yet83srjC4av9nqI2kt+d7/Kl59bacc3zdX4csj9qppqMOLPd7fWw5cC8FkW7XfpvyPk8py6hVaDN1vylU8bh809osoZ4k26D42ZHvAxbTteflRfSmggicHO74t4qO3pQ9vUAoJ0xG2goPSDcjBXHQbh7knBTOdhQ0Rw3r6qxTMdhCQIQpcN6f+XMQCfZfZ4/3DkDrl9BglVY+Zcn/J7C87CTJBUHbDbwpfxx5cHWHyylNDpD3AlfE9oeXjc2uwSF2yRdjfqp6zPr1ICFJ+kCDk1yO350wmvYn8fLjlq0I6JoPEm4KWxKkFg5WBIH3M0mjcEZQPhz4e8TDC9BvUIeAE4byRUPy1UQbmUbH6d3ebGTKEYHk/DFGFlEnH1np+cvpDO/6ezvcJnogHyc3PtNODqzdNyLRsDrHbM0q7jcfiPetkqjeFMThWxPPOW3aDI6KlSTr8x4IbitsL58plIhif0IAekPMDcjnBrUGNdgG5J66CN2Mw2D1H/vpAHYnN0FvcKPMM9+pXzK6QM+Vt+UhwR8ZfaeaVpkkdtJKURGGj0VCTed863lIPlSfqx8+Pyn628bsem3+qtq/9Zg6XUlFQ6P5TQ4lroqnRHu9PBNaNtFnEekVzJX7GhNBRyzGgMgEA/zjBgYbYNwrObheF5/7vZkzz+qbTOdRXHJruNt58+4KdbyIHR1sDtIEV7Y1buhUZXzrUk7Q8gDg7XTwu2DIdQGG48BgUPnZxnIdSNmhmizSAGMrwpWHPAAZWCA3QZ1+cGKJlx87lU3vu93+RyZO+2/mBXxTJQ/rdilE25ZKunw+SdtqV5QgkPJ1Kl3dHj1uluHv4yol/N6PnBDYZVd/6fUGztdc66+YQ7KG6SEw/0jLJwjHo6ruQYPmyuOBKeqbR8tu4tNNRFMirg4CNshPKRTIeQ0c3K5linie2GwuUyJk9laPACjTxssWkpnfjxUocIt4ZMwMjvIOeH01D6kPGhfKB62lhiItoG59DFPD3d1FVX+zpeRf284umjTcy+/UZm1UPJjcwsJN2TwbvRQU4HRTorHVx0Ok52LmbP5Wcsn9tvZ+fmfjp+z9gNKw33Npq9EpJ1sUERhOwccHqWNvFau5i+XEm7cdLQiC4mnup0VDkL+dwhRT97Y/e0mNyc/eqYDAPZFpN2mCDcnCF5zrxo+1RAVVRDlDAD/IaiHTqPh4RoLob8HgtMXZlM9J8zrbL9JZzo4yRsJLX2dgdORuUGfLEEbXqdpYD5QVfADEerej0xb+sSJ5EtTP3uS1+shRdg5H8urZD3WwSkNL6acrFHpnG1DTxh/tbcMtZ25cSTgO3o+MoBGyvz3c+dnYp8fll3xUtSW2BkTDrR6r8nhJl98QdNdlIabQwOVVVq6I02/rEHt9KUUdsnr+dB12jQbf4pJmoQHiAS4UTCtPoREOVjIhNZRVI29FzsadLtLMr6ItAD67Ainlfyen8nv94V+vQJCrZxyptCSyedi1dp/MfN6nhdaPLJBumTzOUcoJnzy8Tuzn3IqAi/M5Gpqg5vQKVF+hk5U6yTooxhdpBP2MRajZj/UYna9/JZz/0cRNN11uNGiBbV2X35EJYBnW5977ijK2K+OCxpuunW+Nt3GPwyIdIFAF0KgV8C+LkD4mhB6nJwF4PbCjLHVPiH5TCKsttyZkDqKKqmY349nyDjc8f8wVhkL8+kZCLTqIMyj0MZxiPiEIiEctEn9S3gvpbATB7afAbMHneSJhNaRgEfCsCzTQJhr0nytto77O7y+GgKujgHw8aSlmNtVTAVorj3t533UV0sfkV9m6bhhl9vZlOAzGEIzGaZRIeeJhyE7moEWBK0B52F1RS+11yrNLN4nlbRCXZSp1Lo7BtGpCmu0wo223Yv0cdCgf9e+yQBdQLiDec14m8b52Zvg6UzAYf+HwyvpAk52HQZbjk0daAof7MAPTcEyiTzR8OsqJMyBJOl4h7mfdCYThMKbBg7e2GzNExdrXxykn2rwbNaSV943YRW3KGi8MdBak3BjL8ID0Tlaxhig6ex6Mz7g/4pZvFVch3mzbeuDepPmpi/DTQPvEOd0ilBhIOHziTKO6YvQ4b0ImS62LukCDuHuCJBq2tYyxsSTtTZV+rnjC98G2LgKOsz9WLl5bZa90+aHXrf9gNtUQSvcTTdOuLDynm7HYiw2ouzQ2gmbBYmoAtESyYGlGJAvmhWNi0MvMwa90fcQ8orhGNKkAIQ77PgtjPyHK6Z8pFc63OGk25cOAZeKIdwdea09x6t7M/d3u5GHaV0F2bSlJdy83PJ4hdbuS7941x1Cfh56tJV2fPFE0VTvKjsanpZ0DY4nEe88Eu/wNTVlxsRYEh0Tl3vlqM89voq7Wi1+Y5Ix3UkYbRnthD5etO5S/sJavOptxYc0uZLmYndCNq6BRq+H32ZMqf6DXoy5rTKaxJsKOAr4DF2F6vhbzJbLX/hse88JanzTb59QbFo8ybrDfpB/j0oUziOzzzVFhaNOSHrb/70/PiGMS4kpxiNbSqmo0i0GA0/I1ptqoVEYQ6YCTgxJyFXGGg8JuSaoeo1CriYIj0AgiQgkW3kmsemi6LMBASHgZ8NdFm0UCAgEBAICAYFAuUMAY8OAEyc0cSQiu/KTrSKjFlTJQkDY4MlCXpRbKggIAQ8Ds3a/ZhhSkVwGERACbnNT8Io1jfZr4qXX7TZkIqkMI+BYwPEyqQO1Bxkr4ManluG2xVQ1Em68Gg7sTBEnasWEZTIzOxJwCPQoVPYSXmGsArxTWcPMI8rTlTa5Wjj6oK0q3Pi4MtaYDLAgFdFlHIGIBJy0GTT3OAh0FWN7cJDNpRB8dUWeMb0MhlvSTnqs3/iEjgQz1o96JhzMsykYvw3CHfEudCMvEU4+AmEFHALcEWJwh11VIfg16AFI5IBMecDwKUO7eoRLg2C/jd/nKp1bf2QDCTcOn9lI6VjFtgXCHbrdTM0sPOUBAVsBx0E2o2GC6HZYIDyINCCWLIbkLaEd4hJrEq+GYzX7hVQH4geTYQ/OEVH2RtIGBidlUA9EdUYexbzCTqAH4JdRVzda8S7x0go3Un4AzSCKF658I2C5mpA0pm6/hAuDLhyzxptbLLENEIQPEP6dx9EVwtQf0rIXZ2fM0cbb+aEtb8bevgyUp1uPjUMXH0Lv0Bp5pypLeFEpvs0MIq9sO7Pjy9NUexrb3CDodLaH3+NjC5UZEpl1h6BfhofpVYUewg275fROcc5EXMslApYCDo0W2MMnsdoQiOcgzD2MLYQ2HwHhWAMhXA+N/hP2V67Cp76PO97E5EIOGX9G52c3hBjJKo2cqXrDeGBv/xXtOQ9kj+IhVRxtdwLvUQi+jwhFuOHfDLohOA6pPtqhCjna9YHkZb8Fcor/5QkB3E8TB5sbGrUvDomoAeH4ChQhwq3mkllXCPoFEI75EPQMaO/e+N1Jh8CoNGE80M7vQ8QDGhS0NGglkyJoVuhyu70VVlFE+omGTysJmA1BPRvqiAwBVGQWoh41RJOR8g0eUGV7FMrKgVkyhGjwyfLKWlqlXdoI4S83CJhrcJxD6PMpx2S1gvDuh/A2CtOidMWkwT/uIFSaEI8NvdKhOoWZux7zFFde2GbhlMcUCpk9ySkheA9A606kMBj2bLt4+l34fn0JT4eQHvb4WaHuSAM1MbwHD9cYlDEdJlV5mgkK3zBBoSBgrmU1B0JCuMMe1g7BU45fUDGl8yoicHl97h9VWOXnv2P7UIY37dh1OQOGLKdsEDj1rBDMSX8ZjMvDw/YWtGsuhLKFyl5m+RDu42rYxIMe4RrwVHoEumKc0F1LhgdICLcWkDPIby7gmgbCRFEOf9FEhXghILqToaBqFUENITREFGbsCWjsYDzOwqtLXmjTDtDMT2EvaH+YHzn46WY0MLPyloGVCAoETBEwN1FACuHaBU3XmHJBi+dITH+IO8VbOeQ9YJWmjXd50zcGvhSgjQ34MfORiZmNi/AE/oiYFQaKRYZwVEE6uvlEzRz1Yamxt/fgBhvu+yEqZiJTmUTAUoNDoE8LlYvNQO23W7UApkMBT3M5OFe73fwZwzDdd4rnbbDhwYvI75VZVRwIlIqeoBqFodF/RS9xF7yYncRpVjF+L4d4kvOmnNKdrV3sOa4LB6jE//KMgKUGh2lyjDcM57/S4YqfwNZWjuvi8RDsGnhCNoL2U2j5QJoU2fdfyBaG0GbhCDWavtM5j8SOIv0AhPkEdR9BtxT07XhAXAUCkSBgqcEpMwTYh5ctS8iPgZw6L0xhchDsX/Eq/1zye2Qcig6HI3Yj+sARCTfRWzmkz4ZwL7RKF/ECgUgQsBVwmAlfYw54KwS9CoStvhVDKNnraSYDJyxtxlxyRNODVrxEvEAgnghYmihUCARWWXiElyH14Fc0uVXh/hJQudkyq/RkxuMU0nlYIag6DIJXU6DZ6ifn/dT9aTWen9QF84g+8KQ6TEvuUQPCU64Q0Nx263qTFrdODaTgzWeZdcpreZOTutzeDJ/ZSV3BXmhbmW2QqFjECNiaKBFzEYQCgTKKgBDwMnpjRLUEAgIBgYBAQCAgEBAICAQEAgIBgYBAQCAgEBAICAQEAqWFAFYz6V2iz5jVlxb/kPHMV9Ge+GMcC0dxf2JBL/F5xf1JPMaxlGC8P+ItTyxoirwCAYGAQCCJCAgFnkTwRdECAYGAQCAWBIQCjwU9kVcgIBAQCCQRgYi2OiSxfqVSNPbuvI2CLol3YT43uwj7iI7Gm29Z44czxTK8LvZHWatXWawPtogNxAk/KcmoG86lKMFLr7nJKPtsKvNQi9n1DraePlfye/Jdfs/+lMLqK6sc7PFV3S3Dfok3DmVKgeNstWoQsKHKYSiGluIEoAKcrP8BtjKrh68YSKIOYje1G0cDxN1JhTigtkwhjCb62RXAeSK2zm7Fbzg2mhZH03DAVR35X0DeHiXYp4j79j2GczfhlKiwR6BFU57TPNhw2x6K8hLI0skUL5uBzlQ9B9Apr3jSA7dG2At5bzx5RsoLZb8asmoh0syC7jQCKSxFLmZdoJP6Qm90wfNUB5u306GfOivnR7rwn8mVZVdJZZ+rpJkvY9/Fhc1nPXaoOR3+y/xQ6FOzvnr5Bdore5ppdL6ypV78rA4UtOkX27DhuQKsvFqwIvZE19SzOxcE7WJo2ddx4gG3/triCJDNeKifgLR9FAk6yreMPOw25HsQvHTby8HnPEjj8xjNTEjmkSGQn25oywXoSFjwww0Z6GBux1dBvkLnlfTj+HCY1es4kP5WYFgxEszjSFPgSsH9L4kjxzCsCjN3pu+64MURxRWP9JfdxdlhyHXJki91S+qpmvMarx//QfrxJsnvfPHFGogUfSuhhWKiwFohESPLRXvyhq4R5gFXSfpvt+T2G3kLHQHfetFbd8SiyMuWAjdvcMJjYaVNxY3IxL0w7TyiqoCfrXV7DIftRsUotkywQjtBwCajfRVMOUnsb4gfC8U7GNa47is0nB6y2g5K52X64IUSB6A07heMYO7nylGfpKFKoBf2Dgxu1gedFH3lxtThHvdBQlsYArNxSFvMlo9pIRFEKiMUGVhK7M8RkMeTZJLuOP14ctbwOth6RoP8pp9OgsK2vBcacksvKfyiyvuz83o9+DARQaFvrf3ztffW3Tp8r2WmBCTguegKTf0OWOsMlngU5fMU9IAiz625p++19TeO1Z88H2EBQoEDKCio5bhJyyPELDKyZGgybc3wiS1Yo1OgvPUfYZHZVnQs98OangILoh5lUa4yW4vr26j2ixRH89olHvYsEq800XZeKPsXoYTeI1pikAwHrY1qsqtQfuMIq1DbncLuhqL/FPUvVUWgw8eHT6mlsC2od6lJCXD6LpGFbe854ZqCzB34hEViJg2pQzjU4sMvDzX/0FvhePPHzI7p0mEchwCMn4/w/LRP8F1yHWm4eK67uPpl0cyRO1XgPdAjUW9k6vBAXRvJ2W6mmUVkXBCAYmrhd7NpYEbvE7RuJw6NvIlGBfj2C7neEEz60tazSoj+Sex23N8RUCxuTDuk4Wp0KzCXPEF5MWtgbiSMRxh1uYxb1SjuCJTQNphB2/EtGx86l4GwZus4LQdHHlPNB6HT/gnNUz626pRHrPQ425DOpf02Vj5O8qO9CXGKxd3849n4JItygL9ZIS5/6saMQ+e/0OS7R9aZpRvjdnZ+vtMfdTZM8LuKOxrTcPc8BVV2/BPfOPpz7R3XDUmURQ7ZWATl3Sik/ARFHGk890ko8DFO2TtS4Jisr2HyUKtl4mts1WksW95cbr8Rb/s8py6Jpt4pBTXfyl789r+iyRvvPDRHLXuggKG8Nbz3oVMdgftyAMpb5yCgs3FP50JJTsdtC3xQwDg3i4+IYfrhQShOReFAeSfF4YGqiTr2gBLvgQ4qZqsfo4pmwOQufAB4ZrJWCuX2u3EyhtEXJxJQzLOubDt/umPFEEmdtl8yfnBB1Z+eM6OVZNfRyge6jG2ybsJ6bTo633RgvgFxm3A/h1Ma7ukkTMP1Rfhi6Jf8oKK/gdJ2dnrhghPnrH1Nlvy6L65Qh0EW+fFa6//ccsWL9FGOuDkYDveDWakpb6q4z1MY2llF0CLDIx1BjjORRFJUQnQtc8V/biy6isCAJssOH6RD/qdgqdyF8AJY27vxcFg6WOz0qaMhENquIKLRFalH6Gz2BuJfwUvjGMCxLDbhCaj7ecCA2nQclvpshENehCE+xeVlI9HAfZgVTwFO9K1jar/qELcVHZ3tcfgqsUNPxd+z3j9Ra2NCFXjFoy2mOaxWROR5ve+9ubDyvj+bEacfb/Rk1rJ/z+RpkKUH0VkOALADMYI7gXuhe6GJ0cG93DAE3lVAT0bFx4j/T7ADuCiv15+GFWbufprz5FfqQFCXzKylk6bwuJivMrtaGac5ZCSnwHDCx93r5A3dh5/tR2scsrYkT6gCP9xkQa0D2VPfxIA8ZKgr+VL2NFv719sq/pqtflfNspYiwTkCMnsjOFWiy7u/3eTmRxotmOYqqbS67cL3x/NEKKk18GfD0q2OB+w3nRbjRJqrP63Yta37uHtKMvLHItrlKc78pM3/ppo+0JpsCfXi4ac5/Svwq6QpqCqUxxi0Kw9KYrEm/rTXF3g5C6VRqq7pmidX5PS/frfs8ibE2oNd8kvTr59eHu9G5Tf+rA6U96NmfDP3dxnZZN0j3wYNgim4Jy/BCHgJ2L+EUY+lw4vouli9dBD34Bjkryd+9HLqHoTvQ0c7kjqEnZ2e//l4vbUhHRLVBXVaUHvXNYcsC3CQgLrXUMp3kIdIMT23KBrF73Zj+SEUv8PiFPKEKvDfG37VTXYXtTGrGOJrHmz2yXlNf81WPpBjRlNacRV/bzn1j2rbMlGeo1UoLtl1vMqBznNKq56xlHOw1fSG+S3m/FeWvEpn6ks7MWDTgEFXZe7vPrLJ+vE0pFUcBPc37je77rzwH51P1Fk3EUPYWtp0b+rxwTlXD81qu+S/Q1xFqTCi4uJugvJtgYd7F6aBdqNTOQjGejUrsYqo8+UorYFdiaDJwsOVhY5qMXjk2dGWZlr6icav4hPftyWizPQT505JBN/8Vh9PAN8QHUfTiaS8qcygQZBluFuh1ZHZMEzjPYWPfg2Csj6oI/Ar69Zf5cYE8d7S9/a3SiocuUNHh+KoTlDgqkFiSHcUhMxtQl26O8oULbHMdkervKnIhCrwaNtU2vmCVsry0i63NMrLbzq37sHs9/8ru3znhpSHF0LH66+ekVt3/frWSyeNdJ+qYWoknWj4dZXdbV59wZdyqmcID8aK0o81fjZr+cRZJmmxRkEPYO5bxk9inUhzc60BPwwlNRhxOcjUF7wupuWEyJT0XbLB1RSfRdyAMkDodxe0N6tGtf09PqZ44DsWneRgbGwZjM7X1LKE0r4dyn28cgdl9iUU5lYznrjPtGGM+H4AOZhMZeQ3+9SowJnfUxh4h2PGxGEc3iX9Ddb/AofZoiOX2TPOpfh0UUKBn8bijPIdabys+v62r0FxlzTTNoxeLlU83vxvJ6v8+Ax0YAVK87kLL8i9bMyWSr+3HN985fOfc/q8PveOLqy072EIWIicuL2VFjbZ8MBjlQ5ekJQt9NEob94uKI50KJmboBwOQHF8Cl7ajisFSr4N5l/PAz1NxazFLyFz4Gp9gh4ovXHGuGjCqDttOEmYa//FRzTisXTA9DVg+hqUd4gDtmMQOUFrmWOT1SvoUE0dWPwG2t488ZwfRu/CL6Hzy5CNn/ES6FbstHyXl5uIK+TvL7D2V8bCO+TBjIVZuc2LFyyYZ2tcmvXHjdsFwVSVZbzKPlHn28ydnV6cIrtL9FNXsuuP6vsuvuXcDX/KCZb1+ZbLb328JP33Ubzsk9W2v5jTfwjewEsy5mUb8nh+xdkO+6vt736/hgdPKpdXKIdz8LDejQ5qL+5FXTRCeR4QL1ziEKAXy6edjfV9mqj0fXg+V6MD6oZ5+dlQtMp+iXjVAvxOoJO9HiOKnbHyFAocCMIqcGktglhBjSQ/lYkbGFd3su76jF3nT3xLr7ylwsxDnW5v8s1jytyktsDsRe8+ixfNbx1o+84cPqcdMtWChLSCuhOzlk2cLHnT4lxjbW2S6Jft58+TWLMzrmjI/G203BUrf2rgTcnvviTuig0HLl6+/goasv5boaN/HcIfkyLHyOQ4+NyHToEWDMTFCQUeFxjLBhOazmg3f8awgqrbK/zU9emX8XJ2etO1Ty6zq12tnVcdxq9HXp/7R+Fl2uOc1u2r8HXdrbeNr/nzpSTEyXEyjiKQlIcoOeVTqVQH4eKKAC13xYvJI1De5cJhRLYNctCbRmYYqXeHEn4Icqkf4Vq1BC8pYc1PhPJeoIzs4mwCOVLg6D0P2pWPN8mHtOkpRVUPFlg1DPHpBXX1y37oSFKLuTBigzkp23SbomyTMAe30SezNNwYyFXiHW6mj8q0mveLtQYVjrYsaLvgg5AXPXZ8cTra+1D8Hx1s+UnbJt8++p0dbWmlQeAfKu2RUWm1zaycRM9dm5Up4pwhQFMryLHaiVzieU+Yc6TAUelv8FBZvkAw1rPJ2se/Qc0t6Y2tovMpwN/6BUyCdgHSZhc8PLud3BRj3Z2EqSc2W6PthEciaEnxlxXlnYj2CZ4CgTMNgXIyiDnTYBftEQgIBAQCsSMgFHjsGAoOAgGBgEAgKQgIBZ4U2EWhAgGBgEBAICAQEAgIBAQCAgGBgEBAICAQEAiULwRoQYTOdXhQbqmLKGeBTS9J27VVFu3RopF8v/H+JL9GogYCgfKLgJgDL7/3TtRcICAQOMsREAr8LBeAWJuPnWlpOBbgHexMc7RxKNZyRX6BgEBA+Z5v6cCATToVeUl0FgL3i2v5RIAUN06QeRe7Y+lwrB7YxPUQFHkerteVzxaJWgsEyh8CznZiOmwfPeT42sSlPj9rxlLYPpePfUIsEJeOTZVjXG521FfEFtCHdh2yFuRJQoC+aejzsNdx7EA3wxbhPHTLo3Hcwu9JqpooViBw1iGQEAWOc0U6ujysG05ZdkN5Wzp8gqiq5GHDiQQKYSsOIlkGpZ+gDfOW1TgrEqgzhbVMX1IZid8+dKLXOvkSiPIxWg97w+tRvjOpxWwbvnM4WvkwsPEsBS2V8AsEBAJxRyBuChzWWB2cpnwlpkcyoYwZro4c8reG5m6NQ57oI7tf4aCnHx0xKCPEfpfyPb3LYYlWxJTCKkwdJffzXRIbCb06AfckTQNRfZ+PfQeL+QXUc7ImPsSLlyQVfBJ7E4r7Im0i7tdWv4fdTIo7WV+q19ZH+AUCZyMCMSlwsuqgcC/Dtakyq22ntGV2MQ5I9+Ms3E/tgMaXMFKRfmXwl+/BMYxWn2Wy45OsNCjEC6HcapIxCuXXEx3Zdjo+szTrgxFNTyjs51BmDZNyixFHGJObgE5mFGp3LTpN3bcwFcXN2FtQ3hcGSAP/0ZAtGCndjOsxfNFdOIGAQCCJCESlwGmKxBOcIoHytnYu1hIKrRcIUoMqrB8UxvN47tcgnIv4IuvMSkptL+ZVMVcuY7j/PTTiGnQANpMyYbiFSaYXrbKHNYHSPQIFqD/q1iyvxJai+coh7zhmsj+NGtDewLm/RE/YpBVJ23o9cHdRxYO3IaKy5Evdji93/6Xx9w9sNGMZQ1xLYPsS8rcIeUMss3UYGUzANwr3E38A+CDad2ewrDrofNfA/wrqO4kUNzrMt9EXdw6mBy4y+wHvKm6maRe7W67LIwICAYFAQhGISoHjuyw7MLddDKV1LpTGuVBcyrcVlZpKrAGU2GVQChlBpR3SACiYrkjvirzFUJqLoBB2hRAFIzBvewxz6b+A10Go+xR0BeGUvhUr23jUoxYOmB+mdA+kAXFeN+JW2mWCpX0dPs7azy2zDVZTPpuvGP2x7C5SD3+X3cUtj527YlZe1V1PZS19eYYdf0dpEisBfQM1j8z2ANfxUMibKA7KW3WIe0nysWnorD6l0QIlgHYc7sk4k0FULvLeQqMgKG/mKmEVij266RiFL3gWQB4Scm/UiguPQEAgoEMgYgUO68vtL8aaXxc75aUPK8hsCzhtgbImZZeF8L/ga6FwDzEBldiQf8ibCqXRXyGX2VoogL9Cgfyis7KDigdTNfQZDwlpmVIKO+nz6j5EG8LbaQTadTjFB8vTzRrCWv0VytvqSzQtUede+KVguudrKLf/EgRWzlOS8V2JRoEH6XwZv2dtsMoTVTy+rwccO0LRdgZGygcZ7G4DtRedVXe0YyzKw3cw9Q5t2uzBh10VxR1khLhW3hTWF7fC1AG3z/AZqj2miSJSICAQiDsCEStwUphQoD1hsTXX1sLtYi5Mo9yFZ9zqudaSW/sl1gV8JkKJvwelURMdQkYIMSZfoeB/lLzsfyFpcYiA8i4Em+1QQiEOyqkhlPp8UtxKIrQZ6nofKW+MJEYgz7qQTIjIXjT5OVye29vh1dbFFY7UqXyga26t3Zfrlk2Cx3X41UMnlQulutSMT6RxXHlHSo9O9DUo8xm4zkEdzsF93ASYb8M02QncB+EEAgKBMoxAxAqc2gALdWWxS6/AMZVC6m4JFNvlsbYT87L7ocQbW/GhuXCphK2AwomLkz1F0g+XjXnFl/pH31CG0okqe3vc3njDg99TGpR3Z1V5G4jRqXVHlKLAQUfz6I8h7noN2cF6G+95DAp/mSZO9UJPfqzoSpOOQyWKwAMFfC4w/Ds6lGpGcijow4h/EPULWacdjOuF3pE+Kud0AZGxKBEWCAgESgkBR6qQpk6QQVFohvpth3KIabkclI8fVt8OA19dEDTroLxP6SJjCGy+4qaF5sqbmMqVjzVYOXPHxY/0oxApWfx7GF7tPC+pvBcxB/5ykKY5vrb9vUF5U1JdzOW/C4z+Q4GEORc7HxhdiNFLC+MP8d2gmbPtyi7t1TJ2dRFpAgGBQHgEHFngxA5zvmtgpbWFpRyYSgiWgSmEJVBQDRE8/UIzmBbJBRYiKW+Td2iB3FCAhXhR+K1iqUbCMAyNN/M3j+z2nROGjHnTTjTiNLBUP4P/M3ofgJpWpGkGKErVYcqhsRow9zQxj05e7N7zJmUXpxwNsdjTCmvn18+5o1yuxU8emqJkgUDpIuBYgWOlhg9b4r/GnHBPbVUx+pfxNw9DeO3UgZbE1g/lb/+lZ6wIgfUf4yTD6Sp4jlf3Zu7rNvp4/dUfINZ0JOL2pa9uteS113kuUtyYMhpT4lXXUeOtKtsTVOwMndASjBCeBg5P8jya615MQQ3HKKbMuO09J1xTUGXHP80qdAKRRen5tzb99onVZukiTiAgEEg+Ao4VOFUZyjsH89EdaCs8bwJewPl9xezf2EL/BMVhuC7JKWwErOZsvBTLhKFaBdMNmZheqAIrmvwVeV5cj+Hl2z/oRSHmiQeCr9HQzkfENg19LN4e6CyegJKd2mT9+Bls/fjWh7I+rH+03srLvanHW0uy+1TaH/VXNv72kWVub4ZuRFDiwxy8rEyh8I0wVNECbWWgzKcjTD8Gi9yFdqmdTllS3to6C79AQCBQPhGISoFTU2Fpr8BlYNBf4C9k09zBNdpQ4plQXjdCeadAwR2ABjtAdFCapy9BP0VAaf+sXLEEDfleQx5alVFXIaZ/MspCZDwcRhA/Q8kuwuqZjaif4urkDd2H33vh+AeV8RRdVVT1HJpbq7xDU0WMQEAgIBCIDYGoFbjsZbtp+gD2ZSqOn5rtCu61hD7rgA0flzipFubTm0KJ01LEGVB6x5D3Iyjw5rhehXj6wk6gA3DC1IIWc/j7kfQSV94WZCJaICAQEAiUeQSiVuDUMijqebBkceZgYMoE18GIVraWO2158KXoKMwhfwMl+y2mindgzvm1khLmgRIXLgIEgNMp4GjpMHWkW8Hj9qXqwsaMLm9FXTo6vRLztwXBnD6ki3tlhFGEBQIJQyAmBa4o72DVgkvQAuuZY6muZkqCNg9BKenmoWNhfabnxXuHxdCfWVbtRD+rc81WPbsYEZb0OmIE8J7jJ1xeMcarYaG8VSiERyBQGgiUoTURpdFcUYZAQCAgEDhzEBAK/My5l6IlAgGBwFmGgFDgZ9kNF80VCAgEBAICAYGAQEAgIBAQCAgEBAICAYGAQCAaBP4f7gEVmIzBYlQAAAAASUVORK5CYII=);background-repeat:no-repeat;background-size:164px;border-radius:3px;display:inline-block;height:21px;width:21px}.fc-icon.icon-chart-bar{background-position:-2px -2px}.fc-icon.icon-chart-stripe{background-position:-25px -2px}.fc-icon.icon-chart-line{background-position:-48px -2px}.fc-icon.icon-chart-area{background-position:-71px -2px}.fc-icon.icon-chart-funnel{background-position:-95px -2px}.fc-icon.icon-chart-gauge{background-position:-118px -2px}.fc-icon.icon-chart-pie{background-position:-141px -2px}.fc-icon.icon-chart-radar{background-position:-2px -25px}.fc-icon.icon-chart-scatter{background-position:-25px -25px}.fc-icon.icon-chart-custom{background-position:-48px -25px}.fd-theme-purple,.fd-theme-purple ._fc-designer,.fd-theme-purple ._fd-config-dialog{--fc-style-color-1:#884cff;--fc-style-bg-color-1:rgba(136,76,255,.05);--el-color-primary:#884cff;--el-color-primary-light-3:#a47fff;--el-color-primary-light-5:#b599ff;--el-color-primary-light-7:#c6b3ff;--el-color-primary-light-8:#d1c2ff;--el-color-primary-light-9:#e1d6ff;--el-color-primary-dark-2:#6e3acc;--fc-style-color-4:#e000ff;--fc-style-bg-color-4:rgba(224,0,255,.05)}.fd-theme-orange,.fd-theme-orange ._fc-designer,.fd-theme-orange ._fd-config-dialog{--fc-style-color-1:#f27024;--fc-style-bg-color-1:rgba(242,112,36,.05);--el-color-primary:#f27024;--el-color-primary-light-3:#ff9a59;--el-color-primary-light-5:#ffb380;--el-color-primary-light-7:#fc9;--el-color-primary-light-8:#ffd6b3;--el-color-primary-light-9:#ffe6cc;--el-color-primary-dark-2:#c25a1d;--fc-style-color-4:#ffb600;--fc-style-bg-color-4:rgba(255,182,0,.05)}.fd-theme-pink,.fd-theme-pink ._fc-designer,.fd-theme-pink ._fd-config-dialog{--fc-style-color-1:#fe679a;--fc-style-bg-color-1:rgba(254,103,154,.05);--el-color-primary:#fe679a;--el-color-primary-light-3:#ff96b3;--el-color-primary-light-5:#ffb3c8;--el-color-primary-light-7:#ffd1dc;--el-color-primary-light-8:#ffdce5;--el-color-primary-light-9:#ffe6ed;--el-color-primary-dark-2:#cb517a;--fc-style-color-4:#bd2bff;--fc-style-bg-color-4:rgba(189,43,255,.05)}.fd-theme-green,.fd-theme-green ._fc-designer,.fd-theme-green ._fd-config-dialog{--fc-style-color-1:#18bf82;--fc-style-bg-color-1:rgba(24,191,130,.05);--el-color-primary:#18bf82;--el-color-primary-light-3:#4fd8a1;--el-color-primary-light-5:#80e6bb;--el-color-primary-light-7:#b3f1d6;--el-color-primary-light-8:#c6f5e0;--el-color-primary-light-9:#d9f9eb;--el-color-primary-dark-2:#149566;--fc-style-color-4:#e2ff00;--fc-style-bg-color-4:rgba(226,255,0,.05)}.fd-theme-green ._fc-designer .el-button--success.is-plain,.fd-theme-green ._fd-config-dialog .el-button--success.is-plain{--el-button-bg-color:#fef1e9;--el-button-text-color:#f27024;--el-button-border-color:#f9b892;--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:#f27024;--el-button-hover-border-color:#f27024;--el-button-active-bg-color:#c65e21;--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:#c65e21}._fc-upload-preview{border-radius:5px;display:inline-block;height:120px;overflow:hidden;width:120px}.form-create.is-preview ._fc-upload .el-icon--close,.form-create.is-preview ._fc-upload .el-icon--close-tip,.form-create.is-preview ._fc-upload .el-upload{display:none!important}pre code.hljs{display:block;overflow-x:auto;padding:1em}code.hljs{padding:3px 5px}.hljs{background:#fff;color:#000}.hljs-subst,.hljs-title{color:#000;font-weight:400}.hljs-title.function_{color:#7a7a43}.hljs-code,.hljs-comment,.hljs-quote{color:#8c8c8c;font-style:italic}.hljs-meta{color:#9e880d}.hljs-section{color:#871094}.hljs-built_in,.hljs-keyword,.hljs-literal,.hljs-meta .hljs-keyword,.hljs-name,.hljs-selector-attr,.hljs-selector-class,.hljs-selector-id,.hljs-selector-pseudo,.hljs-selector-tag,.hljs-symbol,.hljs-template-tag,.hljs-type,.hljs-variable.language_{color:#0033b3}.hljs-attr,.hljs-property{color:#871094}.hljs-attribute{color:#174ad4}.hljs-number{color:#1750eb}.hljs-regexp{color:#264eff}.hljs-link{color:#006dcc;text-decoration:underline}.hljs-meta .hljs-string,.hljs-string{color:#067d17}.hljs-char.escape_{color:#0037a6}.hljs-doctag{text-decoration:underline}.hljs-template-variable{color:#248f8f}.hljs-addition{background:#bee6be}.hljs-deletion{background:#d6d6d6}.hljs-emphasis{font-style:italic}.hljs-strong{font-weight:700}')),document.head.appendChild(e)}}catch(o){console.error("vite-plugin-css-injected-by-js",o)}})();
-(function(gt,n){typeof exports=="object"&&typeof module<"u"?n(exports,require("vue"),require("element-plus"),require("@form-create/element-ui"),require("@form-create/vant"),require("vant")):typeof define=="function"&&define.amd?define(["exports","vue","element-plus","@form-create/element-ui","@form-create/vant","vant"],n):(gt=typeof globalThis<"u"?globalThis:gt||self,n(gt.FcDesigner={},gt.Vue,gt.ElementPlus,gt.formCreate,gt.formCreateMobile,gt.vant))})(this,function(gt,n,ai,Eb,Ab,Sb){"use strict";var P5=Object.defineProperty;var M5=(gt,n,ai)=>n in gt?P5(gt,n,{enumerable:!0,configurable:!0,writable:!0,value:ai}):gt[n]=ai;var Dt=(gt,n,ai)=>(M5(gt,typeof n!="symbol"?n+"":n,ai),ai);const hp=e=>e&&typeof e=="object"&&"default"in e?e:{default:e},Ua=hp(Eb),St=hp(Ab),dt={type(e,t){return Object.prototype.toString.call(e)==="[object "+t+"]"},Undef(e){return e==null},Element(e){return typeof e=="object"&&e!==null&&e.nodeType===1&&!dt.Object(e)},trueArray(e){return Array.isArray(e)&&e.length>0},Function(e){const t=this.getType(e);return t==="Function"||t==="AsyncFunction"},getType(e){const t=Object.prototype.toString.call(e);return/^\[object (.*)\]$/.exec(t)[1]},empty(e){return e==null||Array.isArray(e)&&Array.isArray(e)&&!e.length?!0:typeof e=="string"&&!e}};["Date","Object","String","Boolean","Array","Number"].forEach(e=>{dt[e]=function(t){return dt.type(t,e)}});function li(e,t){return{}.hasOwnProperty.call(e,t)}function Dr(e,t,r){e[t]=r}function td(e,t={},r){let o=!1;for(let i in t)if(Object.prototype.hasOwnProperty.call(t,i)){let l=t[i];if((o=Array.isArray(l))||dt.Object(l)){let d=e[i]===void 0;if(o)o=!1,d&&Dr(e,i,[]);else if(l._clone&&r!==void 0)if(r)l=l.getRule(),d&&Dr(e,i,{});else{Dr(e,i,l._clone());continue}else d&&Dr(e,i,{});e[i]=td(e[i],l,r)}else Dr(e,i,l),dt.Undef(l)||(dt.Undef(l.__json)||(e[i].__json=l.__json),dt.Undef(l.__origin)||(e[i].__origin=l.__origin))}return r!==void 0&&Array.isArray(e)?e.filter(i=>!i||!i.__ctrl):e}function rt(e){return td({},{value:e}).value}function xb(e,t,r){return`[form-create ${e}]: ${t}`+(r?`
+(function(gt,n){typeof exports=="object"&&typeof module<"u"?n(exports,require("vue"),require("element-plus"),require("@form-create/element-ui"),require("@form-create/vant"),require("vant")):typeof define=="function"&&define.amd?define(["exports","vue","element-plus","@form-create/element-ui","@form-create/vant","vant"],n):(gt=typeof globalThis<"u"?globalThis:gt||self,n(gt.FcDesigner={},gt.Vue,gt.ElementPlus,gt.formCreate,gt.formCreateMobile,gt.vant))})(this,function(gt,n,ai,Ab,xb,kb){"use strict";var L5=Object.defineProperty;var j5=(gt,n,ai)=>n in gt?L5(gt,n,{enumerable:!0,configurable:!0,writable:!0,value:ai}):gt[n]=ai;var Dt=(gt,n,ai)=>(j5(gt,typeof n!="symbol"?n+"":n,ai),ai);const mp=e=>e&&typeof e=="object"&&"default"in e?e:{default:e},Ua=mp(Ab),At=mp(xb),dt={type(e,t){return Object.prototype.toString.call(e)==="[object "+t+"]"},Undef(e){return e==null},Element(e){return typeof e=="object"&&e!==null&&e.nodeType===1&&!dt.Object(e)},trueArray(e){return Array.isArray(e)&&e.length>0},Function(e){const t=this.getType(e);return t==="Function"||t==="AsyncFunction"},getType(e){const t=Object.prototype.toString.call(e);return/^\[object (.*)\]$/.exec(t)[1]},empty(e){return e==null||Array.isArray(e)&&Array.isArray(e)&&!e.length?!0:typeof e=="string"&&!e}};["Date","Object","String","Boolean","Array","Number"].forEach(e=>{dt[e]=function(t){return dt.type(t,e)}});function li(e,t){return{}.hasOwnProperty.call(e,t)}function Tr(e,t,r){e[t]=r}function td(e,t={},r){let o=!1;for(let i in t)if(Object.prototype.hasOwnProperty.call(t,i)){let l=t[i];if((o=Array.isArray(l))||dt.Object(l)){let d=e[i]===void 0;if(o)o=!1,d&&Tr(e,i,[]);else if(l._clone&&r!==void 0)if(r)l=l.getRule(),d&&Tr(e,i,{});else{Tr(e,i,l._clone());continue}else d&&Tr(e,i,{});e[i]=td(e[i],l,r)}else Tr(e,i,l),dt.Undef(l)||(dt.Undef(l.__json)||(e[i].__json=l.__json),dt.Undef(l.__origin)||(e[i].__origin=l.__origin))}return r!==void 0&&Array.isArray(e)?e.filter(i=>!i||!i.__ctrl):e}function rt(e){return td({},{value:e}).value}function Nb(e,t,r){return`[form-create ${e}]: ${t}`+(r?`
-rule: `+JSON.stringify(r.getRule?r.getRule():r):"")}function kb(e,t){console.error(xb("err",e,t))}const mp="[[FORM-CREATE-PREFIX-",gp="-FORM-CREATE-SUFFIX]]";function nd(e){return new Function("return "+e)()}function Vr(e,t){if(e&&dt.String(e)&&e.length>4){let r=e.trim(),o=!1;try{if(r.indexOf(gp)>0&&r.indexOf(mp)===0)r=r.replace(gp,"").replace(mp,""),o=!0;else if(r.indexOf("$FN:")===0)r=r.substring(4),o=!0;else if(r.indexOf("$EXEC:")===0)r=r.substring(6),o=!0;else if(r.indexOf("$GLOBAL:")===0){const l=r.substring(8);return r=function(...d){const c=d[0].api.getGlobalEvent(l);if(c)return c.call(this,...d)},r.__json=e,r.__inject=!0,r}else{if(r.indexOf("$FNX:")===0)return r=nd("function($inject){"+r.substring(5)+"}"),r.__json=e,r.__inject=!0,r;(!t&&r.indexOf("function ")===0&&r!=="function "||!t&&r.indexOf("function(")===0&&r!=="function(")&&(o=!0)}if(!o)return e;let i;try{i=nd(r)}catch{i=nd("function "+r)}return i.__json=e,i}catch(i){kb(`\u89E3\u6790\u5931\u8D25:${r}
+rule: `+JSON.stringify(r.getRule?r.getRule():r):"")}function Tb(e,t){console.error(Nb("err",e,t))}const gp="[[FORM-CREATE-PREFIX-",vp="-FORM-CREATE-SUFFIX]]";function nd(e){return new Function("return "+e)()}function Dr(e,t){if(e&&dt.String(e)&&e.length>4){let r=e.trim(),o=!1;try{if(r.indexOf(vp)>0&&r.indexOf(gp)===0)r=r.replace(vp,"").replace(gp,""),o=!0;else if(r.indexOf("$FN:")===0)r=r.substring(4),o=!0;else if(r.indexOf("$EXEC:")===0)r=r.substring(6),o=!0;else if(r.indexOf("$GLOBAL:")===0){const l=r.substring(8);return r=function(...d){const c=d[0].api.getGlobalEvent(l);if(c)return c.call(this,...d)},r.__json=e,r.__inject=!0,r}else{if(r.indexOf("$FNX:")===0)return r=nd("function($inject){"+r.substring(5)+"}"),r.__json=e,r.__inject=!0,r;(!t&&r.indexOf("function ")===0&&r!=="function "||!t&&r.indexOf("function(")===0&&r!=="function(")&&(o=!0)}if(!o)return e;let i;try{i=nd(r)}catch{i=nd("function "+r)}return i.__json=e,i}catch(i){Tb(`\u89E3\u6790\u5931\u8D25:${r}
-err: ${i}`);return}}return e}function id(e){const t=e.replace(/(-[a-z])/g,function(r){return r.replace("-","").toLocaleUpperCase()});return Ha(t)}function Ha(e){return e.replace(e[0],e[0].toLowerCase())}const vp={name:"zh-cn",form:{field:"\u5B57\u6BB5 ID",title:"\u5B57\u6BB5\u540D\u79F0",attributeId:"\u662F\u5426\u4E3B\u952E",fieldtype:"\u5B57\u6BB5\u7C7B\u578B",info:"\u63D0\u793A\u4FE1\u606F",ignore:"\u5FFD\u7565\u5B57\u6BB5",native:"\u662F\u5426\u663E\u793A\u6807\u9898",control:"\u7EC4\u4EF6\u8054\u52A8",labelShow:"\u662F\u5426\u663E\u793A",labelPosition:"\u6807\u7B7E\u7684\u4F4D\u7F6E",tableName:"\u81EA\u5B9A\u4E49\u540D\u79F0",labelStyle:"\u6807\u7B7E\u7684\u6837\u5F0F",labelSuffix:"\u6807\u7B7E\u7684\u540E\u7F00",formItem:"\u914D\u7F6E\u8868\u5355\u9879",formItemSpan:"\u7EC4\u4EF6\u5BBD\u5EA6",row:"\u6574\u884C",globalEvent:"\u5168\u5C40\u4E8B\u4EF6",globalFetch:"\u5168\u5C40\u6570\u636E\u6E90",globalClass:"\u5168\u5C40\u6837\u5F0F",globalConfig:"\u5168\u5C40\u914D\u7F6E",size:"\u8868\u5355\u7684\u5C3A\u5BF8",event:"\u8868\u5355\u4E8B\u4EF6",labelWidth:"\u6807\u7B7E\u7684\u5BBD\u5EA6",hideRequiredAsterisk:"\u9690\u85CF\u5FC5\u586B\u5B57\u6BB5\u7684\u6807\u7B7E\u65C1\u8FB9\u7684\u7EA2\u8272\u661F\u53F7",formItemMarginBottom:"\u8868\u5355\u9879\u7684\u4E0B\u8FB9\u8DDD",showMessage:"\u663E\u793A\u6821\u9A8C\u9519\u8BEF\u4FE1\u606F",inlineMessage:"\u4EE5\u884C\u5185\u5F62\u5F0F\u5C55\u793A\u6821\u9A8C\u4FE1\u606F",submitBtn:"\u662F\u5426\u663E\u793A\u8868\u5355\u63D0\u4EA4\u6309\u94AE",resetBtn:"\u662F\u5426\u663E\u793A\u8868\u5355\u91CD\u7F6E\u6309\u94AE",appendChild:"\u6DFB\u52A0\u5B50\u7EA7",formMode:"\u8868\u5355\u6A21\u5F0F",formName:"\u8868\u5355\u540D\u79F0",ignoreHiddenFields:"\u63D0\u4EA4\u8868\u5355\u65F6\u5FFD\u7565\u88AB\u9690\u85CF\u7684\u5B57\u6BB5",previewMode:"\u9605\u8BFB\u6A21\u5F0F",componentMode:"\u751F\u6210\u7EC4\u4EF6",sfcMode:"\u751F\u6210SFC",document:"\u5E2E\u52A9\u6587\u6863",controlDocument:"\u9700\u8981\u66F4\u8BE6\u7EC6\u7684\u914D\u7F6E\u65B9\u6CD5\uFF1F\u8BF7\u67E5\u770B{doc}",onSubmit:"\u8868\u5355\u63D0\u4EA4\u65F6\u89E6\u53D1",onReset:"\u8868\u5355\u91CD\u7F6E\u540E\u89E6\u53D1",onCreated:"\u8868\u5355\u7EC4\u4EF6\u521D\u59CB\u5316\u5B8C\u6BD5\u540E\u89E6\u53D1",onMounted:"\u8868\u5355\u7EC4\u4EF6\u6E32\u67D3\u5B8C\u6BD5\u540E\u89E6\u53D1",onReload:"\u8868\u5355\u6E32\u67D3\u89C4\u5219\u91CD\u8F7D\u540E\u89E6\u53D1",onChange:"\u8868\u5355\u7EC4\u4EF6\u7684\u503C\u53D1\u751F\u53D8\u5316\u65F6\u89E6\u53D1",beforeSubmit:"\u8868\u5355\u9A8C\u8BC1\u901A\u8FC7\u65F6\u89E6\u53D1",beforeFetch:"\u8FDC\u7A0B\u6570\u636E\u8BF7\u6C42\u53D1\u9001\u524D\u89E6\u53D1"},ai:{name:"\u667A\u80FD\u8868\u5355\u52A9\u7406",info:"\u60A8\u597D\uFF0C\u6211\u662F\u60A8\u7684\u667A\u80FD\u8868\u5355\u52A9\u624B\uFF01\u6211\u53EF\u4EE5\u5E2E\u52A9\u60A8\u5FEB\u901F\u751F\u6210\u548C\u4FEE\u6539\u8868\u5355\uFF0C\u5E2E\u52A9\u60A8\u8F7B\u677E\u9AD8\u6548\u5730\u5B8C\u6210\u8868\u5355\u8BBE\u8BA1\u3002",try:"\u4F60\u53EF\u4EE5\u8BD5\u7740\u95EE\u6211",change:"\u6362\u4E00\u6362",loading:"\u6B63\u5728\u6839\u636E\u60A8\u7684\u9700\u6C42\u5236\u4F5C\u8868\u5355\uFF0C\u8BF7\u7A0D\u5019...",fail:"\u5236\u4F5C\u8868\u5355\u65F6\u9047\u5230\u95EE\u9898\uFF0C\u8BF7\u5C1D\u8BD5\u8C03\u6574\u5185\u5BB9\u3002",success:"\u5DF2\u5904\u7406\u5B8C\u6BD5\uFF01",placeholder:"\u8BF7\u63CF\u8FF0\u60A8\u7684\u9700\u6C42"},warning:{name:"\u7EC4\u4EF6\u7684\u552F\u4E00\u6807\u8BC6\uFF0C\u7528\u4E8E\u83B7\u53D6\u548C\u4FEE\u6539\u8BE5\u7EC4\u4EF6\u7684\u914D\u7F6E\u89C4\u5219\u3002\u901A\u8FC7\u8BE5\u6807\u8BC6\u53EF\u4EE5\u7CBE\u786E\u5B9A\u4F4D\u7EC4\u4EF6\uFF0C\u5B9E\u73B0\u5BF9\u7EC4\u4EF6\u5C5E\u6027\u548C\u884C\u4E3A\u7684\u63A7\u5236\u3002",field:"\u7EC4\u4EF6\u5BF9\u5E94\u7684\u5B57\u6BB5\u540D\u7528\u4E8E\u4E0E\u7EC4\u4EF6\u7684\u6570\u636E\u8FDB\u884C\u7ED1\u5B9A\u3002\u5B57\u6BB5\u540D\u9700\u4EE5\u5B57\u6BCD\u5F00\u5934\uFF0C\u4EE5\u786E\u4FDD\u80FD\u591F\u6B63\u786E\u8BC6\u522B\u3002",formList:"\u7528\u4E8E\u7BA1\u7406\u548C\u5207\u6362\u8868\u5355\u6A21\u677F\uFF0C\u65B9\u4FBF\u5728\u4E0D\u540C\u4E1A\u52A1\u573A\u666F\u4E2D\u5FEB\u901F\u5207\u6362\u548C\u914D\u7F6E\u8868\u5355\u3002",fetch:"\u8FDC\u7A0B\u6570\u636E\u901A\u8FC7\u8FDC\u7A0B\u8BF7\u6C42\u52A0\u8F7D\u7EC4\u4EF6\u7684\u914D\u7F6E\u9879\u3002\u914D\u7F6E\u8BF7\u6C42\u53C2\u6570\u540E\uFF0C\u7EC4\u4EF6\u4F1A\u81EA\u52A8\u53D1\u8D77\u8BF7\u6C42\uFF0C\u83B7\u53D6\u8FDC\u7A0B\u6570\u636E\u5E76\u6839\u636E\u8FD4\u56DE\u7684\u7ED3\u679C\u66F4\u65B0\u7EC4\u4EF6\u3002",fetchQuery:"\u5B9A\u4E49\u8BF7\u6C42\u7684 GET \u53C2\u6570\uFF0C\u901A\u8FC7 URL \u4F20\u9012\u6570\u636E\u3002",fetchData:"\u5B9A\u4E49\u8BF7\u6C42\u7684 POST \u53C2\u6570\uFF0C\u901A\u8FC7\u8BF7\u6C42\u4F53\u4F20\u9012\u6570\u636E\u3002",fetchDataType:"\u9009\u62E9\u8BF7\u6C42\u4F53\u7684\u6570\u636E\u7C7B\u578B\uFF0C\u786E\u4FDD\u6570\u636E\u683C\u5F0F\u6B63\u786E\u3002",beforeFetch:"\u5728\u8BF7\u6C42\u53D1\u9001\u524D\uFF0C\u53EF\u901A\u8FC7\u5904\u7406\u51FD\u6570\u4FEE\u6539\u8BF7\u6C42\u53C2\u6570\uFF1B\u82E5\u9700\u7EC8\u6B62\u8BF7\u6C42\uFF0C\u76F4\u63A5\u8FD4\u56DE false \u6216\u4E00\u4E2A\u62D2\u7EDD\u7684 Promise\u3002",fetchParse:"\u8BF7\u6C42\u8FD4\u56DE\u540E\uFF0C\u53EF\u4EE5\u901A\u8FC7\u5904\u7406\u51FD\u6570\u5BF9\u8FD4\u56DE\u7684\u7ED3\u679C\u8FDB\u884C\u5904\u7406\uFF0C\u5C06\u7ED3\u679C\u8F6C\u6362\u4E3A\u7EC4\u4EF6\u6240\u9700\u7684\u6570\u636E\u548C\u7ED3\u6784\u3002",language:"\u7BA1\u7406\u9875\u9762\u7684\u591A\u8BED\u8A00\u6570\u636E\uFF0C\u5728\u7EC4\u4EF6\u4E2D\u914D\u7F6E\u4E0D\u540C\u8BED\u8A00\u7684\u6587\u672C\uFF0C\u652F\u6301\u4E00\u952E\u5207\u6362\u8BED\u8A00\u4F53\u7CFB\uFF0C\u4FBF\u4E8E\u5728\u591A\u8BED\u8A00\u73AF\u5883\u4E0B\u4F7F\u7528\u548C\u5C55\u793A\u5185\u5BB9\u3002",variable:"\u4ECE\u53D8\u91CF\u8BFB\u53D6\u914D\u7F6E\u9879\u7684\u503C\uFF0C\u652F\u6301\u901A\u8FC7\u53D8\u91CF\uFF08\u5982 Cookie\u3001localStorage\u3001\u5168\u5C40\u53D8\u91CF\u548C\u5916\u90E8\u6570\u636E\u6E90\u7B49\uFF09\u8BBE\u7F6E\u914D\u7F6E\u9879\u3002\u5F53\u5173\u8054\u7684\u53D8\u91CF\u53D8\u5316\u65F6\uFF0C\u914D\u7F6E\u9879\u4F1A\u540C\u6B65\u66F4\u65B0\u3002",variableInfo:"\u8BF7\u5728\u53D8\u91CF\u5217\u8868\u4E2D\u9009\u62E9\u53D8\u91CF\u3002\u5982\u679C\u53D8\u91CF\u7684\u503C\u662F\u5BF9\u8C61\uFF0C\u60A8\u53EF\u4EE5\u901A\u8FC7 {{variableName.attributeName}} \u683C\u5F0F\u8BBF\u95EE\u5BF9\u8C61\u4E2D\u7684\u5C5E\u6027\u503C\u3002",pageManage:"\u8BBE\u8BA1\u8868\u5355\u4E2D\u7684\u5B50\u5F39\u7A97\uFF0C\u901A\u8FC7\u4E8B\u4EF6\u89E6\u53D1\u5F39\u7A97\u663E\u793A\uFF0C\u4FBF\u4E8E\u5728\u8868\u5355\u4E2D\u52A8\u6001\u5C55\u793A\u4FE1\u606F\u6216\u8FDB\u884C\u4EA4\u4E92\u64CD\u4F5C\u3002",globalConfig:"\u7BA1\u7406\u5168\u5C40\u4E8B\u4EF6\u3001\u6837\u5F0F\u3001\u6570\u636E\u548C\u53D8\u91CF\uFF0C\u7528\u4E8E\u5728\u4E0D\u540C\u7EC4\u4EF6\u95F4\u8FDB\u884C\u6570\u636E\u5171\u4EAB\u548C\u4E8B\u4EF6\u5904\u7406\u3002",globalClass:"\u63D0\u4F9B\u5B9A\u4E49\u5168\u5C40\u6837\u5F0F\u548C Class \u7684\u529F\u80FD\uFF0C\u7528\u6237\u53EF\u4EE5\u5728\u7EC4\u4EF6\u914D\u7F6E\u4E2D\u9009\u62E9\u5E76\u5E94\u7528\u8FD9\u4E9B\u9884\u5B9A\u4E49\u7684 Class\uFF0C\u4EE5\u5B9E\u73B0\u7EDF\u4E00\u7684\u6837\u5F0F\u7BA1\u7406\u3002",globalEvent:"\u5168\u5C40\u4E8B\u4EF6\u7528\u4E8E\u5B9A\u4E49\u7EC4\u4EF6\u4E8B\u4EF6\uFF0C\u4F9B\u7EC4\u4EF6\u8FDB\u884C\u914D\u7F6E\u548C\u9009\u62E9\uFF0C\u65B9\u4FBF\u5728\u4E0D\u540C\u7EC4\u4EF6\u4E2D\u7EDF\u4E00\u4F7F\u7528\u9884\u8BBE\u4E8B\u4EF6\uFF0C\u7B80\u5316\u4E8B\u4EF6\u7684\u7BA1\u7406\u548C\u5206\u53D1\u3002",globalFetch:"\u5168\u5C40\u6570\u636E\u6E90\u7528\u4E8E\u5B9A\u4E49\u5E38\u7528\u7684\u6570\u636E\u6E90\uFF0C\u652F\u6301\u9759\u6001\u6570\u636E\u548C\u8FDC\u7A0B\u6570\u636E\u3002\u8BE5\u6570\u636E\u6E90\u53EF\u5728\u5404\u79CD\u7EC4\u4EF6\u914D\u7F6E\u4E2D\u4F7F\u7528\uFF0C\u65B9\u4FBF\u7EDF\u4E00\u7BA1\u7406\u548C\u8C03\u7528\u6570\u636E\u3002",globalVariable:"\u5168\u5C40\u53D8\u91CF\u4E2D\u53EF\u4EE5\u5B9A\u4E49\u8BA1\u7B97\u5C5E\u6027\uFF0C\u901A\u8FC7\u8868\u5355\u6570\u636E\u548C\u5916\u90E8\u6570\u636E\u8FD4\u56DE\u7EC4\u4EF6\u6240\u9700\u7684\u6570\u636E\u3002\u5173\u8054\u6570\u636E\u53D8\u5316\u65F6\uFF0C\u8BA1\u7B97\u5C5E\u6027\u4F1A\u81EA\u52A8\u66F4\u65B0\uFF0C\u53EF\u4EE5\u5728\u7ED1\u5B9A\u53D8\u91CF\u6A21\u5757\u548C\u4E8B\u4EF6\u4E2D\u4F7F\u7528\u3002",ignore:"\u5F00\u542F\u540E\uFF0C\u8868\u5355\u63D0\u4EA4\u65F6\u4F1A\u81EA\u52A8\u6392\u9664\u8BE5\u7EC4\u4EF6\u7684\u5B57\u6BB5\uFF0C\u4E0D\u4F1A\u5C06\u5176\u5305\u542B\u5728\u63D0\u4EA4\u7684\u6570\u636E\u4E2D\u3002",ignoreHiddenFields:"\u5F00\u542F\u540E\uFF0C\u8868\u5355\u63D0\u4EA4\u65F6\u4F1A\u81EA\u52A8\u8FC7\u6EE4\u6389\u88AB\u9690\u85CF\u7684\u7EC4\u4EF6\u5B57\u6BB5\uFF0C\u786E\u4FDD\u4EC5\u63D0\u4EA4\u53EF\u89C1\u7684\u5B57\u6BB5\u6570\u636E\u3002",behaviorIgnoreError:"\u5982\u679C\u52A8\u4F5C\u6267\u884C\u8FC7\u7A0B\u4E2D\u53D1\u751F\u9519\u8BEF\uFF0C\u662F\u5426\u7EE7\u7EED\u6267\u884C\u540E\u7EED\u7684\u52A8\u4F5C\u3002",behaviorExpression:"\u5F53\u6761\u4EF6\u8FBE\u6210\u65F6\uFF0C\u52A8\u4F5C\u624D\u4F1A\u88AB\u6267\u884C\u3002",behaviorStopPropagation:"\u5F53\u6761\u4EF6\u8FBE\u6210\u65F6\uFF0C\u4F1A\u963B\u6B62\u540E\u7EED\u52A8\u4F5C\u7684\u6267\u884C\u3002",computedCondition:"\u901A\u8FC7\u5B9A\u4E49\u6761\u4EF6\uFF0C\u7EC4\u4EF6\u7684\u72B6\u6001\u548C\u6570\u636E\u503C\u4F1A\u6839\u636E\u6761\u4EF6\u662F\u5426\u6210\u7ACB\u81EA\u52A8\u8C03\u6574\u3002",computedFormula:"\u901A\u8FC7\u516C\u5F0F\u548C\u8868\u5355\u6570\u636E\uFF0C\u52A8\u6001\u8BA1\u7B97\u7EC4\u4EF6\u7684\u72B6\u6001\u548C\u6570\u636E\u503C\u3002"},computed:{value:{title:"\u6570\u636E\u8054\u52A8",btn:"\u8BBE\u7F6E\u6570\u636E\u8054\u52A8",name:"\u8BBE\u7F6E\u7EC4\u4EF6\u7684\u503C"},hidden:{title:"\u9690\u85CF\u6761\u4EF6",btn:"\u8BBE\u7F6E\u9690\u85CF\u6761\u4EF6",name:"\u8BBE\u7F6E\u7EC4\u4EF6\u7684\u9690\u85CF\u6761\u4EF6"},required:{title:"\u5FC5\u586B\u6761\u4EF6",btn:"\u8BBE\u7F6E\u5FC5\u586B\u6761\u4EF6",name:"\u8BBE\u7F6E\u7EC4\u4EF6\u7684\u5FC5\u586B\u6761\u4EF6"},disabled:{title:"\u7981\u7528\u6761\u4EF6",btn:"\u8BBE\u7F6E\u7981\u7528\u6761\u4EF6",name:"\u8BBE\u7F6E\u7EC4\u4EF6\u7684\u7981\u7528\u6761\u4EF6"},formulas:{"==":"\u7B49\u4E8E","!=":"\u4E0D\u7B49\u4E8E",on:"\u5305\u542B",notOn:"\u4E0D\u5305\u542B",empty:"\u4E3A\u7A7A",notEmpty:"\u4E0D\u4E3A\u7A7A",pattern:"\u6B63\u5219\u8868\u8FBE\u5F0F",">":"\u5927\u4E8E",">=":"\u5927\u4E8E\u7B49\u4E8E","<":"\u5C0F\u4E8E","<=":"\u5C0F\u4E8E\u7B49\u4E8E"},variable:{attr:"\u5C5E\u6027\u5217\u8868",bind:"\u7ED1\u5B9A\u53D8\u91CF",list:"\u53D8\u91CF\u5217\u8868",btn:"\u8BBE\u7F6E\u53D8\u91CF",title:"\u5168\u5C40\u53D8\u91CF",create:"\u521B\u5EFA\u53D8\u91CF",placeholder:"\u8BF7\u8F93\u5165\u53D8\u91CF\u7684\u63CF\u8FF0\u4FE1\u606F"},linkage:{trigger:"\u89E6\u53D1\u4EE5\u4E0B\u8054\u52A8",info:["\u5F53\u524D\u7EC4\u4EF6\u8054\u52A8\u663E\u793A","\u7684\u503C"]},name:"\u8BA1\u7B97\u516C\u5F0F",setting:"\u8BBE\u7F6E\u6761\u4EF6",invert:"\u6761\u4EF6\u6210\u7ACB\u540E\u7EC4\u4EF6\u72B6\u6001",condition:"\u903B\u8F91\u6761\u4EF6",addCondition:"\u6DFB\u52A0\u6761\u4EF6",addGroup:"\u6DFB\u52A0\u6761\u4EF6\u7EC4",form:"\u5F53\u524D\u8868\u5355",subform:"\u5B50\u8868\u5355",formula:"\u51FD\u6570\u516C\u5F0F",formulaInfo:"\u51FD\u6570\u8BF4\u660E",formulaExample:"\u51FD\u6570\u793A\u4F8B",fieldUsed:"\u3010{label}\u3011\u5728\u8BA1\u7B97\u516C\u5F0F\u4E2D\u88AB\u4F7F\u7528\uFF0C\u8BF7\u5148\u4FEE\u6539\u5BF9\u5E94\u516C\u5F0F",fieldExist:"\u3010{label}\u3011\u5B57\u6BB5\u5DF2\u5B58\u5728",fieldEmpty:"\u5B57\u6BB5\u540D\u79F0\u4E0D\u80FD\u4E3A\u7A7A",fieldChar:"\u5B57\u6BB5\u540D\u79F0\u5FC5\u987B\u4EE5\u5B57\u6BCD\u5F00\u5934"},validate:{type:"\u5B57\u6BB5\u7C7B\u578B",typePlaceholder:"\u8BF7\u9009\u62E9",trigger:"\u89E6\u53D1\u65B9\u5F0F",mode:"\u9A8C\u8BC1\u65B9\u5F0F",modes:{required:"\u5FC5\u586B",notRequired:"\u975E\u5FC5\u586B",pattern:"\u6B63\u5219\u8868\u8FBE\u5F0F",validator:"\u81EA\u5B9A\u4E49\u9A8C\u8BC1",min:"\u6700\u5C0F\u503C",max:"\u6700\u5927\u503C",len:"\u957F\u5EA6"},types:{string:"\u6587\u672C",boolean:"\u5E03\u5C14",array:"\u591A\u9009",number:"\u6570\u5B57",integer:"\u6574\u6570",float:"\u5C0F\u6570",object:"\u5408\u96C6",date:"\u65E5\u671F",url:"URL\u94FE\u63A5",email:"\u90AE\u7BB1\u5730\u5740"},message:"\u9519\u8BEF\u4FE1\u606F",auto:"\u81EA\u52A8\u83B7\u53D6",autoRequired:"\u8BF7\u8F93\u5165{title}",autoMode:"\u8BF7\u8F93\u5165\u6B63\u786E\u7684{title}",requiredPlaceholder:"\u8BF7\u8F93\u5165\u63D0\u793A\u8BED",required:"\u662F\u5426\u5FC5\u586B",rule:"\u9A8C\u8BC1\u89C4\u5219"},tableOptions:{handle:"\u64CD\u4F5C",add:"\u6DFB\u52A0",empty1:"\u70B9\u51FB\u53F3\u4E0B\u89D2",empty2:"\u6309\u94AE\u6DFB\u52A0\u4E00\u5217",rmCol:"\u5220\u9664\u5F53\u524D\u5217",rmRow:"\u5220\u9664\u5F53\u524D\u884C",splitRow:"\u62C6\u5206\u6210\u884C",splitCol:"\u62C6\u5206\u6210\u5217",mergeBottom:"\u5411\u4E0B\u5408\u5E76",mergeRight:"\u5411\u53F3\u5408\u5E76",addTop:"\u6DFB\u52A0\u4E0A\u5217",addBottom:"\u6DFB\u52A0\u4E0B\u5217",addLeft:"\u6DFB\u52A0\u5DE6\u5217",addRight:"\u6DFB\u52A0\u53F3\u5217",keyValue:"\u952E\u503C\u5BF9"},struct:{title:"\u7F16\u8F91\u6570\u636E",only:"\u3010{label}\u3011\u53EA\u5141\u8BB8\u6DFB\u52A0\u4E00\u4E2A",errorMsg:"\u8F93\u5165\u7684\u5185\u5BB9\u8BED\u6CD5\u9519\u8BEF",configured:"\u5DF2\u914D\u7F6E",configuredData:"\u5DF2\u914D\u7F6E {num} \u4E2A\u6570\u636E\u6E90",configuredEvent:"\u5DF2\u914D\u7F6E {num} \u4E2A\u4E8B\u4EF6"},class:{title:"\u8BBE\u7F6E\u6837\u5F0F",create:"\u521B\u5EFA\u6837\u5F0F",placeholder:"\u8BF7\u8F93\u5165\u6837\u5F0F\u7684\u63CF\u8FF0\u4FE1\u606F",saveMsg:"\u8BF7\u5148\u4FDD\u5B58\u5F53\u524D\u6B63\u5728\u7F16\u8F91\u7684\u6837\u5F0F",configured:"\u5DF2\u914D\u7F6E {num} \u4E2A\u6837\u5F0F"},event:{title:"\u8BBE\u7F6E\u4E8B\u4EF6",create:"\u521B\u5EFA\u4E8B\u4EF6",list:"\u4E8B\u4EF6\u5217\u8868",placeholder:"\u8BF7\u8F93\u5165\u4E8B\u4EF6\u7684\u540D\u79F0",saveMsg:"\u8BF7\u5148\u4FDD\u5B58\u5F53\u524D\u6B63\u5728\u7F16\u8F91\u7684\u4E8B\u4EF6",type:"\u7C7B\u578B",info:"\u8BF4\u660E",action:"\u7F16\u8F91\u884C\u4E3A",inject:{api:"\u5F53\u524D\u8868\u5355\u7684api",rule:"\u5F53\u524D\u8868\u5355\u7684\u751F\u6210\u89C4\u5219",self:"\u7EC4\u4EF6\u7684\u751F\u6210\u89C4\u5219",option:"\u8868\u5355\u7684\u914D\u7F6E",args:"\u4E8B\u4EF6\u7684\u539F\u59CB\u53C2\u6570"}},eventInfo:{blur:"\u5931\u53BB\u7126\u70B9\u65F6\u89E6\u53D1",focus:"\u83B7\u5F97\u7126\u70B9\u65F6\u89E6\u53D1",change:"\u5F53\u7ED1\u5B9A\u503C\u53D8\u5316\u65F6\u89E6\u53D1",input:"\u5728\u503C\u6539\u53D8\u65F6\u89E6\u53D1",clear:"\u5728\u70B9\u51FB\u6E05\u7A7A\u6309\u94AE\u65F6\u89E6\u53D1",close:"\u5173\u95ED\u7EC4\u4EF6\u65F6\u89E6\u53D1",click:"\u70B9\u51FB\u7EC4\u4EF6\u65F6\u89E6\u53D1",add:"\u589E\u52A0\u65F6\u89E6\u53D1",delete:"\u5220\u9664\u65F6\u89E6\u53D1",remove:"\u5220\u9664\u65F6\u89E6\u53D1",visibleChange:"\u4E0B\u62C9\u6846\u51FA\u73B0/\u9690\u85CF\u65F6\u89E6\u53D1",calendarChange:"\u5728\u65E5\u5386\u6240\u9009\u65E5\u671F\u66F4\u6539\u65F6\u89E6\u53D1",panelChange:"\u5F53\u65E5\u671F\u9762\u677F\u6539\u53D8\u65F6\u89E6\u53D1",open:"\u6253\u5F00\u7684\u56DE\u8C03",opened:"\u6253\u5F00\u52A8\u753B\u7ED3\u675F\u65F6\u7684\u56DE\u8C03",closed:"\u5173\u95ED\u52A8\u753B\u7ED3\u675F\u65F6\u7684\u56DE\u8C03",openAutoFocus:"\u8F93\u5165\u7126\u70B9\u805A\u7126\u5728\u5185\u5BB9\u65F6\u7684\u56DE\u8C03",closeAutoFocus:"\u8F93\u5165\u7126\u70B9\u4ECE\u5185\u5BB9\u5931\u7126\u65F6\u7684\u56DE\u8C03",submit:"\u8868\u5355\u63D0\u4EA4\u65F6\u89E6\u53D1",confirm:"\u70B9\u51FB\u786E\u8BA4\u6309\u94AE\u65F6\u89E6\u53D1",validateFail:"\u8868\u5355\u9A8C\u8BC1\u5931\u8D25\u65F6\u89E6\u53D1",beforeLoad:"\u521D\u59CB\u5316\u4E4B\u524D\u89E6\u53D1",loaded:"\u521D\u59CB\u5316\u5B8C\u6210\u4E4B\u540E\u89E6\u53D1",hook_load:"\u7EC4\u4EF6\u89C4\u5219\u52A0\u8F7D\u540E\u89E6\u53D1",hook_mounted:"\u7EC4\u4EF6\u6302\u8F7D\u540E\u89E6\u53D1",hook_deleted:"\u7EC4\u4EF6\u89C4\u5219\u88AB\u79FB\u9664\u540E\u89E6\u53D1",hook_watch:"\u7EC4\u4EF6\u89C4\u5219\u53D1\u751F\u53D8\u5316\u540E\u89E6\u53D1",hook_value:"\u7EC4\u4EF6\u7684\u503C\u53D1\u751F\u53D8\u5316\u540E\u89E6\u53D1",hook_hidden:"\u7EC4\u4EF6\u663E\u793A\u72B6\u6001\u53D1\u751F\u53D8\u5316\u540E\u89E6\u53D1"},fetch:{info:"\u5B9A\u4E49\u8BF7\u6C42\u65F6\uFF0C\u652F\u6301\u901A\u8FC7\u53CC\u5927\u62EC\u53F7\u8BED\u6CD5\uFF08\u5982 {{token}}\uFF09\u4F7F\u7528\u53D8\u91CF\u3002\u5728\u63A5\u53E3\u8BF7\u6C42\u65F6\u4F1A\u81EA\u52A8\u8BFB\u53D6\u8FD9\u4E9B\u53D8\u91CF\u3002\u5982\u679C\u53D8\u91CF\u7684\u503C\u662F\u5BF9\u8C61\uFF0C\u53EF\u4EE5\u901A\u8FC7 {{variableName.attributeName}} \u8BBF\u95EE\u5BF9\u8C61\u7684\u5C5E\u6027\u503C\u3002",title:"\u8BBE\u7F6E\u6570\u636E\u6E90",create:"\u521B\u5EFA\u6570\u636E\u6E90",config:"\u8BF7\u6C42\u914D\u7F6E",action:"\u8BF7\u6C42\u94FE\u63A5",actionRequired:"\u8BF7\u8F93\u5165\u6B63\u786E\u7684\u94FE\u63A5",placeholder:"\u8BF7\u8F93\u5165\u6570\u636E\u6E90\u7684\u63CF\u8FF0\u4FE1\u606F",method:"\u8BF7\u6C42\u65B9\u5F0F",data:"\u9644\u5E26\u6570\u636E",dataType:"\u6570\u636E\u7C7B\u578B",headers:"\u8BF7\u6C42\u5934\u90E8",query:"\u8BF7\u6C42\u53C2\u6570",parse:"\u6570\u636E\u5904\u7406",response:"\u63A5\u53E3\u8FD4\u56DE\u7684\u6570\u636E",onError:"\u9519\u8BEF\u5904\u7406",beforeFetch:"\u524D\u7F6E\u5904\u7406",remote:"\u8FDC\u7A0B\u6570\u636E",static:"\u9759\u6001\u6570\u636E",optionsType:{fetch:"\u8FDC\u7A0B\u6570\u636E",global:"\u5168\u5C40\u6570\u636E\u6E90",struct:"\u9759\u6001\u6570\u636E"}},style:{width:"\u5BBD\u5EA6",height:"\u9AD8\u5EA6",minWidth:"\u6700\u5C0F\u5BBD",minHeight:"\u6700\u5C0F\u9AD8",maxWidth:"\u6700\u5927\u5BBD",maxHeight:"\u6700\u5927\u9AD8",color:"\u989C\u8272",backgroundColor:"\u80CC\u666F\u8272",margin:"\u5916\u8FB9\u8DDD",padding:"\u5185\u8FB9\u8DDD",borderRadius:"\u5706\u89D2",border:"\u8FB9\u6846",solid:"\u5B9E\u7EBF",dashed:"\u865A\u7EBF",dotted:"\u70B9\u72B6\u865A\u7EBF",double:"\u53CC\u5B9E\u7EBF",opacity:"\u900F\u660E\u5EA6",scale:"\u7F29\u653E",overflow:{name:"\u6EA2\u51FA",visible:"\u53EF\u89C1",hidden:"\u9690\u85CF",scroll:"\u6EDA\u52A8",auto:"\u6EA2\u51FA\u540E\u81EA\u52A8\u6EDA\u52A8"},shadow:{name:"\u9634\u5F71",x:"x\u8F74\u504F\u79FB\u91CF",y:"y\u8F74\u504F\u79FB\u91CF",vague:"\u6A21\u7CCA\u534A\u5F84",extend:"\u6269\u6563\u534A\u5F84",inset:"\u5411\u5185",external:"\u5411\u5916",mode:"\u6A21\u5F0F",classic:"\u7ECF\u5178",flat:"\u6241\u5E73",solid:"\u7ACB\u4F53"},display:{name:"\u5E03\u5C40",block:"\u533A\u5757","inline-block":"\u884C\u5185\u533A\u5757",inline:"\u884C\u5185\u6587\u672C",flex:"\u5F39\u6027\u76D2\u5B50"},flexDirection:{name:"\u4E3B\u8F74\u7684\u65B9\u5411",row:"\u4E3B\u8F74\u4E3A\u6C34\u5E73\u65B9\u5411\uFF0C\u8D77\u70B9\u5728\u5DE6\u7AEF","row-reverse":"\u4E3B\u8F74\u4E3A\u6C34\u5E73\u65B9\u5411\uFF0C\u8D77\u70B9\u5728\u53F3\u7AEF",column:"\u4E3B\u8F74\u4E3A\u5782\u76F4\u65B9\u5411\uFF0C\u8D77\u70B9\u5728\u4E0A\u6CBF","column-reverse":"\u4E3B\u8F74\u4E3A\u5782\u76F4\u65B9\u5411\uFF0C\u8D77\u70B9\u5728\u4E0B\u6CBF"},flexWrap:{name:"\u662F\u5426\u6362\u884C",nowrap:"\u4E0D\u6362\u884C",wrap:"\u6362\u884C"},justifyContent:{name:"\u4E3B\u8F74\u4E0A\u7684\u5BF9\u9F50\u65B9\u5F0F","flex-start":"\u5DE6\u5BF9\u9F50","flex-end":"\u53F3\u5BF9\u9F50",center:"\u5C45\u4E2D","space-between":"\u4E24\u7AEF\u5BF9\u9F50","space-around":"\u5B50\u5143\u7D20\u4E24\u4FA7\u7684\u95F4\u9694\u76F8\u7B49","space-evenly":"\u5B50\u5143\u7D20\u5E73\u5747\u5206\u5E03\u5728\u4E3B\u8F74\u4E0A"},alignItems:{name:"\u5B50\u5143\u7D20\u4EA4\u53C9\u8F74\u4E0A\u7684\u5BF9\u9F50\u65B9\u5F0F","flex-start":"\u4EA4\u53C9\u8F74\u7684\u8D77\u70B9\u5BF9\u9F50","flex-end":"\u4EA4\u53C9\u8F74\u7684\u7EC8\u70B9\u5BF9\u9F50",center:"\u4EA4\u53C9\u8F74\u7684\u4E2D\u70B9\u5BF9\u9F50",baseline:"\u6CBF\u7B2C\u4E00\u884C\u6587\u5B57\u7684\u57FA\u7EBF\u5BF9\u9F50",stretch:"\u6EE1\u6574\u4E2A\u5BB9\u5668\u7684\u9AD8\u5EA6"},alignContent:{name:"\u591A\u884C\u5B50\u5143\u7D20\u5728\u4EA4\u53C9\u8F74\u4E0A\u7684\u5BF9\u9F50\u65B9\u5F0F","flex-start":"\u4E0E\u4EA4\u53C9\u8F74\u7684\u8D77\u70B9\u5BF9\u9F50","flex-end":"\u4E0E\u4EA4\u53C9\u8F74\u7684\u7EC8\u70B9\u5BF9\u9F50",center:"\u4E0E\u4EA4\u53C9\u8F74\u7684\u4E2D\u70B9\u5BF9\u9F50","space-between":"\u4E0E\u4EA4\u53C9\u8F74\u4E24\u7AEF\u5BF9\u9F50","space-around":"\u591A\u884C\u5B50\u5143\u7D20\u5E73\u5747\u5206\u5E03\u5728\u4EA4\u53C9\u8F74",stretch:"\u8F74\u7EBF\u5360\u6EE1\u6574\u4E2A\u4EA4\u53C9\u8F74"},font:{name:"\u5B57\u4F53",size:"\u5927\u5C0F",align:"\u5BF9\u9F50\u65B9\u5F0F",height:"\u884C\u9AD8",spacing:"\u5B57\u95F4\u8DDD",preview:"\u6837\u5F0F\u9884\u89C8"},decoration:{name:"\u4FEE\u9970",underline:"\u4E0B\u5212\u7EBF","line-through":"\u5220\u9664\u7EBF",overline:"\u4E0A\u5212\u7EBF"},weight:{name:"\u7C97\u7EC6",300:"\u7EC6\u4F53",400:"\u5E38\u89C4\u4F53",500:"\u4E2D\u9ED1\u4F53",700:"\u4E2D\u7C97\u4F53"}},designer:{component:"\u7EC4\u4EF6\u914D\u7F6E",id:"\u552F\u4E00\u503C",name:"\u7F16\u53F7",type:"\u7EC4\u4EF6\u7C7B\u578B",form:"\u8868\u5355\u914D\u7F6E",json:"\u6E32\u67D3\u89C4\u5219",style:"\u6837\u5F0F\u914D\u7F6E",rule:"\u57FA\u7840\u914D\u7F6E",advanced:"\u9AD8\u7EA7\u914D\u7F6E",props:"\u5C5E\u6027\u914D\u7F6E",slots:"\u63D2\u69FD\u914D\u7F6E",customProps:"\u81EA\u5B9A\u4E49\u5C5E\u6027\u914D\u7F6E",validate:"\u9A8C\u8BC1\u914D\u7F6E",event:"\u4E8B\u4EF6\u914D\u7F6E",clearWarn:"\u6E05\u7A7A\u540E\u5C06\u4E0D\u80FD\u6062\u590D\uFF0C\u786E\u5B9A\u8981\u6E05\u7A7A\u5417\uFF1F",childEmpty:"\u70B9\u51FB\u53F3\u4E0B\u89D2 \\e789 \u6309\u94AE\u6DFB\u52A0\u4E00\u5217",dragEmpty:"\u62D6\u62FD\u5DE6\u4FA7\u5217\u8868\u4E2D\u7684\u7EC4\u4EF6\u5230\u6B64\u5904",unload:"\u786E\u5B9A\u79BB\u5F00\u5F53\u524D\u9875\u9762\u5417?",sublist:"\u5B50\u8282\u70B9\u5217\u8868",formList:"\u8868\u5355\u5217\u8868",comList:"\u7EC4\u4EF6\u5217\u8868",addPage:"\u6DFB\u52A0\u6A21\u5757",pageManage:"\u6A21\u5757\u7BA1\u7406",gridLine:"\u8F85\u52A9\u7EBF",main:"\u4E3B\u4F53",layout:"\u5FEB\u901F\u5E03\u5C40",col1:"\u4E00\u5217",col2:"\u4E24\u5217",col3:"\u4E09\u5217",col4:"\u56DB\u5217",print:{title:"\u6253\u5370\u8868\u5355",config:"\u8BBE\u7F6E\u6253\u5370",left:"\u5DE6\u8FB9\u8DDD",right:"\u53F3\u8FB9\u8DDD",top:"\u4E0A\u8FB9\u8DDD",bottom:"\u4E0B\u8FB9\u8DDD",defaultStyle:"\u9ED8\u8BA4\u6837\u5F0F",wordStyle:"\u6587\u6863\u6837\u5F0F",export:"\u5BFC\u51FA PDF"}},menu:{template:"\u6A21\u677F",main:"\u57FA\u7840\u7EC4\u4EF6",aide:"\u8F85\u52A9\u7EC4\u4EF6",layout:"\u5E03\u5C40\u7EC4\u4EF6",component:"\u7EC4\u4EF6",subform:"\u5B50\u8868\u5355\u7EC4\u4EF6",container:"\u5BB9\u5668\u7EC4\u4EF6",chart:"\u56FE\u8868\u7EC4\u4EF6",tree:"\u5927\u7EB2"},formula:{math:"\u6570\u5B57\u5904\u7406",string:"\u6587\u672C\u5904\u7406",date:"\u65F6\u95F4\u5904\u7406",collection:"\u5408\u96C6\u5904\u7406",condition:"\u903B\u8F91\u5904\u7406",ADD:"\u83B7\u53D6\u4E24\u4E2A\u6570\u5B57\u76F8\u52A0\u7684\u503C",SUB:"\u83B7\u53D6\u4E24\u4E2A\u6570\u5B57\u76F8\u51CF\u7684\u503C",MUL:"\u83B7\u53D6\u4E24\u4E2A\u6570\u5B57\u76F8\u4E58\u7684\u503C",DIV:"\u83B7\u53D6\u4E24\u4E2A\u6570\u5B57\u76F8\u9664\u7684\u503C",SUM:"\u83B7\u53D6\u5408\u96C6\u4E2D\u6570\u503C\u7684\u603B\u548C",MAX:"\u83B7\u53D6\u53C2\u6570\u5217\u8868\u4E2D\u7684\u6700\u5927\u503C",MIN:"\u83B7\u53D6\u53C2\u6570\u5217\u8868\u4E2D\u7684\u6700\u5C0F\u503C",ABS:"\u83B7\u53D6\u6570\u5B57\u7684\u7EDD\u5BF9\u503C",AVG:"\u83B7\u53D6\u53C2\u6570\u5217\u8868\u7684\u5E73\u5747\u503C",POWER:"\u83B7\u53D6\u6307\u5B9A\u6570\u5B57\u7684\u4E58\u5E42",RAND:"\u83B7\u53D6\u4E00\u4E2A\u5927\u4E8E\u7B49\u4E8E0\u4E14\u5C0F\u4E8E1\u7684\u968F\u673A\u6570",PI:"\u83B7\u53D6\u5706\u5468\u7387",ROUND:"\u5C06\u4E00\u4E2A\u5C0F\u6570\u56DB\u820D\u4E94\u5165\u5230\u6307\u5B9A\u7684\u4F4D\u6570",SQRT:"\u83B7\u53D6\u4E00\u4E2A\u6570\u5B57\u7684\u6B63\u5E73\u65B9\u6839",NOW:"\u83B7\u53D6\u5F53\u524D\u7684\u65F6\u95F4",TODAY:"\u83B7\u53D6\u4ECA\u5929\u7684\u65E5\u671F",YEAR:"\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u5E74\u4EFD",MONTH:"\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u6708\u4EFD",DAY:"\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u5929\u6570",HOUR:"\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u5C0F\u65F6\u6570",MINUTE:"\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u5206\u949F\u6570",SECOND:"\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u79D2\u6570",DIFFDAYS:"\u83B7\u53D6\u4E24\u4E2A\u65E5\u671F\u4E4B\u95F4\u7684\u5929\u6570",DIFFHOURS:"\u83B7\u53D6\u4E24\u4E2A\u65F6\u95F4\u4E4B\u95F4\u7684\u5C0F\u65F6\u6570,\u4FDD\u7559\u4E24\u4F4D\u5C0F\u6570",DIFFMINUTES:"\u83B7\u53D6\u4E24\u4E2A\u65F6\u95F4\u4E4B\u95F4\u7684\u5206\u949F\u6570",ADDYEAR:"\u589E\u52A0\u6307\u5B9A\u65E5\u671F\u7684\u5E74\u4EFD",ADDMONTH:"\u589E\u52A0\u6307\u5B9A\u65E5\u671F\u7684\u6708\u4EFD",ADDDAY:"\u589E\u52A0\u6307\u5B9A\u65E5\u671F\u7684\u5929\u6570",ADDWEEK:"\u589E\u52A0\u6307\u5B9A\u65E5\u671F\u7684\u5468\u6570",ADDHOUR:"\u589E\u52A0\u6307\u5B9A\u65F6\u95F4\u7684\u5C0F\u65F6\u6570",ADDMINUTE:"\u589E\u52A0\u6307\u5B9A\u65F6\u95F4\u7684\u5206\u949F\u6570",ADDSECOND:"\u589E\u52A0\u6307\u5B9A\u65F6\u95F4\u7684\u79D2\u6570",SUBYEAR:"\u51CF\u5C11\u6307\u5B9A\u65E5\u671F\u7684\u5E74\u4EFD",SUBMONTH:"\u51CF\u5C11\u6307\u5B9A\u65E5\u671F\u7684\u6708\u4EFD",SUBDAY:"\u51CF\u5C11\u6307\u5B9A\u65E5\u671F\u7684\u5929\u6570",SUBWEEK:"\u51CF\u5C11\u6307\u5B9A\u65E5\u671F\u7684\u5468\u6570",SUBHOUR:"\u51CF\u5C11\u6307\u5B9A\u65F6\u95F4\u7684\u5C0F\u65F6\u6570",SUBMINUTE:"\u51CF\u5C11\u6307\u5B9A\u65F6\u95F4\u7684\u5206\u949F\u6570",SUBSECOND:"\u51CF\u5C11\u6307\u5B9A\u65F6\u95F4\u7684\u79D2\u6570",TIMESTAMP:"\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u65F6\u95F4\u6233",STARTSWITH:"\u68C0\u67E5\u5B57\u7B26\u4E32\u662F\u5426\u4EE5\u6307\u5B9A\u5B57\u7B26\u4E32\u5F00\u5934",EMPTY:"\u68C0\u67E5\u53C2\u6570\u662F\u5426\u4E3A\u7A7A",NOTEMPTY:"\u68C0\u67E5\u53C2\u6570\u662F\u5426\u4E0D\u4E3A\u7A7A",LEN:"\u83B7\u53D6\u6307\u5B9A\u5408\u96C6\u7684\u957F\u5EA6",MOD:"\u83B7\u53D6\u4E24\u4E2A\u6570\u5B57\u7684\u4F59\u6570",FLOOR:"\u83B7\u53D6\u6307\u5B9A\u6570\u5B57\u5411\u4E0B\u53D6\u6574\u7684\u503C",CEIL:"\u83B7\u53D6\u6307\u5B9A\u6570\u5B57\u5411\u4E0A\u53D6\u6574\u7684\u503C",FIXED:"\u5C06\u4E00\u4E2A\u5C0F\u6570\u4FDD\u7559\u6307\u5B9A\u4F4D\u6570\u7684\u5C0F\u6570",ISNUMBER:"\u68C0\u67E5\u53C2\u6570\u662F\u5426\u4E3A\u6570\u5B57",TONUMBER:"\u5C06\u53C2\u6570\u8F6C\u6362\u4E3A\u6570\u5B57",SLICELEFT:"\u83B7\u53D6\u4E00\u4E2A\u5B57\u7B26\u4E32\u4ECE\u5F00\u5934\u5F00\u59CB\u6307\u5B9A\u957F\u5EA6\u7684\u5B57\u7B26\u4E32",SLICERIGHT:"\u83B7\u53D6\u4E00\u4E2A\u5B57\u7B26\u4E32\u4ECE\u7ED3\u5C3E\u5F00\u59CB\u6307\u5B9A\u957F\u5EA6\u7684\u5B57\u7B26\u4E32",TOLOWER:"\u5C06\u5B57\u7B26\u4E32\u4E2D\u6240\u6709\u5927\u5199\u5B57\u6BCD\u8F6C\u6362\u4E3A\u5C0F\u5199\u5B57\u6BCD",TOUPPER:"\u5C06\u5B57\u7B26\u4E32\u4E2D\u6240\u6709\u5C0F\u5199\u5B57\u6BCD\u8F6C\u6362\u4E3A\u5927\u5199\u5B57\u6BCD",INCLUDES:"\u68C0\u67E5\u5B57\u7B26\u4E32\u4E2D\u662F\u5426\u5305\u542B\u6307\u5B9A\u5B57\u7B26\u4E32",REPLACE:"\u5C06\u5B57\u7B26\u4E32\u4E2D\u7684\u90E8\u5206\u6587\u672C\u66FF\u6362\u4E3A\u4E0D\u540C\u7684\u6587\u672C,\u53EA\u66FF\u6362\u5339\u914D\u5230\u7684\u7B2C\u4E00\u4E2A",REPLACEALL:"\u5C06\u5B57\u7B26\u4E32\u4E2D\u7684\u90E8\u5206\u6587\u672C\u66FF\u6362\u4E3A\u4E0D\u540C\u7684\u6587\u672C,\u66FF\u6362\u6240\u6709\u5339\u914D\u5230\u7684",TRIM:"\u5C06\u5B57\u7B26\u4E32\u524D\u540E\u7684\u7A7A\u683C\u5220\u9664",TOCHINSESAMOUNT:"\u83B7\u53D6\u6307\u5B9A\u6570\u5B57\u7684\u4E2D\u6587\u5927\u5199\u91D1\u989D",UNION:"\u5C06\u5408\u96C6/\u53C2\u6570\u4E2D\u7684\u503C\u53BB\u91CD,\u8FD4\u56DE\u53BB\u91CD\u540E\u7684\u5408\u96C6",INTERSECTIONSET:"\u83B7\u53D6\u4E24\u4E2A\u96C6\u5408\u7684\u4EA4\u96C6",LIST:"\u83B7\u53D6\u6240\u6709\u53C2\u6570\u7EC4\u6210\u7684\u96C6\u5408",AND:'\u5C06\u8868\u8FBE\u5F0F\u7528"\u5E76\u4E14"\u94FE\u63A5,\u5F53\u6240\u6709\u8868\u8FBE\u5F0F\u5747\u4E3Atrue\u65F6\u8FD4\u56DEtrue\uFF0C\u5426\u5219\u8FD4\u56DEfalse',OR:'\u5C06\u8868\u8FBE\u5F0F\u7528"\u6216"\u94FE\u63A5,\u5F53\u6709\u4E00\u4E2A\u8868\u8FBE\u5F0F\u4E3Atrue\u65F6\u8FD4\u56DEtrue\uFF0C\u5426\u5219\u8FD4\u56DEfalse',IF:"\u68C0\u67E5\u4E00\u4E2A\u6761\u4EF6\u80FD\u5426\u6EE1\u8DB3,\u5982\u679C\u6EE1\u8DB3\u8FD4\u56DE\u7B2C\u4E8C\u4E2A\u53C2\u6570\uFF0C\u5426\u5219\u8FD4\u56DE\u7B2C\u4E09\u4E2A\u53C2\u6570",IN:"\u68C0\u67E5\u7B2C\u4E8C\u4E2A\u53C2\u6570\u662F\u5426\u5728\u5408\u96C6\u4E2D",DEFAULT:"\u68C0\u67E5\u7B2C\u4E00\u4E2A\u53C2\u6570,\u5982\u679C\u4E3A\u7A7A\u8FD4\u56DE\u7B2C\u4E8C\u4E2A\u53C2\u6570,\u5426\u5219\u8FD4\u56DE\u7B2C\u4E00\u4E2A\u53C2\u6570",CASE:"\u68C0\u67E5\u662F\u5426\u6EE1\u8DB3\u4E00\u4E2A\u6216\u591A\u4E2A\u6761\u4EF6\uFF0C\u8FD4\u56DE\u7B2C\u4E00\u4E2A\u6EE1\u8DB3\u6761\u4EF6\u7684\u503C",COLUMN:"\u83B7\u53D6\u5B50\u8868\u5355\u4E2D\u6307\u5B9A\u5B57\u6BB5\u5E76\u8FD4\u56DE\u5408\u96C6",VALUE:"\u83B7\u53D6\u5206\u7EC4\u8868\u5355\u4E2D\u6307\u5B9A\u5B57\u6BB5",CONCAT:"\u5C06\u6240\u6709\u53C2\u6570\u62FC\u63A5,\u8FD4\u56DE\u62FC\u63A5\u540E\u7684\u5B57\u7B26\u4E32",FALSE:"\u8FD4\u56DE\u903B\u8F91\u503C false",TRUE:"\u8FD4\u56DE\u903B\u8F91\u503C true",NOT:"\u83B7\u53D6\u67D0\u4E2A\u903B\u8F91\u503C\u7684\u76F8\u53CD\u503C",EQ:"\u68C0\u67E5\u4E24\u4E2A\u503C\u662F\u5426\u76F8\u7B49",NE:"\u68C0\u67E5\u4E24\u4E2A\u503C\u662F\u5426\u4E0D\u76F8\u7B49",GE:"\u68C0\u67E5\u7B2C\u4E00\u4E2A\u503C\u662F\u5426\u5927\u4E8E\u7B49\u4E8E\u53E6\u4E00\u4E2A\u503C",GT:"\u68C0\u67E5\u7B2C\u4E00\u4E2A\u503C\u662F\u5426\u5927\u4E8E\u53E6\u4E00\u4E2A\u503C",LE:"\u68C0\u67E5\u7B2C\u4E00\u4E2A\u503C\u662F\u5426\u5C0F\u4E8E\u7B49\u4E8E\u53E6\u4E00\u4E2A\u503C",LT:"\u68C0\u67E5\u7B2C\u4E00\u4E2A\u503C\u662F\u5426\u5C0F\u4E8E\u53E6\u4E00\u4E2A\u503C"},language:{name:"\u56FD\u9645\u5316\u914D\u7F6E",add:"\u65B0\u589E\u8BCD\u6761",batchRemove:"\u6279\u91CF\u5220\u9664",select:"\u9009\u62E9\u591A\u8BED\u8A00"},props:{circle:"\u5706\u5F62",square:"\u6B63\u65B9\u5F62",image:"\u56FE\u7247",video:"\u89C6\u9891",audio:"\u97F3\u9891",document:"\u6587\u6863",size:"\u5C3A\u5BF8",info:"\u63D0\u793A",success:"\u6210\u529F",error:"\u5931\u8D25",warning:"\u8B66\u544A",primary:"\u91CD\u8981",danger:"\u5371\u9669",form:"\u8868\u5355",subform:"\u5B50\u8868\u5355",other:"\u5176\u4ED6",model:"\u5F39\u7A97",field:"\u6570\u636E\u96C6",variable:"\u53D8\u91CF",disabled:"\u7981\u7528",enable:"\u542F\u7528",time:"\u65F6\u95F4",email:"\u90AE\u7BB1",number:"\u6570\u5B57",globalData:"\u5168\u5C40\u6570\u636E",mobile:"\u79FB\u52A8\u7AEF",reactive:"\u54CD\u5E94\u5F0F",pc:"\u7535\u8111\u7AEF",title:"\u6807\u9898",content:"\u5185\u5BB9",collection:"\u5408\u96C6",group:"\u5206\u7EC4",custom:"\u81EA\u5B9A\u4E49",change:"\u6539\u53D8",blur:"\u5931\u53BB\u7126\u70B9",preview:"\u9884\u89C8",clear:"\u6E05\u7A7A",cancel:"\u53D6\u6D88",close:"\u5173\u95ED",ok:"\u786E\u5B9A",save:"\u4FDD\u5B58",refresh:"\u5237\u65B0",submit:"\u63D0\u4EA4",reset:"\u91CD\u7F6E",copy:"\u590D\u5236",delete:"\u5220\u9664",hide:"\u9690\u85CF",show:"\u663E\u793A",position:"\u4F4D\u7F6E",render:"\u6E32\u67D3",large:"\u5927",default:"\u9ED8\u8BA4",small:"\u5C0F",always:"\u5E38\u663E",never:"\u4E0D\u663E\u793A",hover:"\u60AC\u6D6E",click:"\u70B9\u51FB",button:"\u6309\u94AE",year:"\u5E74\u4EFD",month:"\u6708\u4EFD",date:"\u65E5\u671F",dates:"\u65E5\u671F\u591A\u9009",week:"\u4E00\u5468",datetime:"\u65E5\u671F\u65F6\u95F4","datetime-local":"\u65E5\u671F\u65F6\u95F4",datetimerange:"\u65E5\u671F\u65F6\u95F4\u533A\u95F4",daterange:"\u65E5\u671F\u533A\u95F4",monthrange:"\u6708\u4EFD\u533A\u95F4",left:"\u5DE6\u5BF9\u9F50",right:"\u53F3\u5BF9\u9F50",top:"\u9876\u90E8",bottom:"\u5E95\u90E8",text:"\u6587\u5B57",icon:"\u56FE\u6807",picture:"\u56FE\u7247","picture-card":"\u5361\u7247",center:"\u5C45\u4E2D",vertical:"\u7AD6\u5411",horizontal:"\u6A2A\u5411",manage:"\u7BA1\u7406",key:"\u952E\u540D",name:"\u540D\u79F0",value:"\u503C",inputData:"\u9ED8\u8BA4\u503C",append:"\u63D2\u5165",options:"\u9009\u9879\u6570\u636E",option:"\u9009\u9879",callback:"\u56DE\u8C03",mode:"\u6A21\u5F0F",style:"\u6837\u5F0F",print:"\u6253\u5370",_self:"\u5F53\u524D\u7A97\u53E3",_blank:"\u65B0\u7684\u7A97\u53E3",_parent:"\u7236\u7EA7\u7A97\u53E3",_top:"\u9876\u7EA7\u7A97\u53E3"},slots:{prefix:"\u5934\u90E8\u5185\u5BB9",suffix:"\u5C3E\u90E8\u5185\u5BB9",prepend:"\u524D\u7F6E\u5185\u5BB9",append:"\u540E\u7F6E\u5185\u5BB9"},behavior:{add:"\u6DFB\u52A0\u52A8\u4F5C",props:{id:"\u9009\u62E9\u7EC4\u4EF6",status:"\u72B6\u6001",compute:"\u6761\u4EF6",static:"\u9759\u6001",formula:"\u8868\u8FBE\u5F0F",setFormula:"\u914D\u7F6E\u8868\u8FBE\u5F0F",continue:"\u7EE7\u7EED\u6267\u884C\u52A8\u4F5C",stop:"\u4E2D\u65AD\u6267\u884C\u52A8\u4F5C",break:"\u8DF3\u8FC7\u5F53\u524D\u52A8\u4F5C",model:"\u9009\u62E9\u5F39\u7A97",fetch:"\u914D\u7F6E\u8BF7\u6C42",response:"\u8BF7\u6C42\u7ED3\u679C",callback:"\u81EA\u5B9A\u4E49JS",ignoreError:"\u6267\u884C\u5F02\u5E38",expression:"\u6267\u884C\u6761\u4EF6",stopPropagation:"\u963B\u65AD\u6761\u4EF6",execute:"\u6267\u884C\u52A8\u4F5C",info:"\u52A8\u4F5C\u8BF4\u660E"},openModel:{name:"\u6253\u5F00\u5F39\u7A97",info:"\u6253\u5F00\u6240\u9009\u7684\u5F39\u7A97"},closeModel:{name:"\u5173\u95ED\u5F39\u7A97",info:"\u5173\u95ED\u5F53\u524D\u5F39\u7A97"},hidden:{name:"\u7EC4\u4EF6\u53EF\u89C1\u6027",info:"\u63A7\u5236\u6240\u9009\u7684\u7EC4\u4EF6\u7684\u663E\u793A/\u9690\u85CF"},disabled:{name:"\u7EC4\u4EF6\u53EF\u7528\u6027",info:"\u63A7\u5236\u6240\u9009\u7684\u7EC4\u4EF6\u7684\u542F\u7528/\u7981\u7528"},resetFields:{name:"\u91CD\u7F6E\u8868\u5355",info:"\u91CD\u7F6E\u8868\u5355\u6570\u636E"},clearFields:{name:"\u6E05\u7A7A\u8868\u5355",info:"\u6E05\u7A7A\u8868\u5355\u6570\u636E"},validate:{name:"\u6821\u9A8C\u8868\u5355",info:"\u5BF9\u6574\u4E2A\u8868\u5355\u7684\u5185\u5BB9\u8FDB\u884C\u6821\u9A8C"},validateFields:{name:"\u6821\u9A8C\u8868\u5355\u9879",info:"\u6821\u9A8C\u6240\u9009\u7684\u7684\u8868\u5355\u9879"},setValue:{name:"\u8868\u5355\u8D4B\u503C",info:"\u4FEE\u6539\u8868\u5355\u7684\u6570\u636E"},fetch:{name:"\u53D1\u9001\u8BF7\u6C42",info:"\u914D\u7F6E\u5E76\u53D1\u9001API\u8BF7\u6C42",props:{append:"\u8FFD\u52A0\u8868\u5355\u6570\u636E"},warning:{append:"\u5F00\u542F\u540E\uFF0C\u8FDC\u7A0B\u8BF7\u6C42\u8FD4\u56DE\u7684\u6570\u636E\u5C06\u81EA\u52A8\u8FFD\u52A0\u5230\u8868\u5355\u7684\u6570\u636E\u4E2D\u3002",response:"\u8FDC\u7A0B\u8BF7\u6C42\u8FD4\u56DE\u7684\u6570\u636E\u5C06\u6682\u5B58\u5230\u6307\u5B9A\u7684\u53D8\u91CF\u4E2D\u3002"}},copy:{name:"\u590D\u5236\u5185\u5BB9",info:"\u590D\u5236\u6587\u672C\u5185\u5BB9\u81F3\u7C98\u8D34\u677F"},callback:{name:"\u81EA\u5B9A\u4E49\u64CD\u4F5C",info:"\u901A\u8FC7JavaScript\u81EA\u5B9A\u4E49\u52A8\u4F5C\u903B\u8F91"},message:{name:"\u6D88\u606F\u63D0\u9192",info:"\u5F39\u51FA\u6D88\u606F\u63D0\u9192",props:{type:"\u7C7B\u578B",message:"\u63D0\u793A\u4FE1\u606F",duration:"\u6301\u7EED\u65F6\u95F4(ms)",showClose:"\u663E\u793A\u5173\u95ED\u6309\u94AE"}},submit:{name:"\u63D0\u4EA4\u8868\u5355",info:"\u624B\u52A8\u63D0\u4EA4\u8868\u5355\u5E76\u89E6\u53D1\u8868\u5355\u63D0\u4EA4\u4E8B\u4EF6"}},com:{cascader:{name:"\u7EA7\u8054\u9009\u62E9\u5668",event:{expandChange:"\u5F53\u5C55\u5F00\u8282\u70B9\u53D1\u751F\u53D8\u5316\u65F6\u89E6\u53D1",removeTag:"\u5728\u591A\u9009\u6A21\u5F0F\u4E0B\uFF0C\u79FB\u9664Tag\u65F6\u89E6\u53D1"},props:{props:"\u914D\u7F6E\u9009\u9879",placeholder:"\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C",disabled:"\u662F\u5426\u7981\u7528",clearable:"\u662F\u5426\u652F\u6301\u6E05\u7A7A\u9009\u9879",showAllLevels:"\u8F93\u5165\u6846\u4E2D\u662F\u5426\u663E\u793A\u9009\u4E2D\u503C\u7684\u5B8C\u6574\u8DEF\u5F84",collapseTags:"\u591A\u9009\u6A21\u5F0F\u4E0B\u662F\u5426\u6298\u53E0Tag",collapseTagsTooltip:"\u5F53\u9F20\u6807\u60AC\u505C\u4E8E\u6298\u53E0\u6807\u7B7E\u7684\u6587\u672C\u65F6\uFF0C\u662F\u5426\u663E\u793A\u6240\u6709\u9009\u4E2D\u7684\u6807\u7B7E",separator:"\u9009\u9879\u5206\u9694\u7B26",filterable:"\u8BE5\u9009\u9879\u662F\u5426\u53EF\u4EE5\u88AB\u641C\u7D22",tagType:"\u6807\u7B7E\u7C7B\u578B"},propsOpt:{multiple:"\u662F\u5426\u591A\u9009",expandTrigger:"\u6B21\u7EA7\u83DC\u5355\u7684\u5C55\u5F00\u65B9\u5F0F",checkStrictly:"\u662F\u5426\u4E25\u683C\u7684\u9075\u5B88\u7236\u5B50\u8282\u70B9\u4E0D\u4E92\u76F8\u5173\u8054",emitPath:"\u5728\u9009\u4E2D\u8282\u70B9\u6539\u53D8\u65F6\uFF0C\u662F\u5426\u8FD4\u56DE\u7531\u8BE5\u8282\u70B9\u6240\u5728\u7684\u5404\u7EA7\u83DC\u5355\u7684\u503C\u6240\u7EC4\u6210\u7684\u6570\u7EC4",value:"\u6307\u5B9A\u9009\u9879\u7684\u503C\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",label:"\u6307\u5B9A\u9009\u9879\u6807\u7B7E\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",children:"\u6307\u5B9A\u9009\u9879\u7684\u5B50\u9009\u9879\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",disabled:"\u6307\u5B9A\u9009\u9879\u7684\u7981\u7528\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",leaf:"\u6307\u5B9A\u9009\u9879\u7684\u53F6\u5B50\u8282\u70B9\u7684\u6807\u5FD7\u4F4D\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C"}},checkbox:{name:"\u591A\u9009\u6846",props:{input:"\u662F\u5426\u53EF\u4EE5\u586B\u5199",type:"\u6309\u94AE\u7C7B\u578B",disabled:"\u662F\u5426\u7981\u7528",min:"\u53EF\u88AB\u52FE\u9009\u7684\u6700\u5C0F\u6570\u91CF",max:"\u53EF\u88AB\u52FE\u9009\u7684\u6700\u5927\u6570\u91CF",textColor:"\u5F53\u6309\u94AE\u4E3A\u6D3B\u8DC3\u72B6\u6001\u65F6\u7684\u5B57\u4F53\u989C\u8272",fill:"\u5F53\u6309\u94AE\u4E3A\u6D3B\u8DC3\u72B6\u6001\u65F6\u7684\u8FB9\u6846\u548C\u80CC\u666F\u989C\u8272"}},col:{name:"\u5E03\u5C40\u683C\u5B50",info:"\u901A\u8FC7\u54CD\u5E94\u5F0F\u914D\u7F6E\u591A\u7AEF\u5E03\u5C40\uFF0C\u79FB\u52A8\u7AEF\u4F1A\u81EA\u52A8\u5E94\u7528\u7B2C\u4E00\u4E2A",props:{span:"\u6805\u683C\u5360\u636E\u7684\u5217\u6570",offset:"\u6805\u683C\u5DE6\u4FA7\u7684\u95F4\u9694\u683C\u6570",push:"\u6805\u683C\u5411\u53F3\u79FB\u52A8\u683C\u6570",pull:"\u6805\u683C\u5411\u5DE6\u79FB\u52A8\u683C\u6570"}},colorPicker:{name:"\u989C\u8272\u9009\u62E9\u5668",event:{activeChange:"\u9762\u677F\u4E2D\u5F53\u524D\u663E\u793A\u7684\u989C\u8272\u53D1\u751F\u6539\u53D8\u65F6\u89E6\u53D1"},props:{disabled:"\u662F\u5426\u7981\u7528",showAlpha:"\u662F\u5426\u652F\u6301\u900F\u660E\u5EA6\u9009\u62E9",colorFormat:"\u989C\u8272\u7684\u683C\u5F0F",predefine:"\u9884\u5B9A\u4E49\u989C\u8272"}},datePicker:{name:"\u65E5\u671F",props:{pickerOptions:"\u5F53\u524D\u65F6\u95F4\u65E5\u671F\u9009\u62E9\u5668\u7279\u6709\u7684\u9009\u9879",readonly:"\u5B8C\u5168\u53EA\u8BFB",disabled:"\u7981\u7528",type:"\u663E\u793A\u7C7B\u578B",editable:"\u6587\u672C\u6846\u53EF\u8F93\u5165",clearable:"\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE",placeholder:"\u975E\u8303\u56F4\u9009\u62E9\u65F6\u7684\u5360\u4F4D\u5185\u5BB9",startPlaceholder:"\u8303\u56F4\u9009\u62E9\u65F6\u5F00\u59CB\u65E5\u671F\u7684\u5360\u4F4D\u5185\u5BB9",endPlaceholder:"\u8303\u56F4\u9009\u62E9\u65F6\u7ED3\u675F\u65E5\u671F\u7684\u5360\u4F4D\u5185\u5BB9",format:"\u663E\u793A\u5728\u8F93\u5165\u6846\u4E2D\u7684\u683C\u5F0F",align:"\u5BF9\u9F50\u65B9\u5F0F",rangeSeparator:"\u9009\u62E9\u8303\u56F4\u65F6\u7684\u5206\u9694\u7B26",unlinkPanels:"\u5728\u8303\u56F4\u9009\u62E9\u5668\u91CC\u53D6\u6D88\u4E24\u4E2A\u65E5\u671F\u9762\u677F\u4E4B\u95F4\u7684\u8054\u52A8"}},dateRange:{name:"\u65E5\u671F\u533A\u95F4"},timeRange:{name:"\u65F6\u95F4\u533A\u95F4"},elAlert:{name:"\u63D0\u793A",description:"\u8BF4\u660E\u6587\u5B57",props:{title:"\u6807\u9898",type:"\u4E3B\u9898",description:"\u8F85\u52A9\u6027\u6587\u5B57",closable:"\u662F\u5426\u53EF\u5173\u95ED",center:"\u6587\u5B57\u662F\u5426\u5C45\u4E2D",closeText:"\u5173\u95ED\u6309\u94AE\u81EA\u5B9A\u4E49\u6587\u672C",showIcon:"\u662F\u5426\u663E\u793A\u56FE\u6807",effect:"\u9009\u62E9\u63D0\u4F9B\u7684\u4E3B\u9898"}},elButton:{name:"\u6309\u94AE",props:{formCreateChild:"\u5185\u5BB9",size:"\u5C3A\u5BF8",type:"\u7C7B\u578B",plain:"\u662F\u5426\u6734\u7D20\u6309\u94AE",round:"\u662F\u5426\u5706\u89D2\u6309\u94AE",circle:"\u662F\u5426\u5706\u5F62\u6309\u94AE",loading:"\u662F\u5426\u52A0\u8F7D\u4E2D\u72B6\u6001",disabled:"\u662F\u5426\u7981\u7528\u72B6\u6001"}},elCard:{name:"\u5361\u7247",props:{header:"\u6807\u9898",shadow:"\u9634\u5F71\u663E\u793A\u65F6\u673A"}},elCollapse:{name:"\u6298\u53E0\u9762\u677F",event:{change:"\u5207\u6362\u5F53\u524D\u6D3B\u52A8\u9762\u677F\uFF0C\u5728\u624B\u98CE\u7434\u6A21\u5F0F\u4E0B\u5176\u7C7B\u578B\u662Fstring\uFF0C\u5728\u5176\u4ED6\u6A21\u5F0F\u4E0B\u662Farray"},props:{accordion:"\u662F\u5426\u624B\u98CE\u7434\u6A21\u5F0F"}},elCollapseItem:{name:"\u9762\u677F",props:{title:"\u9762\u677F\u6807\u9898",name:"\u552F\u4E00\u6807\u5FD7\u7B26",disabled:"\u662F\u5426\u7981\u7528"}},elDescriptions:{name:"\u63CF\u8FF0\u5217\u8868",props:{title:"\u6807\u9898\u6587\u672C\uFF0C\u663E\u793A\u5728\u5DE6\u4E0A\u65B9",extra:"\u64CD\u4F5C\u533A\u6587\u672C\uFF0C\u663E\u793A\u5728\u53F3\u4E0A\u65B9",column:"\u4E00\u884C\u4E2D\u8868\u683C\u7684\u6570\u91CF",border:"\u662F\u5426\u5E26\u6709\u8FB9\u6846",direction:"\u6392\u5217\u7684\u65B9\u5411",size:"\u5217\u8868\u7684\u5C3A\u5BF8"}},elDescriptionsItem:{name:"\u63CF\u8FF0\u683C\u5B50",props:{label:"\u6807\u7B7E\u6587\u672C",__child:"\u5185\u5BB9",span:"\u5217\u7684\u6570\u91CF",width:"\u5217\u7684\u5BBD\u5EA6\uFF0C\u4E0D\u540C\u884C\u76F8\u540C\u5217\u7684\u5BBD\u5EA6\u6309\u6700\u5927\u503C\u8BBE\u5B9A\uFF08\u5982\u65E0 border \uFF0C\u5BBD\u5EA6\u5305\u542B\u6807\u7B7E\u4E0E\u5185\u5BB9",minWidth:"\u5217\u7684\u6700\u5C0F\u5BBD\u5EA6",align:"\u5217\u7684\u5185\u5BB9\u5BF9\u9F50\u65B9\u5F0F\uFF08\u5982\u65E0 border\uFF0C\u5BF9\u6807\u7B7E\u548C\u5185\u5BB9\u5747\u751F\u6548\uFF09",labelAlign:"\u5217\u7684\u6807\u7B7E\u5BF9\u9F50\u65B9\u5F0F\uFF0C\u82E5\u4E0D\u8BBE\u7F6E\u8BE5\u9879\uFF0C\u5219\u4F7F\u7528\u5185\u5BB9\u7684\u5BF9\u9F50\u65B9\u5F0F\uFF08\u5982\u65E0 border\uFF0C\u8BF7\u4F7F\u7528 align \u53C2\u6570\uFF09",className:"\u5217\u7684\u5185\u5BB9\u81EA\u5B9A\u4E49\u7C7B\u540D"}},elDivider:{name:"\u5206\u5272\u7EBF",props:{direction:"\u8BBE\u7F6E\u5206\u5272\u7EBF\u65B9\u5411",formCreateChild:"\u8BBE\u7F6E\u5206\u5272\u7EBF\u6587\u6848",contentPosition:"\u8BBE\u7F6E\u5206\u5272\u7EBF\u6587\u6848\u7684\u4F4D\u7F6E"}},elTabPane:{name:"\u9009\u9879\u5361",props:{label:"\u9009\u9879\u5361\u6807\u9898",disabled:"\u662F\u5426\u7981\u7528",name:"\u9009\u9879\u5361\u7684\u6807\u8BC6\u7B26",lazy:"\u6807\u7B7E\u662F\u5426\u5EF6\u8FDF\u6E32\u67D3"}},elTabs:{name:"\u6807\u7B7E\u9875",event:{tabClick:"tab \u88AB\u9009\u4E2D\u65F6\u89E6\u53D1",tabChange:"activeName \u6539\u53D8\u65F6\u89E6\u53D1",tabRemove:"\u70B9\u51FB tab \u79FB\u9664\u6309\u94AE\u65F6\u89E6\u53D1",tabAdd:"\u70B9\u51FB tab \u65B0\u589E\u6309\u94AE\u65F6\u89E6\u53D1",edit:"\u70B9\u51FB tab \u7684\u65B0\u589E\u6216\u79FB\u9664\u6309\u94AE\u540E\u89E6\u53D1"},props:{type:"\u98CE\u683C\u7C7B\u578B",closable:"\u6807\u7B7E\u662F\u5426\u53EF\u5173\u95ED",tabPosition:"\u9009\u9879\u5361\u6240\u5728\u4F4D\u7F6E",stretch:"\u6807\u7B7E\u7684\u5BBD\u5EA6\u662F\u5426\u81EA\u6491\u5F00"}},elTag:{name:"\u6807\u7B7E",props:{formCreateChild:"\u6807\u7B7E\u5185\u5BB9",type:"\u6807\u7B7E\u7684\u7C7B\u578B",size:"\u6807\u7B7E\u7684\u5C3A\u5BF8",effect:"\u6807\u7B7E\u7684\u4E3B\u9898",closable:"\u662F\u5426\u53EF\u5173\u95ED",disableTransitions:"\u662F\u5426\u7981\u7528\u6E10\u53D8\u52A8\u753B",hit:"\u662F\u5426\u6709\u8FB9\u6846\u63CF\u8FB9",round:"\u662F\u5426\u4E3A\u5706\u5F62",color:"\u80CC\u666F\u8272"}},elTransfer:{name:"\u7A7F\u68AD\u6846",event:{leftCheckChange:"\u5DE6\u4FA7\u5217\u8868\u5143\u7D20\u88AB\u7528\u6237\u9009\u4E2D / \u53D6\u6D88\u9009\u4E2D\u65F6\u89E6\u53D1",rightCheckChange:"\u53F3\u4FA7\u5217\u8868\u5143\u7D20\u88AB\u7528\u6237\u9009\u4E2D / \u53D6\u6D88\u9009\u4E2D\u65F6\u89E6\u53D1"},props:{filterable:"\u662F\u5426\u53EF\u641C\u7D22",filterPlaceholder:"\u641C\u7D22\u6846\u5360\u4F4D\u7B26",targetOrder:"\u53F3\u4FA7\u5217\u8868\u5143\u7D20\u7684\u6392\u5E8F\u7B56\u7565",targetOrderInfo:"\u82E5\u4E3A original\uFF0C\u5219\u4FDD\u6301\u4E0E\u6570\u636E\u76F8\u540C\u7684\u987A\u5E8F\uFF1B\u82E5\u4E3A push\uFF0C\u5219\u65B0\u52A0\u5165\u7684\u5143\u7D20\u6392\u5728\u6700\u540E\uFF1B\u82E5\u4E3A unshift\uFF0C\u5219\u65B0\u52A0\u5165\u7684\u5143\u7D20\u6392\u5728\u6700\u524D",titles:"\u81EA\u5B9A\u4E49\u5217\u8868\u6807\u9898",buttonTexts:"\u81EA\u5B9A\u4E49\u6309\u94AE\u6587\u6848",props:"\u6570\u636E\u6E90\u7684\u5B57\u6BB5\u522B\u540D"}},elTreeSelect:{name:"\u6811\u5F62\u9009\u62E9",event:{removeTag:"\u591A\u9009\u6A21\u5F0F\u4E0B\u79FB\u9664tag\u65F6\u89E6\u53D1"},props:{multiple:"\u662F\u5426\u591A\u9009",disabled:"\u662F\u5426\u7981\u7528",clearable:"\u662F\u5426\u53EF\u4EE5\u6E05\u7A7A\u9009\u9879",collapseTags:"\u591A\u9009\u65F6\u662F\u5426\u5C06\u9009\u4E2D\u503C\u6309\u6587\u5B57\u7684\u5F62\u5F0F\u5C55\u793A",multipleLimit:"\u591A\u9009\u65F6\u7528\u6237\u6700\u591A\u53EF\u4EE5\u9009\u62E9\u7684\u9879\u76EE\u6570\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236",placeholder:"\u5360\u4F4D\u7B26",props:"\u914D\u7F6E\u9009\u9879",checkStrictly:"\u5728\u663E\u793A\u590D\u9009\u6846\u7684\u60C5\u51B5\u4E0B\uFF0C\u662F\u5426\u4E25\u683C\u7684\u9075\u5FAA\u7236\u5B50\u4E0D\u4E92\u76F8\u5173\u8054\u7684\u505A\u6CD5",renderAfterExpand:"\u662F\u5426\u5728\u7B2C\u4E00\u6B21\u5C55\u5F00\u67D0\u4E2A\u6811\u8282\u70B9\u540E\u624D\u6E32\u67D3\u5176\u5B50\u8282\u70B9",defaultExpandAll:"\u662F\u5426\u9ED8\u8BA4\u5C55\u5F00\u6240\u6709\u8282\u70B9",expandOnClickNode:"\u662F\u5426\u5728\u70B9\u51FB\u8282\u70B9\u7684\u65F6\u5019\u5C55\u5F00\u6216\u8005\u6536\u7F29\u8282\u70B9",checkOnClickNode:"\u662F\u5426\u5728\u70B9\u51FB\u8282\u70B9\u7684\u65F6\u5019\u9009\u4E2D\u8282\u70B9",nodeKey:"\u6BCF\u4E2A\u6811\u8282\u70B9\u7528\u6765\u4F5C\u4E3A\u552F\u4E00\u6807\u8BC6\u7684\u5C5E\u6027\uFF0C\u6574\u68F5\u6811\u5E94\u8BE5\u662F\u552F\u4E00\u7684"}},elLink:{name:"\u94FE\u63A5",props:{formCreateChild:"\u5185\u5BB9",href:"\u8DF3\u8F6C\u94FE\u63A5",type:"\u7C7B\u578B",underline:"\u662F\u5426\u663E\u793A\u4E0B\u5212\u7EBF",disabled:"\u662F\u5426\u7981\u7528",target:"\u6253\u5F00\u65B9\u5F0F"}},elWatermark:{name:"\u6C34\u5370",props:{content:"\u6C34\u5370\u6587\u672C\u5185\u5BB9",image:"\u6C34\u5370\u56FE\u7247\uFF0C\u5EFA\u8BAE\u4F7F\u7528 2x \u6216 3x \u56FE\u50CF",width:"\u6C34\u5370\u7684\u5BBD\u5EA6\uFF0C content \u7684\u9ED8\u8BA4\u503C\u662F\u5B83\u81EA\u5DF1\u7684\u5BBD\u5EA6",height:"\u6C34\u5370\u7684\u9AD8\u5EA6\uFF0C content \u7684\u9ED8\u8BA4\u503C\u662F\u5B83\u81EA\u5DF1\u7684\u9AD8\u5EA6",rotate:"\u6C34\u5370\u7684\u65CB\u8F6C\u89D2\u5EA6, \u5355\u4F4D \xB0",zIndex:"\u6C34\u5370\u5143\u7D20\u7684z-index\u503C",gap:"\u6C34\u5370\u4E4B\u95F4\u7684\u95F4\u8DDD"}},elTooltip:{name:"\u6587\u5B57\u63D0\u793A",props:{content:"\u663E\u793A\u7684\u5185\u5BB9",disabled:"\u662F\u5426\u7981\u7528",rawContent:"\u5185\u5BB9\u662F\u5426\u4F5C\u4E3A HTML \u5B57\u7B26\u4E32\u5904\u7406",enterable:"\u9F20\u6807\u662F\u5426\u53EF\u8FDB\u5165\u5230 Tooltip \u4E2D",effect:"\u4E3B\u9898",placement:"Tooltip \u7EC4\u4EF6\u51FA\u73B0\u7684\u4F4D\u7F6E",trigger:"\u5982\u4F55\u89E6\u53D1 Tooltip",offset:"\u51FA\u73B0\u4F4D\u7F6E\u7684\u504F\u79FB\u91CF",showAfter:"\u5728\u89E6\u53D1\u540E\u591A\u4E45\u663E\u793A\u5185\u5BB9\uFF0C\u5355\u4F4D\u6BEB\u79D2",hideAfter:"\u5EF6\u8FDF\u5173\u95ED\uFF0C\u5355\u4F4D\u6BEB\u79D2",autoClose:"\u51FA\u73B0\u540E\u81EA\u52A8\u9690\u85CF\u5EF6\u65F6\uFF0C\u5355\u4F4D\u6BEB\u79D2"}},elImage:{name:"\u56FE\u7247",props:{src:"\u56FE\u7247\u94FE\u63A5",previewSrcList:"\u9884\u89C8\u56FE\u7247\u5217\u8868"}},elAvatar:{name:"\u5934\u50CF\u6846",props:{src:"\u56FE\u7247\u94FE\u63A5",shape:"\u5F62\u72B6",size:"\u5C3A\u5BF8"}},elMention:{name:"\u63D0\u53CA",event:{search:"\u6309\u4E0B\u89E6\u53D1\u5B57\u6BB5\u65F6\u89E6\u53D1",select:"\u5F53\u7528\u6237\u9009\u62E9\u9009\u9879\u65F6\u89E6\u53D1"},props:{type:"\u7C7B\u578B",placeholder:"\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C",clearable:"\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE",disabled:"\u662F\u5426\u7981\u7528",whole:"\u5F53\u9000\u683C\u952E\u88AB\u6309\u4E0B\u505A\u5220\u9664\u64CD\u4F5C\u65F6\uFF0C\u662F\u5426\u5C06\u63D0\u53CA\u90E8\u5206\u4F5C\u4E3A\u6574\u4F53\u5220\u9664",checkIsWhole:"\u5F53\u9000\u683C\u952E\u88AB\u6309\u4E0B\u505A\u5220\u9664\u64CD\u4F5C\u65F6\uFF0C\u68C0\u67E5\u662F\u5426\u5C06\u63D0\u53CA\u90E8\u5206\u4F5C\u4E3A\u6574\u4F53\u5220\u9664",filterOption:"\u7B5B\u9009\u5668\u9009\u9879\u903B\u8F91"}},elSegmented:{name:"\u5206\u6BB5\u63A7\u5236\u5668",props:{size:"\u5C3A\u5BF8",block:"\u6491\u6EE1\u7236\u5143\u7D20\u5BBD\u5EA6",disabled:"\u662F\u5426\u7981\u7528"}},elFormItem:{name:"\u8868\u5355\u9879",props:{label:"\u6807\u7B7E\u6587\u672C",labelWidth:"\u6807\u7B7E\u5BBD\u5EA6",size:"\u5C3A\u5BF8"}},elStatistic:{name:"\u7EDF\u8BA1\u680F",props:{value:"\u6570\u503C",title:"\u6807\u9898",prefix:"\u6570\u503C\u7684\u524D\u7F00",suffix:"\u6570\u503C\u7684\u540E\u7F00"}},fcTitle:{name:"\u6807\u9898",props:{title:"\u6807\u9898",size:"\u5C3A\u5BF8",align:"\u5BF9\u9F50\u65B9\u5F0F"}},fcId:{name:"\u552F\u4E00\u503C",props:{prefix:"\u524D\u7F00"}},fcCity:{name:"\u7701\u5E02\u533A\u9009\u62E9\u5668",props:{api:"\u6570\u636E\u94FE\u63A5 URI",level:"\u7C7B\u578B",clearable:"\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE",disabled:"\u662F\u5426\u7981\u7528",filter:"\u6570\u636E\u8FC7\u6EE4,\u8FD4\u56DE\u53EF\u9009\u62E9\u6570\u636E"}},fcCell:{name:"\u683C\u5B50"},fcEditor:{name:"\u5BCC\u6587\u672C\u6846",props:{disabled:"\u662F\u5426\u7981\u7528"}},fcFlex:{name:"\u76D2\u5B50\u5E03\u5C40"},fcFlex2:{name:"\u76D2\u5B50\u5E03\u5C40",horizontal:"\u6C34\u5E73\u5C45\u4E2D",vertical:"\u5782\u76F4\u5C45\u4E2D",left:"\u5DE6\u5BF9\u9F50",right:"\u53F3\u5BF9\u9F50",reset:"\u91CD\u7F6E\u5E03\u5C40"},fcRow:{name:"\u6805\u683C\u5E03\u5C40",props:{gutter:"\u6805\u683C\u95F4\u9694",type:"flex\u5E03\u5C40\u6A21\u5F0F",justify:"flex\u5E03\u5C40\u4E0B\u7684\u6C34\u5E73\u6392\u5217\u65B9\u5F0F",align:"flex\u5E03\u5C40\u4E0B\u7684\u5782\u76F4\u6392\u5217\u65B9\u5F0F"}},fcDialog:{name:"\u5F39\u51FA\u6846",props:{title:"\u6807\u9898",width:"\u5BF9\u8BDD\u6846\u7684\u5BBD\u5EA6",fullscreen:"\u662F\u5426\u4E3A\u5168\u5C4F",modal:"\u662F\u5426\u9700\u8981\u906E\u7F69\u5C42",autoClose:"\u63D0\u4EA4\u8868\u5355\u540E\u81EA\u52A8\u5173\u95ED\u5F39\u51FA\u6846",footer:"\u662F\u5426\u663E\u793A\u64CD\u4F5C\u6309\u94AE",beforeClose:"\u5173\u95ED\u524D\u7684\u56DE\u8C03"}},fcDrawer:{name:"\u62BD\u5C49",props:{title:"\u6807\u9898",size:"\u5BF9\u8BDD\u6846\u7684\u5BBD\u5EA6",direction:"\u6253\u5F00\u7684\u65B9\u5411",modal:"\u662F\u5426\u9700\u8981\u906E\u7F69\u5C42",autoClose:"\u63D0\u4EA4\u8868\u5355\u540E\u81EA\u52A8\u5173\u95ED\u5F39\u51FA\u6846",footer:"\u662F\u5426\u663E\u793A\u64CD\u4F5C\u6309\u94AE",beforeClose:"\u5173\u95ED\u524D\u7684\u56DE\u8C03"},directionType:{ltr:"\u5DE6\u4FA7",rtl:"\u53F3\u4FA7"}},fcTable:{name:"\u8868\u683C\u5E03\u5C40",props:{mini:"\u7D27\u51D1\u6A21\u5F0F",border:"\u662F\u5426\u663E\u793A\u8FB9\u6846",borderColor:"\u8FB9\u6846\u989C\u8272",borderWidth:"\u8FB9\u6846\u5BBD\u5EA6"}},fcTableGrid:{name:"\u683C\u5B50"},fcValue:{name:"\u8BA1\u7B97\u516C\u5F0F",empty:"\u5728\u53F3\u4FA7\u914D\u7F6E\u4E2D\u8BBE\u7F6E\u8BA1\u7B97\u516C\u5F0F"},fcSlot:{name:"\u63D2\u69FD\u533A\u57DF",empty:"\u901A\u8FC7\u5B9A\u4E49\u63D2\u69FD {tag} \u586B\u5145\u533A\u57DF",props:{name:"\u63D2\u69FD\u540D\u79F0"}},fcJson:{name:"\u52A8\u6001\u533A\u57DF",empty:"\u901A\u8FC7\u52A0\u8F7D {tag} \u89C4\u5219\u586B\u5145\u533A\u57DF",props:{_loadType:"JSON \u89C4\u5219",type:"\u7C7B\u578B"}},lineChart:{name:"\u6298\u7EBF\u56FE",data:"\u56FE\u8868\u6570\u636E",pieTypeOpt:{pie:"\u5706\u5F62",doughnut:"\u73AF\u5F62","half-doughnut":"\u534A\u73AF\u5F62"},funnelSortOpt:{descending:"\u5012\u5E8F",ascending:"\u6B63\u5E8F"},props:{title:"\u56FE\u8868\u7684\u540D\u79F0",subtitle:"\u56FE\u8868\u7684\u7B80\u4ECB",valueFormat:"\u683C\u5F0F\u5316\u6570\u503C\u663E\u793A",stack:"\u591A\u5217\u6570\u636E\u65F6\u662F\u5426\u5806\u53E0",smooth:"\u7EBF\u6761\u662F\u5426\u5E73\u6ED1\u8FC7\u6E21",showLegend:"\u662F\u5426\u663E\u793A\u6807\u8BB0",showSeriesLabel:"\u662F\u5426\u663E\u793A\u6570\u503C",barBackgroundColor:"\u67F1\u72B6\u7684\u80CC\u666F\u8272",funnelSort:"\u6392\u5E8F\u65B9\u5F0F",pieType:"\u5F62\u72B6",min:"\u6700\u5C0F\u503C",max:"\u6700\u5927\u503C",value:"\u6570\u503C",indicator:"\u6307\u793A\u5668",loadOptions:"\u521D\u59CB\u5316"}},areaChart:{name:"\u4F53\u79EF\u56FE"},barChart:{name:"\u67F1\u72B6\u56FE"},customChart:{name:"\u81EA\u5B9A\u4E49\u56FE\u8868"},funnelChart:{name:"\u6F0F\u6597\u56FE"},gaugeChart:{name:"\u4EEA\u8868\u76D8"},pieChart:{name:"\u997C\u56FE"},radarChart:{name:"\u96F7\u8FBE\u56FE"},scatterChart:{name:"\u6563\u70B9\u56FE"},stripeChart:{name:"\u6761\u5F62\u56FE"},fcInlineForm:{name:"\u884C\u5185\u5E03\u5C40"},group:{name:"\u5B50\u8868\u5355",props:{disabled:"\u662F\u5426\u7981\u7528",syncDisabled:"\u662F\u5426\u4E0E\u5B50\u8868\u5355\u5F3A\u5236\u540C\u6B65\u7981\u7528\u72B6\u6001",expand:"\u8BBE\u7F6E\u9ED8\u8BA4\u5C55\u5F00\u51E0\u9879",button:"\u662F\u5426\u663E\u793A\u64CD\u4F5C\u6309\u94AE",sortBtn:"\u662F\u5426\u663E\u793A\u6392\u5E8F\u6309\u94AE",min:"\u8BBE\u7F6E\u6700\u5C0F\u6DFB\u52A0\u51E0\u9879",max:"\u8BBE\u7F6E\u6700\u591A\u6DFB\u52A0\u51E0\u9879"}},html:{name:"HTML",props:{formCreateChild:"\u5185\u5BB9"}},input:{name:"\u8F93\u5165\u6846",event:{change:"\u5F53\u503C\u6539\u53D8\u65F6\uFF0C\u5F53\u7EC4\u4EF6\u5931\u53BB\u7126\u70B9\u6216\u7528\u6237\u6309Enter\u65F6\u89E6\u53D1"},props:{type:"\u7C7B\u578B",maxlength:"\u6700\u5927\u8F93\u5165\u957F\u5EA6",minlength:"\u6700\u5C0F\u8F93\u5165\u957F\u5EA6",placeholder:"\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C",clearable:"\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE",disabled:"\u662F\u5426\u7981\u7528",readonly:"\u662F\u5426\u53EA\u8BFB"}},inputNumber:{name:"\u6570\u5B57\u8F93\u5165\u6846",props:{precision:"\u6570\u503C\u7CBE\u5EA6",min:"\u8BBE\u7F6E\u8BA1\u6570\u5668\u5141\u8BB8\u7684\u6700\u5C0F\u503C",max:"\u8BBE\u7F6E\u8BA1\u6570\u5668\u5141\u8BB8\u7684\u6700\u5927\u503C",step:"\u8BA1\u6570\u5668\u6B65\u957F",stepStrictly:"\u662F\u5426\u53EA\u80FD\u8F93\u5165 step \u7684\u500D\u6570",disabled:"\u662F\u5426\u7981\u7528\u8BA1\u6570\u5668",controls:"\u662F\u5426\u4F7F\u7528\u63A7\u5236\u6309\u94AE",controlsPosition:"\u63A7\u5236\u6309\u94AE\u4F4D\u7F6E",placeholder:"\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C"}},password:{name:"\u5BC6\u7801\u8F93\u5165\u6846",event:{change:"\u5F53\u503C\u6539\u53D8\u65F6\uFF0C\u5F53\u7EC4\u4EF6\u5931\u53BB\u7126\u70B9\u6216\u7528\u6237\u6309Enter\u65F6\u89E6\u53D1"},props:{disabled:"\u662F\u5426\u7981\u7528",readonly:"\u662F\u5426\u53EA\u8BFB",maxlength:"\u6700\u5927\u8F93\u5165\u957F\u5EA6",minlength:"\u6700\u5C0F\u8F93\u5165\u957F\u5EA6",placeholder:"\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C",clearable:"\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE"}},radio:{name:"\u5355\u9009\u6846",props:{input:"\u662F\u5426\u53EF\u4EE5\u586B\u5199",disabled:"\u662F\u5426\u7981\u7528",type:"\u6309\u94AE\u5F62\u5F0F",textColor:"\u6309\u94AE\u5F62\u5F0F\u6FC0\u6D3B\u65F6\u7684\u6587\u672C\u989C\u8272",fill:"\u6309\u94AE\u5F62\u5F0F\u6FC0\u6D3B\u65F6\u7684\u586B\u5145\u8272\u548C\u8FB9\u6846\u8272"}},rate:{name:"\u8BC4\u5206",props:{max:"\u6700\u5927\u5206\u503C",disabled:"\u662F\u5426\u7981\u7528",allowHalf:"\u662F\u5426\u5141\u8BB8\u534A\u9009",voidColor:"\u672A\u9009\u4E2D\u65F6\u56FE\u6807\u7684\u989C\u8272",disabledVoidColor:"\u53EA\u8BFB\u65F6\u672A\u9009\u4E2D\u65F6\u56FE\u6807\u7684\u989C\u8272",voidIconClass:"\u672A\u9009\u4E2D\u65F6\u56FE\u6807\u7684\u7C7B\u540D",disabledVoidIconClass:"\u53EA\u8BFB\u65F6\u672A\u9009\u4E2D\u65F6\u56FE\u6807\u7684\u7C7B\u540D",showScore:"\u662F\u5426\u663E\u793A\u5F53\u524D\u5206\u6570",textColor:"\u8F85\u52A9\u6587\u5B57\u7684\u989C\u8272",scoreTemplate:"\u5206\u6570\u663E\u793A\u6A21\u677F"}},fcDataSelect:{name:"\u5B50\u8868\u5355\u9009\u62E9\u5668"},select:{name:"\u9009\u62E9\u5668",title:"\u8BF7\u9009\u62E9",emptyText:"\u62D6\u62FD\u7EC4\u4EF6\u914D\u7F6E\u641C\u7D22\u6761\u4EF6",event:{removeTag:"\u591A\u9009\u6A21\u5F0F\u4E0B\u79FB\u9664tag\u65F6\u89E6\u53D1"},props:{title:"\u6807\u9898",valueKey:"\u6307\u5B9A\u9009\u9879\u7684\u503C\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",labelKey:"\u6307\u5B9A\u9009\u9879\u6807\u7B7E\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",autoLoad:"\u81EA\u52A8\u89E6\u53D1\u641C\u7D22",multiple:"\u662F\u5426\u591A\u9009",disabled:"\u662F\u5426\u7981\u7528",clearable:"\u662F\u5426\u53EF\u4EE5\u6E05\u7A7A\u9009\u9879",collapseTags:"\u591A\u9009\u65F6\u662F\u5426\u5C06\u9009\u4E2D\u503C\u6309\u6587\u5B57\u7684\u5F62\u5F0F\u5C55\u793A",multipleLimit:"\u591A\u9009\u65F6\u7528\u6237\u6700\u591A\u53EF\u4EE5\u9009\u62E9\u7684\u9879\u76EE\u6570\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236",placeholder:"\u5360\u4F4D\u7B26",filterable:"\u662F\u5426\u53EF\u641C\u7D22",allowCreate:"\u662F\u5426\u5141\u8BB8\u7528\u6237\u521B\u5EFA\u65B0\u6761\u76EE",noMatchText:"\u641C\u7D22\u6761\u4EF6\u65E0\u5339\u914D\u65F6\u663E\u793A\u7684\u6587\u5B57",noDataText:"\u9009\u9879\u4E3A\u7A7A\u65F6\u663E\u793A\u7684\u6587\u5B57",reserveKeyword:"\u591A\u9009\u4E14\u53EF\u641C\u7D22\u65F6\uFF0C\u662F\u5426\u5728\u9009\u4E2D\u4E00\u4E2A\u9009\u9879\u540E\u4FDD\u7559\u5F53\u524D\u7684\u641C\u7D22\u5173\u952E\u8BCD",defaultFirstOption:"\u5728\u8F93\u5165\u6846\u6309\u4E0B\u56DE\u8F66\uFF0C\u9009\u62E9\u7B2C\u4E00\u4E2A\u5339\u914D\u9879",remote:"\u5176\u4E2D\u7684\u9009\u9879\u662F\u5426\u4ECE\u670D\u52A1\u5668\u8FDC\u7A0B\u52A0\u8F7D",remoteMethod:"\u81EA\u5B9A\u4E49\u8FDC\u7A0B\u641C\u7D22\u65B9\u6CD5"}},slider:{name:"\u6ED1\u5757",props:{min:"\u6700\u5C0F\u503C",max:"\u6700\u5927\u503C",disabled:"\u662F\u5426\u7981\u7528",step:"\u6B65\u957F",showInput:"\u662F\u5426\u663E\u793A\u8F93\u5165\u6846\uFF0C\u4EC5\u5728\u975E\u8303\u56F4\u9009\u62E9\u65F6\u6709\u6548",showInputControls:"\u5728\u663E\u793A\u8F93\u5165\u6846\u7684\u60C5\u51B5\u4E0B\uFF0C\u662F\u5426\u663E\u793A\u8F93\u5165\u6846\u7684\u63A7\u5236\u6309\u94AE",showStops:"\u662F\u5426\u663E\u793A\u95F4\u65AD\u70B9",range:"\u662F\u5426\u4E3A\u8303\u56F4\u9009\u62E9",vertical:"\u662F\u5426\u7AD6\u5411\u6A21\u5F0F",height:"Slider \u9AD8\u5EA6\uFF0C\u7AD6\u5411\u6A21\u5F0F\u65F6\u5FC5\u586B"}},space:{name:"\u95F4\u8DDD"},stepForm:{name:"\u5206\u6B65\u8868\u5355",event:{next:"\u70B9\u51FB\u4E0B\u4E00\u6B65\u6309\u94AE\u65F6\u89E6\u53D1"},props:{submitBtn:"\u663E\u793A\u63D0\u4EA4\u6309\u94AE",autoValidate:"\u8FDB\u5165\u4E0B\u4E00\u6B65\u524D\u81EA\u52A8\u9A8C\u8BC1\u8868\u5355","stepsProps>alignCenter":"\u8FDB\u884C\u5C45\u4E2D\u5BF9\u9F50","stepsProps>simple":"\u662F\u5426\u5E94\u7528\u7B80\u6D01\u98CE\u683C"}},stepFormItem:{name:"\u6B65\u9AA4\u6761",props:{title:"\u6807\u9898",description:"\u63CF\u8FF0\u6587\u6848"}},subForm:{name:"\u5206\u7EC4",props:{disabled:"\u662F\u5426\u7981\u7528",syncDisabled:"\u662F\u5426\u4E0E\u5B50\u8868\u5355\u5F3A\u5236\u540C\u6B65\u7981\u7528\u72B6\u6001"}},switch:{name:"\u5F00\u5173",slots:{"active-action":"\u6253\u5F00\u65F6\u7684\u5185\u5BB9","inactive-action":"\u5173\u95ED\u65F6\u7684\u5185\u5BB9"},props:{disabled:"\u662F\u5426\u7981\u7528",width:"\u5BBD\u5EA6\uFF08px\uFF09",activeText:"\u6253\u5F00\u65F6\u7684\u6587\u5B57\u63CF\u8FF0",inactiveText:"\u5173\u95ED\u65F6\u7684\u6587\u5B57\u63CF\u8FF0",activeValue:"\u6253\u5F00\u65F6\u7684\u503C",inactiveValue:"\u5173\u95ED\u65F6\u7684\u503C",activeColor:"\u6253\u5F00\u65F6\u7684\u80CC\u666F\u8272",inactiveColor:"\u5173\u95ED\u65F6\u7684\u80CC\u666F\u8272"}},tableForm:{name:"\u8868\u683C\u8868\u5355",props:{disabled:"\u662F\u5426\u7981\u7528",filterEmptyColumn:"\u662F\u5426\u8FC7\u6EE4\u7A7A\u884C\u7684\u6570\u636E",max:"\u6700\u591A\u6DFB\u52A0\u51E0\u884C\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236",min:"\u6700\u5C11\u6DFB\u52A0\u51E0\u884C",size:"\u5C3A\u5BF8",emptyText:"\u7A7A\u6570\u636E\u65F6\u663E\u793A\u7684\u6587\u672C\u5185\u5BB9",height:"\u9AD8\u5EA6",showIndex:"\u663E\u793A\u884C\u53F7",stripe:"\u663E\u793A\u6591\u9A6C\u7EB9",border:"\u8FB9\u6846",button:"\u64CD\u4F5C\u6309\u94AE",page:"\u5206\u9875",addable:"\u5141\u8BB8\u65B0\u589E",deletable:"\u5141\u8BB8\u5220\u9664",newColumn:"\u9ED8\u8BA4\u663E\u793A\u65B0\u884C","button>column":"\u6309\u94AE\u7BA1\u7406","button>label":"\u64CD\u4F5C","button>fixed":"\u4F4D\u7F6E","button>width":"\u5217\u7684\u5BBD\u5EA6","page>props>pageSize":"\u6BCF\u9875\u663E\u793A\u6761\u76EE\u4E2A\u6570","page>props>small":"\u4F7F\u7528\u5C0F\u578B\u5206\u9875\u6837\u5F0F","page>props>background":"\u4E3A\u5206\u9875\u6309\u94AE\u6DFB\u52A0\u80CC\u666F\u8272"}},tableFormPro:{name:"\u8868\u683C\u8868\u5355Pro",event:{handleClick:"\u70B9\u51FB\u64CD\u4F5C\u6309\u94AE\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6"}},nestedTableForm:{name:"\u5D4C\u5957\u8868\u5355",props:{disabled:"\u662F\u5426\u7981\u7528",max:"\u6700\u591A\u6DFB\u52A0\u51E0\u884C\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236",nestedMax:"\u5B50\u8868\u5355\u6700\u591A\u6DFB\u52A0\u51E0\u884C\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236"}},infiniteTableForm:{name:"\u65E0\u9650\u7EA7\u8868\u5355",props:{disabled:"\u662F\u5426\u7981\u7528",childrenField:"\u8BBE\u7F6E\u5B50\u7EA7\u7684\u5B57\u6BB5\u540D",max:"\u6700\u591A\u6DFB\u52A0\u51E0\u884C\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236",layerMax:"\u6700\u591A\u6DFB\u52A0\u51E0\u5C42\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236"}},nestedSubTableForm:{name:"\u5B50\u8868\u683C\u8868\u5355"},tableFormColumn:{name:"\u8868\u683C\u683C\u5B50",label:"\u81EA\u5B9A\u4E49\u540D\u79F0",props:{label:"\u6807\u9898",header:"\u8868\u5934",fixed:"\u4F4D\u7F6E",width:"\u5BBD\u5EA6",color:"\u989C\u8272",hidden:"\u662F\u5426\u9690\u85CF",required:"\u662F\u5426\u663E\u793A\u5FC5\u586B\u661F\u53F7"}},tableFormColumn2:{name:"\u8868\u683C\u683C\u5B50",header:"\u914D\u7F6E\u5F53\u524D\u5217\u7684\u8868\u5934\u540D\u79F0\uFF0C\u91CD\u590D\u7684\u8868\u5934\u5C06\u81EA\u52A8\u5408\u5E76\u3002"},dataTable:{name:"\u6570\u636E\u8868\u683C",handle:"\u7981\u7528\u903B\u8F91",click:"\u70B9\u51FB\u4E8B\u4EF6",filter:"\u7B5B\u9009",header:"\u8868\u5934",event:{cellMouseEnter:"\u5F53\u5355\u5143\u683C hover \u8FDB\u5165\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",cellMouseLeave:"\u5F53\u5355\u5143\u683C hover \u9000\u51FA\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",handleClick:"\u70B9\u51FB\u64CD\u4F5C\u6309\u94AE\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",rowClick:"\u5F53\u67D0\u4E00\u884C\u88AB\u70B9\u51FB\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",rowDblclick:"\u5F53\u67D0\u4E00\u884C\u88AB\u53CC\u51FB\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",headerClick:"\u5F53\u67D0\u4E00\u5217\u7684\u8868\u5934\u88AB\u70B9\u51FB\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",filterChange:"\u7B5B\u9009\u6761\u4EF6\u53D8\u5316\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",expandChange:"\u5F53\u7528\u6237\u5BF9\u67D0\u4E00\u884C\u5C55\u5F00\u6216\u8005\u5173\u95ED\u7684\u65F6\u5019\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",sortChange:"\u5F53\u8868\u683C\u7684\u6392\u5E8F\u6761\u4EF6\u53D1\u751F\u53D8\u5316\u7684\u65F6\u5019\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",selectionChange:"\u5F53\u9009\u62E9\u9879\u53D1\u751F\u53D8\u5316\u65F6\u89E6\u53D1"},button:{title:"\u64CD\u4F5C\u6309\u94AE",btn:"\u914D\u7F6E\u64CD\u4F5C\u6309\u94AE",link:"\u6587\u5B57",round:"\u5706\u89D2",plain:"\u6734\u7D20",disabled:"\u7981\u7528"},column:{title:"\u5217\u8868\u7BA1\u7406",btn:"\u914D\u7F6E\u8868\u683C\u5217\u8868",prop:"\u5B57\u6BB5\u540D\u79F0",sort:"\u6392\u5E8F"},format:{default:"\u5E38\u89C4",tag:"\u6807\u7B7E",image:"\u56FE\u7247",custom:"\u81EA\u5B9A\u4E49"},fixed:{default:"\u5E38\u89C4",left:"\u5DE6\u60AC\u6D6E",right:"\u53F3\u60AC\u6D6E"},sortable:{disabled:"\u4E0D\u6392\u5E8F",default:"\u5E38\u89C4\u6392\u5E8F",custom:"\u63A5\u53E3\u6392\u5E8F"},props:{_optionType:"\u8868\u683C\u6570\u636E","page>totalField":"\u63A5\u53E3\u54CD\u5E94\u6570\u636E\u4E2D\u603B\u6761\u76EE\u6570\u7684\u5B57\u6BB5\u540D\u79F0","page>dataField":"\u63A5\u53E3\u54CD\u5E94\u6570\u636E\u4E2D\u5217\u8868\u6570\u636E\u7684\u5B57\u6BB5\u540D\u79F0","page>orderField":"\u8BF7\u6C42\u63A5\u53E3\u65F6\u6392\u5E8F\u7684\u53C2\u6570\u540D\u79F0","page>orderByField":"\u8BF7\u6C42\u63A5\u53E3\u65F6\u6392\u5E8F\u65B9\u5F0F\u7684\u53C2\u6570\u540D\u79F0","page>pageField":"\u8BF7\u6C42\u63A5\u53E3\u65F6\u9875\u7801\u7684\u53C2\u6570\u540D\u79F0(\u5206\u9875)","page>pageSizeField":"\u8BF7\u6C42\u63A5\u53E3\u65F6\u6761\u76EE\u6570\u7684\u53C2\u6570\u540D\u79F0(\u5206\u9875)",column:"\u8868\u683C\u7BA1\u7406",showSummary:"\u662F\u5426\u5728\u8868\u5C3E\u663E\u793A\u5408\u8BA1\u884C",selection:"\u662F\u5426\u663E\u793A\u591A\u9009\u6846",size:"\u5C3A\u5BF8",rowKey:"\u884C\u6570\u636E\u7684Key",emptyText:"\u7A7A\u6570\u636E\u65F6\u663E\u793A\u7684\u6587\u672C\u5185\u5BB9",height:"\u9AD8\u5EA6",index:"\u663E\u793A\u884C\u53F7",stripe:"\u663E\u793A\u6591\u9A6C\u7EB9",border:"\u8FB9\u6846",defaultExpandAll:"\u9ED8\u8BA4\u5C55\u5F00\u6240\u6709\u884C",button:"\u64CD\u4F5C\u6309\u94AE",page:"\u5206\u9875","button>column":"\u6309\u94AE\u7BA1\u7406","button>label":"\u64CD\u4F5C","button>fixed":"\u4F4D\u7F6E","button>width":"\u5217\u7684\u5BBD\u5EA6","page>position":"\u4F4D\u7F6E","page>props>pageSize":"\u6BCF\u9875\u663E\u793A\u6761\u76EE\u4E2A\u6570","page>props>small":"\u4F7F\u7528\u5C0F\u578B\u5206\u9875\u6837\u5F0F","page>props>background":"\u4E3A\u5206\u9875\u6309\u94AE\u6DFB\u52A0\u80CC\u666F\u8272"},requiredName:"\u8BF7\u8F93\u5165\u6309\u94AE\u540D\u79F0",requiredKey:"\u8BF7\u8F93\u5165\u6309\u94AE\u6807\u8BC6",requiredLabel:"\u8BF7\u8F93\u5165\u6807\u9898",requiredRender:"\u8BF7\u8F93\u5165\u6E32\u67D3\u51FD\u6570"},text:{name:"\u6587\u5B57",props:{formCreateChild:"\u5185\u5BB9"}},textarea:{name:"\u591A\u884C\u8F93\u5165\u6846",event:{change:"\u5F53\u503C\u6539\u53D8\u65F6\uFF0C\u5F53\u7EC4\u4EF6\u5931\u53BB\u7126\u70B9\u6216\u7528\u6237\u6309Enter\u65F6\u89E6\u53D1"},props:{disabled:"\u662F\u5426\u7981\u7528",readonly:"\u662F\u5426\u53EA\u8BFB",maxlength:"\u6700\u5927\u8F93\u5165\u957F\u5EA6",minlength:"\u6700\u5C0F\u8F93\u5165\u957F\u5EA6",showWordLimit:"\u662F\u5426\u663E\u793A\u7EDF\u8BA1\u5B57\u6570",placeholder:"\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C",rows:"\u8F93\u5165\u6846\u884C\u6570",autosize:"\u9AD8\u5EA6\u662F\u5426\u81EA\u9002\u5E94"}},timePicker:{name:"\u65F6\u95F4","HH:mm:ss":"\u65F6:\u5206:\u79D2","HH:mm":"\u65F6:\u5206",props:{__format:"\u8F93\u5165\u6846\u4E2D\u7684\u683C\u5F0F",pickerOptions:"\u5F53\u524D\u65F6\u95F4\u65E5\u671F\u9009\u62E9\u5668\u7279\u6709\u7684\u9009\u9879",readonly:"\u5B8C\u5168\u53EA\u8BFB",disabled:"\u7981\u7528",editable:"\u6587\u672C\u6846\u53EF\u8F93\u5165",clearable:"\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE",placeholder:"\u975E\u8303\u56F4\u9009\u62E9\u65F6\u7684\u5360\u4F4D\u5185\u5BB9",startPlaceholder:"\u8303\u56F4\u9009\u62E9\u65F6\u5F00\u59CB\u65E5\u671F\u7684\u5360\u4F4D\u5185\u5BB9",endPlaceholder:"\u8303\u56F4\u9009\u62E9\u65F6\u7ED3\u675F\u65E5\u671F\u7684\u5360\u4F4D\u5185\u5BB9",isRange:"\u662F\u5426\u4E3A\u65F6\u95F4\u8303\u56F4\u9009\u62E9",arrowControl:"\u662F\u5426\u4F7F\u7528\u7BAD\u5934\u8FDB\u884C\u65F6\u95F4\u9009\u62E9",align:"\u5BF9\u9F50\u65B9\u5F0F"}},tree:{name:"\u6811\u5F62\u63A7\u4EF6",event:{nodeClick:"\u5F53\u8282\u70B9\u88AB\u70B9\u51FB\u7684\u65F6\u5019\u89E6\u53D1",nodeContextmenu:"\u5F53\u67D0\u4E00\u8282\u70B9\u88AB\u9F20\u6807\u53F3\u952E\u70B9\u51FB\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",checkChange:"\u5F53\u590D\u9009\u6846\u88AB\u70B9\u51FB\u7684\u65F6\u5019\u89E6\u53D1",check:"\u70B9\u51FB\u8282\u70B9\u590D\u9009\u6846\u4E4B\u540E\u89E6\u53D1",currentChange:"\u5F53\u524D\u9009\u4E2D\u8282\u70B9\u53D8\u5316\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",nodeExpand:"\u8282\u70B9\u88AB\u5C55\u5F00\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",nodeCollapse:"\u8282\u70B9\u88AB\u5173\u95ED\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",nodeDragStart:"\u8282\u70B9\u5F00\u59CB\u62D6\u62FD\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",nodeDragEnter:"\u62D6\u62FD\u8FDB\u5165\u5176\u4ED6\u8282\u70B9\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",nodeDragLeave:"\u62D6\u62FD\u79BB\u5F00\u67D0\u4E2A\u8282\u70B9\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",nodeDragOver:"\u5728\u62D6\u62FD\u8282\u70B9\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6\uFF08\u7C7B\u4F3C\u6D4F\u89C8\u5668\u7684 mouseover \u4E8B\u4EF6\uFF09",nodeDragEnd:"\u62D6\u62FD\u7ED3\u675F\u65F6\uFF08\u53EF\u80FD\u672A\u6210\u529F\uFF09\u89E6\u53D1\u7684\u4E8B\u4EF6",nodeDrop:"\u62D6\u62FD\u6210\u529F\u5B8C\u6210\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6"},props:{emptyText:"\u5185\u5BB9\u4E3A\u7A7A\u7684\u65F6\u5019\u5C55\u793A\u7684\u6587\u672C",props:"\u914D\u7F6E\u9009\u9879",renderAfterExpand:"\u662F\u5426\u5728\u7B2C\u4E00\u6B21\u5C55\u5F00\u67D0\u4E2A\u6811\u8282\u70B9\u540E\u624D\u6E32\u67D3\u5176\u5B50\u8282\u70B9",defaultExpandAll:"\u662F\u5426\u9ED8\u8BA4\u5C55\u5F00\u6240\u6709\u8282\u70B9",expandOnClickNode:"\u662F\u5426\u5728\u70B9\u51FB\u8282\u70B9\u7684\u65F6\u5019\u5C55\u5F00\u6216\u8005\u6536\u7F29\u8282\u70B9\uFF0C\u5982\u679C\u4E3A false\uFF0C\u5219\u53EA\u6709\u70B9\u7BAD\u5934\u56FE\u6807\u7684\u65F6\u5019\u624D\u4F1A\u5C55\u5F00\u6216\u8005\u6536\u7F29\u8282\u70B9\u3002",checkOnClickNode:"\u662F\u5426\u5728\u70B9\u51FB\u8282\u70B9\u7684\u65F6\u5019\u9009\u4E2D\u8282\u70B9",autoExpandParent:"\u5C55\u5F00\u5B50\u8282\u70B9\u7684\u65F6\u5019\u662F\u5426\u81EA\u52A8\u5C55\u5F00\u7236\u8282\u70B9",checkStrictly:"\u5728\u663E\u793A\u590D\u9009\u6846\u7684\u60C5\u51B5\u4E0B\uFF0C\u662F\u5426\u4E25\u683C\u7684\u9075\u5FAA\u7236\u5B50\u4E0D\u4E92\u76F8\u5173\u8054\u7684\u505A\u6CD5",accordion:"\u662F\u5426\u6BCF\u6B21\u53EA\u6253\u5F00\u4E00\u4E2A\u540C\u7EA7\u6811\u8282\u70B9\u5C55\u5F00",indent:"\u76F8\u90BB\u7EA7\u8282\u70B9\u95F4\u7684\u6C34\u5E73\u7F29\u8FDB(px)",nodeKey:"\u6BCF\u4E2A\u6811\u8282\u70B9\u7528\u6765\u4F5C\u4E3A\u552F\u4E00\u6807\u8BC6\u7684\u5C5E\u6027\uFF0C\u6574\u68F5\u6811\u5E94\u8BE5\u662F\u552F\u4E00\u7684"}},upload:{name:"\u4E0A\u4F20",info:"\u4E0A\u4F20\u6210\u529F\u540E\uFF0C\u5C06\u63A5\u53E3\u8FD4\u56DE\u7684 URL \u8D4B\u503C\u7ED9 file.url\uFF0C\u6216\u5C06\u8FD4\u56DE\u7ED3\u679C\u8D4B\u503C\u7ED9 file.value\uFF0C\u4EE5\u4FBF\u5728\u540E\u7EED\u7684\u8868\u5355\u63D0\u4EA4\u65F6\u83B7\u53D6\u8FD9\u4E9B\u6570\u636E\u3002",event:{remove:"\u6587\u4EF6\u5217\u8868\u79FB\u9664\u6587\u4EF6\u65F6\u89E6\u53D1",preview:"\u70B9\u51FB\u6587\u4EF6\u5217\u8868\u4E2D\u5DF2\u4E0A\u4F20\u7684\u6587\u4EF6\u65F6\u89E6\u53D1",error:"\u6587\u4EF6\u4E0A\u4F20\u5931\u8D25\u65F6\u89E6\u53D1",progress:"\u6587\u4EF6\u4E0A\u4F20\u65F6\u89E6\u53D1",exceed:"\u5F53\u8D85\u51FA\u9650\u5236\u65F6\u89E6\u53D1"},slots:{tip:"\u8BF4\u660E"},props:{listType:"\u4E0A\u4F20\u7C7B\u578B",multiple:"\u662F\u5426\u652F\u6301\u591A\u9009\u6587\u4EF6",action:"\u4E0A\u4F20\u7684\u5730\u5740(\u5FC5\u586B)",beforeUpload:"\u4E0A\u4F20\u6587\u4EF6\u4E4B\u524D\u89E6\u53D1",onSuccess:"\u4E0A\u4F20\u6210\u529F\u65F6\u89E6\u53D1",beforeRemove:"\u5220\u9664\u6587\u4EF6\u4E4B\u524D\u89E6\u53D1",headers:"\u8BBE\u7F6E\u4E0A\u4F20\u7684\u8BF7\u6C42\u5934\u90E8",data:"\u4E0A\u4F20\u65F6\u9644\u5E26\u7684\u989D\u5916\u53C2\u6570",name:"\u4E0A\u4F20\u7684\u6587\u4EF6\u5B57\u6BB5\u540D",withCredentials:"\u652F\u6301\u53D1\u9001 cookie \u51ED\u8BC1\u4FE1\u606F",accept:"\u63A5\u53D7\u4E0A\u4F20\u7684\u6587\u4EF6\u7C7B\u578B",autoUpload:"\u662F\u5426\u5728\u9009\u53D6\u6587\u4EF6\u540E\u7ACB\u5373\u8FDB\u884C\u4E0A\u4F20",disabled:"\u662F\u5426\u7981\u7528",limit:"\u6700\u5927\u5141\u8BB8\u4E0A\u4F20\u4E2A\u6570"}},audioBox:{name:"\u97F3\u9891\u64AD\u653E\u5668",preloadOpt:{auto:"\u81EA\u52A8",metadata:"\u5143\u6570\u636E",none:"\u7981\u6B62"},event:{pause:"\u97F3\u9891\u64AD\u653E\u6682\u505C\u65F6\u89E6\u53D1",play:"\u97F3\u9891\u5F00\u59CB\u64AD\u653E\u65F6\u89E6\u53D1",ended:"\u97F3\u9891\u64AD\u653E\u7ED3\u675F\u540E\u89E6\u53D1"},props:{src:"\u97F3\u9891\u5730\u5740",type:"\u97F3\u9891\u7C7B\u578B",autoplay:"\u662F\u5426\u81EA\u52A8\u64AD\u653E",loop:"\u662F\u5426\u5FAA\u73AF\u64AD\u653E",muted:"\u662F\u5426\u9759\u97F3",controls:"\u662F\u5426\u663E\u793A\u63A7\u5236\u6761",preload:"\u9884\u52A0\u8F7D"}},barCodeBox:{name:"\u6761\u5F62\u7801",props:{value:"\u5185\u5BB9",format:"\u6761\u5F62\u7801\u7684\u7C7B\u578B",width:"\u5355\u4E2A\u6761\u5F62\u7684\u5BBD\u5EA6",height:"\u6761\u5F62\u7801\u7684\u9AD8\u5EA6",displayValue:"\u662F\u5426\u663E\u793A\u5185\u5BB9",fontSize:"\u8BBE\u7F6E\u6587\u5B57\u7684\u5927\u5C0F",textPosition:"\u8BBE\u7F6E\u6587\u5B57\u7684\u4F4D\u7F6E",textAlign:"\u8BBE\u7F6E\u6587\u5B57\u7684\u5BF9\u9F50\u65B9\u5F0F",textMargin:"\u8BBE\u7F6E\u6587\u5B57\u7684\u8FB9\u8DDD",background:"\u6761\u5F62\u7801\u7684\u80CC\u666F\u8272",lineColor:"\u7EBF\u6761\u7684\u989C\u8272"}},iframeBox:{name:"\u5185\u5D4C\u9875\u9762",event:{load:"\u9875\u9762\u52A0\u8F7D\u5B8C\u6210\u540E\u89E6\u53D1"},loadingOpt:{eager:"\u7ACB\u5373\u52A0\u8F7D",lazy:"\u5EF6\u8FDF\u52A0\u8F7D"},props:{src:"\u9875\u9762\u94FE\u63A5",loading:"\u52A0\u8F7D\u65B9\u5F0F"}},qrCodeBox:{name:"\u4E8C\u7EF4\u7801",circleTypeOpt:{square:"\u6B63\u65B9\u5F62",dots:"\u70B9\u72B6",rounded:"\u5706\u5F62",classy:"\u7ECF\u5178"},props:{data:"\u5185\u5BB9",image:"\u4E2D\u5FC3\u7684\u56FE\u7247\u94FE\u63A5",width:"\u4E8C\u7EF4\u7801\u7684\u5BBD\u5EA6",height:"\u4E8C\u7EF4\u7801\u7684\u9AD8\u5EA6",circleType:"\u70B9\u7684\u7C7B\u578B",circleColor:"\u70B9\u7684\u989C\u8272"}},signaturePad:{name:"\u624B\u5199\u7B7E\u540D",props:{penColor:"\u7EBF\u6761\u7684\u989C\u8272"}},videoBox:{name:"\u89C6\u9891\u64AD\u653E\u5668",event:{error:"\u89C6\u9891\u52A0\u8F7D\u5931\u8D25\u65F6\u89E6\u53D1",pause:"\u89C6\u9891\u64AD\u653E\u6682\u505C\u65F6\u89E6\u53D1",play:"\u89C6\u9891\u5F00\u59CB\u64AD\u653E\u65F6\u89E6\u53D1",ended:"\u89C6\u9891\u64AD\u653E\u7ED3\u675F\u540E\u89E6\u53D1"},props:{src:"\u89C6\u9891\u5730\u5740",type:"\u89C6\u9891\u7C7B\u578B",autoplay:"\u662F\u5426\u81EA\u52A8\u64AD\u653E",loop:"\u662F\u5426\u5FAA\u73AF\u64AD\u653E",isLive:"\u662F\u5426\u662F\u76F4\u64AD",controls:"\u662F\u5426\u663E\u793A\u63A7\u5236\u6761",withCredentials:"\u662F\u5426\u643A\u5E26\u51ED\u8BC1"}}},tmp:{duration:"\u65F6\u957F",chineseAmount:"\u91D1\u989D",col3:"\u4E09\u5217\u6805\u683C",col4:"\u56DB\u5217\u6805\u683C",table43:"4x3\u8868\u683C"}},rd=(e,t)=>ai.ElMessage({message:e,type:t||"info",customClass:"_fc-message-tip"}),dn=e=>rd(e,"error"),Wa=function(e,t,r,o){const i=o||{};return t.forEach(l=>{e.indexOf(l[r||"id"])>-1&&e.splice(e.indexOf(l[r||"id"]),1,l[i.label||"label"]),dt.trueArray(l[i.children||"children"])&&Wa(e,l[i.children||"children"],r,o)}),e},Nb=function(e,t){return t.forEach(r=>{e.indexOf(r.value)>-1&&(e[e.indexOf(r.value)]=r.label)}),e};function Or(e){if(e){if(!Array.isArray(e))return[e]}else return[];return e}function Tb(e,t){let r=t.rule.value;const o=t.$render.vNode.h,i=t.type,l=t.$handle.subForm[t.id],d=t.prop.readMode;if(t.prop.title.title&&t.prop.title.title.trim()&&(t.prop.title.title+="\uFF1A"),d===!1||d==="custom"||!t.input||t.rule.subForm||(Array.isArray(l)?l.length:l)||["fcGroup","fcSubForm","tableForm","tableFormPro","fcJson","stepForm","nestedTableForm","infiniteTableForm","fcUpload","fcDialog","fcDrawer","fcPopup"].indexOf(t.trueType)>-1)return t.trueType==="fcUpload"&&(t.prop.props.disabled=!0),t.parser.render(e,t);if(["radio","select","checkbox"].indexOf(i)>-1)r=Nb([...Or(r)],t.prop.props.options||t.prop.props.formCreateInject.options||[]).join(", ");else if(["timePicker","datePicker","slider"].indexOf(i)>-1)r=Array.isArray(r)?r.join(" - "):r;else if(i==="cascader")r=[...Or(r)],Array.isArray(r[0])||(r=[r]),r=r.map(c=>Wa(c,t.prop.props.options||t.prop.props.formCreateInject.options||[],"value",t.prop.props.props).join("/")).join(", ");else if(i==="elTransfer"){const c=[...Or(r)];r=Wa(c,t.prop.props.data||t.prop.props.formCreateInject.options||[],"key").join(", ")}else if(i==="fcDataSelect")r=[...Or(r)].map(u=>u[t.prop.props.labelKey||"label"]).join(", ");else if(["tree","elTreeSelect"].indexOf(i)>-1){const c=t.prop.props.data||t.prop.props.formCreateInject.options||[];r=Wa([...Or(r)],c,i==="elTreeSelect"?"value":"id").join(", ")}else{if(i==="fcEditor"||d==="html")return o("div",{innerHTML:r});if(d==="image")return r=Or(r),o("div",{class:"_fc-upload"},r.map(function(c){return o("div",{class:"_fc-upload-preview"},[o("el-image",{src:(c==null?void 0:c.url)||c,previewSrcList:r.map(u=>(u==null?void 0:u.url)||u),previewTeleported:!0,fit:"cover"})])}));if((i==="switch"||i==="el-switch")&&(t.prop.props.activeValue!=null||t.prop.props.inactiveValue!=null))r=t.prop.props.activeValue===r?"\u662F":"\u5426";else{if(i==="signaturePad"&&r)return o("el-image",{src:r,previewTeleported:!0,fit:"cover",style:{height:"90px"}});typeof r=="boolean"&&(r=r?"\u662F":"\u5426")}}return o("span",{class:"_fc-read-view"},[""+(r==null?"":r)])}function Db(e,t){return`
+err: ${i}`);return}}return e}function id(e){const t=e.replace(/(-[a-z])/g,function(r){return r.replace("-","").toLocaleUpperCase()});return Ha(t)}function Ha(e){return e.replace(e[0],e[0].toLowerCase())}const yp={name:"zh-cn",form:{field:"\u5B57\u6BB5 ID",title:"\u5B57\u6BB5\u540D\u79F0",attributeId:"\u662F\u5426\u4E3B\u952E",fieldtype:"\u5B57\u6BB5\u7C7B\u578B",info:"\u63D0\u793A\u4FE1\u606F",ignore:"\u5FFD\u7565\u5B57\u6BB5",native:"\u662F\u5426\u663E\u793A\u6807\u9898",control:"\u7EC4\u4EF6\u8054\u52A8",labelShow:"\u662F\u5426\u663E\u793A",labelPosition:"\u6807\u7B7E\u7684\u4F4D\u7F6E",tableName:"\u81EA\u5B9A\u4E49\u540D\u79F0",labelStyle:"\u6807\u7B7E\u7684\u6837\u5F0F",labelSuffix:"\u6807\u7B7E\u7684\u540E\u7F00",formItem:"\u914D\u7F6E\u8868\u5355\u9879",formItemSpan:"\u7EC4\u4EF6\u5BBD\u5EA6",row:"\u6574\u884C",globalEvent:"\u5168\u5C40\u4E8B\u4EF6",globalFetch:"\u5168\u5C40\u6570\u636E\u6E90",globalClass:"\u5168\u5C40\u6837\u5F0F",globalConfig:"\u5168\u5C40\u914D\u7F6E",size:"\u8868\u5355\u7684\u5C3A\u5BF8",event:"\u8868\u5355\u4E8B\u4EF6",labelWidth:"\u6807\u7B7E\u7684\u5BBD\u5EA6",hideRequiredAsterisk:"\u9690\u85CF\u5FC5\u586B\u5B57\u6BB5\u7684\u6807\u7B7E\u65C1\u8FB9\u7684\u7EA2\u8272\u661F\u53F7",formItemMarginBottom:"\u8868\u5355\u9879\u7684\u4E0B\u8FB9\u8DDD",showMessage:"\u663E\u793A\u6821\u9A8C\u9519\u8BEF\u4FE1\u606F",inlineMessage:"\u4EE5\u884C\u5185\u5F62\u5F0F\u5C55\u793A\u6821\u9A8C\u4FE1\u606F",submitBtn:"\u662F\u5426\u663E\u793A\u8868\u5355\u63D0\u4EA4\u6309\u94AE",resetBtn:"\u662F\u5426\u663E\u793A\u8868\u5355\u91CD\u7F6E\u6309\u94AE",appendChild:"\u6DFB\u52A0\u5B50\u7EA7",formMode:"\u8868\u5355\u6A21\u5F0F",formName:"\u8868\u5355\u540D\u79F0",ignoreHiddenFields:"\u63D0\u4EA4\u8868\u5355\u65F6\u5FFD\u7565\u88AB\u9690\u85CF\u7684\u5B57\u6BB5",previewMode:"\u9605\u8BFB\u6A21\u5F0F",componentMode:"\u751F\u6210\u7EC4\u4EF6",sfcMode:"\u751F\u6210SFC",document:"\u5E2E\u52A9\u6587\u6863",controlDocument:"\u9700\u8981\u66F4\u8BE6\u7EC6\u7684\u914D\u7F6E\u65B9\u6CD5\uFF1F\u8BF7\u67E5\u770B{doc}",onSubmit:"\u8868\u5355\u63D0\u4EA4\u65F6\u89E6\u53D1",onReset:"\u8868\u5355\u91CD\u7F6E\u540E\u89E6\u53D1",onCreated:"\u8868\u5355\u7EC4\u4EF6\u521D\u59CB\u5316\u5B8C\u6BD5\u540E\u89E6\u53D1",onMounted:"\u8868\u5355\u7EC4\u4EF6\u6E32\u67D3\u5B8C\u6BD5\u540E\u89E6\u53D1",onReload:"\u8868\u5355\u6E32\u67D3\u89C4\u5219\u91CD\u8F7D\u540E\u89E6\u53D1",onChange:"\u8868\u5355\u7EC4\u4EF6\u7684\u503C\u53D1\u751F\u53D8\u5316\u65F6\u89E6\u53D1",beforeSubmit:"\u8868\u5355\u9A8C\u8BC1\u901A\u8FC7\u65F6\u89E6\u53D1",beforeFetch:"\u8FDC\u7A0B\u6570\u636E\u8BF7\u6C42\u53D1\u9001\u524D\u89E6\u53D1"},ai:{name:"\u667A\u80FD\u8868\u5355\u52A9\u7406",info:"\u60A8\u597D\uFF0C\u6211\u662F\u60A8\u7684\u667A\u80FD\u8868\u5355\u52A9\u624B\uFF01\u6211\u53EF\u4EE5\u5E2E\u52A9\u60A8\u5FEB\u901F\u751F\u6210\u548C\u4FEE\u6539\u8868\u5355\uFF0C\u5E2E\u52A9\u60A8\u8F7B\u677E\u9AD8\u6548\u5730\u5B8C\u6210\u8868\u5355\u8BBE\u8BA1\u3002",try:"\u4F60\u53EF\u4EE5\u8BD5\u7740\u95EE\u6211",change:"\u6362\u4E00\u6362",loading:"\u6B63\u5728\u6839\u636E\u60A8\u7684\u9700\u6C42\u5236\u4F5C\u8868\u5355\uFF0C\u8BF7\u7A0D\u5019...",fail:"\u5236\u4F5C\u8868\u5355\u65F6\u9047\u5230\u95EE\u9898\uFF0C\u8BF7\u5C1D\u8BD5\u8C03\u6574\u5185\u5BB9\u3002",success:"\u5DF2\u5904\u7406\u5B8C\u6BD5\uFF01",placeholder:"\u8BF7\u63CF\u8FF0\u60A8\u7684\u9700\u6C42"},warning:{name:"\u7EC4\u4EF6\u7684\u552F\u4E00\u6807\u8BC6\uFF0C\u7528\u4E8E\u83B7\u53D6\u548C\u4FEE\u6539\u8BE5\u7EC4\u4EF6\u7684\u914D\u7F6E\u89C4\u5219\u3002\u901A\u8FC7\u8BE5\u6807\u8BC6\u53EF\u4EE5\u7CBE\u786E\u5B9A\u4F4D\u7EC4\u4EF6\uFF0C\u5B9E\u73B0\u5BF9\u7EC4\u4EF6\u5C5E\u6027\u548C\u884C\u4E3A\u7684\u63A7\u5236\u3002",field:"\u7EC4\u4EF6\u5BF9\u5E94\u7684\u5B57\u6BB5\u540D\u7528\u4E8E\u4E0E\u7EC4\u4EF6\u7684\u6570\u636E\u8FDB\u884C\u7ED1\u5B9A\u3002\u5B57\u6BB5\u540D\u9700\u4EE5\u5B57\u6BCD\u5F00\u5934\uFF0C\u4EE5\u786E\u4FDD\u80FD\u591F\u6B63\u786E\u8BC6\u522B\u3002",formList:"\u7528\u4E8E\u7BA1\u7406\u548C\u5207\u6362\u8868\u5355\u6A21\u677F\uFF0C\u65B9\u4FBF\u5728\u4E0D\u540C\u4E1A\u52A1\u573A\u666F\u4E2D\u5FEB\u901F\u5207\u6362\u548C\u914D\u7F6E\u8868\u5355\u3002",fetch:"\u8FDC\u7A0B\u6570\u636E\u901A\u8FC7\u8FDC\u7A0B\u8BF7\u6C42\u52A0\u8F7D\u7EC4\u4EF6\u7684\u914D\u7F6E\u9879\u3002\u914D\u7F6E\u8BF7\u6C42\u53C2\u6570\u540E\uFF0C\u7EC4\u4EF6\u4F1A\u81EA\u52A8\u53D1\u8D77\u8BF7\u6C42\uFF0C\u83B7\u53D6\u8FDC\u7A0B\u6570\u636E\u5E76\u6839\u636E\u8FD4\u56DE\u7684\u7ED3\u679C\u66F4\u65B0\u7EC4\u4EF6\u3002",fetchQuery:"\u5B9A\u4E49\u8BF7\u6C42\u7684 GET \u53C2\u6570\uFF0C\u901A\u8FC7 URL \u4F20\u9012\u6570\u636E\u3002",fetchData:"\u5B9A\u4E49\u8BF7\u6C42\u7684 POST \u53C2\u6570\uFF0C\u901A\u8FC7\u8BF7\u6C42\u4F53\u4F20\u9012\u6570\u636E\u3002",fetchDataType:"\u9009\u62E9\u8BF7\u6C42\u4F53\u7684\u6570\u636E\u7C7B\u578B\uFF0C\u786E\u4FDD\u6570\u636E\u683C\u5F0F\u6B63\u786E\u3002",beforeFetch:"\u5728\u8BF7\u6C42\u53D1\u9001\u524D\uFF0C\u53EF\u901A\u8FC7\u5904\u7406\u51FD\u6570\u4FEE\u6539\u8BF7\u6C42\u53C2\u6570\uFF1B\u82E5\u9700\u7EC8\u6B62\u8BF7\u6C42\uFF0C\u76F4\u63A5\u8FD4\u56DE false \u6216\u4E00\u4E2A\u62D2\u7EDD\u7684 Promise\u3002",fetchParse:"\u8BF7\u6C42\u8FD4\u56DE\u540E\uFF0C\u53EF\u4EE5\u901A\u8FC7\u5904\u7406\u51FD\u6570\u5BF9\u8FD4\u56DE\u7684\u7ED3\u679C\u8FDB\u884C\u5904\u7406\uFF0C\u5C06\u7ED3\u679C\u8F6C\u6362\u4E3A\u7EC4\u4EF6\u6240\u9700\u7684\u6570\u636E\u548C\u7ED3\u6784\u3002",language:"\u7BA1\u7406\u9875\u9762\u7684\u591A\u8BED\u8A00\u6570\u636E\uFF0C\u5728\u7EC4\u4EF6\u4E2D\u914D\u7F6E\u4E0D\u540C\u8BED\u8A00\u7684\u6587\u672C\uFF0C\u652F\u6301\u4E00\u952E\u5207\u6362\u8BED\u8A00\u4F53\u7CFB\uFF0C\u4FBF\u4E8E\u5728\u591A\u8BED\u8A00\u73AF\u5883\u4E0B\u4F7F\u7528\u548C\u5C55\u793A\u5185\u5BB9\u3002",variable:"\u4ECE\u53D8\u91CF\u8BFB\u53D6\u914D\u7F6E\u9879\u7684\u503C\uFF0C\u652F\u6301\u901A\u8FC7\u53D8\u91CF\uFF08\u5982 Cookie\u3001localStorage\u3001\u5168\u5C40\u53D8\u91CF\u548C\u5916\u90E8\u6570\u636E\u6E90\u7B49\uFF09\u8BBE\u7F6E\u914D\u7F6E\u9879\u3002\u5F53\u5173\u8054\u7684\u53D8\u91CF\u53D8\u5316\u65F6\uFF0C\u914D\u7F6E\u9879\u4F1A\u540C\u6B65\u66F4\u65B0\u3002",variableInfo:"\u8BF7\u5728\u53D8\u91CF\u5217\u8868\u4E2D\u9009\u62E9\u53D8\u91CF\u3002\u5982\u679C\u53D8\u91CF\u7684\u503C\u662F\u5BF9\u8C61\uFF0C\u60A8\u53EF\u4EE5\u901A\u8FC7 {{variableName.attributeName}} \u683C\u5F0F\u8BBF\u95EE\u5BF9\u8C61\u4E2D\u7684\u5C5E\u6027\u503C\u3002",pageManage:"\u8BBE\u8BA1\u8868\u5355\u4E2D\u7684\u5B50\u5F39\u7A97\uFF0C\u901A\u8FC7\u4E8B\u4EF6\u89E6\u53D1\u5F39\u7A97\u663E\u793A\uFF0C\u4FBF\u4E8E\u5728\u8868\u5355\u4E2D\u52A8\u6001\u5C55\u793A\u4FE1\u606F\u6216\u8FDB\u884C\u4EA4\u4E92\u64CD\u4F5C\u3002",globalConfig:"\u7BA1\u7406\u5168\u5C40\u4E8B\u4EF6\u3001\u6837\u5F0F\u3001\u6570\u636E\u548C\u53D8\u91CF\uFF0C\u7528\u4E8E\u5728\u4E0D\u540C\u7EC4\u4EF6\u95F4\u8FDB\u884C\u6570\u636E\u5171\u4EAB\u548C\u4E8B\u4EF6\u5904\u7406\u3002",globalClass:"\u63D0\u4F9B\u5B9A\u4E49\u5168\u5C40\u6837\u5F0F\u548C Class \u7684\u529F\u80FD\uFF0C\u7528\u6237\u53EF\u4EE5\u5728\u7EC4\u4EF6\u914D\u7F6E\u4E2D\u9009\u62E9\u5E76\u5E94\u7528\u8FD9\u4E9B\u9884\u5B9A\u4E49\u7684 Class\uFF0C\u4EE5\u5B9E\u73B0\u7EDF\u4E00\u7684\u6837\u5F0F\u7BA1\u7406\u3002",globalEvent:"\u5168\u5C40\u4E8B\u4EF6\u7528\u4E8E\u5B9A\u4E49\u7EC4\u4EF6\u4E8B\u4EF6\uFF0C\u4F9B\u7EC4\u4EF6\u8FDB\u884C\u914D\u7F6E\u548C\u9009\u62E9\uFF0C\u65B9\u4FBF\u5728\u4E0D\u540C\u7EC4\u4EF6\u4E2D\u7EDF\u4E00\u4F7F\u7528\u9884\u8BBE\u4E8B\u4EF6\uFF0C\u7B80\u5316\u4E8B\u4EF6\u7684\u7BA1\u7406\u548C\u5206\u53D1\u3002",globalFetch:"\u5168\u5C40\u6570\u636E\u6E90\u7528\u4E8E\u5B9A\u4E49\u5E38\u7528\u7684\u6570\u636E\u6E90\uFF0C\u652F\u6301\u9759\u6001\u6570\u636E\u548C\u8FDC\u7A0B\u6570\u636E\u3002\u8BE5\u6570\u636E\u6E90\u53EF\u5728\u5404\u79CD\u7EC4\u4EF6\u914D\u7F6E\u4E2D\u4F7F\u7528\uFF0C\u65B9\u4FBF\u7EDF\u4E00\u7BA1\u7406\u548C\u8C03\u7528\u6570\u636E\u3002",globalVariable:"\u5168\u5C40\u53D8\u91CF\u4E2D\u53EF\u4EE5\u5B9A\u4E49\u8BA1\u7B97\u5C5E\u6027\uFF0C\u901A\u8FC7\u8868\u5355\u6570\u636E\u548C\u5916\u90E8\u6570\u636E\u8FD4\u56DE\u7EC4\u4EF6\u6240\u9700\u7684\u6570\u636E\u3002\u5173\u8054\u6570\u636E\u53D8\u5316\u65F6\uFF0C\u8BA1\u7B97\u5C5E\u6027\u4F1A\u81EA\u52A8\u66F4\u65B0\uFF0C\u53EF\u4EE5\u5728\u7ED1\u5B9A\u53D8\u91CF\u6A21\u5757\u548C\u4E8B\u4EF6\u4E2D\u4F7F\u7528\u3002",ignore:"\u5F00\u542F\u540E\uFF0C\u8868\u5355\u63D0\u4EA4\u65F6\u4F1A\u81EA\u52A8\u6392\u9664\u8BE5\u7EC4\u4EF6\u7684\u5B57\u6BB5\uFF0C\u4E0D\u4F1A\u5C06\u5176\u5305\u542B\u5728\u63D0\u4EA4\u7684\u6570\u636E\u4E2D\u3002",ignoreHiddenFields:"\u5F00\u542F\u540E\uFF0C\u8868\u5355\u63D0\u4EA4\u65F6\u4F1A\u81EA\u52A8\u8FC7\u6EE4\u6389\u88AB\u9690\u85CF\u7684\u7EC4\u4EF6\u5B57\u6BB5\uFF0C\u786E\u4FDD\u4EC5\u63D0\u4EA4\u53EF\u89C1\u7684\u5B57\u6BB5\u6570\u636E\u3002",behaviorIgnoreError:"\u5982\u679C\u52A8\u4F5C\u6267\u884C\u8FC7\u7A0B\u4E2D\u53D1\u751F\u9519\u8BEF\uFF0C\u662F\u5426\u7EE7\u7EED\u6267\u884C\u540E\u7EED\u7684\u52A8\u4F5C\u3002",behaviorExpression:"\u5F53\u6761\u4EF6\u8FBE\u6210\u65F6\uFF0C\u52A8\u4F5C\u624D\u4F1A\u88AB\u6267\u884C\u3002",behaviorStopPropagation:"\u5F53\u6761\u4EF6\u8FBE\u6210\u65F6\uFF0C\u4F1A\u963B\u6B62\u540E\u7EED\u52A8\u4F5C\u7684\u6267\u884C\u3002",computedCondition:"\u901A\u8FC7\u5B9A\u4E49\u6761\u4EF6\uFF0C\u7EC4\u4EF6\u7684\u72B6\u6001\u548C\u6570\u636E\u503C\u4F1A\u6839\u636E\u6761\u4EF6\u662F\u5426\u6210\u7ACB\u81EA\u52A8\u8C03\u6574\u3002",computedFormula:"\u901A\u8FC7\u516C\u5F0F\u548C\u8868\u5355\u6570\u636E\uFF0C\u52A8\u6001\u8BA1\u7B97\u7EC4\u4EF6\u7684\u72B6\u6001\u548C\u6570\u636E\u503C\u3002"},computed:{value:{title:"\u6570\u636E\u8054\u52A8",btn:"\u8BBE\u7F6E\u6570\u636E\u8054\u52A8",name:"\u8BBE\u7F6E\u7EC4\u4EF6\u7684\u503C"},hidden:{title:"\u9690\u85CF\u6761\u4EF6",btn:"\u8BBE\u7F6E\u9690\u85CF\u6761\u4EF6",name:"\u8BBE\u7F6E\u7EC4\u4EF6\u7684\u9690\u85CF\u6761\u4EF6"},required:{title:"\u5FC5\u586B\u6761\u4EF6",btn:"\u8BBE\u7F6E\u5FC5\u586B\u6761\u4EF6",name:"\u8BBE\u7F6E\u7EC4\u4EF6\u7684\u5FC5\u586B\u6761\u4EF6"},disabled:{title:"\u7981\u7528\u6761\u4EF6",btn:"\u8BBE\u7F6E\u7981\u7528\u6761\u4EF6",name:"\u8BBE\u7F6E\u7EC4\u4EF6\u7684\u7981\u7528\u6761\u4EF6"},formulas:{"==":"\u7B49\u4E8E","!=":"\u4E0D\u7B49\u4E8E",on:"\u5305\u542B",notOn:"\u4E0D\u5305\u542B",empty:"\u4E3A\u7A7A",notEmpty:"\u4E0D\u4E3A\u7A7A",pattern:"\u6B63\u5219\u8868\u8FBE\u5F0F",">":"\u5927\u4E8E",">=":"\u5927\u4E8E\u7B49\u4E8E","<":"\u5C0F\u4E8E","<=":"\u5C0F\u4E8E\u7B49\u4E8E"},variable:{attr:"\u5C5E\u6027\u5217\u8868",bind:"\u7ED1\u5B9A\u53D8\u91CF",list:"\u53D8\u91CF\u5217\u8868",btn:"\u8BBE\u7F6E\u53D8\u91CF",title:"\u5168\u5C40\u53D8\u91CF",create:"\u521B\u5EFA\u53D8\u91CF",placeholder:"\u8BF7\u8F93\u5165\u53D8\u91CF\u7684\u63CF\u8FF0\u4FE1\u606F"},linkage:{trigger:"\u89E6\u53D1\u4EE5\u4E0B\u8054\u52A8",info:["\u5F53\u524D\u7EC4\u4EF6\u8054\u52A8\u663E\u793A","\u7684\u503C"]},name:"\u8BA1\u7B97\u516C\u5F0F",setting:"\u8BBE\u7F6E\u6761\u4EF6",invert:"\u6761\u4EF6\u6210\u7ACB\u540E\u7EC4\u4EF6\u72B6\u6001",condition:"\u903B\u8F91\u6761\u4EF6",addCondition:"\u6DFB\u52A0\u6761\u4EF6",addGroup:"\u6DFB\u52A0\u6761\u4EF6\u7EC4",form:"\u5F53\u524D\u8868\u5355",subform:"\u5B50\u8868\u5355",formula:"\u51FD\u6570\u516C\u5F0F",formulaInfo:"\u51FD\u6570\u8BF4\u660E",formulaExample:"\u51FD\u6570\u793A\u4F8B",fieldUsed:"\u3010{label}\u3011\u5728\u8BA1\u7B97\u516C\u5F0F\u4E2D\u88AB\u4F7F\u7528\uFF0C\u8BF7\u5148\u4FEE\u6539\u5BF9\u5E94\u516C\u5F0F",fieldExist:"\u3010{label}\u3011\u5B57\u6BB5\u5DF2\u5B58\u5728",fieldEmpty:"\u5B57\u6BB5\u540D\u79F0\u4E0D\u80FD\u4E3A\u7A7A",fieldChar:"\u5B57\u6BB5\u540D\u79F0\u5FC5\u987B\u4EE5\u5B57\u6BCD\u5F00\u5934"},validate:{type:"\u5B57\u6BB5\u7C7B\u578B",typePlaceholder:"\u8BF7\u9009\u62E9",trigger:"\u89E6\u53D1\u65B9\u5F0F",mode:"\u9A8C\u8BC1\u65B9\u5F0F",modes:{required:"\u5FC5\u586B",notRequired:"\u975E\u5FC5\u586B",pattern:"\u6B63\u5219\u8868\u8FBE\u5F0F",validator:"\u81EA\u5B9A\u4E49\u9A8C\u8BC1",min:"\u6700\u5C0F\u503C",max:"\u6700\u5927\u503C",len:"\u957F\u5EA6"},types:{string:"\u6587\u672C",boolean:"\u5E03\u5C14",array:"\u591A\u9009",number:"\u6570\u5B57",integer:"\u6574\u6570",float:"\u5C0F\u6570",object:"\u5408\u96C6",date:"\u65E5\u671F",url:"URL\u94FE\u63A5",email:"\u90AE\u7BB1\u5730\u5740"},message:"\u9519\u8BEF\u4FE1\u606F",auto:"\u81EA\u52A8\u83B7\u53D6",autoRequired:"\u8BF7\u8F93\u5165{title}",autoMode:"\u8BF7\u8F93\u5165\u6B63\u786E\u7684{title}",requiredPlaceholder:"\u8BF7\u8F93\u5165\u63D0\u793A\u8BED",required:"\u662F\u5426\u5FC5\u586B",rule:"\u9A8C\u8BC1\u89C4\u5219"},tableOptions:{handle:"\u64CD\u4F5C",add:"\u6DFB\u52A0",empty1:"\u70B9\u51FB\u53F3\u4E0B\u89D2",empty2:"\u6309\u94AE\u6DFB\u52A0\u4E00\u5217",rmCol:"\u5220\u9664\u5F53\u524D\u5217",rmRow:"\u5220\u9664\u5F53\u524D\u884C",splitRow:"\u62C6\u5206\u6210\u884C",splitCol:"\u62C6\u5206\u6210\u5217",mergeBottom:"\u5411\u4E0B\u5408\u5E76",mergeRight:"\u5411\u53F3\u5408\u5E76",addTop:"\u6DFB\u52A0\u4E0A\u5217",addBottom:"\u6DFB\u52A0\u4E0B\u5217",addLeft:"\u6DFB\u52A0\u5DE6\u5217",addRight:"\u6DFB\u52A0\u53F3\u5217",keyValue:"\u952E\u503C\u5BF9"},struct:{title:"\u7F16\u8F91\u6570\u636E",only:"\u3010{label}\u3011\u53EA\u5141\u8BB8\u6DFB\u52A0\u4E00\u4E2A",errorMsg:"\u8F93\u5165\u7684\u5185\u5BB9\u8BED\u6CD5\u9519\u8BEF",configured:"\u5DF2\u914D\u7F6E",configuredData:"\u5DF2\u914D\u7F6E {num} \u4E2A\u6570\u636E\u6E90",configuredEvent:"\u5DF2\u914D\u7F6E {num} \u4E2A\u4E8B\u4EF6"},class:{title:"\u8BBE\u7F6E\u6837\u5F0F",create:"\u521B\u5EFA\u6837\u5F0F",placeholder:"\u8BF7\u8F93\u5165\u6837\u5F0F\u7684\u63CF\u8FF0\u4FE1\u606F",saveMsg:"\u8BF7\u5148\u4FDD\u5B58\u5F53\u524D\u6B63\u5728\u7F16\u8F91\u7684\u6837\u5F0F",configured:"\u5DF2\u914D\u7F6E {num} \u4E2A\u6837\u5F0F"},event:{title:"\u8BBE\u7F6E\u4E8B\u4EF6",create:"\u521B\u5EFA\u4E8B\u4EF6",list:"\u4E8B\u4EF6\u5217\u8868",placeholder:"\u8BF7\u8F93\u5165\u4E8B\u4EF6\u7684\u540D\u79F0",saveMsg:"\u8BF7\u5148\u4FDD\u5B58\u5F53\u524D\u6B63\u5728\u7F16\u8F91\u7684\u4E8B\u4EF6",type:"\u7C7B\u578B",info:"\u8BF4\u660E",action:"\u7F16\u8F91\u884C\u4E3A",inject:{api:"\u5F53\u524D\u8868\u5355\u7684api",rule:"\u5F53\u524D\u8868\u5355\u7684\u751F\u6210\u89C4\u5219",self:"\u7EC4\u4EF6\u7684\u751F\u6210\u89C4\u5219",option:"\u8868\u5355\u7684\u914D\u7F6E",args:"\u4E8B\u4EF6\u7684\u539F\u59CB\u53C2\u6570"}},eventInfo:{blur:"\u5931\u53BB\u7126\u70B9\u65F6\u89E6\u53D1",focus:"\u83B7\u5F97\u7126\u70B9\u65F6\u89E6\u53D1",change:"\u5F53\u7ED1\u5B9A\u503C\u53D8\u5316\u65F6\u89E6\u53D1",input:"\u5728\u503C\u6539\u53D8\u65F6\u89E6\u53D1",clear:"\u5728\u70B9\u51FB\u6E05\u7A7A\u6309\u94AE\u65F6\u89E6\u53D1",close:"\u5173\u95ED\u7EC4\u4EF6\u65F6\u89E6\u53D1",click:"\u70B9\u51FB\u7EC4\u4EF6\u65F6\u89E6\u53D1",add:"\u589E\u52A0\u65F6\u89E6\u53D1",delete:"\u5220\u9664\u65F6\u89E6\u53D1",remove:"\u5220\u9664\u65F6\u89E6\u53D1",visibleChange:"\u4E0B\u62C9\u6846\u51FA\u73B0/\u9690\u85CF\u65F6\u89E6\u53D1",calendarChange:"\u5728\u65E5\u5386\u6240\u9009\u65E5\u671F\u66F4\u6539\u65F6\u89E6\u53D1",panelChange:"\u5F53\u65E5\u671F\u9762\u677F\u6539\u53D8\u65F6\u89E6\u53D1",open:"\u6253\u5F00\u7684\u56DE\u8C03",opened:"\u6253\u5F00\u52A8\u753B\u7ED3\u675F\u65F6\u7684\u56DE\u8C03",closed:"\u5173\u95ED\u52A8\u753B\u7ED3\u675F\u65F6\u7684\u56DE\u8C03",openAutoFocus:"\u8F93\u5165\u7126\u70B9\u805A\u7126\u5728\u5185\u5BB9\u65F6\u7684\u56DE\u8C03",closeAutoFocus:"\u8F93\u5165\u7126\u70B9\u4ECE\u5185\u5BB9\u5931\u7126\u65F6\u7684\u56DE\u8C03",submit:"\u8868\u5355\u63D0\u4EA4\u65F6\u89E6\u53D1",confirm:"\u70B9\u51FB\u786E\u8BA4\u6309\u94AE\u65F6\u89E6\u53D1",validateFail:"\u8868\u5355\u9A8C\u8BC1\u5931\u8D25\u65F6\u89E6\u53D1",beforeLoad:"\u521D\u59CB\u5316\u4E4B\u524D\u89E6\u53D1",loaded:"\u521D\u59CB\u5316\u5B8C\u6210\u4E4B\u540E\u89E6\u53D1",hook_load:"\u7EC4\u4EF6\u89C4\u5219\u52A0\u8F7D\u540E\u89E6\u53D1",hook_mounted:"\u7EC4\u4EF6\u6302\u8F7D\u540E\u89E6\u53D1",hook_deleted:"\u7EC4\u4EF6\u89C4\u5219\u88AB\u79FB\u9664\u540E\u89E6\u53D1",hook_watch:"\u7EC4\u4EF6\u89C4\u5219\u53D1\u751F\u53D8\u5316\u540E\u89E6\u53D1",hook_value:"\u7EC4\u4EF6\u7684\u503C\u53D1\u751F\u53D8\u5316\u540E\u89E6\u53D1",hook_hidden:"\u7EC4\u4EF6\u663E\u793A\u72B6\u6001\u53D1\u751F\u53D8\u5316\u540E\u89E6\u53D1"},fetch:{info:"\u5B9A\u4E49\u8BF7\u6C42\u65F6\uFF0C\u652F\u6301\u901A\u8FC7\u53CC\u5927\u62EC\u53F7\u8BED\u6CD5\uFF08\u5982 {{token}}\uFF09\u4F7F\u7528\u53D8\u91CF\u3002\u5728\u63A5\u53E3\u8BF7\u6C42\u65F6\u4F1A\u81EA\u52A8\u8BFB\u53D6\u8FD9\u4E9B\u53D8\u91CF\u3002\u5982\u679C\u53D8\u91CF\u7684\u503C\u662F\u5BF9\u8C61\uFF0C\u53EF\u4EE5\u901A\u8FC7 {{variableName.attributeName}} \u8BBF\u95EE\u5BF9\u8C61\u7684\u5C5E\u6027\u503C\u3002",title:"\u8BBE\u7F6E\u6570\u636E\u6E90",create:"\u521B\u5EFA\u6570\u636E\u6E90",config:"\u8BF7\u6C42\u914D\u7F6E",action:"\u8BF7\u6C42\u94FE\u63A5",actionRequired:"\u8BF7\u8F93\u5165\u6B63\u786E\u7684\u94FE\u63A5",placeholder:"\u8BF7\u8F93\u5165\u6570\u636E\u6E90\u7684\u63CF\u8FF0\u4FE1\u606F",method:"\u8BF7\u6C42\u65B9\u5F0F",data:"\u9644\u5E26\u6570\u636E",dataType:"\u6570\u636E\u7C7B\u578B",headers:"\u8BF7\u6C42\u5934\u90E8",query:"\u8BF7\u6C42\u53C2\u6570",parse:"\u6570\u636E\u5904\u7406",response:"\u63A5\u53E3\u8FD4\u56DE\u7684\u6570\u636E",onError:"\u9519\u8BEF\u5904\u7406",beforeFetch:"\u524D\u7F6E\u5904\u7406",remote:"\u8FDC\u7A0B\u6570\u636E",static:"\u9759\u6001\u6570\u636E",optionsType:{fetch:"\u8FDC\u7A0B\u6570\u636E",global:"\u5168\u5C40\u6570\u636E\u6E90",struct:"\u9759\u6001\u6570\u636E"}},style:{width:"\u5BBD\u5EA6",height:"\u9AD8\u5EA6",minWidth:"\u6700\u5C0F\u5BBD",minHeight:"\u6700\u5C0F\u9AD8",maxWidth:"\u6700\u5927\u5BBD",maxHeight:"\u6700\u5927\u9AD8",color:"\u989C\u8272",backgroundColor:"\u80CC\u666F\u8272",margin:"\u5916\u8FB9\u8DDD",padding:"\u5185\u8FB9\u8DDD",borderRadius:"\u5706\u89D2",border:"\u8FB9\u6846",solid:"\u5B9E\u7EBF",dashed:"\u865A\u7EBF",dotted:"\u70B9\u72B6\u865A\u7EBF",double:"\u53CC\u5B9E\u7EBF",opacity:"\u900F\u660E\u5EA6",scale:"\u7F29\u653E",overflow:{name:"\u6EA2\u51FA",visible:"\u53EF\u89C1",hidden:"\u9690\u85CF",scroll:"\u6EDA\u52A8",auto:"\u6EA2\u51FA\u540E\u81EA\u52A8\u6EDA\u52A8"},shadow:{name:"\u9634\u5F71",x:"x\u8F74\u504F\u79FB\u91CF",y:"y\u8F74\u504F\u79FB\u91CF",vague:"\u6A21\u7CCA\u534A\u5F84",extend:"\u6269\u6563\u534A\u5F84",inset:"\u5411\u5185",external:"\u5411\u5916",mode:"\u6A21\u5F0F",classic:"\u7ECF\u5178",flat:"\u6241\u5E73",solid:"\u7ACB\u4F53"},display:{name:"\u5E03\u5C40",block:"\u533A\u5757","inline-block":"\u884C\u5185\u533A\u5757",inline:"\u884C\u5185\u6587\u672C",flex:"\u5F39\u6027\u76D2\u5B50"},flexDirection:{name:"\u4E3B\u8F74\u7684\u65B9\u5411",row:"\u4E3B\u8F74\u4E3A\u6C34\u5E73\u65B9\u5411\uFF0C\u8D77\u70B9\u5728\u5DE6\u7AEF","row-reverse":"\u4E3B\u8F74\u4E3A\u6C34\u5E73\u65B9\u5411\uFF0C\u8D77\u70B9\u5728\u53F3\u7AEF",column:"\u4E3B\u8F74\u4E3A\u5782\u76F4\u65B9\u5411\uFF0C\u8D77\u70B9\u5728\u4E0A\u6CBF","column-reverse":"\u4E3B\u8F74\u4E3A\u5782\u76F4\u65B9\u5411\uFF0C\u8D77\u70B9\u5728\u4E0B\u6CBF"},flexWrap:{name:"\u662F\u5426\u6362\u884C",nowrap:"\u4E0D\u6362\u884C",wrap:"\u6362\u884C"},justifyContent:{name:"\u4E3B\u8F74\u4E0A\u7684\u5BF9\u9F50\u65B9\u5F0F","flex-start":"\u5DE6\u5BF9\u9F50","flex-end":"\u53F3\u5BF9\u9F50",center:"\u5C45\u4E2D","space-between":"\u4E24\u7AEF\u5BF9\u9F50","space-around":"\u5B50\u5143\u7D20\u4E24\u4FA7\u7684\u95F4\u9694\u76F8\u7B49","space-evenly":"\u5B50\u5143\u7D20\u5E73\u5747\u5206\u5E03\u5728\u4E3B\u8F74\u4E0A"},alignItems:{name:"\u5B50\u5143\u7D20\u4EA4\u53C9\u8F74\u4E0A\u7684\u5BF9\u9F50\u65B9\u5F0F","flex-start":"\u4EA4\u53C9\u8F74\u7684\u8D77\u70B9\u5BF9\u9F50","flex-end":"\u4EA4\u53C9\u8F74\u7684\u7EC8\u70B9\u5BF9\u9F50",center:"\u4EA4\u53C9\u8F74\u7684\u4E2D\u70B9\u5BF9\u9F50",baseline:"\u6CBF\u7B2C\u4E00\u884C\u6587\u5B57\u7684\u57FA\u7EBF\u5BF9\u9F50",stretch:"\u6EE1\u6574\u4E2A\u5BB9\u5668\u7684\u9AD8\u5EA6"},alignContent:{name:"\u591A\u884C\u5B50\u5143\u7D20\u5728\u4EA4\u53C9\u8F74\u4E0A\u7684\u5BF9\u9F50\u65B9\u5F0F","flex-start":"\u4E0E\u4EA4\u53C9\u8F74\u7684\u8D77\u70B9\u5BF9\u9F50","flex-end":"\u4E0E\u4EA4\u53C9\u8F74\u7684\u7EC8\u70B9\u5BF9\u9F50",center:"\u4E0E\u4EA4\u53C9\u8F74\u7684\u4E2D\u70B9\u5BF9\u9F50","space-between":"\u4E0E\u4EA4\u53C9\u8F74\u4E24\u7AEF\u5BF9\u9F50","space-around":"\u591A\u884C\u5B50\u5143\u7D20\u5E73\u5747\u5206\u5E03\u5728\u4EA4\u53C9\u8F74",stretch:"\u8F74\u7EBF\u5360\u6EE1\u6574\u4E2A\u4EA4\u53C9\u8F74"},font:{name:"\u5B57\u4F53",size:"\u5927\u5C0F",align:"\u5BF9\u9F50\u65B9\u5F0F",height:"\u884C\u9AD8",spacing:"\u5B57\u95F4\u8DDD",preview:"\u6837\u5F0F\u9884\u89C8"},decoration:{name:"\u4FEE\u9970",underline:"\u4E0B\u5212\u7EBF","line-through":"\u5220\u9664\u7EBF",overline:"\u4E0A\u5212\u7EBF"},weight:{name:"\u7C97\u7EC6",300:"\u7EC6\u4F53",400:"\u5E38\u89C4\u4F53",500:"\u4E2D\u9ED1\u4F53",700:"\u4E2D\u7C97\u4F53"}},designer:{component:"\u7EC4\u4EF6\u914D\u7F6E",id:"\u552F\u4E00\u503C",name:"\u7F16\u53F7",type:"\u7EC4\u4EF6\u7C7B\u578B",form:"\u8868\u5355\u914D\u7F6E",json:"\u6E32\u67D3\u89C4\u5219",style:"\u6837\u5F0F\u914D\u7F6E",rule:"\u57FA\u7840\u914D\u7F6E",advanced:"\u9AD8\u7EA7\u914D\u7F6E",props:"\u5C5E\u6027\u914D\u7F6E",slots:"\u63D2\u69FD\u914D\u7F6E",customProps:"\u81EA\u5B9A\u4E49\u5C5E\u6027\u914D\u7F6E",validate:"\u9A8C\u8BC1\u914D\u7F6E",event:"\u4E8B\u4EF6\u914D\u7F6E",clearWarn:"\u6E05\u7A7A\u540E\u5C06\u4E0D\u80FD\u6062\u590D\uFF0C\u786E\u5B9A\u8981\u6E05\u7A7A\u5417\uFF1F",childEmpty:"\u70B9\u51FB\u53F3\u4E0B\u89D2 \\e789 \u6309\u94AE\u6DFB\u52A0\u4E00\u5217",dragEmpty:"\u62D6\u62FD\u5DE6\u4FA7\u5217\u8868\u4E2D\u7684\u7EC4\u4EF6\u5230\u6B64\u5904",unload:"\u786E\u5B9A\u79BB\u5F00\u5F53\u524D\u9875\u9762\u5417?",sublist:"\u5B50\u8282\u70B9\u5217\u8868",formList:"\u8868\u5355\u5217\u8868",comList:"\u7EC4\u4EF6\u5217\u8868",addPage:"\u6DFB\u52A0\u6A21\u5757",pageManage:"\u6A21\u5757\u7BA1\u7406",gridLine:"\u8F85\u52A9\u7EBF",main:"\u4E3B\u4F53",layout:"\u5FEB\u901F\u5E03\u5C40",col1:"\u4E00\u5217",col2:"\u4E24\u5217",col3:"\u4E09\u5217",col4:"\u56DB\u5217",print:{title:"\u6253\u5370\u8868\u5355",config:"\u8BBE\u7F6E\u6253\u5370",left:"\u5DE6\u8FB9\u8DDD",right:"\u53F3\u8FB9\u8DDD",top:"\u4E0A\u8FB9\u8DDD",bottom:"\u4E0B\u8FB9\u8DDD",defaultStyle:"\u9ED8\u8BA4\u6837\u5F0F",wordStyle:"\u6587\u6863\u6837\u5F0F",export:"\u5BFC\u51FA PDF"}},menu:{template:"\u6A21\u677F",main:"\u57FA\u7840\u7EC4\u4EF6",aide:"\u8F85\u52A9\u7EC4\u4EF6",layout:"\u5E03\u5C40\u7EC4\u4EF6",component:"\u7EC4\u4EF6",subform:"\u5B50\u8868\u5355\u7EC4\u4EF6",container:"\u5BB9\u5668\u7EC4\u4EF6",chart:"\u56FE\u8868\u7EC4\u4EF6",tree:"\u5927\u7EB2"},formula:{math:"\u6570\u5B57\u5904\u7406",string:"\u6587\u672C\u5904\u7406",date:"\u65F6\u95F4\u5904\u7406",collection:"\u5408\u96C6\u5904\u7406",condition:"\u903B\u8F91\u5904\u7406",ADD:"\u83B7\u53D6\u4E24\u4E2A\u6570\u5B57\u76F8\u52A0\u7684\u503C",SUB:"\u83B7\u53D6\u4E24\u4E2A\u6570\u5B57\u76F8\u51CF\u7684\u503C",MUL:"\u83B7\u53D6\u4E24\u4E2A\u6570\u5B57\u76F8\u4E58\u7684\u503C",DIV:"\u83B7\u53D6\u4E24\u4E2A\u6570\u5B57\u76F8\u9664\u7684\u503C",SUM:"\u83B7\u53D6\u5408\u96C6\u4E2D\u6570\u503C\u7684\u603B\u548C",MAX:"\u83B7\u53D6\u53C2\u6570\u5217\u8868\u4E2D\u7684\u6700\u5927\u503C",MIN:"\u83B7\u53D6\u53C2\u6570\u5217\u8868\u4E2D\u7684\u6700\u5C0F\u503C",ABS:"\u83B7\u53D6\u6570\u5B57\u7684\u7EDD\u5BF9\u503C",AVG:"\u83B7\u53D6\u53C2\u6570\u5217\u8868\u7684\u5E73\u5747\u503C",POWER:"\u83B7\u53D6\u6307\u5B9A\u6570\u5B57\u7684\u4E58\u5E42",RAND:"\u83B7\u53D6\u4E00\u4E2A\u5927\u4E8E\u7B49\u4E8E0\u4E14\u5C0F\u4E8E1\u7684\u968F\u673A\u6570",PI:"\u83B7\u53D6\u5706\u5468\u7387",ROUND:"\u5C06\u4E00\u4E2A\u5C0F\u6570\u56DB\u820D\u4E94\u5165\u5230\u6307\u5B9A\u7684\u4F4D\u6570",SQRT:"\u83B7\u53D6\u4E00\u4E2A\u6570\u5B57\u7684\u6B63\u5E73\u65B9\u6839",NOW:"\u83B7\u53D6\u5F53\u524D\u7684\u65F6\u95F4",TODAY:"\u83B7\u53D6\u4ECA\u5929\u7684\u65E5\u671F",YEAR:"\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u5E74\u4EFD",MONTH:"\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u6708\u4EFD",DAY:"\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u5929\u6570",HOUR:"\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u5C0F\u65F6\u6570",MINUTE:"\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u5206\u949F\u6570",SECOND:"\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u79D2\u6570",DIFFDAYS:"\u83B7\u53D6\u4E24\u4E2A\u65E5\u671F\u4E4B\u95F4\u7684\u5929\u6570",DIFFHOURS:"\u83B7\u53D6\u4E24\u4E2A\u65F6\u95F4\u4E4B\u95F4\u7684\u5C0F\u65F6\u6570,\u4FDD\u7559\u4E24\u4F4D\u5C0F\u6570",DIFFMINUTES:"\u83B7\u53D6\u4E24\u4E2A\u65F6\u95F4\u4E4B\u95F4\u7684\u5206\u949F\u6570",ADDYEAR:"\u589E\u52A0\u6307\u5B9A\u65E5\u671F\u7684\u5E74\u4EFD",ADDMONTH:"\u589E\u52A0\u6307\u5B9A\u65E5\u671F\u7684\u6708\u4EFD",ADDDAY:"\u589E\u52A0\u6307\u5B9A\u65E5\u671F\u7684\u5929\u6570",ADDWEEK:"\u589E\u52A0\u6307\u5B9A\u65E5\u671F\u7684\u5468\u6570",ADDHOUR:"\u589E\u52A0\u6307\u5B9A\u65F6\u95F4\u7684\u5C0F\u65F6\u6570",ADDMINUTE:"\u589E\u52A0\u6307\u5B9A\u65F6\u95F4\u7684\u5206\u949F\u6570",ADDSECOND:"\u589E\u52A0\u6307\u5B9A\u65F6\u95F4\u7684\u79D2\u6570",SUBYEAR:"\u51CF\u5C11\u6307\u5B9A\u65E5\u671F\u7684\u5E74\u4EFD",SUBMONTH:"\u51CF\u5C11\u6307\u5B9A\u65E5\u671F\u7684\u6708\u4EFD",SUBDAY:"\u51CF\u5C11\u6307\u5B9A\u65E5\u671F\u7684\u5929\u6570",SUBWEEK:"\u51CF\u5C11\u6307\u5B9A\u65E5\u671F\u7684\u5468\u6570",SUBHOUR:"\u51CF\u5C11\u6307\u5B9A\u65F6\u95F4\u7684\u5C0F\u65F6\u6570",SUBMINUTE:"\u51CF\u5C11\u6307\u5B9A\u65F6\u95F4\u7684\u5206\u949F\u6570",SUBSECOND:"\u51CF\u5C11\u6307\u5B9A\u65F6\u95F4\u7684\u79D2\u6570",TIMESTAMP:"\u83B7\u53D6\u6307\u5B9A\u65E5\u671F\u7684\u65F6\u95F4\u6233",STARTSWITH:"\u68C0\u67E5\u5B57\u7B26\u4E32\u662F\u5426\u4EE5\u6307\u5B9A\u5B57\u7B26\u4E32\u5F00\u5934",EMPTY:"\u68C0\u67E5\u53C2\u6570\u662F\u5426\u4E3A\u7A7A",NOTEMPTY:"\u68C0\u67E5\u53C2\u6570\u662F\u5426\u4E0D\u4E3A\u7A7A",LEN:"\u83B7\u53D6\u6307\u5B9A\u5408\u96C6\u7684\u957F\u5EA6",MOD:"\u83B7\u53D6\u4E24\u4E2A\u6570\u5B57\u7684\u4F59\u6570",FLOOR:"\u83B7\u53D6\u6307\u5B9A\u6570\u5B57\u5411\u4E0B\u53D6\u6574\u7684\u503C",CEIL:"\u83B7\u53D6\u6307\u5B9A\u6570\u5B57\u5411\u4E0A\u53D6\u6574\u7684\u503C",FIXED:"\u5C06\u4E00\u4E2A\u5C0F\u6570\u4FDD\u7559\u6307\u5B9A\u4F4D\u6570\u7684\u5C0F\u6570",ISNUMBER:"\u68C0\u67E5\u53C2\u6570\u662F\u5426\u4E3A\u6570\u5B57",TONUMBER:"\u5C06\u53C2\u6570\u8F6C\u6362\u4E3A\u6570\u5B57",SLICELEFT:"\u83B7\u53D6\u4E00\u4E2A\u5B57\u7B26\u4E32\u4ECE\u5F00\u5934\u5F00\u59CB\u6307\u5B9A\u957F\u5EA6\u7684\u5B57\u7B26\u4E32",SLICERIGHT:"\u83B7\u53D6\u4E00\u4E2A\u5B57\u7B26\u4E32\u4ECE\u7ED3\u5C3E\u5F00\u59CB\u6307\u5B9A\u957F\u5EA6\u7684\u5B57\u7B26\u4E32",TOLOWER:"\u5C06\u5B57\u7B26\u4E32\u4E2D\u6240\u6709\u5927\u5199\u5B57\u6BCD\u8F6C\u6362\u4E3A\u5C0F\u5199\u5B57\u6BCD",TOUPPER:"\u5C06\u5B57\u7B26\u4E32\u4E2D\u6240\u6709\u5C0F\u5199\u5B57\u6BCD\u8F6C\u6362\u4E3A\u5927\u5199\u5B57\u6BCD",INCLUDES:"\u68C0\u67E5\u5B57\u7B26\u4E32\u4E2D\u662F\u5426\u5305\u542B\u6307\u5B9A\u5B57\u7B26\u4E32",REPLACE:"\u5C06\u5B57\u7B26\u4E32\u4E2D\u7684\u90E8\u5206\u6587\u672C\u66FF\u6362\u4E3A\u4E0D\u540C\u7684\u6587\u672C,\u53EA\u66FF\u6362\u5339\u914D\u5230\u7684\u7B2C\u4E00\u4E2A",REPLACEALL:"\u5C06\u5B57\u7B26\u4E32\u4E2D\u7684\u90E8\u5206\u6587\u672C\u66FF\u6362\u4E3A\u4E0D\u540C\u7684\u6587\u672C,\u66FF\u6362\u6240\u6709\u5339\u914D\u5230\u7684",TRIM:"\u5C06\u5B57\u7B26\u4E32\u524D\u540E\u7684\u7A7A\u683C\u5220\u9664",TOCHINSESAMOUNT:"\u83B7\u53D6\u6307\u5B9A\u6570\u5B57\u7684\u4E2D\u6587\u5927\u5199\u91D1\u989D",UNION:"\u5C06\u5408\u96C6/\u53C2\u6570\u4E2D\u7684\u503C\u53BB\u91CD,\u8FD4\u56DE\u53BB\u91CD\u540E\u7684\u5408\u96C6",INTERSECTIONSET:"\u83B7\u53D6\u4E24\u4E2A\u96C6\u5408\u7684\u4EA4\u96C6",LIST:"\u83B7\u53D6\u6240\u6709\u53C2\u6570\u7EC4\u6210\u7684\u96C6\u5408",AND:'\u5C06\u8868\u8FBE\u5F0F\u7528"\u5E76\u4E14"\u94FE\u63A5,\u5F53\u6240\u6709\u8868\u8FBE\u5F0F\u5747\u4E3Atrue\u65F6\u8FD4\u56DEtrue\uFF0C\u5426\u5219\u8FD4\u56DEfalse',OR:'\u5C06\u8868\u8FBE\u5F0F\u7528"\u6216"\u94FE\u63A5,\u5F53\u6709\u4E00\u4E2A\u8868\u8FBE\u5F0F\u4E3Atrue\u65F6\u8FD4\u56DEtrue\uFF0C\u5426\u5219\u8FD4\u56DEfalse',IF:"\u68C0\u67E5\u4E00\u4E2A\u6761\u4EF6\u80FD\u5426\u6EE1\u8DB3,\u5982\u679C\u6EE1\u8DB3\u8FD4\u56DE\u7B2C\u4E8C\u4E2A\u53C2\u6570\uFF0C\u5426\u5219\u8FD4\u56DE\u7B2C\u4E09\u4E2A\u53C2\u6570",IN:"\u68C0\u67E5\u7B2C\u4E8C\u4E2A\u53C2\u6570\u662F\u5426\u5728\u5408\u96C6\u4E2D",DEFAULT:"\u68C0\u67E5\u7B2C\u4E00\u4E2A\u53C2\u6570,\u5982\u679C\u4E3A\u7A7A\u8FD4\u56DE\u7B2C\u4E8C\u4E2A\u53C2\u6570,\u5426\u5219\u8FD4\u56DE\u7B2C\u4E00\u4E2A\u53C2\u6570",CASE:"\u68C0\u67E5\u662F\u5426\u6EE1\u8DB3\u4E00\u4E2A\u6216\u591A\u4E2A\u6761\u4EF6\uFF0C\u8FD4\u56DE\u7B2C\u4E00\u4E2A\u6EE1\u8DB3\u6761\u4EF6\u7684\u503C",COLUMN:"\u83B7\u53D6\u5B50\u8868\u5355\u4E2D\u6307\u5B9A\u5B57\u6BB5\u5E76\u8FD4\u56DE\u5408\u96C6",VALUE:"\u83B7\u53D6\u5206\u7EC4\u8868\u5355\u4E2D\u6307\u5B9A\u5B57\u6BB5",CONCAT:"\u5C06\u6240\u6709\u53C2\u6570\u62FC\u63A5,\u8FD4\u56DE\u62FC\u63A5\u540E\u7684\u5B57\u7B26\u4E32",FALSE:"\u8FD4\u56DE\u903B\u8F91\u503C false",TRUE:"\u8FD4\u56DE\u903B\u8F91\u503C true",NOT:"\u83B7\u53D6\u67D0\u4E2A\u903B\u8F91\u503C\u7684\u76F8\u53CD\u503C",EQ:"\u68C0\u67E5\u4E24\u4E2A\u503C\u662F\u5426\u76F8\u7B49",NE:"\u68C0\u67E5\u4E24\u4E2A\u503C\u662F\u5426\u4E0D\u76F8\u7B49",GE:"\u68C0\u67E5\u7B2C\u4E00\u4E2A\u503C\u662F\u5426\u5927\u4E8E\u7B49\u4E8E\u53E6\u4E00\u4E2A\u503C",GT:"\u68C0\u67E5\u7B2C\u4E00\u4E2A\u503C\u662F\u5426\u5927\u4E8E\u53E6\u4E00\u4E2A\u503C",LE:"\u68C0\u67E5\u7B2C\u4E00\u4E2A\u503C\u662F\u5426\u5C0F\u4E8E\u7B49\u4E8E\u53E6\u4E00\u4E2A\u503C",LT:"\u68C0\u67E5\u7B2C\u4E00\u4E2A\u503C\u662F\u5426\u5C0F\u4E8E\u53E6\u4E00\u4E2A\u503C"},language:{name:"\u56FD\u9645\u5316\u914D\u7F6E",add:"\u65B0\u589E\u8BCD\u6761",batchRemove:"\u6279\u91CF\u5220\u9664",select:"\u9009\u62E9\u591A\u8BED\u8A00"},props:{circle:"\u5706\u5F62",square:"\u6B63\u65B9\u5F62",image:"\u56FE\u7247",video:"\u89C6\u9891",audio:"\u97F3\u9891",document:"\u6587\u6863",size:"\u5C3A\u5BF8",info:"\u63D0\u793A",success:"\u6210\u529F",error:"\u5931\u8D25",warning:"\u8B66\u544A",primary:"\u91CD\u8981",danger:"\u5371\u9669",form:"\u8868\u5355",subform:"\u5B50\u8868\u5355",other:"\u5176\u4ED6",model:"\u5F39\u7A97",field:"\u6570\u636E\u96C6",variable:"\u53D8\u91CF",disabled:"\u7981\u7528",enable:"\u542F\u7528",time:"\u65F6\u95F4",email:"\u90AE\u7BB1",number:"\u6570\u5B57",globalData:"\u5168\u5C40\u6570\u636E",mobile:"\u79FB\u52A8\u7AEF",reactive:"\u54CD\u5E94\u5F0F",pc:"\u7535\u8111\u7AEF",title:"\u6807\u9898",content:"\u5185\u5BB9",collection:"\u5408\u96C6",group:"\u5206\u7EC4",custom:"\u81EA\u5B9A\u4E49",change:"\u6539\u53D8",blur:"\u5931\u53BB\u7126\u70B9",preview:"\u9884\u89C8",clear:"\u6E05\u7A7A",cancel:"\u53D6\u6D88",close:"\u5173\u95ED",ok:"\u786E\u5B9A",save:"\u4FDD\u5B58",refresh:"\u5237\u65B0",submit:"\u63D0\u4EA4",reset:"\u91CD\u7F6E",copy:"\u590D\u5236",delete:"\u5220\u9664",hide:"\u9690\u85CF",show:"\u663E\u793A",position:"\u4F4D\u7F6E",render:"\u6E32\u67D3",large:"\u5927",default:"\u9ED8\u8BA4",small:"\u5C0F",always:"\u5E38\u663E",never:"\u4E0D\u663E\u793A",hover:"\u60AC\u6D6E",click:"\u70B9\u51FB",button:"\u6309\u94AE",year:"\u5E74\u4EFD",month:"\u6708\u4EFD",date:"\u65E5\u671F",dates:"\u65E5\u671F\u591A\u9009",week:"\u4E00\u5468",datetime:"\u65E5\u671F\u65F6\u95F4","datetime-local":"\u65E5\u671F\u65F6\u95F4",datetimerange:"\u65E5\u671F\u65F6\u95F4\u533A\u95F4",daterange:"\u65E5\u671F\u533A\u95F4",monthrange:"\u6708\u4EFD\u533A\u95F4",left:"\u5DE6\u5BF9\u9F50",right:"\u53F3\u5BF9\u9F50",top:"\u9876\u90E8",bottom:"\u5E95\u90E8",text:"\u6587\u5B57",icon:"\u56FE\u6807",picture:"\u56FE\u7247","picture-card":"\u5361\u7247",center:"\u5C45\u4E2D",vertical:"\u7AD6\u5411",horizontal:"\u6A2A\u5411",manage:"\u7BA1\u7406",key:"\u952E\u540D",name:"\u540D\u79F0",value:"\u503C",inputData:"\u9ED8\u8BA4\u503C",append:"\u63D2\u5165",options:"\u9009\u9879\u6570\u636E",option:"\u9009\u9879",callback:"\u56DE\u8C03",mode:"\u6A21\u5F0F",style:"\u6837\u5F0F",print:"\u6253\u5370",_self:"\u5F53\u524D\u7A97\u53E3",_blank:"\u65B0\u7684\u7A97\u53E3",_parent:"\u7236\u7EA7\u7A97\u53E3",_top:"\u9876\u7EA7\u7A97\u53E3"},slots:{prefix:"\u5934\u90E8\u5185\u5BB9",suffix:"\u5C3E\u90E8\u5185\u5BB9",prepend:"\u524D\u7F6E\u5185\u5BB9",append:"\u540E\u7F6E\u5185\u5BB9"},behavior:{add:"\u6DFB\u52A0\u52A8\u4F5C",props:{id:"\u9009\u62E9\u7EC4\u4EF6",status:"\u72B6\u6001",compute:"\u6761\u4EF6",static:"\u9759\u6001",formula:"\u8868\u8FBE\u5F0F",setFormula:"\u914D\u7F6E\u8868\u8FBE\u5F0F",continue:"\u7EE7\u7EED\u6267\u884C\u52A8\u4F5C",stop:"\u4E2D\u65AD\u6267\u884C\u52A8\u4F5C",break:"\u8DF3\u8FC7\u5F53\u524D\u52A8\u4F5C",model:"\u9009\u62E9\u5F39\u7A97",fetch:"\u914D\u7F6E\u8BF7\u6C42",response:"\u8BF7\u6C42\u7ED3\u679C",callback:"\u81EA\u5B9A\u4E49JS",ignoreError:"\u6267\u884C\u5F02\u5E38",expression:"\u6267\u884C\u6761\u4EF6",stopPropagation:"\u963B\u65AD\u6761\u4EF6",execute:"\u6267\u884C\u52A8\u4F5C",info:"\u52A8\u4F5C\u8BF4\u660E"},openModel:{name:"\u6253\u5F00\u5F39\u7A97",info:"\u6253\u5F00\u6240\u9009\u7684\u5F39\u7A97"},closeModel:{name:"\u5173\u95ED\u5F39\u7A97",info:"\u5173\u95ED\u5F53\u524D\u5F39\u7A97"},hidden:{name:"\u7EC4\u4EF6\u53EF\u89C1\u6027",info:"\u63A7\u5236\u6240\u9009\u7684\u7EC4\u4EF6\u7684\u663E\u793A/\u9690\u85CF"},disabled:{name:"\u7EC4\u4EF6\u53EF\u7528\u6027",info:"\u63A7\u5236\u6240\u9009\u7684\u7EC4\u4EF6\u7684\u542F\u7528/\u7981\u7528"},resetFields:{name:"\u91CD\u7F6E\u8868\u5355",info:"\u91CD\u7F6E\u8868\u5355\u6570\u636E"},clearFields:{name:"\u6E05\u7A7A\u8868\u5355",info:"\u6E05\u7A7A\u8868\u5355\u6570\u636E"},validate:{name:"\u6821\u9A8C\u8868\u5355",info:"\u5BF9\u6574\u4E2A\u8868\u5355\u7684\u5185\u5BB9\u8FDB\u884C\u6821\u9A8C"},validateFields:{name:"\u6821\u9A8C\u8868\u5355\u9879",info:"\u6821\u9A8C\u6240\u9009\u7684\u7684\u8868\u5355\u9879"},setValue:{name:"\u8868\u5355\u8D4B\u503C",info:"\u4FEE\u6539\u8868\u5355\u7684\u6570\u636E"},fetch:{name:"\u53D1\u9001\u8BF7\u6C42",info:"\u914D\u7F6E\u5E76\u53D1\u9001API\u8BF7\u6C42",props:{append:"\u8FFD\u52A0\u8868\u5355\u6570\u636E"},warning:{append:"\u5F00\u542F\u540E\uFF0C\u8FDC\u7A0B\u8BF7\u6C42\u8FD4\u56DE\u7684\u6570\u636E\u5C06\u81EA\u52A8\u8FFD\u52A0\u5230\u8868\u5355\u7684\u6570\u636E\u4E2D\u3002",response:"\u8FDC\u7A0B\u8BF7\u6C42\u8FD4\u56DE\u7684\u6570\u636E\u5C06\u6682\u5B58\u5230\u6307\u5B9A\u7684\u53D8\u91CF\u4E2D\u3002"}},copy:{name:"\u590D\u5236\u5185\u5BB9",info:"\u590D\u5236\u6587\u672C\u5185\u5BB9\u81F3\u7C98\u8D34\u677F"},callback:{name:"\u81EA\u5B9A\u4E49\u64CD\u4F5C",info:"\u901A\u8FC7JavaScript\u81EA\u5B9A\u4E49\u52A8\u4F5C\u903B\u8F91"},message:{name:"\u6D88\u606F\u63D0\u9192",info:"\u5F39\u51FA\u6D88\u606F\u63D0\u9192",props:{type:"\u7C7B\u578B",message:"\u63D0\u793A\u4FE1\u606F",duration:"\u6301\u7EED\u65F6\u95F4(ms)",showClose:"\u663E\u793A\u5173\u95ED\u6309\u94AE"}},submit:{name:"\u63D0\u4EA4\u8868\u5355",info:"\u624B\u52A8\u63D0\u4EA4\u8868\u5355\u5E76\u89E6\u53D1\u8868\u5355\u63D0\u4EA4\u4E8B\u4EF6"}},com:{cascader:{name:"\u7EA7\u8054\u9009\u62E9\u5668",event:{expandChange:"\u5F53\u5C55\u5F00\u8282\u70B9\u53D1\u751F\u53D8\u5316\u65F6\u89E6\u53D1",removeTag:"\u5728\u591A\u9009\u6A21\u5F0F\u4E0B\uFF0C\u79FB\u9664Tag\u65F6\u89E6\u53D1"},props:{props:"\u914D\u7F6E\u9009\u9879",placeholder:"\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C",disabled:"\u662F\u5426\u7981\u7528",clearable:"\u662F\u5426\u652F\u6301\u6E05\u7A7A\u9009\u9879",showAllLevels:"\u8F93\u5165\u6846\u4E2D\u662F\u5426\u663E\u793A\u9009\u4E2D\u503C\u7684\u5B8C\u6574\u8DEF\u5F84",collapseTags:"\u591A\u9009\u6A21\u5F0F\u4E0B\u662F\u5426\u6298\u53E0Tag",collapseTagsTooltip:"\u5F53\u9F20\u6807\u60AC\u505C\u4E8E\u6298\u53E0\u6807\u7B7E\u7684\u6587\u672C\u65F6\uFF0C\u662F\u5426\u663E\u793A\u6240\u6709\u9009\u4E2D\u7684\u6807\u7B7E",separator:"\u9009\u9879\u5206\u9694\u7B26",filterable:"\u8BE5\u9009\u9879\u662F\u5426\u53EF\u4EE5\u88AB\u641C\u7D22",tagType:"\u6807\u7B7E\u7C7B\u578B"},propsOpt:{multiple:"\u662F\u5426\u591A\u9009",expandTrigger:"\u6B21\u7EA7\u83DC\u5355\u7684\u5C55\u5F00\u65B9\u5F0F",checkStrictly:"\u662F\u5426\u4E25\u683C\u7684\u9075\u5B88\u7236\u5B50\u8282\u70B9\u4E0D\u4E92\u76F8\u5173\u8054",emitPath:"\u5728\u9009\u4E2D\u8282\u70B9\u6539\u53D8\u65F6\uFF0C\u662F\u5426\u8FD4\u56DE\u7531\u8BE5\u8282\u70B9\u6240\u5728\u7684\u5404\u7EA7\u83DC\u5355\u7684\u503C\u6240\u7EC4\u6210\u7684\u6570\u7EC4",value:"\u6307\u5B9A\u9009\u9879\u7684\u503C\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",label:"\u6307\u5B9A\u9009\u9879\u6807\u7B7E\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",children:"\u6307\u5B9A\u9009\u9879\u7684\u5B50\u9009\u9879\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",disabled:"\u6307\u5B9A\u9009\u9879\u7684\u7981\u7528\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",leaf:"\u6307\u5B9A\u9009\u9879\u7684\u53F6\u5B50\u8282\u70B9\u7684\u6807\u5FD7\u4F4D\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C"}},checkbox:{name:"\u591A\u9009\u6846",props:{input:"\u662F\u5426\u53EF\u4EE5\u586B\u5199",type:"\u6309\u94AE\u7C7B\u578B",disabled:"\u662F\u5426\u7981\u7528",min:"\u53EF\u88AB\u52FE\u9009\u7684\u6700\u5C0F\u6570\u91CF",max:"\u53EF\u88AB\u52FE\u9009\u7684\u6700\u5927\u6570\u91CF",textColor:"\u5F53\u6309\u94AE\u4E3A\u6D3B\u8DC3\u72B6\u6001\u65F6\u7684\u5B57\u4F53\u989C\u8272",fill:"\u5F53\u6309\u94AE\u4E3A\u6D3B\u8DC3\u72B6\u6001\u65F6\u7684\u8FB9\u6846\u548C\u80CC\u666F\u989C\u8272"}},col:{name:"\u5E03\u5C40\u683C\u5B50",info:"\u901A\u8FC7\u54CD\u5E94\u5F0F\u914D\u7F6E\u591A\u7AEF\u5E03\u5C40\uFF0C\u79FB\u52A8\u7AEF\u4F1A\u81EA\u52A8\u5E94\u7528\u7B2C\u4E00\u4E2A",props:{span:"\u6805\u683C\u5360\u636E\u7684\u5217\u6570",offset:"\u6805\u683C\u5DE6\u4FA7\u7684\u95F4\u9694\u683C\u6570",push:"\u6805\u683C\u5411\u53F3\u79FB\u52A8\u683C\u6570",pull:"\u6805\u683C\u5411\u5DE6\u79FB\u52A8\u683C\u6570"}},colorPicker:{name:"\u989C\u8272\u9009\u62E9\u5668",event:{activeChange:"\u9762\u677F\u4E2D\u5F53\u524D\u663E\u793A\u7684\u989C\u8272\u53D1\u751F\u6539\u53D8\u65F6\u89E6\u53D1"},props:{disabled:"\u662F\u5426\u7981\u7528",showAlpha:"\u662F\u5426\u652F\u6301\u900F\u660E\u5EA6\u9009\u62E9",colorFormat:"\u989C\u8272\u7684\u683C\u5F0F",predefine:"\u9884\u5B9A\u4E49\u989C\u8272"}},datePicker:{name:"\u65E5\u671F",props:{pickerOptions:"\u5F53\u524D\u65F6\u95F4\u65E5\u671F\u9009\u62E9\u5668\u7279\u6709\u7684\u9009\u9879",readonly:"\u5B8C\u5168\u53EA\u8BFB",disabled:"\u7981\u7528",type:"\u663E\u793A\u7C7B\u578B",editable:"\u6587\u672C\u6846\u53EF\u8F93\u5165",clearable:"\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE",placeholder:"\u975E\u8303\u56F4\u9009\u62E9\u65F6\u7684\u5360\u4F4D\u5185\u5BB9",startPlaceholder:"\u8303\u56F4\u9009\u62E9\u65F6\u5F00\u59CB\u65E5\u671F\u7684\u5360\u4F4D\u5185\u5BB9",endPlaceholder:"\u8303\u56F4\u9009\u62E9\u65F6\u7ED3\u675F\u65E5\u671F\u7684\u5360\u4F4D\u5185\u5BB9",format:"\u663E\u793A\u5728\u8F93\u5165\u6846\u4E2D\u7684\u683C\u5F0F",align:"\u5BF9\u9F50\u65B9\u5F0F",rangeSeparator:"\u9009\u62E9\u8303\u56F4\u65F6\u7684\u5206\u9694\u7B26",unlinkPanels:"\u5728\u8303\u56F4\u9009\u62E9\u5668\u91CC\u53D6\u6D88\u4E24\u4E2A\u65E5\u671F\u9762\u677F\u4E4B\u95F4\u7684\u8054\u52A8"}},dateRange:{name:"\u65E5\u671F\u533A\u95F4"},timeRange:{name:"\u65F6\u95F4\u533A\u95F4"},elAlert:{name:"\u63D0\u793A",description:"\u8BF4\u660E\u6587\u5B57",props:{title:"\u6807\u9898",type:"\u4E3B\u9898",description:"\u8F85\u52A9\u6027\u6587\u5B57",closable:"\u662F\u5426\u53EF\u5173\u95ED",center:"\u6587\u5B57\u662F\u5426\u5C45\u4E2D",closeText:"\u5173\u95ED\u6309\u94AE\u81EA\u5B9A\u4E49\u6587\u672C",showIcon:"\u662F\u5426\u663E\u793A\u56FE\u6807",effect:"\u9009\u62E9\u63D0\u4F9B\u7684\u4E3B\u9898"}},elButton:{name:"\u6309\u94AE",props:{formCreateChild:"\u5185\u5BB9",size:"\u5C3A\u5BF8",type:"\u7C7B\u578B",plain:"\u662F\u5426\u6734\u7D20\u6309\u94AE",round:"\u662F\u5426\u5706\u89D2\u6309\u94AE",circle:"\u662F\u5426\u5706\u5F62\u6309\u94AE",loading:"\u662F\u5426\u52A0\u8F7D\u4E2D\u72B6\u6001",disabled:"\u662F\u5426\u7981\u7528\u72B6\u6001"}},elCard:{name:"\u5361\u7247",props:{header:"\u6807\u9898",shadow:"\u9634\u5F71\u663E\u793A\u65F6\u673A"}},elCollapse:{name:"\u6298\u53E0\u9762\u677F",event:{change:"\u5207\u6362\u5F53\u524D\u6D3B\u52A8\u9762\u677F\uFF0C\u5728\u624B\u98CE\u7434\u6A21\u5F0F\u4E0B\u5176\u7C7B\u578B\u662Fstring\uFF0C\u5728\u5176\u4ED6\u6A21\u5F0F\u4E0B\u662Farray"},props:{accordion:"\u662F\u5426\u624B\u98CE\u7434\u6A21\u5F0F"}},elCollapseItem:{name:"\u9762\u677F",props:{title:"\u9762\u677F\u6807\u9898",name:"\u552F\u4E00\u6807\u5FD7\u7B26",disabled:"\u662F\u5426\u7981\u7528"}},elDescriptions:{name:"\u63CF\u8FF0\u5217\u8868",props:{title:"\u6807\u9898\u6587\u672C\uFF0C\u663E\u793A\u5728\u5DE6\u4E0A\u65B9",extra:"\u64CD\u4F5C\u533A\u6587\u672C\uFF0C\u663E\u793A\u5728\u53F3\u4E0A\u65B9",column:"\u4E00\u884C\u4E2D\u8868\u683C\u7684\u6570\u91CF",border:"\u662F\u5426\u5E26\u6709\u8FB9\u6846",direction:"\u6392\u5217\u7684\u65B9\u5411",size:"\u5217\u8868\u7684\u5C3A\u5BF8"}},elDescriptionsItem:{name:"\u63CF\u8FF0\u683C\u5B50",props:{label:"\u6807\u7B7E\u6587\u672C",__child:"\u5185\u5BB9",span:"\u5217\u7684\u6570\u91CF",width:"\u5217\u7684\u5BBD\u5EA6\uFF0C\u4E0D\u540C\u884C\u76F8\u540C\u5217\u7684\u5BBD\u5EA6\u6309\u6700\u5927\u503C\u8BBE\u5B9A\uFF08\u5982\u65E0 border \uFF0C\u5BBD\u5EA6\u5305\u542B\u6807\u7B7E\u4E0E\u5185\u5BB9",minWidth:"\u5217\u7684\u6700\u5C0F\u5BBD\u5EA6",align:"\u5217\u7684\u5185\u5BB9\u5BF9\u9F50\u65B9\u5F0F\uFF08\u5982\u65E0 border\uFF0C\u5BF9\u6807\u7B7E\u548C\u5185\u5BB9\u5747\u751F\u6548\uFF09",labelAlign:"\u5217\u7684\u6807\u7B7E\u5BF9\u9F50\u65B9\u5F0F\uFF0C\u82E5\u4E0D\u8BBE\u7F6E\u8BE5\u9879\uFF0C\u5219\u4F7F\u7528\u5185\u5BB9\u7684\u5BF9\u9F50\u65B9\u5F0F\uFF08\u5982\u65E0 border\uFF0C\u8BF7\u4F7F\u7528 align \u53C2\u6570\uFF09",className:"\u5217\u7684\u5185\u5BB9\u81EA\u5B9A\u4E49\u7C7B\u540D"}},elDivider:{name:"\u5206\u5272\u7EBF",props:{direction:"\u8BBE\u7F6E\u5206\u5272\u7EBF\u65B9\u5411",formCreateChild:"\u8BBE\u7F6E\u5206\u5272\u7EBF\u6587\u6848",contentPosition:"\u8BBE\u7F6E\u5206\u5272\u7EBF\u6587\u6848\u7684\u4F4D\u7F6E"}},elTabPane:{name:"\u9009\u9879\u5361",props:{label:"\u9009\u9879\u5361\u6807\u9898",disabled:"\u662F\u5426\u7981\u7528",name:"\u9009\u9879\u5361\u7684\u6807\u8BC6\u7B26",lazy:"\u6807\u7B7E\u662F\u5426\u5EF6\u8FDF\u6E32\u67D3"}},elTabs:{name:"\u6807\u7B7E\u9875",event:{tabClick:"tab \u88AB\u9009\u4E2D\u65F6\u89E6\u53D1",tabChange:"activeName \u6539\u53D8\u65F6\u89E6\u53D1",tabRemove:"\u70B9\u51FB tab \u79FB\u9664\u6309\u94AE\u65F6\u89E6\u53D1",tabAdd:"\u70B9\u51FB tab \u65B0\u589E\u6309\u94AE\u65F6\u89E6\u53D1",edit:"\u70B9\u51FB tab \u7684\u65B0\u589E\u6216\u79FB\u9664\u6309\u94AE\u540E\u89E6\u53D1"},props:{type:"\u98CE\u683C\u7C7B\u578B",closable:"\u6807\u7B7E\u662F\u5426\u53EF\u5173\u95ED",tabPosition:"\u9009\u9879\u5361\u6240\u5728\u4F4D\u7F6E",stretch:"\u6807\u7B7E\u7684\u5BBD\u5EA6\u662F\u5426\u81EA\u6491\u5F00"}},elTag:{name:"\u6807\u7B7E",props:{formCreateChild:"\u6807\u7B7E\u5185\u5BB9",type:"\u6807\u7B7E\u7684\u7C7B\u578B",size:"\u6807\u7B7E\u7684\u5C3A\u5BF8",effect:"\u6807\u7B7E\u7684\u4E3B\u9898",closable:"\u662F\u5426\u53EF\u5173\u95ED",disableTransitions:"\u662F\u5426\u7981\u7528\u6E10\u53D8\u52A8\u753B",hit:"\u662F\u5426\u6709\u8FB9\u6846\u63CF\u8FB9",round:"\u662F\u5426\u4E3A\u5706\u5F62",color:"\u80CC\u666F\u8272"}},elTransfer:{name:"\u7A7F\u68AD\u6846",event:{leftCheckChange:"\u5DE6\u4FA7\u5217\u8868\u5143\u7D20\u88AB\u7528\u6237\u9009\u4E2D / \u53D6\u6D88\u9009\u4E2D\u65F6\u89E6\u53D1",rightCheckChange:"\u53F3\u4FA7\u5217\u8868\u5143\u7D20\u88AB\u7528\u6237\u9009\u4E2D / \u53D6\u6D88\u9009\u4E2D\u65F6\u89E6\u53D1"},props:{filterable:"\u662F\u5426\u53EF\u641C\u7D22",filterPlaceholder:"\u641C\u7D22\u6846\u5360\u4F4D\u7B26",targetOrder:"\u53F3\u4FA7\u5217\u8868\u5143\u7D20\u7684\u6392\u5E8F\u7B56\u7565",targetOrderInfo:"\u82E5\u4E3A original\uFF0C\u5219\u4FDD\u6301\u4E0E\u6570\u636E\u76F8\u540C\u7684\u987A\u5E8F\uFF1B\u82E5\u4E3A push\uFF0C\u5219\u65B0\u52A0\u5165\u7684\u5143\u7D20\u6392\u5728\u6700\u540E\uFF1B\u82E5\u4E3A unshift\uFF0C\u5219\u65B0\u52A0\u5165\u7684\u5143\u7D20\u6392\u5728\u6700\u524D",titles:"\u81EA\u5B9A\u4E49\u5217\u8868\u6807\u9898",buttonTexts:"\u81EA\u5B9A\u4E49\u6309\u94AE\u6587\u6848",props:"\u6570\u636E\u6E90\u7684\u5B57\u6BB5\u522B\u540D"}},elTreeSelect:{name:"\u6811\u5F62\u9009\u62E9",event:{removeTag:"\u591A\u9009\u6A21\u5F0F\u4E0B\u79FB\u9664tag\u65F6\u89E6\u53D1"},props:{multiple:"\u662F\u5426\u591A\u9009",disabled:"\u662F\u5426\u7981\u7528",clearable:"\u662F\u5426\u53EF\u4EE5\u6E05\u7A7A\u9009\u9879",collapseTags:"\u591A\u9009\u65F6\u662F\u5426\u5C06\u9009\u4E2D\u503C\u6309\u6587\u5B57\u7684\u5F62\u5F0F\u5C55\u793A",multipleLimit:"\u591A\u9009\u65F6\u7528\u6237\u6700\u591A\u53EF\u4EE5\u9009\u62E9\u7684\u9879\u76EE\u6570\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236",placeholder:"\u5360\u4F4D\u7B26",props:"\u914D\u7F6E\u9009\u9879",checkStrictly:"\u5728\u663E\u793A\u590D\u9009\u6846\u7684\u60C5\u51B5\u4E0B\uFF0C\u662F\u5426\u4E25\u683C\u7684\u9075\u5FAA\u7236\u5B50\u4E0D\u4E92\u76F8\u5173\u8054\u7684\u505A\u6CD5",renderAfterExpand:"\u662F\u5426\u5728\u7B2C\u4E00\u6B21\u5C55\u5F00\u67D0\u4E2A\u6811\u8282\u70B9\u540E\u624D\u6E32\u67D3\u5176\u5B50\u8282\u70B9",defaultExpandAll:"\u662F\u5426\u9ED8\u8BA4\u5C55\u5F00\u6240\u6709\u8282\u70B9",expandOnClickNode:"\u662F\u5426\u5728\u70B9\u51FB\u8282\u70B9\u7684\u65F6\u5019\u5C55\u5F00\u6216\u8005\u6536\u7F29\u8282\u70B9",checkOnClickNode:"\u662F\u5426\u5728\u70B9\u51FB\u8282\u70B9\u7684\u65F6\u5019\u9009\u4E2D\u8282\u70B9",nodeKey:"\u6BCF\u4E2A\u6811\u8282\u70B9\u7528\u6765\u4F5C\u4E3A\u552F\u4E00\u6807\u8BC6\u7684\u5C5E\u6027\uFF0C\u6574\u68F5\u6811\u5E94\u8BE5\u662F\u552F\u4E00\u7684"}},elLink:{name:"\u94FE\u63A5",props:{formCreateChild:"\u5185\u5BB9",href:"\u8DF3\u8F6C\u94FE\u63A5",type:"\u7C7B\u578B",underline:"\u662F\u5426\u663E\u793A\u4E0B\u5212\u7EBF",disabled:"\u662F\u5426\u7981\u7528",target:"\u6253\u5F00\u65B9\u5F0F"}},elWatermark:{name:"\u6C34\u5370",props:{content:"\u6C34\u5370\u6587\u672C\u5185\u5BB9",image:"\u6C34\u5370\u56FE\u7247\uFF0C\u5EFA\u8BAE\u4F7F\u7528 2x \u6216 3x \u56FE\u50CF",width:"\u6C34\u5370\u7684\u5BBD\u5EA6\uFF0C content \u7684\u9ED8\u8BA4\u503C\u662F\u5B83\u81EA\u5DF1\u7684\u5BBD\u5EA6",height:"\u6C34\u5370\u7684\u9AD8\u5EA6\uFF0C content \u7684\u9ED8\u8BA4\u503C\u662F\u5B83\u81EA\u5DF1\u7684\u9AD8\u5EA6",rotate:"\u6C34\u5370\u7684\u65CB\u8F6C\u89D2\u5EA6, \u5355\u4F4D \xB0",zIndex:"\u6C34\u5370\u5143\u7D20\u7684z-index\u503C",gap:"\u6C34\u5370\u4E4B\u95F4\u7684\u95F4\u8DDD"}},elTooltip:{name:"\u6587\u5B57\u63D0\u793A",props:{content:"\u663E\u793A\u7684\u5185\u5BB9",disabled:"\u662F\u5426\u7981\u7528",rawContent:"\u5185\u5BB9\u662F\u5426\u4F5C\u4E3A HTML \u5B57\u7B26\u4E32\u5904\u7406",enterable:"\u9F20\u6807\u662F\u5426\u53EF\u8FDB\u5165\u5230 Tooltip \u4E2D",effect:"\u4E3B\u9898",placement:"Tooltip \u7EC4\u4EF6\u51FA\u73B0\u7684\u4F4D\u7F6E",trigger:"\u5982\u4F55\u89E6\u53D1 Tooltip",offset:"\u51FA\u73B0\u4F4D\u7F6E\u7684\u504F\u79FB\u91CF",showAfter:"\u5728\u89E6\u53D1\u540E\u591A\u4E45\u663E\u793A\u5185\u5BB9\uFF0C\u5355\u4F4D\u6BEB\u79D2",hideAfter:"\u5EF6\u8FDF\u5173\u95ED\uFF0C\u5355\u4F4D\u6BEB\u79D2",autoClose:"\u51FA\u73B0\u540E\u81EA\u52A8\u9690\u85CF\u5EF6\u65F6\uFF0C\u5355\u4F4D\u6BEB\u79D2"}},elImage:{name:"\u56FE\u7247",props:{src:"\u56FE\u7247\u94FE\u63A5",previewSrcList:"\u9884\u89C8\u56FE\u7247\u5217\u8868"}},elAvatar:{name:"\u5934\u50CF\u6846",props:{src:"\u56FE\u7247\u94FE\u63A5",shape:"\u5F62\u72B6",size:"\u5C3A\u5BF8"}},elMention:{name:"\u63D0\u53CA",event:{search:"\u6309\u4E0B\u89E6\u53D1\u5B57\u6BB5\u65F6\u89E6\u53D1",select:"\u5F53\u7528\u6237\u9009\u62E9\u9009\u9879\u65F6\u89E6\u53D1"},props:{type:"\u7C7B\u578B",placeholder:"\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C",clearable:"\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE",disabled:"\u662F\u5426\u7981\u7528",whole:"\u5F53\u9000\u683C\u952E\u88AB\u6309\u4E0B\u505A\u5220\u9664\u64CD\u4F5C\u65F6\uFF0C\u662F\u5426\u5C06\u63D0\u53CA\u90E8\u5206\u4F5C\u4E3A\u6574\u4F53\u5220\u9664",checkIsWhole:"\u5F53\u9000\u683C\u952E\u88AB\u6309\u4E0B\u505A\u5220\u9664\u64CD\u4F5C\u65F6\uFF0C\u68C0\u67E5\u662F\u5426\u5C06\u63D0\u53CA\u90E8\u5206\u4F5C\u4E3A\u6574\u4F53\u5220\u9664",filterOption:"\u7B5B\u9009\u5668\u9009\u9879\u903B\u8F91"}},elSegmented:{name:"\u5206\u6BB5\u63A7\u5236\u5668",props:{size:"\u5C3A\u5BF8",block:"\u6491\u6EE1\u7236\u5143\u7D20\u5BBD\u5EA6",disabled:"\u662F\u5426\u7981\u7528"}},elFormItem:{name:"\u8868\u5355\u9879",props:{label:"\u6807\u7B7E\u6587\u672C",labelWidth:"\u6807\u7B7E\u5BBD\u5EA6",size:"\u5C3A\u5BF8"}},elStatistic:{name:"\u7EDF\u8BA1\u680F",props:{value:"\u6570\u503C",title:"\u6807\u9898",prefix:"\u6570\u503C\u7684\u524D\u7F00",suffix:"\u6570\u503C\u7684\u540E\u7F00"}},fcTitle:{name:"\u6807\u9898",props:{title:"\u6807\u9898",size:"\u5C3A\u5BF8",align:"\u5BF9\u9F50\u65B9\u5F0F"}},fcId:{name:"\u552F\u4E00\u503C",props:{prefix:"\u524D\u7F00"}},fcCity:{name:"\u7701\u5E02\u533A\u9009\u62E9\u5668",props:{api:"\u6570\u636E\u94FE\u63A5 URI",level:"\u7C7B\u578B",clearable:"\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE",disabled:"\u662F\u5426\u7981\u7528",filter:"\u6570\u636E\u8FC7\u6EE4,\u8FD4\u56DE\u53EF\u9009\u62E9\u6570\u636E"}},fcCell:{name:"\u683C\u5B50"},fcEditor:{name:"\u5BCC\u6587\u672C\u6846",props:{disabled:"\u662F\u5426\u7981\u7528"}},fcFlex:{name:"\u76D2\u5B50\u5E03\u5C40"},fcFlex2:{name:"\u76D2\u5B50\u5E03\u5C40",horizontal:"\u6C34\u5E73\u5C45\u4E2D",vertical:"\u5782\u76F4\u5C45\u4E2D",left:"\u5DE6\u5BF9\u9F50",right:"\u53F3\u5BF9\u9F50",reset:"\u91CD\u7F6E\u5E03\u5C40"},fcRow:{name:"\u6805\u683C\u5E03\u5C40",props:{gutter:"\u6805\u683C\u95F4\u9694",type:"flex\u5E03\u5C40\u6A21\u5F0F",justify:"flex\u5E03\u5C40\u4E0B\u7684\u6C34\u5E73\u6392\u5217\u65B9\u5F0F",align:"flex\u5E03\u5C40\u4E0B\u7684\u5782\u76F4\u6392\u5217\u65B9\u5F0F"}},fcDialog:{name:"\u5F39\u51FA\u6846",props:{title:"\u6807\u9898",width:"\u5BF9\u8BDD\u6846\u7684\u5BBD\u5EA6",fullscreen:"\u662F\u5426\u4E3A\u5168\u5C4F",modal:"\u662F\u5426\u9700\u8981\u906E\u7F69\u5C42",autoClose:"\u63D0\u4EA4\u8868\u5355\u540E\u81EA\u52A8\u5173\u95ED\u5F39\u51FA\u6846",footer:"\u662F\u5426\u663E\u793A\u64CD\u4F5C\u6309\u94AE",beforeClose:"\u5173\u95ED\u524D\u7684\u56DE\u8C03"}},fcDrawer:{name:"\u62BD\u5C49",props:{title:"\u6807\u9898",size:"\u5BF9\u8BDD\u6846\u7684\u5BBD\u5EA6",direction:"\u6253\u5F00\u7684\u65B9\u5411",modal:"\u662F\u5426\u9700\u8981\u906E\u7F69\u5C42",autoClose:"\u63D0\u4EA4\u8868\u5355\u540E\u81EA\u52A8\u5173\u95ED\u5F39\u51FA\u6846",footer:"\u662F\u5426\u663E\u793A\u64CD\u4F5C\u6309\u94AE",beforeClose:"\u5173\u95ED\u524D\u7684\u56DE\u8C03"},directionType:{ltr:"\u5DE6\u4FA7",rtl:"\u53F3\u4FA7"}},fcTable:{name:"\u8868\u683C\u5E03\u5C40",props:{mini:"\u7D27\u51D1\u6A21\u5F0F",border:"\u662F\u5426\u663E\u793A\u8FB9\u6846",borderColor:"\u8FB9\u6846\u989C\u8272",borderWidth:"\u8FB9\u6846\u5BBD\u5EA6"}},fcTableGrid:{name:"\u683C\u5B50"},fcValue:{name:"\u8BA1\u7B97\u516C\u5F0F",empty:"\u5728\u53F3\u4FA7\u914D\u7F6E\u4E2D\u8BBE\u7F6E\u8BA1\u7B97\u516C\u5F0F"},fcSlot:{name:"\u63D2\u69FD\u533A\u57DF",empty:"\u901A\u8FC7\u5B9A\u4E49\u63D2\u69FD {tag} \u586B\u5145\u533A\u57DF",props:{name:"\u63D2\u69FD\u540D\u79F0"}},fcJson:{name:"\u52A8\u6001\u533A\u57DF",empty:"\u901A\u8FC7\u52A0\u8F7D {tag} \u89C4\u5219\u586B\u5145\u533A\u57DF",props:{_loadType:"JSON \u89C4\u5219",type:"\u7C7B\u578B"}},lineChart:{name:"\u6298\u7EBF\u56FE",data:"\u56FE\u8868\u6570\u636E",pieTypeOpt:{pie:"\u5706\u5F62",doughnut:"\u73AF\u5F62","half-doughnut":"\u534A\u73AF\u5F62"},funnelSortOpt:{descending:"\u5012\u5E8F",ascending:"\u6B63\u5E8F"},props:{title:"\u56FE\u8868\u7684\u540D\u79F0",subtitle:"\u56FE\u8868\u7684\u7B80\u4ECB",valueFormat:"\u683C\u5F0F\u5316\u6570\u503C\u663E\u793A",stack:"\u591A\u5217\u6570\u636E\u65F6\u662F\u5426\u5806\u53E0",smooth:"\u7EBF\u6761\u662F\u5426\u5E73\u6ED1\u8FC7\u6E21",showLegend:"\u662F\u5426\u663E\u793A\u6807\u8BB0",showSeriesLabel:"\u662F\u5426\u663E\u793A\u6570\u503C",barBackgroundColor:"\u67F1\u72B6\u7684\u80CC\u666F\u8272",funnelSort:"\u6392\u5E8F\u65B9\u5F0F",pieType:"\u5F62\u72B6",min:"\u6700\u5C0F\u503C",max:"\u6700\u5927\u503C",value:"\u6570\u503C",indicator:"\u6307\u793A\u5668",loadOptions:"\u521D\u59CB\u5316"}},areaChart:{name:"\u4F53\u79EF\u56FE"},barChart:{name:"\u67F1\u72B6\u56FE"},customChart:{name:"\u81EA\u5B9A\u4E49\u56FE\u8868"},funnelChart:{name:"\u6F0F\u6597\u56FE"},gaugeChart:{name:"\u4EEA\u8868\u76D8"},pieChart:{name:"\u997C\u56FE"},radarChart:{name:"\u96F7\u8FBE\u56FE"},scatterChart:{name:"\u6563\u70B9\u56FE"},stripeChart:{name:"\u6761\u5F62\u56FE"},fcInlineForm:{name:"\u884C\u5185\u5E03\u5C40"},group:{name:"\u5B50\u8868\u5355",props:{disabled:"\u662F\u5426\u7981\u7528",syncDisabled:"\u662F\u5426\u4E0E\u5B50\u8868\u5355\u5F3A\u5236\u540C\u6B65\u7981\u7528\u72B6\u6001",expand:"\u8BBE\u7F6E\u9ED8\u8BA4\u5C55\u5F00\u51E0\u9879",button:"\u662F\u5426\u663E\u793A\u64CD\u4F5C\u6309\u94AE",sortBtn:"\u662F\u5426\u663E\u793A\u6392\u5E8F\u6309\u94AE",min:"\u8BBE\u7F6E\u6700\u5C0F\u6DFB\u52A0\u51E0\u9879",max:"\u8BBE\u7F6E\u6700\u591A\u6DFB\u52A0\u51E0\u9879"}},html:{name:"HTML",props:{formCreateChild:"\u5185\u5BB9"}},input:{name:"\u8F93\u5165\u6846",event:{change:"\u5F53\u503C\u6539\u53D8\u65F6\uFF0C\u5F53\u7EC4\u4EF6\u5931\u53BB\u7126\u70B9\u6216\u7528\u6237\u6309Enter\u65F6\u89E6\u53D1"},props:{type:"\u7C7B\u578B",maxlength:"\u6700\u5927\u8F93\u5165\u957F\u5EA6",minlength:"\u6700\u5C0F\u8F93\u5165\u957F\u5EA6",placeholder:"\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C",clearable:"\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE",disabled:"\u662F\u5426\u7981\u7528",readonly:"\u662F\u5426\u53EA\u8BFB"}},inputNumber:{name:"\u6570\u5B57\u8F93\u5165\u6846",props:{precision:"\u6570\u503C\u7CBE\u5EA6",min:"\u8BBE\u7F6E\u8BA1\u6570\u5668\u5141\u8BB8\u7684\u6700\u5C0F\u503C",max:"\u8BBE\u7F6E\u8BA1\u6570\u5668\u5141\u8BB8\u7684\u6700\u5927\u503C",step:"\u8BA1\u6570\u5668\u6B65\u957F",stepStrictly:"\u662F\u5426\u53EA\u80FD\u8F93\u5165 step \u7684\u500D\u6570",disabled:"\u662F\u5426\u7981\u7528\u8BA1\u6570\u5668",controls:"\u662F\u5426\u4F7F\u7528\u63A7\u5236\u6309\u94AE",controlsPosition:"\u63A7\u5236\u6309\u94AE\u4F4D\u7F6E",placeholder:"\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C"}},password:{name:"\u5BC6\u7801\u8F93\u5165\u6846",event:{change:"\u5F53\u503C\u6539\u53D8\u65F6\uFF0C\u5F53\u7EC4\u4EF6\u5931\u53BB\u7126\u70B9\u6216\u7528\u6237\u6309Enter\u65F6\u89E6\u53D1"},props:{disabled:"\u662F\u5426\u7981\u7528",readonly:"\u662F\u5426\u53EA\u8BFB",maxlength:"\u6700\u5927\u8F93\u5165\u957F\u5EA6",minlength:"\u6700\u5C0F\u8F93\u5165\u957F\u5EA6",placeholder:"\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C",clearable:"\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE"}},radio:{name:"\u5355\u9009\u6846",props:{input:"\u662F\u5426\u53EF\u4EE5\u586B\u5199",disabled:"\u662F\u5426\u7981\u7528",type:"\u6309\u94AE\u5F62\u5F0F",textColor:"\u6309\u94AE\u5F62\u5F0F\u6FC0\u6D3B\u65F6\u7684\u6587\u672C\u989C\u8272",fill:"\u6309\u94AE\u5F62\u5F0F\u6FC0\u6D3B\u65F6\u7684\u586B\u5145\u8272\u548C\u8FB9\u6846\u8272"}},rate:{name:"\u8BC4\u5206",props:{max:"\u6700\u5927\u5206\u503C",disabled:"\u662F\u5426\u7981\u7528",allowHalf:"\u662F\u5426\u5141\u8BB8\u534A\u9009",voidColor:"\u672A\u9009\u4E2D\u65F6\u56FE\u6807\u7684\u989C\u8272",disabledVoidColor:"\u53EA\u8BFB\u65F6\u672A\u9009\u4E2D\u65F6\u56FE\u6807\u7684\u989C\u8272",voidIconClass:"\u672A\u9009\u4E2D\u65F6\u56FE\u6807\u7684\u7C7B\u540D",disabledVoidIconClass:"\u53EA\u8BFB\u65F6\u672A\u9009\u4E2D\u65F6\u56FE\u6807\u7684\u7C7B\u540D",showScore:"\u662F\u5426\u663E\u793A\u5F53\u524D\u5206\u6570",textColor:"\u8F85\u52A9\u6587\u5B57\u7684\u989C\u8272",scoreTemplate:"\u5206\u6570\u663E\u793A\u6A21\u677F"}},fcDataSelect:{name:"\u5B50\u8868\u5355\u9009\u62E9\u5668"},select:{name:"\u9009\u62E9\u5668",title:"\u8BF7\u9009\u62E9",emptyText:"\u62D6\u62FD\u7EC4\u4EF6\u914D\u7F6E\u641C\u7D22\u6761\u4EF6",event:{removeTag:"\u591A\u9009\u6A21\u5F0F\u4E0B\u79FB\u9664tag\u65F6\u89E6\u53D1"},props:{title:"\u6807\u9898",valueKey:"\u6307\u5B9A\u9009\u9879\u7684\u503C\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",labelKey:"\u6307\u5B9A\u9009\u9879\u6807\u7B7E\u4E3A\u9009\u9879\u5BF9\u8C61\u7684\u67D0\u4E2A\u5C5E\u6027\u503C",autoLoad:"\u81EA\u52A8\u89E6\u53D1\u641C\u7D22",multiple:"\u662F\u5426\u591A\u9009",disabled:"\u662F\u5426\u7981\u7528",clearable:"\u662F\u5426\u53EF\u4EE5\u6E05\u7A7A\u9009\u9879",collapseTags:"\u591A\u9009\u65F6\u662F\u5426\u5C06\u9009\u4E2D\u503C\u6309\u6587\u5B57\u7684\u5F62\u5F0F\u5C55\u793A",multipleLimit:"\u591A\u9009\u65F6\u7528\u6237\u6700\u591A\u53EF\u4EE5\u9009\u62E9\u7684\u9879\u76EE\u6570\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236",placeholder:"\u5360\u4F4D\u7B26",filterable:"\u662F\u5426\u53EF\u641C\u7D22",allowCreate:"\u662F\u5426\u5141\u8BB8\u7528\u6237\u521B\u5EFA\u65B0\u6761\u76EE",noMatchText:"\u641C\u7D22\u6761\u4EF6\u65E0\u5339\u914D\u65F6\u663E\u793A\u7684\u6587\u5B57",noDataText:"\u9009\u9879\u4E3A\u7A7A\u65F6\u663E\u793A\u7684\u6587\u5B57",reserveKeyword:"\u591A\u9009\u4E14\u53EF\u641C\u7D22\u65F6\uFF0C\u662F\u5426\u5728\u9009\u4E2D\u4E00\u4E2A\u9009\u9879\u540E\u4FDD\u7559\u5F53\u524D\u7684\u641C\u7D22\u5173\u952E\u8BCD",defaultFirstOption:"\u5728\u8F93\u5165\u6846\u6309\u4E0B\u56DE\u8F66\uFF0C\u9009\u62E9\u7B2C\u4E00\u4E2A\u5339\u914D\u9879",remote:"\u5176\u4E2D\u7684\u9009\u9879\u662F\u5426\u4ECE\u670D\u52A1\u5668\u8FDC\u7A0B\u52A0\u8F7D",remoteMethod:"\u81EA\u5B9A\u4E49\u8FDC\u7A0B\u641C\u7D22\u65B9\u6CD5"}},slider:{name:"\u6ED1\u5757",props:{min:"\u6700\u5C0F\u503C",max:"\u6700\u5927\u503C",disabled:"\u662F\u5426\u7981\u7528",step:"\u6B65\u957F",showInput:"\u662F\u5426\u663E\u793A\u8F93\u5165\u6846\uFF0C\u4EC5\u5728\u975E\u8303\u56F4\u9009\u62E9\u65F6\u6709\u6548",showInputControls:"\u5728\u663E\u793A\u8F93\u5165\u6846\u7684\u60C5\u51B5\u4E0B\uFF0C\u662F\u5426\u663E\u793A\u8F93\u5165\u6846\u7684\u63A7\u5236\u6309\u94AE",showStops:"\u662F\u5426\u663E\u793A\u95F4\u65AD\u70B9",range:"\u662F\u5426\u4E3A\u8303\u56F4\u9009\u62E9",vertical:"\u662F\u5426\u7AD6\u5411\u6A21\u5F0F",height:"Slider \u9AD8\u5EA6\uFF0C\u7AD6\u5411\u6A21\u5F0F\u65F6\u5FC5\u586B"}},space:{name:"\u95F4\u8DDD"},stepForm:{name:"\u5206\u6B65\u8868\u5355",event:{next:"\u70B9\u51FB\u4E0B\u4E00\u6B65\u6309\u94AE\u65F6\u89E6\u53D1"},props:{submitBtn:"\u663E\u793A\u63D0\u4EA4\u6309\u94AE",autoValidate:"\u8FDB\u5165\u4E0B\u4E00\u6B65\u524D\u81EA\u52A8\u9A8C\u8BC1\u8868\u5355","stepsProps>alignCenter":"\u8FDB\u884C\u5C45\u4E2D\u5BF9\u9F50","stepsProps>simple":"\u662F\u5426\u5E94\u7528\u7B80\u6D01\u98CE\u683C"}},stepFormItem:{name:"\u6B65\u9AA4\u6761",props:{title:"\u6807\u9898",description:"\u63CF\u8FF0\u6587\u6848"}},subForm:{name:"\u5206\u7EC4",props:{disabled:"\u662F\u5426\u7981\u7528",syncDisabled:"\u662F\u5426\u4E0E\u5B50\u8868\u5355\u5F3A\u5236\u540C\u6B65\u7981\u7528\u72B6\u6001"}},switch:{name:"\u5F00\u5173",slots:{"active-action":"\u6253\u5F00\u65F6\u7684\u5185\u5BB9","inactive-action":"\u5173\u95ED\u65F6\u7684\u5185\u5BB9"},props:{disabled:"\u662F\u5426\u7981\u7528",width:"\u5BBD\u5EA6\uFF08px\uFF09",activeText:"\u6253\u5F00\u65F6\u7684\u6587\u5B57\u63CF\u8FF0",inactiveText:"\u5173\u95ED\u65F6\u7684\u6587\u5B57\u63CF\u8FF0",activeValue:"\u6253\u5F00\u65F6\u7684\u503C",inactiveValue:"\u5173\u95ED\u65F6\u7684\u503C",activeColor:"\u6253\u5F00\u65F6\u7684\u80CC\u666F\u8272",inactiveColor:"\u5173\u95ED\u65F6\u7684\u80CC\u666F\u8272"}},tableForm:{name:"\u8868\u683C\u8868\u5355",props:{disabled:"\u662F\u5426\u7981\u7528",filterEmptyColumn:"\u662F\u5426\u8FC7\u6EE4\u7A7A\u884C\u7684\u6570\u636E",max:"\u6700\u591A\u6DFB\u52A0\u51E0\u884C\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236",min:"\u6700\u5C11\u6DFB\u52A0\u51E0\u884C",size:"\u5C3A\u5BF8",emptyText:"\u7A7A\u6570\u636E\u65F6\u663E\u793A\u7684\u6587\u672C\u5185\u5BB9",height:"\u9AD8\u5EA6",showIndex:"\u663E\u793A\u884C\u53F7",stripe:"\u663E\u793A\u6591\u9A6C\u7EB9",border:"\u8FB9\u6846",button:"\u64CD\u4F5C\u6309\u94AE",page:"\u5206\u9875",addable:"\u5141\u8BB8\u65B0\u589E",deletable:"\u5141\u8BB8\u5220\u9664",newColumn:"\u9ED8\u8BA4\u663E\u793A\u65B0\u884C","button>column":"\u6309\u94AE\u7BA1\u7406","button>label":"\u64CD\u4F5C","button>fixed":"\u4F4D\u7F6E","button>width":"\u5217\u7684\u5BBD\u5EA6","page>props>pageSize":"\u6BCF\u9875\u663E\u793A\u6761\u76EE\u4E2A\u6570","page>props>small":"\u4F7F\u7528\u5C0F\u578B\u5206\u9875\u6837\u5F0F","page>props>background":"\u4E3A\u5206\u9875\u6309\u94AE\u6DFB\u52A0\u80CC\u666F\u8272"}},tableFormPro:{name:"\u8868\u683C\u8868\u5355Pro",event:{handleClick:"\u70B9\u51FB\u64CD\u4F5C\u6309\u94AE\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6"}},nestedTableForm:{name:"\u5D4C\u5957\u8868\u5355",props:{disabled:"\u662F\u5426\u7981\u7528",max:"\u6700\u591A\u6DFB\u52A0\u51E0\u884C\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236",nestedMax:"\u5B50\u8868\u5355\u6700\u591A\u6DFB\u52A0\u51E0\u884C\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236"}},infiniteTableForm:{name:"\u65E0\u9650\u7EA7\u8868\u5355",props:{disabled:"\u662F\u5426\u7981\u7528",childrenField:"\u8BBE\u7F6E\u5B50\u7EA7\u7684\u5B57\u6BB5\u540D",max:"\u6700\u591A\u6DFB\u52A0\u51E0\u884C\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236",layerMax:"\u6700\u591A\u6DFB\u52A0\u51E0\u5C42\uFF0C\u4E3A 0 \u5219\u4E0D\u9650\u5236"}},nestedSubTableForm:{name:"\u5B50\u8868\u683C\u8868\u5355"},tableFormColumn:{name:"\u8868\u683C\u683C\u5B50",label:"\u81EA\u5B9A\u4E49\u540D\u79F0",props:{label:"\u6807\u9898",header:"\u8868\u5934",fixed:"\u4F4D\u7F6E",width:"\u5BBD\u5EA6",color:"\u989C\u8272",hidden:"\u662F\u5426\u9690\u85CF",required:"\u662F\u5426\u663E\u793A\u5FC5\u586B\u661F\u53F7"}},tableFormColumn2:{name:"\u8868\u683C\u683C\u5B50",header:"\u914D\u7F6E\u5F53\u524D\u5217\u7684\u8868\u5934\u540D\u79F0\uFF0C\u91CD\u590D\u7684\u8868\u5934\u5C06\u81EA\u52A8\u5408\u5E76\u3002"},dataTable:{name:"\u6570\u636E\u8868\u683C",handle:"\u7981\u7528\u903B\u8F91",click:"\u70B9\u51FB\u4E8B\u4EF6",filter:"\u7B5B\u9009",header:"\u8868\u5934",event:{cellMouseEnter:"\u5F53\u5355\u5143\u683C hover \u8FDB\u5165\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",cellMouseLeave:"\u5F53\u5355\u5143\u683C hover \u9000\u51FA\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",handleClick:"\u70B9\u51FB\u64CD\u4F5C\u6309\u94AE\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",rowClick:"\u5F53\u67D0\u4E00\u884C\u88AB\u70B9\u51FB\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",rowDblclick:"\u5F53\u67D0\u4E00\u884C\u88AB\u53CC\u51FB\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",headerClick:"\u5F53\u67D0\u4E00\u5217\u7684\u8868\u5934\u88AB\u70B9\u51FB\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",filterChange:"\u7B5B\u9009\u6761\u4EF6\u53D8\u5316\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",expandChange:"\u5F53\u7528\u6237\u5BF9\u67D0\u4E00\u884C\u5C55\u5F00\u6216\u8005\u5173\u95ED\u7684\u65F6\u5019\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",sortChange:"\u5F53\u8868\u683C\u7684\u6392\u5E8F\u6761\u4EF6\u53D1\u751F\u53D8\u5316\u7684\u65F6\u5019\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",selectionChange:"\u5F53\u9009\u62E9\u9879\u53D1\u751F\u53D8\u5316\u65F6\u89E6\u53D1"},button:{title:"\u64CD\u4F5C\u6309\u94AE",btn:"\u914D\u7F6E\u64CD\u4F5C\u6309\u94AE",link:"\u6587\u5B57",round:"\u5706\u89D2",plain:"\u6734\u7D20",disabled:"\u7981\u7528"},column:{title:"\u5217\u8868\u7BA1\u7406",btn:"\u914D\u7F6E\u8868\u683C\u5217\u8868",prop:"\u5B57\u6BB5\u540D\u79F0",sort:"\u6392\u5E8F"},format:{default:"\u5E38\u89C4",tag:"\u6807\u7B7E",image:"\u56FE\u7247",custom:"\u81EA\u5B9A\u4E49"},fixed:{default:"\u5E38\u89C4",left:"\u5DE6\u60AC\u6D6E",right:"\u53F3\u60AC\u6D6E"},sortable:{disabled:"\u4E0D\u6392\u5E8F",default:"\u5E38\u89C4\u6392\u5E8F",custom:"\u63A5\u53E3\u6392\u5E8F"},props:{_optionType:"\u8868\u683C\u6570\u636E","page>totalField":"\u63A5\u53E3\u54CD\u5E94\u6570\u636E\u4E2D\u603B\u6761\u76EE\u6570\u7684\u5B57\u6BB5\u540D\u79F0","page>dataField":"\u63A5\u53E3\u54CD\u5E94\u6570\u636E\u4E2D\u5217\u8868\u6570\u636E\u7684\u5B57\u6BB5\u540D\u79F0","page>orderField":"\u8BF7\u6C42\u63A5\u53E3\u65F6\u6392\u5E8F\u7684\u53C2\u6570\u540D\u79F0","page>orderByField":"\u8BF7\u6C42\u63A5\u53E3\u65F6\u6392\u5E8F\u65B9\u5F0F\u7684\u53C2\u6570\u540D\u79F0","page>pageField":"\u8BF7\u6C42\u63A5\u53E3\u65F6\u9875\u7801\u7684\u53C2\u6570\u540D\u79F0(\u5206\u9875)","page>pageSizeField":"\u8BF7\u6C42\u63A5\u53E3\u65F6\u6761\u76EE\u6570\u7684\u53C2\u6570\u540D\u79F0(\u5206\u9875)",column:"\u8868\u683C\u7BA1\u7406",showSummary:"\u662F\u5426\u5728\u8868\u5C3E\u663E\u793A\u5408\u8BA1\u884C",selection:"\u662F\u5426\u663E\u793A\u591A\u9009\u6846",size:"\u5C3A\u5BF8",rowKey:"\u884C\u6570\u636E\u7684Key",emptyText:"\u7A7A\u6570\u636E\u65F6\u663E\u793A\u7684\u6587\u672C\u5185\u5BB9",height:"\u9AD8\u5EA6",index:"\u663E\u793A\u884C\u53F7",stripe:"\u663E\u793A\u6591\u9A6C\u7EB9",border:"\u8FB9\u6846",defaultExpandAll:"\u9ED8\u8BA4\u5C55\u5F00\u6240\u6709\u884C",button:"\u64CD\u4F5C\u6309\u94AE",page:"\u5206\u9875","button>column":"\u6309\u94AE\u7BA1\u7406","button>label":"\u64CD\u4F5C","button>fixed":"\u4F4D\u7F6E","button>width":"\u5217\u7684\u5BBD\u5EA6","page>position":"\u4F4D\u7F6E","page>props>pageSize":"\u6BCF\u9875\u663E\u793A\u6761\u76EE\u4E2A\u6570","page>props>small":"\u4F7F\u7528\u5C0F\u578B\u5206\u9875\u6837\u5F0F","page>props>background":"\u4E3A\u5206\u9875\u6309\u94AE\u6DFB\u52A0\u80CC\u666F\u8272"},requiredName:"\u8BF7\u8F93\u5165\u6309\u94AE\u540D\u79F0",requiredKey:"\u8BF7\u8F93\u5165\u6309\u94AE\u6807\u8BC6",requiredLabel:"\u8BF7\u8F93\u5165\u6807\u9898",requiredRender:"\u8BF7\u8F93\u5165\u6E32\u67D3\u51FD\u6570"},text:{name:"\u6587\u5B57",props:{formCreateChild:"\u5185\u5BB9"}},textarea:{name:"\u591A\u884C\u8F93\u5165\u6846",event:{change:"\u5F53\u503C\u6539\u53D8\u65F6\uFF0C\u5F53\u7EC4\u4EF6\u5931\u53BB\u7126\u70B9\u6216\u7528\u6237\u6309Enter\u65F6\u89E6\u53D1"},props:{disabled:"\u662F\u5426\u7981\u7528",readonly:"\u662F\u5426\u53EA\u8BFB",maxlength:"\u6700\u5927\u8F93\u5165\u957F\u5EA6",minlength:"\u6700\u5C0F\u8F93\u5165\u957F\u5EA6",showWordLimit:"\u662F\u5426\u663E\u793A\u7EDF\u8BA1\u5B57\u6570",placeholder:"\u8F93\u5165\u6846\u5360\u4F4D\u6587\u672C",rows:"\u8F93\u5165\u6846\u884C\u6570",autosize:"\u9AD8\u5EA6\u662F\u5426\u81EA\u9002\u5E94"}},timePicker:{name:"\u65F6\u95F4","HH:mm:ss":"\u65F6:\u5206:\u79D2","HH:mm":"\u65F6:\u5206",props:{__format:"\u8F93\u5165\u6846\u4E2D\u7684\u683C\u5F0F",pickerOptions:"\u5F53\u524D\u65F6\u95F4\u65E5\u671F\u9009\u62E9\u5668\u7279\u6709\u7684\u9009\u9879",readonly:"\u5B8C\u5168\u53EA\u8BFB",disabled:"\u7981\u7528",editable:"\u6587\u672C\u6846\u53EF\u8F93\u5165",clearable:"\u662F\u5426\u663E\u793A\u6E05\u9664\u6309\u94AE",placeholder:"\u975E\u8303\u56F4\u9009\u62E9\u65F6\u7684\u5360\u4F4D\u5185\u5BB9",startPlaceholder:"\u8303\u56F4\u9009\u62E9\u65F6\u5F00\u59CB\u65E5\u671F\u7684\u5360\u4F4D\u5185\u5BB9",endPlaceholder:"\u8303\u56F4\u9009\u62E9\u65F6\u7ED3\u675F\u65E5\u671F\u7684\u5360\u4F4D\u5185\u5BB9",isRange:"\u662F\u5426\u4E3A\u65F6\u95F4\u8303\u56F4\u9009\u62E9",arrowControl:"\u662F\u5426\u4F7F\u7528\u7BAD\u5934\u8FDB\u884C\u65F6\u95F4\u9009\u62E9",align:"\u5BF9\u9F50\u65B9\u5F0F"}},tree:{name:"\u6811\u5F62\u63A7\u4EF6",event:{nodeClick:"\u5F53\u8282\u70B9\u88AB\u70B9\u51FB\u7684\u65F6\u5019\u89E6\u53D1",nodeContextmenu:"\u5F53\u67D0\u4E00\u8282\u70B9\u88AB\u9F20\u6807\u53F3\u952E\u70B9\u51FB\u65F6\u4F1A\u89E6\u53D1\u8BE5\u4E8B\u4EF6",checkChange:"\u5F53\u590D\u9009\u6846\u88AB\u70B9\u51FB\u7684\u65F6\u5019\u89E6\u53D1",check:"\u70B9\u51FB\u8282\u70B9\u590D\u9009\u6846\u4E4B\u540E\u89E6\u53D1",currentChange:"\u5F53\u524D\u9009\u4E2D\u8282\u70B9\u53D8\u5316\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",nodeExpand:"\u8282\u70B9\u88AB\u5C55\u5F00\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",nodeCollapse:"\u8282\u70B9\u88AB\u5173\u95ED\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",nodeDragStart:"\u8282\u70B9\u5F00\u59CB\u62D6\u62FD\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",nodeDragEnter:"\u62D6\u62FD\u8FDB\u5165\u5176\u4ED6\u8282\u70B9\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",nodeDragLeave:"\u62D6\u62FD\u79BB\u5F00\u67D0\u4E2A\u8282\u70B9\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6",nodeDragOver:"\u5728\u62D6\u62FD\u8282\u70B9\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6\uFF08\u7C7B\u4F3C\u6D4F\u89C8\u5668\u7684 mouseover \u4E8B\u4EF6\uFF09",nodeDragEnd:"\u62D6\u62FD\u7ED3\u675F\u65F6\uFF08\u53EF\u80FD\u672A\u6210\u529F\uFF09\u89E6\u53D1\u7684\u4E8B\u4EF6",nodeDrop:"\u62D6\u62FD\u6210\u529F\u5B8C\u6210\u65F6\u89E6\u53D1\u7684\u4E8B\u4EF6"},props:{emptyText:"\u5185\u5BB9\u4E3A\u7A7A\u7684\u65F6\u5019\u5C55\u793A\u7684\u6587\u672C",props:"\u914D\u7F6E\u9009\u9879",renderAfterExpand:"\u662F\u5426\u5728\u7B2C\u4E00\u6B21\u5C55\u5F00\u67D0\u4E2A\u6811\u8282\u70B9\u540E\u624D\u6E32\u67D3\u5176\u5B50\u8282\u70B9",defaultExpandAll:"\u662F\u5426\u9ED8\u8BA4\u5C55\u5F00\u6240\u6709\u8282\u70B9",expandOnClickNode:"\u662F\u5426\u5728\u70B9\u51FB\u8282\u70B9\u7684\u65F6\u5019\u5C55\u5F00\u6216\u8005\u6536\u7F29\u8282\u70B9\uFF0C\u5982\u679C\u4E3A false\uFF0C\u5219\u53EA\u6709\u70B9\u7BAD\u5934\u56FE\u6807\u7684\u65F6\u5019\u624D\u4F1A\u5C55\u5F00\u6216\u8005\u6536\u7F29\u8282\u70B9\u3002",checkOnClickNode:"\u662F\u5426\u5728\u70B9\u51FB\u8282\u70B9\u7684\u65F6\u5019\u9009\u4E2D\u8282\u70B9",autoExpandParent:"\u5C55\u5F00\u5B50\u8282\u70B9\u7684\u65F6\u5019\u662F\u5426\u81EA\u52A8\u5C55\u5F00\u7236\u8282\u70B9",checkStrictly:"\u5728\u663E\u793A\u590D\u9009\u6846\u7684\u60C5\u51B5\u4E0B\uFF0C\u662F\u5426\u4E25\u683C\u7684\u9075\u5FAA\u7236\u5B50\u4E0D\u4E92\u76F8\u5173\u8054\u7684\u505A\u6CD5",accordion:"\u662F\u5426\u6BCF\u6B21\u53EA\u6253\u5F00\u4E00\u4E2A\u540C\u7EA7\u6811\u8282\u70B9\u5C55\u5F00",indent:"\u76F8\u90BB\u7EA7\u8282\u70B9\u95F4\u7684\u6C34\u5E73\u7F29\u8FDB(px)",nodeKey:"\u6BCF\u4E2A\u6811\u8282\u70B9\u7528\u6765\u4F5C\u4E3A\u552F\u4E00\u6807\u8BC6\u7684\u5C5E\u6027\uFF0C\u6574\u68F5\u6811\u5E94\u8BE5\u662F\u552F\u4E00\u7684"}},upload:{name:"\u4E0A\u4F20",info:"\u4E0A\u4F20\u6210\u529F\u540E\uFF0C\u5C06\u63A5\u53E3\u8FD4\u56DE\u7684 URL \u8D4B\u503C\u7ED9 file.url\uFF0C\u6216\u5C06\u8FD4\u56DE\u7ED3\u679C\u8D4B\u503C\u7ED9 file.value\uFF0C\u4EE5\u4FBF\u5728\u540E\u7EED\u7684\u8868\u5355\u63D0\u4EA4\u65F6\u83B7\u53D6\u8FD9\u4E9B\u6570\u636E\u3002",event:{remove:"\u6587\u4EF6\u5217\u8868\u79FB\u9664\u6587\u4EF6\u65F6\u89E6\u53D1",preview:"\u70B9\u51FB\u6587\u4EF6\u5217\u8868\u4E2D\u5DF2\u4E0A\u4F20\u7684\u6587\u4EF6\u65F6\u89E6\u53D1",error:"\u6587\u4EF6\u4E0A\u4F20\u5931\u8D25\u65F6\u89E6\u53D1",progress:"\u6587\u4EF6\u4E0A\u4F20\u65F6\u89E6\u53D1",exceed:"\u5F53\u8D85\u51FA\u9650\u5236\u65F6\u89E6\u53D1"},slots:{tip:"\u8BF4\u660E"},props:{listType:"\u4E0A\u4F20\u7C7B\u578B",multiple:"\u662F\u5426\u652F\u6301\u591A\u9009\u6587\u4EF6",action:"\u4E0A\u4F20\u7684\u5730\u5740(\u5FC5\u586B)",beforeUpload:"\u4E0A\u4F20\u6587\u4EF6\u4E4B\u524D\u89E6\u53D1",onSuccess:"\u4E0A\u4F20\u6210\u529F\u65F6\u89E6\u53D1",beforeRemove:"\u5220\u9664\u6587\u4EF6\u4E4B\u524D\u89E6\u53D1",headers:"\u8BBE\u7F6E\u4E0A\u4F20\u7684\u8BF7\u6C42\u5934\u90E8",data:"\u4E0A\u4F20\u65F6\u9644\u5E26\u7684\u989D\u5916\u53C2\u6570",name:"\u4E0A\u4F20\u7684\u6587\u4EF6\u5B57\u6BB5\u540D",withCredentials:"\u652F\u6301\u53D1\u9001 cookie \u51ED\u8BC1\u4FE1\u606F",accept:"\u63A5\u53D7\u4E0A\u4F20\u7684\u6587\u4EF6\u7C7B\u578B",autoUpload:"\u662F\u5426\u5728\u9009\u53D6\u6587\u4EF6\u540E\u7ACB\u5373\u8FDB\u884C\u4E0A\u4F20",disabled:"\u662F\u5426\u7981\u7528",limit:"\u6700\u5927\u5141\u8BB8\u4E0A\u4F20\u4E2A\u6570"}},audioBox:{name:"\u97F3\u9891\u64AD\u653E\u5668",preloadOpt:{auto:"\u81EA\u52A8",metadata:"\u5143\u6570\u636E",none:"\u7981\u6B62"},event:{pause:"\u97F3\u9891\u64AD\u653E\u6682\u505C\u65F6\u89E6\u53D1",play:"\u97F3\u9891\u5F00\u59CB\u64AD\u653E\u65F6\u89E6\u53D1",ended:"\u97F3\u9891\u64AD\u653E\u7ED3\u675F\u540E\u89E6\u53D1"},props:{src:"\u97F3\u9891\u5730\u5740",type:"\u97F3\u9891\u7C7B\u578B",autoplay:"\u662F\u5426\u81EA\u52A8\u64AD\u653E",loop:"\u662F\u5426\u5FAA\u73AF\u64AD\u653E",muted:"\u662F\u5426\u9759\u97F3",controls:"\u662F\u5426\u663E\u793A\u63A7\u5236\u6761",preload:"\u9884\u52A0\u8F7D"}},barCodeBox:{name:"\u6761\u5F62\u7801",props:{value:"\u5185\u5BB9",format:"\u6761\u5F62\u7801\u7684\u7C7B\u578B",width:"\u5355\u4E2A\u6761\u5F62\u7684\u5BBD\u5EA6",height:"\u6761\u5F62\u7801\u7684\u9AD8\u5EA6",displayValue:"\u662F\u5426\u663E\u793A\u5185\u5BB9",fontSize:"\u8BBE\u7F6E\u6587\u5B57\u7684\u5927\u5C0F",textPosition:"\u8BBE\u7F6E\u6587\u5B57\u7684\u4F4D\u7F6E",textAlign:"\u8BBE\u7F6E\u6587\u5B57\u7684\u5BF9\u9F50\u65B9\u5F0F",textMargin:"\u8BBE\u7F6E\u6587\u5B57\u7684\u8FB9\u8DDD",background:"\u6761\u5F62\u7801\u7684\u80CC\u666F\u8272",lineColor:"\u7EBF\u6761\u7684\u989C\u8272"}},iframeBox:{name:"\u5185\u5D4C\u9875\u9762",event:{load:"\u9875\u9762\u52A0\u8F7D\u5B8C\u6210\u540E\u89E6\u53D1"},loadingOpt:{eager:"\u7ACB\u5373\u52A0\u8F7D",lazy:"\u5EF6\u8FDF\u52A0\u8F7D"},props:{src:"\u9875\u9762\u94FE\u63A5",loading:"\u52A0\u8F7D\u65B9\u5F0F"}},qrCodeBox:{name:"\u4E8C\u7EF4\u7801",circleTypeOpt:{square:"\u6B63\u65B9\u5F62",dots:"\u70B9\u72B6",rounded:"\u5706\u5F62",classy:"\u7ECF\u5178"},props:{data:"\u5185\u5BB9",image:"\u4E2D\u5FC3\u7684\u56FE\u7247\u94FE\u63A5",width:"\u4E8C\u7EF4\u7801\u7684\u5BBD\u5EA6",height:"\u4E8C\u7EF4\u7801\u7684\u9AD8\u5EA6",circleType:"\u70B9\u7684\u7C7B\u578B",circleColor:"\u70B9\u7684\u989C\u8272"}},signaturePad:{name:"\u624B\u5199\u7B7E\u540D",props:{penColor:"\u7EBF\u6761\u7684\u989C\u8272"}},videoBox:{name:"\u89C6\u9891\u64AD\u653E\u5668",event:{error:"\u89C6\u9891\u52A0\u8F7D\u5931\u8D25\u65F6\u89E6\u53D1",pause:"\u89C6\u9891\u64AD\u653E\u6682\u505C\u65F6\u89E6\u53D1",play:"\u89C6\u9891\u5F00\u59CB\u64AD\u653E\u65F6\u89E6\u53D1",ended:"\u89C6\u9891\u64AD\u653E\u7ED3\u675F\u540E\u89E6\u53D1"},props:{src:"\u89C6\u9891\u5730\u5740",type:"\u89C6\u9891\u7C7B\u578B",autoplay:"\u662F\u5426\u81EA\u52A8\u64AD\u653E",loop:"\u662F\u5426\u5FAA\u73AF\u64AD\u653E",isLive:"\u662F\u5426\u662F\u76F4\u64AD",controls:"\u662F\u5426\u663E\u793A\u63A7\u5236\u6761",withCredentials:"\u662F\u5426\u643A\u5E26\u51ED\u8BC1"}}},tmp:{duration:"\u65F6\u957F",chineseAmount:"\u91D1\u989D",col3:"\u4E09\u5217\u6805\u683C",col4:"\u56DB\u5217\u6805\u683C",table43:"4x3\u8868\u683C"}},rd=(e,t)=>ai.ElMessage({message:e,type:t||"info",customClass:"_fc-message-tip"}),dn=e=>rd(e,"error"),Wa=function(e,t,r,o){const i=o||{};return t.forEach(l=>{e.indexOf(l[r||"id"])>-1&&e.splice(e.indexOf(l[r||"id"]),1,l[i.label||"label"]),dt.trueArray(l[i.children||"children"])&&Wa(e,l[i.children||"children"],r,o)}),e},Db=function(e,t){return t.forEach(r=>{e.indexOf(r.value)>-1&&(e[e.indexOf(r.value)]=r.label)}),e};function Vr(e){if(e){if(!Array.isArray(e))return[e]}else return[];return e}function Vb(e,t){let r=t.rule.value;const o=t.$render.vNode.h,i=t.type,l=t.$handle.subForm[t.id],d=t.prop.readMode;if(t.prop.title.title&&t.prop.title.title.trim()&&(t.prop.title.title+="\uFF1A"),d===!1||d==="custom"||!t.input||t.rule.subForm||(Array.isArray(l)?l.length:l)||["fcGroup","fcSubForm","tableForm","tableFormPro","fcJson","stepForm","nestedTableForm","infiniteTableForm","fcUpload","fcDialog","fcDrawer","fcPopup"].indexOf(t.trueType)>-1)return t.trueType==="fcUpload"&&(t.prop.props.disabled=!0),t.parser.render(e,t);if(["radio","select","checkbox"].indexOf(i)>-1)r=Db([...Vr(r)],t.prop.props.options||t.prop.props.formCreateInject.options||[]).join(", ");else if(["timePicker","datePicker","slider"].indexOf(i)>-1)r=Array.isArray(r)?r.join(" - "):r;else if(i==="cascader")r=[...Vr(r)],Array.isArray(r[0])||(r=[r]),r=r.map(c=>Wa(c,t.prop.props.options||t.prop.props.formCreateInject.options||[],"value",t.prop.props.props).join("/")).join(", ");else if(i==="elTransfer"){const c=[...Vr(r)];r=Wa(c,t.prop.props.data||t.prop.props.formCreateInject.options||[],"key").join(", ")}else if(i==="fcDataSelect")r=[...Vr(r)].map(u=>u[t.prop.props.labelKey||"label"]).join(", ");else if(["tree","elTreeSelect"].indexOf(i)>-1){const c=t.prop.props.data||t.prop.props.formCreateInject.options||[];r=Wa([...Vr(r)],c,i==="elTreeSelect"?"value":"id").join(", ")}else{if(i==="fcEditor"||d==="html")return o("div",{innerHTML:r});if(d==="image")return r=Vr(r),o("div",{class:"_fc-upload"},r.map(function(c){return o("div",{class:"_fc-upload-preview"},[o("el-image",{src:(c==null?void 0:c.url)||c,previewSrcList:r.map(u=>(u==null?void 0:u.url)||u),previewTeleported:!0,fit:"cover"})])}));if((i==="switch"||i==="el-switch")&&(t.prop.props.activeValue!=null||t.prop.props.inactiveValue!=null))r=t.prop.props.activeValue===r?"\u662F":"\u5426";else{if(i==="signaturePad"&&r)return o("el-image",{src:r,previewTeleported:!0,fit:"cover",style:{height:"90px"}});typeof r=="boolean"&&(r=r?"\u662F":"\u5426")}}return o("span",{class:"_fc-read-view"},[""+(r==null?"":r)])}function Ob(e,t){return`
`}function Vb(e,t){return`
+<\/script>`}function Bb(e,t){return`
{
//todo \u63D0\u4EA4\u8868\u5355
}
-<\/script>`}function Ob(e,t){return`
+<\/script>`}function Rb(e,t){return`
`}function Bb(e,t){return`
+<\/script>`}function $b(e,t){return`
{
//todo \u63D0\u4EA4\u8868\u5355
}
-<\/script>`}function od(){return{type:"Required",field:"formCreate$required",title:"\u662F\u5426\u5FC5\u586B"}}function L5(e){}function Qn(e,t,r,o=[]){t.id||(t.id=1),r&&r--;for(let i=0;i<3;i++){const l={[t.label]:e+r*10+(i+1),[t.value]:""+t.id++};r&&Qn(e+(i+1)+"-",t,r,l.children=[]),o.push(l)}return o}function ad(e){return[{type:"ConfigItem",col:{show:!0},name:"labelConfig",style:"margin-bottom: 10px",props:{label:e("form.formItem")},children:[{type:"HideConfig",field:"formCreateNative",_fc_important_prop:!1,col:{show:!1},wrap:{show:!1},value:!1,props:{activeValue:!1,inactiveValue:!0}},{type:"input",field:"formCreateTitle",title:e("form.title"),_fc_license:"KrrSN2KlZ2tanmqEGlAE",_fc_important_prop:!1,col:{show:!1},slot:"append"},{type:"select",field:"formCreateWrap>class",title:e("form.labelPosition"),_fc_important_prop:!1,col:{show:!1},slot:"append",options:it(e,[{value:"fc-wrap-top",label:"top"},{value:"fc-wrap-left",label:"left"},{value:"fc-wrap-right",label:"right"}])},{type:"SizeInput",field:"formCreateWrap>labelWidth",_fc_important_prop:!1,col:{show:!1},value:"",slot:"append",title:e("form.labelWidth")},{type:"SizeInput",field:"formCreateWrap>style>marginBottom",_fc_important_prop:!1,col:{show:!1},value:"",slot:"append",title:e("form.formItemMarginBottom")}]}]}function Pi(e,t,r,o){const i=[{label:e("fetch.optionsType.struct"),value:2},{label:e("fetch.optionsType.fetch"),value:3},{label:e("fetch.optionsType.global"),value:1}],l=[{value:1,rule:[{type:"GlobalFetchSelect",field:"formCreateEffect>fetch",props:{to:t}}]},{value:3,rule:[{type:"FetchConfig",field:"formCreateEffect>fetch",props:{to:t}}]},{value:2,rule:[{type:"TableOptions",field:"formCreate"+Rr(t).replace(".",">"),title:e("props.options"),_fc_important_prop:!0,wrap:{show:!1},props:{column:[{label:"label",key:r||"label"},{value:!0,label:"value",key:o||"value"}],keyValue:r||"label"}}]}];return{type:"radio",title:e("props.options"),field:"_optionType",value:2,options:i,props:{type:"button"},control:l}}function Ln(e,t,r){const o=[{label:e("fetch.optionsType.struct"),value:2},{label:e("fetch.optionsType.fetch"),value:3},{label:e("fetch.optionsType.global"),value:1}],i=[{value:1,rule:[{type:"GlobalFetchSelect",field:"formCreateEffect>fetch",props:{to:t}}]},{value:3,rule:[{type:"FetchConfig",field:"formCreateEffect>fetch",props:{to:t}}]},{value:2,rule:[{type:"Struct",field:"formCreate"+Rr(t).replace(".",">"),title:r||e("props.options"),_fc_important_prop:!0,wrap:{show:!1}}]}];return{type:"radio",title:r||e("props.options"),field:"_optionType",value:2,options:o,props:{type:"button"},control:i}}function Br(e,t,r,o){const i=[{label:e("fetch.optionsType.struct"),value:2},{label:e("fetch.optionsType.fetch"),value:3},{label:e("fetch.optionsType.global"),value:1}],l=[{value:1,rule:[{type:"GlobalFetchSelect",field:"formCreateEffect>fetch",props:{to:t}}]},{value:3,rule:[{type:"FetchConfig",field:"formCreateEffect>fetch",props:{to:t}}]},{value:2,rule:[{type:"TreeOptions",field:"formCreate"+Rr(t).replace(".",">"),title:e("props.options"),_fc_important_prop:!0,wrap:{show:!1},props:{columns:{label:r,value:o},keyValue:r}}]}];return{type:"radio",title:e("props.options"),field:"_optionType",value:2,options:i,props:{type:"button"},control:l}}function Rr(e){return e.replace(e[0],e[0].toLocaleUpperCase())}const En=function(e){const t=/object ([a-zA-Z]*)/.exec(Object.prototype.toString.call(e));return t&&yp[t[1].toLowerCase()]?yp[t[1].toLowerCase()](e):e},yp={object:function(e){var t=[];for(var r in e)!li(e,r)||t.push(En(r)+": "+(e[r]!=null?En(e[r]):"null"));return`{
+<\/script>`}function od(){return{type:"Required",field:"formCreate$required",title:"\u662F\u5426\u5FC5\u586B"}}function z5(e){}function Qn(e,t,r,o=[]){t.id||(t.id=1),r&&r--;for(let i=0;i<3;i++){const l={[t.label]:e+r*10+(i+1),[t.value]:""+t.id++};r&&Qn(e+(i+1)+"-",t,r,l.children=[]),o.push(l)}return o}function ad(e){return[{type:"ConfigItem",col:{show:!0},name:"labelConfig",style:"margin-bottom: 10px",props:{label:e("form.formItem")},children:[{type:"HideConfig",field:"formCreateNative",_fc_important_prop:!1,col:{show:!1},wrap:{show:!1},value:!1,props:{activeValue:!1,inactiveValue:!0}},{type:"input",field:"formCreateTitle",title:e("form.title"),_fc_license:"KrrSN2KlZ2tanmqEGlAE",_fc_important_prop:!1,col:{show:!1},slot:"append"},{type:"select",field:"formCreateWrap>class",title:e("form.labelPosition"),_fc_important_prop:!1,col:{show:!1},slot:"append",options:it(e,[{value:"fc-wrap-top",label:"top"},{value:"fc-wrap-left",label:"left"},{value:"fc-wrap-right",label:"right"}])},{type:"SizeInput",field:"formCreateWrap>labelWidth",_fc_important_prop:!1,col:{show:!1},value:"",slot:"append",title:e("form.labelWidth")},{type:"SizeInput",field:"formCreateWrap>style>marginBottom",_fc_important_prop:!1,col:{show:!1},value:"",slot:"append",title:e("form.formItemMarginBottom")}]}]}function Pi(e,t,r,o){const i=[{label:e("fetch.optionsType.struct"),value:2},{label:e("fetch.optionsType.fetch"),value:3},{label:e("fetch.optionsType.global"),value:1}],l=[{value:1,rule:[{type:"GlobalFetchSelect",field:"formCreateEffect>fetch",props:{to:t}}]},{value:3,rule:[{type:"FetchConfig",field:"formCreateEffect>fetch",props:{to:t}}]},{value:2,rule:[{type:"TableOptions",field:"formCreate"+Br(t).replace(".",">"),title:e("props.options"),_fc_important_prop:!0,wrap:{show:!1},props:{column:[{label:"label",key:r||"label"},{value:!0,label:"value",key:o||"value"}],keyValue:r||"label"}}]}];return{type:"radio",title:e("props.options"),field:"_optionType",value:2,options:i,props:{type:"button"},control:l}}function Ln(e,t,r){const o=[{label:e("fetch.optionsType.struct"),value:2},{label:e("fetch.optionsType.fetch"),value:3},{label:e("fetch.optionsType.global"),value:1}],i=[{value:1,rule:[{type:"GlobalFetchSelect",field:"formCreateEffect>fetch",props:{to:t}}]},{value:3,rule:[{type:"FetchConfig",field:"formCreateEffect>fetch",props:{to:t}}]},{value:2,rule:[{type:"Struct",field:"formCreate"+Br(t).replace(".",">"),title:r||e("props.options"),_fc_important_prop:!0,wrap:{show:!1}}]}];return{type:"radio",title:r||e("props.options"),field:"_optionType",value:2,options:o,props:{type:"button"},control:i}}function Or(e,t,r,o){const i=[{label:e("fetch.optionsType.struct"),value:2},{label:e("fetch.optionsType.fetch"),value:3},{label:e("fetch.optionsType.global"),value:1}],l=[{value:1,rule:[{type:"GlobalFetchSelect",field:"formCreateEffect>fetch",props:{to:t}}]},{value:3,rule:[{type:"FetchConfig",field:"formCreateEffect>fetch",props:{to:t}}]},{value:2,rule:[{type:"TreeOptions",field:"formCreate"+Br(t).replace(".",">"),title:e("props.options"),_fc_important_prop:!0,wrap:{show:!1},props:{columns:{label:r,value:o},keyValue:r}}]}];return{type:"radio",title:e("props.options"),field:"_optionType",value:2,options:i,props:{type:"button"},control:l}}function Br(e){return e.replace(e[0],e[0].toLocaleUpperCase())}const En=function(e){const t=/object ([a-zA-Z]*)/.exec(Object.prototype.toString.call(e));return t&&bp[t[1].toLowerCase()]?bp[t[1].toLowerCase()](e):e},bp={object:function(e){var t=[];for(var r in e)!li(e,r)||t.push(En(r)+": "+(e[r]!=null?En(e[r]):"null"));return`{
`+t.join(`,
`)+`
}`},function:function(e){e=""+e;var t=/^ *([\w]+) *\(/.exec(e);return t&&t[1]!=="function"?"function "+e:e},array:function(e){for(var t=0,r=[];t=" "?o==="\\"?t[r]="\\\\":o==='"'&&(t[r]='\\"'):t[r]=o===`
-`?"\\n":o==="\r"?"\\r":o===" "?"\\t":o==="\b"?"\\b":o==="\f"?"\\f":(o=o.charCodeAt(),"\\u00"+(o>15?1:0)+o%16)}return'"'+t.join("")+'"'}},bp=function(e){if(e&&typeof e=="object"){for(let t in e)if(Object.prototype.hasOwnProperty.call(e,t)){let r=e[t];(Array.isArray(r)||dt.Object(r))&&bp(r),dt.String(r)&&(e[t]=Vr(r))}}return e};function $r(e,t,r){t=(t||"").split(".");let o=0,i=t.length;for(;e!=null&&o(t,r)=>$b(t,r,n.unref(e)),$b=(e,t,r)=>$r(r,e,"").replace(/\{(\w+)\}/g,(o,i)=>{var l;return`${(l=t==null?void 0:t[i])!=null?l:`{${i}}`}`}),Ib=e=>{const t=n.computed(()=>n.unref(e).name),r=n.computed(()=>Rr(id(t.value||""))),o=n.isRef(e)?e:n.ref(e);return{lang:t,name:r,locale:o,t:Rb(e)}},ld=e=>Ib(n.computed(()=>(n.isRef(e)?e.value:e)||vp)),it=(e,t,r)=>t.map(o=>(o.label=e((r||"props")+"."+(o.label||o.value))||o.label,o)),Be=(e,t,r)=>r.map(o=>(o.field==="formCreate$required"?o.title=e("validate.required")||o.title:o.field&&o.field!=="_optionType"&&(o.title=e("com."+t+"."+o.field)||o.title),o.type==="template"&&dt.trueArray(o.children)&&(o.children=Be(e,t,o.children)),o)),sd=e=>{const t=[];return e&&e.forEach(r=>{if(!r._fc_drag_skip)if(r._fc_drag_tag){const o={id:r.__fc__.id,rule:r,children:sd(r.children)};o.children.length||delete o.children,t.push(o)}else t.push(...sd(r.children))}),t},wp=e=>{const t=r=>{const o=[];return r&&r.forEach(i=>{i._fc_drag_skip||(i.field?(i.children=t(i.children||[]),i.children.length||delete i.children,o.push(i)):o.push(...t(i.children||[])))}),o};return t(e)},Cp=e=>{const t=r=>{const o=[];return r&&r.forEach(i=>{if(typeof i=="object")if(i._fc_drag_tag){const l={_fc_id:i._fc_id,_fc_drag_tag:i._fc_drag_tag==="_"?void 0:i._fc_drag_tag,type:i.type,field:i.field,title:i.title,name:i.name,slot:i.slot,props:{...i.props||{}},children:t(i.children||[])};i.children&&typeof i.children[0]=="string"&&(l.content=i.children[0]),l.children.length||delete l.children,o.push(l)}else o.push(...t(i.children))}),o};return t(e)};function on(e){return{name:"$inject",columns:[{label:"$inject.api",info:e("event.inject.api"),type:"Api"},{label:"$inject.rule",info:e("event.inject.rule"),type:"Rule[]"},{label:"$inject.self",info:e("event.inject.self"),type:"Rule"},{label:"$inject.option",info:e("event.inject.option"),type:"Object"},{label:"$inject.args",info:e("event.inject.args"),type:"Array"}]}}function si(e){return["",null,void 0].indexOf(e)!==-1}function _p(e){return e.replace(/[\ .*+?^${}()|[\]\\]/g,"\\$&")}function Fb(e,t){const r=e.split("."),o=t.split("."),i=Math.min(r.length,o.length);for(var l=0;l0)return 1;if(d<0)return-1}return r.length===o.length?0:r.lengthe.indexOf(t)===r)}let Pb=0;function We(){const e=370+ ++Pb;return"F"+Math.random().toString(36).substr(3,3)+Number(`${Date.now()}`).toString(36)+e.toString(36)+"c"}function Mb(e,t){return function(r,o,i){const l={...r||{}};Object.keys(l).forEach(d=>{si(l[d])&&delete l[d]}),i.getRule(e).props.info=Object.keys(l).length>0?t("struct.configured"):""}}function Ep({t:e}){const t=We();return[{type:"input",field:">formName",value:"",title:e("form.formName")},{type:"radio",field:"labelPosition",value:"left",title:e("form.labelPosition"),options:it(e,[{value:"left",label:"left"},{value:"right",label:"right"},{value:"top",label:"top"}])},{type:"input",field:">tableName",value:"",title:e("form.tableName")},{type:"radio",field:"size",value:"small",title:e("form.size"),options:it(e,[{value:"large",label:"large"},{value:"default",label:"default"},{value:"small",label:"small"}])},{type:"input",field:"labelSuffix",value:"",title:e("form.labelSuffix"),style:{width:"150px"}},{type:"SizeInput",field:"labelWidth",value:"125px",title:e("form.labelWidth")},{type:"SizeInput",field:"wrap>style>marginBottom",value:"",title:e("form.formItemMarginBottom")},{type:"switch",field:"hideRequiredAsterisk",value:!1,title:e("form.hideRequiredAsterisk")},{type:"switch",field:"showMessage",value:!0,title:e("form.showMessage")},{type:"switch",field:"inlineMessage",value:!1,title:e("form.inlineMessage")},{type:"switch",field:"_submitBtn>show",value:!0,title:e("form.submitBtn")},{type:"switch",field:"_resetBtn>show",value:!1,title:e("form.resetBtn")},{type:"switch",field:">ignoreHiddenFields",value:!1,title:e("form.ignoreHiddenFields"),warning:e("warning.ignoreHiddenFields")},{type:"ConfigItem",col:{show:!0},name:t,style:"margin-bottom: 10px",props:{label:e("form.labelStyle"),info:""},children:[{type:"StyleConfig",field:"title>style",wrap:{show:!1},value:{},slot:"append",update:Mb(t,e)}]},{type:"FnConfig",field:">_event",value:{},col:{show:!0},props:{eventConfig:[{name:"onSubmit",info:e("form.onSubmit"),args:["formData","api"]},{name:"onReset",info:e("form.onReset"),args:["api"]},{name:"onCreated",info:e("form.onCreated"),args:["api"]},{name:"onMounted",info:e("form.onMounted"),args:["api"]},{name:"onReload",info:e("form.onReload"),args:["api"]},{name:"onChange",info:e("form.onChange"),args:["field","value","options"]},{name:"beforeSubmit",info:e("form.beforeSubmit"),args:["formData","data"]},{name:"beforeFetch",info:e("form.beforeFetch"),args:["config","data"]}]},title:e("form.event")}]}function Vo({t:e}){return[{type:"ConfigItem",col:{show:!0},style:"margin-bottom: 10px",name:"attributeId",props:{label:e("form.attributeId"),warning:e("warning.attributeId")},children:[{type:"switch",field:"attributeId",value:!1,wrap:{show:!1},col:{show:!1}}]},{type:"FieldInput",field:"field",value:"",title:e("form.field"),warning:e("warning.field")},{type:"LanguageInput",field:"title",value:"",title:e("form.title")},{type:"Input",field:"fieldtype",value:"",title:e("form.fieldtype")},{type:"LanguageInput",field:"info",value:"",title:e("form.info")},{type:"SpanInput",field:"formCreateCol>span",title:e("form.formItemSpan")},{type:"ConfigItem",col:{show:!0},style:"margin-bottom: 10px",name:"ignoreConfig",props:{label:e("form.ignore"),warning:e("warning.ignore")},children:[{type:"switch",field:"ignore",value:!1,wrap:{show:!1},col:{show:!1}}]},{type:"ConfigItem",col:{show:!0},name:"labelConfig",style:"margin-bottom: 10px",props:{label:e("form.formItem")},children:[{type:"HideConfig",field:"formCreateWrap>title",col:{show:!1},wrap:{show:!1},value:!0},{type:"select",field:"formCreateWrap>class",title:e("form.labelPosition"),col:{show:!1},slot:"append",options:it(e,[{value:"fc-wrap-top",label:"top"},{value:"fc-wrap-left",label:"left"},{value:"fc-wrap-right",label:"right"}])},{type:"SizeInput",field:"formCreateWrap>labelWidth",col:{show:!1},value:"",slot:"append",title:e("form.labelWidth")},{type:"SizeInput",field:"formCreateWrap>style>marginBottom",col:{show:!1},value:"",slot:"append",title:e("form.formItemMarginBottom")}]},{type:"Struct",field:"_control",name:"control",value:[],title:e("form.control"),warning:e("form.controlDocument",{doc:''+e("form.document")+""}),props:{defaultValue:[],validate(t){return Array.isArray(t)?t.length?!t.some(({rule:r})=>!Array.isArray(r)):!0:!1}}}]}function Ap({t:e}){return[{type:"input",title:"ID",field:"id",wrap:{labelWidth:"45px"}},{type:"GlobalClassSelect",title:"Class",field:"class",wrap:{labelWidth:"45px"}},{type:"StyleConfig",field:"style",title:"",value:{}}]}function Sp({t:e}){return[{type:"ComputedConfig",field:"value",value:"",props:{type:"linkage",btn:e("computed.value.btn"),title:e("computed.value.title"),name:e("computed.value.name")},title:e("computed.value.title")},{type:"ComputedConfig",field:"hidden",value:"",props:{btn:e("computed.hidden.btn"),title:e("computed.hidden.title"),name:e("computed.hidden.name"),invertLabel:e("props.show"),validLabel:e("props.hide")},title:e("computed.hidden.title")},{type:"ComputedConfig",field:"$required",value:"",props:{btn:e("computed.required.btn"),title:e("computed.required.title"),name:e("computed.required.name"),invertLabel:e("validate.modes.notRequired"),validLabel:e("validate.modes.required")},title:e("computed.required.title")},{type:"ComputedConfig",field:"props.disabled",value:"",props:{btn:e("computed.disabled.btn"),title:e("computed.disabled.title"),name:e("computed.disabled.name"),invertLabel:e("props.enable"),validLabel:e("props.disabled")},title:e("computed.disabled.title")}]}function xp({t:e}){return[{type:"Required",field:"$required",title:e("validate.required")},{type:"validate",field:"validate",title:e("validate.rule"),value:[]}]}function Lb(e){e=e||new Map;const t={$on(r,o){const i=e.get(r);i&&i.push(o)||e.set(r,[o])},$once(r,o){o._once=!0,t.$on(r,o)},$off(r,o){const i=e.get(r);i&&i.splice(i.indexOf(o)>>>0,1)},$emit(r,...o){(e.get(r)||[]).slice().map(i=>{i._once&&(t.$off(r,i),delete i._once),i(...o)}),(e.get("*")||[]).slice().map(i=>{i(r,o)})}};return t}const jb="\u5355\u9009\u6846",dd="radio",zb={menu:"main",icon:"icon-radio",label:jb,name:dd,input:!0,event:["change"],validate:["string","number"],condition:{type:"select",options:"options"},sfc(e){e.type="elRadioGroup",e.children=(e.options||[]).map(t=>({type:e.props.type==="button"?"elRadioButton":"elRadio",props:{label:t.value,value:t.value},_sfc:{content:t.label}})),delete e.props.type},rule({t:e}){return{type:dd,field:We(),title:e("com.radio.name"),info:"",effect:{fetch:""},$required:!1,props:{},options:Qn(e("props.option"),{label:"label",value:"value"},1)}},props(e,{t}){return Be(t,dd+".props",[Pi(t,"options"),{type:"switch",field:"disabled"},{type:"switch",field:"input"},{type:"switch",field:"type",props:{activeValue:"button",inactiveValue:"default"}},{type:"ColorInput",field:"textColor"},{type:"ColorInput",field:"fill"}])}},Ub="\u591A\u9009\u6846",cd="checkbox",Hb={menu:"main",icon:"icon-checkbox",label:Ub,name:cd,input:!0,event:["change"],validate:["array"],condition:{type:"select",options:"options"},sfc(e){e.type="elCheckboxGroup",e.children=(e.options||[]).map(t=>({type:e.props.type==="button"?"elCheckboxButton":"elCheckbox",props:{label:t.value,value:t.value},_sfc:{content:t.label}})),delete e.props.type},rule({t:e}){return{type:cd,field:We(),title:e("com.checkbox.name"),info:"",effect:{fetch:""},$required:!1,props:{},options:Qn(e("props.option"),{label:"label",value:"value"},1)}},props(e,{t}){return Be(t,cd+".props",[Pi(t,"options"),{type:"switch",field:"disabled"},{type:"switch",field:"input"},{type:"switch",field:"type",props:{activeValue:"button",inactiveValue:"default"}},{field:"min",type:"inputNumber",props:{min:0}},{field:"max",type:"inputNumber",props:{min:0}},{type:"ColorInput",field:"textColor"},{type:"ColorInput",field:"fill"}])}},Wb="\u8F93\u5165\u6846",ud="input",Gb={menu:"main",icon:"icon-input",label:Wb,name:ud,input:!0,easySlots:["prefix","suffix","prepend","append"],event:["blur","focus","change","input","clear"],validate:["string","url","email"],rule({t:e}){return{type:ud,field:We(),title:e("com.input.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,ud+".props",[{type:"switch",field:"disabled"},{type:"switch",field:"readonly"},{type:"select",field:"type",options:it(t,[{label:"text",value:"text"},{label:"number",value:"number"},{label:"time",value:"time"},{label:"date",value:"date"},{label:"month",value:"month"},{label:"datetime-local",value:"datetime-local"}])},{type:"inputNumber",field:"maxlength",props:{min:0}},{type:"input",field:"placeholder"},{type:"switch",field:"clearable"}])}},Kb="\u591A\u884C\u8F93\u5165\u6846",kp="textarea",Yb={menu:"main",icon:"icon-textarea",label:Kb,name:kp,input:!0,event:["blur","focus","change","input"],validate:["string"],rule({t:e}){return{type:"input",field:We(),title:e("com.textarea.name"),info:"",$required:!1,props:{type:"textarea"}}},props(e,{t}){return Be(t,kp+".props",[{type:"switch",field:"disabled"},{type:"switch",field:"readonly"},{type:"inputNumber",field:"maxlength",props:{min:0}},{type:"switch",field:"showWordLimit"},{type:"input",field:"placeholder"},{type:"inputNumber",field:"rows",props:{min:0}},{type:"switch",field:"autosize"}])}},Qb="\u5BC6\u7801\u8F93\u5165\u6846",Np="password",Jb={menu:"main",icon:"icon-password",label:Qb,name:Np,input:!0,easySlots:["prefix","suffix","prepend","append"],event:["blur","focus","change","input","clear"],validate:["string"],rule({t:e}){return{type:"input",field:We(),title:e("com.password.name"),info:"",$required:!1,props:{type:"password"}}},props(e,{t}){return Be(t,Np+".props",[{type:"switch",field:"disabled"},{type:"switch",field:"readonly"},{type:"inputNumber",field:"maxlength",props:{min:0}},{type:"input",field:"placeholder"},{type:"switch",field:"clearable"}])}},Xb="\u8BA1\u6570\u5668",fd="inputNumber",Zb={menu:"main",icon:"icon-number",label:Xb,name:fd,input:!0,easySlots:["prefix","suffix"],event:["blur","focus","change"],validate:["number","integer","float"],condition:"number",rule({t:e}){return{type:fd,field:We(),title:e("com.inputNumber.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,fd+".props",[{type:"switch",field:"disabled"},{type:"inputNumber",field:"min"},{type:"inputNumber",field:"max"},{type:"inputNumber",title:"precision",field:"precision"},{type:"inputNumber",field:"step",props:{min:0}},{type:"switch",field:"stepStrictly"},{type:"switch",field:"controls",value:!0},{type:"select",field:"controlsPosition",options:it(t,[{label:"default",value:""},{label:"right",value:"right"}])},{type:"input",field:"placeholder"}])}},qb="\u9009\u62E9\u5668",pd="select",e1={menu:"main",icon:"icon-select",label:qb,name:pd,input:!0,event:["change","visibleChange","removeTag","clear","blur","focus"],validate:["string","number","array"],condition:{type:"select",options:"options"},sfc(e){e.type="elSelect",e.children=(e.options||[]).map(t=>({type:"elOption",props:{label:t.label,value:t.value}}))},rule({t:e}){return{type:pd,field:We(),title:e("com.select.name"),info:"",effect:{fetch:""},$required:!1,props:{},options:Qn(e("props.option"),{label:"label",value:"value"},1)}},watch:{multiple({rule:e}){e.key=We()}},props(e,{t}){return Be(t,pd+".props",[Pi(t,"options"),{type:"switch",field:"multiple"},{type:"switch",field:"disabled"},{type:"switch",field:"clearable"},{type:"switch",field:"collapseTags"},{type:"inputNumber",field:"multipleLimit",props:{min:0}},{type:"input",field:"placeholder"},{type:"switch",field:"filterable"},{type:"switch",field:"remote"},{type:"FnInput",field:"remoteMethod",props:{body:!0,button:!0,fnx:!0,name:"remoteMethod",args:[on(t)]}},{type:"switch",field:"allowCreate"},{type:"input",field:"noMatchText"},{type:"input",field:"noDataText"},{type:"switch",field:"reserveKeyword"},{type:"switch",field:"defaultFirstOption"}])}},t1="\u5F00\u5173",hd="switch",n1={menu:"main",icon:"icon-switch",label:t1,name:hd,input:!0,easySlots:["active-action","inactive-action"],event:["change"],condition:function(e){return{type:"switch",props:{activeValue:e.props.activeValue,inactiveValue:e.props.inactiveValue,activeText:e.props.activeText,inactiveText:e.props.inactiveText}}},rule({t:e}){return{type:hd,field:We(),title:e("com.switch.name"),info:"",$required:!1,props:{activeValue:!0,inactiveValue:!1}}},props(e,{t}){return Be(t,hd+".props",[{type:"switch",field:"disabled"},{type:"inputNumber",field:"width",props:{min:0}},{type:"input",field:"activeText"},{type:"input",field:"inactiveText"},{type:"ValueInput",field:"activeValue"},{type:"ValueInput",field:"inactiveValue"},{type:"ColorInput",field:"activeColor"},{type:"ColorInput",field:"inactiveColor"}])}},i1="\u6ED1\u5757",md="slider",r1={menu:"main",icon:"icon-slider",label:i1,name:md,input:!0,event:["change","input"],validate:["number","array"],condition:"number",rule({t:e}){return{type:md,field:We(),title:e("com.slider.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,md+".props",[{type:"switch",field:"disabled"},{type:"switch",field:"range"},{type:"inputNumber",field:"min",props:{min:0}},{type:"inputNumber",field:"max",props:{min:0}},{type:"inputNumber",field:"step",props:{min:0}},{type:"switch",field:"showInput"},{type:"switch",field:"showInputControls",value:!0},{type:"switch",field:"showStops"},{type:"switch",field:"vertical"},{type:"input",field:"height"}])}},o1="\u65F6\u95F4",Oo="timePicker",Tp={menu:"main",icon:"icon-time",label:o1,name:Oo,input:!0,event:["change","blur","focus","visibleChange"],sfc(e){e.props.valueFormat||(e.props.valueFormat="HH:mm:ss")},rule({t:e}){return{type:Oo,field:We(),title:e("com.timePicker.name"),info:"",$required:!1,props:{}}},watch:{isRange({rule:e}){e.key=We()},__format({value:e,rule:t}){t.props.format=e,t.props.valueFormat=e}},attrs:{format({rule:e}){return e.props.format||""}},props(e,{t}){return Be(t,Oo+".props",[{type:"switch",field:"readonly"},{type:"switch",field:"disabled"},{type:"switch",field:"isRange"},{type:"switch",field:"clearable",value:!0},{type:"select",field:"__format",options:[{label:t("com."+Oo+".HH:mm:ss"),value:"HH:mm:ss"},{label:t("com."+Oo+".HH:mm"),value:"HH:mm"}]},{type:"Struct",field:"pickerOptions",props:{defaultValue:{}}},{type:"switch",field:"editable",value:!0},{type:"input",field:"placeholder"},{type:"input",field:"startPlaceholder"},{type:"input",field:"endPlaceholder"},{type:"switch",field:"arrowControl"},{type:"select",field:"align",options:it(t,[{label:"left",value:"left"},{label:"center",value:"center"},{label:"right",value:"right"}])}])}},a1={menu:"main",icon:"icon-time-range",label:"\u65F6\u95F4\u533A\u95F4",name:"timeRange",input:!0,event:["change","blur","focus","visibleChange"],sfc:Tp.sfc,rule({t:e}){return{type:"timePicker",field:We(),title:e("com.timeRange.name"),info:"",$required:!1,props:{isRange:!0}}},watch:{__format({value:e,rule:t}){t.props.format=e,t.props.valueFormat=e}},attrs:{format({rule:e}){return e.props.format||""}},props(e,{t}){return Be(t,"timePicker.props",[{type:"switch",field:"readonly"},{type:"switch",field:"disabled"},{type:"switch",field:"clearable",value:!0},{type:"select",field:"__format",options:[{label:t("com.timePicker.HH:mm:ss"),value:"HH:mm:ss"},{label:t("com.timePicker.HH:mm"),value:"HH:mm"}]},{type:"Struct",field:"pickerOptions",props:{defaultValue:{}}},{type:"switch",field:"editable",value:!0},{type:"input",field:"startPlaceholder"},{type:"input",field:"endPlaceholder"},{type:"switch",field:"arrowControl"},{type:"select",field:"align",options:it(t,[{label:"left",value:"left"},{label:"center",value:"center"},{label:"right",value:"right"}])}])}},l1="\u65E5\u671F",gd="datePicker",Dp={date:"YYYY-MM-DD",month:"YYYY-MM",datetime:"YYYY-MM-DD HH:mm:ss",timerange:"HH:mm:ss",daterange:"YYYY-MM-DD",monthrange:"YYYY-MM",datetimerange:"YYYY-MM-DD HH:mm:ss",year:"YYYY"},Vp={menu:"main",icon:"icon-date",label:l1,name:gd,input:!0,event:["change","blur","focus","calendarChange","panelChange","visibleChange"],sfc(e){e.props.valueFormat||(e.props.valueFormat=Dp[e.props.type]||Dp.date)},rule({t:e}){return{type:gd,field:We(),title:e("com.datePicker.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,gd+".props",[{type:"switch",field:"readonly"},{type:"switch",field:"disabled"},{type:"select",field:"type",options:it(t,[{label:"year",value:"year"},{label:"month",value:"month"},{label:"date",value:"date"},{label:"dates",value:"dates"},{label:"week",value:"week"},{label:"datetime",value:"datetime"},{label:"datetimerange",value:"datetimerange"},{label:"daterange",value:"daterange"},{label:"monthrange",value:"monthrange"}])},{type:"switch",field:"clearable",value:!0},{type:"Struct",field:"pickerOptions",props:{defaultValue:{}}},{type:"switch",field:"editable",value:!0},{type:"input",field:"placeholder"},{type:"input",field:"startPlaceholder"},{type:"input",field:"endPlaceholder"},{type:"input",field:"format"},{type:"select",field:"align",options:it(t,[{label:"left",value:"left"},{label:"center",value:"center"},{label:"right",value:"right"}])},{type:"input",field:"rangeSeparator"},{type:"switch",field:"unlinkPanels"}])}},s1={menu:"main",icon:"icon-date-range",label:"\u65E5\u671F\u533A\u95F4",name:"dateRange",input:!0,event:["change","blur","focus","calendarChange","panelChange","visibleChange"],sfc:Vp.sfc,rule({t:e}){return{type:"datePicker",field:We(),title:e("com.dateRange.name"),info:"",$required:!1,props:{type:"datetimerange"}}},props(e,{t}){return Be(t,"datePicker.props",[{type:"switch",field:"readonly"},{type:"switch",field:"disabled"},{type:"select",field:"type",options:it(t,[{label:"datetimerange",value:"datetimerange"},{label:"daterange",value:"daterange"},{label:"monthrange",value:"monthrange"}])},{type:"switch",field:"clearable",value:!0},{type:"Struct",field:"pickerOptions",props:{defaultValue:{}}},{type:"switch",field:"editable",value:!0},{type:"input",field:"startPlaceholder"},{type:"input",field:"endPlaceholder"},{type:"input",field:"format"},{type:"select",field:"align",options:it(t,[{label:"left",value:"left"},{label:"center",value:"center"},{label:"right",value:"right"}])},{type:"input",field:"rangeSeparator"},{type:"switch",field:"unlinkPanels"}])}},d1="\u8BC4\u5206",vd="rate",c1={menu:"main",icon:"icon-rate",label:d1,name:vd,input:!0,event:["change"],validate:["number"],condition:"number",rule({t:e}){return{type:vd,field:We(),title:e("com.rate.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,vd+".props",[{type:"inputNumber",field:"max",props:{min:0}},{type:"switch",field:"disabled"},{type:"switch",field:"allowHalf"},{type:"ColorInput",field:"voidColor"},{type:"ColorInput",field:"disabledVoidColor"},{type:"input",field:"voidIconClass"},{type:"input",field:"disabledVoidIconClass"},{type:"switch",field:"showScore"},{type:"ColorInput",field:"textColor"},{type:"input",field:"scoreTemplate"}])}},u1="\u989C\u8272\u9009\u62E9\u5668",yd="colorPicker",f1={menu:"main",icon:"icon-color",label:u1,name:yd,input:!0,event:["change","activeChange","focus","blur"],validate:["string"],condition:"color",rule({t:e}){return{type:yd,field:We(),title:e("com.colorPicker.name"),info:"",$required:!1,props:{predefine:["#c9e6fc","#c3f2f2","#c2f1d2","#fef6c6","#ffe5c2","#fdcac2","#fadcce","#dec2fa","#ccd2f1","#2196f3","#08c9c9","#00c344","#fad714","#ff9300","#f52222","#eb2f96","#800080","#7500ea","#2d46c4","#000000","#333333","#5a5a5a","#757575","#9e9e9e","#bdbdbd","#dddddd","#f5f5f5","#ffffff"]}}},props(e,{t}){return Be(t,yd+".props",[{type:"switch",field:"disabled"},{type:"switch",field:"showAlpha"},{type:"select",field:"colorFormat",options:[{label:"hsl",value:"hsl"},{label:"hsv",value:"hsv"},{label:"hex",value:"hex"},{label:"rgb",value:"rgb"}]},{type:"tableOptions",field:"predefine",props:{column:[{label:t("props.value"),key:"value"}],valueType:"string"}}])}},p1="\u6805\u683C\u5E03\u5C40",bd="fcRow",h1={menu:"layout",icon:"icon-row",label:p1,name:bd,mask:!1,children:"col",childrenLen:2,subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("style.width"),vnode:t(r("el-slider"),{size:"small",min:0,max:24,modelValue:o.props.span,"onUpdate:modelValue":i=>{o.props.span=i}})}]},sfc(e){e.type="elRow"},rule(){return{type:bd,props:{},children:[]}},props(e,{t}){return Be(t,bd+".props",[{type:"inputNumber",field:"gutter",props:{min:0}},{type:"switch",field:"type",props:{activeValue:"flex",inactiveValue:"default"}},{type:"select",field:"justify",options:[{label:"start",value:"start"},{label:"end",value:"end"},{label:"center",value:"center"},{label:"space-around",value:"space-around"},{label:"space-between",value:"space-between"}]},{type:"select",field:"align",options:[{label:"top",value:"top"},{label:"middle",value:"middle"},{label:"bottom",value:"bottom"}]}])}},wd="col",Op={xs:"<768px",sm:"\u2265768px",md:"\u2265992px",lg:"\u22651200px",xl:"\u22651920px"},m1={name:wd,label:"\u683C\u5B50",drag:!0,dragBtn:!1,inside:!0,mask:!1,rule(){return{type:wd,props:{span:12},children:[]}},props(e,{t}){return Be(t,wd+".props",[{type:"slider",field:"span",value:12,props:{min:0,max:24}},{type:"slider",field:"offset",props:{min:0,max:24}},{type:"slider",field:"push",props:{min:0,max:24}},{type:"slider",field:"pull",props:{min:0,max:24}},{type:"ConfigItem",props:{label:t("props.reactive"),warning:t("com.col.info")},children:[{type:"elTabs",style:{width:"100%"},slot:"append",children:Object.keys(Op).map(r=>({type:"elTabPane",props:{label:Op[r]},style:"padding:0 10px;",children:[{type:"slider",field:r+">span",title:t("com.col.props.span"),value:12,props:{min:0,max:24}},{type:"slider",field:r+">offset",title:t("com.col.props.offset"),props:{min:0,max:24}},{type:"slider",field:r+">push",title:t("com.col.props.push"),props:{min:0,max:24}},{type:"slider",field:r+">pull",title:t("com.col.props.pull"),props:{min:0,max:24}}]}))}]}])}},g1="\u9009\u9879\u5361",Cd="elTabPane",v1={label:g1,name:Cd,inside:!0,drag:!0,dragBtn:!1,mask:!1,rule({t:e}){return{type:Cd,props:{label:e("com.elTabPane.name")},children:[]}},props(e,{t}){return Be(t,Cd+".props",[{type:"input",field:"label"},{type:"switch",field:"disabled"},{type:"input",field:"name"},{type:"switch",field:"lazy"}])}},y1="\u5206\u5272\u7EBF",_d="elDivider",b1={menu:"aide",icon:"icon-divider",label:y1,name:_d,rule({t:e}){return{type:_d,props:{},children:[e("com.elDivider.name")]}},props(e,{t}){return Be(t,_d+".props",[{type:"select",field:"direction",options:it(t,[{label:"horizontal",value:"horizontal"},{label:"vertical",value:"vertical"}])},{type:"input",field:"formCreateChild"},{type:"select",field:"contentPosition",options:it(t,[{label:"left",value:"left"},{label:"right",value:"right"},{label:"center",value:"center"}])}])}},w1="\u7EA7\u8054\u9009\u62E9\u5668",Ka="cascader",C1={menu:"main",icon:"icon-cascader",label:w1,name:Ka,input:!0,event:["change","expandChange","blur","focus","visibleChange","removeTag"],validate:["string","number","array"],condition(e){return{type:"cascader",options:"props.options",props:{props:e.props&&e.props.props||{}}}},rule({t:e}){return{type:Ka,field:We(),title:e("com.cascader.name"),info:"",effect:{fetch:""},$required:!1,props:{options:Qn(e("props.option"),{label:"label",value:"value"},3)}}},props(e,{t}){return Be(t,Ka+".props",[Br(t,"props.options"),{type:"switch",field:"disabled"},{type:"switch",field:"clearable"},{type:"input",field:"placeholder"},{type:"Object",field:"props",props:{rule:Be(t,Ka+".propsOpt",[{type:"switch",field:"multiple"},{type:"select",field:"expandTrigger",options:it(t,[{label:"click",value:"click"},{label:"hover",value:"hover"}])},{type:"switch",field:"checkStrictly"},{type:"switch",field:"emitPath",value:!0},{type:"input",field:"value",value:"value"},{type:"input",field:"label",value:"label"},{type:"input",field:"children",value:"children"},{type:"input",field:"disabled",value:"disabled"},{type:"input",field:"leaf"}])}},{type:"switch",field:"showAllLevels",value:!0},{type:"switch",field:"collapseTags"},{type:"switch",field:"collapseTagsTooltip"},{type:"input",field:"separator"},{type:"switch",field:"filterable"},{type:"select",field:"tagType",options:[{label:"success",value:"success"},{label:"info",value:"info"},{label:"warning",value:"warning"},{label:"danger",value:"danger"}]}])}},_1="\u4E0A\u4F20",Ed="upload",E1={menu:"main",icon:"icon-upload",label:_1,name:Ed,input:!0,easySlots:[{value:"tip",type:"text"}],event:["change","remove","preview","error","progress","exceed"],languageKey:["clickToUpload"],validate:["array"],sfc(e){e.type="elUpload",e.props.listType||(e.props.listType="picture-card"),e._sfc.modelField="fileList"},rule({t:e}){return{type:Ed,field:We(),title:e("com.upload.name"),info:"",$required:!1,props:{action:"/",onSuccess:`$FNX:const res = $inject.args[0];
+`?"\\n":o==="\r"?"\\r":o===" "?"\\t":o==="\b"?"\\b":o==="\f"?"\\f":(o=o.charCodeAt(),"\\u00"+(o>15?1:0)+o%16)}return'"'+t.join("")+'"'}},wp=function(e){if(e&&typeof e=="object"){for(let t in e)if(Object.prototype.hasOwnProperty.call(e,t)){let r=e[t];(Array.isArray(r)||dt.Object(r))&&wp(r),dt.String(r)&&(e[t]=Dr(r))}}return e};function Rr(e,t,r){t=(t||"").split(".");let o=0,i=t.length;for(;e!=null&&o(t,r)=>Fb(t,r,n.unref(e)),Fb=(e,t,r)=>Rr(r,e,"").replace(/\{(\w+)\}/g,(o,i)=>{var l;return`${(l=t==null?void 0:t[i])!=null?l:`{${i}}`}`}),Pb=e=>{const t=n.computed(()=>n.unref(e).name),r=n.computed(()=>Br(id(t.value||""))),o=n.isRef(e)?e:n.ref(e);return{lang:t,name:r,locale:o,t:Ib(e)}},ld=e=>Pb(n.computed(()=>(n.isRef(e)?e.value:e)||yp)),it=(e,t,r)=>t.map(o=>(o.label=e((r||"props")+"."+(o.label||o.value))||o.label,o)),Be=(e,t,r)=>r.map(o=>(o.field==="formCreate$required"?o.title=e("validate.required")||o.title:o.field&&o.field!=="_optionType"&&(o.title=e("com."+t+"."+o.field)||o.title),o.type==="template"&&dt.trueArray(o.children)&&(o.children=Be(e,t,o.children)),o)),sd=e=>{const t=[];return e&&e.forEach(r=>{if(!r._fc_drag_skip)if(r._fc_drag_tag){const o={id:r.__fc__.id,rule:r,children:sd(r.children)};o.children.length||delete o.children,t.push(o)}else t.push(...sd(r.children))}),t},Cp=e=>{const t=r=>{const o=[];return r&&r.forEach(i=>{i._fc_drag_skip||(i.field?(i.children=t(i.children||[]),i.children.length||delete i.children,o.push(i)):o.push(...t(i.children||[])))}),o};return t(e)},_p=e=>{const t=r=>{const o=[];return r&&r.forEach(i=>{if(typeof i=="object")if(i._fc_drag_tag){const l={_fc_id:i._fc_id,_fc_drag_tag:i._fc_drag_tag==="_"?void 0:i._fc_drag_tag,type:i.type,field:i.field,title:i.title,name:i.name,slot:i.slot,props:{...i.props||{}},children:t(i.children||[])};i.children&&typeof i.children[0]=="string"&&(l.content=i.children[0]),l.children.length||delete l.children,o.push(l)}else o.push(...t(i.children))}),o};return t(e)};function on(e){return{name:"$inject",columns:[{label:"$inject.api",info:e("event.inject.api"),type:"Api"},{label:"$inject.rule",info:e("event.inject.rule"),type:"Rule[]"},{label:"$inject.self",info:e("event.inject.self"),type:"Rule"},{label:"$inject.option",info:e("event.inject.option"),type:"Object"},{label:"$inject.args",info:e("event.inject.args"),type:"Array"}]}}function si(e){return["",null,void 0].indexOf(e)!==-1}function Ep(e){return e.replace(/[\ .*+?^${}()|[\]\\]/g,"\\$&")}function Mb(e,t){const r=e.split("."),o=t.split("."),i=Math.min(r.length,o.length);for(var l=0;l0)return 1;if(d<0)return-1}return r.length===o.length?0:r.lengthe.indexOf(t)===r)}let Lb=0;function We(){const e=370+ ++Lb;return"F"+Math.random().toString(36).substr(3,3)+Number(`${Date.now()}`).toString(36)+e.toString(36)+"c"}function jb(e,t){return function(r,o,i){const l={...r||{}};Object.keys(l).forEach(d=>{si(l[d])&&delete l[d]}),i.getRule(e).props.info=Object.keys(l).length>0?t("struct.configured"):""}}function Sp({t:e}){const t=We();return[{type:"input",field:">formName",value:"",title:e("form.formName")},{type:"radio",field:"labelPosition",value:"left",title:e("form.labelPosition"),options:it(e,[{value:"left",label:"left"},{value:"right",label:"right"},{value:"top",label:"top"}])},{type:"input",field:">tableName",value:"",title:e("form.tableName")},{type:"radio",field:"size",value:"small",title:e("form.size"),options:it(e,[{value:"large",label:"large"},{value:"default",label:"default"},{value:"small",label:"small"}])},{type:"input",field:"labelSuffix",value:"",title:e("form.labelSuffix"),style:{width:"150px"}},{type:"SizeInput",field:"labelWidth",value:"125px",title:e("form.labelWidth")},{type:"SizeInput",field:"wrap>style>marginBottom",value:"",title:e("form.formItemMarginBottom")},{type:"switch",field:"hideRequiredAsterisk",value:!1,title:e("form.hideRequiredAsterisk")},{type:"switch",field:"showMessage",value:!0,title:e("form.showMessage")},{type:"switch",field:"inlineMessage",value:!1,title:e("form.inlineMessage")},{type:"switch",field:"_submitBtn>show",value:!0,title:e("form.submitBtn")},{type:"switch",field:"_resetBtn>show",value:!1,title:e("form.resetBtn")},{type:"switch",field:">ignoreHiddenFields",value:!1,title:e("form.ignoreHiddenFields"),warning:e("warning.ignoreHiddenFields")},{type:"ConfigItem",col:{show:!0},name:t,style:"margin-bottom: 10px",props:{label:e("form.labelStyle"),info:""},children:[{type:"StyleConfig",field:"title>style",wrap:{show:!1},value:{},slot:"append",update:jb(t,e)}]},{type:"FnConfig",field:">_event",value:{},col:{show:!0},props:{eventConfig:[{name:"onSubmit",info:e("form.onSubmit"),args:["formData","api"]},{name:"onReset",info:e("form.onReset"),args:["api"]},{name:"onCreated",info:e("form.onCreated"),args:["api"]},{name:"onMounted",info:e("form.onMounted"),args:["api"]},{name:"onReload",info:e("form.onReload"),args:["api"]},{name:"onChange",info:e("form.onChange"),args:["field","value","options"]},{name:"beforeSubmit",info:e("form.beforeSubmit"),args:["formData","data"]},{name:"beforeFetch",info:e("form.beforeFetch"),args:["config","data"]}]},title:e("form.event")}]}function Vo({t:e}){return[{type:"ConfigItem",col:{show:!0},style:"margin-bottom: 10px",name:"attributeId",props:{label:e("form.attributeId"),warning:e("warning.attributeId")},children:[{type:"switch",field:"attributeId",value:!1,wrap:{show:!1},col:{show:!1}}]},{type:"FieldInput",field:"field",value:"",title:e("form.field"),warning:e("warning.field")},{type:"LanguageInput",field:"title",value:"",title:e("form.title")},{type:"Input",field:"fieldtype",value:"",title:e("form.fieldtype")},{type:"LanguageInput",field:"info",value:"",title:e("form.info")},{type:"SpanInput",field:"formCreateCol>span",title:e("form.formItemSpan")},{type:"ConfigItem",col:{show:!0},style:"margin-bottom: 10px",name:"ignoreConfig",props:{label:e("form.ignore"),warning:e("warning.ignore")},children:[{type:"switch",field:"ignore",value:!1,wrap:{show:!1},col:{show:!1}}]},{type:"ConfigItem",col:{show:!0},name:"labelConfig",style:"margin-bottom: 10px",props:{label:e("form.formItem")},children:[{type:"HideConfig",field:"formCreateWrap>title",col:{show:!1},wrap:{show:!1},value:!0},{type:"select",field:"formCreateWrap>class",title:e("form.labelPosition"),col:{show:!1},slot:"append",options:it(e,[{value:"fc-wrap-top",label:"top"},{value:"fc-wrap-left",label:"left"},{value:"fc-wrap-right",label:"right"}])},{type:"SizeInput",field:"formCreateWrap>labelWidth",col:{show:!1},value:"",slot:"append",title:e("form.labelWidth")},{type:"SizeInput",field:"formCreateWrap>style>marginBottom",col:{show:!1},value:"",slot:"append",title:e("form.formItemMarginBottom")}]},{type:"Struct",field:"_control",name:"control",value:[],title:e("form.control"),warning:e("form.controlDocument",{doc:''+e("form.document")+""}),props:{defaultValue:[],validate(t){return Array.isArray(t)?t.length?!t.some(({rule:r})=>!Array.isArray(r)):!0:!1}}}]}function Ap({t:e}){return[{type:"input",title:"ID",field:"id",wrap:{labelWidth:"45px"}},{type:"GlobalClassSelect",title:"Class",field:"class",wrap:{labelWidth:"45px"}},{type:"StyleConfig",field:"style",title:"",value:{}}]}function xp({t:e}){return[{type:"ComputedConfig",field:"value",value:"",props:{type:"linkage",btn:e("computed.value.btn"),title:e("computed.value.title"),name:e("computed.value.name")},title:e("computed.value.title")},{type:"ComputedConfig",field:"hidden",value:"",props:{btn:e("computed.hidden.btn"),title:e("computed.hidden.title"),name:e("computed.hidden.name"),invertLabel:e("props.show"),validLabel:e("props.hide")},title:e("computed.hidden.title")},{type:"ComputedConfig",field:"$required",value:"",props:{btn:e("computed.required.btn"),title:e("computed.required.title"),name:e("computed.required.name"),invertLabel:e("validate.modes.notRequired"),validLabel:e("validate.modes.required")},title:e("computed.required.title")},{type:"ComputedConfig",field:"props.disabled",value:"",props:{btn:e("computed.disabled.btn"),title:e("computed.disabled.title"),name:e("computed.disabled.name"),invertLabel:e("props.enable"),validLabel:e("props.disabled")},title:e("computed.disabled.title")}]}function kp({t:e}){return[{type:"Required",field:"$required",title:e("validate.required")},{type:"validate",field:"validate",title:e("validate.rule"),value:[]}]}function zb(e){e=e||new Map;const t={$on(r,o){const i=e.get(r);i&&i.push(o)||e.set(r,[o])},$once(r,o){o._once=!0,t.$on(r,o)},$off(r,o){const i=e.get(r);i&&i.splice(i.indexOf(o)>>>0,1)},$emit(r,...o){(e.get(r)||[]).slice().map(i=>{i._once&&(t.$off(r,i),delete i._once),i(...o)}),(e.get("*")||[]).slice().map(i=>{i(r,o)})}};return t}const Ub="\u5355\u9009\u6846",dd="radio",Hb={menu:"main",icon:"icon-radio",label:Ub,name:dd,input:!0,event:["change"],validate:["string","number"],condition:{type:"select",options:"options"},sfc(e){e.type="elRadioGroup",e.children=(e.options||[]).map(t=>({type:e.props.type==="button"?"elRadioButton":"elRadio",props:{label:t.value,value:t.value},_sfc:{content:t.label}})),delete e.props.type},rule({t:e}){return{type:dd,field:We(),title:e("com.radio.name"),info:"",effect:{fetch:""},$required:!1,props:{},options:Qn(e("props.option"),{label:"label",value:"value"},1)}},props(e,{t}){return Be(t,dd+".props",[Pi(t,"options"),{type:"switch",field:"disabled"},{type:"switch",field:"input"},{type:"switch",field:"type",props:{activeValue:"button",inactiveValue:"default"}},{type:"ColorInput",field:"textColor"},{type:"ColorInput",field:"fill"}])}},Wb="\u591A\u9009\u6846",cd="checkbox",Gb={menu:"main",icon:"icon-checkbox",label:Wb,name:cd,input:!0,event:["change"],validate:["array"],condition:{type:"select",options:"options"},sfc(e){e.type="elCheckboxGroup",e.children=(e.options||[]).map(t=>({type:e.props.type==="button"?"elCheckboxButton":"elCheckbox",props:{label:t.value,value:t.value},_sfc:{content:t.label}})),delete e.props.type},rule({t:e}){return{type:cd,field:We(),title:e("com.checkbox.name"),info:"",effect:{fetch:""},$required:!1,props:{},options:Qn(e("props.option"),{label:"label",value:"value"},1)}},props(e,{t}){return Be(t,cd+".props",[Pi(t,"options"),{type:"switch",field:"disabled"},{type:"switch",field:"input"},{type:"switch",field:"type",props:{activeValue:"button",inactiveValue:"default"}},{field:"min",type:"inputNumber",props:{min:0}},{field:"max",type:"inputNumber",props:{min:0}},{type:"ColorInput",field:"textColor"},{type:"ColorInput",field:"fill"}])}},Kb="\u8F93\u5165\u6846",ud="input",Yb={menu:"main",icon:"icon-input",label:Kb,name:ud,input:!0,easySlots:["prefix","suffix","prepend","append"],event:["blur","focus","change","input","clear"],validate:["string","url","email"],rule({t:e}){return{type:ud,field:We(),title:e("com.input.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,ud+".props",[{type:"switch",field:"disabled"},{type:"switch",field:"readonly"},{type:"select",field:"type",options:it(t,[{label:"text",value:"text"},{label:"number",value:"number"},{label:"time",value:"time"},{label:"date",value:"date"},{label:"month",value:"month"},{label:"datetime-local",value:"datetime-local"}])},{type:"inputNumber",field:"maxlength",props:{min:0}},{type:"input",field:"placeholder"},{type:"switch",field:"clearable"}])}},Qb="\u591A\u884C\u8F93\u5165\u6846",Np="textarea",Jb={menu:"main",icon:"icon-textarea",label:Qb,name:Np,input:!0,event:["blur","focus","change","input"],validate:["string"],rule({t:e}){return{type:"input",field:We(),title:e("com.textarea.name"),info:"",$required:!1,props:{type:"textarea"}}},props(e,{t}){return Be(t,Np+".props",[{type:"switch",field:"disabled"},{type:"switch",field:"readonly"},{type:"inputNumber",field:"maxlength",props:{min:0}},{type:"switch",field:"showWordLimit"},{type:"input",field:"placeholder"},{type:"inputNumber",field:"rows",props:{min:0}},{type:"switch",field:"autosize"}])}},Xb="\u5BC6\u7801\u8F93\u5165\u6846",Tp="password",Zb={menu:"main",icon:"icon-password",label:Xb,name:Tp,input:!0,easySlots:["prefix","suffix","prepend","append"],event:["blur","focus","change","input","clear"],validate:["string"],rule({t:e}){return{type:"input",field:We(),title:e("com.password.name"),info:"",$required:!1,props:{type:"password"}}},props(e,{t}){return Be(t,Tp+".props",[{type:"switch",field:"disabled"},{type:"switch",field:"readonly"},{type:"inputNumber",field:"maxlength",props:{min:0}},{type:"input",field:"placeholder"},{type:"switch",field:"clearable"}])}},qb="\u8BA1\u6570\u5668",fd="inputNumber",e1={menu:"main",icon:"icon-number",label:qb,name:fd,input:!0,easySlots:["prefix","suffix"],event:["blur","focus","change"],validate:["number","integer","float"],condition:"number",rule({t:e}){return{type:fd,field:We(),title:e("com.inputNumber.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,fd+".props",[{type:"switch",field:"disabled"},{type:"inputNumber",field:"min"},{type:"inputNumber",field:"max"},{type:"inputNumber",title:"precision",field:"precision"},{type:"inputNumber",field:"step",props:{min:0}},{type:"switch",field:"stepStrictly"},{type:"switch",field:"controls",value:!0},{type:"select",field:"controlsPosition",options:it(t,[{label:"default",value:""},{label:"right",value:"right"}])},{type:"input",field:"placeholder"}])}},t1="\u9009\u62E9\u5668",pd="select",n1={menu:"main",icon:"icon-select",label:t1,name:pd,input:!0,event:["change","visibleChange","removeTag","clear","blur","focus"],validate:["string","number","array"],condition:{type:"select",options:"options"},sfc(e){e.type="elSelect",e.children=(e.options||[]).map(t=>({type:"elOption",props:{label:t.label,value:t.value}}))},rule({t:e}){return{type:pd,field:We(),title:e("com.select.name"),info:"",effect:{fetch:""},$required:!1,props:{},options:Qn(e("props.option"),{label:"label",value:"value"},1)}},watch:{multiple({rule:e}){e.key=We()}},props(e,{t}){return Be(t,pd+".props",[Pi(t,"options"),{type:"switch",field:"multiple"},{type:"switch",field:"disabled"},{type:"switch",field:"clearable"},{type:"switch",field:"collapseTags"},{type:"inputNumber",field:"multipleLimit",props:{min:0}},{type:"input",field:"placeholder"},{type:"switch",field:"filterable"},{type:"switch",field:"remote"},{type:"FnInput",field:"remoteMethod",props:{body:!0,button:!0,fnx:!0,name:"remoteMethod",args:[on(t)]}},{type:"switch",field:"allowCreate"},{type:"input",field:"noMatchText"},{type:"input",field:"noDataText"},{type:"switch",field:"reserveKeyword"},{type:"switch",field:"defaultFirstOption"}])}},i1="\u5F00\u5173",hd="switch",r1={menu:"main",icon:"icon-switch",label:i1,name:hd,input:!0,easySlots:["active-action","inactive-action"],event:["change"],condition:function(e){return{type:"switch",props:{activeValue:e.props.activeValue,inactiveValue:e.props.inactiveValue,activeText:e.props.activeText,inactiveText:e.props.inactiveText}}},rule({t:e}){return{type:hd,field:We(),title:e("com.switch.name"),info:"",$required:!1,props:{activeValue:!0,inactiveValue:!1}}},props(e,{t}){return Be(t,hd+".props",[{type:"switch",field:"disabled"},{type:"inputNumber",field:"width",props:{min:0}},{type:"input",field:"activeText"},{type:"input",field:"inactiveText"},{type:"ValueInput",field:"activeValue"},{type:"ValueInput",field:"inactiveValue"},{type:"ColorInput",field:"activeColor"},{type:"ColorInput",field:"inactiveColor"}])}},o1="\u6ED1\u5757",md="slider",a1={menu:"main",icon:"icon-slider",label:o1,name:md,input:!0,event:["change","input"],validate:["number","array"],condition:"number",rule({t:e}){return{type:md,field:We(),title:e("com.slider.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,md+".props",[{type:"switch",field:"disabled"},{type:"switch",field:"range"},{type:"inputNumber",field:"min",props:{min:0}},{type:"inputNumber",field:"max",props:{min:0}},{type:"inputNumber",field:"step",props:{min:0}},{type:"switch",field:"showInput"},{type:"switch",field:"showInputControls",value:!0},{type:"switch",field:"showStops"},{type:"switch",field:"vertical"},{type:"input",field:"height"}])}},l1="\u65F6\u95F4",Oo="timePicker",Dp={menu:"main",icon:"icon-time",label:l1,name:Oo,input:!0,event:["change","blur","focus","visibleChange"],sfc(e){e.props.valueFormat||(e.props.valueFormat="HH:mm:ss")},rule({t:e}){return{type:Oo,field:We(),title:e("com.timePicker.name"),info:"",$required:!1,props:{}}},watch:{isRange({rule:e}){e.key=We()},__format({value:e,rule:t}){t.props.format=e,t.props.valueFormat=e}},attrs:{format({rule:e}){return e.props.format||""}},props(e,{t}){return Be(t,Oo+".props",[{type:"switch",field:"readonly"},{type:"switch",field:"disabled"},{type:"switch",field:"isRange"},{type:"switch",field:"clearable",value:!0},{type:"select",field:"__format",options:[{label:t("com."+Oo+".HH:mm:ss"),value:"HH:mm:ss"},{label:t("com."+Oo+".HH:mm"),value:"HH:mm"}]},{type:"Struct",field:"pickerOptions",props:{defaultValue:{}}},{type:"switch",field:"editable",value:!0},{type:"input",field:"placeholder"},{type:"input",field:"startPlaceholder"},{type:"input",field:"endPlaceholder"},{type:"switch",field:"arrowControl"},{type:"select",field:"align",options:it(t,[{label:"left",value:"left"},{label:"center",value:"center"},{label:"right",value:"right"}])}])}},s1={menu:"main",icon:"icon-time-range",label:"\u65F6\u95F4\u533A\u95F4",name:"timeRange",input:!0,event:["change","blur","focus","visibleChange"],sfc:Dp.sfc,rule({t:e}){return{type:"timePicker",field:We(),title:e("com.timeRange.name"),info:"",$required:!1,props:{isRange:!0}}},watch:{__format({value:e,rule:t}){t.props.format=e,t.props.valueFormat=e}},attrs:{format({rule:e}){return e.props.format||""}},props(e,{t}){return Be(t,"timePicker.props",[{type:"switch",field:"readonly"},{type:"switch",field:"disabled"},{type:"switch",field:"clearable",value:!0},{type:"select",field:"__format",options:[{label:t("com.timePicker.HH:mm:ss"),value:"HH:mm:ss"},{label:t("com.timePicker.HH:mm"),value:"HH:mm"}]},{type:"Struct",field:"pickerOptions",props:{defaultValue:{}}},{type:"switch",field:"editable",value:!0},{type:"input",field:"startPlaceholder"},{type:"input",field:"endPlaceholder"},{type:"switch",field:"arrowControl"},{type:"select",field:"align",options:it(t,[{label:"left",value:"left"},{label:"center",value:"center"},{label:"right",value:"right"}])}])}},d1="\u65E5\u671F",gd="datePicker",Vp={date:"YYYY-MM-DD",month:"YYYY-MM",datetime:"YYYY-MM-DD HH:mm:ss",timerange:"HH:mm:ss",daterange:"YYYY-MM-DD",monthrange:"YYYY-MM",datetimerange:"YYYY-MM-DD HH:mm:ss",year:"YYYY"},Op={menu:"main",icon:"icon-date",label:d1,name:gd,input:!0,event:["change","blur","focus","calendarChange","panelChange","visibleChange"],sfc(e){e.props.valueFormat||(e.props.valueFormat=Vp[e.props.type]||Vp.date)},rule({t:e}){return{type:gd,field:We(),title:e("com.datePicker.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,gd+".props",[{type:"switch",field:"readonly"},{type:"switch",field:"disabled"},{type:"select",field:"type",options:it(t,[{label:"year",value:"year"},{label:"month",value:"month"},{label:"date",value:"date"},{label:"dates",value:"dates"},{label:"week",value:"week"},{label:"datetime",value:"datetime"},{label:"datetimerange",value:"datetimerange"},{label:"daterange",value:"daterange"},{label:"monthrange",value:"monthrange"}])},{type:"switch",field:"clearable",value:!0},{type:"Struct",field:"pickerOptions",props:{defaultValue:{}}},{type:"switch",field:"editable",value:!0},{type:"input",field:"placeholder"},{type:"input",field:"startPlaceholder"},{type:"input",field:"endPlaceholder"},{type:"input",field:"format"},{type:"select",field:"align",options:it(t,[{label:"left",value:"left"},{label:"center",value:"center"},{label:"right",value:"right"}])},{type:"input",field:"rangeSeparator"},{type:"switch",field:"unlinkPanels"}])}},c1={menu:"main",icon:"icon-date-range",label:"\u65E5\u671F\u533A\u95F4",name:"dateRange",input:!0,event:["change","blur","focus","calendarChange","panelChange","visibleChange"],sfc:Op.sfc,rule({t:e}){return{type:"datePicker",field:We(),title:e("com.dateRange.name"),info:"",$required:!1,props:{type:"datetimerange"}}},props(e,{t}){return Be(t,"datePicker.props",[{type:"switch",field:"readonly"},{type:"switch",field:"disabled"},{type:"select",field:"type",options:it(t,[{label:"datetimerange",value:"datetimerange"},{label:"daterange",value:"daterange"},{label:"monthrange",value:"monthrange"}])},{type:"switch",field:"clearable",value:!0},{type:"Struct",field:"pickerOptions",props:{defaultValue:{}}},{type:"switch",field:"editable",value:!0},{type:"input",field:"startPlaceholder"},{type:"input",field:"endPlaceholder"},{type:"input",field:"format"},{type:"select",field:"align",options:it(t,[{label:"left",value:"left"},{label:"center",value:"center"},{label:"right",value:"right"}])},{type:"input",field:"rangeSeparator"},{type:"switch",field:"unlinkPanels"}])}},u1="\u8BC4\u5206",vd="rate",f1={menu:"main",icon:"icon-rate",label:u1,name:vd,input:!0,event:["change"],validate:["number"],condition:"number",rule({t:e}){return{type:vd,field:We(),title:e("com.rate.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,vd+".props",[{type:"inputNumber",field:"max",props:{min:0}},{type:"switch",field:"disabled"},{type:"switch",field:"allowHalf"},{type:"ColorInput",field:"voidColor"},{type:"ColorInput",field:"disabledVoidColor"},{type:"input",field:"voidIconClass"},{type:"input",field:"disabledVoidIconClass"},{type:"switch",field:"showScore"},{type:"ColorInput",field:"textColor"},{type:"input",field:"scoreTemplate"}])}},p1="\u989C\u8272\u9009\u62E9\u5668",yd="colorPicker",h1={menu:"main",icon:"icon-color",label:p1,name:yd,input:!0,event:["change","activeChange","focus","blur"],validate:["string"],condition:"color",rule({t:e}){return{type:yd,field:We(),title:e("com.colorPicker.name"),info:"",$required:!1,props:{predefine:["#c9e6fc","#c3f2f2","#c2f1d2","#fef6c6","#ffe5c2","#fdcac2","#fadcce","#dec2fa","#ccd2f1","#2196f3","#08c9c9","#00c344","#fad714","#ff9300","#f52222","#eb2f96","#800080","#7500ea","#2d46c4","#000000","#333333","#5a5a5a","#757575","#9e9e9e","#bdbdbd","#dddddd","#f5f5f5","#ffffff"]}}},props(e,{t}){return Be(t,yd+".props",[{type:"switch",field:"disabled"},{type:"switch",field:"showAlpha"},{type:"select",field:"colorFormat",options:[{label:"hsl",value:"hsl"},{label:"hsv",value:"hsv"},{label:"hex",value:"hex"},{label:"rgb",value:"rgb"}]},{type:"tableOptions",field:"predefine",props:{column:[{label:t("props.value"),key:"value"}],valueType:"string"}}])}},m1="\u6805\u683C\u5E03\u5C40",bd="fcRow",g1={menu:"layout",icon:"icon-row",label:m1,name:bd,mask:!1,children:"col",childrenLen:2,subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("style.width"),vnode:t(r("el-slider"),{size:"small",min:0,max:24,modelValue:o.props.span,"onUpdate:modelValue":i=>{o.props.span=i}})}]},sfc(e){e.type="elRow"},rule(){return{type:bd,props:{},children:[]}},props(e,{t}){return Be(t,bd+".props",[{type:"inputNumber",field:"gutter",props:{min:0}},{type:"switch",field:"type",props:{activeValue:"flex",inactiveValue:"default"}},{type:"select",field:"justify",options:[{label:"start",value:"start"},{label:"end",value:"end"},{label:"center",value:"center"},{label:"space-around",value:"space-around"},{label:"space-between",value:"space-between"}]},{type:"select",field:"align",options:[{label:"top",value:"top"},{label:"middle",value:"middle"},{label:"bottom",value:"bottom"}]}])}},wd="col",Bp={xs:"<768px",sm:"\u2265768px",md:"\u2265992px",lg:"\u22651200px",xl:"\u22651920px"},v1={name:wd,label:"\u683C\u5B50",drag:!0,dragBtn:!1,inside:!0,mask:!1,rule(){return{type:wd,props:{span:12},children:[]}},props(e,{t}){return Be(t,wd+".props",[{type:"slider",field:"span",value:12,props:{min:0,max:24}},{type:"slider",field:"offset",props:{min:0,max:24}},{type:"slider",field:"push",props:{min:0,max:24}},{type:"slider",field:"pull",props:{min:0,max:24}},{type:"ConfigItem",props:{label:t("props.reactive"),warning:t("com.col.info")},children:[{type:"elTabs",style:{width:"100%"},slot:"append",children:Object.keys(Bp).map(r=>({type:"elTabPane",props:{label:Bp[r]},style:"padding:0 10px;",children:[{type:"slider",field:r+">span",title:t("com.col.props.span"),value:12,props:{min:0,max:24}},{type:"slider",field:r+">offset",title:t("com.col.props.offset"),props:{min:0,max:24}},{type:"slider",field:r+">push",title:t("com.col.props.push"),props:{min:0,max:24}},{type:"slider",field:r+">pull",title:t("com.col.props.pull"),props:{min:0,max:24}}]}))}]}])}},y1="\u9009\u9879\u5361",Cd="elTabPane",b1={label:y1,name:Cd,inside:!0,drag:!0,dragBtn:!1,mask:!1,rule({t:e}){return{type:Cd,props:{label:e("com.elTabPane.name")},children:[]}},props(e,{t}){return Be(t,Cd+".props",[{type:"input",field:"label"},{type:"switch",field:"disabled"},{type:"input",field:"name"},{type:"switch",field:"lazy"}])}},w1="\u5206\u5272\u7EBF",_d="elDivider",C1={menu:"aide",icon:"icon-divider",label:w1,name:_d,rule({t:e}){return{type:_d,props:{},children:[e("com.elDivider.name")]}},props(e,{t}){return Be(t,_d+".props",[{type:"select",field:"direction",options:it(t,[{label:"horizontal",value:"horizontal"},{label:"vertical",value:"vertical"}])},{type:"input",field:"formCreateChild"},{type:"select",field:"contentPosition",options:it(t,[{label:"left",value:"left"},{label:"right",value:"right"},{label:"center",value:"center"}])}])}},_1="\u7EA7\u8054\u9009\u62E9\u5668",Ka="cascader",E1={menu:"main",icon:"icon-cascader",label:_1,name:Ka,input:!0,event:["change","expandChange","blur","focus","visibleChange","removeTag"],validate:["string","number","array"],condition(e){return{type:"cascader",options:"props.options",props:{props:e.props&&e.props.props||{}}}},rule({t:e}){return{type:Ka,field:We(),title:e("com.cascader.name"),info:"",effect:{fetch:""},$required:!1,props:{options:Qn(e("props.option"),{label:"label",value:"value"},3)}}},props(e,{t}){return Be(t,Ka+".props",[Or(t,"props.options"),{type:"switch",field:"disabled"},{type:"switch",field:"clearable"},{type:"input",field:"placeholder"},{type:"Object",field:"props",props:{rule:Be(t,Ka+".propsOpt",[{type:"switch",field:"multiple"},{type:"select",field:"expandTrigger",options:it(t,[{label:"click",value:"click"},{label:"hover",value:"hover"}])},{type:"switch",field:"checkStrictly"},{type:"switch",field:"emitPath",value:!0},{type:"input",field:"value",value:"value"},{type:"input",field:"label",value:"label"},{type:"input",field:"children",value:"children"},{type:"input",field:"disabled",value:"disabled"},{type:"input",field:"leaf"}])}},{type:"switch",field:"showAllLevels",value:!0},{type:"switch",field:"collapseTags"},{type:"switch",field:"collapseTagsTooltip"},{type:"input",field:"separator"},{type:"switch",field:"filterable"},{type:"select",field:"tagType",options:[{label:"success",value:"success"},{label:"info",value:"info"},{label:"warning",value:"warning"},{label:"danger",value:"danger"}]}])}},S1="\u4E0A\u4F20",Ed="upload",A1={menu:"main",icon:"icon-upload",label:S1,name:Ed,input:!0,easySlots:[{value:"tip",type:"text"}],event:["change","remove","preview","error","progress","exceed"],languageKey:["clickToUpload"],validate:["array"],sfc(e){e.type="elUpload",e.props.listType||(e.props.listType="picture-card"),e._sfc.modelField="fileList"},rule({t:e}){return{type:Ed,field:We(),title:e("com.upload.name"),info:"",$required:!1,props:{action:"/",onSuccess:`$FNX:const res = $inject.args[0];
const file = $inject.args[1];
-file.url = res.data.url;`}}},props(e,{t}){return Be(t,Ed+".props",[{type:"switch",field:"disabled"},{type:"select",field:"listType",options:it(t,[{label:"text",value:"text"},{label:"picture",value:"picture"},{label:"picture-card",value:"picture-card"}])},{type:"switch",field:"multiple"},{type:"input",field:"name"},{type:"PromptInput",field:"accept",props:{options:[{label:t("props.image"),value:"image/*"},{label:t("props.document"),value:".pdf,.doc,.docx,.xml,application/msword,application/vnd.openxmlformats-officedocument.wordprocessingml.document"},{label:t("props.video"),value:"video/*"},{label:t("props.audio"),value:"audio/*"}]}},{type:"input",field:"action"},{type:"FnInput",field:"beforeUpload",props:{body:!0,button:!0,fnx:!0,args:[on(t)],name:"beforeUpload"}},{type:"FnInput",field:"beforeRemove",props:{body:!0,button:!0,fnx:!0,args:[on(t)],name:"beforeRemove"}},{type:"FnInput",field:"onSuccess",warning:t("com.upload.info"),props:{body:!0,button:!0,fnx:!0,args:[on(t)],name:"onSuccess"}},{type:"TableOptions",field:"headers",props:{column:[{label:t("props.key"),key:"label"},{label:t("props.value"),key:"value"}],valueType:"object"}},{type:"TableOptions",field:"data",props:{column:[{label:t("props.key"),key:"label"},{label:t("props.value"),key:"value"}],valueType:"object"}},{type:"switch",field:"withCredentials"},{type:"switch",field:"autoUpload",value:!0},{type:"inputNumber",field:"limit",props:{min:0}}])}},A1="\u7A7F\u68AD\u6846",Ad="elTransfer",S1={menu:"main",icon:"icon-transfer",label:A1,name:Ad,input:!0,event:["change","leftCheckChange","rightCheckChange"],validate:["array"],condition:function(e){return{type:"select",options:e.props.data?e.props.data.map(t=>({label:t.label,value:t.key})):[]}},rule({t:e}){return{type:Ad,field:We(),title:e("com.elTransfer.name"),info:"",$required:!1,props:{data:Qn(e("props.option"),{label:"label",value:"key"},1)}}},props(e,{t}){return Be(t,Ad+".props",[Pi(t,"props.data","label","key"),{type:"switch",field:"filterable"},{type:"input",field:"filterPlaceholder"},{type:"select",field:"targetOrder",warning:t("com.elTransfer.props.targetOrderInfo"),options:[{label:"original",value:"original"},{label:"push",value:"push"},{label:"unshift",value:"unshift"}]},{type:"TableOptions",field:"titles",props:{column:[{label:t("props.value"),key:"value"}],valueType:"string",max:2}},{type:"TableOptions",field:"buttonTexts",props:{column:[{label:t("props.value"),key:"value"}],valueType:"string",max:2}}])}},x1="\u6811\u5F62\u63A7\u4EF6",Sd="tree",k1={menu:"main",icon:"icon-tree",label:x1,name:Sd,input:!0,event:["nodeClick","nodeContextmenu","checkChange","check","currentChange","nodeExpand","nodeCollapse","nodeDragStart","nodeDragEnter","nodeDragLeave","nodeDragOver","nodeDragEnd","nodeDrop"],validate:["string","number","array"],condition:function(e){return{type:"cascader",options:e.props.data||[],props:{props:{checkStrictly:!0,emitPath:!1,value:"id"}}}},sfc(e){e.type="elTree",e._sfc.modelField="defaultCheckedKeys"},rule({t:e}){return{type:Sd,field:We(),title:e("com.tree.name"),info:"",effect:{fetch:""},$required:!1,props:{props:{label:"label"},showCheckbox:!0,nodeKey:"id",data:Qn(e("props.option"),{label:"label",value:"id"},3)}}},props(e,{t}){return Be(t,Sd+".props",[Br(t,"props.data","label","id"),{type:"input",field:"emptyText"},{type:"TableOptions",field:"props",props:{column:[{label:t("props.key"),key:"label"},{label:t("props.value"),key:"value"}],valueType:"object"}},{type:"switch",field:"renderAfterExpand",value:!0},{type:"switch",field:"defaultExpandAll"},{type:"switch",field:"expandOnClickNode",value:!0},{type:"switch",field:"checkOnClickNode"},{type:"switch",field:"autoExpandParent",value:!0},{type:"switch",field:"checkStrictly"},{type:"switch",field:"accordion"},{type:"inputNumber",field:"indent"},{type:"input",field:"nodeKey"}])}},N1="\u63D0\u793A",xd="elAlert",T1={menu:"aide",icon:"icon-alert",label:N1,name:xd,event:["close"],rule({t:e}){return{type:xd,props:{title:e("com.elAlert.name"),description:e("com.elAlert.description"),type:"success",effect:"dark"},children:[]}},props(e,{t}){return Be(t,xd+".props",[{type:"input",field:"title"},{type:"select",field:"type",options:[{label:"success",value:"success"},{label:"warning",value:"warning"},{label:"info",value:"info"},{label:"error",value:"error"}]},{type:"input",field:"description"},{type:"switch",field:"closable",value:!0},{type:"switch",field:"center",value:!0},{type:"input",field:"closeText"},{type:"switch",field:"showIcon"},{type:"select",field:"effect",options:[{label:"light",value:"light"},{label:"dark",value:"dark"}]}])}},D1="\u6587\u5B57",Bp="text",V1={menu:"aide",icon:"icon-span",label:D1,name:Bp,inline:!0,rule({t:e}){return{type:"div",title:"",style:{whiteSpace:"pre-line"},children:[e("com.text.name")]}},props(e,{t}){return Be(t,Bp+".props",[{type:"input",field:"formCreateChild",props:{type:"textarea"}}])}},O1={menu:"layout",icon:"icon-space",label:"\u95F4\u8DDD",name:"space",rule(){return{type:"div",wrap:{show:!1},native:!0,style:{width:"100%",height:"20px"},children:[]}},props(){return[]}},B1="\u6807\u7B7E\u9875",kd="elTabs",R1={menu:"layout",icon:"icon-tab",label:B1,name:kd,mask:!1,event:["tabClick","tabChange","tabRemove","tabAdd","edit"],children:"elTabPane",subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("props.title"),vnode:t(r("el-input"),{size:"small",modelValue:o.props.label,"onUpdate:modelValue":i=>{o.props.label=i}})}]},rule(){return{type:kd,style:{width:"100%"},props:{modelValue:"0"},sync:["modelValue"],children:[]}},props(e,{t}){return Be(t,kd+".props",[{type:"select",field:"type",options:[{label:"card",value:"card"},{label:"border-card",value:"border-card"}]},{type:"switch",field:"closable"},{type:"select",field:"tabPosition",options:it(t,[{label:"top",value:"top"},{label:"right",value:"right"},{label:"left",value:"left"}])},{type:"switch",field:"stretch"}])}},$1="\u6309\u94AE",Nd="elButton",I1={menu:"aide",icon:"icon-button",label:$1,name:Nd,mask:!0,inline:!0,easySlots:[{value:"icon",type:"icon"}],event:["click"],rule({t:e}){return{type:Nd,props:{},children:[e("com.elButton.name")]}},props(e,{t}){return Be(t,Nd+".props",[{type:"input",field:"formCreateChild"},{type:"select",field:"size",options:it(t,[{label:"large",value:"large"},{label:"default",value:"default"},{label:"small",value:"small"}])},{type:"select",field:"type",options:it(t,[{label:"primary",value:"primary"},{label:"success",value:"success"},{label:"warning",value:"warning"},{label:"danger",value:"danger"},{label:"info",value:"info"}])},{type:"switch",field:"plain"},{type:"switch",field:"round"},{type:"switch",field:"circle"},{type:"switch",field:"loading"},{type:"switch",field:"disabled"}])}},F1="\u5BCC\u6587\u672C\u6846",Td="fcEditor",P1={menu:"main",icon:"icon-editor",label:F1,name:Td,input:!0,event:["change"],validate:["string"],rule({t:e}){return{type:Td,field:We(),title:e("com.fcEditor.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,Td+".props",[{type:"switch",field:"disabled"}])}},M1="\u5B50\u8868\u5355",Rp="group",L1={menu:"subform",icon:"icon-subform",label:M1,name:Rp,input:!0,inside:!1,drag:!0,dragBtn:!0,mask:!1,event:["change"],subForm:"array",loadRule(e){e.children=e.props.rule||[],e.type="FcRow",delete e.props.rule},parseRule(e){e.props.rule=e.children,e.type="group",delete e.children,delete e.props.mode},sfc:!1,rule({t:e}){return{type:"fcRow",field:We(),title:e("com.group.name"),info:"",$required:!1,props:{},children:[]}},props(e,{t}){return Be(t,Rp+".props",[{type:"switch",field:"disabled"},{type:"switch",field:"button",value:!0},{type:"switch",field:"sortBtn",value:!0},{type:"inputNumber",field:"expand"},{type:"inputNumber",field:"min"},{type:"inputNumber",field:"max"}])}},j1="\u5206\u7EC4",$p="subForm",z1={menu:"subform",icon:"icon-group",label:j1,name:$p,input:!0,inside:!1,drag:!0,dragBtn:!0,mask:!1,subForm:"object",event:["change"],loadRule(e){e.children=e.props.rule||[],e.type="FcRow",delete e.props.rule},parseRule(e){e.props.rule=e.children,e.type="subForm",delete e.children},sfc(e,{getParentFieldStr:t}){return{type:"elFormItem",props:{prop:t()+e.field,label:e.title,required:e.$required===!0?!0:void 0},col:{show:!0},_sfc:{parentField:e.field},_fc_id:e._fc_id,children:[{type:"elRow",class:e.class,style:e.style,children:e.children}]}},rule({t:e}){return{type:"fcRow",field:We(),title:e("com.subForm.name"),info:"",$required:!1,props:{},children:[]}},props(e,{t}){return Be(t,$p+".props",[{type:"switch",field:"disabled"}])}},U1="\u5361\u7247",Dd="elCard",H1={menu:"layout",icon:"icon-card",label:U1,name:Dd,drag:!0,inside:!1,mask:!1,rule({t:e}){return{type:Dd,props:{header:e("com.elCard.props.header")},style:{width:"100%"},children:[]}},props(e,{t}){return Be(t,Dd+".props",[{type:"input",field:"header"},{type:"select",field:"shadow",value:"always",options:it(t,[{label:"always",value:"always"},{label:"never",value:"never"},{label:"hover",value:"hover"}])}])}},W1="\u6298\u53E0\u9762\u677F",Vd="elCollapse",G1={menu:"layout",icon:"icon-collapse",label:W1,name:Vd,mask:!1,children:"elCollapseItem",subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("props.title"),vnode:t(r("el-input"),{size:"small",modelValue:o.props.title,"onUpdate:modelValue":i=>{o.props.title=i}})}]},event:["change"],rule(){return{type:Vd,props:{modelValue:[]},sync:["modelValue"],style:{width:"100%"},children:[]}},props(e,{t}){return Be(t,Vd+".props",[{type:"switch",field:"accordion"}])}},K1="\u9762\u677F",Od="elCollapseItem",Y1={icon:"icon-cell",label:K1,name:Od,drag:!0,dragBtn:!1,inside:!0,mask:!1,easySlots:[{value:"icon",type:"icon"}],rule({t:e}){return{type:Od,props:{title:e("com.elCollapseItem.name"),name:We()},style:{},children:[]}},props(e,{t}){return Be(t,Od+".props",[{type:"input",field:"title"},{type:"input",field:"name"},{type:"switch",field:"disabled"}])}},Q1="\u6811\u5F62\u9009\u62E9",Bd="elTreeSelect",J1={menu:"main",icon:"icon-tree-select",label:Q1,name:Bd,input:!0,event:["change","visibleChange","removeTag","clear","blur","focus"],validate:["string","number","array"],condition:function(e){return{type:"cascader",options:e.props.data||[],props:{props:{checkStrictly:!0,emitPath:!1}}}},rule({t:e}){return{type:Bd,field:We(),title:e("com.elTreeSelect.name"),info:"",effect:{fetch:""},$required:!1,props:{nodeKey:"value",showCheckbox:!0,data:Qn(e("props.option"),{label:"label",value:"value"},3)}}},watch:{multiple({rule:e}){e.key=We()}},props(e,{t}){return Be(t,Bd+".props",[Br(t,"props.data","label","value"),{type:"switch",field:"multiple"},{type:"switch",field:"disabled"},{type:"switch",field:"clearable"},{type:"switch",field:"collapseTags"},{type:"inputNumber",field:"multipleLimit",props:{min:0}},{type:"input",field:"placeholder"},{type:"TableOptions",field:"props",props:{column:[{label:t("props.key"),key:"label"},{label:t("props.value"),key:"value"}],valueType:"object"}},{type:"switch",field:"renderAfterExpand",value:!0},{type:"switch",field:"defaultExpandAll"},{type:"switch",field:"expandOnClickNode",value:!0},{type:"switch",field:"checkOnClickNode"},{type:"switch",field:"checkStrictly"},{type:"input",field:"nodeKey"}])}},X1="\u6807\u7B7E",Rd="elTag",Z1={menu:"aide",icon:"icon-tag",label:X1,name:Rd,mask:!0,inline:!0,event:["click","close"],rule({t:e}){return{type:Rd,title:"",children:[e("com.elTag.name")]}},props(e,{t}){return Be(t,Rd+".props",[{type:"input",field:"formCreateChild"},{type:"select",field:"type",options:it(t,[{label:"primary",value:"primary"},{label:"success",value:"success"},{label:"warning",value:"warning"},{label:"danger",value:"danger"},{label:"info",value:"info"}])},{type:"select",field:"size",options:it(t,[{label:"large",value:"large"},{label:"default",value:"default"},{label:"small",value:"small"}])},{type:"select",field:"effect",options:[{label:"dark",value:"dark"},{label:"light",value:"light"},{label:"plain",value:"plain"}]},{type:"switch",field:"closable"},{type:"switch",field:"disableTransitions"},{type:"switch",field:"hit"},{type:"switch",field:"round"},{type:"ColorInput",field:"color"}])}},q1="\u63CF\u8FF0\u683C\u5B50",$d="elDescriptionsItem",ew={icon:"icon-cell",label:q1,name:$d,dragBtn:!1,inside:!0,mask:!1,rule({t:e}){return{type:$d,props:{label:e("props.title")},children:[e("props.content")]}},watch:{__child({value:e,rule:t}){t.children[0].children[0]=e}},attrs:{child({rule:e}){return e.children[0].children[0]||""}},props(e,{t}){return Be(t,$d+".props",[{type:"input",field:"label"},{type:"input",field:"__child",_fc_important_prop:"formCreateChild"},{type:"inputNumber",field:"span"},{type:"input",field:"width"},{type:"input",field:"minWidth"},{type:"select",field:"align",options:it(t,[{label:"left",value:"left"},{label:"center",value:"center"},{label:"right",value:"right"}])},{type:"select",field:"labelAlign",options:it(t,[{label:"left",value:"left"},{label:"center",value:"center"},{label:"right",value:"right"}])},{type:"input",field:"className"}])}},tw="\u63CF\u8FF0\u5217\u8868",Id="elDescriptions",nw={menu:"layout",icon:"icon-descriptions",label:tw,name:Id,mask:!1,rule(){return{type:Id,props:{border:!0},style:{width:"100%"},children:[]}},children:"elDescriptionsItem",childrenLen:2,subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("props.title"),vnode:t(r("el-input"),{size:"small",modelValue:o.props.label,"onUpdate:modelValue":i=>{o.props.label=i}})}]},props(e,{t}){return Be(t,Id+".props",[{type:"input",field:"title",value:""},{type:"input",field:"extra",value:""},{type:"inputNumber",field:"column",value:3,props:{min:0}},{type:"switch",field:"border"},{type:"select",field:"direction",options:it(t,[{label:"vertical",value:"vertical"},{label:"horizontal",value:"horizontal"}])},{type:"select",field:"size",options:it(t,[{label:"large",value:"large"},{label:"default",value:"default"},{label:"small",value:"small"}])}])}},iw="\u5206\u6B65\u8868\u5355",Fd="stepForm",rw={menu:"subform",icon:"icon-step-form",label:iw,name:Fd,input:!0,mask:!1,languageKey:["prevStep","nextStep","submit"],event:["change","submit","next"],subForm:"object",children:"stepFormItem",childrenLen:2,subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("props.title"),vnode:t(r("el-input"),{size:"small",modelValue:o.props.title,"onUpdate:modelValue":i=>{o.props.title=i}})}]},loadRule(e){e.props||(e.props={});const t=e.props.steps||{};e.children=t.map(r=>({type:"stepFormItem",_fc_drag_tag:"stepFormItem",props:{title:r.props.title,description:r.props.description},children:r.rule})),delete e.props.steps},parseRule(e){const t=e.children||[];e.props.steps=t.map(r=>({props:r.props,rule:r.children})),e.children=[]},sfc:!1,rule(){return{type:Fd,field:We(),title:"",info:"",$required:!1,props:{},children:[]}},props(e,{t}){return Be(t,Fd+".props",[{type:"switch",field:"submitBtn",value:!0},{type:"switch",field:"autoValidate"},{type:"switch",field:"stepsProps>alignCenter"},{type:"switch",field:"stepsProps>simple"}])}},ow="\u6B65\u9AA4\u6761",Pd="stepFormItem",aw={icon:"icon-cell",label:ow,name:Pd,aide:!0,drag:!0,dragBtn:!1,inside:!0,mask:!1,style:!1,advanced:!1,variable:!1,rule({t:e}){return{type:Pd,props:{title:e("com.stepFormItem.props.title"),description:""},children:[]}},props(e,{t}){return Be(t,Pd+".props",[{type:"input",field:"title",value:""},{type:"input",field:"description",value:""}])}},lw="HTML",Md="html",sw={menu:"aide",icon:"icon-html",label:lw,name:Md,sfc(e){e.type="div"},rule(){return{type:Md,title:"",style:{display:"block",width:"100%"},children:['
HTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTMLHTML ']}},props(e,{t}){return Be(t,Md+".props",[{type:"HtmlEditor",field:"formCreateChild"}])}},uw="\u8868\u683C\u5E03\u5C40",Ld="fcTable",fw={menu:"layout",icon:"icon-table",label:uw,name:Ld,inside:!1,mask:!1,sfc:{style:`._fc-table {
overflow: auto;
}
._fc-table > table {
@@ -146,13 +146,13 @@ overflow: hidden;
border: 0 none;
border-right: 1px solid #EBEEF5;
border-bottom: 1px solid #EBEEF5;
-}`,handle(e){const t=(e.children||[]).reduce((m,y)=>(m[y.slot]||(m[y.slot]=[]),m[y.slot].push(y),delete y.slot,m),{}),{row:r,col:o,style:i,class:l,layout:d}=e.props.rule,c={},u=[];d.forEach(m=>{const y=m.row||1,C=m.col||1,S=`${m.top}:${m.left}`;c[S]={row:y,col:C};for(let w=0;w-1)continue;const w=t[S];y.push({type:"td",props:{rowspan:""+(c[S]?c[S].row:1),colspan:""+(c[S]?c[S].col:1)},style:i[S],class:l[S],children:w})}h.push({type:"tr",children:y})}return{type:"elCol",props:{span:24},style:e.style,class:e.class,children:[{type:"div",class:"_fc-table",children:[{type:"table",props:{border:"1",cellspacing:"0",cellpadding:"0"},children:h}]}]}}},rule(){return{type:Ld,props:{rule:{row:3,col:4,style:{},class:{},layout:[]}},children:[]}},props(e,{t}){return Be(t,Ld+".props",[{type:"switch",field:"border",value:!0},{type:"switch",field:"mini"},{type:"ColorInput",field:"borderColor"},{type:"input",field:"borderWidth"}])}},uw="\u8868\u683C\u8868\u5355",jd="tableForm",fw={menu:"subform",icon:"icon-table-form",label:uw,name:jd,input:!0,mask:!1,subForm:"array",languageKey:["add","operation","dataEmpty"],event:["change","add","delete"],children:"tableFormColumn",subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("props.title"),vnode:t(r("el-input"),{size:"small",modelValue:o.props.label,"onUpdate:modelValue":i=>{o.props.label=i}})}]},loadRule(e){e.props||(e.props={});const t=e.props.columns||[];e.children=t.map(r=>({type:"tableFormColumn",_fc_drag_tag:"tableFormColumn",props:{label:r.label,required:r.required||!1,width:r.style.width||"",color:r.style.color||""},children:r.rule||[]})),delete e.props.columns},parseRule(e){const t=e.children||[];e.props.columns=t.map(r=>({label:r.props.label,required:r.props.required,style:{width:r.props.width,color:r.props.color},rule:r.children||[]})),e.children=[]},sfc:!1,rule({t:e}){return{type:jd,field:We(),title:e("com.tableForm.name"),info:"",props:{},children:[]}},props(e,{t}){return Be(t,jd+".props",[{type:"switch",field:"disabled"},{type:"switch",field:"addable",value:!0},{type:"switch",field:"deletable",value:!0},{type:"switch",field:"filterEmptyColumn",value:!0},{type:"inputNumber",field:"min",props:{min:0}},{type:"inputNumber",field:"max",props:{min:0}}])}},pw="\u8868\u683C\u8868\u5355Pro",hw="tableFormPro",Ip=e=>e.map(t=>{let r=t.children||[];const o=r.filter(i=>i._fc_drag_tag==="tableFormColumn2");return o.length>0&&(r=Ip(o)),{header:t.props.header,label:t.props.label,fixed:t.props.fixed,required:t.props.required,hidden:t.props.hidden,style:{width:t.props.width,color:t.props.color},[o.length?"children":"rule"]:r}}),Fp=e=>e.map(t=>({type:"tableFormColumn",_fc_drag_tag:"tableFormColumn2",props:{header:t.header,label:t.label,fixed:t.fixed,required:t.required||!1,hidden:t.hidden||!1,width:t.style.width||"",color:t.style.color||""},children:t.children?Fp(t.children):t.rule||[]})),mw={menu:"subform",icon:"icon-table-form",label:pw,name:hw,input:!0,mask:!1,subForm:"array",languageKey:["add","delete","operation","dataEmpty"],event:["change","add","delete","handleClick"],children:"tableFormColumn2",subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("props.title"),vnode:t(r("el-input"),{size:"small",modelValue:o.props.label,"onUpdate:modelValue":i=>{o.props.label=i}})}]},loadRule(e){e.props||(e.props={}),e.children=Fp(e.props.columns||[]),delete e.props.columns},parseRule(e){e.props.columns=Ip(e.children||[]),e.children=[]},sfc:!1,rule({t:e}){return{type:"tableFormPro",field:We(),title:e("com.tableFormPro.name"),info:"",props:{button:{open:!0,column:[{key:"delete",name:"\u5220\u9664",type:"danger",size:"small",prop:["link"]}]}},children:[]}},props(e,{t}){const r=function(o){return Be(t,"tableForm.props",o)};return Be(t,"tableForm.props",[{type:"ConfigItem",props:{label:t("com.dataTable.props.button")},col:{show:!0},children:[{type:"HideConfig",title:t("com.dataTable.props.button"),wrap:{show:!1},col:{show:!1},field:"button>open"},{type:"template",slot:"append",children:r([{type:"TableButtonConfig",col:{show:!1},field:"button>column"},{type:"input",col:{show:!1},field:"button>label",value:"\u64CD\u4F5C"},{type:"select",col:{show:!1},field:"button>fixed",options:[{label:t("com.dataTable.fixed.default"),value:!1},{label:t("com.dataTable.fixed.left"),value:"left"},{label:t("com.dataTable.fixed.right"),value:"right"}],value:"right"},{type:"SizeInput",col:{show:!1},field:"button>width",value:"100px"}])}]},{type:"ConfigItem",props:{label:t("com.dataTable.props.page")},col:{show:!0},children:[{type:"HideConfig",wrap:{show:!1},col:{show:!1},title:t("com.dataTable.props.page"),field:"page>open"},{type:"template",slot:"append",children:r([{type:"inputNumber",col:{show:!1},field:"page>props>pageSize",value:20},{type:"switch",col:{show:!1},field:"page>props>small"},{type:"switch",col:{show:!1},field:"page>props>background"}])}]},{type:"switch",field:"disabled"},{type:"select",field:"size",options:it(t,[{label:"large",value:"large"},{label:"default",value:"default"},{label:"small",value:"small"}])},{type:"input",field:"emptyText"},{type:"switch",field:"stripe"},{type:"switch",field:"border"},{type:"switch",field:"showIndex"},{type:"switch",field:"addable",value:!0},{type:"switch",field:"deletable",value:!0},{type:"switch",field:"newColumn"},{type:"switch",field:"filterEmptyColumn",value:!0},{type:"SizeInput",field:"height"},{type:"inputNumber",field:"min",props:{min:0}},{type:"inputNumber",field:"max",props:{min:0}}])}},gw="\u65E0\u9650\u7EA7\u8868\u5355",Ya="infiniteTableForm",vw={menu:"subform",icon:"icon-table-form3",label:gw,name:Ya,input:!0,mask:!1,subForm:"array",languageKey:["add","operation"],event:["change","add","delete"],children:"tableFormColumn",subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("props.title"),vnode:t(r("el-input"),{size:"small",modelValue:o.props.label,"onUpdate:modelValue":i=>{o.props.label=i}})}]},loadRule(e){e.props||(e.props={});const t=e.props.columns||[];e.children=t.map(r=>({type:"tableFormColumn",_fc_drag_tag:"tableFormColumn",props:{label:r.label,required:r.required||!1,width:r.style.width||"",color:r.style.color||""},children:r.rule||[]})),delete e.props.columns},parseRule(e){const t=e.children||[];e.props.columns=t.map(r=>({label:r.props.label,required:r.props.required,style:{width:r.props.width,color:r.props.color},rule:r.children||[]})),e.children=[]},sfc:!1,rule({t:e}){return{type:Ya,field:We(),title:e("com."+Ya+".name"),info:"",props:{},children:[]}},props(e,{t}){return Be(t,Ya+".props",[{type:"switch",field:"disabled"},{type:"input",field:"childrenField",value:"children"},{type:"inputNumber",field:"max",props:{min:0}},{type:"inputNumber",field:"layerMax",props:{min:0}}])}},yw="\u5D4C\u5957\u8868\u5355",Qa="nestedTableForm",bw=e=>e.map(t=>({type:"tableFormColumn",_fc_drag_tag:"tableFormColumn",props:{label:t.label,required:t.required||!1,width:t.style.width||"",color:t.style.color||""},children:t.rule||[]})),ww={menu:"subform",icon:"icon-table-form2",label:yw,name:Qa,input:!0,mask:!1,subForm:"array",languageKey:["add","operation"],event:["change","add","delete"],slot:["default",{name:"nested",type:"nestedSubTableForm"}],children:"tableFormColumn",subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("props.title"),vnode:t(r("el-input"),{size:"small",modelValue:o.props.label,"onUpdate:modelValue":i=>{o.props.label=i}})}]},loadRule(e){e.props||(e.props={});const t=e.props.columns||[],r=e.props.nested||[];e.children=bw(t),e.children.push({type:"TableForm",_fc_drag_tag:"nestedSubTableForm",field:e.props.nestedField,props:{columns:r},slot:"nested"}),delete e.props.nestedField,delete e.props.columns,delete e.props.nested},parseRule(e){const t=e.children||[];e.props.columns=[],t.forEach(r=>{if(r.slot==="nested"){e.props.nested=r.props.columns,e.props.nestedField=r.field;return}e.props.columns.push({label:r.props.label,required:r.props.required,style:{width:r.props.width,color:r.props.color},rule:r.children||[]})}),e.children=[]},sfc:!1,rule({t:e}){return{type:Qa,field:We(),title:e("com."+Qa+".name"),info:"",props:{},children:[]}},props(e,{t}){return Be(t,Qa+".props",[{type:"switch",field:"disabled"},{type:"inputNumber",field:"max",props:{min:0}},{type:"inputNumber",field:"nestedMax",props:{min:0}}])}},Cw={icon:"icon-table-form",label:"\u5B50\u8868\u683C\u8868\u5355",name:"nestedSubTableForm",aide:!0,mask:!1,validate:!1,style:!1,advanced:!1,variable:!1,subForm:"array",hiddenBaseField:["title","info","labelConfig","formCreate_computed>hidden","formCreate_computed>value","_control"],children:"tableFormColumn",subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("props.title"),vnode:t(r("el-input"),{size:"small",modelValue:o.props.label,"onUpdate:modelValue":i=>{o.props.label=i}})}]},loadRule(e){e.props||(e.props={});const t=e.props.columns||[];e.children=t.map(r=>({type:"tableFormColumn",_fc_drag_tag:"tableFormColumn",props:{label:r.label,required:r.required||!1,width:r.style.width||"",color:r.style.color||""},children:r.rule||[]})),delete e.props.columns},parseRule(e){const t=e.children||[];e.props.columns=t.map(r=>({label:r.props.label,required:r.props.required,style:{width:r.props.width,color:r.props.color},rule:r.children||[]})),e.children=[]},rule(){return{type:"TableForm",field:We(),title:"",info:"",props:{},children:[]}},props(){return[]}},zd="tableFormColumn",_w={icon:"icon-cell",name:zd,aide:!0,drag:!0,dragBtn:!1,mask:!1,style:!1,advanced:!1,variable:!1,rule({t:e}){return{type:zd,props:{label:e("com.tableFormColumn.label"),width:"auto"},children:[]}},props(e,{t}){return Be(t,zd+".props",[{type:"input",field:"label"},{type:"switch",field:"required"},{type:"input",field:"width"},{type:"ColorInput",field:"color"}])}},Pp="tableFormColumn2",Ew={icon:"icon-cell",name:Pp,aide:!0,drag:!0,dragBtn:!1,mask:!1,style:!1,advanced:!1,variable:!1,children:"tableFormColumn2",childrenLen:0,checkDrag({toRule:e}){return!(e.children[0].children.length>0&&e.children[0].children.some(t=>t._config.name==="tableFormColumn2"))},rule({t:e}){return{type:Pp,props:{label:e("com.tableFormColumn.label"),width:"auto"},children:[]}},props(e,{t}){return Be(t,"tableFormColumn.props",[{type:"input",field:"label"},{type:"select",field:"fixed",options:[!1,"left","right"].map(r=>({label:t("com.dataTable.fixed."+(r||"default")),value:r}))},{type:"switch",field:"required"},{type:"switch",field:"hidden"},{type:"input",field:"width"},{type:"ColorInput",field:"color"}])}},Aw={icon:"icon-flex",label:"\u76D2\u5B50\u5E03\u5C40",name:"fcFlex",mask:!1,children:"fcCell",childrenLen:2,subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("style.width"),vnode:t(r("SizeInput"),{size:"small",modelValue:o.style&&o.style.width||"","onUpdate:modelValue":i=>{o.style||(o.style={}),o.style.width=i}})},{label:e("style.height"),vnode:t(r("SizeInput"),{size:"small",modelValue:o.style&&o.style.height||"auto","onUpdate:modelValue":i=>{o.style||(o.style={}),o.style.height=i}})}]},sfc(e){e.type="elRow"},rule(){return{type:"fcRow",props:{},children:[]}},props(){return[]}},Mp="fcCell",Sw={name:Mp,label:"\u683C\u5B50",drag:!0,dragBtn:!1,inside:!0,inline:!0,mask:!1,sfc(e){e.type="div"},rule(){return{type:Mp,style:{display:"block",width:"50%",height:"100px"},children:[]}},props(e,{t}){return[{type:"SizeInput",field:"formCreateStyle>width",title:t("style.width")}]}},xw="\u8BA1\u7B97\u516C\u5F0F",Lp="fcValue",kw={menu:"main",icon:"icon-value",label:xw,name:Lp,input:!0,event:["change"],validate:!1,sfc(e,{getParentFieldStr:t}){e.type="div",e._sfc.content=`{{formData.${t()}${e.field}}}`,e._sfc.vModel=!1},rule({t:e}){return{type:Lp,field:We(),title:e("com.fcValue.name"),info:"",props:{}}},props(){return[]}},Nw="\u94FE\u63A5",Ud="elLink",Tw={menu:"aide",icon:"icon-link",label:Nw,name:Ud,inline:!0,easySlots:[{value:"icon",type:"icon"}],rule({t:e}){return{type:Ud,title:"",children:[e("com.elLink.name")]}},props(e,{t}){return Be(t,Ud+".props",[{type:"input",field:"href"},{type:"input",field:"formCreateChild"},{type:"select",field:"target",options:it(t,[{label:"_self",value:"_self"},{label:"_blank",value:"_blank"},{label:"_parent",value:"_parent"},{label:"_top",value:"_top"}])},{type:"switch",field:"underline",value:!0},{type:"switch",field:"disabled"},{type:"select",field:"type",options:it(t,[{label:"primary",value:"primary"},{label:"success",value:"success"},{label:"warning",value:"warning"},{label:"danger",value:"danger"},{label:"info",value:"info"},{label:"default",value:"default"}])}])}},Dw="\u6587\u5B57\u63D0\u793A",Ja="elTooltip",Vw={menu:"aide",icon:"icon-tooltip",label:Dw,name:Ja,drag:!0,dragBtn:!0,inside:!1,mask:!1,rule({t:e}){return{type:Ja,props:{content:e("com."+Ja+".name")},children:[]}},props(e,{t}){return Be(t,Ja+".props",[{type:"input",field:"content",props:{type:"textarea"}},{type:"switch",field:"disabled"},{type:"switch",field:"rawContent"},{type:"switch",field:"enterable",value:!0},{type:"select",field:"effect",value:"dark",options:[{label:"dark",value:"dark"},{label:"light",value:"light"}]},{type:"select",field:"placement",value:"bottom",options:[{label:"top",value:"top"},{label:"top-start",value:"top-start"},{label:"top-end",value:"top-end"},{label:"bottom",value:"bottom"},{label:"bottom-start",value:"bottom-start"},{label:"bottom-end",value:"bottom-end"},{label:"left",value:"left"},{label:"left-start",value:"left-start"},{label:"left-end",value:"left-end"},{label:"right",value:"right"},{label:"right-start",value:"right-start"},{label:"right-end",value:"right-end"}]},{type:"select",field:"trigger",value:"hover",options:[{label:"hover",value:"hover"},{label:"click",value:"click"},{label:"focus",value:"focus"},{label:"contextmenu",value:"contextmenu"}]},{type:"inputNumber",field:"offset"},{type:"inputNumber",field:"showAfter",props:{min:0}},{type:"inputNumber",field:"hideAfter",props:{min:0}},{type:"inputNumber",field:"autoClose",props:{min:0}}])}},Ow="\u6C34\u5370",Xa="elWatermark",Bw={menu:"aide",icon:"icon-watermark",label:Ow,name:Xa,drag:!0,dragBtn:!0,inside:!1,mask:!1,rule({t:e}){return{type:Xa,style:{width:"100%"},props:{content:e("com."+Xa+".name")},children:[]}},props(e,{t}){return Be(t,Xa+".props",[{type:"input",field:"content"},{type:"input",field:"image"},{type:"inputNumber",field:"width",props:{min:0},value:120},{type:"inputNumber",field:"height",props:{min:0},value:64},{type:"inputNumber",field:"rotate",value:-22},{type:"inputNumber",field:"zIndex",props:{min:0}},{type:"TableOptions",field:"gap",props:{column:[{label:t("props.value"),key:"value"}],valueType:"string",max:2},value:[100,100]}])}},Rw={menu:"template",name:"chineseAmount",label:"\u91D1\u989D",autoField:!0,template:[{type:"inputNumber",field:"Fgtxlugfgbdvb5c",title:"\u91D1\u989D",info:"",$required:!1,display:!0,hidden:!1,_fc_drag_tag:"inputNumber"},{type:"fcValue",field:"Fvr1lugfgd3yb7c",title:" ",info:"",display:!0,hidden:!1,_fc_drag_tag:"fcValue",style:{color:"#999999"},computed:{value:'"\u5927\u5199: " + TOCHINSESAMOUNT(Fgtxlugfgbdvb5c || 0)'}}]},$w={menu:"template",name:"duration",label:"\u65F6\u957F",autoField:!0,template:[{type:"fcInlineForm",_fc_id:"id_Founm50iu5kocac",name:"ref_Fqrpm50iu5kocbc",display:!0,hidden:!1,_fc_drag_tag:"fcInlineForm",children:[{type:"datePicker",field:"Fz0um50itwf6bbc",title:"\u5F00\u59CB\u65F6\u95F4",$required:!1,_fc_drag_tag:"datePicker",validate:[{type:"validator",trigger:"change",validator:`[[FORM-CREATE-PREFIX-function validator(rule, value, callback){this.api.validateField('Fv92m50itwf6bdc');
+}`,handle(e){const t=(e.children||[]).reduce((m,y)=>(m[y.slot]||(m[y.slot]=[]),m[y.slot].push(y),delete y.slot,m),{}),{row:r,col:o,style:i,class:l,layout:d}=e.props.rule,c={},u=[];d.forEach(m=>{const y=m.row||1,C=m.col||1,A=`${m.top}:${m.left}`;c[A]={row:y,col:C};for(let w=0;w-1)continue;const w=t[A];y.push({type:"td",props:{rowspan:""+(c[A]?c[A].row:1),colspan:""+(c[A]?c[A].col:1)},style:i[A],class:l[A],children:w})}h.push({type:"tr",children:y})}return{type:"elCol",props:{span:24},style:e.style,class:e.class,children:[{type:"div",class:"_fc-table",children:[{type:"table",props:{border:"1",cellspacing:"0",cellpadding:"0"},children:h}]}]}}},rule(){return{type:Ld,props:{rule:{row:3,col:4,style:{},class:{},layout:[]}},children:[]}},props(e,{t}){return Be(t,Ld+".props",[{type:"switch",field:"border",value:!0},{type:"switch",field:"mini"},{type:"ColorInput",field:"borderColor"},{type:"input",field:"borderWidth"}])}},pw="\u8868\u683C\u8868\u5355",jd="tableForm",hw={menu:"subform",icon:"icon-table-form",label:pw,name:jd,input:!0,mask:!1,subForm:"array",languageKey:["add","operation","dataEmpty"],event:["change","add","delete"],children:"tableFormColumn",subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("props.title"),vnode:t(r("el-input"),{size:"small",modelValue:o.props.label,"onUpdate:modelValue":i=>{o.props.label=i}})}]},loadRule(e){e.props||(e.props={});const t=e.props.columns||[];e.children=t.map(r=>({type:"tableFormColumn",_fc_drag_tag:"tableFormColumn",props:{label:r.label,required:r.required||!1,width:r.style.width||"",color:r.style.color||""},children:r.rule||[]})),delete e.props.columns},parseRule(e){const t=e.children||[];e.props.columns=t.map(r=>({label:r.props.label,required:r.props.required,style:{width:r.props.width,color:r.props.color},rule:r.children||[]})),e.children=[]},sfc:!1,rule({t:e}){return{type:jd,field:We(),title:e("com.tableForm.name"),info:"",props:{},children:[]}},props(e,{t}){return Be(t,jd+".props",[{type:"switch",field:"disabled"},{type:"switch",field:"addable",value:!0},{type:"switch",field:"deletable",value:!0},{type:"switch",field:"filterEmptyColumn",value:!0},{type:"inputNumber",field:"min",props:{min:0}},{type:"inputNumber",field:"max",props:{min:0}}])}},mw="\u8868\u683C\u8868\u5355Pro",gw="tableFormPro",Fp=e=>e.map(t=>{let r=t.children||[];const o=r.filter(i=>i._fc_drag_tag==="tableFormColumn2");return o.length>0&&(r=Fp(o)),{header:t.props.header,label:t.props.label,fixed:t.props.fixed,required:t.props.required,hidden:t.props.hidden,style:{width:t.props.width,color:t.props.color},[o.length?"children":"rule"]:r}}),Pp=e=>e.map(t=>({type:"tableFormColumn",_fc_drag_tag:"tableFormColumn2",props:{header:t.header,label:t.label,fixed:t.fixed,required:t.required||!1,hidden:t.hidden||!1,width:t.style.width||"",color:t.style.color||""},children:t.children?Pp(t.children):t.rule||[]})),vw={menu:"subform",icon:"icon-table-form",label:mw,name:gw,input:!0,mask:!1,subForm:"array",languageKey:["add","delete","operation","dataEmpty"],event:["change","add","delete","handleClick"],children:"tableFormColumn2",subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("props.title"),vnode:t(r("el-input"),{size:"small",modelValue:o.props.label,"onUpdate:modelValue":i=>{o.props.label=i}})}]},loadRule(e){e.props||(e.props={}),e.children=Pp(e.props.columns||[]),delete e.props.columns},parseRule(e){e.props.columns=Fp(e.children||[]),e.children=[]},sfc:!1,rule({t:e}){return{type:"tableFormPro",field:We(),title:e("com.tableFormPro.name"),info:"",props:{button:{open:!0,column:[{key:"delete",name:"\u5220\u9664",type:"danger",size:"small",prop:["link"]}]}},children:[]}},props(e,{t}){const r=function(o){return Be(t,"tableForm.props",o)};return Be(t,"tableForm.props",[{type:"ConfigItem",props:{label:t("com.dataTable.props.button")},col:{show:!0},children:[{type:"HideConfig",title:t("com.dataTable.props.button"),wrap:{show:!1},col:{show:!1},field:"button>open"},{type:"template",slot:"append",children:r([{type:"TableButtonConfig",col:{show:!1},field:"button>column"},{type:"input",col:{show:!1},field:"button>label",value:"\u64CD\u4F5C"},{type:"select",col:{show:!1},field:"button>fixed",options:[{label:t("com.dataTable.fixed.default"),value:!1},{label:t("com.dataTable.fixed.left"),value:"left"},{label:t("com.dataTable.fixed.right"),value:"right"}],value:"right"},{type:"SizeInput",col:{show:!1},field:"button>width",value:"100px"}])}]},{type:"ConfigItem",props:{label:t("com.dataTable.props.page")},col:{show:!0},children:[{type:"HideConfig",wrap:{show:!1},col:{show:!1},title:t("com.dataTable.props.page"),field:"page>open"},{type:"template",slot:"append",children:r([{type:"inputNumber",col:{show:!1},field:"page>props>pageSize",value:20},{type:"switch",col:{show:!1},field:"page>props>small"},{type:"switch",col:{show:!1},field:"page>props>background"}])}]},{type:"switch",field:"disabled"},{type:"select",field:"size",options:it(t,[{label:"large",value:"large"},{label:"default",value:"default"},{label:"small",value:"small"}])},{type:"input",field:"emptyText"},{type:"switch",field:"stripe"},{type:"switch",field:"border"},{type:"switch",field:"showIndex"},{type:"switch",field:"addable",value:!0},{type:"switch",field:"deletable",value:!0},{type:"switch",field:"newColumn"},{type:"switch",field:"filterEmptyColumn",value:!0},{type:"SizeInput",field:"height"},{type:"inputNumber",field:"min",props:{min:0}},{type:"inputNumber",field:"max",props:{min:0}}])}},yw="\u65E0\u9650\u7EA7\u8868\u5355",Ya="infiniteTableForm",bw={menu:"subform",icon:"icon-table-form3",label:yw,name:Ya,input:!0,mask:!1,subForm:"array",languageKey:["add","operation"],event:["change","add","delete"],children:"tableFormColumn",subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("props.title"),vnode:t(r("el-input"),{size:"small",modelValue:o.props.label,"onUpdate:modelValue":i=>{o.props.label=i}})}]},loadRule(e){e.props||(e.props={});const t=e.props.columns||[];e.children=t.map(r=>({type:"tableFormColumn",_fc_drag_tag:"tableFormColumn",props:{label:r.label,required:r.required||!1,width:r.style.width||"",color:r.style.color||""},children:r.rule||[]})),delete e.props.columns},parseRule(e){const t=e.children||[];e.props.columns=t.map(r=>({label:r.props.label,required:r.props.required,style:{width:r.props.width,color:r.props.color},rule:r.children||[]})),e.children=[]},sfc:!1,rule({t:e}){return{type:Ya,field:We(),title:e("com."+Ya+".name"),info:"",props:{},children:[]}},props(e,{t}){return Be(t,Ya+".props",[{type:"switch",field:"disabled"},{type:"input",field:"childrenField",value:"children"},{type:"inputNumber",field:"max",props:{min:0}},{type:"inputNumber",field:"layerMax",props:{min:0}}])}},ww="\u5D4C\u5957\u8868\u5355",Qa="nestedTableForm",Cw=e=>e.map(t=>({type:"tableFormColumn",_fc_drag_tag:"tableFormColumn",props:{label:t.label,required:t.required||!1,width:t.style.width||"",color:t.style.color||""},children:t.rule||[]})),_w={menu:"subform",icon:"icon-table-form2",label:ww,name:Qa,input:!0,mask:!1,subForm:"array",languageKey:["add","operation"],event:["change","add","delete"],slot:["default",{name:"nested",type:"nestedSubTableForm"}],children:"tableFormColumn",subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("props.title"),vnode:t(r("el-input"),{size:"small",modelValue:o.props.label,"onUpdate:modelValue":i=>{o.props.label=i}})}]},loadRule(e){e.props||(e.props={});const t=e.props.columns||[],r=e.props.nested||[];e.children=Cw(t),e.children.push({type:"TableForm",_fc_drag_tag:"nestedSubTableForm",field:e.props.nestedField,props:{columns:r},slot:"nested"}),delete e.props.nestedField,delete e.props.columns,delete e.props.nested},parseRule(e){const t=e.children||[];e.props.columns=[],t.forEach(r=>{if(r.slot==="nested"){e.props.nested=r.props.columns,e.props.nestedField=r.field;return}e.props.columns.push({label:r.props.label,required:r.props.required,style:{width:r.props.width,color:r.props.color},rule:r.children||[]})}),e.children=[]},sfc:!1,rule({t:e}){return{type:Qa,field:We(),title:e("com."+Qa+".name"),info:"",props:{},children:[]}},props(e,{t}){return Be(t,Qa+".props",[{type:"switch",field:"disabled"},{type:"inputNumber",field:"max",props:{min:0}},{type:"inputNumber",field:"nestedMax",props:{min:0}}])}},Ew={icon:"icon-table-form",label:"\u5B50\u8868\u683C\u8868\u5355",name:"nestedSubTableForm",aide:!0,mask:!1,validate:!1,style:!1,advanced:!1,variable:!1,subForm:"array",hiddenBaseField:["title","info","labelConfig","formCreate_computed>hidden","formCreate_computed>value","_control"],children:"tableFormColumn",subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("props.title"),vnode:t(r("el-input"),{size:"small",modelValue:o.props.label,"onUpdate:modelValue":i=>{o.props.label=i}})}]},loadRule(e){e.props||(e.props={});const t=e.props.columns||[];e.children=t.map(r=>({type:"tableFormColumn",_fc_drag_tag:"tableFormColumn",props:{label:r.label,required:r.required||!1,width:r.style.width||"",color:r.style.color||""},children:r.rule||[]})),delete e.props.columns},parseRule(e){const t=e.children||[];e.props.columns=t.map(r=>({label:r.props.label,required:r.props.required,style:{width:r.props.width,color:r.props.color},rule:r.children||[]})),e.children=[]},rule(){return{type:"TableForm",field:We(),title:"",info:"",props:{},children:[]}},props(){return[]}},zd="tableFormColumn",Sw={icon:"icon-cell",name:zd,aide:!0,drag:!0,dragBtn:!1,mask:!1,style:!1,advanced:!1,variable:!1,rule({t:e}){return{type:zd,props:{label:e("com.tableFormColumn.label"),width:"auto"},children:[]}},props(e,{t}){return Be(t,zd+".props",[{type:"input",field:"label"},{type:"switch",field:"required"},{type:"input",field:"width"},{type:"ColorInput",field:"color"}])}},Mp="tableFormColumn2",Aw={icon:"icon-cell",name:Mp,aide:!0,drag:!0,dragBtn:!1,mask:!1,style:!1,advanced:!1,variable:!1,children:"tableFormColumn2",childrenLen:0,checkDrag({toRule:e}){return!(e.children[0].children.length>0&&e.children[0].children.some(t=>t._config.name==="tableFormColumn2"))},rule({t:e}){return{type:Mp,props:{label:e("com.tableFormColumn.label"),width:"auto"},children:[]}},props(e,{t}){return Be(t,"tableFormColumn.props",[{type:"input",field:"label"},{type:"select",field:"fixed",options:[!1,"left","right"].map(r=>({label:t("com.dataTable.fixed."+(r||"default")),value:r}))},{type:"switch",field:"required"},{type:"switch",field:"hidden"},{type:"input",field:"width"},{type:"ColorInput",field:"color"}])}},xw={icon:"icon-flex",label:"\u76D2\u5B50\u5E03\u5C40",name:"fcFlex",mask:!1,children:"fcCell",childrenLen:2,subRender({t:e,h:t,resolveComponent:r,subRule:o}){return[{label:e("style.width"),vnode:t(r("SizeInput"),{size:"small",modelValue:o.style&&o.style.width||"","onUpdate:modelValue":i=>{o.style||(o.style={}),o.style.width=i}})},{label:e("style.height"),vnode:t(r("SizeInput"),{size:"small",modelValue:o.style&&o.style.height||"auto","onUpdate:modelValue":i=>{o.style||(o.style={}),o.style.height=i}})}]},sfc(e){e.type="elRow"},rule(){return{type:"fcRow",props:{},children:[]}},props(){return[]}},Lp="fcCell",kw={name:Lp,label:"\u683C\u5B50",drag:!0,dragBtn:!1,inside:!0,inline:!0,mask:!1,sfc(e){e.type="div"},rule(){return{type:Lp,style:{display:"block",width:"50%",height:"100px"},children:[]}},props(e,{t}){return[{type:"SizeInput",field:"formCreateStyle>width",title:t("style.width")}]}},Nw="\u8BA1\u7B97\u516C\u5F0F",jp="fcValue",Tw={menu:"main",icon:"icon-value",label:Nw,name:jp,input:!0,event:["change"],validate:!1,sfc(e,{getParentFieldStr:t}){e.type="div",e._sfc.content=`{{formData.${t()}${e.field}}}`,e._sfc.vModel=!1},rule({t:e}){return{type:jp,field:We(),title:e("com.fcValue.name"),info:"",props:{}}},props(){return[]}},Dw="\u94FE\u63A5",Ud="elLink",Vw={menu:"aide",icon:"icon-link",label:Dw,name:Ud,inline:!0,easySlots:[{value:"icon",type:"icon"}],rule({t:e}){return{type:Ud,title:"",children:[e("com.elLink.name")]}},props(e,{t}){return Be(t,Ud+".props",[{type:"input",field:"href"},{type:"input",field:"formCreateChild"},{type:"select",field:"target",options:it(t,[{label:"_self",value:"_self"},{label:"_blank",value:"_blank"},{label:"_parent",value:"_parent"},{label:"_top",value:"_top"}])},{type:"switch",field:"underline",value:!0},{type:"switch",field:"disabled"},{type:"select",field:"type",options:it(t,[{label:"primary",value:"primary"},{label:"success",value:"success"},{label:"warning",value:"warning"},{label:"danger",value:"danger"},{label:"info",value:"info"},{label:"default",value:"default"}])}])}},Ow="\u6587\u5B57\u63D0\u793A",Ja="elTooltip",Bw={menu:"aide",icon:"icon-tooltip",label:Ow,name:Ja,drag:!0,dragBtn:!0,inside:!1,mask:!1,rule({t:e}){return{type:Ja,props:{content:e("com."+Ja+".name")},children:[]}},props(e,{t}){return Be(t,Ja+".props",[{type:"input",field:"content",props:{type:"textarea"}},{type:"switch",field:"disabled"},{type:"switch",field:"rawContent"},{type:"switch",field:"enterable",value:!0},{type:"select",field:"effect",value:"dark",options:[{label:"dark",value:"dark"},{label:"light",value:"light"}]},{type:"select",field:"placement",value:"bottom",options:[{label:"top",value:"top"},{label:"top-start",value:"top-start"},{label:"top-end",value:"top-end"},{label:"bottom",value:"bottom"},{label:"bottom-start",value:"bottom-start"},{label:"bottom-end",value:"bottom-end"},{label:"left",value:"left"},{label:"left-start",value:"left-start"},{label:"left-end",value:"left-end"},{label:"right",value:"right"},{label:"right-start",value:"right-start"},{label:"right-end",value:"right-end"}]},{type:"select",field:"trigger",value:"hover",options:[{label:"hover",value:"hover"},{label:"click",value:"click"},{label:"focus",value:"focus"},{label:"contextmenu",value:"contextmenu"}]},{type:"inputNumber",field:"offset"},{type:"inputNumber",field:"showAfter",props:{min:0}},{type:"inputNumber",field:"hideAfter",props:{min:0}},{type:"inputNumber",field:"autoClose",props:{min:0}}])}},Rw="\u6C34\u5370",Xa="elWatermark",$w={menu:"aide",icon:"icon-watermark",label:Rw,name:Xa,drag:!0,dragBtn:!0,inside:!1,mask:!1,rule({t:e}){return{type:Xa,style:{width:"100%"},props:{content:e("com."+Xa+".name")},children:[]}},props(e,{t}){return Be(t,Xa+".props",[{type:"input",field:"content"},{type:"input",field:"image"},{type:"inputNumber",field:"width",props:{min:0},value:120},{type:"inputNumber",field:"height",props:{min:0},value:64},{type:"inputNumber",field:"rotate",value:-22},{type:"inputNumber",field:"zIndex",props:{min:0}},{type:"TableOptions",field:"gap",props:{column:[{label:t("props.value"),key:"value"}],valueType:"string",max:2},value:[100,100]}])}},Iw={menu:"template",name:"chineseAmount",label:"\u91D1\u989D",autoField:!0,template:[{type:"inputNumber",field:"Fgtxlugfgbdvb5c",title:"\u91D1\u989D",info:"",$required:!1,display:!0,hidden:!1,_fc_drag_tag:"inputNumber"},{type:"fcValue",field:"Fvr1lugfgd3yb7c",title:" ",info:"",display:!0,hidden:!1,_fc_drag_tag:"fcValue",style:{color:"#999999"},computed:{value:'"\u5927\u5199: " + TOCHINSESAMOUNT(Fgtxlugfgbdvb5c || 0)'}}]},Fw={menu:"template",name:"duration",label:"\u65F6\u957F",autoField:!0,template:[{type:"fcInlineForm",_fc_id:"id_Founm50iu5kocac",name:"ref_Fqrpm50iu5kocbc",display:!0,hidden:!1,_fc_drag_tag:"fcInlineForm",children:[{type:"datePicker",field:"Fz0um50itwf6bbc",title:"\u5F00\u59CB\u65F6\u95F4",$required:!1,_fc_drag_tag:"datePicker",validate:[{type:"validator",trigger:"change",validator:`[[FORM-CREATE-PREFIX-function validator(rule, value, callback){this.api.validateField('Fv92m50itwf6bdc');
callback();}-FORM-CREATE-SUFFIX]]`,mode:"validator",message:""}],_fc_template:"duration",_fc_id:"id_Fhqtm50itwf6bgc",name:"ref_Fzsym50itwf6bhc",display:!0,hidden:!1},{type:"select",field:"F730m50itwf6bcc",title:"\u5F00\u59CB\u65F6\u95F4\u6BB5",effect:{fetch:""},$required:!1,options:[{label:"\u4E0A\u5348",value:"1"},{label:"\u4E0B\u5348",value:"1.5"}],_fc_drag_tag:"select",_fc_template:"duration",_fc_id:"id_Fnj8m50itwf6bkc",name:"ref_Fyjym50itwf6blc",display:!0,hidden:!1,wrap:{title:!1},style:{marginLeft:"10px",width:"150px"}}]},{type:"fcInlineForm",_fc_id:"id_Fxbnm50iw4ttccc",name:"ref_Fhwmm50iw4ttcdc",display:!0,hidden:!1,_fc_drag_tag:"fcInlineForm",children:[{type:"datePicker",field:"Fv92m50itwf6bdc",title:"\u7ED3\u675F\u65F6\u95F4",$required:!1,_fc_drag_tag:"datePicker",validate:[{type:"validator",trigger:"change",validator:`[[FORM-CREATE-PREFIX-function validator(rule, value, callback){let startTime = this.api.getValue('Fz0um50itwf6bbc');
if(startTime && value && Date.parse(startTime) > Date.parse(value)) {
callback(false);
return;
}
-callback()}-FORM-CREATE-SUFFIX]]`,mode:"min",message:"\u5F00\u59CB\u65F6\u95F4\u4E0D\u80FD\u5927\u4E8E\u7ED3\u675F\u65F6\u95F4"}],_fc_template:"duration",_fc_id:"id_Fu8im50itwf6bqc",name:"ref_Fy17m50itwf6brc",display:!0,hidden:!1},{type:"select",field:"Fx9gm50itwf6bec",title:"\u7ED3\u675F\u65F6\u95F4\u6BB5",effect:{fetch:""},$required:!1,options:[{label:"\u4E0A\u5348",value:"1"},{label:"\u4E0B\u5348",value:"1.5"}],_fc_drag_tag:"select",_fc_template:"duration",_fc_id:"id_Fxrxm50itwf6buc",name:"ref_Fehcm50itwf6bvc",display:!0,hidden:!1,wrap:{title:!1},style:{marginLeft:"10px",width:"150px"}}]},{type:"fcInlineForm",_fc_id:"id_Ffb0m50j0g8vcec",name:"ref_Ftpym50j0g8vcfc",display:!0,hidden:!1,_fc_drag_tag:"fcInlineForm",children:[{type:"inputNumber",field:"F5q8m50itwf6bfc",title:"\u65F6\u957F",$required:!1,props:{controls:!1},_fc_drag_tag:"inputNumber",_fc_template:"duration",_fc_id:"id_Fo5cm50itwf7c0c",name:"ref_Fnnvm50itwf7c1c",display:!0,hidden:!1,computed:{value:"MAX(IF(Fz0um50itwf6bbc && Fv92m50itwf6bdc && TIMESTAMP(Fv92m50itwf6bdc) > TIMESTAMP(Fz0um50itwf6bbc), DIFFDAYS(Fz0um50itwf6bbc, Fv92m50itwf6bdc), 0) + IF(Fx9gm50itwf6bec && F730m50itwf6bcc, Fx9gm50itwf6bec - F730m50itwf6bcc + 0.5, 0), 0);"}},{type:"div",native:!0,children:["\u5929"],_fc_drag_tag:"text",_fc_template:"duration",_fc_id:"id_Fatsm50itwf7c4c",name:"ref_Fh2rm50itwf7c5c",display:!0,hidden:!1,style:{marginTop:"5px",marginLeft:"10px"}}],style:{alignItems:"flex-start"}}]},Iw={menu:"template",name:"col3",label:"\u4E09\u5217\u6805\u683C",autoField:!1,template:[{type:"fcRow",children:[{type:"col",props:{span:8},display:!0,hidden:!1,_fc_drag_tag:"col"},{type:"col",props:{span:8},display:!0,hidden:!1,_fc_drag_tag:"col"},{type:"col",props:{span:8},display:!0,hidden:!1,_fc_drag_tag:"col"}],display:!0,hidden:!1,_fc_drag_tag:"fcRow"}]},Fw={menu:"template",name:"col4",label:"\u56DB\u5217\u6805\u683C",autoField:!1,template:[{type:"fcRow",children:[{type:"col",props:{span:6},display:!0,hidden:!1,_fc_drag_tag:"col"},{type:"col",props:{span:6},display:!0,hidden:!1,_fc_drag_tag:"col"},{type:"col",props:{span:6},display:!0,hidden:!1,_fc_drag_tag:"col"},{type:"col",props:{span:6},display:!0,hidden:!1,_fc_drag_tag:"col"}],display:!0,hidden:!1,_fc_drag_tag:"fcRow"}]},Pw={menu:"template",name:"table43",label:"\u56DB\u884C\u4E09\u5217\u8868\u683C",autoField:!1,template:[{type:"fcTable",props:{rule:{row:4,col:3,style:{},class:{},layout:[]}},display:!0,hidden:!1,_fc_drag_tag:"fcTable"}]},Mw="\u6570\u636E\u8868\u683C",Za="dataTable",Lw=()=>{const e=[];for(let t=0;t<30;t++)e.push({date:"2016-05-12",name:"Tom "+(10+t),state:"California",city:"Los Angeles",address:"No. 189, Grove St, Los Angeles",zip:"CA 90036"});return e},jw=e=>{if(e.format==="tag")return{type:"elTag",props:{disableTransitions:!0},_sfc:{content:`{{scope.row.${e.prop}}}`}};if(e.format==="image")return{type:"div",class:"_fc-data-table-img-list",children:[{type:"template",children:[{type:"el-image",props:{previewTeleported:!0,fit:"cover"},_sfc:{attr:{":initialIndex":"i",":src":"src",":previewSrcList":`Array.isArray(scope.row.${e.prop}) ? scope.row.${e.prop} : [scope.row.${e.prop}]`}}}],_sfc:{attr:{"v-for":`(src, i) in Array.isArray(scope.row.${e.prop}) ? scope.row.${e.prop} : [scope.row.${e.prop}]`}}}]}},zw={menu:"main",icon:"icon-data-table",label:Mw,name:Za,languageKey:["operation"],event:["cellMouseEnter","cellMouseLeave","handleClick","rowClick","rowDblclick","headerClick","filterChange","expandChange","sortChange","selectionChange"],sfc:{style:`._fc-data-table {
+callback()}-FORM-CREATE-SUFFIX]]`,mode:"min",message:"\u5F00\u59CB\u65F6\u95F4\u4E0D\u80FD\u5927\u4E8E\u7ED3\u675F\u65F6\u95F4"}],_fc_template:"duration",_fc_id:"id_Fu8im50itwf6bqc",name:"ref_Fy17m50itwf6brc",display:!0,hidden:!1},{type:"select",field:"Fx9gm50itwf6bec",title:"\u7ED3\u675F\u65F6\u95F4\u6BB5",effect:{fetch:""},$required:!1,options:[{label:"\u4E0A\u5348",value:"1"},{label:"\u4E0B\u5348",value:"1.5"}],_fc_drag_tag:"select",_fc_template:"duration",_fc_id:"id_Fxrxm50itwf6buc",name:"ref_Fehcm50itwf6bvc",display:!0,hidden:!1,wrap:{title:!1},style:{marginLeft:"10px",width:"150px"}}]},{type:"fcInlineForm",_fc_id:"id_Ffb0m50j0g8vcec",name:"ref_Ftpym50j0g8vcfc",display:!0,hidden:!1,_fc_drag_tag:"fcInlineForm",children:[{type:"inputNumber",field:"F5q8m50itwf6bfc",title:"\u65F6\u957F",$required:!1,props:{controls:!1},_fc_drag_tag:"inputNumber",_fc_template:"duration",_fc_id:"id_Fo5cm50itwf7c0c",name:"ref_Fnnvm50itwf7c1c",display:!0,hidden:!1,computed:{value:"MAX(IF(Fz0um50itwf6bbc && Fv92m50itwf6bdc && TIMESTAMP(Fv92m50itwf6bdc) > TIMESTAMP(Fz0um50itwf6bbc), DIFFDAYS(Fz0um50itwf6bbc, Fv92m50itwf6bdc), 0) + IF(Fx9gm50itwf6bec && F730m50itwf6bcc, Fx9gm50itwf6bec - F730m50itwf6bcc + 0.5, 0), 0);"}},{type:"div",native:!0,children:["\u5929"],_fc_drag_tag:"text",_fc_template:"duration",_fc_id:"id_Fatsm50itwf7c4c",name:"ref_Fh2rm50itwf7c5c",display:!0,hidden:!1,style:{marginTop:"5px",marginLeft:"10px"}}],style:{alignItems:"flex-start"}}]},Pw={menu:"template",name:"col3",label:"\u4E09\u5217\u6805\u683C",autoField:!1,template:[{type:"fcRow",children:[{type:"col",props:{span:8},display:!0,hidden:!1,_fc_drag_tag:"col"},{type:"col",props:{span:8},display:!0,hidden:!1,_fc_drag_tag:"col"},{type:"col",props:{span:8},display:!0,hidden:!1,_fc_drag_tag:"col"}],display:!0,hidden:!1,_fc_drag_tag:"fcRow"}]},Mw={menu:"template",name:"col4",label:"\u56DB\u5217\u6805\u683C",autoField:!1,template:[{type:"fcRow",children:[{type:"col",props:{span:6},display:!0,hidden:!1,_fc_drag_tag:"col"},{type:"col",props:{span:6},display:!0,hidden:!1,_fc_drag_tag:"col"},{type:"col",props:{span:6},display:!0,hidden:!1,_fc_drag_tag:"col"},{type:"col",props:{span:6},display:!0,hidden:!1,_fc_drag_tag:"col"}],display:!0,hidden:!1,_fc_drag_tag:"fcRow"}]},Lw={menu:"template",name:"table43",label:"\u56DB\u884C\u4E09\u5217\u8868\u683C",autoField:!1,template:[{type:"fcTable",props:{rule:{row:4,col:3,style:{},class:{},layout:[]}},display:!0,hidden:!1,_fc_drag_tag:"fcTable"}]},jw="\u6570\u636E\u8868\u683C",Za="dataTable",zw=()=>{const e=[];for(let t=0;t<30;t++)e.push({date:"2016-05-12",name:"Tom "+(10+t),state:"California",city:"Los Angeles",address:"No. 189, Grove St, Los Angeles",zip:"CA 90036"});return e},Uw=e=>{if(e.format==="tag")return{type:"elTag",props:{disableTransitions:!0},_sfc:{content:`{{scope.row.${e.prop}}}`}};if(e.format==="image")return{type:"div",class:"_fc-data-table-img-list",children:[{type:"template",children:[{type:"el-image",props:{previewTeleported:!0,fit:"cover"},_sfc:{attr:{":initialIndex":"i",":src":"src",":previewSrcList":`Array.isArray(scope.row.${e.prop}) ? scope.row.${e.prop} : [scope.row.${e.prop}]`}}}],_sfc:{attr:{"v-for":`(src, i) in Array.isArray(scope.row.${e.prop}) ? scope.row.${e.prop} : [scope.row.${e.prop}]`}}}]}},Hw={menu:"main",icon:"icon-data-table",label:jw,name:Za,languageKey:["operation"],event:["cellMouseEnter","cellMouseLeave","handleClick","rowClick","rowDblclick","headerClick","filterChange","expandChange","sortChange","selectionChange"],sfc:{style:`._fc-data-table {
width: 100%;
}
._fc-data-table .el-table {
@@ -174,13 +174,13 @@ justify-content: flex-end;
._fc-data-table ._fc-data-table-img-list .el-image {
max-width: 150px;
height: 60px;
-}`,handle(e){const{column:t,button:r,page:o,index:i,selection:l,data:d}=e.props,c=[];["column","button","index","globalDataKey","fetch","page"].forEach(h=>{delete e.props[h]}),t.forEach(h=>{const m=jw(h),y={type:"elTableColumn",props:{label:h.label,prop:h.prop,width:h.width,align:h.align,className:h.className,fixed:h.fixed,sortable:h.sortable},_sfc:{attr:{"#default":"scope"}}};m&&(y.children=[m]),c.push(y)}),r&&r.open===!0&&r.column&&c.push({type:"elTableColumn",props:{label:r.label||"\u64CD\u4F5C",fixed:r.fixed===void 0?"right":r.fixed,width:r.width||"100px"},_sfc:{attr:{"#default":"scope"}},children:r.column.map(h=>{const m=h.prop||[],y={type:"elButton",props:{type:h.type,size:h.size},_sfc:{content:h.name}};return m.forEach(C=>{y.props[C]=!0}),y})}),l&&c.unshift({type:"elTableColumn",props:{type:"selection",width:"50px"}}),i&&c.unshift({type:"elTableColumn",props:{type:"index",width:"50px"}});const u=[{type:"elTable",props:{data:[],...e.props},_fc_id:e._fc_id,children:c}];if(o&&o.open===!0){const h=o.props&&o.props.pageSize||20;o.props&&delete o.props.pageSize,u.push({type:"elPagination",class:o.position||"right",_fc_id:e._fc_id,props:{layout:"prev, pager, next",...o.props||{}},_sfc:{prop:{total:(d||[]).length,currentPage:1,pageSize:h}}})}return{type:"div",class:"_fc-data-table",children:u}}},rule(){return{type:Za,native:!0,props:{height:"500px",button:{},data:Lw(),column:[{format:"default",prop:"date",label:"Date",width:"150"},{format:"default",prop:"name",label:"Name",width:"120"},{format:"default",prop:"state",label:"State",width:"120"},{format:"default",prop:"city",label:"City",width:"320"},{format:"default",prop:"address",label:"Address",width:"600"},{format:"default",prop:"zip",label:"Zip",width:"120"}]}}},props(e,{t}){const r=function(i){return Be(t,Za+".props",i)},o=r([{type:"input",field:"page>totalField",value:"count"},{type:"input",field:"page>dataField",value:"list"},{type:"input",field:"page>orderField",value:"order"},{type:"input",field:"page>orderByField",value:"orderBy"},{type:"input",field:"page>pageField",value:"page"},{type:"input",field:"page>pageSizeField",value:"limit"}]);return Be(t,Za+".props",[{type:"radio",field:"_optionType",value:0,options:[{label:t("fetch.optionsType.struct"),value:0},{label:t("fetch.optionsType.fetch"),value:2},{label:t("fetch.optionsType.global"),value:1}],props:{type:"button"},control:[{value:1,rule:[{type:"GlobalFetchSelect",field:"globalDataKey"},...o]},{value:2,rule:[{type:"FetchConfig",field:"fetch"},...o]},{value:0,rule:[{type:"Struct",title:t("com.dataTable.props._optionType"),field:"data",_fc_important_prop:!0,props:{validate(i){return!i||Array.isArray(i)}}}]}]},{type:"TableColumnConfig",field:"column",_fc_important_prop:!0},{type:"select",field:"size",options:it(t,[{label:"large",value:"large"},{label:"default",value:"default"},{label:"small",value:"small"}])},{type:"ConfigItem",props:{label:t("com.dataTable.props.button")},col:{show:!0},children:[{type:"HideConfig",title:t("com.dataTable.props.button"),wrap:{show:!1},col:{show:!1},field:"button>open"},{type:"template",slot:"append",children:r([{type:"TableButtonConfig",col:{show:!1},field:"button>column"},{type:"input",col:{show:!1},field:"button>label",value:"\u64CD\u4F5C"},{type:"select",col:{show:!1},field:"button>fixed",options:[{label:t("com.dataTable.fixed.default"),value:!1},{label:t("com.dataTable.fixed.left"),value:"left"},{label:t("com.dataTable.fixed.right"),value:"right"}],value:"right"},{type:"SizeInput",col:{show:!1},field:"button>width",value:"100px"}])}]},{type:"ConfigItem",props:{label:t("com.dataTable.props.page")},col:{show:!0},children:[{type:"HideConfig",wrap:{show:!1},col:{show:!1},title:t("com.dataTable.props.page"),field:"page>open"},{type:"template",slot:"append",children:r([{type:"select",field:"page>position",value:"right",col:{show:!1},options:it(t,[{label:"left",value:"left"},{label:"center",value:"center"},{label:"right",value:"right"}])},{type:"inputNumber",col:{show:!1},field:"page>props>pageSize",value:20},{type:"switch",col:{show:!1},field:"page>props>small"},{type:"switch",col:{show:!1},field:"page>props>background"}])}]},{type:"input",field:"rowKey"},{type:"input",field:"emptyText"},{type:"SizeInput",field:"height"},{type:"switch",field:"showSummary"},{type:"switch",field:"selection"},{type:"switch",field:"index"},{type:"switch",field:"stripe"},{type:"switch",field:"border"},{type:"switch",field:"defaultExpandAll"}])}},qa="fcDialog",Uw={name:qa,icon:"icon-dialog",label:"\u5F39\u51FA\u6846",drag:!0,dragBtn:!1,handleBtn:!1,inside:!1,mask:!1,style:!1,advanced:!1,input:!0,subForm:"object",hiddenBaseField:["title","info","formCreateCol>span","labelConfig","_control"],languageKey:["close","ok"],event:["confirm","submit","validateFail","open","opened","close","closed","openAutoFocus","closeAutoFocus"],container:{formDataField:"value",labelField:"props.title"},loadRule(e){e.children=e.props.rule||[],e.native==null&&(e.native=!0),e.ignore==null&&(e.ignore=!0),delete e.props.rule},parseRule(e){e.props.rule=e.children||[],e.children=[]},rule({t:e}){return{type:qa,props:{title:e("com."+qa+".name")},native:!0,ignore:!0,children:[]}},props(e,{t}){return Be(t,qa+".props",[{type:"input",field:"title"},{type:"SizeInput",field:"width",value:"50%"},{type:"switch",field:"fullscreen"},{type:"switch",field:"preview",title:t("form.previewMode")},{type:"switch",field:"modal",value:!0},{type:"switch",field:"footer",value:!0},{type:"switch",field:"autoClose",value:!0},{type:"FnInput",field:"beforeClose",props:{body:!0,button:!0,fnx:!0,name:"beforeClose",args:[on(t)]}}])}},el="fcDrawer",Hw={name:el,icon:"icon-dialog",label:"\u62BD\u5C49",drag:!0,dragBtn:!1,handleBtn:!1,inside:!1,mask:!1,style:!1,advanced:!1,input:!0,subForm:"object",hiddenBaseField:["title","info","formCreateCol>span","labelConfig","_control"],languageKey:["close","ok"],event:["confirm","submit","validateFail","open","opened","close","closed","openAutoFocus","closeAutoFocus"],container:{formDataField:"value",labelField:"props.title"},loadRule(e){e.children=e.props.rule||[],e.native==null&&(e.native=!0),e.ignore==null&&(e.ignore=!0),delete e.props.rule},parseRule(e){e.props.rule=e.children||[],e.children=[]},rule({t:e}){return{type:el,props:{title:e("com."+el+".name")},native:!0,ignore:!0,children:[]}},props(e,{t}){return Be(t,el+".props",[{type:"input",field:"title"},{type:"SizeInput",field:"size",value:"30%"},{type:"select",field:"direction",options:it(t,[{label:"ltr",value:"ltr"},{label:"rtl",value:"rtl"}],"com.fcDrawer.directionType"),value:"rtl"},{type:"switch",field:"preview",title:t("form.previewMode")},{type:"switch",field:"modal",value:!0},{type:"switch",field:"footer",value:!0},{type:"switch",field:"autoClose",value:!0},{type:"FnInput",field:"beforeClose",props:{body:!0,button:!0,fnx:!0,name:"beforeClose",args:[on(t)]}}])}},Ww="\u63D2\u69FD\u533A\u57DF",Hd="fcSlot",Gw={menu:"container",icon:"icon-slot",label:Ww,name:Hd,input:!0,mask:!0,style:!1,sfc:!1,rule(){return{type:Hd,field:We(),title:"",native:!1,$required:!1,readMode:"custom",props:{name:"block_"+We()}}},props(e,{t}){return Be(t,Hd+".props",[{type:"input",field:"name"}])}},Kw="\u52A8\u6001\u533A\u57DF",Wd="fcJson",Yw={menu:"container",icon:"icon-json",label:Kw,name:Wd,input:!0,mask:!0,style:!1,sfc:!1,rule(){return{type:Wd,field:We(),props:{expand:1}}},props(e,{t}){return Be(t,Wd+".props",[{type:"radio",field:"_loadType",value:2,props:{type:"button"},options:[{label:t("fetch.optionsType.struct"),value:2},{label:t("fetch.optionsType.fetch"),value:3},{label:t("fetch.optionsType.global"),value:1}],control:[{value:1,rule:[{type:"GlobalFetchSelect",field:"formCreateEffect>fetch",props:{to:"props.rule"}}]},{value:2,rule:[{type:"Struct",field:"rule",title:t("com.fcJson.props._loadType"),_fc_important_prop:!0,wrap:{show:!1}}]},{value:3,rule:[{type:"FetchConfig",field:"formCreateEffect>fetch",props:{to:"props.rule"}}]}]},{type:"select",field:"type",options:it(t,[{label:t("props.default"),value:"default"},{label:t("com.group.name"),value:"array"},{label:t("com.subForm.name"),value:"object"}]),control:[{value:"array",method:"hidden",rule:Be(t,"group.props",[{type:"switch",field:"disabled",ignore:"hidden"},{type:"switch",field:"button",ignore:"hidden",value:!0},{type:"switch",field:"sortBtn",ignore:"hidden",value:!0},{type:"inputNumber",field:"expand",ignore:"hidden"},{type:"inputNumber",field:"min",ignore:"hidden"},{type:"inputNumber",field:"max",ignore:"hidden"}])},{value:"object",method:"hidden",rule:Be(t,"group.props",[{type:"switch",field:"disabled",ignore:"hidden"}])}]}])}},Qw="\u5185\u8054\u5E03\u5C40",jp="fcInlineForm",Jw={menu:"layout",icon:"icon-inline",label:Qw,name:jp,denyDrag:{menu:["subform","layout"]},drag:!0,inside:!1,mask:!1,sfc:{style:`._fc-line-form .el-form-item {
+}`,handle(e){const{column:t,button:r,page:o,index:i,selection:l,data:d}=e.props,c=[];["column","button","index","globalDataKey","fetch","page"].forEach(h=>{delete e.props[h]}),t.forEach(h=>{const m=Uw(h),y={type:"elTableColumn",props:{label:h.label,prop:h.prop,width:h.width,align:h.align,className:h.className,fixed:h.fixed,sortable:h.sortable},_sfc:{attr:{"#default":"scope"}}};m&&(y.children=[m]),c.push(y)}),r&&r.open===!0&&r.column&&c.push({type:"elTableColumn",props:{label:r.label||"\u64CD\u4F5C",fixed:r.fixed===void 0?"right":r.fixed,width:r.width||"100px"},_sfc:{attr:{"#default":"scope"}},children:r.column.map(h=>{const m=h.prop||[],y={type:"elButton",props:{type:h.type,size:h.size},_sfc:{content:h.name}};return m.forEach(C=>{y.props[C]=!0}),y})}),l&&c.unshift({type:"elTableColumn",props:{type:"selection",width:"50px"}}),i&&c.unshift({type:"elTableColumn",props:{type:"index",width:"50px"}});const u=[{type:"elTable",props:{data:[],...e.props},_fc_id:e._fc_id,children:c}];if(o&&o.open===!0){const h=o.props&&o.props.pageSize||20;o.props&&delete o.props.pageSize,u.push({type:"elPagination",class:o.position||"right",_fc_id:e._fc_id,props:{layout:"prev, pager, next",...o.props||{}},_sfc:{prop:{total:(d||[]).length,currentPage:1,pageSize:h}}})}return{type:"div",class:"_fc-data-table",children:u}}},rule(){return{type:Za,native:!0,props:{height:"500px",button:{},data:zw(),column:[{format:"default",prop:"date",label:"Date",width:"150"},{format:"default",prop:"name",label:"Name",width:"120"},{format:"default",prop:"state",label:"State",width:"120"},{format:"default",prop:"city",label:"City",width:"320"},{format:"default",prop:"address",label:"Address",width:"600"},{format:"default",prop:"zip",label:"Zip",width:"120"}]}}},props(e,{t}){const r=function(i){return Be(t,Za+".props",i)},o=r([{type:"input",field:"page>totalField",value:"count"},{type:"input",field:"page>dataField",value:"list"},{type:"input",field:"page>orderField",value:"order"},{type:"input",field:"page>orderByField",value:"orderBy"},{type:"input",field:"page>pageField",value:"page"},{type:"input",field:"page>pageSizeField",value:"limit"}]);return Be(t,Za+".props",[{type:"radio",field:"_optionType",value:0,options:[{label:t("fetch.optionsType.struct"),value:0},{label:t("fetch.optionsType.fetch"),value:2},{label:t("fetch.optionsType.global"),value:1}],props:{type:"button"},control:[{value:1,rule:[{type:"GlobalFetchSelect",field:"globalDataKey"},...o]},{value:2,rule:[{type:"FetchConfig",field:"fetch"},...o]},{value:0,rule:[{type:"Struct",title:t("com.dataTable.props._optionType"),field:"data",_fc_important_prop:!0,props:{validate(i){return!i||Array.isArray(i)}}}]}]},{type:"TableColumnConfig",field:"column",_fc_important_prop:!0},{type:"select",field:"size",options:it(t,[{label:"large",value:"large"},{label:"default",value:"default"},{label:"small",value:"small"}])},{type:"ConfigItem",props:{label:t("com.dataTable.props.button")},col:{show:!0},children:[{type:"HideConfig",title:t("com.dataTable.props.button"),wrap:{show:!1},col:{show:!1},field:"button>open"},{type:"template",slot:"append",children:r([{type:"TableButtonConfig",col:{show:!1},field:"button>column"},{type:"input",col:{show:!1},field:"button>label",value:"\u64CD\u4F5C"},{type:"select",col:{show:!1},field:"button>fixed",options:[{label:t("com.dataTable.fixed.default"),value:!1},{label:t("com.dataTable.fixed.left"),value:"left"},{label:t("com.dataTable.fixed.right"),value:"right"}],value:"right"},{type:"SizeInput",col:{show:!1},field:"button>width",value:"100px"}])}]},{type:"ConfigItem",props:{label:t("com.dataTable.props.page")},col:{show:!0},children:[{type:"HideConfig",wrap:{show:!1},col:{show:!1},title:t("com.dataTable.props.page"),field:"page>open"},{type:"template",slot:"append",children:r([{type:"select",field:"page>position",value:"right",col:{show:!1},options:it(t,[{label:"left",value:"left"},{label:"center",value:"center"},{label:"right",value:"right"}])},{type:"inputNumber",col:{show:!1},field:"page>props>pageSize",value:20},{type:"switch",col:{show:!1},field:"page>props>small"},{type:"switch",col:{show:!1},field:"page>props>background"}])}]},{type:"input",field:"rowKey"},{type:"input",field:"emptyText"},{type:"SizeInput",field:"height"},{type:"switch",field:"showSummary"},{type:"switch",field:"selection"},{type:"switch",field:"index"},{type:"switch",field:"stripe"},{type:"switch",field:"border"},{type:"switch",field:"defaultExpandAll"}])}},qa="fcDialog",Ww={name:qa,icon:"icon-dialog",label:"\u5F39\u51FA\u6846",drag:!0,dragBtn:!1,handleBtn:!1,inside:!1,mask:!1,style:!1,advanced:!1,input:!0,subForm:"object",hiddenBaseField:["title","info","formCreateCol>span","labelConfig","_control"],languageKey:["close","ok"],event:["confirm","submit","validateFail","open","opened","close","closed","openAutoFocus","closeAutoFocus"],container:{formDataField:"value",labelField:"props.title"},loadRule(e){e.children=e.props.rule||[],e.native==null&&(e.native=!0),e.ignore==null&&(e.ignore=!0),delete e.props.rule},parseRule(e){e.props.rule=e.children||[],e.children=[]},rule({t:e}){return{type:qa,props:{title:e("com."+qa+".name")},native:!0,ignore:!0,children:[]}},props(e,{t}){return Be(t,qa+".props",[{type:"input",field:"title"},{type:"SizeInput",field:"width",value:"50%"},{type:"switch",field:"fullscreen"},{type:"switch",field:"preview",title:t("form.previewMode")},{type:"switch",field:"modal",value:!0},{type:"switch",field:"footer",value:!0},{type:"switch",field:"autoClose",value:!0},{type:"FnInput",field:"beforeClose",props:{body:!0,button:!0,fnx:!0,name:"beforeClose",args:[on(t)]}}])}},el="fcDrawer",Gw={name:el,icon:"icon-dialog",label:"\u62BD\u5C49",drag:!0,dragBtn:!1,handleBtn:!1,inside:!1,mask:!1,style:!1,advanced:!1,input:!0,subForm:"object",hiddenBaseField:["title","info","formCreateCol>span","labelConfig","_control"],languageKey:["close","ok"],event:["confirm","submit","validateFail","open","opened","close","closed","openAutoFocus","closeAutoFocus"],container:{formDataField:"value",labelField:"props.title"},loadRule(e){e.children=e.props.rule||[],e.native==null&&(e.native=!0),e.ignore==null&&(e.ignore=!0),delete e.props.rule},parseRule(e){e.props.rule=e.children||[],e.children=[]},rule({t:e}){return{type:el,props:{title:e("com."+el+".name")},native:!0,ignore:!0,children:[]}},props(e,{t}){return Be(t,el+".props",[{type:"input",field:"title"},{type:"SizeInput",field:"size",value:"30%"},{type:"select",field:"direction",options:it(t,[{label:"ltr",value:"ltr"},{label:"rtl",value:"rtl"}],"com.fcDrawer.directionType"),value:"rtl"},{type:"switch",field:"preview",title:t("form.previewMode")},{type:"switch",field:"modal",value:!0},{type:"switch",field:"footer",value:!0},{type:"switch",field:"autoClose",value:!0},{type:"FnInput",field:"beforeClose",props:{body:!0,button:!0,fnx:!0,name:"beforeClose",args:[on(t)]}}])}},Kw="\u63D2\u69FD\u533A\u57DF",Hd="fcSlot",Yw={menu:"container",icon:"icon-slot",label:Kw,name:Hd,input:!0,mask:!0,style:!1,sfc:!1,rule(){return{type:Hd,field:We(),title:"",native:!1,$required:!1,readMode:"custom",props:{name:"block_"+We()}}},props(e,{t}){return Be(t,Hd+".props",[{type:"input",field:"name"}])}},Qw="\u52A8\u6001\u533A\u57DF",Wd="fcJson",Jw={menu:"container",icon:"icon-json",label:Qw,name:Wd,input:!0,mask:!0,style:!1,sfc:!1,rule(){return{type:Wd,field:We(),props:{expand:1}}},props(e,{t}){return Be(t,Wd+".props",[{type:"radio",field:"_loadType",value:2,props:{type:"button"},options:[{label:t("fetch.optionsType.struct"),value:2},{label:t("fetch.optionsType.fetch"),value:3},{label:t("fetch.optionsType.global"),value:1}],control:[{value:1,rule:[{type:"GlobalFetchSelect",field:"formCreateEffect>fetch",props:{to:"props.rule"}}]},{value:2,rule:[{type:"Struct",field:"rule",title:t("com.fcJson.props._loadType"),_fc_important_prop:!0,wrap:{show:!1}}]},{value:3,rule:[{type:"FetchConfig",field:"formCreateEffect>fetch",props:{to:"props.rule"}}]}]},{type:"select",field:"type",options:it(t,[{label:t("props.default"),value:"default"},{label:t("com.group.name"),value:"array"},{label:t("com.subForm.name"),value:"object"}]),control:[{value:"array",method:"hidden",rule:Be(t,"group.props",[{type:"switch",field:"disabled",ignore:"hidden"},{type:"switch",field:"button",ignore:"hidden",value:!0},{type:"switch",field:"sortBtn",ignore:"hidden",value:!0},{type:"inputNumber",field:"expand",ignore:"hidden"},{type:"inputNumber",field:"min",ignore:"hidden"},{type:"inputNumber",field:"max",ignore:"hidden"}])},{value:"object",method:"hidden",rule:Be(t,"group.props",[{type:"switch",field:"disabled",ignore:"hidden"}])}]}])}},Xw="\u5185\u8054\u5E03\u5C40",zp="fcInlineForm",Zw={menu:"layout",icon:"icon-inline",label:Xw,name:zp,denyDrag:{menu:["subform","layout"]},drag:!0,inside:!1,mask:!1,sfc:{style:`._fc-line-form .el-form-item {
display: inline-flex;
vertical-align: middle;
}
._fc-line-form .el-select, ._fc-line-form .el-slider {
width: 220px;
-}`,handle(e){return{type:"div",class:"_fc-line-form",children:e.children}}},rule(){return{type:jp,props:{}}},props(){return[]}},Xw="\u56FE\u7247",Gd="elImage",Zw={menu:"aide",icon:"icon-image",label:Xw,name:Gd,inline:!0,rule(){return{type:Gd,title:"",style:{width:"100px",height:"100px"},props:{src:"https://static.form-create.com/example.png"}}},props(e,{t}){return Be(t,Gd+".props",[{type:"input",field:"src"},{type:"TableOptions",field:"previewSrcList",props:{column:[{label:t("com.elImage.props.src"),key:"value"}],valueType:"string"}}])}},qw={menu:"layout",icon:"icon-flex",name:"fcFlex2",label:"\u76D2\u5B50\u5E03\u5C40",drag:!0,inside:!0,inline:!0,mask:!1,sfc(e){e.type="div"},actions:[{label:"com.fcFlex2.horizontal",handler(e){e.style||(e.style={}),e.style.display!=="flex"?(e.style.display="flex",e.style.flexDirection="row",e.style.justifyContent="center"):["column-reverse","column"].indexOf(e.style.flexDirection)>-1?e.style.alignItems="center":e.style.justifyContent="center"}},{label:"com.fcFlex2.vertical",handler(e){e.style||(e.style={}),e.style.display!=="flex"?(e.style.display="flex",e.style.flexDirection="row",e.style.alignItems="center"):["column-reverse","column"].indexOf(e.style.flexDirection)>-1?e.style.justifyContent="center":e.style.alignItems="center"}},{label:"com.fcFlex2.left",handler(e){e.style||(e.style={}),e.style.display!=="flex"?(e.style.display="flex",e.style.flexDirection="row",e.style.justifyContent="flex-start"):["column-reverse","column"].indexOf(e.style.flexDirection)>-1?e.style.alignItems="flex-start":e.style.justifyContent="flex-start"}},{label:"com.fcFlex2.right",handler(e){e.style||(e.style={}),e.style.display!=="flex"?(e.style.display="flex",e.style.flexDirection="row",e.style.justifyContent="flex-end"):["column-reverse","column"].indexOf(e.style.flexDirection)>-1?e.style.alignItems="flex-end":e.style.justifyContent="flex-end"}},{label:"com.fcFlex2.reset",handler(e){e.style?(delete e.style.flexDirection,delete e.style.justifyContent,delete e.style.alignContent,delete e.style.flexWrap,delete e.style.alignItems,e.style.display="flex"):e.style={}}}],rule(){return{type:"fcCell",style:{display:"block",width:"100%",height:"100px"},children:[]}},props(e,{t}){return[{type:"SizeInput",field:"formCreateStyle>width",title:t("style.width")},{type:"SizeInput",field:"formCreateStyle>height",title:t("style.height")}]}},eC="\u8868\u5355\u9879",Kd="elFormItem",tC={menu:"container",icon:"icon-form-item",label:eC,name:Kd,drag:!0,mask:!1,event:!1,rule({t:e}){return{type:Kd,props:{label:e("com.elFormItem.name")},children:[]}},props(e,{t}){return Be(t,Kd+".props",[{type:"input",field:"label"},{type:"SizeInput",field:"labelWidth"},{type:"select",field:"formCreateClass",title:t("form.labelPosition"),options:it(t,[{value:"fc-wrap-top",label:"top"},{value:"fc-wrap-left",label:"left"},{value:"fc-wrap-right",label:"right"}])},{type:"select",field:"size",options:it(t,[{label:"large",value:"large"},{label:"default",value:"default"},{label:"small",value:"small"}])}])}},nC="\u97F3\u9891\u64AD\u653E\u5668",Yd="audioBox",iC={menu:"aide",icon:"icon-audio",label:nC,name:Yd,mask:!1,event:["pause","play","ended"],rule(){return{type:Yd,props:{src:"https://static.form-create.com/res/demo.mp3",type:"audio/mpeg"}}},props(e,{t}){return Be(t,Yd+".props",[{type:"input",field:"src"},{type:"select",field:"type",options:[{label:"MP3",value:"audio/mpeg"},{label:"OGG",value:"audio/ogg"},{label:"AAC",value:"audio/aac"},{label:"WAV",value:"audio/wav"},{label:"WMA",value:"audio/x-ms-wma"},{label:"WEBA",value:"audio/webm"},{label:"FLAC",value:"audio/flac"},{label:"ALAC",value:"audio/x-alac"},{label:"AMR",value:"audio/amr"},{label:"MIDI",value:"audio/midi"}]},{type:"switch",field:"autoplay"},{type:"switch",field:"loop"},{type:"switch",field:"muted"},{type:"switch",field:"controls"},{type:"select",field:"preload",options:it(t,[{label:"auto",value:"auto"},{label:"metadata",value:"metadata"},{label:"none",value:"none"}],"com.audioBox.preloadOpt")}])}},rC="\u89C6\u9891\u64AD\u653E\u5668",Qd="videoBox",oC={menu:"aide",icon:"icon-video",label:rC,name:Qd,mask:!1,event:["pause","play","ended","error"],rule(){return{type:Qd,props:{src:"",type:"mp4"}}},props(e,{t}){return Be(t,Qd+".props",[{type:"input",field:"src"},{type:"select",field:"type",options:[{label:"mp4",value:"mp4"},{label:"mpegts",value:"mpegts"},{label:"m2ts",value:"m2ts"},{label:"flv",value:"flv"},{label:"mse",value:"mse"}]},{type:"switch",field:"autoplay"},{type:"switch",field:"controls",value:!0},{type:"switch",field:"isLive"},{type:"switch",field:"loop"},{type:"switch",field:"withCredentials",value:!0}])}},aC="\u5934\u50CF\u6846",zp="elAvatar",lC={menu:"aide",icon:"icon-avatar",label:aC,name:zp,mask:!0,inline:!0,event:[],rule(){return{type:zp,props:{fit:"cover",src:"https://static.form-create.com/example.png"}}},props(e,{t}){return Be(t,"elAvatar.props",[{type:"input",field:"src"},{type:"select",field:"shape",options:it(t,[{label:"circle",value:"circle"},{label:"square",value:"square"}])},{type:"select",field:"size",options:it(t,[{label:"large",value:"large"},{label:"default",value:"default"},{label:"small",value:"small"}])}])}},sC="\u6761\u5F62\u7801",Up="barCodeBox",dC={menu:"aide",icon:"icon-barcode",label:sC,name:Up,mask:!0,inline:!0,event:[],rule(){return{type:Up,props:{value:"12345670",format:"CODE128"}}},props(e,{t}){return Be(t,"barCodeBox.props",[{type:"input",field:"value"},{type:"select",field:"format",options:[{label:"CODE39",value:"CODE39"},{label:"CODE128",value:"CODE128"},{label:"CODE128A",value:"CODE128A"},{label:"CODE128B",value:"CODE128B"},{label:"CODE128C",value:"CODE128C"},{label:"EAN13",value:"EAN13"},{label:"UPC",value:"UPC"},{label:"CODABAR",value:"CODABAR"}]},{type:"inputNumber",field:"width",value:2},{type:"inputNumber",field:"height",value:50},{type:"switch",field:"displayValue",value:!0},{type:"inputNumber",field:"fontSize",value:12},{type:"select",field:"textPosition",options:it(t,[{label:"top",value:"top"},{label:"bottom",value:"bottom"}])},{type:"select",field:"textAlign",options:it(t,[{label:"left",value:"left"},{label:"center",value:"center"},{label:"right",value:"right"}])},{type:"inputNumber",field:"textMargin",value:2},{type:"ColorInput",field:"background"},{type:"ColorInput",field:"lineColor"}])}},cC="\u5185\u5D4C\u7F51\u9875",Hp="iframeBox",uC={menu:"aide",icon:"icon-iframe",label:cC,name:Hp,mask:!0,event:["load"],rule(){return{type:Hp,props:{src:"https://github.com/xaboy/form-create"}}},props(e,{t}){return Be(t,"iframeBox.props",[{type:"input",field:"src"},{type:"select",field:"loading",value:"eager",options:it(t,[{label:"eager",value:"eager"},{label:"lazy",value:"lazy"}],"com.iframeBox.loadingOpt")}])}},fC="\u4E8C\u7EF4\u7801",Jd="qrCodeBox",pC={menu:"aide",icon:"icon-qrcode",label:fC,name:Jd,mask:!0,inline:!0,rule(){return{type:Jd,props:{data:"1234567890",width:150,height:150}}},props(e,{t}){return Be(t,Jd+".props",[{type:"input",field:"data"},{type:"input",field:"image"},{type:"inputNumber",field:"width"},{type:"inputNumber",field:"height"},{type:"select",field:"circleType",options:it(t,[{label:"square",value:"square"},{label:"dots",value:"dots"},{label:"rounded",value:"rounded"},{label:"classy",value:"classy"}],"com.qrCodeBox.circleTypeOpt")},{type:"ColorInput",field:"circleColor"}])}},hC="\u624B\u5199\u7B7E\u540D",Xd="signaturePad",mC={menu:"main",icon:"icon-sign",label:hC,name:Xd,input:!0,mask:!0,languageKey:["signaturePadTip","signaturePadTitle","reset","ok"],event:["change","remove"],rule({t:e}){return{type:Xd,field:We(),title:e("com.signaturePad.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,Xd+".props",[{type:"ColorInput",field:"penColor"}])}},gC="\u63D0\u53CA",Zd="elMention",vC={menu:"main",icon:"icon-mention",label:gC,name:Zd,input:!0,event:["search","select","blur","focus","change","input","clear"],validate:["string"],rule({t:e}){return{type:Zd,field:We(),title:e("com.elMention.name"),info:"",$required:!1,props:{options:[{label:"Fuphoenixes",value:"Fuphoenixes"},{label:"kooriookami",value:"kooriookami"},{label:"Jeremy",value:"Jeremy"},{label:"btea",value:"btea"}]}}},props(e,{t}){return Be(t,Zd+".props",[Pi(t,"props.options"),{type:"switch",field:"disabled"},{type:"switch",field:"clearable"},{type:"switch",field:"whole"},{type:"input",field:"placeholder"},{type:"select",field:"type",options:[{label:"input",value:"input"},{label:"textarea",value:"textarea"}]},{type:"FnInput",field:"checkIsWhole",props:{body:!0,button:!0,fnx:!0,args:[on(t)],name:"checkIsWhole"}},{type:"FnInput",field:"filterOption",props:{body:!0,button:!0,fnx:!0,args:[on(t)],name:"filterOption"}}])}},yC="\u5206\u6BB5\u63A7\u5236\u5668",qd="elSegmented",bC={menu:"main",icon:"icon-segmented",label:yC,name:qd,input:!0,event:["change"],validate:["string","number"],rule(){return{type:qd,field:We(),title:"",props:{options:["Mon","Tue","Wed","Thu","Fri","Sat","Sun"].map(e=>({label:e,value:e}))}}},props(e,{t}){return Be(t,qd+".props",[{type:"TableOptions",field:"options",title:t("props.options"),wrap:{show:!1},props:{column:[{label:"label",key:"label"},{value:!0,label:"value",key:"value"}],keyValue:"label"}},{type:"switch",field:"disabled"},{type:"switch",field:"block"},{type:"select",field:"size",options:it(t,[{label:"large",value:"large"},{label:"default",value:"default"},{label:"small",value:"small"}])}])}},wC="\u6807\u9898",Wp="fcTitle",CC={menu:"aide",icon:"icon-title",label:wC,name:Wp,event:[],rule({t:e}){return{type:"fcTitle",props:{title:e("props.title")}}},props(e,{t}){return Be(t,Wp+".props",[{type:"input",field:"title"},{type:"select",field:"size",value:"H2",options:[1,2,3,4,5,6].map(r=>({label:"H"+r,value:"h"+r}))},{type:"select",field:"align",options:it(t,[{label:"left",value:"left"},{label:"center",value:"center"},{label:"right",value:"right"}])}])}},_C="\u552F\u4E00\u503C",ec="fcId",EC={menu:"main",icon:"icon-input-id",label:_C,name:ec,input:!0,validate:!1,rule({t:e}){return{type:ec,field:We(),title:e("com.fcId.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,ec+".props",[{type:"input",field:"prefix"}])}},AC="\u7701\u5E02\u533A\u9009\u62E9\u5668",tc="fcCity",SC={menu:"main",icon:"icon-city",label:AC,name:tc,input:!0,event:["change"],validate:["array"],rule({t:e}){return{type:tc,field:We(),title:e("com.fcCity.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,tc+".props",[{type:"select",field:"level",value:3,options:[{label:"\u7701\u4F1A",value:1},{label:"\u7701\u4F1A/\u57CE\u5E02",value:2},{label:"\u7701\u4F1A/\u57CE\u5E02/\u533A\u57DF",value:3}]},{type:"switch",field:"disabled"},{type:"switch",field:"clearable"},{type:"FnInput",field:"filter",props:{body:!0,button:!0,fnx:!0,args:[on(t)],name:"filter"}},{type:"input",field:"api"}])}},xC={menu:"aide",icon:"icon-markdown",label:"Markdown",name:"markdown",rule(){return{type:"FcMarkdown",native:!0,props:{content:`### \u6807\u9898
+}`,handle(e){return{type:"div",class:"_fc-line-form",children:e.children}}},rule(){return{type:zp,props:{}}},props(){return[]}},qw="\u56FE\u7247",Gd="elImage",eC={menu:"aide",icon:"icon-image",label:qw,name:Gd,inline:!0,rule(){return{type:Gd,title:"",style:{width:"100px",height:"100px"},props:{src:"https://static.form-create.com/example.png"}}},props(e,{t}){return Be(t,Gd+".props",[{type:"input",field:"src"},{type:"TableOptions",field:"previewSrcList",props:{column:[{label:t("com.elImage.props.src"),key:"value"}],valueType:"string"}}])}},tC={menu:"layout",icon:"icon-flex",name:"fcFlex2",label:"\u76D2\u5B50\u5E03\u5C40",drag:!0,inside:!0,inline:!0,mask:!1,sfc(e){e.type="div"},actions:[{label:"com.fcFlex2.horizontal",handler(e){e.style||(e.style={}),e.style.display!=="flex"?(e.style.display="flex",e.style.flexDirection="row",e.style.justifyContent="center"):["column-reverse","column"].indexOf(e.style.flexDirection)>-1?e.style.alignItems="center":e.style.justifyContent="center"}},{label:"com.fcFlex2.vertical",handler(e){e.style||(e.style={}),e.style.display!=="flex"?(e.style.display="flex",e.style.flexDirection="row",e.style.alignItems="center"):["column-reverse","column"].indexOf(e.style.flexDirection)>-1?e.style.justifyContent="center":e.style.alignItems="center"}},{label:"com.fcFlex2.left",handler(e){e.style||(e.style={}),e.style.display!=="flex"?(e.style.display="flex",e.style.flexDirection="row",e.style.justifyContent="flex-start"):["column-reverse","column"].indexOf(e.style.flexDirection)>-1?e.style.alignItems="flex-start":e.style.justifyContent="flex-start"}},{label:"com.fcFlex2.right",handler(e){e.style||(e.style={}),e.style.display!=="flex"?(e.style.display="flex",e.style.flexDirection="row",e.style.justifyContent="flex-end"):["column-reverse","column"].indexOf(e.style.flexDirection)>-1?e.style.alignItems="flex-end":e.style.justifyContent="flex-end"}},{label:"com.fcFlex2.reset",handler(e){e.style?(delete e.style.flexDirection,delete e.style.justifyContent,delete e.style.alignContent,delete e.style.flexWrap,delete e.style.alignItems,e.style.display="flex"):e.style={}}}],rule(){return{type:"fcCell",style:{display:"block",width:"100%",height:"100px"},children:[]}},props(e,{t}){return[{type:"SizeInput",field:"formCreateStyle>width",title:t("style.width")},{type:"SizeInput",field:"formCreateStyle>height",title:t("style.height")}]}},nC="\u8868\u5355\u9879",Kd="elFormItem",iC={menu:"container",icon:"icon-form-item",label:nC,name:Kd,drag:!0,mask:!1,event:!1,rule({t:e}){return{type:Kd,props:{label:e("com.elFormItem.name")},children:[]}},props(e,{t}){return Be(t,Kd+".props",[{type:"input",field:"label"},{type:"SizeInput",field:"labelWidth"},{type:"select",field:"formCreateClass",title:t("form.labelPosition"),options:it(t,[{value:"fc-wrap-top",label:"top"},{value:"fc-wrap-left",label:"left"},{value:"fc-wrap-right",label:"right"}])},{type:"select",field:"size",options:it(t,[{label:"large",value:"large"},{label:"default",value:"default"},{label:"small",value:"small"}])}])}},rC="\u97F3\u9891\u64AD\u653E\u5668",Yd="audioBox",oC={menu:"aide",icon:"icon-audio",label:rC,name:Yd,mask:!1,event:["pause","play","ended"],rule(){return{type:Yd,props:{src:"https://static.form-create.com/res/demo.mp3",type:"audio/mpeg"}}},props(e,{t}){return Be(t,Yd+".props",[{type:"input",field:"src"},{type:"select",field:"type",options:[{label:"MP3",value:"audio/mpeg"},{label:"OGG",value:"audio/ogg"},{label:"AAC",value:"audio/aac"},{label:"WAV",value:"audio/wav"},{label:"WMA",value:"audio/x-ms-wma"},{label:"WEBA",value:"audio/webm"},{label:"FLAC",value:"audio/flac"},{label:"ALAC",value:"audio/x-alac"},{label:"AMR",value:"audio/amr"},{label:"MIDI",value:"audio/midi"}]},{type:"switch",field:"autoplay"},{type:"switch",field:"loop"},{type:"switch",field:"muted"},{type:"switch",field:"controls"},{type:"select",field:"preload",options:it(t,[{label:"auto",value:"auto"},{label:"metadata",value:"metadata"},{label:"none",value:"none"}],"com.audioBox.preloadOpt")}])}},aC="\u89C6\u9891\u64AD\u653E\u5668",Qd="videoBox",lC={menu:"aide",icon:"icon-video",label:aC,name:Qd,mask:!1,event:["pause","play","ended","error"],rule(){return{type:Qd,props:{src:"",type:"mp4"}}},props(e,{t}){return Be(t,Qd+".props",[{type:"input",field:"src"},{type:"select",field:"type",options:[{label:"mp4",value:"mp4"},{label:"mpegts",value:"mpegts"},{label:"m2ts",value:"m2ts"},{label:"flv",value:"flv"},{label:"mse",value:"mse"}]},{type:"switch",field:"autoplay"},{type:"switch",field:"controls",value:!0},{type:"switch",field:"isLive"},{type:"switch",field:"loop"},{type:"switch",field:"withCredentials",value:!0}])}},sC="\u5934\u50CF\u6846",Up="elAvatar",dC={menu:"aide",icon:"icon-avatar",label:sC,name:Up,mask:!0,inline:!0,event:[],rule(){return{type:Up,props:{fit:"cover",src:"https://static.form-create.com/example.png"}}},props(e,{t}){return Be(t,"elAvatar.props",[{type:"input",field:"src"},{type:"select",field:"shape",options:it(t,[{label:"circle",value:"circle"},{label:"square",value:"square"}])},{type:"select",field:"size",options:it(t,[{label:"large",value:"large"},{label:"default",value:"default"},{label:"small",value:"small"}])}])}},cC="\u6761\u5F62\u7801",Hp="barCodeBox",uC={menu:"aide",icon:"icon-barcode",label:cC,name:Hp,mask:!0,inline:!0,event:[],rule(){return{type:Hp,props:{value:"12345670",format:"CODE128"}}},props(e,{t}){return Be(t,"barCodeBox.props",[{type:"input",field:"value"},{type:"select",field:"format",options:[{label:"CODE39",value:"CODE39"},{label:"CODE128",value:"CODE128"},{label:"CODE128A",value:"CODE128A"},{label:"CODE128B",value:"CODE128B"},{label:"CODE128C",value:"CODE128C"},{label:"EAN13",value:"EAN13"},{label:"UPC",value:"UPC"},{label:"CODABAR",value:"CODABAR"}]},{type:"inputNumber",field:"width",value:2},{type:"inputNumber",field:"height",value:50},{type:"switch",field:"displayValue",value:!0},{type:"inputNumber",field:"fontSize",value:12},{type:"select",field:"textPosition",options:it(t,[{label:"top",value:"top"},{label:"bottom",value:"bottom"}])},{type:"select",field:"textAlign",options:it(t,[{label:"left",value:"left"},{label:"center",value:"center"},{label:"right",value:"right"}])},{type:"inputNumber",field:"textMargin",value:2},{type:"ColorInput",field:"background"},{type:"ColorInput",field:"lineColor"}])}},fC="\u5185\u5D4C\u7F51\u9875",Wp="iframeBox",pC={menu:"aide",icon:"icon-iframe",label:fC,name:Wp,mask:!0,event:["load"],rule(){return{type:Wp,props:{src:"https://github.com/xaboy/form-create"}}},props(e,{t}){return Be(t,"iframeBox.props",[{type:"input",field:"src"},{type:"select",field:"loading",value:"eager",options:it(t,[{label:"eager",value:"eager"},{label:"lazy",value:"lazy"}],"com.iframeBox.loadingOpt")}])}},hC="\u4E8C\u7EF4\u7801",Jd="qrCodeBox",mC={menu:"aide",icon:"icon-qrcode",label:hC,name:Jd,mask:!0,inline:!0,rule(){return{type:Jd,props:{data:"1234567890",width:150,height:150}}},props(e,{t}){return Be(t,Jd+".props",[{type:"input",field:"data"},{type:"input",field:"image"},{type:"inputNumber",field:"width"},{type:"inputNumber",field:"height"},{type:"select",field:"circleType",options:it(t,[{label:"square",value:"square"},{label:"dots",value:"dots"},{label:"rounded",value:"rounded"},{label:"classy",value:"classy"}],"com.qrCodeBox.circleTypeOpt")},{type:"ColorInput",field:"circleColor"}])}},gC="\u624B\u5199\u7B7E\u540D",Xd="signaturePad",vC={menu:"main",icon:"icon-sign",label:gC,name:Xd,input:!0,mask:!0,languageKey:["signaturePadTip","signaturePadTitle","reset","ok"],event:["change","remove"],rule({t:e}){return{type:Xd,field:We(),title:e("com.signaturePad.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,Xd+".props",[{type:"ColorInput",field:"penColor"}])}},yC="\u63D0\u53CA",Zd="elMention",bC={menu:"main",icon:"icon-mention",label:yC,name:Zd,input:!0,event:["search","select","blur","focus","change","input","clear"],validate:["string"],rule({t:e}){return{type:Zd,field:We(),title:e("com.elMention.name"),info:"",$required:!1,props:{options:[{label:"Fuphoenixes",value:"Fuphoenixes"},{label:"kooriookami",value:"kooriookami"},{label:"Jeremy",value:"Jeremy"},{label:"btea",value:"btea"}]}}},props(e,{t}){return Be(t,Zd+".props",[Pi(t,"props.options"),{type:"switch",field:"disabled"},{type:"switch",field:"clearable"},{type:"switch",field:"whole"},{type:"input",field:"placeholder"},{type:"select",field:"type",options:[{label:"input",value:"input"},{label:"textarea",value:"textarea"}]},{type:"FnInput",field:"checkIsWhole",props:{body:!0,button:!0,fnx:!0,args:[on(t)],name:"checkIsWhole"}},{type:"FnInput",field:"filterOption",props:{body:!0,button:!0,fnx:!0,args:[on(t)],name:"filterOption"}}])}},wC="\u5206\u6BB5\u63A7\u5236\u5668",qd="elSegmented",CC={menu:"main",icon:"icon-segmented",label:wC,name:qd,input:!0,event:["change"],validate:["string","number"],rule(){return{type:qd,field:We(),title:"",props:{options:["Mon","Tue","Wed","Thu","Fri","Sat","Sun"].map(e=>({label:e,value:e}))}}},props(e,{t}){return Be(t,qd+".props",[{type:"TableOptions",field:"options",title:t("props.options"),wrap:{show:!1},props:{column:[{label:"label",key:"label"},{value:!0,label:"value",key:"value"}],keyValue:"label"}},{type:"switch",field:"disabled"},{type:"switch",field:"block"},{type:"select",field:"size",options:it(t,[{label:"large",value:"large"},{label:"default",value:"default"},{label:"small",value:"small"}])}])}},_C="\u6807\u9898",Gp="fcTitle",EC={menu:"aide",icon:"icon-title",label:_C,name:Gp,event:[],rule({t:e}){return{type:"fcTitle",props:{title:e("props.title")}}},props(e,{t}){return Be(t,Gp+".props",[{type:"input",field:"title"},{type:"select",field:"size",value:"H2",options:[1,2,3,4,5,6].map(r=>({label:"H"+r,value:"h"+r}))},{type:"select",field:"align",options:it(t,[{label:"left",value:"left"},{label:"center",value:"center"},{label:"right",value:"right"}])}])}},SC="\u552F\u4E00\u503C",ec="fcId",AC={menu:"main",icon:"icon-input-id",label:SC,name:ec,input:!0,validate:!1,rule({t:e}){return{type:ec,field:We(),title:e("com.fcId.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,ec+".props",[{type:"input",field:"prefix"}])}},xC="\u7701\u5E02\u533A\u9009\u62E9\u5668",tc="fcCity",kC={menu:"main",icon:"icon-city",label:xC,name:tc,input:!0,event:["change"],validate:["array"],rule({t:e}){return{type:tc,field:We(),title:e("com.fcCity.name"),info:"",$required:!1,props:{}}},props(e,{t}){return Be(t,tc+".props",[{type:"select",field:"level",value:3,options:[{label:"\u7701\u4F1A",value:1},{label:"\u7701\u4F1A/\u57CE\u5E02",value:2},{label:"\u7701\u4F1A/\u57CE\u5E02/\u533A\u57DF",value:3}]},{type:"switch",field:"disabled"},{type:"switch",field:"clearable"},{type:"FnInput",field:"filter",props:{body:!0,button:!0,fnx:!0,args:[on(t)],name:"filter"}},{type:"input",field:"api"}])}},NC={menu:"aide",icon:"icon-markdown",label:"Markdown",name:"markdown",rule(){return{type:"FcMarkdown",native:!0,props:{content:`### \u6807\u9898
\u4F7F\u7528 # \u53F7\u521B\u5EFA\u6807\u9898
@@ -304,7 +304,7 @@ function hello() {
\`\`\`
\u7B2C\u4E00\u884C
\u7B2C\u4E09\u884C
\`\`\`
-`}}},props(e,{t}){return[{type:"HtmlEditor",field:"content",title:t("props.content"),props:{text:!0}}]}},kC="\u7EDF\u8BA1\u680F",tl="elStatistic",Gp=[Gb,Yb,Jb,vC,bC,Zb,zb,Hb,e1,n1,c1,Tp,a1,r1,Vp,s1,f1,C1,E1,S1,k1,J1,SC,P1,zw,EC,mC,kw,{menu:"main",icon:"icon-data-select",label:"\u5B50\u8868\u5355\u9009\u62E9\u5668",name:"fcDataSelect",drag:!0,input:!0,mask:!1,subForm:"scope",slot:[{name:"search",type:"fcInlineForm"},{name:"table",type:"dataTable"}],event:["change","clear"],validate:["object","array"],parseRule(e){e.children.forEach(t=>{t.slot==="search"?(delete t.slot,e.props.searchRule=t):t.slot==="table"&&(delete t.slot,e.props.tableRule=t)}),delete e.children},loadRule(e){e.children=[e.props.searchRule,e.props.tableRule],e.children[0].slot="search",e.children[1].slot="table",delete e.props.searchRule,delete e.props.tableRule},rule({t:e}){return{type:"fcDataSelect",field:We(),title:e("com.fcDataSelect.name"),info:"",$required:!1,props:{title:e("com.select.title"),labelKey:"name",valueKey:"name"}}},props(e,{t}){return Be(t,"select.props",[{type:"input",field:"title"},{type:"input",field:"labelKey",value:"label"},{type:"input",field:"valueKey",value:"value"},{type:"switch",field:"autoLoad"},{type:"switch",field:"multiple"},{type:"switch",field:"disabled"},{type:"switch",field:"clearable"},{type:"inputNumber",field:"multipleLimit",props:{min:0}},{type:"input",field:"placeholder"}])}},L1,z1,rw,fw,mw,_w,Ew,ww,Cw,vw,Gw,Yw,tC,T1,I1,Z1,CC,V1,sw,{menu:"aide",icon:"icon-statistic",label:kC,name:tl,inline:!0,easySlots:["prefix","suffix"],rule({t:e}){return{type:tl,props:{value:99e3,title:e("com."+tl+".name")}}},props(e,{t}){return Be(t,tl+".props",[{type:"inputNumber",field:"value"},{type:"input",field:"title"},{type:"input",field:"prefix"},{type:"input",field:"suffix"}])}},b1,Tw,Vw,Bw,Zw,iC,oC,lC,dC,uC,pC,xC,{menu:"chart",icon:"icon-chart-line",label:"\u6298\u7EBF\u56FE",name:"lineChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"line",config:{category:["Mon","Tue","Wed","Thu","Fri","Sat","Sun"],series:[{name:"Email",data:[120,132,101,134,90,230,210]},{name:"Union Ads",data:[220,182,191,234,290,330,310]},{name:"Video Ads",data:[150,232,201,154,190,330,410]},{name:"Direct",data:[320,332,301,334,390,330,320]},{name:"Search Engine",data:[820,932,901,934,1290,1330,1320]}]}}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.config",t("com.lineChart.data")),{type:"input",field:"title"},{type:"input",field:"subtitle"},{type:"input",field:"valueFormat",value:"{value}"},{type:"switch",field:"stack"},{type:"switch",field:"smooth"},{type:"switch",field:"showLegend",value:!0},{type:"switch",field:"showSeriesLabel"}])}},{menu:"chart",icon:"icon-chart-area",label:"\u4F53\u79EF\u56FE",name:"areaChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"area",config:{category:["Mon","Tue","Wed","Thu","Fri","Sat","Sun"],series:[{name:"Email",data:[120,132,101,134,90,230,210]},{name:"Union Ads",data:[220,182,191,234,290,330,310]},{name:"Video Ads",data:[150,232,201,154,190,330,410]},{name:"Direct",data:[320,332,301,334,390,330,320]},{name:"Search Engine",data:[820,932,901,934,1290,1330,1320]}]}}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.config",t("com.lineChart.data")),{type:"input",field:"title"},{type:"input",field:"subtitle"},{type:"input",field:"valueFormat",value:"{value}"},{type:"switch",field:"stack"},{type:"switch",field:"smooth"},{type:"switch",field:"showLegend",value:!0},{type:"switch",field:"showSeriesLabel"}])}},{menu:"chart",icon:"icon-chart-bar",label:"\u67F1\u72B6\u56FE",name:"barChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"bar",config:{category:["Mon","Tue","Wed","Thu","Fri","Sat","Sun"],series:[{name:"Direct",data:[320,332,301,334,390,330,320]}]}}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.config",t("com.lineChart.data")),{type:"input",field:"title"},{type:"input",field:"subtitle"},{type:"input",field:"valueFormat",value:"{value}"},{type:"ColorInput",field:"barBackgroundColor"},{type:"switch",field:"stack"},{type:"switch",field:"showLegend",value:!0},{type:"switch",field:"showSeriesLabel"}])}},{menu:"chart",icon:"icon-chart-stripe",label:"\u6761\u5F62\u56FE",name:"stripeChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"bar",stripe:!0,config:{category:["Mon","Tue","Wed","Thu","Fri","Sat","Sun"],series:[{name:"Direct",data:[320,332,301,334,390,330,320]},{name:"Direct2",data:[320,332,301,334,390,330,320]}]}}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.config",t("com.lineChart.data")),{type:"input",field:"title"},{type:"input",field:"subtitle"},{type:"input",field:"valueFormat",value:"{value}"},{type:"ColorInput",field:"barBackgroundColor"},{type:"switch",field:"stack"},{type:"switch",field:"showLegend",value:!0},{type:"switch",field:"showSeriesLabel"}])}},{menu:"chart",icon:"icon-chart-pie",label:"\u997C\u56FE",name:"pieChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"pie",data:[{value:1048,name:"Search Engine"},{value:735,name:"Direct"},{value:580,name:"Email"},{value:484,name:"Union Num"},{value:300,name:"Video Num"}]}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.data",t("com.lineChart.data")),{type:"input",field:"title"},{type:"input",field:"subtitle"},{type:"select",field:"pieType",options:it(t,[{label:"pie",value:"pie"},{label:"doughnut",value:"doughnut"},{label:"half-doughnut",value:"half-doughnut"}],"com.lineChart.pieTypeOpt")},{type:"switch",field:"showLegend",value:!0}])}},{menu:"chart",icon:"icon-chart-funnel",label:"\u6F0F\u6597\u56FE",name:"funnelChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"funnel",data:[{value:60,name:"Visit"},{value:40,name:"Inquiry"},{value:20,name:"Order"},{value:80,name:"Click"},{value:100,name:"Show"}]}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.data",t("com.lineChart.data")),{type:"input",field:"title"},{type:"input",field:"subtitle"},{type:"select",field:"funnelSort",options:it(t,[{label:"descending",value:"descending"},{label:"ascending",value:"ascending"}],"com.lineChart.funnelSortOpt"),value:"descending"},{type:"switch",field:"showLegend",value:!0}])}},{menu:"chart",icon:"icon-chart-gauge",label:"\u4EEA\u8868\u76D8",name:"gaugeChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"gauge",value:50}}},props(e,{t}){return Be(t,"lineChart.props",[{type:"inputNumber",field:"value"},{type:"input",field:"title"},{type:"input",field:"subtitle"},{type:"inputNumber",field:"min"},{type:"inputNumber",field:"max"}])}},{menu:"chart",icon:"icon-chart-radar",label:"\u96F7\u8FBE\u56FE",name:"radarChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"radar",indicator:[{name:"Sales",max:6500},{name:"Administration",max:16e3},{name:"Information Technology",max:3e4},{name:"Customer Support",max:38e3},{name:"Development",max:52e3},{name:"Marketing",max:25e3}],data:[{value:[4200,3e3,2e4,35e3,5e4,18e3],name:"Allocated Budget"},{value:[5e3,14e3,28e3,26e3,42e3,21e3],name:"Actual Spending"}]}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.data",t("com.lineChart.data")),{type:"TableOptions",field:"indicator",props:{column:[{label:t("props.name"),key:"name"},{label:t("com.lineChart.props.max"),key:"max"}]}},{type:"input",field:"title"},{type:"input",field:"subtitle"},{type:"switch",field:"showLegend",value:!0},{type:"switch",field:"showSeriesLabel"}])}},{menu:"chart",icon:"icon-chart-scatter",label:"\u6563\u70B9\u56FE",name:"scatterChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"scatter",data:[[[161.2,51.6],[167.5,59],[159.5,49.2],[157,63],[155.8,53.6],[170,59],[159.1,47.6],[166,69.8],[176.2,66.8],[160.2,75.2]],[[172.5,55.2],[170.9,54.2],[172.9,62.5],[153.4,42],[160,50],[147.2,49.8],[168.2,49.2],[175,73.2],[157,47.8],[167.6,68.8]]]}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.data",t("com.lineChart.data")),{type:"input",field:"title"},{type:"input",field:"subtitle"}])}},{menu:"chart",icon:"icon-chart-custom",label:"\u81EA\u5B9A\u4E49\u56FE\u8868",name:"customChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",style:{height:"500px"},props:{type:"custom",config:{builderJson:{all:10887,charts:{map:3237,lines:2164,bar:7561,line:7778,pie:7355,scatter:2405,candlestick:1842,radar:2090,heatmap:1762,treemap:1593,graph:2060,boxplot:1537,parallel:1908,gauge:2107,funnel:1692,sankey:1568},components:{geo:2788,title:9575,legend:9400,tooltip:9466,grid:9266,markPoint:3419,markLine:2984,timeline:2739,dataZoom:2744,visualMap:2466,toolbox:3034,polar:1945},ie:9743},downloadJson:{"echarts.min.js":17365,"echarts.simple.min.js":4079,"echarts.common.min.js":6929,"echarts.js":14890},themeJson:{"dark.js":1594,"infographic.js":925,"shine.js":1608,"roma.js":721,"macarons.js":2179,"vintage.js":1982}},loadOptions:`$FNX:const builderJson = $inject.args[0]?.builderJson;
+`}}},props(e,{t}){return[{type:"HtmlEditor",field:"content",title:t("props.content"),props:{text:!0}}]}},TC="\u7EDF\u8BA1\u680F",tl="elStatistic",Kp=[Yb,Jb,Zb,bC,CC,e1,Hb,Gb,n1,r1,f1,Dp,s1,a1,Op,c1,h1,E1,A1,k1,T1,Z1,kC,L1,Hw,AC,vC,Tw,{menu:"main",icon:"icon-data-select",label:"\u5B50\u8868\u5355\u9009\u62E9\u5668",name:"fcDataSelect",drag:!0,input:!0,mask:!1,subForm:"scope",slot:[{name:"search",type:"fcInlineForm"},{name:"table",type:"dataTable"}],event:["change","clear"],validate:["object","array"],parseRule(e){e.children.forEach(t=>{t.slot==="search"?(delete t.slot,e.props.searchRule=t):t.slot==="table"&&(delete t.slot,e.props.tableRule=t)}),delete e.children},loadRule(e){e.children=[e.props.searchRule,e.props.tableRule],e.children[0].slot="search",e.children[1].slot="table",delete e.props.searchRule,delete e.props.tableRule},rule({t:e}){return{type:"fcDataSelect",field:We(),title:e("com.fcDataSelect.name"),info:"",$required:!1,props:{title:e("com.select.title"),labelKey:"name",valueKey:"name"}}},props(e,{t}){return Be(t,"select.props",[{type:"input",field:"title"},{type:"input",field:"labelKey",value:"label"},{type:"input",field:"valueKey",value:"value"},{type:"switch",field:"autoLoad"},{type:"switch",field:"multiple"},{type:"switch",field:"disabled"},{type:"switch",field:"clearable"},{type:"inputNumber",field:"multipleLimit",props:{min:0}},{type:"input",field:"placeholder"}])}},z1,H1,aw,hw,vw,Sw,Aw,_w,Ew,bw,Yw,Jw,iC,V1,P1,ew,EC,B1,cw,{menu:"aide",icon:"icon-statistic",label:TC,name:tl,inline:!0,easySlots:["prefix","suffix"],rule({t:e}){return{type:tl,props:{value:99e3,title:e("com."+tl+".name")}}},props(e,{t}){return Be(t,tl+".props",[{type:"inputNumber",field:"value"},{type:"input",field:"title"},{type:"input",field:"prefix"},{type:"input",field:"suffix"}])}},C1,Vw,Bw,$w,eC,oC,lC,dC,uC,pC,mC,NC,{menu:"chart",icon:"icon-chart-line",label:"\u6298\u7EBF\u56FE",name:"lineChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"line",config:{category:["Mon","Tue","Wed","Thu","Fri","Sat","Sun"],series:[{name:"Email",data:[120,132,101,134,90,230,210]},{name:"Union Ads",data:[220,182,191,234,290,330,310]},{name:"Video Ads",data:[150,232,201,154,190,330,410]},{name:"Direct",data:[320,332,301,334,390,330,320]},{name:"Search Engine",data:[820,932,901,934,1290,1330,1320]}]}}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.config",t("com.lineChart.data")),{type:"input",field:"title"},{type:"input",field:"subtitle"},{type:"input",field:"valueFormat",value:"{value}"},{type:"switch",field:"stack"},{type:"switch",field:"smooth"},{type:"switch",field:"showLegend",value:!0},{type:"switch",field:"showSeriesLabel"}])}},{menu:"chart",icon:"icon-chart-area",label:"\u4F53\u79EF\u56FE",name:"areaChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"area",config:{category:["Mon","Tue","Wed","Thu","Fri","Sat","Sun"],series:[{name:"Email",data:[120,132,101,134,90,230,210]},{name:"Union Ads",data:[220,182,191,234,290,330,310]},{name:"Video Ads",data:[150,232,201,154,190,330,410]},{name:"Direct",data:[320,332,301,334,390,330,320]},{name:"Search Engine",data:[820,932,901,934,1290,1330,1320]}]}}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.config",t("com.lineChart.data")),{type:"input",field:"title"},{type:"input",field:"subtitle"},{type:"input",field:"valueFormat",value:"{value}"},{type:"switch",field:"stack"},{type:"switch",field:"smooth"},{type:"switch",field:"showLegend",value:!0},{type:"switch",field:"showSeriesLabel"}])}},{menu:"chart",icon:"icon-chart-bar",label:"\u67F1\u72B6\u56FE",name:"barChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"bar",config:{category:["Mon","Tue","Wed","Thu","Fri","Sat","Sun"],series:[{name:"Direct",data:[320,332,301,334,390,330,320]}]}}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.config",t("com.lineChart.data")),{type:"input",field:"title"},{type:"input",field:"subtitle"},{type:"input",field:"valueFormat",value:"{value}"},{type:"ColorInput",field:"barBackgroundColor"},{type:"switch",field:"stack"},{type:"switch",field:"showLegend",value:!0},{type:"switch",field:"showSeriesLabel"}])}},{menu:"chart",icon:"icon-chart-stripe",label:"\u6761\u5F62\u56FE",name:"stripeChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"bar",stripe:!0,config:{category:["Mon","Tue","Wed","Thu","Fri","Sat","Sun"],series:[{name:"Direct",data:[320,332,301,334,390,330,320]},{name:"Direct2",data:[320,332,301,334,390,330,320]}]}}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.config",t("com.lineChart.data")),{type:"input",field:"title"},{type:"input",field:"subtitle"},{type:"input",field:"valueFormat",value:"{value}"},{type:"ColorInput",field:"barBackgroundColor"},{type:"switch",field:"stack"},{type:"switch",field:"showLegend",value:!0},{type:"switch",field:"showSeriesLabel"}])}},{menu:"chart",icon:"icon-chart-pie",label:"\u997C\u56FE",name:"pieChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"pie",data:[{value:1048,name:"Search Engine"},{value:735,name:"Direct"},{value:580,name:"Email"},{value:484,name:"Union Num"},{value:300,name:"Video Num"}]}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.data",t("com.lineChart.data")),{type:"input",field:"title"},{type:"input",field:"subtitle"},{type:"select",field:"pieType",options:it(t,[{label:"pie",value:"pie"},{label:"doughnut",value:"doughnut"},{label:"half-doughnut",value:"half-doughnut"}],"com.lineChart.pieTypeOpt")},{type:"switch",field:"showLegend",value:!0}])}},{menu:"chart",icon:"icon-chart-funnel",label:"\u6F0F\u6597\u56FE",name:"funnelChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"funnel",data:[{value:60,name:"Visit"},{value:40,name:"Inquiry"},{value:20,name:"Order"},{value:80,name:"Click"},{value:100,name:"Show"}]}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.data",t("com.lineChart.data")),{type:"input",field:"title"},{type:"input",field:"subtitle"},{type:"select",field:"funnelSort",options:it(t,[{label:"descending",value:"descending"},{label:"ascending",value:"ascending"}],"com.lineChart.funnelSortOpt"),value:"descending"},{type:"switch",field:"showLegend",value:!0}])}},{menu:"chart",icon:"icon-chart-gauge",label:"\u4EEA\u8868\u76D8",name:"gaugeChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"gauge",value:50}}},props(e,{t}){return Be(t,"lineChart.props",[{type:"inputNumber",field:"value"},{type:"input",field:"title"},{type:"input",field:"subtitle"},{type:"inputNumber",field:"min"},{type:"inputNumber",field:"max"}])}},{menu:"chart",icon:"icon-chart-radar",label:"\u96F7\u8FBE\u56FE",name:"radarChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"radar",indicator:[{name:"Sales",max:6500},{name:"Administration",max:16e3},{name:"Information Technology",max:3e4},{name:"Customer Support",max:38e3},{name:"Development",max:52e3},{name:"Marketing",max:25e3}],data:[{value:[4200,3e3,2e4,35e3,5e4,18e3],name:"Allocated Budget"},{value:[5e3,14e3,28e3,26e3,42e3,21e3],name:"Actual Spending"}]}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.data",t("com.lineChart.data")),{type:"TableOptions",field:"indicator",props:{column:[{label:t("props.name"),key:"name"},{label:t("com.lineChart.props.max"),key:"max"}]}},{type:"input",field:"title"},{type:"input",field:"subtitle"},{type:"switch",field:"showLegend",value:!0},{type:"switch",field:"showSeriesLabel"}])}},{menu:"chart",icon:"icon-chart-scatter",label:"\u6563\u70B9\u56FE",name:"scatterChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",props:{type:"scatter",data:[[[161.2,51.6],[167.5,59],[159.5,49.2],[157,63],[155.8,53.6],[170,59],[159.1,47.6],[166,69.8],[176.2,66.8],[160.2,75.2]],[[172.5,55.2],[170.9,54.2],[172.9,62.5],[153.4,42],[160,50],[147.2,49.8],[168.2,49.2],[175,73.2],[157,47.8],[167.6,68.8]]]}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.data",t("com.lineChart.data")),{type:"input",field:"title"},{type:"input",field:"subtitle"}])}},{menu:"chart",icon:"icon-chart-custom",label:"\u81EA\u5B9A\u4E49\u56FE\u8868",name:"customChart",mask:!1,event:["beforeLoad","loaded","click"],rule(){return{type:"fcEcharts",style:{height:"500px"},props:{type:"custom",config:{builderJson:{all:10887,charts:{map:3237,lines:2164,bar:7561,line:7778,pie:7355,scatter:2405,candlestick:1842,radar:2090,heatmap:1762,treemap:1593,graph:2060,boxplot:1537,parallel:1908,gauge:2107,funnel:1692,sankey:1568},components:{geo:2788,title:9575,legend:9400,tooltip:9466,grid:9266,markPoint:3419,markLine:2984,timeline:2739,dataZoom:2744,visualMap:2466,toolbox:3034,polar:1945},ie:9743},downloadJson:{"echarts.min.js":17365,"echarts.simple.min.js":4079,"echarts.common.min.js":6929,"echarts.js":14890},themeJson:{"dark.js":1594,"infographic.js":925,"shine.js":1608,"roma.js":721,"macarons.js":2179,"vintage.js":1982}},loadOptions:`$FNX:const builderJson = $inject.args[0]?.builderJson;
const downloadJson = $inject.args[0]?.downloadJson;
const themeJson = $inject.args[0]?.themeJson;
const waterMarkText = 'ECHARTS';
@@ -486,55 +486,55 @@ value: themeJson[key]
})
}
]
-};`}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.config",t("com.lineChart.data")),{type:"FnInput",field:"loadOptions",props:{body:!0,button:!0,fnx:!0,args:[on(t)],name:"loadOptions"}}])}},h1,cw,Jw,qw,Aw,Sw,R1,O1,H1,G1,nw,Uw,Hw,Iw,Fw,Pw,Rw,$w,m1,v1,Y1,ew,aw];function NC(e){return{icon:e.field?"icon-input":"icon-cell",label:e.field||e.type,name:"_",mask:!0,handleBtn:["delete"],rule(){return e},props(){return[]}}}/**!
+};`}}},props(e,{t}){return Be(t,"lineChart.props",[Ln(t,"props.config",t("com.lineChart.data")),{type:"FnInput",field:"loadOptions",props:{body:!0,button:!0,fnx:!0,args:[on(t)],name:"loadOptions"}}])}},g1,fw,Zw,tC,xw,kw,I1,R1,G1,Y1,rw,Ww,Gw,Pw,Mw,Lw,Iw,Fw,v1,b1,J1,nw,sw];function DC(e){return{icon:e.field?"icon-input":"icon-cell",label:e.field||e.type,name:"_",mask:!0,handleBtn:["delete"],rule(){return e},props(){return[]}}}/**!
* Sortable 1.14.0
* @author RubaXa
* @author owenm
* @license MIT
- */function Kp(e,t){var r=Object.keys(e);if(Object.getOwnPropertySymbols){var o=Object.getOwnPropertySymbols(e);t&&(o=o.filter(function(i){return Object.getOwnPropertyDescriptor(e,i).enumerable})),r.push.apply(r,o)}return r}function ci(e){for(var t=1;t=0)&&(r[i]=e[i]);return r}function VC(e,t){if(e==null)return{};var r=DC(e,t),o,i;if(Object.getOwnPropertySymbols){var l=Object.getOwnPropertySymbols(e);for(i=0;i=0)&&(!Object.prototype.propertyIsEnumerable.call(e,o)||(r[o]=e[o]))}return r}var OC="1.14.0";function Ai(e){if(typeof window<"u"&&window.navigator)return!!navigator.userAgent.match(e)}var Si=Ai(/(?:Trident.*rv[ :]?11\.|msie|iemobile|Windows Phone)/i),Bo=Ai(/Edge/i),Yp=Ai(/firefox/i),Ro=Ai(/safari/i)&&!Ai(/chrome/i)&&!Ai(/android/i),Qp=Ai(/iP(ad|od|hone)/i),BC=Ai(/chrome/i)&&Ai(/android/i),Jp={capture:!1,passive:!1};function _t(e,t,r){e.addEventListener(t,r,!Si&&Jp)}function vt(e,t,r){e.removeEventListener(t,r,!Si&&Jp)}function il(e,t){if(!!t){if(t[0]===">"&&(t=t.substring(1)),e)try{if(e.matches)return e.matches(t);if(e.msMatchesSelector)return e.msMatchesSelector(t);if(e.webkitMatchesSelector)return e.webkitMatchesSelector(t)}catch{return!1}return!1}}function RC(e){return e.host&&e!==document&&e.host.nodeType?e.host:e.parentNode}function ui(e,t,r,o){if(e){r=r||document;do{if(t!=null&&(t[0]===">"?e.parentNode===r&&il(e,t):il(e,t))||o&&e===r)return e;if(e===r)break}while(e=RC(e))}return null}var Xp=/\s+/g;function On(e,t,r){if(e&&t)if(e.classList)e.classList[r?"add":"remove"](t);else{var o=(" "+e.className+" ").replace(Xp," ").replace(" "+t+" "," ");e.className=(o+(r?" "+t:"")).replace(Xp," ")}}function lt(e,t,r){var o=e&&e.style;if(o){if(r===void 0)return document.defaultView&&document.defaultView.getComputedStyle?r=document.defaultView.getComputedStyle(e,""):e.currentStyle&&(r=e.currentStyle),t===void 0?r:r[t];!(t in o)&&t.indexOf("webkit")===-1&&(t="-webkit-"+t),o[t]=r+(typeof r=="string"?"":"px")}}function Ir(e,t){var r="";if(typeof e=="string")r=e;else do{var o=lt(e,"transform");o&&o!=="none"&&(r=o+" "+r)}while(!t&&(e=e.parentNode));var i=window.DOMMatrix||window.WebKitCSSMatrix||window.CSSMatrix||window.MSCSSMatrix;return i&&new i(r)}function Zp(e,t,r){if(e){var o=e.getElementsByTagName(t),i=0,l=o.length;if(r)for(;i=l:d=i<=l,!d)return o;if(o===fi())break;o=Mi(o,!1)}return!1}function Fr(e,t,r,o){for(var i=0,l=0,d=e.children;l2&&arguments[2]!==void 0?arguments[2]:{},i=o.evt,l=VC(o,zC);Io.pluginEvent.bind(st)(t,r,ci({dragEl:je,parentEl:Mt,ghostEl:ut,rootEl:Bt,nextEl:ar,lastDownEl:rl,cloneEl:Lt,cloneHidden:Li,dragStarted:Po,putSortable:an,activeSortable:st.active,originalEvent:i,oldIndex:Mr,oldDraggableIndex:Fo,newIndex:Rn,newDraggableIndex:ji,hideGhostForTarget:ch,unhideGhostForTarget:uh,cloneNowHidden:function(){Li=!0},cloneNowShown:function(){Li=!1},dispatchSortableEvent:function(c){hn({sortable:r,name:c,originalEvent:i})}},l))};function hn(e){jC(ci({putSortable:an,cloneEl:Lt,targetEl:je,rootEl:Bt,oldIndex:Mr,oldDraggableIndex:Fo,newIndex:Rn,newDraggableIndex:ji},e))}var je,Mt,ut,Bt,ar,rl,Lt,Li,Mr,Rn,Fo,ji,ol,an,Lr=!1,al=!1,ll=[],lr,Jn,oc,ac,rh,oh,Po,jr,Mo,Lo=!1,sl=!1,dl,cn,lc=[],sc=!1,cl=[],ul=typeof document<"u",fl=Qp,ah=Bo||Si?"cssFloat":"float",UC=ul&&!BC&&!Qp&&"draggable"in document.createElement("div"),lh=function(){if(!!ul){if(Si)return!1;var e=document.createElement("x");return e.style.cssText="pointer-events:auto",e.style.pointerEvents==="auto"}}(),sh=function(t,r){var o=lt(t),i=parseInt(o.width)-parseInt(o.paddingLeft)-parseInt(o.paddingRight)-parseInt(o.borderLeftWidth)-parseInt(o.borderRightWidth),l=Fr(t,0,r),d=Fr(t,1,r),c=l&<(l),u=d&<(d),h=c&&parseInt(c.marginLeft)+parseInt(c.marginRight)+Qt(l).width,m=u&&parseInt(u.marginLeft)+parseInt(u.marginRight)+Qt(d).width;if(o.display==="flex")return o.flexDirection==="column"||o.flexDirection==="column-reverse"?"vertical":"horizontal";if(o.display==="grid")return o.gridTemplateColumns.split(" ").length<=1?"vertical":"horizontal";if(l&&c.float&&c.float!=="none"){var y=c.float==="left"?"left":"right";return d&&(u.clear==="both"||u.clear===y)?"vertical":"horizontal"}return l&&(c.display==="block"||c.display==="flex"||c.display==="table"||c.display==="grid"||h>=i&&o[ah]==="none"||d&&o[ah]==="none"&&h+m>i)?"vertical":"horizontal"},HC=function(t,r,o){var i=o?t.left:t.top,l=o?t.right:t.bottom,d=o?t.width:t.height,c=o?r.left:r.top,u=o?r.right:r.bottom,h=o?r.width:r.height;return i===c||l===u||i+d/2===c+h/2},WC=function(t,r){var o;return ll.some(function(i){var l=i[Bn].options.emptyInsertThreshold;if(!(!l||nc(i))){var d=Qt(i),c=t>=d.left-l&&t<=d.right+l,u=r>=d.top-l&&r<=d.bottom+l;if(c&&u)return o=i}}),o},dh=function(t){function r(l,d){return function(c,u,h,m){var y=c.options.group.name&&u.options.group.name&&c.options.group.name===u.options.group.name;if(l==null&&(d||y))return!0;if(l==null||l===!1)return!1;if(d&&l==="clone")return l;if(typeof l=="function")return r(l(c,u,h,m),d)(c,u,h,m);var C=(d?c:u).options.group.name;return l===!0||typeof l=="string"&&l===C||l.join&&l.indexOf(C)>-1}}var o={},i=t.group;(!i||nl(i)!="object")&&(i={name:i}),o.name=i.name,o.checkPull=r(i.pull,!0),o.checkPut=r(i.put),o.revertClone=i.revertClone,t.group=o},ch=function(){!lh&&ut&<(ut,"display","none")},uh=function(){!lh&&ut&<(ut,"display","")};ul&&document.addEventListener("click",function(e){if(al)return e.preventDefault(),e.stopPropagation&&e.stopPropagation(),e.stopImmediatePropagation&&e.stopImmediatePropagation(),al=!1,!1},!0);var sr=function(t){if(je){t=t.touches?t.touches[0]:t;var r=WC(t.clientX,t.clientY);if(r){var o={};for(var i in t)t.hasOwnProperty(i)&&(o[i]=t[i]);o.target=o.rootEl=r,o.preventDefault=void 0,o.stopPropagation=void 0,r[Bn]._onDragOver(o)}}},GC=function(t){je&&je.parentNode[Bn]._isOutsideThisEl(t.target)};function st(e,t){if(!(e&&e.nodeType&&e.nodeType===1))throw"Sortable: `el` must be an HTMLElement, not ".concat({}.toString.call(e));this.el=e,this.options=t=Ei({},t),e[Bn]=this;var r={group:null,sort:!0,disabled:!1,store:null,handle:null,draggable:/^[uo]l$/i.test(e.nodeName)?">li":">*",swapThreshold:1,invertSwap:!1,invertedSwapThreshold:null,removeCloneOnHide:!0,direction:function(){return sh(e,this.options)},ghostClass:"sortable-ghost",chosenClass:"sortable-chosen",dragClass:"sortable-drag",ignore:"a, img",filter:null,preventOnFilter:!0,animation:0,easing:null,setData:function(d,c){d.setData("Text",c.textContent)},dropBubble:!1,dragoverBubble:!1,dataIdAttr:"data-id",delay:0,delayOnTouchOnly:!1,touchStartThreshold:(Number.parseInt?Number:window).parseInt(window.devicePixelRatio,10)||1,forceFallback:!1,fallbackClass:"sortable-fallback",fallbackOnBody:!1,fallbackTolerance:0,fallbackOffset:{x:0,y:0},supportPointer:st.supportPointer!==!1&&"PointerEvent"in window&&!Ro,emptyInsertThreshold:5};Io.initializePlugins(this,e,r);for(var o in r)!(o in t)&&(t[o]=r[o]);dh(t);for(var i in this)i.charAt(0)==="_"&&typeof this[i]=="function"&&(this[i]=this[i].bind(this));this.nativeDraggable=t.forceFallback?!1:UC,this.nativeDraggable&&(this.options.touchStartThreshold=1),t.supportPointer?_t(e,"pointerdown",this._onTapStart):(_t(e,"mousedown",this._onTapStart),_t(e,"touchstart",this._onTapStart)),this.nativeDraggable&&(_t(e,"dragover",this),_t(e,"dragenter",this)),ll.push(this.el),t.store&&t.store.get&&this.sort(t.store.get(this)||[]),Ei(this,PC())}st.prototype={constructor:st,_isOutsideThisEl:function(t){!this.el.contains(t)&&t!==this.el&&(jr=null)},_getDirection:function(t,r){return typeof this.options.direction=="function"?this.options.direction.call(this,t,r,je):this.options.direction},_onTapStart:function(t){if(!!t.cancelable){var r=this,o=this.el,i=this.options,l=i.preventOnFilter,d=t.type,c=t.touches&&t.touches[0]||t.pointerType&&t.pointerType==="touch"&&t,u=(c||t).target,h=t.target.shadowRoot&&(t.path&&t.path[0]||t.composedPath&&t.composedPath()[0])||u,m=i.filter;if(e_(o),!je&&!(/mousedown|pointerdown/.test(d)&&t.button!==0||i.disabled)&&!h.isContentEditable&&!(!this.nativeDraggable&&Ro&&u&&u.tagName.toUpperCase()==="SELECT")&&(u=ui(u,i.draggable,o,!1),!(u&&u.animated)&&rl!==u)){if(Mr=jn(u),Fo=jn(u,i.draggable),typeof m=="function"){if(m.call(this,t,u,this)){hn({sortable:r,rootEl:h,name:"filter",targetEl:u,toEl:o,fromEl:o}),An("filter",r,{evt:t}),l&&t.cancelable&&t.preventDefault();return}}else if(m&&(m=m.split(",").some(function(y){if(y=ui(h,y.trim(),o,!1),y)return hn({sortable:r,rootEl:y,name:"filter",targetEl:u,fromEl:o,toEl:o}),An("filter",r,{evt:t}),!0}),m)){l&&t.cancelable&&t.preventDefault();return}i.handle&&!ui(h,i.handle,o,!1)||this._prepareDragStart(t,c,u)}}},_prepareDragStart:function(t,r,o){var i=this,l=i.el,d=i.options,c=l.ownerDocument,u;if(o&&!je&&o.parentNode===l){var h=Qt(o);if(Bt=l,je=o,Mt=je.parentNode,ar=je.nextSibling,rl=o,ol=d.group,st.dragged=je,lr={target:je,clientX:(r||t).clientX,clientY:(r||t).clientY},rh=lr.clientX-h.left,oh=lr.clientY-h.top,this._lastX=(r||t).clientX,this._lastY=(r||t).clientY,je.style["will-change"]="all",u=function(){if(An("delayEnded",i,{evt:t}),st.eventCanceled){i._onDrop();return}i._disableDelayedDragEvents(),!Yp&&i.nativeDraggable&&(je.draggable=!0),i._triggerDragStart(t,r),hn({sortable:i,name:"choose",originalEvent:t}),On(je,d.chosenClass,!0)},d.ignore.split(",").forEach(function(m){Zp(je,m.trim(),dc)}),_t(c,"dragover",sr),_t(c,"mousemove",sr),_t(c,"touchmove",sr),_t(c,"mouseup",i._onDrop),_t(c,"touchend",i._onDrop),_t(c,"touchcancel",i._onDrop),Yp&&this.nativeDraggable&&(this.options.touchStartThreshold=4,je.draggable=!0),An("delayStart",this,{evt:t}),d.delay&&(!d.delayOnTouchOnly||r)&&(!this.nativeDraggable||!(Bo||Si))){if(st.eventCanceled){this._onDrop();return}_t(c,"mouseup",i._disableDelayedDrag),_t(c,"touchend",i._disableDelayedDrag),_t(c,"touchcancel",i._disableDelayedDrag),_t(c,"mousemove",i._delayedDragTouchMoveHandler),_t(c,"touchmove",i._delayedDragTouchMoveHandler),d.supportPointer&&_t(c,"pointermove",i._delayedDragTouchMoveHandler),i._dragStartTimer=setTimeout(u,d.delay)}else u()}},_delayedDragTouchMoveHandler:function(t){var r=t.touches?t.touches[0]:t;Math.max(Math.abs(r.clientX-this._lastX),Math.abs(r.clientY-this._lastY))>=Math.floor(this.options.touchStartThreshold/(this.nativeDraggable&&window.devicePixelRatio||1))&&this._disableDelayedDrag()},_disableDelayedDrag:function(){je&&dc(je),clearTimeout(this._dragStartTimer),this._disableDelayedDragEvents()},_disableDelayedDragEvents:function(){var t=this.el.ownerDocument;vt(t,"mouseup",this._disableDelayedDrag),vt(t,"touchend",this._disableDelayedDrag),vt(t,"touchcancel",this._disableDelayedDrag),vt(t,"mousemove",this._delayedDragTouchMoveHandler),vt(t,"touchmove",this._delayedDragTouchMoveHandler),vt(t,"pointermove",this._delayedDragTouchMoveHandler)},_triggerDragStart:function(t,r){r=r||t.pointerType=="touch"&&t,!this.nativeDraggable||r?this.options.supportPointer?_t(document,"pointermove",this._onTouchMove):r?_t(document,"touchmove",this._onTouchMove):_t(document,"mousemove",this._onTouchMove):(_t(je,"dragend",this),_t(Bt,"dragstart",this._onDragStart));try{document.selection?hl(function(){document.selection.empty()}):window.getSelection().removeAllRanges()}catch{}},_dragStarted:function(t,r){if(Lr=!1,Bt&&je){An("dragStarted",this,{evt:r}),this.nativeDraggable&&_t(document,"dragover",GC);var o=this.options;!t&&On(je,o.dragClass,!1),On(je,o.ghostClass,!0),st.active=this,t&&this._appendGhost(),hn({sortable:this,name:"start",originalEvent:r})}else this._nulling()},_emulateDragOver:function(){if(Jn){this._lastX=Jn.clientX,this._lastY=Jn.clientY,ch();for(var t=document.elementFromPoint(Jn.clientX,Jn.clientY),r=t;t&&t.shadowRoot&&(t=t.shadowRoot.elementFromPoint(Jn.clientX,Jn.clientY),t!==r);)r=t;if(je.parentNode[Bn]._isOutsideThisEl(t),r)do{if(r[Bn]){var o=void 0;if(o=r[Bn]._onDragOver({clientX:Jn.clientX,clientY:Jn.clientY,target:t,rootEl:r}),o&&!this.options.dragoverBubble)break}t=r}while(r=r.parentNode);uh()}},_onTouchMove:function(t){if(lr){var r=this.options,o=r.fallbackTolerance,i=r.fallbackOffset,l=t.touches?t.touches[0]:t,d=ut&&Ir(ut,!0),c=ut&&d&&d.a,u=ut&&d&&d.d,h=fl&&cn&&eh(cn),m=(l.clientX-lr.clientX+i.x)/(c||1)+(h?h[0]-lc[0]:0)/(c||1),y=(l.clientY-lr.clientY+i.y)/(u||1)+(h?h[1]-lc[1]:0)/(u||1);if(!st.active&&!Lr){if(o&&Math.max(Math.abs(l.clientX-this._lastX),Math.abs(l.clientY-this._lastY))=0&&(hn({rootEl:Mt,name:"add",toEl:Mt,fromEl:Bt,originalEvent:t}),hn({sortable:this,name:"remove",toEl:Mt,originalEvent:t}),hn({rootEl:Mt,name:"sort",toEl:Mt,fromEl:Bt,originalEvent:t}),hn({sortable:this,name:"sort",toEl:Mt,originalEvent:t})),an&&an.save()):Rn!==Mr&&Rn>=0&&(hn({sortable:this,name:"update",toEl:Mt,originalEvent:t}),hn({sortable:this,name:"sort",toEl:Mt,originalEvent:t})),st.active&&((Rn==null||Rn===-1)&&(Rn=Mr,ji=Fo),hn({sortable:this,name:"end",toEl:Mt,originalEvent:t}),this.save()))),this._nulling()},_nulling:function(){An("nulling",this),Bt=je=Mt=ut=ar=Lt=rl=Li=lr=Jn=Po=Rn=ji=Mr=Fo=jr=Mo=an=ol=st.dragged=st.ghost=st.clone=st.active=null,cl.forEach(function(t){t.checked=!0}),cl.length=oc=ac=0},handleEvent:function(t){switch(t.type){case"drop":case"dragend":this._onDrop(t);break;case"dragenter":case"dragover":je&&(this._onDragOver(t),KC(t));break;case"selectstart":t.preventDefault();break}},toArray:function(){for(var t=[],r,o=this.el.children,i=0,l=o.length,d=this.options;io.right+i||e.clientX<=o.right&&e.clientY>o.bottom&&e.clientX>=o.left:e.clientX>o.right&&e.clientY>o.top||e.clientX<=o.right&&e.clientY>o.bottom+i}function XC(e,t,r,o,i,l,d,c){var u=o?e.clientY:e.clientX,h=o?r.height:r.width,m=o?r.top:r.left,y=o?r.bottom:r.right,C=!1;if(!d){if(c&&dlm+h*l/2:uy-dl)return-Mo}else if(u>m+h*(1-i)/2&&uy-h*l/2)?u>m+h/2?1:-1:0}function ZC(e){return jn(je)e.replace(o_,(t,r)=>r.toUpperCase())),mh=["Start","Add","Remove","Update","End"],gh=["Choose","Unchoose","Sort","Filter","Clone"],vh=["Move"],l_=[vh,mh,gh].flatMap(e=>e).map(e=>`on${e}`),bc={manage:vh,manageAndEmit:mh,emit:gh};function s_(e){return l_.indexOf(e)!==-1}const d_=["a","abbr","address","area","article","aside","audio","b","base","bdi","bdo","blockquote","body","br","button","canvas","caption","cite","code","col","colgroup","data","datalist","dd","del","details","dfn","dialog","div","dl","dt","em","embed","fieldset","figcaption","figure","footer","form","h1","h2","h3","h4","h5","h6","head","header","hgroup","hr","html","i","iframe","img","input","ins","kbd","label","legend","li","link","main","map","mark","math","menu","menuitem","meta","meter","nav","noscript","object","ol","optgroup","option","output","p","param","picture","pre","progress","q","rb","rp","rt","rtc","ruby","s","samp","script","section","select","slot","small","source","span","strong","style","sub","summary","sup","svg","table","tbody","td","template","textarea","tfoot","th","thead","time","title","tr","track","u","ul","var","video","wbr"];function c_(e){return d_.includes(e)}function u_(e){return["transition-group","TransitionGroup"].includes(e)}function yh(e){return["id","class","role","style"].includes(e)||e.startsWith("data-")||e.startsWith("aria-")||e.startsWith("on")}function bh(e){return e.reduce((t,[r,o])=>(t[r]=o,t),{})}function f_({$attrs:e,componentData:t={}}){return{...bh(Object.entries(e).filter(([o,i])=>yh(o))),...t}}function p_({$attrs:e,callBackBuilder:t}){const r=bh(wh(e));Object.entries(t).forEach(([i,l])=>{bc[i].forEach(d=>{r[`on${d}`]=l(d)})});const o=`[data-draggable]${r.draggable||""}`;return{...r,draggable:o}}function wh(e){return Object.entries(e).filter(([t,r])=>!yh(t)).map(([t,r])=>[a_(t),r]).filter(([t,r])=>!s_(t))}const Ch=({el:e})=>e,h_=(e,t)=>e.__draggable_context=t,_h=e=>e.__draggable_context;class m_{constructor({nodes:{header:t,default:r,footer:o},root:i,realList:l}){this.defaultNodes=r,this.children=[...t,...r,...o],this.externalComponent=i.externalComponent,this.rootTransition=i.transition,this.tag=i.tag,this.realList=l}get _isRootComponent(){return this.externalComponent||this.rootTransition}render(t,r){const{tag:o,children:i,_isRootComponent:l}=this;return t(o,r,l?{default:()=>i}:i)}updated(){const{defaultNodes:t,realList:r}=this;t.forEach((o,i)=>{h_(Ch(o),{element:r[i],index:i})})}getUnderlyingVm(t){return _h(t)}getVmIndexFromDomIndex(t,r){const{defaultNodes:o}=this,{length:i}=o,l=r.children,d=l.item(t);if(d===null)return i;const c=_h(d);if(c)return c.index;if(i===0)return 0;const u=Ch(o[0]),h=[...l].findIndex(m=>m===u);return tg_(e,u)),{item:d}=e;if(!d)throw new Error("draggable element must have an item slot");const c=o.flatMap((u,h)=>d({element:u,index:h}).map(m=>(m.key=r(u),m.props={...m.props||{},"data-draggable":!0},m)));if(c.length!==o.length)throw new Error("Item slot must have only one child");return{header:i,footer:l,default:c}}function y_(e){const t=u_(e),r=!c_(e)&&!t;return{transition:t,externalComponent:r,tag:r?n.resolveComponent(e):t?n.TransitionGroup:e}}function b_({$slots:e,tag:t,realList:r,getKey:o}){const i=v_({$slots:e,realList:r,getKey:o}),l=y_(t);return new m_({nodes:i,root:l,realList:r})}function Eh(e,t){n.nextTick(()=>this.$emit(e.toLowerCase(),t))}function Ah(e){return(t,r)=>{if(this.realList!==null)return this[`onDrag${e}`](t,r)}}function w_(e){const t=Ah.call(this,e);return(r,o)=>{t.call(this,r,o),Eh.call(this,e,r)}}let wc=null;const C_={list:{type:Array,required:!1,default:null},modelValue:{type:Array,required:!1,default:null},itemKey:{type:[String,Function],required:!0},clone:{type:Function,default:e=>e},tag:{type:String,default:"div"},move:{type:Function,default:null},componentData:{type:Object,required:!1,default:null}},__=["update:modelValue","change",...[...bc.manageAndEmit,...bc.emit].map(e=>e.toLowerCase())],zr=n.defineComponent({name:"draggable",inheritAttrs:!1,props:C_,emits:__,data(){return{error:!1}},render(){try{this.error=!1;const{$slots:e,$attrs:t,tag:r,componentData:o,realList:i,getKey:l}=this,d=b_({$slots:e,tag:r,realList:i,getKey:l});this.componentStructure=d;const c=f_({$attrs:t,componentData:o});return d.render(n.h,c)}catch(e){return this.error=!0,n.h("pre",{style:{color:"red"}},e.stack)}},created(){this.list!==null&&this.modelValue!==null&&i_.error("modelValue and list props are mutually exclusive! Please set one or another.")},mounted(){if(this.error)return;const{$attrs:e,$el:t,componentStructure:r}=this;r.updated();const o=p_({$attrs:e,callBackBuilder:{manageAndEmit:l=>w_.call(this,l),emit:l=>Eh.bind(this,l),manage:l=>Ah.call(this,l)}}),i=t.nodeType===1?t:t.parentElement;this._sortable=new st(i,o),this.targetDomElement=i,i.__draggable_component__=this},updated(){this.componentStructure.updated()},beforeUnmount(){this._sortable!==void 0&&this._sortable.destroy()},computed:{realList(){const{list:e}=this;return e||this.modelValue},getKey(){const{itemKey:e}=this;return typeof e=="function"?e:t=>t[e]}},watch:{$attrs:{handler(e){const{_sortable:t}=this;!t||wh(e).forEach(([r,o])=>{t.option(r,o)})},deep:!0}},methods:{getUnderlyingVm(e){return this.componentStructure.getUnderlyingVm(e)||null},getUnderlyingPotencialDraggableComponent(e){return e.__draggable_component__},emitChanges(e){n.nextTick(()=>this.$emit("change",e))},alterList(e){if(this.list){e(this.list);return}const t=[...this.modelValue];e(t),this.$emit("update:modelValue",t)},spliceList(){const e=t=>t.splice(...arguments);this.alterList(e)},updatePosition(e,t){const r=o=>o.splice(t,0,o.splice(e,1)[0]);this.alterList(r)},getRelatedContextFromMoveEvent({to:e,related:t}){const r=this.getUnderlyingPotencialDraggableComponent(e);if(!r)return{component:r};const o=r.realList,i={list:o,component:r};return e!==t&&o?{...r.getUnderlyingVm(t)||{},...i}:i},getVmIndexFromDomIndex(e){return this.componentStructure.getVmIndexFromDomIndex(e,this.targetDomElement)},onDragStart(e){this.context=this.getUnderlyingVm(e.item),e.item._underlying_vm_=this.clone(this.context.element),wc=e.item},onDragAdd(e){const t=e.item._underlying_vm_;if(t===void 0)return;yc(e.item);const r=this.getVmIndexFromDomIndex(e.newIndex);this.spliceList(r,0,t);const o={element:t,newIndex:r};this.emitChanges({added:o})},onDragRemove(e){if(hh(this.$el,e.item,e.oldIndex),e.pullMode==="clone"){yc(e.clone);return}const{index:t,element:r}=this.context;this.spliceList(t,1);const o={element:r,oldIndex:t};this.emitChanges({removed:o})},onDragUpdate(e){yc(e.item),hh(e.from,e.item,e.oldIndex);const t=this.context.index,r=this.getVmIndexFromDomIndex(e.newIndex);this.updatePosition(t,r);const o={element:this.context.element,oldIndex:t,newIndex:r};this.emitChanges({moved:o})},computeFutureIndex(e,t){if(!e.element)return 0;const r=[...t.to.children].filter(d=>d.style.display!=="none"),o=r.indexOf(t.related),i=e.component.getVmIndexFromDomIndex(o);return r.indexOf(wc)!==-1||!t.willInsertAfter?i:i+1},onDragMove(e,t){const{move:r,realList:o}=this;if(!r||!o)return!0;const i=this.getRelatedContextFromMoveEvent(e),l=this.computeFutureIndex(i,e),d={...this.context,futureIndex:l},c={...e,relatedContext:i,draggedContext:d};return r(c,t)},onDragEnd(){wc=null}}});function E_(){return[{name:"template",title:"\u6A21\u677F",list:[]},{name:"main",title:"\u57FA\u7840\u7EC4\u4EF6",list:[]},{name:"subform",title:"\u5B50\u8868\u5355\u7EC4\u4EF6",list:[]},{name:"container",title:"\u5BB9\u5668\u7EC4\u4EF6",list:[]},{name:"chart",title:"\u56FE\u8868\u7EC4\u4EF6",list:[]},{name:"aide",title:"\u8F85\u52A9\u7EC4\u4EF6",list:[]},{name:"layout",title:"\u5E03\u5C40\u7EC4\u4EF6",list:[]}]}var Cc=typeof globalThis<"u"?globalThis:typeof window<"u"?window:typeof global<"u"?global:typeof self<"u"?self:{};function A_(e){return e&&e.__esModule&&Object.prototype.hasOwnProperty.call(e,"default")?e.default:e}var Sh={exports:{}};(function(e,t){(function(r,o){e.exports=o()})(Cc,function(){var r=1e3,o=6e4,i=36e5,l="millisecond",d="second",c="minute",u="hour",h="day",m="week",y="month",C="quarter",S="year",w="date",E="Invalid Date",b=/^(\d{4})[-/]?(\d{1,2})?[-/]?(\d{0,2})[Tt\s]*(\d{1,2})?:?(\d{1,2})?:?(\d{1,2})?[.:]?(\d+)?$/,g=/\[([^\]]+)]|Y{1,4}|M{1,4}|D{1,2}|d{1,4}|H{1,2}|h{1,2}|a|A|m{1,2}|s{1,2}|Z{1,2}|SSS/g,_={name:"en",weekdays:"Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"),months:"January_February_March_April_May_June_July_August_September_October_November_December".split("_"),ordinal:function(H){var R=["th","st","nd","rd"],z=H%100;return"["+H+(R[(z-20)%10]||R[z]||R[0])+"]"}},x=function(H,R,z){var $=String(H);return!$||$.length>=R?H:""+Array(R+1-$.length).join(z)+H},k={s:x,z:function(H){var R=-H.utcOffset(),z=Math.abs(R),$=Math.floor(z/60),A=z%60;return(R<=0?"+":"-")+x($,2,"0")+":"+x(A,2,"0")},m:function H(R,z){if(R.date()1)return H(Q[0])}else{var G=R.name;O[G]=R,A=G}return!$&&A&&(T=A),A||!$&&T},N=function(H,R){if(I(H))return H.clone();var z=typeof R=="object"?R:{};return z.date=H,z.args=arguments,new L(z)},B=k;B.l=M,B.i=I,B.w=function(H,R){return N(H,{locale:R.$L,utc:R.$u,x:R.$x,$offset:R.$offset})};var L=function(){function H(z){this.$L=M(z.locale,null,!0),this.parse(z),this.$x=this.$x||z.x||{},this[F]=!0}var R=H.prototype;return R.parse=function(z){this.$d=function($){var A=$.date,J=$.utc;if(A===null)return new Date(NaN);if(B.u(A))return new Date;if(A instanceof Date)return new Date(A);if(typeof A=="string"&&!/Z$/i.test(A)){var Q=A.match(b);if(Q){var G=Q[2]-1||0,ie=(Q[7]||"0").substring(0,3);return J?new Date(Date.UTC(Q[1],G,Q[3]||1,Q[4]||0,Q[5]||0,Q[6]||0,ie)):new Date(Q[1],G,Q[3]||1,Q[4]||0,Q[5]||0,Q[6]||0,ie)}}return new Date(A)}(z),this.init()},R.init=function(){var z=this.$d;this.$y=z.getFullYear(),this.$M=z.getMonth(),this.$D=z.getDate(),this.$W=z.getDay(),this.$H=z.getHours(),this.$m=z.getMinutes(),this.$s=z.getSeconds(),this.$ms=z.getMilliseconds()},R.$utils=function(){return B},R.isValid=function(){return this.$d.toString()!==E},R.isSame=function(z,$){var A=N(z);return this.startOf($)<=A&&A<=this.endOf($)},R.isAfter=function(z,$){return N(z){let r,o,i;try{r=e.toString().split(".")[1].length}catch{r=0}try{o=t.toString().split(".")[1].length}catch{o=0}return i=Math.pow(10,Math.max(r,o)),(e*i+t*i)/i},Sub:(e,t)=>{let r,o,i;try{r=e.toString().split(".")[1].length}catch{r=0}try{o=t.toString().split(".")[1].length}catch{o=0}i=Math.pow(10,Math.max(r,o));let l=r>=o?r:o;return Number(((e*i-t*i)/i).toFixed(l))},Mul:(e,t)=>{let r=0,o=e.toString(),i=t.toString();try{r+=o.split(".")[1].length}catch{}try{r+=i.split(".")[1].length}catch{}return Number(o.replace(".",""))*Number(i.replace(".",""))/Math.pow(10,r)},Div:(e,t)=>{let r=0,o=0;try{r=e.toString().split(".")[1].length}catch{}try{o=t.toString().split(".")[1].length}catch{}let i=Number(e.toString().replace(".","")),l=Number(t.toString().replace(".",""));return i/l*Math.pow(10,o-r)}},x_="YYYY-MM-DD HH:mm:ss",zi=(e,t)=>e==null?t:e,jt={ADD:function(e,t){return Ur.Add(zi(e,"0"),zi(t,"0"))},SUB:function(e,t){return Ur.Sub(zi(e,"0"),zi(t,"0"))},MUL:function(e,t){return Ur.Mul(zi(e,"0"),zi(t,"0"))},DIV:function(e,t){return Ur.Div(zi(e,"0"),zi(t,"0"))},SUM:function(...e){return(e||[]).reduce((t,r)=>Ur.Add(t,Array.isArray(r)?jt.SUM(...r):r||0),0)},MAX:function(...e){const t=Array.isArray(e[0])?e[0]:e;return Math.max(...t.map(r=>parseFloat(r)).filter(r=>!isNaN(r)))},MIN:function(...e){const t=Array.isArray(e[0])?e[0]:e;return Math.min(...t.map(r=>parseFloat(r)).filter(r=>!isNaN(r)))},ABS:function(e){return parseFloat(Math.abs(e))||0},AVG:function(...e){const t=Array.isArray(e[0])?e[0]:e;return t.length?Ur.Div(jt.SUM(t),t.length):0},POWER:function(e,t){return Math.pow(parseFloat(e),parseFloat(t))},RAND:function(){return Math.random()},CEIL:function(e){return Math.ceil(parseFloat(e))||0},FLOOR:function(e){return Math.floor(parseFloat(e)||0)},FIXED:function(e,t){const r=Math.pow(10,t||0);return(Math.floor(parseFloat(e)*r)/r).toFixed(t||0)},ISNUMBER:function(e){return e===""||e===null?!1:!isNaN(Number(e))},PI:function(){return Number(Math.PI)},ROUND:function(e,t){return e=parseFloat(e),isNaN(e)?0:parseFloat(e.toFixed(parseFloat(t)||0))},SQRT:function(e){return Math.sqrt(parseFloat(e))||0},TONUMBER:function(e){return parseFloat(e)||0},MODIFYDATE:function(e,t,r,o){if(!e)return null;let i=S_(e);return t>0?i=i.add(t,r):t<0&&(i=i.subtract(-1*t,r)),i.format(o||x_)},ADDYEAR:function(e,t,r){return jt.MODIFYDATE(e,Math.max(t,0),"y",r)},ADDMONTH:function(e,t,r){return jt.MODIFYDATE(e,Math.max(t,0),"M",r)},ADDDAY:function(e,t,r){return jt.MODIFYDATE(e,Math.max(t,0),"d",r)},ADDHOUR:function(e,t,r){return jt.MODIFYDATE(e,Math.max(t,0),"h",r)},ADDMINUTE:function(e,t,r){return jt.MODIFYDATE(e,Math.max(t,0),"m",r)},ADDSECOND:function(e,t,r){return jt.MODIFYDATE(e,Math.max(t,0),"s",r)},ADDWEEK:function(e,t,r){return jt.MODIFYDATE(e,Math.max(t,0),"w",r)},SUBYEAR:function(e,t,r){return t=Math.max(t,0),jt.MODIFYDATE(e,t>0?-1*t:0,"y",r)},SUBMONTH:function(e,t,r){return t=Math.max(t,0),jt.MODIFYDATE(e,t>0?-1*t:0,"M",r)},SUBDAY:function(e,t,r){return t=Math.max(t,0),jt.MODIFYDATE(e,t>0?-1*t:0,"d",r)},SUBHOUR:function(e,t,r){return t=Math.max(t,0),jt.MODIFYDATE(e,t>0?-1*t:0,"h",r)},SUBMINUTE:function(e,t,r){return t=Math.max(t,0),jt.MODIFYDATE(e,t>0?-1*t:0,"m",r)},SUBSECOND:function(e,t,r){return t=Math.max(t,0),jt.MODIFYDATE(e,t>0?-1*t:0,"s",r)},SUBWEEK:function(e,t,r){return t=Math.max(t,0),jt.MODIFYDATE(e,t>0?-1*t:0,"w",r)},NOW:function(){const e=new Date,t=e.getFullYear(),r=("0"+(e.getMonth()+1)).slice(-2),o=("0"+e.getDate()).slice(-2),i=("0"+e.getHours()).slice(-2),l=("0"+e.getMinutes()).slice(-2),d=("0"+e.getSeconds()).slice(-2);return t+"-"+r+"-"+o+" "+i+":"+l+":"+d},TODAY:function(){const e=new Date,t=e.getFullYear(),r=("0"+(e.getMonth()+1)).slice(-2),o=("0"+e.getDate()).slice(-2);return t+"-"+r+"-"+o},YEAR:function(e){return e?new Date(e).getFullYear():null},MONTH:function(e){return e?new Date(e).getMonth()+1:null},DAY:function(e){return e?new Date(e).getDate():null},HOUR:function(e){return e?new Date(e).getHours():null},MINUTE:function(e){return e?new Date(e).getMinutes():null},SECOND:function(e){return e?new Date(e).getSeconds():null},DIFFDAYS:function(e,t){const r=new Date(e),o=new Date(t);return parseInt(Math.ceil(Math.abs(o.getTime()-r.getTime())/(1e3*60*60*24)))},DIFFHOURS:function(e,t){const r=new Date(e),o=new Date(t);return parseFloat(Math.abs(o.getTime()-r.getTime())/(1e3*60*60)).toFixed(2)},DIFFMINUTES:function(e,t){const r=new Date(e),o=new Date(t);return parseInt(Math.ceil(Math.abs(o.getTime()-r.getTime())/(1e3*60)))},TIMESTAMP:function(e){return Date.parse(e)},STARTSWITH:function(e,t){return(""+e).substring(0,(""+t).length)===t},EMPTY:function(e){return dt.empty(e)},NOTEMPTY:function(e){return!dt.empty(e)},LEN:function(e){return Array.isArray(e)?e.length:0},MOD:function(e,t){return e=parseFloat(e),t=parseFloat(t),!e||!t||isNaN(e)||isNaN(t)?0:e%t},SLICELEFT:function(e,t){return(""+e).slice(0,Number(t)||0)},SLICERIGHT:function(e,t){return(""+e).slice(Number(t)*-1)},TOLOWER:function(e){return(""+e).toLowerCase()},TOUPPER:function(e){return(""+e).toUpperCase()},INCLUDES:function(e,t){return(e||"").indexOf(t||"")},REPLACE:function(e,t,r){return(e||"").replace(t||"",r||"")},REPLACEALL:function(e,t,r){return(e||"").replaceAll(t||"",r||"")},TRIM:function(e){return(e||"").trim()},TOCHINSESAMOUNT:function(e){let t=["\u96F6","\u58F9","\u8D30","\u53C1","\u8086","\u4F0D","\u9646","\u67D2","\u634C","\u7396"],r=["","\u4E07","\u4EBF","\u4E07\u4EBF","\u4EBF\u4EBF"],o=["","\u62FE","\u4F70","\u4EDF"],i=["\u89D2","\u5206"];function l(C){let S="",w="",E=0,b=!0;for(;C>0;){let g=C%10;g===0?b||(b=!0,w=t[g]+w):(b=!1,S=t[g],S+=o[E],w=S+w),E++,C=Math.floor(C/10)}return w}let d=0,c="",u="",h=!1;if(e===0)return t[0];let m=Math.floor(e),y=Math.round((e-m)*100);for(;m>0;){let C=m%1e4;h&&(u=t[0]+u),c=l(C),c+=C!==0?r[d]:r[0],u=c+u,h=C<1e3&&C>0,m=Math.floor(m/1e4),d++}return u&&(u+="\u5143"),y>0?(u+=t[Math.floor(y/10)]+i[0],y%10!==0&&(u+=t[y%10]+i[1])):u&&(u+="\u6574"),u},UNION:function(...e){return(Array.isArray(e[0])?e[0]:e).filter((r,o,i)=>i.indexOf(r)===o)},AND:function(...e){return!!e.reduce((t,r)=>t&&r,!0)},OR:function(...e){return!!e.reduce((t,r)=>t||r,!1)},IF:function(e,t=!0,r=!1){return e?t:r},DEFAULT:function(e,t){return dt.Undef(e)?t:e},CASE:function(...e){for(let t=0;t-1},FALSE:function(){return!1},TRUE:function(){return!0},NOT:function(e){return!e},EQ:function(e,t){return e===t},GE:function(e,t){return e>=t},GT:function(e,t){return e>t},LE:function(e,t){return e<=t},LT:function(e,t){return e{let r=[e];const o=t.split(".");let i=1;for(;o[i];){let l=[];r.forEach(d=>{Object.values(d.ctxs).forEach(c=>{if(c.rule._fc_id===o[i-1]){const u=d.subForm[c.id];l.push(...Array.isArray(u)?u:[u])}})}),r=l.map(d=>d.rule[0].__fc__.$handle),i++}return[r,o[i-1]]},vl=(e,t,r)=>{const o=e.vm.setupState.top.setupState.fc.$handle;let i=[e.$handle];e.$handle!==o&&i.push(o);let l=t;t.indexOf(".")>-1&&([i,l]=k_(o,t)),i.forEach(d=>{Object.values(d.ctxs).forEach(c=>{c.rule._fc_id===l&&r(c.rule,d.api)})})},Ec={openModel(e,t){t.api.open(e.model)},closeModel(e,t){t.api.close(e.model)},hidden(e,t,r){const o=typeof e.id=="string"?[e.id]:e.id||[];let i=!!e.status;e.compute&&(i=!!r.$handle.compute(t.self.__fc__,e.formula)),o.forEach(l=>{vl(r,l,d=>{d.hidden=i})})},disabled(e,t,r){const o=typeof e.id=="string"?[e.id]:e.id||[];let i=!!e.status;e.compute&&(i=!!r.$handle.compute(t.self.__fc__,e.formula)),o.forEach(l=>{vl(r,l,d=>{d.props||(d.props={}),d.props.disabled=i})})},resetFields(e,t){t.api.top.resetFields()},clearFields(e,t){t.api.top.coverValue({})},validate(e,t){return t.api.top.validate()},validateFields(e,t,r){const o=typeof e.id=="string"?[e.id]:e.id||[],i=[];return o.forEach(l=>{vl(r,l,(d,c)=>{d.field&&i.push(c.validateField(d.field))})}),i.length?Promise.all(i):void 0},submit(e,t){return t.api.top.submit()},setValue(e,t,r){(e.formData||[]).forEach(o=>{let i=o.value;o.compute&&(i=r.$handle.compute(t.self.__fc__,o.formula)),vl(r,o.id,l=>{l.value=i})})},fetch(e,t){const{append:r,response:o,fetch:i}=e;return r&&(i.data={...t.api.formData(),...i.data||{}}),new Promise((l,d)=>{t.api.fetch(e.fetch).then(c=>{o&&t.api.setData(o,c),l(c)}).catch(c=>{d(c)})})},copy(e,t,r){let o=e.content||"";e.compute&&(o=r.$handle.compute(t.self.__fc__,e.formula)),di(o)},callback(e,t){return e.callback&&e.callback(t)},message(e){ai.ElMessage(e||{})}},kh=[{key:"model",children:["openModel","closeModel","message"]},{key:"form",children:["hidden","disabled","resetFields","clearFields","setValue","validate","validateFields","submit"]},{key:"other",children:["fetch","copy","callback"]}],Nh={openModel(e){return[{type:"select",field:"model",$required:!0,options:e.pageData.filter(t=>!t.default).map(t=>{const r=t.main._menu;return{label:$r(t.main,t.config.labelField,"")||e.t("com."+r.name+".name")||r.label,value:t.main.name}})}]},message(e){return[{type:"radio",field:"type",value:"info",props:{type:"button"},options:it(e.t,["info","warning","success","error"].map(t=>({label:t,value:t})))},{type:"input",$required:!0,field:"message"},{type:"inputNumber",field:"duration",props:{precision:0,controlsPosition:"right"}},{type:"switch",field:"showClose"}]},hidden(e){const t=e.t;return[{type:"RuleSelect",field:"id",$required:!0,props:{multiple:!0}},{type:"radio",field:"compute",value:!1,options:[{label:t("behavior.props.static"),value:!1},{label:t("behavior.props.formula"),value:!0}],control:[{value:!1,rule:[{type:"radio",field:"status",value:!0,options:[{label:t("props.show"),value:!1},{label:t("props.hide"),value:!0}]}]},{value:!0,rule:[{type:"ComputedConfig",field:"formula",$required:!0,props:{btn:t("behavior.props.setFormula"),title:t("behavior.props.setFormula"),name:t("behavior.props.setFormula"),invertLabel:t("props.show"),validLabel:t("props.hide")}}]}]}]},disabled(e){const t=e.t;return[{type:"RuleSelect",field:"id",$required:!0,props:{onlyField:!0,multiple:!0}},{type:"radio",field:"compute",value:!1,options:[{label:t("behavior.props.static"),value:!1},{label:t("behavior.props.formula"),value:!0}],control:[{value:!1,rule:[{type:"radio",field:"status",value:!0,options:[{label:t("props.enable"),value:!1},{label:t("props.disabled"),value:!0}]}]},{value:!0,rule:[{type:"ComputedConfig",field:"formula",$required:!0,props:{title:t("behavior.props.setFormula"),invertLabel:t("props.enable"),validLabel:t("props.disabled")}}]}]}]},validateFields(){return[{type:"RuleSelect",field:"id",$required:!0,props:{onlyField:!0,multiple:!0}}]},setValue(e){const t=e.t;return[{type:"group",field:"formData",props:{expand:1,rule:[{type:"RuleSelect",field:"id",title:t("behavior.props.id"),$required:!0,props:{onlyField:!0}},{type:"radio",field:"compute",value:!1,title:t("behavior.props.compute"),options:[{label:t("behavior.props.static"),value:!1},{label:t("behavior.props.formula"),value:!0}],control:[{value:!1,rule:[{type:"ValueInput",field:"value",title:t("props.value"),$required:!0}]},{value:!0,rule:[{type:"ComputedConfig",field:"formula",title:t("behavior.props.formula"),$required:!0,props:{type:"value",title:t("behavior.props.setFormula"),invertLabel:t("props.show"),validLabel:t("props.hide")}}]}]}]}}]},fetch(){return[{type:"FetchConfig",field:"fetch",$required:!0},{type:"switch",field:"append",value:!1},{type:"input",field:"response",value:"res_"+We()}]},copy(e){const t=e.t;return[{type:"radio",field:"compute",value:!1,options:[{label:t("behavior.props.static"),value:!1},{label:t("behavior.props.formula"),value:!0}],control:[{value:!1,rule:[{type:"input",field:"content",$required:!0,props:{type:"textarea"},options:[{label:t("props.enable"),value:!1},{label:t("props.disabled"),value:!0}]}]},{value:!0,rule:[{type:"ComputedConfig",field:"formula",$required:!0,props:{type:"value",title:t("behavior.props.setFormula"),invertLabel:t("props.enable"),validLabel:t("props.disabled")}}]}]}]},callback(e){return[{type:"FnInput",field:"callback",$required:!0,props:{name:"callback",args:[on(e.t)]}}]}};function N_(e,t){return e.reduce((r,o)=>r.then(()=>o(t)),Promise.resolve())}const Th=function(e){return{name:"behavior",load(t,r){const o=t.getValue(),i={},l={};o&&Object.keys(o).forEach(d=>{if(Array.isArray(o[d])){const c=[];if(o[d].forEach(u=>{const{method:h,config:m,expression:y,stopPropagation:C,ignoreError:S}=u;c.push(w=>new Promise(E=>{if(y&&e.$handle.compute(r.__fc__,y)===!1){E();return}const b=(..._)=>{(!C||e.$handle.compute(r.__fc__,C)!==!0)&&E(..._)};let g;try{g=Ec[h](m||{},w,e)}catch(_){console.error(_),S!==!1&&b();return}g&&g.then?g.then(b).catch(()=>{S!==!1&&b()}):b(g)}))}),c.length){const u=e.$handle.inject(r,function(h){N_(c,h)},r.inject||e.$handle.options.injectEvent);d.indexOf("hook_")>-1?l[d.replace("hook_","")]=u:i[d]=u}}}),t.getProp().on=i,t.getProp().hook=l}}},Uo={name:"easySlots",load(e){const t=e.getValue(),r={};t&&Object.keys(t).forEach(o=>{r[o]=t[o].type==="icon"?{type:"i",class:"fc-icon iconfont "+t[o].value}:{type:"div",children:[""+(t[o].value||"")]}}),e.getProp().renderSlots=r}};Uo.watch=Uo.load;const T_=Object.assign||function(e){for(let t,r=1;r{yl(Ec,t)},e.extendApi(t=>({open(r,...o){(t.el(r)||t.top.el(r)).open(...o)},close(r){r?(t.el(r)||t.top.el(r)).close():(t.top.bus.$emit("fc.closeDialog"),t!==t.top&&t.bus.$emit("fc.closeDialog"))}}))}function Dh(e){e.extendApi(t=>({message(r){return ai.ElMessage(r||{})}}))}Ua.default.parser().preview=Tb,Object.keys(jt).forEach(e=>{Ua.default.setFormula(e,jt[e])});const Sn=Ua.default,ze=Ua.default.factory();Ac(Sn),Dh(Sn),Ac(ze),Dh(ze),Sn.register("behavior",Th),Sn.register("easySlots",Uo),ze.register("easySlots",Uo);/*!
+ */function Yp(e,t){var r=Object.keys(e);if(Object.getOwnPropertySymbols){var o=Object.getOwnPropertySymbols(e);t&&(o=o.filter(function(i){return Object.getOwnPropertyDescriptor(e,i).enumerable})),r.push.apply(r,o)}return r}function ci(e){for(var t=1;t=0)&&(r[i]=e[i]);return r}function BC(e,t){if(e==null)return{};var r=OC(e,t),o,i;if(Object.getOwnPropertySymbols){var l=Object.getOwnPropertySymbols(e);for(i=0;i=0)&&(!Object.prototype.propertyIsEnumerable.call(e,o)||(r[o]=e[o]))}return r}var RC="1.14.0";function Si(e){if(typeof window<"u"&&window.navigator)return!!navigator.userAgent.match(e)}var Ai=Si(/(?:Trident.*rv[ :]?11\.|msie|iemobile|Windows Phone)/i),Bo=Si(/Edge/i),Qp=Si(/firefox/i),Ro=Si(/safari/i)&&!Si(/chrome/i)&&!Si(/android/i),Jp=Si(/iP(ad|od|hone)/i),$C=Si(/chrome/i)&&Si(/android/i),Xp={capture:!1,passive:!1};function _t(e,t,r){e.addEventListener(t,r,!Ai&&Xp)}function vt(e,t,r){e.removeEventListener(t,r,!Ai&&Xp)}function il(e,t){if(!!t){if(t[0]===">"&&(t=t.substring(1)),e)try{if(e.matches)return e.matches(t);if(e.msMatchesSelector)return e.msMatchesSelector(t);if(e.webkitMatchesSelector)return e.webkitMatchesSelector(t)}catch{return!1}return!1}}function IC(e){return e.host&&e!==document&&e.host.nodeType?e.host:e.parentNode}function ui(e,t,r,o){if(e){r=r||document;do{if(t!=null&&(t[0]===">"?e.parentNode===r&&il(e,t):il(e,t))||o&&e===r)return e;if(e===r)break}while(e=IC(e))}return null}var Zp=/\s+/g;function On(e,t,r){if(e&&t)if(e.classList)e.classList[r?"add":"remove"](t);else{var o=(" "+e.className+" ").replace(Zp," ").replace(" "+t+" "," ");e.className=(o+(r?" "+t:"")).replace(Zp," ")}}function lt(e,t,r){var o=e&&e.style;if(o){if(r===void 0)return document.defaultView&&document.defaultView.getComputedStyle?r=document.defaultView.getComputedStyle(e,""):e.currentStyle&&(r=e.currentStyle),t===void 0?r:r[t];!(t in o)&&t.indexOf("webkit")===-1&&(t="-webkit-"+t),o[t]=r+(typeof r=="string"?"":"px")}}function $r(e,t){var r="";if(typeof e=="string")r=e;else do{var o=lt(e,"transform");o&&o!=="none"&&(r=o+" "+r)}while(!t&&(e=e.parentNode));var i=window.DOMMatrix||window.WebKitCSSMatrix||window.CSSMatrix||window.MSCSSMatrix;return i&&new i(r)}function qp(e,t,r){if(e){var o=e.getElementsByTagName(t),i=0,l=o.length;if(r)for(;i=l:d=i<=l,!d)return o;if(o===fi())break;o=Mi(o,!1)}return!1}function Ir(e,t,r,o){for(var i=0,l=0,d=e.children;l2&&arguments[2]!==void 0?arguments[2]:{},i=o.evt,l=BC(o,HC);Io.pluginEvent.bind(st)(t,r,ci({dragEl:je,parentEl:Mt,ghostEl:ut,rootEl:Bt,nextEl:ar,lastDownEl:rl,cloneEl:Lt,cloneHidden:Li,dragStarted:Po,putSortable:an,activeSortable:st.active,originalEvent:i,oldIndex:Pr,oldDraggableIndex:Fo,newIndex:Rn,newDraggableIndex:ji,hideGhostForTarget:uh,unhideGhostForTarget:fh,cloneNowHidden:function(){Li=!0},cloneNowShown:function(){Li=!1},dispatchSortableEvent:function(c){hn({sortable:r,name:c,originalEvent:i})}},l))};function hn(e){UC(ci({putSortable:an,cloneEl:Lt,targetEl:je,rootEl:Bt,oldIndex:Pr,oldDraggableIndex:Fo,newIndex:Rn,newDraggableIndex:ji},e))}var je,Mt,ut,Bt,ar,rl,Lt,Li,Pr,Rn,Fo,ji,ol,an,Mr=!1,al=!1,ll=[],lr,Jn,oc,ac,oh,ah,Po,Lr,Mo,Lo=!1,sl=!1,dl,cn,lc=[],sc=!1,cl=[],ul=typeof document<"u",fl=Jp,lh=Bo||Ai?"cssFloat":"float",WC=ul&&!$C&&!Jp&&"draggable"in document.createElement("div"),sh=function(){if(!!ul){if(Ai)return!1;var e=document.createElement("x");return e.style.cssText="pointer-events:auto",e.style.pointerEvents==="auto"}}(),dh=function(t,r){var o=lt(t),i=parseInt(o.width)-parseInt(o.paddingLeft)-parseInt(o.paddingRight)-parseInt(o.borderLeftWidth)-parseInt(o.borderRightWidth),l=Ir(t,0,r),d=Ir(t,1,r),c=l&<(l),u=d&<(d),h=c&&parseInt(c.marginLeft)+parseInt(c.marginRight)+Qt(l).width,m=u&&parseInt(u.marginLeft)+parseInt(u.marginRight)+Qt(d).width;if(o.display==="flex")return o.flexDirection==="column"||o.flexDirection==="column-reverse"?"vertical":"horizontal";if(o.display==="grid")return o.gridTemplateColumns.split(" ").length<=1?"vertical":"horizontal";if(l&&c.float&&c.float!=="none"){var y=c.float==="left"?"left":"right";return d&&(u.clear==="both"||u.clear===y)?"vertical":"horizontal"}return l&&(c.display==="block"||c.display==="flex"||c.display==="table"||c.display==="grid"||h>=i&&o[lh]==="none"||d&&o[lh]==="none"&&h+m>i)?"vertical":"horizontal"},GC=function(t,r,o){var i=o?t.left:t.top,l=o?t.right:t.bottom,d=o?t.width:t.height,c=o?r.left:r.top,u=o?r.right:r.bottom,h=o?r.width:r.height;return i===c||l===u||i+d/2===c+h/2},KC=function(t,r){var o;return ll.some(function(i){var l=i[Bn].options.emptyInsertThreshold;if(!(!l||nc(i))){var d=Qt(i),c=t>=d.left-l&&t<=d.right+l,u=r>=d.top-l&&r<=d.bottom+l;if(c&&u)return o=i}}),o},ch=function(t){function r(l,d){return function(c,u,h,m){var y=c.options.group.name&&u.options.group.name&&c.options.group.name===u.options.group.name;if(l==null&&(d||y))return!0;if(l==null||l===!1)return!1;if(d&&l==="clone")return l;if(typeof l=="function")return r(l(c,u,h,m),d)(c,u,h,m);var C=(d?c:u).options.group.name;return l===!0||typeof l=="string"&&l===C||l.join&&l.indexOf(C)>-1}}var o={},i=t.group;(!i||nl(i)!="object")&&(i={name:i}),o.name=i.name,o.checkPull=r(i.pull,!0),o.checkPut=r(i.put),o.revertClone=i.revertClone,t.group=o},uh=function(){!sh&&ut&<(ut,"display","none")},fh=function(){!sh&&ut&<(ut,"display","")};ul&&document.addEventListener("click",function(e){if(al)return e.preventDefault(),e.stopPropagation&&e.stopPropagation(),e.stopImmediatePropagation&&e.stopImmediatePropagation(),al=!1,!1},!0);var sr=function(t){if(je){t=t.touches?t.touches[0]:t;var r=KC(t.clientX,t.clientY);if(r){var o={};for(var i in t)t.hasOwnProperty(i)&&(o[i]=t[i]);o.target=o.rootEl=r,o.preventDefault=void 0,o.stopPropagation=void 0,r[Bn]._onDragOver(o)}}},YC=function(t){je&&je.parentNode[Bn]._isOutsideThisEl(t.target)};function st(e,t){if(!(e&&e.nodeType&&e.nodeType===1))throw"Sortable: `el` must be an HTMLElement, not ".concat({}.toString.call(e));this.el=e,this.options=t=Ei({},t),e[Bn]=this;var r={group:null,sort:!0,disabled:!1,store:null,handle:null,draggable:/^[uo]l$/i.test(e.nodeName)?">li":">*",swapThreshold:1,invertSwap:!1,invertedSwapThreshold:null,removeCloneOnHide:!0,direction:function(){return dh(e,this.options)},ghostClass:"sortable-ghost",chosenClass:"sortable-chosen",dragClass:"sortable-drag",ignore:"a, img",filter:null,preventOnFilter:!0,animation:0,easing:null,setData:function(d,c){d.setData("Text",c.textContent)},dropBubble:!1,dragoverBubble:!1,dataIdAttr:"data-id",delay:0,delayOnTouchOnly:!1,touchStartThreshold:(Number.parseInt?Number:window).parseInt(window.devicePixelRatio,10)||1,forceFallback:!1,fallbackClass:"sortable-fallback",fallbackOnBody:!1,fallbackTolerance:0,fallbackOffset:{x:0,y:0},supportPointer:st.supportPointer!==!1&&"PointerEvent"in window&&!Ro,emptyInsertThreshold:5};Io.initializePlugins(this,e,r);for(var o in r)!(o in t)&&(t[o]=r[o]);ch(t);for(var i in this)i.charAt(0)==="_"&&typeof this[i]=="function"&&(this[i]=this[i].bind(this));this.nativeDraggable=t.forceFallback?!1:WC,this.nativeDraggable&&(this.options.touchStartThreshold=1),t.supportPointer?_t(e,"pointerdown",this._onTapStart):(_t(e,"mousedown",this._onTapStart),_t(e,"touchstart",this._onTapStart)),this.nativeDraggable&&(_t(e,"dragover",this),_t(e,"dragenter",this)),ll.push(this.el),t.store&&t.store.get&&this.sort(t.store.get(this)||[]),Ei(this,LC())}st.prototype={constructor:st,_isOutsideThisEl:function(t){!this.el.contains(t)&&t!==this.el&&(Lr=null)},_getDirection:function(t,r){return typeof this.options.direction=="function"?this.options.direction.call(this,t,r,je):this.options.direction},_onTapStart:function(t){if(!!t.cancelable){var r=this,o=this.el,i=this.options,l=i.preventOnFilter,d=t.type,c=t.touches&&t.touches[0]||t.pointerType&&t.pointerType==="touch"&&t,u=(c||t).target,h=t.target.shadowRoot&&(t.path&&t.path[0]||t.composedPath&&t.composedPath()[0])||u,m=i.filter;if(n_(o),!je&&!(/mousedown|pointerdown/.test(d)&&t.button!==0||i.disabled)&&!h.isContentEditable&&!(!this.nativeDraggable&&Ro&&u&&u.tagName.toUpperCase()==="SELECT")&&(u=ui(u,i.draggable,o,!1),!(u&&u.animated)&&rl!==u)){if(Pr=jn(u),Fo=jn(u,i.draggable),typeof m=="function"){if(m.call(this,t,u,this)){hn({sortable:r,rootEl:h,name:"filter",targetEl:u,toEl:o,fromEl:o}),Sn("filter",r,{evt:t}),l&&t.cancelable&&t.preventDefault();return}}else if(m&&(m=m.split(",").some(function(y){if(y=ui(h,y.trim(),o,!1),y)return hn({sortable:r,rootEl:y,name:"filter",targetEl:u,fromEl:o,toEl:o}),Sn("filter",r,{evt:t}),!0}),m)){l&&t.cancelable&&t.preventDefault();return}i.handle&&!ui(h,i.handle,o,!1)||this._prepareDragStart(t,c,u)}}},_prepareDragStart:function(t,r,o){var i=this,l=i.el,d=i.options,c=l.ownerDocument,u;if(o&&!je&&o.parentNode===l){var h=Qt(o);if(Bt=l,je=o,Mt=je.parentNode,ar=je.nextSibling,rl=o,ol=d.group,st.dragged=je,lr={target:je,clientX:(r||t).clientX,clientY:(r||t).clientY},oh=lr.clientX-h.left,ah=lr.clientY-h.top,this._lastX=(r||t).clientX,this._lastY=(r||t).clientY,je.style["will-change"]="all",u=function(){if(Sn("delayEnded",i,{evt:t}),st.eventCanceled){i._onDrop();return}i._disableDelayedDragEvents(),!Qp&&i.nativeDraggable&&(je.draggable=!0),i._triggerDragStart(t,r),hn({sortable:i,name:"choose",originalEvent:t}),On(je,d.chosenClass,!0)},d.ignore.split(",").forEach(function(m){qp(je,m.trim(),dc)}),_t(c,"dragover",sr),_t(c,"mousemove",sr),_t(c,"touchmove",sr),_t(c,"mouseup",i._onDrop),_t(c,"touchend",i._onDrop),_t(c,"touchcancel",i._onDrop),Qp&&this.nativeDraggable&&(this.options.touchStartThreshold=4,je.draggable=!0),Sn("delayStart",this,{evt:t}),d.delay&&(!d.delayOnTouchOnly||r)&&(!this.nativeDraggable||!(Bo||Ai))){if(st.eventCanceled){this._onDrop();return}_t(c,"mouseup",i._disableDelayedDrag),_t(c,"touchend",i._disableDelayedDrag),_t(c,"touchcancel",i._disableDelayedDrag),_t(c,"mousemove",i._delayedDragTouchMoveHandler),_t(c,"touchmove",i._delayedDragTouchMoveHandler),d.supportPointer&&_t(c,"pointermove",i._delayedDragTouchMoveHandler),i._dragStartTimer=setTimeout(u,d.delay)}else u()}},_delayedDragTouchMoveHandler:function(t){var r=t.touches?t.touches[0]:t;Math.max(Math.abs(r.clientX-this._lastX),Math.abs(r.clientY-this._lastY))>=Math.floor(this.options.touchStartThreshold/(this.nativeDraggable&&window.devicePixelRatio||1))&&this._disableDelayedDrag()},_disableDelayedDrag:function(){je&&dc(je),clearTimeout(this._dragStartTimer),this._disableDelayedDragEvents()},_disableDelayedDragEvents:function(){var t=this.el.ownerDocument;vt(t,"mouseup",this._disableDelayedDrag),vt(t,"touchend",this._disableDelayedDrag),vt(t,"touchcancel",this._disableDelayedDrag),vt(t,"mousemove",this._delayedDragTouchMoveHandler),vt(t,"touchmove",this._delayedDragTouchMoveHandler),vt(t,"pointermove",this._delayedDragTouchMoveHandler)},_triggerDragStart:function(t,r){r=r||t.pointerType=="touch"&&t,!this.nativeDraggable||r?this.options.supportPointer?_t(document,"pointermove",this._onTouchMove):r?_t(document,"touchmove",this._onTouchMove):_t(document,"mousemove",this._onTouchMove):(_t(je,"dragend",this),_t(Bt,"dragstart",this._onDragStart));try{document.selection?hl(function(){document.selection.empty()}):window.getSelection().removeAllRanges()}catch{}},_dragStarted:function(t,r){if(Mr=!1,Bt&&je){Sn("dragStarted",this,{evt:r}),this.nativeDraggable&&_t(document,"dragover",YC);var o=this.options;!t&&On(je,o.dragClass,!1),On(je,o.ghostClass,!0),st.active=this,t&&this._appendGhost(),hn({sortable:this,name:"start",originalEvent:r})}else this._nulling()},_emulateDragOver:function(){if(Jn){this._lastX=Jn.clientX,this._lastY=Jn.clientY,uh();for(var t=document.elementFromPoint(Jn.clientX,Jn.clientY),r=t;t&&t.shadowRoot&&(t=t.shadowRoot.elementFromPoint(Jn.clientX,Jn.clientY),t!==r);)r=t;if(je.parentNode[Bn]._isOutsideThisEl(t),r)do{if(r[Bn]){var o=void 0;if(o=r[Bn]._onDragOver({clientX:Jn.clientX,clientY:Jn.clientY,target:t,rootEl:r}),o&&!this.options.dragoverBubble)break}t=r}while(r=r.parentNode);fh()}},_onTouchMove:function(t){if(lr){var r=this.options,o=r.fallbackTolerance,i=r.fallbackOffset,l=t.touches?t.touches[0]:t,d=ut&&$r(ut,!0),c=ut&&d&&d.a,u=ut&&d&&d.d,h=fl&&cn&&th(cn),m=(l.clientX-lr.clientX+i.x)/(c||1)+(h?h[0]-lc[0]:0)/(c||1),y=(l.clientY-lr.clientY+i.y)/(u||1)+(h?h[1]-lc[1]:0)/(u||1);if(!st.active&&!Mr){if(o&&Math.max(Math.abs(l.clientX-this._lastX),Math.abs(l.clientY-this._lastY))=0&&(hn({rootEl:Mt,name:"add",toEl:Mt,fromEl:Bt,originalEvent:t}),hn({sortable:this,name:"remove",toEl:Mt,originalEvent:t}),hn({rootEl:Mt,name:"sort",toEl:Mt,fromEl:Bt,originalEvent:t}),hn({sortable:this,name:"sort",toEl:Mt,originalEvent:t})),an&&an.save()):Rn!==Pr&&Rn>=0&&(hn({sortable:this,name:"update",toEl:Mt,originalEvent:t}),hn({sortable:this,name:"sort",toEl:Mt,originalEvent:t})),st.active&&((Rn==null||Rn===-1)&&(Rn=Pr,ji=Fo),hn({sortable:this,name:"end",toEl:Mt,originalEvent:t}),this.save()))),this._nulling()},_nulling:function(){Sn("nulling",this),Bt=je=Mt=ut=ar=Lt=rl=Li=lr=Jn=Po=Rn=ji=Pr=Fo=Lr=Mo=an=ol=st.dragged=st.ghost=st.clone=st.active=null,cl.forEach(function(t){t.checked=!0}),cl.length=oc=ac=0},handleEvent:function(t){switch(t.type){case"drop":case"dragend":this._onDrop(t);break;case"dragenter":case"dragover":je&&(this._onDragOver(t),QC(t));break;case"selectstart":t.preventDefault();break}},toArray:function(){for(var t=[],r,o=this.el.children,i=0,l=o.length,d=this.options;io.right+i||e.clientX<=o.right&&e.clientY>o.bottom&&e.clientX>=o.left:e.clientX>o.right&&e.clientY>o.top||e.clientX<=o.right&&e.clientY>o.bottom+i}function qC(e,t,r,o,i,l,d,c){var u=o?e.clientY:e.clientX,h=o?r.height:r.width,m=o?r.top:r.left,y=o?r.bottom:r.right,C=!1;if(!d){if(c&&dlm+h*l/2:uy-dl)return-Mo}else if(u>m+h*(1-i)/2&&uy-h*l/2)?u>m+h/2?1:-1:0}function e_(e){return jn(je)e.replace(l_,(t,r)=>r.toUpperCase())),gh=["Start","Add","Remove","Update","End"],vh=["Choose","Unchoose","Sort","Filter","Clone"],yh=["Move"],d_=[yh,gh,vh].flatMap(e=>e).map(e=>`on${e}`),bc={manage:yh,manageAndEmit:gh,emit:vh};function c_(e){return d_.indexOf(e)!==-1}const u_=["a","abbr","address","area","article","aside","audio","b","base","bdi","bdo","blockquote","body","br","button","canvas","caption","cite","code","col","colgroup","data","datalist","dd","del","details","dfn","dialog","div","dl","dt","em","embed","fieldset","figcaption","figure","footer","form","h1","h2","h3","h4","h5","h6","head","header","hgroup","hr","html","i","iframe","img","input","ins","kbd","label","legend","li","link","main","map","mark","math","menu","menuitem","meta","meter","nav","noscript","object","ol","optgroup","option","output","p","param","picture","pre","progress","q","rb","rp","rt","rtc","ruby","s","samp","script","section","select","slot","small","source","span","strong","style","sub","summary","sup","svg","table","tbody","td","template","textarea","tfoot","th","thead","time","title","tr","track","u","ul","var","video","wbr"];function f_(e){return u_.includes(e)}function p_(e){return["transition-group","TransitionGroup"].includes(e)}function bh(e){return["id","class","role","style"].includes(e)||e.startsWith("data-")||e.startsWith("aria-")||e.startsWith("on")}function wh(e){return e.reduce((t,[r,o])=>(t[r]=o,t),{})}function h_({$attrs:e,componentData:t={}}){return{...wh(Object.entries(e).filter(([o,i])=>bh(o))),...t}}function m_({$attrs:e,callBackBuilder:t}){const r=wh(Ch(e));Object.entries(t).forEach(([i,l])=>{bc[i].forEach(d=>{r[`on${d}`]=l(d)})});const o=`[data-draggable]${r.draggable||""}`;return{...r,draggable:o}}function Ch(e){return Object.entries(e).filter(([t,r])=>!bh(t)).map(([t,r])=>[s_(t),r]).filter(([t,r])=>!c_(t))}const _h=({el:e})=>e,g_=(e,t)=>e.__draggable_context=t,Eh=e=>e.__draggable_context;class v_{constructor({nodes:{header:t,default:r,footer:o},root:i,realList:l}){this.defaultNodes=r,this.children=[...t,...r,...o],this.externalComponent=i.externalComponent,this.rootTransition=i.transition,this.tag=i.tag,this.realList=l}get _isRootComponent(){return this.externalComponent||this.rootTransition}render(t,r){const{tag:o,children:i,_isRootComponent:l}=this;return t(o,r,l?{default:()=>i}:i)}updated(){const{defaultNodes:t,realList:r}=this;t.forEach((o,i)=>{g_(_h(o),{element:r[i],index:i})})}getUnderlyingVm(t){return Eh(t)}getVmIndexFromDomIndex(t,r){const{defaultNodes:o}=this,{length:i}=o,l=r.children,d=l.item(t);if(d===null)return i;const c=Eh(d);if(c)return c.index;if(i===0)return 0;const u=_h(o[0]),h=[...l].findIndex(m=>m===u);return ty_(e,u)),{item:d}=e;if(!d)throw new Error("draggable element must have an item slot");const c=o.flatMap((u,h)=>d({element:u,index:h}).map(m=>(m.key=r(u),m.props={...m.props||{},"data-draggable":!0},m)));if(c.length!==o.length)throw new Error("Item slot must have only one child");return{header:i,footer:l,default:c}}function w_(e){const t=p_(e),r=!f_(e)&&!t;return{transition:t,externalComponent:r,tag:r?n.resolveComponent(e):t?n.TransitionGroup:e}}function C_({$slots:e,tag:t,realList:r,getKey:o}){const i=b_({$slots:e,realList:r,getKey:o}),l=w_(t);return new v_({nodes:i,root:l,realList:r})}function Sh(e,t){n.nextTick(()=>this.$emit(e.toLowerCase(),t))}function Ah(e){return(t,r)=>{if(this.realList!==null)return this[`onDrag${e}`](t,r)}}function __(e){const t=Ah.call(this,e);return(r,o)=>{t.call(this,r,o),Sh.call(this,e,r)}}let wc=null;const E_={list:{type:Array,required:!1,default:null},modelValue:{type:Array,required:!1,default:null},itemKey:{type:[String,Function],required:!0},clone:{type:Function,default:e=>e},tag:{type:String,default:"div"},move:{type:Function,default:null},componentData:{type:Object,required:!1,default:null}},S_=["update:modelValue","change",...[...bc.manageAndEmit,...bc.emit].map(e=>e.toLowerCase())],jr=n.defineComponent({name:"draggable",inheritAttrs:!1,props:E_,emits:S_,data(){return{error:!1}},render(){try{this.error=!1;const{$slots:e,$attrs:t,tag:r,componentData:o,realList:i,getKey:l}=this,d=C_({$slots:e,tag:r,realList:i,getKey:l});this.componentStructure=d;const c=h_({$attrs:t,componentData:o});return d.render(n.h,c)}catch(e){return this.error=!0,n.h("pre",{style:{color:"red"}},e.stack)}},created(){this.list!==null&&this.modelValue!==null&&o_.error("modelValue and list props are mutually exclusive! Please set one or another.")},mounted(){if(this.error)return;const{$attrs:e,$el:t,componentStructure:r}=this;r.updated();const o=m_({$attrs:e,callBackBuilder:{manageAndEmit:l=>__.call(this,l),emit:l=>Sh.bind(this,l),manage:l=>Ah.call(this,l)}}),i=t.nodeType===1?t:t.parentElement;this._sortable=new st(i,o),this.targetDomElement=i,i.__draggable_component__=this},updated(){this.componentStructure.updated()},beforeUnmount(){this._sortable!==void 0&&this._sortable.destroy()},computed:{realList(){const{list:e}=this;return e||this.modelValue},getKey(){const{itemKey:e}=this;return typeof e=="function"?e:t=>t[e]}},watch:{$attrs:{handler(e){const{_sortable:t}=this;!t||Ch(e).forEach(([r,o])=>{t.option(r,o)})},deep:!0}},methods:{getUnderlyingVm(e){return this.componentStructure.getUnderlyingVm(e)||null},getUnderlyingPotencialDraggableComponent(e){return e.__draggable_component__},emitChanges(e){n.nextTick(()=>this.$emit("change",e))},alterList(e){if(this.list){e(this.list);return}const t=[...this.modelValue];e(t),this.$emit("update:modelValue",t)},spliceList(){const e=t=>t.splice(...arguments);this.alterList(e)},updatePosition(e,t){const r=o=>o.splice(t,0,o.splice(e,1)[0]);this.alterList(r)},getRelatedContextFromMoveEvent({to:e,related:t}){const r=this.getUnderlyingPotencialDraggableComponent(e);if(!r)return{component:r};const o=r.realList,i={list:o,component:r};return e!==t&&o?{...r.getUnderlyingVm(t)||{},...i}:i},getVmIndexFromDomIndex(e){return this.componentStructure.getVmIndexFromDomIndex(e,this.targetDomElement)},onDragStart(e){this.context=this.getUnderlyingVm(e.item),e.item._underlying_vm_=this.clone(this.context.element),wc=e.item},onDragAdd(e){const t=e.item._underlying_vm_;if(t===void 0)return;yc(e.item);const r=this.getVmIndexFromDomIndex(e.newIndex);this.spliceList(r,0,t);const o={element:t,newIndex:r};this.emitChanges({added:o})},onDragRemove(e){if(mh(this.$el,e.item,e.oldIndex),e.pullMode==="clone"){yc(e.clone);return}const{index:t,element:r}=this.context;this.spliceList(t,1);const o={element:r,oldIndex:t};this.emitChanges({removed:o})},onDragUpdate(e){yc(e.item),mh(e.from,e.item,e.oldIndex);const t=this.context.index,r=this.getVmIndexFromDomIndex(e.newIndex);this.updatePosition(t,r);const o={element:this.context.element,oldIndex:t,newIndex:r};this.emitChanges({moved:o})},computeFutureIndex(e,t){if(!e.element)return 0;const r=[...t.to.children].filter(d=>d.style.display!=="none"),o=r.indexOf(t.related),i=e.component.getVmIndexFromDomIndex(o);return r.indexOf(wc)!==-1||!t.willInsertAfter?i:i+1},onDragMove(e,t){const{move:r,realList:o}=this;if(!r||!o)return!0;const i=this.getRelatedContextFromMoveEvent(e),l=this.computeFutureIndex(i,e),d={...this.context,futureIndex:l},c={...e,relatedContext:i,draggedContext:d};return r(c,t)},onDragEnd(){wc=null}}});function A_(){return[{name:"template",title:"\u6A21\u677F",list:[]},{name:"main",title:"\u57FA\u7840\u7EC4\u4EF6",list:[]},{name:"subform",title:"\u5B50\u8868\u5355\u7EC4\u4EF6",list:[]},{name:"container",title:"\u5BB9\u5668\u7EC4\u4EF6",list:[]},{name:"chart",title:"\u56FE\u8868\u7EC4\u4EF6",list:[]},{name:"aide",title:"\u8F85\u52A9\u7EC4\u4EF6",list:[]},{name:"layout",title:"\u5E03\u5C40\u7EC4\u4EF6",list:[]}]}var Cc=typeof globalThis<"u"?globalThis:typeof window<"u"?window:typeof global<"u"?global:typeof self<"u"?self:{};function x_(e){return e&&e.__esModule&&Object.prototype.hasOwnProperty.call(e,"default")?e.default:e}var xh={exports:{}};(function(e,t){(function(r,o){e.exports=o()})(Cc,function(){var r=1e3,o=6e4,i=36e5,l="millisecond",d="second",c="minute",u="hour",h="day",m="week",y="month",C="quarter",A="year",w="date",E="Invalid Date",b=/^(\d{4})[-/]?(\d{1,2})?[-/]?(\d{0,2})[Tt\s]*(\d{1,2})?:?(\d{1,2})?:?(\d{1,2})?[.:]?(\d+)?$/,g=/\[([^\]]+)]|Y{1,4}|M{1,4}|D{1,2}|d{1,4}|H{1,2}|h{1,2}|a|A|m{1,2}|s{1,2}|Z{1,2}|SSS/g,_={name:"en",weekdays:"Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"),months:"January_February_March_April_May_June_July_August_September_October_November_December".split("_"),ordinal:function(H){var R=["th","st","nd","rd"],z=H%100;return"["+H+(R[(z-20)%10]||R[z]||R[0])+"]"}},x=function(H,R,z){var $=String(H);return!$||$.length>=R?H:""+Array(R+1-$.length).join(z)+H},k={s:x,z:function(H){var R=-H.utcOffset(),z=Math.abs(R),$=Math.floor(z/60),S=z%60;return(R<=0?"+":"-")+x($,2,"0")+":"+x(S,2,"0")},m:function H(R,z){if(R.date()1)return H(Q[0])}else{var G=R.name;O[G]=R,S=G}return!$&&S&&(T=S),S||!$&&T},N=function(H,R){if(I(H))return H.clone();var z=typeof R=="object"?R:{};return z.date=H,z.args=arguments,new L(z)},B=k;B.l=M,B.i=I,B.w=function(H,R){return N(H,{locale:R.$L,utc:R.$u,x:R.$x,$offset:R.$offset})};var L=function(){function H(z){this.$L=M(z.locale,null,!0),this.parse(z),this.$x=this.$x||z.x||{},this[F]=!0}var R=H.prototype;return R.parse=function(z){this.$d=function($){var S=$.date,J=$.utc;if(S===null)return new Date(NaN);if(B.u(S))return new Date;if(S instanceof Date)return new Date(S);if(typeof S=="string"&&!/Z$/i.test(S)){var Q=S.match(b);if(Q){var G=Q[2]-1||0,ie=(Q[7]||"0").substring(0,3);return J?new Date(Date.UTC(Q[1],G,Q[3]||1,Q[4]||0,Q[5]||0,Q[6]||0,ie)):new Date(Q[1],G,Q[3]||1,Q[4]||0,Q[5]||0,Q[6]||0,ie)}}return new Date(S)}(z),this.init()},R.init=function(){var z=this.$d;this.$y=z.getFullYear(),this.$M=z.getMonth(),this.$D=z.getDate(),this.$W=z.getDay(),this.$H=z.getHours(),this.$m=z.getMinutes(),this.$s=z.getSeconds(),this.$ms=z.getMilliseconds()},R.$utils=function(){return B},R.isValid=function(){return this.$d.toString()!==E},R.isSame=function(z,$){var S=N(z);return this.startOf($)<=S&&S<=this.endOf($)},R.isAfter=function(z,$){return N(z){let r,o,i;try{r=e.toString().split(".")[1].length}catch{r=0}try{o=t.toString().split(".")[1].length}catch{o=0}return i=Math.pow(10,Math.max(r,o)),(e*i+t*i)/i},Sub:(e,t)=>{let r,o,i;try{r=e.toString().split(".")[1].length}catch{r=0}try{o=t.toString().split(".")[1].length}catch{o=0}i=Math.pow(10,Math.max(r,o));let l=r>=o?r:o;return Number(((e*i-t*i)/i).toFixed(l))},Mul:(e,t)=>{let r=0,o=e.toString(),i=t.toString();try{r+=o.split(".")[1].length}catch{}try{r+=i.split(".")[1].length}catch{}return Number(o.replace(".",""))*Number(i.replace(".",""))/Math.pow(10,r)},Div:(e,t)=>{let r=0,o=0;try{r=e.toString().split(".")[1].length}catch{}try{o=t.toString().split(".")[1].length}catch{}let i=Number(e.toString().replace(".","")),l=Number(t.toString().replace(".",""));return i/l*Math.pow(10,o-r)}},N_="YYYY-MM-DD HH:mm:ss",zi=(e,t)=>e==null?t:e,jt={ADD:function(e,t){return zr.Add(zi(e,"0"),zi(t,"0"))},SUB:function(e,t){return zr.Sub(zi(e,"0"),zi(t,"0"))},MUL:function(e,t){return zr.Mul(zi(e,"0"),zi(t,"0"))},DIV:function(e,t){return zr.Div(zi(e,"0"),zi(t,"0"))},SUM:function(...e){return(e||[]).reduce((t,r)=>zr.Add(t,Array.isArray(r)?jt.SUM(...r):r||0),0)},MAX:function(...e){const t=Array.isArray(e[0])?e[0]:e;return Math.max(...t.map(r=>parseFloat(r)).filter(r=>!isNaN(r)))},MIN:function(...e){const t=Array.isArray(e[0])?e[0]:e;return Math.min(...t.map(r=>parseFloat(r)).filter(r=>!isNaN(r)))},ABS:function(e){return parseFloat(Math.abs(e))||0},AVG:function(...e){const t=Array.isArray(e[0])?e[0]:e;return t.length?zr.Div(jt.SUM(t),t.length):0},POWER:function(e,t){return Math.pow(parseFloat(e),parseFloat(t))},RAND:function(){return Math.random()},CEIL:function(e){return Math.ceil(parseFloat(e))||0},FLOOR:function(e){return Math.floor(parseFloat(e)||0)},FIXED:function(e,t){const r=Math.pow(10,t||0);return(Math.floor(parseFloat(e)*r)/r).toFixed(t||0)},ISNUMBER:function(e){return e===""||e===null?!1:!isNaN(Number(e))},PI:function(){return Number(Math.PI)},ROUND:function(e,t){return e=parseFloat(e),isNaN(e)?0:parseFloat(e.toFixed(parseFloat(t)||0))},SQRT:function(e){return Math.sqrt(parseFloat(e))||0},TONUMBER:function(e){return parseFloat(e)||0},MODIFYDATE:function(e,t,r,o){if(!e)return null;let i=k_(e);return t>0?i=i.add(t,r):t<0&&(i=i.subtract(-1*t,r)),i.format(o||N_)},ADDYEAR:function(e,t,r){return jt.MODIFYDATE(e,Math.max(t,0),"y",r)},ADDMONTH:function(e,t,r){return jt.MODIFYDATE(e,Math.max(t,0),"M",r)},ADDDAY:function(e,t,r){return jt.MODIFYDATE(e,Math.max(t,0),"d",r)},ADDHOUR:function(e,t,r){return jt.MODIFYDATE(e,Math.max(t,0),"h",r)},ADDMINUTE:function(e,t,r){return jt.MODIFYDATE(e,Math.max(t,0),"m",r)},ADDSECOND:function(e,t,r){return jt.MODIFYDATE(e,Math.max(t,0),"s",r)},ADDWEEK:function(e,t,r){return jt.MODIFYDATE(e,Math.max(t,0),"w",r)},SUBYEAR:function(e,t,r){return t=Math.max(t,0),jt.MODIFYDATE(e,t>0?-1*t:0,"y",r)},SUBMONTH:function(e,t,r){return t=Math.max(t,0),jt.MODIFYDATE(e,t>0?-1*t:0,"M",r)},SUBDAY:function(e,t,r){return t=Math.max(t,0),jt.MODIFYDATE(e,t>0?-1*t:0,"d",r)},SUBHOUR:function(e,t,r){return t=Math.max(t,0),jt.MODIFYDATE(e,t>0?-1*t:0,"h",r)},SUBMINUTE:function(e,t,r){return t=Math.max(t,0),jt.MODIFYDATE(e,t>0?-1*t:0,"m",r)},SUBSECOND:function(e,t,r){return t=Math.max(t,0),jt.MODIFYDATE(e,t>0?-1*t:0,"s",r)},SUBWEEK:function(e,t,r){return t=Math.max(t,0),jt.MODIFYDATE(e,t>0?-1*t:0,"w",r)},NOW:function(){const e=new Date,t=e.getFullYear(),r=("0"+(e.getMonth()+1)).slice(-2),o=("0"+e.getDate()).slice(-2),i=("0"+e.getHours()).slice(-2),l=("0"+e.getMinutes()).slice(-2),d=("0"+e.getSeconds()).slice(-2);return t+"-"+r+"-"+o+" "+i+":"+l+":"+d},TODAY:function(){const e=new Date,t=e.getFullYear(),r=("0"+(e.getMonth()+1)).slice(-2),o=("0"+e.getDate()).slice(-2);return t+"-"+r+"-"+o},YEAR:function(e){return e?new Date(e).getFullYear():null},MONTH:function(e){return e?new Date(e).getMonth()+1:null},DAY:function(e){return e?new Date(e).getDate():null},HOUR:function(e){return e?new Date(e).getHours():null},MINUTE:function(e){return e?new Date(e).getMinutes():null},SECOND:function(e){return e?new Date(e).getSeconds():null},DIFFDAYS:function(e,t){const r=new Date(e),o=new Date(t);return parseInt(Math.ceil(Math.abs(o.getTime()-r.getTime())/(1e3*60*60*24)))},DIFFHOURS:function(e,t){const r=new Date(e),o=new Date(t);return parseFloat(Math.abs(o.getTime()-r.getTime())/(1e3*60*60)).toFixed(2)},DIFFMINUTES:function(e,t){const r=new Date(e),o=new Date(t);return parseInt(Math.ceil(Math.abs(o.getTime()-r.getTime())/(1e3*60)))},TIMESTAMP:function(e){return Date.parse(e)},STARTSWITH:function(e,t){return(""+e).substring(0,(""+t).length)===t},EMPTY:function(e){return dt.empty(e)},NOTEMPTY:function(e){return!dt.empty(e)},LEN:function(e){return Array.isArray(e)?e.length:0},MOD:function(e,t){return e=parseFloat(e),t=parseFloat(t),!e||!t||isNaN(e)||isNaN(t)?0:e%t},SLICELEFT:function(e,t){return(""+e).slice(0,Number(t)||0)},SLICERIGHT:function(e,t){return(""+e).slice(Number(t)*-1)},TOLOWER:function(e){return(""+e).toLowerCase()},TOUPPER:function(e){return(""+e).toUpperCase()},INCLUDES:function(e,t){return(e||"").indexOf(t||"")},REPLACE:function(e,t,r){return(e||"").replace(t||"",r||"")},REPLACEALL:function(e,t,r){return(e||"").replaceAll(t||"",r||"")},TRIM:function(e){return(e||"").trim()},TOCHINSESAMOUNT:function(e){let t=["\u96F6","\u58F9","\u8D30","\u53C1","\u8086","\u4F0D","\u9646","\u67D2","\u634C","\u7396"],r=["","\u4E07","\u4EBF","\u4E07\u4EBF","\u4EBF\u4EBF"],o=["","\u62FE","\u4F70","\u4EDF"],i=["\u89D2","\u5206"];function l(C){let A="",w="",E=0,b=!0;for(;C>0;){let g=C%10;g===0?b||(b=!0,w=t[g]+w):(b=!1,A=t[g],A+=o[E],w=A+w),E++,C=Math.floor(C/10)}return w}let d=0,c="",u="",h=!1;if(e===0)return t[0];let m=Math.floor(e),y=Math.round((e-m)*100);for(;m>0;){let C=m%1e4;h&&(u=t[0]+u),c=l(C),c+=C!==0?r[d]:r[0],u=c+u,h=C<1e3&&C>0,m=Math.floor(m/1e4),d++}return u&&(u+="\u5143"),y>0?(u+=t[Math.floor(y/10)]+i[0],y%10!==0&&(u+=t[y%10]+i[1])):u&&(u+="\u6574"),u},UNION:function(...e){return(Array.isArray(e[0])?e[0]:e).filter((r,o,i)=>i.indexOf(r)===o)},AND:function(...e){return!!e.reduce((t,r)=>t&&r,!0)},OR:function(...e){return!!e.reduce((t,r)=>t||r,!1)},IF:function(e,t=!0,r=!1){return e?t:r},DEFAULT:function(e,t){return dt.Undef(e)?t:e},CASE:function(...e){for(let t=0;t-1},FALSE:function(){return!1},TRUE:function(){return!0},NOT:function(e){return!e},EQ:function(e,t){return e===t},GE:function(e,t){return e>=t},GT:function(e,t){return e>t},LE:function(e,t){return e<=t},LT:function(e,t){return e{let r=[e];const o=t.split(".");let i=1;for(;o[i];){let l=[];r.forEach(d=>{Object.values(d.ctxs).forEach(c=>{if(c.rule._fc_id===o[i-1]){const u=d.subForm[c.id];l.push(...Array.isArray(u)?u:[u])}})}),r=l.map(d=>d.rule[0].__fc__.$handle),i++}return[r,o[i-1]]},vl=(e,t,r)=>{const o=e.vm.setupState.top.setupState.fc.$handle;let i=[e.$handle];e.$handle!==o&&i.push(o);let l=t;t.indexOf(".")>-1&&([i,l]=T_(o,t)),i.forEach(d=>{Object.values(d.ctxs).forEach(c=>{c.rule._fc_id===l&&r(c.rule,d.api)})})},Ec={openModel(e,t){t.api.open(e.model)},closeModel(e,t){t.api.close(e.model)},hidden(e,t,r){const o=typeof e.id=="string"?[e.id]:e.id||[];let i=!!e.status;e.compute&&(i=!!r.$handle.compute(t.self.__fc__,e.formula)),o.forEach(l=>{vl(r,l,d=>{d.hidden=i})})},disabled(e,t,r){const o=typeof e.id=="string"?[e.id]:e.id||[];let i=!!e.status;e.compute&&(i=!!r.$handle.compute(t.self.__fc__,e.formula)),o.forEach(l=>{vl(r,l,d=>{d.props||(d.props={}),d.props.disabled=i})})},resetFields(e,t){t.api.top.resetFields()},clearFields(e,t){t.api.top.coverValue({})},validate(e,t){return t.api.top.validate()},validateFields(e,t,r){const o=typeof e.id=="string"?[e.id]:e.id||[],i=[];return o.forEach(l=>{vl(r,l,(d,c)=>{d.field&&i.push(c.validateField(d.field))})}),i.length?Promise.all(i):void 0},submit(e,t){return t.api.top.submit()},setValue(e,t,r){(e.formData||[]).forEach(o=>{let i=o.value;o.compute&&(i=r.$handle.compute(t.self.__fc__,o.formula)),vl(r,o.id,l=>{l.value=i})})},fetch(e,t){const{append:r,response:o,fetch:i}=e;return r&&(i.data={...t.api.formData(),...i.data||{}}),new Promise((l,d)=>{t.api.fetch(e.fetch).then(c=>{o&&t.api.setData(o,c),l(c)}).catch(c=>{d(c)})})},copy(e,t,r){let o=e.content||"";e.compute&&(o=r.$handle.compute(t.self.__fc__,e.formula)),di(o)},callback(e,t){return e.callback&&e.callback(t)},message(e){ai.ElMessage(e||{})}},Nh=[{key:"model",children:["openModel","closeModel","message"]},{key:"form",children:["hidden","disabled","resetFields","clearFields","setValue","validate","validateFields","submit"]},{key:"other",children:["fetch","copy","callback"]}],Th={openModel(e){return[{type:"select",field:"model",$required:!0,options:e.pageData.filter(t=>!t.default).map(t=>{const r=t.main._menu;return{label:Rr(t.main,t.config.labelField,"")||e.t("com."+r.name+".name")||r.label,value:t.main.name}})}]},message(e){return[{type:"radio",field:"type",value:"info",props:{type:"button"},options:it(e.t,["info","warning","success","error"].map(t=>({label:t,value:t})))},{type:"input",$required:!0,field:"message"},{type:"inputNumber",field:"duration",props:{precision:0,controlsPosition:"right"}},{type:"switch",field:"showClose"}]},hidden(e){const t=e.t;return[{type:"RuleSelect",field:"id",$required:!0,props:{multiple:!0}},{type:"radio",field:"compute",value:!1,options:[{label:t("behavior.props.static"),value:!1},{label:t("behavior.props.formula"),value:!0}],control:[{value:!1,rule:[{type:"radio",field:"status",value:!0,options:[{label:t("props.show"),value:!1},{label:t("props.hide"),value:!0}]}]},{value:!0,rule:[{type:"ComputedConfig",field:"formula",$required:!0,props:{btn:t("behavior.props.setFormula"),title:t("behavior.props.setFormula"),name:t("behavior.props.setFormula"),invertLabel:t("props.show"),validLabel:t("props.hide")}}]}]}]},disabled(e){const t=e.t;return[{type:"RuleSelect",field:"id",$required:!0,props:{onlyField:!0,multiple:!0}},{type:"radio",field:"compute",value:!1,options:[{label:t("behavior.props.static"),value:!1},{label:t("behavior.props.formula"),value:!0}],control:[{value:!1,rule:[{type:"radio",field:"status",value:!0,options:[{label:t("props.enable"),value:!1},{label:t("props.disabled"),value:!0}]}]},{value:!0,rule:[{type:"ComputedConfig",field:"formula",$required:!0,props:{title:t("behavior.props.setFormula"),invertLabel:t("props.enable"),validLabel:t("props.disabled")}}]}]}]},validateFields(){return[{type:"RuleSelect",field:"id",$required:!0,props:{onlyField:!0,multiple:!0}}]},setValue(e){const t=e.t;return[{type:"group",field:"formData",props:{expand:1,rule:[{type:"RuleSelect",field:"id",title:t("behavior.props.id"),$required:!0,props:{onlyField:!0}},{type:"radio",field:"compute",value:!1,title:t("behavior.props.compute"),options:[{label:t("behavior.props.static"),value:!1},{label:t("behavior.props.formula"),value:!0}],control:[{value:!1,rule:[{type:"ValueInput",field:"value",title:t("props.value"),$required:!0}]},{value:!0,rule:[{type:"ComputedConfig",field:"formula",title:t("behavior.props.formula"),$required:!0,props:{type:"value",title:t("behavior.props.setFormula"),invertLabel:t("props.show"),validLabel:t("props.hide")}}]}]}]}}]},fetch(){return[{type:"FetchConfig",field:"fetch",$required:!0},{type:"switch",field:"append",value:!1},{type:"input",field:"response",value:"res_"+We()}]},copy(e){const t=e.t;return[{type:"radio",field:"compute",value:!1,options:[{label:t("behavior.props.static"),value:!1},{label:t("behavior.props.formula"),value:!0}],control:[{value:!1,rule:[{type:"input",field:"content",$required:!0,props:{type:"textarea"},options:[{label:t("props.enable"),value:!1},{label:t("props.disabled"),value:!0}]}]},{value:!0,rule:[{type:"ComputedConfig",field:"formula",$required:!0,props:{type:"value",title:t("behavior.props.setFormula"),invertLabel:t("props.enable"),validLabel:t("props.disabled")}}]}]}]},callback(e){return[{type:"FnInput",field:"callback",$required:!0,props:{name:"callback",args:[on(e.t)]}}]}};function D_(e,t){return e.reduce((r,o)=>r.then(()=>o(t)),Promise.resolve())}const Dh=function(e){return{name:"behavior",load(t,r){const o=t.getValue(),i={},l={};o&&Object.keys(o).forEach(d=>{if(Array.isArray(o[d])){const c=[];if(o[d].forEach(u=>{const{method:h,config:m,expression:y,stopPropagation:C,ignoreError:A}=u;c.push(w=>new Promise(E=>{if(y&&e.$handle.compute(r.__fc__,y)===!1){E();return}const b=(..._)=>{(!C||e.$handle.compute(r.__fc__,C)!==!0)&&E(..._)};let g;try{g=Ec[h](m||{},w,e)}catch(_){console.error(_),A!==!1&&b();return}g&&g.then?g.then(b).catch(()=>{A!==!1&&b()}):b(g)}))}),c.length){const u=e.$handle.inject(r,function(h){D_(c,h)},r.inject||e.$handle.options.injectEvent);d.indexOf("hook_")>-1?l[d.replace("hook_","")]=u:i[d]=u}}}),t.getProp().on=i,t.getProp().hook=l}}},Uo={name:"easySlots",load(e){const t=e.getValue(),r={};t&&Object.keys(t).forEach(o=>{r[o]=t[o].type==="icon"?{type:"i",class:"fc-icon iconfont "+t[o].value}:{type:"div",children:[""+(t[o].value||"")]}}),e.getProp().renderSlots=r}};Uo.watch=Uo.load;const V_=Object.assign||function(e){for(let t,r=1;r{yl(Ec,t)},e.extendApi(t=>({open(r,...o){(t.el(r)||t.top.el(r)).open(...o)},close(r){r?(t.el(r)||t.top.el(r)).close():(t.top.bus.$emit("fc.closeDialog"),t!==t.top&&t.bus.$emit("fc.closeDialog"))}}))}function Vh(e){e.extendApi(t=>({message(r){return ai.ElMessage(r||{})}}))}Ua.default.parser().preview=Vb,Object.keys(jt).forEach(e=>{Ua.default.setFormula(e,jt[e])});const An=Ua.default,ze=Ua.default.factory();Sc(An),Vh(An),Sc(ze),Vh(ze),An.register("behavior",Dh),An.register("easySlots",Uo),ze.register("easySlots",Uo);/*!
* @form-create/component-elm-select v3.2.18
* (c) 2018-2025 xaboy
* Github https://github.com/xaboy/form-create with select
* Released under the MIT License.
- */function Vh(e,t){var r=Object.keys(e);if(Object.getOwnPropertySymbols){var o=Object.getOwnPropertySymbols(e);t&&(o=o.filter(function(i){return Object.getOwnPropertyDescriptor(e,i).enumerable})),r.push.apply(r,o)}return r}function V_(e){for(var t=1;t0},Function:function(t){var r=this.getType(t);return r==="Function"||r==="AsyncFunction"},getType:function(t){var r=Object.prototype.toString.call(t);return/^\[object (.*)\]$/.exec(r)[1]},empty:function(t){return t==null||Array.isArray(t)&&Array.isArray(t)&&!t.length?!0:typeof t=="string"&&!t}};["Date","Object","String","Boolean","Array","Number"].forEach(function(e){wl[e]=function(t){return wl.type(t,e)}});function R_(e,t){return{}.hasOwnProperty.call(e,t)}var $_="fcSelect",I_=n.defineComponent({name:$_,inheritAttrs:!1,props:{formCreateInject:Object,modelValue:{type:[Array,String,Number,Boolean,Object],default:void 0},type:String},emits:["update:modelValue","fc.el"],setup:function(t){var r=n.toRef(t.formCreateInject,"options",[]),o=n.toRef(t,"modelValue"),i=function(){return Array.isArray(r.value)?r.value:[]};return{options:i,value:o}},render:function(){var t=this,r,o,i=function(u,h){return n.createVNode(n.resolveComponent("ElOption"),n.mergeProps(u,{key:""+h+"-"+u.value}),null)},l=function(u,h){return n.createVNode(n.resolveComponent("ElOptionGroup"),{label:u.label,key:""+h+"-"+u.label},{default:function(){return[wl.trueArray(u.options)&&u.options.map(function(y,C){return i(y,C)})]}})},d=this.options();return n.createVNode(n.resolveComponent("ElSelect"),n.mergeProps(this.$attrs,{modelValue:this.value,"onUpdate:modelValue":function(u){return t.$emit("update:modelValue",u)},ref:"el"}),V_({default:function(){return[d.map(function(u,h){return R_(u||"","options")?l(u,h):i(u,h)}),(r=(o=t.$slots).default)===null||r===void 0?void 0:r.call(o)]}},B_(this.$slots,["default"])))},mounted:function(){this.$emit("fc.el",this.$refs.el)}});/*!
+ */function Oh(e,t){var r=Object.keys(e);if(Object.getOwnPropertySymbols){var o=Object.getOwnPropertySymbols(e);t&&(o=o.filter(function(i){return Object.getOwnPropertyDescriptor(e,i).enumerable})),r.push.apply(r,o)}return r}function B_(e){for(var t=1;t0},Function:function(t){var r=this.getType(t);return r==="Function"||r==="AsyncFunction"},getType:function(t){var r=Object.prototype.toString.call(t);return/^\[object (.*)\]$/.exec(r)[1]},empty:function(t){return t==null||Array.isArray(t)&&Array.isArray(t)&&!t.length?!0:typeof t=="string"&&!t}};["Date","Object","String","Boolean","Array","Number"].forEach(function(e){wl[e]=function(t){return wl.type(t,e)}});function I_(e,t){return{}.hasOwnProperty.call(e,t)}var F_="fcSelect",P_=n.defineComponent({name:F_,inheritAttrs:!1,props:{formCreateInject:Object,modelValue:{type:[Array,String,Number,Boolean,Object],default:void 0},type:String},emits:["update:modelValue","fc.el"],setup:function(t){var r=n.toRef(t.formCreateInject,"options",[]),o=n.toRef(t,"modelValue"),i=function(){return Array.isArray(r.value)?r.value:[]};return{options:i,value:o}},render:function(){var t=this,r,o,i=function(u,h){return n.createVNode(n.resolveComponent("ElOption"),n.mergeProps(u,{key:""+h+"-"+u.value}),null)},l=function(u,h){return n.createVNode(n.resolveComponent("ElOptionGroup"),{label:u.label,key:""+h+"-"+u.label},{default:function(){return[wl.trueArray(u.options)&&u.options.map(function(y,C){return i(y,C)})]}})},d=this.options();return n.createVNode(n.resolveComponent("ElSelect"),n.mergeProps(this.$attrs,{modelValue:this.value,"onUpdate:modelValue":function(u){return t.$emit("update:modelValue",u)},ref:"el"}),B_({default:function(){return[d.map(function(u,h){return I_(u||"","options")?l(u,h):i(u,h)}),(r=(o=t.$slots).default)===null||r===void 0?void 0:r.call(o)]}},$_(this.$slots,["default"])))},mounted:function(){this.$emit("fc.el",this.$refs.el)}});/*!
* @form-create/component-elm-tree v3.2.18
* (c) 2018-2025 xaboy
* Github https://github.com/xaboy/form-create with tree
* Released under the MIT License.
- */function F_(e){return Array.isArray(e)?e:[null,void 0,""].indexOf(e)>-1?[]:[e]}var P_="fcTree",M_=n.defineComponent({name:P_,inheritAttrs:!1,formCreateParser:{mergeProp:function(t){var r=t.prop.props;r.nodeKey||(r.nodeKey="id"),r.props||(r.props={label:"title"})}},props:{type:String,modelValue:{type:[Array,String,Number],default:function(){return[]}}},emits:["update:modelValue","fc.el"],watch:{modelValue:function(){this.setValue()}},methods:{updateValue:function(){if(!!this.$refs.tree){var t;this.type==="selected"?t=this.$refs.tree.getCurrentKey():t=this.$refs.tree.getCheckedKeys(),this.$emit("update:modelValue",t)}},setValue:function(){if(!!this.$refs.tree){var t=this.type;t==="selected"?this.$refs.tree.setCurrentKey(this.modelValue):this.$refs.tree.setCheckedKeys(F_(this.modelValue))}}},render:function(){return n.createVNode(n.resolveComponent("ElTree"),n.mergeProps(this.$attrs,{ref:"tree",onCheck:this.updateValue,onNodeClick:this.updateValue}),this.$slots)},mounted:function(){this.setValue(),this.$emit("fc.el",this.$refs.tree)}});/*!
+ */function M_(e){return Array.isArray(e)?e:[null,void 0,""].indexOf(e)>-1?[]:[e]}var L_="fcTree",j_=n.defineComponent({name:L_,inheritAttrs:!1,formCreateParser:{mergeProp:function(t){var r=t.prop.props;r.nodeKey||(r.nodeKey="id"),r.props||(r.props={label:"title"})}},props:{type:String,modelValue:{type:[Array,String,Number],default:function(){return[]}}},emits:["update:modelValue","fc.el"],watch:{modelValue:function(){this.setValue()}},methods:{updateValue:function(){if(!!this.$refs.tree){var t;this.type==="selected"?t=this.$refs.tree.getCurrentKey():t=this.$refs.tree.getCheckedKeys(),this.$emit("update:modelValue",t)}},setValue:function(){if(!!this.$refs.tree){var t=this.type;t==="selected"?this.$refs.tree.setCurrentKey(this.modelValue):this.$refs.tree.setCheckedKeys(M_(this.modelValue))}}},render:function(){return n.createVNode(n.resolveComponent("ElTree"),n.mergeProps(this.$attrs,{ref:"tree",onCheck:this.updateValue,onNodeClick:this.updateValue}),this.$slots)},mounted:function(){this.setValue(),this.$emit("fc.el",this.$refs.tree)}});/*!
* @form-create/component-elm-upload v3.2.18
* (c) 2018-2025 xaboy
* Github https://github.com/xaboy/form-create with upload
* Released under the MIT License.
- */function Oh(e,t){var r=Object.keys(e);if(Object.getOwnPropertySymbols){var o=Object.getOwnPropertySymbols(e);t&&(o=o.filter(function(i){return Object.getOwnPropertyDescriptor(e,i).enumerable})),r.push.apply(r,o)}return r}function Sc(e){for(var t=1;t-1?[]:[e]}function j_(e,t){return Object.keys(e).reduce(function(r,o){return(!t||t.indexOf(o)===-1)&&(r[o]=e[o]),r},{})}function z_(e,t){t===void 0&&(t={});var r=t.insertAt;if(!(!e||typeof document>"u")){var o=document.head||document.getElementsByTagName("head")[0],i=document.createElement("style");i.type="text/css",r==="top"&&o.firstChild?o.insertBefore(i,o.firstChild):o.appendChild(i),i.styleSheet?i.styleSheet.cssText=e:i.appendChild(document.createTextNode(e))}}var U_="._fc-upload{width:100%}._fc-exceed .el-upload{display:none}.el-upload-list.is-disabled .el-upload{cursor:not-allowed!important}";z_(U_);var Bh={name:"IconUpload"},H_={class:"icon",viewBox:"0 0 1024 1024",xmlns:"http://www.w3.org/2000/svg"},W_=n.createElementVNode("path",{fill:"currentColor",d:"M160 832h704a32 32 0 110 64H160a32 32 0 110-64zm384-578.304V704h-64V247.296L237.248 490.048 192 444.8 508.8 128l316.8 316.8-45.312 45.248L544 253.696z"},null,-1),G_=[W_];function K_(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("svg",H_,G_)}Bh.render=K_;function Rh(e,t){return Cl(e)==="object"?e:{url:e,is_string:!0,name:Y_(e),uid:t}}function $h(e){return Sc(Sc({},e),{},{file:e,value:e})}function Y_(e){return(""+e).split("/").pop()}var Q_="fcUpload",J_=n.defineComponent({name:Q_,inheritAttrs:!1,formCreateParser:{toFormValue:function(t){return _l(t)},toValue:function(t,r){return r.prop.props.limit===1?t[0]||"":t}},props:{previewMask:void 0,onPreview:Function,httpRequest:Function,modalTitle:String,listType:String,formCreateInject:Object,modelValue:[Array,String,Object]},emits:["update:modelValue","change","remove","fc.el"],data:function(){return{previewVisible:!1,previewImage:"",fileList:[]}},created:function(){this.fileList=_l(this.modelValue).map(Rh).map($h)},watch:{modelValue:function(t){this.fileList=_l(t).map(Rh).map($h)}},methods:{handlePreview:function(t){this.onPreview?this.onPreview.apply(this,arguments):this.listType==="text"?window.open(t.url):(this.previewImage=t.url,this.previewVisible=!0)},update:function(t){var r=t.map(function(o){return o.is_string?o.url:o.value||o.url}).filter(function(o){return o!==void 0});this.$emit("update:modelValue",r)},handleCancel:function(){this.previewVisible=!1},handleChange:function(t,r){this.$emit.apply(this,["change"].concat(Array.prototype.slice.call(arguments))),t.status==="success"&&this.update(r)},handleRemove:function(t,r){this.$emit.apply(this,["remove"].concat(Array.prototype.slice.call(arguments))),this.update(r)},doHttpRequest:function(t){if(this.httpRequest)return this.httpRequest(t);t.source="upload",this.formCreateInject.api.fetch(t)}},render:function(){var t,r,o=this,i=_l(this.modelValue).length;return n.createVNode("div",{class:"_fc-upload"},[n.createVNode(n.resolveComponent("ElUpload"),n.mergeProps({key:i},this.$attrs,{listType:this.listType||"picture-card",class:{"_fc-exceed":this.$attrs.limit?this.$attrs.limit<=i:!1},onPreview:this.handlePreview,onChange:this.handleChange,onRemove:this.handleRemove,httpRequest:this.doHttpRequest,fileList:this.fileList,ref:"upload"}),Sc({default:function(){return[((t=(r=o.$slots).default)===null||t===void 0?void 0:t.call(r))||(["text","picture"].indexOf(o.listType)===-1?n.createVNode(n.resolveComponent("ElIcon"),null,{default:function(){return[n.createVNode(Bh,null,null)]}}):n.createVNode(n.resolveComponent("ElButton"),{type:"primary"},{default:function(){return[o.formCreateInject.t("clickToUpload")||"\u70B9\u51FB\u4E0A\u4F20"]}}))]}},j_(this.$slots,["default"]))),n.createVNode(n.resolveComponent("ElDialog"),{appendToBody:!0,modal:this.previewMask,title:this.modalTitle,modelValue:this.previewVisible,onClose:this.handleCancel},{default:function(){return[n.createVNode("img",{style:"width: 100%",src:o.previewImage},null)]}})])},mounted:function(){this.$emit("fc.el",this.$refs.upload)}});const L6="",Te=(e,t)=>{const r=e.__vccOpts||e;for(const[o,i]of t)r[o]=i;return r},Ih=e=>{const t=[];return e.forEach(r=>{r.field&&t.push(r.field),r.children&&t.push(...Ih(r.children))}),t},X_=n.defineComponent({name:"StepForm",props:{stepsProps:Object,modelValue:Object,formCreateInject:Object,autoValidate:Boolean,submitBtn:Boolean,steps:{type:Array,required:!0,default:()=>[]},options:{type:Object,default:()=>n.reactive({submitBtn:!1,resetBtn:!1})}},emits:["update:modelValue","change","itemMounted","submit","next"],data(){return{active:0,cacheRule:[],cacheValue:{},subApi:{},Form:n.markRaw(this.formCreateInject.form.$form())}},watch:{active(){this.init()},modelValue(e){this.setValue(e)}},methods:{init(){this.steps.forEach((e,t)=>{this.cacheRule[t]?this.cacheRule[t].display=t===this.active:this.cacheRule[t]={type:"FcRow",native:!0,display:t===this.active,children:e.rule}})},onPrev(){this.active--},validate(){return new Promise((e,t)=>{const r=Ih(this.cacheRule[this.active].children);r.length>0?Promise.all(r.map(o=>this.subApi.validateField(o))).then(()=>{e()}).catch(o=>{t(o)}):e()})},onNext(){this.autoValidate?this.validate().then(()=>{this.active++}).catch(e=>{}):this.active++,this.$emit("next",{active:this.active,api:this.subApi})},submit(){const e=()=>{this.$emit("submit",this.subApi.formData(),this.subApi)};this.autoValidate?this.validate().then(()=>{e()}).catch(t=>{}):e()},addSubApi(e){this.subApi=e,this.$emit("itemMounted",e)},formData(e){this.cacheValue=JSON.stringify(e),this.$emit("update:modelValue",e),this.$emit("change",e)},setValue(e){const t=JSON.stringify(e);this.cacheValue!==t&&(this.cacheValue=t,this.subApi.coverValue(e||{}))}},created(){this.init()}}),Z_={class:"_fc-step-form"};function q_(e,t,r,o,i,l){const d=n.resolveComponent("van-step"),c=n.resolveComponent("van-steps"),u=n.resolveComponent("van-button"),h=n.resolveComponent("van-col"),m=n.resolveComponent("van-row");return n.openBlock(),n.createElementBlock("div",Z_,[n.createVNode(c,n.mergeProps({active:e.active},e.stepsProps),{default:n.withCtx(()=>[(n.openBlock(!0),n.createElementBlock(n.Fragment,null,n.renderList(e.steps,y=>(n.openBlock(),n.createBlock(d,n.mergeProps({ref_for:!0},y.props),{default:n.withCtx(()=>[n.createTextVNode(n.toDisplayString(y.props.title),1)]),_:2},1040))),256))]),_:1},16,["active"]),(n.openBlock(),n.createBlock(n.resolveDynamicComponent(e.Form),{option:e.options,rule:e.cacheRule,extendOption:!0,modelValue:e.modelValue,"onUpdate:api":e.addSubApi,onEmitEvent:e.$emit,"onUpdate:modelValue":e.formData},null,40,["option","rule","modelValue","onUpdate:api","onEmitEvent","onUpdate:modelValue"])),n.createVNode(m,null,{default:n.withCtx(()=>[n.createVNode(h,{span:24,style:{"margin-top":"15px"}},{default:n.withCtx(()=>[e.active>0?(n.openBlock(),n.createBlock(u,{key:0,block:"",size:"small",onClick:e.onPrev},{default:n.withCtx(()=>[n.createTextVNode(n.toDisplayString(e.formCreateInject.t("prevStep")||"\u4E0A\u4E00\u6B65"),1)]),_:1},8,["onClick"])):n.createCommentVNode("",!0),e.active[n.createTextVNode(n.toDisplayString(e.formCreateInject.t("nextStep")||"\u4E0B\u4E00\u6B65"),1)]),_:1},8,["onClick"])):n.createCommentVNode("",!0),e.submitBtn!==!1&&e.active===e.cacheRule.length-1?(n.openBlock(),n.createBlock(u,{key:2,block:"",size:"small",class:"fc-clock",type:"primary",onClick:e.submit,style:{"margin-top":"10px"}},{default:n.withCtx(()=>[n.createTextVNode(n.toDisplayString(e.formCreateInject.t("submit")||"\u63D0\u4EA4"),1)]),_:1},8,["onClick"])):n.createCommentVNode("",!0)]),_:1})]),_:1})])}const eE=Te(X_,[["render",q_]]),j6="",tE=n.defineComponent({name:"FcPopup",emits:["confirm","submit","validateFail","update:modelValue"],props:{formData:Object,options:{type:Object,default:()=>n.reactive({submitBtn:!1,resetBtn:!1})},rule:Array,autoClose:{type:Boolean,default:!0},footer:{type:Boolean,default:!0},preview:Boolean,modelValue:Object,formCreateInject:Object,title:String},computed:{formOptions(){const e={...this.options};return this.preview&&(e.preview=this.preview),e}},data(){return{visible:!1,fapi:{},value:{},formRule:[],Form:n.markRaw(this.formCreateInject.form.$form())}},methods:{formChange(){this.$emit("update:modelValue",this.fapi.formData())},open(e){this.$nextTick(()=>{this.visible=!0,this.value=rt(e||this.modelValue||this.formData||{}),this.formRule=rt(this.rule||[])})},close(){this.visible=!1},handleConfirm(){this.$emit("confirm",this.fapi),this.fapi.submit().then(e=>{this.$emit("submit",e,this.fapi,this.close),this.autoClose&&this.close()}).catch(e=>{this.$emit("validateFail",e,this.fapi)})}},mounted(){this.formCreateInject.api.top.bus.$on("fc.closeDialog",this.close),n.onUnmounted(()=>{this.formCreateInject.api.top.bus.$off("fc.closeDialog",this.close)})}}),nE={class:"_fc-popup-title"},iE={class:"_fc-popup-content"},rE={class:"_fc-popup-footer"};function oE(e,t,r,o,i,l){const d=n.resolveComponent("van-button"),c=n.resolveComponent("van-popup");return n.openBlock(),n.createBlock(c,n.mergeProps({class:"_fc-popup",closeable:""},e.$attrs,{show:e.visible,"onUpdate:show":t[1]||(t[1]=u=>e.visible=u)}),{default:n.withCtx(()=>[n.createElementVNode("div",nE,n.toDisplayString(e.title),1),n.createElementVNode("div",iE,[(n.openBlock(),n.createBlock(n.resolveDynamicComponent(e.Form),{option:e.formOptions,rule:e.formRule,extendOption:!0,api:e.fapi,"onUpdate:api":t[0]||(t[0]=u=>e.fapi=u),"model-value":e.value,subForm:!1,onChange:e.formChange,onEmitEvent:e.$emit},null,40,["option","rule","api","model-value","onChange","onEmitEvent"]))]),n.createElementVNode("div",rE,[e.footer!==!1?(n.openBlock(),n.createElementBlock(n.Fragment,{key:0},[n.createVNode(d,{block:"",size:"small",type:"primary",class:"fc-clock",onClick:e.handleConfirm},{default:n.withCtx(()=>[n.createTextVNode(n.toDisplayString(e.formCreateInject.t("ok")||"\u786E\u5B9A"),1)]),_:1},8,["onClick"]),n.createVNode(d,{block:"",size:"small",class:"fc-clock",style:{"margin-top":"10px"},onClick:e.close},{default:n.withCtx(()=>[n.createTextVNode(n.toDisplayString(e.formCreateInject.t("close")||"\u5173\u95ED"),1)]),_:1},8,["onClick"])],64)):n.createCommentVNode("",!0)])]),_:1},16,["show"])}const aE=Te(tE,[["render",oE]]),z6="",xc=n.defineComponent({name:"DataTable",emits:["sortChange","handleClick"],props:{column:{type:Array,default:()=>[]},globalDataKey:[String,Object],fetch:Object,data:{type:Array,default:()=>[]},button:Object,index:Boolean,selection:Boolean,page:Object,formCreateInject:Object},data(){return{total:0,loading:!1,unwatch:null,list:[],currentPage:1,id:1,order:"",orderBy:""}},watch:{globalDataKey(){this.initPage()},fetch(){this.globalDataKey||this.initPage()},data(){!this.globalDataKey&&!this.fetch&&this.initPage()},selection(){this.id++},index(){this.id++},page:{handler(){this.initPage(),this.id++},deep:!0},button:{handler(){this.id++},deep:!0}},computed:{filterList(){let e=this.list||[];const t=[];return this.column.forEach(r=>{r.prop&&Array.isArray(r.filter)&&r.filter.length>0&&t.push(o=>r.filter.indexOf(o[r.prop])>-1)}),t.forEach(r=>{e=e.filter(r)}),e}},render(){return n.withDirectives(n.h("div",{class:"_fc-data-table"},[n.h(n.resolveComponent("el-table"),{data:this.filterList,...this.$attrs,key:this.id,ref:"table",onSortChange:e=>{this.$emit("sortChange",e),e.order?(this.orderBy=e.order==="descending"?"DESC":"ASC",this.order=e.prop):(this.orderBy="",this.order=""),this.initPage()}},()=>{const e=this.column.filter(r=>r.hidden!==!0).map(r=>this.makeColumn(r));this.selection&&e.unshift(n.h(n.resolveComponent("el-table-column"),{type:"selection",width:"50px"}));const t=this.makeButtonCol();return t&&e.push(t),this.index&&e.unshift(n.h(n.resolveComponent("el-table-column"),{type:"index",width:"50px"})),e}),this.makePage()]),[[n.resolveDirective("loading"),this.loading]])},methods:{getEl(){return this.$refs.table},deepGet(e,t,r){t=(t||"").split(".");let o=0,i=t.length;for(;e!=null&&o{this.list=e}):this.list=this.data},btnProps(e,t){const r=e.prop||[],o={type:e.type,size:e.size,round:r.indexOf("round")>-1,link:r.indexOf("link")>-1,plain:r.indexOf("plain")>-1,disabled:r.indexOf("disabled")>-1,onClick:l=>{l.stopPropagation();const d=Vr(e.click);try{d&&d(t,this.formCreateInject.api)}catch(c){console.error(c)}this.$emit("handleClick",{name:e.name,key:e.key,scope:t,column:t.row})}},i=Vr(e.handle);try{const l=i&&i(o,t,this.formCreateInject.api);typeof l=="boolean"&&(o.disabled=l)}catch(l){console.error(l)}return o},getLimit(){return this.page.props&&this.page.props.pageSize||20},nextList(){if(this.globalDataKey||this.fetch)this.fetchData(!0).then(({list:e,total:t})=>{this.list=e,this.total=t});else{const e=this.data,t=this.getLimit(),r=this.currentPage*t;this.list=e.slice(r-t,r),this.total=e.length}},fetchData(e){return this.unwatch&&this.unwatch(),new Promise(t=>{let r=this.fetch;if(this.globalDataKey){const o=typeof this.globalDataKey=="string"?this.globalDataKey:this.globalDataKey.key;r=this.formCreateInject.api.options.globalData[o]}if(r)if(r.type==="fetch"||!this.globalDataKey){r={...r};let o={};if(e){const l=this.page.props&&this.page.props.pageSize||20,d=this.page.pageField||"page",c=this.page.pageSizeField||"limit";o={[d]:this.currentPage,[c]:l}}if(this.order){const l=this.page.orderField||"order",d=this.page.orderByField||"orderBy";o[l]=this.order,o[d]=this.orderBy}const i=Object.keys(o).map(l=>encodeURIComponent(l)+"="+encodeURIComponent(o[l]),"").join("&");i&&(r.action+=(r.action.indexOf("?")!==-1?"&":"?")+i),this.loading=!0,r.wait=1e3,this.unwatch=this.formCreateInject.api.watchFetch(r,(l,d)=>{this.loading=!1;const c=this.page.totalField,u=this.page.dataField,h=u?this.deepGet(l,u,[]):l;let m=c?this.deepGet(l,c):0;m||(m=h.length||0),t({list:h,total:m})},l=>{console.error(l),this.loading=!1},(l,d)=>{if(d)return this.unwatch&&this.unwatch(),this.unwatch=null,setTimeout(()=>{this.changePage(1)}),!1})}else{let o=r.data||[],i=r.data.length;if(e){const l=this.getLimit(),d=this.currentPage*l;o=o.slice(d-l,d),i=o.length}t({list:o,total:i})}else t({list:[],total:0})})},changePage(e){this.currentPage=e,this.nextList()},makePage(){if(this.page&&this.page.open===!0)return n.h(n.resolveComponent("el-pagination"),{layout:"prev, pager, next",total:this.total,currentPage:this.currentPage,"onUpdate:currentPage":e=>{this.currentPage!==e&&this.changePage(e)},class:this.page.position||"right",...this.page.props||{},pageSize:this.page.props&&this.page.props.pageSize||20})},makeButtonCol(){if(this.button&&this.button.open===!0&&this.button.column)return n.h(n.resolveComponent("el-table-column"),{label:this.button.label||this.formCreateInject.t("operation")||"\u64CD\u4F5C",fixed:this.button.fixed===void 0?"right":this.button.fixed,width:this.button.width||"100px"},{default:e=>this.button.column.filter(t=>t.hidden!==!0).map(t=>n.h(n.resolveComponent("el-button"),this.btnProps(t,e),()=>[t.name]))})},makeColumn(e){return n.h(n.resolveComponent("el-table-column"),{label:e.label,prop:e.prop,width:e.width,align:e.align,className:e.className,fixed:e.fixed,sortable:e.sortable},{default:t=>{if(e.children&&e.children.length>0)return e.children.map(r=>this.makeColumn(r));if(!(!e.format||e.format==="default"))return this.makeTd(e,t)}})},makeTd(e,t){return e.format==="custom"&&e.render?e.render(t,n.h,n.resolveComponent,this.formCreateInject.api):e.format==="tag"?n.h(n.resolveComponent("el-tag"),{disableTransitions:!0},()=>[this.deepGet(t.row,e.prop,"")]):e.format==="image"?n.h("div",{class:"_fc-data-table-img-list"},(()=>{let r=this.deepGet(t.row,e.prop,"");return r=(Array.isArray(r)?r:[r]).filter(o=>!!o),r.map((o,i)=>n.h(n.resolveComponent("el-image"),{src:o,previewSrcList:r,previewTeleported:!0,initialIndex:i,fit:"cover"}))})()):""+this.deepGet(t.row,e.prop,"")}},created(){this.initPage(),this.$watch(()=>this.data&&this.data.length,()=>{!this.globalDataKey&&!this.fetch&&this.initPage()})}}),U6="",lE={name:"FcTable",props:{mini:Boolean,label:String,width:[Number,String],border:{type:Boolean,default:!0},borderWidth:String,borderColor:String,rule:{type:Object,default:()=>({row:1,col:1})}},watch:{rule:{handler(){this.initRule(),this.loadRule(),this.tdStyle=this.rule.style||{},this.tdClass=this.rule.class||{}},immediate:!0,deep:!0}},data(){return{tdStyle:{},tdClass:{},lattice:{}}},computed:{tableColor(){const e={};return this.border===!1?e.border="0 none":(this.borderColor&&(e.borderColor=this.borderColor),this.borderWidth&&(e.borderWidth=this.borderWidth)),e}},methods:{initRule(){const e=this.rule;e.style||(e.style={}),e.layout||(e.layout=[]),e.row||(e.row=1),e.col||(e.col=1)},loadRule(){const e=[],t=this.rule||{row:1,col:1};for(let o=0;o{if((!o.row||o.row<=0)&&(!o.col||o.col<=0)||!e[o.top]||!e[o.top][o.left]||!e[o.top][o.left].show){t.layout.splice(i,1);return}const l=e[o.top][o.left];l.layout=o;let d=1,c=1;if(o.col&&(d=o.col+o.left>t.col?t.col-o.left:o.col,l.colspan=d),o.row&&(c=o.row+o.top>t.row?t.row-o.top:o.row,l.rowspan=c),c&&d)for(let u=0;u!!(!o||o.layout||!o.show);e.forEach((o,i)=>{o.forEach((l,d)=>{let c=!1,u=!1;if(l.layout){const h=l.layout.col||1,m=l.layout.row||1;for(let y=0;y[n.createElementVNode("div",{class:n.normalizeClass(["_fc-table",{"is-mini":r.mini}])},[n.createElementVNode("table",{border:"1",cellspacing:"0",cellpadding:"0",style:n.normalizeStyle(l.tableColor)},[(n.openBlock(!0),n.createElementBlock(n.Fragment,null,n.renderList(r.rule.row,(c,u)=>(n.openBlock(),n.createElementBlock("tr",{key:u},[(n.openBlock(!0),n.createElementBlock(n.Fragment,null,n.renderList(r.rule.col,(h,m)=>(n.openBlock(),n.createElementBlock(n.Fragment,{key:`${u}${m}`},[i.lattice[u][m].show?(n.openBlock(),n.createElementBlock("td",n.mergeProps({key:0,ref_for:!0},i.lattice[u][m]?{colspan:i.lattice[u][m].colspan,rowspan:i.lattice[u][m].rowspan}:{},{valign:"top",class:i.tdClass&&i.tdClass[`${u}:${m}`]||"",style:[l.tableColor,i.tdStyle&&i.tdStyle[`${u}:${m}`]||{}]}),[n.renderSlot(e.$slots,`${u}:${m}`),(n.openBlock(!0),n.createElementBlock(n.Fragment,null,n.renderList(i.lattice[u][m].slot,y=>n.renderSlot(e.$slots,`${y}`)),256))],16)):n.createCommentVNode("",!0)],64))),128))]))),128))],4)],2)]),_:3})}const Fh=Te(lE,[["render",sE]]),H6="",dE={name:"TableForm",emits:["change","add","delete","update:modelValue"],props:{formCreateInject:Object,modelValue:{type:Array,default:()=>[]},columns:{type:Array,required:!0,default:()=>[]},filterEmptyColumn:{type:Boolean,default:!0},deletable:{type:Boolean,default:!0},addable:{type:Boolean,default:!0},options:{type:Object,default:()=>n.reactive({submitBtn:!1,resetBtn:!1})},max:Number,min:Number,disabled:Boolean},watch:{modelValue:{handler(){this.updateTable()},deep:!0},"formCreateInject.preview":function(e){this.emptyRule.children[0].props.colspan=this.columns.length+(e?1:2)}},data(){return{rule:[],trs:[],fapi:{},Form:n.markRaw(this.formCreateInject.form.$form()),copyTrs:"",oldValue:"",emptyRule:{type:"tr",_isEmpty:!0,native:!0,subRule:!0,children:[{type:"td",style:{textAlign:"center"},native:!0,subRule:!0,props:{colspan:this.columns.length+(this.formCreateInject.preview?1:2)},children:[this.formCreateInject.t("dataEmpty")||"\u6682\u65E0\u6570\u636E"]}]}}},methods:{formChange(){this.updateValue()},updateValue(){const e=this.trs.map((r,o)=>({...this.modelValue[o]||{},...this.fapi.getChildrenFormData(r)})).filter(r=>{if(!this.filterEmptyColumn)return!0;if(r==null)return!1;let o=!1;return Object.keys(r).forEach(i=>{o=o||r[i]!==void 0&&r[i]!==""&&r[i]!==null}),o}),t=JSON.stringify(e);t!==this.oldValue&&(this.oldValue=t,this.$emit("update:modelValue",e),this.$emit("change",e))},setRawData(e,t){const r=this.trs[e];this.fapi.setChildrenFormData(r,t,!0)},updateTable(){const e=JSON.stringify(this.modelValue);this.oldValue!==e&&(this.oldValue=e,this.trs=this.trs.splice(0,this.modelValue.length),this.modelValue.length?this.clearEmpty():this.addEmpty(),this.modelValue.forEach((t,r)=>{this.trs[r]||this.addRaw(),this.setRawData(r,t||{})}),this.rule[0].children[1].children=this.trs)},addEmpty(){this.trs.length&&this.trs.splice(0,this.trs.length),this.trs.push(this.emptyRule)},clearEmpty(){this.trs[0]&&this.trs[0]._isEmpty&&this.trs.splice(0,1)},delRaw(e){this.disabled||!this.deletable||this.min>0&&this.trs.length<=this.min||(this.trs.splice(e,1),this.updateValue(),this.trs.length?this.trs.forEach(t=>this.updateRaw(t)):this.addEmpty(),this.$emit("delete",e))},addRaw(e){if(e&&this.disabled)return;const t=this.formCreateInject.form.parseJson(this.copyTrs)[0];this.trs.length===1&&this.trs[0]._isEmpty&&this.trs.splice(0,1),this.trs.push(t),this.updateRaw(t),e&&(this.$emit("add",this.trs.length),this.updateValue())},updateRaw(e){const t=this.trs.indexOf(e);e.children[0].props.innerText=t+1,e.children[e.children.length-1].children[0].props.onClick=()=>{this.delRaw(t)}},loadRule(){const e=[{type:"th",native:!0,class:"_fc-tf-head-idx",props:{innerText:"#"}}];let t=[{type:"td",class:"_fc-tf-idx",native:!0,props:{innerText:"0"}}];this.columns.forEach(r=>{e.push({type:"th",native:!0,style:r.style,class:r.required?"_fc-tf-head-required":"",props:{innerText:r.label||""}}),t.push({type:"td",native:!0,children:[...r.rule||[]]})}),e.push({type:"th",native:!0,class:"_fc-tf-edit fc-clock",props:{innerText:this.formCreateInject.t("operation")||"\u64CD\u4F5C"}}),t.push({type:"td",native:!0,class:"_fc-tf-btn fc-clock",children:[{type:"i",native:!0,class:"fc-icon icon-delete",props:{}}]}),this.copyTrs=this.formCreateInject.form.toJson([{type:"tr",native:!0,subRule:!0,children:t}]),this.rule=[{type:"table",native:!0,class:"_fc-tf-table",props:{border:"1",cellspacing:"0",cellpadding:"0"},children:[{type:"thead",native:!0,children:[{type:"tr",native:!0,children:e}]},{type:"tbody",native:!0,children:this.trs}]}]}},created(){this.loadRule()},mounted(){this.updateTable()}};function cE(e,t,r,o,i,l){const d=n.resolveComponent("el-button");return n.openBlock(),n.createElementBlock("div",{class:n.normalizeClass(["_fc-table-form",{"_fc-disabled":r.disabled}])},[(n.openBlock(),n.createBlock(n.resolveDynamicComponent(i.Form),{option:r.options,rule:i.rule,extendOption:!0,disabled:r.disabled,onChange:l.formChange,api:i.fapi,"onUpdate:api":t[0]||(t[0]=c=>i.fapi=c),onEmitEvent:e.$emit},null,40,["option","rule","disabled","onChange","api","onEmitEvent"])),r.addable&&(!r.max||r.max>this.trs.length)?(n.openBlock(),n.createBlock(d,{key:0,link:"",type:"primary",class:"fc-clock",onClick:t[1]||(t[1]=c=>l.addRaw(!0))},{default:n.withCtx(()=>[t[2]||(t[2]=n.createElementVNode("i",{class:"fc-icon icon-add-circle",style:{"font-weight":"700"}},null,-1)),n.createTextVNode(" "+n.toDisplayString(r.formCreateInject.t("add")||"\u6DFB\u52A0"),1)]),_:1})):n.createCommentVNode("",!0)],2)}const Ph=Te(dE,[["render",cE]]),W6="",uE={name:"TableFormPro",emits:["change","add","delete","update:modelValue","handleClick"],props:{formCreateInject:Object,height:[String,Number],modelValue:{type:Array,default:()=>[]},columns:{type:Array,required:!0,default:()=>[]},button:Object,page:Object,size:String,filterEmptyColumn:{type:Boolean,default:!0},newColumn:Boolean,deletable:{type:Boolean,default:!0},addable:{type:Boolean,default:!0},options:{type:Object,default:()=>n.reactive({submitBtn:!1,resetBtn:!1})},showIndex:Boolean,max:Number,min:Number,disabled:Boolean},watch:{modelValue:{handler(){const e=JSON.stringify(this.modelValue||[]);this.oldValue!==e&&(this.chunk=[[]],this.nowPage=1,this.updateTable(),this.oldValue=e)}}},computed:{total(){return this.chunk.reduce((e,t)=>(e+=t.length,e),0)},limit(){return!this.page||this.page.open!==!0?1e6:this.page.props&&this.page.props.pageSize||20},pageData(){return this.chunk[this.nowPage-1]}},data(){return{chunk:[[]],data:[],rule:[],trs:[],fapi:{},Form:n.markRaw(this.formCreateInject.form.$form()),copyTrs:"",oldValue:"",nowPage:1,indexRule:{type:"el-table-column",props:{label:"#",type:"index",fixed:"left"}}}},methods:{paginateArray(){const e=this.modelValue||[],t=this.limit,r=[];for(let o=0;o{this.chunk[i]=[...this.chunk[i]||[],...o]}),this.nowPage>this.chunk.length&&(this.nowPage=this.chunk.length)},formChange(){this.updateValue()},updateValue(){this.trs.forEach((r,o)=>{yl(this.pageData[o],this.fapi.getChildrenFormData(r))});const e=rt(this.chunk.reduce((r,o)=>[...r,...o],[]).filter(r=>{if(!this.filterEmptyColumn)return!0;if(r==null)return!1;let o=!1;return Object.keys(r).forEach(i=>{o=o||r[i]!==void 0&&r[i]!==""&&r[i]!==null}),o})),t=JSON.stringify(e);t!==this.oldValue&&(this.oldValue=t,this.$emit("update:modelValue",e),this.$emit("change",e))},setRawData(e,t){const r=this.trs[e];this.fapi.setChildrenFormData(r,t,!0)},changePage(e){e!==this.nowPage&&(this.chunk[this.nowPage-1]=this.pageData,this.nowPage=e,this.rule[1].props.data=this.pageData,this.trs.splice(0,this.trs.length),this.pageData.forEach((t,r)=>{this.trs[r]||this.addRaw(),this.setRawData(r,t||{})}),this.rule[0].children=this.trs)},updateTable(){this.paginateArray(),this.rule[1].props.data=this.pageData,this.trs.splice(0,this.trs.length),this.pageData.forEach((e,t)=>{this.trs[t]||this.addRaw(),this.setRawData(t,e||{})}),this.rule[0].children=this.trs},delRaw(e){this.disabled||this.deletable===!1||this.min>0&&this.total<=this.min||(this.trs.splice(e,1),this.rule[1].props.data.splice(e,1),this.updateValue(),this.$emit("delete",e),this.oldValue="")},addRaw(e){if(!(e&&(this.disabled||this.addable===!1))){if(!e){const t=this.formCreateInject.form.parseJson(this.copy);this.trs.push(t);return}if(this.chunk[this.chunk.length-1].length>=this.limit)this.chunk.push([{}]);else if(e&&this.chunk[this.chunk.length-1].push({}),e&&this.nowPage===this.chunk.length){const t=this.formCreateInject.form.parseJson(this.copy);this.trs.push(t)}e&&(this.$emit("add",this.total),this.updateValue())}},btnProps(e,t){const r={...t};r.row=this.modelValue[t.$index]||{};const o=e.prop||[],i={type:e.type,size:e.size,round:o.indexOf("round")>-1,link:o.indexOf("link")>-1,plain:o.indexOf("plain")>-1,disabled:o.indexOf("disabled")>-1||this.disabled||e.key==="delete"&&this.deletable===!1,onClick:l=>{if(r.row=this.modelValue[t.$index]||{},l.stopPropagation(),e.key==="delete"){this.delRaw(t.$index);return}const d=Vr(e.click);try{d&&d(r,this.formCreateInject.api)}catch(c){console.error(c)}this.$emit("handleClick",{name:e.name,key:e.key,_scope:r,column:r.row})}};try{if(!this.disabled){const l=Vr(e.handle),d=l&&l(i,r,this.formCreateInject.api);typeof d=="boolean"&&(i.disabled=d)}}catch(l){console.error(l)}return i},processRule(e){let t=[];return e.forEach(r=>{r.children?t.push(...this.processRule(r.children)):(r._renderId=We(),t.push({type:"template",name:r._renderId,children:[...r.rule||[]]}))}),t},processColumns(e){return e.map((t,r)=>{var i;const o={type:"el-table-column",hidden:t.hidden===!0,props:{fixed:t.fixed||!1,width:((i=t==null?void 0:t.style)==null?void 0:i.width)||"auto",minWidth:120},renderSlots:{header(){var l;return n.h("span",{class:t.required?"is-required":"",style:{color:(l=t==null?void 0:t.style)==null?void 0:l.color}},t.label)}}};return t.children?o.children=this.processColumns(t.children):o.renderSlots.default=({$index:l})=>{var d,c,u,h,m,y,C,S;for(let w=0;w<((c=(d=this.rule[0])==null?void 0:d.children[l])==null?void 0:c.children.length);w++)if(((h=(u=this.rule[0])==null?void 0:u.children[l])==null?void 0:h.children[w].name)===t._renderId)return(S=(C=this.fapi.renderRule((y=(m=this.rule[0])==null?void 0:m.children[l])==null?void 0:y.children[w],void 0,!0))==null?void 0:C.default)==null?void 0:S.call(C)},o})},loadRule(){this.copy=this.formCreateInject.form.toJson({type:"template",name:"template",subRule:!0,children:this.processRule(this.columns)}),this.rule=[{type:"hidden",children:this.trs},{type:"elTable",style:{width:"100%"},key:1,props:{...this.$attrs,height:this.height,size:this.size,data:[]},children:[]}]}},created(){this.loadRule()},mounted(){const e=this.fapi.sync;this.fapi.sync=t=>{t.tableRenderUni=We(),e(t)},this.updateTable(),this.newColumn&&(!this.modelValue||!this.modelValue.length)&&this.addRaw(!0),this.$watch(()=>[...this.columns],t=>{this.rule[1].children.splice(this.rule[1].children.indexOf(this.indexRule)>-1?1:0,0,...this.processColumns(t)),this.rule[1].key++},{immediate:!0}),this.$watch(()=>this.showIndex,t=>{t===!1&&this.rule[1].children.indexOf(this.indexRule)>-1?this.rule[1].children.splice(0,1):t!==!1&&this.rule[1].children.indexOf(this.indexRule)===-1&&this.rule[1].children.unshift(this.indexRule)},{immediate:!0}),this.$watch(()=>this.formCreateInject.preview&&this.button&&this.button.column&&[{...this.button},...this.button.column],t=>{this.rule[1].children.forEach((r,o)=>{r._tableHandle&&this.rule[1].children.splice(o,1)}),!this.formCreateInject.preview&&this.button.open!==!1&&this.rule[1].children.push({type:"el-table-column",_tableHandle:!0,props:{label:this.button.label||this.formCreateInject.t("operation")||"\u64CD\u4F5C",fixed:this.button.fixed===void 0?"right":this.button.fixed,width:this.button.width||"100px"},renderSlots:{default:r=>this.button.column.filter(o=>o.hidden!==!0).map(o=>n.h(n.resolveComponent("el-button"),this.btnProps(o,r),()=>[o.key==="delete"&&this.formCreateInject.t("delete")||o.name]))}})},{immediate:!0})}},fE={class:"_fc-tf-pro-handle"};function pE(e,t,r,o,i,l){const d=n.resolveComponent("el-button"),c=n.resolveComponent("el-pagination");return n.openBlock(),n.createElementBlock("div",{class:n.normalizeClass(["_fc-table-form-v2",{"_fc-disabled":r.disabled}])},[(n.openBlock(),n.createBlock(n.resolveDynamicComponent(i.Form),{option:r.options,rule:i.rule,extendOption:!0,disabled:r.disabled,onChange:l.formChange,api:i.fapi,"onUpdate:api":t[0]||(t[0]=u=>i.fapi=u),onEmitEvent:e.$emit},null,40,["option","rule","disabled","onChange","api","onEmitEvent"])),n.createElementVNode("div",fE,[n.createElementVNode("div",null,[(!r.max||r.max>l.total)&&r.addable!==!1&&r.disabled!==!0?(n.openBlock(),n.createBlock(d,{key:0,link:"",type:"primary",class:"fc-clock",onClick:t[1]||(t[1]=u=>l.addRaw(!0))},{default:n.withCtx(()=>[t[2]||(t[2]=n.createElementVNode("i",{class:"fc-icon icon-add-circle",style:{"font-weight":"700"}},null,-1)),n.createTextVNode(" "+n.toDisplayString(r.formCreateInject.t("add")||"\u6DFB\u52A0"),1)]),_:1})):n.createCommentVNode("",!0)]),r.page&&r.page.open===!0&&i.chunk.length>1?(n.openBlock(),n.createBlock(c,n.mergeProps({key:0},r.page.props||{},{layout:"prev, pager, next",currentPage:i.nowPage,"onUpdate:currentPage":l.changePage,total:l.total,pageSize:l.limit}),null,16,["currentPage","onUpdate:currentPage","total","pageSize"])):n.createCommentVNode("",!0)])],2)}const Mh=Te(uE,[["render",pE]]),G6="",hE={name:"InfiniteTableForm",emits:["change","add","delete","update:modelValue"],props:{formCreateInject:Object,modelValue:{type:Array,default:()=>[]},columns:{type:Array,required:!0,default:()=>[]},options:{type:Object,default:()=>n.reactive({submitBtn:!1,resetBtn:!1})},max:Number,layerMax:{type:Number,default:0},childrenField:String,disabled:Boolean},computed:{preview(){return this.formCreateInject.preview},subField(){return this.childrenField||"children"}},watch:{modelValue(){this.updateTable()},"formCreateInject.preview"(e){this.trs.forEach((t,r)=>{t.children[1]&&(t.children[1].children[0].props.colspan=this.rule[0].children[0].children[0].children.length-(e?1:0)),t.children[0].children[0].children[0].hidden=this.layerMax===1||e&&!(this.modelValue&&this.modelValue[r]&&Array.isArray(this.modelValue[r][this.subField])&&this.modelValue[r][this.subField].length>0)})}},data(){return{rule:[],trs:[],fapi:{},Form:n.markRaw(this.formCreateInject.form.$form()),copyTrs:"",oldValue:""}},methods:{formChange(e,t,r,o,i){i===!1&&this.updateValue()},updateValue(){const e=this.trs.map((r,o)=>{const i={...this.modelValue[o]||{},...this.fapi.getChildrenFormData(r)};return!li(i,this.subField)&&this.modelValue[o]&&(i[this.subField]=this.modelValue[o][this.subField]),i[this.subField]==null&&delete i[this.subField],i}),t=JSON.stringify(e);t!==this.oldValue&&(this.oldValue=t,this.$emit("update:modelValue",e),this.$emit("change",e))},setRawData(e,t){const r=this.trs[e];this.fapi.setChildrenFormData(r,t,!0)},updateTable(){const e=JSON.stringify(this.modelValue);this.oldValue!==e&&(this.oldValue=e,this.trs=this.trs.splice(0,this.modelValue.length),this.modelValue.length||this.addRaw(),this.modelValue.forEach((t,r)=>{this.trs[r]||this.addRaw(),this.setRawData(r,t||{})}),this.rule[0].children[1].children=this.trs)},delRaw(e){this.disabled||(this.trs.splice(e,1),this.updateValue(),this.trs.length?this.trs.forEach(t=>this.updateRaw(t)):this.addRaw(),this.$emit("delete",e))},addRaw(e){if(e&&this.disabled)return;const t=this.formCreateInject.form.parseJson(this.copyTrs)[0],r={type:"template",subRule:!0,children:[]};r.children.push(t),this.trs.push(r),this.trs.forEach(o=>this.updateRaw(o)),e&&this.$emit("add",this.trs)},updateRaw(e){const t=this.trs.indexOf(e),r=e.children[0];r.children[0].children[0].hidden=this.layerMax===1||this.preview&&!(this.modelValue&&this.modelValue[t]&&Array.isArray(this.modelValue[t][this.subField])&&this.modelValue[t][this.subField].length>0),r.children[0].children[0].props.onClick=o=>{if(this.trs[t].children.length===1){if(this.disabled&&!(this.modelValue&&this.modelValue[t]&&Array.isArray(this.modelValue[t][this.subField])&&this.modelValue[t][this.subField].length>0))return;this.trs[t].children.push({type:"tr",native:!0,display:!0,children:[{type:"td",native:!0,props:{colspan:this.rule[0].children[0].children[0].children.length-(this.preview?1:0)},class:"_fc-itf-sub",children:[{type:"infiniteTableForm",field:this.subField,value:[...this.modelValue[t]&&this.modelValue[t][this.subField]||[]],props:{disabled:this.disabled,layerMax:this.layerMax===0?0:this.layerMax>1?this.layerMax-1:1,max:this.max||0,columns:rt(this.columns),options:rt(this.options)}}]}]})}const i=o.self.children[0]==="-"?"+":"-";o.self.children=[i],this.trs[t].children[1].display=i==="-"},r.children[1].props.innerText=t+1,r.children[r.children.length-1].children[0].props.onClick=()=>{this.delRaw(t)}},loadRule(){const e=[{type:"th",native:!0,class:"_fc-itf-sub-idx"},{type:"th",native:!0,class:"_fc-itf-head-idx",props:{innerText:"#"}}];let t=[{type:"td",class:"_fc-itf-idx",native:!0,children:[{type:"div",hidden:!1,children:["+"],inject:!0,props:{}}]},{type:"td",class:"_fc-itf-idx",native:!0,props:{innerText:"0"}}];this.columns.forEach(r=>{e.push({type:"th",native:!0,class:r.required?"_fc-itf-head-required":"",style:r.style,props:{innerText:r.label||""}}),t.push({type:"td",native:!0,children:[...r.rule||[]]})}),e.push({type:"th",native:!0,class:"_fc-itf-edit fc-clock",props:{innerText:this.formCreateInject.t("operation")||"\u64CD\u4F5C"}}),t.push({type:"td",native:!0,class:"_fc-itf-btn fc-clock",children:[{type:"i",native:!0,class:"fc-icon icon-delete",props:{}}]}),this.copyTrs=this.formCreateInject.form.toJson([{type:"tr",native:!0,children:t}]),this.rule=[{type:"table",native:!0,class:"_fc-itf-table",props:{border:"1",cellspacing:"0",cellpadding:"0"},children:[{type:"thead",native:!0,children:[{type:"tr",native:!0,children:e}]},{type:"tbody",native:!0,children:this.trs}]}]}},created(){this.loadRule()},mounted(){this.updateTable()}};function mE(e,t,r,o,i,l){const d=n.resolveComponent("el-button");return n.openBlock(),n.createElementBlock("div",{class:n.normalizeClass(["_fc-infinite-table-form",{"_fc-disabled":r.disabled}])},[(n.openBlock(),n.createBlock(n.resolveDynamicComponent(i.Form),{option:r.options,rule:i.rule,extendOption:!0,onChange:l.formChange,disabled:r.disabled,api:i.fapi,"onUpdate:api":t[0]||(t[0]=c=>i.fapi=c),onEmitEvent:e.$emit},null,40,["option","rule","onChange","disabled","api","onEmitEvent"])),!r.max||r.max>this.trs.length?(n.openBlock(),n.createBlock(d,{key:0,link:"",type:"primary",class:"fc-clock",onClick:t[1]||(t[1]=c=>l.addRaw(!0))},{default:n.withCtx(()=>[t[2]||(t[2]=n.createElementVNode("i",{class:"fc-icon icon-add-circle",style:{"font-weight":"700"}},null,-1)),n.createTextVNode(" "+n.toDisplayString(r.formCreateInject.t("add")||"\u6DFB\u52A0"),1)]),_:1})):n.createCommentVNode("",!0)],2)}const Lh=Te(hE,[["render",mE]]),K6="",gE={name:"NestedTableForm",emits:["change","add","delete","update:modelValue"],props:{formCreateInject:Object,modelValue:{type:Array,default:()=>[]},nested:Array,nestedField:String,columns:{type:Array,required:!0,default:()=>[]},options:{type:Object,default:()=>n.reactive({submitBtn:!1,resetBtn:!1})},max:Number,nestedMax:Number,disabled:Boolean},computed:{preview(){return this.formCreateInject.preview}},watch:{modelValue(){this.updateTable()},"formCreateInject.preview"(e){this.trs.forEach(t=>{const r=t.children[1].children[0].props.colspan;t.children[1].children[0].props.colspan=e?r-1:r+1})}},data(){return{rule:[],trs:[],fapi:{},Form:n.markRaw(this.formCreateInject.form.$form()),copyTrs:"",oldValue:""}},methods:{formChange(e,t,r,o,i){i===!1&&this.updateValue()},updateValue(){const e=this.trs.map((r,o)=>({...this.modelValue[o]||{},...this.fapi.getChildrenFormData(r)})).filter(r=>{if(r==null)return!1;let o=!1;return Object.keys(r).forEach(i=>{o||(o=o||r[i]!==void 0&&r[i]!==""&&r[i]!==null&&(Array.isArray(r[i])?!!r[i].length:!0))}),o}),t=JSON.stringify(e);t!==this.oldValue&&(this.oldValue=t,this.$emit("update:modelValue",e),this.$emit("change",e))},setRawData(e,t){const r=this.trs[e];this.fapi.setChildrenFormData(r,t,!0)},updateTable(){const e=JSON.stringify(this.modelValue);this.oldValue!==e&&(this.oldValue=e,this.trs=this.trs.splice(0,this.modelValue.length),this.modelValue.length||this.addRaw(),this.modelValue.forEach((t,r)=>{this.trs[r]||this.addRaw(),this.setRawData(r,t||{})}),this.rule[0].children[1].children=this.trs)},delRaw(e){this.disabled||(this.trs.splice(e,1),this.updateValue(),this.trs.length?this.trs.forEach(t=>this.updateRaw(t)):this.addRaw(),this.$emit("delete",e))},addRaw(e){if(e&&this.disabled)return;const t=this.formCreateInject.form.parseJson(this.copyTrs)[0],r={type:"template",subRule:!0,children:[]};r.children.push(t),r.children.push({type:"tr",native:!0,display:!1,children:[{type:"td",native:!0,props:{colspan:t.children.length-(this.preview?1:0)},class:"_fc-ntf-sub",children:[{type:"TableForm",field:this.nestedField,value:[],props:{disabled:this.disabled,max:this.nestedMax||0,columns:rt(this.nested),options:rt(this.options)}}]}]}),this.trs.push(r),this.updateRaw(r),e&&this.$emit("add",this.trs)},updateRaw(e){const t=this.trs.indexOf(e),r=e.children[0];r.children[0].children[0].props.onClick=o=>{const i=o.self.children[0]==="-"?"+":"-";o.self.children=[i],this.trs[t].children[1].display=i==="-"},r.children[1].props.innerText=t+1,r.children[r.children.length-1].children[0].props.onClick=()=>{this.delRaw(t)}},loadRule(){const e=[{type:"th",native:!0,class:"_fc-ntf-sub-idx"},{type:"th",native:!0,class:"_fc-ntf-head-idx",props:{innerText:"#"}}];let t=[{type:"td",class:"_fc-ntf-idx",native:!0,children:[{type:"div",hidden:!1,children:["+"],inject:!0,props:{}}]},{type:"td",class:"_fc-ntf-idx",native:!0,props:{innerText:"0"}}];this.columns.forEach(r=>{e.push({type:"th",native:!0,class:r.required?"_fc-ntf-head-required":"",style:r.style,props:{innerText:r.label||""}}),t.push({type:"td",native:!0,children:[...r.rule||[]]})}),e.push({type:"th",native:!0,class:"_fc-ntf-edit fc-clock",props:{innerText:this.formCreateInject.t("operation")||"\u64CD\u4F5C"}}),t.push({type:"td",native:!0,class:"_fc-ntf-btn fc-clock",children:[{type:"i",native:!0,class:"fc-icon icon-delete",props:{}}]}),this.copyTrs=this.formCreateInject.form.toJson([{type:"tr",native:!0,children:t}]),this.rule=[{type:"table",native:!0,class:"_fc-ntf-table",props:{border:"1",cellspacing:"0",cellpadding:"0"},children:[{type:"thead",native:!0,children:[{type:"tr",native:!0,children:e}]},{type:"tbody",native:!0,children:this.trs}]}]}},created(){this.loadRule()},mounted(){this.updateTable()}};function vE(e,t,r,o,i,l){const d=n.resolveComponent("el-button");return n.openBlock(),n.createElementBlock("div",{class:n.normalizeClass(["_fc-nested-table-form",{"_fc-disabled":r.disabled}])},[(n.openBlock(),n.createBlock(n.resolveDynamicComponent(i.Form),{option:r.options,rule:i.rule,extendOption:!0,onChange:l.formChange,disabled:r.disabled,api:i.fapi,"onUpdate:api":t[0]||(t[0]=c=>i.fapi=c),onEmitEvent:e.$emit},null,40,["option","rule","onChange","disabled","api","onEmitEvent"])),!r.max||r.max>this.trs.length?(n.openBlock(),n.createBlock(d,{key:0,link:"",type:"primary",class:"fc-clock",onClick:t[1]||(t[1]=c=>l.addRaw(!0))},{default:n.withCtx(()=>[t[2]||(t[2]=n.createElementVNode("i",{class:"fc-icon icon-add-circle",style:{"font-weight":"700"}},null,-1)),n.createTextVNode(" "+n.toDisplayString(r.formCreateInject.t("add")||"\u6DFB\u52A0"),1)]),_:1})):n.createCommentVNode("",!0)],2)}const jh=Te(gE,[["render",vE]]),Y6="",yE=n.defineComponent({name:"FcCell"}),bE={ref:"cell",class:"_fc-cell"};function wE(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("div",bE,[n.renderSlot(e.$slots,"default")],512)}const zh=Te(yE,[["render",wE]]),CE=n.defineComponent({name:"FcValue",props:["modelValue"],watch:{modelValue(e){this.$emit("change",e)}}}),_E={class:"_fc-value"};function EE(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("div",_E,n.toDisplayString(e.modelValue),1)}const Uh=Te(CE,[["render",EE]]),Q6="",AE=n.defineComponent({name:"FcCity",props:{modelValue:Array,clearable:Boolean,placeholder:String,disabled:Boolean,filter:Function,level:{type:Number,default:3},api:String},emits:["update:modelValue","change"],data(){return{inputValue:"",show:!1,province:[]}},watch:{modelValue:{handler(e){this.inputValue=(e||[]).join(" / ")},deep:!0,immediate:!0}},computed:{city(){if(this.value.p){for(let e=0;er.text).join(" / "),this.show=!1;const t=e.map(r=>r.value);this.$emit("update:modelValue",t),this.$emit("change",t)},clear(e){e.stopPropagation(),this.inputValue="",this.$emit("update:modelValue",[]),this.$emit("change",[])},loadData(e){return fetch(e).then(t=>t.json()).then(t=>{this.province=n.markRaw(this.tidyOptions(this.filter?this.filter(t)||[]:t,0))})},tidyOptions(e,t){return e.map(r=>{const o={text:r.text||r.n,value:r.value||r.text||r.n};return(r.children||r.d)&&t+1{this.loadData("https://cdn.jsdelivr.net/npm/@province-city-china/level/level.min.json").catch(()=>{this.loadData("https://npm.onmicrosoft.cn/@province-city-china/level/level.min.json")})})}}),SE={class:"_fc-city-m"};function xE(e,t,r,o,i,l){const d=n.resolveComponent("van-field"),c=n.resolveComponent("van-cascader"),u=n.resolveComponent("van-popup");return n.openBlock(),n.createElementBlock("div",SE,[n.createVNode(d,{ref:"el",placeholder:e.placeholder,readonly:"",disabled:e.disabled,onClick:e.open,"model-value":e.inputValue,border:!1,isLink:""},n.createSlots({_:2},[e.clearable&&e.inputValue?{name:"right-icon",fn:n.withCtx(()=>[n.createElementVNode("i",{class:"van-badge__wrapper van-icon van-icon-clear van-field__clear",onClick:t[0]||(t[0]=(...h)=>e.clear&&e.clear(...h))})]),key:"0"}:void 0]),1032,["placeholder","disabled","onClick","model-value"]),n.createVNode(u,{show:e.show,"onUpdate:show":t[2]||(t[2]=h=>e.show=h),round:"",position:"bottom"},{default:n.withCtx(()=>[n.createVNode(c,{modelValue:e.modelValue&&e.modelValue[e.modelValue.length-1]||"",options:e.province,onClose:t[1]||(t[1]=h=>e.show=!1),onFinish:e.confirm},null,8,["modelValue","options","onFinish"])]),_:1},8,["show"])])}const kE=Te(AE,[["render",xE]]),Hh=n.defineComponent({name:"FcSlot",inheritAttrs:!1,inject:["parentFC"],props:{name:String,formCreateInject:Object},computed:{slotName(){return this.name||"block_default"},slotArg(){const{rule:e,preview:t,api:r}=this.formCreateInject,o=e.__fc__.prop;return{rule:e,prop:o,preview:t,api:r,model:o.model||{}}}},render(){const e=this.getSlot();return n.createVNode(n.Fragment,{},e?[e(this.slotArg)]:[])},methods:{getSlot(){const e=t=>{if(t){let r=t.slots[this.slotName];return r||e(t.setupState.parent)}};return e(this.parentFC)}}}),Wh=n.defineComponent({name:"FcJson",inheritAttrs:!1,props:{rule:[Array,String,Object],type:String,disabled:Boolean,expand:Number,button:{type:Boolean,default:!0},max:{type:Number,default:0},min:{type:Number,default:0},sortBtn:{type:Boolean,default:!0},modelValue:[Object,Array],formCreateInject:Object},data(){return{fcSubForm:n.shallowRef(this.formCreateInject.form.component("fcSubForm")),fcGroup:n.shallowRef(this.formCreateInject.form.component("fcGroup")),uni:0,formRule:[],formOptions:{submitBtn:!1,resetBtn:!1}}},watch:{rule(){this.uni++,this.loadRule()},type(){this.loadRule()}},render(){var e,t;if(this.rule)return this.type==="object"?n.createVNode(this.fcSubForm,{key:2,...this.$attrs,modelValue:this.modelValue,"onUpdate:modelValue":r=>{this.$emit("update:modelValue",r)},disabled:this.disabled,formCreateInject:this.formCreateInject,rule:this.formRule,options:this.formOptions}):this.type==="array"?n.createVNode(this.fcGroup,{key:3,...this.$attrs,modelValue:this.modelValue,"onUpdate:modelValue":r=>{this.$emit("update:modelValue",r)},sortBtn:this.sortBtn,min:this.min,max:this.max,expand:this.expand,button:this.button,disabled:this.disabled,formCreateInject:this.formCreateInject,rule:this.formRule,options:this.formOptions}):n.createVNode(n.Fragment,{key:this.uni},[(t=(e=this.$slots)==null?void 0:e.default)==null?void 0:t.call(e)])},methods:{loadRule(){let e=rt(this.rule);typeof e=="string"&&(e=this.formCreateInject.form.parseJson(e)),Array.isArray(e)?this.formRule=e:typeof e=="object"&&(this.formRule=e.rule||[],this.formOptions={submitBtn:!1,resetBtn:!1,...e.options||{}}),e!=null?["array","object"].indexOf(this.type)===-1&&(this.formCreateInject.rule.children=[{type:"template",_fc_drag_skip:!0,children:this.formRule}]):this.formCreateInject.rule.children=[]}},created(){this.rule&&this.loadRule()}}),J6="",NE=n.defineComponent({name:"fcInlineForm"}),TE={class:"_fc-line-form"};function DE(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("div",TE,[n.renderSlot(e.$slots,"default")])}const kc=Te(NE,[["render",DE]]),nn=function(){var e=function(){},t={},r={},o={};function i(m,y){m=m.push?m:[m];var C=[],S=m.length,w=S,E,b,g,_;for(E=function(x,k){k.length&&C.push(x),w--,w||y(C)};S--;){if(b=m[S],g=r[b],g){E(b,g);continue}_=o[b]=o[b]||[],_.push(E)}}function l(m,y){if(!!m){var C=o[m];if(r[m]=y,!!C)for(;C.length;)C[0](m,y),C.splice(0,1)}}function d(m,y){m.call&&(m={success:m}),y.length?(m.error||e)(y):(m.success||e)(m)}function c(m,y,C,S){var w=document,E=C.async,b=(C.numRetries||0)+1,g=C.before||e,_=m.replace(/[\?|#].*$/,""),x=m.replace(/^(css|img|module|nomodule)!/,""),k,T,O;if(S=S||0,/(^css!|\.css$)/.test(_))O=w.createElement("link"),O.rel="stylesheet",O.href=x,k="hideFocus"in O,k&&O.relList&&(k=0,O.rel="preload",O.as="style");else if(/(^img!|\.(png|gif|jpg|svg|webp)$)/.test(_))O=w.createElement("img"),O.src=x;else if(O=w.createElement("script"),O.src=x,O.async=E===void 0?!0:E,T="noModule"in O,/^module!/.test(_)){if(!T)return y(m,"l");O.type="module"}else if(/^nomodule!/.test(_)&&T)return y(m,"l");O.onload=O.onerror=O.onbeforeload=function(F){var I=F.type[0];if(k)try{O.sheet.cssText.length||(I="e")}catch(M){M.code!=18&&(I="e")}if(I=="e"){if(S+=1,Sw.src.indexOf(E)===-1);else{S=!1;break}if(y&&S&&Math.random()<.1){const w=new Image,E=btoa(encodeURIComponent(m.location.host+", "+(m.formCreate.license||""))+", KrrSN2KlZ2tanmqEGlAE"),b=E.substr(2,8);w.src=atob("aHR0cHM6Ly9hcGkuZm9ybS1jcmVhdGUuY29tL2gucG5nP3U9")+(b.substr(2,3)+E.slice(0,10).split("").reverse().join("")+b.substr(3,2)+E.slice(10)).replace(/=/g,"")}}catch{}})();function u(m,y,C){m=m.push?m:[m];var S=m.length,w=S,E=[],b,g,_=!0;for(b=function(x,k,T){if(k=="e"&&(E.push(x),_=!1),k=="b")if(T)E.push(x);else return;S--,S||y(E,_)},g=0;g{h.reset(C),y.length>0&&h.tryLoad(y,C)})},h.loadNpm=function(y,C){h.tryLoad(["https://unpkg.com/"+y,"https://cdn.jsdelivr.net/npm/"+y,"https://npm.onmicrosoft.cn/"+y],C)},h.isDefined=function(y){return y in t},h}();function El(e,t){var r=null;return function(...o){r!==null&&clearTimeout(r),r=setTimeout(()=>e.call(this,...o),t)}}const X6="",VE=n.defineComponent({name:"FcEcharts",data(){return{chart:null,debounceLoad:El(()=>{this.load()},600),debounceResize:El(()=>{this.chart&&this.chart.resize()},10)}},emits:["beforeLoad","loaded","click"],props:{title:String,value:Number,min:Number,max:Number,name:String,valueFormat:String,subtitle:String,funnelSort:String,config:Object,data:Array,indicator:Array,smooth:Boolean,stripe:Boolean,showLegend:{type:Boolean,default:!0},loadOptions:{type:Function,default:()=>{}},showSeriesLabel:Boolean,type:String,pieType:String,stack:Boolean,barBackgroundColor:String},watch:{$props:{handler(){this.debounceLoad()},deep:!0}},methods:{getSeries(){var r;const e={type:"line",stack:this.stack?"Total":"",smooth:this.smooth,showBackground:!1,label:{show:this.showSeriesLabel,position:this.stripe?"inside":"top"}};this.type==="area"?(e.areaStyle={},e.emphasis={focus:"series"}):this.type==="bar"&&(e.type="bar",this.barBackgroundColor&&(e.showBackground=!0,e.backgroundStyle={color:this.barBackgroundColor}));let t=((r=this.config)==null?void 0:r.series)||[];return t.length?(typeof t[0]!="object"&&(t=[{data:t}]),t=t.map(o=>({...e,...o})),t):[]},getTooltip(){const e={trigger:"axis",valueFormat:void 0};return this.valueFormat&&(e.valueFormatter=t=>this.valueFormat?this.valueFormat.replaceAll("{value}",t):t),this.type==="bar"&&(e.axisPointer={type:"shadow"}),e},getAxis(){var e,t;return this.stripe?{yAxis:{type:"category",boundaryGap:this.type==="bar",data:((t=this.config)==null?void 0:t.category)||[]},xAxis:{type:"value"}}:{xAxis:{type:"category",boundaryGap:this.type==="bar",data:(e=this.config)==null?void 0:e.category},yAxis:{type:"value"}}},getDefOptions(){return{title:{text:this.title,subtext:this.subtitle},tooltip:this.getTooltip(),legend:{left:"right",show:this.showLegend},grid:{left:"20px",right:"20px",bottom:"20px",containLabel:!0},...this.getAxis(),series:this.getSeries()}},getPieOptions(){const e={radius:"50%",center:"50%",startAngle:0,avoidLabelOverlap:!0,labelLine:{show:!0},emphasis:{itemStyle:{shadowBlur:10,shadowOffsetX:0,shadowColor:"rgba(0, 0, 0, 0.5)"}}};return this.pieType==="doughnut"?(e.radius=["40%","70%"],e.avoidLabelOverlap=!1):this.pieType==="half-doughnut"&&(e.radius=["40%","70%"],e.center=["50%","70%"],e.startAngle=180,e.endAngle=360),{title:{text:this.title,subtext:this.subtitle,left:"left"},tooltip:{trigger:"item"},legend:{left:"right",show:this.showLegend},series:[{type:"pie",data:this.data,...e}]}},getGaugeOptions(){return{title:{text:this.title,subtext:this.subtitle,left:"center"},series:[{name:"Pressure",type:"gauge",min:this.min||0,max:this.max||60,progress:{show:!0},detail:{valueAnimation:!0,formatter:"{value}"},data:[{value:this.value,name:this.name}]}]}},getRadarOptions(){return{title:{text:this.title,subtext:this.subtitle,left:"left"},tooltip:{trigger:"axis"},legend:{left:"right",show:this.showLegend},radar:{indicator:this.indicator},series:[{type:"radar",tooltip:{trigger:"item"},data:this.data}]}},getScatterOptions(){return{title:{text:this.title,subtext:this.subtitle,left:"left"},tooltip:{trigger:"axis"},legend:{left:"right",show:!0},xAxis:{scale:!0},yAxis:{scale:!0},grid:{left:"20px",right:"20px",bottom:"20px",containLabel:!0},series:(this.data||[]).map(e=>Array.isArray(e)?{type:"scatter",data:e}:{type:"scatter",...e})}},getFunnelOptions(){return{title:{text:this.title,subtext:this.subtitle,left:"left"},tooltip:{trigger:"item"},legend:{left:"right",show:this.showLegend},series:[{name:"Funnel",type:"funnel",left:"10%",top:"40px",bottom:"20px",width:"80%",min:0,max:Math.max(...(this.data||[]).map(e=>e.value)),minSize:"0%",maxSize:"100%",sort:this.funnelSort||"descending",gap:2,label:{show:!0,position:"inside"},labelLine:{length:10,lineStyle:{width:1,type:"solid"}},itemStyle:{borderColor:"#fff",borderWidth:1},emphasis:{label:{}},data:this.data}]}},load(){this.$nextTick(()=>{nn.ready("echarts",()=>{this.chart=n.markRaw(window.echarts.init(this.$refs.chart)),this.chart.on("click",(...t)=>{this.$emit("click",...t)});let e;if(this.type==="pie")e=this.getPieOptions();else if(this.type==="funnel")e=this.getFunnelOptions();else if(this.type==="gauge")e=this.getGaugeOptions();else if(this.type==="radar")e=this.getRadarOptions();else if(this.type==="scatter")e=this.getScatterOptions();else if(this.type==="custom"){if(e=this.loadOptions(this.config,this.chart)||{},typeof e.then=="function"){e.then(t=>{this.$emit("beforeLoad",this.chart,t),this.chart.setOption(t),this.$emit("loaded",this.chart,t)});return}}else e=this.getDefOptions();this.$emit("beforeLoad",this.chart,e),this.chart.setOption(e),this.$emit("loaded",this.chart,e)})})}},created(){window.echarts?nn.done("echarts"):nn.isDefined("echarts")||nn.loadNpm("echarts@5.6.0/dist/echarts.min.js","echarts")},mounted(){this.load(),window.addEventListener("resize",this.debounceResize)},unmounted(){window.removeEventListener("resize",this.debounceResize)}}),OE={class:"_fc-echarts",ref:"chart"};function BE(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("div",OE,null,512)}const Gh=Te(VE,[["render",BE]]);/*!
+ */function Bh(e,t){var r=Object.keys(e);if(Object.getOwnPropertySymbols){var o=Object.getOwnPropertySymbols(e);t&&(o=o.filter(function(i){return Object.getOwnPropertyDescriptor(e,i).enumerable})),r.push.apply(r,o)}return r}function Ac(e){for(var t=1;t-1?[]:[e]}function U_(e,t){return Object.keys(e).reduce(function(r,o){return(!t||t.indexOf(o)===-1)&&(r[o]=e[o]),r},{})}function H_(e,t){t===void 0&&(t={});var r=t.insertAt;if(!(!e||typeof document>"u")){var o=document.head||document.getElementsByTagName("head")[0],i=document.createElement("style");i.type="text/css",r==="top"&&o.firstChild?o.insertBefore(i,o.firstChild):o.appendChild(i),i.styleSheet?i.styleSheet.cssText=e:i.appendChild(document.createTextNode(e))}}var W_="._fc-upload{width:100%}._fc-exceed .el-upload{display:none}.el-upload-list.is-disabled .el-upload{cursor:not-allowed!important}";H_(W_);var Rh={name:"IconUpload"},G_={class:"icon",viewBox:"0 0 1024 1024",xmlns:"http://www.w3.org/2000/svg"},K_=n.createElementVNode("path",{fill:"currentColor",d:"M160 832h704a32 32 0 110 64H160a32 32 0 110-64zm384-578.304V704h-64V247.296L237.248 490.048 192 444.8 508.8 128l316.8 316.8-45.312 45.248L544 253.696z"},null,-1),Y_=[K_];function Q_(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("svg",G_,Y_)}Rh.render=Q_;function $h(e,t){return Cl(e)==="object"?e:{url:e,is_string:!0,name:J_(e),uid:t}}function Ih(e){return Ac(Ac({},e),{},{file:e,value:e})}function J_(e){return(""+e).split("/").pop()}var X_="fcUpload",Z_=n.defineComponent({name:X_,inheritAttrs:!1,formCreateParser:{toFormValue:function(t){return _l(t)},toValue:function(t,r){return r.prop.props.limit===1?t[0]||"":t}},props:{previewMask:void 0,onPreview:Function,httpRequest:Function,modalTitle:String,listType:String,formCreateInject:Object,modelValue:[Array,String,Object]},emits:["update:modelValue","change","remove","fc.el"],data:function(){return{previewVisible:!1,previewImage:"",fileList:[]}},created:function(){this.fileList=_l(this.modelValue).map($h).map(Ih)},watch:{modelValue:function(t){this.fileList=_l(t).map($h).map(Ih)}},methods:{handlePreview:function(t){this.onPreview?this.onPreview.apply(this,arguments):this.listType==="text"?window.open(t.url):(this.previewImage=t.url,this.previewVisible=!0)},update:function(t){var r=t.map(function(o){return o.is_string?o.url:o.value||o.url}).filter(function(o){return o!==void 0});this.$emit("update:modelValue",r)},handleCancel:function(){this.previewVisible=!1},handleChange:function(t,r){this.$emit.apply(this,["change"].concat(Array.prototype.slice.call(arguments))),t.status==="success"&&this.update(r)},handleRemove:function(t,r){this.$emit.apply(this,["remove"].concat(Array.prototype.slice.call(arguments))),this.update(r)},doHttpRequest:function(t){if(this.httpRequest)return this.httpRequest(t);t.source="upload",this.formCreateInject.api.fetch(t)}},render:function(){var t,r,o=this,i=_l(this.modelValue).length;return n.createVNode("div",{class:"_fc-upload"},[n.createVNode(n.resolveComponent("ElUpload"),n.mergeProps({key:i},this.$attrs,{listType:this.listType||"picture-card",class:{"_fc-exceed":this.$attrs.limit?this.$attrs.limit<=i:!1},onPreview:this.handlePreview,onChange:this.handleChange,onRemove:this.handleRemove,httpRequest:this.doHttpRequest,fileList:this.fileList,ref:"upload"}),Ac({default:function(){return[((t=(r=o.$slots).default)===null||t===void 0?void 0:t.call(r))||(["text","picture"].indexOf(o.listType)===-1?n.createVNode(n.resolveComponent("ElIcon"),null,{default:function(){return[n.createVNode(Rh,null,null)]}}):n.createVNode(n.resolveComponent("ElButton"),{type:"primary"},{default:function(){return[o.formCreateInject.t("clickToUpload")||"\u70B9\u51FB\u4E0A\u4F20"]}}))]}},U_(this.$slots,["default"]))),n.createVNode(n.resolveComponent("ElDialog"),{appendToBody:!0,modal:this.previewMask,title:this.modalTitle,modelValue:this.previewVisible,onClose:this.handleCancel},{default:function(){return[n.createVNode("img",{style:"width: 100%",src:o.previewImage},null)]}})])},mounted:function(){this.$emit("fc.el",this.$refs.upload)}});const z6="",Te=(e,t)=>{const r=e.__vccOpts||e;for(const[o,i]of t)r[o]=i;return r},Fh=e=>{const t=[];return e.forEach(r=>{r.field&&t.push(r.field),r.children&&t.push(...Fh(r.children))}),t},q_=n.defineComponent({name:"StepForm",props:{stepsProps:Object,modelValue:Object,formCreateInject:Object,autoValidate:Boolean,submitBtn:Boolean,steps:{type:Array,required:!0,default:()=>[]},options:{type:Object,default:()=>n.reactive({submitBtn:!1,resetBtn:!1})}},emits:["update:modelValue","change","itemMounted","submit","next"],data(){return{active:0,cacheRule:[],cacheValue:{},subApi:{},Form:n.markRaw(this.formCreateInject.form.$form())}},watch:{active(){this.init()},modelValue(e){this.setValue(e)}},methods:{init(){this.steps.forEach((e,t)=>{this.cacheRule[t]?this.cacheRule[t].display=t===this.active:this.cacheRule[t]={type:"FcRow",native:!0,display:t===this.active,children:e.rule}})},onPrev(){this.active--},validate(){return new Promise((e,t)=>{const r=Fh(this.cacheRule[this.active].children);r.length>0?Promise.all(r.map(o=>this.subApi.validateField(o))).then(()=>{e()}).catch(o=>{t(o)}):e()})},onNext(){this.autoValidate?this.validate().then(()=>{this.active++}).catch(e=>{}):this.active++,this.$emit("next",{active:this.active,api:this.subApi})},submit(){const e=()=>{this.$emit("submit",this.subApi.formData(),this.subApi)};this.autoValidate?this.validate().then(()=>{e()}).catch(t=>{}):e()},addSubApi(e){this.subApi=e,this.$emit("itemMounted",e)},formData(e){this.cacheValue=JSON.stringify(e),this.$emit("update:modelValue",e),this.$emit("change",e)},setValue(e){const t=JSON.stringify(e);this.cacheValue!==t&&(this.cacheValue=t,this.subApi.coverValue(e||{}))}},created(){this.init()}}),eE={class:"_fc-step-form"};function tE(e,t,r,o,i,l){const d=n.resolveComponent("van-step"),c=n.resolveComponent("van-steps"),u=n.resolveComponent("van-button"),h=n.resolveComponent("van-col"),m=n.resolveComponent("van-row");return n.openBlock(),n.createElementBlock("div",eE,[n.createVNode(c,n.mergeProps({active:e.active},e.stepsProps),{default:n.withCtx(()=>[(n.openBlock(!0),n.createElementBlock(n.Fragment,null,n.renderList(e.steps,y=>(n.openBlock(),n.createBlock(d,n.mergeProps({ref_for:!0},y.props),{default:n.withCtx(()=>[n.createTextVNode(n.toDisplayString(y.props.title),1)]),_:2},1040))),256))]),_:1},16,["active"]),(n.openBlock(),n.createBlock(n.resolveDynamicComponent(e.Form),{option:e.options,rule:e.cacheRule,extendOption:!0,modelValue:e.modelValue,"onUpdate:api":e.addSubApi,onEmitEvent:e.$emit,"onUpdate:modelValue":e.formData},null,40,["option","rule","modelValue","onUpdate:api","onEmitEvent","onUpdate:modelValue"])),n.createVNode(m,null,{default:n.withCtx(()=>[n.createVNode(h,{span:24,style:{"margin-top":"15px"}},{default:n.withCtx(()=>[e.active>0?(n.openBlock(),n.createBlock(u,{key:0,block:"",size:"small",onClick:e.onPrev},{default:n.withCtx(()=>[n.createTextVNode(n.toDisplayString(e.formCreateInject.t("prevStep")||"\u4E0A\u4E00\u6B65"),1)]),_:1},8,["onClick"])):n.createCommentVNode("",!0),e.active[n.createTextVNode(n.toDisplayString(e.formCreateInject.t("nextStep")||"\u4E0B\u4E00\u6B65"),1)]),_:1},8,["onClick"])):n.createCommentVNode("",!0),e.submitBtn!==!1&&e.active===e.cacheRule.length-1?(n.openBlock(),n.createBlock(u,{key:2,block:"",size:"small",class:"fc-clock",type:"primary",onClick:e.submit,style:{"margin-top":"10px"}},{default:n.withCtx(()=>[n.createTextVNode(n.toDisplayString(e.formCreateInject.t("submit")||"\u63D0\u4EA4"),1)]),_:1},8,["onClick"])):n.createCommentVNode("",!0)]),_:1})]),_:1})])}const nE=Te(q_,[["render",tE]]),U6="",iE=n.defineComponent({name:"FcPopup",emits:["confirm","submit","validateFail","update:modelValue"],props:{formData:Object,options:{type:Object,default:()=>n.reactive({submitBtn:!1,resetBtn:!1})},rule:Array,autoClose:{type:Boolean,default:!0},footer:{type:Boolean,default:!0},preview:Boolean,modelValue:Object,formCreateInject:Object,title:String},computed:{formOptions(){const e={...this.options};return this.preview&&(e.preview=this.preview),e}},data(){return{visible:!1,fapi:{},value:{},formRule:[],Form:n.markRaw(this.formCreateInject.form.$form())}},methods:{formChange(){this.$emit("update:modelValue",this.fapi.formData())},open(e){this.$nextTick(()=>{this.visible=!0,this.value=rt(e||this.modelValue||this.formData||{}),this.formRule=rt(this.rule||[])})},close(){this.visible=!1},handleConfirm(){this.$emit("confirm",this.fapi),this.fapi.submit().then(e=>{this.$emit("submit",e,this.fapi,this.close),this.autoClose&&this.close()}).catch(e=>{this.$emit("validateFail",e,this.fapi)})}},mounted(){this.formCreateInject.api.top.bus.$on("fc.closeDialog",this.close),n.onUnmounted(()=>{this.formCreateInject.api.top.bus.$off("fc.closeDialog",this.close)})}}),rE={class:"_fc-popup-title"},oE={class:"_fc-popup-content"},aE={class:"_fc-popup-footer"};function lE(e,t,r,o,i,l){const d=n.resolveComponent("van-button"),c=n.resolveComponent("van-popup");return n.openBlock(),n.createBlock(c,n.mergeProps({class:"_fc-popup",closeable:""},e.$attrs,{show:e.visible,"onUpdate:show":t[1]||(t[1]=u=>e.visible=u)}),{default:n.withCtx(()=>[n.createElementVNode("div",rE,n.toDisplayString(e.title),1),n.createElementVNode("div",oE,[(n.openBlock(),n.createBlock(n.resolveDynamicComponent(e.Form),{option:e.formOptions,rule:e.formRule,extendOption:!0,api:e.fapi,"onUpdate:api":t[0]||(t[0]=u=>e.fapi=u),"model-value":e.value,subForm:!1,onChange:e.formChange,onEmitEvent:e.$emit},null,40,["option","rule","api","model-value","onChange","onEmitEvent"]))]),n.createElementVNode("div",aE,[e.footer!==!1?(n.openBlock(),n.createElementBlock(n.Fragment,{key:0},[n.createVNode(d,{block:"",size:"small",type:"primary",class:"fc-clock",onClick:e.handleConfirm},{default:n.withCtx(()=>[n.createTextVNode(n.toDisplayString(e.formCreateInject.t("ok")||"\u786E\u5B9A"),1)]),_:1},8,["onClick"]),n.createVNode(d,{block:"",size:"small",class:"fc-clock",style:{"margin-top":"10px"},onClick:e.close},{default:n.withCtx(()=>[n.createTextVNode(n.toDisplayString(e.formCreateInject.t("close")||"\u5173\u95ED"),1)]),_:1},8,["onClick"])],64)):n.createCommentVNode("",!0)])]),_:1},16,["show"])}const sE=Te(iE,[["render",lE]]),H6="",xc=n.defineComponent({name:"DataTable",emits:["sortChange","handleClick"],props:{column:{type:Array,default:()=>[]},globalDataKey:[String,Object],fetch:Object,data:{type:Array,default:()=>[]},button:Object,index:Boolean,selection:Boolean,page:Object,formCreateInject:Object},data(){return{total:0,loading:!1,unwatch:null,list:[],currentPage:1,id:1,order:"",orderBy:""}},watch:{globalDataKey(){this.initPage()},fetch(){this.globalDataKey||this.initPage()},data(){!this.globalDataKey&&!this.fetch&&this.initPage()},selection(){this.id++},index(){this.id++},page:{handler(){this.initPage(),this.id++},deep:!0},button:{handler(){this.id++},deep:!0}},computed:{filterList(){let e=this.list||[];const t=[];return this.column.forEach(r=>{r.prop&&Array.isArray(r.filter)&&r.filter.length>0&&t.push(o=>r.filter.indexOf(o[r.prop])>-1)}),t.forEach(r=>{e=e.filter(r)}),e}},render(){return n.withDirectives(n.h("div",{class:"_fc-data-table"},[n.h(n.resolveComponent("el-table"),{data:this.filterList,...this.$attrs,key:this.id,ref:"table",onSortChange:e=>{this.$emit("sortChange",e),e.order?(this.orderBy=e.order==="descending"?"DESC":"ASC",this.order=e.prop):(this.orderBy="",this.order=""),this.initPage()}},()=>{const e=this.column.filter(r=>r.hidden!==!0).map(r=>this.makeColumn(r));this.selection&&e.unshift(n.h(n.resolveComponent("el-table-column"),{type:"selection",width:"50px"}));const t=this.makeButtonCol();return t&&e.push(t),this.index&&e.unshift(n.h(n.resolveComponent("el-table-column"),{type:"index",width:"50px"})),e}),this.makePage()]),[[n.resolveDirective("loading"),this.loading]])},methods:{getEl(){return this.$refs.table},deepGet(e,t,r){t=(t||"").split(".");let o=0,i=t.length;for(;e!=null&&o{this.list=e}):this.list=this.data},btnProps(e,t){const r=e.prop||[],o={type:e.type,size:e.size,round:r.indexOf("round")>-1,link:r.indexOf("link")>-1,plain:r.indexOf("plain")>-1,disabled:r.indexOf("disabled")>-1,onClick:l=>{l.stopPropagation();const d=Dr(e.click);try{d&&d(t,this.formCreateInject.api)}catch(c){console.error(c)}this.$emit("handleClick",{name:e.name,key:e.key,scope:t,column:t.row})}},i=Dr(e.handle);try{const l=i&&i(o,t,this.formCreateInject.api);typeof l=="boolean"&&(o.disabled=l)}catch(l){console.error(l)}return o},getLimit(){return this.page.props&&this.page.props.pageSize||20},nextList(){if(this.globalDataKey||this.fetch)this.fetchData(!0).then(({list:e,total:t})=>{this.list=e,this.total=t});else{const e=this.data,t=this.getLimit(),r=this.currentPage*t;this.list=e.slice(r-t,r),this.total=e.length}},fetchData(e){return this.unwatch&&this.unwatch(),new Promise(t=>{let r=this.fetch;if(this.globalDataKey){const o=typeof this.globalDataKey=="string"?this.globalDataKey:this.globalDataKey.key;r=this.formCreateInject.api.options.globalData[o]}if(r)if(r.type==="fetch"||!this.globalDataKey){r={...r};let o={};if(e){const l=this.page.props&&this.page.props.pageSize||20,d=this.page.pageField||"page",c=this.page.pageSizeField||"limit";o={[d]:this.currentPage,[c]:l}}if(this.order){const l=this.page.orderField||"order",d=this.page.orderByField||"orderBy";o[l]=this.order,o[d]=this.orderBy}const i=Object.keys(o).map(l=>encodeURIComponent(l)+"="+encodeURIComponent(o[l]),"").join("&");i&&(r.action+=(r.action.indexOf("?")!==-1?"&":"?")+i),this.loading=!0,r.wait=1e3,this.unwatch=this.formCreateInject.api.watchFetch(r,(l,d)=>{this.loading=!1;const c=this.page.totalField,u=this.page.dataField,h=u?this.deepGet(l,u,[]):l;let m=c?this.deepGet(l,c):0;m||(m=h.length||0),t({list:h,total:m})},l=>{console.error(l),this.loading=!1},(l,d)=>{if(d)return this.unwatch&&this.unwatch(),this.unwatch=null,setTimeout(()=>{this.changePage(1)}),!1})}else{let o=r.data||[],i=r.data.length;if(e){const l=this.getLimit(),d=this.currentPage*l;o=o.slice(d-l,d),i=o.length}t({list:o,total:i})}else t({list:[],total:0})})},changePage(e){this.currentPage=e,this.nextList()},makePage(){if(this.page&&this.page.open===!0)return n.h(n.resolveComponent("el-pagination"),{layout:"prev, pager, next",total:this.total,currentPage:this.currentPage,"onUpdate:currentPage":e=>{this.currentPage!==e&&this.changePage(e)},class:this.page.position||"right",...this.page.props||{},pageSize:this.page.props&&this.page.props.pageSize||20})},makeButtonCol(){if(this.button&&this.button.open===!0&&this.button.column)return n.h(n.resolveComponent("el-table-column"),{label:this.button.label||this.formCreateInject.t("operation")||"\u64CD\u4F5C",fixed:this.button.fixed===void 0?"right":this.button.fixed,width:this.button.width||"100px"},{default:e=>this.button.column.filter(t=>t.hidden!==!0).map(t=>n.h(n.resolveComponent("el-button"),this.btnProps(t,e),()=>[t.name]))})},makeColumn(e){return n.h(n.resolveComponent("el-table-column"),{label:e.label,prop:e.prop,width:e.width,align:e.align,className:e.className,fixed:e.fixed,sortable:e.sortable},{default:t=>{if(e.children&&e.children.length>0)return e.children.map(r=>this.makeColumn(r));if(!(!e.format||e.format==="default"))return this.makeTd(e,t)}})},makeTd(e,t){return e.format==="custom"&&e.render?e.render(t,n.h,n.resolveComponent,this.formCreateInject.api):e.format==="tag"?n.h(n.resolveComponent("el-tag"),{disableTransitions:!0},()=>[this.deepGet(t.row,e.prop,"")]):e.format==="image"?n.h("div",{class:"_fc-data-table-img-list"},(()=>{let r=this.deepGet(t.row,e.prop,"");return r=(Array.isArray(r)?r:[r]).filter(o=>!!o),r.map((o,i)=>n.h(n.resolveComponent("el-image"),{src:o,previewSrcList:r,previewTeleported:!0,initialIndex:i,fit:"cover"}))})()):""+this.deepGet(t.row,e.prop,"")}},created(){this.initPage(),this.$watch(()=>this.data&&this.data.length,()=>{!this.globalDataKey&&!this.fetch&&this.initPage()})}}),W6="",dE={name:"FcTable",props:{mini:Boolean,label:String,width:[Number,String],border:{type:Boolean,default:!0},borderWidth:String,borderColor:String,rule:{type:Object,default:()=>({row:1,col:1})}},watch:{rule:{handler(){this.initRule(),this.loadRule(),this.tdStyle=this.rule.style||{},this.tdClass=this.rule.class||{}},immediate:!0,deep:!0}},data(){return{tdStyle:{},tdClass:{},lattice:{}}},computed:{tableColor(){const e={};return this.border===!1?e.border="0 none":(this.borderColor&&(e.borderColor=this.borderColor),this.borderWidth&&(e.borderWidth=this.borderWidth)),e}},methods:{initRule(){const e=this.rule;e.style||(e.style={}),e.layout||(e.layout=[]),e.row||(e.row=1),e.col||(e.col=1)},loadRule(){const e=[],t=this.rule||{row:1,col:1};for(let o=0;o{if((!o.row||o.row<=0)&&(!o.col||o.col<=0)||!e[o.top]||!e[o.top][o.left]||!e[o.top][o.left].show){t.layout.splice(i,1);return}const l=e[o.top][o.left];l.layout=o;let d=1,c=1;if(o.col&&(d=o.col+o.left>t.col?t.col-o.left:o.col,l.colspan=d),o.row&&(c=o.row+o.top>t.row?t.row-o.top:o.row,l.rowspan=c),c&&d)for(let u=0;u!!(!o||o.layout||!o.show);e.forEach((o,i)=>{o.forEach((l,d)=>{let c=!1,u=!1;if(l.layout){const h=l.layout.col||1,m=l.layout.row||1;for(let y=0;y[n.createElementVNode("div",{class:n.normalizeClass(["_fc-table",{"is-mini":r.mini}])},[n.createElementVNode("table",{border:"1",cellspacing:"0",cellpadding:"0",style:n.normalizeStyle(l.tableColor)},[(n.openBlock(!0),n.createElementBlock(n.Fragment,null,n.renderList(r.rule.row,(c,u)=>(n.openBlock(),n.createElementBlock("tr",{key:u},[(n.openBlock(!0),n.createElementBlock(n.Fragment,null,n.renderList(r.rule.col,(h,m)=>(n.openBlock(),n.createElementBlock(n.Fragment,{key:`${u}${m}`},[i.lattice[u][m].show?(n.openBlock(),n.createElementBlock("td",n.mergeProps({key:0,ref_for:!0},i.lattice[u][m]?{colspan:i.lattice[u][m].colspan,rowspan:i.lattice[u][m].rowspan}:{},{valign:"top",class:i.tdClass&&i.tdClass[`${u}:${m}`]||"",style:[l.tableColor,i.tdStyle&&i.tdStyle[`${u}:${m}`]||{}]}),[n.renderSlot(e.$slots,`${u}:${m}`),(n.openBlock(!0),n.createElementBlock(n.Fragment,null,n.renderList(i.lattice[u][m].slot,y=>n.renderSlot(e.$slots,`${y}`)),256))],16)):n.createCommentVNode("",!0)],64))),128))]))),128))],4)],2)]),_:3})}const Ph=Te(dE,[["render",cE]]),G6="",uE={name:"TableForm",emits:["change","add","delete","update:modelValue"],props:{formCreateInject:Object,modelValue:{type:Array,default:()=>[]},columns:{type:Array,required:!0,default:()=>[]},filterEmptyColumn:{type:Boolean,default:!0},deletable:{type:Boolean,default:!0},addable:{type:Boolean,default:!0},options:{type:Object,default:()=>n.reactive({submitBtn:!1,resetBtn:!1})},max:Number,min:Number,disabled:Boolean},watch:{modelValue:{handler(){this.updateTable()},deep:!0},"formCreateInject.preview":function(e){this.emptyRule.children[0].props.colspan=this.columns.length+(e?1:2)}},data(){return{rule:[],trs:[],fapi:{},Form:n.markRaw(this.formCreateInject.form.$form()),copyTrs:"",oldValue:"",emptyRule:{type:"tr",_isEmpty:!0,native:!0,subRule:!0,children:[{type:"td",style:{textAlign:"center"},native:!0,subRule:!0,props:{colspan:this.columns.length+(this.formCreateInject.preview?1:2)},children:[this.formCreateInject.t("dataEmpty")||"\u6682\u65E0\u6570\u636E"]}]}}},methods:{formChange(){this.updateValue()},updateValue(){const e=this.trs.map((r,o)=>({...this.modelValue[o]||{},...this.fapi.getChildrenFormData(r)})).filter(r=>{if(!this.filterEmptyColumn)return!0;if(r==null)return!1;let o=!1;return Object.keys(r).forEach(i=>{o=o||r[i]!==void 0&&r[i]!==""&&r[i]!==null}),o}),t=JSON.stringify(e);t!==this.oldValue&&(this.oldValue=t,this.$emit("update:modelValue",e),this.$emit("change",e))},setRawData(e,t){const r=this.trs[e];this.fapi.setChildrenFormData(r,t,!0)},updateTable(){const e=JSON.stringify(this.modelValue);this.oldValue!==e&&(this.oldValue=e,this.trs=this.trs.splice(0,this.modelValue.length),this.modelValue.length?this.clearEmpty():this.addEmpty(),this.modelValue.forEach((t,r)=>{this.trs[r]||this.addRaw(),this.setRawData(r,t||{})}),this.rule[0].children[1].children=this.trs)},addEmpty(){this.trs.length&&this.trs.splice(0,this.trs.length),this.trs.push(this.emptyRule)},clearEmpty(){this.trs[0]&&this.trs[0]._isEmpty&&this.trs.splice(0,1)},delRaw(e){this.disabled||!this.deletable||this.min>0&&this.trs.length<=this.min||(this.trs.splice(e,1),this.updateValue(),this.trs.length?this.trs.forEach(t=>this.updateRaw(t)):this.addEmpty(),this.$emit("delete",e))},addRaw(e){if(e&&this.disabled)return;const t=this.formCreateInject.form.parseJson(this.copyTrs)[0];this.trs.length===1&&this.trs[0]._isEmpty&&this.trs.splice(0,1),this.trs.push(t),this.updateRaw(t),e&&(this.$emit("add",this.trs.length),this.updateValue())},updateRaw(e){const t=this.trs.indexOf(e);e.children[0].props.innerText=t+1,e.children[e.children.length-1].children[0].props.onClick=()=>{this.delRaw(t)}},loadRule(){const e=[{type:"th",native:!0,class:"_fc-tf-head-idx",props:{innerText:"#"}}];let t=[{type:"td",class:"_fc-tf-idx",native:!0,props:{innerText:"0"}}];this.columns.forEach(r=>{e.push({type:"th",native:!0,style:r.style,class:r.required?"_fc-tf-head-required":"",props:{innerText:r.label||""}}),t.push({type:"td",native:!0,children:[...r.rule||[]]})}),e.push({type:"th",native:!0,class:"_fc-tf-edit fc-clock",props:{innerText:this.formCreateInject.t("operation")||"\u64CD\u4F5C"}}),t.push({type:"td",native:!0,class:"_fc-tf-btn fc-clock",children:[{type:"i",native:!0,class:"fc-icon icon-delete",props:{}}]}),this.copyTrs=this.formCreateInject.form.toJson([{type:"tr",native:!0,subRule:!0,children:t}]),this.rule=[{type:"table",native:!0,class:"_fc-tf-table",props:{border:"1",cellspacing:"0",cellpadding:"0"},children:[{type:"thead",native:!0,children:[{type:"tr",native:!0,children:e}]},{type:"tbody",native:!0,children:this.trs}]}]}},created(){this.loadRule()},mounted(){this.updateTable()}};function fE(e,t,r,o,i,l){const d=n.resolveComponent("el-button");return n.openBlock(),n.createElementBlock("div",{class:n.normalizeClass(["_fc-table-form",{"_fc-disabled":r.disabled}])},[(n.openBlock(),n.createBlock(n.resolveDynamicComponent(i.Form),{option:r.options,rule:i.rule,extendOption:!0,disabled:r.disabled,onChange:l.formChange,api:i.fapi,"onUpdate:api":t[0]||(t[0]=c=>i.fapi=c),onEmitEvent:e.$emit},null,40,["option","rule","disabled","onChange","api","onEmitEvent"])),r.addable&&(!r.max||r.max>this.trs.length)?(n.openBlock(),n.createBlock(d,{key:0,link:"",type:"primary",class:"fc-clock",onClick:t[1]||(t[1]=c=>l.addRaw(!0))},{default:n.withCtx(()=>[t[2]||(t[2]=n.createElementVNode("i",{class:"fc-icon icon-add-circle",style:{"font-weight":"700"}},null,-1)),n.createTextVNode(" "+n.toDisplayString(r.formCreateInject.t("add")||"\u6DFB\u52A0"),1)]),_:1})):n.createCommentVNode("",!0)],2)}const Mh=Te(uE,[["render",fE]]),K6="",pE={name:"TableFormPro",emits:["change","add","delete","update:modelValue","handleClick"],props:{formCreateInject:Object,height:[String,Number],modelValue:{type:Array,default:()=>[]},columns:{type:Array,required:!0,default:()=>[]},button:Object,page:Object,size:String,filterEmptyColumn:{type:Boolean,default:!0},newColumn:Boolean,deletable:{type:Boolean,default:!0},addable:{type:Boolean,default:!0},options:{type:Object,default:()=>n.reactive({submitBtn:!1,resetBtn:!1})},showIndex:Boolean,max:Number,min:Number,disabled:Boolean},watch:{modelValue:{handler(){const e=JSON.stringify(this.modelValue||[]);this.oldValue!==e&&(this.chunk=[[]],this.nowPage=1,this.updateTable(),this.oldValue=e)}}},computed:{total(){return this.chunk.reduce((e,t)=>(e+=t.length,e),0)},limit(){return!this.page||this.page.open!==!0?1e6:this.page.props&&this.page.props.pageSize||20},pageData(){return this.chunk[this.nowPage-1]}},data(){return{chunk:[[]],data:[],rule:[],trs:[],fapi:{},Form:n.markRaw(this.formCreateInject.form.$form()),copyTrs:"",oldValue:"",nowPage:1,indexRule:{type:"el-table-column",props:{label:"#",type:"index",fixed:"left"}}}},methods:{paginateArray(){const e=this.modelValue||[],t=this.limit,r=[];for(let o=0;o{this.chunk[i]=[...this.chunk[i]||[],...o]}),this.nowPage>this.chunk.length&&(this.nowPage=this.chunk.length)},formChange(){this.updateValue()},updateValue(){this.trs.forEach((r,o)=>{yl(this.pageData[o],this.fapi.getChildrenFormData(r))});const e=rt(this.chunk.reduce((r,o)=>[...r,...o],[]).filter(r=>{if(!this.filterEmptyColumn)return!0;if(r==null)return!1;let o=!1;return Object.keys(r).forEach(i=>{o=o||r[i]!==void 0&&r[i]!==""&&r[i]!==null}),o})),t=JSON.stringify(e);t!==this.oldValue&&(this.oldValue=t,this.$emit("update:modelValue",e),this.$emit("change",e))},setRawData(e,t){const r=this.trs[e];this.fapi.setChildrenFormData(r,t,!0)},changePage(e){e!==this.nowPage&&(this.chunk[this.nowPage-1]=this.pageData,this.nowPage=e,this.rule[1].props.data=this.pageData,this.trs.splice(0,this.trs.length),this.pageData.forEach((t,r)=>{this.trs[r]||this.addRaw(),this.setRawData(r,t||{})}),this.rule[0].children=this.trs)},updateTable(){this.paginateArray(),this.rule[1].props.data=this.pageData,this.trs.splice(0,this.trs.length),this.pageData.forEach((e,t)=>{this.trs[t]||this.addRaw(),this.setRawData(t,e||{})}),this.rule[0].children=this.trs},delRaw(e){this.disabled||this.deletable===!1||this.min>0&&this.total<=this.min||(this.trs.splice(e,1),this.rule[1].props.data.splice(e,1),this.updateValue(),this.$emit("delete",e),this.oldValue="")},addRaw(e){if(!(e&&(this.disabled||this.addable===!1))){if(!e){const t=this.formCreateInject.form.parseJson(this.copy);this.trs.push(t);return}if(this.chunk[this.chunk.length-1].length>=this.limit)this.chunk.push([{}]);else if(e&&this.chunk[this.chunk.length-1].push({}),e&&this.nowPage===this.chunk.length){const t=this.formCreateInject.form.parseJson(this.copy);this.trs.push(t)}e&&(this.$emit("add",this.total),this.updateValue())}},btnProps(e,t){const r={...t};r.row=this.modelValue[t.$index]||{};const o=e.prop||[],i={type:e.type,size:e.size,round:o.indexOf("round")>-1,link:o.indexOf("link")>-1,plain:o.indexOf("plain")>-1,disabled:o.indexOf("disabled")>-1||this.disabled||e.key==="delete"&&this.deletable===!1,onClick:l=>{if(r.row=this.modelValue[t.$index]||{},l.stopPropagation(),e.key==="delete"){this.delRaw(t.$index);return}const d=Dr(e.click);try{d&&d(r,this.formCreateInject.api)}catch(c){console.error(c)}this.$emit("handleClick",{name:e.name,key:e.key,_scope:r,column:r.row})}};try{if(!this.disabled){const l=Dr(e.handle),d=l&&l(i,r,this.formCreateInject.api);typeof d=="boolean"&&(i.disabled=d)}}catch(l){console.error(l)}return i},processRule(e){let t=[];return e.forEach(r=>{r.children?t.push(...this.processRule(r.children)):(r._renderId=We(),t.push({type:"template",name:r._renderId,children:[...r.rule||[]]}))}),t},processColumns(e){return e.map((t,r)=>{var i;const o={type:"el-table-column",hidden:t.hidden===!0,props:{fixed:t.fixed||!1,width:((i=t==null?void 0:t.style)==null?void 0:i.width)||"auto",minWidth:120},renderSlots:{header(){var l;return n.h("span",{class:t.required?"is-required":"",style:{color:(l=t==null?void 0:t.style)==null?void 0:l.color}},t.label)}}};return t.children?o.children=this.processColumns(t.children):o.renderSlots.default=({$index:l})=>{var d,c,u,h,m,y,C,A;for(let w=0;w<((c=(d=this.rule[0])==null?void 0:d.children[l])==null?void 0:c.children.length);w++)if(((h=(u=this.rule[0])==null?void 0:u.children[l])==null?void 0:h.children[w].name)===t._renderId)return(A=(C=this.fapi.renderRule((y=(m=this.rule[0])==null?void 0:m.children[l])==null?void 0:y.children[w],void 0,!0))==null?void 0:C.default)==null?void 0:A.call(C)},o})},loadRule(){this.copy=this.formCreateInject.form.toJson({type:"template",name:"template",subRule:!0,children:this.processRule(this.columns)}),this.rule=[{type:"hidden",children:this.trs},{type:"elTable",style:{width:"100%"},key:1,props:{...this.$attrs,height:this.height,size:this.size,data:[]},children:[]}]}},created(){this.loadRule()},mounted(){const e=this.fapi.sync;this.fapi.sync=t=>{t.tableRenderUni=We(),e(t)},this.updateTable(),this.newColumn&&(!this.modelValue||!this.modelValue.length)&&this.addRaw(!0),this.$watch(()=>[...this.columns],t=>{this.rule[1].children.splice(this.rule[1].children.indexOf(this.indexRule)>-1?1:0,0,...this.processColumns(t)),this.rule[1].key++},{immediate:!0}),this.$watch(()=>this.showIndex,t=>{t===!1&&this.rule[1].children.indexOf(this.indexRule)>-1?this.rule[1].children.splice(0,1):t!==!1&&this.rule[1].children.indexOf(this.indexRule)===-1&&this.rule[1].children.unshift(this.indexRule)},{immediate:!0}),this.$watch(()=>this.formCreateInject.preview&&this.button&&this.button.column&&[{...this.button},...this.button.column],t=>{this.rule[1].children.forEach((r,o)=>{r._tableHandle&&this.rule[1].children.splice(o,1)}),!this.formCreateInject.preview&&this.button.open!==!1&&this.rule[1].children.push({type:"el-table-column",_tableHandle:!0,props:{label:this.button.label||this.formCreateInject.t("operation")||"\u64CD\u4F5C",fixed:this.button.fixed===void 0?"right":this.button.fixed,width:this.button.width||"100px"},renderSlots:{default:r=>this.button.column.filter(o=>o.hidden!==!0).map(o=>n.h(n.resolveComponent("el-button"),this.btnProps(o,r),()=>[o.key==="delete"&&this.formCreateInject.t("delete")||o.name]))}})},{immediate:!0})}},hE={class:"_fc-tf-pro-handle"};function mE(e,t,r,o,i,l){const d=n.resolveComponent("el-button"),c=n.resolveComponent("el-pagination");return n.openBlock(),n.createElementBlock("div",{class:n.normalizeClass(["_fc-table-form-v2",{"_fc-disabled":r.disabled}])},[(n.openBlock(),n.createBlock(n.resolveDynamicComponent(i.Form),{option:r.options,rule:i.rule,extendOption:!0,disabled:r.disabled,onChange:l.formChange,api:i.fapi,"onUpdate:api":t[0]||(t[0]=u=>i.fapi=u),onEmitEvent:e.$emit},null,40,["option","rule","disabled","onChange","api","onEmitEvent"])),n.createElementVNode("div",hE,[n.createElementVNode("div",null,[(!r.max||r.max>l.total)&&r.addable!==!1&&r.disabled!==!0?(n.openBlock(),n.createBlock(d,{key:0,link:"",type:"primary",class:"fc-clock",onClick:t[1]||(t[1]=u=>l.addRaw(!0))},{default:n.withCtx(()=>[t[2]||(t[2]=n.createElementVNode("i",{class:"fc-icon icon-add-circle",style:{"font-weight":"700"}},null,-1)),n.createTextVNode(" "+n.toDisplayString(r.formCreateInject.t("add")||"\u6DFB\u52A0"),1)]),_:1})):n.createCommentVNode("",!0)]),r.page&&r.page.open===!0&&i.chunk.length>1?(n.openBlock(),n.createBlock(c,n.mergeProps({key:0},r.page.props||{},{layout:"prev, pager, next",currentPage:i.nowPage,"onUpdate:currentPage":l.changePage,total:l.total,pageSize:l.limit}),null,16,["currentPage","onUpdate:currentPage","total","pageSize"])):n.createCommentVNode("",!0)])],2)}const Lh=Te(pE,[["render",mE]]),Y6="",gE={name:"InfiniteTableForm",emits:["change","add","delete","update:modelValue"],props:{formCreateInject:Object,modelValue:{type:Array,default:()=>[]},columns:{type:Array,required:!0,default:()=>[]},options:{type:Object,default:()=>n.reactive({submitBtn:!1,resetBtn:!1})},max:Number,layerMax:{type:Number,default:0},childrenField:String,disabled:Boolean},computed:{preview(){return this.formCreateInject.preview},subField(){return this.childrenField||"children"}},watch:{modelValue(){this.updateTable()},"formCreateInject.preview"(e){this.trs.forEach((t,r)=>{t.children[1]&&(t.children[1].children[0].props.colspan=this.rule[0].children[0].children[0].children.length-(e?1:0)),t.children[0].children[0].children[0].hidden=this.layerMax===1||e&&!(this.modelValue&&this.modelValue[r]&&Array.isArray(this.modelValue[r][this.subField])&&this.modelValue[r][this.subField].length>0)})}},data(){return{rule:[],trs:[],fapi:{},Form:n.markRaw(this.formCreateInject.form.$form()),copyTrs:"",oldValue:""}},methods:{formChange(e,t,r,o,i){i===!1&&this.updateValue()},updateValue(){const e=this.trs.map((r,o)=>{const i={...this.modelValue[o]||{},...this.fapi.getChildrenFormData(r)};return!li(i,this.subField)&&this.modelValue[o]&&(i[this.subField]=this.modelValue[o][this.subField]),i[this.subField]==null&&delete i[this.subField],i}),t=JSON.stringify(e);t!==this.oldValue&&(this.oldValue=t,this.$emit("update:modelValue",e),this.$emit("change",e))},setRawData(e,t){const r=this.trs[e];this.fapi.setChildrenFormData(r,t,!0)},updateTable(){const e=JSON.stringify(this.modelValue);this.oldValue!==e&&(this.oldValue=e,this.trs=this.trs.splice(0,this.modelValue.length),this.modelValue.length||this.addRaw(),this.modelValue.forEach((t,r)=>{this.trs[r]||this.addRaw(),this.setRawData(r,t||{})}),this.rule[0].children[1].children=this.trs)},delRaw(e){this.disabled||(this.trs.splice(e,1),this.updateValue(),this.trs.length?this.trs.forEach(t=>this.updateRaw(t)):this.addRaw(),this.$emit("delete",e))},addRaw(e){if(e&&this.disabled)return;const t=this.formCreateInject.form.parseJson(this.copyTrs)[0],r={type:"template",subRule:!0,children:[]};r.children.push(t),this.trs.push(r),this.trs.forEach(o=>this.updateRaw(o)),e&&this.$emit("add",this.trs)},updateRaw(e){const t=this.trs.indexOf(e),r=e.children[0];r.children[0].children[0].hidden=this.layerMax===1||this.preview&&!(this.modelValue&&this.modelValue[t]&&Array.isArray(this.modelValue[t][this.subField])&&this.modelValue[t][this.subField].length>0),r.children[0].children[0].props.onClick=o=>{if(this.trs[t].children.length===1){if(this.disabled&&!(this.modelValue&&this.modelValue[t]&&Array.isArray(this.modelValue[t][this.subField])&&this.modelValue[t][this.subField].length>0))return;this.trs[t].children.push({type:"tr",native:!0,display:!0,children:[{type:"td",native:!0,props:{colspan:this.rule[0].children[0].children[0].children.length-(this.preview?1:0)},class:"_fc-itf-sub",children:[{type:"infiniteTableForm",field:this.subField,value:[...this.modelValue[t]&&this.modelValue[t][this.subField]||[]],props:{disabled:this.disabled,layerMax:this.layerMax===0?0:this.layerMax>1?this.layerMax-1:1,max:this.max||0,columns:rt(this.columns),options:rt(this.options)}}]}]})}const i=o.self.children[0]==="-"?"+":"-";o.self.children=[i],this.trs[t].children[1].display=i==="-"},r.children[1].props.innerText=t+1,r.children[r.children.length-1].children[0].props.onClick=()=>{this.delRaw(t)}},loadRule(){const e=[{type:"th",native:!0,class:"_fc-itf-sub-idx"},{type:"th",native:!0,class:"_fc-itf-head-idx",props:{innerText:"#"}}];let t=[{type:"td",class:"_fc-itf-idx",native:!0,children:[{type:"div",hidden:!1,children:["+"],inject:!0,props:{}}]},{type:"td",class:"_fc-itf-idx",native:!0,props:{innerText:"0"}}];this.columns.forEach(r=>{e.push({type:"th",native:!0,class:r.required?"_fc-itf-head-required":"",style:r.style,props:{innerText:r.label||""}}),t.push({type:"td",native:!0,children:[...r.rule||[]]})}),e.push({type:"th",native:!0,class:"_fc-itf-edit fc-clock",props:{innerText:this.formCreateInject.t("operation")||"\u64CD\u4F5C"}}),t.push({type:"td",native:!0,class:"_fc-itf-btn fc-clock",children:[{type:"i",native:!0,class:"fc-icon icon-delete",props:{}}]}),this.copyTrs=this.formCreateInject.form.toJson([{type:"tr",native:!0,children:t}]),this.rule=[{type:"table",native:!0,class:"_fc-itf-table",props:{border:"1",cellspacing:"0",cellpadding:"0"},children:[{type:"thead",native:!0,children:[{type:"tr",native:!0,children:e}]},{type:"tbody",native:!0,children:this.trs}]}]}},created(){this.loadRule()},mounted(){this.updateTable()}};function vE(e,t,r,o,i,l){const d=n.resolveComponent("el-button");return n.openBlock(),n.createElementBlock("div",{class:n.normalizeClass(["_fc-infinite-table-form",{"_fc-disabled":r.disabled}])},[(n.openBlock(),n.createBlock(n.resolveDynamicComponent(i.Form),{option:r.options,rule:i.rule,extendOption:!0,onChange:l.formChange,disabled:r.disabled,api:i.fapi,"onUpdate:api":t[0]||(t[0]=c=>i.fapi=c),onEmitEvent:e.$emit},null,40,["option","rule","onChange","disabled","api","onEmitEvent"])),!r.max||r.max>this.trs.length?(n.openBlock(),n.createBlock(d,{key:0,link:"",type:"primary",class:"fc-clock",onClick:t[1]||(t[1]=c=>l.addRaw(!0))},{default:n.withCtx(()=>[t[2]||(t[2]=n.createElementVNode("i",{class:"fc-icon icon-add-circle",style:{"font-weight":"700"}},null,-1)),n.createTextVNode(" "+n.toDisplayString(r.formCreateInject.t("add")||"\u6DFB\u52A0"),1)]),_:1})):n.createCommentVNode("",!0)],2)}const jh=Te(gE,[["render",vE]]),Q6="",yE={name:"NestedTableForm",emits:["change","add","delete","update:modelValue"],props:{formCreateInject:Object,modelValue:{type:Array,default:()=>[]},nested:Array,nestedField:String,columns:{type:Array,required:!0,default:()=>[]},options:{type:Object,default:()=>n.reactive({submitBtn:!1,resetBtn:!1})},max:Number,nestedMax:Number,disabled:Boolean},computed:{preview(){return this.formCreateInject.preview}},watch:{modelValue(){this.updateTable()},"formCreateInject.preview"(e){this.trs.forEach(t=>{const r=t.children[1].children[0].props.colspan;t.children[1].children[0].props.colspan=e?r-1:r+1})}},data(){return{rule:[],trs:[],fapi:{},Form:n.markRaw(this.formCreateInject.form.$form()),copyTrs:"",oldValue:""}},methods:{formChange(e,t,r,o,i){i===!1&&this.updateValue()},updateValue(){const e=this.trs.map((r,o)=>({...this.modelValue[o]||{},...this.fapi.getChildrenFormData(r)})).filter(r=>{if(r==null)return!1;let o=!1;return Object.keys(r).forEach(i=>{o||(o=o||r[i]!==void 0&&r[i]!==""&&r[i]!==null&&(Array.isArray(r[i])?!!r[i].length:!0))}),o}),t=JSON.stringify(e);t!==this.oldValue&&(this.oldValue=t,this.$emit("update:modelValue",e),this.$emit("change",e))},setRawData(e,t){const r=this.trs[e];this.fapi.setChildrenFormData(r,t,!0)},updateTable(){const e=JSON.stringify(this.modelValue);this.oldValue!==e&&(this.oldValue=e,this.trs=this.trs.splice(0,this.modelValue.length),this.modelValue.length||this.addRaw(),this.modelValue.forEach((t,r)=>{this.trs[r]||this.addRaw(),this.setRawData(r,t||{})}),this.rule[0].children[1].children=this.trs)},delRaw(e){this.disabled||(this.trs.splice(e,1),this.updateValue(),this.trs.length?this.trs.forEach(t=>this.updateRaw(t)):this.addRaw(),this.$emit("delete",e))},addRaw(e){if(e&&this.disabled)return;const t=this.formCreateInject.form.parseJson(this.copyTrs)[0],r={type:"template",subRule:!0,children:[]};r.children.push(t),r.children.push({type:"tr",native:!0,display:!1,children:[{type:"td",native:!0,props:{colspan:t.children.length-(this.preview?1:0)},class:"_fc-ntf-sub",children:[{type:"TableForm",field:this.nestedField,value:[],props:{disabled:this.disabled,max:this.nestedMax||0,columns:rt(this.nested),options:rt(this.options)}}]}]}),this.trs.push(r),this.updateRaw(r),e&&this.$emit("add",this.trs)},updateRaw(e){const t=this.trs.indexOf(e),r=e.children[0];r.children[0].children[0].props.onClick=o=>{const i=o.self.children[0]==="-"?"+":"-";o.self.children=[i],this.trs[t].children[1].display=i==="-"},r.children[1].props.innerText=t+1,r.children[r.children.length-1].children[0].props.onClick=()=>{this.delRaw(t)}},loadRule(){const e=[{type:"th",native:!0,class:"_fc-ntf-sub-idx"},{type:"th",native:!0,class:"_fc-ntf-head-idx",props:{innerText:"#"}}];let t=[{type:"td",class:"_fc-ntf-idx",native:!0,children:[{type:"div",hidden:!1,children:["+"],inject:!0,props:{}}]},{type:"td",class:"_fc-ntf-idx",native:!0,props:{innerText:"0"}}];this.columns.forEach(r=>{e.push({type:"th",native:!0,class:r.required?"_fc-ntf-head-required":"",style:r.style,props:{innerText:r.label||""}}),t.push({type:"td",native:!0,children:[...r.rule||[]]})}),e.push({type:"th",native:!0,class:"_fc-ntf-edit fc-clock",props:{innerText:this.formCreateInject.t("operation")||"\u64CD\u4F5C"}}),t.push({type:"td",native:!0,class:"_fc-ntf-btn fc-clock",children:[{type:"i",native:!0,class:"fc-icon icon-delete",props:{}}]}),this.copyTrs=this.formCreateInject.form.toJson([{type:"tr",native:!0,children:t}]),this.rule=[{type:"table",native:!0,class:"_fc-ntf-table",props:{border:"1",cellspacing:"0",cellpadding:"0"},children:[{type:"thead",native:!0,children:[{type:"tr",native:!0,children:e}]},{type:"tbody",native:!0,children:this.trs}]}]}},created(){this.loadRule()},mounted(){this.updateTable()}};function bE(e,t,r,o,i,l){const d=n.resolveComponent("el-button");return n.openBlock(),n.createElementBlock("div",{class:n.normalizeClass(["_fc-nested-table-form",{"_fc-disabled":r.disabled}])},[(n.openBlock(),n.createBlock(n.resolveDynamicComponent(i.Form),{option:r.options,rule:i.rule,extendOption:!0,onChange:l.formChange,disabled:r.disabled,api:i.fapi,"onUpdate:api":t[0]||(t[0]=c=>i.fapi=c),onEmitEvent:e.$emit},null,40,["option","rule","onChange","disabled","api","onEmitEvent"])),!r.max||r.max>this.trs.length?(n.openBlock(),n.createBlock(d,{key:0,link:"",type:"primary",class:"fc-clock",onClick:t[1]||(t[1]=c=>l.addRaw(!0))},{default:n.withCtx(()=>[t[2]||(t[2]=n.createElementVNode("i",{class:"fc-icon icon-add-circle",style:{"font-weight":"700"}},null,-1)),n.createTextVNode(" "+n.toDisplayString(r.formCreateInject.t("add")||"\u6DFB\u52A0"),1)]),_:1})):n.createCommentVNode("",!0)],2)}const zh=Te(yE,[["render",bE]]),J6="",wE=n.defineComponent({name:"FcCell"}),CE={ref:"cell",class:"_fc-cell"};function _E(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("div",CE,[n.renderSlot(e.$slots,"default")],512)}const Uh=Te(wE,[["render",_E]]),EE=n.defineComponent({name:"FcValue",props:["modelValue"],watch:{modelValue(e){this.$emit("change",e)}}}),SE={class:"_fc-value"};function AE(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("div",SE,n.toDisplayString(e.modelValue),1)}const Hh=Te(EE,[["render",AE]]),X6="",xE=n.defineComponent({name:"FcCity",props:{modelValue:Array,clearable:Boolean,placeholder:String,disabled:Boolean,filter:Function,level:{type:Number,default:3},api:String},emits:["update:modelValue","change"],data(){return{inputValue:"",show:!1,province:[]}},watch:{modelValue:{handler(e){this.inputValue=(e||[]).join(" / ")},deep:!0,immediate:!0}},computed:{city(){if(this.value.p){for(let e=0;er.text).join(" / "),this.show=!1;const t=e.map(r=>r.value);this.$emit("update:modelValue",t),this.$emit("change",t)},clear(e){e.stopPropagation(),this.inputValue="",this.$emit("update:modelValue",[]),this.$emit("change",[])},loadData(e){return fetch(e).then(t=>t.json()).then(t=>{this.province=n.markRaw(this.tidyOptions(this.filter?this.filter(t)||[]:t,0))})},tidyOptions(e,t){return e.map(r=>{const o={text:r.text||r.n,value:r.value||r.text||r.n};return(r.children||r.d)&&t+1{this.loadData("https://cdn.jsdelivr.net/npm/@province-city-china/level/level.min.json").catch(()=>{this.loadData("https://npm.onmicrosoft.cn/@province-city-china/level/level.min.json")})})}}),kE={class:"_fc-city-m"};function NE(e,t,r,o,i,l){const d=n.resolveComponent("van-field"),c=n.resolveComponent("van-cascader"),u=n.resolveComponent("van-popup");return n.openBlock(),n.createElementBlock("div",kE,[n.createVNode(d,{ref:"el",placeholder:e.placeholder,readonly:"",disabled:e.disabled,onClick:e.open,"model-value":e.inputValue,border:!1,isLink:""},n.createSlots({_:2},[e.clearable&&e.inputValue?{name:"right-icon",fn:n.withCtx(()=>[n.createElementVNode("i",{class:"van-badge__wrapper van-icon van-icon-clear van-field__clear",onClick:t[0]||(t[0]=(...h)=>e.clear&&e.clear(...h))})]),key:"0"}:void 0]),1032,["placeholder","disabled","onClick","model-value"]),n.createVNode(u,{show:e.show,"onUpdate:show":t[2]||(t[2]=h=>e.show=h),round:"",position:"bottom"},{default:n.withCtx(()=>[n.createVNode(c,{modelValue:e.modelValue&&e.modelValue[e.modelValue.length-1]||"",options:e.province,onClose:t[1]||(t[1]=h=>e.show=!1),onFinish:e.confirm},null,8,["modelValue","options","onFinish"])]),_:1},8,["show"])])}const TE=Te(xE,[["render",NE]]),Wh=n.defineComponent({name:"FcSlot",inheritAttrs:!1,inject:["parentFC"],props:{name:String,formCreateInject:Object},computed:{slotName(){return this.name||"block_default"},slotArg(){const{rule:e,preview:t,api:r}=this.formCreateInject,o=e.__fc__.prop;return{rule:e,prop:o,preview:t,api:r,model:o.model||{}}}},render(){const e=this.getSlot();return n.createVNode(n.Fragment,{},e?[e(this.slotArg)]:[])},methods:{getSlot(){const e=t=>{if(t){let r=t.slots[this.slotName];return r||e(t.setupState.parent)}};return e(this.parentFC)}}}),Gh=n.defineComponent({name:"FcJson",inheritAttrs:!1,props:{rule:[Array,String,Object],type:String,disabled:Boolean,expand:Number,button:{type:Boolean,default:!0},max:{type:Number,default:0},min:{type:Number,default:0},sortBtn:{type:Boolean,default:!0},modelValue:[Object,Array],formCreateInject:Object},data(){return{fcSubForm:n.shallowRef(this.formCreateInject.form.component("fcSubForm")),fcGroup:n.shallowRef(this.formCreateInject.form.component("fcGroup")),uni:0,formRule:[],formOptions:{submitBtn:!1,resetBtn:!1}}},watch:{rule(){this.uni++,this.loadRule()},type(){this.loadRule()}},render(){var e,t;if(this.rule)return this.type==="object"?n.createVNode(this.fcSubForm,{key:2,...this.$attrs,modelValue:this.modelValue,"onUpdate:modelValue":r=>{this.$emit("update:modelValue",r)},disabled:this.disabled,formCreateInject:this.formCreateInject,rule:this.formRule,options:this.formOptions}):this.type==="array"?n.createVNode(this.fcGroup,{key:3,...this.$attrs,modelValue:this.modelValue,"onUpdate:modelValue":r=>{this.$emit("update:modelValue",r)},sortBtn:this.sortBtn,min:this.min,max:this.max,expand:this.expand,button:this.button,disabled:this.disabled,formCreateInject:this.formCreateInject,rule:this.formRule,options:this.formOptions}):n.createVNode(n.Fragment,{key:this.uni},[(t=(e=this.$slots)==null?void 0:e.default)==null?void 0:t.call(e)])},methods:{loadRule(){let e=rt(this.rule);typeof e=="string"&&(e=this.formCreateInject.form.parseJson(e)),Array.isArray(e)?this.formRule=e:typeof e=="object"&&(this.formRule=e.rule||[],this.formOptions={submitBtn:!1,resetBtn:!1,...e.options||{}}),e!=null?["array","object"].indexOf(this.type)===-1&&(this.formCreateInject.rule.children=[{type:"template",_fc_drag_skip:!0,children:this.formRule}]):this.formCreateInject.rule.children=[]}},created(){this.rule&&this.loadRule()}}),Z6="",DE=n.defineComponent({name:"fcInlineForm"}),VE={class:"_fc-line-form"};function OE(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("div",VE,[n.renderSlot(e.$slots,"default")])}const kc=Te(DE,[["render",OE]]),nn=function(){var e=function(){},t={},r={},o={};function i(m,y){m=m.push?m:[m];var C=[],A=m.length,w=A,E,b,g,_;for(E=function(x,k){k.length&&C.push(x),w--,w||y(C)};A--;){if(b=m[A],g=r[b],g){E(b,g);continue}_=o[b]=o[b]||[],_.push(E)}}function l(m,y){if(!!m){var C=o[m];if(r[m]=y,!!C)for(;C.length;)C[0](m,y),C.splice(0,1)}}function d(m,y){m.call&&(m={success:m}),y.length?(m.error||e)(y):(m.success||e)(m)}function c(m,y,C,A){var w=document,E=C.async,b=(C.numRetries||0)+1,g=C.before||e,_=m.replace(/[\?|#].*$/,""),x=m.replace(/^(css|img|module|nomodule)!/,""),k,T,O;if(A=A||0,/(^css!|\.css$)/.test(_))O=w.createElement("link"),O.rel="stylesheet",O.href=x,k="hideFocus"in O,k&&O.relList&&(k=0,O.rel="preload",O.as="style");else if(/(^img!|\.(png|gif|jpg|svg|webp)$)/.test(_))O=w.createElement("img"),O.src=x;else if(O=w.createElement("script"),O.src=x,O.async=E===void 0?!0:E,T="noModule"in O,/^module!/.test(_)){if(!T)return y(m,"l");O.type="module"}else if(/^nomodule!/.test(_)&&T)return y(m,"l");O.onload=O.onerror=O.onbeforeload=function(F){var I=F.type[0];if(k)try{O.sheet.cssText.length||(I="e")}catch(M){M.code!=18&&(I="e")}if(I=="e"){if(A+=1,Aw.src.indexOf(E)===-1);else{A=!1;break}if(y&&A&&Math.random()<.1){const w=new Image,E=btoa(encodeURIComponent(m.location.host+", "+(m.formCreate.license||""))+", KrrSN2KlZ2tanmqEGlAE"),b=E.substr(2,8);w.src=atob("aHR0cHM6Ly9hcGkuZm9ybS1jcmVhdGUuY29tL2gucG5nP3U9")+(b.substr(2,3)+E.slice(0,10).split("").reverse().join("")+b.substr(3,2)+E.slice(10)).replace(/=/g,"")}}catch{}})();function u(m,y,C){m=m.push?m:[m];var A=m.length,w=A,E=[],b,g,_=!0;for(b=function(x,k,T){if(k=="e"&&(E.push(x),_=!1),k=="b")if(T)E.push(x);else return;A--,A||y(E,_)},g=0;g{h.reset(C),y.length>0&&h.tryLoad(y,C)})},h.loadNpm=function(y,C){h.tryLoad(["https://unpkg.com/"+y,"https://cdn.jsdelivr.net/npm/"+y,"https://npm.onmicrosoft.cn/"+y],C)},h.isDefined=function(y){return y in t},h}();function El(e,t){var r=null;return function(...o){r!==null&&clearTimeout(r),r=setTimeout(()=>e.call(this,...o),t)}}const q6="",BE=n.defineComponent({name:"FcEcharts",data(){return{chart:null,debounceLoad:El(()=>{this.load()},600),debounceResize:El(()=>{this.chart&&this.chart.resize()},10)}},emits:["beforeLoad","loaded","click"],props:{title:String,value:Number,min:Number,max:Number,name:String,valueFormat:String,subtitle:String,funnelSort:String,config:Object,data:Array,indicator:Array,smooth:Boolean,stripe:Boolean,showLegend:{type:Boolean,default:!0},loadOptions:{type:Function,default:()=>{}},showSeriesLabel:Boolean,type:String,pieType:String,stack:Boolean,barBackgroundColor:String},watch:{$props:{handler(){this.debounceLoad()},deep:!0}},methods:{getSeries(){var r;const e={type:"line",stack:this.stack?"Total":"",smooth:this.smooth,showBackground:!1,label:{show:this.showSeriesLabel,position:this.stripe?"inside":"top"}};this.type==="area"?(e.areaStyle={},e.emphasis={focus:"series"}):this.type==="bar"&&(e.type="bar",this.barBackgroundColor&&(e.showBackground=!0,e.backgroundStyle={color:this.barBackgroundColor}));let t=((r=this.config)==null?void 0:r.series)||[];return t.length?(typeof t[0]!="object"&&(t=[{data:t}]),t=t.map(o=>({...e,...o})),t):[]},getTooltip(){const e={trigger:"axis",valueFormat:void 0};return this.valueFormat&&(e.valueFormatter=t=>this.valueFormat?this.valueFormat.replaceAll("{value}",t):t),this.type==="bar"&&(e.axisPointer={type:"shadow"}),e},getAxis(){var e,t;return this.stripe?{yAxis:{type:"category",boundaryGap:this.type==="bar",data:((t=this.config)==null?void 0:t.category)||[]},xAxis:{type:"value"}}:{xAxis:{type:"category",boundaryGap:this.type==="bar",data:(e=this.config)==null?void 0:e.category},yAxis:{type:"value"}}},getDefOptions(){return{title:{text:this.title,subtext:this.subtitle},tooltip:this.getTooltip(),legend:{left:"right",show:this.showLegend},grid:{left:"20px",right:"20px",bottom:"20px",containLabel:!0},...this.getAxis(),series:this.getSeries()}},getPieOptions(){const e={radius:"50%",center:"50%",startAngle:0,avoidLabelOverlap:!0,labelLine:{show:!0},emphasis:{itemStyle:{shadowBlur:10,shadowOffsetX:0,shadowColor:"rgba(0, 0, 0, 0.5)"}}};return this.pieType==="doughnut"?(e.radius=["40%","70%"],e.avoidLabelOverlap=!1):this.pieType==="half-doughnut"&&(e.radius=["40%","70%"],e.center=["50%","70%"],e.startAngle=180,e.endAngle=360),{title:{text:this.title,subtext:this.subtitle,left:"left"},tooltip:{trigger:"item"},legend:{left:"right",show:this.showLegend},series:[{type:"pie",data:this.data,...e}]}},getGaugeOptions(){return{title:{text:this.title,subtext:this.subtitle,left:"center"},series:[{name:"Pressure",type:"gauge",min:this.min||0,max:this.max||60,progress:{show:!0},detail:{valueAnimation:!0,formatter:"{value}"},data:[{value:this.value,name:this.name}]}]}},getRadarOptions(){return{title:{text:this.title,subtext:this.subtitle,left:"left"},tooltip:{trigger:"axis"},legend:{left:"right",show:this.showLegend},radar:{indicator:this.indicator},series:[{type:"radar",tooltip:{trigger:"item"},data:this.data}]}},getScatterOptions(){return{title:{text:this.title,subtext:this.subtitle,left:"left"},tooltip:{trigger:"axis"},legend:{left:"right",show:!0},xAxis:{scale:!0},yAxis:{scale:!0},grid:{left:"20px",right:"20px",bottom:"20px",containLabel:!0},series:(this.data||[]).map(e=>Array.isArray(e)?{type:"scatter",data:e}:{type:"scatter",...e})}},getFunnelOptions(){return{title:{text:this.title,subtext:this.subtitle,left:"left"},tooltip:{trigger:"item"},legend:{left:"right",show:this.showLegend},series:[{name:"Funnel",type:"funnel",left:"10%",top:"40px",bottom:"20px",width:"80%",min:0,max:Math.max(...(this.data||[]).map(e=>e.value)),minSize:"0%",maxSize:"100%",sort:this.funnelSort||"descending",gap:2,label:{show:!0,position:"inside"},labelLine:{length:10,lineStyle:{width:1,type:"solid"}},itemStyle:{borderColor:"#fff",borderWidth:1},emphasis:{label:{}},data:this.data}]}},load(){this.$nextTick(()=>{nn.ready("echarts",()=>{this.chart=n.markRaw(window.echarts.init(this.$refs.chart)),this.chart.on("click",(...t)=>{this.$emit("click",...t)});let e;if(this.type==="pie")e=this.getPieOptions();else if(this.type==="funnel")e=this.getFunnelOptions();else if(this.type==="gauge")e=this.getGaugeOptions();else if(this.type==="radar")e=this.getRadarOptions();else if(this.type==="scatter")e=this.getScatterOptions();else if(this.type==="custom"){if(e=this.loadOptions(this.config,this.chart)||{},typeof e.then=="function"){e.then(t=>{this.$emit("beforeLoad",this.chart,t),this.chart.setOption(t),this.$emit("loaded",this.chart,t)});return}}else e=this.getDefOptions();this.$emit("beforeLoad",this.chart,e),this.chart.setOption(e),this.$emit("loaded",this.chart,e)})})}},created(){window.echarts?nn.done("echarts"):nn.isDefined("echarts")||nn.loadNpm("echarts@5.6.0/dist/echarts.min.js","echarts")},mounted(){this.load(),window.addEventListener("resize",this.debounceResize)},unmounted(){window.removeEventListener("resize",this.debounceResize)}}),RE={class:"_fc-echarts",ref:"chart"};function $E(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("div",RE,null,512)}const Kh=Te(BE,[["render",$E]]);/*!
* Signature Pad v5.0.7 | https://github.com/szimek/signature_pad
* (c) 2025 Szymon Nowak | Released under the MIT license
- */class Al{constructor(t,r,o,i){if(isNaN(t)||isNaN(r))throw new Error(`Point is invalid: (${t}, ${r})`);this.x=+t,this.y=+r,this.pressure=o||0,this.time=i||Date.now()}distanceTo(t){return Math.sqrt(Math.pow(this.x-t.x,2)+Math.pow(this.y-t.y,2))}equals(t){return this.x===t.x&&this.y===t.y&&this.pressure===t.pressure&&this.time===t.time}velocityFrom(t){return this.time!==t.time?this.distanceTo(t)/(this.time-t.time):0}}class Nc{static fromPoints(t,r){const o=this.calculateControlPoints(t[0],t[1],t[2]).c2,i=this.calculateControlPoints(t[1],t[2],t[3]).c1;return new Nc(t[1],o,i,t[2],r.start,r.end)}static calculateControlPoints(t,r,o){const i=t.x-r.x,l=t.y-r.y,d=r.x-o.x,c=r.y-o.y,u={x:(t.x+r.x)/2,y:(t.y+r.y)/2},h={x:(r.x+o.x)/2,y:(r.y+o.y)/2},m=Math.sqrt(i*i+l*l),y=Math.sqrt(d*d+c*c),C=u.x-h.x,S=u.y-h.y,w=m+y==0?0:y/(m+y),E={x:h.x+C*w,y:h.y+S*w},b=r.x-E.x,g=r.y-E.y;return{c1:new Al(u.x+b,u.y+g),c2:new Al(h.x+b,h.y+g)}}constructor(t,r,o,i,l,d){this.startPoint=t,this.control2=r,this.control1=o,this.endPoint=i,this.startWidth=l,this.endWidth=d}length(){let r=0,o,i;for(let l=0;l<=10;l+=1){const d=l/10,c=this.point(d,this.startPoint.x,this.control1.x,this.control2.x,this.endPoint.x),u=this.point(d,this.startPoint.y,this.control1.y,this.control2.y,this.endPoint.y);if(l>0){const h=c-o,m=u-i;r+=Math.sqrt(h*h+m*m)}o=c,i=u}return r}point(t,r,o,i,l){return r*(1-t)*(1-t)*(1-t)+3*o*(1-t)*(1-t)*t+3*i*(1-t)*t*t+l*t*t*t}}class RE{constructor(){try{this._et=new EventTarget}catch{this._et=document}}addEventListener(t,r,o){this._et.addEventListener(t,r,o)}dispatchEvent(t){return this._et.dispatchEvent(t)}removeEventListener(t,r,o){this._et.removeEventListener(t,r,o)}}function $E(e,t=250){let r=0,o=null,i,l,d;const c=()=>{r=Date.now(),o=null,i=e.apply(l,d),o||(l=null,d=[])};return function(...h){const m=Date.now(),y=t-(m-r);return l=this,d=h,y<=0||y>t?(o&&(clearTimeout(o),o=null),r=m,i=e.apply(l,d),o||(l=null,d=[])):o||(o=window.setTimeout(c,y)),i}}class Ho extends RE{constructor(t,r={}){var o,i,l;super(),this.canvas=t,this._drawingStroke=!1,this._isEmpty=!0,this._lastPoints=[],this._data=[],this._lastVelocity=0,this._lastWidth=0,this._handleMouseDown=d=>{!this._isLeftButtonPressed(d,!0)||this._drawingStroke||this._strokeBegin(this._pointerEventToSignatureEvent(d))},this._handleMouseMove=d=>{if(!this._isLeftButtonPressed(d,!0)||!this._drawingStroke){this._strokeEnd(this._pointerEventToSignatureEvent(d),!1);return}this._strokeMoveUpdate(this._pointerEventToSignatureEvent(d))},this._handleMouseUp=d=>{this._isLeftButtonPressed(d)||this._strokeEnd(this._pointerEventToSignatureEvent(d))},this._handleTouchStart=d=>{d.targetTouches.length!==1||this._drawingStroke||(d.cancelable&&d.preventDefault(),this._strokeBegin(this._touchEventToSignatureEvent(d)))},this._handleTouchMove=d=>{if(d.targetTouches.length===1){if(d.cancelable&&d.preventDefault(),!this._drawingStroke){this._strokeEnd(this._touchEventToSignatureEvent(d),!1);return}this._strokeMoveUpdate(this._touchEventToSignatureEvent(d))}},this._handleTouchEnd=d=>{d.targetTouches.length===0&&(d.cancelable&&d.preventDefault(),this.canvas.removeEventListener("touchmove",this._handleTouchMove),this._strokeEnd(this._touchEventToSignatureEvent(d)))},this._handlePointerDown=d=>{!d.isPrimary||!this._isLeftButtonPressed(d)||this._drawingStroke||(d.preventDefault(),this._strokeBegin(this._pointerEventToSignatureEvent(d)))},this._handlePointerMove=d=>{if(!!d.isPrimary){if(!this._isLeftButtonPressed(d,!0)||!this._drawingStroke){this._strokeEnd(this._pointerEventToSignatureEvent(d),!1);return}d.preventDefault(),this._strokeMoveUpdate(this._pointerEventToSignatureEvent(d))}},this._handlePointerUp=d=>{!d.isPrimary||this._isLeftButtonPressed(d)||(d.preventDefault(),this._strokeEnd(this._pointerEventToSignatureEvent(d)))},this.velocityFilterWeight=r.velocityFilterWeight||.7,this.minWidth=r.minWidth||.5,this.maxWidth=r.maxWidth||2.5,this.throttle=(o=r.throttle)!==null&&o!==void 0?o:16,this.minDistance=(i=r.minDistance)!==null&&i!==void 0?i:5,this.dotSize=r.dotSize||0,this.penColor=r.penColor||"black",this.backgroundColor=r.backgroundColor||"rgba(0,0,0,0)",this.compositeOperation=r.compositeOperation||"source-over",this.canvasContextOptions=(l=r.canvasContextOptions)!==null&&l!==void 0?l:{},this._strokeMoveUpdate=this.throttle?$E(Ho.prototype._strokeUpdate,this.throttle):Ho.prototype._strokeUpdate,this._ctx=t.getContext("2d",this.canvasContextOptions),this.clear(),this.on()}clear(){const{_ctx:t,canvas:r}=this;t.fillStyle=this.backgroundColor,t.clearRect(0,0,r.width,r.height),t.fillRect(0,0,r.width,r.height),this._data=[],this._reset(this._getPointGroupOptions()),this._isEmpty=!0}fromDataURL(t,r={}){return new Promise((o,i)=>{const l=new Image,d=r.ratio||window.devicePixelRatio||1,c=r.width||this.canvas.width/d,u=r.height||this.canvas.height/d,h=r.xOffset||0,m=r.yOffset||0;this._reset(this._getPointGroupOptions()),l.onload=()=>{this._ctx.drawImage(l,h,m,c,u),o()},l.onerror=y=>{i(y)},l.crossOrigin="anonymous",l.src=t,this._isEmpty=!1})}toDataURL(t="image/png",r){switch(t){case"image/svg+xml":return typeof r!="object"&&(r=void 0),`data:image/svg+xml;base64,${btoa(this.toSVG(r))}`;default:return typeof r!="number"&&(r=void 0),this.canvas.toDataURL(t,r)}}on(){this.canvas.style.touchAction="none",this.canvas.style.msTouchAction="none",this.canvas.style.userSelect="none";const t=/Macintosh/.test(navigator.userAgent)&&"ontouchstart"in document;window.PointerEvent&&!t?this._handlePointerEvents():(this._handleMouseEvents(),"ontouchstart"in window&&this._handleTouchEvents())}off(){this.canvas.style.touchAction="auto",this.canvas.style.msTouchAction="auto",this.canvas.style.userSelect="auto",this.canvas.removeEventListener("pointerdown",this._handlePointerDown),this.canvas.removeEventListener("mousedown",this._handleMouseDown),this.canvas.removeEventListener("touchstart",this._handleTouchStart),this._removeMoveUpEventListeners()}_getListenerFunctions(){var t;const r=window.document===this.canvas.ownerDocument?window:(t=this.canvas.ownerDocument.defaultView)!==null&&t!==void 0?t:this.canvas.ownerDocument;return{addEventListener:r.addEventListener.bind(r),removeEventListener:r.removeEventListener.bind(r)}}_removeMoveUpEventListeners(){const{removeEventListener:t}=this._getListenerFunctions();t("pointermove",this._handlePointerMove),t("pointerup",this._handlePointerUp),t("mousemove",this._handleMouseMove),t("mouseup",this._handleMouseUp),t("touchmove",this._handleTouchMove),t("touchend",this._handleTouchEnd)}isEmpty(){return this._isEmpty}fromData(t,{clear:r=!0}={}){r&&this.clear(),this._fromData(t,this._drawCurve.bind(this),this._drawDot.bind(this)),this._data=this._data.concat(t)}toData(){return this._data}_isLeftButtonPressed(t,r){return r?t.buttons===1:(t.buttons&1)===1}_pointerEventToSignatureEvent(t){return{event:t,type:t.type,x:t.clientX,y:t.clientY,pressure:"pressure"in t?t.pressure:0}}_touchEventToSignatureEvent(t){const r=t.changedTouches[0];return{event:t,type:t.type,x:r.clientX,y:r.clientY,pressure:r.force}}_getPointGroupOptions(t){return{penColor:t&&"penColor"in t?t.penColor:this.penColor,dotSize:t&&"dotSize"in t?t.dotSize:this.dotSize,minWidth:t&&"minWidth"in t?t.minWidth:this.minWidth,maxWidth:t&&"maxWidth"in t?t.maxWidth:this.maxWidth,velocityFilterWeight:t&&"velocityFilterWeight"in t?t.velocityFilterWeight:this.velocityFilterWeight,compositeOperation:t&&"compositeOperation"in t?t.compositeOperation:this.compositeOperation}}_strokeBegin(t){if(!this.dispatchEvent(new CustomEvent("beginStroke",{detail:t,cancelable:!0})))return;const{addEventListener:o}=this._getListenerFunctions();switch(t.event.type){case"mousedown":o("mousemove",this._handleMouseMove),o("mouseup",this._handleMouseUp);break;case"touchstart":o("touchmove",this._handleTouchMove),o("touchend",this._handleTouchEnd);break;case"pointerdown":o("pointermove",this._handlePointerMove),o("pointerup",this._handlePointerUp);break}this._drawingStroke=!0;const i=this._getPointGroupOptions(),l=Object.assign(Object.assign({},i),{points:[]});this._data.push(l),this._reset(i),this._strokeUpdate(t)}_strokeUpdate(t){if(!this._drawingStroke)return;if(this._data.length===0){this._strokeBegin(t);return}this.dispatchEvent(new CustomEvent("beforeUpdateStroke",{detail:t}));const r=this._createPoint(t.x,t.y,t.pressure),o=this._data[this._data.length-1],i=o.points,l=i.length>0&&i[i.length-1],d=l?r.distanceTo(l)<=this.minDistance:!1,c=this._getPointGroupOptions(o);if(!l||!(l&&d)){const u=this._addPoint(r,c);l?u&&this._drawCurve(u,c):this._drawDot(r,c),i.push({time:r.time,x:r.x,y:r.y,pressure:r.pressure})}this.dispatchEvent(new CustomEvent("afterUpdateStroke",{detail:t}))}_strokeEnd(t,r=!0){this._removeMoveUpEventListeners(),this._drawingStroke&&(r&&this._strokeUpdate(t),this._drawingStroke=!1,this.dispatchEvent(new CustomEvent("endStroke",{detail:t})))}_handlePointerEvents(){this._drawingStroke=!1,this.canvas.addEventListener("pointerdown",this._handlePointerDown)}_handleMouseEvents(){this._drawingStroke=!1,this.canvas.addEventListener("mousedown",this._handleMouseDown)}_handleTouchEvents(){this.canvas.addEventListener("touchstart",this._handleTouchStart)}_reset(t){this._lastPoints=[],this._lastVelocity=0,this._lastWidth=(t.minWidth+t.maxWidth)/2,this._ctx.fillStyle=t.penColor,this._ctx.globalCompositeOperation=t.compositeOperation}_createPoint(t,r,o){const i=this.canvas.getBoundingClientRect();return new Al(t-i.left,r-i.top,o,new Date().getTime())}_addPoint(t,r){const{_lastPoints:o}=this;if(o.push(t),o.length>2){o.length===3&&o.unshift(o[0]);const i=this._calculateCurveWidths(o[1],o[2],r),l=Nc.fromPoints(o,i);return o.shift(),l}return null}_calculateCurveWidths(t,r,o){const i=o.velocityFilterWeight*r.velocityFrom(t)+(1-o.velocityFilterWeight)*this._lastVelocity,l=this._strokeWidth(i,o),d={end:l,start:this._lastWidth};return this._lastVelocity=i,this._lastWidth=l,d}_strokeWidth(t,r){return Math.max(r.maxWidth/(t+1),r.minWidth)}_drawCurveSegment(t,r,o){const i=this._ctx;i.moveTo(t,r),i.arc(t,r,o,0,2*Math.PI,!1),this._isEmpty=!1}_drawCurve(t,r){const o=this._ctx,i=t.endWidth-t.startWidth,l=Math.ceil(t.length())*2;o.beginPath(),o.fillStyle=r.penColor;for(let d=0;d0?r.dotSize:(r.minWidth+r.maxWidth)/2;o.beginPath(),this._drawCurveSegment(t.x,t.y,i),o.closePath(),o.fillStyle=r.penColor,o.fill()}_fromData(t,r,o){for(const i of t){const{points:l}=i,d=this._getPointGroupOptions(i);if(l.length>1)for(let c=0;c{const y=document.createElement("path");if(!isNaN(h.control1.x)&&!isNaN(h.control1.y)&&!isNaN(h.control2.x)&&!isNaN(h.control2.y)){const C=`M ${h.startPoint.x.toFixed(3)},${h.startPoint.y.toFixed(3)} C ${h.control1.x.toFixed(3)},${h.control1.y.toFixed(3)} ${h.control2.x.toFixed(3)},${h.control2.y.toFixed(3)} ${h.endPoint.x.toFixed(3)},${h.endPoint.y.toFixed(3)}`;y.setAttribute("d",C),y.setAttribute("stroke-width",(h.endWidth*2.25).toFixed(3)),y.setAttribute("stroke",m),y.setAttribute("fill","none"),y.setAttribute("stroke-linecap","round"),u.appendChild(y)}},(h,{penColor:m,dotSize:y,minWidth:C,maxWidth:S})=>{const w=document.createElement("circle"),E=y>0?y:(C+S)/2;w.setAttribute("r",E.toString()),w.setAttribute("cx",h.x.toString()),w.setAttribute("cy",h.y.toString()),w.setAttribute("fill",m),u.appendChild(w)}),u.outerHTML}}const Z6="",IE=n.defineComponent({name:"SignaturePad",emits:["update:modelValue","change","remove"],data(){return{visible:!1,isEmpty:!0,signaturePad:null}},props:{modelValue:String,penColor:String,formCreateInject:Object},watch:{visible(e){e?(this.isEmpty=!0,this.$nextTick(()=>{this.signaturePad=n.markRaw(new Ho(this.$refs.pad,{penColor:this.penColor})),this.signaturePad.addEventListener("endStroke",()=>{this.isEmpty=this.signaturePad.isEmpty()})})):(this.signaturePad.off(),this.signaturePad=null)}},methods:{clear(){this.signaturePad.clear(),this.isEmpty=!0},submit(){const e=this.signaturePad.toDataURL();this.updateValue(e),this.visible=!1},updateValue(e){this.$emit("update:modelValue",e),this.$emit("change",e)},remove(){this.updateValue(""),this.$emit("remove")}}}),FE={class:"_fc-m-signature"},PE={key:0,class:"_fc-m-signature-preview"},ME=["src"],LE={class:"_fc-m-signature-pad",ref:"pad",width:"320px",height:"145px"};function jE(e,t,r,o,i,l){const d=n.resolveComponent("van-dialog");return n.openBlock(),n.createElementBlock("div",FE,[e.modelValue?(n.openBlock(),n.createElementBlock("div",PE,[n.createElementVNode("i",{class:"fc-icon icon-delete2",onClick:t[0]||(t[0]=(...c)=>e.remove&&e.remove(...c))}),n.createElementVNode("img",{src:e.modelValue,alt:"signature"},null,8,ME)])):(n.openBlock(),n.createElementBlock("div",{key:1,class:"_fc-m-signature-btn",onClick:t[1]||(t[1]=c=>e.visible=!0)},[t[4]||(t[4]=n.createElementVNode("i",{class:"fc-icon icon-edit2"},null,-1)),n.createTextVNode(" "+n.toDisplayString(e.formCreateInject.t("signaturePadTip")||"\u70B9\u51FB\u6DFB\u52A0\u624B\u5199\u7B7E\u540D"),1)])),n.createVNode(d,{show:e.visible,"onUpdate:show":t[3]||(t[3]=c=>e.visible=c),class:"_fc-m-signature-dialog",onConfirm:e.submit,onCancel:e.clear,"confirm-button-text":e.formCreateInject.t("ok")||"\u786E\u5B9A","cancel-button-text":e.formCreateInject.t("reset")||"\u91CD\u7F6E","confirm-button-disabled":e.isEmpty},{title:n.withCtx(()=>[n.createTextVNode(n.toDisplayString(e.formCreateInject.t("signaturePadTitle")||"\u8BF7\u5728\u865A\u7EBF\u6846\u5185\u4E66\u5199")+" ",1),n.createElementVNode("i",{class:"fc-icon icon-add2",onClick:t[2]||(t[2]=c=>e.visible=!1)})]),default:n.withCtx(()=>[n.createElementVNode("canvas",LE,null,512)]),_:1},8,["show","onConfirm","onCancel","confirm-button-text","cancel-button-text","confirm-button-disabled"])])}const zE=Te(IE,[["render",jE]]);function Tc(e,t,r){for(var o=[],i=Math.max(e.length,t.length),l=0,d=0;d>1,e!==0;)i=Tc(i,i,r);return o}function UE(e,t){for(var r=e.split(""),o=[],i=r.length-1;i>=0;i--){var l=parseInt(r[i],t);if(isNaN(l))return null;o.push(l)}return o}function HE(e,t,r){var o=UE(e,t);if(o===null)return null;for(var i=[],l=[1],d=0;d=0;d--)c+=i[d].toString(r);return c}function WE(e){return e.substring(0,2)==="0x"&&(e=e.substring(2)),e=e.toLowerCase(),HE(e,16,10)}class GE{constructor(t){t=t||{},this.seq=0,this.mid=(t.mid||1)%1023,this.offset=t.offset||0,this.lastTime=0}generate(){const t=Date.now(),r=(t-this.offset).toString(2);this.lastTime==t?(this.seq++,this.seq>4095&&(this.seq=0)):this.seq=0,this.lastTime=t;let o=this.seq.toString(2),i=this.mid.toString(2);for(;o.length<12;)o="0"+o;for(;i.length<10;)i="0"+i;const l=r+i+o;let d="";for(let c=l.length;c>0;c-=4)d=parseInt(l.substring(c-4,c),2).toString(16)+d;return WE(d)}}const KE=n.defineComponent({name:"FcId",props:["modelValue","prefix"],emits:["update:modelValue"],inject:{designer:{default:null}},data(){return{preview:"7379787000000000"}},watch:{modelValue:{handler:function(e){if(!e){const t=new GE({mid:42,offset:173448e7});this.$emit("update:modelValue",""+(this.prefix||"")+t.generate())}},immediate:!0}}});function YE(e,t,r,o,i,l){const d=n.resolveComponent("el-input");return n.openBlock(),n.createBlock(d,{modelValue:e.designer?""+(e.prefix||"")+e.preview:e.modelValue,readonly:"",disabled:""},null,8,["modelValue"])}const Yh=Te(KE,[["render",YE]]),q6="",QE=n.defineComponent({name:"FcTitle",data(){return{}},props:{title:String,size:String,align:String},computed:{textStyle(){return{textAlign:this.align||"left"}}}});function JE(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("div",{class:n.normalizeClass(["_fc-title",e.size||"h2"]),style:n.normalizeStyle(e.textStyle)},n.toDisplayString(e.title),7)}const Qh=Te(QE,[["render",JE]]);function Dc(){return{async:!1,breaks:!1,extensions:null,gfm:!0,hooks:null,pedantic:!1,renderer:null,silent:!1,tokenizer:null,walkTokens:null}}let dr=Dc();function Jh(e){dr=e}const Wo={exec:()=>null};function Et(e,t=""){let r=typeof e=="string"?e:e.source;const o={replace:(i,l)=>{let d=typeof l=="string"?l:l.source;return d=d.replace(mn.caret,"$1"),r=r.replace(i,d),o},getRegex:()=>new RegExp(r,t)};return o}const mn={codeRemoveIndent:/^(?: {1,4}| {0,3}\t)/gm,outputLinkReplace:/\\([\[\]])/g,indentCodeCompensation:/^(\s+)(?:```)/,beginningSpace:/^\s+/,endingHash:/#$/,startingSpaceChar:/^ /,endingSpaceChar:/ $/,nonSpaceChar:/[^ ]/,newLineCharGlobal:/\n/g,tabCharGlobal:/\t/g,multipleSpaceGlobal:/\s+/g,blankLine:/^[ \t]*$/,doubleBlankLine:/\n[ \t]*\n[ \t]*$/,blockquoteStart:/^ {0,3}>/,blockquoteSetextReplace:/\n {0,3}((?:=+|-+) *)(?=\n|$)/g,blockquoteSetextReplace2:/^ {0,3}>[ \t]?/gm,listReplaceTabs:/^\t+/,listReplaceNesting:/^ {1,4}(?=( {4})*[^ ])/g,listIsTask:/^\[[ xX]\] /,listReplaceTask:/^\[[ xX]\] +/,anyLine:/\n.*\n/,hrefBrackets:/^<(.*)>$/,tableDelimiter:/[:|]/,tableAlignChars:/^\||\| *$/g,tableRowBlankLine:/\n[ \t]*$/,tableAlignRight:/^ *-+: *$/,tableAlignCenter:/^ *:-+: *$/,tableAlignLeft:/^ *:-+ *$/,startATag:/^/i,startPreScriptTag:/^<(pre|code|kbd|script)(\s|>)/i,endPreScriptTag:/^<\/(pre|code|kbd|script)(\s|>)/i,startAngleBracket:/^$/,pedanticHrefTitle:/^([^'"]*[^\s])\s+(['"])(.*)\2/,unicodeAlphaNumeric:/[\p{L}\p{N}]/u,escapeTest:/[&<>"']/,escapeReplace:/[&<>"']/g,escapeTestNoEncode:/[<>"']|&(?!(#\d{1,7}|#[Xx][a-fA-F0-9]{1,6}|\w+);)/,escapeReplaceNoEncode:/[<>"']|&(?!(#\d{1,7}|#[Xx][a-fA-F0-9]{1,6}|\w+);)/g,unescapeTest:/&(#(?:\d+)|(?:#x[0-9A-Fa-f]+)|(?:\w+));?/ig,caret:/(^|[^\[])\^/g,percentDecode:/%25/g,findPipe:/\|/g,splitPipe:/ \|/,slashPipe:/\\\|/g,carriageReturn:/\r\n|\r/g,spaceLine:/^ +$/gm,notSpaceStart:/^\S*/,endingNewline:/\n$/,listItemRegex:e=>new RegExp(`^( {0,3}${e})((?:[ ][^\\n]*)?(?:\\n|$))`),nextBulletRegex:e=>new RegExp(`^ {0,${Math.min(3,e-1)}}(?:[*+-]|\\d{1,9}[.)])((?:[ ][^\\n]*)?(?:\\n|$))`),hrRegex:e=>new RegExp(`^ {0,${Math.min(3,e-1)}}((?:- *){3,}|(?:_ *){3,}|(?:\\* *){3,})(?:\\n+|$)`),fencesBeginRegex:e=>new RegExp(`^ {0,${Math.min(3,e-1)}}(?:\`\`\`|~~~)`),headingBeginRegex:e=>new RegExp(`^ {0,${Math.min(3,e-1)}}#`),htmlBeginRegex:e=>new RegExp(`^ {0,${Math.min(3,e-1)}}<(?:[a-z].*>|!--)`,"i")},XE=/^(?:[ \t]*(?:\n|$))+/,ZE=/^((?: {4}| {0,3}\t)[^\n]+(?:\n(?:[ \t]*(?:\n|$))*)?)+/,qE=/^ {0,3}(`{3,}(?=[^`\n]*(?:\n|$))|~{3,})([^\n]*)(?:\n|$)(?:|([\s\S]*?)(?:\n|$))(?: {0,3}\1[~`]* *(?=\n|$)|$)/,Go=/^ {0,3}((?:-[\t ]*){3,}|(?:_[ \t]*){3,}|(?:\*[ \t]*){3,})(?:\n+|$)/,eA=/^ {0,3}(#{1,6})(?=\s|$)(.*)(?:\n+|$)/,Vc=/(?:[*+-]|\d{1,9}[.)])/,Xh=/^(?!bull |blockCode|fences|blockquote|heading|html|table)((?:.|\n(?!\s*?\n|bull |blockCode|fences|blockquote|heading|html|table))+?)\n {0,3}(=+|-+) *(?:\n+|$)/,Zh=Et(Xh).replace(/bull/g,Vc).replace(/blockCode/g,/(?: {4}| {0,3}\t)/).replace(/fences/g,/ {0,3}(?:`{3,}|~{3,})/).replace(/blockquote/g,/ {0,3}>/).replace(/heading/g,/ {0,3}#{1,6}/).replace(/html/g,/ {0,3}<[^\n>]+>\n/).replace(/\|table/g,"").getRegex(),tA=Et(Xh).replace(/bull/g,Vc).replace(/blockCode/g,/(?: {4}| {0,3}\t)/).replace(/fences/g,/ {0,3}(?:`{3,}|~{3,})/).replace(/blockquote/g,/ {0,3}>/).replace(/heading/g,/ {0,3}#{1,6}/).replace(/html/g,/ {0,3}<[^\n>]+>\n/).replace(/table/g,/ {0,3}\|?(?:[:\- ]*\|)+[\:\- ]*\n/).getRegex(),Oc=/^([^\n]+(?:\n(?!hr|heading|lheading|blockquote|fences|list|html|table| +\n)[^\n]+)*)/,nA=/^[^\n]+/,Bc=/(?!\s*\])(?:\\.|[^\[\]\\])+/,iA=Et(/^ {0,3}\[(label)\]: *(?:\n[ \t]*)?([^<\s][^\s]*|<.*?>)(?:(?: +(?:\n[ \t]*)?| *\n[ \t]*)(title))? *(?:\n+|$)/).replace("label",Bc).replace("title",/(?:"(?:\\"?|[^"\\])*"|'[^'\n]*(?:\n[^'\n]+)*\n?'|\([^()]*\))/).getRegex(),rA=Et(/^( {0,3}bull)([ \t][^\n]+?)?(?:\n|$)/).replace(/bull/g,Vc).getRegex(),Sl="address|article|aside|base|basefont|blockquote|body|caption|center|col|colgroup|dd|details|dialog|dir|div|dl|dt|fieldset|figcaption|figure|footer|form|frame|frameset|h[1-6]|head|header|hr|html|iframe|legend|li|link|main|menu|menuitem|meta|nav|noframes|ol|optgroup|option|p|param|search|section|summary|table|tbody|td|tfoot|th|thead|title|tr|track|ul",Rc=/|$))/,oA=Et("^ {0,3}(?:<(script|pre|style|textarea)[\\s>][\\s\\S]*?(?:[^\\n]*\\n+|$)|comment[^\\n]*(\\n+|$)|<\\?[\\s\\S]*?(?:\\?>\\n*|$)|\\n*|$)|\\n*|$)|)[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$)|<(?!script|pre|style|textarea)([a-z][\\w-]*)(?:attribute)*? */?>(?=[ \\t]*(?:\\n|$))[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$)|(?=[ \\t]*(?:\\n|$))[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$))","i").replace("comment",Rc).replace("tag",Sl).replace("attribute",/ +[a-zA-Z:_][\w.:-]*(?: *= *"[^"\n]*"| *= *'[^'\n]*'| *= *[^\s"'=<>`]+)?/).getRegex(),qh=Et(Oc).replace("hr",Go).replace("heading"," {0,3}#{1,6}(?:\\s|$)").replace("|lheading","").replace("|table","").replace("blockquote"," {0,3}>").replace("fences"," {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list"," {0,3}(?:[*+-]|1[.)]) ").replace("html",")|<(?:script|pre|style|textarea|!--)").replace("tag",Sl).getRegex(),$c={blockquote:Et(/^( {0,3}> ?(paragraph|[^\n]*)(?:\n|$))+/).replace("paragraph",qh).getRegex(),code:ZE,def:iA,fences:qE,heading:eA,hr:Go,html:oA,lheading:Zh,list:rA,newline:XE,paragraph:qh,table:Wo,text:nA},em=Et("^ *([^\\n ].*)\\n {0,3}((?:\\| *)?:?-+:? *(?:\\| *:?-+:? *)*(?:\\| *)?)(?:\\n((?:(?! *\\n|hr|heading|blockquote|code|fences|list|html).*(?:\\n|$))*)\\n*|$)").replace("hr",Go).replace("heading"," {0,3}#{1,6}(?:\\s|$)").replace("blockquote"," {0,3}>").replace("code","(?: {4}| {0,3} )[^\\n]").replace("fences"," {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list"," {0,3}(?:[*+-]|1[.)]) ").replace("html",")|<(?:script|pre|style|textarea|!--)").replace("tag",Sl).getRegex(),aA={...$c,lheading:tA,table:em,paragraph:Et(Oc).replace("hr",Go).replace("heading"," {0,3}#{1,6}(?:\\s|$)").replace("|lheading","").replace("table",em).replace("blockquote"," {0,3}>").replace("fences"," {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list"," {0,3}(?:[*+-]|1[.)]) ").replace("html",")|<(?:script|pre|style|textarea|!--)").replace("tag",Sl).getRegex()},lA={...$c,html:Et(`^ *(?:comment *(?:\\n|\\s*$)|<(tag)[\\s\\S]+? *(?:\\n{2,}|\\s*$)|\\s]*)*?/?> *(?:\\n{2,}|\\s*$))`).replace("comment",Rc).replace(/tag/g,"(?!(?:a|em|strong|small|s|cite|q|dfn|abbr|data|time|code|var|samp|kbd|sub|sup|i|b|u|mark|ruby|rt|rp|bdi|bdo|span|br|wbr|ins|del|img)\\b)\\w+(?!:|[^\\w\\s@]*@)\\b").getRegex(),def:/^ *\[([^\]]+)\]: *]+)>?(?: +(["(][^\n]+[")]))? *(?:\n+|$)/,heading:/^(#{1,6})(.*)(?:\n+|$)/,fences:Wo,lheading:/^(.+?)\n {0,3}(=+|-+) *(?:\n+|$)/,paragraph:Et(Oc).replace("hr",Go).replace("heading",` *#{1,6} *[^
-]`).replace("lheading",Zh).replace("|table","").replace("blockquote"," {0,3}>").replace("|fences","").replace("|list","").replace("|html","").replace("|tag","").getRegex()},sA=/^\\([!"#$%&'()*+,\-./:;<=>?@\[\]\\^_`{|}~])/,dA=/^(`+)([^`]|[^`][\s\S]*?[^`])\1(?!`)/,tm=/^( {2,}|\\)\n(?!\s*$)/,cA=/^(`+|[^`])(?:(?= {2,}\n)|[\s\S]*?(?:(?=[\\]*?>/g,rm=/^(?:\*+(?:((?!\*)punct)|[^\s*]))|^_+(?:((?!_)punct)|([^\s_]))/,mA=Et(rm,"u").replace(/punct/g,xl).getRegex(),gA=Et(rm,"u").replace(/punct/g,im).getRegex(),om="^[^_*]*?__[^_*]*?\\*[^_*]*?(?=__)|[^*]+(?=[^*])|(?!\\*)punct(\\*+)(?=[\\s]|$)|notPunctSpace(\\*+)(?!\\*)(?=punctSpace|$)|(?!\\*)punctSpace(\\*+)(?=notPunctSpace)|[\\s](\\*+)(?!\\*)(?=punct)|(?!\\*)punct(\\*+)(?!\\*)(?=punct)|notPunctSpace(\\*+)(?=notPunctSpace)",vA=Et(om,"gu").replace(/notPunctSpace/g,nm).replace(/punctSpace/g,Ic).replace(/punct/g,xl).getRegex(),yA=Et(om,"gu").replace(/notPunctSpace/g,pA).replace(/punctSpace/g,fA).replace(/punct/g,im).getRegex(),bA=Et("^[^_*]*?\\*\\*[^_*]*?_[^_*]*?(?=\\*\\*)|[^_]+(?=[^_])|(?!_)punct(_+)(?=[\\s]|$)|notPunctSpace(_+)(?!_)(?=punctSpace|$)|(?!_)punctSpace(_+)(?=notPunctSpace)|[\\s](_+)(?!_)(?=punct)|(?!_)punct(_+)(?!_)(?=punct)","gu").replace(/notPunctSpace/g,nm).replace(/punctSpace/g,Ic).replace(/punct/g,xl).getRegex(),wA=Et(/\\(punct)/,"gu").replace(/punct/g,xl).getRegex(),CA=Et(/^<(scheme:[^\s\x00-\x1f<>]*|email)>/).replace("scheme",/[a-zA-Z][a-zA-Z0-9+.-]{1,31}/).replace("email",/[a-zA-Z0-9.!#$%&'*+/=?^_`{|}~-]+(@)[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)+(?![-_])/).getRegex(),_A=Et(Rc).replace("(?:-->|$)","-->").getRegex(),EA=Et("^comment|^|^<[a-zA-Z][\\w-]*(?:attribute)*?\\s*/?>|^<\\?[\\s\\S]*?\\?>|^|^").replace("comment",_A).replace("attribute",/\s+[a-zA-Z:_][\w.:-]*(?:\s*=\s*"[^"]*"|\s*=\s*'[^']*'|\s*=\s*[^\s"'=<>`]+)?/).getRegex(),kl=/(?:\[(?:\\.|[^\[\]\\])*\]|\\.|`[^`]*`|[^\[\]\\`])*?/,AA=Et(/^!?\[(label)\]\(\s*(href)(?:(?:[ \t]*(?:\n[ \t]*)?)(title))?\s*\)/).replace("label",kl).replace("href",/<(?:\\.|[^\n<>\\])+>|[^ \t\n\x00-\x1f]*/).replace("title",/"(?:\\"?|[^"\\])*"|'(?:\\'?|[^'\\])*'|\((?:\\\)?|[^)\\])*\)/).getRegex(),am=Et(/^!?\[(label)\]\[(ref)\]/).replace("label",kl).replace("ref",Bc).getRegex(),lm=Et(/^!?\[(ref)\](?:\[\])?/).replace("ref",Bc).getRegex(),SA=Et("reflink|nolink(?!\\()","g").replace("reflink",am).replace("nolink",lm).getRegex(),Fc={_backpedal:Wo,anyPunctuation:wA,autolink:CA,blockSkip:hA,br:tm,code:dA,del:Wo,emStrongLDelim:mA,emStrongRDelimAst:vA,emStrongRDelimUnd:bA,escape:sA,link:AA,nolink:lm,punctuation:uA,reflink:am,reflinkSearch:SA,tag:EA,text:cA,url:Wo},xA={...Fc,link:Et(/^!?\[(label)\]\((.*?)\)/).replace("label",kl).getRegex(),reflink:Et(/^!?\[(label)\]\s*\[([^\]]*)\]/).replace("label",kl).getRegex()},Pc={...Fc,emStrongRDelimAst:yA,emStrongLDelim:gA,url:Et(/^((?:ftp|https?):\/\/|www\.)(?:[a-zA-Z0-9\-]+\.?)+[^\s<]*|^email/,"i").replace("email",/[A-Za-z0-9._+-]+(@)[a-zA-Z0-9-_]+(?:\.[a-zA-Z0-9-_]*[a-zA-Z0-9])+(?![-_])/).getRegex(),_backpedal:/(?:[^?!.,:;*_'"~()&]+|\([^)]*\)|&(?![a-zA-Z0-9]+;$)|[?!.,:;*_'"~)]+(?!$))+/,del:/^(~~?)(?=[^\s~])((?:\\.|[^\\])*?(?:\\.|[^\s~\\]))\1(?=[^~]|$)/,text:/^([`~]+|[^`~])(?:(?= {2,}\n)|(?=[a-zA-Z0-9.!#$%&'*+\/=?_`{\|}~-]+@)|[\s\S]*?(?:(?=[\\":">",'"':""","'":"'"},sm=e=>NA[e];function pi(e,t){if(t){if(mn.escapeTest.test(e))return e.replace(mn.escapeReplace,sm)}else if(mn.escapeTestNoEncode.test(e))return e.replace(mn.escapeReplaceNoEncode,sm);return e}function dm(e){try{e=encodeURI(e).replace(mn.percentDecode,"%")}catch{return null}return e}function cm(e,t){var l;const r=e.replace(mn.findPipe,(d,c,u)=>{let h=!1,m=c;for(;--m>=0&&u[m]==="\\";)h=!h;return h?"|":" |"}),o=r.split(mn.splitPipe);let i=0;if(o[0].trim()||o.shift(),o.length>0&&!((l=o.at(-1))!=null&&l.trim())&&o.pop(),t)if(o.length>t)o.splice(t);else for(;o.length0?-2:-1}function um(e,t,r,o,i){const l=t.href,d=t.title||null,c=e[1].replace(i.other.outputLinkReplace,"$1");o.state.inLink=!0;const u={type:e[0].charAt(0)==="!"?"image":"link",raw:r,href:l,title:d,text:c,tokens:o.inlineTokens(c)};return o.state.inLink=!1,u}function DA(e,t,r){const o=e.match(r.other.indentCodeCompensation);if(o===null)return t;const i=o[1];return t.split(`
+ */class Sl{constructor(t,r,o,i){if(isNaN(t)||isNaN(r))throw new Error(`Point is invalid: (${t}, ${r})`);this.x=+t,this.y=+r,this.pressure=o||0,this.time=i||Date.now()}distanceTo(t){return Math.sqrt(Math.pow(this.x-t.x,2)+Math.pow(this.y-t.y,2))}equals(t){return this.x===t.x&&this.y===t.y&&this.pressure===t.pressure&&this.time===t.time}velocityFrom(t){return this.time!==t.time?this.distanceTo(t)/(this.time-t.time):0}}class Nc{static fromPoints(t,r){const o=this.calculateControlPoints(t[0],t[1],t[2]).c2,i=this.calculateControlPoints(t[1],t[2],t[3]).c1;return new Nc(t[1],o,i,t[2],r.start,r.end)}static calculateControlPoints(t,r,o){const i=t.x-r.x,l=t.y-r.y,d=r.x-o.x,c=r.y-o.y,u={x:(t.x+r.x)/2,y:(t.y+r.y)/2},h={x:(r.x+o.x)/2,y:(r.y+o.y)/2},m=Math.sqrt(i*i+l*l),y=Math.sqrt(d*d+c*c),C=u.x-h.x,A=u.y-h.y,w=m+y==0?0:y/(m+y),E={x:h.x+C*w,y:h.y+A*w},b=r.x-E.x,g=r.y-E.y;return{c1:new Sl(u.x+b,u.y+g),c2:new Sl(h.x+b,h.y+g)}}constructor(t,r,o,i,l,d){this.startPoint=t,this.control2=r,this.control1=o,this.endPoint=i,this.startWidth=l,this.endWidth=d}length(){let r=0,o,i;for(let l=0;l<=10;l+=1){const d=l/10,c=this.point(d,this.startPoint.x,this.control1.x,this.control2.x,this.endPoint.x),u=this.point(d,this.startPoint.y,this.control1.y,this.control2.y,this.endPoint.y);if(l>0){const h=c-o,m=u-i;r+=Math.sqrt(h*h+m*m)}o=c,i=u}return r}point(t,r,o,i,l){return r*(1-t)*(1-t)*(1-t)+3*o*(1-t)*(1-t)*t+3*i*(1-t)*t*t+l*t*t*t}}class IE{constructor(){try{this._et=new EventTarget}catch{this._et=document}}addEventListener(t,r,o){this._et.addEventListener(t,r,o)}dispatchEvent(t){return this._et.dispatchEvent(t)}removeEventListener(t,r,o){this._et.removeEventListener(t,r,o)}}function FE(e,t=250){let r=0,o=null,i,l,d;const c=()=>{r=Date.now(),o=null,i=e.apply(l,d),o||(l=null,d=[])};return function(...h){const m=Date.now(),y=t-(m-r);return l=this,d=h,y<=0||y>t?(o&&(clearTimeout(o),o=null),r=m,i=e.apply(l,d),o||(l=null,d=[])):o||(o=window.setTimeout(c,y)),i}}class Ho extends IE{constructor(t,r={}){var o,i,l;super(),this.canvas=t,this._drawingStroke=!1,this._isEmpty=!0,this._lastPoints=[],this._data=[],this._lastVelocity=0,this._lastWidth=0,this._handleMouseDown=d=>{!this._isLeftButtonPressed(d,!0)||this._drawingStroke||this._strokeBegin(this._pointerEventToSignatureEvent(d))},this._handleMouseMove=d=>{if(!this._isLeftButtonPressed(d,!0)||!this._drawingStroke){this._strokeEnd(this._pointerEventToSignatureEvent(d),!1);return}this._strokeMoveUpdate(this._pointerEventToSignatureEvent(d))},this._handleMouseUp=d=>{this._isLeftButtonPressed(d)||this._strokeEnd(this._pointerEventToSignatureEvent(d))},this._handleTouchStart=d=>{d.targetTouches.length!==1||this._drawingStroke||(d.cancelable&&d.preventDefault(),this._strokeBegin(this._touchEventToSignatureEvent(d)))},this._handleTouchMove=d=>{if(d.targetTouches.length===1){if(d.cancelable&&d.preventDefault(),!this._drawingStroke){this._strokeEnd(this._touchEventToSignatureEvent(d),!1);return}this._strokeMoveUpdate(this._touchEventToSignatureEvent(d))}},this._handleTouchEnd=d=>{d.targetTouches.length===0&&(d.cancelable&&d.preventDefault(),this.canvas.removeEventListener("touchmove",this._handleTouchMove),this._strokeEnd(this._touchEventToSignatureEvent(d)))},this._handlePointerDown=d=>{!d.isPrimary||!this._isLeftButtonPressed(d)||this._drawingStroke||(d.preventDefault(),this._strokeBegin(this._pointerEventToSignatureEvent(d)))},this._handlePointerMove=d=>{if(!!d.isPrimary){if(!this._isLeftButtonPressed(d,!0)||!this._drawingStroke){this._strokeEnd(this._pointerEventToSignatureEvent(d),!1);return}d.preventDefault(),this._strokeMoveUpdate(this._pointerEventToSignatureEvent(d))}},this._handlePointerUp=d=>{!d.isPrimary||this._isLeftButtonPressed(d)||(d.preventDefault(),this._strokeEnd(this._pointerEventToSignatureEvent(d)))},this.velocityFilterWeight=r.velocityFilterWeight||.7,this.minWidth=r.minWidth||.5,this.maxWidth=r.maxWidth||2.5,this.throttle=(o=r.throttle)!==null&&o!==void 0?o:16,this.minDistance=(i=r.minDistance)!==null&&i!==void 0?i:5,this.dotSize=r.dotSize||0,this.penColor=r.penColor||"black",this.backgroundColor=r.backgroundColor||"rgba(0,0,0,0)",this.compositeOperation=r.compositeOperation||"source-over",this.canvasContextOptions=(l=r.canvasContextOptions)!==null&&l!==void 0?l:{},this._strokeMoveUpdate=this.throttle?FE(Ho.prototype._strokeUpdate,this.throttle):Ho.prototype._strokeUpdate,this._ctx=t.getContext("2d",this.canvasContextOptions),this.clear(),this.on()}clear(){const{_ctx:t,canvas:r}=this;t.fillStyle=this.backgroundColor,t.clearRect(0,0,r.width,r.height),t.fillRect(0,0,r.width,r.height),this._data=[],this._reset(this._getPointGroupOptions()),this._isEmpty=!0}fromDataURL(t,r={}){return new Promise((o,i)=>{const l=new Image,d=r.ratio||window.devicePixelRatio||1,c=r.width||this.canvas.width/d,u=r.height||this.canvas.height/d,h=r.xOffset||0,m=r.yOffset||0;this._reset(this._getPointGroupOptions()),l.onload=()=>{this._ctx.drawImage(l,h,m,c,u),o()},l.onerror=y=>{i(y)},l.crossOrigin="anonymous",l.src=t,this._isEmpty=!1})}toDataURL(t="image/png",r){switch(t){case"image/svg+xml":return typeof r!="object"&&(r=void 0),`data:image/svg+xml;base64,${btoa(this.toSVG(r))}`;default:return typeof r!="number"&&(r=void 0),this.canvas.toDataURL(t,r)}}on(){this.canvas.style.touchAction="none",this.canvas.style.msTouchAction="none",this.canvas.style.userSelect="none";const t=/Macintosh/.test(navigator.userAgent)&&"ontouchstart"in document;window.PointerEvent&&!t?this._handlePointerEvents():(this._handleMouseEvents(),"ontouchstart"in window&&this._handleTouchEvents())}off(){this.canvas.style.touchAction="auto",this.canvas.style.msTouchAction="auto",this.canvas.style.userSelect="auto",this.canvas.removeEventListener("pointerdown",this._handlePointerDown),this.canvas.removeEventListener("mousedown",this._handleMouseDown),this.canvas.removeEventListener("touchstart",this._handleTouchStart),this._removeMoveUpEventListeners()}_getListenerFunctions(){var t;const r=window.document===this.canvas.ownerDocument?window:(t=this.canvas.ownerDocument.defaultView)!==null&&t!==void 0?t:this.canvas.ownerDocument;return{addEventListener:r.addEventListener.bind(r),removeEventListener:r.removeEventListener.bind(r)}}_removeMoveUpEventListeners(){const{removeEventListener:t}=this._getListenerFunctions();t("pointermove",this._handlePointerMove),t("pointerup",this._handlePointerUp),t("mousemove",this._handleMouseMove),t("mouseup",this._handleMouseUp),t("touchmove",this._handleTouchMove),t("touchend",this._handleTouchEnd)}isEmpty(){return this._isEmpty}fromData(t,{clear:r=!0}={}){r&&this.clear(),this._fromData(t,this._drawCurve.bind(this),this._drawDot.bind(this)),this._data=this._data.concat(t)}toData(){return this._data}_isLeftButtonPressed(t,r){return r?t.buttons===1:(t.buttons&1)===1}_pointerEventToSignatureEvent(t){return{event:t,type:t.type,x:t.clientX,y:t.clientY,pressure:"pressure"in t?t.pressure:0}}_touchEventToSignatureEvent(t){const r=t.changedTouches[0];return{event:t,type:t.type,x:r.clientX,y:r.clientY,pressure:r.force}}_getPointGroupOptions(t){return{penColor:t&&"penColor"in t?t.penColor:this.penColor,dotSize:t&&"dotSize"in t?t.dotSize:this.dotSize,minWidth:t&&"minWidth"in t?t.minWidth:this.minWidth,maxWidth:t&&"maxWidth"in t?t.maxWidth:this.maxWidth,velocityFilterWeight:t&&"velocityFilterWeight"in t?t.velocityFilterWeight:this.velocityFilterWeight,compositeOperation:t&&"compositeOperation"in t?t.compositeOperation:this.compositeOperation}}_strokeBegin(t){if(!this.dispatchEvent(new CustomEvent("beginStroke",{detail:t,cancelable:!0})))return;const{addEventListener:o}=this._getListenerFunctions();switch(t.event.type){case"mousedown":o("mousemove",this._handleMouseMove),o("mouseup",this._handleMouseUp);break;case"touchstart":o("touchmove",this._handleTouchMove),o("touchend",this._handleTouchEnd);break;case"pointerdown":o("pointermove",this._handlePointerMove),o("pointerup",this._handlePointerUp);break}this._drawingStroke=!0;const i=this._getPointGroupOptions(),l=Object.assign(Object.assign({},i),{points:[]});this._data.push(l),this._reset(i),this._strokeUpdate(t)}_strokeUpdate(t){if(!this._drawingStroke)return;if(this._data.length===0){this._strokeBegin(t);return}this.dispatchEvent(new CustomEvent("beforeUpdateStroke",{detail:t}));const r=this._createPoint(t.x,t.y,t.pressure),o=this._data[this._data.length-1],i=o.points,l=i.length>0&&i[i.length-1],d=l?r.distanceTo(l)<=this.minDistance:!1,c=this._getPointGroupOptions(o);if(!l||!(l&&d)){const u=this._addPoint(r,c);l?u&&this._drawCurve(u,c):this._drawDot(r,c),i.push({time:r.time,x:r.x,y:r.y,pressure:r.pressure})}this.dispatchEvent(new CustomEvent("afterUpdateStroke",{detail:t}))}_strokeEnd(t,r=!0){this._removeMoveUpEventListeners(),this._drawingStroke&&(r&&this._strokeUpdate(t),this._drawingStroke=!1,this.dispatchEvent(new CustomEvent("endStroke",{detail:t})))}_handlePointerEvents(){this._drawingStroke=!1,this.canvas.addEventListener("pointerdown",this._handlePointerDown)}_handleMouseEvents(){this._drawingStroke=!1,this.canvas.addEventListener("mousedown",this._handleMouseDown)}_handleTouchEvents(){this.canvas.addEventListener("touchstart",this._handleTouchStart)}_reset(t){this._lastPoints=[],this._lastVelocity=0,this._lastWidth=(t.minWidth+t.maxWidth)/2,this._ctx.fillStyle=t.penColor,this._ctx.globalCompositeOperation=t.compositeOperation}_createPoint(t,r,o){const i=this.canvas.getBoundingClientRect();return new Sl(t-i.left,r-i.top,o,new Date().getTime())}_addPoint(t,r){const{_lastPoints:o}=this;if(o.push(t),o.length>2){o.length===3&&o.unshift(o[0]);const i=this._calculateCurveWidths(o[1],o[2],r),l=Nc.fromPoints(o,i);return o.shift(),l}return null}_calculateCurveWidths(t,r,o){const i=o.velocityFilterWeight*r.velocityFrom(t)+(1-o.velocityFilterWeight)*this._lastVelocity,l=this._strokeWidth(i,o),d={end:l,start:this._lastWidth};return this._lastVelocity=i,this._lastWidth=l,d}_strokeWidth(t,r){return Math.max(r.maxWidth/(t+1),r.minWidth)}_drawCurveSegment(t,r,o){const i=this._ctx;i.moveTo(t,r),i.arc(t,r,o,0,2*Math.PI,!1),this._isEmpty=!1}_drawCurve(t,r){const o=this._ctx,i=t.endWidth-t.startWidth,l=Math.ceil(t.length())*2;o.beginPath(),o.fillStyle=r.penColor;for(let d=0;d0?r.dotSize:(r.minWidth+r.maxWidth)/2;o.beginPath(),this._drawCurveSegment(t.x,t.y,i),o.closePath(),o.fillStyle=r.penColor,o.fill()}_fromData(t,r,o){for(const i of t){const{points:l}=i,d=this._getPointGroupOptions(i);if(l.length>1)for(let c=0;c{const y=document.createElement("path");if(!isNaN(h.control1.x)&&!isNaN(h.control1.y)&&!isNaN(h.control2.x)&&!isNaN(h.control2.y)){const C=`M ${h.startPoint.x.toFixed(3)},${h.startPoint.y.toFixed(3)} C ${h.control1.x.toFixed(3)},${h.control1.y.toFixed(3)} ${h.control2.x.toFixed(3)},${h.control2.y.toFixed(3)} ${h.endPoint.x.toFixed(3)},${h.endPoint.y.toFixed(3)}`;y.setAttribute("d",C),y.setAttribute("stroke-width",(h.endWidth*2.25).toFixed(3)),y.setAttribute("stroke",m),y.setAttribute("fill","none"),y.setAttribute("stroke-linecap","round"),u.appendChild(y)}},(h,{penColor:m,dotSize:y,minWidth:C,maxWidth:A})=>{const w=document.createElement("circle"),E=y>0?y:(C+A)/2;w.setAttribute("r",E.toString()),w.setAttribute("cx",h.x.toString()),w.setAttribute("cy",h.y.toString()),w.setAttribute("fill",m),u.appendChild(w)}),u.outerHTML}}const ej="",PE=n.defineComponent({name:"SignaturePad",emits:["update:modelValue","change","remove"],data(){return{visible:!1,isEmpty:!0,signaturePad:null}},props:{modelValue:String,penColor:String,formCreateInject:Object},watch:{visible(e){e?(this.isEmpty=!0,this.$nextTick(()=>{this.signaturePad=n.markRaw(new Ho(this.$refs.pad,{penColor:this.penColor})),this.signaturePad.addEventListener("endStroke",()=>{this.isEmpty=this.signaturePad.isEmpty()})})):(this.signaturePad.off(),this.signaturePad=null)}},methods:{clear(){this.signaturePad.clear(),this.isEmpty=!0},submit(){const e=this.signaturePad.toDataURL();this.updateValue(e),this.visible=!1},updateValue(e){this.$emit("update:modelValue",e),this.$emit("change",e)},remove(){this.updateValue(""),this.$emit("remove")}}}),ME={class:"_fc-m-signature"},LE={key:0,class:"_fc-m-signature-preview"},jE=["src"],zE={class:"_fc-m-signature-pad",ref:"pad",width:"320px",height:"145px"};function UE(e,t,r,o,i,l){const d=n.resolveComponent("van-dialog");return n.openBlock(),n.createElementBlock("div",ME,[e.modelValue?(n.openBlock(),n.createElementBlock("div",LE,[n.createElementVNode("i",{class:"fc-icon icon-delete2",onClick:t[0]||(t[0]=(...c)=>e.remove&&e.remove(...c))}),n.createElementVNode("img",{src:e.modelValue,alt:"signature"},null,8,jE)])):(n.openBlock(),n.createElementBlock("div",{key:1,class:"_fc-m-signature-btn",onClick:t[1]||(t[1]=c=>e.visible=!0)},[t[4]||(t[4]=n.createElementVNode("i",{class:"fc-icon icon-edit2"},null,-1)),n.createTextVNode(" "+n.toDisplayString(e.formCreateInject.t("signaturePadTip")||"\u70B9\u51FB\u6DFB\u52A0\u624B\u5199\u7B7E\u540D"),1)])),n.createVNode(d,{show:e.visible,"onUpdate:show":t[3]||(t[3]=c=>e.visible=c),class:"_fc-m-signature-dialog",onConfirm:e.submit,onCancel:e.clear,"confirm-button-text":e.formCreateInject.t("ok")||"\u786E\u5B9A","cancel-button-text":e.formCreateInject.t("reset")||"\u91CD\u7F6E","confirm-button-disabled":e.isEmpty},{title:n.withCtx(()=>[n.createTextVNode(n.toDisplayString(e.formCreateInject.t("signaturePadTitle")||"\u8BF7\u5728\u865A\u7EBF\u6846\u5185\u4E66\u5199")+" ",1),n.createElementVNode("i",{class:"fc-icon icon-add2",onClick:t[2]||(t[2]=c=>e.visible=!1)})]),default:n.withCtx(()=>[n.createElementVNode("canvas",zE,null,512)]),_:1},8,["show","onConfirm","onCancel","confirm-button-text","cancel-button-text","confirm-button-disabled"])])}const HE=Te(PE,[["render",UE]]);function Tc(e,t,r){for(var o=[],i=Math.max(e.length,t.length),l=0,d=0;d>1,e!==0;)i=Tc(i,i,r);return o}function WE(e,t){for(var r=e.split(""),o=[],i=r.length-1;i>=0;i--){var l=parseInt(r[i],t);if(isNaN(l))return null;o.push(l)}return o}function GE(e,t,r){var o=WE(e,t);if(o===null)return null;for(var i=[],l=[1],d=0;d=0;d--)c+=i[d].toString(r);return c}function KE(e){return e.substring(0,2)==="0x"&&(e=e.substring(2)),e=e.toLowerCase(),GE(e,16,10)}class YE{constructor(t){t=t||{},this.seq=0,this.mid=(t.mid||1)%1023,this.offset=t.offset||0,this.lastTime=0}generate(){const t=Date.now(),r=(t-this.offset).toString(2);this.lastTime==t?(this.seq++,this.seq>4095&&(this.seq=0)):this.seq=0,this.lastTime=t;let o=this.seq.toString(2),i=this.mid.toString(2);for(;o.length<12;)o="0"+o;for(;i.length<10;)i="0"+i;const l=r+i+o;let d="";for(let c=l.length;c>0;c-=4)d=parseInt(l.substring(c-4,c),2).toString(16)+d;return KE(d)}}const QE=n.defineComponent({name:"FcId",props:["modelValue","prefix"],emits:["update:modelValue"],inject:{designer:{default:null}},data(){return{preview:"7379787000000000"}},watch:{modelValue:{handler:function(e){if(!e){const t=new YE({mid:42,offset:173448e7});this.$emit("update:modelValue",""+(this.prefix||"")+t.generate())}},immediate:!0}}});function JE(e,t,r,o,i,l){const d=n.resolveComponent("el-input");return n.openBlock(),n.createBlock(d,{modelValue:e.designer?""+(e.prefix||"")+e.preview:e.modelValue,readonly:"",disabled:""},null,8,["modelValue"])}const Qh=Te(QE,[["render",JE]]),tj="",XE=n.defineComponent({name:"FcTitle",data(){return{}},props:{title:String,size:String,align:String},computed:{textStyle(){return{textAlign:this.align||"left"}}}});function ZE(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("div",{class:n.normalizeClass(["_fc-title",e.size||"h2"]),style:n.normalizeStyle(e.textStyle)},n.toDisplayString(e.title),7)}const Jh=Te(XE,[["render",ZE]]);function Dc(){return{async:!1,breaks:!1,extensions:null,gfm:!0,hooks:null,pedantic:!1,renderer:null,silent:!1,tokenizer:null,walkTokens:null}}let dr=Dc();function Xh(e){dr=e}const Wo={exec:()=>null};function Et(e,t=""){let r=typeof e=="string"?e:e.source;const o={replace:(i,l)=>{let d=typeof l=="string"?l:l.source;return d=d.replace(mn.caret,"$1"),r=r.replace(i,d),o},getRegex:()=>new RegExp(r,t)};return o}const mn={codeRemoveIndent:/^(?: {1,4}| {0,3}\t)/gm,outputLinkReplace:/\\([\[\]])/g,indentCodeCompensation:/^(\s+)(?:```)/,beginningSpace:/^\s+/,endingHash:/#$/,startingSpaceChar:/^ /,endingSpaceChar:/ $/,nonSpaceChar:/[^ ]/,newLineCharGlobal:/\n/g,tabCharGlobal:/\t/g,multipleSpaceGlobal:/\s+/g,blankLine:/^[ \t]*$/,doubleBlankLine:/\n[ \t]*\n[ \t]*$/,blockquoteStart:/^ {0,3}>/,blockquoteSetextReplace:/\n {0,3}((?:=+|-+) *)(?=\n|$)/g,blockquoteSetextReplace2:/^ {0,3}>[ \t]?/gm,listReplaceTabs:/^\t+/,listReplaceNesting:/^ {1,4}(?=( {4})*[^ ])/g,listIsTask:/^\[[ xX]\] /,listReplaceTask:/^\[[ xX]\] +/,anyLine:/\n.*\n/,hrefBrackets:/^<(.*)>$/,tableDelimiter:/[:|]/,tableAlignChars:/^\||\| *$/g,tableRowBlankLine:/\n[ \t]*$/,tableAlignRight:/^ *-+: *$/,tableAlignCenter:/^ *:-+: *$/,tableAlignLeft:/^ *:-+ *$/,startATag:/^/i,startPreScriptTag:/^<(pre|code|kbd|script)(\s|>)/i,endPreScriptTag:/^<\/(pre|code|kbd|script)(\s|>)/i,startAngleBracket:/^$/,pedanticHrefTitle:/^([^'"]*[^\s])\s+(['"])(.*)\2/,unicodeAlphaNumeric:/[\p{L}\p{N}]/u,escapeTest:/[&<>"']/,escapeReplace:/[&<>"']/g,escapeTestNoEncode:/[<>"']|&(?!(#\d{1,7}|#[Xx][a-fA-F0-9]{1,6}|\w+);)/,escapeReplaceNoEncode:/[<>"']|&(?!(#\d{1,7}|#[Xx][a-fA-F0-9]{1,6}|\w+);)/g,unescapeTest:/&(#(?:\d+)|(?:#x[0-9A-Fa-f]+)|(?:\w+));?/ig,caret:/(^|[^\[])\^/g,percentDecode:/%25/g,findPipe:/\|/g,splitPipe:/ \|/,slashPipe:/\\\|/g,carriageReturn:/\r\n|\r/g,spaceLine:/^ +$/gm,notSpaceStart:/^\S*/,endingNewline:/\n$/,listItemRegex:e=>new RegExp(`^( {0,3}${e})((?:[ ][^\\n]*)?(?:\\n|$))`),nextBulletRegex:e=>new RegExp(`^ {0,${Math.min(3,e-1)}}(?:[*+-]|\\d{1,9}[.)])((?:[ ][^\\n]*)?(?:\\n|$))`),hrRegex:e=>new RegExp(`^ {0,${Math.min(3,e-1)}}((?:- *){3,}|(?:_ *){3,}|(?:\\* *){3,})(?:\\n+|$)`),fencesBeginRegex:e=>new RegExp(`^ {0,${Math.min(3,e-1)}}(?:\`\`\`|~~~)`),headingBeginRegex:e=>new RegExp(`^ {0,${Math.min(3,e-1)}}#`),htmlBeginRegex:e=>new RegExp(`^ {0,${Math.min(3,e-1)}}<(?:[a-z].*>|!--)`,"i")},qE=/^(?:[ \t]*(?:\n|$))+/,eS=/^((?: {4}| {0,3}\t)[^\n]+(?:\n(?:[ \t]*(?:\n|$))*)?)+/,tS=/^ {0,3}(`{3,}(?=[^`\n]*(?:\n|$))|~{3,})([^\n]*)(?:\n|$)(?:|([\s\S]*?)(?:\n|$))(?: {0,3}\1[~`]* *(?=\n|$)|$)/,Go=/^ {0,3}((?:-[\t ]*){3,}|(?:_[ \t]*){3,}|(?:\*[ \t]*){3,})(?:\n+|$)/,nS=/^ {0,3}(#{1,6})(?=\s|$)(.*)(?:\n+|$)/,Vc=/(?:[*+-]|\d{1,9}[.)])/,Zh=/^(?!bull |blockCode|fences|blockquote|heading|html|table)((?:.|\n(?!\s*?\n|bull |blockCode|fences|blockquote|heading|html|table))+?)\n {0,3}(=+|-+) *(?:\n+|$)/,qh=Et(Zh).replace(/bull/g,Vc).replace(/blockCode/g,/(?: {4}| {0,3}\t)/).replace(/fences/g,/ {0,3}(?:`{3,}|~{3,})/).replace(/blockquote/g,/ {0,3}>/).replace(/heading/g,/ {0,3}#{1,6}/).replace(/html/g,/ {0,3}<[^\n>]+>\n/).replace(/\|table/g,"").getRegex(),iS=Et(Zh).replace(/bull/g,Vc).replace(/blockCode/g,/(?: {4}| {0,3}\t)/).replace(/fences/g,/ {0,3}(?:`{3,}|~{3,})/).replace(/blockquote/g,/ {0,3}>/).replace(/heading/g,/ {0,3}#{1,6}/).replace(/html/g,/ {0,3}<[^\n>]+>\n/).replace(/table/g,/ {0,3}\|?(?:[:\- ]*\|)+[\:\- ]*\n/).getRegex(),Oc=/^([^\n]+(?:\n(?!hr|heading|lheading|blockquote|fences|list|html|table| +\n)[^\n]+)*)/,rS=/^[^\n]+/,Bc=/(?!\s*\])(?:\\.|[^\[\]\\])+/,oS=Et(/^ {0,3}\[(label)\]: *(?:\n[ \t]*)?([^<\s][^\s]*|<.*?>)(?:(?: +(?:\n[ \t]*)?| *\n[ \t]*)(title))? *(?:\n+|$)/).replace("label",Bc).replace("title",/(?:"(?:\\"?|[^"\\])*"|'[^'\n]*(?:\n[^'\n]+)*\n?'|\([^()]*\))/).getRegex(),aS=Et(/^( {0,3}bull)([ \t][^\n]+?)?(?:\n|$)/).replace(/bull/g,Vc).getRegex(),Al="address|article|aside|base|basefont|blockquote|body|caption|center|col|colgroup|dd|details|dialog|dir|div|dl|dt|fieldset|figcaption|figure|footer|form|frame|frameset|h[1-6]|head|header|hr|html|iframe|legend|li|link|main|menu|menuitem|meta|nav|noframes|ol|optgroup|option|p|param|search|section|summary|table|tbody|td|tfoot|th|thead|title|tr|track|ul",Rc=/|$))/,lS=Et("^ {0,3}(?:<(script|pre|style|textarea)[\\s>][\\s\\S]*?(?:[^\\n]*\\n+|$)|comment[^\\n]*(\\n+|$)|<\\?[\\s\\S]*?(?:\\?>\\n*|$)|\\n*|$)|\\n*|$)|)[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$)|<(?!script|pre|style|textarea)([a-z][\\w-]*)(?:attribute)*? */?>(?=[ \\t]*(?:\\n|$))[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$)|(?=[ \\t]*(?:\\n|$))[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$))","i").replace("comment",Rc).replace("tag",Al).replace("attribute",/ +[a-zA-Z:_][\w.:-]*(?: *= *"[^"\n]*"| *= *'[^'\n]*'| *= *[^\s"'=<>`]+)?/).getRegex(),em=Et(Oc).replace("hr",Go).replace("heading"," {0,3}#{1,6}(?:\\s|$)").replace("|lheading","").replace("|table","").replace("blockquote"," {0,3}>").replace("fences"," {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list"," {0,3}(?:[*+-]|1[.)]) ").replace("html",")|<(?:script|pre|style|textarea|!--)").replace("tag",Al).getRegex(),$c={blockquote:Et(/^( {0,3}> ?(paragraph|[^\n]*)(?:\n|$))+/).replace("paragraph",em).getRegex(),code:eS,def:oS,fences:tS,heading:nS,hr:Go,html:lS,lheading:qh,list:aS,newline:qE,paragraph:em,table:Wo,text:rS},tm=Et("^ *([^\\n ].*)\\n {0,3}((?:\\| *)?:?-+:? *(?:\\| *:?-+:? *)*(?:\\| *)?)(?:\\n((?:(?! *\\n|hr|heading|blockquote|code|fences|list|html).*(?:\\n|$))*)\\n*|$)").replace("hr",Go).replace("heading"," {0,3}#{1,6}(?:\\s|$)").replace("blockquote"," {0,3}>").replace("code","(?: {4}| {0,3} )[^\\n]").replace("fences"," {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list"," {0,3}(?:[*+-]|1[.)]) ").replace("html",")|<(?:script|pre|style|textarea|!--)").replace("tag",Al).getRegex(),sS={...$c,lheading:iS,table:tm,paragraph:Et(Oc).replace("hr",Go).replace("heading"," {0,3}#{1,6}(?:\\s|$)").replace("|lheading","").replace("table",tm).replace("blockquote"," {0,3}>").replace("fences"," {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list"," {0,3}(?:[*+-]|1[.)]) ").replace("html",")|<(?:script|pre|style|textarea|!--)").replace("tag",Al).getRegex()},dS={...$c,html:Et(`^ *(?:comment *(?:\\n|\\s*$)|<(tag)[\\s\\S]+? *(?:\\n{2,}|\\s*$)|\\s]*)*?/?> *(?:\\n{2,}|\\s*$))`).replace("comment",Rc).replace(/tag/g,"(?!(?:a|em|strong|small|s|cite|q|dfn|abbr|data|time|code|var|samp|kbd|sub|sup|i|b|u|mark|ruby|rt|rp|bdi|bdo|span|br|wbr|ins|del|img)\\b)\\w+(?!:|[^\\w\\s@]*@)\\b").getRegex(),def:/^ *\[([^\]]+)\]: *]+)>?(?: +(["(][^\n]+[")]))? *(?:\n+|$)/,heading:/^(#{1,6})(.*)(?:\n+|$)/,fences:Wo,lheading:/^(.+?)\n {0,3}(=+|-+) *(?:\n+|$)/,paragraph:Et(Oc).replace("hr",Go).replace("heading",` *#{1,6} *[^
+]`).replace("lheading",qh).replace("|table","").replace("blockquote"," {0,3}>").replace("|fences","").replace("|list","").replace("|html","").replace("|tag","").getRegex()},cS=/^\\([!"#$%&'()*+,\-./:;<=>?@\[\]\\^_`{|}~])/,uS=/^(`+)([^`]|[^`][\s\S]*?[^`])\1(?!`)/,nm=/^( {2,}|\\)\n(?!\s*$)/,fS=/^(`+|[^`])(?:(?= {2,}\n)|[\s\S]*?(?:(?=[\\]*?>/g,om=/^(?:\*+(?:((?!\*)punct)|[^\s*]))|^_+(?:((?!_)punct)|([^\s_]))/,vS=Et(om,"u").replace(/punct/g,xl).getRegex(),yS=Et(om,"u").replace(/punct/g,rm).getRegex(),am="^[^_*]*?__[^_*]*?\\*[^_*]*?(?=__)|[^*]+(?=[^*])|(?!\\*)punct(\\*+)(?=[\\s]|$)|notPunctSpace(\\*+)(?!\\*)(?=punctSpace|$)|(?!\\*)punctSpace(\\*+)(?=notPunctSpace)|[\\s](\\*+)(?!\\*)(?=punct)|(?!\\*)punct(\\*+)(?!\\*)(?=punct)|notPunctSpace(\\*+)(?=notPunctSpace)",bS=Et(am,"gu").replace(/notPunctSpace/g,im).replace(/punctSpace/g,Ic).replace(/punct/g,xl).getRegex(),wS=Et(am,"gu").replace(/notPunctSpace/g,mS).replace(/punctSpace/g,hS).replace(/punct/g,rm).getRegex(),CS=Et("^[^_*]*?\\*\\*[^_*]*?_[^_*]*?(?=\\*\\*)|[^_]+(?=[^_])|(?!_)punct(_+)(?=[\\s]|$)|notPunctSpace(_+)(?!_)(?=punctSpace|$)|(?!_)punctSpace(_+)(?=notPunctSpace)|[\\s](_+)(?!_)(?=punct)|(?!_)punct(_+)(?!_)(?=punct)","gu").replace(/notPunctSpace/g,im).replace(/punctSpace/g,Ic).replace(/punct/g,xl).getRegex(),_S=Et(/\\(punct)/,"gu").replace(/punct/g,xl).getRegex(),ES=Et(/^<(scheme:[^\s\x00-\x1f<>]*|email)>/).replace("scheme",/[a-zA-Z][a-zA-Z0-9+.-]{1,31}/).replace("email",/[a-zA-Z0-9.!#$%&'*+/=?^_`{|}~-]+(@)[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)+(?![-_])/).getRegex(),SS=Et(Rc).replace("(?:-->|$)","-->").getRegex(),AS=Et("^comment|^|^<[a-zA-Z][\\w-]*(?:attribute)*?\\s*/?>|^<\\?[\\s\\S]*?\\?>|^|^").replace("comment",SS).replace("attribute",/\s+[a-zA-Z:_][\w.:-]*(?:\s*=\s*"[^"]*"|\s*=\s*'[^']*'|\s*=\s*[^\s"'=<>`]+)?/).getRegex(),kl=/(?:\[(?:\\.|[^\[\]\\])*\]|\\.|`[^`]*`|[^\[\]\\`])*?/,xS=Et(/^!?\[(label)\]\(\s*(href)(?:(?:[ \t]*(?:\n[ \t]*)?)(title))?\s*\)/).replace("label",kl).replace("href",/<(?:\\.|[^\n<>\\])+>|[^ \t\n\x00-\x1f]*/).replace("title",/"(?:\\"?|[^"\\])*"|'(?:\\'?|[^'\\])*'|\((?:\\\)?|[^)\\])*\)/).getRegex(),lm=Et(/^!?\[(label)\]\[(ref)\]/).replace("label",kl).replace("ref",Bc).getRegex(),sm=Et(/^!?\[(ref)\](?:\[\])?/).replace("ref",Bc).getRegex(),kS=Et("reflink|nolink(?!\\()","g").replace("reflink",lm).replace("nolink",sm).getRegex(),Fc={_backpedal:Wo,anyPunctuation:_S,autolink:ES,blockSkip:gS,br:nm,code:uS,del:Wo,emStrongLDelim:vS,emStrongRDelimAst:bS,emStrongRDelimUnd:CS,escape:cS,link:xS,nolink:sm,punctuation:pS,reflink:lm,reflinkSearch:kS,tag:AS,text:fS,url:Wo},NS={...Fc,link:Et(/^!?\[(label)\]\((.*?)\)/).replace("label",kl).getRegex(),reflink:Et(/^!?\[(label)\]\s*\[([^\]]*)\]/).replace("label",kl).getRegex()},Pc={...Fc,emStrongRDelimAst:wS,emStrongLDelim:yS,url:Et(/^((?:ftp|https?):\/\/|www\.)(?:[a-zA-Z0-9\-]+\.?)+[^\s<]*|^email/,"i").replace("email",/[A-Za-z0-9._+-]+(@)[a-zA-Z0-9-_]+(?:\.[a-zA-Z0-9-_]*[a-zA-Z0-9])+(?![-_])/).getRegex(),_backpedal:/(?:[^?!.,:;*_'"~()&]+|\([^)]*\)|&(?![a-zA-Z0-9]+;$)|[?!.,:;*_'"~)]+(?!$))+/,del:/^(~~?)(?=[^\s~])((?:\\.|[^\\])*?(?:\\.|[^\s~\\]))\1(?=[^~]|$)/,text:/^([`~]+|[^`~])(?:(?= {2,}\n)|(?=[a-zA-Z0-9.!#$%&'*+\/=?_`{\|}~-]+@)|[\s\S]*?(?:(?=[\\":">",'"':""","'":"'"},dm=e=>DS[e];function pi(e,t){if(t){if(mn.escapeTest.test(e))return e.replace(mn.escapeReplace,dm)}else if(mn.escapeTestNoEncode.test(e))return e.replace(mn.escapeReplaceNoEncode,dm);return e}function cm(e){try{e=encodeURI(e).replace(mn.percentDecode,"%")}catch{return null}return e}function um(e,t){var l;const r=e.replace(mn.findPipe,(d,c,u)=>{let h=!1,m=c;for(;--m>=0&&u[m]==="\\";)h=!h;return h?"|":" |"}),o=r.split(mn.splitPipe);let i=0;if(o[0].trim()||o.shift(),o.length>0&&!((l=o.at(-1))!=null&&l.trim())&&o.pop(),t)if(o.length>t)o.splice(t);else for(;o.length0?-2:-1}function fm(e,t,r,o,i){const l=t.href,d=t.title||null,c=e[1].replace(i.other.outputLinkReplace,"$1");o.state.inLink=!0;const u={type:e[0].charAt(0)==="!"?"image":"link",raw:r,href:l,title:d,text:c,tokens:o.inlineTokens(c)};return o.state.inLink=!1,u}function OS(e,t,r){const o=e.match(r.other.indentCodeCompensation);if(o===null)return t;const i=o[1];return t.split(`
`).map(l=>{const d=l.match(r.other.beginningSpace);if(d===null)return l;const[c]=d;return c.length>=i.length?l.slice(i.length):l}).join(`
`)}class Tl{constructor(t){Dt(this,"options");Dt(this,"rules");Dt(this,"lexer");this.options=t||dr}space(t){const r=this.rules.block.newline.exec(t);if(r&&r[0].length>0)return{type:"space",raw:r[0]}}code(t){const r=this.rules.block.code.exec(t);if(r){const o=r[0].replace(this.rules.other.codeRemoveIndent,"");return{type:"code",raw:r[0],codeBlockStyle:"indented",text:this.options.pedantic?o:Yo(o,`
-`)}}}fences(t){const r=this.rules.block.fences.exec(t);if(r){const o=r[0],i=DA(o,r[3]||"",this.rules);return{type:"code",raw:o,lang:r[2]?r[2].trim().replace(this.rules.inline.anyPunctuation,"$1"):r[2],text:i}}}heading(t){const r=this.rules.block.heading.exec(t);if(r){let o=r[2].trim();if(this.rules.other.endingHash.test(o)){const i=Yo(o,"#");(this.options.pedantic||!i||this.rules.other.endingSpaceChar.test(i))&&(o=i.trim())}return{type:"heading",raw:r[0],depth:r[1].length,text:o,tokens:this.lexer.inline(o)}}}hr(t){const r=this.rules.block.hr.exec(t);if(r)return{type:"hr",raw:Yo(r[0],`
+`)}}}fences(t){const r=this.rules.block.fences.exec(t);if(r){const o=r[0],i=OS(o,r[3]||"",this.rules);return{type:"code",raw:o,lang:r[2]?r[2].trim().replace(this.rules.inline.anyPunctuation,"$1"):r[2],text:i}}}heading(t){const r=this.rules.block.heading.exec(t);if(r){let o=r[2].trim();if(this.rules.other.endingHash.test(o)){const i=Yo(o,"#");(this.options.pedantic||!i||this.rules.other.endingSpaceChar.test(i))&&(o=i.trim())}return{type:"heading",raw:r[0],depth:r[1].length,text:o,tokens:this.lexer.inline(o)}}}hr(t){const r=this.rules.block.hr.exec(t);if(r)return{type:"hr",raw:Yo(r[0],`
`)}}blockquote(t){const r=this.rules.block.blockquote.exec(t);if(r){let o=Yo(r[0],`
`).split(`
`),i="",l="";const d=[];for(;o.length>0;){let c=!1;const u=[];let h;for(h=0;h1,l={type:"list",raw:"",ordered:i,start:i?+o.slice(0,-1):"",loose:!1,items:[]};o=i?`\\d{1,9}\\${o.slice(-1)}`:`\\${o}`,this.options.pedantic&&(o=i?o:"[*+-]");const d=this.rules.other.listItemRegex(o);let c=!1;for(;t;){let h=!1,m="",y="";if(!(r=d.exec(t))||this.rules.block.hr.test(t))break;m=r[0],t=t.substring(m.length);let C=r[2].split(`
-`,1)[0].replace(this.rules.other.listReplaceTabs,_=>" ".repeat(3*_.length)),S=t.split(`
-`,1)[0],w=!C.trim(),E=0;if(this.options.pedantic?(E=2,y=C.trimStart()):w?E=r[1].length+1:(E=r[2].search(this.rules.other.nonSpaceChar),E=E>4?1:E,y=C.slice(E),E+=r[1].length),w&&this.rules.other.blankLine.test(S)&&(m+=S+`
-`,t=t.substring(S.length+1),h=!0),!h){const _=this.rules.other.nextBulletRegex(E),x=this.rules.other.hrRegex(E),k=this.rules.other.fencesBeginRegex(E),T=this.rules.other.headingBeginRegex(E),O=this.rules.other.htmlBeginRegex(E);for(;t;){const F=t.split(`
-`,1)[0];let I;if(S=F,this.options.pedantic?(S=S.replace(this.rules.other.listReplaceNesting," "),I=S):I=S.replace(this.rules.other.tabCharGlobal," "),k.test(S)||T.test(S)||O.test(S)||_.test(S)||x.test(S))break;if(I.search(this.rules.other.nonSpaceChar)>=E||!S.trim())y+=`
+`,1)[0].replace(this.rules.other.listReplaceTabs,_=>" ".repeat(3*_.length)),A=t.split(`
+`,1)[0],w=!C.trim(),E=0;if(this.options.pedantic?(E=2,y=C.trimStart()):w?E=r[1].length+1:(E=r[2].search(this.rules.other.nonSpaceChar),E=E>4?1:E,y=C.slice(E),E+=r[1].length),w&&this.rules.other.blankLine.test(A)&&(m+=A+`
+`,t=t.substring(A.length+1),h=!0),!h){const _=this.rules.other.nextBulletRegex(E),x=this.rules.other.hrRegex(E),k=this.rules.other.fencesBeginRegex(E),T=this.rules.other.headingBeginRegex(E),O=this.rules.other.htmlBeginRegex(E);for(;t;){const F=t.split(`
+`,1)[0];let I;if(A=F,this.options.pedantic?(A=A.replace(this.rules.other.listReplaceNesting," "),I=A):I=A.replace(this.rules.other.tabCharGlobal," "),k.test(A)||T.test(A)||O.test(A)||_.test(A)||x.test(A))break;if(I.search(this.rules.other.nonSpaceChar)>=E||!A.trim())y+=`
`+I.slice(E);else{if(w||C.replace(this.rules.other.tabCharGlobal," ").search(this.rules.other.nonSpaceChar)>=4||k.test(C)||T.test(C)||x.test(C))break;y+=`
-`+S}!w&&!S.trim()&&(w=!0),m+=F+`
-`,t=t.substring(F.length+1),C=I.slice(E)}}l.loose||(c?l.loose=!0:this.rules.other.doubleBlankLine.test(m)&&(c=!0));let b=null,g;this.options.gfm&&(b=this.rules.other.listIsTask.exec(y),b&&(g=b[0]!=="[ ] ",y=y.replace(this.rules.other.listReplaceTask,""))),l.items.push({type:"list_item",raw:m,task:!!b,checked:g,loose:!1,text:y,tokens:[]}),l.raw+=m}const u=l.items.at(-1);if(u)u.raw=u.raw.trimEnd(),u.text=u.text.trimEnd();else return;l.raw=l.raw.trimEnd();for(let h=0;hC.type==="space"),y=m.length>0&&m.some(C=>this.rules.other.anyLine.test(C.raw));l.loose=y}if(l.loose)for(let h=0;h({text:h,tokens:this.lexer.inline(h),header:!1,align:d.align[m]})));return d}}lheading(t){const r=this.rules.block.lheading.exec(t);if(r)return{type:"heading",raw:r[0],depth:r[2].charAt(0)==="="?1:2,text:r[1],tokens:this.lexer.inline(r[1])}}paragraph(t){const r=this.rules.block.paragraph.exec(t);if(r){const o=r[1].charAt(r[1].length-1)===`
-`?r[1].slice(0,-1):r[1];return{type:"paragraph",raw:r[0],text:o,tokens:this.lexer.inline(o)}}}text(t){const r=this.rules.block.text.exec(t);if(r)return{type:"text",raw:r[0],text:r[0],tokens:this.lexer.inline(r[0])}}escape(t){const r=this.rules.inline.escape.exec(t);if(r)return{type:"escape",raw:r[0],text:r[1]}}tag(t){const r=this.rules.inline.tag.exec(t);if(r)return!this.lexer.state.inLink&&this.rules.other.startATag.test(r[0])?this.lexer.state.inLink=!0:this.lexer.state.inLink&&this.rules.other.endATag.test(r[0])&&(this.lexer.state.inLink=!1),!this.lexer.state.inRawBlock&&this.rules.other.startPreScriptTag.test(r[0])?this.lexer.state.inRawBlock=!0:this.lexer.state.inRawBlock&&this.rules.other.endPreScriptTag.test(r[0])&&(this.lexer.state.inRawBlock=!1),{type:"html",raw:r[0],inLink:this.lexer.state.inLink,inRawBlock:this.lexer.state.inRawBlock,block:!1,text:r[0]}}link(t){const r=this.rules.inline.link.exec(t);if(r){const o=r[2].trim();if(!this.options.pedantic&&this.rules.other.startAngleBracket.test(o)){if(!this.rules.other.endAngleBracket.test(o))return;const d=Yo(o.slice(0,-1),"\\");if((o.length-d.length)%2===0)return}else{const d=TA(r[2],"()");if(d===-2)return;if(d>-1){const u=(r[0].indexOf("!")===0?5:4)+r[1].length+d;r[2]=r[2].substring(0,d),r[0]=r[0].substring(0,u).trim(),r[3]=""}}let i=r[2],l="";if(this.options.pedantic){const d=this.rules.other.pedanticHrefTitle.exec(i);d&&(i=d[1],l=d[3])}else l=r[3]?r[3].slice(1,-1):"";return i=i.trim(),this.rules.other.startAngleBracket.test(i)&&(this.options.pedantic&&!this.rules.other.endAngleBracket.test(o)?i=i.slice(1):i=i.slice(1,-1)),um(r,{href:i&&i.replace(this.rules.inline.anyPunctuation,"$1"),title:l&&l.replace(this.rules.inline.anyPunctuation,"$1")},r[0],this.lexer,this.rules)}}reflink(t,r){let o;if((o=this.rules.inline.reflink.exec(t))||(o=this.rules.inline.nolink.exec(t))){const i=(o[2]||o[1]).replace(this.rules.other.multipleSpaceGlobal," "),l=r[i.toLowerCase()];if(!l){const d=o[0].charAt(0);return{type:"text",raw:d,text:d}}return um(o,l,o[0],this.lexer,this.rules)}}emStrong(t,r,o=""){let i=this.rules.inline.emStrongLDelim.exec(t);if(!i||i[3]&&o.match(this.rules.other.unicodeAlphaNumeric))return;if(!(i[1]||i[2]||"")||!o||this.rules.inline.punctuation.exec(o)){const d=[...i[0]].length-1;let c,u,h=d,m=0;const y=i[0][0]==="*"?this.rules.inline.emStrongRDelimAst:this.rules.inline.emStrongRDelimUnd;for(y.lastIndex=0,r=r.slice(-1*t.length+d);(i=y.exec(r))!=null;){if(c=i[1]||i[2]||i[3]||i[4]||i[5]||i[6],!c)continue;if(u=[...c].length,i[3]||i[4]){h+=u;continue}else if((i[5]||i[6])&&d%3&&!((d+u)%3)){m+=u;continue}if(h-=u,h>0)continue;u=Math.min(u,u+h+m);const C=[...i[0]][0].length,S=t.slice(0,d+i.index+C+u);if(Math.min(d,u)%2){const E=S.slice(1,-1);return{type:"em",raw:S,text:E,tokens:this.lexer.inlineTokens(E)}}const w=S.slice(2,-2);return{type:"strong",raw:S,text:w,tokens:this.lexer.inlineTokens(w)}}}}codespan(t){const r=this.rules.inline.code.exec(t);if(r){let o=r[2].replace(this.rules.other.newLineCharGlobal," ");const i=this.rules.other.nonSpaceChar.test(o),l=this.rules.other.startingSpaceChar.test(o)&&this.rules.other.endingSpaceChar.test(o);return i&&l&&(o=o.substring(1,o.length-1)),{type:"codespan",raw:r[0],text:o}}}br(t){const r=this.rules.inline.br.exec(t);if(r)return{type:"br",raw:r[0]}}del(t){const r=this.rules.inline.del.exec(t);if(r)return{type:"del",raw:r[0],text:r[2],tokens:this.lexer.inlineTokens(r[2])}}autolink(t){const r=this.rules.inline.autolink.exec(t);if(r){let o,i;return r[2]==="@"?(o=r[1],i="mailto:"+o):(o=r[1],i=o),{type:"link",raw:r[0],text:o,href:i,tokens:[{type:"text",raw:o,text:o}]}}}url(t){var o,i;let r;if(r=this.rules.inline.url.exec(t)){let l,d;if(r[2]==="@")l=r[0],d="mailto:"+l;else{let c;do c=r[0],r[0]=(i=(o=this.rules.inline._backpedal.exec(r[0]))==null?void 0:o[0])!=null?i:"";while(c!==r[0]);l=r[0],r[1]==="www."?d="http://"+r[0]:d=r[0]}return{type:"link",raw:r[0],text:l,href:d,tokens:[{type:"text",raw:l,text:l}]}}}inlineText(t){const r=this.rules.inline.text.exec(t);if(r){const o=this.lexer.state.inRawBlock;return{type:"text",raw:r[0],text:r[0],escaped:o}}}}class zn{constructor(t){Dt(this,"tokens");Dt(this,"options");Dt(this,"state");Dt(this,"tokenizer");Dt(this,"inlineQueue");this.tokens=[],this.tokens.links=Object.create(null),this.options=t||dr,this.options.tokenizer=this.options.tokenizer||new Tl,this.tokenizer=this.options.tokenizer,this.tokenizer.options=this.options,this.tokenizer.lexer=this,this.inlineQueue=[],this.state={inLink:!1,inRawBlock:!1,top:!0};const r={other:mn,block:Nl.normal,inline:Ko.normal};this.options.pedantic?(r.block=Nl.pedantic,r.inline=Ko.pedantic):this.options.gfm&&(r.block=Nl.gfm,this.options.breaks?r.inline=Ko.breaks:r.inline=Ko.gfm),this.tokenizer.rules=r}static get rules(){return{block:Nl,inline:Ko}}static lex(t,r){return new zn(r).lex(t)}static lexInline(t,r){return new zn(r).inlineTokens(t)}lex(t){t=t.replace(mn.carriageReturn,`
+`+A}!w&&!A.trim()&&(w=!0),m+=F+`
+`,t=t.substring(F.length+1),C=I.slice(E)}}l.loose||(c?l.loose=!0:this.rules.other.doubleBlankLine.test(m)&&(c=!0));let b=null,g;this.options.gfm&&(b=this.rules.other.listIsTask.exec(y),b&&(g=b[0]!=="[ ] ",y=y.replace(this.rules.other.listReplaceTask,""))),l.items.push({type:"list_item",raw:m,task:!!b,checked:g,loose:!1,text:y,tokens:[]}),l.raw+=m}const u=l.items.at(-1);if(u)u.raw=u.raw.trimEnd(),u.text=u.text.trimEnd();else return;l.raw=l.raw.trimEnd();for(let h=0;hC.type==="space"),y=m.length>0&&m.some(C=>this.rules.other.anyLine.test(C.raw));l.loose=y}if(l.loose)for(let h=0;h({text:h,tokens:this.lexer.inline(h),header:!1,align:d.align[m]})));return d}}lheading(t){const r=this.rules.block.lheading.exec(t);if(r)return{type:"heading",raw:r[0],depth:r[2].charAt(0)==="="?1:2,text:r[1],tokens:this.lexer.inline(r[1])}}paragraph(t){const r=this.rules.block.paragraph.exec(t);if(r){const o=r[1].charAt(r[1].length-1)===`
+`?r[1].slice(0,-1):r[1];return{type:"paragraph",raw:r[0],text:o,tokens:this.lexer.inline(o)}}}text(t){const r=this.rules.block.text.exec(t);if(r)return{type:"text",raw:r[0],text:r[0],tokens:this.lexer.inline(r[0])}}escape(t){const r=this.rules.inline.escape.exec(t);if(r)return{type:"escape",raw:r[0],text:r[1]}}tag(t){const r=this.rules.inline.tag.exec(t);if(r)return!this.lexer.state.inLink&&this.rules.other.startATag.test(r[0])?this.lexer.state.inLink=!0:this.lexer.state.inLink&&this.rules.other.endATag.test(r[0])&&(this.lexer.state.inLink=!1),!this.lexer.state.inRawBlock&&this.rules.other.startPreScriptTag.test(r[0])?this.lexer.state.inRawBlock=!0:this.lexer.state.inRawBlock&&this.rules.other.endPreScriptTag.test(r[0])&&(this.lexer.state.inRawBlock=!1),{type:"html",raw:r[0],inLink:this.lexer.state.inLink,inRawBlock:this.lexer.state.inRawBlock,block:!1,text:r[0]}}link(t){const r=this.rules.inline.link.exec(t);if(r){const o=r[2].trim();if(!this.options.pedantic&&this.rules.other.startAngleBracket.test(o)){if(!this.rules.other.endAngleBracket.test(o))return;const d=Yo(o.slice(0,-1),"\\");if((o.length-d.length)%2===0)return}else{const d=VS(r[2],"()");if(d===-2)return;if(d>-1){const u=(r[0].indexOf("!")===0?5:4)+r[1].length+d;r[2]=r[2].substring(0,d),r[0]=r[0].substring(0,u).trim(),r[3]=""}}let i=r[2],l="";if(this.options.pedantic){const d=this.rules.other.pedanticHrefTitle.exec(i);d&&(i=d[1],l=d[3])}else l=r[3]?r[3].slice(1,-1):"";return i=i.trim(),this.rules.other.startAngleBracket.test(i)&&(this.options.pedantic&&!this.rules.other.endAngleBracket.test(o)?i=i.slice(1):i=i.slice(1,-1)),fm(r,{href:i&&i.replace(this.rules.inline.anyPunctuation,"$1"),title:l&&l.replace(this.rules.inline.anyPunctuation,"$1")},r[0],this.lexer,this.rules)}}reflink(t,r){let o;if((o=this.rules.inline.reflink.exec(t))||(o=this.rules.inline.nolink.exec(t))){const i=(o[2]||o[1]).replace(this.rules.other.multipleSpaceGlobal," "),l=r[i.toLowerCase()];if(!l){const d=o[0].charAt(0);return{type:"text",raw:d,text:d}}return fm(o,l,o[0],this.lexer,this.rules)}}emStrong(t,r,o=""){let i=this.rules.inline.emStrongLDelim.exec(t);if(!i||i[3]&&o.match(this.rules.other.unicodeAlphaNumeric))return;if(!(i[1]||i[2]||"")||!o||this.rules.inline.punctuation.exec(o)){const d=[...i[0]].length-1;let c,u,h=d,m=0;const y=i[0][0]==="*"?this.rules.inline.emStrongRDelimAst:this.rules.inline.emStrongRDelimUnd;for(y.lastIndex=0,r=r.slice(-1*t.length+d);(i=y.exec(r))!=null;){if(c=i[1]||i[2]||i[3]||i[4]||i[5]||i[6],!c)continue;if(u=[...c].length,i[3]||i[4]){h+=u;continue}else if((i[5]||i[6])&&d%3&&!((d+u)%3)){m+=u;continue}if(h-=u,h>0)continue;u=Math.min(u,u+h+m);const C=[...i[0]][0].length,A=t.slice(0,d+i.index+C+u);if(Math.min(d,u)%2){const E=A.slice(1,-1);return{type:"em",raw:A,text:E,tokens:this.lexer.inlineTokens(E)}}const w=A.slice(2,-2);return{type:"strong",raw:A,text:w,tokens:this.lexer.inlineTokens(w)}}}}codespan(t){const r=this.rules.inline.code.exec(t);if(r){let o=r[2].replace(this.rules.other.newLineCharGlobal," ");const i=this.rules.other.nonSpaceChar.test(o),l=this.rules.other.startingSpaceChar.test(o)&&this.rules.other.endingSpaceChar.test(o);return i&&l&&(o=o.substring(1,o.length-1)),{type:"codespan",raw:r[0],text:o}}}br(t){const r=this.rules.inline.br.exec(t);if(r)return{type:"br",raw:r[0]}}del(t){const r=this.rules.inline.del.exec(t);if(r)return{type:"del",raw:r[0],text:r[2],tokens:this.lexer.inlineTokens(r[2])}}autolink(t){const r=this.rules.inline.autolink.exec(t);if(r){let o,i;return r[2]==="@"?(o=r[1],i="mailto:"+o):(o=r[1],i=o),{type:"link",raw:r[0],text:o,href:i,tokens:[{type:"text",raw:o,text:o}]}}}url(t){var o,i;let r;if(r=this.rules.inline.url.exec(t)){let l,d;if(r[2]==="@")l=r[0],d="mailto:"+l;else{let c;do c=r[0],r[0]=(i=(o=this.rules.inline._backpedal.exec(r[0]))==null?void 0:o[0])!=null?i:"";while(c!==r[0]);l=r[0],r[1]==="www."?d="http://"+r[0]:d=r[0]}return{type:"link",raw:r[0],text:l,href:d,tokens:[{type:"text",raw:l,text:l}]}}}inlineText(t){const r=this.rules.inline.text.exec(t);if(r){const o=this.lexer.state.inRawBlock;return{type:"text",raw:r[0],text:r[0],escaped:o}}}}class zn{constructor(t){Dt(this,"tokens");Dt(this,"options");Dt(this,"state");Dt(this,"tokenizer");Dt(this,"inlineQueue");this.tokens=[],this.tokens.links=Object.create(null),this.options=t||dr,this.options.tokenizer=this.options.tokenizer||new Tl,this.tokenizer=this.options.tokenizer,this.tokenizer.options=this.options,this.tokenizer.lexer=this,this.inlineQueue=[],this.state={inLink:!1,inRawBlock:!1,top:!0};const r={other:mn,block:Nl.normal,inline:Ko.normal};this.options.pedantic?(r.block=Nl.pedantic,r.inline=Ko.pedantic):this.options.gfm&&(r.block=Nl.gfm,this.options.breaks?r.inline=Ko.breaks:r.inline=Ko.gfm),this.tokenizer.rules=r}static get rules(){return{block:Nl,inline:Ko}}static lex(t,r){return new zn(r).lex(t)}static lexInline(t,r){return new zn(r).inlineTokens(t)}lex(t){t=t.replace(mn.carriageReturn,`
`),this.blockTokens(t,this.tokens);for(let r=0;r(c=h.call({lexer:this},t,r))?(t=t.substring(c.raw.length),r.push(c),!0):!1))continue;if(c=this.tokenizer.space(t)){t=t.substring(c.raw.length);const h=r.at(-1);c.raw.length===1&&h!==void 0?h.raw+=`
`:r.push(c);continue}if(c=this.tokenizer.code(t)){t=t.substring(c.raw.length);const h=r.at(-1);(h==null?void 0:h.type)==="paragraph"||(h==null?void 0:h.type)==="text"?(h.raw+=`
`+c.raw,h.text+=`
@@ -544,7 +544,7 @@ ${y}`:y;const C=this.lexer.state.top;if(this.lexer.state.top=!0,this.lexer.block
`+c.raw,h.text+=`
`+c.text,this.inlineQueue.pop(),this.inlineQueue.at(-1).src=h.text):r.push(c),o=u.length!==t.length,t=t.substring(c.raw.length);continue}if(c=this.tokenizer.text(t)){t=t.substring(c.raw.length);const h=r.at(-1);(h==null?void 0:h.type)==="text"?(h.raw+=`
`+c.raw,h.text+=`
-`+c.text,this.inlineQueue.pop(),this.inlineQueue.at(-1).src=h.text):r.push(c);continue}if(t){const h="Infinite loop on byte: "+t.charCodeAt(0);if(this.options.silent){console.error(h);break}else throw new Error(h)}}return this.state.top=!0,r}inline(t,r=[]){return this.inlineQueue.push({src:t,tokens:r}),r}inlineTokens(t,r=[]){var c,u,h;let o=t,i=null;if(this.tokens.links){const m=Object.keys(this.tokens.links);if(m.length>0)for(;(i=this.tokenizer.rules.inline.reflinkSearch.exec(o))!=null;)m.includes(i[0].slice(i[0].lastIndexOf("[")+1,-1))&&(o=o.slice(0,i.index)+"["+"a".repeat(i[0].length-2)+"]"+o.slice(this.tokenizer.rules.inline.reflinkSearch.lastIndex))}for(;(i=this.tokenizer.rules.inline.anyPunctuation.exec(o))!=null;)o=o.slice(0,i.index)+"++"+o.slice(this.tokenizer.rules.inline.anyPunctuation.lastIndex);for(;(i=this.tokenizer.rules.inline.blockSkip.exec(o))!=null;)o=o.slice(0,i.index)+"["+"a".repeat(i[0].length-2)+"]"+o.slice(this.tokenizer.rules.inline.blockSkip.lastIndex);let l=!1,d="";for(;t;){l||(d=""),l=!1;let m;if((u=(c=this.options.extensions)==null?void 0:c.inline)!=null&&u.some(C=>(m=C.call({lexer:this},t,r))?(t=t.substring(m.raw.length),r.push(m),!0):!1))continue;if(m=this.tokenizer.escape(t)){t=t.substring(m.raw.length),r.push(m);continue}if(m=this.tokenizer.tag(t)){t=t.substring(m.raw.length),r.push(m);continue}if(m=this.tokenizer.link(t)){t=t.substring(m.raw.length),r.push(m);continue}if(m=this.tokenizer.reflink(t,this.tokens.links)){t=t.substring(m.raw.length);const C=r.at(-1);m.type==="text"&&(C==null?void 0:C.type)==="text"?(C.raw+=m.raw,C.text+=m.text):r.push(m);continue}if(m=this.tokenizer.emStrong(t,o,d)){t=t.substring(m.raw.length),r.push(m);continue}if(m=this.tokenizer.codespan(t)){t=t.substring(m.raw.length),r.push(m);continue}if(m=this.tokenizer.br(t)){t=t.substring(m.raw.length),r.push(m);continue}if(m=this.tokenizer.del(t)){t=t.substring(m.raw.length),r.push(m);continue}if(m=this.tokenizer.autolink(t)){t=t.substring(m.raw.length),r.push(m);continue}if(!this.state.inLink&&(m=this.tokenizer.url(t))){t=t.substring(m.raw.length),r.push(m);continue}let y=t;if((h=this.options.extensions)!=null&&h.startInline){let C=1/0;const S=t.slice(1);let w;this.options.extensions.startInline.forEach(E=>{w=E.call({lexer:this},S),typeof w=="number"&&w>=0&&(C=Math.min(C,w))}),C<1/0&&C>=0&&(y=t.substring(0,C+1))}if(m=this.tokenizer.inlineText(y)){t=t.substring(m.raw.length),m.raw.slice(-1)!=="_"&&(d=m.raw.slice(-1)),l=!0;const C=r.at(-1);(C==null?void 0:C.type)==="text"?(C.raw+=m.raw,C.text+=m.text):r.push(m);continue}if(t){const C="Infinite loop on byte: "+t.charCodeAt(0);if(this.options.silent){console.error(C);break}else throw new Error(C)}}return r}}class Dl{constructor(t){Dt(this,"options");Dt(this,"parser");this.options=t||dr}space(t){return""}code({text:t,lang:r,escaped:o}){var d;const i=(d=(r||"").match(mn.notSpaceStart))==null?void 0:d[0],l=t.replace(mn.endingNewline,"")+`
+`+c.text,this.inlineQueue.pop(),this.inlineQueue.at(-1).src=h.text):r.push(c);continue}if(t){const h="Infinite loop on byte: "+t.charCodeAt(0);if(this.options.silent){console.error(h);break}else throw new Error(h)}}return this.state.top=!0,r}inline(t,r=[]){return this.inlineQueue.push({src:t,tokens:r}),r}inlineTokens(t,r=[]){var c,u,h;let o=t,i=null;if(this.tokens.links){const m=Object.keys(this.tokens.links);if(m.length>0)for(;(i=this.tokenizer.rules.inline.reflinkSearch.exec(o))!=null;)m.includes(i[0].slice(i[0].lastIndexOf("[")+1,-1))&&(o=o.slice(0,i.index)+"["+"a".repeat(i[0].length-2)+"]"+o.slice(this.tokenizer.rules.inline.reflinkSearch.lastIndex))}for(;(i=this.tokenizer.rules.inline.anyPunctuation.exec(o))!=null;)o=o.slice(0,i.index)+"++"+o.slice(this.tokenizer.rules.inline.anyPunctuation.lastIndex);for(;(i=this.tokenizer.rules.inline.blockSkip.exec(o))!=null;)o=o.slice(0,i.index)+"["+"a".repeat(i[0].length-2)+"]"+o.slice(this.tokenizer.rules.inline.blockSkip.lastIndex);let l=!1,d="";for(;t;){l||(d=""),l=!1;let m;if((u=(c=this.options.extensions)==null?void 0:c.inline)!=null&&u.some(C=>(m=C.call({lexer:this},t,r))?(t=t.substring(m.raw.length),r.push(m),!0):!1))continue;if(m=this.tokenizer.escape(t)){t=t.substring(m.raw.length),r.push(m);continue}if(m=this.tokenizer.tag(t)){t=t.substring(m.raw.length),r.push(m);continue}if(m=this.tokenizer.link(t)){t=t.substring(m.raw.length),r.push(m);continue}if(m=this.tokenizer.reflink(t,this.tokens.links)){t=t.substring(m.raw.length);const C=r.at(-1);m.type==="text"&&(C==null?void 0:C.type)==="text"?(C.raw+=m.raw,C.text+=m.text):r.push(m);continue}if(m=this.tokenizer.emStrong(t,o,d)){t=t.substring(m.raw.length),r.push(m);continue}if(m=this.tokenizer.codespan(t)){t=t.substring(m.raw.length),r.push(m);continue}if(m=this.tokenizer.br(t)){t=t.substring(m.raw.length),r.push(m);continue}if(m=this.tokenizer.del(t)){t=t.substring(m.raw.length),r.push(m);continue}if(m=this.tokenizer.autolink(t)){t=t.substring(m.raw.length),r.push(m);continue}if(!this.state.inLink&&(m=this.tokenizer.url(t))){t=t.substring(m.raw.length),r.push(m);continue}let y=t;if((h=this.options.extensions)!=null&&h.startInline){let C=1/0;const A=t.slice(1);let w;this.options.extensions.startInline.forEach(E=>{w=E.call({lexer:this},A),typeof w=="number"&&w>=0&&(C=Math.min(C,w))}),C<1/0&&C>=0&&(y=t.substring(0,C+1))}if(m=this.tokenizer.inlineText(y)){t=t.substring(m.raw.length),m.raw.slice(-1)!=="_"&&(d=m.raw.slice(-1)),l=!0;const C=r.at(-1);(C==null?void 0:C.type)==="text"?(C.raw+=m.raw,C.text+=m.text):r.push(m);continue}if(t){const C="Infinite loop on byte: "+t.charCodeAt(0);if(this.options.silent){console.error(C);break}else throw new Error(C)}}return r}}class Dl{constructor(t){Dt(this,"options");Dt(this,"parser");this.options=t||dr}space(t){return""}code({text:t,lang:r,escaped:o}){var d;const i=(d=(r||"").match(mn.notSpaceStart))==null?void 0:d[0],l=t.replace(mn.endingNewline,"")+`
`;return i?''+(o?l:pi(l,!0))+`
`:""+(o?l:pi(l,!0))+`
`}blockquote({tokens:t}){return`
@@ -562,80 +562,80 @@ ${this.parser.parse(t)}
`}tablerow({text:t}){return`
${t}
`}tablecell(t){const r=this.parser.parseInline(t.tokens),o=t.header?"th":"td";return(t.align?`<${o} align="${t.align}">`:`<${o}>`)+r+`
-`}strong({tokens:t}){return`${this.parser.parseInline(t)}`}em({tokens:t}){return`${this.parser.parseInline(t)}`}codespan({text:t}){return`${pi(t,!0)}`}br(t){return"
"}del({tokens:t}){return`${this.parser.parseInline(t)}`}link({href:t,title:r,tokens:o}){const i=this.parser.parseInline(o),l=dm(t);if(l===null)return i;t=l;let d='",d}image({href:t,title:r,text:o,tokens:i}){i&&(o=this.parser.parseInline(i,this.parser.textRenderer));const l=dm(t);if(l===null)return pi(o);t=l;let d=`
{const h=c[u].flat(1/0);o=o.concat(this.walkTokens(h,r))}):c.tokens&&(o=o.concat(this.walkTokens(c.tokens,r)))}}return o}use(...t){const r=this.defaults.extensions||{renderers:{},childTokens:{}};return t.forEach(o=>{const i={...o};if(i.async=this.defaults.async||i.async||!1,o.extensions&&(o.extensions.forEach(l=>{if(!l.name)throw new Error("extension name required");if("renderer"in l){const d=r.renderers[l.name];d?r.renderers[l.name]=function(...c){let u=l.renderer.apply(this,c);return u===!1&&(u=d.apply(this,c)),u}:r.renderers[l.name]=l.renderer}if("tokenizer"in l){if(!l.level||l.level!=="block"&&l.level!=="inline")throw new Error("extension level must be 'block' or 'inline'");const d=r[l.level];d?d.unshift(l.tokenizer):r[l.level]=[l.tokenizer],l.start&&(l.level==="block"?r.startBlock?r.startBlock.push(l.start):r.startBlock=[l.start]:l.level==="inline"&&(r.startInline?r.startInline.push(l.start):r.startInline=[l.start]))}"childTokens"in l&&l.childTokens&&(r.childTokens[l.name]=l.childTokens)}),i.extensions=r),o.renderer){const l=this.defaults.renderer||new Dl(this.defaults);for(const d in o.renderer){if(!(d in l))throw new Error(`renderer '${d}' does not exist`);if(["options","parser"].includes(d))continue;const c=d,u=o.renderer[c],h=l[c];l[c]=(...m)=>{let y=u.apply(l,m);return y===!1&&(y=h.apply(l,m)),y||""}}i.renderer=l}if(o.tokenizer){const l=this.defaults.tokenizer||new Tl(this.defaults);for(const d in o.tokenizer){if(!(d in l))throw new Error(`tokenizer '${d}' does not exist`);if(["options","rules","lexer"].includes(d))continue;const c=d,u=o.tokenizer[c],h=l[c];l[c]=(...m)=>{let y=u.apply(l,m);return y===!1&&(y=h.apply(l,m)),y}}i.tokenizer=l}if(o.hooks){const l=this.defaults.hooks||new Qo;for(const d in o.hooks){if(!(d in l))throw new Error(`hook '${d}' does not exist`);if(["options","block"].includes(d))continue;const c=d,u=o.hooks[c],h=l[c];Qo.passThroughHooks.has(d)?l[c]=m=>{if(this.defaults.async)return Promise.resolve(u.call(l,m)).then(C=>h.call(l,C));const y=u.call(l,m);return h.call(l,y)}:l[c]=(...m)=>{let y=u.apply(l,m);return y===!1&&(y=h.apply(l,m)),y}}i.hooks=l}if(o.walkTokens){const l=this.defaults.walkTokens,d=o.walkTokens;i.walkTokens=function(c){let u=[];return u.push(d.call(this,c)),l&&(u=u.concat(l.call(this,c))),u}}this.defaults={...this.defaults,...i}}),this}setOptions(t){return this.defaults={...this.defaults,...t},this}lexer(t,r){return zn.lex(t,r!=null?r:this.defaults)}parser(t,r){return Un.parse(t,r!=null?r:this.defaults)}parseMarkdown(t){return(o,i)=>{const l={...i},d={...this.defaults,...l},c=this.onError(!!d.silent,!!d.async);if(this.defaults.async===!0&&l.async===!1)return c(new Error("marked(): The async option was set to true by an extension. Remove async: false from the parse options object to return a Promise."));if(typeof o>"u"||o===null)return c(new Error("marked(): input parameter is undefined or null"));if(typeof o!="string")return c(new Error("marked(): input parameter is of type "+Object.prototype.toString.call(o)+", string expected"));d.hooks&&(d.hooks.options=d,d.hooks.block=t);const u=d.hooks?d.hooks.provideLexer():t?zn.lex:zn.lexInline,h=d.hooks?d.hooks.provideParser():t?Un.parse:Un.parseInline;if(d.async)return Promise.resolve(d.hooks?d.hooks.preprocess(o):o).then(m=>u(m,d)).then(m=>d.hooks?d.hooks.processAllTokens(m):m).then(m=>d.walkTokens?Promise.all(this.walkTokens(m,d.walkTokens)).then(()=>m):m).then(m=>h(m,d)).then(m=>d.hooks?d.hooks.postprocess(m):m).catch(c);try{d.hooks&&(o=d.hooks.preprocess(o));let m=u(o,d);d.hooks&&(m=d.hooks.processAllTokens(m)),d.walkTokens&&this.walkTokens(m,d.walkTokens);let y=h(m,d);return d.hooks&&(y=d.hooks.postprocess(y)),y}catch(m){return c(m)}}}onError(t,r){return o=>{if(o.message+=`
-Please report this to https://github.com/markedjs/marked.`,t){const i="An error occurred:
"+pi(o.message+"",!0)+"
";return r?Promise.resolve(i):i}if(r)return Promise.reject(o);throw o}}}const cr=new fm;function xt(e,t){return cr.parse(e,t)}xt.options=xt.setOptions=function(e){return cr.setOptions(e),xt.defaults=cr.defaults,Jh(xt.defaults),xt},xt.getDefaults=Dc,xt.defaults=dr,xt.use=function(...e){return cr.use(...e),xt.defaults=cr.defaults,Jh(xt.defaults),xt},xt.walkTokens=function(e,t){return cr.walkTokens(e,t)},xt.parseInline=cr.parseInline,xt.Parser=Un,xt.parser=Un.parse,xt.Renderer=Dl,xt.TextRenderer=Mc,xt.Lexer=zn,xt.lexer=zn.lex,xt.Tokenizer=Tl,xt.Hooks=Qo,xt.parse=xt,xt.options,xt.setOptions,xt.use,xt.walkTokens,xt.parseInline,Un.parse,zn.lex;const tj="",VA=n.defineComponent({name:"FcMarkdown",data(){return{marked:n.markRaw(new fm),html:""}},props:{content:String},watch:{content:{handler(){this.html=this.marked.parse(this.content||"")},immediate:!0}}}),OA=["innerHTML"];function BA(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("div",{class:"_fc-markdown",innerHTML:e.html},null,8,OA)}const pm=Te(VA,[["render",BA]]),nj="",RA=n.defineComponent({name:"FcDialog",emits:["confirm","submit","validateFail","update:modelValue"],props:{formData:Object,options:{type:Object,default:()=>n.reactive({submitBtn:!1,resetBtn:!1})},rule:Array,autoClose:{type:Boolean,default:!0},footer:{type:Boolean,default:!0},preview:Boolean,modelValue:Object,formCreateInject:Object},computed:{formOptions(){const e={...this.options};return this.preview&&(e.preview=this.preview),e}},data(){return{visible:!1,max:this.$attrs.fullscreen||!1,fapi:{},value:{},formRule:[],Form:n.markRaw(this.formCreateInject.form.$form())}},methods:{formChange(){this.$emit("update:modelValue",this.fapi.formData())},open(e){this.$nextTick(()=>{this.visible=!0,this.value=rt(e||this.modelValue||this.formData||{}),this.formRule=rt(this.rule||[])})},close(){this.visible=!1},handleConfirm(){this.$emit("confirm",this.fapi),this.fapi.submit().then(e=>{this.$emit("submit",e,this.fapi,this.close),this.autoClose&&this.close()}).catch(e=>{this.$emit("validateFail",e,this.fapi)})}},mounted(){this.formCreateInject.api.top.bus.$on("fc.closeDialog",this.close),n.onUnmounted(()=>{this.formCreateInject.api.top.bus.$off("fc.closeDialog",this.close)})}}),$A={key:0,class:"el-dialog__headerbtn",type:"button",style:{right:"36px"}};function IA(e,t,r,o,i,l){const d=n.resolveComponent("el-button"),c=n.resolveComponent("el-dialog");return n.openBlock(),n.createBlock(c,n.mergeProps({class:"_fc-dialog"},e.$attrs,{fullscreen:e.max,modelValue:e.visible,"onUpdate:modelValue":t[3]||(t[3]=u=>e.visible=u),destroyOnClose:""}),n.createSlots({default:n.withCtx(()=>[e.$attrs.fullscreen?n.createCommentVNode("",!0):(n.openBlock(),n.createElementBlock("button",$A,[e.max?(n.openBlock(),n.createElementBlock("i",{key:0,class:"fc-icon icon-page-min",onClick:t[0]||(t[0]=u=>e.max=!1)})):(n.openBlock(),n.createElementBlock("i",{key:1,class:"fc-icon icon-page-max",onClick:t[1]||(t[1]=u=>e.max=!0)}))])),(n.openBlock(),n.createBlock(n.resolveDynamicComponent(e.Form),{option:e.formOptions,rule:e.formRule,extendOption:!0,api:e.fapi,"onUpdate:api":t[2]||(t[2]=u=>e.fapi=u),"model-value":e.value,subForm:!1,onChange:e.formChange,onEmitEvent:e.$emit},null,40,["option","rule","api","model-value","onChange","onEmitEvent"]))]),_:2},[e.footer!==!1?{name:"footer",fn:n.withCtx(()=>[n.createVNode(d,{onClick:e.close},{default:n.withCtx(()=>[n.createTextVNode(n.toDisplayString(e.formCreateInject.t("close")||"\u5173\u95ED"),1)]),_:1},8,["onClick"]),n.createVNode(d,{type:"primary",onClick:e.handleConfirm},{default:n.withCtx(()=>[n.createTextVNode(n.toDisplayString(e.formCreateInject.t("ok")||"\u786E\u5B9A"),1)]),_:1},8,["onClick"])]),key:"0"}:void 0]),1040,["fullscreen","modelValue"])}const hm=Te(RA,[["render",IA]]),FA=e=>e!==null&&typeof e=="object",PA=e=>e!=null;function Lc(e){if(!PA(e))return e;if(Array.isArray(e))return e.map(t=>Lc(t));if(FA(e)){const t={};return Object.keys(e).forEach(r=>{t[r]=Lc(e[r])}),t}return e}const ij="",MA=n.defineComponent({name:"FcDataSelect",components:{FcDialog:hm},emits:["update:modelValue","change","clear"],props:{title:String,formCreateInject:Object,placeholder:String,multiple:Boolean,disabled:Boolean,multipleLimit:Number,valueKey:String,labelKey:String,clearable:Boolean,searchRule:Object,tableRule:Object,autoLoad:Boolean,modelValue:[Object,Array]},computed:{options(){return this.list.map(e=>({label:e[this.labelKey||"label"],value:e[this.valueKey||"value"]}))},selectValue(){const e=this.options.map(t=>t.value);return this.multiple===!0?e:e[0]},fapi(){var e,t;return(t=(e=this.$refs)==null?void 0:e.dialog)==null?void 0:t.fapi}},data(){return{list:[],visible:!1,formRule:[],load:El(()=>{this.$refs.dialog.fapi.el(this.formRule[1].name).initPage()},500)}},watch:{modelValue:{handler(e){e?this.list=Array.isArray(e)?e:[e]:this.list=[]},immediate:!0}},methods:{getTableEl(){return this.$refs.dialog.fapi.el(this.formRule[1].name)},getDialogEl(){return this.$refs.dialog},formChange(){this.autoLoad&&this.load()},changeSelectValue(e){e==null?this.list=[]:this.list=this.list.filter(t=>e.indexOf(t[this.valueKey||"value"])!==-1),this.updateValue()},confirm(){const e=Ga([...this.list,...this.$refs.dialog.fapi.el(this.formRule[1].name).getEl().getSelectionRows()]),t=e.map(r=>r[this.valueKey||"value"]);this.list=e.filter((r,o)=>t.indexOf(r[this.valueKey||"value"])===o),this.$refs.dialog.close(),this.updateValue()},tableRowClick(e){this.multiple?this.$refs.dialog.fapi.el(this.formRule[1].name).getEl().toggleRowSelection(e):(this.list=[e],this.updateValue(),this.$refs.dialog.close())},updateValue(){this.multipleLimit>0&&this.list.length>this.multipleLimit&&(this.list=this.list.splice(0,this.multipleLimit));const e=this.list.map(t=>({[this.valueKey||"value"]:t[this.valueKey||"value"],[this.labelKey||"label"]:t[this.labelKey||"label"]}));this.$emit("update:modelValue",this.multiple?e:e[0]),this.$emit("change",this.multiple?e:e[0])},getFormRule(){const e=Lc([this.searchRule,this.tableRule]);return e[1].on||(e[1].on={}),e[1].props||(e[1].props={}),this.multiple&&(e[1].props.rowKey||(e[1].props.rowKey=this.valueKey||"value"),e[1].name||(e[1].name=We())),e[1].props.selection=!0,e[1].on.rowClick?e[1].on.rowClick=[(...t)=>this.tableRowClick(...t),e[1].on.rowClick]:e[1].on.rowClick=(...t)=>this.tableRowClick(...t),e[1].on.selectionChange?e[1].on.selectionChange=[(...t)=>this.selectionChange(...t),e[1].on.selectionChange]:e[1].on.selectionChange=(...t)=>this.selectionChange(...t),e},selectionChange(e){this.multiple||this.tableRowClick(e[0])},handleClear(...e){this.$emit("clear",...e)},handleClick(e){this.disabled||!e||(this.visible=!0,this.formRule=this.getFormRule(),this.$refs.dialog.open())}}}),LA={class:"_fc-data-select"};function jA(e,t,r,o,i,l){const d=n.resolveComponent("el-option"),c=n.resolveComponent("el-select"),u=n.resolveComponent("FcDialog");return n.openBlock(),n.createElementBlock("div",LA,[n.createVNode(c,{disabled:e.disabled,placeholder:e.placeholder,multiple:e.multiple,multipleLimit:e.multipleLimit,clearable:e.clearable,"model-value":e.selectValue,"onUpdate:modelValue":e.changeSelectValue,"popper-class":"_fc-data-select-pop",onVisibleChange:e.handleClick,onClear:e.handleClear},{default:n.withCtx(()=>[(n.openBlock(!0),n.createElementBlock(n.Fragment,null,n.renderList(e.options,h=>(n.openBlock(),n.createBlock(d,{key:h.value,label:h.label,value:h.value},null,8,["label","value"]))),128))]),_:1},8,["disabled","placeholder","multiple","multipleLimit","clearable","model-value","onUpdate:modelValue","onVisibleChange","onClear"]),n.createVNode(u,{ref:"dialog",formCreateInject:e.formCreateInject,rule:e.formRule,"onUpdate:modelValue":e.formChange,footer:e.multiple,title:e.title,width:"900px",onConfirm:e.confirm},null,8,["formCreateInject","rule","onUpdate:modelValue","footer","title","onConfirm"])])}const mm=Te(MA,[["render",jA]]),zA=n.defineComponent({name:"AudioBox",emits:["pause","play","ended"],data(){return{}},props:{src:String,type:String,controls:{type:Boolean,default:!0},autoplay:Boolean,loop:Boolean,preload:{type:String,default:"auto"},muted:Boolean}}),UA=["controls","autoplay","loop","preload","muted"],HA=["src","type"];function WA(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("audio",{key:e.src,controls:e.controls,autoplay:e.autoplay,loop:e.loop,preload:e.preload,muted:e.muted,onPause:t[0]||(t[0]=d=>e.$emit("pause",d)),onPlay:t[1]||(t[1]=d=>e.$emit("play",d)),onEnded:t[2]||(t[2]=d=>e.$emit("ended",d))},[n.createElementVNode("source",{src:e.src,type:e.type},null,8,HA),t[3]||(t[3]=n.createTextVNode(" Your browser does not support the audio element. "))],40,UA)}const gm=Te(zA,[["render",WA]]),rj="",GA=n.defineComponent({name:"IframeBox",emits:["load"],data(){return{}},props:{src:String,loading:String}}),KA=["src"];function YA(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("iframe",{class:"_fc-iframe-box",src:e.src,frameborder:"0",onLoad:t[0]||(t[0]=d=>e.$emit("load",d))},null,40,KA)}const vm=Te(GA,[["render",YA]]);var jc={},Vl={},xn={};Object.defineProperty(xn,"__esModule",{value:!0});function QA(e,t){if(!(e instanceof t))throw new TypeError("Cannot call a class as a function")}var JA=function e(t,r){QA(this,e),this.data=t,this.text=r.text||t,this.options=r};xn.default=JA,Object.defineProperty(Vl,"__esModule",{value:!0}),Vl.CODE39=void 0;var XA=function(){function e(t,r){for(var o=0;o=200){c=o.shift()-105;var u=$n.SWAP[c];u!==void 0?d=t.next(o,i+1,u):((l===$n.SET_A||l===$n.SET_B)&&c===$n.SHIFT&&(o[0]=l===$n.SET_A?o[0]>95?o[0]-96:o[0]:o[0]<32?o[0]+96:o[0]),d=t.next(o,i+1,l))}else c=t.correctIndex(o,l),d=t.next(o,i+1,l);var h=t.getBar(c),m=c*i;return{result:h+d.result,checksum:m+d.checksum}}}]),t}(hS.default);Hr.default=bS;var Wc={};Object.defineProperty(Wc,"__esModule",{value:!0});var Ui=Vt,Em=function(t){return t.match(new RegExp("^"+Ui.A_CHARS+"*"))[0].length},Am=function(t){return t.match(new RegExp("^"+Ui.B_CHARS+"*"))[0].length},Sm=function(t){return t.match(new RegExp("^"+Ui.C_CHARS+"*"))[0]};function Gc(e,t){var r=t?Ui.A_CHARS:Ui.B_CHARS,o=e.match(new RegExp("^("+r+"+?)(([0-9]{2}){2,})([^0-9]|$)"));if(o)return o[1]+String.fromCharCode(204)+xm(e.substring(o[1].length));var i=e.match(new RegExp("^"+r+"+"))[0];return i.length===e.length?e:i+String.fromCharCode(t?205:206)+Gc(e.substring(i.length),!t)}function xm(e){var t=Sm(e),r=t.length;if(r===e.length)return e;e=e.substring(r);var o=Em(e)>=Am(e);return t+String.fromCharCode(o?206:205)+Gc(e,o)}Wc.default=function(e){var t=void 0,r=Sm(e).length;if(r>=2)t=Ui.C_START_CHAR+xm(e);else{var o=Em(e)>Am(e);t=(o?Ui.A_START_CHAR:Ui.B_START_CHAR)+Gc(e,o)}return t.replace(/[\xCD\xCE]([^])[\xCD\xCE]/,function(i,l){return String.fromCharCode(203)+l})},Object.defineProperty(Uc,"__esModule",{value:!0});var wS=Hr,CS=km(wS),_S=Wc,ES=km(_S);function km(e){return e&&e.__esModule?e:{default:e}}function AS(e,t){if(!(e instanceof t))throw new TypeError("Cannot call a class as a function")}function Kc(e,t){if(!e)throw new ReferenceError("this hasn't been initialised - super() hasn't been called");return t&&(typeof t=="object"||typeof t=="function")?t:e}function SS(e,t){if(typeof t!="function"&&t!==null)throw new TypeError("Super expression must either be null or a function, not "+typeof t);e.prototype=Object.create(t&&t.prototype,{constructor:{value:e,enumerable:!1,writable:!0,configurable:!0}}),t&&(Object.setPrototypeOf?Object.setPrototypeOf(e,t):e.__proto__=t)}var xS=function(e){SS(t,e);function t(r,o){if(AS(this,t),/^[\x00-\x7F\xC8-\xD3]+$/.test(r))var i=Kc(this,(t.__proto__||Object.getPrototypeOf(t)).call(this,(0,ES.default)(r),o));else var i=Kc(this,(t.__proto__||Object.getPrototypeOf(t)).call(this,r,o));return Kc(i)}return t}(CS.default);Uc.default=xS;var Yc={};Object.defineProperty(Yc,"__esModule",{value:!0});var kS=function(){function e(t,r){for(var o=0;oo.width*10?o.width*10:o.fontSize,i.guardHeight=o.height+i.fontSize/2+o.textMargin,i}return lx(t,[{key:"encode",value:function(){return this.options.flat?this.encodeFlat():this.encodeGuarded()}},{key:"leftText",value:function(o,i){return this.text.substr(o,i)}},{key:"leftEncode",value:function(o,i){return(0,Vm.default)(o,i)}},{key:"rightText",value:function(o,i){return this.text.substr(o,i)}},{key:"rightEncode",value:function(o,i){return(0,Vm.default)(o,i)}},{key:"encodeGuarded",value:function(){var o={fontSize:this.fontSize},i={height:this.guardHeight};return[{data:Wr.SIDE_BIN,options:i},{data:this.leftEncode(),text:this.leftText(),options:o},{data:Wr.MIDDLE_BIN,options:i},{data:this.rightEncode(),text:this.rightText(),options:o},{data:Wr.SIDE_BIN,options:i}]}},{key:"encodeFlat",value:function(){var o=[Wr.SIDE_BIN,this.leftEncode(),Wr.MIDDLE_BIN,this.rightEncode(),Wr.SIDE_BIN];return{data:o.join(""),text:this.text}}}]),t}(cx.default);Bl.default=hx,Object.defineProperty(Xc,"__esModule",{value:!0});var mx=function(){function e(t,r){for(var o=0;oo.width*10?i.fontSize=o.width*10:i.fontSize=o.fontSize,i.guardHeight=o.height+i.fontSize/2+o.textMargin,i}return qx(t,[{key:"valid",value:function(){return this.data.search(/^[0-9]{12}$/)!==-1&&this.data[11]==tu(this.data)}},{key:"encode",value:function(){return this.options.flat?this.flatEncoding():this.guardedEncoding()}},{key:"flatEncoding",value:function(){var o="";return o+="101",o+=(0,Gr.default)(this.data.substr(0,6),"LLLLLL"),o+="01010",o+=(0,Gr.default)(this.data.substr(6,6),"RRRRRR"),o+="101",{data:o,text:this.text}}},{key:"guardedEncoding",value:function(){var o=[];return this.displayValue&&o.push({data:"00000000",text:this.text.substr(0,1),options:{textAlign:"left",fontSize:this.fontSize}}),o.push({data:"101"+(0,Gr.default)(this.data[0],"L"),options:{height:this.guardHeight}}),o.push({data:(0,Gr.default)(this.data.substr(1,5),"LLLLL"),text:this.text.substr(1,5),options:{fontSize:this.fontSize}}),o.push({data:"01010",options:{height:this.guardHeight}}),o.push({data:(0,Gr.default)(this.data.substr(6,5),"RRRRR"),text:this.text.substr(6,5),options:{fontSize:this.fontSize}}),o.push({data:(0,Gr.default)(this.data[11],"R")+"101",options:{height:this.guardHeight}}),this.displayValue&&o.push({data:"00000000",text:this.text.substr(11,1),options:{textAlign:"right",fontSize:this.fontSize}}),o}}]),t}(nk.default);function tu(e){var t=0,r;for(r=1;r<11;r+=2)t+=parseInt(e[r]);for(r=0;r<11;r+=2)t+=parseInt(e[r])*3;return(10-t%10)%10}Zo.default=ak;var nu={};Object.defineProperty(nu,"__esModule",{value:!0});var lk=function(){function e(t,r){for(var o=0;oo.width*10?i.fontSize=o.width*10:i.fontSize=o.fontSize,i.guardHeight=o.height+i.fontSize/2+o.textMargin,i}return lk(t,[{key:"valid",value:function(){return this.isValid}},{key:"encode",value:function(){return this.options.flat?this.flatEncoding():this.guardedEncoding()}},{key:"flatEncoding",value:function(){var o="";return o+="101",o+=this.encodeMiddleDigits(),o+="010101",{data:o,text:this.text}}},{key:"guardedEncoding",value:function(){var o=[];return this.displayValue&&o.push({data:"00000000",text:this.text[0],options:{textAlign:"left",fontSize:this.fontSize}}),o.push({data:"101",options:{height:this.guardHeight}}),o.push({data:this.encodeMiddleDigits(),text:this.text.substring(1,7),options:{fontSize:this.fontSize}}),o.push({data:"010101",options:{height:this.guardHeight}}),this.displayValue&&o.push({data:"00000000",text:this.text[7],options:{textAlign:"right",fontSize:this.fontSize}}),o}},{key:"encodeMiddleDigits",value:function(){var o=this.upcA[0],i=this.upcA[this.upcA.length-1],l=gk[parseInt(i)][parseInt(o)];return(0,dk.default)(this.middleDigits,l)}}]),t}(uk.default);function Mm(e,t){for(var r=parseInt(e[e.length-1]),o=mk[r],i="",l=0,d=0;d=3&&this.number<=131070}}]),t}(Q2.default);Fl.pharmacode=eN;var Pl={};Object.defineProperty(Pl,"__esModule",{value:!0}),Pl.codabar=void 0;var tN=function(){function e(t,r){for(var o=0;o0?t.fontSize+t.textMargin:0)+t.marginTop+t.marginBottom}function Ym(e,t,r){if(r.displayValue&&tt&&(t=e[r].height);return t}function IN(e,t,r){var o;if(r)o=r;else if(typeof document<"u")o=document.createElement("canvas").getContext("2d");else return 0;o.font=t.fontOptions+" "+t.fontSize+"px "+t.font;var i=o.measureText(e);if(!i)return 0;var l=i.width;return l}In.getMaximumHeightOfEncodings=$N,In.getEncodingHeight=Km,In.getBarcodePadding=Ym,In.calculateEncodingAttributes=BN,In.getTotalWidthOfEncodings=RN,Object.defineProperty(hu,"__esModule",{value:!0});var FN=function(){function e(t,r){for(var o=0;o0?(d=0,i.textAlign="left"):r.textAlign=="right"?(d=o.width-1,i.textAlign="right"):(d=o.width/2,i.textAlign="center"),i.fillText(o.text,d,c)}}},{key:"moveCanvasDrawing",value:function(r){var o=this.canvas.getContext("2d");o.translate(r.width,0)}},{key:"restoreCanvas",value:function(){var r=this.canvas.getContext("2d");r.restore()}}]),e}();hu.default=zN;var gu={};Object.defineProperty(gu,"__esModule",{value:!0});var UN=function(){function e(t,r){for(var o=0;o0&&(this.drawRect(u-o.width*c,d,o.width*c,o.height,r),c=0);c>0&&this.drawRect(u-o.width*(c-1),d,o.width*c,o.height,r)}},{key:"drawSVGText",value:function(r,o,i){var l=this.document.createElementNS(Ul,"text");if(o.displayValue){var d,c;l.setAttribute("style","font:"+o.fontOptions+" "+o.fontSize+"px "+o.font),o.textPosition=="top"?c=o.fontSize-o.textMargin:c=o.height+o.textMargin+o.fontSize,o.textAlign=="left"||i.barcodePadding>0?(d=0,l.setAttribute("text-anchor","start")):o.textAlign=="right"?(d=i.width-1,l.setAttribute("text-anchor","end")):(d=i.width/2,l.setAttribute("text-anchor","middle")),l.setAttribute("x",d),l.setAttribute("y",c),l.appendChild(this.document.createTextNode(i.text)),r.appendChild(l)}}},{key:"setSvgAttributes",value:function(r,o){var i=this.svg;i.setAttribute("width",r+"px"),i.setAttribute("height",o+"px"),i.setAttribute("x","0px"),i.setAttribute("y","0px"),i.setAttribute("viewBox","0 0 "+r+" "+o),i.setAttribute("xmlns",Ul),i.setAttribute("version","1.1"),i.setAttribute("style","transform: translate(0,0)")}},{key:"createGroup",value:function(r,o,i){var l=this.document.createElementNS(Ul,"g");return l.setAttribute("transform","translate("+r+", "+o+")"),i.appendChild(l),l}},{key:"setGroupOptions",value:function(r,o){r.setAttribute("style","fill:"+o.lineColor+";")}},{key:"drawRect",value:function(r,o,i,l,d){var c=this.document.createElementNS(Ul,"rect");return c.setAttribute("x",r),c.setAttribute("y",o),c.setAttribute("width",i),c.setAttribute("height",l),d.appendChild(c),c}}]),e}();gu.default=YN;var yu={};Object.defineProperty(yu,"__esModule",{value:!0});var QN=function(){function e(t,r){for(var o=0;o"u"?"undefined":lT(e))==="object"&&!e.nodeName)return{element:e,renderer:na.default.ObjectRenderer};throw new cT.InvalidElementException}}function uT(e){var t=document.querySelectorAll(e);if(t.length!==0){for(var r=[],o=0;o"u")throw Error("No element to render on was provided.");return i._renderProperties=(0,CT.default)(t),i._encodings=[],i._options=qm.default,i._errorHandler=new ST.default(i),typeof r<"u"&&(o=o||{},o.format||(o.format=ng()),i.options(o)[o.format](r,o).render()),i};Hl.getModule=function(e){return hr.default[e]};for(var eg in hr.default)hr.default.hasOwnProperty(eg)&&kT(hr.default,eg);function kT(e,t){xi.prototype[t]=xi.prototype[t.toUpperCase()]=xi.prototype[t.toLowerCase()]=function(r,o){var i=this;return i._errorHandler.wrapBarcodeCall(function(){o.text=typeof o.text>"u"?void 0:""+o.text;var l=(0,ia.default)(i._options,o);l=(0,ET.default)(l);var d=e[t],c=tg(r,d,l);return i._encodings.push(c),i})}}function tg(e,t,r){e=""+e;var o=new t(e,r);if(!o.valid())throw new Zm.InvalidInputException(o.constructor.name,e);var i=o.encode();i=(0,Jm.default)(i);for(var l=0;l{this.$props[r]!=null&&this.$props[r]!==""&&(t[r]=this.$props[r])}),delete t.value,delete t.formCreateInject,this.$nextTick(()=>{NT(this.$refs.bar,e||"",t)})},deep:!0,immediate:!0}}}),DT={class:"_fc-barcode",ref:"bar"};function VT(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("img",DT,null,512)}const ig=Te(TT,[["render",VT]]),oj="",OT=n.defineComponent({name:"VideoBox",emits:["pause","play","ended","error"],data(){return{player:null}},props:{src:String,type:String,controls:{type:Boolean,default:!0},autoplay:Boolean,isLive:Boolean,withCredentials:Boolean,loop:Boolean},watch:{src:{handler:function(){this.$nextTick(()=>{nn.ready("mpegts",()=>{const e=this.$refs.video,t=window.mpegts.createPlayer({isLive:this.isLive,type:this.type,url:this.src});t.attachMediaElement(e),t.on("error",r=>{this.$emit("error",r)}),t.load(),this.autoplay&&t.play().catch(r=>{this.$emit("error",r)}),this.player=t})})},immediate:!0}},created(){window.mpegts?nn.done("mpegts"):nn.isDefined("mpegts")||nn.loadNpm("mpegts.js@1.8.0/dist/mpegts.js","mpegts")}}),BT=["controls","loop"];function RT(e,t,r,o,i,l){return n.openBlock(),n.createElementBlock("video",{ref:"video",class:"_fc-video-box",controls:e.controls,loop:e.loop,onPause:t[0]||(t[0]=d=>e.$emit("pause",d)),onPlay:t[1]||(t[1]=d=>e.$emit("play",d)),onEnded:t[2]||(t[2]=d=>e.$emit("ended",d))},null,40,BT)}const rg=Te(OT,[["render",RT]]);var og={exports:{}};(function(e,t){(function(r,o){e.exports=o()})(Cc,()=>(()=>{var r={873:(d,c)=>{var u,h,m=function(){var y=function(H,R){var z=H,$=g[R],A=null,J=0,Q=null,G=[],ie={},X=function(V,W){A=function(Y){for(var q=new Array(Y),ee=0;ee=7&&de(V),Q==null&&(Q=ge(z,$,G)),se(Q,W)},le=function(V,W){for(var Y=-1;Y<=7;Y+=1)if(!(V+Y<=-1||J<=V+Y))for(var q=-1;q<=7;q+=1)W+q<=-1||J<=W+q||(A[V+Y][W+q]=0<=Y&&Y<=6&&(q==0||q==6)||0<=q&&q<=6&&(Y==0||Y==6)||2<=Y&&Y<=4&&2<=q&&q<=4)},be=function(){for(var V=8;V>Y&1)==1;A[Math.floor(Y/3)][Y%3+J-8-3]=q}for(Y=0;Y<18;Y+=1)q=!V&&(W>>Y&1)==1,A[Y%3+J-8-3][Math.floor(Y/3)]=q},pe=function(V,W){for(var Y=$<<3|W,q=_.getBCHTypeInfo(Y),ee=0;ee<15;ee+=1){var oe=!V&&(q>>ee&1)==1;ee<6?A[ee][8]=oe:ee<8?A[ee+1][8]=oe:A[J-15+ee][8]=oe}for(ee=0;ee<15;ee+=1)oe=!V&&(q>>ee&1)==1,ee<8?A[8][J-ee-1]=oe:ee<9?A[8][15-ee-1+1]=oe:A[8][15-ee-1]=oe;A[J-8][8]=!V},se=function(V,W){for(var Y=-1,q=J-1,ee=7,oe=0,he=_.getMaskFunction(W),Se=J-1;Se>0;Se-=2)for(Se==6&&(Se-=1);;){for(var Me=0;Me<2;Me+=1)if(A[q][Se-Me]==null){var Le=!1;oe>>ee&1)==1),he(q,Se-Me)&&(Le=!Le),A[q][Se-Me]=Le,(ee-=1)==-1&&(oe+=1,ee=7)}if((q+=Y)<0||J<=q){q-=Y,Y=-Y;break}}},ge=function(V,W,Y){for(var q=T.getRSBlocks(V,W),ee=O(),oe=0;oe8*Se)throw"code length overflow. ("+ee.getLengthInBits()+">"+8*Se+")";for(ee.getLengthInBits()+4<=8*Se&&ee.put(0,4);ee.getLengthInBits()%8!=0;)ee.putBit(!1);for(;!(ee.getLengthInBits()>=8*Se||(ee.put(236,8),ee.getLengthInBits()>=8*Se));)ee.put(17,8);return function(Me,Le){for(var fe=0,ke=0,we=0,He=new Array(Le.length),et=new Array(Le.length),_e=0;_e=0?Ze.getAt(De):0}}var Pe=0;for(Re=0;ReLe)&&(he=Le,Se=Me)}return Se}())},ie.createTableTag=function(V,W){V=V||2;var Y="";Y+='";for(var ee=0;ee';Y+=""}return(Y+="")+"
"},ie.createSvgTag=function(V,W,Y,q){var ee={};typeof arguments[0]=="object"&&(V=(ee=arguments[0]).cellSize,W=ee.margin,Y=ee.alt,q=ee.title),V=V||2,W=W===void 0?4*V:W,(Y=typeof Y=="string"?{text:Y}:Y||{}).text=Y.text||null,Y.id=Y.text?Y.id||"qrcode-description":null,(q=typeof q=="string"?{text:q}:q||{}).text=q.text||null,q.id=q.text?q.id||"qrcode-title":null;var oe,he,Se,Me,Le=ie.getModuleCount()*V+2*W,fe="";for(Me="l"+V+",0 0,"+V+" -"+V+",0 0,-"+V+"z ",fe+='